diff options
Diffstat (limited to 'libtomcrypt/src')
426 files changed, 25248 insertions, 9118 deletions
diff --git a/libtomcrypt/src/ciphers/aes/aes.c b/libtomcrypt/src/ciphers/aes/aes.c index 3481fe2..47e8eeb 100644 --- a/libtomcrypt/src/ciphers/aes/aes.c +++ b/libtomcrypt/src/ciphers/aes/aes.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /* AES implementation by Tom St Denis @@ -50,7 +48,7 @@ const struct ltc_cipher_descriptor rijndael_desc = 6, 16, 32, 16, 10, SETUP, ECB_ENC, ECB_DEC, ECB_TEST, ECB_DONE, ECB_KS, - NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL + NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL }; #endif @@ -60,7 +58,7 @@ const struct ltc_cipher_descriptor aes_desc = 6, 16, 32, 16, 10, SETUP, ECB_ENC, ECB_DEC, ECB_TEST, ECB_DONE, ECB_KS, - NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL + NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL }; #else @@ -76,7 +74,7 @@ const struct ltc_cipher_descriptor rijndael_enc_desc = 6, 16, 32, 16, 10, SETUP, ECB_ENC, NULL, NULL, ECB_DONE, ECB_KS, - NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL + NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL }; const struct ltc_cipher_descriptor aes_enc_desc = @@ -85,11 +83,12 @@ const struct ltc_cipher_descriptor aes_enc_desc = 6, 16, 32, 16, 10, SETUP, ECB_ENC, NULL, NULL, ECB_DONE, ECB_KS, - NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL + NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL }; #endif +#define __LTC_AES_TAB_C__ #include "aes_tab.c" static ulong32 setup_mix(ulong32 temp) @@ -125,7 +124,6 @@ int SETUP(const unsigned char *key, int keylen, int num_rounds, symmetric_key *s int i; ulong32 temp, *rk; #ifndef ENCRYPT_ONLY - int j; ulong32 *rrk; #endif LTC_ARGCHK(key != NULL); @@ -149,9 +147,6 @@ int SETUP(const unsigned char *key, int keylen, int num_rounds, symmetric_key *s LOAD32H(rk[2], key + 8); LOAD32H(rk[3], key + 12); if (keylen == 16) { - #ifndef ENCRYPT_ONLY - j = 44; - #endif for (;;) { temp = rk[3]; rk[4] = rk[0] ^ setup_mix(temp) ^ rcon[i]; @@ -164,9 +159,6 @@ int SETUP(const unsigned char *key, int keylen, int num_rounds, symmetric_key *s rk += 4; } } else if (keylen == 24) { - #ifndef ENCRYPT_ONLY - j = 52; - #endif LOAD32H(rk[4], key + 16); LOAD32H(rk[5], key + 20); for (;;) { @@ -187,9 +179,6 @@ int SETUP(const unsigned char *key, int keylen, int num_rounds, symmetric_key *s rk += 6; } } else if (keylen == 32) { - #ifndef ENCRYPT_ONLY - j = 60; - #endif LOAD32H(rk[4], key + 16); LOAD32H(rk[5], key + 20); LOAD32H(rk[6], key + 24); @@ -216,13 +205,14 @@ int SETUP(const unsigned char *key, int keylen, int num_rounds, symmetric_key *s } } else { /* this can't happen */ + /* coverity[dead_error_line] */ return CRYPT_ERROR; } #ifndef ENCRYPT_ONLY /* setup the inverse key now */ rk = skey->rijndael.dK; - rrk = skey->rijndael.eK + j - 4; + rrk = skey->rijndael.eK + (28 + keylen) - 4; /* apply the inverse MixColumn transform to all round keys but the first and the last: */ /* copy first */ @@ -697,23 +687,8 @@ int ECB_TEST(void) rijndael_ecb_encrypt(tests[i].pt, tmp[0], &key); rijndael_ecb_decrypt(tmp[0], tmp[1], &key); - if (XMEMCMP(tmp[0], tests[i].ct, 16) || XMEMCMP(tmp[1], tests[i].pt, 16)) { -#if 0 - printf("\n\nTest %d failed\n", i); - if (XMEMCMP(tmp[0], tests[i].ct, 16)) { - printf("CT: "); - for (i = 0; i < 16; i++) { - printf("%02x ", tmp[0][i]); - } - printf("\n"); - } else { - printf("PT: "); - for (i = 0; i < 16; i++) { - printf("%02x ", tmp[1][i]); - } - printf("\n"); - } -#endif + if (compare_testvector(tmp[0], 16, tests[i].ct, 16, "AES Encrypt", i) || + compare_testvector(tmp[1], 16, tests[i].pt, 16, "AES Decrypt", i)) { return CRYPT_FAIL_TESTVECTOR; } @@ -735,7 +710,7 @@ int ECB_TEST(void) */ void ECB_DONE(symmetric_key *skey) { - (void)skey; + LTC_UNUSED_PARAM(skey); } @@ -765,6 +740,6 @@ int ECB_KS(int *keysize) #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/ciphers/aes/aes_tab.c b/libtomcrypt/src/ciphers/aes/aes_tab.c index ca7008d..463d05c 100644 --- a/libtomcrypt/src/ciphers/aes/aes_tab.c +++ b/libtomcrypt/src/ciphers/aes/aes_tab.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /* The precomputed tables for AES */ /* @@ -23,10 +21,12 @@ Td3[x] = Si[x].[09, 0d, 0b, 0e]; Td4[x] = Si[x].[01, 01, 01, 01]; */ +#ifdef __LTC_AES_TAB_C__ + /** @file aes_tab.c AES tables -*/ +*/ static const ulong32 TE0[256] = { 0xc66363a5UL, 0xf87c7c84UL, 0xee777799UL, 0xf67b7b8dUL, 0xfff2f20dUL, 0xd66b6bbdUL, 0xde6f6fb1UL, 0x91c5c554UL, @@ -532,142 +532,142 @@ static const ulong32 TE3[256] = { #ifndef PELI_TAB static const ulong32 Te4_0[] = { -0x00000063UL, 0x0000007cUL, 0x00000077UL, 0x0000007bUL, 0x000000f2UL, 0x0000006bUL, 0x0000006fUL, 0x000000c5UL, -0x00000030UL, 0x00000001UL, 0x00000067UL, 0x0000002bUL, 0x000000feUL, 0x000000d7UL, 0x000000abUL, 0x00000076UL, -0x000000caUL, 0x00000082UL, 0x000000c9UL, 0x0000007dUL, 0x000000faUL, 0x00000059UL, 0x00000047UL, 0x000000f0UL, -0x000000adUL, 0x000000d4UL, 0x000000a2UL, 0x000000afUL, 0x0000009cUL, 0x000000a4UL, 0x00000072UL, 0x000000c0UL, -0x000000b7UL, 0x000000fdUL, 0x00000093UL, 0x00000026UL, 0x00000036UL, 0x0000003fUL, 0x000000f7UL, 0x000000ccUL, -0x00000034UL, 0x000000a5UL, 0x000000e5UL, 0x000000f1UL, 0x00000071UL, 0x000000d8UL, 0x00000031UL, 0x00000015UL, -0x00000004UL, 0x000000c7UL, 0x00000023UL, 0x000000c3UL, 0x00000018UL, 0x00000096UL, 0x00000005UL, 0x0000009aUL, -0x00000007UL, 0x00000012UL, 0x00000080UL, 0x000000e2UL, 0x000000ebUL, 0x00000027UL, 0x000000b2UL, 0x00000075UL, -0x00000009UL, 0x00000083UL, 0x0000002cUL, 0x0000001aUL, 0x0000001bUL, 0x0000006eUL, 0x0000005aUL, 0x000000a0UL, -0x00000052UL, 0x0000003bUL, 0x000000d6UL, 0x000000b3UL, 0x00000029UL, 0x000000e3UL, 0x0000002fUL, 0x00000084UL, -0x00000053UL, 0x000000d1UL, 0x00000000UL, 0x000000edUL, 0x00000020UL, 0x000000fcUL, 0x000000b1UL, 0x0000005bUL, -0x0000006aUL, 0x000000cbUL, 0x000000beUL, 0x00000039UL, 0x0000004aUL, 0x0000004cUL, 0x00000058UL, 0x000000cfUL, -0x000000d0UL, 0x000000efUL, 0x000000aaUL, 0x000000fbUL, 0x00000043UL, 0x0000004dUL, 0x00000033UL, 0x00000085UL, -0x00000045UL, 0x000000f9UL, 0x00000002UL, 0x0000007fUL, 0x00000050UL, 0x0000003cUL, 0x0000009fUL, 0x000000a8UL, -0x00000051UL, 0x000000a3UL, 0x00000040UL, 0x0000008fUL, 0x00000092UL, 0x0000009dUL, 0x00000038UL, 0x000000f5UL, -0x000000bcUL, 0x000000b6UL, 0x000000daUL, 0x00000021UL, 0x00000010UL, 0x000000ffUL, 0x000000f3UL, 0x000000d2UL, -0x000000cdUL, 0x0000000cUL, 0x00000013UL, 0x000000ecUL, 0x0000005fUL, 0x00000097UL, 0x00000044UL, 0x00000017UL, -0x000000c4UL, 0x000000a7UL, 0x0000007eUL, 0x0000003dUL, 0x00000064UL, 0x0000005dUL, 0x00000019UL, 0x00000073UL, -0x00000060UL, 0x00000081UL, 0x0000004fUL, 0x000000dcUL, 0x00000022UL, 0x0000002aUL, 0x00000090UL, 0x00000088UL, -0x00000046UL, 0x000000eeUL, 0x000000b8UL, 0x00000014UL, 0x000000deUL, 0x0000005eUL, 0x0000000bUL, 0x000000dbUL, -0x000000e0UL, 0x00000032UL, 0x0000003aUL, 0x0000000aUL, 0x00000049UL, 0x00000006UL, 0x00000024UL, 0x0000005cUL, -0x000000c2UL, 0x000000d3UL, 0x000000acUL, 0x00000062UL, 0x00000091UL, 0x00000095UL, 0x000000e4UL, 0x00000079UL, -0x000000e7UL, 0x000000c8UL, 0x00000037UL, 0x0000006dUL, 0x0000008dUL, 0x000000d5UL, 0x0000004eUL, 0x000000a9UL, -0x0000006cUL, 0x00000056UL, 0x000000f4UL, 0x000000eaUL, 0x00000065UL, 0x0000007aUL, 0x000000aeUL, 0x00000008UL, -0x000000baUL, 0x00000078UL, 0x00000025UL, 0x0000002eUL, 0x0000001cUL, 0x000000a6UL, 0x000000b4UL, 0x000000c6UL, -0x000000e8UL, 0x000000ddUL, 0x00000074UL, 0x0000001fUL, 0x0000004bUL, 0x000000bdUL, 0x0000008bUL, 0x0000008aUL, -0x00000070UL, 0x0000003eUL, 0x000000b5UL, 0x00000066UL, 0x00000048UL, 0x00000003UL, 0x000000f6UL, 0x0000000eUL, -0x00000061UL, 0x00000035UL, 0x00000057UL, 0x000000b9UL, 0x00000086UL, 0x000000c1UL, 0x0000001dUL, 0x0000009eUL, -0x000000e1UL, 0x000000f8UL, 0x00000098UL, 0x00000011UL, 0x00000069UL, 0x000000d9UL, 0x0000008eUL, 0x00000094UL, -0x0000009bUL, 0x0000001eUL, 0x00000087UL, 0x000000e9UL, 0x000000ceUL, 0x00000055UL, 0x00000028UL, 0x000000dfUL, -0x0000008cUL, 0x000000a1UL, 0x00000089UL, 0x0000000dUL, 0x000000bfUL, 0x000000e6UL, 0x00000042UL, 0x00000068UL, +0x00000063UL, 0x0000007cUL, 0x00000077UL, 0x0000007bUL, 0x000000f2UL, 0x0000006bUL, 0x0000006fUL, 0x000000c5UL, +0x00000030UL, 0x00000001UL, 0x00000067UL, 0x0000002bUL, 0x000000feUL, 0x000000d7UL, 0x000000abUL, 0x00000076UL, +0x000000caUL, 0x00000082UL, 0x000000c9UL, 0x0000007dUL, 0x000000faUL, 0x00000059UL, 0x00000047UL, 0x000000f0UL, +0x000000adUL, 0x000000d4UL, 0x000000a2UL, 0x000000afUL, 0x0000009cUL, 0x000000a4UL, 0x00000072UL, 0x000000c0UL, +0x000000b7UL, 0x000000fdUL, 0x00000093UL, 0x00000026UL, 0x00000036UL, 0x0000003fUL, 0x000000f7UL, 0x000000ccUL, +0x00000034UL, 0x000000a5UL, 0x000000e5UL, 0x000000f1UL, 0x00000071UL, 0x000000d8UL, 0x00000031UL, 0x00000015UL, +0x00000004UL, 0x000000c7UL, 0x00000023UL, 0x000000c3UL, 0x00000018UL, 0x00000096UL, 0x00000005UL, 0x0000009aUL, +0x00000007UL, 0x00000012UL, 0x00000080UL, 0x000000e2UL, 0x000000ebUL, 0x00000027UL, 0x000000b2UL, 0x00000075UL, +0x00000009UL, 0x00000083UL, 0x0000002cUL, 0x0000001aUL, 0x0000001bUL, 0x0000006eUL, 0x0000005aUL, 0x000000a0UL, +0x00000052UL, 0x0000003bUL, 0x000000d6UL, 0x000000b3UL, 0x00000029UL, 0x000000e3UL, 0x0000002fUL, 0x00000084UL, +0x00000053UL, 0x000000d1UL, 0x00000000UL, 0x000000edUL, 0x00000020UL, 0x000000fcUL, 0x000000b1UL, 0x0000005bUL, +0x0000006aUL, 0x000000cbUL, 0x000000beUL, 0x00000039UL, 0x0000004aUL, 0x0000004cUL, 0x00000058UL, 0x000000cfUL, +0x000000d0UL, 0x000000efUL, 0x000000aaUL, 0x000000fbUL, 0x00000043UL, 0x0000004dUL, 0x00000033UL, 0x00000085UL, +0x00000045UL, 0x000000f9UL, 0x00000002UL, 0x0000007fUL, 0x00000050UL, 0x0000003cUL, 0x0000009fUL, 0x000000a8UL, +0x00000051UL, 0x000000a3UL, 0x00000040UL, 0x0000008fUL, 0x00000092UL, 0x0000009dUL, 0x00000038UL, 0x000000f5UL, +0x000000bcUL, 0x000000b6UL, 0x000000daUL, 0x00000021UL, 0x00000010UL, 0x000000ffUL, 0x000000f3UL, 0x000000d2UL, +0x000000cdUL, 0x0000000cUL, 0x00000013UL, 0x000000ecUL, 0x0000005fUL, 0x00000097UL, 0x00000044UL, 0x00000017UL, +0x000000c4UL, 0x000000a7UL, 0x0000007eUL, 0x0000003dUL, 0x00000064UL, 0x0000005dUL, 0x00000019UL, 0x00000073UL, +0x00000060UL, 0x00000081UL, 0x0000004fUL, 0x000000dcUL, 0x00000022UL, 0x0000002aUL, 0x00000090UL, 0x00000088UL, +0x00000046UL, 0x000000eeUL, 0x000000b8UL, 0x00000014UL, 0x000000deUL, 0x0000005eUL, 0x0000000bUL, 0x000000dbUL, +0x000000e0UL, 0x00000032UL, 0x0000003aUL, 0x0000000aUL, 0x00000049UL, 0x00000006UL, 0x00000024UL, 0x0000005cUL, +0x000000c2UL, 0x000000d3UL, 0x000000acUL, 0x00000062UL, 0x00000091UL, 0x00000095UL, 0x000000e4UL, 0x00000079UL, +0x000000e7UL, 0x000000c8UL, 0x00000037UL, 0x0000006dUL, 0x0000008dUL, 0x000000d5UL, 0x0000004eUL, 0x000000a9UL, +0x0000006cUL, 0x00000056UL, 0x000000f4UL, 0x000000eaUL, 0x00000065UL, 0x0000007aUL, 0x000000aeUL, 0x00000008UL, +0x000000baUL, 0x00000078UL, 0x00000025UL, 0x0000002eUL, 0x0000001cUL, 0x000000a6UL, 0x000000b4UL, 0x000000c6UL, +0x000000e8UL, 0x000000ddUL, 0x00000074UL, 0x0000001fUL, 0x0000004bUL, 0x000000bdUL, 0x0000008bUL, 0x0000008aUL, +0x00000070UL, 0x0000003eUL, 0x000000b5UL, 0x00000066UL, 0x00000048UL, 0x00000003UL, 0x000000f6UL, 0x0000000eUL, +0x00000061UL, 0x00000035UL, 0x00000057UL, 0x000000b9UL, 0x00000086UL, 0x000000c1UL, 0x0000001dUL, 0x0000009eUL, +0x000000e1UL, 0x000000f8UL, 0x00000098UL, 0x00000011UL, 0x00000069UL, 0x000000d9UL, 0x0000008eUL, 0x00000094UL, +0x0000009bUL, 0x0000001eUL, 0x00000087UL, 0x000000e9UL, 0x000000ceUL, 0x00000055UL, 0x00000028UL, 0x000000dfUL, +0x0000008cUL, 0x000000a1UL, 0x00000089UL, 0x0000000dUL, 0x000000bfUL, 0x000000e6UL, 0x00000042UL, 0x00000068UL, 0x00000041UL, 0x00000099UL, 0x0000002dUL, 0x0000000fUL, 0x000000b0UL, 0x00000054UL, 0x000000bbUL, 0x00000016UL }; static const ulong32 Te4_1[] = { -0x00006300UL, 0x00007c00UL, 0x00007700UL, 0x00007b00UL, 0x0000f200UL, 0x00006b00UL, 0x00006f00UL, 0x0000c500UL, -0x00003000UL, 0x00000100UL, 0x00006700UL, 0x00002b00UL, 0x0000fe00UL, 0x0000d700UL, 0x0000ab00UL, 0x00007600UL, -0x0000ca00UL, 0x00008200UL, 0x0000c900UL, 0x00007d00UL, 0x0000fa00UL, 0x00005900UL, 0x00004700UL, 0x0000f000UL, -0x0000ad00UL, 0x0000d400UL, 0x0000a200UL, 0x0000af00UL, 0x00009c00UL, 0x0000a400UL, 0x00007200UL, 0x0000c000UL, -0x0000b700UL, 0x0000fd00UL, 0x00009300UL, 0x00002600UL, 0x00003600UL, 0x00003f00UL, 0x0000f700UL, 0x0000cc00UL, -0x00003400UL, 0x0000a500UL, 0x0000e500UL, 0x0000f100UL, 0x00007100UL, 0x0000d800UL, 0x00003100UL, 0x00001500UL, -0x00000400UL, 0x0000c700UL, 0x00002300UL, 0x0000c300UL, 0x00001800UL, 0x00009600UL, 0x00000500UL, 0x00009a00UL, -0x00000700UL, 0x00001200UL, 0x00008000UL, 0x0000e200UL, 0x0000eb00UL, 0x00002700UL, 0x0000b200UL, 0x00007500UL, -0x00000900UL, 0x00008300UL, 0x00002c00UL, 0x00001a00UL, 0x00001b00UL, 0x00006e00UL, 0x00005a00UL, 0x0000a000UL, -0x00005200UL, 0x00003b00UL, 0x0000d600UL, 0x0000b300UL, 0x00002900UL, 0x0000e300UL, 0x00002f00UL, 0x00008400UL, -0x00005300UL, 0x0000d100UL, 0x00000000UL, 0x0000ed00UL, 0x00002000UL, 0x0000fc00UL, 0x0000b100UL, 0x00005b00UL, -0x00006a00UL, 0x0000cb00UL, 0x0000be00UL, 0x00003900UL, 0x00004a00UL, 0x00004c00UL, 0x00005800UL, 0x0000cf00UL, -0x0000d000UL, 0x0000ef00UL, 0x0000aa00UL, 0x0000fb00UL, 0x00004300UL, 0x00004d00UL, 0x00003300UL, 0x00008500UL, -0x00004500UL, 0x0000f900UL, 0x00000200UL, 0x00007f00UL, 0x00005000UL, 0x00003c00UL, 0x00009f00UL, 0x0000a800UL, -0x00005100UL, 0x0000a300UL, 0x00004000UL, 0x00008f00UL, 0x00009200UL, 0x00009d00UL, 0x00003800UL, 0x0000f500UL, -0x0000bc00UL, 0x0000b600UL, 0x0000da00UL, 0x00002100UL, 0x00001000UL, 0x0000ff00UL, 0x0000f300UL, 0x0000d200UL, -0x0000cd00UL, 0x00000c00UL, 0x00001300UL, 0x0000ec00UL, 0x00005f00UL, 0x00009700UL, 0x00004400UL, 0x00001700UL, -0x0000c400UL, 0x0000a700UL, 0x00007e00UL, 0x00003d00UL, 0x00006400UL, 0x00005d00UL, 0x00001900UL, 0x00007300UL, -0x00006000UL, 0x00008100UL, 0x00004f00UL, 0x0000dc00UL, 0x00002200UL, 0x00002a00UL, 0x00009000UL, 0x00008800UL, -0x00004600UL, 0x0000ee00UL, 0x0000b800UL, 0x00001400UL, 0x0000de00UL, 0x00005e00UL, 0x00000b00UL, 0x0000db00UL, -0x0000e000UL, 0x00003200UL, 0x00003a00UL, 0x00000a00UL, 0x00004900UL, 0x00000600UL, 0x00002400UL, 0x00005c00UL, -0x0000c200UL, 0x0000d300UL, 0x0000ac00UL, 0x00006200UL, 0x00009100UL, 0x00009500UL, 0x0000e400UL, 0x00007900UL, -0x0000e700UL, 0x0000c800UL, 0x00003700UL, 0x00006d00UL, 0x00008d00UL, 0x0000d500UL, 0x00004e00UL, 0x0000a900UL, -0x00006c00UL, 0x00005600UL, 0x0000f400UL, 0x0000ea00UL, 0x00006500UL, 0x00007a00UL, 0x0000ae00UL, 0x00000800UL, -0x0000ba00UL, 0x00007800UL, 0x00002500UL, 0x00002e00UL, 0x00001c00UL, 0x0000a600UL, 0x0000b400UL, 0x0000c600UL, -0x0000e800UL, 0x0000dd00UL, 0x00007400UL, 0x00001f00UL, 0x00004b00UL, 0x0000bd00UL, 0x00008b00UL, 0x00008a00UL, -0x00007000UL, 0x00003e00UL, 0x0000b500UL, 0x00006600UL, 0x00004800UL, 0x00000300UL, 0x0000f600UL, 0x00000e00UL, -0x00006100UL, 0x00003500UL, 0x00005700UL, 0x0000b900UL, 0x00008600UL, 0x0000c100UL, 0x00001d00UL, 0x00009e00UL, -0x0000e100UL, 0x0000f800UL, 0x00009800UL, 0x00001100UL, 0x00006900UL, 0x0000d900UL, 0x00008e00UL, 0x00009400UL, -0x00009b00UL, 0x00001e00UL, 0x00008700UL, 0x0000e900UL, 0x0000ce00UL, 0x00005500UL, 0x00002800UL, 0x0000df00UL, -0x00008c00UL, 0x0000a100UL, 0x00008900UL, 0x00000d00UL, 0x0000bf00UL, 0x0000e600UL, 0x00004200UL, 0x00006800UL, +0x00006300UL, 0x00007c00UL, 0x00007700UL, 0x00007b00UL, 0x0000f200UL, 0x00006b00UL, 0x00006f00UL, 0x0000c500UL, +0x00003000UL, 0x00000100UL, 0x00006700UL, 0x00002b00UL, 0x0000fe00UL, 0x0000d700UL, 0x0000ab00UL, 0x00007600UL, +0x0000ca00UL, 0x00008200UL, 0x0000c900UL, 0x00007d00UL, 0x0000fa00UL, 0x00005900UL, 0x00004700UL, 0x0000f000UL, +0x0000ad00UL, 0x0000d400UL, 0x0000a200UL, 0x0000af00UL, 0x00009c00UL, 0x0000a400UL, 0x00007200UL, 0x0000c000UL, +0x0000b700UL, 0x0000fd00UL, 0x00009300UL, 0x00002600UL, 0x00003600UL, 0x00003f00UL, 0x0000f700UL, 0x0000cc00UL, +0x00003400UL, 0x0000a500UL, 0x0000e500UL, 0x0000f100UL, 0x00007100UL, 0x0000d800UL, 0x00003100UL, 0x00001500UL, +0x00000400UL, 0x0000c700UL, 0x00002300UL, 0x0000c300UL, 0x00001800UL, 0x00009600UL, 0x00000500UL, 0x00009a00UL, +0x00000700UL, 0x00001200UL, 0x00008000UL, 0x0000e200UL, 0x0000eb00UL, 0x00002700UL, 0x0000b200UL, 0x00007500UL, +0x00000900UL, 0x00008300UL, 0x00002c00UL, 0x00001a00UL, 0x00001b00UL, 0x00006e00UL, 0x00005a00UL, 0x0000a000UL, +0x00005200UL, 0x00003b00UL, 0x0000d600UL, 0x0000b300UL, 0x00002900UL, 0x0000e300UL, 0x00002f00UL, 0x00008400UL, +0x00005300UL, 0x0000d100UL, 0x00000000UL, 0x0000ed00UL, 0x00002000UL, 0x0000fc00UL, 0x0000b100UL, 0x00005b00UL, +0x00006a00UL, 0x0000cb00UL, 0x0000be00UL, 0x00003900UL, 0x00004a00UL, 0x00004c00UL, 0x00005800UL, 0x0000cf00UL, +0x0000d000UL, 0x0000ef00UL, 0x0000aa00UL, 0x0000fb00UL, 0x00004300UL, 0x00004d00UL, 0x00003300UL, 0x00008500UL, +0x00004500UL, 0x0000f900UL, 0x00000200UL, 0x00007f00UL, 0x00005000UL, 0x00003c00UL, 0x00009f00UL, 0x0000a800UL, +0x00005100UL, 0x0000a300UL, 0x00004000UL, 0x00008f00UL, 0x00009200UL, 0x00009d00UL, 0x00003800UL, 0x0000f500UL, +0x0000bc00UL, 0x0000b600UL, 0x0000da00UL, 0x00002100UL, 0x00001000UL, 0x0000ff00UL, 0x0000f300UL, 0x0000d200UL, +0x0000cd00UL, 0x00000c00UL, 0x00001300UL, 0x0000ec00UL, 0x00005f00UL, 0x00009700UL, 0x00004400UL, 0x00001700UL, +0x0000c400UL, 0x0000a700UL, 0x00007e00UL, 0x00003d00UL, 0x00006400UL, 0x00005d00UL, 0x00001900UL, 0x00007300UL, +0x00006000UL, 0x00008100UL, 0x00004f00UL, 0x0000dc00UL, 0x00002200UL, 0x00002a00UL, 0x00009000UL, 0x00008800UL, +0x00004600UL, 0x0000ee00UL, 0x0000b800UL, 0x00001400UL, 0x0000de00UL, 0x00005e00UL, 0x00000b00UL, 0x0000db00UL, +0x0000e000UL, 0x00003200UL, 0x00003a00UL, 0x00000a00UL, 0x00004900UL, 0x00000600UL, 0x00002400UL, 0x00005c00UL, +0x0000c200UL, 0x0000d300UL, 0x0000ac00UL, 0x00006200UL, 0x00009100UL, 0x00009500UL, 0x0000e400UL, 0x00007900UL, +0x0000e700UL, 0x0000c800UL, 0x00003700UL, 0x00006d00UL, 0x00008d00UL, 0x0000d500UL, 0x00004e00UL, 0x0000a900UL, +0x00006c00UL, 0x00005600UL, 0x0000f400UL, 0x0000ea00UL, 0x00006500UL, 0x00007a00UL, 0x0000ae00UL, 0x00000800UL, +0x0000ba00UL, 0x00007800UL, 0x00002500UL, 0x00002e00UL, 0x00001c00UL, 0x0000a600UL, 0x0000b400UL, 0x0000c600UL, +0x0000e800UL, 0x0000dd00UL, 0x00007400UL, 0x00001f00UL, 0x00004b00UL, 0x0000bd00UL, 0x00008b00UL, 0x00008a00UL, +0x00007000UL, 0x00003e00UL, 0x0000b500UL, 0x00006600UL, 0x00004800UL, 0x00000300UL, 0x0000f600UL, 0x00000e00UL, +0x00006100UL, 0x00003500UL, 0x00005700UL, 0x0000b900UL, 0x00008600UL, 0x0000c100UL, 0x00001d00UL, 0x00009e00UL, +0x0000e100UL, 0x0000f800UL, 0x00009800UL, 0x00001100UL, 0x00006900UL, 0x0000d900UL, 0x00008e00UL, 0x00009400UL, +0x00009b00UL, 0x00001e00UL, 0x00008700UL, 0x0000e900UL, 0x0000ce00UL, 0x00005500UL, 0x00002800UL, 0x0000df00UL, +0x00008c00UL, 0x0000a100UL, 0x00008900UL, 0x00000d00UL, 0x0000bf00UL, 0x0000e600UL, 0x00004200UL, 0x00006800UL, 0x00004100UL, 0x00009900UL, 0x00002d00UL, 0x00000f00UL, 0x0000b000UL, 0x00005400UL, 0x0000bb00UL, 0x00001600UL }; static const ulong32 Te4_2[] = { -0x00630000UL, 0x007c0000UL, 0x00770000UL, 0x007b0000UL, 0x00f20000UL, 0x006b0000UL, 0x006f0000UL, 0x00c50000UL, -0x00300000UL, 0x00010000UL, 0x00670000UL, 0x002b0000UL, 0x00fe0000UL, 0x00d70000UL, 0x00ab0000UL, 0x00760000UL, -0x00ca0000UL, 0x00820000UL, 0x00c90000UL, 0x007d0000UL, 0x00fa0000UL, 0x00590000UL, 0x00470000UL, 0x00f00000UL, -0x00ad0000UL, 0x00d40000UL, 0x00a20000UL, 0x00af0000UL, 0x009c0000UL, 0x00a40000UL, 0x00720000UL, 0x00c00000UL, -0x00b70000UL, 0x00fd0000UL, 0x00930000UL, 0x00260000UL, 0x00360000UL, 0x003f0000UL, 0x00f70000UL, 0x00cc0000UL, -0x00340000UL, 0x00a50000UL, 0x00e50000UL, 0x00f10000UL, 0x00710000UL, 0x00d80000UL, 0x00310000UL, 0x00150000UL, -0x00040000UL, 0x00c70000UL, 0x00230000UL, 0x00c30000UL, 0x00180000UL, 0x00960000UL, 0x00050000UL, 0x009a0000UL, -0x00070000UL, 0x00120000UL, 0x00800000UL, 0x00e20000UL, 0x00eb0000UL, 0x00270000UL, 0x00b20000UL, 0x00750000UL, -0x00090000UL, 0x00830000UL, 0x002c0000UL, 0x001a0000UL, 0x001b0000UL, 0x006e0000UL, 0x005a0000UL, 0x00a00000UL, -0x00520000UL, 0x003b0000UL, 0x00d60000UL, 0x00b30000UL, 0x00290000UL, 0x00e30000UL, 0x002f0000UL, 0x00840000UL, -0x00530000UL, 0x00d10000UL, 0x00000000UL, 0x00ed0000UL, 0x00200000UL, 0x00fc0000UL, 0x00b10000UL, 0x005b0000UL, -0x006a0000UL, 0x00cb0000UL, 0x00be0000UL, 0x00390000UL, 0x004a0000UL, 0x004c0000UL, 0x00580000UL, 0x00cf0000UL, -0x00d00000UL, 0x00ef0000UL, 0x00aa0000UL, 0x00fb0000UL, 0x00430000UL, 0x004d0000UL, 0x00330000UL, 0x00850000UL, -0x00450000UL, 0x00f90000UL, 0x00020000UL, 0x007f0000UL, 0x00500000UL, 0x003c0000UL, 0x009f0000UL, 0x00a80000UL, -0x00510000UL, 0x00a30000UL, 0x00400000UL, 0x008f0000UL, 0x00920000UL, 0x009d0000UL, 0x00380000UL, 0x00f50000UL, -0x00bc0000UL, 0x00b60000UL, 0x00da0000UL, 0x00210000UL, 0x00100000UL, 0x00ff0000UL, 0x00f30000UL, 0x00d20000UL, -0x00cd0000UL, 0x000c0000UL, 0x00130000UL, 0x00ec0000UL, 0x005f0000UL, 0x00970000UL, 0x00440000UL, 0x00170000UL, -0x00c40000UL, 0x00a70000UL, 0x007e0000UL, 0x003d0000UL, 0x00640000UL, 0x005d0000UL, 0x00190000UL, 0x00730000UL, -0x00600000UL, 0x00810000UL, 0x004f0000UL, 0x00dc0000UL, 0x00220000UL, 0x002a0000UL, 0x00900000UL, 0x00880000UL, -0x00460000UL, 0x00ee0000UL, 0x00b80000UL, 0x00140000UL, 0x00de0000UL, 0x005e0000UL, 0x000b0000UL, 0x00db0000UL, -0x00e00000UL, 0x00320000UL, 0x003a0000UL, 0x000a0000UL, 0x00490000UL, 0x00060000UL, 0x00240000UL, 0x005c0000UL, -0x00c20000UL, 0x00d30000UL, 0x00ac0000UL, 0x00620000UL, 0x00910000UL, 0x00950000UL, 0x00e40000UL, 0x00790000UL, -0x00e70000UL, 0x00c80000UL, 0x00370000UL, 0x006d0000UL, 0x008d0000UL, 0x00d50000UL, 0x004e0000UL, 0x00a90000UL, -0x006c0000UL, 0x00560000UL, 0x00f40000UL, 0x00ea0000UL, 0x00650000UL, 0x007a0000UL, 0x00ae0000UL, 0x00080000UL, -0x00ba0000UL, 0x00780000UL, 0x00250000UL, 0x002e0000UL, 0x001c0000UL, 0x00a60000UL, 0x00b40000UL, 0x00c60000UL, -0x00e80000UL, 0x00dd0000UL, 0x00740000UL, 0x001f0000UL, 0x004b0000UL, 0x00bd0000UL, 0x008b0000UL, 0x008a0000UL, -0x00700000UL, 0x003e0000UL, 0x00b50000UL, 0x00660000UL, 0x00480000UL, 0x00030000UL, 0x00f60000UL, 0x000e0000UL, -0x00610000UL, 0x00350000UL, 0x00570000UL, 0x00b90000UL, 0x00860000UL, 0x00c10000UL, 0x001d0000UL, 0x009e0000UL, -0x00e10000UL, 0x00f80000UL, 0x00980000UL, 0x00110000UL, 0x00690000UL, 0x00d90000UL, 0x008e0000UL, 0x00940000UL, -0x009b0000UL, 0x001e0000UL, 0x00870000UL, 0x00e90000UL, 0x00ce0000UL, 0x00550000UL, 0x00280000UL, 0x00df0000UL, -0x008c0000UL, 0x00a10000UL, 0x00890000UL, 0x000d0000UL, 0x00bf0000UL, 0x00e60000UL, 0x00420000UL, 0x00680000UL, +0x00630000UL, 0x007c0000UL, 0x00770000UL, 0x007b0000UL, 0x00f20000UL, 0x006b0000UL, 0x006f0000UL, 0x00c50000UL, +0x00300000UL, 0x00010000UL, 0x00670000UL, 0x002b0000UL, 0x00fe0000UL, 0x00d70000UL, 0x00ab0000UL, 0x00760000UL, +0x00ca0000UL, 0x00820000UL, 0x00c90000UL, 0x007d0000UL, 0x00fa0000UL, 0x00590000UL, 0x00470000UL, 0x00f00000UL, +0x00ad0000UL, 0x00d40000UL, 0x00a20000UL, 0x00af0000UL, 0x009c0000UL, 0x00a40000UL, 0x00720000UL, 0x00c00000UL, +0x00b70000UL, 0x00fd0000UL, 0x00930000UL, 0x00260000UL, 0x00360000UL, 0x003f0000UL, 0x00f70000UL, 0x00cc0000UL, +0x00340000UL, 0x00a50000UL, 0x00e50000UL, 0x00f10000UL, 0x00710000UL, 0x00d80000UL, 0x00310000UL, 0x00150000UL, +0x00040000UL, 0x00c70000UL, 0x00230000UL, 0x00c30000UL, 0x00180000UL, 0x00960000UL, 0x00050000UL, 0x009a0000UL, +0x00070000UL, 0x00120000UL, 0x00800000UL, 0x00e20000UL, 0x00eb0000UL, 0x00270000UL, 0x00b20000UL, 0x00750000UL, +0x00090000UL, 0x00830000UL, 0x002c0000UL, 0x001a0000UL, 0x001b0000UL, 0x006e0000UL, 0x005a0000UL, 0x00a00000UL, +0x00520000UL, 0x003b0000UL, 0x00d60000UL, 0x00b30000UL, 0x00290000UL, 0x00e30000UL, 0x002f0000UL, 0x00840000UL, +0x00530000UL, 0x00d10000UL, 0x00000000UL, 0x00ed0000UL, 0x00200000UL, 0x00fc0000UL, 0x00b10000UL, 0x005b0000UL, +0x006a0000UL, 0x00cb0000UL, 0x00be0000UL, 0x00390000UL, 0x004a0000UL, 0x004c0000UL, 0x00580000UL, 0x00cf0000UL, +0x00d00000UL, 0x00ef0000UL, 0x00aa0000UL, 0x00fb0000UL, 0x00430000UL, 0x004d0000UL, 0x00330000UL, 0x00850000UL, +0x00450000UL, 0x00f90000UL, 0x00020000UL, 0x007f0000UL, 0x00500000UL, 0x003c0000UL, 0x009f0000UL, 0x00a80000UL, +0x00510000UL, 0x00a30000UL, 0x00400000UL, 0x008f0000UL, 0x00920000UL, 0x009d0000UL, 0x00380000UL, 0x00f50000UL, +0x00bc0000UL, 0x00b60000UL, 0x00da0000UL, 0x00210000UL, 0x00100000UL, 0x00ff0000UL, 0x00f30000UL, 0x00d20000UL, +0x00cd0000UL, 0x000c0000UL, 0x00130000UL, 0x00ec0000UL, 0x005f0000UL, 0x00970000UL, 0x00440000UL, 0x00170000UL, +0x00c40000UL, 0x00a70000UL, 0x007e0000UL, 0x003d0000UL, 0x00640000UL, 0x005d0000UL, 0x00190000UL, 0x00730000UL, +0x00600000UL, 0x00810000UL, 0x004f0000UL, 0x00dc0000UL, 0x00220000UL, 0x002a0000UL, 0x00900000UL, 0x00880000UL, +0x00460000UL, 0x00ee0000UL, 0x00b80000UL, 0x00140000UL, 0x00de0000UL, 0x005e0000UL, 0x000b0000UL, 0x00db0000UL, +0x00e00000UL, 0x00320000UL, 0x003a0000UL, 0x000a0000UL, 0x00490000UL, 0x00060000UL, 0x00240000UL, 0x005c0000UL, +0x00c20000UL, 0x00d30000UL, 0x00ac0000UL, 0x00620000UL, 0x00910000UL, 0x00950000UL, 0x00e40000UL, 0x00790000UL, +0x00e70000UL, 0x00c80000UL, 0x00370000UL, 0x006d0000UL, 0x008d0000UL, 0x00d50000UL, 0x004e0000UL, 0x00a90000UL, +0x006c0000UL, 0x00560000UL, 0x00f40000UL, 0x00ea0000UL, 0x00650000UL, 0x007a0000UL, 0x00ae0000UL, 0x00080000UL, +0x00ba0000UL, 0x00780000UL, 0x00250000UL, 0x002e0000UL, 0x001c0000UL, 0x00a60000UL, 0x00b40000UL, 0x00c60000UL, +0x00e80000UL, 0x00dd0000UL, 0x00740000UL, 0x001f0000UL, 0x004b0000UL, 0x00bd0000UL, 0x008b0000UL, 0x008a0000UL, +0x00700000UL, 0x003e0000UL, 0x00b50000UL, 0x00660000UL, 0x00480000UL, 0x00030000UL, 0x00f60000UL, 0x000e0000UL, +0x00610000UL, 0x00350000UL, 0x00570000UL, 0x00b90000UL, 0x00860000UL, 0x00c10000UL, 0x001d0000UL, 0x009e0000UL, +0x00e10000UL, 0x00f80000UL, 0x00980000UL, 0x00110000UL, 0x00690000UL, 0x00d90000UL, 0x008e0000UL, 0x00940000UL, +0x009b0000UL, 0x001e0000UL, 0x00870000UL, 0x00e90000UL, 0x00ce0000UL, 0x00550000UL, 0x00280000UL, 0x00df0000UL, +0x008c0000UL, 0x00a10000UL, 0x00890000UL, 0x000d0000UL, 0x00bf0000UL, 0x00e60000UL, 0x00420000UL, 0x00680000UL, 0x00410000UL, 0x00990000UL, 0x002d0000UL, 0x000f0000UL, 0x00b00000UL, 0x00540000UL, 0x00bb0000UL, 0x00160000UL }; static const ulong32 Te4_3[] = { -0x63000000UL, 0x7c000000UL, 0x77000000UL, 0x7b000000UL, 0xf2000000UL, 0x6b000000UL, 0x6f000000UL, 0xc5000000UL, -0x30000000UL, 0x01000000UL, 0x67000000UL, 0x2b000000UL, 0xfe000000UL, 0xd7000000UL, 0xab000000UL, 0x76000000UL, -0xca000000UL, 0x82000000UL, 0xc9000000UL, 0x7d000000UL, 0xfa000000UL, 0x59000000UL, 0x47000000UL, 0xf0000000UL, -0xad000000UL, 0xd4000000UL, 0xa2000000UL, 0xaf000000UL, 0x9c000000UL, 0xa4000000UL, 0x72000000UL, 0xc0000000UL, -0xb7000000UL, 0xfd000000UL, 0x93000000UL, 0x26000000UL, 0x36000000UL, 0x3f000000UL, 0xf7000000UL, 0xcc000000UL, -0x34000000UL, 0xa5000000UL, 0xe5000000UL, 0xf1000000UL, 0x71000000UL, 0xd8000000UL, 0x31000000UL, 0x15000000UL, -0x04000000UL, 0xc7000000UL, 0x23000000UL, 0xc3000000UL, 0x18000000UL, 0x96000000UL, 0x05000000UL, 0x9a000000UL, -0x07000000UL, 0x12000000UL, 0x80000000UL, 0xe2000000UL, 0xeb000000UL, 0x27000000UL, 0xb2000000UL, 0x75000000UL, -0x09000000UL, 0x83000000UL, 0x2c000000UL, 0x1a000000UL, 0x1b000000UL, 0x6e000000UL, 0x5a000000UL, 0xa0000000UL, -0x52000000UL, 0x3b000000UL, 0xd6000000UL, 0xb3000000UL, 0x29000000UL, 0xe3000000UL, 0x2f000000UL, 0x84000000UL, -0x53000000UL, 0xd1000000UL, 0x00000000UL, 0xed000000UL, 0x20000000UL, 0xfc000000UL, 0xb1000000UL, 0x5b000000UL, -0x6a000000UL, 0xcb000000UL, 0xbe000000UL, 0x39000000UL, 0x4a000000UL, 0x4c000000UL, 0x58000000UL, 0xcf000000UL, -0xd0000000UL, 0xef000000UL, 0xaa000000UL, 0xfb000000UL, 0x43000000UL, 0x4d000000UL, 0x33000000UL, 0x85000000UL, -0x45000000UL, 0xf9000000UL, 0x02000000UL, 0x7f000000UL, 0x50000000UL, 0x3c000000UL, 0x9f000000UL, 0xa8000000UL, -0x51000000UL, 0xa3000000UL, 0x40000000UL, 0x8f000000UL, 0x92000000UL, 0x9d000000UL, 0x38000000UL, 0xf5000000UL, -0xbc000000UL, 0xb6000000UL, 0xda000000UL, 0x21000000UL, 0x10000000UL, 0xff000000UL, 0xf3000000UL, 0xd2000000UL, -0xcd000000UL, 0x0c000000UL, 0x13000000UL, 0xec000000UL, 0x5f000000UL, 0x97000000UL, 0x44000000UL, 0x17000000UL, -0xc4000000UL, 0xa7000000UL, 0x7e000000UL, 0x3d000000UL, 0x64000000UL, 0x5d000000UL, 0x19000000UL, 0x73000000UL, -0x60000000UL, 0x81000000UL, 0x4f000000UL, 0xdc000000UL, 0x22000000UL, 0x2a000000UL, 0x90000000UL, 0x88000000UL, -0x46000000UL, 0xee000000UL, 0xb8000000UL, 0x14000000UL, 0xde000000UL, 0x5e000000UL, 0x0b000000UL, 0xdb000000UL, -0xe0000000UL, 0x32000000UL, 0x3a000000UL, 0x0a000000UL, 0x49000000UL, 0x06000000UL, 0x24000000UL, 0x5c000000UL, -0xc2000000UL, 0xd3000000UL, 0xac000000UL, 0x62000000UL, 0x91000000UL, 0x95000000UL, 0xe4000000UL, 0x79000000UL, -0xe7000000UL, 0xc8000000UL, 0x37000000UL, 0x6d000000UL, 0x8d000000UL, 0xd5000000UL, 0x4e000000UL, 0xa9000000UL, -0x6c000000UL, 0x56000000UL, 0xf4000000UL, 0xea000000UL, 0x65000000UL, 0x7a000000UL, 0xae000000UL, 0x08000000UL, -0xba000000UL, 0x78000000UL, 0x25000000UL, 0x2e000000UL, 0x1c000000UL, 0xa6000000UL, 0xb4000000UL, 0xc6000000UL, -0xe8000000UL, 0xdd000000UL, 0x74000000UL, 0x1f000000UL, 0x4b000000UL, 0xbd000000UL, 0x8b000000UL, 0x8a000000UL, -0x70000000UL, 0x3e000000UL, 0xb5000000UL, 0x66000000UL, 0x48000000UL, 0x03000000UL, 0xf6000000UL, 0x0e000000UL, -0x61000000UL, 0x35000000UL, 0x57000000UL, 0xb9000000UL, 0x86000000UL, 0xc1000000UL, 0x1d000000UL, 0x9e000000UL, -0xe1000000UL, 0xf8000000UL, 0x98000000UL, 0x11000000UL, 0x69000000UL, 0xd9000000UL, 0x8e000000UL, 0x94000000UL, -0x9b000000UL, 0x1e000000UL, 0x87000000UL, 0xe9000000UL, 0xce000000UL, 0x55000000UL, 0x28000000UL, 0xdf000000UL, -0x8c000000UL, 0xa1000000UL, 0x89000000UL, 0x0d000000UL, 0xbf000000UL, 0xe6000000UL, 0x42000000UL, 0x68000000UL, +0x63000000UL, 0x7c000000UL, 0x77000000UL, 0x7b000000UL, 0xf2000000UL, 0x6b000000UL, 0x6f000000UL, 0xc5000000UL, +0x30000000UL, 0x01000000UL, 0x67000000UL, 0x2b000000UL, 0xfe000000UL, 0xd7000000UL, 0xab000000UL, 0x76000000UL, +0xca000000UL, 0x82000000UL, 0xc9000000UL, 0x7d000000UL, 0xfa000000UL, 0x59000000UL, 0x47000000UL, 0xf0000000UL, +0xad000000UL, 0xd4000000UL, 0xa2000000UL, 0xaf000000UL, 0x9c000000UL, 0xa4000000UL, 0x72000000UL, 0xc0000000UL, +0xb7000000UL, 0xfd000000UL, 0x93000000UL, 0x26000000UL, 0x36000000UL, 0x3f000000UL, 0xf7000000UL, 0xcc000000UL, +0x34000000UL, 0xa5000000UL, 0xe5000000UL, 0xf1000000UL, 0x71000000UL, 0xd8000000UL, 0x31000000UL, 0x15000000UL, +0x04000000UL, 0xc7000000UL, 0x23000000UL, 0xc3000000UL, 0x18000000UL, 0x96000000UL, 0x05000000UL, 0x9a000000UL, +0x07000000UL, 0x12000000UL, 0x80000000UL, 0xe2000000UL, 0xeb000000UL, 0x27000000UL, 0xb2000000UL, 0x75000000UL, +0x09000000UL, 0x83000000UL, 0x2c000000UL, 0x1a000000UL, 0x1b000000UL, 0x6e000000UL, 0x5a000000UL, 0xa0000000UL, +0x52000000UL, 0x3b000000UL, 0xd6000000UL, 0xb3000000UL, 0x29000000UL, 0xe3000000UL, 0x2f000000UL, 0x84000000UL, +0x53000000UL, 0xd1000000UL, 0x00000000UL, 0xed000000UL, 0x20000000UL, 0xfc000000UL, 0xb1000000UL, 0x5b000000UL, +0x6a000000UL, 0xcb000000UL, 0xbe000000UL, 0x39000000UL, 0x4a000000UL, 0x4c000000UL, 0x58000000UL, 0xcf000000UL, +0xd0000000UL, 0xef000000UL, 0xaa000000UL, 0xfb000000UL, 0x43000000UL, 0x4d000000UL, 0x33000000UL, 0x85000000UL, +0x45000000UL, 0xf9000000UL, 0x02000000UL, 0x7f000000UL, 0x50000000UL, 0x3c000000UL, 0x9f000000UL, 0xa8000000UL, +0x51000000UL, 0xa3000000UL, 0x40000000UL, 0x8f000000UL, 0x92000000UL, 0x9d000000UL, 0x38000000UL, 0xf5000000UL, +0xbc000000UL, 0xb6000000UL, 0xda000000UL, 0x21000000UL, 0x10000000UL, 0xff000000UL, 0xf3000000UL, 0xd2000000UL, +0xcd000000UL, 0x0c000000UL, 0x13000000UL, 0xec000000UL, 0x5f000000UL, 0x97000000UL, 0x44000000UL, 0x17000000UL, +0xc4000000UL, 0xa7000000UL, 0x7e000000UL, 0x3d000000UL, 0x64000000UL, 0x5d000000UL, 0x19000000UL, 0x73000000UL, +0x60000000UL, 0x81000000UL, 0x4f000000UL, 0xdc000000UL, 0x22000000UL, 0x2a000000UL, 0x90000000UL, 0x88000000UL, +0x46000000UL, 0xee000000UL, 0xb8000000UL, 0x14000000UL, 0xde000000UL, 0x5e000000UL, 0x0b000000UL, 0xdb000000UL, +0xe0000000UL, 0x32000000UL, 0x3a000000UL, 0x0a000000UL, 0x49000000UL, 0x06000000UL, 0x24000000UL, 0x5c000000UL, +0xc2000000UL, 0xd3000000UL, 0xac000000UL, 0x62000000UL, 0x91000000UL, 0x95000000UL, 0xe4000000UL, 0x79000000UL, +0xe7000000UL, 0xc8000000UL, 0x37000000UL, 0x6d000000UL, 0x8d000000UL, 0xd5000000UL, 0x4e000000UL, 0xa9000000UL, +0x6c000000UL, 0x56000000UL, 0xf4000000UL, 0xea000000UL, 0x65000000UL, 0x7a000000UL, 0xae000000UL, 0x08000000UL, +0xba000000UL, 0x78000000UL, 0x25000000UL, 0x2e000000UL, 0x1c000000UL, 0xa6000000UL, 0xb4000000UL, 0xc6000000UL, +0xe8000000UL, 0xdd000000UL, 0x74000000UL, 0x1f000000UL, 0x4b000000UL, 0xbd000000UL, 0x8b000000UL, 0x8a000000UL, +0x70000000UL, 0x3e000000UL, 0xb5000000UL, 0x66000000UL, 0x48000000UL, 0x03000000UL, 0xf6000000UL, 0x0e000000UL, +0x61000000UL, 0x35000000UL, 0x57000000UL, 0xb9000000UL, 0x86000000UL, 0xc1000000UL, 0x1d000000UL, 0x9e000000UL, +0xe1000000UL, 0xf8000000UL, 0x98000000UL, 0x11000000UL, 0x69000000UL, 0xd9000000UL, 0x8e000000UL, 0x94000000UL, +0x9b000000UL, 0x1e000000UL, 0x87000000UL, 0xe9000000UL, 0xce000000UL, 0x55000000UL, 0x28000000UL, 0xdf000000UL, +0x8c000000UL, 0xa1000000UL, 0x89000000UL, 0x0d000000UL, 0xbf000000UL, 0xe6000000UL, 0x42000000UL, 0x68000000UL, 0x41000000UL, 0x99000000UL, 0x2d000000UL, 0x0f000000UL, 0xb0000000UL, 0x54000000UL, 0xbb000000UL, 0x16000000UL }; #endif /* pelimac */ @@ -874,142 +874,142 @@ static const ulong32 TD3[256] = { }; static const ulong32 Tks0[] = { -0x00000000UL, 0x0e090d0bUL, 0x1c121a16UL, 0x121b171dUL, 0x3824342cUL, 0x362d3927UL, 0x24362e3aUL, 0x2a3f2331UL, -0x70486858UL, 0x7e416553UL, 0x6c5a724eUL, 0x62537f45UL, 0x486c5c74UL, 0x4665517fUL, 0x547e4662UL, 0x5a774b69UL, -0xe090d0b0UL, 0xee99ddbbUL, 0xfc82caa6UL, 0xf28bc7adUL, 0xd8b4e49cUL, 0xd6bde997UL, 0xc4a6fe8aUL, 0xcaaff381UL, -0x90d8b8e8UL, 0x9ed1b5e3UL, 0x8ccaa2feUL, 0x82c3aff5UL, 0xa8fc8cc4UL, 0xa6f581cfUL, 0xb4ee96d2UL, 0xbae79bd9UL, -0xdb3bbb7bUL, 0xd532b670UL, 0xc729a16dUL, 0xc920ac66UL, 0xe31f8f57UL, 0xed16825cUL, 0xff0d9541UL, 0xf104984aUL, -0xab73d323UL, 0xa57ade28UL, 0xb761c935UL, 0xb968c43eUL, 0x9357e70fUL, 0x9d5eea04UL, 0x8f45fd19UL, 0x814cf012UL, -0x3bab6bcbUL, 0x35a266c0UL, 0x27b971ddUL, 0x29b07cd6UL, 0x038f5fe7UL, 0x0d8652ecUL, 0x1f9d45f1UL, 0x119448faUL, -0x4be30393UL, 0x45ea0e98UL, 0x57f11985UL, 0x59f8148eUL, 0x73c737bfUL, 0x7dce3ab4UL, 0x6fd52da9UL, 0x61dc20a2UL, -0xad766df6UL, 0xa37f60fdUL, 0xb16477e0UL, 0xbf6d7aebUL, 0x955259daUL, 0x9b5b54d1UL, 0x894043ccUL, 0x87494ec7UL, -0xdd3e05aeUL, 0xd33708a5UL, 0xc12c1fb8UL, 0xcf2512b3UL, 0xe51a3182UL, 0xeb133c89UL, 0xf9082b94UL, 0xf701269fUL, -0x4de6bd46UL, 0x43efb04dUL, 0x51f4a750UL, 0x5ffdaa5bUL, 0x75c2896aUL, 0x7bcb8461UL, 0x69d0937cUL, 0x67d99e77UL, -0x3daed51eUL, 0x33a7d815UL, 0x21bccf08UL, 0x2fb5c203UL, 0x058ae132UL, 0x0b83ec39UL, 0x1998fb24UL, 0x1791f62fUL, -0x764dd68dUL, 0x7844db86UL, 0x6a5fcc9bUL, 0x6456c190UL, 0x4e69e2a1UL, 0x4060efaaUL, 0x527bf8b7UL, 0x5c72f5bcUL, -0x0605bed5UL, 0x080cb3deUL, 0x1a17a4c3UL, 0x141ea9c8UL, 0x3e218af9UL, 0x302887f2UL, 0x223390efUL, 0x2c3a9de4UL, -0x96dd063dUL, 0x98d40b36UL, 0x8acf1c2bUL, 0x84c61120UL, 0xaef93211UL, 0xa0f03f1aUL, 0xb2eb2807UL, 0xbce2250cUL, -0xe6956e65UL, 0xe89c636eUL, 0xfa877473UL, 0xf48e7978UL, 0xdeb15a49UL, 0xd0b85742UL, 0xc2a3405fUL, 0xccaa4d54UL, -0x41ecdaf7UL, 0x4fe5d7fcUL, 0x5dfec0e1UL, 0x53f7cdeaUL, 0x79c8eedbUL, 0x77c1e3d0UL, 0x65daf4cdUL, 0x6bd3f9c6UL, -0x31a4b2afUL, 0x3fadbfa4UL, 0x2db6a8b9UL, 0x23bfa5b2UL, 0x09808683UL, 0x07898b88UL, 0x15929c95UL, 0x1b9b919eUL, -0xa17c0a47UL, 0xaf75074cUL, 0xbd6e1051UL, 0xb3671d5aUL, 0x99583e6bUL, 0x97513360UL, 0x854a247dUL, 0x8b432976UL, -0xd134621fUL, 0xdf3d6f14UL, 0xcd267809UL, 0xc32f7502UL, 0xe9105633UL, 0xe7195b38UL, 0xf5024c25UL, 0xfb0b412eUL, -0x9ad7618cUL, 0x94de6c87UL, 0x86c57b9aUL, 0x88cc7691UL, 0xa2f355a0UL, 0xacfa58abUL, 0xbee14fb6UL, 0xb0e842bdUL, -0xea9f09d4UL, 0xe49604dfUL, 0xf68d13c2UL, 0xf8841ec9UL, 0xd2bb3df8UL, 0xdcb230f3UL, 0xcea927eeUL, 0xc0a02ae5UL, -0x7a47b13cUL, 0x744ebc37UL, 0x6655ab2aUL, 0x685ca621UL, 0x42638510UL, 0x4c6a881bUL, 0x5e719f06UL, 0x5078920dUL, -0x0a0fd964UL, 0x0406d46fUL, 0x161dc372UL, 0x1814ce79UL, 0x322bed48UL, 0x3c22e043UL, 0x2e39f75eUL, 0x2030fa55UL, -0xec9ab701UL, 0xe293ba0aUL, 0xf088ad17UL, 0xfe81a01cUL, 0xd4be832dUL, 0xdab78e26UL, 0xc8ac993bUL, 0xc6a59430UL, -0x9cd2df59UL, 0x92dbd252UL, 0x80c0c54fUL, 0x8ec9c844UL, 0xa4f6eb75UL, 0xaaffe67eUL, 0xb8e4f163UL, 0xb6edfc68UL, -0x0c0a67b1UL, 0x02036abaUL, 0x10187da7UL, 0x1e1170acUL, 0x342e539dUL, 0x3a275e96UL, 0x283c498bUL, 0x26354480UL, -0x7c420fe9UL, 0x724b02e2UL, 0x605015ffUL, 0x6e5918f4UL, 0x44663bc5UL, 0x4a6f36ceUL, 0x587421d3UL, 0x567d2cd8UL, -0x37a10c7aUL, 0x39a80171UL, 0x2bb3166cUL, 0x25ba1b67UL, 0x0f853856UL, 0x018c355dUL, 0x13972240UL, 0x1d9e2f4bUL, -0x47e96422UL, 0x49e06929UL, 0x5bfb7e34UL, 0x55f2733fUL, 0x7fcd500eUL, 0x71c45d05UL, 0x63df4a18UL, 0x6dd64713UL, -0xd731dccaUL, 0xd938d1c1UL, 0xcb23c6dcUL, 0xc52acbd7UL, 0xef15e8e6UL, 0xe11ce5edUL, 0xf307f2f0UL, 0xfd0efffbUL, +0x00000000UL, 0x0e090d0bUL, 0x1c121a16UL, 0x121b171dUL, 0x3824342cUL, 0x362d3927UL, 0x24362e3aUL, 0x2a3f2331UL, +0x70486858UL, 0x7e416553UL, 0x6c5a724eUL, 0x62537f45UL, 0x486c5c74UL, 0x4665517fUL, 0x547e4662UL, 0x5a774b69UL, +0xe090d0b0UL, 0xee99ddbbUL, 0xfc82caa6UL, 0xf28bc7adUL, 0xd8b4e49cUL, 0xd6bde997UL, 0xc4a6fe8aUL, 0xcaaff381UL, +0x90d8b8e8UL, 0x9ed1b5e3UL, 0x8ccaa2feUL, 0x82c3aff5UL, 0xa8fc8cc4UL, 0xa6f581cfUL, 0xb4ee96d2UL, 0xbae79bd9UL, +0xdb3bbb7bUL, 0xd532b670UL, 0xc729a16dUL, 0xc920ac66UL, 0xe31f8f57UL, 0xed16825cUL, 0xff0d9541UL, 0xf104984aUL, +0xab73d323UL, 0xa57ade28UL, 0xb761c935UL, 0xb968c43eUL, 0x9357e70fUL, 0x9d5eea04UL, 0x8f45fd19UL, 0x814cf012UL, +0x3bab6bcbUL, 0x35a266c0UL, 0x27b971ddUL, 0x29b07cd6UL, 0x038f5fe7UL, 0x0d8652ecUL, 0x1f9d45f1UL, 0x119448faUL, +0x4be30393UL, 0x45ea0e98UL, 0x57f11985UL, 0x59f8148eUL, 0x73c737bfUL, 0x7dce3ab4UL, 0x6fd52da9UL, 0x61dc20a2UL, +0xad766df6UL, 0xa37f60fdUL, 0xb16477e0UL, 0xbf6d7aebUL, 0x955259daUL, 0x9b5b54d1UL, 0x894043ccUL, 0x87494ec7UL, +0xdd3e05aeUL, 0xd33708a5UL, 0xc12c1fb8UL, 0xcf2512b3UL, 0xe51a3182UL, 0xeb133c89UL, 0xf9082b94UL, 0xf701269fUL, +0x4de6bd46UL, 0x43efb04dUL, 0x51f4a750UL, 0x5ffdaa5bUL, 0x75c2896aUL, 0x7bcb8461UL, 0x69d0937cUL, 0x67d99e77UL, +0x3daed51eUL, 0x33a7d815UL, 0x21bccf08UL, 0x2fb5c203UL, 0x058ae132UL, 0x0b83ec39UL, 0x1998fb24UL, 0x1791f62fUL, +0x764dd68dUL, 0x7844db86UL, 0x6a5fcc9bUL, 0x6456c190UL, 0x4e69e2a1UL, 0x4060efaaUL, 0x527bf8b7UL, 0x5c72f5bcUL, +0x0605bed5UL, 0x080cb3deUL, 0x1a17a4c3UL, 0x141ea9c8UL, 0x3e218af9UL, 0x302887f2UL, 0x223390efUL, 0x2c3a9de4UL, +0x96dd063dUL, 0x98d40b36UL, 0x8acf1c2bUL, 0x84c61120UL, 0xaef93211UL, 0xa0f03f1aUL, 0xb2eb2807UL, 0xbce2250cUL, +0xe6956e65UL, 0xe89c636eUL, 0xfa877473UL, 0xf48e7978UL, 0xdeb15a49UL, 0xd0b85742UL, 0xc2a3405fUL, 0xccaa4d54UL, +0x41ecdaf7UL, 0x4fe5d7fcUL, 0x5dfec0e1UL, 0x53f7cdeaUL, 0x79c8eedbUL, 0x77c1e3d0UL, 0x65daf4cdUL, 0x6bd3f9c6UL, +0x31a4b2afUL, 0x3fadbfa4UL, 0x2db6a8b9UL, 0x23bfa5b2UL, 0x09808683UL, 0x07898b88UL, 0x15929c95UL, 0x1b9b919eUL, +0xa17c0a47UL, 0xaf75074cUL, 0xbd6e1051UL, 0xb3671d5aUL, 0x99583e6bUL, 0x97513360UL, 0x854a247dUL, 0x8b432976UL, +0xd134621fUL, 0xdf3d6f14UL, 0xcd267809UL, 0xc32f7502UL, 0xe9105633UL, 0xe7195b38UL, 0xf5024c25UL, 0xfb0b412eUL, +0x9ad7618cUL, 0x94de6c87UL, 0x86c57b9aUL, 0x88cc7691UL, 0xa2f355a0UL, 0xacfa58abUL, 0xbee14fb6UL, 0xb0e842bdUL, +0xea9f09d4UL, 0xe49604dfUL, 0xf68d13c2UL, 0xf8841ec9UL, 0xd2bb3df8UL, 0xdcb230f3UL, 0xcea927eeUL, 0xc0a02ae5UL, +0x7a47b13cUL, 0x744ebc37UL, 0x6655ab2aUL, 0x685ca621UL, 0x42638510UL, 0x4c6a881bUL, 0x5e719f06UL, 0x5078920dUL, +0x0a0fd964UL, 0x0406d46fUL, 0x161dc372UL, 0x1814ce79UL, 0x322bed48UL, 0x3c22e043UL, 0x2e39f75eUL, 0x2030fa55UL, +0xec9ab701UL, 0xe293ba0aUL, 0xf088ad17UL, 0xfe81a01cUL, 0xd4be832dUL, 0xdab78e26UL, 0xc8ac993bUL, 0xc6a59430UL, +0x9cd2df59UL, 0x92dbd252UL, 0x80c0c54fUL, 0x8ec9c844UL, 0xa4f6eb75UL, 0xaaffe67eUL, 0xb8e4f163UL, 0xb6edfc68UL, +0x0c0a67b1UL, 0x02036abaUL, 0x10187da7UL, 0x1e1170acUL, 0x342e539dUL, 0x3a275e96UL, 0x283c498bUL, 0x26354480UL, +0x7c420fe9UL, 0x724b02e2UL, 0x605015ffUL, 0x6e5918f4UL, 0x44663bc5UL, 0x4a6f36ceUL, 0x587421d3UL, 0x567d2cd8UL, +0x37a10c7aUL, 0x39a80171UL, 0x2bb3166cUL, 0x25ba1b67UL, 0x0f853856UL, 0x018c355dUL, 0x13972240UL, 0x1d9e2f4bUL, +0x47e96422UL, 0x49e06929UL, 0x5bfb7e34UL, 0x55f2733fUL, 0x7fcd500eUL, 0x71c45d05UL, 0x63df4a18UL, 0x6dd64713UL, +0xd731dccaUL, 0xd938d1c1UL, 0xcb23c6dcUL, 0xc52acbd7UL, 0xef15e8e6UL, 0xe11ce5edUL, 0xf307f2f0UL, 0xfd0efffbUL, 0xa779b492UL, 0xa970b999UL, 0xbb6bae84UL, 0xb562a38fUL, 0x9f5d80beUL, 0x91548db5UL, 0x834f9aa8UL, 0x8d4697a3UL }; static const ulong32 Tks1[] = { -0x00000000UL, 0x0b0e090dUL, 0x161c121aUL, 0x1d121b17UL, 0x2c382434UL, 0x27362d39UL, 0x3a24362eUL, 0x312a3f23UL, -0x58704868UL, 0x537e4165UL, 0x4e6c5a72UL, 0x4562537fUL, 0x74486c5cUL, 0x7f466551UL, 0x62547e46UL, 0x695a774bUL, -0xb0e090d0UL, 0xbbee99ddUL, 0xa6fc82caUL, 0xadf28bc7UL, 0x9cd8b4e4UL, 0x97d6bde9UL, 0x8ac4a6feUL, 0x81caaff3UL, -0xe890d8b8UL, 0xe39ed1b5UL, 0xfe8ccaa2UL, 0xf582c3afUL, 0xc4a8fc8cUL, 0xcfa6f581UL, 0xd2b4ee96UL, 0xd9bae79bUL, -0x7bdb3bbbUL, 0x70d532b6UL, 0x6dc729a1UL, 0x66c920acUL, 0x57e31f8fUL, 0x5ced1682UL, 0x41ff0d95UL, 0x4af10498UL, -0x23ab73d3UL, 0x28a57adeUL, 0x35b761c9UL, 0x3eb968c4UL, 0x0f9357e7UL, 0x049d5eeaUL, 0x198f45fdUL, 0x12814cf0UL, -0xcb3bab6bUL, 0xc035a266UL, 0xdd27b971UL, 0xd629b07cUL, 0xe7038f5fUL, 0xec0d8652UL, 0xf11f9d45UL, 0xfa119448UL, -0x934be303UL, 0x9845ea0eUL, 0x8557f119UL, 0x8e59f814UL, 0xbf73c737UL, 0xb47dce3aUL, 0xa96fd52dUL, 0xa261dc20UL, -0xf6ad766dUL, 0xfda37f60UL, 0xe0b16477UL, 0xebbf6d7aUL, 0xda955259UL, 0xd19b5b54UL, 0xcc894043UL, 0xc787494eUL, -0xaedd3e05UL, 0xa5d33708UL, 0xb8c12c1fUL, 0xb3cf2512UL, 0x82e51a31UL, 0x89eb133cUL, 0x94f9082bUL, 0x9ff70126UL, -0x464de6bdUL, 0x4d43efb0UL, 0x5051f4a7UL, 0x5b5ffdaaUL, 0x6a75c289UL, 0x617bcb84UL, 0x7c69d093UL, 0x7767d99eUL, -0x1e3daed5UL, 0x1533a7d8UL, 0x0821bccfUL, 0x032fb5c2UL, 0x32058ae1UL, 0x390b83ecUL, 0x241998fbUL, 0x2f1791f6UL, -0x8d764dd6UL, 0x867844dbUL, 0x9b6a5fccUL, 0x906456c1UL, 0xa14e69e2UL, 0xaa4060efUL, 0xb7527bf8UL, 0xbc5c72f5UL, -0xd50605beUL, 0xde080cb3UL, 0xc31a17a4UL, 0xc8141ea9UL, 0xf93e218aUL, 0xf2302887UL, 0xef223390UL, 0xe42c3a9dUL, -0x3d96dd06UL, 0x3698d40bUL, 0x2b8acf1cUL, 0x2084c611UL, 0x11aef932UL, 0x1aa0f03fUL, 0x07b2eb28UL, 0x0cbce225UL, -0x65e6956eUL, 0x6ee89c63UL, 0x73fa8774UL, 0x78f48e79UL, 0x49deb15aUL, 0x42d0b857UL, 0x5fc2a340UL, 0x54ccaa4dUL, -0xf741ecdaUL, 0xfc4fe5d7UL, 0xe15dfec0UL, 0xea53f7cdUL, 0xdb79c8eeUL, 0xd077c1e3UL, 0xcd65daf4UL, 0xc66bd3f9UL, -0xaf31a4b2UL, 0xa43fadbfUL, 0xb92db6a8UL, 0xb223bfa5UL, 0x83098086UL, 0x8807898bUL, 0x9515929cUL, 0x9e1b9b91UL, -0x47a17c0aUL, 0x4caf7507UL, 0x51bd6e10UL, 0x5ab3671dUL, 0x6b99583eUL, 0x60975133UL, 0x7d854a24UL, 0x768b4329UL, -0x1fd13462UL, 0x14df3d6fUL, 0x09cd2678UL, 0x02c32f75UL, 0x33e91056UL, 0x38e7195bUL, 0x25f5024cUL, 0x2efb0b41UL, -0x8c9ad761UL, 0x8794de6cUL, 0x9a86c57bUL, 0x9188cc76UL, 0xa0a2f355UL, 0xabacfa58UL, 0xb6bee14fUL, 0xbdb0e842UL, -0xd4ea9f09UL, 0xdfe49604UL, 0xc2f68d13UL, 0xc9f8841eUL, 0xf8d2bb3dUL, 0xf3dcb230UL, 0xeecea927UL, 0xe5c0a02aUL, -0x3c7a47b1UL, 0x37744ebcUL, 0x2a6655abUL, 0x21685ca6UL, 0x10426385UL, 0x1b4c6a88UL, 0x065e719fUL, 0x0d507892UL, -0x640a0fd9UL, 0x6f0406d4UL, 0x72161dc3UL, 0x791814ceUL, 0x48322bedUL, 0x433c22e0UL, 0x5e2e39f7UL, 0x552030faUL, -0x01ec9ab7UL, 0x0ae293baUL, 0x17f088adUL, 0x1cfe81a0UL, 0x2dd4be83UL, 0x26dab78eUL, 0x3bc8ac99UL, 0x30c6a594UL, -0x599cd2dfUL, 0x5292dbd2UL, 0x4f80c0c5UL, 0x448ec9c8UL, 0x75a4f6ebUL, 0x7eaaffe6UL, 0x63b8e4f1UL, 0x68b6edfcUL, -0xb10c0a67UL, 0xba02036aUL, 0xa710187dUL, 0xac1e1170UL, 0x9d342e53UL, 0x963a275eUL, 0x8b283c49UL, 0x80263544UL, -0xe97c420fUL, 0xe2724b02UL, 0xff605015UL, 0xf46e5918UL, 0xc544663bUL, 0xce4a6f36UL, 0xd3587421UL, 0xd8567d2cUL, -0x7a37a10cUL, 0x7139a801UL, 0x6c2bb316UL, 0x6725ba1bUL, 0x560f8538UL, 0x5d018c35UL, 0x40139722UL, 0x4b1d9e2fUL, -0x2247e964UL, 0x2949e069UL, 0x345bfb7eUL, 0x3f55f273UL, 0x0e7fcd50UL, 0x0571c45dUL, 0x1863df4aUL, 0x136dd647UL, -0xcad731dcUL, 0xc1d938d1UL, 0xdccb23c6UL, 0xd7c52acbUL, 0xe6ef15e8UL, 0xede11ce5UL, 0xf0f307f2UL, 0xfbfd0effUL, +0x00000000UL, 0x0b0e090dUL, 0x161c121aUL, 0x1d121b17UL, 0x2c382434UL, 0x27362d39UL, 0x3a24362eUL, 0x312a3f23UL, +0x58704868UL, 0x537e4165UL, 0x4e6c5a72UL, 0x4562537fUL, 0x74486c5cUL, 0x7f466551UL, 0x62547e46UL, 0x695a774bUL, +0xb0e090d0UL, 0xbbee99ddUL, 0xa6fc82caUL, 0xadf28bc7UL, 0x9cd8b4e4UL, 0x97d6bde9UL, 0x8ac4a6feUL, 0x81caaff3UL, +0xe890d8b8UL, 0xe39ed1b5UL, 0xfe8ccaa2UL, 0xf582c3afUL, 0xc4a8fc8cUL, 0xcfa6f581UL, 0xd2b4ee96UL, 0xd9bae79bUL, +0x7bdb3bbbUL, 0x70d532b6UL, 0x6dc729a1UL, 0x66c920acUL, 0x57e31f8fUL, 0x5ced1682UL, 0x41ff0d95UL, 0x4af10498UL, +0x23ab73d3UL, 0x28a57adeUL, 0x35b761c9UL, 0x3eb968c4UL, 0x0f9357e7UL, 0x049d5eeaUL, 0x198f45fdUL, 0x12814cf0UL, +0xcb3bab6bUL, 0xc035a266UL, 0xdd27b971UL, 0xd629b07cUL, 0xe7038f5fUL, 0xec0d8652UL, 0xf11f9d45UL, 0xfa119448UL, +0x934be303UL, 0x9845ea0eUL, 0x8557f119UL, 0x8e59f814UL, 0xbf73c737UL, 0xb47dce3aUL, 0xa96fd52dUL, 0xa261dc20UL, +0xf6ad766dUL, 0xfda37f60UL, 0xe0b16477UL, 0xebbf6d7aUL, 0xda955259UL, 0xd19b5b54UL, 0xcc894043UL, 0xc787494eUL, +0xaedd3e05UL, 0xa5d33708UL, 0xb8c12c1fUL, 0xb3cf2512UL, 0x82e51a31UL, 0x89eb133cUL, 0x94f9082bUL, 0x9ff70126UL, +0x464de6bdUL, 0x4d43efb0UL, 0x5051f4a7UL, 0x5b5ffdaaUL, 0x6a75c289UL, 0x617bcb84UL, 0x7c69d093UL, 0x7767d99eUL, +0x1e3daed5UL, 0x1533a7d8UL, 0x0821bccfUL, 0x032fb5c2UL, 0x32058ae1UL, 0x390b83ecUL, 0x241998fbUL, 0x2f1791f6UL, +0x8d764dd6UL, 0x867844dbUL, 0x9b6a5fccUL, 0x906456c1UL, 0xa14e69e2UL, 0xaa4060efUL, 0xb7527bf8UL, 0xbc5c72f5UL, +0xd50605beUL, 0xde080cb3UL, 0xc31a17a4UL, 0xc8141ea9UL, 0xf93e218aUL, 0xf2302887UL, 0xef223390UL, 0xe42c3a9dUL, +0x3d96dd06UL, 0x3698d40bUL, 0x2b8acf1cUL, 0x2084c611UL, 0x11aef932UL, 0x1aa0f03fUL, 0x07b2eb28UL, 0x0cbce225UL, +0x65e6956eUL, 0x6ee89c63UL, 0x73fa8774UL, 0x78f48e79UL, 0x49deb15aUL, 0x42d0b857UL, 0x5fc2a340UL, 0x54ccaa4dUL, +0xf741ecdaUL, 0xfc4fe5d7UL, 0xe15dfec0UL, 0xea53f7cdUL, 0xdb79c8eeUL, 0xd077c1e3UL, 0xcd65daf4UL, 0xc66bd3f9UL, +0xaf31a4b2UL, 0xa43fadbfUL, 0xb92db6a8UL, 0xb223bfa5UL, 0x83098086UL, 0x8807898bUL, 0x9515929cUL, 0x9e1b9b91UL, +0x47a17c0aUL, 0x4caf7507UL, 0x51bd6e10UL, 0x5ab3671dUL, 0x6b99583eUL, 0x60975133UL, 0x7d854a24UL, 0x768b4329UL, +0x1fd13462UL, 0x14df3d6fUL, 0x09cd2678UL, 0x02c32f75UL, 0x33e91056UL, 0x38e7195bUL, 0x25f5024cUL, 0x2efb0b41UL, +0x8c9ad761UL, 0x8794de6cUL, 0x9a86c57bUL, 0x9188cc76UL, 0xa0a2f355UL, 0xabacfa58UL, 0xb6bee14fUL, 0xbdb0e842UL, +0xd4ea9f09UL, 0xdfe49604UL, 0xc2f68d13UL, 0xc9f8841eUL, 0xf8d2bb3dUL, 0xf3dcb230UL, 0xeecea927UL, 0xe5c0a02aUL, +0x3c7a47b1UL, 0x37744ebcUL, 0x2a6655abUL, 0x21685ca6UL, 0x10426385UL, 0x1b4c6a88UL, 0x065e719fUL, 0x0d507892UL, +0x640a0fd9UL, 0x6f0406d4UL, 0x72161dc3UL, 0x791814ceUL, 0x48322bedUL, 0x433c22e0UL, 0x5e2e39f7UL, 0x552030faUL, +0x01ec9ab7UL, 0x0ae293baUL, 0x17f088adUL, 0x1cfe81a0UL, 0x2dd4be83UL, 0x26dab78eUL, 0x3bc8ac99UL, 0x30c6a594UL, +0x599cd2dfUL, 0x5292dbd2UL, 0x4f80c0c5UL, 0x448ec9c8UL, 0x75a4f6ebUL, 0x7eaaffe6UL, 0x63b8e4f1UL, 0x68b6edfcUL, +0xb10c0a67UL, 0xba02036aUL, 0xa710187dUL, 0xac1e1170UL, 0x9d342e53UL, 0x963a275eUL, 0x8b283c49UL, 0x80263544UL, +0xe97c420fUL, 0xe2724b02UL, 0xff605015UL, 0xf46e5918UL, 0xc544663bUL, 0xce4a6f36UL, 0xd3587421UL, 0xd8567d2cUL, +0x7a37a10cUL, 0x7139a801UL, 0x6c2bb316UL, 0x6725ba1bUL, 0x560f8538UL, 0x5d018c35UL, 0x40139722UL, 0x4b1d9e2fUL, +0x2247e964UL, 0x2949e069UL, 0x345bfb7eUL, 0x3f55f273UL, 0x0e7fcd50UL, 0x0571c45dUL, 0x1863df4aUL, 0x136dd647UL, +0xcad731dcUL, 0xc1d938d1UL, 0xdccb23c6UL, 0xd7c52acbUL, 0xe6ef15e8UL, 0xede11ce5UL, 0xf0f307f2UL, 0xfbfd0effUL, 0x92a779b4UL, 0x99a970b9UL, 0x84bb6baeUL, 0x8fb562a3UL, 0xbe9f5d80UL, 0xb591548dUL, 0xa8834f9aUL, 0xa38d4697UL }; static const ulong32 Tks2[] = { -0x00000000UL, 0x0d0b0e09UL, 0x1a161c12UL, 0x171d121bUL, 0x342c3824UL, 0x3927362dUL, 0x2e3a2436UL, 0x23312a3fUL, -0x68587048UL, 0x65537e41UL, 0x724e6c5aUL, 0x7f456253UL, 0x5c74486cUL, 0x517f4665UL, 0x4662547eUL, 0x4b695a77UL, -0xd0b0e090UL, 0xddbbee99UL, 0xcaa6fc82UL, 0xc7adf28bUL, 0xe49cd8b4UL, 0xe997d6bdUL, 0xfe8ac4a6UL, 0xf381caafUL, -0xb8e890d8UL, 0xb5e39ed1UL, 0xa2fe8ccaUL, 0xaff582c3UL, 0x8cc4a8fcUL, 0x81cfa6f5UL, 0x96d2b4eeUL, 0x9bd9bae7UL, -0xbb7bdb3bUL, 0xb670d532UL, 0xa16dc729UL, 0xac66c920UL, 0x8f57e31fUL, 0x825ced16UL, 0x9541ff0dUL, 0x984af104UL, -0xd323ab73UL, 0xde28a57aUL, 0xc935b761UL, 0xc43eb968UL, 0xe70f9357UL, 0xea049d5eUL, 0xfd198f45UL, 0xf012814cUL, -0x6bcb3babUL, 0x66c035a2UL, 0x71dd27b9UL, 0x7cd629b0UL, 0x5fe7038fUL, 0x52ec0d86UL, 0x45f11f9dUL, 0x48fa1194UL, -0x03934be3UL, 0x0e9845eaUL, 0x198557f1UL, 0x148e59f8UL, 0x37bf73c7UL, 0x3ab47dceUL, 0x2da96fd5UL, 0x20a261dcUL, -0x6df6ad76UL, 0x60fda37fUL, 0x77e0b164UL, 0x7aebbf6dUL, 0x59da9552UL, 0x54d19b5bUL, 0x43cc8940UL, 0x4ec78749UL, -0x05aedd3eUL, 0x08a5d337UL, 0x1fb8c12cUL, 0x12b3cf25UL, 0x3182e51aUL, 0x3c89eb13UL, 0x2b94f908UL, 0x269ff701UL, -0xbd464de6UL, 0xb04d43efUL, 0xa75051f4UL, 0xaa5b5ffdUL, 0x896a75c2UL, 0x84617bcbUL, 0x937c69d0UL, 0x9e7767d9UL, -0xd51e3daeUL, 0xd81533a7UL, 0xcf0821bcUL, 0xc2032fb5UL, 0xe132058aUL, 0xec390b83UL, 0xfb241998UL, 0xf62f1791UL, -0xd68d764dUL, 0xdb867844UL, 0xcc9b6a5fUL, 0xc1906456UL, 0xe2a14e69UL, 0xefaa4060UL, 0xf8b7527bUL, 0xf5bc5c72UL, -0xbed50605UL, 0xb3de080cUL, 0xa4c31a17UL, 0xa9c8141eUL, 0x8af93e21UL, 0x87f23028UL, 0x90ef2233UL, 0x9de42c3aUL, -0x063d96ddUL, 0x0b3698d4UL, 0x1c2b8acfUL, 0x112084c6UL, 0x3211aef9UL, 0x3f1aa0f0UL, 0x2807b2ebUL, 0x250cbce2UL, -0x6e65e695UL, 0x636ee89cUL, 0x7473fa87UL, 0x7978f48eUL, 0x5a49deb1UL, 0x5742d0b8UL, 0x405fc2a3UL, 0x4d54ccaaUL, -0xdaf741ecUL, 0xd7fc4fe5UL, 0xc0e15dfeUL, 0xcdea53f7UL, 0xeedb79c8UL, 0xe3d077c1UL, 0xf4cd65daUL, 0xf9c66bd3UL, -0xb2af31a4UL, 0xbfa43fadUL, 0xa8b92db6UL, 0xa5b223bfUL, 0x86830980UL, 0x8b880789UL, 0x9c951592UL, 0x919e1b9bUL, -0x0a47a17cUL, 0x074caf75UL, 0x1051bd6eUL, 0x1d5ab367UL, 0x3e6b9958UL, 0x33609751UL, 0x247d854aUL, 0x29768b43UL, -0x621fd134UL, 0x6f14df3dUL, 0x7809cd26UL, 0x7502c32fUL, 0x5633e910UL, 0x5b38e719UL, 0x4c25f502UL, 0x412efb0bUL, -0x618c9ad7UL, 0x6c8794deUL, 0x7b9a86c5UL, 0x769188ccUL, 0x55a0a2f3UL, 0x58abacfaUL, 0x4fb6bee1UL, 0x42bdb0e8UL, -0x09d4ea9fUL, 0x04dfe496UL, 0x13c2f68dUL, 0x1ec9f884UL, 0x3df8d2bbUL, 0x30f3dcb2UL, 0x27eecea9UL, 0x2ae5c0a0UL, -0xb13c7a47UL, 0xbc37744eUL, 0xab2a6655UL, 0xa621685cUL, 0x85104263UL, 0x881b4c6aUL, 0x9f065e71UL, 0x920d5078UL, -0xd9640a0fUL, 0xd46f0406UL, 0xc372161dUL, 0xce791814UL, 0xed48322bUL, 0xe0433c22UL, 0xf75e2e39UL, 0xfa552030UL, -0xb701ec9aUL, 0xba0ae293UL, 0xad17f088UL, 0xa01cfe81UL, 0x832dd4beUL, 0x8e26dab7UL, 0x993bc8acUL, 0x9430c6a5UL, -0xdf599cd2UL, 0xd25292dbUL, 0xc54f80c0UL, 0xc8448ec9UL, 0xeb75a4f6UL, 0xe67eaaffUL, 0xf163b8e4UL, 0xfc68b6edUL, -0x67b10c0aUL, 0x6aba0203UL, 0x7da71018UL, 0x70ac1e11UL, 0x539d342eUL, 0x5e963a27UL, 0x498b283cUL, 0x44802635UL, -0x0fe97c42UL, 0x02e2724bUL, 0x15ff6050UL, 0x18f46e59UL, 0x3bc54466UL, 0x36ce4a6fUL, 0x21d35874UL, 0x2cd8567dUL, -0x0c7a37a1UL, 0x017139a8UL, 0x166c2bb3UL, 0x1b6725baUL, 0x38560f85UL, 0x355d018cUL, 0x22401397UL, 0x2f4b1d9eUL, -0x642247e9UL, 0x692949e0UL, 0x7e345bfbUL, 0x733f55f2UL, 0x500e7fcdUL, 0x5d0571c4UL, 0x4a1863dfUL, 0x47136dd6UL, -0xdccad731UL, 0xd1c1d938UL, 0xc6dccb23UL, 0xcbd7c52aUL, 0xe8e6ef15UL, 0xe5ede11cUL, 0xf2f0f307UL, 0xfffbfd0eUL, +0x00000000UL, 0x0d0b0e09UL, 0x1a161c12UL, 0x171d121bUL, 0x342c3824UL, 0x3927362dUL, 0x2e3a2436UL, 0x23312a3fUL, +0x68587048UL, 0x65537e41UL, 0x724e6c5aUL, 0x7f456253UL, 0x5c74486cUL, 0x517f4665UL, 0x4662547eUL, 0x4b695a77UL, +0xd0b0e090UL, 0xddbbee99UL, 0xcaa6fc82UL, 0xc7adf28bUL, 0xe49cd8b4UL, 0xe997d6bdUL, 0xfe8ac4a6UL, 0xf381caafUL, +0xb8e890d8UL, 0xb5e39ed1UL, 0xa2fe8ccaUL, 0xaff582c3UL, 0x8cc4a8fcUL, 0x81cfa6f5UL, 0x96d2b4eeUL, 0x9bd9bae7UL, +0xbb7bdb3bUL, 0xb670d532UL, 0xa16dc729UL, 0xac66c920UL, 0x8f57e31fUL, 0x825ced16UL, 0x9541ff0dUL, 0x984af104UL, +0xd323ab73UL, 0xde28a57aUL, 0xc935b761UL, 0xc43eb968UL, 0xe70f9357UL, 0xea049d5eUL, 0xfd198f45UL, 0xf012814cUL, +0x6bcb3babUL, 0x66c035a2UL, 0x71dd27b9UL, 0x7cd629b0UL, 0x5fe7038fUL, 0x52ec0d86UL, 0x45f11f9dUL, 0x48fa1194UL, +0x03934be3UL, 0x0e9845eaUL, 0x198557f1UL, 0x148e59f8UL, 0x37bf73c7UL, 0x3ab47dceUL, 0x2da96fd5UL, 0x20a261dcUL, +0x6df6ad76UL, 0x60fda37fUL, 0x77e0b164UL, 0x7aebbf6dUL, 0x59da9552UL, 0x54d19b5bUL, 0x43cc8940UL, 0x4ec78749UL, +0x05aedd3eUL, 0x08a5d337UL, 0x1fb8c12cUL, 0x12b3cf25UL, 0x3182e51aUL, 0x3c89eb13UL, 0x2b94f908UL, 0x269ff701UL, +0xbd464de6UL, 0xb04d43efUL, 0xa75051f4UL, 0xaa5b5ffdUL, 0x896a75c2UL, 0x84617bcbUL, 0x937c69d0UL, 0x9e7767d9UL, +0xd51e3daeUL, 0xd81533a7UL, 0xcf0821bcUL, 0xc2032fb5UL, 0xe132058aUL, 0xec390b83UL, 0xfb241998UL, 0xf62f1791UL, +0xd68d764dUL, 0xdb867844UL, 0xcc9b6a5fUL, 0xc1906456UL, 0xe2a14e69UL, 0xefaa4060UL, 0xf8b7527bUL, 0xf5bc5c72UL, +0xbed50605UL, 0xb3de080cUL, 0xa4c31a17UL, 0xa9c8141eUL, 0x8af93e21UL, 0x87f23028UL, 0x90ef2233UL, 0x9de42c3aUL, +0x063d96ddUL, 0x0b3698d4UL, 0x1c2b8acfUL, 0x112084c6UL, 0x3211aef9UL, 0x3f1aa0f0UL, 0x2807b2ebUL, 0x250cbce2UL, +0x6e65e695UL, 0x636ee89cUL, 0x7473fa87UL, 0x7978f48eUL, 0x5a49deb1UL, 0x5742d0b8UL, 0x405fc2a3UL, 0x4d54ccaaUL, +0xdaf741ecUL, 0xd7fc4fe5UL, 0xc0e15dfeUL, 0xcdea53f7UL, 0xeedb79c8UL, 0xe3d077c1UL, 0xf4cd65daUL, 0xf9c66bd3UL, +0xb2af31a4UL, 0xbfa43fadUL, 0xa8b92db6UL, 0xa5b223bfUL, 0x86830980UL, 0x8b880789UL, 0x9c951592UL, 0x919e1b9bUL, +0x0a47a17cUL, 0x074caf75UL, 0x1051bd6eUL, 0x1d5ab367UL, 0x3e6b9958UL, 0x33609751UL, 0x247d854aUL, 0x29768b43UL, +0x621fd134UL, 0x6f14df3dUL, 0x7809cd26UL, 0x7502c32fUL, 0x5633e910UL, 0x5b38e719UL, 0x4c25f502UL, 0x412efb0bUL, +0x618c9ad7UL, 0x6c8794deUL, 0x7b9a86c5UL, 0x769188ccUL, 0x55a0a2f3UL, 0x58abacfaUL, 0x4fb6bee1UL, 0x42bdb0e8UL, +0x09d4ea9fUL, 0x04dfe496UL, 0x13c2f68dUL, 0x1ec9f884UL, 0x3df8d2bbUL, 0x30f3dcb2UL, 0x27eecea9UL, 0x2ae5c0a0UL, +0xb13c7a47UL, 0xbc37744eUL, 0xab2a6655UL, 0xa621685cUL, 0x85104263UL, 0x881b4c6aUL, 0x9f065e71UL, 0x920d5078UL, +0xd9640a0fUL, 0xd46f0406UL, 0xc372161dUL, 0xce791814UL, 0xed48322bUL, 0xe0433c22UL, 0xf75e2e39UL, 0xfa552030UL, +0xb701ec9aUL, 0xba0ae293UL, 0xad17f088UL, 0xa01cfe81UL, 0x832dd4beUL, 0x8e26dab7UL, 0x993bc8acUL, 0x9430c6a5UL, +0xdf599cd2UL, 0xd25292dbUL, 0xc54f80c0UL, 0xc8448ec9UL, 0xeb75a4f6UL, 0xe67eaaffUL, 0xf163b8e4UL, 0xfc68b6edUL, +0x67b10c0aUL, 0x6aba0203UL, 0x7da71018UL, 0x70ac1e11UL, 0x539d342eUL, 0x5e963a27UL, 0x498b283cUL, 0x44802635UL, +0x0fe97c42UL, 0x02e2724bUL, 0x15ff6050UL, 0x18f46e59UL, 0x3bc54466UL, 0x36ce4a6fUL, 0x21d35874UL, 0x2cd8567dUL, +0x0c7a37a1UL, 0x017139a8UL, 0x166c2bb3UL, 0x1b6725baUL, 0x38560f85UL, 0x355d018cUL, 0x22401397UL, 0x2f4b1d9eUL, +0x642247e9UL, 0x692949e0UL, 0x7e345bfbUL, 0x733f55f2UL, 0x500e7fcdUL, 0x5d0571c4UL, 0x4a1863dfUL, 0x47136dd6UL, +0xdccad731UL, 0xd1c1d938UL, 0xc6dccb23UL, 0xcbd7c52aUL, 0xe8e6ef15UL, 0xe5ede11cUL, 0xf2f0f307UL, 0xfffbfd0eUL, 0xb492a779UL, 0xb999a970UL, 0xae84bb6bUL, 0xa38fb562UL, 0x80be9f5dUL, 0x8db59154UL, 0x9aa8834fUL, 0x97a38d46UL }; static const ulong32 Tks3[] = { -0x00000000UL, 0x090d0b0eUL, 0x121a161cUL, 0x1b171d12UL, 0x24342c38UL, 0x2d392736UL, 0x362e3a24UL, 0x3f23312aUL, -0x48685870UL, 0x4165537eUL, 0x5a724e6cUL, 0x537f4562UL, 0x6c5c7448UL, 0x65517f46UL, 0x7e466254UL, 0x774b695aUL, -0x90d0b0e0UL, 0x99ddbbeeUL, 0x82caa6fcUL, 0x8bc7adf2UL, 0xb4e49cd8UL, 0xbde997d6UL, 0xa6fe8ac4UL, 0xaff381caUL, -0xd8b8e890UL, 0xd1b5e39eUL, 0xcaa2fe8cUL, 0xc3aff582UL, 0xfc8cc4a8UL, 0xf581cfa6UL, 0xee96d2b4UL, 0xe79bd9baUL, -0x3bbb7bdbUL, 0x32b670d5UL, 0x29a16dc7UL, 0x20ac66c9UL, 0x1f8f57e3UL, 0x16825cedUL, 0x0d9541ffUL, 0x04984af1UL, -0x73d323abUL, 0x7ade28a5UL, 0x61c935b7UL, 0x68c43eb9UL, 0x57e70f93UL, 0x5eea049dUL, 0x45fd198fUL, 0x4cf01281UL, -0xab6bcb3bUL, 0xa266c035UL, 0xb971dd27UL, 0xb07cd629UL, 0x8f5fe703UL, 0x8652ec0dUL, 0x9d45f11fUL, 0x9448fa11UL, -0xe303934bUL, 0xea0e9845UL, 0xf1198557UL, 0xf8148e59UL, 0xc737bf73UL, 0xce3ab47dUL, 0xd52da96fUL, 0xdc20a261UL, -0x766df6adUL, 0x7f60fda3UL, 0x6477e0b1UL, 0x6d7aebbfUL, 0x5259da95UL, 0x5b54d19bUL, 0x4043cc89UL, 0x494ec787UL, -0x3e05aeddUL, 0x3708a5d3UL, 0x2c1fb8c1UL, 0x2512b3cfUL, 0x1a3182e5UL, 0x133c89ebUL, 0x082b94f9UL, 0x01269ff7UL, -0xe6bd464dUL, 0xefb04d43UL, 0xf4a75051UL, 0xfdaa5b5fUL, 0xc2896a75UL, 0xcb84617bUL, 0xd0937c69UL, 0xd99e7767UL, -0xaed51e3dUL, 0xa7d81533UL, 0xbccf0821UL, 0xb5c2032fUL, 0x8ae13205UL, 0x83ec390bUL, 0x98fb2419UL, 0x91f62f17UL, -0x4dd68d76UL, 0x44db8678UL, 0x5fcc9b6aUL, 0x56c19064UL, 0x69e2a14eUL, 0x60efaa40UL, 0x7bf8b752UL, 0x72f5bc5cUL, -0x05bed506UL, 0x0cb3de08UL, 0x17a4c31aUL, 0x1ea9c814UL, 0x218af93eUL, 0x2887f230UL, 0x3390ef22UL, 0x3a9de42cUL, -0xdd063d96UL, 0xd40b3698UL, 0xcf1c2b8aUL, 0xc6112084UL, 0xf93211aeUL, 0xf03f1aa0UL, 0xeb2807b2UL, 0xe2250cbcUL, -0x956e65e6UL, 0x9c636ee8UL, 0x877473faUL, 0x8e7978f4UL, 0xb15a49deUL, 0xb85742d0UL, 0xa3405fc2UL, 0xaa4d54ccUL, -0xecdaf741UL, 0xe5d7fc4fUL, 0xfec0e15dUL, 0xf7cdea53UL, 0xc8eedb79UL, 0xc1e3d077UL, 0xdaf4cd65UL, 0xd3f9c66bUL, -0xa4b2af31UL, 0xadbfa43fUL, 0xb6a8b92dUL, 0xbfa5b223UL, 0x80868309UL, 0x898b8807UL, 0x929c9515UL, 0x9b919e1bUL, -0x7c0a47a1UL, 0x75074cafUL, 0x6e1051bdUL, 0x671d5ab3UL, 0x583e6b99UL, 0x51336097UL, 0x4a247d85UL, 0x4329768bUL, -0x34621fd1UL, 0x3d6f14dfUL, 0x267809cdUL, 0x2f7502c3UL, 0x105633e9UL, 0x195b38e7UL, 0x024c25f5UL, 0x0b412efbUL, -0xd7618c9aUL, 0xde6c8794UL, 0xc57b9a86UL, 0xcc769188UL, 0xf355a0a2UL, 0xfa58abacUL, 0xe14fb6beUL, 0xe842bdb0UL, -0x9f09d4eaUL, 0x9604dfe4UL, 0x8d13c2f6UL, 0x841ec9f8UL, 0xbb3df8d2UL, 0xb230f3dcUL, 0xa927eeceUL, 0xa02ae5c0UL, -0x47b13c7aUL, 0x4ebc3774UL, 0x55ab2a66UL, 0x5ca62168UL, 0x63851042UL, 0x6a881b4cUL, 0x719f065eUL, 0x78920d50UL, -0x0fd9640aUL, 0x06d46f04UL, 0x1dc37216UL, 0x14ce7918UL, 0x2bed4832UL, 0x22e0433cUL, 0x39f75e2eUL, 0x30fa5520UL, -0x9ab701ecUL, 0x93ba0ae2UL, 0x88ad17f0UL, 0x81a01cfeUL, 0xbe832dd4UL, 0xb78e26daUL, 0xac993bc8UL, 0xa59430c6UL, -0xd2df599cUL, 0xdbd25292UL, 0xc0c54f80UL, 0xc9c8448eUL, 0xf6eb75a4UL, 0xffe67eaaUL, 0xe4f163b8UL, 0xedfc68b6UL, -0x0a67b10cUL, 0x036aba02UL, 0x187da710UL, 0x1170ac1eUL, 0x2e539d34UL, 0x275e963aUL, 0x3c498b28UL, 0x35448026UL, -0x420fe97cUL, 0x4b02e272UL, 0x5015ff60UL, 0x5918f46eUL, 0x663bc544UL, 0x6f36ce4aUL, 0x7421d358UL, 0x7d2cd856UL, -0xa10c7a37UL, 0xa8017139UL, 0xb3166c2bUL, 0xba1b6725UL, 0x8538560fUL, 0x8c355d01UL, 0x97224013UL, 0x9e2f4b1dUL, -0xe9642247UL, 0xe0692949UL, 0xfb7e345bUL, 0xf2733f55UL, 0xcd500e7fUL, 0xc45d0571UL, 0xdf4a1863UL, 0xd647136dUL, -0x31dccad7UL, 0x38d1c1d9UL, 0x23c6dccbUL, 0x2acbd7c5UL, 0x15e8e6efUL, 0x1ce5ede1UL, 0x07f2f0f3UL, 0x0efffbfdUL, +0x00000000UL, 0x090d0b0eUL, 0x121a161cUL, 0x1b171d12UL, 0x24342c38UL, 0x2d392736UL, 0x362e3a24UL, 0x3f23312aUL, +0x48685870UL, 0x4165537eUL, 0x5a724e6cUL, 0x537f4562UL, 0x6c5c7448UL, 0x65517f46UL, 0x7e466254UL, 0x774b695aUL, +0x90d0b0e0UL, 0x99ddbbeeUL, 0x82caa6fcUL, 0x8bc7adf2UL, 0xb4e49cd8UL, 0xbde997d6UL, 0xa6fe8ac4UL, 0xaff381caUL, +0xd8b8e890UL, 0xd1b5e39eUL, 0xcaa2fe8cUL, 0xc3aff582UL, 0xfc8cc4a8UL, 0xf581cfa6UL, 0xee96d2b4UL, 0xe79bd9baUL, +0x3bbb7bdbUL, 0x32b670d5UL, 0x29a16dc7UL, 0x20ac66c9UL, 0x1f8f57e3UL, 0x16825cedUL, 0x0d9541ffUL, 0x04984af1UL, +0x73d323abUL, 0x7ade28a5UL, 0x61c935b7UL, 0x68c43eb9UL, 0x57e70f93UL, 0x5eea049dUL, 0x45fd198fUL, 0x4cf01281UL, +0xab6bcb3bUL, 0xa266c035UL, 0xb971dd27UL, 0xb07cd629UL, 0x8f5fe703UL, 0x8652ec0dUL, 0x9d45f11fUL, 0x9448fa11UL, +0xe303934bUL, 0xea0e9845UL, 0xf1198557UL, 0xf8148e59UL, 0xc737bf73UL, 0xce3ab47dUL, 0xd52da96fUL, 0xdc20a261UL, +0x766df6adUL, 0x7f60fda3UL, 0x6477e0b1UL, 0x6d7aebbfUL, 0x5259da95UL, 0x5b54d19bUL, 0x4043cc89UL, 0x494ec787UL, +0x3e05aeddUL, 0x3708a5d3UL, 0x2c1fb8c1UL, 0x2512b3cfUL, 0x1a3182e5UL, 0x133c89ebUL, 0x082b94f9UL, 0x01269ff7UL, +0xe6bd464dUL, 0xefb04d43UL, 0xf4a75051UL, 0xfdaa5b5fUL, 0xc2896a75UL, 0xcb84617bUL, 0xd0937c69UL, 0xd99e7767UL, +0xaed51e3dUL, 0xa7d81533UL, 0xbccf0821UL, 0xb5c2032fUL, 0x8ae13205UL, 0x83ec390bUL, 0x98fb2419UL, 0x91f62f17UL, +0x4dd68d76UL, 0x44db8678UL, 0x5fcc9b6aUL, 0x56c19064UL, 0x69e2a14eUL, 0x60efaa40UL, 0x7bf8b752UL, 0x72f5bc5cUL, +0x05bed506UL, 0x0cb3de08UL, 0x17a4c31aUL, 0x1ea9c814UL, 0x218af93eUL, 0x2887f230UL, 0x3390ef22UL, 0x3a9de42cUL, +0xdd063d96UL, 0xd40b3698UL, 0xcf1c2b8aUL, 0xc6112084UL, 0xf93211aeUL, 0xf03f1aa0UL, 0xeb2807b2UL, 0xe2250cbcUL, +0x956e65e6UL, 0x9c636ee8UL, 0x877473faUL, 0x8e7978f4UL, 0xb15a49deUL, 0xb85742d0UL, 0xa3405fc2UL, 0xaa4d54ccUL, +0xecdaf741UL, 0xe5d7fc4fUL, 0xfec0e15dUL, 0xf7cdea53UL, 0xc8eedb79UL, 0xc1e3d077UL, 0xdaf4cd65UL, 0xd3f9c66bUL, +0xa4b2af31UL, 0xadbfa43fUL, 0xb6a8b92dUL, 0xbfa5b223UL, 0x80868309UL, 0x898b8807UL, 0x929c9515UL, 0x9b919e1bUL, +0x7c0a47a1UL, 0x75074cafUL, 0x6e1051bdUL, 0x671d5ab3UL, 0x583e6b99UL, 0x51336097UL, 0x4a247d85UL, 0x4329768bUL, +0x34621fd1UL, 0x3d6f14dfUL, 0x267809cdUL, 0x2f7502c3UL, 0x105633e9UL, 0x195b38e7UL, 0x024c25f5UL, 0x0b412efbUL, +0xd7618c9aUL, 0xde6c8794UL, 0xc57b9a86UL, 0xcc769188UL, 0xf355a0a2UL, 0xfa58abacUL, 0xe14fb6beUL, 0xe842bdb0UL, +0x9f09d4eaUL, 0x9604dfe4UL, 0x8d13c2f6UL, 0x841ec9f8UL, 0xbb3df8d2UL, 0xb230f3dcUL, 0xa927eeceUL, 0xa02ae5c0UL, +0x47b13c7aUL, 0x4ebc3774UL, 0x55ab2a66UL, 0x5ca62168UL, 0x63851042UL, 0x6a881b4cUL, 0x719f065eUL, 0x78920d50UL, +0x0fd9640aUL, 0x06d46f04UL, 0x1dc37216UL, 0x14ce7918UL, 0x2bed4832UL, 0x22e0433cUL, 0x39f75e2eUL, 0x30fa5520UL, +0x9ab701ecUL, 0x93ba0ae2UL, 0x88ad17f0UL, 0x81a01cfeUL, 0xbe832dd4UL, 0xb78e26daUL, 0xac993bc8UL, 0xa59430c6UL, +0xd2df599cUL, 0xdbd25292UL, 0xc0c54f80UL, 0xc9c8448eUL, 0xf6eb75a4UL, 0xffe67eaaUL, 0xe4f163b8UL, 0xedfc68b6UL, +0x0a67b10cUL, 0x036aba02UL, 0x187da710UL, 0x1170ac1eUL, 0x2e539d34UL, 0x275e963aUL, 0x3c498b28UL, 0x35448026UL, +0x420fe97cUL, 0x4b02e272UL, 0x5015ff60UL, 0x5918f46eUL, 0x663bc544UL, 0x6f36ce4aUL, 0x7421d358UL, 0x7d2cd856UL, +0xa10c7a37UL, 0xa8017139UL, 0xb3166c2bUL, 0xba1b6725UL, 0x8538560fUL, 0x8c355d01UL, 0x97224013UL, 0x9e2f4b1dUL, +0xe9642247UL, 0xe0692949UL, 0xfb7e345bUL, 0xf2733f55UL, 0xcd500e7fUL, 0xc45d0571UL, 0xdf4a1863UL, 0xd647136dUL, +0x31dccad7UL, 0x38d1c1d9UL, 0x23c6dccbUL, 0x2acbd7c5UL, 0x15e8e6efUL, 0x1ce5ede1UL, 0x07f2f0f3UL, 0x0efffbfdUL, 0x79b492a7UL, 0x70b999a9UL, 0x6bae84bbUL, 0x62a38fb5UL, 0x5d80be9fUL, 0x548db591UL, 0x4f9aa883UL, 0x4697a38dUL }; @@ -1023,6 +1023,8 @@ static const ulong32 rcon[] = { 0x1B000000UL, 0x36000000UL, /* for 128-bit blocks, Rijndael never uses more than 10 rcon values */ }; -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +#endif /* __LTC_AES_TAB_C__ */ + +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/ciphers/anubis.c b/libtomcrypt/src/ciphers/anubis.c index 229d5e8..a28c7e1 100644 --- a/libtomcrypt/src/ciphers/anubis.c +++ b/libtomcrypt/src/ciphers/anubis.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /** @@ -29,17 +27,17 @@ const struct ltc_cipher_descriptor anubis_desc = { &anubis_test, &anubis_done, &anubis_keysize, - NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL + NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL }; -#define MIN_N 4 -#define MAX_N 10 -#define MIN_ROUNDS (8 + MIN_N) -#define MAX_ROUNDS (8 + MAX_N) -#define MIN_KEYSIZEB (4*MIN_N) -#define MAX_KEYSIZEB (4*MAX_N) -#define BLOCKSIZE 128 -#define BLOCKSIZEB (BLOCKSIZE/8) +#define MIN_N 4 +#define MAX_N 10 +#define MIN_ROUNDS (8 + MIN_N) +#define MAX_ROUNDS (8 + MAX_N) +#define MIN_KEYSIZEB (4*MIN_N) +#define MAX_KEYSIZEB (4*MAX_N) +#define BLOCKSIZE 128 +#define BLOCKSIZEB (BLOCKSIZE/8) /* @@ -899,7 +897,7 @@ int anubis_setup(const unsigned char *key, int keylen, int num_rounds, symmetri { int N, R, i, pos, r; ulong32 kappa[MAX_N]; - ulong32 inter[MAX_N]; + ulong32 inter[MAX_N] = { 0 }; /* initialize as all zeroes */ ulong32 v, K0, K1, K2, K3; LTC_ARGCHK(key != NULL); @@ -926,16 +924,16 @@ int anubis_setup(const unsigned char *key, int keylen, int num_rounds, symmetri return CRYPT_INVALID_ROUNDS; } - /* - * map cipher key to initial key state (mu): - */ - for (i = 0, pos = 0; i < N; i++, pos += 4) { + /* + * map cipher key to initial key state (mu): + */ + for (i = 0, pos = 0; i < N; i++, pos += 4) { kappa[i] = - (key[pos ] << 24) ^ - (key[pos + 1] << 16) ^ - (key[pos + 2] << 8) ^ - (key[pos + 3] ); - } + (((ulong32)key[pos ]) << 24) ^ + (((ulong32)key[pos + 1]) << 16) ^ + (((ulong32)key[pos + 2]) << 8) ^ + (((ulong32)key[pos + 3]) ); + } /* * generate R + 1 round keys: @@ -1034,7 +1032,7 @@ int anubis_setup(const unsigned char *key, int keylen, int num_rounds, symmetri return err; } #endif - + static void anubis_crypt(const unsigned char *plaintext, unsigned char *ciphertext, ulong32 roundKey[18 + 1][4], int R) { @@ -1048,10 +1046,10 @@ static void anubis_crypt(const unsigned char *plaintext, unsigned char *cipherte */ for (i = 0, pos = 0; i < 4; i++, pos += 4) { state[i] = - (plaintext[pos ] << 24) ^ - (plaintext[pos + 1] << 16) ^ - (plaintext[pos + 2] << 8) ^ - (plaintext[pos + 3] ) ^ + (((ulong32)plaintext[pos ]) << 24) ^ + (((ulong32)plaintext[pos + 1]) << 16) ^ + (((ulong32)plaintext[pos + 2]) << 8) ^ + (((ulong32)plaintext[pos + 3]) ) ^ roundKey[0][i]; } @@ -1149,7 +1147,7 @@ int anubis_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key Decrypts a block of text with Anubis @param ct The input ciphertext (16 bytes) @param pt The output plaintext (16 bytes) - @param skey The key as scheduled + @param skey The key as scheduled @return CRYPT_OK if successful */ int anubis_ecb_decrypt(const unsigned char *ct, unsigned char *pt, symmetric_key *skey) @@ -1181,7 +1179,7 @@ int anubis_test(void) 16, { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, - { 0xF0, 0x68, 0x60, 0xFC, 0x67, 0x30, 0xE8, 0x18, + { 0xF0, 0x68, 0x60, 0xFC, 0x67, 0x30, 0xE8, 0x18, 0xF1, 0x32, 0xC7, 0x8A, 0xF4, 0x13, 0x2A, 0xFE }, { 0x80, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 } @@ -1189,7 +1187,7 @@ int anubis_test(void) 16, { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, - { 0xA8, 0x66, 0x84, 0x80, 0x07, 0x74, 0x5C, 0x89, + { 0xA8, 0x66, 0x84, 0x80, 0x07, 0x74, 0x5C, 0x89, 0xFC, 0x5E, 0xB5, 0xBA, 0xD4, 0xFE, 0x32, 0x6D }, { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x01 } @@ -1221,7 +1219,7 @@ int anubis_test(void) 24, { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, - { 0x17, 0xAC, 0x57, 0x44, 0x9D, 0x59, 0x61, 0x66, + { 0x17, 0xAC, 0x57, 0x44, 0x9D, 0x59, 0x61, 0x66, 0xD0, 0xC7, 0x9E, 0x04, 0x7C, 0xC7, 0x58, 0xF0 }, { 0x80, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, @@ -1230,7 +1228,7 @@ int anubis_test(void) 24, { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, - { 0x71, 0x52, 0xB4, 0xEB, 0x1D, 0xAA, 0x36, 0xFD, + { 0x71, 0x52, 0xB4, 0xEB, 0x1D, 0xAA, 0x36, 0xFD, 0x57, 0x14, 0x5F, 0x57, 0x04, 0x9F, 0x70, 0x74 }, { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, @@ -1242,7 +1240,7 @@ int anubis_test(void) 28, { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, - { 0xA2, 0xF0, 0xA6, 0xB9, 0x17, 0x93, 0x2A, 0x3B, + { 0xA2, 0xF0, 0xA6, 0xB9, 0x17, 0x93, 0x2A, 0x3B, 0xEF, 0x08, 0xE8, 0x7A, 0x58, 0xD6, 0xF8, 0x53 }, { 0x80, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, @@ -1252,7 +1250,7 @@ int anubis_test(void) 28, { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, - { 0xF0, 0xCA, 0xFC, 0x78, 0x8B, 0x4B, 0x4E, 0x53, + { 0xF0, 0xCA, 0xFC, 0x78, 0x8B, 0x4B, 0x4E, 0x53, 0x8B, 0xC4, 0x32, 0x6A, 0xF5, 0xB9, 0x1B, 0x5F }, { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, @@ -1265,7 +1263,7 @@ int anubis_test(void) 32, { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, - { 0xE0, 0x86, 0xAC, 0x45, 0x6B, 0x3C, 0xE5, 0x13, + { 0xE0, 0x86, 0xAC, 0x45, 0x6B, 0x3C, 0xE5, 0x13, 0xED, 0xF5, 0xDF, 0xDD, 0xD6, 0x3B, 0x71, 0x93 }, { 0x80, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, @@ -1275,7 +1273,7 @@ int anubis_test(void) 32, { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, - { 0x50, 0x01, 0xB9, 0xF5, 0x21, 0xC1, 0xC1, 0x29, + { 0x50, 0x01, 0xB9, 0xF5, 0x21, 0xC1, 0xC1, 0x29, 0x00, 0xD5, 0xEC, 0x98, 0x2B, 0x9E, 0xE8, 0x21 }, { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, @@ -1288,7 +1286,7 @@ int anubis_test(void) 36, { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, - { 0xE8, 0xF4, 0xAF, 0x2B, 0x21, 0xA0, 0x87, 0x9B, + { 0xE8, 0xF4, 0xAF, 0x2B, 0x21, 0xA0, 0x87, 0x9B, 0x41, 0x95, 0xB9, 0x71, 0x75, 0x79, 0x04, 0x7C }, { 0x80, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, @@ -1299,7 +1297,7 @@ int anubis_test(void) 36, { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, - { 0xE6, 0xA6, 0xA5, 0xBC, 0x8B, 0x63, 0x6F, 0xE2, + { 0xE6, 0xA6, 0xA5, 0xBC, 0x8B, 0x63, 0x6F, 0xE2, 0xBD, 0xA7, 0xA7, 0x53, 0xAB, 0x40, 0x22, 0xE0 }, { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, @@ -1313,7 +1311,7 @@ int anubis_test(void) 40, { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, - { 0x17, 0x04, 0xD7, 0x2C, 0xC6, 0x85, 0x76, 0x02, + { 0x17, 0x04, 0xD7, 0x2C, 0xC6, 0x85, 0x76, 0x02, 0x4B, 0xCC, 0x39, 0x80, 0xD8, 0x22, 0xEA, 0xA4 }, { 0x80, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, @@ -1324,7 +1322,7 @@ int anubis_test(void) 40, { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, - { 0x7A, 0x41, 0xE6, 0x7D, 0x4F, 0xD8, 0x64, 0xF0, + { 0x7A, 0x41, 0xE6, 0x7D, 0x4F, 0xD8, 0x64, 0xF0, 0x44, 0xA8, 0x3C, 0x73, 0x81, 0x7E, 0x53, 0xD8 }, { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, @@ -1500,13 +1498,14 @@ int anubis_test(void) anubis_setup(tests[x].key, tests[x].keylen, 0, &skey); anubis_ecb_encrypt(tests[x].pt, buf[0], &skey); anubis_ecb_decrypt(buf[0], buf[1], &skey); - if (XMEMCMP(buf[0], tests[x].ct, 16) || XMEMCMP(buf[1], tests[x].pt, 16)) { + if (compare_testvector(buf[0], 16, tests[x].ct, 16, "Anubis Encrypt", x) || + compare_testvector(buf[1], 16, tests[x].pt, 16, "Anubis Decrypt", x)) { return CRYPT_FAIL_TESTVECTOR; } for (y = 0; y < 1000; y++) anubis_ecb_encrypt(buf[0], buf[0], &skey); for (y = 0; y < 1000; y++) anubis_ecb_decrypt(buf[0], buf[0], &skey); - if (XMEMCMP(buf[0], tests[x].ct, 16)) { + if (compare_testvector(buf[0], 16, tests[x].ct, 16, "Anubis 1000", 1000)) { return CRYPT_FAIL_TESTVECTOR; } @@ -1515,11 +1514,12 @@ int anubis_test(void) #endif } -/** Terminate the context +/** Terminate the context @param skey The scheduled key */ void anubis_done(symmetric_key *skey) { + LTC_UNUSED_PARAM(skey); } /** @@ -1553,6 +1553,6 @@ int anubis_keysize(int *keysize) #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/ciphers/blowfish.c b/libtomcrypt/src/ciphers/blowfish.c index 6a55abc..a1945ae 100644 --- a/libtomcrypt/src/ciphers/blowfish.c +++ b/libtomcrypt/src/ciphers/blowfish.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /** @file blowfish.c @@ -27,7 +25,7 @@ const struct ltc_cipher_descriptor blowfish_desc = &blowfish_test, &blowfish_done, &blowfish_keysize, - NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL + NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL }; static const ulong32 ORIG_P[16 + 2] = { @@ -322,15 +320,15 @@ int blowfish_setup(const unsigned char *key, int keylen, int num_rounds, /* check rounds */ if (num_rounds != 0 && num_rounds != 16) { return CRYPT_INVALID_ROUNDS; - } + } /* load in key bytes (Supplied by David Hopwood) */ for (x = y = 0; x < 18; x++) { A = 0; for (z = 0; z < 4; z++) { A = (A << 8) | ((ulong32)key[y++] & 255); - if (y == (ulong32)keylen) { - y = 0; + if (y == (ulong32)keylen) { + y = 0; } } skey->blowfish.K[x] = ORIG_P[x] ^ A; @@ -347,7 +345,7 @@ int blowfish_setup(const unsigned char *key, int keylen, int num_rounds, for (x = 0; x < 8; x++) { B[x] = 0; } - + for (x = 0; x < 18; x += 2) { /* encrypt it */ blowfish_ecb_encrypt(B, B, skey); @@ -446,7 +444,7 @@ int blowfish_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_k Decrypts a block of text with Blowfish @param ct The input ciphertext (8 bytes) @param pt The output plaintext (8 bytes) - @param skey The key as scheduled + @param skey The key as scheduled @return CRYPT_OK if successful */ #ifdef LTC_CLEAN_STACK @@ -464,7 +462,7 @@ int blowfish_ecb_decrypt(const unsigned char *ct, unsigned char *pt, symmetric_k LTC_ARGCHK(pt != NULL); LTC_ARGCHK(ct != NULL); LTC_ARGCHK(skey != NULL); - + #ifndef __GNUC__ S1 = skey->blowfish.S[0]; S2 = skey->blowfish.S[1]; @@ -512,7 +510,7 @@ int blowfish_test(void) { #ifndef LTC_TEST return CRYPT_NOP; - #else + #else int err; symmetric_key key; static const struct { @@ -548,7 +546,8 @@ int blowfish_test(void) blowfish_ecb_decrypt(tmp[0], tmp[1], &key); /* compare */ - if ((XMEMCMP(tmp[0], tests[x].ct, 8) != 0) || (XMEMCMP(tmp[1], tests[x].pt, 8) != 0)) { + if ((compare_testvector(tmp[0], 8, tests[x].ct, 8, "Blowfish Encrypt", x) != 0) || + (compare_testvector(tmp[1], 8, tests[x].pt, 8, "Blowfish Decrypt", x) != 0)) { return CRYPT_FAIL_TESTVECTOR; } @@ -562,11 +561,12 @@ int blowfish_test(void) #endif } -/** Terminate the context +/** Terminate the context @param skey The scheduled key */ void blowfish_done(symmetric_key *skey) { + LTC_UNUSED_PARAM(skey); } /** @@ -589,6 +589,6 @@ int blowfish_keysize(int *keysize) #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/ciphers/camellia.c b/libtomcrypt/src/ciphers/camellia.c new file mode 100644 index 0000000..0a75087 --- /dev/null +++ b/libtomcrypt/src/ciphers/camellia.c @@ -0,0 +1,726 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + */ + +/** + @file camellia.c + Implementation by Tom St Denis of Elliptic Semiconductor +*/ + +#include "tomcrypt.h" + +#ifdef LTC_CAMELLIA + +const struct ltc_cipher_descriptor camellia_desc = { + "camellia", + 23, + 16, 32, 16, 18, + &camellia_setup, + &camellia_ecb_encrypt, + &camellia_ecb_decrypt, + &camellia_test, + &camellia_done, + &camellia_keysize, + NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL +}; + +static const ulong32 SP1110[] = { +0x70707000, 0x82828200, 0x2c2c2c00, 0xececec00, 0xb3b3b300, 0x27272700, 0xc0c0c000, 0xe5e5e500, +0xe4e4e400, 0x85858500, 0x57575700, 0x35353500, 0xeaeaea00, 0x0c0c0c00, 0xaeaeae00, 0x41414100, +0x23232300, 0xefefef00, 0x6b6b6b00, 0x93939300, 0x45454500, 0x19191900, 0xa5a5a500, 0x21212100, +0xededed00, 0x0e0e0e00, 0x4f4f4f00, 0x4e4e4e00, 0x1d1d1d00, 0x65656500, 0x92929200, 0xbdbdbd00, +0x86868600, 0xb8b8b800, 0xafafaf00, 0x8f8f8f00, 0x7c7c7c00, 0xebebeb00, 0x1f1f1f00, 0xcecece00, +0x3e3e3e00, 0x30303000, 0xdcdcdc00, 0x5f5f5f00, 0x5e5e5e00, 0xc5c5c500, 0x0b0b0b00, 0x1a1a1a00, +0xa6a6a600, 0xe1e1e100, 0x39393900, 0xcacaca00, 0xd5d5d500, 0x47474700, 0x5d5d5d00, 0x3d3d3d00, +0xd9d9d900, 0x01010100, 0x5a5a5a00, 0xd6d6d600, 0x51515100, 0x56565600, 0x6c6c6c00, 0x4d4d4d00, +0x8b8b8b00, 0x0d0d0d00, 0x9a9a9a00, 0x66666600, 0xfbfbfb00, 0xcccccc00, 0xb0b0b000, 0x2d2d2d00, +0x74747400, 0x12121200, 0x2b2b2b00, 0x20202000, 0xf0f0f000, 0xb1b1b100, 0x84848400, 0x99999900, +0xdfdfdf00, 0x4c4c4c00, 0xcbcbcb00, 0xc2c2c200, 0x34343400, 0x7e7e7e00, 0x76767600, 0x05050500, +0x6d6d6d00, 0xb7b7b700, 0xa9a9a900, 0x31313100, 0xd1d1d100, 0x17171700, 0x04040400, 0xd7d7d700, +0x14141400, 0x58585800, 0x3a3a3a00, 0x61616100, 0xdedede00, 0x1b1b1b00, 0x11111100, 0x1c1c1c00, +0x32323200, 0x0f0f0f00, 0x9c9c9c00, 0x16161600, 0x53535300, 0x18181800, 0xf2f2f200, 0x22222200, +0xfefefe00, 0x44444400, 0xcfcfcf00, 0xb2b2b200, 0xc3c3c300, 0xb5b5b500, 0x7a7a7a00, 0x91919100, +0x24242400, 0x08080800, 0xe8e8e800, 0xa8a8a800, 0x60606000, 0xfcfcfc00, 0x69696900, 0x50505000, +0xaaaaaa00, 0xd0d0d000, 0xa0a0a000, 0x7d7d7d00, 0xa1a1a100, 0x89898900, 0x62626200, 0x97979700, +0x54545400, 0x5b5b5b00, 0x1e1e1e00, 0x95959500, 0xe0e0e000, 0xffffff00, 0x64646400, 0xd2d2d200, +0x10101000, 0xc4c4c400, 0x00000000, 0x48484800, 0xa3a3a300, 0xf7f7f700, 0x75757500, 0xdbdbdb00, +0x8a8a8a00, 0x03030300, 0xe6e6e600, 0xdadada00, 0x09090900, 0x3f3f3f00, 0xdddddd00, 0x94949400, +0x87878700, 0x5c5c5c00, 0x83838300, 0x02020200, 0xcdcdcd00, 0x4a4a4a00, 0x90909000, 0x33333300, +0x73737300, 0x67676700, 0xf6f6f600, 0xf3f3f300, 0x9d9d9d00, 0x7f7f7f00, 0xbfbfbf00, 0xe2e2e200, +0x52525200, 0x9b9b9b00, 0xd8d8d800, 0x26262600, 0xc8c8c800, 0x37373700, 0xc6c6c600, 0x3b3b3b00, +0x81818100, 0x96969600, 0x6f6f6f00, 0x4b4b4b00, 0x13131300, 0xbebebe00, 0x63636300, 0x2e2e2e00, +0xe9e9e900, 0x79797900, 0xa7a7a700, 0x8c8c8c00, 0x9f9f9f00, 0x6e6e6e00, 0xbcbcbc00, 0x8e8e8e00, +0x29292900, 0xf5f5f500, 0xf9f9f900, 0xb6b6b600, 0x2f2f2f00, 0xfdfdfd00, 0xb4b4b400, 0x59595900, +0x78787800, 0x98989800, 0x06060600, 0x6a6a6a00, 0xe7e7e700, 0x46464600, 0x71717100, 0xbababa00, +0xd4d4d400, 0x25252500, 0xababab00, 0x42424200, 0x88888800, 0xa2a2a200, 0x8d8d8d00, 0xfafafa00, +0x72727200, 0x07070700, 0xb9b9b900, 0x55555500, 0xf8f8f800, 0xeeeeee00, 0xacacac00, 0x0a0a0a00, +0x36363600, 0x49494900, 0x2a2a2a00, 0x68686800, 0x3c3c3c00, 0x38383800, 0xf1f1f100, 0xa4a4a400, +0x40404000, 0x28282800, 0xd3d3d300, 0x7b7b7b00, 0xbbbbbb00, 0xc9c9c900, 0x43434300, 0xc1c1c100, +0x15151500, 0xe3e3e300, 0xadadad00, 0xf4f4f400, 0x77777700, 0xc7c7c700, 0x80808000, 0x9e9e9e00, +}; + +static const ulong32 SP0222[] = { +0x00e0e0e0, 0x00050505, 0x00585858, 0x00d9d9d9, 0x00676767, 0x004e4e4e, 0x00818181, 0x00cbcbcb, +0x00c9c9c9, 0x000b0b0b, 0x00aeaeae, 0x006a6a6a, 0x00d5d5d5, 0x00181818, 0x005d5d5d, 0x00828282, +0x00464646, 0x00dfdfdf, 0x00d6d6d6, 0x00272727, 0x008a8a8a, 0x00323232, 0x004b4b4b, 0x00424242, +0x00dbdbdb, 0x001c1c1c, 0x009e9e9e, 0x009c9c9c, 0x003a3a3a, 0x00cacaca, 0x00252525, 0x007b7b7b, +0x000d0d0d, 0x00717171, 0x005f5f5f, 0x001f1f1f, 0x00f8f8f8, 0x00d7d7d7, 0x003e3e3e, 0x009d9d9d, +0x007c7c7c, 0x00606060, 0x00b9b9b9, 0x00bebebe, 0x00bcbcbc, 0x008b8b8b, 0x00161616, 0x00343434, +0x004d4d4d, 0x00c3c3c3, 0x00727272, 0x00959595, 0x00ababab, 0x008e8e8e, 0x00bababa, 0x007a7a7a, +0x00b3b3b3, 0x00020202, 0x00b4b4b4, 0x00adadad, 0x00a2a2a2, 0x00acacac, 0x00d8d8d8, 0x009a9a9a, +0x00171717, 0x001a1a1a, 0x00353535, 0x00cccccc, 0x00f7f7f7, 0x00999999, 0x00616161, 0x005a5a5a, +0x00e8e8e8, 0x00242424, 0x00565656, 0x00404040, 0x00e1e1e1, 0x00636363, 0x00090909, 0x00333333, +0x00bfbfbf, 0x00989898, 0x00979797, 0x00858585, 0x00686868, 0x00fcfcfc, 0x00ececec, 0x000a0a0a, +0x00dadada, 0x006f6f6f, 0x00535353, 0x00626262, 0x00a3a3a3, 0x002e2e2e, 0x00080808, 0x00afafaf, +0x00282828, 0x00b0b0b0, 0x00747474, 0x00c2c2c2, 0x00bdbdbd, 0x00363636, 0x00222222, 0x00383838, +0x00646464, 0x001e1e1e, 0x00393939, 0x002c2c2c, 0x00a6a6a6, 0x00303030, 0x00e5e5e5, 0x00444444, +0x00fdfdfd, 0x00888888, 0x009f9f9f, 0x00656565, 0x00878787, 0x006b6b6b, 0x00f4f4f4, 0x00232323, +0x00484848, 0x00101010, 0x00d1d1d1, 0x00515151, 0x00c0c0c0, 0x00f9f9f9, 0x00d2d2d2, 0x00a0a0a0, +0x00555555, 0x00a1a1a1, 0x00414141, 0x00fafafa, 0x00434343, 0x00131313, 0x00c4c4c4, 0x002f2f2f, +0x00a8a8a8, 0x00b6b6b6, 0x003c3c3c, 0x002b2b2b, 0x00c1c1c1, 0x00ffffff, 0x00c8c8c8, 0x00a5a5a5, +0x00202020, 0x00898989, 0x00000000, 0x00909090, 0x00474747, 0x00efefef, 0x00eaeaea, 0x00b7b7b7, +0x00151515, 0x00060606, 0x00cdcdcd, 0x00b5b5b5, 0x00121212, 0x007e7e7e, 0x00bbbbbb, 0x00292929, +0x000f0f0f, 0x00b8b8b8, 0x00070707, 0x00040404, 0x009b9b9b, 0x00949494, 0x00212121, 0x00666666, +0x00e6e6e6, 0x00cecece, 0x00ededed, 0x00e7e7e7, 0x003b3b3b, 0x00fefefe, 0x007f7f7f, 0x00c5c5c5, +0x00a4a4a4, 0x00373737, 0x00b1b1b1, 0x004c4c4c, 0x00919191, 0x006e6e6e, 0x008d8d8d, 0x00767676, +0x00030303, 0x002d2d2d, 0x00dedede, 0x00969696, 0x00262626, 0x007d7d7d, 0x00c6c6c6, 0x005c5c5c, +0x00d3d3d3, 0x00f2f2f2, 0x004f4f4f, 0x00191919, 0x003f3f3f, 0x00dcdcdc, 0x00797979, 0x001d1d1d, +0x00525252, 0x00ebebeb, 0x00f3f3f3, 0x006d6d6d, 0x005e5e5e, 0x00fbfbfb, 0x00696969, 0x00b2b2b2, +0x00f0f0f0, 0x00313131, 0x000c0c0c, 0x00d4d4d4, 0x00cfcfcf, 0x008c8c8c, 0x00e2e2e2, 0x00757575, +0x00a9a9a9, 0x004a4a4a, 0x00575757, 0x00848484, 0x00111111, 0x00454545, 0x001b1b1b, 0x00f5f5f5, +0x00e4e4e4, 0x000e0e0e, 0x00737373, 0x00aaaaaa, 0x00f1f1f1, 0x00dddddd, 0x00595959, 0x00141414, +0x006c6c6c, 0x00929292, 0x00545454, 0x00d0d0d0, 0x00787878, 0x00707070, 0x00e3e3e3, 0x00494949, +0x00808080, 0x00505050, 0x00a7a7a7, 0x00f6f6f6, 0x00777777, 0x00939393, 0x00868686, 0x00838383, +0x002a2a2a, 0x00c7c7c7, 0x005b5b5b, 0x00e9e9e9, 0x00eeeeee, 0x008f8f8f, 0x00010101, 0x003d3d3d, +}; + +static const ulong32 SP3033[] = { +0x38003838, 0x41004141, 0x16001616, 0x76007676, 0xd900d9d9, 0x93009393, 0x60006060, 0xf200f2f2, +0x72007272, 0xc200c2c2, 0xab00abab, 0x9a009a9a, 0x75007575, 0x06000606, 0x57005757, 0xa000a0a0, +0x91009191, 0xf700f7f7, 0xb500b5b5, 0xc900c9c9, 0xa200a2a2, 0x8c008c8c, 0xd200d2d2, 0x90009090, +0xf600f6f6, 0x07000707, 0xa700a7a7, 0x27002727, 0x8e008e8e, 0xb200b2b2, 0x49004949, 0xde00dede, +0x43004343, 0x5c005c5c, 0xd700d7d7, 0xc700c7c7, 0x3e003e3e, 0xf500f5f5, 0x8f008f8f, 0x67006767, +0x1f001f1f, 0x18001818, 0x6e006e6e, 0xaf00afaf, 0x2f002f2f, 0xe200e2e2, 0x85008585, 0x0d000d0d, +0x53005353, 0xf000f0f0, 0x9c009c9c, 0x65006565, 0xea00eaea, 0xa300a3a3, 0xae00aeae, 0x9e009e9e, +0xec00ecec, 0x80008080, 0x2d002d2d, 0x6b006b6b, 0xa800a8a8, 0x2b002b2b, 0x36003636, 0xa600a6a6, +0xc500c5c5, 0x86008686, 0x4d004d4d, 0x33003333, 0xfd00fdfd, 0x66006666, 0x58005858, 0x96009696, +0x3a003a3a, 0x09000909, 0x95009595, 0x10001010, 0x78007878, 0xd800d8d8, 0x42004242, 0xcc00cccc, +0xef00efef, 0x26002626, 0xe500e5e5, 0x61006161, 0x1a001a1a, 0x3f003f3f, 0x3b003b3b, 0x82008282, +0xb600b6b6, 0xdb00dbdb, 0xd400d4d4, 0x98009898, 0xe800e8e8, 0x8b008b8b, 0x02000202, 0xeb00ebeb, +0x0a000a0a, 0x2c002c2c, 0x1d001d1d, 0xb000b0b0, 0x6f006f6f, 0x8d008d8d, 0x88008888, 0x0e000e0e, +0x19001919, 0x87008787, 0x4e004e4e, 0x0b000b0b, 0xa900a9a9, 0x0c000c0c, 0x79007979, 0x11001111, +0x7f007f7f, 0x22002222, 0xe700e7e7, 0x59005959, 0xe100e1e1, 0xda00dada, 0x3d003d3d, 0xc800c8c8, +0x12001212, 0x04000404, 0x74007474, 0x54005454, 0x30003030, 0x7e007e7e, 0xb400b4b4, 0x28002828, +0x55005555, 0x68006868, 0x50005050, 0xbe00bebe, 0xd000d0d0, 0xc400c4c4, 0x31003131, 0xcb00cbcb, +0x2a002a2a, 0xad00adad, 0x0f000f0f, 0xca00caca, 0x70007070, 0xff00ffff, 0x32003232, 0x69006969, +0x08000808, 0x62006262, 0x00000000, 0x24002424, 0xd100d1d1, 0xfb00fbfb, 0xba00baba, 0xed00eded, +0x45004545, 0x81008181, 0x73007373, 0x6d006d6d, 0x84008484, 0x9f009f9f, 0xee00eeee, 0x4a004a4a, +0xc300c3c3, 0x2e002e2e, 0xc100c1c1, 0x01000101, 0xe600e6e6, 0x25002525, 0x48004848, 0x99009999, +0xb900b9b9, 0xb300b3b3, 0x7b007b7b, 0xf900f9f9, 0xce00cece, 0xbf00bfbf, 0xdf00dfdf, 0x71007171, +0x29002929, 0xcd00cdcd, 0x6c006c6c, 0x13001313, 0x64006464, 0x9b009b9b, 0x63006363, 0x9d009d9d, +0xc000c0c0, 0x4b004b4b, 0xb700b7b7, 0xa500a5a5, 0x89008989, 0x5f005f5f, 0xb100b1b1, 0x17001717, +0xf400f4f4, 0xbc00bcbc, 0xd300d3d3, 0x46004646, 0xcf00cfcf, 0x37003737, 0x5e005e5e, 0x47004747, +0x94009494, 0xfa00fafa, 0xfc00fcfc, 0x5b005b5b, 0x97009797, 0xfe00fefe, 0x5a005a5a, 0xac00acac, +0x3c003c3c, 0x4c004c4c, 0x03000303, 0x35003535, 0xf300f3f3, 0x23002323, 0xb800b8b8, 0x5d005d5d, +0x6a006a6a, 0x92009292, 0xd500d5d5, 0x21002121, 0x44004444, 0x51005151, 0xc600c6c6, 0x7d007d7d, +0x39003939, 0x83008383, 0xdc00dcdc, 0xaa00aaaa, 0x7c007c7c, 0x77007777, 0x56005656, 0x05000505, +0x1b001b1b, 0xa400a4a4, 0x15001515, 0x34003434, 0x1e001e1e, 0x1c001c1c, 0xf800f8f8, 0x52005252, +0x20002020, 0x14001414, 0xe900e9e9, 0xbd00bdbd, 0xdd00dddd, 0xe400e4e4, 0xa100a1a1, 0xe000e0e0, +0x8a008a8a, 0xf100f1f1, 0xd600d6d6, 0x7a007a7a, 0xbb00bbbb, 0xe300e3e3, 0x40004040, 0x4f004f4f, +}; + +static const ulong32 SP4404[] = { +0x70700070, 0x2c2c002c, 0xb3b300b3, 0xc0c000c0, 0xe4e400e4, 0x57570057, 0xeaea00ea, 0xaeae00ae, +0x23230023, 0x6b6b006b, 0x45450045, 0xa5a500a5, 0xeded00ed, 0x4f4f004f, 0x1d1d001d, 0x92920092, +0x86860086, 0xafaf00af, 0x7c7c007c, 0x1f1f001f, 0x3e3e003e, 0xdcdc00dc, 0x5e5e005e, 0x0b0b000b, +0xa6a600a6, 0x39390039, 0xd5d500d5, 0x5d5d005d, 0xd9d900d9, 0x5a5a005a, 0x51510051, 0x6c6c006c, +0x8b8b008b, 0x9a9a009a, 0xfbfb00fb, 0xb0b000b0, 0x74740074, 0x2b2b002b, 0xf0f000f0, 0x84840084, +0xdfdf00df, 0xcbcb00cb, 0x34340034, 0x76760076, 0x6d6d006d, 0xa9a900a9, 0xd1d100d1, 0x04040004, +0x14140014, 0x3a3a003a, 0xdede00de, 0x11110011, 0x32320032, 0x9c9c009c, 0x53530053, 0xf2f200f2, +0xfefe00fe, 0xcfcf00cf, 0xc3c300c3, 0x7a7a007a, 0x24240024, 0xe8e800e8, 0x60600060, 0x69690069, +0xaaaa00aa, 0xa0a000a0, 0xa1a100a1, 0x62620062, 0x54540054, 0x1e1e001e, 0xe0e000e0, 0x64640064, +0x10100010, 0x00000000, 0xa3a300a3, 0x75750075, 0x8a8a008a, 0xe6e600e6, 0x09090009, 0xdddd00dd, +0x87870087, 0x83830083, 0xcdcd00cd, 0x90900090, 0x73730073, 0xf6f600f6, 0x9d9d009d, 0xbfbf00bf, +0x52520052, 0xd8d800d8, 0xc8c800c8, 0xc6c600c6, 0x81810081, 0x6f6f006f, 0x13130013, 0x63630063, +0xe9e900e9, 0xa7a700a7, 0x9f9f009f, 0xbcbc00bc, 0x29290029, 0xf9f900f9, 0x2f2f002f, 0xb4b400b4, +0x78780078, 0x06060006, 0xe7e700e7, 0x71710071, 0xd4d400d4, 0xabab00ab, 0x88880088, 0x8d8d008d, +0x72720072, 0xb9b900b9, 0xf8f800f8, 0xacac00ac, 0x36360036, 0x2a2a002a, 0x3c3c003c, 0xf1f100f1, +0x40400040, 0xd3d300d3, 0xbbbb00bb, 0x43430043, 0x15150015, 0xadad00ad, 0x77770077, 0x80800080, +0x82820082, 0xecec00ec, 0x27270027, 0xe5e500e5, 0x85850085, 0x35350035, 0x0c0c000c, 0x41410041, +0xefef00ef, 0x93930093, 0x19190019, 0x21210021, 0x0e0e000e, 0x4e4e004e, 0x65650065, 0xbdbd00bd, +0xb8b800b8, 0x8f8f008f, 0xebeb00eb, 0xcece00ce, 0x30300030, 0x5f5f005f, 0xc5c500c5, 0x1a1a001a, +0xe1e100e1, 0xcaca00ca, 0x47470047, 0x3d3d003d, 0x01010001, 0xd6d600d6, 0x56560056, 0x4d4d004d, +0x0d0d000d, 0x66660066, 0xcccc00cc, 0x2d2d002d, 0x12120012, 0x20200020, 0xb1b100b1, 0x99990099, +0x4c4c004c, 0xc2c200c2, 0x7e7e007e, 0x05050005, 0xb7b700b7, 0x31310031, 0x17170017, 0xd7d700d7, +0x58580058, 0x61610061, 0x1b1b001b, 0x1c1c001c, 0x0f0f000f, 0x16160016, 0x18180018, 0x22220022, +0x44440044, 0xb2b200b2, 0xb5b500b5, 0x91910091, 0x08080008, 0xa8a800a8, 0xfcfc00fc, 0x50500050, +0xd0d000d0, 0x7d7d007d, 0x89890089, 0x97970097, 0x5b5b005b, 0x95950095, 0xffff00ff, 0xd2d200d2, +0xc4c400c4, 0x48480048, 0xf7f700f7, 0xdbdb00db, 0x03030003, 0xdada00da, 0x3f3f003f, 0x94940094, +0x5c5c005c, 0x02020002, 0x4a4a004a, 0x33330033, 0x67670067, 0xf3f300f3, 0x7f7f007f, 0xe2e200e2, +0x9b9b009b, 0x26260026, 0x37370037, 0x3b3b003b, 0x96960096, 0x4b4b004b, 0xbebe00be, 0x2e2e002e, +0x79790079, 0x8c8c008c, 0x6e6e006e, 0x8e8e008e, 0xf5f500f5, 0xb6b600b6, 0xfdfd00fd, 0x59590059, +0x98980098, 0x6a6a006a, 0x46460046, 0xbaba00ba, 0x25250025, 0x42420042, 0xa2a200a2, 0xfafa00fa, +0x07070007, 0x55550055, 0xeeee00ee, 0x0a0a000a, 0x49490049, 0x68680068, 0x38380038, 0xa4a400a4, +0x28280028, 0x7b7b007b, 0xc9c900c9, 0xc1c100c1, 0xe3e300e3, 0xf4f400f4, 0xc7c700c7, 0x9e9e009e, +}; + +static const ulong64 key_sigma[] = { + CONST64(0xA09E667F3BCC908B), + CONST64(0xB67AE8584CAA73B2), + CONST64(0xC6EF372FE94F82BE), + CONST64(0x54FF53A5F1D36F1C), + CONST64(0x10E527FADE682D1D), + CONST64(0xB05688C2B3E6C1FD) +}; + +static ulong64 F(ulong64 x) +{ + ulong32 D, U; + +#define loc(i) ((8-i)*8) + + D = SP1110[(x >> loc(8)) & 0xFF] ^ SP0222[(x >> loc(5)) & 0xFF] ^ SP3033[(x >> loc(6)) & 0xFF] ^ SP4404[(x >> loc(7)) & 0xFF]; + U = SP1110[(x >> loc(1)) & 0xFF] ^ SP0222[(x >> loc(2)) & 0xFF] ^ SP3033[(x >> loc(3)) & 0xFF] ^ SP4404[(x >> loc(4)) & 0xFF]; + + D ^= U; + U = D ^ RORc(U, 8); + + return ((ulong64)U) | (((ulong64)D) << CONST64(32)); +} + +static void rot_128(unsigned char *in, unsigned count, unsigned char *out) +{ + unsigned x, w, b; + + w = count >> 3; + b = count & 7; + + for (x = 0; x < 16; x++) { + out[x] = (in[(x+w)&15] << b) | (in[(x+w+1)&15] >> (8 - b)); + } +} + +int camellia_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey) +{ + unsigned char T[48], kA[16], kB[16], kR[16], kL[16]; + int x; + ulong64 A, B; + + LTC_ARGCHK(key != NULL); + LTC_ARGCHK(skey != NULL); + + /* Valid sizes (in bytes) are 16, 24, 32 */ + if (keylen != 16 && keylen != 24 && keylen != 32) { + return CRYPT_INVALID_KEYSIZE; + } + + /* number of rounds */ + skey->camellia.R = (keylen == 16) ? 18 : 24; + + if (num_rounds != 0 && num_rounds != skey->camellia.R) { + return CRYPT_INVALID_ROUNDS; + } + + /* expand key */ + if (keylen == 16) { + for (x = 0; x < 16; x++) { + T[x] = key[x]; + T[x + 16] = 0; + } + } else if (keylen == 24) { + for (x = 0; x < 24; x++) { + T[x] = key[x]; + } + for (x = 24; x < 32; x++) { + T[x] = key[x-8] ^ 0xFF; + } + } else { + for (x = 0; x < 32; x++) { + T[x] = key[x]; + } + } + + for (x = 0; x < 16; x++) { + kL[x] = T[x]; + kR[x] = T[x + 16]; + } + + for (x = 32; x < 48; x++) { + T[x] = T[x - 32] ^ T[x - 16]; + } + + /* first two rounds */ + LOAD64H(A, T+32); LOAD64H(B, T+40); + B ^= F(A ^ key_sigma[0]); + A ^= F(B ^ key_sigma[1]); + STORE64H(A, T+32); STORE64H(B, T+40); + + /* xor kL in */ + for (x = 0; x < 16; x++) { T[x+32] ^= kL[x]; } + + /* next two rounds */ + LOAD64H(A, T+32); LOAD64H(B, T+40); + B ^= F(A ^ key_sigma[2]); + A ^= F(B ^ key_sigma[3]); + STORE64H(A, T+32); STORE64H(B, T+40); + + /* grab KA */ + for (x = 0; x < 16; x++) { kA[x] = T[x+32]; } + + /* xor kR in */ + for (x = 0; x < 16; x++) { T[x+32] ^= kR[x]; } + + if (keylen == 16) { + /* grab whitening keys kw1 and kw2 */ + LOAD64H(skey->camellia.kw[0], kL); + LOAD64H(skey->camellia.kw[1], kL+8); + + /* k1-k2 */ + LOAD64H(skey->camellia.k[0], kA); + LOAD64H(skey->camellia.k[1], kA+8); + + /* rotate kL by 15, k3/k4 */ + rot_128(kL, 15, T+32); + LOAD64H(skey->camellia.k[2], T+32); + LOAD64H(skey->camellia.k[3], T+40); + + /* rotate kA by 15, k5/k6 */ + rot_128(kA, 15, T+32); + LOAD64H(skey->camellia.k[4], T+32); + LOAD64H(skey->camellia.k[5], T+40); + + /* rotate kA by 30, kl1, kl2 */ + rot_128(kA, 30, T+32); + LOAD64H(skey->camellia.kl[0], T+32); + LOAD64H(skey->camellia.kl[1], T+40); + + /* rotate kL by 45, k7/k8 */ + rot_128(kL, 45, T+32); + LOAD64H(skey->camellia.k[6], T+32); + LOAD64H(skey->camellia.k[7], T+40); + + /* rotate kA by 45, k9/k10 */ + rot_128(kA, 45, T+32); + LOAD64H(skey->camellia.k[8], T+32); + rot_128(kL, 60, T+32); + LOAD64H(skey->camellia.k[9], T+40); + + /* rotate kA by 60, k11/k12 */ + rot_128(kA, 60, T+32); + LOAD64H(skey->camellia.k[10], T+32); + LOAD64H(skey->camellia.k[11], T+40); + + /* rotate kL by 77, kl3, kl4 */ + rot_128(kL, 77, T+32); + LOAD64H(skey->camellia.kl[2], T+32); + LOAD64H(skey->camellia.kl[3], T+40); + + /* rotate kL by 94, k13/k14 */ + rot_128(kL, 94, T+32); + LOAD64H(skey->camellia.k[12], T+32); + LOAD64H(skey->camellia.k[13], T+40); + + /* rotate kA by 94, k15/k16 */ + rot_128(kA, 94, T+32); + LOAD64H(skey->camellia.k[14], T+32); + LOAD64H(skey->camellia.k[15], T+40); + + /* rotate kL by 111, k17/k18 */ + rot_128(kL, 111, T+32); + LOAD64H(skey->camellia.k[16], T+32); + LOAD64H(skey->camellia.k[17], T+40); + + /* rotate kA by 111, kw3/kw4 */ + rot_128(kA, 111, T+32); + LOAD64H(skey->camellia.kw[2], T+32); + LOAD64H(skey->camellia.kw[3], T+40); + } else { + /* last two rounds */ + LOAD64H(A, T+32); LOAD64H(B, T+40); + B ^= F(A ^ key_sigma[4]); + A ^= F(B ^ key_sigma[5]); + STORE64H(A, T+32); STORE64H(B, T+40); + + /* grab kB */ + for (x = 0; x < 16; x++) { kB[x] = T[x+32]; } + + /* kw1/2 from kL*/ + LOAD64H(skey->camellia.kw[0], kL); + LOAD64H(skey->camellia.kw[1], kL+8); + + /* k1/k2 = kB */ + LOAD64H(skey->camellia.k[0], kB); + LOAD64H(skey->camellia.k[1], kB+8); + + /* k3/k4 = kR by 15 */ + rot_128(kR, 15, T+32); + LOAD64H(skey->camellia.k[2], T+32); + LOAD64H(skey->camellia.k[3], T+40); + + /* k5/k7 = kA by 15 */ + rot_128(kA, 15, T+32); + LOAD64H(skey->camellia.k[4], T+32); + LOAD64H(skey->camellia.k[5], T+40); + + /* kl1/2 = kR by 30 */ + rot_128(kR, 30, T+32); + LOAD64H(skey->camellia.kl[0], T+32); + LOAD64H(skey->camellia.kl[1], T+40); + + /* k7/k8 = kB by 30 */ + rot_128(kB, 30, T+32); + LOAD64H(skey->camellia.k[6], T+32); + LOAD64H(skey->camellia.k[7], T+40); + + /* k9/k10 = kL by 45 */ + rot_128(kL, 45, T+32); + LOAD64H(skey->camellia.k[8], T+32); + LOAD64H(skey->camellia.k[9], T+40); + + /* k11/k12 = kA by 45 */ + rot_128(kA, 45, T+32); + LOAD64H(skey->camellia.k[10], T+32); + LOAD64H(skey->camellia.k[11], T+40); + + /* kl3/4 = kL by 60 */ + rot_128(kL, 60, T+32); + LOAD64H(skey->camellia.kl[2], T+32); + LOAD64H(skey->camellia.kl[3], T+40); + + /* k13/k14 = kR by 60 */ + rot_128(kR, 60, T+32); + LOAD64H(skey->camellia.k[12], T+32); + LOAD64H(skey->camellia.k[13], T+40); + + /* k15/k16 = kB by 15 */ + rot_128(kB, 60, T+32); + LOAD64H(skey->camellia.k[14], T+32); + LOAD64H(skey->camellia.k[15], T+40); + + /* k17/k18 = kL by 77 */ + rot_128(kL, 77, T+32); + LOAD64H(skey->camellia.k[16], T+32); + LOAD64H(skey->camellia.k[17], T+40); + + /* kl5/6 = kA by 77 */ + rot_128(kA, 77, T+32); + LOAD64H(skey->camellia.kl[4], T+32); + LOAD64H(skey->camellia.kl[5], T+40); + + /* k19/k20 = kR by 94 */ + rot_128(kR, 94, T+32); + LOAD64H(skey->camellia.k[18], T+32); + LOAD64H(skey->camellia.k[19], T+40); + + /* k21/k22 = kA by 94 */ + rot_128(kA, 94, T+32); + LOAD64H(skey->camellia.k[20], T+32); + LOAD64H(skey->camellia.k[21], T+40); + + /* k23/k24 = kL by 111 */ + rot_128(kL, 111, T+32); + LOAD64H(skey->camellia.k[22], T+32); + LOAD64H(skey->camellia.k[23], T+40); + + /* kw2/kw3 = kB by 111 */ + rot_128(kB, 111, T+32); + LOAD64H(skey->camellia.kw[2], T+32); + LOAD64H(skey->camellia.kw[3], T+40); + } + + return CRYPT_OK; +} + +int camellia_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key *skey) +{ + ulong64 L, R; + ulong32 a, b; + + LOAD64H(L, pt+0); LOAD64H(R, pt+8); + L ^= skey->camellia.kw[0]; + R ^= skey->camellia.kw[1]; + + /* first 6 rounds */ + R ^= F(L ^ skey->camellia.k[0]); + L ^= F(R ^ skey->camellia.k[1]); + R ^= F(L ^ skey->camellia.k[2]); + L ^= F(R ^ skey->camellia.k[3]); + R ^= F(L ^ skey->camellia.k[4]); + L ^= F(R ^ skey->camellia.k[5]); + + /* FL */ + a = (ulong32)(L >> 32); + b = (ulong32)(L & 0xFFFFFFFFUL); + b ^= ROL((a & (ulong32)(skey->camellia.kl[0] >> 32)), 1); + a ^= b | (skey->camellia.kl[0] & 0xFFFFFFFFU); + L = (((ulong64)a) << 32) | b; + + /* FL^-1 */ + a = (ulong32)(R >> 32); + b = (ulong32)(R & 0xFFFFFFFFUL); + a ^= b | (skey->camellia.kl[1] & 0xFFFFFFFFU); + b ^= ROL((a & (ulong32)(skey->camellia.kl[1] >> 32)), 1); + R = (((ulong64)a) << 32) | b; + + /* second 6 rounds */ + R ^= F(L ^ skey->camellia.k[6]); + L ^= F(R ^ skey->camellia.k[7]); + R ^= F(L ^ skey->camellia.k[8]); + L ^= F(R ^ skey->camellia.k[9]); + R ^= F(L ^ skey->camellia.k[10]); + L ^= F(R ^ skey->camellia.k[11]); + + /* FL */ + a = (ulong32)(L >> 32); + b = (ulong32)(L & 0xFFFFFFFFUL); + b ^= ROL((a & (ulong32)(skey->camellia.kl[2] >> 32)), 1); + a ^= b | (skey->camellia.kl[2] & 0xFFFFFFFFU); + L = (((ulong64)a) << 32) | b; + + /* FL^-1 */ + a = (ulong32)(R >> 32); + b = (ulong32)(R & 0xFFFFFFFFUL); + a ^= b | (skey->camellia.kl[3] & 0xFFFFFFFFU); + b ^= ROL((a & (ulong32)(skey->camellia.kl[3] >> 32)), 1); + R = (((ulong64)a) << 32) | b; + + /* third 6 rounds */ + R ^= F(L ^ skey->camellia.k[12]); + L ^= F(R ^ skey->camellia.k[13]); + R ^= F(L ^ skey->camellia.k[14]); + L ^= F(R ^ skey->camellia.k[15]); + R ^= F(L ^ skey->camellia.k[16]); + L ^= F(R ^ skey->camellia.k[17]); + + /* next FL */ + if (skey->camellia.R == 24) { + /* FL */ + a = (ulong32)(L >> 32); + b = (ulong32)(L & 0xFFFFFFFFUL); + b ^= ROL((a & (ulong32)(skey->camellia.kl[4] >> 32)), 1); + a ^= b | (skey->camellia.kl[4] & 0xFFFFFFFFU); + L = (((ulong64)a) << 32) | b; + + /* FL^-1 */ + a = (ulong32)(R >> 32); + b = (ulong32)(R & 0xFFFFFFFFUL); + a ^= b | (skey->camellia.kl[5] & 0xFFFFFFFFU); + b ^= ROL((a & (ulong32)(skey->camellia.kl[5] >> 32)), 1); + R = (((ulong64)a) << 32) | b; + + /* fourth 6 rounds */ + R ^= F(L ^ skey->camellia.k[18]); + L ^= F(R ^ skey->camellia.k[19]); + R ^= F(L ^ skey->camellia.k[20]); + L ^= F(R ^ skey->camellia.k[21]); + R ^= F(L ^ skey->camellia.k[22]); + L ^= F(R ^ skey->camellia.k[23]); + } + + L ^= skey->camellia.kw[3]; + R ^= skey->camellia.kw[2]; + + STORE64H(R, ct+0); STORE64H(L, ct+8); + + return CRYPT_OK; +} + +int camellia_ecb_decrypt(const unsigned char *ct, unsigned char *pt, symmetric_key *skey) +{ + ulong64 L, R; + ulong32 a, b; + + LOAD64H(R, ct+0); LOAD64H(L, ct+8); + L ^= skey->camellia.kw[3]; + R ^= skey->camellia.kw[2]; + + /* next FL */ + if (skey->camellia.R == 24) { + /* fourth 6 rounds */ + L ^= F(R ^ skey->camellia.k[23]); + R ^= F(L ^ skey->camellia.k[22]); + L ^= F(R ^ skey->camellia.k[21]); + R ^= F(L ^ skey->camellia.k[20]); + L ^= F(R ^ skey->camellia.k[19]); + R ^= F(L ^ skey->camellia.k[18]); + + /* FL */ + a = (ulong32)(L >> 32); + b = (ulong32)(L & 0xFFFFFFFFUL); + a ^= b | (skey->camellia.kl[4] & 0xFFFFFFFFU); + b ^= ROL((a & (ulong32)(skey->camellia.kl[4] >> 32)), 1); + L = (((ulong64)a) << 32) | b; + + /* FL^-1 */ + a = (ulong32)(R >> 32); + b = (ulong32)(R & 0xFFFFFFFFUL); + b ^= ROL((a & (ulong32)(skey->camellia.kl[5] >> 32)), 1); + a ^= b | (skey->camellia.kl[5] & 0xFFFFFFFFU); + R = (((ulong64)a) << 32) | b; + + } + + /* third 6 rounds */ + L ^= F(R ^ skey->camellia.k[17]); + R ^= F(L ^ skey->camellia.k[16]); + L ^= F(R ^ skey->camellia.k[15]); + R ^= F(L ^ skey->camellia.k[14]); + L ^= F(R ^ skey->camellia.k[13]); + R ^= F(L ^ skey->camellia.k[12]); + + /* FL */ + a = (ulong32)(L >> 32); + b = (ulong32)(L & 0xFFFFFFFFUL); + a ^= b | (skey->camellia.kl[2] & 0xFFFFFFFFU); + b ^= ROL((a & (ulong32)(skey->camellia.kl[2] >> 32)), 1); + L = (((ulong64)a) << 32) | b; + + /* FL^-1 */ + a = (ulong32)(R >> 32); + b = (ulong32)(R & 0xFFFFFFFFUL); + b ^= ROL((a & (ulong32)(skey->camellia.kl[3] >> 32)), 1); + a ^= b | (skey->camellia.kl[3] & 0xFFFFFFFFU); + R = (((ulong64)a) << 32) | b; + + /* second 6 rounds */ + L ^= F(R ^ skey->camellia.k[11]); + R ^= F(L ^ skey->camellia.k[10]); + L ^= F(R ^ skey->camellia.k[9]); + R ^= F(L ^ skey->camellia.k[8]); + L ^= F(R ^ skey->camellia.k[7]); + R ^= F(L ^ skey->camellia.k[6]); + + /* FL */ + a = (ulong32)(L >> 32); + b = (ulong32)(L & 0xFFFFFFFFUL); + a ^= b | (skey->camellia.kl[0] & 0xFFFFFFFFU); + b ^= ROL((a & (ulong32)(skey->camellia.kl[0] >> 32)), 1); + L = (((ulong64)a) << 32) | b; + + /* FL^-1 */ + a = (ulong32)(R >> 32); + b = (ulong32)(R & 0xFFFFFFFFUL); + b ^= ROL((a & (ulong32)(skey->camellia.kl[1] >> 32)), 1); + a ^= b | (skey->camellia.kl[1] & 0xFFFFFFFFU); + R = (((ulong64)a) << 32) | b; + + /* first 6 rounds */ + L ^= F(R ^ skey->camellia.k[5]); + R ^= F(L ^ skey->camellia.k[4]); + L ^= F(R ^ skey->camellia.k[3]); + R ^= F(L ^ skey->camellia.k[2]); + L ^= F(R ^ skey->camellia.k[1]); + R ^= F(L ^ skey->camellia.k[0]); + + R ^= skey->camellia.kw[1]; + L ^= skey->camellia.kw[0]; + + STORE64H(R, pt+8); STORE64H(L, pt+0); + + return CRYPT_OK; +} + +int camellia_test(void) +{ + static const struct { + int keylen; + unsigned char key[32], pt[16], ct[16]; + } tests[] = { + +{ + 16, + { 0x01, 0x23, 0x45, 0x67, 0x89, 0xab, 0xcd, 0xef, + 0xfe, 0xdc, 0xba, 0x98, 0x76, 0x54, 0x32, 0x10 }, + { 0x01, 0x23, 0x45, 0x67, 0x89, 0xab, 0xcd, 0xef, + 0xfe, 0xdc, 0xba, 0x98, 0x76, 0x54, 0x32, 0x10 }, + { 0x67, 0x67, 0x31, 0x38, 0x54, 0x96, 0x69, 0x73, + 0x08, 0x57, 0x06, 0x56, 0x48, 0xea, 0xbe, 0x43 } +}, + +{ + 24, + { 0x01, 0x23, 0x45, 0x67, 0x89, 0xab, 0xcd, 0xef, + 0xfe, 0xdc, 0xba, 0x98, 0x76, 0x54, 0x32, 0x10, + 0x00, 0x11, 0x22, 0x33, 0x44, 0x55, 0x66, 0x77 }, + { 0x01, 0x23, 0x45, 0x67, 0x89, 0xab, 0xcd, 0xef, + 0xfe, 0xdc, 0xba, 0x98, 0x76, 0x54, 0x32, 0x10 }, + { 0xb4, 0x99, 0x34, 0x01, 0xb3, 0xe9, 0x96, 0xf8, + 0x4e, 0xe5, 0xce, 0xe7, 0xd7, 0x9b, 0x09, 0xb9 } +}, + + +{ + 32, + { 0x01, 0x23, 0x45, 0x67, 0x89, 0xab, 0xcd, 0xef, + 0xfe, 0xdc, 0xba, 0x98, 0x76, 0x54, 0x32, 0x10, + 0x00, 0x11, 0x22, 0x33, 0x44, 0x55, 0x66, 0x77, + 0x88, 0x99, 0xaa, 0xbb, 0xcc, 0xdd, 0xee, 0xff }, + { 0x01, 0x23, 0x45, 0x67, 0x89, 0xab, 0xcd, 0xef, + 0xfe, 0xdc, 0xba, 0x98, 0x76, 0x54, 0x32, 0x10 }, + { 0x9a, 0xcc, 0x23, 0x7d, 0xff, 0x16, 0xd7, 0x6c, + 0x20, 0xef, 0x7c, 0x91, 0x9e, 0x3a, 0x75, 0x09 } +}, + +{ + 32, + { 0x60, 0x3D, 0xEB, 0x10, 0x15, 0xCA, 0x71, 0xBE, + 0x2B, 0x73, 0xAE, 0xF0, 0x85, 0x7D, 0x77, 0x81, + 0x1F, 0x35, 0x2C, 0x07, 0x3B, 0x61, 0x08, 0xD7, + 0x2D, 0x98, 0x10, 0xA3, 0x09, 0x14, 0xDF, 0xF4 }, + { 0xF6, 0x9F, 0x24, 0x45, 0xDF, 0x4F, 0x9B, 0x17, + 0xAD, 0x2B, 0x41, 0x7B, 0xE6, 0x6C, 0x37, 0x10 }, + { 0x79, 0x60, 0x10, 0x9F, 0xB6, 0xDC, 0x42, 0x94, + 0x7F, 0xCF, 0xE5, 0x9E, 0xA3, 0xC5, 0xEB, 0x6B } +} +}; + unsigned char buf[2][16]; + symmetric_key skey; + int err; + unsigned int x; + + for (x = 0; x < sizeof(tests)/sizeof(tests[0]); x++) { + zeromem(&skey, sizeof(skey)); + if ((err = camellia_setup(tests[x].key, tests[x].keylen, 0, &skey)) != CRYPT_OK) { + return err; + } + if ((err = camellia_ecb_encrypt(tests[x].pt, buf[0], &skey)) != CRYPT_OK) { + camellia_done(&skey); + return err; + } + if ((err = camellia_ecb_decrypt(tests[x].ct, buf[1], &skey)) != CRYPT_OK) { + camellia_done(&skey); + return err; + } + camellia_done(&skey); + if (compare_testvector(tests[x].ct, 16, buf[0], 16, "Camellia Encrypt", x) || + compare_testvector(tests[x].pt, 16, buf[1], 16, "Camellia Decrypt", x)) { + return CRYPT_FAIL_TESTVECTOR; + } + } + return CRYPT_OK; +} + +void camellia_done(symmetric_key *skey) +{ + LTC_UNUSED_PARAM(skey); +} + +int camellia_keysize(int *keysize) +{ + if (*keysize >= 32) { *keysize = 32; } + else if (*keysize >= 24) { *keysize = 24; } + else if (*keysize >= 16) { *keysize = 16; } + else return CRYPT_INVALID_KEYSIZE; + return CRYPT_OK; +} + +#endif + +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/ciphers/cast5.c b/libtomcrypt/src/ciphers/cast5.c index ffc2f28..43ca580 100644 --- a/libtomcrypt/src/ciphers/cast5.c +++ b/libtomcrypt/src/ciphers/cast5.c @@ -5,13 +5,11 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ - - /** + + /** @file cast5.c - Implementation of LTC_CAST5 (RFC 2144) by Tom St Denis + Implementation of LTC_CAST5 (RFC 2144) by Tom St Denis */ #include "tomcrypt.h" @@ -27,375 +25,375 @@ const struct ltc_cipher_descriptor cast5_desc = { &cast5_test, &cast5_done, &cast5_keysize, - NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL + NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL }; static const ulong32 S1[256] = { -0x30fb40d4UL, 0x9fa0ff0bUL, 0x6beccd2fUL, 0x3f258c7aUL, 0x1e213f2fUL, 0x9c004dd3UL, -0x6003e540UL, 0xcf9fc949UL, 0xbfd4af27UL, 0x88bbbdb5UL, 0xe2034090UL, 0x98d09675UL, -0x6e63a0e0UL, 0x15c361d2UL, 0xc2e7661dUL, 0x22d4ff8eUL, 0x28683b6fUL, 0xc07fd059UL, -0xff2379c8UL, 0x775f50e2UL, 0x43c340d3UL, 0xdf2f8656UL, 0x887ca41aUL, 0xa2d2bd2dUL, -0xa1c9e0d6UL, 0x346c4819UL, 0x61b76d87UL, 0x22540f2fUL, 0x2abe32e1UL, 0xaa54166bUL, -0x22568e3aUL, 0xa2d341d0UL, 0x66db40c8UL, 0xa784392fUL, 0x004dff2fUL, 0x2db9d2deUL, -0x97943facUL, 0x4a97c1d8UL, 0x527644b7UL, 0xb5f437a7UL, 0xb82cbaefUL, 0xd751d159UL, -0x6ff7f0edUL, 0x5a097a1fUL, 0x827b68d0UL, 0x90ecf52eUL, 0x22b0c054UL, 0xbc8e5935UL, -0x4b6d2f7fUL, 0x50bb64a2UL, 0xd2664910UL, 0xbee5812dUL, 0xb7332290UL, 0xe93b159fUL, -0xb48ee411UL, 0x4bff345dUL, 0xfd45c240UL, 0xad31973fUL, 0xc4f6d02eUL, 0x55fc8165UL, -0xd5b1caadUL, 0xa1ac2daeUL, 0xa2d4b76dUL, 0xc19b0c50UL, 0x882240f2UL, 0x0c6e4f38UL, -0xa4e4bfd7UL, 0x4f5ba272UL, 0x564c1d2fUL, 0xc59c5319UL, 0xb949e354UL, 0xb04669feUL, -0xb1b6ab8aUL, 0xc71358ddUL, 0x6385c545UL, 0x110f935dUL, 0x57538ad5UL, 0x6a390493UL, -0xe63d37e0UL, 0x2a54f6b3UL, 0x3a787d5fUL, 0x6276a0b5UL, 0x19a6fcdfUL, 0x7a42206aUL, -0x29f9d4d5UL, 0xf61b1891UL, 0xbb72275eUL, 0xaa508167UL, 0x38901091UL, 0xc6b505ebUL, -0x84c7cb8cUL, 0x2ad75a0fUL, 0x874a1427UL, 0xa2d1936bUL, 0x2ad286afUL, 0xaa56d291UL, -0xd7894360UL, 0x425c750dUL, 0x93b39e26UL, 0x187184c9UL, 0x6c00b32dUL, 0x73e2bb14UL, -0xa0bebc3cUL, 0x54623779UL, 0x64459eabUL, 0x3f328b82UL, 0x7718cf82UL, 0x59a2cea6UL, -0x04ee002eUL, 0x89fe78e6UL, 0x3fab0950UL, 0x325ff6c2UL, 0x81383f05UL, 0x6963c5c8UL, -0x76cb5ad6UL, 0xd49974c9UL, 0xca180dcfUL, 0x380782d5UL, 0xc7fa5cf6UL, 0x8ac31511UL, -0x35e79e13UL, 0x47da91d0UL, 0xf40f9086UL, 0xa7e2419eUL, 0x31366241UL, 0x051ef495UL, -0xaa573b04UL, 0x4a805d8dUL, 0x548300d0UL, 0x00322a3cUL, 0xbf64cddfUL, 0xba57a68eUL, -0x75c6372bUL, 0x50afd341UL, 0xa7c13275UL, 0x915a0bf5UL, 0x6b54bfabUL, 0x2b0b1426UL, -0xab4cc9d7UL, 0x449ccd82UL, 0xf7fbf265UL, 0xab85c5f3UL, 0x1b55db94UL, 0xaad4e324UL, -0xcfa4bd3fUL, 0x2deaa3e2UL, 0x9e204d02UL, 0xc8bd25acUL, 0xeadf55b3UL, 0xd5bd9e98UL, -0xe31231b2UL, 0x2ad5ad6cUL, 0x954329deUL, 0xadbe4528UL, 0xd8710f69UL, 0xaa51c90fUL, -0xaa786bf6UL, 0x22513f1eUL, 0xaa51a79bUL, 0x2ad344ccUL, 0x7b5a41f0UL, 0xd37cfbadUL, -0x1b069505UL, 0x41ece491UL, 0xb4c332e6UL, 0x032268d4UL, 0xc9600accUL, 0xce387e6dUL, -0xbf6bb16cUL, 0x6a70fb78UL, 0x0d03d9c9UL, 0xd4df39deUL, 0xe01063daUL, 0x4736f464UL, -0x5ad328d8UL, 0xb347cc96UL, 0x75bb0fc3UL, 0x98511bfbUL, 0x4ffbcc35UL, 0xb58bcf6aUL, -0xe11f0abcUL, 0xbfc5fe4aUL, 0xa70aec10UL, 0xac39570aUL, 0x3f04442fUL, 0x6188b153UL, -0xe0397a2eUL, 0x5727cb79UL, 0x9ceb418fUL, 0x1cacd68dUL, 0x2ad37c96UL, 0x0175cb9dUL, -0xc69dff09UL, 0xc75b65f0UL, 0xd9db40d8UL, 0xec0e7779UL, 0x4744ead4UL, 0xb11c3274UL, -0xdd24cb9eUL, 0x7e1c54bdUL, 0xf01144f9UL, 0xd2240eb1UL, 0x9675b3fdUL, 0xa3ac3755UL, -0xd47c27afUL, 0x51c85f4dUL, 0x56907596UL, 0xa5bb15e6UL, 0x580304f0UL, 0xca042cf1UL, -0x011a37eaUL, 0x8dbfaadbUL, 0x35ba3e4aUL, 0x3526ffa0UL, 0xc37b4d09UL, 0xbc306ed9UL, -0x98a52666UL, 0x5648f725UL, 0xff5e569dUL, 0x0ced63d0UL, 0x7c63b2cfUL, 0x700b45e1UL, -0xd5ea50f1UL, 0x85a92872UL, 0xaf1fbda7UL, 0xd4234870UL, 0xa7870bf3UL, 0x2d3b4d79UL, -0x42e04198UL, 0x0cd0ede7UL, 0x26470db8UL, 0xf881814cUL, 0x474d6ad7UL, 0x7c0c5e5cUL, -0xd1231959UL, 0x381b7298UL, 0xf5d2f4dbUL, 0xab838653UL, 0x6e2f1e23UL, 0x83719c9eUL, -0xbd91e046UL, 0x9a56456eUL, 0xdc39200cUL, 0x20c8c571UL, 0x962bda1cUL, 0xe1e696ffUL, -0xb141ab08UL, 0x7cca89b9UL, 0x1a69e783UL, 0x02cc4843UL, 0xa2f7c579UL, 0x429ef47dUL, +0x30fb40d4UL, 0x9fa0ff0bUL, 0x6beccd2fUL, 0x3f258c7aUL, 0x1e213f2fUL, 0x9c004dd3UL, +0x6003e540UL, 0xcf9fc949UL, 0xbfd4af27UL, 0x88bbbdb5UL, 0xe2034090UL, 0x98d09675UL, +0x6e63a0e0UL, 0x15c361d2UL, 0xc2e7661dUL, 0x22d4ff8eUL, 0x28683b6fUL, 0xc07fd059UL, +0xff2379c8UL, 0x775f50e2UL, 0x43c340d3UL, 0xdf2f8656UL, 0x887ca41aUL, 0xa2d2bd2dUL, +0xa1c9e0d6UL, 0x346c4819UL, 0x61b76d87UL, 0x22540f2fUL, 0x2abe32e1UL, 0xaa54166bUL, +0x22568e3aUL, 0xa2d341d0UL, 0x66db40c8UL, 0xa784392fUL, 0x004dff2fUL, 0x2db9d2deUL, +0x97943facUL, 0x4a97c1d8UL, 0x527644b7UL, 0xb5f437a7UL, 0xb82cbaefUL, 0xd751d159UL, +0x6ff7f0edUL, 0x5a097a1fUL, 0x827b68d0UL, 0x90ecf52eUL, 0x22b0c054UL, 0xbc8e5935UL, +0x4b6d2f7fUL, 0x50bb64a2UL, 0xd2664910UL, 0xbee5812dUL, 0xb7332290UL, 0xe93b159fUL, +0xb48ee411UL, 0x4bff345dUL, 0xfd45c240UL, 0xad31973fUL, 0xc4f6d02eUL, 0x55fc8165UL, +0xd5b1caadUL, 0xa1ac2daeUL, 0xa2d4b76dUL, 0xc19b0c50UL, 0x882240f2UL, 0x0c6e4f38UL, +0xa4e4bfd7UL, 0x4f5ba272UL, 0x564c1d2fUL, 0xc59c5319UL, 0xb949e354UL, 0xb04669feUL, +0xb1b6ab8aUL, 0xc71358ddUL, 0x6385c545UL, 0x110f935dUL, 0x57538ad5UL, 0x6a390493UL, +0xe63d37e0UL, 0x2a54f6b3UL, 0x3a787d5fUL, 0x6276a0b5UL, 0x19a6fcdfUL, 0x7a42206aUL, +0x29f9d4d5UL, 0xf61b1891UL, 0xbb72275eUL, 0xaa508167UL, 0x38901091UL, 0xc6b505ebUL, +0x84c7cb8cUL, 0x2ad75a0fUL, 0x874a1427UL, 0xa2d1936bUL, 0x2ad286afUL, 0xaa56d291UL, +0xd7894360UL, 0x425c750dUL, 0x93b39e26UL, 0x187184c9UL, 0x6c00b32dUL, 0x73e2bb14UL, +0xa0bebc3cUL, 0x54623779UL, 0x64459eabUL, 0x3f328b82UL, 0x7718cf82UL, 0x59a2cea6UL, +0x04ee002eUL, 0x89fe78e6UL, 0x3fab0950UL, 0x325ff6c2UL, 0x81383f05UL, 0x6963c5c8UL, +0x76cb5ad6UL, 0xd49974c9UL, 0xca180dcfUL, 0x380782d5UL, 0xc7fa5cf6UL, 0x8ac31511UL, +0x35e79e13UL, 0x47da91d0UL, 0xf40f9086UL, 0xa7e2419eUL, 0x31366241UL, 0x051ef495UL, +0xaa573b04UL, 0x4a805d8dUL, 0x548300d0UL, 0x00322a3cUL, 0xbf64cddfUL, 0xba57a68eUL, +0x75c6372bUL, 0x50afd341UL, 0xa7c13275UL, 0x915a0bf5UL, 0x6b54bfabUL, 0x2b0b1426UL, +0xab4cc9d7UL, 0x449ccd82UL, 0xf7fbf265UL, 0xab85c5f3UL, 0x1b55db94UL, 0xaad4e324UL, +0xcfa4bd3fUL, 0x2deaa3e2UL, 0x9e204d02UL, 0xc8bd25acUL, 0xeadf55b3UL, 0xd5bd9e98UL, +0xe31231b2UL, 0x2ad5ad6cUL, 0x954329deUL, 0xadbe4528UL, 0xd8710f69UL, 0xaa51c90fUL, +0xaa786bf6UL, 0x22513f1eUL, 0xaa51a79bUL, 0x2ad344ccUL, 0x7b5a41f0UL, 0xd37cfbadUL, +0x1b069505UL, 0x41ece491UL, 0xb4c332e6UL, 0x032268d4UL, 0xc9600accUL, 0xce387e6dUL, +0xbf6bb16cUL, 0x6a70fb78UL, 0x0d03d9c9UL, 0xd4df39deUL, 0xe01063daUL, 0x4736f464UL, +0x5ad328d8UL, 0xb347cc96UL, 0x75bb0fc3UL, 0x98511bfbUL, 0x4ffbcc35UL, 0xb58bcf6aUL, +0xe11f0abcUL, 0xbfc5fe4aUL, 0xa70aec10UL, 0xac39570aUL, 0x3f04442fUL, 0x6188b153UL, +0xe0397a2eUL, 0x5727cb79UL, 0x9ceb418fUL, 0x1cacd68dUL, 0x2ad37c96UL, 0x0175cb9dUL, +0xc69dff09UL, 0xc75b65f0UL, 0xd9db40d8UL, 0xec0e7779UL, 0x4744ead4UL, 0xb11c3274UL, +0xdd24cb9eUL, 0x7e1c54bdUL, 0xf01144f9UL, 0xd2240eb1UL, 0x9675b3fdUL, 0xa3ac3755UL, +0xd47c27afUL, 0x51c85f4dUL, 0x56907596UL, 0xa5bb15e6UL, 0x580304f0UL, 0xca042cf1UL, +0x011a37eaUL, 0x8dbfaadbUL, 0x35ba3e4aUL, 0x3526ffa0UL, 0xc37b4d09UL, 0xbc306ed9UL, +0x98a52666UL, 0x5648f725UL, 0xff5e569dUL, 0x0ced63d0UL, 0x7c63b2cfUL, 0x700b45e1UL, +0xd5ea50f1UL, 0x85a92872UL, 0xaf1fbda7UL, 0xd4234870UL, 0xa7870bf3UL, 0x2d3b4d79UL, +0x42e04198UL, 0x0cd0ede7UL, 0x26470db8UL, 0xf881814cUL, 0x474d6ad7UL, 0x7c0c5e5cUL, +0xd1231959UL, 0x381b7298UL, 0xf5d2f4dbUL, 0xab838653UL, 0x6e2f1e23UL, 0x83719c9eUL, +0xbd91e046UL, 0x9a56456eUL, 0xdc39200cUL, 0x20c8c571UL, 0x962bda1cUL, 0xe1e696ffUL, +0xb141ab08UL, 0x7cca89b9UL, 0x1a69e783UL, 0x02cc4843UL, 0xa2f7c579UL, 0x429ef47dUL, 0x427b169cUL, 0x5ac9f049UL, 0xdd8f0f00UL, 0x5c8165bfUL}; static const ulong32 S2[256] = { -0x1f201094UL, 0xef0ba75bUL, 0x69e3cf7eUL, 0x393f4380UL, 0xfe61cf7aUL, 0xeec5207aUL, -0x55889c94UL, 0x72fc0651UL, 0xada7ef79UL, 0x4e1d7235UL, 0xd55a63ceUL, 0xde0436baUL, -0x99c430efUL, 0x5f0c0794UL, 0x18dcdb7dUL, 0xa1d6eff3UL, 0xa0b52f7bUL, 0x59e83605UL, -0xee15b094UL, 0xe9ffd909UL, 0xdc440086UL, 0xef944459UL, 0xba83ccb3UL, 0xe0c3cdfbUL, -0xd1da4181UL, 0x3b092ab1UL, 0xf997f1c1UL, 0xa5e6cf7bUL, 0x01420ddbUL, 0xe4e7ef5bUL, -0x25a1ff41UL, 0xe180f806UL, 0x1fc41080UL, 0x179bee7aUL, 0xd37ac6a9UL, 0xfe5830a4UL, -0x98de8b7fUL, 0x77e83f4eUL, 0x79929269UL, 0x24fa9f7bUL, 0xe113c85bUL, 0xacc40083UL, -0xd7503525UL, 0xf7ea615fUL, 0x62143154UL, 0x0d554b63UL, 0x5d681121UL, 0xc866c359UL, -0x3d63cf73UL, 0xcee234c0UL, 0xd4d87e87UL, 0x5c672b21UL, 0x071f6181UL, 0x39f7627fUL, -0x361e3084UL, 0xe4eb573bUL, 0x602f64a4UL, 0xd63acd9cUL, 0x1bbc4635UL, 0x9e81032dUL, -0x2701f50cUL, 0x99847ab4UL, 0xa0e3df79UL, 0xba6cf38cUL, 0x10843094UL, 0x2537a95eUL, -0xf46f6ffeUL, 0xa1ff3b1fUL, 0x208cfb6aUL, 0x8f458c74UL, 0xd9e0a227UL, 0x4ec73a34UL, -0xfc884f69UL, 0x3e4de8dfUL, 0xef0e0088UL, 0x3559648dUL, 0x8a45388cUL, 0x1d804366UL, -0x721d9bfdUL, 0xa58684bbUL, 0xe8256333UL, 0x844e8212UL, 0x128d8098UL, 0xfed33fb4UL, -0xce280ae1UL, 0x27e19ba5UL, 0xd5a6c252UL, 0xe49754bdUL, 0xc5d655ddUL, 0xeb667064UL, -0x77840b4dUL, 0xa1b6a801UL, 0x84db26a9UL, 0xe0b56714UL, 0x21f043b7UL, 0xe5d05860UL, -0x54f03084UL, 0x066ff472UL, 0xa31aa153UL, 0xdadc4755UL, 0xb5625dbfUL, 0x68561be6UL, -0x83ca6b94UL, 0x2d6ed23bUL, 0xeccf01dbUL, 0xa6d3d0baUL, 0xb6803d5cUL, 0xaf77a709UL, -0x33b4a34cUL, 0x397bc8d6UL, 0x5ee22b95UL, 0x5f0e5304UL, 0x81ed6f61UL, 0x20e74364UL, -0xb45e1378UL, 0xde18639bUL, 0x881ca122UL, 0xb96726d1UL, 0x8049a7e8UL, 0x22b7da7bUL, -0x5e552d25UL, 0x5272d237UL, 0x79d2951cUL, 0xc60d894cUL, 0x488cb402UL, 0x1ba4fe5bUL, -0xa4b09f6bUL, 0x1ca815cfUL, 0xa20c3005UL, 0x8871df63UL, 0xb9de2fcbUL, 0x0cc6c9e9UL, -0x0beeff53UL, 0xe3214517UL, 0xb4542835UL, 0x9f63293cUL, 0xee41e729UL, 0x6e1d2d7cUL, -0x50045286UL, 0x1e6685f3UL, 0xf33401c6UL, 0x30a22c95UL, 0x31a70850UL, 0x60930f13UL, -0x73f98417UL, 0xa1269859UL, 0xec645c44UL, 0x52c877a9UL, 0xcdff33a6UL, 0xa02b1741UL, -0x7cbad9a2UL, 0x2180036fUL, 0x50d99c08UL, 0xcb3f4861UL, 0xc26bd765UL, 0x64a3f6abUL, -0x80342676UL, 0x25a75e7bUL, 0xe4e6d1fcUL, 0x20c710e6UL, 0xcdf0b680UL, 0x17844d3bUL, -0x31eef84dUL, 0x7e0824e4UL, 0x2ccb49ebUL, 0x846a3baeUL, 0x8ff77888UL, 0xee5d60f6UL, -0x7af75673UL, 0x2fdd5cdbUL, 0xa11631c1UL, 0x30f66f43UL, 0xb3faec54UL, 0x157fd7faUL, -0xef8579ccUL, 0xd152de58UL, 0xdb2ffd5eUL, 0x8f32ce19UL, 0x306af97aUL, 0x02f03ef8UL, -0x99319ad5UL, 0xc242fa0fUL, 0xa7e3ebb0UL, 0xc68e4906UL, 0xb8da230cUL, 0x80823028UL, -0xdcdef3c8UL, 0xd35fb171UL, 0x088a1bc8UL, 0xbec0c560UL, 0x61a3c9e8UL, 0xbca8f54dUL, -0xc72feffaUL, 0x22822e99UL, 0x82c570b4UL, 0xd8d94e89UL, 0x8b1c34bcUL, 0x301e16e6UL, -0x273be979UL, 0xb0ffeaa6UL, 0x61d9b8c6UL, 0x00b24869UL, 0xb7ffce3fUL, 0x08dc283bUL, -0x43daf65aUL, 0xf7e19798UL, 0x7619b72fUL, 0x8f1c9ba4UL, 0xdc8637a0UL, 0x16a7d3b1UL, -0x9fc393b7UL, 0xa7136eebUL, 0xc6bcc63eUL, 0x1a513742UL, 0xef6828bcUL, 0x520365d6UL, -0x2d6a77abUL, 0x3527ed4bUL, 0x821fd216UL, 0x095c6e2eUL, 0xdb92f2fbUL, 0x5eea29cbUL, -0x145892f5UL, 0x91584f7fUL, 0x5483697bUL, 0x2667a8ccUL, 0x85196048UL, 0x8c4baceaUL, -0x833860d4UL, 0x0d23e0f9UL, 0x6c387e8aUL, 0x0ae6d249UL, 0xb284600cUL, 0xd835731dUL, -0xdcb1c647UL, 0xac4c56eaUL, 0x3ebd81b3UL, 0x230eabb0UL, 0x6438bc87UL, 0xf0b5b1faUL, -0x8f5ea2b3UL, 0xfc184642UL, 0x0a036b7aUL, 0x4fb089bdUL, 0x649da589UL, 0xa345415eUL, -0x5c038323UL, 0x3e5d3bb9UL, 0x43d79572UL, 0x7e6dd07cUL, 0x06dfdf1eUL, 0x6c6cc4efUL, +0x1f201094UL, 0xef0ba75bUL, 0x69e3cf7eUL, 0x393f4380UL, 0xfe61cf7aUL, 0xeec5207aUL, +0x55889c94UL, 0x72fc0651UL, 0xada7ef79UL, 0x4e1d7235UL, 0xd55a63ceUL, 0xde0436baUL, +0x99c430efUL, 0x5f0c0794UL, 0x18dcdb7dUL, 0xa1d6eff3UL, 0xa0b52f7bUL, 0x59e83605UL, +0xee15b094UL, 0xe9ffd909UL, 0xdc440086UL, 0xef944459UL, 0xba83ccb3UL, 0xe0c3cdfbUL, +0xd1da4181UL, 0x3b092ab1UL, 0xf997f1c1UL, 0xa5e6cf7bUL, 0x01420ddbUL, 0xe4e7ef5bUL, +0x25a1ff41UL, 0xe180f806UL, 0x1fc41080UL, 0x179bee7aUL, 0xd37ac6a9UL, 0xfe5830a4UL, +0x98de8b7fUL, 0x77e83f4eUL, 0x79929269UL, 0x24fa9f7bUL, 0xe113c85bUL, 0xacc40083UL, +0xd7503525UL, 0xf7ea615fUL, 0x62143154UL, 0x0d554b63UL, 0x5d681121UL, 0xc866c359UL, +0x3d63cf73UL, 0xcee234c0UL, 0xd4d87e87UL, 0x5c672b21UL, 0x071f6181UL, 0x39f7627fUL, +0x361e3084UL, 0xe4eb573bUL, 0x602f64a4UL, 0xd63acd9cUL, 0x1bbc4635UL, 0x9e81032dUL, +0x2701f50cUL, 0x99847ab4UL, 0xa0e3df79UL, 0xba6cf38cUL, 0x10843094UL, 0x2537a95eUL, +0xf46f6ffeUL, 0xa1ff3b1fUL, 0x208cfb6aUL, 0x8f458c74UL, 0xd9e0a227UL, 0x4ec73a34UL, +0xfc884f69UL, 0x3e4de8dfUL, 0xef0e0088UL, 0x3559648dUL, 0x8a45388cUL, 0x1d804366UL, +0x721d9bfdUL, 0xa58684bbUL, 0xe8256333UL, 0x844e8212UL, 0x128d8098UL, 0xfed33fb4UL, +0xce280ae1UL, 0x27e19ba5UL, 0xd5a6c252UL, 0xe49754bdUL, 0xc5d655ddUL, 0xeb667064UL, +0x77840b4dUL, 0xa1b6a801UL, 0x84db26a9UL, 0xe0b56714UL, 0x21f043b7UL, 0xe5d05860UL, +0x54f03084UL, 0x066ff472UL, 0xa31aa153UL, 0xdadc4755UL, 0xb5625dbfUL, 0x68561be6UL, +0x83ca6b94UL, 0x2d6ed23bUL, 0xeccf01dbUL, 0xa6d3d0baUL, 0xb6803d5cUL, 0xaf77a709UL, +0x33b4a34cUL, 0x397bc8d6UL, 0x5ee22b95UL, 0x5f0e5304UL, 0x81ed6f61UL, 0x20e74364UL, +0xb45e1378UL, 0xde18639bUL, 0x881ca122UL, 0xb96726d1UL, 0x8049a7e8UL, 0x22b7da7bUL, +0x5e552d25UL, 0x5272d237UL, 0x79d2951cUL, 0xc60d894cUL, 0x488cb402UL, 0x1ba4fe5bUL, +0xa4b09f6bUL, 0x1ca815cfUL, 0xa20c3005UL, 0x8871df63UL, 0xb9de2fcbUL, 0x0cc6c9e9UL, +0x0beeff53UL, 0xe3214517UL, 0xb4542835UL, 0x9f63293cUL, 0xee41e729UL, 0x6e1d2d7cUL, +0x50045286UL, 0x1e6685f3UL, 0xf33401c6UL, 0x30a22c95UL, 0x31a70850UL, 0x60930f13UL, +0x73f98417UL, 0xa1269859UL, 0xec645c44UL, 0x52c877a9UL, 0xcdff33a6UL, 0xa02b1741UL, +0x7cbad9a2UL, 0x2180036fUL, 0x50d99c08UL, 0xcb3f4861UL, 0xc26bd765UL, 0x64a3f6abUL, +0x80342676UL, 0x25a75e7bUL, 0xe4e6d1fcUL, 0x20c710e6UL, 0xcdf0b680UL, 0x17844d3bUL, +0x31eef84dUL, 0x7e0824e4UL, 0x2ccb49ebUL, 0x846a3baeUL, 0x8ff77888UL, 0xee5d60f6UL, +0x7af75673UL, 0x2fdd5cdbUL, 0xa11631c1UL, 0x30f66f43UL, 0xb3faec54UL, 0x157fd7faUL, +0xef8579ccUL, 0xd152de58UL, 0xdb2ffd5eUL, 0x8f32ce19UL, 0x306af97aUL, 0x02f03ef8UL, +0x99319ad5UL, 0xc242fa0fUL, 0xa7e3ebb0UL, 0xc68e4906UL, 0xb8da230cUL, 0x80823028UL, +0xdcdef3c8UL, 0xd35fb171UL, 0x088a1bc8UL, 0xbec0c560UL, 0x61a3c9e8UL, 0xbca8f54dUL, +0xc72feffaUL, 0x22822e99UL, 0x82c570b4UL, 0xd8d94e89UL, 0x8b1c34bcUL, 0x301e16e6UL, +0x273be979UL, 0xb0ffeaa6UL, 0x61d9b8c6UL, 0x00b24869UL, 0xb7ffce3fUL, 0x08dc283bUL, +0x43daf65aUL, 0xf7e19798UL, 0x7619b72fUL, 0x8f1c9ba4UL, 0xdc8637a0UL, 0x16a7d3b1UL, +0x9fc393b7UL, 0xa7136eebUL, 0xc6bcc63eUL, 0x1a513742UL, 0xef6828bcUL, 0x520365d6UL, +0x2d6a77abUL, 0x3527ed4bUL, 0x821fd216UL, 0x095c6e2eUL, 0xdb92f2fbUL, 0x5eea29cbUL, +0x145892f5UL, 0x91584f7fUL, 0x5483697bUL, 0x2667a8ccUL, 0x85196048UL, 0x8c4baceaUL, +0x833860d4UL, 0x0d23e0f9UL, 0x6c387e8aUL, 0x0ae6d249UL, 0xb284600cUL, 0xd835731dUL, +0xdcb1c647UL, 0xac4c56eaUL, 0x3ebd81b3UL, 0x230eabb0UL, 0x6438bc87UL, 0xf0b5b1faUL, +0x8f5ea2b3UL, 0xfc184642UL, 0x0a036b7aUL, 0x4fb089bdUL, 0x649da589UL, 0xa345415eUL, +0x5c038323UL, 0x3e5d3bb9UL, 0x43d79572UL, 0x7e6dd07cUL, 0x06dfdf1eUL, 0x6c6cc4efUL, 0x7160a539UL, 0x73bfbe70UL, 0x83877605UL, 0x4523ecf1UL}; static const ulong32 S3[256] = { -0x8defc240UL, 0x25fa5d9fUL, 0xeb903dbfUL, 0xe810c907UL, 0x47607fffUL, 0x369fe44bUL, -0x8c1fc644UL, 0xaececa90UL, 0xbeb1f9bfUL, 0xeefbcaeaUL, 0xe8cf1950UL, 0x51df07aeUL, -0x920e8806UL, 0xf0ad0548UL, 0xe13c8d83UL, 0x927010d5UL, 0x11107d9fUL, 0x07647db9UL, -0xb2e3e4d4UL, 0x3d4f285eUL, 0xb9afa820UL, 0xfade82e0UL, 0xa067268bUL, 0x8272792eUL, -0x553fb2c0UL, 0x489ae22bUL, 0xd4ef9794UL, 0x125e3fbcUL, 0x21fffceeUL, 0x825b1bfdUL, -0x9255c5edUL, 0x1257a240UL, 0x4e1a8302UL, 0xbae07fffUL, 0x528246e7UL, 0x8e57140eUL, -0x3373f7bfUL, 0x8c9f8188UL, 0xa6fc4ee8UL, 0xc982b5a5UL, 0xa8c01db7UL, 0x579fc264UL, -0x67094f31UL, 0xf2bd3f5fUL, 0x40fff7c1UL, 0x1fb78dfcUL, 0x8e6bd2c1UL, 0x437be59bUL, -0x99b03dbfUL, 0xb5dbc64bUL, 0x638dc0e6UL, 0x55819d99UL, 0xa197c81cUL, 0x4a012d6eUL, -0xc5884a28UL, 0xccc36f71UL, 0xb843c213UL, 0x6c0743f1UL, 0x8309893cUL, 0x0feddd5fUL, -0x2f7fe850UL, 0xd7c07f7eUL, 0x02507fbfUL, 0x5afb9a04UL, 0xa747d2d0UL, 0x1651192eUL, -0xaf70bf3eUL, 0x58c31380UL, 0x5f98302eUL, 0x727cc3c4UL, 0x0a0fb402UL, 0x0f7fef82UL, -0x8c96fdadUL, 0x5d2c2aaeUL, 0x8ee99a49UL, 0x50da88b8UL, 0x8427f4a0UL, 0x1eac5790UL, -0x796fb449UL, 0x8252dc15UL, 0xefbd7d9bUL, 0xa672597dUL, 0xada840d8UL, 0x45f54504UL, -0xfa5d7403UL, 0xe83ec305UL, 0x4f91751aUL, 0x925669c2UL, 0x23efe941UL, 0xa903f12eUL, -0x60270df2UL, 0x0276e4b6UL, 0x94fd6574UL, 0x927985b2UL, 0x8276dbcbUL, 0x02778176UL, -0xf8af918dUL, 0x4e48f79eUL, 0x8f616ddfUL, 0xe29d840eUL, 0x842f7d83UL, 0x340ce5c8UL, -0x96bbb682UL, 0x93b4b148UL, 0xef303cabUL, 0x984faf28UL, 0x779faf9bUL, 0x92dc560dUL, -0x224d1e20UL, 0x8437aa88UL, 0x7d29dc96UL, 0x2756d3dcUL, 0x8b907ceeUL, 0xb51fd240UL, -0xe7c07ce3UL, 0xe566b4a1UL, 0xc3e9615eUL, 0x3cf8209dUL, 0x6094d1e3UL, 0xcd9ca341UL, -0x5c76460eUL, 0x00ea983bUL, 0xd4d67881UL, 0xfd47572cUL, 0xf76cedd9UL, 0xbda8229cUL, -0x127dadaaUL, 0x438a074eUL, 0x1f97c090UL, 0x081bdb8aUL, 0x93a07ebeUL, 0xb938ca15UL, -0x97b03cffUL, 0x3dc2c0f8UL, 0x8d1ab2ecUL, 0x64380e51UL, 0x68cc7bfbUL, 0xd90f2788UL, -0x12490181UL, 0x5de5ffd4UL, 0xdd7ef86aUL, 0x76a2e214UL, 0xb9a40368UL, 0x925d958fUL, -0x4b39fffaUL, 0xba39aee9UL, 0xa4ffd30bUL, 0xfaf7933bUL, 0x6d498623UL, 0x193cbcfaUL, -0x27627545UL, 0x825cf47aUL, 0x61bd8ba0UL, 0xd11e42d1UL, 0xcead04f4UL, 0x127ea392UL, -0x10428db7UL, 0x8272a972UL, 0x9270c4a8UL, 0x127de50bUL, 0x285ba1c8UL, 0x3c62f44fUL, -0x35c0eaa5UL, 0xe805d231UL, 0x428929fbUL, 0xb4fcdf82UL, 0x4fb66a53UL, 0x0e7dc15bUL, -0x1f081fabUL, 0x108618aeUL, 0xfcfd086dUL, 0xf9ff2889UL, 0x694bcc11UL, 0x236a5caeUL, -0x12deca4dUL, 0x2c3f8cc5UL, 0xd2d02dfeUL, 0xf8ef5896UL, 0xe4cf52daUL, 0x95155b67UL, -0x494a488cUL, 0xb9b6a80cUL, 0x5c8f82bcUL, 0x89d36b45UL, 0x3a609437UL, 0xec00c9a9UL, -0x44715253UL, 0x0a874b49UL, 0xd773bc40UL, 0x7c34671cUL, 0x02717ef6UL, 0x4feb5536UL, -0xa2d02fffUL, 0xd2bf60c4UL, 0xd43f03c0UL, 0x50b4ef6dUL, 0x07478cd1UL, 0x006e1888UL, -0xa2e53f55UL, 0xb9e6d4bcUL, 0xa2048016UL, 0x97573833UL, 0xd7207d67UL, 0xde0f8f3dUL, -0x72f87b33UL, 0xabcc4f33UL, 0x7688c55dUL, 0x7b00a6b0UL, 0x947b0001UL, 0x570075d2UL, -0xf9bb88f8UL, 0x8942019eUL, 0x4264a5ffUL, 0x856302e0UL, 0x72dbd92bUL, 0xee971b69UL, -0x6ea22fdeUL, 0x5f08ae2bUL, 0xaf7a616dUL, 0xe5c98767UL, 0xcf1febd2UL, 0x61efc8c2UL, -0xf1ac2571UL, 0xcc8239c2UL, 0x67214cb8UL, 0xb1e583d1UL, 0xb7dc3e62UL, 0x7f10bdceUL, -0xf90a5c38UL, 0x0ff0443dUL, 0x606e6dc6UL, 0x60543a49UL, 0x5727c148UL, 0x2be98a1dUL, -0x8ab41738UL, 0x20e1be24UL, 0xaf96da0fUL, 0x68458425UL, 0x99833be5UL, 0x600d457dUL, -0x282f9350UL, 0x8334b362UL, 0xd91d1120UL, 0x2b6d8da0UL, 0x642b1e31UL, 0x9c305a00UL, -0x52bce688UL, 0x1b03588aUL, 0xf7baefd5UL, 0x4142ed9cUL, 0xa4315c11UL, 0x83323ec5UL, +0x8defc240UL, 0x25fa5d9fUL, 0xeb903dbfUL, 0xe810c907UL, 0x47607fffUL, 0x369fe44bUL, +0x8c1fc644UL, 0xaececa90UL, 0xbeb1f9bfUL, 0xeefbcaeaUL, 0xe8cf1950UL, 0x51df07aeUL, +0x920e8806UL, 0xf0ad0548UL, 0xe13c8d83UL, 0x927010d5UL, 0x11107d9fUL, 0x07647db9UL, +0xb2e3e4d4UL, 0x3d4f285eUL, 0xb9afa820UL, 0xfade82e0UL, 0xa067268bUL, 0x8272792eUL, +0x553fb2c0UL, 0x489ae22bUL, 0xd4ef9794UL, 0x125e3fbcUL, 0x21fffceeUL, 0x825b1bfdUL, +0x9255c5edUL, 0x1257a240UL, 0x4e1a8302UL, 0xbae07fffUL, 0x528246e7UL, 0x8e57140eUL, +0x3373f7bfUL, 0x8c9f8188UL, 0xa6fc4ee8UL, 0xc982b5a5UL, 0xa8c01db7UL, 0x579fc264UL, +0x67094f31UL, 0xf2bd3f5fUL, 0x40fff7c1UL, 0x1fb78dfcUL, 0x8e6bd2c1UL, 0x437be59bUL, +0x99b03dbfUL, 0xb5dbc64bUL, 0x638dc0e6UL, 0x55819d99UL, 0xa197c81cUL, 0x4a012d6eUL, +0xc5884a28UL, 0xccc36f71UL, 0xb843c213UL, 0x6c0743f1UL, 0x8309893cUL, 0x0feddd5fUL, +0x2f7fe850UL, 0xd7c07f7eUL, 0x02507fbfUL, 0x5afb9a04UL, 0xa747d2d0UL, 0x1651192eUL, +0xaf70bf3eUL, 0x58c31380UL, 0x5f98302eUL, 0x727cc3c4UL, 0x0a0fb402UL, 0x0f7fef82UL, +0x8c96fdadUL, 0x5d2c2aaeUL, 0x8ee99a49UL, 0x50da88b8UL, 0x8427f4a0UL, 0x1eac5790UL, +0x796fb449UL, 0x8252dc15UL, 0xefbd7d9bUL, 0xa672597dUL, 0xada840d8UL, 0x45f54504UL, +0xfa5d7403UL, 0xe83ec305UL, 0x4f91751aUL, 0x925669c2UL, 0x23efe941UL, 0xa903f12eUL, +0x60270df2UL, 0x0276e4b6UL, 0x94fd6574UL, 0x927985b2UL, 0x8276dbcbUL, 0x02778176UL, +0xf8af918dUL, 0x4e48f79eUL, 0x8f616ddfUL, 0xe29d840eUL, 0x842f7d83UL, 0x340ce5c8UL, +0x96bbb682UL, 0x93b4b148UL, 0xef303cabUL, 0x984faf28UL, 0x779faf9bUL, 0x92dc560dUL, +0x224d1e20UL, 0x8437aa88UL, 0x7d29dc96UL, 0x2756d3dcUL, 0x8b907ceeUL, 0xb51fd240UL, +0xe7c07ce3UL, 0xe566b4a1UL, 0xc3e9615eUL, 0x3cf8209dUL, 0x6094d1e3UL, 0xcd9ca341UL, +0x5c76460eUL, 0x00ea983bUL, 0xd4d67881UL, 0xfd47572cUL, 0xf76cedd9UL, 0xbda8229cUL, +0x127dadaaUL, 0x438a074eUL, 0x1f97c090UL, 0x081bdb8aUL, 0x93a07ebeUL, 0xb938ca15UL, +0x97b03cffUL, 0x3dc2c0f8UL, 0x8d1ab2ecUL, 0x64380e51UL, 0x68cc7bfbUL, 0xd90f2788UL, +0x12490181UL, 0x5de5ffd4UL, 0xdd7ef86aUL, 0x76a2e214UL, 0xb9a40368UL, 0x925d958fUL, +0x4b39fffaUL, 0xba39aee9UL, 0xa4ffd30bUL, 0xfaf7933bUL, 0x6d498623UL, 0x193cbcfaUL, +0x27627545UL, 0x825cf47aUL, 0x61bd8ba0UL, 0xd11e42d1UL, 0xcead04f4UL, 0x127ea392UL, +0x10428db7UL, 0x8272a972UL, 0x9270c4a8UL, 0x127de50bUL, 0x285ba1c8UL, 0x3c62f44fUL, +0x35c0eaa5UL, 0xe805d231UL, 0x428929fbUL, 0xb4fcdf82UL, 0x4fb66a53UL, 0x0e7dc15bUL, +0x1f081fabUL, 0x108618aeUL, 0xfcfd086dUL, 0xf9ff2889UL, 0x694bcc11UL, 0x236a5caeUL, +0x12deca4dUL, 0x2c3f8cc5UL, 0xd2d02dfeUL, 0xf8ef5896UL, 0xe4cf52daUL, 0x95155b67UL, +0x494a488cUL, 0xb9b6a80cUL, 0x5c8f82bcUL, 0x89d36b45UL, 0x3a609437UL, 0xec00c9a9UL, +0x44715253UL, 0x0a874b49UL, 0xd773bc40UL, 0x7c34671cUL, 0x02717ef6UL, 0x4feb5536UL, +0xa2d02fffUL, 0xd2bf60c4UL, 0xd43f03c0UL, 0x50b4ef6dUL, 0x07478cd1UL, 0x006e1888UL, +0xa2e53f55UL, 0xb9e6d4bcUL, 0xa2048016UL, 0x97573833UL, 0xd7207d67UL, 0xde0f8f3dUL, +0x72f87b33UL, 0xabcc4f33UL, 0x7688c55dUL, 0x7b00a6b0UL, 0x947b0001UL, 0x570075d2UL, +0xf9bb88f8UL, 0x8942019eUL, 0x4264a5ffUL, 0x856302e0UL, 0x72dbd92bUL, 0xee971b69UL, +0x6ea22fdeUL, 0x5f08ae2bUL, 0xaf7a616dUL, 0xe5c98767UL, 0xcf1febd2UL, 0x61efc8c2UL, +0xf1ac2571UL, 0xcc8239c2UL, 0x67214cb8UL, 0xb1e583d1UL, 0xb7dc3e62UL, 0x7f10bdceUL, +0xf90a5c38UL, 0x0ff0443dUL, 0x606e6dc6UL, 0x60543a49UL, 0x5727c148UL, 0x2be98a1dUL, +0x8ab41738UL, 0x20e1be24UL, 0xaf96da0fUL, 0x68458425UL, 0x99833be5UL, 0x600d457dUL, +0x282f9350UL, 0x8334b362UL, 0xd91d1120UL, 0x2b6d8da0UL, 0x642b1e31UL, 0x9c305a00UL, +0x52bce688UL, 0x1b03588aUL, 0xf7baefd5UL, 0x4142ed9cUL, 0xa4315c11UL, 0x83323ec5UL, 0xdfef4636UL, 0xa133c501UL, 0xe9d3531cUL, 0xee353783UL}; static const ulong32 S4[256] = { -0x9db30420UL, 0x1fb6e9deUL, 0xa7be7befUL, 0xd273a298UL, 0x4a4f7bdbUL, 0x64ad8c57UL, -0x85510443UL, 0xfa020ed1UL, 0x7e287affUL, 0xe60fb663UL, 0x095f35a1UL, 0x79ebf120UL, -0xfd059d43UL, 0x6497b7b1UL, 0xf3641f63UL, 0x241e4adfUL, 0x28147f5fUL, 0x4fa2b8cdUL, -0xc9430040UL, 0x0cc32220UL, 0xfdd30b30UL, 0xc0a5374fUL, 0x1d2d00d9UL, 0x24147b15UL, -0xee4d111aUL, 0x0fca5167UL, 0x71ff904cUL, 0x2d195ffeUL, 0x1a05645fUL, 0x0c13fefeUL, -0x081b08caUL, 0x05170121UL, 0x80530100UL, 0xe83e5efeUL, 0xac9af4f8UL, 0x7fe72701UL, -0xd2b8ee5fUL, 0x06df4261UL, 0xbb9e9b8aUL, 0x7293ea25UL, 0xce84ffdfUL, 0xf5718801UL, -0x3dd64b04UL, 0xa26f263bUL, 0x7ed48400UL, 0x547eebe6UL, 0x446d4ca0UL, 0x6cf3d6f5UL, -0x2649abdfUL, 0xaea0c7f5UL, 0x36338cc1UL, 0x503f7e93UL, 0xd3772061UL, 0x11b638e1UL, -0x72500e03UL, 0xf80eb2bbUL, 0xabe0502eUL, 0xec8d77deUL, 0x57971e81UL, 0xe14f6746UL, -0xc9335400UL, 0x6920318fUL, 0x081dbb99UL, 0xffc304a5UL, 0x4d351805UL, 0x7f3d5ce3UL, -0xa6c866c6UL, 0x5d5bcca9UL, 0xdaec6feaUL, 0x9f926f91UL, 0x9f46222fUL, 0x3991467dUL, -0xa5bf6d8eUL, 0x1143c44fUL, 0x43958302UL, 0xd0214eebUL, 0x022083b8UL, 0x3fb6180cUL, -0x18f8931eUL, 0x281658e6UL, 0x26486e3eUL, 0x8bd78a70UL, 0x7477e4c1UL, 0xb506e07cUL, -0xf32d0a25UL, 0x79098b02UL, 0xe4eabb81UL, 0x28123b23UL, 0x69dead38UL, 0x1574ca16UL, -0xdf871b62UL, 0x211c40b7UL, 0xa51a9ef9UL, 0x0014377bUL, 0x041e8ac8UL, 0x09114003UL, -0xbd59e4d2UL, 0xe3d156d5UL, 0x4fe876d5UL, 0x2f91a340UL, 0x557be8deUL, 0x00eae4a7UL, -0x0ce5c2ecUL, 0x4db4bba6UL, 0xe756bdffUL, 0xdd3369acUL, 0xec17b035UL, 0x06572327UL, -0x99afc8b0UL, 0x56c8c391UL, 0x6b65811cUL, 0x5e146119UL, 0x6e85cb75UL, 0xbe07c002UL, -0xc2325577UL, 0x893ff4ecUL, 0x5bbfc92dUL, 0xd0ec3b25UL, 0xb7801ab7UL, 0x8d6d3b24UL, -0x20c763efUL, 0xc366a5fcUL, 0x9c382880UL, 0x0ace3205UL, 0xaac9548aUL, 0xeca1d7c7UL, -0x041afa32UL, 0x1d16625aUL, 0x6701902cUL, 0x9b757a54UL, 0x31d477f7UL, 0x9126b031UL, -0x36cc6fdbUL, 0xc70b8b46UL, 0xd9e66a48UL, 0x56e55a79UL, 0x026a4cebUL, 0x52437effUL, -0x2f8f76b4UL, 0x0df980a5UL, 0x8674cde3UL, 0xedda04ebUL, 0x17a9be04UL, 0x2c18f4dfUL, -0xb7747f9dUL, 0xab2af7b4UL, 0xefc34d20UL, 0x2e096b7cUL, 0x1741a254UL, 0xe5b6a035UL, -0x213d42f6UL, 0x2c1c7c26UL, 0x61c2f50fUL, 0x6552daf9UL, 0xd2c231f8UL, 0x25130f69UL, -0xd8167fa2UL, 0x0418f2c8UL, 0x001a96a6UL, 0x0d1526abUL, 0x63315c21UL, 0x5e0a72ecUL, -0x49bafefdUL, 0x187908d9UL, 0x8d0dbd86UL, 0x311170a7UL, 0x3e9b640cUL, 0xcc3e10d7UL, -0xd5cad3b6UL, 0x0caec388UL, 0xf73001e1UL, 0x6c728affUL, 0x71eae2a1UL, 0x1f9af36eUL, -0xcfcbd12fUL, 0xc1de8417UL, 0xac07be6bUL, 0xcb44a1d8UL, 0x8b9b0f56UL, 0x013988c3UL, -0xb1c52fcaUL, 0xb4be31cdUL, 0xd8782806UL, 0x12a3a4e2UL, 0x6f7de532UL, 0x58fd7eb6UL, -0xd01ee900UL, 0x24adffc2UL, 0xf4990fc5UL, 0x9711aac5UL, 0x001d7b95UL, 0x82e5e7d2UL, -0x109873f6UL, 0x00613096UL, 0xc32d9521UL, 0xada121ffUL, 0x29908415UL, 0x7fbb977fUL, -0xaf9eb3dbUL, 0x29c9ed2aUL, 0x5ce2a465UL, 0xa730f32cUL, 0xd0aa3fe8UL, 0x8a5cc091UL, -0xd49e2ce7UL, 0x0ce454a9UL, 0xd60acd86UL, 0x015f1919UL, 0x77079103UL, 0xdea03af6UL, -0x78a8565eUL, 0xdee356dfUL, 0x21f05cbeUL, 0x8b75e387UL, 0xb3c50651UL, 0xb8a5c3efUL, -0xd8eeb6d2UL, 0xe523be77UL, 0xc2154529UL, 0x2f69efdfUL, 0xafe67afbUL, 0xf470c4b2UL, -0xf3e0eb5bUL, 0xd6cc9876UL, 0x39e4460cUL, 0x1fda8538UL, 0x1987832fUL, 0xca007367UL, -0xa99144f8UL, 0x296b299eUL, 0x492fc295UL, 0x9266beabUL, 0xb5676e69UL, 0x9bd3dddaUL, -0xdf7e052fUL, 0xdb25701cUL, 0x1b5e51eeUL, 0xf65324e6UL, 0x6afce36cUL, 0x0316cc04UL, -0x8644213eUL, 0xb7dc59d0UL, 0x7965291fUL, 0xccd6fd43UL, 0x41823979UL, 0x932bcdf6UL, -0xb657c34dUL, 0x4edfd282UL, 0x7ae5290cUL, 0x3cb9536bUL, 0x851e20feUL, 0x9833557eUL, +0x9db30420UL, 0x1fb6e9deUL, 0xa7be7befUL, 0xd273a298UL, 0x4a4f7bdbUL, 0x64ad8c57UL, +0x85510443UL, 0xfa020ed1UL, 0x7e287affUL, 0xe60fb663UL, 0x095f35a1UL, 0x79ebf120UL, +0xfd059d43UL, 0x6497b7b1UL, 0xf3641f63UL, 0x241e4adfUL, 0x28147f5fUL, 0x4fa2b8cdUL, +0xc9430040UL, 0x0cc32220UL, 0xfdd30b30UL, 0xc0a5374fUL, 0x1d2d00d9UL, 0x24147b15UL, +0xee4d111aUL, 0x0fca5167UL, 0x71ff904cUL, 0x2d195ffeUL, 0x1a05645fUL, 0x0c13fefeUL, +0x081b08caUL, 0x05170121UL, 0x80530100UL, 0xe83e5efeUL, 0xac9af4f8UL, 0x7fe72701UL, +0xd2b8ee5fUL, 0x06df4261UL, 0xbb9e9b8aUL, 0x7293ea25UL, 0xce84ffdfUL, 0xf5718801UL, +0x3dd64b04UL, 0xa26f263bUL, 0x7ed48400UL, 0x547eebe6UL, 0x446d4ca0UL, 0x6cf3d6f5UL, +0x2649abdfUL, 0xaea0c7f5UL, 0x36338cc1UL, 0x503f7e93UL, 0xd3772061UL, 0x11b638e1UL, +0x72500e03UL, 0xf80eb2bbUL, 0xabe0502eUL, 0xec8d77deUL, 0x57971e81UL, 0xe14f6746UL, +0xc9335400UL, 0x6920318fUL, 0x081dbb99UL, 0xffc304a5UL, 0x4d351805UL, 0x7f3d5ce3UL, +0xa6c866c6UL, 0x5d5bcca9UL, 0xdaec6feaUL, 0x9f926f91UL, 0x9f46222fUL, 0x3991467dUL, +0xa5bf6d8eUL, 0x1143c44fUL, 0x43958302UL, 0xd0214eebUL, 0x022083b8UL, 0x3fb6180cUL, +0x18f8931eUL, 0x281658e6UL, 0x26486e3eUL, 0x8bd78a70UL, 0x7477e4c1UL, 0xb506e07cUL, +0xf32d0a25UL, 0x79098b02UL, 0xe4eabb81UL, 0x28123b23UL, 0x69dead38UL, 0x1574ca16UL, +0xdf871b62UL, 0x211c40b7UL, 0xa51a9ef9UL, 0x0014377bUL, 0x041e8ac8UL, 0x09114003UL, +0xbd59e4d2UL, 0xe3d156d5UL, 0x4fe876d5UL, 0x2f91a340UL, 0x557be8deUL, 0x00eae4a7UL, +0x0ce5c2ecUL, 0x4db4bba6UL, 0xe756bdffUL, 0xdd3369acUL, 0xec17b035UL, 0x06572327UL, +0x99afc8b0UL, 0x56c8c391UL, 0x6b65811cUL, 0x5e146119UL, 0x6e85cb75UL, 0xbe07c002UL, +0xc2325577UL, 0x893ff4ecUL, 0x5bbfc92dUL, 0xd0ec3b25UL, 0xb7801ab7UL, 0x8d6d3b24UL, +0x20c763efUL, 0xc366a5fcUL, 0x9c382880UL, 0x0ace3205UL, 0xaac9548aUL, 0xeca1d7c7UL, +0x041afa32UL, 0x1d16625aUL, 0x6701902cUL, 0x9b757a54UL, 0x31d477f7UL, 0x9126b031UL, +0x36cc6fdbUL, 0xc70b8b46UL, 0xd9e66a48UL, 0x56e55a79UL, 0x026a4cebUL, 0x52437effUL, +0x2f8f76b4UL, 0x0df980a5UL, 0x8674cde3UL, 0xedda04ebUL, 0x17a9be04UL, 0x2c18f4dfUL, +0xb7747f9dUL, 0xab2af7b4UL, 0xefc34d20UL, 0x2e096b7cUL, 0x1741a254UL, 0xe5b6a035UL, +0x213d42f6UL, 0x2c1c7c26UL, 0x61c2f50fUL, 0x6552daf9UL, 0xd2c231f8UL, 0x25130f69UL, +0xd8167fa2UL, 0x0418f2c8UL, 0x001a96a6UL, 0x0d1526abUL, 0x63315c21UL, 0x5e0a72ecUL, +0x49bafefdUL, 0x187908d9UL, 0x8d0dbd86UL, 0x311170a7UL, 0x3e9b640cUL, 0xcc3e10d7UL, +0xd5cad3b6UL, 0x0caec388UL, 0xf73001e1UL, 0x6c728affUL, 0x71eae2a1UL, 0x1f9af36eUL, +0xcfcbd12fUL, 0xc1de8417UL, 0xac07be6bUL, 0xcb44a1d8UL, 0x8b9b0f56UL, 0x013988c3UL, +0xb1c52fcaUL, 0xb4be31cdUL, 0xd8782806UL, 0x12a3a4e2UL, 0x6f7de532UL, 0x58fd7eb6UL, +0xd01ee900UL, 0x24adffc2UL, 0xf4990fc5UL, 0x9711aac5UL, 0x001d7b95UL, 0x82e5e7d2UL, +0x109873f6UL, 0x00613096UL, 0xc32d9521UL, 0xada121ffUL, 0x29908415UL, 0x7fbb977fUL, +0xaf9eb3dbUL, 0x29c9ed2aUL, 0x5ce2a465UL, 0xa730f32cUL, 0xd0aa3fe8UL, 0x8a5cc091UL, +0xd49e2ce7UL, 0x0ce454a9UL, 0xd60acd86UL, 0x015f1919UL, 0x77079103UL, 0xdea03af6UL, +0x78a8565eUL, 0xdee356dfUL, 0x21f05cbeUL, 0x8b75e387UL, 0xb3c50651UL, 0xb8a5c3efUL, +0xd8eeb6d2UL, 0xe523be77UL, 0xc2154529UL, 0x2f69efdfUL, 0xafe67afbUL, 0xf470c4b2UL, +0xf3e0eb5bUL, 0xd6cc9876UL, 0x39e4460cUL, 0x1fda8538UL, 0x1987832fUL, 0xca007367UL, +0xa99144f8UL, 0x296b299eUL, 0x492fc295UL, 0x9266beabUL, 0xb5676e69UL, 0x9bd3dddaUL, +0xdf7e052fUL, 0xdb25701cUL, 0x1b5e51eeUL, 0xf65324e6UL, 0x6afce36cUL, 0x0316cc04UL, +0x8644213eUL, 0xb7dc59d0UL, 0x7965291fUL, 0xccd6fd43UL, 0x41823979UL, 0x932bcdf6UL, +0xb657c34dUL, 0x4edfd282UL, 0x7ae5290cUL, 0x3cb9536bUL, 0x851e20feUL, 0x9833557eUL, 0x13ecf0b0UL, 0xd3ffb372UL, 0x3f85c5c1UL, 0x0aef7ed2UL}; static const ulong32 S5[256] = { -0x7ec90c04UL, 0x2c6e74b9UL, 0x9b0e66dfUL, 0xa6337911UL, 0xb86a7fffUL, 0x1dd358f5UL, -0x44dd9d44UL, 0x1731167fUL, 0x08fbf1faUL, 0xe7f511ccUL, 0xd2051b00UL, 0x735aba00UL, -0x2ab722d8UL, 0x386381cbUL, 0xacf6243aUL, 0x69befd7aUL, 0xe6a2e77fUL, 0xf0c720cdUL, -0xc4494816UL, 0xccf5c180UL, 0x38851640UL, 0x15b0a848UL, 0xe68b18cbUL, 0x4caadeffUL, -0x5f480a01UL, 0x0412b2aaUL, 0x259814fcUL, 0x41d0efe2UL, 0x4e40b48dUL, 0x248eb6fbUL, -0x8dba1cfeUL, 0x41a99b02UL, 0x1a550a04UL, 0xba8f65cbUL, 0x7251f4e7UL, 0x95a51725UL, -0xc106ecd7UL, 0x97a5980aUL, 0xc539b9aaUL, 0x4d79fe6aUL, 0xf2f3f763UL, 0x68af8040UL, -0xed0c9e56UL, 0x11b4958bUL, 0xe1eb5a88UL, 0x8709e6b0UL, 0xd7e07156UL, 0x4e29fea7UL, -0x6366e52dUL, 0x02d1c000UL, 0xc4ac8e05UL, 0x9377f571UL, 0x0c05372aUL, 0x578535f2UL, -0x2261be02UL, 0xd642a0c9UL, 0xdf13a280UL, 0x74b55bd2UL, 0x682199c0UL, 0xd421e5ecUL, -0x53fb3ce8UL, 0xc8adedb3UL, 0x28a87fc9UL, 0x3d959981UL, 0x5c1ff900UL, 0xfe38d399UL, -0x0c4eff0bUL, 0x062407eaUL, 0xaa2f4fb1UL, 0x4fb96976UL, 0x90c79505UL, 0xb0a8a774UL, -0xef55a1ffUL, 0xe59ca2c2UL, 0xa6b62d27UL, 0xe66a4263UL, 0xdf65001fUL, 0x0ec50966UL, -0xdfdd55bcUL, 0x29de0655UL, 0x911e739aUL, 0x17af8975UL, 0x32c7911cUL, 0x89f89468UL, -0x0d01e980UL, 0x524755f4UL, 0x03b63cc9UL, 0x0cc844b2UL, 0xbcf3f0aaUL, 0x87ac36e9UL, -0xe53a7426UL, 0x01b3d82bUL, 0x1a9e7449UL, 0x64ee2d7eUL, 0xcddbb1daUL, 0x01c94910UL, -0xb868bf80UL, 0x0d26f3fdUL, 0x9342ede7UL, 0x04a5c284UL, 0x636737b6UL, 0x50f5b616UL, -0xf24766e3UL, 0x8eca36c1UL, 0x136e05dbUL, 0xfef18391UL, 0xfb887a37UL, 0xd6e7f7d4UL, -0xc7fb7dc9UL, 0x3063fcdfUL, 0xb6f589deUL, 0xec2941daUL, 0x26e46695UL, 0xb7566419UL, -0xf654efc5UL, 0xd08d58b7UL, 0x48925401UL, 0xc1bacb7fUL, 0xe5ff550fUL, 0xb6083049UL, -0x5bb5d0e8UL, 0x87d72e5aUL, 0xab6a6ee1UL, 0x223a66ceUL, 0xc62bf3cdUL, 0x9e0885f9UL, -0x68cb3e47UL, 0x086c010fUL, 0xa21de820UL, 0xd18b69deUL, 0xf3f65777UL, 0xfa02c3f6UL, -0x407edac3UL, 0xcbb3d550UL, 0x1793084dUL, 0xb0d70ebaUL, 0x0ab378d5UL, 0xd951fb0cUL, -0xded7da56UL, 0x4124bbe4UL, 0x94ca0b56UL, 0x0f5755d1UL, 0xe0e1e56eUL, 0x6184b5beUL, -0x580a249fUL, 0x94f74bc0UL, 0xe327888eUL, 0x9f7b5561UL, 0xc3dc0280UL, 0x05687715UL, -0x646c6bd7UL, 0x44904db3UL, 0x66b4f0a3UL, 0xc0f1648aUL, 0x697ed5afUL, 0x49e92ff6UL, -0x309e374fUL, 0x2cb6356aUL, 0x85808573UL, 0x4991f840UL, 0x76f0ae02UL, 0x083be84dUL, -0x28421c9aUL, 0x44489406UL, 0x736e4cb8UL, 0xc1092910UL, 0x8bc95fc6UL, 0x7d869cf4UL, -0x134f616fUL, 0x2e77118dUL, 0xb31b2be1UL, 0xaa90b472UL, 0x3ca5d717UL, 0x7d161bbaUL, -0x9cad9010UL, 0xaf462ba2UL, 0x9fe459d2UL, 0x45d34559UL, 0xd9f2da13UL, 0xdbc65487UL, -0xf3e4f94eUL, 0x176d486fUL, 0x097c13eaUL, 0x631da5c7UL, 0x445f7382UL, 0x175683f4UL, -0xcdc66a97UL, 0x70be0288UL, 0xb3cdcf72UL, 0x6e5dd2f3UL, 0x20936079UL, 0x459b80a5UL, -0xbe60e2dbUL, 0xa9c23101UL, 0xeba5315cUL, 0x224e42f2UL, 0x1c5c1572UL, 0xf6721b2cUL, -0x1ad2fff3UL, 0x8c25404eUL, 0x324ed72fUL, 0x4067b7fdUL, 0x0523138eUL, 0x5ca3bc78UL, -0xdc0fd66eUL, 0x75922283UL, 0x784d6b17UL, 0x58ebb16eUL, 0x44094f85UL, 0x3f481d87UL, -0xfcfeae7bUL, 0x77b5ff76UL, 0x8c2302bfUL, 0xaaf47556UL, 0x5f46b02aUL, 0x2b092801UL, -0x3d38f5f7UL, 0x0ca81f36UL, 0x52af4a8aUL, 0x66d5e7c0UL, 0xdf3b0874UL, 0x95055110UL, -0x1b5ad7a8UL, 0xf61ed5adUL, 0x6cf6e479UL, 0x20758184UL, 0xd0cefa65UL, 0x88f7be58UL, -0x4a046826UL, 0x0ff6f8f3UL, 0xa09c7f70UL, 0x5346aba0UL, 0x5ce96c28UL, 0xe176eda3UL, -0x6bac307fUL, 0x376829d2UL, 0x85360fa9UL, 0x17e3fe2aUL, 0x24b79767UL, 0xf5a96b20UL, -0xd6cd2595UL, 0x68ff1ebfUL, 0x7555442cUL, 0xf19f06beUL, 0xf9e0659aUL, 0xeeb9491dUL, -0x34010718UL, 0xbb30cab8UL, 0xe822fe15UL, 0x88570983UL, 0x750e6249UL, 0xda627e55UL, +0x7ec90c04UL, 0x2c6e74b9UL, 0x9b0e66dfUL, 0xa6337911UL, 0xb86a7fffUL, 0x1dd358f5UL, +0x44dd9d44UL, 0x1731167fUL, 0x08fbf1faUL, 0xe7f511ccUL, 0xd2051b00UL, 0x735aba00UL, +0x2ab722d8UL, 0x386381cbUL, 0xacf6243aUL, 0x69befd7aUL, 0xe6a2e77fUL, 0xf0c720cdUL, +0xc4494816UL, 0xccf5c180UL, 0x38851640UL, 0x15b0a848UL, 0xe68b18cbUL, 0x4caadeffUL, +0x5f480a01UL, 0x0412b2aaUL, 0x259814fcUL, 0x41d0efe2UL, 0x4e40b48dUL, 0x248eb6fbUL, +0x8dba1cfeUL, 0x41a99b02UL, 0x1a550a04UL, 0xba8f65cbUL, 0x7251f4e7UL, 0x95a51725UL, +0xc106ecd7UL, 0x97a5980aUL, 0xc539b9aaUL, 0x4d79fe6aUL, 0xf2f3f763UL, 0x68af8040UL, +0xed0c9e56UL, 0x11b4958bUL, 0xe1eb5a88UL, 0x8709e6b0UL, 0xd7e07156UL, 0x4e29fea7UL, +0x6366e52dUL, 0x02d1c000UL, 0xc4ac8e05UL, 0x9377f571UL, 0x0c05372aUL, 0x578535f2UL, +0x2261be02UL, 0xd642a0c9UL, 0xdf13a280UL, 0x74b55bd2UL, 0x682199c0UL, 0xd421e5ecUL, +0x53fb3ce8UL, 0xc8adedb3UL, 0x28a87fc9UL, 0x3d959981UL, 0x5c1ff900UL, 0xfe38d399UL, +0x0c4eff0bUL, 0x062407eaUL, 0xaa2f4fb1UL, 0x4fb96976UL, 0x90c79505UL, 0xb0a8a774UL, +0xef55a1ffUL, 0xe59ca2c2UL, 0xa6b62d27UL, 0xe66a4263UL, 0xdf65001fUL, 0x0ec50966UL, +0xdfdd55bcUL, 0x29de0655UL, 0x911e739aUL, 0x17af8975UL, 0x32c7911cUL, 0x89f89468UL, +0x0d01e980UL, 0x524755f4UL, 0x03b63cc9UL, 0x0cc844b2UL, 0xbcf3f0aaUL, 0x87ac36e9UL, +0xe53a7426UL, 0x01b3d82bUL, 0x1a9e7449UL, 0x64ee2d7eUL, 0xcddbb1daUL, 0x01c94910UL, +0xb868bf80UL, 0x0d26f3fdUL, 0x9342ede7UL, 0x04a5c284UL, 0x636737b6UL, 0x50f5b616UL, +0xf24766e3UL, 0x8eca36c1UL, 0x136e05dbUL, 0xfef18391UL, 0xfb887a37UL, 0xd6e7f7d4UL, +0xc7fb7dc9UL, 0x3063fcdfUL, 0xb6f589deUL, 0xec2941daUL, 0x26e46695UL, 0xb7566419UL, +0xf654efc5UL, 0xd08d58b7UL, 0x48925401UL, 0xc1bacb7fUL, 0xe5ff550fUL, 0xb6083049UL, +0x5bb5d0e8UL, 0x87d72e5aUL, 0xab6a6ee1UL, 0x223a66ceUL, 0xc62bf3cdUL, 0x9e0885f9UL, +0x68cb3e47UL, 0x086c010fUL, 0xa21de820UL, 0xd18b69deUL, 0xf3f65777UL, 0xfa02c3f6UL, +0x407edac3UL, 0xcbb3d550UL, 0x1793084dUL, 0xb0d70ebaUL, 0x0ab378d5UL, 0xd951fb0cUL, +0xded7da56UL, 0x4124bbe4UL, 0x94ca0b56UL, 0x0f5755d1UL, 0xe0e1e56eUL, 0x6184b5beUL, +0x580a249fUL, 0x94f74bc0UL, 0xe327888eUL, 0x9f7b5561UL, 0xc3dc0280UL, 0x05687715UL, +0x646c6bd7UL, 0x44904db3UL, 0x66b4f0a3UL, 0xc0f1648aUL, 0x697ed5afUL, 0x49e92ff6UL, +0x309e374fUL, 0x2cb6356aUL, 0x85808573UL, 0x4991f840UL, 0x76f0ae02UL, 0x083be84dUL, +0x28421c9aUL, 0x44489406UL, 0x736e4cb8UL, 0xc1092910UL, 0x8bc95fc6UL, 0x7d869cf4UL, +0x134f616fUL, 0x2e77118dUL, 0xb31b2be1UL, 0xaa90b472UL, 0x3ca5d717UL, 0x7d161bbaUL, +0x9cad9010UL, 0xaf462ba2UL, 0x9fe459d2UL, 0x45d34559UL, 0xd9f2da13UL, 0xdbc65487UL, +0xf3e4f94eUL, 0x176d486fUL, 0x097c13eaUL, 0x631da5c7UL, 0x445f7382UL, 0x175683f4UL, +0xcdc66a97UL, 0x70be0288UL, 0xb3cdcf72UL, 0x6e5dd2f3UL, 0x20936079UL, 0x459b80a5UL, +0xbe60e2dbUL, 0xa9c23101UL, 0xeba5315cUL, 0x224e42f2UL, 0x1c5c1572UL, 0xf6721b2cUL, +0x1ad2fff3UL, 0x8c25404eUL, 0x324ed72fUL, 0x4067b7fdUL, 0x0523138eUL, 0x5ca3bc78UL, +0xdc0fd66eUL, 0x75922283UL, 0x784d6b17UL, 0x58ebb16eUL, 0x44094f85UL, 0x3f481d87UL, +0xfcfeae7bUL, 0x77b5ff76UL, 0x8c2302bfUL, 0xaaf47556UL, 0x5f46b02aUL, 0x2b092801UL, +0x3d38f5f7UL, 0x0ca81f36UL, 0x52af4a8aUL, 0x66d5e7c0UL, 0xdf3b0874UL, 0x95055110UL, +0x1b5ad7a8UL, 0xf61ed5adUL, 0x6cf6e479UL, 0x20758184UL, 0xd0cefa65UL, 0x88f7be58UL, +0x4a046826UL, 0x0ff6f8f3UL, 0xa09c7f70UL, 0x5346aba0UL, 0x5ce96c28UL, 0xe176eda3UL, +0x6bac307fUL, 0x376829d2UL, 0x85360fa9UL, 0x17e3fe2aUL, 0x24b79767UL, 0xf5a96b20UL, +0xd6cd2595UL, 0x68ff1ebfUL, 0x7555442cUL, 0xf19f06beUL, 0xf9e0659aUL, 0xeeb9491dUL, +0x34010718UL, 0xbb30cab8UL, 0xe822fe15UL, 0x88570983UL, 0x750e6249UL, 0xda627e55UL, 0x5e76ffa8UL, 0xb1534546UL, 0x6d47de08UL, 0xefe9e7d4UL}; static const ulong32 S6[256] = { -0xf6fa8f9dUL, 0x2cac6ce1UL, 0x4ca34867UL, 0xe2337f7cUL, 0x95db08e7UL, 0x016843b4UL, -0xeced5cbcUL, 0x325553acUL, 0xbf9f0960UL, 0xdfa1e2edUL, 0x83f0579dUL, 0x63ed86b9UL, -0x1ab6a6b8UL, 0xde5ebe39UL, 0xf38ff732UL, 0x8989b138UL, 0x33f14961UL, 0xc01937bdUL, -0xf506c6daUL, 0xe4625e7eUL, 0xa308ea99UL, 0x4e23e33cUL, 0x79cbd7ccUL, 0x48a14367UL, -0xa3149619UL, 0xfec94bd5UL, 0xa114174aUL, 0xeaa01866UL, 0xa084db2dUL, 0x09a8486fUL, -0xa888614aUL, 0x2900af98UL, 0x01665991UL, 0xe1992863UL, 0xc8f30c60UL, 0x2e78ef3cUL, -0xd0d51932UL, 0xcf0fec14UL, 0xf7ca07d2UL, 0xd0a82072UL, 0xfd41197eUL, 0x9305a6b0UL, -0xe86be3daUL, 0x74bed3cdUL, 0x372da53cUL, 0x4c7f4448UL, 0xdab5d440UL, 0x6dba0ec3UL, -0x083919a7UL, 0x9fbaeed9UL, 0x49dbcfb0UL, 0x4e670c53UL, 0x5c3d9c01UL, 0x64bdb941UL, -0x2c0e636aUL, 0xba7dd9cdUL, 0xea6f7388UL, 0xe70bc762UL, 0x35f29adbUL, 0x5c4cdd8dUL, -0xf0d48d8cUL, 0xb88153e2UL, 0x08a19866UL, 0x1ae2eac8UL, 0x284caf89UL, 0xaa928223UL, -0x9334be53UL, 0x3b3a21bfUL, 0x16434be3UL, 0x9aea3906UL, 0xefe8c36eUL, 0xf890cdd9UL, -0x80226daeUL, 0xc340a4a3UL, 0xdf7e9c09UL, 0xa694a807UL, 0x5b7c5eccUL, 0x221db3a6UL, -0x9a69a02fUL, 0x68818a54UL, 0xceb2296fUL, 0x53c0843aUL, 0xfe893655UL, 0x25bfe68aUL, -0xb4628abcUL, 0xcf222ebfUL, 0x25ac6f48UL, 0xa9a99387UL, 0x53bddb65UL, 0xe76ffbe7UL, -0xe967fd78UL, 0x0ba93563UL, 0x8e342bc1UL, 0xe8a11be9UL, 0x4980740dUL, 0xc8087dfcUL, -0x8de4bf99UL, 0xa11101a0UL, 0x7fd37975UL, 0xda5a26c0UL, 0xe81f994fUL, 0x9528cd89UL, -0xfd339fedUL, 0xb87834bfUL, 0x5f04456dUL, 0x22258698UL, 0xc9c4c83bUL, 0x2dc156beUL, -0x4f628daaUL, 0x57f55ec5UL, 0xe2220abeUL, 0xd2916ebfUL, 0x4ec75b95UL, 0x24f2c3c0UL, -0x42d15d99UL, 0xcd0d7fa0UL, 0x7b6e27ffUL, 0xa8dc8af0UL, 0x7345c106UL, 0xf41e232fUL, -0x35162386UL, 0xe6ea8926UL, 0x3333b094UL, 0x157ec6f2UL, 0x372b74afUL, 0x692573e4UL, -0xe9a9d848UL, 0xf3160289UL, 0x3a62ef1dUL, 0xa787e238UL, 0xf3a5f676UL, 0x74364853UL, -0x20951063UL, 0x4576698dUL, 0xb6fad407UL, 0x592af950UL, 0x36f73523UL, 0x4cfb6e87UL, -0x7da4cec0UL, 0x6c152daaUL, 0xcb0396a8UL, 0xc50dfe5dUL, 0xfcd707abUL, 0x0921c42fUL, -0x89dff0bbUL, 0x5fe2be78UL, 0x448f4f33UL, 0x754613c9UL, 0x2b05d08dUL, 0x48b9d585UL, -0xdc049441UL, 0xc8098f9bUL, 0x7dede786UL, 0xc39a3373UL, 0x42410005UL, 0x6a091751UL, -0x0ef3c8a6UL, 0x890072d6UL, 0x28207682UL, 0xa9a9f7beUL, 0xbf32679dUL, 0xd45b5b75UL, -0xb353fd00UL, 0xcbb0e358UL, 0x830f220aUL, 0x1f8fb214UL, 0xd372cf08UL, 0xcc3c4a13UL, -0x8cf63166UL, 0x061c87beUL, 0x88c98f88UL, 0x6062e397UL, 0x47cf8e7aUL, 0xb6c85283UL, -0x3cc2acfbUL, 0x3fc06976UL, 0x4e8f0252UL, 0x64d8314dUL, 0xda3870e3UL, 0x1e665459UL, -0xc10908f0UL, 0x513021a5UL, 0x6c5b68b7UL, 0x822f8aa0UL, 0x3007cd3eUL, 0x74719eefUL, -0xdc872681UL, 0x073340d4UL, 0x7e432fd9UL, 0x0c5ec241UL, 0x8809286cUL, 0xf592d891UL, -0x08a930f6UL, 0x957ef305UL, 0xb7fbffbdUL, 0xc266e96fUL, 0x6fe4ac98UL, 0xb173ecc0UL, -0xbc60b42aUL, 0x953498daUL, 0xfba1ae12UL, 0x2d4bd736UL, 0x0f25faabUL, 0xa4f3fcebUL, -0xe2969123UL, 0x257f0c3dUL, 0x9348af49UL, 0x361400bcUL, 0xe8816f4aUL, 0x3814f200UL, -0xa3f94043UL, 0x9c7a54c2UL, 0xbc704f57UL, 0xda41e7f9UL, 0xc25ad33aUL, 0x54f4a084UL, -0xb17f5505UL, 0x59357cbeUL, 0xedbd15c8UL, 0x7f97c5abUL, 0xba5ac7b5UL, 0xb6f6deafUL, -0x3a479c3aUL, 0x5302da25UL, 0x653d7e6aUL, 0x54268d49UL, 0x51a477eaUL, 0x5017d55bUL, -0xd7d25d88UL, 0x44136c76UL, 0x0404a8c8UL, 0xb8e5a121UL, 0xb81a928aUL, 0x60ed5869UL, -0x97c55b96UL, 0xeaec991bUL, 0x29935913UL, 0x01fdb7f1UL, 0x088e8dfaUL, 0x9ab6f6f5UL, -0x3b4cbf9fUL, 0x4a5de3abUL, 0xe6051d35UL, 0xa0e1d855UL, 0xd36b4cf1UL, 0xf544edebUL, -0xb0e93524UL, 0xbebb8fbdUL, 0xa2d762cfUL, 0x49c92f54UL, 0x38b5f331UL, 0x7128a454UL, +0xf6fa8f9dUL, 0x2cac6ce1UL, 0x4ca34867UL, 0xe2337f7cUL, 0x95db08e7UL, 0x016843b4UL, +0xeced5cbcUL, 0x325553acUL, 0xbf9f0960UL, 0xdfa1e2edUL, 0x83f0579dUL, 0x63ed86b9UL, +0x1ab6a6b8UL, 0xde5ebe39UL, 0xf38ff732UL, 0x8989b138UL, 0x33f14961UL, 0xc01937bdUL, +0xf506c6daUL, 0xe4625e7eUL, 0xa308ea99UL, 0x4e23e33cUL, 0x79cbd7ccUL, 0x48a14367UL, +0xa3149619UL, 0xfec94bd5UL, 0xa114174aUL, 0xeaa01866UL, 0xa084db2dUL, 0x09a8486fUL, +0xa888614aUL, 0x2900af98UL, 0x01665991UL, 0xe1992863UL, 0xc8f30c60UL, 0x2e78ef3cUL, +0xd0d51932UL, 0xcf0fec14UL, 0xf7ca07d2UL, 0xd0a82072UL, 0xfd41197eUL, 0x9305a6b0UL, +0xe86be3daUL, 0x74bed3cdUL, 0x372da53cUL, 0x4c7f4448UL, 0xdab5d440UL, 0x6dba0ec3UL, +0x083919a7UL, 0x9fbaeed9UL, 0x49dbcfb0UL, 0x4e670c53UL, 0x5c3d9c01UL, 0x64bdb941UL, +0x2c0e636aUL, 0xba7dd9cdUL, 0xea6f7388UL, 0xe70bc762UL, 0x35f29adbUL, 0x5c4cdd8dUL, +0xf0d48d8cUL, 0xb88153e2UL, 0x08a19866UL, 0x1ae2eac8UL, 0x284caf89UL, 0xaa928223UL, +0x9334be53UL, 0x3b3a21bfUL, 0x16434be3UL, 0x9aea3906UL, 0xefe8c36eUL, 0xf890cdd9UL, +0x80226daeUL, 0xc340a4a3UL, 0xdf7e9c09UL, 0xa694a807UL, 0x5b7c5eccUL, 0x221db3a6UL, +0x9a69a02fUL, 0x68818a54UL, 0xceb2296fUL, 0x53c0843aUL, 0xfe893655UL, 0x25bfe68aUL, +0xb4628abcUL, 0xcf222ebfUL, 0x25ac6f48UL, 0xa9a99387UL, 0x53bddb65UL, 0xe76ffbe7UL, +0xe967fd78UL, 0x0ba93563UL, 0x8e342bc1UL, 0xe8a11be9UL, 0x4980740dUL, 0xc8087dfcUL, +0x8de4bf99UL, 0xa11101a0UL, 0x7fd37975UL, 0xda5a26c0UL, 0xe81f994fUL, 0x9528cd89UL, +0xfd339fedUL, 0xb87834bfUL, 0x5f04456dUL, 0x22258698UL, 0xc9c4c83bUL, 0x2dc156beUL, +0x4f628daaUL, 0x57f55ec5UL, 0xe2220abeUL, 0xd2916ebfUL, 0x4ec75b95UL, 0x24f2c3c0UL, +0x42d15d99UL, 0xcd0d7fa0UL, 0x7b6e27ffUL, 0xa8dc8af0UL, 0x7345c106UL, 0xf41e232fUL, +0x35162386UL, 0xe6ea8926UL, 0x3333b094UL, 0x157ec6f2UL, 0x372b74afUL, 0x692573e4UL, +0xe9a9d848UL, 0xf3160289UL, 0x3a62ef1dUL, 0xa787e238UL, 0xf3a5f676UL, 0x74364853UL, +0x20951063UL, 0x4576698dUL, 0xb6fad407UL, 0x592af950UL, 0x36f73523UL, 0x4cfb6e87UL, +0x7da4cec0UL, 0x6c152daaUL, 0xcb0396a8UL, 0xc50dfe5dUL, 0xfcd707abUL, 0x0921c42fUL, +0x89dff0bbUL, 0x5fe2be78UL, 0x448f4f33UL, 0x754613c9UL, 0x2b05d08dUL, 0x48b9d585UL, +0xdc049441UL, 0xc8098f9bUL, 0x7dede786UL, 0xc39a3373UL, 0x42410005UL, 0x6a091751UL, +0x0ef3c8a6UL, 0x890072d6UL, 0x28207682UL, 0xa9a9f7beUL, 0xbf32679dUL, 0xd45b5b75UL, +0xb353fd00UL, 0xcbb0e358UL, 0x830f220aUL, 0x1f8fb214UL, 0xd372cf08UL, 0xcc3c4a13UL, +0x8cf63166UL, 0x061c87beUL, 0x88c98f88UL, 0x6062e397UL, 0x47cf8e7aUL, 0xb6c85283UL, +0x3cc2acfbUL, 0x3fc06976UL, 0x4e8f0252UL, 0x64d8314dUL, 0xda3870e3UL, 0x1e665459UL, +0xc10908f0UL, 0x513021a5UL, 0x6c5b68b7UL, 0x822f8aa0UL, 0x3007cd3eUL, 0x74719eefUL, +0xdc872681UL, 0x073340d4UL, 0x7e432fd9UL, 0x0c5ec241UL, 0x8809286cUL, 0xf592d891UL, +0x08a930f6UL, 0x957ef305UL, 0xb7fbffbdUL, 0xc266e96fUL, 0x6fe4ac98UL, 0xb173ecc0UL, +0xbc60b42aUL, 0x953498daUL, 0xfba1ae12UL, 0x2d4bd736UL, 0x0f25faabUL, 0xa4f3fcebUL, +0xe2969123UL, 0x257f0c3dUL, 0x9348af49UL, 0x361400bcUL, 0xe8816f4aUL, 0x3814f200UL, +0xa3f94043UL, 0x9c7a54c2UL, 0xbc704f57UL, 0xda41e7f9UL, 0xc25ad33aUL, 0x54f4a084UL, +0xb17f5505UL, 0x59357cbeUL, 0xedbd15c8UL, 0x7f97c5abUL, 0xba5ac7b5UL, 0xb6f6deafUL, +0x3a479c3aUL, 0x5302da25UL, 0x653d7e6aUL, 0x54268d49UL, 0x51a477eaUL, 0x5017d55bUL, +0xd7d25d88UL, 0x44136c76UL, 0x0404a8c8UL, 0xb8e5a121UL, 0xb81a928aUL, 0x60ed5869UL, +0x97c55b96UL, 0xeaec991bUL, 0x29935913UL, 0x01fdb7f1UL, 0x088e8dfaUL, 0x9ab6f6f5UL, +0x3b4cbf9fUL, 0x4a5de3abUL, 0xe6051d35UL, 0xa0e1d855UL, 0xd36b4cf1UL, 0xf544edebUL, +0xb0e93524UL, 0xbebb8fbdUL, 0xa2d762cfUL, 0x49c92f54UL, 0x38b5f331UL, 0x7128a454UL, 0x48392905UL, 0xa65b1db8UL, 0x851c97bdUL, 0xd675cf2fUL}; static const ulong32 S7[256] = { -0x85e04019UL, 0x332bf567UL, 0x662dbfffUL, 0xcfc65693UL, 0x2a8d7f6fUL, 0xab9bc912UL, -0xde6008a1UL, 0x2028da1fUL, 0x0227bce7UL, 0x4d642916UL, 0x18fac300UL, 0x50f18b82UL, -0x2cb2cb11UL, 0xb232e75cUL, 0x4b3695f2UL, 0xb28707deUL, 0xa05fbcf6UL, 0xcd4181e9UL, -0xe150210cUL, 0xe24ef1bdUL, 0xb168c381UL, 0xfde4e789UL, 0x5c79b0d8UL, 0x1e8bfd43UL, -0x4d495001UL, 0x38be4341UL, 0x913cee1dUL, 0x92a79c3fUL, 0x089766beUL, 0xbaeeadf4UL, -0x1286becfUL, 0xb6eacb19UL, 0x2660c200UL, 0x7565bde4UL, 0x64241f7aUL, 0x8248dca9UL, -0xc3b3ad66UL, 0x28136086UL, 0x0bd8dfa8UL, 0x356d1cf2UL, 0x107789beUL, 0xb3b2e9ceUL, -0x0502aa8fUL, 0x0bc0351eUL, 0x166bf52aUL, 0xeb12ff82UL, 0xe3486911UL, 0xd34d7516UL, -0x4e7b3affUL, 0x5f43671bUL, 0x9cf6e037UL, 0x4981ac83UL, 0x334266ceUL, 0x8c9341b7UL, -0xd0d854c0UL, 0xcb3a6c88UL, 0x47bc2829UL, 0x4725ba37UL, 0xa66ad22bUL, 0x7ad61f1eUL, -0x0c5cbafaUL, 0x4437f107UL, 0xb6e79962UL, 0x42d2d816UL, 0x0a961288UL, 0xe1a5c06eUL, -0x13749e67UL, 0x72fc081aUL, 0xb1d139f7UL, 0xf9583745UL, 0xcf19df58UL, 0xbec3f756UL, -0xc06eba30UL, 0x07211b24UL, 0x45c28829UL, 0xc95e317fUL, 0xbc8ec511UL, 0x38bc46e9UL, -0xc6e6fa14UL, 0xbae8584aUL, 0xad4ebc46UL, 0x468f508bUL, 0x7829435fUL, 0xf124183bUL, -0x821dba9fUL, 0xaff60ff4UL, 0xea2c4e6dUL, 0x16e39264UL, 0x92544a8bUL, 0x009b4fc3UL, -0xaba68cedUL, 0x9ac96f78UL, 0x06a5b79aUL, 0xb2856e6eUL, 0x1aec3ca9UL, 0xbe838688UL, -0x0e0804e9UL, 0x55f1be56UL, 0xe7e5363bUL, 0xb3a1f25dUL, 0xf7debb85UL, 0x61fe033cUL, -0x16746233UL, 0x3c034c28UL, 0xda6d0c74UL, 0x79aac56cUL, 0x3ce4e1adUL, 0x51f0c802UL, -0x98f8f35aUL, 0x1626a49fUL, 0xeed82b29UL, 0x1d382fe3UL, 0x0c4fb99aUL, 0xbb325778UL, -0x3ec6d97bUL, 0x6e77a6a9UL, 0xcb658b5cUL, 0xd45230c7UL, 0x2bd1408bUL, 0x60c03eb7UL, -0xb9068d78UL, 0xa33754f4UL, 0xf430c87dUL, 0xc8a71302UL, 0xb96d8c32UL, 0xebd4e7beUL, -0xbe8b9d2dUL, 0x7979fb06UL, 0xe7225308UL, 0x8b75cf77UL, 0x11ef8da4UL, 0xe083c858UL, -0x8d6b786fUL, 0x5a6317a6UL, 0xfa5cf7a0UL, 0x5dda0033UL, 0xf28ebfb0UL, 0xf5b9c310UL, -0xa0eac280UL, 0x08b9767aUL, 0xa3d9d2b0UL, 0x79d34217UL, 0x021a718dUL, 0x9ac6336aUL, -0x2711fd60UL, 0x438050e3UL, 0x069908a8UL, 0x3d7fedc4UL, 0x826d2befUL, 0x4eeb8476UL, -0x488dcf25UL, 0x36c9d566UL, 0x28e74e41UL, 0xc2610acaUL, 0x3d49a9cfUL, 0xbae3b9dfUL, -0xb65f8de6UL, 0x92aeaf64UL, 0x3ac7d5e6UL, 0x9ea80509UL, 0xf22b017dUL, 0xa4173f70UL, -0xdd1e16c3UL, 0x15e0d7f9UL, 0x50b1b887UL, 0x2b9f4fd5UL, 0x625aba82UL, 0x6a017962UL, -0x2ec01b9cUL, 0x15488aa9UL, 0xd716e740UL, 0x40055a2cUL, 0x93d29a22UL, 0xe32dbf9aUL, -0x058745b9UL, 0x3453dc1eUL, 0xd699296eUL, 0x496cff6fUL, 0x1c9f4986UL, 0xdfe2ed07UL, -0xb87242d1UL, 0x19de7eaeUL, 0x053e561aUL, 0x15ad6f8cUL, 0x66626c1cUL, 0x7154c24cUL, -0xea082b2aUL, 0x93eb2939UL, 0x17dcb0f0UL, 0x58d4f2aeUL, 0x9ea294fbUL, 0x52cf564cUL, -0x9883fe66UL, 0x2ec40581UL, 0x763953c3UL, 0x01d6692eUL, 0xd3a0c108UL, 0xa1e7160eUL, -0xe4f2dfa6UL, 0x693ed285UL, 0x74904698UL, 0x4c2b0eddUL, 0x4f757656UL, 0x5d393378UL, -0xa132234fUL, 0x3d321c5dUL, 0xc3f5e194UL, 0x4b269301UL, 0xc79f022fUL, 0x3c997e7eUL, -0x5e4f9504UL, 0x3ffafbbdUL, 0x76f7ad0eUL, 0x296693f4UL, 0x3d1fce6fUL, 0xc61e45beUL, -0xd3b5ab34UL, 0xf72bf9b7UL, 0x1b0434c0UL, 0x4e72b567UL, 0x5592a33dUL, 0xb5229301UL, -0xcfd2a87fUL, 0x60aeb767UL, 0x1814386bUL, 0x30bcc33dUL, 0x38a0c07dUL, 0xfd1606f2UL, -0xc363519bUL, 0x589dd390UL, 0x5479f8e6UL, 0x1cb8d647UL, 0x97fd61a9UL, 0xea7759f4UL, -0x2d57539dUL, 0x569a58cfUL, 0xe84e63adUL, 0x462e1b78UL, 0x6580f87eUL, 0xf3817914UL, -0x91da55f4UL, 0x40a230f3UL, 0xd1988f35UL, 0xb6e318d2UL, 0x3ffa50bcUL, 0x3d40f021UL, -0xc3c0bdaeUL, 0x4958c24cUL, 0x518f36b2UL, 0x84b1d370UL, 0x0fedce83UL, 0x878ddadaUL, +0x85e04019UL, 0x332bf567UL, 0x662dbfffUL, 0xcfc65693UL, 0x2a8d7f6fUL, 0xab9bc912UL, +0xde6008a1UL, 0x2028da1fUL, 0x0227bce7UL, 0x4d642916UL, 0x18fac300UL, 0x50f18b82UL, +0x2cb2cb11UL, 0xb232e75cUL, 0x4b3695f2UL, 0xb28707deUL, 0xa05fbcf6UL, 0xcd4181e9UL, +0xe150210cUL, 0xe24ef1bdUL, 0xb168c381UL, 0xfde4e789UL, 0x5c79b0d8UL, 0x1e8bfd43UL, +0x4d495001UL, 0x38be4341UL, 0x913cee1dUL, 0x92a79c3fUL, 0x089766beUL, 0xbaeeadf4UL, +0x1286becfUL, 0xb6eacb19UL, 0x2660c200UL, 0x7565bde4UL, 0x64241f7aUL, 0x8248dca9UL, +0xc3b3ad66UL, 0x28136086UL, 0x0bd8dfa8UL, 0x356d1cf2UL, 0x107789beUL, 0xb3b2e9ceUL, +0x0502aa8fUL, 0x0bc0351eUL, 0x166bf52aUL, 0xeb12ff82UL, 0xe3486911UL, 0xd34d7516UL, +0x4e7b3affUL, 0x5f43671bUL, 0x9cf6e037UL, 0x4981ac83UL, 0x334266ceUL, 0x8c9341b7UL, +0xd0d854c0UL, 0xcb3a6c88UL, 0x47bc2829UL, 0x4725ba37UL, 0xa66ad22bUL, 0x7ad61f1eUL, +0x0c5cbafaUL, 0x4437f107UL, 0xb6e79962UL, 0x42d2d816UL, 0x0a961288UL, 0xe1a5c06eUL, +0x13749e67UL, 0x72fc081aUL, 0xb1d139f7UL, 0xf9583745UL, 0xcf19df58UL, 0xbec3f756UL, +0xc06eba30UL, 0x07211b24UL, 0x45c28829UL, 0xc95e317fUL, 0xbc8ec511UL, 0x38bc46e9UL, +0xc6e6fa14UL, 0xbae8584aUL, 0xad4ebc46UL, 0x468f508bUL, 0x7829435fUL, 0xf124183bUL, +0x821dba9fUL, 0xaff60ff4UL, 0xea2c4e6dUL, 0x16e39264UL, 0x92544a8bUL, 0x009b4fc3UL, +0xaba68cedUL, 0x9ac96f78UL, 0x06a5b79aUL, 0xb2856e6eUL, 0x1aec3ca9UL, 0xbe838688UL, +0x0e0804e9UL, 0x55f1be56UL, 0xe7e5363bUL, 0xb3a1f25dUL, 0xf7debb85UL, 0x61fe033cUL, +0x16746233UL, 0x3c034c28UL, 0xda6d0c74UL, 0x79aac56cUL, 0x3ce4e1adUL, 0x51f0c802UL, +0x98f8f35aUL, 0x1626a49fUL, 0xeed82b29UL, 0x1d382fe3UL, 0x0c4fb99aUL, 0xbb325778UL, +0x3ec6d97bUL, 0x6e77a6a9UL, 0xcb658b5cUL, 0xd45230c7UL, 0x2bd1408bUL, 0x60c03eb7UL, +0xb9068d78UL, 0xa33754f4UL, 0xf430c87dUL, 0xc8a71302UL, 0xb96d8c32UL, 0xebd4e7beUL, +0xbe8b9d2dUL, 0x7979fb06UL, 0xe7225308UL, 0x8b75cf77UL, 0x11ef8da4UL, 0xe083c858UL, +0x8d6b786fUL, 0x5a6317a6UL, 0xfa5cf7a0UL, 0x5dda0033UL, 0xf28ebfb0UL, 0xf5b9c310UL, +0xa0eac280UL, 0x08b9767aUL, 0xa3d9d2b0UL, 0x79d34217UL, 0x021a718dUL, 0x9ac6336aUL, +0x2711fd60UL, 0x438050e3UL, 0x069908a8UL, 0x3d7fedc4UL, 0x826d2befUL, 0x4eeb8476UL, +0x488dcf25UL, 0x36c9d566UL, 0x28e74e41UL, 0xc2610acaUL, 0x3d49a9cfUL, 0xbae3b9dfUL, +0xb65f8de6UL, 0x92aeaf64UL, 0x3ac7d5e6UL, 0x9ea80509UL, 0xf22b017dUL, 0xa4173f70UL, +0xdd1e16c3UL, 0x15e0d7f9UL, 0x50b1b887UL, 0x2b9f4fd5UL, 0x625aba82UL, 0x6a017962UL, +0x2ec01b9cUL, 0x15488aa9UL, 0xd716e740UL, 0x40055a2cUL, 0x93d29a22UL, 0xe32dbf9aUL, +0x058745b9UL, 0x3453dc1eUL, 0xd699296eUL, 0x496cff6fUL, 0x1c9f4986UL, 0xdfe2ed07UL, +0xb87242d1UL, 0x19de7eaeUL, 0x053e561aUL, 0x15ad6f8cUL, 0x66626c1cUL, 0x7154c24cUL, +0xea082b2aUL, 0x93eb2939UL, 0x17dcb0f0UL, 0x58d4f2aeUL, 0x9ea294fbUL, 0x52cf564cUL, +0x9883fe66UL, 0x2ec40581UL, 0x763953c3UL, 0x01d6692eUL, 0xd3a0c108UL, 0xa1e7160eUL, +0xe4f2dfa6UL, 0x693ed285UL, 0x74904698UL, 0x4c2b0eddUL, 0x4f757656UL, 0x5d393378UL, +0xa132234fUL, 0x3d321c5dUL, 0xc3f5e194UL, 0x4b269301UL, 0xc79f022fUL, 0x3c997e7eUL, +0x5e4f9504UL, 0x3ffafbbdUL, 0x76f7ad0eUL, 0x296693f4UL, 0x3d1fce6fUL, 0xc61e45beUL, +0xd3b5ab34UL, 0xf72bf9b7UL, 0x1b0434c0UL, 0x4e72b567UL, 0x5592a33dUL, 0xb5229301UL, +0xcfd2a87fUL, 0x60aeb767UL, 0x1814386bUL, 0x30bcc33dUL, 0x38a0c07dUL, 0xfd1606f2UL, +0xc363519bUL, 0x589dd390UL, 0x5479f8e6UL, 0x1cb8d647UL, 0x97fd61a9UL, 0xea7759f4UL, +0x2d57539dUL, 0x569a58cfUL, 0xe84e63adUL, 0x462e1b78UL, 0x6580f87eUL, 0xf3817914UL, +0x91da55f4UL, 0x40a230f3UL, 0xd1988f35UL, 0xb6e318d2UL, 0x3ffa50bcUL, 0x3d40f021UL, +0xc3c0bdaeUL, 0x4958c24cUL, 0x518f36b2UL, 0x84b1d370UL, 0x0fedce83UL, 0x878ddadaUL, 0xf2a279c7UL, 0x94e01be8UL, 0x90716f4bUL, 0x954b8aa3UL}; static const ulong32 S8[256] = { -0xe216300dUL, 0xbbddfffcUL, 0xa7ebdabdUL, 0x35648095UL, 0x7789f8b7UL, 0xe6c1121bUL, -0x0e241600UL, 0x052ce8b5UL, 0x11a9cfb0UL, 0xe5952f11UL, 0xece7990aUL, 0x9386d174UL, -0x2a42931cUL, 0x76e38111UL, 0xb12def3aUL, 0x37ddddfcUL, 0xde9adeb1UL, 0x0a0cc32cUL, -0xbe197029UL, 0x84a00940UL, 0xbb243a0fUL, 0xb4d137cfUL, 0xb44e79f0UL, 0x049eedfdUL, -0x0b15a15dUL, 0x480d3168UL, 0x8bbbde5aUL, 0x669ded42UL, 0xc7ece831UL, 0x3f8f95e7UL, -0x72df191bUL, 0x7580330dUL, 0x94074251UL, 0x5c7dcdfaUL, 0xabbe6d63UL, 0xaa402164UL, -0xb301d40aUL, 0x02e7d1caUL, 0x53571daeUL, 0x7a3182a2UL, 0x12a8ddecUL, 0xfdaa335dUL, -0x176f43e8UL, 0x71fb46d4UL, 0x38129022UL, 0xce949ad4UL, 0xb84769adUL, 0x965bd862UL, -0x82f3d055UL, 0x66fb9767UL, 0x15b80b4eUL, 0x1d5b47a0UL, 0x4cfde06fUL, 0xc28ec4b8UL, -0x57e8726eUL, 0x647a78fcUL, 0x99865d44UL, 0x608bd593UL, 0x6c200e03UL, 0x39dc5ff6UL, -0x5d0b00a3UL, 0xae63aff2UL, 0x7e8bd632UL, 0x70108c0cUL, 0xbbd35049UL, 0x2998df04UL, -0x980cf42aUL, 0x9b6df491UL, 0x9e7edd53UL, 0x06918548UL, 0x58cb7e07UL, 0x3b74ef2eUL, -0x522fffb1UL, 0xd24708ccUL, 0x1c7e27cdUL, 0xa4eb215bUL, 0x3cf1d2e2UL, 0x19b47a38UL, -0x424f7618UL, 0x35856039UL, 0x9d17dee7UL, 0x27eb35e6UL, 0xc9aff67bUL, 0x36baf5b8UL, -0x09c467cdUL, 0xc18910b1UL, 0xe11dbf7bUL, 0x06cd1af8UL, 0x7170c608UL, 0x2d5e3354UL, -0xd4de495aUL, 0x64c6d006UL, 0xbcc0c62cUL, 0x3dd00db3UL, 0x708f8f34UL, 0x77d51b42UL, -0x264f620fUL, 0x24b8d2bfUL, 0x15c1b79eUL, 0x46a52564UL, 0xf8d7e54eUL, 0x3e378160UL, -0x7895cda5UL, 0x859c15a5UL, 0xe6459788UL, 0xc37bc75fUL, 0xdb07ba0cUL, 0x0676a3abUL, -0x7f229b1eUL, 0x31842e7bUL, 0x24259fd7UL, 0xf8bef472UL, 0x835ffcb8UL, 0x6df4c1f2UL, -0x96f5b195UL, 0xfd0af0fcUL, 0xb0fe134cUL, 0xe2506d3dUL, 0x4f9b12eaUL, 0xf215f225UL, -0xa223736fUL, 0x9fb4c428UL, 0x25d04979UL, 0x34c713f8UL, 0xc4618187UL, 0xea7a6e98UL, -0x7cd16efcUL, 0x1436876cUL, 0xf1544107UL, 0xbedeee14UL, 0x56e9af27UL, 0xa04aa441UL, -0x3cf7c899UL, 0x92ecbae6UL, 0xdd67016dUL, 0x151682ebUL, 0xa842eedfUL, 0xfdba60b4UL, -0xf1907b75UL, 0x20e3030fUL, 0x24d8c29eUL, 0xe139673bUL, 0xefa63fb8UL, 0x71873054UL, -0xb6f2cf3bUL, 0x9f326442UL, 0xcb15a4ccUL, 0xb01a4504UL, 0xf1e47d8dUL, 0x844a1be5UL, -0xbae7dfdcUL, 0x42cbda70UL, 0xcd7dae0aUL, 0x57e85b7aUL, 0xd53f5af6UL, 0x20cf4d8cUL, -0xcea4d428UL, 0x79d130a4UL, 0x3486ebfbUL, 0x33d3cddcUL, 0x77853b53UL, 0x37effcb5UL, -0xc5068778UL, 0xe580b3e6UL, 0x4e68b8f4UL, 0xc5c8b37eUL, 0x0d809ea2UL, 0x398feb7cUL, -0x132a4f94UL, 0x43b7950eUL, 0x2fee7d1cUL, 0x223613bdUL, 0xdd06caa2UL, 0x37df932bUL, -0xc4248289UL, 0xacf3ebc3UL, 0x5715f6b7UL, 0xef3478ddUL, 0xf267616fUL, 0xc148cbe4UL, -0x9052815eUL, 0x5e410fabUL, 0xb48a2465UL, 0x2eda7fa4UL, 0xe87b40e4UL, 0xe98ea084UL, -0x5889e9e1UL, 0xefd390fcUL, 0xdd07d35bUL, 0xdb485694UL, 0x38d7e5b2UL, 0x57720101UL, -0x730edebcUL, 0x5b643113UL, 0x94917e4fUL, 0x503c2fbaUL, 0x646f1282UL, 0x7523d24aUL, -0xe0779695UL, 0xf9c17a8fUL, 0x7a5b2121UL, 0xd187b896UL, 0x29263a4dUL, 0xba510cdfUL, -0x81f47c9fUL, 0xad1163edUL, 0xea7b5965UL, 0x1a00726eUL, 0x11403092UL, 0x00da6d77UL, -0x4a0cdd61UL, 0xad1f4603UL, 0x605bdfb0UL, 0x9eedc364UL, 0x22ebe6a8UL, 0xcee7d28aUL, -0xa0e736a0UL, 0x5564a6b9UL, 0x10853209UL, 0xc7eb8f37UL, 0x2de705caUL, 0x8951570fUL, -0xdf09822bUL, 0xbd691a6cUL, 0xaa12e4f2UL, 0x87451c0fUL, 0xe0f6a27aUL, 0x3ada4819UL, -0x4cf1764fUL, 0x0d771c2bUL, 0x67cdb156UL, 0x350d8384UL, 0x5938fa0fUL, 0x42399ef3UL, -0x36997b07UL, 0x0e84093dUL, 0x4aa93e61UL, 0x8360d87bUL, 0x1fa98b0cUL, 0x1149382cUL, -0xe97625a5UL, 0x0614d1b7UL, 0x0e25244bUL, 0x0c768347UL, 0x589e8d82UL, 0x0d2059d1UL, -0xa466bb1eUL, 0xf8da0a82UL, 0x04f19130UL, 0xba6e4ec0UL, 0x99265164UL, 0x1ee7230dUL, +0xe216300dUL, 0xbbddfffcUL, 0xa7ebdabdUL, 0x35648095UL, 0x7789f8b7UL, 0xe6c1121bUL, +0x0e241600UL, 0x052ce8b5UL, 0x11a9cfb0UL, 0xe5952f11UL, 0xece7990aUL, 0x9386d174UL, +0x2a42931cUL, 0x76e38111UL, 0xb12def3aUL, 0x37ddddfcUL, 0xde9adeb1UL, 0x0a0cc32cUL, +0xbe197029UL, 0x84a00940UL, 0xbb243a0fUL, 0xb4d137cfUL, 0xb44e79f0UL, 0x049eedfdUL, +0x0b15a15dUL, 0x480d3168UL, 0x8bbbde5aUL, 0x669ded42UL, 0xc7ece831UL, 0x3f8f95e7UL, +0x72df191bUL, 0x7580330dUL, 0x94074251UL, 0x5c7dcdfaUL, 0xabbe6d63UL, 0xaa402164UL, +0xb301d40aUL, 0x02e7d1caUL, 0x53571daeUL, 0x7a3182a2UL, 0x12a8ddecUL, 0xfdaa335dUL, +0x176f43e8UL, 0x71fb46d4UL, 0x38129022UL, 0xce949ad4UL, 0xb84769adUL, 0x965bd862UL, +0x82f3d055UL, 0x66fb9767UL, 0x15b80b4eUL, 0x1d5b47a0UL, 0x4cfde06fUL, 0xc28ec4b8UL, +0x57e8726eUL, 0x647a78fcUL, 0x99865d44UL, 0x608bd593UL, 0x6c200e03UL, 0x39dc5ff6UL, +0x5d0b00a3UL, 0xae63aff2UL, 0x7e8bd632UL, 0x70108c0cUL, 0xbbd35049UL, 0x2998df04UL, +0x980cf42aUL, 0x9b6df491UL, 0x9e7edd53UL, 0x06918548UL, 0x58cb7e07UL, 0x3b74ef2eUL, +0x522fffb1UL, 0xd24708ccUL, 0x1c7e27cdUL, 0xa4eb215bUL, 0x3cf1d2e2UL, 0x19b47a38UL, +0x424f7618UL, 0x35856039UL, 0x9d17dee7UL, 0x27eb35e6UL, 0xc9aff67bUL, 0x36baf5b8UL, +0x09c467cdUL, 0xc18910b1UL, 0xe11dbf7bUL, 0x06cd1af8UL, 0x7170c608UL, 0x2d5e3354UL, +0xd4de495aUL, 0x64c6d006UL, 0xbcc0c62cUL, 0x3dd00db3UL, 0x708f8f34UL, 0x77d51b42UL, +0x264f620fUL, 0x24b8d2bfUL, 0x15c1b79eUL, 0x46a52564UL, 0xf8d7e54eUL, 0x3e378160UL, +0x7895cda5UL, 0x859c15a5UL, 0xe6459788UL, 0xc37bc75fUL, 0xdb07ba0cUL, 0x0676a3abUL, +0x7f229b1eUL, 0x31842e7bUL, 0x24259fd7UL, 0xf8bef472UL, 0x835ffcb8UL, 0x6df4c1f2UL, +0x96f5b195UL, 0xfd0af0fcUL, 0xb0fe134cUL, 0xe2506d3dUL, 0x4f9b12eaUL, 0xf215f225UL, +0xa223736fUL, 0x9fb4c428UL, 0x25d04979UL, 0x34c713f8UL, 0xc4618187UL, 0xea7a6e98UL, +0x7cd16efcUL, 0x1436876cUL, 0xf1544107UL, 0xbedeee14UL, 0x56e9af27UL, 0xa04aa441UL, +0x3cf7c899UL, 0x92ecbae6UL, 0xdd67016dUL, 0x151682ebUL, 0xa842eedfUL, 0xfdba60b4UL, +0xf1907b75UL, 0x20e3030fUL, 0x24d8c29eUL, 0xe139673bUL, 0xefa63fb8UL, 0x71873054UL, +0xb6f2cf3bUL, 0x9f326442UL, 0xcb15a4ccUL, 0xb01a4504UL, 0xf1e47d8dUL, 0x844a1be5UL, +0xbae7dfdcUL, 0x42cbda70UL, 0xcd7dae0aUL, 0x57e85b7aUL, 0xd53f5af6UL, 0x20cf4d8cUL, +0xcea4d428UL, 0x79d130a4UL, 0x3486ebfbUL, 0x33d3cddcUL, 0x77853b53UL, 0x37effcb5UL, +0xc5068778UL, 0xe580b3e6UL, 0x4e68b8f4UL, 0xc5c8b37eUL, 0x0d809ea2UL, 0x398feb7cUL, +0x132a4f94UL, 0x43b7950eUL, 0x2fee7d1cUL, 0x223613bdUL, 0xdd06caa2UL, 0x37df932bUL, +0xc4248289UL, 0xacf3ebc3UL, 0x5715f6b7UL, 0xef3478ddUL, 0xf267616fUL, 0xc148cbe4UL, +0x9052815eUL, 0x5e410fabUL, 0xb48a2465UL, 0x2eda7fa4UL, 0xe87b40e4UL, 0xe98ea084UL, +0x5889e9e1UL, 0xefd390fcUL, 0xdd07d35bUL, 0xdb485694UL, 0x38d7e5b2UL, 0x57720101UL, +0x730edebcUL, 0x5b643113UL, 0x94917e4fUL, 0x503c2fbaUL, 0x646f1282UL, 0x7523d24aUL, +0xe0779695UL, 0xf9c17a8fUL, 0x7a5b2121UL, 0xd187b896UL, 0x29263a4dUL, 0xba510cdfUL, +0x81f47c9fUL, 0xad1163edUL, 0xea7b5965UL, 0x1a00726eUL, 0x11403092UL, 0x00da6d77UL, +0x4a0cdd61UL, 0xad1f4603UL, 0x605bdfb0UL, 0x9eedc364UL, 0x22ebe6a8UL, 0xcee7d28aUL, +0xa0e736a0UL, 0x5564a6b9UL, 0x10853209UL, 0xc7eb8f37UL, 0x2de705caUL, 0x8951570fUL, +0xdf09822bUL, 0xbd691a6cUL, 0xaa12e4f2UL, 0x87451c0fUL, 0xe0f6a27aUL, 0x3ada4819UL, +0x4cf1764fUL, 0x0d771c2bUL, 0x67cdb156UL, 0x350d8384UL, 0x5938fa0fUL, 0x42399ef3UL, +0x36997b07UL, 0x0e84093dUL, 0x4aa93e61UL, 0x8360d87bUL, 0x1fa98b0cUL, 0x1149382cUL, +0xe97625a5UL, 0x0614d1b7UL, 0x0e25244bUL, 0x0c768347UL, 0x589e8d82UL, 0x0d2059d1UL, +0xa466bb1eUL, 0xf8da0a82UL, 0x04f19130UL, 0xba6e4ec0UL, 0x99265164UL, 0x1ee7230dUL, 0x50b2ad80UL, 0xeaee6801UL, 0x8db2a283UL, 0xea8bf59eUL}; /* returns the i'th byte of a variable */ #ifdef _MSC_VER #define GB(x, i) ((unsigned char)((x[(15-i)>>2])>>(unsigned)(8*((15-i)&3)))) -#else +#else #define GB(x, i) (((x[(15-i)>>2])>>(unsigned)(8*((15-i)&3)))&255) -#endif +#endif /** Initialize the LTC_CAST5 block cipher @@ -419,9 +417,9 @@ int cast5_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_ LTC_ARGCHK(skey != NULL); if (num_rounds != 12 && num_rounds != 16 && num_rounds != 0) { - return CRYPT_INVALID_ROUNDS; + return CRYPT_INVALID_ROUNDS; } - + if (num_rounds == 12 && keylen > 10) { return CRYPT_INVALID_ROUNDS; } @@ -484,7 +482,7 @@ int cast5_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_ zeromem(buf, sizeof(buf)); zeromem(x, sizeof(x)); zeromem(z, sizeof(z)); -#endif +#endif return CRYPT_OK; } @@ -502,9 +500,9 @@ int cast5_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_ #ifdef _MSC_VER #define INLINE __inline #else - #define INLINE -#endif - + #define INLINE +#endif + INLINE static ulong32 FI(ulong32 R, ulong32 Km, ulong32 Kr) { ulong32 I; @@ -512,7 +510,7 @@ INLINE static ulong32 FI(ulong32 R, ulong32 Km, ulong32 Kr) I = ROL(I, Kr); return ((S1[byte(I, 3)] ^ S2[byte(I,2)]) - S3[byte(I,1)]) + S4[byte(I,0)]; } - + INLINE static ulong32 FII(ulong32 R, ulong32 Km, ulong32 Kr) { ulong32 I; @@ -547,7 +545,7 @@ int cast5_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key LTC_ARGCHK(ct != NULL); LTC_ARGCHK(skey != NULL); - LOAD32H(L,&pt[0]); + LOAD32H(L,&pt[0]); LOAD32H(R,&pt[4]); L ^= FI(R, skey->cast5.K[0], skey->cast5.K[16]); R ^= FII(L, skey->cast5.K[1], skey->cast5.K[17]); @@ -586,7 +584,7 @@ int cast5_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key Decrypts a block of text with LTC_CAST5 @param ct The input ciphertext (8 bytes) @param pt The output plaintext (8 bytes) - @param skey The key as scheduled + @param skey The key as scheduled */ #ifdef LTC_CLEAN_STACK static int _cast5_ecb_decrypt(const unsigned char *ct, unsigned char *pt, symmetric_key *skey) @@ -600,7 +598,7 @@ int cast5_ecb_decrypt(const unsigned char *ct, unsigned char *pt, symmetric_key LTC_ARGCHK(ct != NULL); LTC_ARGCHK(skey != NULL); - LOAD32H(R,&ct[0]); + LOAD32H(R,&ct[0]); LOAD32H(L,&ct[4]); if (skey->cast5.keylen > 10) { R ^= FI(L, skey->cast5.K[15], skey->cast5.K[31]); @@ -643,7 +641,7 @@ int cast5_test(void) { #ifndef LTC_TEST return CRYPT_NOP; - #else + #else static const struct { int keylen; unsigned char key[16]; @@ -676,7 +674,8 @@ int cast5_test(void) } cast5_ecb_encrypt(tests[i].pt, tmp[0], &key); cast5_ecb_decrypt(tmp[0], tmp[1], &key); - if ((XMEMCMP(tmp[0], tests[i].ct, 8) != 0) || (XMEMCMP(tmp[1], tests[i].pt, 8) != 0)) { + if ((compare_testvector(tmp[0], 8, tests[i].ct, 8, "CAST5 Encrypt", i) != 0) || + (compare_testvector(tmp[1], 8, tests[i].pt, 8, "CAST5 Decrypt", i) != 0)) { return CRYPT_FAIL_TESTVECTOR; } /* now see if we can encrypt all zero bytes 1000 times, decrypt and come back where we started */ @@ -684,17 +683,18 @@ int cast5_test(void) for (y = 0; y < 1000; y++) cast5_ecb_encrypt(tmp[0], tmp[0], &key); for (y = 0; y < 1000; y++) cast5_ecb_decrypt(tmp[0], tmp[0], &key); for (y = 0; y < 8; y++) if (tmp[0][y] != 0) return CRYPT_FAIL_TESTVECTOR; - + } return CRYPT_OK; #endif } -/** Terminate the context +/** Terminate the context @param skey The scheduled key */ void cast5_done(symmetric_key *skey) { + LTC_UNUSED_PARAM(skey); } /** @@ -711,10 +711,10 @@ int cast5_keysize(int *keysize) *keysize = 16; } return CRYPT_OK; -} +} #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/ciphers/des.c b/libtomcrypt/src/ciphers/des.c index 338dcc2..d45b925 100644 --- a/libtomcrypt/src/ciphers/des.c +++ b/libtomcrypt/src/ciphers/des.c @@ -5,14 +5,12 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" /** @file des.c - LTC_DES code submitted by Dobes Vandermeer + DES code submitted by Dobes Vandermeer */ #ifdef LTC_DES @@ -32,7 +30,7 @@ const struct ltc_cipher_descriptor des_desc = &des_test, &des_done, &des_keysize, - NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL + NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL }; #endif @@ -47,7 +45,7 @@ const struct ltc_cipher_descriptor des3_desc = &des3_test, &des3_done, &des3_keysize, - NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL + NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL }; static const ulong32 bytebit[8] = @@ -1387,7 +1385,7 @@ static void cookey(const ulong32 *raw1, ulong32 *keyout) *cook++ |= (*raw1 & 0x0000003fL); } - XMEMCPY(keyout, dough, sizeof dough); + XMEMCPY(keyout, dough, sizeof(dough)); } #ifdef LTC_CLEAN_STACK @@ -1566,17 +1564,27 @@ int des3_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_k return CRYPT_INVALID_ROUNDS; } - if (keylen != 24) { + if (keylen != 24 && keylen != 16) { return CRYPT_INVALID_KEYSIZE; } deskey(key, EN0, skey->des3.ek[0]); deskey(key+8, DE1, skey->des3.ek[1]); + if (keylen == 24) { deskey(key+16, EN0, skey->des3.ek[2]); + } else { + /* two-key 3DES: K3=K1 */ + deskey(key, EN0, skey->des3.ek[2]); + } deskey(key, DE1, skey->des3.dk[2]); deskey(key+8, EN0, skey->des3.dk[1]); + if (keylen == 24) { deskey(key+16, DE1, skey->des3.dk[0]); + } else { + /* two-key 3DES: K3=K1 */ + deskey(key, DE1, skey->des3.dk[0]); + } return CRYPT_OK; } @@ -1747,7 +1755,178 @@ int des_test(void) { 0x0D, 0x9F, 0x27, 0x9B, 0xA5, 0xD8, 0x72, 0x60 } }, {10, 0, { 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01 }, { 0x00, 0x80, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, - { 0xD9, 0x03, 0x1B, 0x02, 0x71, 0xBD, 0x5A, 0x0A } } + { 0xD9, 0x03, 0x1B, 0x02, 0x71, 0xBD, 0x5A, 0x0A } }, + +#ifdef LTC_TEST_EXT + { 0+11, 0, { 0x80, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01 }, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0x95, 0xA8, 0xD7, 0x28, 0x13, 0xDA, 0xA9, 0x4D } }, + { 1+11, 0, { 0x40, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01 }, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0x0E, 0xEC, 0x14, 0x87, 0xDD, 0x8C, 0x26, 0xD5 } }, + { 2+11, 0, { 0x20, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01 }, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0x7A, 0xD1, 0x6F, 0xFB, 0x79, 0xC4, 0x59, 0x26 } }, + { 3+11, 0, { 0x10, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01 }, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0xD3, 0x74, 0x62, 0x94, 0xCA, 0x6A, 0x6C, 0xF3 } }, + { 4+11, 0, { 0x08, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01 }, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0x80, 0x9F, 0x5F, 0x87, 0x3C, 0x1F, 0xD7, 0x61 } }, + { 5+11, 0, { 0x04, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01 }, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0xC0, 0x2F, 0xAF, 0xFE, 0xC9, 0x89, 0xD1, 0xFC } }, + { 6+11, 0, { 0x02, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01 }, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0x46, 0x15, 0xAA, 0x1D, 0x33, 0xE7, 0x2F, 0x10 } }, + { 7+11, 0, { 0x01, 0x80, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01 }, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0x20, 0x55, 0x12, 0x33, 0x50, 0xC0, 0x08, 0x58 } }, + { 8+11, 0, { 0x01, 0x40, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01 }, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0xDF, 0x3B, 0x99, 0xD6, 0x57, 0x73, 0x97, 0xC8 } }, + { 9+11, 0, { 0x01, 0x20, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01 }, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0x31, 0xFE, 0x17, 0x36, 0x9B, 0x52, 0x88, 0xC9 } }, + {10+11, 0, { 0x01, 0x10, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01 }, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0xDF, 0xDD, 0x3C, 0xC6, 0x4D, 0xAE, 0x16, 0x42 } }, + {11+11, 0, { 0x01, 0x08, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01 }, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0x17, 0x8C, 0x83, 0xCE, 0x2B, 0x39, 0x9D, 0x94 } }, + {12+11, 0, { 0x01, 0x04, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01 }, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0x50, 0xF6, 0x36, 0x32, 0x4A, 0x9B, 0x7F, 0x80 } }, + {13+11, 0, { 0x01, 0x02, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01 }, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0xA8, 0x46, 0x8E, 0xE3, 0xBC, 0x18, 0xF0, 0x6D } }, + {14+11, 0, { 0x01, 0x01, 0x80, 0x01, 0x01, 0x01, 0x01, 0x01 }, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0xA2, 0xDC, 0x9E, 0x92, 0xFD, 0x3C, 0xDE, 0x92 } }, + {15+11, 0, { 0x01, 0x01, 0x40, 0x01, 0x01, 0x01, 0x01, 0x01 }, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0xCA, 0xC0, 0x9F, 0x79, 0x7D, 0x03, 0x12, 0x87 } }, + {16+11, 0, { 0x01, 0x01, 0x20, 0x01, 0x01, 0x01, 0x01, 0x01 }, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0x90, 0xBA, 0x68, 0x0B, 0x22, 0xAE, 0xB5, 0x25 } }, + {17+11, 0, { 0x01, 0x01, 0x10, 0x01, 0x01, 0x01, 0x01, 0x01 }, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0xCE, 0x7A, 0x24, 0xF3, 0x50, 0xE2, 0x80, 0xB6 } }, + {18+11, 0, { 0x01, 0x01, 0x08, 0x01, 0x01, 0x01, 0x01, 0x01 }, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0x88, 0x2B, 0xFF, 0x0A, 0xA0, 0x1A, 0x0B, 0x87 } }, + {19+11, 0, { 0x01, 0x01, 0x04, 0x01, 0x01, 0x01, 0x01, 0x01 }, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0x25, 0x61, 0x02, 0x88, 0x92, 0x45, 0x11, 0xC2 } }, + {20+11, 0, { 0x01, 0x01, 0x02, 0x01, 0x01, 0x01, 0x01, 0x01 }, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0xC7, 0x15, 0x16, 0xC2, 0x9C, 0x75, 0xD1, 0x70 } }, + {21+11, 0, { 0x01, 0x01, 0x01, 0x80, 0x01, 0x01, 0x01, 0x01 }, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0x51, 0x99, 0xC2, 0x9A, 0x52, 0xC9, 0xF0, 0x59 } }, + {22+11, 0, { 0x01, 0x01, 0x01, 0x40, 0x01, 0x01, 0x01, 0x01 }, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0xC2, 0x2F, 0x0A, 0x29, 0x4A, 0x71, 0xF2, 0x9F } }, + {23+11, 0, { 0x01, 0x01, 0x01, 0x20, 0x01, 0x01, 0x01, 0x01 }, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0xEE, 0x37, 0x14, 0x83, 0x71, 0x4C, 0x02, 0xEA } }, + {24+11, 0, { 0x01, 0x01, 0x01, 0x10, 0x01, 0x01, 0x01, 0x01 }, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0xA8, 0x1F, 0xBD, 0x44, 0x8F, 0x9E, 0x52, 0x2F } }, + {25+11, 0, { 0x01, 0x01, 0x01, 0x08, 0x01, 0x01, 0x01, 0x01 }, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0x4F, 0x64, 0x4C, 0x92, 0xE1, 0x92, 0xDF, 0xED } }, + {26+11, 0, { 0x01, 0x01, 0x01, 0x04, 0x01, 0x01, 0x01, 0x01 }, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0x1A, 0xFA, 0x9A, 0x66, 0xA6, 0xDF, 0x92, 0xAE } }, + {27+11, 0, { 0x01, 0x01, 0x01, 0x02, 0x01, 0x01, 0x01, 0x01 }, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0xB3, 0xC1, 0xCC, 0x71, 0x5C, 0xB8, 0x79, 0xD8 } }, + {28+11, 0, { 0x01, 0x01, 0x01, 0x01, 0x80, 0x01, 0x01, 0x01 }, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0x19, 0xD0, 0x32, 0xE6, 0x4A, 0xB0, 0xBD, 0x8B } }, + {29+11, 0, { 0x01, 0x01, 0x01, 0x01, 0x40, 0x01, 0x01, 0x01 }, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0x3C, 0xFA, 0xA7, 0xA7, 0xDC, 0x87, 0x20, 0xDC } }, + {30+11, 0, { 0x01, 0x01, 0x01, 0x01, 0x20, 0x01, 0x01, 0x01 }, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0xB7, 0x26, 0x5F, 0x7F, 0x44, 0x7A, 0xC6, 0xF3 } }, + {31+11, 0, { 0x01, 0x01, 0x01, 0x01, 0x10, 0x01, 0x01, 0x01 }, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0x9D, 0xB7, 0x3B, 0x3C, 0x0D, 0x16, 0x3F, 0x54 } }, + {32+11, 0, { 0x01, 0x01, 0x01, 0x01, 0x08, 0x01, 0x01, 0x01 }, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0x81, 0x81, 0xB6, 0x5B, 0xAB, 0xF4, 0xA9, 0x75 } }, + {33+11, 0, { 0x01, 0x01, 0x01, 0x01, 0x04, 0x01, 0x01, 0x01 }, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0x93, 0xC9, 0xB6, 0x40, 0x42, 0xEA, 0xA2, 0x40 } }, + {34+11, 0, { 0x01, 0x01, 0x01, 0x01, 0x02, 0x01, 0x01, 0x01 }, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0x55, 0x70, 0x53, 0x08, 0x29, 0x70, 0x55, 0x92 } }, + {35+11, 0, { 0x01, 0x01, 0x01, 0x01, 0x01, 0x80, 0x01, 0x01 }, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0x86, 0x38, 0x80, 0x9E, 0x87, 0x87, 0x87, 0xA0 } }, + {36+11, 0, { 0x01, 0x01, 0x01, 0x01, 0x01, 0x40, 0x01, 0x01 }, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0x41, 0xB9, 0xA7, 0x9A, 0xF7, 0x9A, 0xC2, 0x08 } }, + {37+11, 0, { 0x01, 0x01, 0x01, 0x01, 0x01, 0x20, 0x01, 0x01 }, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0x7A, 0x9B, 0xE4, 0x2F, 0x20, 0x09, 0xA8, 0x92 } }, + {38+11, 0, { 0x01, 0x01, 0x01, 0x01, 0x01, 0x10, 0x01, 0x01 }, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0x29, 0x03, 0x8D, 0x56, 0xBA, 0x6D, 0x27, 0x45 } }, + {39+11, 0, { 0x01, 0x01, 0x01, 0x01, 0x01, 0x08, 0x01, 0x01 }, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0x54, 0x95, 0xC6, 0xAB, 0xF1, 0xE5, 0xDF, 0x51 } }, + {40+11, 0, { 0x01, 0x01, 0x01, 0x01, 0x01, 0x04, 0x01, 0x01 }, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0xAE, 0x13, 0xDB, 0xD5, 0x61, 0x48, 0x89, 0x33 } }, + {41+11, 0, { 0x01, 0x01, 0x01, 0x01, 0x01, 0x02, 0x01, 0x01 }, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0x02, 0x4D, 0x1F, 0xFA, 0x89, 0x04, 0xE3, 0x89 } }, + {42+11, 0, { 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x80, 0x01 }, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0xD1, 0x39, 0x97, 0x12, 0xF9, 0x9B, 0xF0, 0x2E } }, + {43+11, 0, { 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x40, 0x01 }, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0x14, 0xC1, 0xD7, 0xC1, 0xCF, 0xFE, 0xC7, 0x9E } }, + {44+11, 0, { 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x20, 0x01 }, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0x1D, 0xE5, 0x27, 0x9D, 0xAE, 0x3B, 0xED, 0x6F } }, + {45+11, 0, { 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x10, 0x01 }, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0xE9, 0x41, 0xA3, 0x3F, 0x85, 0x50, 0x13, 0x03 } }, + {46+11, 0, { 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x08, 0x01 }, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0xDA, 0x99, 0xDB, 0xBC, 0x9A, 0x03, 0xF3, 0x79 } }, + {47+11, 0, { 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x04, 0x01 }, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0xB7, 0xFC, 0x92, 0xF9, 0x1D, 0x8E, 0x92, 0xE9 } }, + {48+11, 0, { 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x02, 0x01 }, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0xAE, 0x8E, 0x5C, 0xAA, 0x3C, 0xA0, 0x4E, 0x85 } }, + {49+11, 0, { 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x80 }, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0x9C, 0xC6, 0x2D, 0xF4, 0x3B, 0x6E, 0xED, 0x74 } }, + {50+11, 0, { 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x40 }, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0xD8, 0x63, 0xDB, 0xB5, 0xC5, 0x9A, 0x91, 0xA0 } }, + {51+11, 0, { 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x20 }, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0xA1, 0xAB, 0x21, 0x90, 0x54, 0x5B, 0x91, 0xD7 } }, + {52+11, 0, { 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x10 }, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0x08, 0x75, 0x04, 0x1E, 0x64, 0xC5, 0x70, 0xF7 } }, + {53+11, 0, { 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x08 }, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0x5A, 0x59, 0x45, 0x28, 0xBE, 0xBE, 0xF1, 0xCC } }, + {54+11, 0, { 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x04 }, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0xFC, 0xDB, 0x32, 0x91, 0xDE, 0x21, 0xF0, 0xC0 } }, + {55+11, 0, { 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x02 }, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0x86, 0x9E, 0xFD, 0x7F, 0x9F, 0x26, 0x5A, 0x09 } }, +#endif /* LTC_TEST_EXT */ /*** more test cases you could add if you are not convinced (the above test cases aren't really too good): @@ -1805,7 +1984,7 @@ int des_test(void) des_ecb_decrypt(cases[i].txt, tmp, &des); } - if (XMEMCMP(cases[i].out, tmp, sizeof(tmp)) != 0) { + if (compare_testvector(cases[i].out, sizeof(tmp), tmp, sizeof(tmp), "DES", i) != 0) { return CRYPT_FAIL_TESTVECTOR; } @@ -1814,7 +1993,7 @@ int des_test(void) for (y = 0; y < 1000; y++) des_ecb_encrypt(tmp, tmp, &des); for (y = 0; y < 1000; y++) des_ecb_decrypt(tmp, tmp, &des); for (y = 0; y < 8; y++) if (tmp[y] != 0) return CRYPT_FAIL_TESTVECTOR; -} + } return CRYPT_OK; #endif @@ -1849,7 +2028,7 @@ int des3_test(void) des3_ecb_encrypt(pt, ct, &skey); des3_ecb_decrypt(ct, tmp, &skey); - if (XMEMCMP(pt, tmp, 8) != 0) { + if (compare_testvector(pt, 8, tmp, 8, "3DES", 0) != 0) { return CRYPT_FAIL_TESTVECTOR; } @@ -1863,6 +2042,7 @@ int des3_test(void) */ void des_done(symmetric_key *skey) { + LTC_UNUSED_PARAM(skey); } #endif @@ -1871,7 +2051,7 @@ void des_done(symmetric_key *skey) */ void des3_done(symmetric_key *skey) { - (void)skey; + LTC_UNUSED_PARAM(skey); } @@ -1910,6 +2090,6 @@ int des3_keysize(int *keysize) #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/ciphers/kasumi.c b/libtomcrypt/src/ciphers/kasumi.c index 3b765d0..7c2add5 100644 --- a/libtomcrypt/src/ciphers/kasumi.c +++ b/libtomcrypt/src/ciphers/kasumi.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /** @@ -33,7 +31,7 @@ const struct ltc_cipher_descriptor kasumi_desc = { &kasumi_test, &kasumi_done, &kasumi_keysize, - NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL + NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL }; static u16 FI( u16 in, u16 subkey ) @@ -150,7 +148,7 @@ int kasumi_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key LOAD32H(left, pt); LOAD32H(right, pt+4); - for (n = 0; n <= 7; ) { + for (n = 0; n <= 7; ) { temp = FL(left, n, skey); temp = FO(temp, n++, skey); right ^= temp; @@ -236,6 +234,7 @@ int kasumi_setup(const unsigned char *key, int keylen, int num_rounds, symmetric void kasumi_done(symmetric_key *skey) { + LTC_UNUSED_PARAM(skey); } int kasumi_keysize(int *keysize) @@ -303,7 +302,8 @@ int kasumi_test(void) if ((err = kasumi_ecb_decrypt(tests[x].ct, buf[1], &key)) != CRYPT_OK) { return err; } - if (XMEMCMP(tests[x].pt, buf[1], 8) || XMEMCMP(tests[x].ct, buf[0], 8)) { + if (compare_testvector(buf[1], 8, tests[x].pt, 8, "Kasumi Decrypt", x) || + compare_testvector(buf[0], 8, tests[x].ct, 8, "Kasumi Encrypt", x)) { return CRYPT_FAIL_TESTVECTOR; } } @@ -313,6 +313,6 @@ int kasumi_test(void) #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/ciphers/khazad.c b/libtomcrypt/src/ciphers/khazad.c index a3c67d5..4d1f2ce 100644 --- a/libtomcrypt/src/ciphers/khazad.c +++ b/libtomcrypt/src/ciphers/khazad.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" @@ -28,14 +26,14 @@ const struct ltc_cipher_descriptor khazad_desc = { &khazad_test, &khazad_done, &khazad_keysize, - NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL + NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL }; -#define R 8 -#define KEYSIZE 128 -#define KEYSIZEB (KEYSIZE/8) -#define BLOCKSIZE 64 -#define BLOCKSIZEB (BLOCKSIZE/8) +#define R 8 +#define KEYSIZE 128 +#define KEYSIZEB (KEYSIZE/8) +#define BLOCKSIZE 64 +#define BLOCKSIZEB (BLOCKSIZE/8) static const ulong64 T0[256] = { CONST64(0xbad3d268bbb96a01), CONST64(0x54fc4d19e59a66b1), CONST64(0x2f71bc93e26514cd), CONST64(0x749ccdb925871b51), @@ -756,7 +754,7 @@ int khazad_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key Decrypts a block of text with Khazad @param ct The input ciphertext (8 bytes) @param pt The output plaintext (8 bytes) - @param skey The key as scheduled + @param skey The key as scheduled @return CRYPT_OK if successful */ int khazad_ecb_decrypt(const unsigned char *ct, unsigned char *pt, symmetric_key *skey) @@ -783,22 +781,22 @@ int khazad_test(void) { { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, { 0x49, 0xA4, 0xCE, 0x32, 0xAC, 0x19, 0x0E, 0x3F }, - { 0x80, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + { 0x80, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 } }, { { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, { 0x64, 0x5D, 0x77, 0x3E, 0x40, 0xAB, 0xDD, 0x53 }, - { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x01 } }, { { 0x80, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, { 0x9E, 0x39, 0x98, 0x64, 0xF7, 0x8E, 0xCA, 0x02 }, - { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 } }, { { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x01 }, { 0xA9, 0xDF, 0x3D, 0x2C, 0x64, 0xD3, 0xEA, 0x28 }, - { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 } } }; @@ -810,13 +808,14 @@ int khazad_test(void) khazad_setup(tests[x].key, 16, 0, &skey); khazad_ecb_encrypt(tests[x].pt, buf[0], &skey); khazad_ecb_decrypt(buf[0], buf[1], &skey); - if (XMEMCMP(buf[0], tests[x].ct, 8) || XMEMCMP(buf[1], tests[x].pt, 8)) { + if (compare_testvector(buf[0], 8, tests[x].ct, 8, "Khazad Encrypt", x) || + compare_testvector(buf[1], 8, tests[x].pt, 8, "Khazad Decrypt", x)) { return CRYPT_FAIL_TESTVECTOR; } for (y = 0; y < 1000; y++) khazad_ecb_encrypt(buf[0], buf[0], &skey); for (y = 0; y < 1000; y++) khazad_ecb_decrypt(buf[0], buf[0], &skey); - if (XMEMCMP(buf[0], tests[x].ct, 8)) { + if (compare_testvector(buf[0], 8, tests[x].ct, 8, "Khazad 1000", 1000)) { return CRYPT_FAIL_TESTVECTOR; } @@ -825,11 +824,12 @@ int khazad_test(void) #endif } -/** Terminate the context +/** Terminate the context @param skey The scheduled key */ void khazad_done(symmetric_key *skey) { + LTC_UNUSED_PARAM(skey); } /** @@ -850,6 +850,6 @@ int khazad_keysize(int *keysize) #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/ciphers/kseed.c b/libtomcrypt/src/ciphers/kseed.c index a163c95..e12fdc7 100644 --- a/libtomcrypt/src/ciphers/kseed.c +++ b/libtomcrypt/src/ciphers/kseed.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /** @@ -29,7 +27,7 @@ const struct ltc_cipher_descriptor kseed_desc = { &kseed_test, &kseed_done, &kseed_keysize, - NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL + NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL }; static const ulong32 SS0[256] = { @@ -201,41 +199,41 @@ static const ulong32 KCi[16] = { */ int kseed_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey) { - int i; - ulong32 tmp, k1, k2, k3, k4; + int i; + ulong32 tmp, k1, k2, k3, k4; - if (keylen != 16) { - return CRYPT_INVALID_KEYSIZE; - } - - if (num_rounds != 16 && num_rounds != 0) { - return CRYPT_INVALID_ROUNDS; - } + if (keylen != 16) { + return CRYPT_INVALID_KEYSIZE; + } - /* load key */ - LOAD32H(k1, key); - LOAD32H(k2, key+4); - LOAD32H(k3, key+8); - LOAD32H(k4, key+12); + if (num_rounds != 16 && num_rounds != 0) { + return CRYPT_INVALID_ROUNDS; + } - for (i = 0; i < 16; i++) { - skey->kseed.K[2*i+0] = G(k1 + k3 - KCi[i]); - skey->kseed.K[2*i+1] = G(k2 - k4 + KCi[i]); - if (i&1) { - tmp = k3; - k3 = ((k3 << 8) | (k4 >> 24)) & 0xFFFFFFFF; - k4 = ((k4 << 8) | (tmp >> 24)) & 0xFFFFFFFF; - } else { - tmp = k1; - k1 = ((k1 >> 8) | (k2 << 24)) & 0xFFFFFFFF; - k2 = ((k2 >> 8) | (tmp << 24)) & 0xFFFFFFFF; + /* load key */ + LOAD32H(k1, key); + LOAD32H(k2, key+4); + LOAD32H(k3, key+8); + LOAD32H(k4, key+12); + + for (i = 0; i < 16; i++) { + skey->kseed.K[2*i+0] = G(k1 + k3 - KCi[i]); + skey->kseed.K[2*i+1] = G(k2 - k4 + KCi[i]); + if (i&1) { + tmp = k3; + k3 = ((k3 << 8) | (k4 >> 24)) & 0xFFFFFFFF; + k4 = ((k4 << 8) | (tmp >> 24)) & 0xFFFFFFFF; + } else { + tmp = k1; + k1 = ((k1 >> 8) | (k2 << 24)) & 0xFFFFFFFF; + k2 = ((k2 >> 8) | (tmp << 24)) & 0xFFFFFFFF; } /* reverse keys for decrypt */ skey->kseed.dK[2*(15-i)+0] = skey->kseed.K[2*i+0]; skey->kseed.dK[2*(15-i)+1] = skey->kseed.K[2*i+1]; - } + } - return CRYPT_OK; + return CRYPT_OK; } static void rounds(ulong32 *P, ulong32 *K) @@ -275,7 +273,7 @@ int kseed_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key Decrypts a block of text with SEED @param ct The input ciphertext (16 bytes) @param pt The output plaintext (16 bytes) - @param skey The key as scheduled + @param skey The key as scheduled @return CRYPT_OK if successful */ int kseed_ecb_decrypt(const unsigned char *ct, unsigned char *pt, symmetric_key *skey) @@ -293,11 +291,12 @@ int kseed_ecb_decrypt(const unsigned char *ct, unsigned char *pt, symmetric_key return CRYPT_OK; } -/** Terminate the context +/** Terminate the context @param skey The scheduled key */ void kseed_done(symmetric_key *skey) { + LTC_UNUSED_PARAM(skey); } /** @@ -345,7 +344,8 @@ int kseed_test(void) kseed_setup(tests[x].key, 16, 0, &skey); kseed_ecb_encrypt(tests[x].pt, buf[0], &skey); kseed_ecb_decrypt(buf[0], buf[1], &skey); - if (XMEMCMP(buf[0], tests[x].ct, 16) || XMEMCMP(buf[1], tests[x].pt, 16)) { + if (compare_testvector(buf[0], 16, tests[x].ct, 16, "KSEED Encrypt", x) || + compare_testvector(buf[1], 16, tests[x].pt, 16, "KSEED Decrypt", x)) { return CRYPT_FAIL_TESTVECTOR; } } @@ -371,6 +371,6 @@ int kseed_keysize(int *keysize) #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/ciphers/multi2.c b/libtomcrypt/src/ciphers/multi2.c index db0b3ba..86c1812 100644 --- a/libtomcrypt/src/ciphers/multi2.c +++ b/libtomcrypt/src/ciphers/multi2.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /** @@ -58,7 +56,7 @@ static void setup(ulong32 *dk, ulong32 *k, ulong32 *uk) p[0] = dk[0]; p[1] = dk[1]; - t = 4; + t = 4; n = 0; pi1(p); pi2(p, k); @@ -83,28 +81,28 @@ static void encrypt(ulong32 *p, int N, ulong32 *uk) { int n, t; for (t = n = 0; ; ) { - pi1(p); if (++n == N) break; + pi1(p); if (++n == N) break; pi2(p, uk+t); if (++n == N) break; pi3(p, uk+t); if (++n == N) break; pi4(p, uk+t); if (++n == N) break; t ^= 4; } -} +} static void decrypt(ulong32 *p, int N, ulong32 *uk) { int n, t; - for (t = 4*((N&1)^1), n = N; ; ) { - switch (n >= 4 ? 4 : 0) { - case 4: pi4(p, uk+t); --n; - case 3: pi3(p, uk+t); --n; - case 2: pi2(p, uk+t); --n; + for (t = 4*(((N-1)>>2)&1), n = N; ; ) { + switch (n<=4 ? n : ((n-1)%4)+1) { + case 4: pi4(p, uk+t); --n; /* FALLTHROUGH */ + case 3: pi3(p, uk+t); --n; /* FALLTHROUGH */ + case 2: pi2(p, uk+t); --n; /* FALLTHROUGH */ case 1: pi1(p); --n; break; case 0: return; } t ^= 4; } -} +} const struct ltc_cipher_descriptor multi2_desc = { "multi2", @@ -116,7 +114,7 @@ const struct ltc_cipher_descriptor multi2_desc = { &multi2_test, &multi2_done, &multi2_keysize, - NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL + NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL }; int multi2_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey) @@ -129,7 +127,7 @@ int multi2_setup(const unsigned char *key, int keylen, int num_rounds, symmetri if (keylen != 40) return CRYPT_INVALID_KEYSIZE; if (num_rounds == 0) num_rounds = 128; - + skey->multi2.N = num_rounds; for (x = 0; x < 8; x++) { LOAD32H(sk[x], key + x*4); @@ -159,7 +157,7 @@ int multi2_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key LOAD32H(p[0], pt); LOAD32H(p[1], pt+4); encrypt(p, skey->multi2.N, skey->multi2.uk); - STORE32H(p[0], ct); + STORE32H(p[0], ct); STORE32H(p[1], ct+4); return CRYPT_OK; } @@ -180,7 +178,7 @@ int multi2_ecb_decrypt(const unsigned char *ct, unsigned char *pt, symmetric_key LOAD32H(p[0], ct); LOAD32H(p[1], ct+4); decrypt(p, skey->multi2.N, skey->multi2.uk); - STORE32H(p[0], pt); + STORE32H(p[0], pt); STORE32H(p[1], pt+4); return CRYPT_OK; } @@ -207,7 +205,7 @@ int multi2_test(void) 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, - + 0x01, 0x23, 0x45, 0x67, 0x89, 0xAB, 0xCD, 0xEF }, @@ -235,7 +233,7 @@ int multi2_test(void) 0xb1, 0x27, 0xb9, 0x06, 0xe7, 0x56, 0x22, 0x38, }, - { + { 0x1f, 0xb4, 0x60, 0x60, 0xd0, 0xb3, 0x4f, 0xa5 }, @@ -258,26 +256,44 @@ int multi2_test(void) return err; } - if (XMEMCMP(buf, tests[x].ct, 8)) { + if (compare_testvector(buf, 8, tests[x].ct, 8, "Multi2 Encrypt", x)) { return CRYPT_FAIL_TESTVECTOR; } - + if ((err = multi2_ecb_decrypt(buf, buf, &skey)) != CRYPT_OK) { return err; } - if (XMEMCMP(buf, tests[x].pt, 8)) { + if (compare_testvector(buf, 8, tests[x].pt, 8, "Multi2 Decrypt", x)) { return CRYPT_FAIL_TESTVECTOR; } } - + + for (x = 128; x < 256; ++x) { + unsigned char ct[8]; + + if ((err = multi2_setup(tests[0].key, 40, x, &skey)) != CRYPT_OK) { + return err; + } + if ((err = multi2_ecb_encrypt(tests[0].pt, ct, &skey)) != CRYPT_OK) { + return err; + } + if ((err = multi2_ecb_decrypt(ct, buf, &skey)) != CRYPT_OK) { + return err; + } + if (compare_testvector(buf, 8, tests[0].pt, 8, "Multi2 Rounds", x)) { + return CRYPT_FAIL_TESTVECTOR; + } + } + return CRYPT_OK; } -/** Terminate the context +/** Terminate the context @param skey The scheduled key */ void multi2_done(symmetric_key *skey) { + LTC_UNUSED_PARAM(skey); } /** @@ -298,6 +314,6 @@ int multi2_keysize(int *keysize) #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/ciphers/noekeon.c b/libtomcrypt/src/ciphers/noekeon.c index bdbcb2a..13720d1 100644 --- a/libtomcrypt/src/ciphers/noekeon.c +++ b/libtomcrypt/src/ciphers/noekeon.c @@ -5,12 +5,10 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /** @file noekeon.c - Implementation of the Noekeon block cipher by Tom St Denis + Implementation of the Noekeon block cipher by Tom St Denis */ #include "tomcrypt.h" @@ -27,7 +25,7 @@ const struct ltc_cipher_descriptor noekeon_desc = &noekeon_test, &noekeon_done, &noekeon_keysize, - NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL + NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL }; static const ulong32 RC[] = { @@ -35,7 +33,7 @@ static const ulong32 RC[] = { 0x000000d8UL, 0x000000abUL, 0x0000004dUL, 0x0000009aUL, 0x0000002fUL, 0x0000005eUL, 0x000000bcUL, 0x00000063UL, 0x000000c6UL, 0x00000097UL, 0x00000035UL, 0x0000006aUL, - 0x000000d4UL + 0x000000d4UL }; #define kTHETA(a, b, c, d) \ @@ -49,7 +47,7 @@ static const ulong32 RC[] = { b ^= temp ^ k[1]; d ^= temp ^ k[3]; \ temp = b^d; temp = temp ^ ROLc(temp, 8) ^ RORc(temp, 8); \ a ^= temp ^ k[0]; c ^= temp ^ k[2]; - + #define GAMMA(a, b, c, d) \ b ^= ~(d|c); \ a ^= c&b; \ @@ -57,13 +55,13 @@ static const ulong32 RC[] = { c ^= a ^ b ^ d; \ b ^= ~(d|c); \ a ^= c&b; - + #define PI1(a, b, c, d) \ - a = ROLc(a, 1); c = ROLc(c, 5); d = ROLc(d, 2); - + b = ROLc(b, 1); c = ROLc(c, 5); d = ROLc(d, 2); + #define PI2(a, b, c, d) \ - a = RORc(a, 1); c = RORc(c, 5); d = RORc(d, 2); - + b = RORc(b, 1); c = RORc(c, 5); d = RORc(d, 2); + /** Initialize the Noekeon block cipher @param key The symmetric key you wish to pass @@ -75,23 +73,23 @@ static const ulong32 RC[] = { int noekeon_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey) { ulong32 temp; - + LTC_ARGCHK(key != NULL); LTC_ARGCHK(skey != NULL); - + if (keylen != 16) { return CRYPT_INVALID_KEYSIZE; } - + if (num_rounds != 16 && num_rounds != 0) { return CRYPT_INVALID_ROUNDS; } - + LOAD32H(skey->noekeon.K[0],&key[0]); LOAD32H(skey->noekeon.K[1],&key[4]); LOAD32H(skey->noekeon.K[2],&key[8]); LOAD32H(skey->noekeon.K[3],&key[12]); - + LOAD32H(skey->noekeon.dK[0],&key[0]); LOAD32H(skey->noekeon.dK[1],&key[4]); LOAD32H(skey->noekeon.dK[2],&key[8]); @@ -121,10 +119,10 @@ int noekeon_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_ke LTC_ARGCHK(skey != NULL); LTC_ARGCHK(pt != NULL); LTC_ARGCHK(ct != NULL); - + LOAD32H(a,&pt[0]); LOAD32H(b,&pt[4]); LOAD32H(c,&pt[8]); LOAD32H(d,&pt[12]); - + #define ROUND(i) \ a ^= RC[i]; \ THETA(skey->noekeon.K, a,b,c,d); \ @@ -140,7 +138,7 @@ int noekeon_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_ke a ^= RC[16]; THETA(skey->noekeon.K, a, b, c, d); - + STORE32H(a,&ct[0]); STORE32H(b,&ct[4]); STORE32H(c,&ct[8]); STORE32H(d,&ct[12]); @@ -152,7 +150,7 @@ int noekeon_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_ke { int err = _noekeon_ecb_encrypt(pt, ct, skey); burn_stack(sizeof(ulong32) * 5 + sizeof(int)); - return CRYPT_OK; + return err; } #endif @@ -160,7 +158,7 @@ int noekeon_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_ke Decrypts a block of text with Noekeon @param ct The input ciphertext (16 bytes) @param pt The output plaintext (16 bytes) - @param skey The key as scheduled + @param skey The key as scheduled @return CRYPT_OK if successful */ #ifdef LTC_CLEAN_STACK @@ -175,17 +173,17 @@ int noekeon_ecb_decrypt(const unsigned char *ct, unsigned char *pt, symmetric_ke LTC_ARGCHK(skey != NULL); LTC_ARGCHK(pt != NULL); LTC_ARGCHK(ct != NULL); - + LOAD32H(a,&ct[0]); LOAD32H(b,&ct[4]); LOAD32H(c,&ct[8]); LOAD32H(d,&ct[12]); - + #define ROUND(i) \ THETA(skey->noekeon.dK, a,b,c,d); \ a ^= RC[i]; \ PI1(a,b,c,d); \ GAMMA(a,b,c,d); \ - PI2(a,b,c,d); + PI2(a,b,c,d); for (r = 16; r > 0; --r) { ROUND(r); @@ -224,59 +222,86 @@ int noekeon_test(void) } tests[] = { { 16, - { 0, 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15 }, - { 0, 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15 }, - { 0x18, 0xa6, 0xec, 0xe5, 0x28, 0xaa, 0x79, 0x73, - 0x28, 0xb2, 0xc0, 0x91, 0xa0, 0x2f, 0x54, 0xc5} + { 0xAA, 0x3C, 0x8C, 0x86, 0xD9, 0x8B, 0xF8, 0xBE, 0x21, 0xE0, 0x36, 0x09, 0x78, 0xFB, 0xE4, 0x90 }, + { 0xE4, 0x96, 0x6C, 0xD3, 0x13, 0xA0, 0x6C, 0xAF, 0xD0, 0x23, 0xC9, 0xFD, 0x45, 0x32, 0x23, 0x16 }, + { 0xA6, 0xEC, 0xB8, 0xA8, 0x61, 0xFD, 0x62, 0xD9, 0x13, 0x02, 0xFE, 0x9E, 0x47, 0x01, 0x3F, 0xC3 } + }, + { + 16, + { 0xED, 0x43, 0xD1, 0x87, 0x21, 0x7E, 0xE0, 0x97, 0x3D, 0x76, 0xC3, 0x37, 0x2E, 0x7D, 0xAE, 0xD3 }, + { 0xE3, 0x38, 0x32, 0xCC, 0xF2, 0x2F, 0x2F, 0x0A, 0x4A, 0x8B, 0x8F, 0x18, 0x12, 0x20, 0x17, 0xD3 }, + { 0x94, 0xA5, 0xDF, 0xF5, 0xAE, 0x1C, 0xBB, 0x22, 0xAD, 0xEB, 0xA7, 0x0D, 0xB7, 0x82, 0x90, 0xA0 } + }, + { + 16, + { 0x6F, 0xDC, 0x23, 0x38, 0xF2, 0x10, 0xFB, 0xD3, 0xC1, 0x8C, 0x02, 0xF6, 0xB4, 0x6A, 0xD5, 0xA8 }, + { 0xDB, 0x29, 0xED, 0xB5, 0x5F, 0xB3, 0x60, 0x3A, 0x92, 0xA8, 0xEB, 0x9C, 0x6D, 0x9D, 0x3E, 0x8F }, + { 0x78, 0xF3, 0x6F, 0xF8, 0x9E, 0xBB, 0x8C, 0x6A, 0xE8, 0x10, 0xF7, 0x00, 0x22, 0x15, 0x30, 0x3D } + }, + { + 16, + { 0x2C, 0x0C, 0x02, 0xEF, 0x6B, 0xC4, 0xF2, 0x0B, 0x2E, 0xB9, 0xE0, 0xBF, 0xD9, 0x36, 0xC2, 0x4E }, + { 0x84, 0xE2, 0xFE, 0x64, 0xB1, 0xB9, 0xFE, 0x76, 0xA8, 0x3F, 0x45, 0xC7, 0x40, 0x7A, 0xAF, 0xEE }, + { 0x2A, 0x08, 0xD6, 0xA2, 0x1C, 0x63, 0x08, 0xB0, 0xF8, 0xBC, 0xB3, 0xA1, 0x66, 0xF7, 0xAE, 0xCF } + }, + { + 16, + { 0x6F, 0x30, 0xF8, 0x9F, 0xDA, 0x6E, 0xA0, 0x91, 0x04, 0x0F, 0x6C, 0x8B, 0x7D, 0xF7, 0x2A, 0x4B }, + { 0x65, 0xB6, 0xA6, 0xD0, 0x42, 0x14, 0x08, 0x60, 0x34, 0x8D, 0x37, 0x2F, 0x01, 0xF0, 0x46, 0xBE }, + { 0x66, 0xAC, 0x0B, 0x62, 0x1D, 0x68, 0x11, 0xF5, 0x27, 0xB1, 0x13, 0x5D, 0xF3, 0x2A, 0xE9, 0x18 } + }, + { + 16, + { 0xCA, 0xA4, 0x16, 0xB7, 0x1C, 0x92, 0x2E, 0xAD, 0xEB, 0xA7, 0xDB, 0x69, 0x92, 0xCB, 0x35, 0xEF }, + { 0x81, 0x6F, 0x8E, 0x4D, 0x96, 0xC6, 0xB3, 0x67, 0x83, 0xF5, 0x63, 0xC7, 0x20, 0x6D, 0x40, 0x23 }, + { 0x44, 0xF7, 0x63, 0x62, 0xF0, 0x43, 0xBB, 0x67, 0x4A, 0x75, 0x12, 0x42, 0x46, 0x29, 0x28, 0x19 } + }, + { + 16, + { 0x6B, 0xCF, 0x22, 0x2F, 0xE0, 0x1B, 0xB0, 0xAA, 0xD8, 0x3C, 0x91, 0x99, 0x18, 0xB2, 0x28, 0xE8 }, + { 0x7C, 0x37, 0xC7, 0xD0, 0xAC, 0x92, 0x29, 0xF1, 0x60, 0x82, 0x93, 0x89, 0xAA, 0x61, 0xAA, 0xA9 }, + { 0xE5, 0x89, 0x1B, 0xB3, 0xFE, 0x8B, 0x0C, 0xA1, 0xA6, 0xC7, 0xBE, 0x12, 0x73, 0x0F, 0xC1, 0x19 } + }, + { + 16, + { 0xE6, 0xD0, 0xF1, 0x03, 0x2E, 0xDE, 0x70, 0x8D, 0xD8, 0x9E, 0x36, 0x5C, 0x05, 0x52, 0xE7, 0x0D }, + { 0xE2, 0x42, 0xE7, 0x92, 0x0E, 0xF7, 0x82, 0xA2, 0xB8, 0x21, 0x8D, 0x26, 0xBA, 0x2D, 0xE6, 0x32 }, + { 0x1E, 0xDD, 0x75, 0x22, 0xB9, 0x36, 0x8A, 0x0F, 0x32, 0xFD, 0xD4, 0x48, 0x65, 0x12, 0x5A, 0x2F } } }; symmetric_key key; unsigned char tmp[2][16]; int err, i, y; - + for (i = 0; i < (int)(sizeof(tests)/sizeof(tests[0])); i++) { zeromem(&key, sizeof(key)); - if ((err = noekeon_setup(tests[i].key, tests[i].keylen, 0, &key)) != CRYPT_OK) { + if ((err = noekeon_setup(tests[i].key, tests[i].keylen, 0, &key)) != CRYPT_OK) { return err; } - + noekeon_ecb_encrypt(tests[i].pt, tmp[0], &key); noekeon_ecb_decrypt(tmp[0], tmp[1], &key); - if (XMEMCMP(tmp[0], tests[i].ct, 16) || XMEMCMP(tmp[1], tests[i].pt, 16)) { -#if 0 - printf("\n\nTest %d failed\n", i); - if (XMEMCMP(tmp[0], tests[i].ct, 16)) { - printf("CT: "); - for (i = 0; i < 16; i++) { - printf("%02x ", tmp[0][i]); - } - printf("\n"); - } else { - printf("PT: "); - for (i = 0; i < 16; i++) { - printf("%02x ", tmp[1][i]); - } - printf("\n"); - } -#endif + if (compare_testvector(tmp[0], 16, tests[i].ct, 16, "Noekeon Encrypt", i) || + compare_testvector(tmp[1], 16, tests[i].pt, 16, "Noekeon Decrypt", i)) { return CRYPT_FAIL_TESTVECTOR; } - /* now see if we can encrypt all zero bytes 1000 times, decrypt and come back where we started */ - for (y = 0; y < 16; y++) tmp[0][y] = 0; - for (y = 0; y < 1000; y++) noekeon_ecb_encrypt(tmp[0], tmp[0], &key); - for (y = 0; y < 1000; y++) noekeon_ecb_decrypt(tmp[0], tmp[0], &key); - for (y = 0; y < 16; y++) if (tmp[0][y] != 0) return CRYPT_FAIL_TESTVECTOR; - } + /* now see if we can encrypt all zero bytes 1000 times, decrypt and come back where we started */ + for (y = 0; y < 16; y++) tmp[0][y] = 0; + for (y = 0; y < 1000; y++) noekeon_ecb_encrypt(tmp[0], tmp[0], &key); + for (y = 0; y < 1000; y++) noekeon_ecb_decrypt(tmp[0], tmp[0], &key); + for (y = 0; y < 16; y++) if (tmp[0][y] != 0) return CRYPT_FAIL_TESTVECTOR; + } return CRYPT_OK; #endif } -/** Terminate the context +/** Terminate the context @param skey The scheduled key */ void noekeon_done(symmetric_key *skey) { + LTC_UNUSED_PARAM(skey); } /** @@ -298,6 +323,6 @@ int noekeon_keysize(int *keysize) #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/ciphers/rc2.c b/libtomcrypt/src/ciphers/rc2.c index 256f074..ebd8f88 100644 --- a/libtomcrypt/src/ciphers/rc2.c +++ b/libtomcrypt/src/ciphers/rc2.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /**********************************************************************\ * To commemorate the 1996 RSA Data Security Conference, the following * @@ -18,12 +16,12 @@ * Thanks to CodeView, SoftIce, and D86 for helping bring this code to * * the public. * \**********************************************************************/ -#include <tomcrypt.h> +#include "tomcrypt.h" /** @file rc2.c - Implementation of LTC_RC2 -*/ + Implementation of RC2 with fixed effective key length of 64bits +*/ #ifdef LTC_RC2 @@ -36,7 +34,7 @@ const struct ltc_cipher_descriptor rc2_desc = { &rc2_test, &rc2_done, &rc2_keysize, - NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL + NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL }; /* 256-entry permutation table, probably derived somehow from pi */ @@ -60,68 +58,87 @@ static const unsigned char permute[256] = { }; /** - Initialize the LTC_RC2 block cipher + Initialize the RC2 block cipher @param key The symmetric key you wish to pass @param keylen The key length in bytes + @param bits The effective key length in bits @param num_rounds The number of rounds desired (0 for default) @param skey The key in as scheduled by this function. @return CRYPT_OK if successful */ -int rc2_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey) +int rc2_setup_ex(const unsigned char *key, int keylen, int bits, int num_rounds, symmetric_key *skey) { unsigned *xkey = skey->rc2.xkey; unsigned char tmp[128]; unsigned T8, TM; - int i, bits; + int i; LTC_ARGCHK(key != NULL); LTC_ARGCHK(skey != NULL); - if (keylen < 8 || keylen > 128) { + if (keylen == 0 || keylen > 128 || bits > 1024) { return CRYPT_INVALID_KEYSIZE; } + if (bits == 0) { + bits = 1024; + } if (num_rounds != 0 && num_rounds != 16) { return CRYPT_INVALID_ROUNDS; } for (i = 0; i < keylen; i++) { - tmp[i] = key[i] & 255; + tmp[i] = key[i] & 255; } - /* Phase 1: Expand input key to 128 bytes */ - if (keylen < 128) { - for (i = keylen; i < 128; i++) { - tmp[i] = permute[(tmp[i - 1] + tmp[i - keylen]) & 255]; - } - } - - /* Phase 2 - reduce effective key size to "bits" */ - bits = keylen<<3; - T8 = (unsigned)(bits+7)>>3; - TM = (255 >> (unsigned)(7 & -bits)); - tmp[128 - T8] = permute[tmp[128 - T8] & TM]; - for (i = 127 - T8; i >= 0; i--) { - tmp[i] = permute[tmp[i + 1] ^ tmp[i + T8]]; - } + /* Phase 1: Expand input key to 128 bytes */ + if (keylen < 128) { + for (i = keylen; i < 128; i++) { + tmp[i] = permute[(tmp[i - 1] + tmp[i - keylen]) & 255]; + } + } - /* Phase 3 - copy to xkey in little-endian order */ - for (i = 0; i < 64; i++) { - xkey[i] = (unsigned)tmp[2*i] + ((unsigned)tmp[2*i+1] << 8); - } + /* Phase 2 - reduce effective key size to "bits" */ + T8 = (unsigned)(bits+7)>>3; + TM = (255 >> (unsigned)(7 & -bits)); + tmp[128 - T8] = permute[tmp[128 - T8] & TM]; + for (i = 127 - T8; i >= 0; i--) { + tmp[i] = permute[tmp[i + 1] ^ tmp[i + T8]]; + } + + /* Phase 3 - copy to xkey in little-endian order */ + for (i = 0; i < 64; i++) { + xkey[i] = (unsigned)tmp[2*i] + ((unsigned)tmp[2*i+1] << 8); + } #ifdef LTC_CLEAN_STACK - zeromem(tmp, sizeof(tmp)); + zeromem(tmp, sizeof(tmp)); #endif - - return CRYPT_OK; + + return CRYPT_OK; +} + +/** + Initialize the RC2 block cipher + + The effective key length is here always keylen * 8 + + @param key The symmetric key you wish to pass + @param keylen The key length in bytes + @param num_rounds The number of rounds desired (0 for default) + @param skey The key in as scheduled by this function. + @return CRYPT_OK if successful +*/ +int rc2_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey) +{ + return rc2_setup_ex(key, keylen, keylen * 8, num_rounds, skey); } /**********************************************************************\ * Encrypt an 8-byte block of plaintext using the given key. * \**********************************************************************/ /** - Encrypts a block of text with LTC_RC2 + Encrypts a block of text with RC2 @param pt The input plaintext (8 bytes) @param ct The output ciphertext (8 bytes) @param skey The key as scheduled @@ -180,7 +197,7 @@ int rc2_ecb_encrypt( const unsigned char *pt, ct[5] = (unsigned char)(x54 >> 8); ct[6] = (unsigned char)x76; ct[7] = (unsigned char)(x76 >> 8); - + return CRYPT_OK; } @@ -199,10 +216,10 @@ int rc2_ecb_encrypt( const unsigned char *pt, * Decrypt an 8-byte block of ciphertext using the given key. * \**********************************************************************/ /** - Decrypts a block of text with LTC_RC2 + Decrypts a block of text with RC2 @param ct The input ciphertext (8 bytes) @param pt The output plaintext (8 bytes) - @param skey The key as scheduled + @param skey The key as scheduled @return CRYPT_OK if successful */ #ifdef LTC_CLEAN_STACK @@ -275,27 +292,56 @@ int rc2_ecb_decrypt( const unsigned char *ct, #endif /** - Performs a self-test of the LTC_RC2 block cipher + Performs a self-test of the RC2 block cipher @return CRYPT_OK if functional, CRYPT_NOP if self-test has been disabled */ int rc2_test(void) { #ifndef LTC_TEST return CRYPT_NOP; - #else + #else static const struct { - int keylen; + int keylen, bits; unsigned char key[16], pt[8], ct[8]; } tests[] = { - { 8, + { 8, 63, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0xeb, 0xb7, 0x73, 0xf9, 0x93, 0x27, 0x8e, 0xff } + }, + { 8, 64, + { 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff }, + { 0x27, 0x8b, 0x27, 0xe4, 0x2e, 0x2f, 0x0d, 0x49 } + }, + { 8, 64, { 0x30, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, { 0x10, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x01 }, { 0x30, 0x64, 0x9e, 0xdf, 0x9b, 0xe7, 0xd2, 0xc2 } - }, - { 16, + { 1, 64, + { 0x88, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0x61, 0xa8, 0xa2, 0x44, 0xad, 0xac, 0xcc, 0xf0 } + }, + { 7, 64, + { 0x88, 0xbc, 0xa9, 0x0e, 0x90, 0x87, 0x5a, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0x6c, 0xcf, 0x43, 0x08, 0x97, 0x4c, 0x26, 0x7f } + }, + { 16, 64, + { 0x88, 0xbc, 0xa9, 0x0e, 0x90, 0x87, 0x5a, 0x7f, + 0x0f, 0x79, 0xc3, 0x84, 0x62, 0x7b, 0xaf, 0xb2 }, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0x1a, 0x80, 0x7d, 0x27, 0x2b, 0xbe, 0x5d, 0xb1 } + }, + { 16, 128, { 0x88, 0xbc, 0xa9, 0x0e, 0x90, 0x87, 0x5a, 0x7f, 0x0f, 0x79, 0xc3, 0x84, 0x62, 0x7b, 0xaf, 0xb2 }, { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, @@ -308,14 +354,22 @@ int rc2_test(void) for (x = 0; x < (int)(sizeof(tests) / sizeof(tests[0])); x++) { zeromem(tmp, sizeof(tmp)); - if ((err = rc2_setup(tests[x].key, tests[x].keylen, 0, &skey)) != CRYPT_OK) { - return err; + if (tests[x].bits == (tests[x].keylen * 8)) { + if ((err = rc2_setup(tests[x].key, tests[x].keylen, 0, &skey)) != CRYPT_OK) { + return err; + } + } + else { + if ((err = rc2_setup_ex(tests[x].key, tests[x].keylen, tests[x].bits, 0, &skey)) != CRYPT_OK) { + return err; + } } - + rc2_ecb_encrypt(tests[x].pt, tmp[0], &skey); rc2_ecb_decrypt(tmp[0], tmp[1], &skey); - - if (XMEMCMP(tmp[0], tests[x].ct, 8) != 0 || XMEMCMP(tmp[1], tests[x].pt, 8) != 0) { + + if (compare_testvector(tmp[0], 8, tests[x].ct, 8, "RC2 CT", x) || + compare_testvector(tmp[1], 8, tests[x].pt, 8, "RC2 PT", x)) { return CRYPT_FAIL_TESTVECTOR; } @@ -329,11 +383,12 @@ int rc2_test(void) #endif } -/** Terminate the context +/** Terminate the context @param skey The scheduled key */ void rc2_done(symmetric_key *skey) { + LTC_UNUSED_PARAM(skey); } /** @@ -344,7 +399,7 @@ void rc2_done(symmetric_key *skey) int rc2_keysize(int *keysize) { LTC_ARGCHK(keysize != NULL); - if (*keysize < 8) { + if (*keysize < 1) { return CRYPT_INVALID_KEYSIZE; } else if (*keysize > 128) { *keysize = 128; @@ -357,6 +412,6 @@ int rc2_keysize(int *keysize) -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/ciphers/rc5.c b/libtomcrypt/src/ciphers/rc5.c index ac56451..bda537f 100644 --- a/libtomcrypt/src/ciphers/rc5.c +++ b/libtomcrypt/src/ciphers/rc5.c @@ -5,13 +5,11 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /** @file rc5.c - LTC_RC5 code by Tom St Denis + LTC_RC5 code by Tom St Denis */ #include "tomcrypt.h" @@ -29,7 +27,7 @@ const struct ltc_cipher_descriptor rc5_desc = &rc5_test, &rc5_done, &rc5_keysize, - NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL + NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL }; static const ulong32 stab[50] = { @@ -60,13 +58,13 @@ int rc5_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_ke LTC_ARGCHK(skey != NULL); LTC_ARGCHK(key != NULL); - + /* test parameters */ - if (num_rounds == 0) { + if (num_rounds == 0) { num_rounds = rc5_desc.default_rounds; } - if (num_rounds < 12 || num_rounds > 24) { + if (num_rounds < 12 || num_rounds > 24) { return CRYPT_INVALID_ROUNDS; } @@ -74,12 +72,12 @@ int rc5_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_ke if (keylen < 8 || keylen > 128) { return CRYPT_INVALID_KEYSIZE; } - + skey->rc5.rounds = num_rounds; S = skey->rc5.K; /* copy the key into the L array */ - for (A = i = j = 0; i < (ulong32)keylen; ) { + for (A = i = j = 0; i < (ulong32)keylen; ) { A = (A << 8) | ((ulong32)(key[i++] & 255)); if ((i & 3) == 0) { L[j++] = BSWAP(A); @@ -87,8 +85,8 @@ int rc5_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_ke } } - if ((keylen & 3) != 0) { - A <<= (ulong32)((8 * (4 - (keylen&3)))); + if ((keylen & 3) != 0) { + A <<= (ulong32)((8 * (4 - (keylen&3)))); L[j++] = BSWAP(A); } @@ -99,7 +97,7 @@ int rc5_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_ke /* mix buffer */ s = 3 * MAX(t, j); l = j; - for (A = B = i = j = v = 0; v < s; v++) { + for (A = B = i = j = v = 0; v < s; v++) { A = S[i] = ROLc(S[i] + A + B, 3); B = L[j] = ROL(L[j] + A + B, (A+B)); if (++i == t) { i = 0; } @@ -142,7 +140,7 @@ int rc5_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key *s A += skey->rc5.K[0]; B += skey->rc5.K[1]; K = skey->rc5.K + 2; - + if ((skey->rc5.rounds & 1) == 0) { for (r = 0; r < skey->rc5.rounds; r += 2) { A = ROL(A ^ B, B) + K[0]; @@ -177,7 +175,7 @@ int rc5_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key *s Decrypts a block of text with LTC_RC5 @param ct The input ciphertext (8 bytes) @param pt The output plaintext (8 bytes) - @param skey The key as scheduled + @param skey The key as scheduled @return CRYPT_OK if successful */ #ifdef LTC_CLEAN_STACK @@ -195,7 +193,7 @@ int rc5_ecb_decrypt(const unsigned char *ct, unsigned char *pt, symmetric_key *s LOAD32L(A, &ct[0]); LOAD32L(B, &ct[4]); K = skey->rc5.K + (skey->rc5.rounds << 1); - + if ((skey->rc5.rounds & 1) == 0) { K -= 2; for (r = skey->rc5.rounds - 1; r >= 0; r -= 2) { @@ -237,7 +235,7 @@ int rc5_test(void) { #ifndef LTC_TEST return CRYPT_NOP; - #else + #else static const struct { unsigned char key[16], pt[8], ct[8]; } tests[] = { @@ -275,7 +273,8 @@ int rc5_test(void) rc5_ecb_decrypt(tmp[0], tmp[1], &key); /* compare */ - if (XMEMCMP(tmp[0], tests[x].ct, 8) != 0 || XMEMCMP(tmp[1], tests[x].pt, 8) != 0) { + if (compare_testvector(tmp[0], 8, tests[x].ct, 8, "RC5 Encrypt", x) != 0 || + compare_testvector(tmp[1], 8, tests[x].pt, 8, "RC5 Decrypt", x) != 0) { return CRYPT_FAIL_TESTVECTOR; } @@ -289,11 +288,12 @@ int rc5_test(void) #endif } -/** Terminate the context +/** Terminate the context @param skey The scheduled key */ void rc5_done(symmetric_key *skey) { + LTC_UNUSED_PARAM(skey); } /** @@ -317,6 +317,6 @@ int rc5_keysize(int *keysize) -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/ciphers/rc6.c b/libtomcrypt/src/ciphers/rc6.c index 88639b8..56ca705 100644 --- a/libtomcrypt/src/ciphers/rc6.c +++ b/libtomcrypt/src/ciphers/rc6.c @@ -5,13 +5,11 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /** @file rc6.c - LTC_RC6 code by Tom St Denis + LTC_RC6 code by Tom St Denis */ #include "tomcrypt.h" @@ -28,7 +26,7 @@ const struct ltc_cipher_descriptor rc6_desc = &rc6_test, &rc6_done, &rc6_keysize, - NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL + NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL }; static const ulong32 stab[44] = { @@ -59,7 +57,7 @@ int rc6_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_ke LTC_ARGCHK(skey != NULL); /* test parameters */ - if (num_rounds != 0 && num_rounds != 20) { + if (num_rounds != 0 && num_rounds != 20) { return CRYPT_INVALID_ROUNDS; } @@ -69,7 +67,7 @@ int rc6_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_ke } /* copy the key into the L array */ - for (A = i = j = 0; i < (ulong32)keylen; ) { + for (A = i = j = 0; i < (ulong32)keylen; ) { A = (A << 8) | ((ulong32)(key[i++] & 255)); if (!(i & 3)) { L[j++] = BSWAP(A); @@ -78,9 +76,9 @@ int rc6_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_ke } /* handle odd sized keys */ - if (keylen & 3) { - A <<= (8 * (4 - (keylen&3))); - L[j++] = BSWAP(A); + if (keylen & 3) { + A <<= (8 * (4 - (keylen&3))); + L[j++] = BSWAP(A); } /* setup the S array */ @@ -89,15 +87,15 @@ int rc6_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_ke /* mix buffer */ s = 3 * MAX(44, j); l = j; - for (A = B = i = j = v = 0; v < s; v++) { + for (A = B = i = j = v = 0; v < s; v++) { A = S[i] = ROLc(S[i] + A + B, 3); B = L[j] = ROL(L[j] + A + B, (A+B)); if (++i == 44) { i = 0; } if (++j == l) { j = 0; } } - + /* copy to key */ - for (i = 0; i < 44; i++) { + for (i = 0; i < 44; i++) { skey->rc6.K[i] = S[i]; } return CRYPT_OK; @@ -127,7 +125,7 @@ int rc6_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key *s { ulong32 a,b,c,d,t,u, *K; int r; - + LTC_ARGCHK(skey != NULL); LTC_ARGCHK(pt != NULL); LTC_ARGCHK(ct != NULL); @@ -140,8 +138,8 @@ int rc6_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key *s t = (b * (b + b + 1)); t = ROLc(t, 5); \ u = (d * (d + d + 1)); u = ROLc(u, 5); \ a = ROL(a^t,u) + K[0]; \ - c = ROL(c^u,t) + K[1]; K += 2; - + c = ROL(c^u,t) + K[1]; K += 2; + K = skey->rc6.K + 2; for (r = 0; r < 20; r += 4) { RND(a,b,c,d); @@ -149,7 +147,7 @@ int rc6_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key *s RND(c,d,a,b); RND(d,a,b,c); } - + #undef RND a += skey->rc6.K[42]; @@ -171,7 +169,7 @@ int rc6_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key *s Decrypts a block of text with LTC_RC6 @param ct The input ciphertext (16 bytes) @param pt The output plaintext (16 bytes) - @param skey The key as scheduled + @param skey The key as scheduled */ #ifdef LTC_CLEAN_STACK static int _rc6_ecb_decrypt(const unsigned char *ct, unsigned char *pt, symmetric_key *skey) @@ -185,26 +183,26 @@ int rc6_ecb_decrypt(const unsigned char *ct, unsigned char *pt, symmetric_key *s LTC_ARGCHK(skey != NULL); LTC_ARGCHK(pt != NULL); LTC_ARGCHK(ct != NULL); - + LOAD32L(a,&ct[0]);LOAD32L(b,&ct[4]);LOAD32L(c,&ct[8]);LOAD32L(d,&ct[12]); a -= skey->rc6.K[42]; c -= skey->rc6.K[43]; - + #define RND(a,b,c,d) \ t = (b * (b + b + 1)); t = ROLc(t, 5); \ u = (d * (d + d + 1)); u = ROLc(u, 5); \ c = ROR(c - K[1], t) ^ u; \ a = ROR(a - K[0], u) ^ t; K -= 2; - + K = skey->rc6.K + 40; - + for (r = 0; r < 20; r += 4) { RND(d,a,b,c); RND(c,d,a,b); RND(b,c,d,a); RND(a,b,c,d); } - + #undef RND b -= skey->rc6.K[0]; @@ -231,7 +229,7 @@ int rc6_test(void) { #ifndef LTC_TEST return CRYPT_NOP; - #else + #else static const struct { int keylen; unsigned char key[32], pt[16], ct[16]; @@ -285,24 +283,8 @@ int rc6_test(void) rc6_ecb_decrypt(tmp[0], tmp[1], &key); /* compare */ - if (XMEMCMP(tmp[0], tests[x].ct, 16) || XMEMCMP(tmp[1], tests[x].pt, 16)) { -#if 0 - printf("\n\nFailed test %d\n", x); - if (XMEMCMP(tmp[0], tests[x].ct, 16)) { - printf("Ciphertext: "); - for (y = 0; y < 16; y++) printf("%02x ", tmp[0][y]); - printf("\nExpected : "); - for (y = 0; y < 16; y++) printf("%02x ", tests[x].ct[y]); - printf("\n"); - } - if (XMEMCMP(tmp[1], tests[x].pt, 16)) { - printf("Plaintext: "); - for (y = 0; y < 16; y++) printf("%02x ", tmp[0][y]); - printf("\nExpected : "); - for (y = 0; y < 16; y++) printf("%02x ", tests[x].pt[y]); - printf("\n"); - } -#endif + if (compare_testvector(tmp[0], 16, tests[x].ct, 16, "RC6 Encrypt", x) || + compare_testvector(tmp[1], 16, tests[x].pt, 16, "RC6 Decrypt", x)) { return CRYPT_FAIL_TESTVECTOR; } @@ -316,11 +298,12 @@ int rc6_test(void) #endif } -/** Terminate the context +/** Terminate the context @param skey The scheduled key */ void rc6_done(symmetric_key *skey) { + LTC_UNUSED_PARAM(skey); } /** @@ -343,6 +326,6 @@ int rc6_keysize(int *keysize) -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/ciphers/safer/safer.c b/libtomcrypt/src/ciphers/safer/safer.c index 5189c2f..9eefcfb 100644 --- a/libtomcrypt/src/ciphers/safer/safer.c +++ b/libtomcrypt/src/ciphers/safer/safer.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /******************************************************************************* @@ -28,13 +26,15 @@ * *******************************************************************************/ -#include <tomcrypt.h> +#include "tomcrypt.h" #ifdef LTC_SAFER -const struct ltc_cipher_descriptor - safer_k64_desc = { - "safer-k64", +#define __LTC_SAFER_TAB_C__ +#include "safer_tab.c" + +const struct ltc_cipher_descriptor safer_k64_desc = { + "safer-k64", 8, 8, 8, 8, LTC_SAFER_K64_DEFAULT_NOF_ROUNDS, &safer_k64_setup, &safer_ecb_encrypt, @@ -42,7 +42,7 @@ const struct ltc_cipher_descriptor &safer_k64_test, &safer_done, &safer_64_keysize, - NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL + NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL }, safer_sk64_desc = { @@ -54,7 +54,7 @@ const struct ltc_cipher_descriptor &safer_sk64_test, &safer_done, &safer_64_keysize, - NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL + NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL }, safer_k128_desc = { @@ -66,7 +66,7 @@ const struct ltc_cipher_descriptor &safer_sk128_test, &safer_done, &safer_128_keysize, - NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL + NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL }, safer_sk128_desc = { @@ -78,7 +78,7 @@ const struct ltc_cipher_descriptor &safer_sk128_test, &safer_done, &safer_128_keysize, - NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL + NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL }; /******************* Constants ************************************************/ @@ -95,7 +95,6 @@ const struct ltc_cipher_descriptor #define IPHT(x, y) { x -= y; y -= x; } /******************* Types ****************************************************/ -extern const unsigned char safer_ebox[], safer_lbox[]; #ifdef LTC_CLEAN_STACK static void _Safer_Expand_Userkey(const unsigned char *userkey_1, @@ -158,7 +157,7 @@ static void Safer_Expand_Userkey(const unsigned char *userkey_1, } } } - + #ifdef LTC_CLEAN_STACK zeromem(ka, sizeof(ka)); zeromem(kb, sizeof(kb)); @@ -193,7 +192,7 @@ int safer_k64_setup(const unsigned char *key, int keylen, int numrounds, symmetr Safer_Expand_Userkey(key, key, (unsigned int)(numrounds != 0 ?numrounds:LTC_SAFER_K64_DEFAULT_NOF_ROUNDS), 0, skey->safer.key); return CRYPT_OK; } - + int safer_sk64_setup(const unsigned char *key, int keylen, int numrounds, symmetric_key *skey) { LTC_ARGCHK(key != NULL); @@ -380,7 +379,7 @@ int safer_k64_test(void) { #ifndef LTC_TEST return CRYPT_NOP; - #else + #else static const unsigned char k64_pt[] = { 1, 2, 3, 4, 5, 6, 7, 8 }, k64_key[] = { 8, 7, 6, 5, 4, 3, 2, 1 }, k64_ct[] = { 200, 242, 156, 221, 135, 120, 62, 217 }; @@ -396,7 +395,8 @@ int safer_k64_test(void) safer_ecb_encrypt(k64_pt, buf[0], &skey); safer_ecb_decrypt(buf[0], buf[1], &skey); - if (XMEMCMP(buf[0], k64_ct, 8) != 0 || XMEMCMP(buf[1], k64_pt, 8) != 0) { + if (compare_testvector(buf[0], 8, k64_ct, 8, "Safer K64 Encrypt", 0) != 0 || + compare_testvector(buf[1], 8, k64_pt, 8, "Safer K64 Decrypt", 0) != 0) { return CRYPT_FAIL_TESTVECTOR; } @@ -409,7 +409,7 @@ int safer_sk64_test(void) { #ifndef LTC_TEST return CRYPT_NOP; - #else + #else static const unsigned char sk64_pt[] = { 1, 2, 3, 4, 5, 6, 7, 8 }, sk64_key[] = { 1, 2, 3, 4, 5, 6, 7, 8 }, sk64_ct[] = { 95, 206, 155, 162, 5, 132, 56, 199 }; @@ -426,32 +426,34 @@ int safer_sk64_test(void) safer_ecb_encrypt(sk64_pt, buf[0], &skey); safer_ecb_decrypt(buf[0], buf[1], &skey); - if (XMEMCMP(buf[0], sk64_ct, 8) != 0 || XMEMCMP(buf[1], sk64_pt, 8) != 0) { + if (compare_testvector(buf[0], 8, sk64_ct, 8, "Safer SK64 Encrypt", 0) != 0 || + compare_testvector(buf[1], 8, sk64_pt, 8, "Safer SK64 Decrypt", 0) != 0) { return CRYPT_FAIL_TESTVECTOR; } - /* now see if we can encrypt all zero bytes 1000 times, decrypt and come back where we started */ - for (y = 0; y < 8; y++) buf[0][y] = 0; - for (y = 0; y < 1000; y++) safer_ecb_encrypt(buf[0], buf[0], &skey); - for (y = 0; y < 1000; y++) safer_ecb_decrypt(buf[0], buf[0], &skey); - for (y = 0; y < 8; y++) if (buf[0][y] != 0) return CRYPT_FAIL_TESTVECTOR; + /* now see if we can encrypt all zero bytes 1000 times, decrypt and come back where we started */ + for (y = 0; y < 8; y++) buf[0][y] = 0; + for (y = 0; y < 1000; y++) safer_ecb_encrypt(buf[0], buf[0], &skey); + for (y = 0; y < 1000; y++) safer_ecb_decrypt(buf[0], buf[0], &skey); + for (y = 0; y < 8; y++) if (buf[0][y] != 0) return CRYPT_FAIL_TESTVECTOR; return CRYPT_OK; #endif } -/** Terminate the context +/** Terminate the context @param skey The scheduled key */ void safer_done(symmetric_key *skey) { + LTC_UNUSED_PARAM(skey); } int safer_sk128_test(void) { #ifndef LTC_TEST return CRYPT_NOP; - #else + #else static const unsigned char sk128_pt[] = { 1, 2, 3, 4, 5, 6, 7, 8 }, sk128_key[] = { 1, 2, 3, 4, 5, 6, 7, 8, 0, 0, 0, 0, 0, 0, 0, 0 }, @@ -468,16 +470,18 @@ int safer_sk128_test(void) safer_ecb_encrypt(sk128_pt, buf[0], &skey); safer_ecb_decrypt(buf[0], buf[1], &skey); - if (XMEMCMP(buf[0], sk128_ct, 8) != 0 || XMEMCMP(buf[1], sk128_pt, 8) != 0) { + if (compare_testvector(buf[0], 8, sk128_ct, 8, "Safer SK128 Encrypt", 0) != 0 || + compare_testvector(buf[1], 8, sk128_pt, 8, "Safer SK128 Decrypt", 0) != 0) { return CRYPT_FAIL_TESTVECTOR; } - /* now see if we can encrypt all zero bytes 1000 times, decrypt and come back where we started */ - for (y = 0; y < 8; y++) buf[0][y] = 0; - for (y = 0; y < 1000; y++) safer_ecb_encrypt(buf[0], buf[0], &skey); - for (y = 0; y < 1000; y++) safer_ecb_decrypt(buf[0], buf[0], &skey); - for (y = 0; y < 8; y++) if (buf[0][y] != 0) return CRYPT_FAIL_TESTVECTOR; - return CRYPT_OK; + /* now see if we can encrypt all zero bytes 1000 times, decrypt and come back where we started */ + for (y = 0; y < 8; y++) buf[0][y] = 0; + for (y = 0; y < 1000; y++) safer_ecb_encrypt(buf[0], buf[0], &skey); + for (y = 0; y < 1000; y++) safer_ecb_decrypt(buf[0], buf[0], &skey); + for (y = 0; y < 8; y++) if (buf[0][y] != 0) return CRYPT_FAIL_TESTVECTOR; + + return CRYPT_OK; #endif } @@ -486,6 +490,6 @@ int safer_sk128_test(void) -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/ciphers/safer/safer_tab.c b/libtomcrypt/src/ciphers/safer/safer_tab.c index 9a515ff..99962a0 100644 --- a/libtomcrypt/src/ciphers/safer/safer_tab.c +++ b/libtomcrypt/src/ciphers/safer/safer_tab.c @@ -5,64 +5,60 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /** @file safer_tab.c Tables for LTC_SAFER block ciphers -*/ - -#include "tomcrypt.h" +*/ -#if defined(LTC_SAFERP) || defined(LTC_SAFER) +#ifdef __LTC_SAFER_TAB_C__ -/* This is the box defined by ebox[x] = 45^x mod 257. +/* This is the box defined by ebox[x] = 45^x mod 257. * Its assumed that the value "256" corresponds to zero. */ -const unsigned char safer_ebox[256] = { - 1, 45, 226, 147, 190, 69, 21, 174, 120, 3, 135, 164, 184, 56, 207, 63, - 8, 103, 9, 148, 235, 38, 168, 107, 189, 24, 52, 27, 187, 191, 114, 247, - 64, 53, 72, 156, 81, 47, 59, 85, 227, 192, 159, 216, 211, 243, 141, 177, -255, 167, 62, 220, 134, 119, 215, 166, 17, 251, 244, 186, 146, 145, 100, 131, -241, 51, 239, 218, 44, 181, 178, 43, 136, 209, 153, 203, 140, 132, 29, 20, -129, 151, 113, 202, 95, 163, 139, 87, 60, 130, 196, 82, 92, 28, 232, 160, - 4, 180, 133, 74, 246, 19, 84, 182, 223, 12, 26, 142, 222, 224, 57, 252, - 32, 155, 36, 78, 169, 152, 158, 171, 242, 96, 208, 108, 234, 250, 199, 217, - 0, 212, 31, 110, 67, 188, 236, 83, 137, 254, 122, 93, 73, 201, 50, 194, -249, 154, 248, 109, 22, 219, 89, 150, 68, 233, 205, 230, 70, 66, 143, 10, -193, 204, 185, 101, 176, 210, 198, 172, 30, 65, 98, 41, 46, 14, 116, 80, - 2, 90, 195, 37, 123, 138, 42, 91, 240, 6, 13, 71, 111, 112, 157, 126, - 16, 206, 18, 39, 213, 76, 79, 214, 121, 48, 104, 54, 117, 125, 228, 237, -128, 106, 144, 55, 162, 94, 118, 170, 197, 127, 61, 175, 165, 229, 25, 97, -253, 77, 124, 183, 11, 238, 173, 75, 34, 245, 231, 115, 35, 33, 200, 5, +static const unsigned char safer_ebox[256] = { + 1, 45, 226, 147, 190, 69, 21, 174, 120, 3, 135, 164, 184, 56, 207, 63, + 8, 103, 9, 148, 235, 38, 168, 107, 189, 24, 52, 27, 187, 191, 114, 247, + 64, 53, 72, 156, 81, 47, 59, 85, 227, 192, 159, 216, 211, 243, 141, 177, +255, 167, 62, 220, 134, 119, 215, 166, 17, 251, 244, 186, 146, 145, 100, 131, +241, 51, 239, 218, 44, 181, 178, 43, 136, 209, 153, 203, 140, 132, 29, 20, +129, 151, 113, 202, 95, 163, 139, 87, 60, 130, 196, 82, 92, 28, 232, 160, + 4, 180, 133, 74, 246, 19, 84, 182, 223, 12, 26, 142, 222, 224, 57, 252, + 32, 155, 36, 78, 169, 152, 158, 171, 242, 96, 208, 108, 234, 250, 199, 217, + 0, 212, 31, 110, 67, 188, 236, 83, 137, 254, 122, 93, 73, 201, 50, 194, +249, 154, 248, 109, 22, 219, 89, 150, 68, 233, 205, 230, 70, 66, 143, 10, +193, 204, 185, 101, 176, 210, 198, 172, 30, 65, 98, 41, 46, 14, 116, 80, + 2, 90, 195, 37, 123, 138, 42, 91, 240, 6, 13, 71, 111, 112, 157, 126, + 16, 206, 18, 39, 213, 76, 79, 214, 121, 48, 104, 54, 117, 125, 228, 237, +128, 106, 144, 55, 162, 94, 118, 170, 197, 127, 61, 175, 165, 229, 25, 97, +253, 77, 124, 183, 11, 238, 173, 75, 34, 245, 231, 115, 35, 33, 200, 5, 225, 102, 221, 179, 88, 105, 99, 86, 15, 161, 49, 149, 23, 7, 58, 40 }; /* This is the inverse of ebox or the base 45 logarithm */ -const unsigned char safer_lbox[256] = { +static const unsigned char safer_lbox[256] = { 128, 0, 176, 9, 96, 239, 185, 253, 16, 18, 159, 228, 105, 186, 173, 248, 192, 56, 194, 101, 79, 6, 148, 252, 25, 222, 106, 27, 93, 78, 168, 130, -112, 237, 232, 236, 114, 179, 21, 195, 255, 171, 182, 71, 68, 1, 172, 37, -201, 250, 142, 65, 26, 33, 203, 211, 13, 110, 254, 38, 88, 218, 50, 15, - 32, 169, 157, 132, 152, 5, 156, 187, 34, 140, 99, 231, 197, 225, 115, 198, -175, 36, 91, 135, 102, 39, 247, 87, 244, 150, 177, 183, 92, 139, 213, 84, -121, 223, 170, 246, 62, 163, 241, 17, 202, 245, 209, 23, 123, 147, 131, 188, +112, 237, 232, 236, 114, 179, 21, 195, 255, 171, 182, 71, 68, 1, 172, 37, +201, 250, 142, 65, 26, 33, 203, 211, 13, 110, 254, 38, 88, 218, 50, 15, + 32, 169, 157, 132, 152, 5, 156, 187, 34, 140, 99, 231, 197, 225, 115, 198, +175, 36, 91, 135, 102, 39, 247, 87, 244, 150, 177, 183, 92, 139, 213, 84, +121, 223, 170, 246, 62, 163, 241, 17, 202, 245, 209, 23, 123, 147, 131, 188, 189, 82, 30, 235, 174, 204, 214, 53, 8, 200, 138, 180, 226, 205, 191, 217, -208, 80, 89, 63, 77, 98, 52, 10, 72, 136, 181, 86, 76, 46, 107, 158, -210, 61, 60, 3, 19, 251, 151, 81, 117, 74, 145, 113, 35, 190, 118, 42, +208, 80, 89, 63, 77, 98, 52, 10, 72, 136, 181, 86, 76, 46, 107, 158, +210, 61, 60, 3, 19, 251, 151, 81, 117, 74, 145, 113, 35, 190, 118, 42, 95, 249, 212, 85, 11, 220, 55, 49, 22, 116, 215, 119, 167, 230, 7, 219, -164, 47, 70, 243, 97, 69, 103, 227, 12, 162, 59, 28, 133, 24, 4, 29, - 41, 160, 143, 178, 90, 216, 166, 126, 238, 141, 83, 75, 161, 154, 193, 14, -122, 73, 165, 44, 129, 196, 199, 54, 43, 127, 67, 149, 51, 242, 108, 104, -109, 240, 2, 40, 206, 221, 155, 234, 94, 153, 124, 20, 134, 207, 229, 66, +164, 47, 70, 243, 97, 69, 103, 227, 12, 162, 59, 28, 133, 24, 4, 29, + 41, 160, 143, 178, 90, 216, 166, 126, 238, 141, 83, 75, 161, 154, 193, 14, +122, 73, 165, 44, 129, 196, 199, 54, 43, 127, 67, 149, 51, 242, 108, 104, +109, 240, 2, 40, 206, 221, 155, 234, 94, 153, 124, 20, 134, 207, 229, 66, 184, 64, 120, 45, 58, 233, 100, 31, 146, 144, 125, 57, 111, 224, 137, 48 }; -#endif +#endif /* __LTC_SAFER_TAB_C__ */ -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/ciphers/safer/saferp.c b/libtomcrypt/src/ciphers/safer/saferp.c index 8cecab0..116590f 100644 --- a/libtomcrypt/src/ciphers/safer/saferp.c +++ b/libtomcrypt/src/ciphers/safer/saferp.c @@ -5,18 +5,19 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ -/** +/** @file saferp.c - LTC_SAFER+ Implementation by Tom St Denis + LTC_SAFER+ Implementation by Tom St Denis */ #include "tomcrypt.h" #ifdef LTC_SAFERP +#define __LTC_SAFER_TAB_C__ +#include "safer_tab.c" + const struct ltc_cipher_descriptor saferp_desc = { "safer+", @@ -28,23 +29,21 @@ const struct ltc_cipher_descriptor saferp_desc = &saferp_test, &saferp_done, &saferp_keysize, - NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL + NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL }; -/* ROUND(b,i) +/* ROUND(b,i) * - * This is one forward key application. Note the basic form is - * key addition, substitution, key addition. The safer_ebox and safer_lbox - * are the exponentiation box and logarithm boxes respectively. - * The value of 'i' is the current round number which allows this - * function to be unrolled massively. Most of LTC_SAFER+'s speed - * comes from not having to compute indirect accesses into the + * This is one forward key application. Note the basic form is + * key addition, substitution, key addition. The safer_ebox and safer_lbox + * are the exponentiation box and logarithm boxes respectively. + * The value of 'i' is the current round number which allows this + * function to be unrolled massively. Most of LTC_SAFER+'s speed + * comes from not having to compute indirect accesses into the * array of 16 bytes b[0..15] which is the block of data */ -extern const unsigned char safer_ebox[], safer_lbox[]; - -#define ROUND(b, i) \ +#define ROUND(b, i) do { \ b[0] = (safer_ebox[(b[0] ^ skey->saferp.K[i][0]) & 255] + skey->saferp.K[i+1][0]) & 255; \ b[1] = safer_lbox[(b[1] + skey->saferp.K[i][1]) & 255] ^ skey->saferp.K[i+1][1]; \ b[2] = safer_lbox[(b[2] + skey->saferp.K[i][2]) & 255] ^ skey->saferp.K[i+1][2]; \ @@ -60,10 +59,11 @@ extern const unsigned char safer_ebox[], safer_lbox[]; b[12] = (safer_ebox[(b[12] ^ skey->saferp.K[i][12]) & 255] + skey->saferp.K[i+1][12]) & 255; \ b[13] = safer_lbox[(b[13] + skey->saferp.K[i][13]) & 255] ^ skey->saferp.K[i+1][13]; \ b[14] = safer_lbox[(b[14] + skey->saferp.K[i][14]) & 255] ^ skey->saferp.K[i+1][14]; \ - b[15] = (safer_ebox[(b[15] ^ skey->saferp.K[i][15]) & 255] + skey->saferp.K[i+1][15]) & 255; + b[15] = (safer_ebox[(b[15] ^ skey->saferp.K[i][15]) & 255] + skey->saferp.K[i+1][15]) & 255; \ +} while (0) /* This is one inverse key application */ -#define iROUND(b, i) \ +#define iROUND(b, i) do { \ b[0] = safer_lbox[(b[0] - skey->saferp.K[i+1][0]) & 255] ^ skey->saferp.K[i][0]; \ b[1] = (safer_ebox[(b[1] ^ skey->saferp.K[i+1][1]) & 255] - skey->saferp.K[i][1]) & 255; \ b[2] = (safer_ebox[(b[2] ^ skey->saferp.K[i+1][2]) & 255] - skey->saferp.K[i][2]) & 255; \ @@ -79,10 +79,11 @@ extern const unsigned char safer_ebox[], safer_lbox[]; b[12] = safer_lbox[(b[12] - skey->saferp.K[i+1][12]) & 255] ^ skey->saferp.K[i][12]; \ b[13] = (safer_ebox[(b[13] ^ skey->saferp.K[i+1][13]) & 255] - skey->saferp.K[i][13]) & 255; \ b[14] = (safer_ebox[(b[14] ^ skey->saferp.K[i+1][14]) & 255] - skey->saferp.K[i][14]) & 255; \ - b[15] = safer_lbox[(b[15] - skey->saferp.K[i+1][15]) & 255] ^ skey->saferp.K[i][15]; + b[15] = safer_lbox[(b[15] - skey->saferp.K[i+1][15]) & 255] ^ skey->saferp.K[i][15]; \ +} while (0) /* This is a forward single layer PHT transform. */ -#define PHT(b) \ +#define PHT(b) do { \ b[0] = (b[0] + (b[1] = (b[0] + b[1]) & 255)) & 255; \ b[2] = (b[2] + (b[3] = (b[3] + b[2]) & 255)) & 255; \ b[4] = (b[4] + (b[5] = (b[5] + b[4]) & 255)) & 255; \ @@ -90,10 +91,11 @@ extern const unsigned char safer_ebox[], safer_lbox[]; b[8] = (b[8] + (b[9] = (b[9] + b[8]) & 255)) & 255; \ b[10] = (b[10] + (b[11] = (b[11] + b[10]) & 255)) & 255; \ b[12] = (b[12] + (b[13] = (b[13] + b[12]) & 255)) & 255; \ - b[14] = (b[14] + (b[15] = (b[15] + b[14]) & 255)) & 255; + b[14] = (b[14] + (b[15] = (b[15] + b[14]) & 255)) & 255; \ +} while (0) /* This is an inverse single layer PHT transform */ -#define iPHT(b) \ +#define iPHT(b) do { \ b[15] = (b[15] - (b[14] = (b[14] - b[15]) & 255)) & 255; \ b[13] = (b[13] - (b[12] = (b[12] - b[13]) & 255)) & 255; \ b[11] = (b[11] - (b[10] = (b[10] - b[11]) & 255)) & 255; \ @@ -102,41 +104,46 @@ extern const unsigned char safer_ebox[], safer_lbox[]; b[5] = (b[5] - (b[4] = (b[4] - b[5]) & 255)) & 255; \ b[3] = (b[3] - (b[2] = (b[2] - b[3]) & 255)) & 255; \ b[1] = (b[1] - (b[0] = (b[0] - b[1]) & 255)) & 255; \ + } while (0) /* This is the "Armenian" Shuffle. It takes the input from b and stores it in b2 */ -#define SHUF(b, b2) \ +#define SHUF(b, b2) do { \ b2[0] = b[8]; b2[1] = b[11]; b2[2] = b[12]; b2[3] = b[15]; \ b2[4] = b[2]; b2[5] = b[1]; b2[6] = b[6]; b2[7] = b[5]; \ b2[8] = b[10]; b2[9] = b[9]; b2[10] = b[14]; b2[11] = b[13]; \ - b2[12] = b[0]; b2[13] = b[7]; b2[14] = b[4]; b2[15] = b[3]; + b2[12] = b[0]; b2[13] = b[7]; b2[14] = b[4]; b2[15] = b[3]; \ +} while (0) /* This is the inverse shuffle. It takes from b and gives to b2 */ -#define iSHUF(b, b2) \ +#define iSHUF(b, b2) do { \ b2[0] = b[12]; b2[1] = b[5]; b2[2] = b[4]; b2[3] = b[15]; \ b2[4] = b[14]; b2[5] = b[7]; b2[6] = b[6]; b2[7] = b[13]; \ b2[8] = b[0]; b2[9] = b[9]; b2[10] = b[8]; b2[11] = b[1]; \ - b2[12] = b[2]; b2[13] = b[11]; b2[14] = b[10]; b2[15] = b[3]; + b2[12] = b[2]; b2[13] = b[11]; b2[14] = b[10]; b2[15] = b[3]; \ +} while (0) -/* The complete forward Linear Transform layer. - * Note that alternating usage of b and b2. - * Each round of LT starts in 'b' and ends in 'b2'. +/* The complete forward Linear Transform layer. + * Note that alternating usage of b and b2. + * Each round of LT starts in 'b' and ends in 'b2'. */ -#define LT(b, b2) \ +#define LT(b, b2) do { \ PHT(b); SHUF(b, b2); \ PHT(b2); SHUF(b2, b); \ PHT(b); SHUF(b, b2); \ - PHT(b2); + PHT(b2); \ +} while (0) /* This is the inverse linear transform layer. */ -#define iLT(b, b2) \ +#define iLT(b, b2) do { \ iPHT(b); \ iSHUF(b, b2); iPHT(b2); \ iSHUF(b2, b); iPHT(b); \ - iSHUF(b, b2); iPHT(b2); - -#ifdef LTC_SMALL_CODE + iSHUF(b, b2); iPHT(b2); \ +} while (0) + +#ifdef LTC_SMALL_CODE -static void _round(unsigned char *b, int i, symmetric_key *skey) +static void _round(unsigned char *b, int i, symmetric_key *skey) { ROUND(b, i); } @@ -154,7 +161,7 @@ static void _lt(unsigned char *b, unsigned char *b2) static void _ilt(unsigned char *b, unsigned char *b2) { iLT(b, b2); -} +} #undef ROUND #define ROUND(b, i) _round(b, i, skey) @@ -228,7 +235,7 @@ int saferp_setup(const unsigned char *key, int keylen, int num_rounds, symmetric } /* Is the number of rounds valid? Either use zero for default or - * 8,12,16 rounds for 16,24,32 byte keys + * 8,12,16 rounds for 16,24,32 byte keys */ if (num_rounds != 0 && num_rounds != rounds[(keylen/8)-2]) { return CRYPT_INVALID_ROUNDS; @@ -237,9 +244,9 @@ int saferp_setup(const unsigned char *key, int keylen, int num_rounds, symmetric /* 128 bit key version */ if (keylen == 16) { /* copy key into t */ - for (x = y = 0; x < 16; x++) { - t[x] = key[x]; - y ^= key[x]; + for (x = y = 0; x < 16; x++) { + t[x] = key[x]; + y ^= key[x]; } t[16] = y; @@ -265,9 +272,9 @@ int saferp_setup(const unsigned char *key, int keylen, int num_rounds, symmetric skey->saferp.rounds = 8; } else if (keylen == 24) { /* copy key into t */ - for (x = y = 0; x < 24; x++) { - t[x] = key[x]; - y ^= key[x]; + for (x = y = 0; x < 24; x++) { + t[x] = key[x]; + y ^= key[x]; } t[24] = y; @@ -284,7 +291,7 @@ int saferp_setup(const unsigned char *key, int keylen, int num_rounds, symmetric /* select and add */ z = x; - for (y = 0; y < 16; y++) { + for (y = 0; y < 16; y++) { skey->saferp.K[x][y] = (t[z] + safer_bias[x-1][y]) & 255; if (++z == 25) { z = 0; } } @@ -292,14 +299,14 @@ int saferp_setup(const unsigned char *key, int keylen, int num_rounds, symmetric skey->saferp.rounds = 12; } else { /* copy key into t */ - for (x = y = 0; x < 32; x++) { - t[x] = key[x]; - y ^= key[x]; + for (x = y = 0; x < 32; x++) { + t[x] = key[x]; + y ^= key[x]; } t[32] = y; /* make round keys */ - for (x = 0; x < 16; x++) { + for (x = 0; x < 16; x++) { skey->saferp.K[0][x] = t[x]; } @@ -308,7 +315,7 @@ int saferp_setup(const unsigned char *key, int keylen, int num_rounds, symmetric for (y = 0; y < 33; y++) { t[y] = ((t[y]<<3)|(t[y]>>5)) & 255; } - + /* select and add */ z = x; for (y = 0; y < 16; y++) { @@ -392,7 +399,7 @@ int saferp_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key Decrypts a block of text with LTC_SAFER+ @param ct The input ciphertext (16 bytes) @param pt The output plaintext (16 bytes) - @param skey The key as scheduled + @param skey The key as scheduled @return CRYPT_OK if successful */ int saferp_ecb_decrypt(const unsigned char *ct, unsigned char *pt, symmetric_key *skey) @@ -460,40 +467,40 @@ int saferp_test(void) { #ifndef LTC_TEST return CRYPT_NOP; - #else + #else static const struct { int keylen; unsigned char key[32], pt[16], ct[16]; } tests[] = { { 16, - { 41, 35, 190, 132, 225, 108, 214, 174, + { 41, 35, 190, 132, 225, 108, 214, 174, 82, 144, 73, 241, 241, 187, 233, 235 }, - { 179, 166, 219, 60, 135, 12, 62, 153, + { 179, 166, 219, 60, 135, 12, 62, 153, 36, 94, 13, 28, 6, 183, 71, 222 }, - { 224, 31, 182, 10, 12, 255, 84, 70, + { 224, 31, 182, 10, 12, 255, 84, 70, 127, 13, 89, 249, 9, 57, 165, 220 } }, { 24, - { 72, 211, 143, 117, 230, 217, 29, 42, - 229, 192, 247, 43, 120, 129, 135, 68, + { 72, 211, 143, 117, 230, 217, 29, 42, + 229, 192, 247, 43, 120, 129, 135, 68, 14, 95, 80, 0, 212, 97, 141, 190 }, - { 123, 5, 21, 7, 59, 51, 130, 31, + { 123, 5, 21, 7, 59, 51, 130, 31, 24, 112, 146, 218, 100, 84, 206, 177 }, - { 92, 136, 4, 63, 57, 95, 100, 0, + { 92, 136, 4, 63, 57, 95, 100, 0, 150, 130, 130, 16, 193, 111, 219, 133 } }, { 32, - { 243, 168, 141, 254, 190, 242, 235, 113, + { 243, 168, 141, 254, 190, 242, 235, 113, 255, 160, 208, 59, 117, 6, 140, 126, - 135, 120, 115, 77, 208, 190, 130, 190, + 135, 120, 115, 77, 208, 190, 130, 190, 219, 194, 70, 65, 43, 140, 250, 48 }, - { 127, 112, 240, 167, 84, 134, 50, 149, + { 127, 112, 240, 167, 84, 134, 50, 149, 170, 91, 104, 19, 11, 230, 252, 245 }, - { 88, 11, 25, 36, 172, 229, 202, 213, + { 88, 11, 25, 36, 172, 229, 202, 213, 170, 65, 105, 153, 220, 104, 153, 138 } } - }; + }; unsigned char tmp[2][16]; symmetric_key skey; @@ -507,7 +514,8 @@ int saferp_test(void) saferp_ecb_decrypt(tmp[0], tmp[1], &skey); /* compare */ - if (XMEMCMP(tmp[0], tests[i].ct, 16) || XMEMCMP(tmp[1], tests[i].pt, 16)) { + if (compare_testvector(tmp[0], 16, tests[i].ct, 16, "Safer+ Encrypt", i) || + compare_testvector(tmp[1], 16, tests[i].pt, 16, "Safer+ Decrypt", i)) { return CRYPT_FAIL_TESTVECTOR; } @@ -522,11 +530,12 @@ int saferp_test(void) #endif } -/** Terminate the context +/** Terminate the context @param skey The scheduled key */ void saferp_done(symmetric_key *skey) { + LTC_UNUSED_PARAM(skey); } /** @@ -537,7 +546,7 @@ void saferp_done(symmetric_key *skey) int saferp_keysize(int *keysize) { LTC_ARGCHK(keysize != NULL); - + if (*keysize < 16) return CRYPT_INVALID_KEYSIZE; if (*keysize < 24) { @@ -554,6 +563,6 @@ int saferp_keysize(int *keysize) -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/ciphers/skipjack.c b/libtomcrypt/src/ciphers/skipjack.c index 89e9a56..d47f2d3 100644 --- a/libtomcrypt/src/ciphers/skipjack.c +++ b/libtomcrypt/src/ciphers/skipjack.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /** @@ -28,7 +26,7 @@ const struct ltc_cipher_descriptor skipjack_desc = &skipjack_test, &skipjack_done, &skipjack_keysize, - NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL + NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL }; static const unsigned char sbox[256] = { @@ -75,7 +73,7 @@ int skipjack_setup(const unsigned char *key, int keylen, int num_rounds, symmetr return CRYPT_INVALID_KEYSIZE; } - if (num_rounds != 32 && num_rounds != 0) { + if (num_rounds != 32 && num_rounds != 0) { return CRYPT_INVALID_ROUNDS; } @@ -201,7 +199,7 @@ int skipjack_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_k Decrypts a block of text with Skipjack @param ct The input ciphertext (8 bytes) @param pt The output plaintext (8 bytes) - @param skey The key as scheduled + @param skey The key as scheduled @return CRYPT_OK if successful */ #ifdef LTC_CLEAN_STACK @@ -223,7 +221,7 @@ int skipjack_ecb_decrypt(const unsigned char *ct, unsigned char *pt, symmetric_k w3 = ((unsigned)ct[4]<<8)|ct[5]; w4 = ((unsigned)ct[6]<<8)|ct[7]; - /* 8 rounds of RULE B^-1 + /* 8 rounds of RULE B^-1 Note the value "kp = 8" comes from "kp = (32 * 4) mod 10" where 32*4 is 128 which mod 10 is 8 */ @@ -273,7 +271,7 @@ int skipjack_test(void) { #ifndef LTC_TEST return CRYPT_NOP; - #else + #else static const struct { unsigned char key[10], pt[8], ct[8]; } tests[] = { @@ -298,7 +296,8 @@ int skipjack_test(void) skipjack_ecb_decrypt(buf[0], buf[1], &key); /* compare */ - if (XMEMCMP(buf[0], tests[x].ct, 8) != 0 || XMEMCMP(buf[1], tests[x].pt, 8) != 0) { + if (compare_testvector(buf[0], 8, tests[x].ct, 8, "Skipjack Encrypt", x) != 0 || + compare_testvector(buf[1], 8, tests[x].pt, 8, "Skipjack Decrypt", x) != 0) { return CRYPT_FAIL_TESTVECTOR; } @@ -313,11 +312,12 @@ int skipjack_test(void) #endif } -/** Terminate the context +/** Terminate the context @param skey The scheduled key */ void skipjack_done(symmetric_key *skey) { + LTC_UNUSED_PARAM(skey); } /** @@ -338,6 +338,6 @@ int skipjack_keysize(int *keysize) #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/ciphers/twofish/twofish.c b/libtomcrypt/src/ciphers/twofish/twofish.c index 624dadf..5331f91 100644 --- a/libtomcrypt/src/ciphers/twofish/twofish.c +++ b/libtomcrypt/src/ciphers/twofish/twofish.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /** @@ -35,23 +33,13 @@ const struct ltc_cipher_descriptor twofish_desc = &twofish_test, &twofish_done, &twofish_keysize, - NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL + NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL }; /* the two polynomials */ #define MDS_POLY 0x169 #define RS_POLY 0x14D -/* The 4x4 MDS Linear Transform */ -#if 0 -static const unsigned char MDS[4][4] = { - { 0x01, 0xEF, 0x5B, 0x5B }, - { 0x5B, 0xEF, 0xEF, 0x01 }, - { 0xEF, 0x5B, 0x01, 0xEF }, - { 0xEF, 0x01, 0xEF, 0x5B } -}; -#endif - /* The 4x8 RS Linear Transform */ static const unsigned char RS[4][8] = { { 0x01, 0xA4, 0x55, 0x87, 0x5A, 0x58, 0xDB, 0x9E }, @@ -60,6 +48,7 @@ static const unsigned char RS[4][8] = { { 0XA4, 0X55, 0X87, 0X5A, 0X58, 0XDB, 0X9E, 0X03 } }; +#ifdef LTC_TWOFISH_SMALL /* sbox usage orderings */ static const unsigned char qord[4][5] = { { 1, 1, 0, 0, 1 }, @@ -67,9 +56,11 @@ static const unsigned char qord[4][5] = { { 0, 0, 0, 1, 1 }, { 1, 0, 1, 1, 0 } }; +#endif /* LTC_TWOFISH_SMALL */ #ifdef LTC_TWOFISH_TABLES +#define __LTC_TWOFISH_TAB_C__ #include "twofish_tab.c" #define sbox(i, x) ((ulong32)SBOX[i][(x)&255]) @@ -259,16 +250,19 @@ static void h_func(const unsigned char *in, unsigned char *out, unsigned char *M y[1] = (unsigned char)(sbox(0, (ulong32)y[1]) ^ M[4 * (6 + offset) + 1]); y[2] = (unsigned char)(sbox(0, (ulong32)y[2]) ^ M[4 * (6 + offset) + 2]); y[3] = (unsigned char)(sbox(1, (ulong32)y[3]) ^ M[4 * (6 + offset) + 3]); + /* FALLTHROUGH */ case 3: y[0] = (unsigned char)(sbox(1, (ulong32)y[0]) ^ M[4 * (4 + offset) + 0]); y[1] = (unsigned char)(sbox(1, (ulong32)y[1]) ^ M[4 * (4 + offset) + 1]); y[2] = (unsigned char)(sbox(0, (ulong32)y[2]) ^ M[4 * (4 + offset) + 2]); y[3] = (unsigned char)(sbox(0, (ulong32)y[3]) ^ M[4 * (4 + offset) + 3]); + /* FALLTHROUGH */ case 2: y[0] = (unsigned char)(sbox(1, sbox(0, sbox(0, (ulong32)y[0]) ^ M[4 * (2 + offset) + 0]) ^ M[4 * (0 + offset) + 0])); y[1] = (unsigned char)(sbox(0, sbox(0, sbox(1, (ulong32)y[1]) ^ M[4 * (2 + offset) + 1]) ^ M[4 * (0 + offset) + 1])); y[2] = (unsigned char)(sbox(1, sbox(1, sbox(0, (ulong32)y[2]) ^ M[4 * (2 + offset) + 2]) ^ M[4 * (0 + offset) + 2])); y[3] = (unsigned char)(sbox(0, sbox(1, sbox(1, (ulong32)y[3]) ^ M[4 * (2 + offset) + 3]) ^ M[4 * (0 + offset) + 3])); + /* FALLTHROUGH */ } mds_mult(y, out); } @@ -663,10 +657,8 @@ int twofish_test(void) } twofish_ecb_encrypt(tests[i].pt, tmp[0], &key); twofish_ecb_decrypt(tmp[0], tmp[1], &key); - if (XMEMCMP(tmp[0], tests[i].ct, 16) != 0 || XMEMCMP(tmp[1], tests[i].pt, 16) != 0) { -#if 0 - printf("Twofish failed test %d, %d, %d\n", i, XMEMCMP(tmp[0], tests[i].ct, 16), XMEMCMP(tmp[1], tests[i].pt, 16)); -#endif + if (compare_testvector(tmp[0], 16, tests[i].ct, 16, "Twofish Encrypt", i) != 0 || + compare_testvector(tmp[1], 16, tests[i].pt, 16, "Twofish Decrypt", i) != 0) { return CRYPT_FAIL_TESTVECTOR; } /* now see if we can encrypt all zero bytes 1000 times, decrypt and come back where we started */ @@ -684,7 +676,7 @@ int twofish_test(void) */ void twofish_done(symmetric_key *skey) { - (void)skey; + LTC_UNUSED_PARAM(skey); } /** @@ -714,6 +706,6 @@ int twofish_keysize(int *keysize) -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/ciphers/twofish/twofish_tab.c b/libtomcrypt/src/ciphers/twofish/twofish_tab.c index ea3eb21..b4135ab 100644 --- a/libtomcrypt/src/ciphers/twofish/twofish_tab.c +++ b/libtomcrypt/src/ciphers/twofish/twofish_tab.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /** @@ -14,201 +12,202 @@ Twofish tables, Tom St Denis */ #ifdef LTC_TWOFISH_TABLES +#ifdef __LTC_TWOFISH_TAB_C__ /* pre generated 8x8 tables from the four 4x4s */ static const unsigned char SBOX[2][256] = { { - 0xa9, 0x67, 0xb3, 0xe8, 0x04, 0xfd, 0xa3, 0x76, 0x9a, 0x92, - 0x80, 0x78, 0xe4, 0xdd, 0xd1, 0x38, 0x0d, 0xc6, 0x35, 0x98, - 0x18, 0xf7, 0xec, 0x6c, 0x43, 0x75, 0x37, 0x26, 0xfa, 0x13, - 0x94, 0x48, 0xf2, 0xd0, 0x8b, 0x30, 0x84, 0x54, 0xdf, 0x23, - 0x19, 0x5b, 0x3d, 0x59, 0xf3, 0xae, 0xa2, 0x82, 0x63, 0x01, - 0x83, 0x2e, 0xd9, 0x51, 0x9b, 0x7c, 0xa6, 0xeb, 0xa5, 0xbe, - 0x16, 0x0c, 0xe3, 0x61, 0xc0, 0x8c, 0x3a, 0xf5, 0x73, 0x2c, - 0x25, 0x0b, 0xbb, 0x4e, 0x89, 0x6b, 0x53, 0x6a, 0xb4, 0xf1, + 0xa9, 0x67, 0xb3, 0xe8, 0x04, 0xfd, 0xa3, 0x76, 0x9a, 0x92, + 0x80, 0x78, 0xe4, 0xdd, 0xd1, 0x38, 0x0d, 0xc6, 0x35, 0x98, + 0x18, 0xf7, 0xec, 0x6c, 0x43, 0x75, 0x37, 0x26, 0xfa, 0x13, + 0x94, 0x48, 0xf2, 0xd0, 0x8b, 0x30, 0x84, 0x54, 0xdf, 0x23, + 0x19, 0x5b, 0x3d, 0x59, 0xf3, 0xae, 0xa2, 0x82, 0x63, 0x01, + 0x83, 0x2e, 0xd9, 0x51, 0x9b, 0x7c, 0xa6, 0xeb, 0xa5, 0xbe, + 0x16, 0x0c, 0xe3, 0x61, 0xc0, 0x8c, 0x3a, 0xf5, 0x73, 0x2c, + 0x25, 0x0b, 0xbb, 0x4e, 0x89, 0x6b, 0x53, 0x6a, 0xb4, 0xf1, 0xe1, 0xe6, 0xbd, 0x45, 0xe2, 0xf4, 0xb6, 0x66, 0xcc, 0x95, - 0x03, 0x56, 0xd4, 0x1c, 0x1e, 0xd7, 0xfb, 0xc3, 0x8e, 0xb5, - 0xe9, 0xcf, 0xbf, 0xba, 0xea, 0x77, 0x39, 0xaf, 0x33, 0xc9, - 0x62, 0x71, 0x81, 0x79, 0x09, 0xad, 0x24, 0xcd, 0xf9, 0xd8, - 0xe5, 0xc5, 0xb9, 0x4d, 0x44, 0x08, 0x86, 0xe7, 0xa1, 0x1d, - 0xaa, 0xed, 0x06, 0x70, 0xb2, 0xd2, 0x41, 0x7b, 0xa0, 0x11, + 0x03, 0x56, 0xd4, 0x1c, 0x1e, 0xd7, 0xfb, 0xc3, 0x8e, 0xb5, + 0xe9, 0xcf, 0xbf, 0xba, 0xea, 0x77, 0x39, 0xaf, 0x33, 0xc9, + 0x62, 0x71, 0x81, 0x79, 0x09, 0xad, 0x24, 0xcd, 0xf9, 0xd8, + 0xe5, 0xc5, 0xb9, 0x4d, 0x44, 0x08, 0x86, 0xe7, 0xa1, 0x1d, + 0xaa, 0xed, 0x06, 0x70, 0xb2, 0xd2, 0x41, 0x7b, 0xa0, 0x11, 0x31, 0xc2, 0x27, 0x90, 0x20, 0xf6, 0x60, 0xff, 0x96, 0x5c, - 0xb1, 0xab, 0x9e, 0x9c, 0x52, 0x1b, 0x5f, 0x93, 0x0a, 0xef, - 0x91, 0x85, 0x49, 0xee, 0x2d, 0x4f, 0x8f, 0x3b, 0x47, 0x87, - 0x6d, 0x46, 0xd6, 0x3e, 0x69, 0x64, 0x2a, 0xce, 0xcb, 0x2f, - 0xfc, 0x97, 0x05, 0x7a, 0xac, 0x7f, 0xd5, 0x1a, 0x4b, 0x0e, - 0xa7, 0x5a, 0x28, 0x14, 0x3f, 0x29, 0x88, 0x3c, 0x4c, 0x02, - 0xb8, 0xda, 0xb0, 0x17, 0x55, 0x1f, 0x8a, 0x7d, 0x57, 0xc7, - 0x8d, 0x74, 0xb7, 0xc4, 0x9f, 0x72, 0x7e, 0x15, 0x22, 0x12, - 0x58, 0x07, 0x99, 0x34, 0x6e, 0x50, 0xde, 0x68, 0x65, 0xbc, - 0xdb, 0xf8, 0xc8, 0xa8, 0x2b, 0x40, 0xdc, 0xfe, 0x32, 0xa4, - 0xca, 0x10, 0x21, 0xf0, 0xd3, 0x5d, 0x0f, 0x00, 0x6f, 0x9d, + 0xb1, 0xab, 0x9e, 0x9c, 0x52, 0x1b, 0x5f, 0x93, 0x0a, 0xef, + 0x91, 0x85, 0x49, 0xee, 0x2d, 0x4f, 0x8f, 0x3b, 0x47, 0x87, + 0x6d, 0x46, 0xd6, 0x3e, 0x69, 0x64, 0x2a, 0xce, 0xcb, 0x2f, + 0xfc, 0x97, 0x05, 0x7a, 0xac, 0x7f, 0xd5, 0x1a, 0x4b, 0x0e, + 0xa7, 0x5a, 0x28, 0x14, 0x3f, 0x29, 0x88, 0x3c, 0x4c, 0x02, + 0xb8, 0xda, 0xb0, 0x17, 0x55, 0x1f, 0x8a, 0x7d, 0x57, 0xc7, + 0x8d, 0x74, 0xb7, 0xc4, 0x9f, 0x72, 0x7e, 0x15, 0x22, 0x12, + 0x58, 0x07, 0x99, 0x34, 0x6e, 0x50, 0xde, 0x68, 0x65, 0xbc, + 0xdb, 0xf8, 0xc8, 0xa8, 0x2b, 0x40, 0xdc, 0xfe, 0x32, 0xa4, + 0xca, 0x10, 0x21, 0xf0, 0xd3, 0x5d, 0x0f, 0x00, 0x6f, 0x9d, 0x36, 0x42, 0x4a, 0x5e, 0xc1, 0xe0}, { - 0x75, 0xf3, 0xc6, 0xf4, 0xdb, 0x7b, 0xfb, 0xc8, 0x4a, 0xd3, + 0x75, 0xf3, 0xc6, 0xf4, 0xdb, 0x7b, 0xfb, 0xc8, 0x4a, 0xd3, 0xe6, 0x6b, 0x45, 0x7d, 0xe8, 0x4b, 0xd6, 0x32, 0xd8, 0xfd, 0x37, 0x71, 0xf1, 0xe1, 0x30, 0x0f, 0xf8, 0x1b, 0x87, 0xfa, 0x06, 0x3f, 0x5e, 0xba, 0xae, 0x5b, 0x8a, 0x00, 0xbc, 0x9d, - 0x6d, 0xc1, 0xb1, 0x0e, 0x80, 0x5d, 0xd2, 0xd5, 0xa0, 0x84, - 0x07, 0x14, 0xb5, 0x90, 0x2c, 0xa3, 0xb2, 0x73, 0x4c, 0x54, - 0x92, 0x74, 0x36, 0x51, 0x38, 0xb0, 0xbd, 0x5a, 0xfc, 0x60, - 0x62, 0x96, 0x6c, 0x42, 0xf7, 0x10, 0x7c, 0x28, 0x27, 0x8c, - 0x13, 0x95, 0x9c, 0xc7, 0x24, 0x46, 0x3b, 0x70, 0xca, 0xe3, + 0x6d, 0xc1, 0xb1, 0x0e, 0x80, 0x5d, 0xd2, 0xd5, 0xa0, 0x84, + 0x07, 0x14, 0xb5, 0x90, 0x2c, 0xa3, 0xb2, 0x73, 0x4c, 0x54, + 0x92, 0x74, 0x36, 0x51, 0x38, 0xb0, 0xbd, 0x5a, 0xfc, 0x60, + 0x62, 0x96, 0x6c, 0x42, 0xf7, 0x10, 0x7c, 0x28, 0x27, 0x8c, + 0x13, 0x95, 0x9c, 0xc7, 0x24, 0x46, 0x3b, 0x70, 0xca, 0xe3, 0x85, 0xcb, 0x11, 0xd0, 0x93, 0xb8, 0xa6, 0x83, 0x20, 0xff, - 0x9f, 0x77, 0xc3, 0xcc, 0x03, 0x6f, 0x08, 0xbf, 0x40, 0xe7, - 0x2b, 0xe2, 0x79, 0x0c, 0xaa, 0x82, 0x41, 0x3a, 0xea, 0xb9, - 0xe4, 0x9a, 0xa4, 0x97, 0x7e, 0xda, 0x7a, 0x17, 0x66, 0x94, - 0xa1, 0x1d, 0x3d, 0xf0, 0xde, 0xb3, 0x0b, 0x72, 0xa7, 0x1c, - 0xef, 0xd1, 0x53, 0x3e, 0x8f, 0x33, 0x26, 0x5f, 0xec, 0x76, - 0x2a, 0x49, 0x81, 0x88, 0xee, 0x21, 0xc4, 0x1a, 0xeb, 0xd9, - 0xc5, 0x39, 0x99, 0xcd, 0xad, 0x31, 0x8b, 0x01, 0x18, 0x23, - 0xdd, 0x1f, 0x4e, 0x2d, 0xf9, 0x48, 0x4f, 0xf2, 0x65, 0x8e, - 0x78, 0x5c, 0x58, 0x19, 0x8d, 0xe5, 0x98, 0x57, 0x67, 0x7f, - 0x05, 0x64, 0xaf, 0x63, 0xb6, 0xfe, 0xf5, 0xb7, 0x3c, 0xa5, - 0xce, 0xe9, 0x68, 0x44, 0xe0, 0x4d, 0x43, 0x69, 0x29, 0x2e, - 0xac, 0x15, 0x59, 0xa8, 0x0a, 0x9e, 0x6e, 0x47, 0xdf, 0x34, - 0x35, 0x6a, 0xcf, 0xdc, 0x22, 0xc9, 0xc0, 0x9b, 0x89, 0xd4, - 0xed, 0xab, 0x12, 0xa2, 0x0d, 0x52, 0xbb, 0x02, 0x2f, 0xa9, - 0xd7, 0x61, 0x1e, 0xb4, 0x50, 0x04, 0xf6, 0xc2, 0x16, 0x25, + 0x9f, 0x77, 0xc3, 0xcc, 0x03, 0x6f, 0x08, 0xbf, 0x40, 0xe7, + 0x2b, 0xe2, 0x79, 0x0c, 0xaa, 0x82, 0x41, 0x3a, 0xea, 0xb9, + 0xe4, 0x9a, 0xa4, 0x97, 0x7e, 0xda, 0x7a, 0x17, 0x66, 0x94, + 0xa1, 0x1d, 0x3d, 0xf0, 0xde, 0xb3, 0x0b, 0x72, 0xa7, 0x1c, + 0xef, 0xd1, 0x53, 0x3e, 0x8f, 0x33, 0x26, 0x5f, 0xec, 0x76, + 0x2a, 0x49, 0x81, 0x88, 0xee, 0x21, 0xc4, 0x1a, 0xeb, 0xd9, + 0xc5, 0x39, 0x99, 0xcd, 0xad, 0x31, 0x8b, 0x01, 0x18, 0x23, + 0xdd, 0x1f, 0x4e, 0x2d, 0xf9, 0x48, 0x4f, 0xf2, 0x65, 0x8e, + 0x78, 0x5c, 0x58, 0x19, 0x8d, 0xe5, 0x98, 0x57, 0x67, 0x7f, + 0x05, 0x64, 0xaf, 0x63, 0xb6, 0xfe, 0xf5, 0xb7, 0x3c, 0xa5, + 0xce, 0xe9, 0x68, 0x44, 0xe0, 0x4d, 0x43, 0x69, 0x29, 0x2e, + 0xac, 0x15, 0x59, 0xa8, 0x0a, 0x9e, 0x6e, 0x47, 0xdf, 0x34, + 0x35, 0x6a, 0xcf, 0xdc, 0x22, 0xc9, 0xc0, 0x9b, 0x89, 0xd4, + 0xed, 0xab, 0x12, 0xa2, 0x0d, 0x52, 0xbb, 0x02, 0x2f, 0xa9, + 0xd7, 0x61, 0x1e, 0xb4, 0x50, 0x04, 0xf6, 0xc2, 0x16, 0x25, 0x86, 0x56, 0x55, 0x09, 0xbe, 0x91} }; /* the 4x4 MDS in a nicer format */ static const ulong32 mds_tab[4][256] = { { -0x00000000UL, 0xefef5b01UL, 0xb7b7b602UL, 0x5858ed03UL, 0x07070504UL, 0xe8e85e05UL, 0xb0b0b306UL, 0x5f5fe807UL, -0x0e0e0a08UL, 0xe1e15109UL, 0xb9b9bc0aUL, 0x5656e70bUL, 0x09090f0cUL, 0xe6e6540dUL, 0xbebeb90eUL, 0x5151e20fUL, -0x1c1c1410UL, 0xf3f34f11UL, 0xababa212UL, 0x4444f913UL, 0x1b1b1114UL, 0xf4f44a15UL, 0xacaca716UL, 0x4343fc17UL, -0x12121e18UL, 0xfdfd4519UL, 0xa5a5a81aUL, 0x4a4af31bUL, 0x15151b1cUL, 0xfafa401dUL, 0xa2a2ad1eUL, 0x4d4df61fUL, -0x38382820UL, 0xd7d77321UL, 0x8f8f9e22UL, 0x6060c523UL, 0x3f3f2d24UL, 0xd0d07625UL, 0x88889b26UL, 0x6767c027UL, -0x36362228UL, 0xd9d97929UL, 0x8181942aUL, 0x6e6ecf2bUL, 0x3131272cUL, 0xdede7c2dUL, 0x8686912eUL, 0x6969ca2fUL, -0x24243c30UL, 0xcbcb6731UL, 0x93938a32UL, 0x7c7cd133UL, 0x23233934UL, 0xcccc6235UL, 0x94948f36UL, 0x7b7bd437UL, -0x2a2a3638UL, 0xc5c56d39UL, 0x9d9d803aUL, 0x7272db3bUL, 0x2d2d333cUL, 0xc2c2683dUL, 0x9a9a853eUL, 0x7575de3fUL, +0x00000000UL, 0xefef5b01UL, 0xb7b7b602UL, 0x5858ed03UL, 0x07070504UL, 0xe8e85e05UL, 0xb0b0b306UL, 0x5f5fe807UL, +0x0e0e0a08UL, 0xe1e15109UL, 0xb9b9bc0aUL, 0x5656e70bUL, 0x09090f0cUL, 0xe6e6540dUL, 0xbebeb90eUL, 0x5151e20fUL, +0x1c1c1410UL, 0xf3f34f11UL, 0xababa212UL, 0x4444f913UL, 0x1b1b1114UL, 0xf4f44a15UL, 0xacaca716UL, 0x4343fc17UL, +0x12121e18UL, 0xfdfd4519UL, 0xa5a5a81aUL, 0x4a4af31bUL, 0x15151b1cUL, 0xfafa401dUL, 0xa2a2ad1eUL, 0x4d4df61fUL, +0x38382820UL, 0xd7d77321UL, 0x8f8f9e22UL, 0x6060c523UL, 0x3f3f2d24UL, 0xd0d07625UL, 0x88889b26UL, 0x6767c027UL, +0x36362228UL, 0xd9d97929UL, 0x8181942aUL, 0x6e6ecf2bUL, 0x3131272cUL, 0xdede7c2dUL, 0x8686912eUL, 0x6969ca2fUL, +0x24243c30UL, 0xcbcb6731UL, 0x93938a32UL, 0x7c7cd133UL, 0x23233934UL, 0xcccc6235UL, 0x94948f36UL, 0x7b7bd437UL, +0x2a2a3638UL, 0xc5c56d39UL, 0x9d9d803aUL, 0x7272db3bUL, 0x2d2d333cUL, 0xc2c2683dUL, 0x9a9a853eUL, 0x7575de3fUL, 0x70705040UL, 0x9f9f0b41UL, 0xc7c7e642UL, 0x2828bd43UL, 0x77775544UL, 0x98980e45UL, 0xc0c0e346UL, 0x2f2fb847UL, -0x7e7e5a48UL, 0x91910149UL, 0xc9c9ec4aUL, 0x2626b74bUL, 0x79795f4cUL, 0x9696044dUL, 0xcecee94eUL, 0x2121b24fUL, -0x6c6c4450UL, 0x83831f51UL, 0xdbdbf252UL, 0x3434a953UL, 0x6b6b4154UL, 0x84841a55UL, 0xdcdcf756UL, 0x3333ac57UL, -0x62624e58UL, 0x8d8d1559UL, 0xd5d5f85aUL, 0x3a3aa35bUL, 0x65654b5cUL, 0x8a8a105dUL, 0xd2d2fd5eUL, 0x3d3da65fUL, -0x48487860UL, 0xa7a72361UL, 0xffffce62UL, 0x10109563UL, 0x4f4f7d64UL, 0xa0a02665UL, 0xf8f8cb66UL, 0x17179067UL, +0x7e7e5a48UL, 0x91910149UL, 0xc9c9ec4aUL, 0x2626b74bUL, 0x79795f4cUL, 0x9696044dUL, 0xcecee94eUL, 0x2121b24fUL, +0x6c6c4450UL, 0x83831f51UL, 0xdbdbf252UL, 0x3434a953UL, 0x6b6b4154UL, 0x84841a55UL, 0xdcdcf756UL, 0x3333ac57UL, +0x62624e58UL, 0x8d8d1559UL, 0xd5d5f85aUL, 0x3a3aa35bUL, 0x65654b5cUL, 0x8a8a105dUL, 0xd2d2fd5eUL, 0x3d3da65fUL, +0x48487860UL, 0xa7a72361UL, 0xffffce62UL, 0x10109563UL, 0x4f4f7d64UL, 0xa0a02665UL, 0xf8f8cb66UL, 0x17179067UL, 0x46467268UL, 0xa9a92969UL, 0xf1f1c46aUL, 0x1e1e9f6bUL, 0x4141776cUL, 0xaeae2c6dUL, 0xf6f6c16eUL, 0x19199a6fUL, -0x54546c70UL, 0xbbbb3771UL, 0xe3e3da72UL, 0x0c0c8173UL, 0x53536974UL, 0xbcbc3275UL, 0xe4e4df76UL, 0x0b0b8477UL, -0x5a5a6678UL, 0xb5b53d79UL, 0xededd07aUL, 0x02028b7bUL, 0x5d5d637cUL, 0xb2b2387dUL, 0xeaead57eUL, 0x05058e7fUL, -0xe0e0a080UL, 0x0f0ffb81UL, 0x57571682UL, 0xb8b84d83UL, 0xe7e7a584UL, 0x0808fe85UL, 0x50501386UL, 0xbfbf4887UL, -0xeeeeaa88UL, 0x0101f189UL, 0x59591c8aUL, 0xb6b6478bUL, 0xe9e9af8cUL, 0x0606f48dUL, 0x5e5e198eUL, 0xb1b1428fUL, -0xfcfcb490UL, 0x1313ef91UL, 0x4b4b0292UL, 0xa4a45993UL, 0xfbfbb194UL, 0x1414ea95UL, 0x4c4c0796UL, 0xa3a35c97UL, -0xf2f2be98UL, 0x1d1de599UL, 0x4545089aUL, 0xaaaa539bUL, 0xf5f5bb9cUL, 0x1a1ae09dUL, 0x42420d9eUL, 0xadad569fUL, -0xd8d888a0UL, 0x3737d3a1UL, 0x6f6f3ea2UL, 0x808065a3UL, 0xdfdf8da4UL, 0x3030d6a5UL, 0x68683ba6UL, 0x878760a7UL, -0xd6d682a8UL, 0x3939d9a9UL, 0x616134aaUL, 0x8e8e6fabUL, 0xd1d187acUL, 0x3e3edcadUL, 0x666631aeUL, 0x89896aafUL, -0xc4c49cb0UL, 0x2b2bc7b1UL, 0x73732ab2UL, 0x9c9c71b3UL, 0xc3c399b4UL, 0x2c2cc2b5UL, 0x74742fb6UL, 0x9b9b74b7UL, -0xcaca96b8UL, 0x2525cdb9UL, 0x7d7d20baUL, 0x92927bbbUL, 0xcdcd93bcUL, 0x2222c8bdUL, 0x7a7a25beUL, 0x95957ebfUL, -0x9090f0c0UL, 0x7f7fabc1UL, 0x272746c2UL, 0xc8c81dc3UL, 0x9797f5c4UL, 0x7878aec5UL, 0x202043c6UL, 0xcfcf18c7UL, -0x9e9efac8UL, 0x7171a1c9UL, 0x29294ccaUL, 0xc6c617cbUL, 0x9999ffccUL, 0x7676a4cdUL, 0x2e2e49ceUL, 0xc1c112cfUL, -0x8c8ce4d0UL, 0x6363bfd1UL, 0x3b3b52d2UL, 0xd4d409d3UL, 0x8b8be1d4UL, 0x6464bad5UL, 0x3c3c57d6UL, 0xd3d30cd7UL, -0x8282eed8UL, 0x6d6db5d9UL, 0x353558daUL, 0xdada03dbUL, 0x8585ebdcUL, 0x6a6ab0ddUL, 0x32325ddeUL, 0xdddd06dfUL, +0x54546c70UL, 0xbbbb3771UL, 0xe3e3da72UL, 0x0c0c8173UL, 0x53536974UL, 0xbcbc3275UL, 0xe4e4df76UL, 0x0b0b8477UL, +0x5a5a6678UL, 0xb5b53d79UL, 0xededd07aUL, 0x02028b7bUL, 0x5d5d637cUL, 0xb2b2387dUL, 0xeaead57eUL, 0x05058e7fUL, +0xe0e0a080UL, 0x0f0ffb81UL, 0x57571682UL, 0xb8b84d83UL, 0xe7e7a584UL, 0x0808fe85UL, 0x50501386UL, 0xbfbf4887UL, +0xeeeeaa88UL, 0x0101f189UL, 0x59591c8aUL, 0xb6b6478bUL, 0xe9e9af8cUL, 0x0606f48dUL, 0x5e5e198eUL, 0xb1b1428fUL, +0xfcfcb490UL, 0x1313ef91UL, 0x4b4b0292UL, 0xa4a45993UL, 0xfbfbb194UL, 0x1414ea95UL, 0x4c4c0796UL, 0xa3a35c97UL, +0xf2f2be98UL, 0x1d1de599UL, 0x4545089aUL, 0xaaaa539bUL, 0xf5f5bb9cUL, 0x1a1ae09dUL, 0x42420d9eUL, 0xadad569fUL, +0xd8d888a0UL, 0x3737d3a1UL, 0x6f6f3ea2UL, 0x808065a3UL, 0xdfdf8da4UL, 0x3030d6a5UL, 0x68683ba6UL, 0x878760a7UL, +0xd6d682a8UL, 0x3939d9a9UL, 0x616134aaUL, 0x8e8e6fabUL, 0xd1d187acUL, 0x3e3edcadUL, 0x666631aeUL, 0x89896aafUL, +0xc4c49cb0UL, 0x2b2bc7b1UL, 0x73732ab2UL, 0x9c9c71b3UL, 0xc3c399b4UL, 0x2c2cc2b5UL, 0x74742fb6UL, 0x9b9b74b7UL, +0xcaca96b8UL, 0x2525cdb9UL, 0x7d7d20baUL, 0x92927bbbUL, 0xcdcd93bcUL, 0x2222c8bdUL, 0x7a7a25beUL, 0x95957ebfUL, +0x9090f0c0UL, 0x7f7fabc1UL, 0x272746c2UL, 0xc8c81dc3UL, 0x9797f5c4UL, 0x7878aec5UL, 0x202043c6UL, 0xcfcf18c7UL, +0x9e9efac8UL, 0x7171a1c9UL, 0x29294ccaUL, 0xc6c617cbUL, 0x9999ffccUL, 0x7676a4cdUL, 0x2e2e49ceUL, 0xc1c112cfUL, +0x8c8ce4d0UL, 0x6363bfd1UL, 0x3b3b52d2UL, 0xd4d409d3UL, 0x8b8be1d4UL, 0x6464bad5UL, 0x3c3c57d6UL, 0xd3d30cd7UL, +0x8282eed8UL, 0x6d6db5d9UL, 0x353558daUL, 0xdada03dbUL, 0x8585ebdcUL, 0x6a6ab0ddUL, 0x32325ddeUL, 0xdddd06dfUL, 0xa8a8d8e0UL, 0x474783e1UL, 0x1f1f6ee2UL, 0xf0f035e3UL, 0xafafdde4UL, 0x404086e5UL, 0x18186be6UL, 0xf7f730e7UL, 0xa6a6d2e8UL, 0x494989e9UL, 0x111164eaUL, 0xfefe3febUL, 0xa1a1d7ecUL, 0x4e4e8cedUL, 0x161661eeUL, 0xf9f93aefUL, -0xb4b4ccf0UL, 0x5b5b97f1UL, 0x03037af2UL, 0xecec21f3UL, 0xb3b3c9f4UL, 0x5c5c92f5UL, 0x04047ff6UL, 0xebeb24f7UL, +0xb4b4ccf0UL, 0x5b5b97f1UL, 0x03037af2UL, 0xecec21f3UL, 0xb3b3c9f4UL, 0x5c5c92f5UL, 0x04047ff6UL, 0xebeb24f7UL, 0xbabac6f8UL, 0x55559df9UL, 0x0d0d70faUL, 0xe2e22bfbUL, 0xbdbdc3fcUL, 0x525298fdUL, 0x0a0a75feUL, 0xe5e52effUL -}, +}, { -0x00000000UL, 0x015befefUL, 0x02b6b7b7UL, 0x03ed5858UL, 0x04050707UL, 0x055ee8e8UL, 0x06b3b0b0UL, 0x07e85f5fUL, -0x080a0e0eUL, 0x0951e1e1UL, 0x0abcb9b9UL, 0x0be75656UL, 0x0c0f0909UL, 0x0d54e6e6UL, 0x0eb9bebeUL, 0x0fe25151UL, -0x10141c1cUL, 0x114ff3f3UL, 0x12a2ababUL, 0x13f94444UL, 0x14111b1bUL, 0x154af4f4UL, 0x16a7acacUL, 0x17fc4343UL, -0x181e1212UL, 0x1945fdfdUL, 0x1aa8a5a5UL, 0x1bf34a4aUL, 0x1c1b1515UL, 0x1d40fafaUL, 0x1eada2a2UL, 0x1ff64d4dUL, -0x20283838UL, 0x2173d7d7UL, 0x229e8f8fUL, 0x23c56060UL, 0x242d3f3fUL, 0x2576d0d0UL, 0x269b8888UL, 0x27c06767UL, -0x28223636UL, 0x2979d9d9UL, 0x2a948181UL, 0x2bcf6e6eUL, 0x2c273131UL, 0x2d7cdedeUL, 0x2e918686UL, 0x2fca6969UL, -0x303c2424UL, 0x3167cbcbUL, 0x328a9393UL, 0x33d17c7cUL, 0x34392323UL, 0x3562ccccUL, 0x368f9494UL, 0x37d47b7bUL, -0x38362a2aUL, 0x396dc5c5UL, 0x3a809d9dUL, 0x3bdb7272UL, 0x3c332d2dUL, 0x3d68c2c2UL, 0x3e859a9aUL, 0x3fde7575UL, -0x40507070UL, 0x410b9f9fUL, 0x42e6c7c7UL, 0x43bd2828UL, 0x44557777UL, 0x450e9898UL, 0x46e3c0c0UL, 0x47b82f2fUL, -0x485a7e7eUL, 0x49019191UL, 0x4aecc9c9UL, 0x4bb72626UL, 0x4c5f7979UL, 0x4d049696UL, 0x4ee9ceceUL, 0x4fb22121UL, -0x50446c6cUL, 0x511f8383UL, 0x52f2dbdbUL, 0x53a93434UL, 0x54416b6bUL, 0x551a8484UL, 0x56f7dcdcUL, 0x57ac3333UL, +0x00000000UL, 0x015befefUL, 0x02b6b7b7UL, 0x03ed5858UL, 0x04050707UL, 0x055ee8e8UL, 0x06b3b0b0UL, 0x07e85f5fUL, +0x080a0e0eUL, 0x0951e1e1UL, 0x0abcb9b9UL, 0x0be75656UL, 0x0c0f0909UL, 0x0d54e6e6UL, 0x0eb9bebeUL, 0x0fe25151UL, +0x10141c1cUL, 0x114ff3f3UL, 0x12a2ababUL, 0x13f94444UL, 0x14111b1bUL, 0x154af4f4UL, 0x16a7acacUL, 0x17fc4343UL, +0x181e1212UL, 0x1945fdfdUL, 0x1aa8a5a5UL, 0x1bf34a4aUL, 0x1c1b1515UL, 0x1d40fafaUL, 0x1eada2a2UL, 0x1ff64d4dUL, +0x20283838UL, 0x2173d7d7UL, 0x229e8f8fUL, 0x23c56060UL, 0x242d3f3fUL, 0x2576d0d0UL, 0x269b8888UL, 0x27c06767UL, +0x28223636UL, 0x2979d9d9UL, 0x2a948181UL, 0x2bcf6e6eUL, 0x2c273131UL, 0x2d7cdedeUL, 0x2e918686UL, 0x2fca6969UL, +0x303c2424UL, 0x3167cbcbUL, 0x328a9393UL, 0x33d17c7cUL, 0x34392323UL, 0x3562ccccUL, 0x368f9494UL, 0x37d47b7bUL, +0x38362a2aUL, 0x396dc5c5UL, 0x3a809d9dUL, 0x3bdb7272UL, 0x3c332d2dUL, 0x3d68c2c2UL, 0x3e859a9aUL, 0x3fde7575UL, +0x40507070UL, 0x410b9f9fUL, 0x42e6c7c7UL, 0x43bd2828UL, 0x44557777UL, 0x450e9898UL, 0x46e3c0c0UL, 0x47b82f2fUL, +0x485a7e7eUL, 0x49019191UL, 0x4aecc9c9UL, 0x4bb72626UL, 0x4c5f7979UL, 0x4d049696UL, 0x4ee9ceceUL, 0x4fb22121UL, +0x50446c6cUL, 0x511f8383UL, 0x52f2dbdbUL, 0x53a93434UL, 0x54416b6bUL, 0x551a8484UL, 0x56f7dcdcUL, 0x57ac3333UL, 0x584e6262UL, 0x59158d8dUL, 0x5af8d5d5UL, 0x5ba33a3aUL, 0x5c4b6565UL, 0x5d108a8aUL, 0x5efdd2d2UL, 0x5fa63d3dUL, -0x60784848UL, 0x6123a7a7UL, 0x62ceffffUL, 0x63951010UL, 0x647d4f4fUL, 0x6526a0a0UL, 0x66cbf8f8UL, 0x67901717UL, -0x68724646UL, 0x6929a9a9UL, 0x6ac4f1f1UL, 0x6b9f1e1eUL, 0x6c774141UL, 0x6d2caeaeUL, 0x6ec1f6f6UL, 0x6f9a1919UL, -0x706c5454UL, 0x7137bbbbUL, 0x72dae3e3UL, 0x73810c0cUL, 0x74695353UL, 0x7532bcbcUL, 0x76dfe4e4UL, 0x77840b0bUL, -0x78665a5aUL, 0x793db5b5UL, 0x7ad0ededUL, 0x7b8b0202UL, 0x7c635d5dUL, 0x7d38b2b2UL, 0x7ed5eaeaUL, 0x7f8e0505UL, -0x80a0e0e0UL, 0x81fb0f0fUL, 0x82165757UL, 0x834db8b8UL, 0x84a5e7e7UL, 0x85fe0808UL, 0x86135050UL, 0x8748bfbfUL, -0x88aaeeeeUL, 0x89f10101UL, 0x8a1c5959UL, 0x8b47b6b6UL, 0x8cafe9e9UL, 0x8df40606UL, 0x8e195e5eUL, 0x8f42b1b1UL, -0x90b4fcfcUL, 0x91ef1313UL, 0x92024b4bUL, 0x9359a4a4UL, 0x94b1fbfbUL, 0x95ea1414UL, 0x96074c4cUL, 0x975ca3a3UL, +0x60784848UL, 0x6123a7a7UL, 0x62ceffffUL, 0x63951010UL, 0x647d4f4fUL, 0x6526a0a0UL, 0x66cbf8f8UL, 0x67901717UL, +0x68724646UL, 0x6929a9a9UL, 0x6ac4f1f1UL, 0x6b9f1e1eUL, 0x6c774141UL, 0x6d2caeaeUL, 0x6ec1f6f6UL, 0x6f9a1919UL, +0x706c5454UL, 0x7137bbbbUL, 0x72dae3e3UL, 0x73810c0cUL, 0x74695353UL, 0x7532bcbcUL, 0x76dfe4e4UL, 0x77840b0bUL, +0x78665a5aUL, 0x793db5b5UL, 0x7ad0ededUL, 0x7b8b0202UL, 0x7c635d5dUL, 0x7d38b2b2UL, 0x7ed5eaeaUL, 0x7f8e0505UL, +0x80a0e0e0UL, 0x81fb0f0fUL, 0x82165757UL, 0x834db8b8UL, 0x84a5e7e7UL, 0x85fe0808UL, 0x86135050UL, 0x8748bfbfUL, +0x88aaeeeeUL, 0x89f10101UL, 0x8a1c5959UL, 0x8b47b6b6UL, 0x8cafe9e9UL, 0x8df40606UL, 0x8e195e5eUL, 0x8f42b1b1UL, +0x90b4fcfcUL, 0x91ef1313UL, 0x92024b4bUL, 0x9359a4a4UL, 0x94b1fbfbUL, 0x95ea1414UL, 0x96074c4cUL, 0x975ca3a3UL, 0x98bef2f2UL, 0x99e51d1dUL, 0x9a084545UL, 0x9b53aaaaUL, 0x9cbbf5f5UL, 0x9de01a1aUL, 0x9e0d4242UL, 0x9f56adadUL, -0xa088d8d8UL, 0xa1d33737UL, 0xa23e6f6fUL, 0xa3658080UL, 0xa48ddfdfUL, 0xa5d63030UL, 0xa63b6868UL, 0xa7608787UL, -0xa882d6d6UL, 0xa9d93939UL, 0xaa346161UL, 0xab6f8e8eUL, 0xac87d1d1UL, 0xaddc3e3eUL, 0xae316666UL, 0xaf6a8989UL, -0xb09cc4c4UL, 0xb1c72b2bUL, 0xb22a7373UL, 0xb3719c9cUL, 0xb499c3c3UL, 0xb5c22c2cUL, 0xb62f7474UL, 0xb7749b9bUL, -0xb896cacaUL, 0xb9cd2525UL, 0xba207d7dUL, 0xbb7b9292UL, 0xbc93cdcdUL, 0xbdc82222UL, 0xbe257a7aUL, 0xbf7e9595UL, -0xc0f09090UL, 0xc1ab7f7fUL, 0xc2462727UL, 0xc31dc8c8UL, 0xc4f59797UL, 0xc5ae7878UL, 0xc6432020UL, 0xc718cfcfUL, -0xc8fa9e9eUL, 0xc9a17171UL, 0xca4c2929UL, 0xcb17c6c6UL, 0xccff9999UL, 0xcda47676UL, 0xce492e2eUL, 0xcf12c1c1UL, -0xd0e48c8cUL, 0xd1bf6363UL, 0xd2523b3bUL, 0xd309d4d4UL, 0xd4e18b8bUL, 0xd5ba6464UL, 0xd6573c3cUL, 0xd70cd3d3UL, -0xd8ee8282UL, 0xd9b56d6dUL, 0xda583535UL, 0xdb03dadaUL, 0xdceb8585UL, 0xddb06a6aUL, 0xde5d3232UL, 0xdf06ddddUL, -0xe0d8a8a8UL, 0xe1834747UL, 0xe26e1f1fUL, 0xe335f0f0UL, 0xe4ddafafUL, 0xe5864040UL, 0xe66b1818UL, 0xe730f7f7UL, -0xe8d2a6a6UL, 0xe9894949UL, 0xea641111UL, 0xeb3ffefeUL, 0xecd7a1a1UL, 0xed8c4e4eUL, 0xee611616UL, 0xef3af9f9UL, -0xf0ccb4b4UL, 0xf1975b5bUL, 0xf27a0303UL, 0xf321ececUL, 0xf4c9b3b3UL, 0xf5925c5cUL, 0xf67f0404UL, 0xf724ebebUL, +0xa088d8d8UL, 0xa1d33737UL, 0xa23e6f6fUL, 0xa3658080UL, 0xa48ddfdfUL, 0xa5d63030UL, 0xa63b6868UL, 0xa7608787UL, +0xa882d6d6UL, 0xa9d93939UL, 0xaa346161UL, 0xab6f8e8eUL, 0xac87d1d1UL, 0xaddc3e3eUL, 0xae316666UL, 0xaf6a8989UL, +0xb09cc4c4UL, 0xb1c72b2bUL, 0xb22a7373UL, 0xb3719c9cUL, 0xb499c3c3UL, 0xb5c22c2cUL, 0xb62f7474UL, 0xb7749b9bUL, +0xb896cacaUL, 0xb9cd2525UL, 0xba207d7dUL, 0xbb7b9292UL, 0xbc93cdcdUL, 0xbdc82222UL, 0xbe257a7aUL, 0xbf7e9595UL, +0xc0f09090UL, 0xc1ab7f7fUL, 0xc2462727UL, 0xc31dc8c8UL, 0xc4f59797UL, 0xc5ae7878UL, 0xc6432020UL, 0xc718cfcfUL, +0xc8fa9e9eUL, 0xc9a17171UL, 0xca4c2929UL, 0xcb17c6c6UL, 0xccff9999UL, 0xcda47676UL, 0xce492e2eUL, 0xcf12c1c1UL, +0xd0e48c8cUL, 0xd1bf6363UL, 0xd2523b3bUL, 0xd309d4d4UL, 0xd4e18b8bUL, 0xd5ba6464UL, 0xd6573c3cUL, 0xd70cd3d3UL, +0xd8ee8282UL, 0xd9b56d6dUL, 0xda583535UL, 0xdb03dadaUL, 0xdceb8585UL, 0xddb06a6aUL, 0xde5d3232UL, 0xdf06ddddUL, +0xe0d8a8a8UL, 0xe1834747UL, 0xe26e1f1fUL, 0xe335f0f0UL, 0xe4ddafafUL, 0xe5864040UL, 0xe66b1818UL, 0xe730f7f7UL, +0xe8d2a6a6UL, 0xe9894949UL, 0xea641111UL, 0xeb3ffefeUL, 0xecd7a1a1UL, 0xed8c4e4eUL, 0xee611616UL, 0xef3af9f9UL, +0xf0ccb4b4UL, 0xf1975b5bUL, 0xf27a0303UL, 0xf321ececUL, 0xf4c9b3b3UL, 0xf5925c5cUL, 0xf67f0404UL, 0xf724ebebUL, 0xf8c6babaUL, 0xf99d5555UL, 0xfa700d0dUL, 0xfb2be2e2UL, 0xfcc3bdbdUL, 0xfd985252UL, 0xfe750a0aUL, 0xff2ee5e5UL -}, +}, { -0x00000000UL, 0xef01ef5bUL, 0xb702b7b6UL, 0x580358edUL, 0x07040705UL, 0xe805e85eUL, 0xb006b0b3UL, 0x5f075fe8UL, +0x00000000UL, 0xef01ef5bUL, 0xb702b7b6UL, 0x580358edUL, 0x07040705UL, 0xe805e85eUL, 0xb006b0b3UL, 0x5f075fe8UL, 0x0e080e0aUL, 0xe109e151UL, 0xb90ab9bcUL, 0x560b56e7UL, 0x090c090fUL, 0xe60de654UL, 0xbe0ebeb9UL, 0x510f51e2UL, -0x1c101c14UL, 0xf311f34fUL, 0xab12aba2UL, 0x441344f9UL, 0x1b141b11UL, 0xf415f44aUL, 0xac16aca7UL, 0x431743fcUL, -0x1218121eUL, 0xfd19fd45UL, 0xa51aa5a8UL, 0x4a1b4af3UL, 0x151c151bUL, 0xfa1dfa40UL, 0xa21ea2adUL, 0x4d1f4df6UL, -0x38203828UL, 0xd721d773UL, 0x8f228f9eUL, 0x602360c5UL, 0x3f243f2dUL, 0xd025d076UL, 0x8826889bUL, 0x672767c0UL, -0x36283622UL, 0xd929d979UL, 0x812a8194UL, 0x6e2b6ecfUL, 0x312c3127UL, 0xde2dde7cUL, 0x862e8691UL, 0x692f69caUL, -0x2430243cUL, 0xcb31cb67UL, 0x9332938aUL, 0x7c337cd1UL, 0x23342339UL, 0xcc35cc62UL, 0x9436948fUL, 0x7b377bd4UL, +0x1c101c14UL, 0xf311f34fUL, 0xab12aba2UL, 0x441344f9UL, 0x1b141b11UL, 0xf415f44aUL, 0xac16aca7UL, 0x431743fcUL, +0x1218121eUL, 0xfd19fd45UL, 0xa51aa5a8UL, 0x4a1b4af3UL, 0x151c151bUL, 0xfa1dfa40UL, 0xa21ea2adUL, 0x4d1f4df6UL, +0x38203828UL, 0xd721d773UL, 0x8f228f9eUL, 0x602360c5UL, 0x3f243f2dUL, 0xd025d076UL, 0x8826889bUL, 0x672767c0UL, +0x36283622UL, 0xd929d979UL, 0x812a8194UL, 0x6e2b6ecfUL, 0x312c3127UL, 0xde2dde7cUL, 0x862e8691UL, 0x692f69caUL, +0x2430243cUL, 0xcb31cb67UL, 0x9332938aUL, 0x7c337cd1UL, 0x23342339UL, 0xcc35cc62UL, 0x9436948fUL, 0x7b377bd4UL, 0x2a382a36UL, 0xc539c56dUL, 0x9d3a9d80UL, 0x723b72dbUL, 0x2d3c2d33UL, 0xc23dc268UL, 0x9a3e9a85UL, 0x753f75deUL, -0x70407050UL, 0x9f419f0bUL, 0xc742c7e6UL, 0x284328bdUL, 0x77447755UL, 0x9845980eUL, 0xc046c0e3UL, 0x2f472fb8UL, -0x7e487e5aUL, 0x91499101UL, 0xc94ac9ecUL, 0x264b26b7UL, 0x794c795fUL, 0x964d9604UL, 0xce4ecee9UL, 0x214f21b2UL, +0x70407050UL, 0x9f419f0bUL, 0xc742c7e6UL, 0x284328bdUL, 0x77447755UL, 0x9845980eUL, 0xc046c0e3UL, 0x2f472fb8UL, +0x7e487e5aUL, 0x91499101UL, 0xc94ac9ecUL, 0x264b26b7UL, 0x794c795fUL, 0x964d9604UL, 0xce4ecee9UL, 0x214f21b2UL, 0x6c506c44UL, 0x8351831fUL, 0xdb52dbf2UL, 0x345334a9UL, 0x6b546b41UL, 0x8455841aUL, 0xdc56dcf7UL, 0x335733acUL, -0x6258624eUL, 0x8d598d15UL, 0xd55ad5f8UL, 0x3a5b3aa3UL, 0x655c654bUL, 0x8a5d8a10UL, 0xd25ed2fdUL, 0x3d5f3da6UL, -0x48604878UL, 0xa761a723UL, 0xff62ffceUL, 0x10631095UL, 0x4f644f7dUL, 0xa065a026UL, 0xf866f8cbUL, 0x17671790UL, -0x46684672UL, 0xa969a929UL, 0xf16af1c4UL, 0x1e6b1e9fUL, 0x416c4177UL, 0xae6dae2cUL, 0xf66ef6c1UL, 0x196f199aUL, +0x6258624eUL, 0x8d598d15UL, 0xd55ad5f8UL, 0x3a5b3aa3UL, 0x655c654bUL, 0x8a5d8a10UL, 0xd25ed2fdUL, 0x3d5f3da6UL, +0x48604878UL, 0xa761a723UL, 0xff62ffceUL, 0x10631095UL, 0x4f644f7dUL, 0xa065a026UL, 0xf866f8cbUL, 0x17671790UL, +0x46684672UL, 0xa969a929UL, 0xf16af1c4UL, 0x1e6b1e9fUL, 0x416c4177UL, 0xae6dae2cUL, 0xf66ef6c1UL, 0x196f199aUL, 0x5470546cUL, 0xbb71bb37UL, 0xe372e3daUL, 0x0c730c81UL, 0x53745369UL, 0xbc75bc32UL, 0xe476e4dfUL, 0x0b770b84UL, -0x5a785a66UL, 0xb579b53dUL, 0xed7aedd0UL, 0x027b028bUL, 0x5d7c5d63UL, 0xb27db238UL, 0xea7eead5UL, 0x057f058eUL, +0x5a785a66UL, 0xb579b53dUL, 0xed7aedd0UL, 0x027b028bUL, 0x5d7c5d63UL, 0xb27db238UL, 0xea7eead5UL, 0x057f058eUL, 0xe080e0a0UL, 0x0f810ffbUL, 0x57825716UL, 0xb883b84dUL, 0xe784e7a5UL, 0x088508feUL, 0x50865013UL, 0xbf87bf48UL, 0xee88eeaaUL, 0x018901f1UL, 0x598a591cUL, 0xb68bb647UL, 0xe98ce9afUL, 0x068d06f4UL, 0x5e8e5e19UL, 0xb18fb142UL, -0xfc90fcb4UL, 0x139113efUL, 0x4b924b02UL, 0xa493a459UL, 0xfb94fbb1UL, 0x149514eaUL, 0x4c964c07UL, 0xa397a35cUL, -0xf298f2beUL, 0x1d991de5UL, 0x459a4508UL, 0xaa9baa53UL, 0xf59cf5bbUL, 0x1a9d1ae0UL, 0x429e420dUL, 0xad9fad56UL, -0xd8a0d888UL, 0x37a137d3UL, 0x6fa26f3eUL, 0x80a38065UL, 0xdfa4df8dUL, 0x30a530d6UL, 0x68a6683bUL, 0x87a78760UL, -0xd6a8d682UL, 0x39a939d9UL, 0x61aa6134UL, 0x8eab8e6fUL, 0xd1acd187UL, 0x3ead3edcUL, 0x66ae6631UL, 0x89af896aUL, -0xc4b0c49cUL, 0x2bb12bc7UL, 0x73b2732aUL, 0x9cb39c71UL, 0xc3b4c399UL, 0x2cb52cc2UL, 0x74b6742fUL, 0x9bb79b74UL, -0xcab8ca96UL, 0x25b925cdUL, 0x7dba7d20UL, 0x92bb927bUL, 0xcdbccd93UL, 0x22bd22c8UL, 0x7abe7a25UL, 0x95bf957eUL, -0x90c090f0UL, 0x7fc17fabUL, 0x27c22746UL, 0xc8c3c81dUL, 0x97c497f5UL, 0x78c578aeUL, 0x20c62043UL, 0xcfc7cf18UL, -0x9ec89efaUL, 0x71c971a1UL, 0x29ca294cUL, 0xc6cbc617UL, 0x99cc99ffUL, 0x76cd76a4UL, 0x2ece2e49UL, 0xc1cfc112UL, -0x8cd08ce4UL, 0x63d163bfUL, 0x3bd23b52UL, 0xd4d3d409UL, 0x8bd48be1UL, 0x64d564baUL, 0x3cd63c57UL, 0xd3d7d30cUL, -0x82d882eeUL, 0x6dd96db5UL, 0x35da3558UL, 0xdadbda03UL, 0x85dc85ebUL, 0x6add6ab0UL, 0x32de325dUL, 0xdddfdd06UL, -0xa8e0a8d8UL, 0x47e14783UL, 0x1fe21f6eUL, 0xf0e3f035UL, 0xafe4afddUL, 0x40e54086UL, 0x18e6186bUL, 0xf7e7f730UL, -0xa6e8a6d2UL, 0x49e94989UL, 0x11ea1164UL, 0xfeebfe3fUL, 0xa1eca1d7UL, 0x4eed4e8cUL, 0x16ee1661UL, 0xf9eff93aUL, -0xb4f0b4ccUL, 0x5bf15b97UL, 0x03f2037aUL, 0xecf3ec21UL, 0xb3f4b3c9UL, 0x5cf55c92UL, 0x04f6047fUL, 0xebf7eb24UL, +0xfc90fcb4UL, 0x139113efUL, 0x4b924b02UL, 0xa493a459UL, 0xfb94fbb1UL, 0x149514eaUL, 0x4c964c07UL, 0xa397a35cUL, +0xf298f2beUL, 0x1d991de5UL, 0x459a4508UL, 0xaa9baa53UL, 0xf59cf5bbUL, 0x1a9d1ae0UL, 0x429e420dUL, 0xad9fad56UL, +0xd8a0d888UL, 0x37a137d3UL, 0x6fa26f3eUL, 0x80a38065UL, 0xdfa4df8dUL, 0x30a530d6UL, 0x68a6683bUL, 0x87a78760UL, +0xd6a8d682UL, 0x39a939d9UL, 0x61aa6134UL, 0x8eab8e6fUL, 0xd1acd187UL, 0x3ead3edcUL, 0x66ae6631UL, 0x89af896aUL, +0xc4b0c49cUL, 0x2bb12bc7UL, 0x73b2732aUL, 0x9cb39c71UL, 0xc3b4c399UL, 0x2cb52cc2UL, 0x74b6742fUL, 0x9bb79b74UL, +0xcab8ca96UL, 0x25b925cdUL, 0x7dba7d20UL, 0x92bb927bUL, 0xcdbccd93UL, 0x22bd22c8UL, 0x7abe7a25UL, 0x95bf957eUL, +0x90c090f0UL, 0x7fc17fabUL, 0x27c22746UL, 0xc8c3c81dUL, 0x97c497f5UL, 0x78c578aeUL, 0x20c62043UL, 0xcfc7cf18UL, +0x9ec89efaUL, 0x71c971a1UL, 0x29ca294cUL, 0xc6cbc617UL, 0x99cc99ffUL, 0x76cd76a4UL, 0x2ece2e49UL, 0xc1cfc112UL, +0x8cd08ce4UL, 0x63d163bfUL, 0x3bd23b52UL, 0xd4d3d409UL, 0x8bd48be1UL, 0x64d564baUL, 0x3cd63c57UL, 0xd3d7d30cUL, +0x82d882eeUL, 0x6dd96db5UL, 0x35da3558UL, 0xdadbda03UL, 0x85dc85ebUL, 0x6add6ab0UL, 0x32de325dUL, 0xdddfdd06UL, +0xa8e0a8d8UL, 0x47e14783UL, 0x1fe21f6eUL, 0xf0e3f035UL, 0xafe4afddUL, 0x40e54086UL, 0x18e6186bUL, 0xf7e7f730UL, +0xa6e8a6d2UL, 0x49e94989UL, 0x11ea1164UL, 0xfeebfe3fUL, 0xa1eca1d7UL, 0x4eed4e8cUL, 0x16ee1661UL, 0xf9eff93aUL, +0xb4f0b4ccUL, 0x5bf15b97UL, 0x03f2037aUL, 0xecf3ec21UL, 0xb3f4b3c9UL, 0x5cf55c92UL, 0x04f6047fUL, 0xebf7eb24UL, 0xbaf8bac6UL, 0x55f9559dUL, 0x0dfa0d70UL, 0xe2fbe22bUL, 0xbdfcbdc3UL, 0x52fd5298UL, 0x0afe0a75UL, 0xe5ffe52eUL -}, +}, { -0x00000000UL, 0x5bef015bUL, 0xb6b702b6UL, 0xed5803edUL, 0x05070405UL, 0x5ee8055eUL, 0xb3b006b3UL, 0xe85f07e8UL, -0x0a0e080aUL, 0x51e10951UL, 0xbcb90abcUL, 0xe7560be7UL, 0x0f090c0fUL, 0x54e60d54UL, 0xb9be0eb9UL, 0xe2510fe2UL, -0x141c1014UL, 0x4ff3114fUL, 0xa2ab12a2UL, 0xf94413f9UL, 0x111b1411UL, 0x4af4154aUL, 0xa7ac16a7UL, 0xfc4317fcUL, -0x1e12181eUL, 0x45fd1945UL, 0xa8a51aa8UL, 0xf34a1bf3UL, 0x1b151c1bUL, 0x40fa1d40UL, 0xada21eadUL, 0xf64d1ff6UL, -0x28382028UL, 0x73d72173UL, 0x9e8f229eUL, 0xc56023c5UL, 0x2d3f242dUL, 0x76d02576UL, 0x9b88269bUL, 0xc06727c0UL, -0x22362822UL, 0x79d92979UL, 0x94812a94UL, 0xcf6e2bcfUL, 0x27312c27UL, 0x7cde2d7cUL, 0x91862e91UL, 0xca692fcaUL, -0x3c24303cUL, 0x67cb3167UL, 0x8a93328aUL, 0xd17c33d1UL, 0x39233439UL, 0x62cc3562UL, 0x8f94368fUL, 0xd47b37d4UL, +0x00000000UL, 0x5bef015bUL, 0xb6b702b6UL, 0xed5803edUL, 0x05070405UL, 0x5ee8055eUL, 0xb3b006b3UL, 0xe85f07e8UL, +0x0a0e080aUL, 0x51e10951UL, 0xbcb90abcUL, 0xe7560be7UL, 0x0f090c0fUL, 0x54e60d54UL, 0xb9be0eb9UL, 0xe2510fe2UL, +0x141c1014UL, 0x4ff3114fUL, 0xa2ab12a2UL, 0xf94413f9UL, 0x111b1411UL, 0x4af4154aUL, 0xa7ac16a7UL, 0xfc4317fcUL, +0x1e12181eUL, 0x45fd1945UL, 0xa8a51aa8UL, 0xf34a1bf3UL, 0x1b151c1bUL, 0x40fa1d40UL, 0xada21eadUL, 0xf64d1ff6UL, +0x28382028UL, 0x73d72173UL, 0x9e8f229eUL, 0xc56023c5UL, 0x2d3f242dUL, 0x76d02576UL, 0x9b88269bUL, 0xc06727c0UL, +0x22362822UL, 0x79d92979UL, 0x94812a94UL, 0xcf6e2bcfUL, 0x27312c27UL, 0x7cde2d7cUL, 0x91862e91UL, 0xca692fcaUL, +0x3c24303cUL, 0x67cb3167UL, 0x8a93328aUL, 0xd17c33d1UL, 0x39233439UL, 0x62cc3562UL, 0x8f94368fUL, 0xd47b37d4UL, 0x362a3836UL, 0x6dc5396dUL, 0x809d3a80UL, 0xdb723bdbUL, 0x332d3c33UL, 0x68c23d68UL, 0x859a3e85UL, 0xde753fdeUL, -0x50704050UL, 0x0b9f410bUL, 0xe6c742e6UL, 0xbd2843bdUL, 0x55774455UL, 0x0e98450eUL, 0xe3c046e3UL, 0xb82f47b8UL, -0x5a7e485aUL, 0x01914901UL, 0xecc94aecUL, 0xb7264bb7UL, 0x5f794c5fUL, 0x04964d04UL, 0xe9ce4ee9UL, 0xb2214fb2UL, -0x446c5044UL, 0x1f83511fUL, 0xf2db52f2UL, 0xa93453a9UL, 0x416b5441UL, 0x1a84551aUL, 0xf7dc56f7UL, 0xac3357acUL, -0x4e62584eUL, 0x158d5915UL, 0xf8d55af8UL, 0xa33a5ba3UL, 0x4b655c4bUL, 0x108a5d10UL, 0xfdd25efdUL, 0xa63d5fa6UL, -0x78486078UL, 0x23a76123UL, 0xceff62ceUL, 0x95106395UL, 0x7d4f647dUL, 0x26a06526UL, 0xcbf866cbUL, 0x90176790UL, -0x72466872UL, 0x29a96929UL, 0xc4f16ac4UL, 0x9f1e6b9fUL, 0x77416c77UL, 0x2cae6d2cUL, 0xc1f66ec1UL, 0x9a196f9aUL, -0x6c54706cUL, 0x37bb7137UL, 0xdae372daUL, 0x810c7381UL, 0x69537469UL, 0x32bc7532UL, 0xdfe476dfUL, 0x840b7784UL, -0x665a7866UL, 0x3db5793dUL, 0xd0ed7ad0UL, 0x8b027b8bUL, 0x635d7c63UL, 0x38b27d38UL, 0xd5ea7ed5UL, 0x8e057f8eUL, -0xa0e080a0UL, 0xfb0f81fbUL, 0x16578216UL, 0x4db8834dUL, 0xa5e784a5UL, 0xfe0885feUL, 0x13508613UL, 0x48bf8748UL, +0x50704050UL, 0x0b9f410bUL, 0xe6c742e6UL, 0xbd2843bdUL, 0x55774455UL, 0x0e98450eUL, 0xe3c046e3UL, 0xb82f47b8UL, +0x5a7e485aUL, 0x01914901UL, 0xecc94aecUL, 0xb7264bb7UL, 0x5f794c5fUL, 0x04964d04UL, 0xe9ce4ee9UL, 0xb2214fb2UL, +0x446c5044UL, 0x1f83511fUL, 0xf2db52f2UL, 0xa93453a9UL, 0x416b5441UL, 0x1a84551aUL, 0xf7dc56f7UL, 0xac3357acUL, +0x4e62584eUL, 0x158d5915UL, 0xf8d55af8UL, 0xa33a5ba3UL, 0x4b655c4bUL, 0x108a5d10UL, 0xfdd25efdUL, 0xa63d5fa6UL, +0x78486078UL, 0x23a76123UL, 0xceff62ceUL, 0x95106395UL, 0x7d4f647dUL, 0x26a06526UL, 0xcbf866cbUL, 0x90176790UL, +0x72466872UL, 0x29a96929UL, 0xc4f16ac4UL, 0x9f1e6b9fUL, 0x77416c77UL, 0x2cae6d2cUL, 0xc1f66ec1UL, 0x9a196f9aUL, +0x6c54706cUL, 0x37bb7137UL, 0xdae372daUL, 0x810c7381UL, 0x69537469UL, 0x32bc7532UL, 0xdfe476dfUL, 0x840b7784UL, +0x665a7866UL, 0x3db5793dUL, 0xd0ed7ad0UL, 0x8b027b8bUL, 0x635d7c63UL, 0x38b27d38UL, 0xd5ea7ed5UL, 0x8e057f8eUL, +0xa0e080a0UL, 0xfb0f81fbUL, 0x16578216UL, 0x4db8834dUL, 0xa5e784a5UL, 0xfe0885feUL, 0x13508613UL, 0x48bf8748UL, 0xaaee88aaUL, 0xf10189f1UL, 0x1c598a1cUL, 0x47b68b47UL, 0xafe98cafUL, 0xf4068df4UL, 0x195e8e19UL, 0x42b18f42UL, -0xb4fc90b4UL, 0xef1391efUL, 0x024b9202UL, 0x59a49359UL, 0xb1fb94b1UL, 0xea1495eaUL, 0x074c9607UL, 0x5ca3975cUL, -0xbef298beUL, 0xe51d99e5UL, 0x08459a08UL, 0x53aa9b53UL, 0xbbf59cbbUL, 0xe01a9de0UL, 0x0d429e0dUL, 0x56ad9f56UL, -0x88d8a088UL, 0xd337a1d3UL, 0x3e6fa23eUL, 0x6580a365UL, 0x8ddfa48dUL, 0xd630a5d6UL, 0x3b68a63bUL, 0x6087a760UL, -0x82d6a882UL, 0xd939a9d9UL, 0x3461aa34UL, 0x6f8eab6fUL, 0x87d1ac87UL, 0xdc3eaddcUL, 0x3166ae31UL, 0x6a89af6aUL, -0x9cc4b09cUL, 0xc72bb1c7UL, 0x2a73b22aUL, 0x719cb371UL, 0x99c3b499UL, 0xc22cb5c2UL, 0x2f74b62fUL, 0x749bb774UL, +0xb4fc90b4UL, 0xef1391efUL, 0x024b9202UL, 0x59a49359UL, 0xb1fb94b1UL, 0xea1495eaUL, 0x074c9607UL, 0x5ca3975cUL, +0xbef298beUL, 0xe51d99e5UL, 0x08459a08UL, 0x53aa9b53UL, 0xbbf59cbbUL, 0xe01a9de0UL, 0x0d429e0dUL, 0x56ad9f56UL, +0x88d8a088UL, 0xd337a1d3UL, 0x3e6fa23eUL, 0x6580a365UL, 0x8ddfa48dUL, 0xd630a5d6UL, 0x3b68a63bUL, 0x6087a760UL, +0x82d6a882UL, 0xd939a9d9UL, 0x3461aa34UL, 0x6f8eab6fUL, 0x87d1ac87UL, 0xdc3eaddcUL, 0x3166ae31UL, 0x6a89af6aUL, +0x9cc4b09cUL, 0xc72bb1c7UL, 0x2a73b22aUL, 0x719cb371UL, 0x99c3b499UL, 0xc22cb5c2UL, 0x2f74b62fUL, 0x749bb774UL, 0x96cab896UL, 0xcd25b9cdUL, 0x207dba20UL, 0x7b92bb7bUL, 0x93cdbc93UL, 0xc822bdc8UL, 0x257abe25UL, 0x7e95bf7eUL, -0xf090c0f0UL, 0xab7fc1abUL, 0x4627c246UL, 0x1dc8c31dUL, 0xf597c4f5UL, 0xae78c5aeUL, 0x4320c643UL, 0x18cfc718UL, -0xfa9ec8faUL, 0xa171c9a1UL, 0x4c29ca4cUL, 0x17c6cb17UL, 0xff99ccffUL, 0xa476cda4UL, 0x492ece49UL, 0x12c1cf12UL, -0xe48cd0e4UL, 0xbf63d1bfUL, 0x523bd252UL, 0x09d4d309UL, 0xe18bd4e1UL, 0xba64d5baUL, 0x573cd657UL, 0x0cd3d70cUL, -0xee82d8eeUL, 0xb56dd9b5UL, 0x5835da58UL, 0x03dadb03UL, 0xeb85dcebUL, 0xb06addb0UL, 0x5d32de5dUL, 0x06dddf06UL, -0xd8a8e0d8UL, 0x8347e183UL, 0x6e1fe26eUL, 0x35f0e335UL, 0xddafe4ddUL, 0x8640e586UL, 0x6b18e66bUL, 0x30f7e730UL, +0xf090c0f0UL, 0xab7fc1abUL, 0x4627c246UL, 0x1dc8c31dUL, 0xf597c4f5UL, 0xae78c5aeUL, 0x4320c643UL, 0x18cfc718UL, +0xfa9ec8faUL, 0xa171c9a1UL, 0x4c29ca4cUL, 0x17c6cb17UL, 0xff99ccffUL, 0xa476cda4UL, 0x492ece49UL, 0x12c1cf12UL, +0xe48cd0e4UL, 0xbf63d1bfUL, 0x523bd252UL, 0x09d4d309UL, 0xe18bd4e1UL, 0xba64d5baUL, 0x573cd657UL, 0x0cd3d70cUL, +0xee82d8eeUL, 0xb56dd9b5UL, 0x5835da58UL, 0x03dadb03UL, 0xeb85dcebUL, 0xb06addb0UL, 0x5d32de5dUL, 0x06dddf06UL, +0xd8a8e0d8UL, 0x8347e183UL, 0x6e1fe26eUL, 0x35f0e335UL, 0xddafe4ddUL, 0x8640e586UL, 0x6b18e66bUL, 0x30f7e730UL, 0xd2a6e8d2UL, 0x8949e989UL, 0x6411ea64UL, 0x3ffeeb3fUL, 0xd7a1ecd7UL, 0x8c4eed8cUL, 0x6116ee61UL, 0x3af9ef3aUL, -0xccb4f0ccUL, 0x975bf197UL, 0x7a03f27aUL, 0x21ecf321UL, 0xc9b3f4c9UL, 0x925cf592UL, 0x7f04f67fUL, 0x24ebf724UL, +0xccb4f0ccUL, 0x975bf197UL, 0x7a03f27aUL, 0x21ecf321UL, 0xc9b3f4c9UL, 0x925cf592UL, 0x7f04f67fUL, 0x24ebf724UL, 0xc6baf8c6UL, 0x9d55f99dUL, 0x700dfa70UL, 0x2be2fb2bUL, 0xc3bdfcc3UL, 0x9852fd98UL, 0x750afe75UL, 0x2ee5ff2eUL }}; @@ -216,281 +215,282 @@ static const ulong32 mds_tab[4][256] = { /* the 4x8 RS transform */ static const ulong32 rs_tab0[256] = { -0x00000000LU, 0xa402a401LU, 0x05040502LU, 0xa106a103LU, 0x0a080a04LU, 0xae0aae05LU, 0x0f0c0f06LU, 0xab0eab07LU, -0x14101408LU, 0xb012b009LU, 0x1114110aLU, 0xb516b50bLU, 0x1e181e0cLU, 0xba1aba0dLU, 0x1b1c1b0eLU, 0xbf1ebf0fLU, -0x28202810LU, 0x8c228c11LU, 0x2d242d12LU, 0x89268913LU, 0x22282214LU, 0x862a8615LU, 0x272c2716LU, 0x832e8317LU, -0x3c303c18LU, 0x98329819LU, 0x3934391aLU, 0x9d369d1bLU, 0x3638361cLU, 0x923a921dLU, 0x333c331eLU, 0x973e971fLU, -0x50405020LU, 0xf442f421LU, 0x55445522LU, 0xf146f123LU, 0x5a485a24LU, 0xfe4afe25LU, 0x5f4c5f26LU, 0xfb4efb27LU, -0x44504428LU, 0xe052e029LU, 0x4154412aLU, 0xe556e52bLU, 0x4e584e2cLU, 0xea5aea2dLU, 0x4b5c4b2eLU, 0xef5eef2fLU, -0x78607830LU, 0xdc62dc31LU, 0x7d647d32LU, 0xd966d933LU, 0x72687234LU, 0xd66ad635LU, 0x776c7736LU, 0xd36ed337LU, -0x6c706c38LU, 0xc872c839LU, 0x6974693aLU, 0xcd76cd3bLU, 0x6678663cLU, 0xc27ac23dLU, 0x637c633eLU, 0xc77ec73fLU, -0xa080a040LU, 0x04820441LU, 0xa584a542LU, 0x01860143LU, 0xaa88aa44LU, 0x0e8a0e45LU, 0xaf8caf46LU, 0x0b8e0b47LU, -0xb490b448LU, 0x10921049LU, 0xb194b14aLU, 0x1596154bLU, 0xbe98be4cLU, 0x1a9a1a4dLU, 0xbb9cbb4eLU, 0x1f9e1f4fLU, -0x88a08850LU, 0x2ca22c51LU, 0x8da48d52LU, 0x29a62953LU, 0x82a88254LU, 0x26aa2655LU, 0x87ac8756LU, 0x23ae2357LU, -0x9cb09c58LU, 0x38b23859LU, 0x99b4995aLU, 0x3db63d5bLU, 0x96b8965cLU, 0x32ba325dLU, 0x93bc935eLU, 0x37be375fLU, -0xf0c0f060LU, 0x54c25461LU, 0xf5c4f562LU, 0x51c65163LU, 0xfac8fa64LU, 0x5eca5e65LU, 0xffccff66LU, 0x5bce5b67LU, -0xe4d0e468LU, 0x40d24069LU, 0xe1d4e16aLU, 0x45d6456bLU, 0xeed8ee6cLU, 0x4ada4a6dLU, 0xebdceb6eLU, 0x4fde4f6fLU, -0xd8e0d870LU, 0x7ce27c71LU, 0xdde4dd72LU, 0x79e67973LU, 0xd2e8d274LU, 0x76ea7675LU, 0xd7ecd776LU, 0x73ee7377LU, -0xccf0cc78LU, 0x68f26879LU, 0xc9f4c97aLU, 0x6df66d7bLU, 0xc6f8c67cLU, 0x62fa627dLU, 0xc3fcc37eLU, 0x67fe677fLU, -0x0d4d0d80LU, 0xa94fa981LU, 0x08490882LU, 0xac4bac83LU, 0x07450784LU, 0xa347a385LU, 0x02410286LU, 0xa643a687LU, -0x195d1988LU, 0xbd5fbd89LU, 0x1c591c8aLU, 0xb85bb88bLU, 0x1355138cLU, 0xb757b78dLU, 0x1651168eLU, 0xb253b28fLU, -0x256d2590LU, 0x816f8191LU, 0x20692092LU, 0x846b8493LU, 0x2f652f94LU, 0x8b678b95LU, 0x2a612a96LU, 0x8e638e97LU, -0x317d3198LU, 0x957f9599LU, 0x3479349aLU, 0x907b909bLU, 0x3b753b9cLU, 0x9f779f9dLU, 0x3e713e9eLU, 0x9a739a9fLU, -0x5d0d5da0LU, 0xf90ff9a1LU, 0x580958a2LU, 0xfc0bfca3LU, 0x570557a4LU, 0xf307f3a5LU, 0x520152a6LU, 0xf603f6a7LU, -0x491d49a8LU, 0xed1feda9LU, 0x4c194caaLU, 0xe81be8abLU, 0x431543acLU, 0xe717e7adLU, 0x461146aeLU, 0xe213e2afLU, -0x752d75b0LU, 0xd12fd1b1LU, 0x702970b2LU, 0xd42bd4b3LU, 0x7f257fb4LU, 0xdb27dbb5LU, 0x7a217ab6LU, 0xde23deb7LU, -0x613d61b8LU, 0xc53fc5b9LU, 0x643964baLU, 0xc03bc0bbLU, 0x6b356bbcLU, 0xcf37cfbdLU, 0x6e316ebeLU, 0xca33cabfLU, -0xadcdadc0LU, 0x09cf09c1LU, 0xa8c9a8c2LU, 0x0ccb0cc3LU, 0xa7c5a7c4LU, 0x03c703c5LU, 0xa2c1a2c6LU, 0x06c306c7LU, -0xb9ddb9c8LU, 0x1ddf1dc9LU, 0xbcd9bccaLU, 0x18db18cbLU, 0xb3d5b3ccLU, 0x17d717cdLU, 0xb6d1b6ceLU, 0x12d312cfLU, -0x85ed85d0LU, 0x21ef21d1LU, 0x80e980d2LU, 0x24eb24d3LU, 0x8fe58fd4LU, 0x2be72bd5LU, 0x8ae18ad6LU, 0x2ee32ed7LU, -0x91fd91d8LU, 0x35ff35d9LU, 0x94f994daLU, 0x30fb30dbLU, 0x9bf59bdcLU, 0x3ff73fddLU, 0x9ef19edeLU, 0x3af33adfLU, -0xfd8dfde0LU, 0x598f59e1LU, 0xf889f8e2LU, 0x5c8b5ce3LU, 0xf785f7e4LU, 0x538753e5LU, 0xf281f2e6LU, 0x568356e7LU, -0xe99de9e8LU, 0x4d9f4de9LU, 0xec99eceaLU, 0x489b48ebLU, 0xe395e3ecLU, 0x479747edLU, 0xe691e6eeLU, 0x429342efLU, -0xd5add5f0LU, 0x71af71f1LU, 0xd0a9d0f2LU, 0x74ab74f3LU, 0xdfa5dff4LU, 0x7ba77bf5LU, 0xdaa1daf6LU, 0x7ea37ef7LU, -0xc1bdc1f8LU, 0x65bf65f9LU, 0xc4b9c4faLU, 0x60bb60fbLU, 0xcbb5cbfcLU, 0x6fb76ffdLU, 0xceb1cefeLU, 0x6ab36affLU }; +0x00000000LU, 0xa402a401LU, 0x05040502LU, 0xa106a103LU, 0x0a080a04LU, 0xae0aae05LU, 0x0f0c0f06LU, 0xab0eab07LU, +0x14101408LU, 0xb012b009LU, 0x1114110aLU, 0xb516b50bLU, 0x1e181e0cLU, 0xba1aba0dLU, 0x1b1c1b0eLU, 0xbf1ebf0fLU, +0x28202810LU, 0x8c228c11LU, 0x2d242d12LU, 0x89268913LU, 0x22282214LU, 0x862a8615LU, 0x272c2716LU, 0x832e8317LU, +0x3c303c18LU, 0x98329819LU, 0x3934391aLU, 0x9d369d1bLU, 0x3638361cLU, 0x923a921dLU, 0x333c331eLU, 0x973e971fLU, +0x50405020LU, 0xf442f421LU, 0x55445522LU, 0xf146f123LU, 0x5a485a24LU, 0xfe4afe25LU, 0x5f4c5f26LU, 0xfb4efb27LU, +0x44504428LU, 0xe052e029LU, 0x4154412aLU, 0xe556e52bLU, 0x4e584e2cLU, 0xea5aea2dLU, 0x4b5c4b2eLU, 0xef5eef2fLU, +0x78607830LU, 0xdc62dc31LU, 0x7d647d32LU, 0xd966d933LU, 0x72687234LU, 0xd66ad635LU, 0x776c7736LU, 0xd36ed337LU, +0x6c706c38LU, 0xc872c839LU, 0x6974693aLU, 0xcd76cd3bLU, 0x6678663cLU, 0xc27ac23dLU, 0x637c633eLU, 0xc77ec73fLU, +0xa080a040LU, 0x04820441LU, 0xa584a542LU, 0x01860143LU, 0xaa88aa44LU, 0x0e8a0e45LU, 0xaf8caf46LU, 0x0b8e0b47LU, +0xb490b448LU, 0x10921049LU, 0xb194b14aLU, 0x1596154bLU, 0xbe98be4cLU, 0x1a9a1a4dLU, 0xbb9cbb4eLU, 0x1f9e1f4fLU, +0x88a08850LU, 0x2ca22c51LU, 0x8da48d52LU, 0x29a62953LU, 0x82a88254LU, 0x26aa2655LU, 0x87ac8756LU, 0x23ae2357LU, +0x9cb09c58LU, 0x38b23859LU, 0x99b4995aLU, 0x3db63d5bLU, 0x96b8965cLU, 0x32ba325dLU, 0x93bc935eLU, 0x37be375fLU, +0xf0c0f060LU, 0x54c25461LU, 0xf5c4f562LU, 0x51c65163LU, 0xfac8fa64LU, 0x5eca5e65LU, 0xffccff66LU, 0x5bce5b67LU, +0xe4d0e468LU, 0x40d24069LU, 0xe1d4e16aLU, 0x45d6456bLU, 0xeed8ee6cLU, 0x4ada4a6dLU, 0xebdceb6eLU, 0x4fde4f6fLU, +0xd8e0d870LU, 0x7ce27c71LU, 0xdde4dd72LU, 0x79e67973LU, 0xd2e8d274LU, 0x76ea7675LU, 0xd7ecd776LU, 0x73ee7377LU, +0xccf0cc78LU, 0x68f26879LU, 0xc9f4c97aLU, 0x6df66d7bLU, 0xc6f8c67cLU, 0x62fa627dLU, 0xc3fcc37eLU, 0x67fe677fLU, +0x0d4d0d80LU, 0xa94fa981LU, 0x08490882LU, 0xac4bac83LU, 0x07450784LU, 0xa347a385LU, 0x02410286LU, 0xa643a687LU, +0x195d1988LU, 0xbd5fbd89LU, 0x1c591c8aLU, 0xb85bb88bLU, 0x1355138cLU, 0xb757b78dLU, 0x1651168eLU, 0xb253b28fLU, +0x256d2590LU, 0x816f8191LU, 0x20692092LU, 0x846b8493LU, 0x2f652f94LU, 0x8b678b95LU, 0x2a612a96LU, 0x8e638e97LU, +0x317d3198LU, 0x957f9599LU, 0x3479349aLU, 0x907b909bLU, 0x3b753b9cLU, 0x9f779f9dLU, 0x3e713e9eLU, 0x9a739a9fLU, +0x5d0d5da0LU, 0xf90ff9a1LU, 0x580958a2LU, 0xfc0bfca3LU, 0x570557a4LU, 0xf307f3a5LU, 0x520152a6LU, 0xf603f6a7LU, +0x491d49a8LU, 0xed1feda9LU, 0x4c194caaLU, 0xe81be8abLU, 0x431543acLU, 0xe717e7adLU, 0x461146aeLU, 0xe213e2afLU, +0x752d75b0LU, 0xd12fd1b1LU, 0x702970b2LU, 0xd42bd4b3LU, 0x7f257fb4LU, 0xdb27dbb5LU, 0x7a217ab6LU, 0xde23deb7LU, +0x613d61b8LU, 0xc53fc5b9LU, 0x643964baLU, 0xc03bc0bbLU, 0x6b356bbcLU, 0xcf37cfbdLU, 0x6e316ebeLU, 0xca33cabfLU, +0xadcdadc0LU, 0x09cf09c1LU, 0xa8c9a8c2LU, 0x0ccb0cc3LU, 0xa7c5a7c4LU, 0x03c703c5LU, 0xa2c1a2c6LU, 0x06c306c7LU, +0xb9ddb9c8LU, 0x1ddf1dc9LU, 0xbcd9bccaLU, 0x18db18cbLU, 0xb3d5b3ccLU, 0x17d717cdLU, 0xb6d1b6ceLU, 0x12d312cfLU, +0x85ed85d0LU, 0x21ef21d1LU, 0x80e980d2LU, 0x24eb24d3LU, 0x8fe58fd4LU, 0x2be72bd5LU, 0x8ae18ad6LU, 0x2ee32ed7LU, +0x91fd91d8LU, 0x35ff35d9LU, 0x94f994daLU, 0x30fb30dbLU, 0x9bf59bdcLU, 0x3ff73fddLU, 0x9ef19edeLU, 0x3af33adfLU, +0xfd8dfde0LU, 0x598f59e1LU, 0xf889f8e2LU, 0x5c8b5ce3LU, 0xf785f7e4LU, 0x538753e5LU, 0xf281f2e6LU, 0x568356e7LU, +0xe99de9e8LU, 0x4d9f4de9LU, 0xec99eceaLU, 0x489b48ebLU, 0xe395e3ecLU, 0x479747edLU, 0xe691e6eeLU, 0x429342efLU, +0xd5add5f0LU, 0x71af71f1LU, 0xd0a9d0f2LU, 0x74ab74f3LU, 0xdfa5dff4LU, 0x7ba77bf5LU, 0xdaa1daf6LU, 0x7ea37ef7LU, +0xc1bdc1f8LU, 0x65bf65f9LU, 0xc4b9c4faLU, 0x60bb60fbLU, 0xcbb5cbfcLU, 0x6fb76ffdLU, 0xceb1cefeLU, 0x6ab36affLU }; static const ulong32 rs_tab1[256] = { -0x00000000LU, 0x55a156a4LU, 0xaa0fac05LU, 0xffaefaa1LU, 0x191e150aLU, 0x4cbf43aeLU, 0xb311b90fLU, 0xe6b0efabLU, -0x323c2a14LU, 0x679d7cb0LU, 0x98338611LU, 0xcd92d0b5LU, 0x2b223f1eLU, 0x7e8369baLU, 0x812d931bLU, 0xd48cc5bfLU, -0x64785428LU, 0x31d9028cLU, 0xce77f82dLU, 0x9bd6ae89LU, 0x7d664122LU, 0x28c71786LU, 0xd769ed27LU, 0x82c8bb83LU, -0x56447e3cLU, 0x03e52898LU, 0xfc4bd239LU, 0xa9ea849dLU, 0x4f5a6b36LU, 0x1afb3d92LU, 0xe555c733LU, 0xb0f49197LU, -0xc8f0a850LU, 0x9d51fef4LU, 0x62ff0455LU, 0x375e52f1LU, 0xd1eebd5aLU, 0x844febfeLU, 0x7be1115fLU, 0x2e4047fbLU, -0xfacc8244LU, 0xaf6dd4e0LU, 0x50c32e41LU, 0x056278e5LU, 0xe3d2974eLU, 0xb673c1eaLU, 0x49dd3b4bLU, 0x1c7c6defLU, -0xac88fc78LU, 0xf929aadcLU, 0x0687507dLU, 0x532606d9LU, 0xb596e972LU, 0xe037bfd6LU, 0x1f994577LU, 0x4a3813d3LU, -0x9eb4d66cLU, 0xcb1580c8LU, 0x34bb7a69LU, 0x611a2ccdLU, 0x87aac366LU, 0xd20b95c2LU, 0x2da56f63LU, 0x780439c7LU, -0xddad1da0LU, 0x880c4b04LU, 0x77a2b1a5LU, 0x2203e701LU, 0xc4b308aaLU, 0x91125e0eLU, 0x6ebca4afLU, 0x3b1df20bLU, -0xef9137b4LU, 0xba306110LU, 0x459e9bb1LU, 0x103fcd15LU, 0xf68f22beLU, 0xa32e741aLU, 0x5c808ebbLU, 0x0921d81fLU, -0xb9d54988LU, 0xec741f2cLU, 0x13dae58dLU, 0x467bb329LU, 0xa0cb5c82LU, 0xf56a0a26LU, 0x0ac4f087LU, 0x5f65a623LU, -0x8be9639cLU, 0xde483538LU, 0x21e6cf99LU, 0x7447993dLU, 0x92f77696LU, 0xc7562032LU, 0x38f8da93LU, 0x6d598c37LU, -0x155db5f0LU, 0x40fce354LU, 0xbf5219f5LU, 0xeaf34f51LU, 0x0c43a0faLU, 0x59e2f65eLU, 0xa64c0cffLU, 0xf3ed5a5bLU, -0x27619fe4LU, 0x72c0c940LU, 0x8d6e33e1LU, 0xd8cf6545LU, 0x3e7f8aeeLU, 0x6bdedc4aLU, 0x947026ebLU, 0xc1d1704fLU, -0x7125e1d8LU, 0x2484b77cLU, 0xdb2a4dddLU, 0x8e8b1b79LU, 0x683bf4d2LU, 0x3d9aa276LU, 0xc23458d7LU, 0x97950e73LU, +0x00000000LU, 0x55a156a4LU, 0xaa0fac05LU, 0xffaefaa1LU, 0x191e150aLU, 0x4cbf43aeLU, 0xb311b90fLU, 0xe6b0efabLU, +0x323c2a14LU, 0x679d7cb0LU, 0x98338611LU, 0xcd92d0b5LU, 0x2b223f1eLU, 0x7e8369baLU, 0x812d931bLU, 0xd48cc5bfLU, +0x64785428LU, 0x31d9028cLU, 0xce77f82dLU, 0x9bd6ae89LU, 0x7d664122LU, 0x28c71786LU, 0xd769ed27LU, 0x82c8bb83LU, +0x56447e3cLU, 0x03e52898LU, 0xfc4bd239LU, 0xa9ea849dLU, 0x4f5a6b36LU, 0x1afb3d92LU, 0xe555c733LU, 0xb0f49197LU, +0xc8f0a850LU, 0x9d51fef4LU, 0x62ff0455LU, 0x375e52f1LU, 0xd1eebd5aLU, 0x844febfeLU, 0x7be1115fLU, 0x2e4047fbLU, +0xfacc8244LU, 0xaf6dd4e0LU, 0x50c32e41LU, 0x056278e5LU, 0xe3d2974eLU, 0xb673c1eaLU, 0x49dd3b4bLU, 0x1c7c6defLU, +0xac88fc78LU, 0xf929aadcLU, 0x0687507dLU, 0x532606d9LU, 0xb596e972LU, 0xe037bfd6LU, 0x1f994577LU, 0x4a3813d3LU, +0x9eb4d66cLU, 0xcb1580c8LU, 0x34bb7a69LU, 0x611a2ccdLU, 0x87aac366LU, 0xd20b95c2LU, 0x2da56f63LU, 0x780439c7LU, +0xddad1da0LU, 0x880c4b04LU, 0x77a2b1a5LU, 0x2203e701LU, 0xc4b308aaLU, 0x91125e0eLU, 0x6ebca4afLU, 0x3b1df20bLU, +0xef9137b4LU, 0xba306110LU, 0x459e9bb1LU, 0x103fcd15LU, 0xf68f22beLU, 0xa32e741aLU, 0x5c808ebbLU, 0x0921d81fLU, +0xb9d54988LU, 0xec741f2cLU, 0x13dae58dLU, 0x467bb329LU, 0xa0cb5c82LU, 0xf56a0a26LU, 0x0ac4f087LU, 0x5f65a623LU, +0x8be9639cLU, 0xde483538LU, 0x21e6cf99LU, 0x7447993dLU, 0x92f77696LU, 0xc7562032LU, 0x38f8da93LU, 0x6d598c37LU, +0x155db5f0LU, 0x40fce354LU, 0xbf5219f5LU, 0xeaf34f51LU, 0x0c43a0faLU, 0x59e2f65eLU, 0xa64c0cffLU, 0xf3ed5a5bLU, +0x27619fe4LU, 0x72c0c940LU, 0x8d6e33e1LU, 0xd8cf6545LU, 0x3e7f8aeeLU, 0x6bdedc4aLU, 0x947026ebLU, 0xc1d1704fLU, +0x7125e1d8LU, 0x2484b77cLU, 0xdb2a4dddLU, 0x8e8b1b79LU, 0x683bf4d2LU, 0x3d9aa276LU, 0xc23458d7LU, 0x97950e73LU, 0x4319cbccLU, 0x16b89d68LU, 0xe91667c9LU, 0xbcb7316dLU, 0x5a07dec6LU, 0x0fa68862LU, 0xf00872c3LU, 0xa5a92467LU, -0xf7173a0dLU, 0xa2b66ca9LU, 0x5d189608LU, 0x08b9c0acLU, 0xee092f07LU, 0xbba879a3LU, 0x44068302LU, 0x11a7d5a6LU, -0xc52b1019LU, 0x908a46bdLU, 0x6f24bc1cLU, 0x3a85eab8LU, 0xdc350513LU, 0x899453b7LU, 0x763aa916LU, 0x239bffb2LU, -0x936f6e25LU, 0xc6ce3881LU, 0x3960c220LU, 0x6cc19484LU, 0x8a717b2fLU, 0xdfd02d8bLU, 0x207ed72aLU, 0x75df818eLU, +0xf7173a0dLU, 0xa2b66ca9LU, 0x5d189608LU, 0x08b9c0acLU, 0xee092f07LU, 0xbba879a3LU, 0x44068302LU, 0x11a7d5a6LU, +0xc52b1019LU, 0x908a46bdLU, 0x6f24bc1cLU, 0x3a85eab8LU, 0xdc350513LU, 0x899453b7LU, 0x763aa916LU, 0x239bffb2LU, +0x936f6e25LU, 0xc6ce3881LU, 0x3960c220LU, 0x6cc19484LU, 0x8a717b2fLU, 0xdfd02d8bLU, 0x207ed72aLU, 0x75df818eLU, 0xa1534431LU, 0xf4f21295LU, 0x0b5ce834LU, 0x5efdbe90LU, 0xb84d513bLU, 0xedec079fLU, 0x1242fd3eLU, 0x47e3ab9aLU, -0x3fe7925dLU, 0x6a46c4f9LU, 0x95e83e58LU, 0xc04968fcLU, 0x26f98757LU, 0x7358d1f3LU, 0x8cf62b52LU, 0xd9577df6LU, +0x3fe7925dLU, 0x6a46c4f9LU, 0x95e83e58LU, 0xc04968fcLU, 0x26f98757LU, 0x7358d1f3LU, 0x8cf62b52LU, 0xd9577df6LU, 0x0ddbb849LU, 0x587aeeedLU, 0xa7d4144cLU, 0xf27542e8LU, 0x14c5ad43LU, 0x4164fbe7LU, 0xbeca0146LU, 0xeb6b57e2LU, -0x5b9fc675LU, 0x0e3e90d1LU, 0xf1906a70LU, 0xa4313cd4LU, 0x4281d37fLU, 0x172085dbLU, 0xe88e7f7aLU, 0xbd2f29deLU, -0x69a3ec61LU, 0x3c02bac5LU, 0xc3ac4064LU, 0x960d16c0LU, 0x70bdf96bLU, 0x251cafcfLU, 0xdab2556eLU, 0x8f1303caLU, -0x2aba27adLU, 0x7f1b7109LU, 0x80b58ba8LU, 0xd514dd0cLU, 0x33a432a7LU, 0x66056403LU, 0x99ab9ea2LU, 0xcc0ac806LU, -0x18860db9LU, 0x4d275b1dLU, 0xb289a1bcLU, 0xe728f718LU, 0x019818b3LU, 0x54394e17LU, 0xab97b4b6LU, 0xfe36e212LU, -0x4ec27385LU, 0x1b632521LU, 0xe4cddf80LU, 0xb16c8924LU, 0x57dc668fLU, 0x027d302bLU, 0xfdd3ca8aLU, 0xa8729c2eLU, -0x7cfe5991LU, 0x295f0f35LU, 0xd6f1f594LU, 0x8350a330LU, 0x65e04c9bLU, 0x30411a3fLU, 0xcfefe09eLU, 0x9a4eb63aLU, -0xe24a8ffdLU, 0xb7ebd959LU, 0x484523f8LU, 0x1de4755cLU, 0xfb549af7LU, 0xaef5cc53LU, 0x515b36f2LU, 0x04fa6056LU, -0xd076a5e9LU, 0x85d7f34dLU, 0x7a7909ecLU, 0x2fd85f48LU, 0xc968b0e3LU, 0x9cc9e647LU, 0x63671ce6LU, 0x36c64a42LU, -0x8632dbd5LU, 0xd3938d71LU, 0x2c3d77d0LU, 0x799c2174LU, 0x9f2ccedfLU, 0xca8d987bLU, 0x352362daLU, 0x6082347eLU, -0xb40ef1c1LU, 0xe1afa765LU, 0x1e015dc4LU, 0x4ba00b60LU, 0xad10e4cbLU, 0xf8b1b26fLU, 0x071f48ceLU, 0x52be1e6aLU }; +0x5b9fc675LU, 0x0e3e90d1LU, 0xf1906a70LU, 0xa4313cd4LU, 0x4281d37fLU, 0x172085dbLU, 0xe88e7f7aLU, 0xbd2f29deLU, +0x69a3ec61LU, 0x3c02bac5LU, 0xc3ac4064LU, 0x960d16c0LU, 0x70bdf96bLU, 0x251cafcfLU, 0xdab2556eLU, 0x8f1303caLU, +0x2aba27adLU, 0x7f1b7109LU, 0x80b58ba8LU, 0xd514dd0cLU, 0x33a432a7LU, 0x66056403LU, 0x99ab9ea2LU, 0xcc0ac806LU, +0x18860db9LU, 0x4d275b1dLU, 0xb289a1bcLU, 0xe728f718LU, 0x019818b3LU, 0x54394e17LU, 0xab97b4b6LU, 0xfe36e212LU, +0x4ec27385LU, 0x1b632521LU, 0xe4cddf80LU, 0xb16c8924LU, 0x57dc668fLU, 0x027d302bLU, 0xfdd3ca8aLU, 0xa8729c2eLU, +0x7cfe5991LU, 0x295f0f35LU, 0xd6f1f594LU, 0x8350a330LU, 0x65e04c9bLU, 0x30411a3fLU, 0xcfefe09eLU, 0x9a4eb63aLU, +0xe24a8ffdLU, 0xb7ebd959LU, 0x484523f8LU, 0x1de4755cLU, 0xfb549af7LU, 0xaef5cc53LU, 0x515b36f2LU, 0x04fa6056LU, +0xd076a5e9LU, 0x85d7f34dLU, 0x7a7909ecLU, 0x2fd85f48LU, 0xc968b0e3LU, 0x9cc9e647LU, 0x63671ce6LU, 0x36c64a42LU, +0x8632dbd5LU, 0xd3938d71LU, 0x2c3d77d0LU, 0x799c2174LU, 0x9f2ccedfLU, 0xca8d987bLU, 0x352362daLU, 0x6082347eLU, +0xb40ef1c1LU, 0xe1afa765LU, 0x1e015dc4LU, 0x4ba00b60LU, 0xad10e4cbLU, 0xf8b1b26fLU, 0x071f48ceLU, 0x52be1e6aLU }; static const ulong32 rs_tab2[256] = { -0x00000000LU, 0x87fc8255LU, 0x43b549aaLU, 0xc449cbffLU, 0x86279219LU, 0x01db104cLU, 0xc592dbb3LU, 0x426e59e6LU, -0x414e6932LU, 0xc6b2eb67LU, 0x02fb2098LU, 0x8507a2cdLU, 0xc769fb2bLU, 0x4095797eLU, 0x84dcb281LU, 0x032030d4LU, -0x829cd264LU, 0x05605031LU, 0xc1299bceLU, 0x46d5199bLU, 0x04bb407dLU, 0x8347c228LU, 0x470e09d7LU, 0xc0f28b82LU, -0xc3d2bb56LU, 0x442e3903LU, 0x8067f2fcLU, 0x079b70a9LU, 0x45f5294fLU, 0xc209ab1aLU, 0x064060e5LU, 0x81bce2b0LU, -0x4975e9c8LU, 0xce896b9dLU, 0x0ac0a062LU, 0x8d3c2237LU, 0xcf527bd1LU, 0x48aef984LU, 0x8ce7327bLU, 0x0b1bb02eLU, -0x083b80faLU, 0x8fc702afLU, 0x4b8ec950LU, 0xcc724b05LU, 0x8e1c12e3LU, 0x09e090b6LU, 0xcda95b49LU, 0x4a55d91cLU, -0xcbe93bacLU, 0x4c15b9f9LU, 0x885c7206LU, 0x0fa0f053LU, 0x4dcea9b5LU, 0xca322be0LU, 0x0e7be01fLU, 0x8987624aLU, -0x8aa7529eLU, 0x0d5bd0cbLU, 0xc9121b34LU, 0x4eee9961LU, 0x0c80c087LU, 0x8b7c42d2LU, 0x4f35892dLU, 0xc8c90b78LU, -0x92ea9fddLU, 0x15161d88LU, 0xd15fd677LU, 0x56a35422LU, 0x14cd0dc4LU, 0x93318f91LU, 0x5778446eLU, 0xd084c63bLU, -0xd3a4f6efLU, 0x545874baLU, 0x9011bf45LU, 0x17ed3d10LU, 0x558364f6LU, 0xd27fe6a3LU, 0x16362d5cLU, 0x91caaf09LU, -0x10764db9LU, 0x978acfecLU, 0x53c30413LU, 0xd43f8646LU, 0x9651dfa0LU, 0x11ad5df5LU, 0xd5e4960aLU, 0x5218145fLU, -0x5138248bLU, 0xd6c4a6deLU, 0x128d6d21LU, 0x9571ef74LU, 0xd71fb692LU, 0x50e334c7LU, 0x94aaff38LU, 0x13567d6dLU, -0xdb9f7615LU, 0x5c63f440LU, 0x982a3fbfLU, 0x1fd6bdeaLU, 0x5db8e40cLU, 0xda446659LU, 0x1e0dada6LU, 0x99f12ff3LU, -0x9ad11f27LU, 0x1d2d9d72LU, 0xd964568dLU, 0x5e98d4d8LU, 0x1cf68d3eLU, 0x9b0a0f6bLU, 0x5f43c494LU, 0xd8bf46c1LU, -0x5903a471LU, 0xdeff2624LU, 0x1ab6eddbLU, 0x9d4a6f8eLU, 0xdf243668LU, 0x58d8b43dLU, 0x9c917fc2LU, 0x1b6dfd97LU, -0x184dcd43LU, 0x9fb14f16LU, 0x5bf884e9LU, 0xdc0406bcLU, 0x9e6a5f5aLU, 0x1996dd0fLU, 0xdddf16f0LU, 0x5a2394a5LU, -0x699973f7LU, 0xee65f1a2LU, 0x2a2c3a5dLU, 0xadd0b808LU, 0xefbee1eeLU, 0x684263bbLU, 0xac0ba844LU, 0x2bf72a11LU, -0x28d71ac5LU, 0xaf2b9890LU, 0x6b62536fLU, 0xec9ed13aLU, 0xaef088dcLU, 0x290c0a89LU, 0xed45c176LU, 0x6ab94323LU, -0xeb05a193LU, 0x6cf923c6LU, 0xa8b0e839LU, 0x2f4c6a6cLU, 0x6d22338aLU, 0xeadeb1dfLU, 0x2e977a20LU, 0xa96bf875LU, -0xaa4bc8a1LU, 0x2db74af4LU, 0xe9fe810bLU, 0x6e02035eLU, 0x2c6c5ab8LU, 0xab90d8edLU, 0x6fd91312LU, 0xe8259147LU, -0x20ec9a3fLU, 0xa710186aLU, 0x6359d395LU, 0xe4a551c0LU, 0xa6cb0826LU, 0x21378a73LU, 0xe57e418cLU, 0x6282c3d9LU, -0x61a2f30dLU, 0xe65e7158LU, 0x2217baa7LU, 0xa5eb38f2LU, 0xe7856114LU, 0x6079e341LU, 0xa43028beLU, 0x23ccaaebLU, -0xa270485bLU, 0x258cca0eLU, 0xe1c501f1LU, 0x663983a4LU, 0x2457da42LU, 0xa3ab5817LU, 0x67e293e8LU, 0xe01e11bdLU, -0xe33e2169LU, 0x64c2a33cLU, 0xa08b68c3LU, 0x2777ea96LU, 0x6519b370LU, 0xe2e53125LU, 0x26acfadaLU, 0xa150788fLU, -0xfb73ec2aLU, 0x7c8f6e7fLU, 0xb8c6a580LU, 0x3f3a27d5LU, 0x7d547e33LU, 0xfaa8fc66LU, 0x3ee13799LU, 0xb91db5ccLU, -0xba3d8518LU, 0x3dc1074dLU, 0xf988ccb2LU, 0x7e744ee7LU, 0x3c1a1701LU, 0xbbe69554LU, 0x7faf5eabLU, 0xf853dcfeLU, -0x79ef3e4eLU, 0xfe13bc1bLU, 0x3a5a77e4LU, 0xbda6f5b1LU, 0xffc8ac57LU, 0x78342e02LU, 0xbc7de5fdLU, 0x3b8167a8LU, -0x38a1577cLU, 0xbf5dd529LU, 0x7b141ed6LU, 0xfce89c83LU, 0xbe86c565LU, 0x397a4730LU, 0xfd338ccfLU, 0x7acf0e9aLU, -0xb20605e2LU, 0x35fa87b7LU, 0xf1b34c48LU, 0x764fce1dLU, 0x342197fbLU, 0xb3dd15aeLU, 0x7794de51LU, 0xf0685c04LU, -0xf3486cd0LU, 0x74b4ee85LU, 0xb0fd257aLU, 0x3701a72fLU, 0x756ffec9LU, 0xf2937c9cLU, 0x36dab763LU, 0xb1263536LU, -0x309ad786LU, 0xb76655d3LU, 0x732f9e2cLU, 0xf4d31c79LU, 0xb6bd459fLU, 0x3141c7caLU, 0xf5080c35LU, 0x72f48e60LU, -0x71d4beb4LU, 0xf6283ce1LU, 0x3261f71eLU, 0xb59d754bLU, 0xf7f32cadLU, 0x700faef8LU, 0xb4466507LU, 0x33bae752LU }; +0x00000000LU, 0x87fc8255LU, 0x43b549aaLU, 0xc449cbffLU, 0x86279219LU, 0x01db104cLU, 0xc592dbb3LU, 0x426e59e6LU, +0x414e6932LU, 0xc6b2eb67LU, 0x02fb2098LU, 0x8507a2cdLU, 0xc769fb2bLU, 0x4095797eLU, 0x84dcb281LU, 0x032030d4LU, +0x829cd264LU, 0x05605031LU, 0xc1299bceLU, 0x46d5199bLU, 0x04bb407dLU, 0x8347c228LU, 0x470e09d7LU, 0xc0f28b82LU, +0xc3d2bb56LU, 0x442e3903LU, 0x8067f2fcLU, 0x079b70a9LU, 0x45f5294fLU, 0xc209ab1aLU, 0x064060e5LU, 0x81bce2b0LU, +0x4975e9c8LU, 0xce896b9dLU, 0x0ac0a062LU, 0x8d3c2237LU, 0xcf527bd1LU, 0x48aef984LU, 0x8ce7327bLU, 0x0b1bb02eLU, +0x083b80faLU, 0x8fc702afLU, 0x4b8ec950LU, 0xcc724b05LU, 0x8e1c12e3LU, 0x09e090b6LU, 0xcda95b49LU, 0x4a55d91cLU, +0xcbe93bacLU, 0x4c15b9f9LU, 0x885c7206LU, 0x0fa0f053LU, 0x4dcea9b5LU, 0xca322be0LU, 0x0e7be01fLU, 0x8987624aLU, +0x8aa7529eLU, 0x0d5bd0cbLU, 0xc9121b34LU, 0x4eee9961LU, 0x0c80c087LU, 0x8b7c42d2LU, 0x4f35892dLU, 0xc8c90b78LU, +0x92ea9fddLU, 0x15161d88LU, 0xd15fd677LU, 0x56a35422LU, 0x14cd0dc4LU, 0x93318f91LU, 0x5778446eLU, 0xd084c63bLU, +0xd3a4f6efLU, 0x545874baLU, 0x9011bf45LU, 0x17ed3d10LU, 0x558364f6LU, 0xd27fe6a3LU, 0x16362d5cLU, 0x91caaf09LU, +0x10764db9LU, 0x978acfecLU, 0x53c30413LU, 0xd43f8646LU, 0x9651dfa0LU, 0x11ad5df5LU, 0xd5e4960aLU, 0x5218145fLU, +0x5138248bLU, 0xd6c4a6deLU, 0x128d6d21LU, 0x9571ef74LU, 0xd71fb692LU, 0x50e334c7LU, 0x94aaff38LU, 0x13567d6dLU, +0xdb9f7615LU, 0x5c63f440LU, 0x982a3fbfLU, 0x1fd6bdeaLU, 0x5db8e40cLU, 0xda446659LU, 0x1e0dada6LU, 0x99f12ff3LU, +0x9ad11f27LU, 0x1d2d9d72LU, 0xd964568dLU, 0x5e98d4d8LU, 0x1cf68d3eLU, 0x9b0a0f6bLU, 0x5f43c494LU, 0xd8bf46c1LU, +0x5903a471LU, 0xdeff2624LU, 0x1ab6eddbLU, 0x9d4a6f8eLU, 0xdf243668LU, 0x58d8b43dLU, 0x9c917fc2LU, 0x1b6dfd97LU, +0x184dcd43LU, 0x9fb14f16LU, 0x5bf884e9LU, 0xdc0406bcLU, 0x9e6a5f5aLU, 0x1996dd0fLU, 0xdddf16f0LU, 0x5a2394a5LU, +0x699973f7LU, 0xee65f1a2LU, 0x2a2c3a5dLU, 0xadd0b808LU, 0xefbee1eeLU, 0x684263bbLU, 0xac0ba844LU, 0x2bf72a11LU, +0x28d71ac5LU, 0xaf2b9890LU, 0x6b62536fLU, 0xec9ed13aLU, 0xaef088dcLU, 0x290c0a89LU, 0xed45c176LU, 0x6ab94323LU, +0xeb05a193LU, 0x6cf923c6LU, 0xa8b0e839LU, 0x2f4c6a6cLU, 0x6d22338aLU, 0xeadeb1dfLU, 0x2e977a20LU, 0xa96bf875LU, +0xaa4bc8a1LU, 0x2db74af4LU, 0xe9fe810bLU, 0x6e02035eLU, 0x2c6c5ab8LU, 0xab90d8edLU, 0x6fd91312LU, 0xe8259147LU, +0x20ec9a3fLU, 0xa710186aLU, 0x6359d395LU, 0xe4a551c0LU, 0xa6cb0826LU, 0x21378a73LU, 0xe57e418cLU, 0x6282c3d9LU, +0x61a2f30dLU, 0xe65e7158LU, 0x2217baa7LU, 0xa5eb38f2LU, 0xe7856114LU, 0x6079e341LU, 0xa43028beLU, 0x23ccaaebLU, +0xa270485bLU, 0x258cca0eLU, 0xe1c501f1LU, 0x663983a4LU, 0x2457da42LU, 0xa3ab5817LU, 0x67e293e8LU, 0xe01e11bdLU, +0xe33e2169LU, 0x64c2a33cLU, 0xa08b68c3LU, 0x2777ea96LU, 0x6519b370LU, 0xe2e53125LU, 0x26acfadaLU, 0xa150788fLU, +0xfb73ec2aLU, 0x7c8f6e7fLU, 0xb8c6a580LU, 0x3f3a27d5LU, 0x7d547e33LU, 0xfaa8fc66LU, 0x3ee13799LU, 0xb91db5ccLU, +0xba3d8518LU, 0x3dc1074dLU, 0xf988ccb2LU, 0x7e744ee7LU, 0x3c1a1701LU, 0xbbe69554LU, 0x7faf5eabLU, 0xf853dcfeLU, +0x79ef3e4eLU, 0xfe13bc1bLU, 0x3a5a77e4LU, 0xbda6f5b1LU, 0xffc8ac57LU, 0x78342e02LU, 0xbc7de5fdLU, 0x3b8167a8LU, +0x38a1577cLU, 0xbf5dd529LU, 0x7b141ed6LU, 0xfce89c83LU, 0xbe86c565LU, 0x397a4730LU, 0xfd338ccfLU, 0x7acf0e9aLU, +0xb20605e2LU, 0x35fa87b7LU, 0xf1b34c48LU, 0x764fce1dLU, 0x342197fbLU, 0xb3dd15aeLU, 0x7794de51LU, 0xf0685c04LU, +0xf3486cd0LU, 0x74b4ee85LU, 0xb0fd257aLU, 0x3701a72fLU, 0x756ffec9LU, 0xf2937c9cLU, 0x36dab763LU, 0xb1263536LU, +0x309ad786LU, 0xb76655d3LU, 0x732f9e2cLU, 0xf4d31c79LU, 0xb6bd459fLU, 0x3141c7caLU, 0xf5080c35LU, 0x72f48e60LU, +0x71d4beb4LU, 0xf6283ce1LU, 0x3261f71eLU, 0xb59d754bLU, 0xf7f32cadLU, 0x700faef8LU, 0xb4466507LU, 0x33bae752LU }; static const ulong32 rs_tab3[256] = { -0x00000000LU, 0x5ac1f387LU, 0xb4cfab43LU, 0xee0e58c4LU, 0x25d31b86LU, 0x7f12e801LU, 0x911cb0c5LU, 0xcbdd4342LU, -0x4aeb3641LU, 0x102ac5c6LU, 0xfe249d02LU, 0xa4e56e85LU, 0x6f382dc7LU, 0x35f9de40LU, 0xdbf78684LU, 0x81367503LU, -0x949b6c82LU, 0xce5a9f05LU, 0x2054c7c1LU, 0x7a953446LU, 0xb1487704LU, 0xeb898483LU, 0x0587dc47LU, 0x5f462fc0LU, +0x00000000LU, 0x5ac1f387LU, 0xb4cfab43LU, 0xee0e58c4LU, 0x25d31b86LU, 0x7f12e801LU, 0x911cb0c5LU, 0xcbdd4342LU, +0x4aeb3641LU, 0x102ac5c6LU, 0xfe249d02LU, 0xa4e56e85LU, 0x6f382dc7LU, 0x35f9de40LU, 0xdbf78684LU, 0x81367503LU, +0x949b6c82LU, 0xce5a9f05LU, 0x2054c7c1LU, 0x7a953446LU, 0xb1487704LU, 0xeb898483LU, 0x0587dc47LU, 0x5f462fc0LU, 0xde705ac3LU, 0x84b1a944LU, 0x6abff180LU, 0x307e0207LU, 0xfba34145LU, 0xa162b2c2LU, 0x4f6cea06LU, 0x15ad1981LU, -0x657bd849LU, 0x3fba2bceLU, 0xd1b4730aLU, 0x8b75808dLU, 0x40a8c3cfLU, 0x1a693048LU, 0xf467688cLU, 0xaea69b0bLU, -0x2f90ee08LU, 0x75511d8fLU, 0x9b5f454bLU, 0xc19eb6ccLU, 0x0a43f58eLU, 0x50820609LU, 0xbe8c5ecdLU, 0xe44dad4aLU, -0xf1e0b4cbLU, 0xab21474cLU, 0x452f1f88LU, 0x1feeec0fLU, 0xd433af4dLU, 0x8ef25ccaLU, 0x60fc040eLU, 0x3a3df789LU, -0xbb0b828aLU, 0xe1ca710dLU, 0x0fc429c9LU, 0x5505da4eLU, 0x9ed8990cLU, 0xc4196a8bLU, 0x2a17324fLU, 0x70d6c1c8LU, -0xcaf6fd92LU, 0x90370e15LU, 0x7e3956d1LU, 0x24f8a556LU, 0xef25e614LU, 0xb5e41593LU, 0x5bea4d57LU, 0x012bbed0LU, +0x657bd849LU, 0x3fba2bceLU, 0xd1b4730aLU, 0x8b75808dLU, 0x40a8c3cfLU, 0x1a693048LU, 0xf467688cLU, 0xaea69b0bLU, +0x2f90ee08LU, 0x75511d8fLU, 0x9b5f454bLU, 0xc19eb6ccLU, 0x0a43f58eLU, 0x50820609LU, 0xbe8c5ecdLU, 0xe44dad4aLU, +0xf1e0b4cbLU, 0xab21474cLU, 0x452f1f88LU, 0x1feeec0fLU, 0xd433af4dLU, 0x8ef25ccaLU, 0x60fc040eLU, 0x3a3df789LU, +0xbb0b828aLU, 0xe1ca710dLU, 0x0fc429c9LU, 0x5505da4eLU, 0x9ed8990cLU, 0xc4196a8bLU, 0x2a17324fLU, 0x70d6c1c8LU, +0xcaf6fd92LU, 0x90370e15LU, 0x7e3956d1LU, 0x24f8a556LU, 0xef25e614LU, 0xb5e41593LU, 0x5bea4d57LU, 0x012bbed0LU, 0x801dcbd3LU, 0xdadc3854LU, 0x34d26090LU, 0x6e139317LU, 0xa5ced055LU, 0xff0f23d2LU, 0x11017b16LU, 0x4bc08891LU, -0x5e6d9110LU, 0x04ac6297LU, 0xeaa23a53LU, 0xb063c9d4LU, 0x7bbe8a96LU, 0x217f7911LU, 0xcf7121d5LU, 0x95b0d252LU, -0x1486a751LU, 0x4e4754d6LU, 0xa0490c12LU, 0xfa88ff95LU, 0x3155bcd7LU, 0x6b944f50LU, 0x859a1794LU, 0xdf5be413LU, +0x5e6d9110LU, 0x04ac6297LU, 0xeaa23a53LU, 0xb063c9d4LU, 0x7bbe8a96LU, 0x217f7911LU, 0xcf7121d5LU, 0x95b0d252LU, +0x1486a751LU, 0x4e4754d6LU, 0xa0490c12LU, 0xfa88ff95LU, 0x3155bcd7LU, 0x6b944f50LU, 0x859a1794LU, 0xdf5be413LU, 0xaf8d25dbLU, 0xf54cd65cLU, 0x1b428e98LU, 0x41837d1fLU, 0x8a5e3e5dLU, 0xd09fcddaLU, 0x3e91951eLU, 0x64506699LU, -0xe566139aLU, 0xbfa7e01dLU, 0x51a9b8d9LU, 0x0b684b5eLU, 0xc0b5081cLU, 0x9a74fb9bLU, 0x747aa35fLU, 0x2ebb50d8LU, -0x3b164959LU, 0x61d7badeLU, 0x8fd9e21aLU, 0xd518119dLU, 0x1ec552dfLU, 0x4404a158LU, 0xaa0af99cLU, 0xf0cb0a1bLU, -0x71fd7f18LU, 0x2b3c8c9fLU, 0xc532d45bLU, 0x9ff327dcLU, 0x542e649eLU, 0x0eef9719LU, 0xe0e1cfddLU, 0xba203c5aLU, -0xd9a1b769LU, 0x836044eeLU, 0x6d6e1c2aLU, 0x37afefadLU, 0xfc72acefLU, 0xa6b35f68LU, 0x48bd07acLU, 0x127cf42bLU, -0x934a8128LU, 0xc98b72afLU, 0x27852a6bLU, 0x7d44d9ecLU, 0xb6999aaeLU, 0xec586929LU, 0x025631edLU, 0x5897c26aLU, -0x4d3adbebLU, 0x17fb286cLU, 0xf9f570a8LU, 0xa334832fLU, 0x68e9c06dLU, 0x322833eaLU, 0xdc266b2eLU, 0x86e798a9LU, -0x07d1edaaLU, 0x5d101e2dLU, 0xb31e46e9LU, 0xe9dfb56eLU, 0x2202f62cLU, 0x78c305abLU, 0x96cd5d6fLU, 0xcc0caee8LU, -0xbcda6f20LU, 0xe61b9ca7LU, 0x0815c463LU, 0x52d437e4LU, 0x990974a6LU, 0xc3c88721LU, 0x2dc6dfe5LU, 0x77072c62LU, -0xf6315961LU, 0xacf0aae6LU, 0x42fef222LU, 0x183f01a5LU, 0xd3e242e7LU, 0x8923b160LU, 0x672de9a4LU, 0x3dec1a23LU, -0x284103a2LU, 0x7280f025LU, 0x9c8ea8e1LU, 0xc64f5b66LU, 0x0d921824LU, 0x5753eba3LU, 0xb95db367LU, 0xe39c40e0LU, -0x62aa35e3LU, 0x386bc664LU, 0xd6659ea0LU, 0x8ca46d27LU, 0x47792e65LU, 0x1db8dde2LU, 0xf3b68526LU, 0xa97776a1LU, -0x13574afbLU, 0x4996b97cLU, 0xa798e1b8LU, 0xfd59123fLU, 0x3684517dLU, 0x6c45a2faLU, 0x824bfa3eLU, 0xd88a09b9LU, -0x59bc7cbaLU, 0x037d8f3dLU, 0xed73d7f9LU, 0xb7b2247eLU, 0x7c6f673cLU, 0x26ae94bbLU, 0xc8a0cc7fLU, 0x92613ff8LU, -0x87cc2679LU, 0xdd0dd5feLU, 0x33038d3aLU, 0x69c27ebdLU, 0xa21f3dffLU, 0xf8dece78LU, 0x16d096bcLU, 0x4c11653bLU, -0xcd271038LU, 0x97e6e3bfLU, 0x79e8bb7bLU, 0x232948fcLU, 0xe8f40bbeLU, 0xb235f839LU, 0x5c3ba0fdLU, 0x06fa537aLU, -0x762c92b2LU, 0x2ced6135LU, 0xc2e339f1LU, 0x9822ca76LU, 0x53ff8934LU, 0x093e7ab3LU, 0xe7302277LU, 0xbdf1d1f0LU, -0x3cc7a4f3LU, 0x66065774LU, 0x88080fb0LU, 0xd2c9fc37LU, 0x1914bf75LU, 0x43d54cf2LU, 0xaddb1436LU, 0xf71ae7b1LU, -0xe2b7fe30LU, 0xb8760db7LU, 0x56785573LU, 0x0cb9a6f4LU, 0xc764e5b6LU, 0x9da51631LU, 0x73ab4ef5LU, 0x296abd72LU, -0xa85cc871LU, 0xf29d3bf6LU, 0x1c936332LU, 0x465290b5LU, 0x8d8fd3f7LU, 0xd74e2070LU, 0x394078b4LU, 0x63818b33LU }; +0xe566139aLU, 0xbfa7e01dLU, 0x51a9b8d9LU, 0x0b684b5eLU, 0xc0b5081cLU, 0x9a74fb9bLU, 0x747aa35fLU, 0x2ebb50d8LU, +0x3b164959LU, 0x61d7badeLU, 0x8fd9e21aLU, 0xd518119dLU, 0x1ec552dfLU, 0x4404a158LU, 0xaa0af99cLU, 0xf0cb0a1bLU, +0x71fd7f18LU, 0x2b3c8c9fLU, 0xc532d45bLU, 0x9ff327dcLU, 0x542e649eLU, 0x0eef9719LU, 0xe0e1cfddLU, 0xba203c5aLU, +0xd9a1b769LU, 0x836044eeLU, 0x6d6e1c2aLU, 0x37afefadLU, 0xfc72acefLU, 0xa6b35f68LU, 0x48bd07acLU, 0x127cf42bLU, +0x934a8128LU, 0xc98b72afLU, 0x27852a6bLU, 0x7d44d9ecLU, 0xb6999aaeLU, 0xec586929LU, 0x025631edLU, 0x5897c26aLU, +0x4d3adbebLU, 0x17fb286cLU, 0xf9f570a8LU, 0xa334832fLU, 0x68e9c06dLU, 0x322833eaLU, 0xdc266b2eLU, 0x86e798a9LU, +0x07d1edaaLU, 0x5d101e2dLU, 0xb31e46e9LU, 0xe9dfb56eLU, 0x2202f62cLU, 0x78c305abLU, 0x96cd5d6fLU, 0xcc0caee8LU, +0xbcda6f20LU, 0xe61b9ca7LU, 0x0815c463LU, 0x52d437e4LU, 0x990974a6LU, 0xc3c88721LU, 0x2dc6dfe5LU, 0x77072c62LU, +0xf6315961LU, 0xacf0aae6LU, 0x42fef222LU, 0x183f01a5LU, 0xd3e242e7LU, 0x8923b160LU, 0x672de9a4LU, 0x3dec1a23LU, +0x284103a2LU, 0x7280f025LU, 0x9c8ea8e1LU, 0xc64f5b66LU, 0x0d921824LU, 0x5753eba3LU, 0xb95db367LU, 0xe39c40e0LU, +0x62aa35e3LU, 0x386bc664LU, 0xd6659ea0LU, 0x8ca46d27LU, 0x47792e65LU, 0x1db8dde2LU, 0xf3b68526LU, 0xa97776a1LU, +0x13574afbLU, 0x4996b97cLU, 0xa798e1b8LU, 0xfd59123fLU, 0x3684517dLU, 0x6c45a2faLU, 0x824bfa3eLU, 0xd88a09b9LU, +0x59bc7cbaLU, 0x037d8f3dLU, 0xed73d7f9LU, 0xb7b2247eLU, 0x7c6f673cLU, 0x26ae94bbLU, 0xc8a0cc7fLU, 0x92613ff8LU, +0x87cc2679LU, 0xdd0dd5feLU, 0x33038d3aLU, 0x69c27ebdLU, 0xa21f3dffLU, 0xf8dece78LU, 0x16d096bcLU, 0x4c11653bLU, +0xcd271038LU, 0x97e6e3bfLU, 0x79e8bb7bLU, 0x232948fcLU, 0xe8f40bbeLU, 0xb235f839LU, 0x5c3ba0fdLU, 0x06fa537aLU, +0x762c92b2LU, 0x2ced6135LU, 0xc2e339f1LU, 0x9822ca76LU, 0x53ff8934LU, 0x093e7ab3LU, 0xe7302277LU, 0xbdf1d1f0LU, +0x3cc7a4f3LU, 0x66065774LU, 0x88080fb0LU, 0xd2c9fc37LU, 0x1914bf75LU, 0x43d54cf2LU, 0xaddb1436LU, 0xf71ae7b1LU, +0xe2b7fe30LU, 0xb8760db7LU, 0x56785573LU, 0x0cb9a6f4LU, 0xc764e5b6LU, 0x9da51631LU, 0x73ab4ef5LU, 0x296abd72LU, +0xa85cc871LU, 0xf29d3bf6LU, 0x1c936332LU, 0x465290b5LU, 0x8d8fd3f7LU, 0xd74e2070LU, 0x394078b4LU, 0x63818b33LU }; static const ulong32 rs_tab4[256] = { -0x00000000LU, 0x58471e5aLU, 0xb08e3cb4LU, 0xe8c922eeLU, 0x2d517825LU, 0x7516667fLU, 0x9ddf4491LU, 0xc5985acbLU, -0x5aa2f04aLU, 0x02e5ee10LU, 0xea2cccfeLU, 0xb26bd2a4LU, 0x77f3886fLU, 0x2fb49635LU, 0xc77db4dbLU, 0x9f3aaa81LU, -0xb409ad94LU, 0xec4eb3ceLU, 0x04879120LU, 0x5cc08f7aLU, 0x9958d5b1LU, 0xc11fcbebLU, 0x29d6e905LU, 0x7191f75fLU, -0xeeab5ddeLU, 0xb6ec4384LU, 0x5e25616aLU, 0x06627f30LU, 0xc3fa25fbLU, 0x9bbd3ba1LU, 0x7374194fLU, 0x2b330715LU, -0x25121765LU, 0x7d55093fLU, 0x959c2bd1LU, 0xcddb358bLU, 0x08436f40LU, 0x5004711aLU, 0xb8cd53f4LU, 0xe08a4daeLU, -0x7fb0e72fLU, 0x27f7f975LU, 0xcf3edb9bLU, 0x9779c5c1LU, 0x52e19f0aLU, 0x0aa68150LU, 0xe26fa3beLU, 0xba28bde4LU, -0x911bbaf1LU, 0xc95ca4abLU, 0x21958645LU, 0x79d2981fLU, 0xbc4ac2d4LU, 0xe40ddc8eLU, 0x0cc4fe60LU, 0x5483e03aLU, -0xcbb94abbLU, 0x93fe54e1LU, 0x7b37760fLU, 0x23706855LU, 0xe6e8329eLU, 0xbeaf2cc4LU, 0x56660e2aLU, 0x0e211070LU, -0x4a242ecaLU, 0x12633090LU, 0xfaaa127eLU, 0xa2ed0c24LU, 0x677556efLU, 0x3f3248b5LU, 0xd7fb6a5bLU, 0x8fbc7401LU, -0x1086de80LU, 0x48c1c0daLU, 0xa008e234LU, 0xf84ffc6eLU, 0x3dd7a6a5LU, 0x6590b8ffLU, 0x8d599a11LU, 0xd51e844bLU, -0xfe2d835eLU, 0xa66a9d04LU, 0x4ea3bfeaLU, 0x16e4a1b0LU, 0xd37cfb7bLU, 0x8b3be521LU, 0x63f2c7cfLU, 0x3bb5d995LU, -0xa48f7314LU, 0xfcc86d4eLU, 0x14014fa0LU, 0x4c4651faLU, 0x89de0b31LU, 0xd199156bLU, 0x39503785LU, 0x611729dfLU, -0x6f3639afLU, 0x377127f5LU, 0xdfb8051bLU, 0x87ff1b41LU, 0x4267418aLU, 0x1a205fd0LU, 0xf2e97d3eLU, 0xaaae6364LU, -0x3594c9e5LU, 0x6dd3d7bfLU, 0x851af551LU, 0xdd5deb0bLU, 0x18c5b1c0LU, 0x4082af9aLU, 0xa84b8d74LU, 0xf00c932eLU, -0xdb3f943bLU, 0x83788a61LU, 0x6bb1a88fLU, 0x33f6b6d5LU, 0xf66eec1eLU, 0xae29f244LU, 0x46e0d0aaLU, 0x1ea7cef0LU, -0x819d6471LU, 0xd9da7a2bLU, 0x311358c5LU, 0x6954469fLU, 0xaccc1c54LU, 0xf48b020eLU, 0x1c4220e0LU, 0x44053ebaLU, -0x94485cd9LU, 0xcc0f4283LU, 0x24c6606dLU, 0x7c817e37LU, 0xb91924fcLU, 0xe15e3aa6LU, 0x09971848LU, 0x51d00612LU, -0xceeaac93LU, 0x96adb2c9LU, 0x7e649027LU, 0x26238e7dLU, 0xe3bbd4b6LU, 0xbbfccaecLU, 0x5335e802LU, 0x0b72f658LU, -0x2041f14dLU, 0x7806ef17LU, 0x90cfcdf9LU, 0xc888d3a3LU, 0x0d108968LU, 0x55579732LU, 0xbd9eb5dcLU, 0xe5d9ab86LU, -0x7ae30107LU, 0x22a41f5dLU, 0xca6d3db3LU, 0x922a23e9LU, 0x57b27922LU, 0x0ff56778LU, 0xe73c4596LU, 0xbf7b5bccLU, -0xb15a4bbcLU, 0xe91d55e6LU, 0x01d47708LU, 0x59936952LU, 0x9c0b3399LU, 0xc44c2dc3LU, 0x2c850f2dLU, 0x74c21177LU, -0xebf8bbf6LU, 0xb3bfa5acLU, 0x5b768742LU, 0x03319918LU, 0xc6a9c3d3LU, 0x9eeedd89LU, 0x7627ff67LU, 0x2e60e13dLU, -0x0553e628LU, 0x5d14f872LU, 0xb5ddda9cLU, 0xed9ac4c6LU, 0x28029e0dLU, 0x70458057LU, 0x988ca2b9LU, 0xc0cbbce3LU, -0x5ff11662LU, 0x07b60838LU, 0xef7f2ad6LU, 0xb738348cLU, 0x72a06e47LU, 0x2ae7701dLU, 0xc22e52f3LU, 0x9a694ca9LU, -0xde6c7213LU, 0x862b6c49LU, 0x6ee24ea7LU, 0x36a550fdLU, 0xf33d0a36LU, 0xab7a146cLU, 0x43b33682LU, 0x1bf428d8LU, +0x00000000LU, 0x58471e5aLU, 0xb08e3cb4LU, 0xe8c922eeLU, 0x2d517825LU, 0x7516667fLU, 0x9ddf4491LU, 0xc5985acbLU, +0x5aa2f04aLU, 0x02e5ee10LU, 0xea2cccfeLU, 0xb26bd2a4LU, 0x77f3886fLU, 0x2fb49635LU, 0xc77db4dbLU, 0x9f3aaa81LU, +0xb409ad94LU, 0xec4eb3ceLU, 0x04879120LU, 0x5cc08f7aLU, 0x9958d5b1LU, 0xc11fcbebLU, 0x29d6e905LU, 0x7191f75fLU, +0xeeab5ddeLU, 0xb6ec4384LU, 0x5e25616aLU, 0x06627f30LU, 0xc3fa25fbLU, 0x9bbd3ba1LU, 0x7374194fLU, 0x2b330715LU, +0x25121765LU, 0x7d55093fLU, 0x959c2bd1LU, 0xcddb358bLU, 0x08436f40LU, 0x5004711aLU, 0xb8cd53f4LU, 0xe08a4daeLU, +0x7fb0e72fLU, 0x27f7f975LU, 0xcf3edb9bLU, 0x9779c5c1LU, 0x52e19f0aLU, 0x0aa68150LU, 0xe26fa3beLU, 0xba28bde4LU, +0x911bbaf1LU, 0xc95ca4abLU, 0x21958645LU, 0x79d2981fLU, 0xbc4ac2d4LU, 0xe40ddc8eLU, 0x0cc4fe60LU, 0x5483e03aLU, +0xcbb94abbLU, 0x93fe54e1LU, 0x7b37760fLU, 0x23706855LU, 0xe6e8329eLU, 0xbeaf2cc4LU, 0x56660e2aLU, 0x0e211070LU, +0x4a242ecaLU, 0x12633090LU, 0xfaaa127eLU, 0xa2ed0c24LU, 0x677556efLU, 0x3f3248b5LU, 0xd7fb6a5bLU, 0x8fbc7401LU, +0x1086de80LU, 0x48c1c0daLU, 0xa008e234LU, 0xf84ffc6eLU, 0x3dd7a6a5LU, 0x6590b8ffLU, 0x8d599a11LU, 0xd51e844bLU, +0xfe2d835eLU, 0xa66a9d04LU, 0x4ea3bfeaLU, 0x16e4a1b0LU, 0xd37cfb7bLU, 0x8b3be521LU, 0x63f2c7cfLU, 0x3bb5d995LU, +0xa48f7314LU, 0xfcc86d4eLU, 0x14014fa0LU, 0x4c4651faLU, 0x89de0b31LU, 0xd199156bLU, 0x39503785LU, 0x611729dfLU, +0x6f3639afLU, 0x377127f5LU, 0xdfb8051bLU, 0x87ff1b41LU, 0x4267418aLU, 0x1a205fd0LU, 0xf2e97d3eLU, 0xaaae6364LU, +0x3594c9e5LU, 0x6dd3d7bfLU, 0x851af551LU, 0xdd5deb0bLU, 0x18c5b1c0LU, 0x4082af9aLU, 0xa84b8d74LU, 0xf00c932eLU, +0xdb3f943bLU, 0x83788a61LU, 0x6bb1a88fLU, 0x33f6b6d5LU, 0xf66eec1eLU, 0xae29f244LU, 0x46e0d0aaLU, 0x1ea7cef0LU, +0x819d6471LU, 0xd9da7a2bLU, 0x311358c5LU, 0x6954469fLU, 0xaccc1c54LU, 0xf48b020eLU, 0x1c4220e0LU, 0x44053ebaLU, +0x94485cd9LU, 0xcc0f4283LU, 0x24c6606dLU, 0x7c817e37LU, 0xb91924fcLU, 0xe15e3aa6LU, 0x09971848LU, 0x51d00612LU, +0xceeaac93LU, 0x96adb2c9LU, 0x7e649027LU, 0x26238e7dLU, 0xe3bbd4b6LU, 0xbbfccaecLU, 0x5335e802LU, 0x0b72f658LU, +0x2041f14dLU, 0x7806ef17LU, 0x90cfcdf9LU, 0xc888d3a3LU, 0x0d108968LU, 0x55579732LU, 0xbd9eb5dcLU, 0xe5d9ab86LU, +0x7ae30107LU, 0x22a41f5dLU, 0xca6d3db3LU, 0x922a23e9LU, 0x57b27922LU, 0x0ff56778LU, 0xe73c4596LU, 0xbf7b5bccLU, +0xb15a4bbcLU, 0xe91d55e6LU, 0x01d47708LU, 0x59936952LU, 0x9c0b3399LU, 0xc44c2dc3LU, 0x2c850f2dLU, 0x74c21177LU, +0xebf8bbf6LU, 0xb3bfa5acLU, 0x5b768742LU, 0x03319918LU, 0xc6a9c3d3LU, 0x9eeedd89LU, 0x7627ff67LU, 0x2e60e13dLU, +0x0553e628LU, 0x5d14f872LU, 0xb5ddda9cLU, 0xed9ac4c6LU, 0x28029e0dLU, 0x70458057LU, 0x988ca2b9LU, 0xc0cbbce3LU, +0x5ff11662LU, 0x07b60838LU, 0xef7f2ad6LU, 0xb738348cLU, 0x72a06e47LU, 0x2ae7701dLU, 0xc22e52f3LU, 0x9a694ca9LU, +0xde6c7213LU, 0x862b6c49LU, 0x6ee24ea7LU, 0x36a550fdLU, 0xf33d0a36LU, 0xab7a146cLU, 0x43b33682LU, 0x1bf428d8LU, 0x84ce8259LU, 0xdc899c03LU, 0x3440beedLU, 0x6c07a0b7LU, 0xa99ffa7cLU, 0xf1d8e426LU, 0x1911c6c8LU, 0x4156d892LU, -0x6a65df87LU, 0x3222c1ddLU, 0xdaebe333LU, 0x82acfd69LU, 0x4734a7a2LU, 0x1f73b9f8LU, 0xf7ba9b16LU, 0xaffd854cLU, -0x30c72fcdLU, 0x68803197LU, 0x80491379LU, 0xd80e0d23LU, 0x1d9657e8LU, 0x45d149b2LU, 0xad186b5cLU, 0xf55f7506LU, -0xfb7e6576LU, 0xa3397b2cLU, 0x4bf059c2LU, 0x13b74798LU, 0xd62f1d53LU, 0x8e680309LU, 0x66a121e7LU, 0x3ee63fbdLU, -0xa1dc953cLU, 0xf99b8b66LU, 0x1152a988LU, 0x4915b7d2LU, 0x8c8ded19LU, 0xd4caf343LU, 0x3c03d1adLU, 0x6444cff7LU, -0x4f77c8e2LU, 0x1730d6b8LU, 0xfff9f456LU, 0xa7beea0cLU, 0x6226b0c7LU, 0x3a61ae9dLU, 0xd2a88c73LU, 0x8aef9229LU, +0x6a65df87LU, 0x3222c1ddLU, 0xdaebe333LU, 0x82acfd69LU, 0x4734a7a2LU, 0x1f73b9f8LU, 0xf7ba9b16LU, 0xaffd854cLU, +0x30c72fcdLU, 0x68803197LU, 0x80491379LU, 0xd80e0d23LU, 0x1d9657e8LU, 0x45d149b2LU, 0xad186b5cLU, 0xf55f7506LU, +0xfb7e6576LU, 0xa3397b2cLU, 0x4bf059c2LU, 0x13b74798LU, 0xd62f1d53LU, 0x8e680309LU, 0x66a121e7LU, 0x3ee63fbdLU, +0xa1dc953cLU, 0xf99b8b66LU, 0x1152a988LU, 0x4915b7d2LU, 0x8c8ded19LU, 0xd4caf343LU, 0x3c03d1adLU, 0x6444cff7LU, +0x4f77c8e2LU, 0x1730d6b8LU, 0xfff9f456LU, 0xa7beea0cLU, 0x6226b0c7LU, 0x3a61ae9dLU, 0xd2a88c73LU, 0x8aef9229LU, 0x15d538a8LU, 0x4d9226f2LU, 0xa55b041cLU, 0xfd1c1a46LU, 0x3884408dLU, 0x60c35ed7LU, 0x880a7c39LU, 0xd04d6263LU }; static const ulong32 rs_tab5[256] = { -0x00000000LU, 0xdbaec658LU, 0xfb11c1b0LU, 0x20bf07e8LU, 0xbb22cf2dLU, 0x608c0975LU, 0x40330e9dLU, 0x9b9dc8c5LU, -0x3b44d35aLU, 0xe0ea1502LU, 0xc05512eaLU, 0x1bfbd4b2LU, 0x80661c77LU, 0x5bc8da2fLU, 0x7b77ddc7LU, 0xa0d91b9fLU, -0x7688ebb4LU, 0xad262decLU, 0x8d992a04LU, 0x5637ec5cLU, 0xcdaa2499LU, 0x1604e2c1LU, 0x36bbe529LU, 0xed152371LU, -0x4dcc38eeLU, 0x9662feb6LU, 0xb6ddf95eLU, 0x6d733f06LU, 0xf6eef7c3LU, 0x2d40319bLU, 0x0dff3673LU, 0xd651f02bLU, -0xec5d9b25LU, 0x37f35d7dLU, 0x174c5a95LU, 0xcce29ccdLU, 0x577f5408LU, 0x8cd19250LU, 0xac6e95b8LU, 0x77c053e0LU, -0xd719487fLU, 0x0cb78e27LU, 0x2c0889cfLU, 0xf7a64f97LU, 0x6c3b8752LU, 0xb795410aLU, 0x972a46e2LU, 0x4c8480baLU, -0x9ad57091LU, 0x417bb6c9LU, 0x61c4b121LU, 0xba6a7779LU, 0x21f7bfbcLU, 0xfa5979e4LU, 0xdae67e0cLU, 0x0148b854LU, -0xa191a3cbLU, 0x7a3f6593LU, 0x5a80627bLU, 0x812ea423LU, 0x1ab36ce6LU, 0xc11daabeLU, 0xe1a2ad56LU, 0x3a0c6b0eLU, -0x95ba7b4aLU, 0x4e14bd12LU, 0x6eabbafaLU, 0xb5057ca2LU, 0x2e98b467LU, 0xf536723fLU, 0xd58975d7LU, 0x0e27b38fLU, -0xaefea810LU, 0x75506e48LU, 0x55ef69a0LU, 0x8e41aff8LU, 0x15dc673dLU, 0xce72a165LU, 0xeecda68dLU, 0x356360d5LU, -0xe33290feLU, 0x389c56a6LU, 0x1823514eLU, 0xc38d9716LU, 0x58105fd3LU, 0x83be998bLU, 0xa3019e63LU, 0x78af583bLU, -0xd87643a4LU, 0x03d885fcLU, 0x23678214LU, 0xf8c9444cLU, 0x63548c89LU, 0xb8fa4ad1LU, 0x98454d39LU, 0x43eb8b61LU, -0x79e7e06fLU, 0xa2492637LU, 0x82f621dfLU, 0x5958e787LU, 0xc2c52f42LU, 0x196be91aLU, 0x39d4eef2LU, 0xe27a28aaLU, -0x42a33335LU, 0x990df56dLU, 0xb9b2f285LU, 0x621c34ddLU, 0xf981fc18LU, 0x222f3a40LU, 0x02903da8LU, 0xd93efbf0LU, -0x0f6f0bdbLU, 0xd4c1cd83LU, 0xf47eca6bLU, 0x2fd00c33LU, 0xb44dc4f6LU, 0x6fe302aeLU, 0x4f5c0546LU, 0x94f2c31eLU, -0x342bd881LU, 0xef851ed9LU, 0xcf3a1931LU, 0x1494df69LU, 0x8f0917acLU, 0x54a7d1f4LU, 0x7418d61cLU, 0xafb61044LU, -0x6739f694LU, 0xbc9730ccLU, 0x9c283724LU, 0x4786f17cLU, 0xdc1b39b9LU, 0x07b5ffe1LU, 0x270af809LU, 0xfca43e51LU, -0x5c7d25ceLU, 0x87d3e396LU, 0xa76ce47eLU, 0x7cc22226LU, 0xe75feae3LU, 0x3cf12cbbLU, 0x1c4e2b53LU, 0xc7e0ed0bLU, -0x11b11d20LU, 0xca1fdb78LU, 0xeaa0dc90LU, 0x310e1ac8LU, 0xaa93d20dLU, 0x713d1455LU, 0x518213bdLU, 0x8a2cd5e5LU, -0x2af5ce7aLU, 0xf15b0822LU, 0xd1e40fcaLU, 0x0a4ac992LU, 0x91d70157LU, 0x4a79c70fLU, 0x6ac6c0e7LU, 0xb16806bfLU, -0x8b646db1LU, 0x50caabe9LU, 0x7075ac01LU, 0xabdb6a59LU, 0x3046a29cLU, 0xebe864c4LU, 0xcb57632cLU, 0x10f9a574LU, -0xb020beebLU, 0x6b8e78b3LU, 0x4b317f5bLU, 0x909fb903LU, 0x0b0271c6LU, 0xd0acb79eLU, 0xf013b076LU, 0x2bbd762eLU, -0xfdec8605LU, 0x2642405dLU, 0x06fd47b5LU, 0xdd5381edLU, 0x46ce4928LU, 0x9d608f70LU, 0xbddf8898LU, 0x66714ec0LU, -0xc6a8555fLU, 0x1d069307LU, 0x3db994efLU, 0xe61752b7LU, 0x7d8a9a72LU, 0xa6245c2aLU, 0x869b5bc2LU, 0x5d359d9aLU, -0xf2838ddeLU, 0x292d4b86LU, 0x09924c6eLU, 0xd23c8a36LU, 0x49a142f3LU, 0x920f84abLU, 0xb2b08343LU, 0x691e451bLU, -0xc9c75e84LU, 0x126998dcLU, 0x32d69f34LU, 0xe978596cLU, 0x72e591a9LU, 0xa94b57f1LU, 0x89f45019LU, 0x525a9641LU, -0x840b666aLU, 0x5fa5a032LU, 0x7f1aa7daLU, 0xa4b46182LU, 0x3f29a947LU, 0xe4876f1fLU, 0xc43868f7LU, 0x1f96aeafLU, -0xbf4fb530LU, 0x64e17368LU, 0x445e7480LU, 0x9ff0b2d8LU, 0x046d7a1dLU, 0xdfc3bc45LU, 0xff7cbbadLU, 0x24d27df5LU, -0x1ede16fbLU, 0xc570d0a3LU, 0xe5cfd74bLU, 0x3e611113LU, 0xa5fcd9d6LU, 0x7e521f8eLU, 0x5eed1866LU, 0x8543de3eLU, -0x259ac5a1LU, 0xfe3403f9LU, 0xde8b0411LU, 0x0525c249LU, 0x9eb80a8cLU, 0x4516ccd4LU, 0x65a9cb3cLU, 0xbe070d64LU, -0x6856fd4fLU, 0xb3f83b17LU, 0x93473cffLU, 0x48e9faa7LU, 0xd3743262LU, 0x08daf43aLU, 0x2865f3d2LU, 0xf3cb358aLU, -0x53122e15LU, 0x88bce84dLU, 0xa803efa5LU, 0x73ad29fdLU, 0xe830e138LU, 0x339e2760LU, 0x13212088LU, 0xc88fe6d0LU }; +0x00000000LU, 0xdbaec658LU, 0xfb11c1b0LU, 0x20bf07e8LU, 0xbb22cf2dLU, 0x608c0975LU, 0x40330e9dLU, 0x9b9dc8c5LU, +0x3b44d35aLU, 0xe0ea1502LU, 0xc05512eaLU, 0x1bfbd4b2LU, 0x80661c77LU, 0x5bc8da2fLU, 0x7b77ddc7LU, 0xa0d91b9fLU, +0x7688ebb4LU, 0xad262decLU, 0x8d992a04LU, 0x5637ec5cLU, 0xcdaa2499LU, 0x1604e2c1LU, 0x36bbe529LU, 0xed152371LU, +0x4dcc38eeLU, 0x9662feb6LU, 0xb6ddf95eLU, 0x6d733f06LU, 0xf6eef7c3LU, 0x2d40319bLU, 0x0dff3673LU, 0xd651f02bLU, +0xec5d9b25LU, 0x37f35d7dLU, 0x174c5a95LU, 0xcce29ccdLU, 0x577f5408LU, 0x8cd19250LU, 0xac6e95b8LU, 0x77c053e0LU, +0xd719487fLU, 0x0cb78e27LU, 0x2c0889cfLU, 0xf7a64f97LU, 0x6c3b8752LU, 0xb795410aLU, 0x972a46e2LU, 0x4c8480baLU, +0x9ad57091LU, 0x417bb6c9LU, 0x61c4b121LU, 0xba6a7779LU, 0x21f7bfbcLU, 0xfa5979e4LU, 0xdae67e0cLU, 0x0148b854LU, +0xa191a3cbLU, 0x7a3f6593LU, 0x5a80627bLU, 0x812ea423LU, 0x1ab36ce6LU, 0xc11daabeLU, 0xe1a2ad56LU, 0x3a0c6b0eLU, +0x95ba7b4aLU, 0x4e14bd12LU, 0x6eabbafaLU, 0xb5057ca2LU, 0x2e98b467LU, 0xf536723fLU, 0xd58975d7LU, 0x0e27b38fLU, +0xaefea810LU, 0x75506e48LU, 0x55ef69a0LU, 0x8e41aff8LU, 0x15dc673dLU, 0xce72a165LU, 0xeecda68dLU, 0x356360d5LU, +0xe33290feLU, 0x389c56a6LU, 0x1823514eLU, 0xc38d9716LU, 0x58105fd3LU, 0x83be998bLU, 0xa3019e63LU, 0x78af583bLU, +0xd87643a4LU, 0x03d885fcLU, 0x23678214LU, 0xf8c9444cLU, 0x63548c89LU, 0xb8fa4ad1LU, 0x98454d39LU, 0x43eb8b61LU, +0x79e7e06fLU, 0xa2492637LU, 0x82f621dfLU, 0x5958e787LU, 0xc2c52f42LU, 0x196be91aLU, 0x39d4eef2LU, 0xe27a28aaLU, +0x42a33335LU, 0x990df56dLU, 0xb9b2f285LU, 0x621c34ddLU, 0xf981fc18LU, 0x222f3a40LU, 0x02903da8LU, 0xd93efbf0LU, +0x0f6f0bdbLU, 0xd4c1cd83LU, 0xf47eca6bLU, 0x2fd00c33LU, 0xb44dc4f6LU, 0x6fe302aeLU, 0x4f5c0546LU, 0x94f2c31eLU, +0x342bd881LU, 0xef851ed9LU, 0xcf3a1931LU, 0x1494df69LU, 0x8f0917acLU, 0x54a7d1f4LU, 0x7418d61cLU, 0xafb61044LU, +0x6739f694LU, 0xbc9730ccLU, 0x9c283724LU, 0x4786f17cLU, 0xdc1b39b9LU, 0x07b5ffe1LU, 0x270af809LU, 0xfca43e51LU, +0x5c7d25ceLU, 0x87d3e396LU, 0xa76ce47eLU, 0x7cc22226LU, 0xe75feae3LU, 0x3cf12cbbLU, 0x1c4e2b53LU, 0xc7e0ed0bLU, +0x11b11d20LU, 0xca1fdb78LU, 0xeaa0dc90LU, 0x310e1ac8LU, 0xaa93d20dLU, 0x713d1455LU, 0x518213bdLU, 0x8a2cd5e5LU, +0x2af5ce7aLU, 0xf15b0822LU, 0xd1e40fcaLU, 0x0a4ac992LU, 0x91d70157LU, 0x4a79c70fLU, 0x6ac6c0e7LU, 0xb16806bfLU, +0x8b646db1LU, 0x50caabe9LU, 0x7075ac01LU, 0xabdb6a59LU, 0x3046a29cLU, 0xebe864c4LU, 0xcb57632cLU, 0x10f9a574LU, +0xb020beebLU, 0x6b8e78b3LU, 0x4b317f5bLU, 0x909fb903LU, 0x0b0271c6LU, 0xd0acb79eLU, 0xf013b076LU, 0x2bbd762eLU, +0xfdec8605LU, 0x2642405dLU, 0x06fd47b5LU, 0xdd5381edLU, 0x46ce4928LU, 0x9d608f70LU, 0xbddf8898LU, 0x66714ec0LU, +0xc6a8555fLU, 0x1d069307LU, 0x3db994efLU, 0xe61752b7LU, 0x7d8a9a72LU, 0xa6245c2aLU, 0x869b5bc2LU, 0x5d359d9aLU, +0xf2838ddeLU, 0x292d4b86LU, 0x09924c6eLU, 0xd23c8a36LU, 0x49a142f3LU, 0x920f84abLU, 0xb2b08343LU, 0x691e451bLU, +0xc9c75e84LU, 0x126998dcLU, 0x32d69f34LU, 0xe978596cLU, 0x72e591a9LU, 0xa94b57f1LU, 0x89f45019LU, 0x525a9641LU, +0x840b666aLU, 0x5fa5a032LU, 0x7f1aa7daLU, 0xa4b46182LU, 0x3f29a947LU, 0xe4876f1fLU, 0xc43868f7LU, 0x1f96aeafLU, +0xbf4fb530LU, 0x64e17368LU, 0x445e7480LU, 0x9ff0b2d8LU, 0x046d7a1dLU, 0xdfc3bc45LU, 0xff7cbbadLU, 0x24d27df5LU, +0x1ede16fbLU, 0xc570d0a3LU, 0xe5cfd74bLU, 0x3e611113LU, 0xa5fcd9d6LU, 0x7e521f8eLU, 0x5eed1866LU, 0x8543de3eLU, +0x259ac5a1LU, 0xfe3403f9LU, 0xde8b0411LU, 0x0525c249LU, 0x9eb80a8cLU, 0x4516ccd4LU, 0x65a9cb3cLU, 0xbe070d64LU, +0x6856fd4fLU, 0xb3f83b17LU, 0x93473cffLU, 0x48e9faa7LU, 0xd3743262LU, 0x08daf43aLU, 0x2865f3d2LU, 0xf3cb358aLU, +0x53122e15LU, 0x88bce84dLU, 0xa803efa5LU, 0x73ad29fdLU, 0xe830e138LU, 0x339e2760LU, 0x13212088LU, 0xc88fe6d0LU }; static const ulong32 rs_tab6[256] = { -0x00000000LU, 0x9e3d68dbLU, 0x717ad0fbLU, 0xef47b820LU, 0xe2f4edbbLU, 0x7cc98560LU, 0x938e3d40LU, 0x0db3559bLU, -0x89a5973bLU, 0x1798ffe0LU, 0xf8df47c0LU, 0x66e22f1bLU, 0x6b517a80LU, 0xf56c125bLU, 0x1a2baa7bLU, 0x8416c2a0LU, -0x5f076376LU, 0xc13a0badLU, 0x2e7db38dLU, 0xb040db56LU, 0xbdf38ecdLU, 0x23cee616LU, 0xcc895e36LU, 0x52b436edLU, -0xd6a2f44dLU, 0x489f9c96LU, 0xa7d824b6LU, 0x39e54c6dLU, 0x345619f6LU, 0xaa6b712dLU, 0x452cc90dLU, 0xdb11a1d6LU, -0xbe0ec6ecLU, 0x2033ae37LU, 0xcf741617LU, 0x51497eccLU, 0x5cfa2b57LU, 0xc2c7438cLU, 0x2d80fbacLU, 0xb3bd9377LU, -0x37ab51d7LU, 0xa996390cLU, 0x46d1812cLU, 0xd8ece9f7LU, 0xd55fbc6cLU, 0x4b62d4b7LU, 0xa4256c97LU, 0x3a18044cLU, -0xe109a59aLU, 0x7f34cd41LU, 0x90737561LU, 0x0e4e1dbaLU, 0x03fd4821LU, 0x9dc020faLU, 0x728798daLU, 0xecbaf001LU, -0x68ac32a1LU, 0xf6915a7aLU, 0x19d6e25aLU, 0x87eb8a81LU, 0x8a58df1aLU, 0x1465b7c1LU, 0xfb220fe1LU, 0x651f673aLU, -0x311cc195LU, 0xaf21a94eLU, 0x4066116eLU, 0xde5b79b5LU, 0xd3e82c2eLU, 0x4dd544f5LU, 0xa292fcd5LU, 0x3caf940eLU, -0xb8b956aeLU, 0x26843e75LU, 0xc9c38655LU, 0x57feee8eLU, 0x5a4dbb15LU, 0xc470d3ceLU, 0x2b376beeLU, 0xb50a0335LU, -0x6e1ba2e3LU, 0xf026ca38LU, 0x1f617218LU, 0x815c1ac3LU, 0x8cef4f58LU, 0x12d22783LU, 0xfd959fa3LU, 0x63a8f778LU, -0xe7be35d8LU, 0x79835d03LU, 0x96c4e523LU, 0x08f98df8LU, 0x054ad863LU, 0x9b77b0b8LU, 0x74300898LU, 0xea0d6043LU, -0x8f120779LU, 0x112f6fa2LU, 0xfe68d782LU, 0x6055bf59LU, 0x6de6eac2LU, 0xf3db8219LU, 0x1c9c3a39LU, 0x82a152e2LU, +0x00000000LU, 0x9e3d68dbLU, 0x717ad0fbLU, 0xef47b820LU, 0xe2f4edbbLU, 0x7cc98560LU, 0x938e3d40LU, 0x0db3559bLU, +0x89a5973bLU, 0x1798ffe0LU, 0xf8df47c0LU, 0x66e22f1bLU, 0x6b517a80LU, 0xf56c125bLU, 0x1a2baa7bLU, 0x8416c2a0LU, +0x5f076376LU, 0xc13a0badLU, 0x2e7db38dLU, 0xb040db56LU, 0xbdf38ecdLU, 0x23cee616LU, 0xcc895e36LU, 0x52b436edLU, +0xd6a2f44dLU, 0x489f9c96LU, 0xa7d824b6LU, 0x39e54c6dLU, 0x345619f6LU, 0xaa6b712dLU, 0x452cc90dLU, 0xdb11a1d6LU, +0xbe0ec6ecLU, 0x2033ae37LU, 0xcf741617LU, 0x51497eccLU, 0x5cfa2b57LU, 0xc2c7438cLU, 0x2d80fbacLU, 0xb3bd9377LU, +0x37ab51d7LU, 0xa996390cLU, 0x46d1812cLU, 0xd8ece9f7LU, 0xd55fbc6cLU, 0x4b62d4b7LU, 0xa4256c97LU, 0x3a18044cLU, +0xe109a59aLU, 0x7f34cd41LU, 0x90737561LU, 0x0e4e1dbaLU, 0x03fd4821LU, 0x9dc020faLU, 0x728798daLU, 0xecbaf001LU, +0x68ac32a1LU, 0xf6915a7aLU, 0x19d6e25aLU, 0x87eb8a81LU, 0x8a58df1aLU, 0x1465b7c1LU, 0xfb220fe1LU, 0x651f673aLU, +0x311cc195LU, 0xaf21a94eLU, 0x4066116eLU, 0xde5b79b5LU, 0xd3e82c2eLU, 0x4dd544f5LU, 0xa292fcd5LU, 0x3caf940eLU, +0xb8b956aeLU, 0x26843e75LU, 0xc9c38655LU, 0x57feee8eLU, 0x5a4dbb15LU, 0xc470d3ceLU, 0x2b376beeLU, 0xb50a0335LU, +0x6e1ba2e3LU, 0xf026ca38LU, 0x1f617218LU, 0x815c1ac3LU, 0x8cef4f58LU, 0x12d22783LU, 0xfd959fa3LU, 0x63a8f778LU, +0xe7be35d8LU, 0x79835d03LU, 0x96c4e523LU, 0x08f98df8LU, 0x054ad863LU, 0x9b77b0b8LU, 0x74300898LU, 0xea0d6043LU, +0x8f120779LU, 0x112f6fa2LU, 0xfe68d782LU, 0x6055bf59LU, 0x6de6eac2LU, 0xf3db8219LU, 0x1c9c3a39LU, 0x82a152e2LU, 0x06b79042LU, 0x988af899LU, 0x77cd40b9LU, 0xe9f02862LU, 0xe4437df9LU, 0x7a7e1522LU, 0x9539ad02LU, 0x0b04c5d9LU, -0xd015640fLU, 0x4e280cd4LU, 0xa16fb4f4LU, 0x3f52dc2fLU, 0x32e189b4LU, 0xacdce16fLU, 0x439b594fLU, 0xdda63194LU, -0x59b0f334LU, 0xc78d9befLU, 0x28ca23cfLU, 0xb6f74b14LU, 0xbb441e8fLU, 0x25797654LU, 0xca3ece74LU, 0x5403a6afLU, -0x6238cf67LU, 0xfc05a7bcLU, 0x13421f9cLU, 0x8d7f7747LU, 0x80cc22dcLU, 0x1ef14a07LU, 0xf1b6f227LU, 0x6f8b9afcLU, -0xeb9d585cLU, 0x75a03087LU, 0x9ae788a7LU, 0x04dae07cLU, 0x0969b5e7LU, 0x9754dd3cLU, 0x7813651cLU, 0xe62e0dc7LU, -0x3d3fac11LU, 0xa302c4caLU, 0x4c457ceaLU, 0xd2781431LU, 0xdfcb41aaLU, 0x41f62971LU, 0xaeb19151LU, 0x308cf98aLU, +0xd015640fLU, 0x4e280cd4LU, 0xa16fb4f4LU, 0x3f52dc2fLU, 0x32e189b4LU, 0xacdce16fLU, 0x439b594fLU, 0xdda63194LU, +0x59b0f334LU, 0xc78d9befLU, 0x28ca23cfLU, 0xb6f74b14LU, 0xbb441e8fLU, 0x25797654LU, 0xca3ece74LU, 0x5403a6afLU, +0x6238cf67LU, 0xfc05a7bcLU, 0x13421f9cLU, 0x8d7f7747LU, 0x80cc22dcLU, 0x1ef14a07LU, 0xf1b6f227LU, 0x6f8b9afcLU, +0xeb9d585cLU, 0x75a03087LU, 0x9ae788a7LU, 0x04dae07cLU, 0x0969b5e7LU, 0x9754dd3cLU, 0x7813651cLU, 0xe62e0dc7LU, +0x3d3fac11LU, 0xa302c4caLU, 0x4c457ceaLU, 0xd2781431LU, 0xdfcb41aaLU, 0x41f62971LU, 0xaeb19151LU, 0x308cf98aLU, 0xb49a3b2aLU, 0x2aa753f1LU, 0xc5e0ebd1LU, 0x5bdd830aLU, 0x566ed691LU, 0xc853be4aLU, 0x2714066aLU, 0xb9296eb1LU, -0xdc36098bLU, 0x420b6150LU, 0xad4cd970LU, 0x3371b1abLU, 0x3ec2e430LU, 0xa0ff8cebLU, 0x4fb834cbLU, 0xd1855c10LU, -0x55939eb0LU, 0xcbaef66bLU, 0x24e94e4bLU, 0xbad42690LU, 0xb767730bLU, 0x295a1bd0LU, 0xc61da3f0LU, 0x5820cb2bLU, -0x83316afdLU, 0x1d0c0226LU, 0xf24bba06LU, 0x6c76d2ddLU, 0x61c58746LU, 0xfff8ef9dLU, 0x10bf57bdLU, 0x8e823f66LU, -0x0a94fdc6LU, 0x94a9951dLU, 0x7bee2d3dLU, 0xe5d345e6LU, 0xe860107dLU, 0x765d78a6LU, 0x991ac086LU, 0x0727a85dLU, -0x53240ef2LU, 0xcd196629LU, 0x225ede09LU, 0xbc63b6d2LU, 0xb1d0e349LU, 0x2fed8b92LU, 0xc0aa33b2LU, 0x5e975b69LU, -0xda8199c9LU, 0x44bcf112LU, 0xabfb4932LU, 0x35c621e9LU, 0x38757472LU, 0xa6481ca9LU, 0x490fa489LU, 0xd732cc52LU, -0x0c236d84LU, 0x921e055fLU, 0x7d59bd7fLU, 0xe364d5a4LU, 0xeed7803fLU, 0x70eae8e4LU, 0x9fad50c4LU, 0x0190381fLU, -0x8586fabfLU, 0x1bbb9264LU, 0xf4fc2a44LU, 0x6ac1429fLU, 0x67721704LU, 0xf94f7fdfLU, 0x1608c7ffLU, 0x8835af24LU, -0xed2ac81eLU, 0x7317a0c5LU, 0x9c5018e5LU, 0x026d703eLU, 0x0fde25a5LU, 0x91e34d7eLU, 0x7ea4f55eLU, 0xe0999d85LU, -0x648f5f25LU, 0xfab237feLU, 0x15f58fdeLU, 0x8bc8e705LU, 0x867bb29eLU, 0x1846da45LU, 0xf7016265LU, 0x693c0abeLU, -0xb22dab68LU, 0x2c10c3b3LU, 0xc3577b93LU, 0x5d6a1348LU, 0x50d946d3LU, 0xcee42e08LU, 0x21a39628LU, 0xbf9efef3LU, -0x3b883c53LU, 0xa5b55488LU, 0x4af2eca8LU, 0xd4cf8473LU, 0xd97cd1e8LU, 0x4741b933LU, 0xa8060113LU, 0x363b69c8LU }; +0xdc36098bLU, 0x420b6150LU, 0xad4cd970LU, 0x3371b1abLU, 0x3ec2e430LU, 0xa0ff8cebLU, 0x4fb834cbLU, 0xd1855c10LU, +0x55939eb0LU, 0xcbaef66bLU, 0x24e94e4bLU, 0xbad42690LU, 0xb767730bLU, 0x295a1bd0LU, 0xc61da3f0LU, 0x5820cb2bLU, +0x83316afdLU, 0x1d0c0226LU, 0xf24bba06LU, 0x6c76d2ddLU, 0x61c58746LU, 0xfff8ef9dLU, 0x10bf57bdLU, 0x8e823f66LU, +0x0a94fdc6LU, 0x94a9951dLU, 0x7bee2d3dLU, 0xe5d345e6LU, 0xe860107dLU, 0x765d78a6LU, 0x991ac086LU, 0x0727a85dLU, +0x53240ef2LU, 0xcd196629LU, 0x225ede09LU, 0xbc63b6d2LU, 0xb1d0e349LU, 0x2fed8b92LU, 0xc0aa33b2LU, 0x5e975b69LU, +0xda8199c9LU, 0x44bcf112LU, 0xabfb4932LU, 0x35c621e9LU, 0x38757472LU, 0xa6481ca9LU, 0x490fa489LU, 0xd732cc52LU, +0x0c236d84LU, 0x921e055fLU, 0x7d59bd7fLU, 0xe364d5a4LU, 0xeed7803fLU, 0x70eae8e4LU, 0x9fad50c4LU, 0x0190381fLU, +0x8586fabfLU, 0x1bbb9264LU, 0xf4fc2a44LU, 0x6ac1429fLU, 0x67721704LU, 0xf94f7fdfLU, 0x1608c7ffLU, 0x8835af24LU, +0xed2ac81eLU, 0x7317a0c5LU, 0x9c5018e5LU, 0x026d703eLU, 0x0fde25a5LU, 0x91e34d7eLU, 0x7ea4f55eLU, 0xe0999d85LU, +0x648f5f25LU, 0xfab237feLU, 0x15f58fdeLU, 0x8bc8e705LU, 0x867bb29eLU, 0x1846da45LU, 0xf7016265LU, 0x693c0abeLU, +0xb22dab68LU, 0x2c10c3b3LU, 0xc3577b93LU, 0x5d6a1348LU, 0x50d946d3LU, 0xcee42e08LU, 0x21a39628LU, 0xbf9efef3LU, +0x3b883c53LU, 0xa5b55488LU, 0x4af2eca8LU, 0xd4cf8473LU, 0xd97cd1e8LU, 0x4741b933LU, 0xa8060113LU, 0x363b69c8LU }; static const ulong32 rs_tab7[256] = { -0x00000000LU, 0x0319e59eLU, 0x06328771LU, 0x052b62efLU, 0x0c6443e2LU, 0x0f7da67cLU, 0x0a56c493LU, 0x094f210dLU, -0x18c88689LU, 0x1bd16317LU, 0x1efa01f8LU, 0x1de3e466LU, 0x14acc56bLU, 0x17b520f5LU, 0x129e421aLU, 0x1187a784LU, -0x30dd415fLU, 0x33c4a4c1LU, 0x36efc62eLU, 0x35f623b0LU, 0x3cb902bdLU, 0x3fa0e723LU, 0x3a8b85ccLU, 0x39926052LU, -0x2815c7d6LU, 0x2b0c2248LU, 0x2e2740a7LU, 0x2d3ea539LU, 0x24718434LU, 0x276861aaLU, 0x22430345LU, 0x215ae6dbLU, -0x60f782beLU, 0x63ee6720LU, 0x66c505cfLU, 0x65dce051LU, 0x6c93c15cLU, 0x6f8a24c2LU, 0x6aa1462dLU, 0x69b8a3b3LU, -0x783f0437LU, 0x7b26e1a9LU, 0x7e0d8346LU, 0x7d1466d8LU, 0x745b47d5LU, 0x7742a24bLU, 0x7269c0a4LU, 0x7170253aLU, -0x502ac3e1LU, 0x5333267fLU, 0x56184490LU, 0x5501a10eLU, 0x5c4e8003LU, 0x5f57659dLU, 0x5a7c0772LU, 0x5965e2ecLU, -0x48e24568LU, 0x4bfba0f6LU, 0x4ed0c219LU, 0x4dc92787LU, 0x4486068aLU, 0x479fe314LU, 0x42b481fbLU, 0x41ad6465LU, -0xc0a34931LU, 0xc3baacafLU, 0xc691ce40LU, 0xc5882bdeLU, 0xccc70ad3LU, 0xcfdeef4dLU, 0xcaf58da2LU, 0xc9ec683cLU, -0xd86bcfb8LU, 0xdb722a26LU, 0xde5948c9LU, 0xdd40ad57LU, 0xd40f8c5aLU, 0xd71669c4LU, 0xd23d0b2bLU, 0xd124eeb5LU, -0xf07e086eLU, 0xf367edf0LU, 0xf64c8f1fLU, 0xf5556a81LU, 0xfc1a4b8cLU, 0xff03ae12LU, 0xfa28ccfdLU, 0xf9312963LU, -0xe8b68ee7LU, 0xebaf6b79LU, 0xee840996LU, 0xed9dec08LU, 0xe4d2cd05LU, 0xe7cb289bLU, 0xe2e04a74LU, 0xe1f9afeaLU, -0xa054cb8fLU, 0xa34d2e11LU, 0xa6664cfeLU, 0xa57fa960LU, 0xac30886dLU, 0xaf296df3LU, 0xaa020f1cLU, 0xa91bea82LU, -0xb89c4d06LU, 0xbb85a898LU, 0xbeaeca77LU, 0xbdb72fe9LU, 0xb4f80ee4LU, 0xb7e1eb7aLU, 0xb2ca8995LU, 0xb1d36c0bLU, -0x90898ad0LU, 0x93906f4eLU, 0x96bb0da1LU, 0x95a2e83fLU, 0x9cedc932LU, 0x9ff42cacLU, 0x9adf4e43LU, 0x99c6abddLU, -0x88410c59LU, 0x8b58e9c7LU, 0x8e738b28LU, 0x8d6a6eb6LU, 0x84254fbbLU, 0x873caa25LU, 0x8217c8caLU, 0x810e2d54LU, -0xcd0b9262LU, 0xce1277fcLU, 0xcb391513LU, 0xc820f08dLU, 0xc16fd180LU, 0xc276341eLU, 0xc75d56f1LU, 0xc444b36fLU, -0xd5c314ebLU, 0xd6daf175LU, 0xd3f1939aLU, 0xd0e87604LU, 0xd9a75709LU, 0xdabeb297LU, 0xdf95d078LU, 0xdc8c35e6LU, -0xfdd6d33dLU, 0xfecf36a3LU, 0xfbe4544cLU, 0xf8fdb1d2LU, 0xf1b290dfLU, 0xf2ab7541LU, 0xf78017aeLU, 0xf499f230LU, -0xe51e55b4LU, 0xe607b02aLU, 0xe32cd2c5LU, 0xe035375bLU, 0xe97a1656LU, 0xea63f3c8LU, 0xef489127LU, 0xec5174b9LU, -0xadfc10dcLU, 0xaee5f542LU, 0xabce97adLU, 0xa8d77233LU, 0xa198533eLU, 0xa281b6a0LU, 0xa7aad44fLU, 0xa4b331d1LU, -0xb5349655LU, 0xb62d73cbLU, 0xb3061124LU, 0xb01ff4baLU, 0xb950d5b7LU, 0xba493029LU, 0xbf6252c6LU, 0xbc7bb758LU, -0x9d215183LU, 0x9e38b41dLU, 0x9b13d6f2LU, 0x980a336cLU, 0x91451261LU, 0x925cf7ffLU, 0x97779510LU, 0x946e708eLU, -0x85e9d70aLU, 0x86f03294LU, 0x83db507bLU, 0x80c2b5e5LU, 0x898d94e8LU, 0x8a947176LU, 0x8fbf1399LU, 0x8ca6f607LU, -0x0da8db53LU, 0x0eb13ecdLU, 0x0b9a5c22LU, 0x0883b9bcLU, 0x01cc98b1LU, 0x02d57d2fLU, 0x07fe1fc0LU, 0x04e7fa5eLU, -0x15605ddaLU, 0x1679b844LU, 0x1352daabLU, 0x104b3f35LU, 0x19041e38LU, 0x1a1dfba6LU, 0x1f369949LU, 0x1c2f7cd7LU, -0x3d759a0cLU, 0x3e6c7f92LU, 0x3b471d7dLU, 0x385ef8e3LU, 0x3111d9eeLU, 0x32083c70LU, 0x37235e9fLU, 0x343abb01LU, -0x25bd1c85LU, 0x26a4f91bLU, 0x238f9bf4LU, 0x20967e6aLU, 0x29d95f67LU, 0x2ac0baf9LU, 0x2febd816LU, 0x2cf23d88LU, -0x6d5f59edLU, 0x6e46bc73LU, 0x6b6dde9cLU, 0x68743b02LU, 0x613b1a0fLU, 0x6222ff91LU, 0x67099d7eLU, 0x641078e0LU, -0x7597df64LU, 0x768e3afaLU, 0x73a55815LU, 0x70bcbd8bLU, 0x79f39c86LU, 0x7aea7918LU, 0x7fc11bf7LU, 0x7cd8fe69LU, -0x5d8218b2LU, 0x5e9bfd2cLU, 0x5bb09fc3LU, 0x58a97a5dLU, 0x51e65b50LU, 0x52ffbeceLU, 0x57d4dc21LU, 0x54cd39bfLU, +0x00000000LU, 0x0319e59eLU, 0x06328771LU, 0x052b62efLU, 0x0c6443e2LU, 0x0f7da67cLU, 0x0a56c493LU, 0x094f210dLU, +0x18c88689LU, 0x1bd16317LU, 0x1efa01f8LU, 0x1de3e466LU, 0x14acc56bLU, 0x17b520f5LU, 0x129e421aLU, 0x1187a784LU, +0x30dd415fLU, 0x33c4a4c1LU, 0x36efc62eLU, 0x35f623b0LU, 0x3cb902bdLU, 0x3fa0e723LU, 0x3a8b85ccLU, 0x39926052LU, +0x2815c7d6LU, 0x2b0c2248LU, 0x2e2740a7LU, 0x2d3ea539LU, 0x24718434LU, 0x276861aaLU, 0x22430345LU, 0x215ae6dbLU, +0x60f782beLU, 0x63ee6720LU, 0x66c505cfLU, 0x65dce051LU, 0x6c93c15cLU, 0x6f8a24c2LU, 0x6aa1462dLU, 0x69b8a3b3LU, +0x783f0437LU, 0x7b26e1a9LU, 0x7e0d8346LU, 0x7d1466d8LU, 0x745b47d5LU, 0x7742a24bLU, 0x7269c0a4LU, 0x7170253aLU, +0x502ac3e1LU, 0x5333267fLU, 0x56184490LU, 0x5501a10eLU, 0x5c4e8003LU, 0x5f57659dLU, 0x5a7c0772LU, 0x5965e2ecLU, +0x48e24568LU, 0x4bfba0f6LU, 0x4ed0c219LU, 0x4dc92787LU, 0x4486068aLU, 0x479fe314LU, 0x42b481fbLU, 0x41ad6465LU, +0xc0a34931LU, 0xc3baacafLU, 0xc691ce40LU, 0xc5882bdeLU, 0xccc70ad3LU, 0xcfdeef4dLU, 0xcaf58da2LU, 0xc9ec683cLU, +0xd86bcfb8LU, 0xdb722a26LU, 0xde5948c9LU, 0xdd40ad57LU, 0xd40f8c5aLU, 0xd71669c4LU, 0xd23d0b2bLU, 0xd124eeb5LU, +0xf07e086eLU, 0xf367edf0LU, 0xf64c8f1fLU, 0xf5556a81LU, 0xfc1a4b8cLU, 0xff03ae12LU, 0xfa28ccfdLU, 0xf9312963LU, +0xe8b68ee7LU, 0xebaf6b79LU, 0xee840996LU, 0xed9dec08LU, 0xe4d2cd05LU, 0xe7cb289bLU, 0xe2e04a74LU, 0xe1f9afeaLU, +0xa054cb8fLU, 0xa34d2e11LU, 0xa6664cfeLU, 0xa57fa960LU, 0xac30886dLU, 0xaf296df3LU, 0xaa020f1cLU, 0xa91bea82LU, +0xb89c4d06LU, 0xbb85a898LU, 0xbeaeca77LU, 0xbdb72fe9LU, 0xb4f80ee4LU, 0xb7e1eb7aLU, 0xb2ca8995LU, 0xb1d36c0bLU, +0x90898ad0LU, 0x93906f4eLU, 0x96bb0da1LU, 0x95a2e83fLU, 0x9cedc932LU, 0x9ff42cacLU, 0x9adf4e43LU, 0x99c6abddLU, +0x88410c59LU, 0x8b58e9c7LU, 0x8e738b28LU, 0x8d6a6eb6LU, 0x84254fbbLU, 0x873caa25LU, 0x8217c8caLU, 0x810e2d54LU, +0xcd0b9262LU, 0xce1277fcLU, 0xcb391513LU, 0xc820f08dLU, 0xc16fd180LU, 0xc276341eLU, 0xc75d56f1LU, 0xc444b36fLU, +0xd5c314ebLU, 0xd6daf175LU, 0xd3f1939aLU, 0xd0e87604LU, 0xd9a75709LU, 0xdabeb297LU, 0xdf95d078LU, 0xdc8c35e6LU, +0xfdd6d33dLU, 0xfecf36a3LU, 0xfbe4544cLU, 0xf8fdb1d2LU, 0xf1b290dfLU, 0xf2ab7541LU, 0xf78017aeLU, 0xf499f230LU, +0xe51e55b4LU, 0xe607b02aLU, 0xe32cd2c5LU, 0xe035375bLU, 0xe97a1656LU, 0xea63f3c8LU, 0xef489127LU, 0xec5174b9LU, +0xadfc10dcLU, 0xaee5f542LU, 0xabce97adLU, 0xa8d77233LU, 0xa198533eLU, 0xa281b6a0LU, 0xa7aad44fLU, 0xa4b331d1LU, +0xb5349655LU, 0xb62d73cbLU, 0xb3061124LU, 0xb01ff4baLU, 0xb950d5b7LU, 0xba493029LU, 0xbf6252c6LU, 0xbc7bb758LU, +0x9d215183LU, 0x9e38b41dLU, 0x9b13d6f2LU, 0x980a336cLU, 0x91451261LU, 0x925cf7ffLU, 0x97779510LU, 0x946e708eLU, +0x85e9d70aLU, 0x86f03294LU, 0x83db507bLU, 0x80c2b5e5LU, 0x898d94e8LU, 0x8a947176LU, 0x8fbf1399LU, 0x8ca6f607LU, +0x0da8db53LU, 0x0eb13ecdLU, 0x0b9a5c22LU, 0x0883b9bcLU, 0x01cc98b1LU, 0x02d57d2fLU, 0x07fe1fc0LU, 0x04e7fa5eLU, +0x15605ddaLU, 0x1679b844LU, 0x1352daabLU, 0x104b3f35LU, 0x19041e38LU, 0x1a1dfba6LU, 0x1f369949LU, 0x1c2f7cd7LU, +0x3d759a0cLU, 0x3e6c7f92LU, 0x3b471d7dLU, 0x385ef8e3LU, 0x3111d9eeLU, 0x32083c70LU, 0x37235e9fLU, 0x343abb01LU, +0x25bd1c85LU, 0x26a4f91bLU, 0x238f9bf4LU, 0x20967e6aLU, 0x29d95f67LU, 0x2ac0baf9LU, 0x2febd816LU, 0x2cf23d88LU, +0x6d5f59edLU, 0x6e46bc73LU, 0x6b6dde9cLU, 0x68743b02LU, 0x613b1a0fLU, 0x6222ff91LU, 0x67099d7eLU, 0x641078e0LU, +0x7597df64LU, 0x768e3afaLU, 0x73a55815LU, 0x70bcbd8bLU, 0x79f39c86LU, 0x7aea7918LU, 0x7fc11bf7LU, 0x7cd8fe69LU, +0x5d8218b2LU, 0x5e9bfd2cLU, 0x5bb09fc3LU, 0x58a97a5dLU, 0x51e65b50LU, 0x52ffbeceLU, 0x57d4dc21LU, 0x54cd39bfLU, 0x454a9e3bLU, 0x46537ba5LU, 0x4378194aLU, 0x4061fcd4LU, 0x492eddd9LU, 0x4a373847LU, 0x4f1c5aa8LU, 0x4c05bf36LU }; #endif /* LTC_TWOFISH_ALL_TABLES */ +#endif /* __LTC_TWOFISH_TAB_C__ */ #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/ciphers/xtea.c b/libtomcrypt/src/ciphers/xtea.c index d907e54..fe26f98 100644 --- a/libtomcrypt/src/ciphers/xtea.c +++ b/libtomcrypt/src/ciphers/xtea.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /** @@ -28,13 +26,13 @@ const struct ltc_cipher_descriptor xtea_desc = &xtea_test, &xtea_done, &xtea_keysize, - NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL + NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL }; int xtea_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey) { - unsigned long x, sum, K[4]; - + ulong32 x, sum, K[4]; + LTC_ARGCHK(key != NULL); LTC_ARGCHK(skey != NULL); @@ -48,21 +46,21 @@ int xtea_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_k } /* load key */ - LOAD32L(K[0], key+0); - LOAD32L(K[1], key+4); - LOAD32L(K[2], key+8); - LOAD32L(K[3], key+12); - + LOAD32H(K[0], key+0); + LOAD32H(K[1], key+4); + LOAD32H(K[2], key+8); + LOAD32H(K[3], key+12); + for (x = sum = 0; x < 32; x++) { skey->xtea.A[x] = (sum + K[sum&3]) & 0xFFFFFFFFUL; sum = (sum + 0x9E3779B9UL) & 0xFFFFFFFFUL; skey->xtea.B[x] = (sum + K[(sum>>11)&3]) & 0xFFFFFFFFUL; } - + #ifdef LTC_CLEAN_STACK zeromem(&K, sizeof(K)); -#endif - +#endif + return CRYPT_OK; } @@ -75,15 +73,15 @@ int xtea_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_k */ int xtea_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key *skey) { - unsigned long y, z; + ulong32 y, z; int r; LTC_ARGCHK(pt != NULL); LTC_ARGCHK(ct != NULL); LTC_ARGCHK(skey != NULL); - LOAD32L(y, &pt[0]); - LOAD32L(z, &pt[4]); + LOAD32H(y, &pt[0]); + LOAD32H(z, &pt[4]); for (r = 0; r < 32; r += 4) { y = (y + ((((z<<4)^(z>>5)) + z) ^ skey->xtea.A[r])) & 0xFFFFFFFFUL; z = (z + ((((y<<4)^(y>>5)) + y) ^ skey->xtea.B[r])) & 0xFFFFFFFFUL; @@ -97,8 +95,8 @@ int xtea_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key * y = (y + ((((z<<4)^(z>>5)) + z) ^ skey->xtea.A[r+3])) & 0xFFFFFFFFUL; z = (z + ((((y<<4)^(y>>5)) + y) ^ skey->xtea.B[r+3])) & 0xFFFFFFFFUL; } - STORE32L(y, &ct[0]); - STORE32L(z, &ct[4]); + STORE32H(y, &ct[0]); + STORE32H(z, &ct[4]); return CRYPT_OK; } @@ -106,20 +104,20 @@ int xtea_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key * Decrypts a block of text with LTC_XTEA @param ct The input ciphertext (8 bytes) @param pt The output plaintext (8 bytes) - @param skey The key as scheduled + @param skey The key as scheduled @return CRYPT_OK if successful */ int xtea_ecb_decrypt(const unsigned char *ct, unsigned char *pt, symmetric_key *skey) { - unsigned long y, z; + ulong32 y, z; int r; LTC_ARGCHK(pt != NULL); LTC_ARGCHK(ct != NULL); LTC_ARGCHK(skey != NULL); - LOAD32L(y, &ct[0]); - LOAD32L(z, &ct[4]); + LOAD32H(y, &ct[0]); + LOAD32H(z, &ct[4]); for (r = 31; r >= 0; r -= 4) { z = (z - ((((y<<4)^(y>>5)) + y) ^ skey->xtea.B[r])) & 0xFFFFFFFFUL; y = (y - ((((z<<4)^(z>>5)) + z) ^ skey->xtea.A[r])) & 0xFFFFFFFFUL; @@ -133,8 +131,8 @@ int xtea_ecb_decrypt(const unsigned char *ct, unsigned char *pt, symmetric_key * z = (z - ((((y<<4)^(y>>5)) + y) ^ skey->xtea.B[r-3])) & 0xFFFFFFFFUL; y = (y - ((((z<<4)^(z>>5)) + z) ^ skey->xtea.A[r-3])) & 0xFFFFFFFFUL; } - STORE32L(y, &pt[0]); - STORE32L(z, &pt[4]); + STORE32H(y, &pt[0]); + STORE32H(z, &pt[4]); return CRYPT_OK; } @@ -146,43 +144,95 @@ int xtea_test(void) { #ifndef LTC_TEST return CRYPT_NOP; - #else - static const unsigned char key[16] = - { 0x78, 0x56, 0x34, 0x12, 0xf0, 0xcd, 0xcb, 0x9a, - 0x48, 0x37, 0x26, 0x15, 0xc0, 0xbf, 0xae, 0x9d }; - static const unsigned char pt[8] = - { 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07, 0x08 }; - static const unsigned char ct[8] = - { 0x75, 0xd7, 0xc5, 0xbf, 0xcf, 0x58, 0xc9, 0x3f }; + #else + static const struct { + unsigned char key[16], pt[8], ct[8]; + } tests[] = { + { + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0xde, 0xe9, 0xd4, 0xd8, 0xf7, 0x13, 0x1e, 0xd9 } + }, { + { 0x00, 0x00, 0x00, 0x01, 0x00, 0x00, 0x00, 0x02, + 0x00, 0x00, 0x00, 0x03, 0x00, 0x00, 0x00, 0x04 }, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0xa5, 0x97, 0xab, 0x41, 0x76, 0x01, 0x4d, 0x72 } + }, { + { 0x00, 0x00, 0x00, 0x03, 0x00, 0x00, 0x00, 0x04, + 0x00, 0x00, 0x00, 0x05, 0x00, 0x00, 0x00, 0x06 }, + { 0x00, 0x00, 0x00, 0x01, 0x00, 0x00, 0x00, 0x02 }, + { 0xb1, 0xfd, 0x5d, 0xa9, 0xcc, 0x6d, 0xc9, 0xdc } + }, { + { 0x78, 0x69, 0x5a, 0x4b, 0x3c, 0x2d, 0x1e, 0x0f, + 0xf0, 0xe1, 0xd2, 0xc3, 0xb4, 0xa5, 0x96, 0x87 }, + { 0xf0, 0xe1, 0xd2, 0xc3, 0xb4, 0xa5, 0x96, 0x87 }, + { 0x70, 0x4b, 0x31, 0x34, 0x47, 0x44, 0xdf, 0xab } + }, { + { 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07, + 0x08, 0x09, 0x0a, 0x0b, 0x0c, 0x0d, 0x0e, 0x0f }, + { 0x41, 0x42, 0x43, 0x44, 0x45, 0x46, 0x47, 0x48 }, + { 0x49, 0x7d, 0xf3, 0xd0, 0x72, 0x61, 0x2c, 0xb5 } + }, { + { 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07, + 0x08, 0x09, 0x0a, 0x0b, 0x0c, 0x0d, 0x0e, 0x0f }, + { 0x41, 0x41, 0x41, 0x41, 0x41, 0x41, 0x41, 0x41 }, + { 0xe7, 0x8f, 0x2d, 0x13, 0x74, 0x43, 0x41, 0xd8 } + }, { + { 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07, + 0x08, 0x09, 0x0a, 0x0b, 0x0c, 0x0d, 0x0e, 0x0f }, + { 0x5a, 0x5b, 0x6e, 0x27, 0x89, 0x48, 0xd7, 0x7f }, + { 0x41, 0x41, 0x41, 0x41, 0x41, 0x41, 0x41, 0x41 } + }, { + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0x41, 0x42, 0x43, 0x44, 0x45, 0x46, 0x47, 0x48 }, + { 0xa0, 0x39, 0x05, 0x89, 0xf8, 0xb8, 0xef, 0xa5 } + }, { + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0x41, 0x41, 0x41, 0x41, 0x41, 0x41, 0x41, 0x41 }, + { 0xed, 0x23, 0x37, 0x5a, 0x82, 0x1a, 0x8c, 0x2d } + }, { + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0x70, 0xe1, 0x22, 0x5d, 0x6e, 0x4e, 0x76, 0x55 }, + { 0x41, 0x41, 0x41, 0x41, 0x41, 0x41, 0x41, 0x41 } + } + }; unsigned char tmp[2][8]; symmetric_key skey; - int err, y; - - if ((err = xtea_setup(key, 16, 0, &skey)) != CRYPT_OK) { - return err; - } - xtea_ecb_encrypt(pt, tmp[0], &skey); - xtea_ecb_decrypt(tmp[0], tmp[1], &skey); - - if (XMEMCMP(tmp[0], ct, 8) != 0 || XMEMCMP(tmp[1], pt, 8) != 0) { - return CRYPT_FAIL_TESTVECTOR; - } + int i, err, y; + for (i = 0; i < (int)(sizeof(tests)/sizeof(tests[0])); i++) { + zeromem(&skey, sizeof(skey)); + if ((err = xtea_setup(tests[i].key, 16, 0, &skey)) != CRYPT_OK) { + return err; + } + xtea_ecb_encrypt(tests[i].pt, tmp[0], &skey); + xtea_ecb_decrypt(tmp[0], tmp[1], &skey); + + if (compare_testvector(tmp[0], 8, tests[i].ct, 8, "XTEA Encrypt", i) != 0 || + compare_testvector(tmp[1], 8, tests[i].pt, 8, "XTEA Decrypt", i) != 0) { + return CRYPT_FAIL_TESTVECTOR; + } /* now see if we can encrypt all zero bytes 1000 times, decrypt and come back where we started */ for (y = 0; y < 8; y++) tmp[0][y] = 0; for (y = 0; y < 1000; y++) xtea_ecb_encrypt(tmp[0], tmp[0], &skey); for (y = 0; y < 1000; y++) xtea_ecb_decrypt(tmp[0], tmp[0], &skey); for (y = 0; y < 8; y++) if (tmp[0][y] != 0) return CRYPT_FAIL_TESTVECTOR; + } /* for */ return CRYPT_OK; #endif } -/** Terminate the context +/** Terminate the context @param skey The scheduled key */ void xtea_done(symmetric_key *skey) { + LTC_UNUSED_PARAM(skey); } /** @@ -194,7 +244,7 @@ int xtea_keysize(int *keysize) { LTC_ARGCHK(keysize != NULL); if (*keysize < 16) { - return CRYPT_INVALID_KEYSIZE; + return CRYPT_INVALID_KEYSIZE; } *keysize = 16; return CRYPT_OK; @@ -206,6 +256,6 @@ int xtea_keysize(int *keysize) -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/encauth/ccm/ccm_add_aad.c b/libtomcrypt/src/encauth/ccm/ccm_add_aad.c new file mode 100644 index 0000000..9744c57 --- /dev/null +++ b/libtomcrypt/src/encauth/ccm/ccm_add_aad.c @@ -0,0 +1,63 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + */ +#include "tomcrypt.h" + +#ifdef LTC_CCM_MODE + +/** + Add AAD to the CCM state + @param ccm The CCM state + @param adata The additional authentication data to add to the CCM state + @param adatalen The length of the AAD data. + @return CRYPT_OK on success + */ +int ccm_add_aad(ccm_state *ccm, + const unsigned char *adata, unsigned long adatalen) +{ + unsigned long y; + int err; + + LTC_ARGCHK(ccm != NULL); + LTC_ARGCHK(adata != NULL); + + if (ccm->aadlen < ccm->current_aadlen + adatalen) { + return CRYPT_INVALID_ARG; + } + ccm->current_aadlen += adatalen; + + /* now add the data */ + for (y = 0; y < adatalen; y++) { + if (ccm->x == 16) { + /* full block so let's encrypt it */ + if ((err = cipher_descriptor[ccm->cipher].ecb_encrypt(ccm->PAD, ccm->PAD, &ccm->K)) != CRYPT_OK) { + return err; + } + ccm->x = 0; + } + ccm->PAD[ccm->x++] ^= adata[y]; + } + + /* remainder? */ + if (ccm->aadlen == ccm->current_aadlen) { + if (ccm->x != 0) { + if ((err = cipher_descriptor[ccm->cipher].ecb_encrypt(ccm->PAD, ccm->PAD, &ccm->K)) != CRYPT_OK) { + return err; + } + } + ccm->x = 0; + } + + return CRYPT_OK; +} + +#endif + +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/encauth/ccm/ccm_add_nonce.c b/libtomcrypt/src/encauth/ccm/ccm_add_nonce.c new file mode 100644 index 0000000..ceffb8e --- /dev/null +++ b/libtomcrypt/src/encauth/ccm/ccm_add_nonce.c @@ -0,0 +1,113 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + */ +#include "tomcrypt.h" + +#ifdef LTC_CCM_MODE + +/** + Add nonce data to the CCM state + @param ccm The CCM state + @param nonce The nonce data to add + @param noncelen The length of the nonce + @return CRYPT_OK on success + */ +int ccm_add_nonce(ccm_state *ccm, + const unsigned char *nonce, unsigned long noncelen) +{ + unsigned long x, y, len; + int err; + + LTC_ARGCHK(ccm != NULL); + LTC_ARGCHK(nonce != NULL); + + /* increase L to match the nonce len */ + ccm->noncelen = (noncelen > 13) ? 13 : noncelen; + if ((15 - ccm->noncelen) > ccm->L) { + ccm->L = 15 - ccm->noncelen; + } + + /* decrease noncelen to match L */ + if ((ccm->noncelen + ccm->L) > 15) { + ccm->noncelen = 15 - ccm->L; + } + + /* form B_0 == flags | Nonce N | l(m) */ + x = 0; + ccm->PAD[x++] = (unsigned char)(((ccm->aadlen > 0) ? (1<<6) : 0) | + (((ccm->taglen - 2)>>1)<<3) | + (ccm->L-1)); + + /* nonce */ + for (y = 0; y < (16 - (ccm->L + 1)); y++) { + ccm->PAD[x++] = nonce[y]; + } + + /* store len */ + len = ccm->ptlen; + + /* shift len so the upper bytes of len are the contents of the length */ + for (y = ccm->L; y < 4; y++) { + len <<= 8; + } + + /* store l(m) (only store 32-bits) */ + for (y = 0; ccm->L > 4 && (ccm->L-y)>4; y++) { + ccm->PAD[x++] = 0; + } + for (; y < ccm->L; y++) { + ccm->PAD[x++] = (unsigned char)((len >> 24) & 255); + len <<= 8; + } + + /* encrypt PAD */ + if ((err = cipher_descriptor[ccm->cipher].ecb_encrypt(ccm->PAD, ccm->PAD, &ccm->K)) != CRYPT_OK) { + return err; + } + + /* handle header */ + ccm->x = 0; + if (ccm->aadlen > 0) { + /* store length */ + if (ccm->aadlen < ((1UL<<16) - (1UL<<8))) { + ccm->PAD[ccm->x++] ^= (ccm->aadlen>>8) & 255; + ccm->PAD[ccm->x++] ^= ccm->aadlen & 255; + } else { + ccm->PAD[ccm->x++] ^= 0xFF; + ccm->PAD[ccm->x++] ^= 0xFE; + ccm->PAD[ccm->x++] ^= (ccm->aadlen>>24) & 255; + ccm->PAD[ccm->x++] ^= (ccm->aadlen>>16) & 255; + ccm->PAD[ccm->x++] ^= (ccm->aadlen>>8) & 255; + ccm->PAD[ccm->x++] ^= ccm->aadlen & 255; + } + } + + /* setup the ctr counter */ + x = 0; + + /* flags */ + ccm->ctr[x++] = (unsigned char)ccm->L-1; + + /* nonce */ + for (y = 0; y < (16 - (ccm->L+1)); ++y) { + ccm->ctr[x++] = nonce[y]; + } + /* offset */ + while (x < 16) { + ccm->ctr[x++] = 0; + } + + ccm->CTRlen = 16; + return CRYPT_OK; +} + +#endif + +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/encauth/ccm/ccm_done.c b/libtomcrypt/src/encauth/ccm/ccm_done.c new file mode 100644 index 0000000..797b7d9 --- /dev/null +++ b/libtomcrypt/src/encauth/ccm/ccm_done.c @@ -0,0 +1,65 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + */ +#include "tomcrypt.h" + +#ifdef LTC_CCM_MODE + +/** + Terminate a CCM stream + @param ccm The CCM state + @param tag [out] The destination for the MAC tag + @param taglen [in/out] The length of the MAC tag + @return CRYPT_OK on success + */ +int ccm_done(ccm_state *ccm, + unsigned char *tag, unsigned long *taglen) +{ + unsigned long x, y; + int err; + + LTC_ARGCHK(ccm != NULL); + + /* Check all data have been processed */ + if (ccm->ptlen != ccm->current_ptlen) { + return CRYPT_ERROR; + } + + LTC_ARGCHK(tag != NULL); + LTC_ARGCHK(taglen != NULL); + + if (ccm->x != 0) { + if ((err = cipher_descriptor[ccm->cipher].ecb_encrypt(ccm->PAD, ccm->PAD, &ccm->K)) != CRYPT_OK) { + return err; + } + } + + /* setup CTR for the TAG (zero the count) */ + for (y = 15; y > 15 - ccm->L; y--) { + ccm->ctr[y] = 0x00; + } + if ((err = cipher_descriptor[ccm->cipher].ecb_encrypt(ccm->ctr, ccm->CTRPAD, &ccm->K)) != CRYPT_OK) { + return err; + } + + cipher_descriptor[ccm->cipher].done(&ccm->K); + + /* store the TAG */ + for (x = 0; x < 16 && x < *taglen; x++) { + tag[x] = ccm->PAD[x] ^ ccm->CTRPAD[x]; + } + *taglen = x; + + return CRYPT_OK; +} + +#endif + +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/encauth/ccm/ccm_init.c b/libtomcrypt/src/encauth/ccm/ccm_init.c new file mode 100644 index 0000000..b24e33e --- /dev/null +++ b/libtomcrypt/src/encauth/ccm/ccm_init.c @@ -0,0 +1,81 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + */ +#include "tomcrypt.h" + +#ifdef LTC_CCM_MODE + +/** + Initialize a CCM state + @param ccm The CCM state to initialize + @param cipher The index of the cipher to use + @param key The secret key + @param keylen The length of the secret key + @param ptlen The length of the plain/cipher text that will be processed + @param taglen The max length of the MAC tag + @param aadlen The length of the AAD + + @return CRYPT_OK on success + */ +int ccm_init(ccm_state *ccm, int cipher, + const unsigned char *key, int keylen, int ptlen, int taglen, int aadlen) +{ + int err; + + LTC_ARGCHK(ccm != NULL); + LTC_ARGCHK(key != NULL); + LTC_ARGCHK(taglen != 0); + + XMEMSET(ccm, 0, sizeof(ccm_state)); + + /* check cipher input */ + if ((err = cipher_is_valid(cipher)) != CRYPT_OK) { + return err; + } + if (cipher_descriptor[cipher].block_length != 16) { + return CRYPT_INVALID_CIPHER; + } + + /* make sure the taglen is even and <= 16 */ + ccm->taglen = taglen; + ccm->taglen &= ~1; + if (ccm->taglen > 16) { + ccm->taglen = 16; + } + + /* can't use < 4 */ + if (ccm->taglen < 4) { + return CRYPT_INVALID_ARG; + } + + /* schedule key */ + if ((err = cipher_descriptor[cipher].setup(key, keylen, 0, &ccm->K)) != CRYPT_OK) { + return err; + } + ccm->cipher = cipher; + + /* let's get the L value */ + ccm->ptlen = ptlen; + ccm->L = 0; + while (ptlen) { + ++ccm->L; + ptlen >>= 8; + } + if (ccm->L <= 1) { + ccm->L = 2; + } + + ccm->aadlen = aadlen; + return CRYPT_OK; +} + +#endif + +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/encauth/ccm/ccm_memory.c b/libtomcrypt/src/encauth/ccm/ccm_memory.c index abd8653..3326ce5 100644 --- a/libtomcrypt/src/encauth/ccm/ccm_memory.c +++ b/libtomcrypt/src/encauth/ccm/ccm_memory.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" @@ -19,6 +17,9 @@ /** CCM encrypt/decrypt and produce an authentication tag + + *1 'pt', 'ct' and 'tag' can both be 'in' or 'out', depending on 'direction' + @param cipher The index of the cipher desired @param key The secret key to use @param keylen The length of the secret key (octets) @@ -27,11 +28,11 @@ @param noncelen The length of the nonce @param header The header for the session @param headerlen The length of the header (octets) - @param pt [out] The plaintext + @param pt [*1] The plaintext @param ptlen The length of the plaintext (octets) - @param ct [out] The ciphertext - @param tag [out] The destination tag - @param taglen [in/out] The max size and resulting size of the authentication tag + @param ct [*1] The ciphertext + @param tag [*1] The destination tag + @param taglen The max size and resulting size of the authentication tag @param direction Encrypt or Decrypt direction (0 or 1) @return CRYPT_OK if successful */ @@ -45,10 +46,15 @@ int ccm_memory(int cipher, unsigned char *tag, unsigned long *taglen, int direction) { - unsigned char PAD[16], ctr[16], CTRPAD[16], b; + unsigned char PAD[16], ctr[16], CTRPAD[16], ptTag[16], b, *pt_real; + unsigned char *pt_work = NULL; symmetric_key *skey; int err; unsigned long len, L, x, y, z, CTRlen; +#ifdef LTC_FAST + LTC_FAST_TYPE fastMask = ~0; /* initialize fastMask at all zeroes */ +#endif + unsigned char mask = 0xff; /* initialize mask at all zeroes */ if (uskey == NULL) { LTC_ARGCHK(key != NULL); @@ -62,6 +68,8 @@ int ccm_memory(int cipher, LTC_ARGCHK(tag != NULL); LTC_ARGCHK(taglen != NULL); + pt_real = pt; + #ifdef LTC_FAST if (16 % sizeof(LTC_FAST_TYPE)) { return CRYPT_INVALID_ARG; @@ -95,7 +103,7 @@ int ccm_memory(int cipher, nonce, noncelen, header, headerlen, pt, ptlen, - ct, + ct, tag, taglen, direction); } @@ -117,11 +125,6 @@ int ccm_memory(int cipher, L = 15 - noncelen; } - /* decrease noncelen to match L */ - if ((noncelen + L) > 15) { - noncelen = 15 - L; - } - /* allocate mem for the symmetric key */ if (uskey == NULL) { skey = XMALLOC(sizeof(*skey)); @@ -138,6 +141,15 @@ int ccm_memory(int cipher, skey = uskey; } + /* initialize buffer for pt */ + if (direction == CCM_DECRYPT && ptlen > 0) { + pt_work = XMALLOC(ptlen); + if (pt_work == NULL) { + goto error; + } + pt = pt_work; + } + /* form B_0 == flags | Nonce N | l(m) */ x = 0; PAD[x++] = (unsigned char)(((headerlen > 0) ? (1<<6) : 0) | @@ -174,7 +186,7 @@ int ccm_memory(int cipher, /* handle header */ if (headerlen > 0) { x = 0; - + /* store length */ if (headerlen < ((1UL<<16) - (1UL<<8))) { PAD[x++] ^= (headerlen>>8) & 255; @@ -200,11 +212,9 @@ int ccm_memory(int cipher, PAD[x++] ^= header[y]; } - /* remainder? */ - if (x != 0) { - if ((err = cipher_descriptor[cipher].ecb_encrypt(PAD, PAD, skey)) != CRYPT_OK) { - goto error; - } + /* remainder */ + if ((err = cipher_descriptor[cipher].ecb_encrypt(PAD, PAD, skey)) != CRYPT_OK) { + goto error; } } @@ -213,7 +223,7 @@ int ccm_memory(int cipher, /* flags */ ctr[x++] = (unsigned char)L-1; - + /* nonce */ for (y = 0; y < (16 - (L+1)); ++y) { ctr[x++] = nonce[y]; @@ -244,14 +254,14 @@ int ccm_memory(int cipher, /* xor the PT against the pad first */ for (z = 0; z < 16; z += sizeof(LTC_FAST_TYPE)) { - *((LTC_FAST_TYPE*)(&PAD[z])) ^= *((LTC_FAST_TYPE*)(&pt[y+z])); - *((LTC_FAST_TYPE*)(&ct[y+z])) = *((LTC_FAST_TYPE*)(&pt[y+z])) ^ *((LTC_FAST_TYPE*)(&CTRPAD[z])); + *(LTC_FAST_TYPE_PTR_CAST(&PAD[z])) ^= *(LTC_FAST_TYPE_PTR_CAST(&pt[y+z])); + *(LTC_FAST_TYPE_PTR_CAST(&ct[y+z])) = *(LTC_FAST_TYPE_PTR_CAST(&pt[y+z])) ^ *(LTC_FAST_TYPE_PTR_CAST(&CTRPAD[z])); } if ((err = cipher_descriptor[cipher].ecb_encrypt(PAD, PAD, skey)) != CRYPT_OK) { goto error; } } - } else { + } else { /* direction == CCM_DECRYPT */ for (; y < (ptlen & ~15); y += 16) { /* increment the ctr? */ for (z = 15; z > 15-L; z--) { @@ -264,15 +274,15 @@ int ccm_memory(int cipher, /* xor the PT against the pad last */ for (z = 0; z < 16; z += sizeof(LTC_FAST_TYPE)) { - *((LTC_FAST_TYPE*)(&pt[y+z])) = *((LTC_FAST_TYPE*)(&ct[y+z])) ^ *((LTC_FAST_TYPE*)(&CTRPAD[z])); - *((LTC_FAST_TYPE*)(&PAD[z])) ^= *((LTC_FAST_TYPE*)(&pt[y+z])); + *(LTC_FAST_TYPE_PTR_CAST(&pt[y+z])) = *(LTC_FAST_TYPE_PTR_CAST(&ct[y+z])) ^ *(LTC_FAST_TYPE_PTR_CAST(&CTRPAD[z])); + *(LTC_FAST_TYPE_PTR_CAST(&PAD[z])) ^= *(LTC_FAST_TYPE_PTR_CAST(&pt[y+z])); } if ((err = cipher_descriptor[cipher].ecb_encrypt(PAD, PAD, skey)) != CRYPT_OK) { goto error; } } - } - } + } + } #endif for (; y < ptlen; y++) { @@ -305,7 +315,7 @@ int ccm_memory(int cipher, } PAD[x++] ^= b; } - + if (x != 0) { if ((err = cipher_descriptor[cipher].ecb_encrypt(PAD, PAD, skey)) != CRYPT_OK) { goto error; @@ -323,20 +333,66 @@ int ccm_memory(int cipher, if (skey != uskey) { cipher_descriptor[cipher].done(skey); +#ifdef LTC_CLEAN_STACK + zeromem(skey, sizeof(*skey)); +#endif } - /* store the TAG */ - for (x = 0; x < 16 && x < *taglen; x++) { - tag[x] = PAD[x] ^ CTRPAD[x]; + if (direction == CCM_ENCRYPT) { + /* store the TAG */ + for (x = 0; x < 16 && x < *taglen; x++) { + tag[x] = PAD[x] ^ CTRPAD[x]; + } + *taglen = x; + } else { /* direction == CCM_DECRYPT */ + /* decrypt the tag */ + for (x = 0; x < 16 && x < *taglen; x++) { + ptTag[x] = tag[x] ^ CTRPAD[x]; + } + *taglen = x; + + /* check validity of the decrypted tag against the computed PAD (in constant time) */ + /* HACK: the boolean value of XMEM_NEQ becomes either 0 (CRYPT_OK) or 1 (CRYPT_ERR). + * there should be a better way of setting the correct error code in constant + * time. + */ + err = XMEM_NEQ(ptTag, PAD, *taglen); + + /* Zero the plaintext if the tag was invalid (in constant time) */ + if (ptlen > 0) { + y = 0; + mask *= 1 - err; /* mask = ( err ? 0 : 0xff ) */ +#ifdef LTC_FAST + fastMask *= 1 - err; + if (ptlen & ~15) { + for (; y < (ptlen & ~15); y += 16) { + for (z = 0; z < 16; z += sizeof(LTC_FAST_TYPE)) { + *(LTC_FAST_TYPE_PTR_CAST(&pt_real[y+z])) = *(LTC_FAST_TYPE_PTR_CAST(&pt[y+z])) & fastMask; + } + } + } +#endif + for (; y < ptlen; y++) { + pt_real[y] = pt[y] & mask; + } + } } - *taglen = x; #ifdef LTC_CLEAN_STACK - zeromem(skey, sizeof(*skey)); +#ifdef LTC_FAST + fastMask = 0; +#endif + mask = 0; zeromem(PAD, sizeof(PAD)); zeromem(CTRPAD, sizeof(CTRPAD)); + if (pt_work != NULL) { + zeromem(pt_work, ptlen); + } #endif error: + if (pt_work) { + XFREE(pt_work); + } if (skey != uskey) { XFREE(skey); } @@ -346,6 +402,6 @@ error: #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/encauth/ccm/ccm_process.c b/libtomcrypt/src/encauth/ccm/ccm_process.c new file mode 100644 index 0000000..8346d22 --- /dev/null +++ b/libtomcrypt/src/encauth/ccm/ccm_process.c @@ -0,0 +1,88 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + */ +#include "tomcrypt.h" + +#ifdef LTC_CCM_MODE + +/** + Process plaintext/ciphertext through CCM + @param ccm The CCM state + @param pt The plaintext + @param ptlen The plaintext length (ciphertext length is the same) + @param ct The ciphertext + @param direction Encrypt or Decrypt mode (CCM_ENCRYPT or CCM_DECRYPT) + @return CRYPT_OK on success + */ +int ccm_process(ccm_state *ccm, + unsigned char *pt, unsigned long ptlen, + unsigned char *ct, + int direction) +{ + unsigned char z, b; + unsigned long y; + int err; + + LTC_ARGCHK(ccm != NULL); + + /* Check aad has been correctly added */ + if (ccm->aadlen != ccm->current_aadlen) { + return CRYPT_ERROR; + } + + /* Check we do not process too much data */ + if (ccm->ptlen < ccm->current_ptlen + ptlen) { + return CRYPT_ERROR; + } + ccm->current_ptlen += ptlen; + + /* now handle the PT */ + if (ptlen > 0) { + LTC_ARGCHK(pt != NULL); + LTC_ARGCHK(ct != NULL); + + for (y = 0; y < ptlen; y++) { + /* increment the ctr? */ + if (ccm->CTRlen == 16) { + for (z = 15; z > 15-ccm->L; z--) { + ccm->ctr[z] = (ccm->ctr[z] + 1) & 255; + if (ccm->ctr[z]) break; + } + if ((err = cipher_descriptor[ccm->cipher].ecb_encrypt(ccm->ctr, ccm->CTRPAD, &ccm->K)) != CRYPT_OK) { + return err; + } + ccm->CTRlen = 0; + } + + /* if we encrypt we add the bytes to the MAC first */ + if (direction == CCM_ENCRYPT) { + b = pt[y]; + ct[y] = b ^ ccm->CTRPAD[ccm->CTRlen++]; + } else { + b = ct[y] ^ ccm->CTRPAD[ccm->CTRlen++]; + pt[y] = b; + } + + if (ccm->x == 16) { + if ((err = cipher_descriptor[ccm->cipher].ecb_encrypt(ccm->PAD, ccm->PAD, &ccm->K)) != CRYPT_OK) { + return err; + } + ccm->x = 0; + } + ccm->PAD[ccm->x++] ^= b; + } + } + + return CRYPT_OK; +} + +#endif + +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/encauth/ccm/ccm_reset.c b/libtomcrypt/src/encauth/ccm/ccm_reset.c new file mode 100644 index 0000000..c2d0cae --- /dev/null +++ b/libtomcrypt/src/encauth/ccm/ccm_reset.c @@ -0,0 +1,35 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + */ +#include "tomcrypt.h" + +#ifdef LTC_CCM_MODE + +/** + Reset a CCM state to as if you just called ccm_init(). This saves the initialization time. + @param ccm The CCM state to reset + @return CRYPT_OK on success +*/ +int ccm_reset(ccm_state *ccm) +{ + LTC_ARGCHK(ccm != NULL); + zeromem(ccm->PAD, sizeof(ccm->PAD)); + zeromem(ccm->ctr, sizeof(ccm->ctr)); + zeromem(ccm->CTRPAD, sizeof(ccm->CTRPAD)); + ccm->CTRlen = 0; + ccm->current_ptlen = 0; + ccm->current_aadlen = 0; + + return CRYPT_OK; +} + +#endif + +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/encauth/ccm/ccm_test.c b/libtomcrypt/src/encauth/ccm/ccm_test.c index 9b63ffc..6d1e1e6 100644 --- a/libtomcrypt/src/encauth/ccm/ccm_test.c +++ b/libtomcrypt/src/encauth/ccm/ccm_test.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" @@ -32,14 +30,14 @@ int ccm_test(void) int ptlen; unsigned char ct[64]; unsigned char tag[16]; - int taglen; + unsigned long taglen; } tests[] = { /* 13 byte nonce, 8 byte auth, 23 byte pt */ { - { 0xC0, 0xC1, 0xC2, 0xC3, 0xC4, 0xC5, 0xC6, 0xC7, + { 0xC0, 0xC1, 0xC2, 0xC3, 0xC4, 0xC5, 0xC6, 0xC7, 0xC8, 0xC9, 0xCA, 0xCB, 0xCC, 0xCD, 0xCE, 0xCF }, - { 0x00, 0x00, 0x00, 0x03, 0x02, 0x01, 0x00, 0xA0, + { 0x00, 0x00, 0x00, 0x03, 0x02, 0x01, 0x00, 0xA0, 0xA1, 0xA2, 0xA3, 0xA4, 0xA5 }, 13, { 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07 }, @@ -57,20 +55,20 @@ int ccm_test(void) /* 13 byte nonce, 12 byte header, 19 byte pt */ { - { 0xC0, 0xC1, 0xC2, 0xC3, 0xC4, 0xC5, 0xC6, 0xC7, + { 0xC0, 0xC1, 0xC2, 0xC3, 0xC4, 0xC5, 0xC6, 0xC7, 0xC8, 0xC9, 0xCA, 0xCB, 0xCC, 0xCD, 0xCE, 0xCF }, - { 0x00, 0x00, 0x00, 0x06, 0x05, 0x04, 0x03, 0xA0, + { 0x00, 0x00, 0x00, 0x06, 0x05, 0x04, 0x03, 0xA0, 0xA1, 0xA2, 0xA3, 0xA4, 0xA5 }, 13, { 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07, 0x08, 0x09, 0x0A, 0x0B }, 12, - { 0x0C, 0x0D, 0x0E, 0x0F, 0x10, 0x11, 0x12, 0x13, - 0x14, 0x15, 0x16, 0x17, 0x18, 0x19, 0x1A, 0x1B, + { 0x0C, 0x0D, 0x0E, 0x0F, 0x10, 0x11, 0x12, 0x13, + 0x14, 0x15, 0x16, 0x17, 0x18, 0x19, 0x1A, 0x1B, 0x1C, 0x1D, 0x1E }, 19, - { 0xA2, 0x8C, 0x68, 0x65, 0x93, 0x9A, 0x9A, 0x79, - 0xFA, 0xAA, 0x5C, 0x4C, 0x2A, 0x9D, 0x4A, 0x91, + { 0xA2, 0x8C, 0x68, 0x65, 0x93, 0x9A, 0x9A, 0x79, + 0xFA, 0xAA, 0x5C, 0x4C, 0x2A, 0x9D, 0x4A, 0x91, 0xCD, 0xAC, 0x8C }, { 0x96, 0xC8, 0x61, 0xB9, 0xC9, 0xE6, 0x1E, 0xF1 }, 8 @@ -78,7 +76,7 @@ int ccm_test(void) /* supplied by Brian Gladman */ { - { 0x40, 0x41, 0x42, 0x43, 0x44, 0x45, 0x46, 0x47, + { 0x40, 0x41, 0x42, 0x43, 0x44, 0x45, 0x46, 0x47, 0x48, 0x49, 0x4a, 0x4b, 0x4c, 0x4d, 0x4e, 0x4f }, { 0x10, 0x11, 0x12, 0x13, 0x14, 0x15, 0x16 }, 7, @@ -92,31 +90,34 @@ int ccm_test(void) }, { - { 0xc9, 0x7c, 0x1f, 0x67, 0xce, 0x37, 0x11, 0x85, + { 0xc9, 0x7c, 0x1f, 0x67, 0xce, 0x37, 0x11, 0x85, 0x51, 0x4a, 0x8a, 0x19, 0xf2, 0xbd, 0xd5, 0x2f }, - { 0x00, 0x50, 0x30, 0xf1, 0x84, 0x44, 0x08, 0xb5, + { 0x00, 0x50, 0x30, 0xf1, 0x84, 0x44, 0x08, 0xb5, 0x03, 0x97, 0x76, 0xe7, 0x0c }, 13, - { 0x08, 0x40, 0x0f, 0xd2, 0xe1, 0x28, 0xa5, 0x7c, - 0x50, 0x30, 0xf1, 0x84, 0x44, 0x08, 0xab, 0xae, + { 0x08, 0x40, 0x0f, 0xd2, 0xe1, 0x28, 0xa5, 0x7c, + 0x50, 0x30, 0xf1, 0x84, 0x44, 0x08, 0xab, 0xae, 0xa5, 0xb8, 0xfc, 0xba, 0x00, 0x00 }, 22, - { 0xf8, 0xba, 0x1a, 0x55, 0xd0, 0x2f, 0x85, 0xae, - 0x96, 0x7b, 0xb6, 0x2f, 0xb6, 0xcd, 0xa8, 0xeb, + { 0xf8, 0xba, 0x1a, 0x55, 0xd0, 0x2f, 0x85, 0xae, + 0x96, 0x7b, 0xb6, 0x2f, 0xb6, 0xcd, 0xa8, 0xeb, 0x7e, 0x78, 0xa0, 0x50 }, 20, - { 0xf3, 0xd0, 0xa2, 0xfe, 0x9a, 0x3d, 0xbf, 0x23, - 0x42, 0xa6, 0x43, 0xe4, 0x32, 0x46, 0xe8, 0x0c, + { 0xf3, 0xd0, 0xa2, 0xfe, 0x9a, 0x3d, 0xbf, 0x23, + 0x42, 0xa6, 0x43, 0xe4, 0x32, 0x46, 0xe8, 0x0c, 0x3c, 0x04, 0xd0, 0x19 }, { 0x78, 0x45, 0xce, 0x0b, 0x16, 0xf9, 0x76, 0x23 }, 8 }, }; - unsigned long taglen, x; - unsigned char buf[64], buf2[64], tag2[16], tag[16]; + unsigned long taglen, x, y; + unsigned char buf[64], buf2[64], tag[16], tag2[16], tag3[16], zero[64]; int err, idx; symmetric_key skey; + ccm_state ccm; + + zeromem(zero, 64); idx = find_cipher("aes"); if (idx == -1) { @@ -127,54 +128,130 @@ int ccm_test(void) } for (x = 0; x < (sizeof(tests)/sizeof(tests[0])); x++) { + for (y = 0; y < 2; y++) { taglen = tests[x].taglen; - if ((err = cipher_descriptor[idx].setup(tests[x].key, 16, 0, &skey)) != CRYPT_OK) { - return err; - } - - if ((err = ccm_memory(idx, - tests[x].key, 16, - &skey, - tests[x].nonce, tests[x].noncelen, - tests[x].header, tests[x].headerlen, - (unsigned char*)tests[x].pt, tests[x].ptlen, - buf, - tag, &taglen, 0)) != CRYPT_OK) { - return err; + if (y == 0) { + if ((err = cipher_descriptor[idx].setup(tests[x].key, 16, 0, &skey)) != CRYPT_OK) { + return err; + } + + if ((err = ccm_memory(idx, + tests[x].key, 16, + &skey, + tests[x].nonce, tests[x].noncelen, + tests[x].header, tests[x].headerlen, + (unsigned char*)tests[x].pt, tests[x].ptlen, + buf, + tag, &taglen, 0)) != CRYPT_OK) { + return err; + } + /* run a second time to make sure skey is not touched */ + if ((err = ccm_memory(idx, + tests[x].key, 16, + &skey, + tests[x].nonce, tests[x].noncelen, + tests[x].header, tests[x].headerlen, + (unsigned char*)tests[x].pt, tests[x].ptlen, + buf, + tag, &taglen, 0)) != CRYPT_OK) { + return err; + } + } else { + if ((err = ccm_init(&ccm, idx, tests[x].key, 16, tests[x].ptlen, tests[x].taglen, tests[x].headerlen)) != CRYPT_OK) { + return err; + } + if ((err = ccm_add_nonce(&ccm, tests[x].nonce, tests[x].noncelen)) != CRYPT_OK) { + return err; + } + if ((err = ccm_add_aad(&ccm, tests[x].header, tests[x].headerlen)) != CRYPT_OK) { + return err; + } + if ((err = ccm_process(&ccm, (unsigned char*)tests[x].pt, tests[x].ptlen, buf, CCM_ENCRYPT)) != CRYPT_OK) { + return err; + } + if ((err = ccm_done(&ccm, tag, &taglen)) != CRYPT_OK) { + return err; + } } - if (XMEMCMP(buf, tests[x].ct, tests[x].ptlen)) { + if (compare_testvector(buf, tests[x].ptlen, tests[x].ct, tests[x].ptlen, "CCM encrypt data", x)) { return CRYPT_FAIL_TESTVECTOR; } - if (XMEMCMP(tag, tests[x].tag, tests[x].taglen)) { + if (compare_testvector(tag, taglen, tests[x].tag, tests[x].taglen, "CCM encrypt tag", x)) { return CRYPT_FAIL_TESTVECTOR; } - if ((err = ccm_memory(idx, - tests[x].key, 16, - NULL, - tests[x].nonce, tests[x].noncelen, - tests[x].header, tests[x].headerlen, - buf2, tests[x].ptlen, - buf, - tag2, &taglen, 1 )) != CRYPT_OK) { - return err; + if (y == 0) { + XMEMCPY(tag3, tests[x].tag, tests[x].taglen); + taglen = tests[x].taglen; + if ((err = ccm_memory(idx, + tests[x].key, 16, + NULL, + tests[x].nonce, tests[x].noncelen, + tests[x].header, tests[x].headerlen, + buf2, tests[x].ptlen, + buf, + tag3, &taglen, 1 )) != CRYPT_OK) { + return err; + } + } else { + if ((err = ccm_init(&ccm, idx, tests[x].key, 16, tests[x].ptlen, tests[x].taglen, tests[x].headerlen)) != CRYPT_OK) { + return err; + } + if ((err = ccm_add_nonce(&ccm, tests[x].nonce, tests[x].noncelen)) != CRYPT_OK) { + return err; + } + if ((err = ccm_add_aad(&ccm, tests[x].header, tests[x].headerlen)) != CRYPT_OK) { + return err; + } + if ((err = ccm_process(&ccm, buf2, tests[x].ptlen, buf, CCM_DECRYPT)) != CRYPT_OK) { + return err; + } + if ((err = ccm_done(&ccm, tag2, &taglen)) != CRYPT_OK) { + return err; + } } - if (XMEMCMP(buf2, tests[x].pt, tests[x].ptlen)) { + + if (compare_testvector(buf2, tests[x].ptlen, tests[x].pt, tests[x].ptlen, "CCM decrypt data", x)) { return CRYPT_FAIL_TESTVECTOR; } - if (XMEMCMP(tag2, tests[x].tag, tests[x].taglen)) { - return CRYPT_FAIL_TESTVECTOR; + if (y == 0) { + /* check if decryption with the wrong tag does not reveal the plaintext */ + XMEMCPY(tag3, tests[x].tag, tests[x].taglen); + tag3[0] ^= 0xff; /* set the tag to the wrong value */ + taglen = tests[x].taglen; + if ((err = ccm_memory(idx, + tests[x].key, 16, + NULL, + tests[x].nonce, tests[x].noncelen, + tests[x].header, tests[x].headerlen, + buf2, tests[x].ptlen, + buf, + tag3, &taglen, 1 )) != CRYPT_ERROR) { + return CRYPT_FAIL_TESTVECTOR; + } + if (compare_testvector(buf2, tests[x].ptlen, zero, tests[x].ptlen, "CCM decrypt wrong tag", x)) { + return CRYPT_FAIL_TESTVECTOR; + } + } else { + if (compare_testvector(tag2, taglen, tests[x].tag, tests[x].taglen, "CCM decrypt tag", x)) { + return CRYPT_FAIL_TESTVECTOR; + } + } + + if (y == 0) { + cipher_descriptor[idx].done(&skey); } - cipher_descriptor[idx].done(&skey); + } } + return CRYPT_OK; #endif } #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/encauth/chachapoly/chacha20poly1305_add_aad.c b/libtomcrypt/src/encauth/chachapoly/chacha20poly1305_add_aad.c new file mode 100644 index 0000000..0c0cf9d --- /dev/null +++ b/libtomcrypt/src/encauth/chachapoly/chacha20poly1305_add_aad.c @@ -0,0 +1,38 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + */ + +#include "tomcrypt.h" + +#ifdef LTC_CHACHA20POLY1305_MODE + +/** + Add AAD to the ChaCha20Poly1305 state + @param st The ChaCha20Poly1305 state + @param in The additional authentication data to add to the ChaCha20Poly1305 state + @param inlen The length of the ChaCha20Poly1305 data. + @return CRYPT_OK on success + */ +int chacha20poly1305_add_aad(chacha20poly1305_state *st, const unsigned char *in, unsigned long inlen) +{ + int err; + + if (inlen == 0) return CRYPT_OK; /* nothing to do */ + LTC_ARGCHK(st != NULL); + + if (st->aadflg == 0) return CRYPT_ERROR; + if ((err = poly1305_process(&st->poly, in, inlen)) != CRYPT_OK) return err; + st->aadlen += (ulong64)inlen; + return CRYPT_OK; +} + +#endif + +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/encauth/chachapoly/chacha20poly1305_decrypt.c b/libtomcrypt/src/encauth/chachapoly/chacha20poly1305_decrypt.c new file mode 100644 index 0000000..1797932 --- /dev/null +++ b/libtomcrypt/src/encauth/chachapoly/chacha20poly1305_decrypt.c @@ -0,0 +1,49 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + */ + +#include "tomcrypt.h" + +#ifdef LTC_CHACHA20POLY1305_MODE + +/** + Decrypt bytes of ciphertext with ChaCha20Poly1305 + @param st The ChaCha20Poly1305 state + @param in The ciphertext + @param inlen The length of the input (octets) + @param out [out] The plaintext (length inlen) + @return CRYPT_OK if successful +*/ +int chacha20poly1305_decrypt(chacha20poly1305_state *st, const unsigned char *in, unsigned long inlen, unsigned char *out) +{ + unsigned char padzero[16] = { 0 }; + unsigned long padlen; + int err; + + if (inlen == 0) return CRYPT_OK; /* nothing to do */ + LTC_ARGCHK(st != NULL); + + if (st->aadflg) { + padlen = 16 - (unsigned long)(st->aadlen % 16); + if (padlen < 16) { + if ((err = poly1305_process(&st->poly, padzero, padlen)) != CRYPT_OK) return err; + } + st->aadflg = 0; /* no more AAD */ + } + if (st->aadflg) st->aadflg = 0; /* no more AAD */ + if ((err = poly1305_process(&st->poly, in, inlen)) != CRYPT_OK) return err; + if ((err = chacha_crypt(&st->chacha, in, inlen, out)) != CRYPT_OK) return err; + st->ctlen += (ulong64)inlen; + return CRYPT_OK; +} + +#endif + +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/encauth/chachapoly/chacha20poly1305_done.c b/libtomcrypt/src/encauth/chachapoly/chacha20poly1305_done.c new file mode 100644 index 0000000..127a7f0 --- /dev/null +++ b/libtomcrypt/src/encauth/chachapoly/chacha20poly1305_done.c @@ -0,0 +1,46 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + */ + +#include "tomcrypt.h" + +#ifdef LTC_CHACHA20POLY1305_MODE + +/** + Terminate a ChaCha20Poly1305 stream + @param st The ChaCha20Poly1305 state + @param tag [out] The destination for the MAC tag + @param taglen [in/out] The length of the MAC tag + @return CRYPT_OK on success + */ +int chacha20poly1305_done(chacha20poly1305_state *st, unsigned char *tag, unsigned long *taglen) +{ + unsigned char padzero[16] = { 0 }; + unsigned long padlen; + unsigned char buf[16]; + int err; + + LTC_ARGCHK(st != NULL); + + padlen = 16 - (unsigned long)(st->ctlen % 16); + if (padlen < 16) { + if ((err = poly1305_process(&st->poly, padzero, padlen)) != CRYPT_OK) return err; + } + STORE64L(st->aadlen, buf); + STORE64L(st->ctlen, buf + 8); + if ((err = poly1305_process(&st->poly, buf, 16)) != CRYPT_OK) return err; + if ((err = poly1305_done(&st->poly, tag, taglen)) != CRYPT_OK) return err; + if ((err = chacha_done(&st->chacha)) != CRYPT_OK) return err; + return CRYPT_OK; +} + +#endif + +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/encauth/chachapoly/chacha20poly1305_encrypt.c b/libtomcrypt/src/encauth/chachapoly/chacha20poly1305_encrypt.c new file mode 100644 index 0000000..c53c4a6 --- /dev/null +++ b/libtomcrypt/src/encauth/chachapoly/chacha20poly1305_encrypt.c @@ -0,0 +1,48 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + */ + +#include "tomcrypt.h" + +#ifdef LTC_CHACHA20POLY1305_MODE + +/** + Encrypt bytes of ciphertext with ChaCha20Poly1305 + @param st The ChaCha20Poly1305 state + @param in The plaintext + @param inlen The length of the input (octets) + @param out [out] The ciphertext (length inlen) + @return CRYPT_OK if successful +*/ +int chacha20poly1305_encrypt(chacha20poly1305_state *st, const unsigned char *in, unsigned long inlen, unsigned char *out) +{ + unsigned char padzero[16] = { 0 }; + unsigned long padlen; + int err; + + if (inlen == 0) return CRYPT_OK; /* nothing to do */ + LTC_ARGCHK(st != NULL); + + if ((err = chacha_crypt(&st->chacha, in, inlen, out)) != CRYPT_OK) return err; + if (st->aadflg) { + padlen = 16 - (unsigned long)(st->aadlen % 16); + if (padlen < 16) { + if ((err = poly1305_process(&st->poly, padzero, padlen)) != CRYPT_OK) return err; + } + st->aadflg = 0; /* no more AAD */ + } + if ((err = poly1305_process(&st->poly, out, inlen)) != CRYPT_OK) return err; + st->ctlen += (ulong64)inlen; + return CRYPT_OK; +} + +#endif + +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/encauth/chachapoly/chacha20poly1305_init.c b/libtomcrypt/src/encauth/chachapoly/chacha20poly1305_init.c new file mode 100644 index 0000000..2799e98 --- /dev/null +++ b/libtomcrypt/src/encauth/chachapoly/chacha20poly1305_init.c @@ -0,0 +1,30 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + */ + +#include "tomcrypt.h" + +#ifdef LTC_CHACHA20POLY1305_MODE + +/** + Initialize an ChaCha20Poly1305 context (only the key) + @param st [out] The destination of the ChaCha20Poly1305 state + @param key The secret key + @param keylen The length of the secret key (octets) + @return CRYPT_OK if successful +*/ +int chacha20poly1305_init(chacha20poly1305_state *st, const unsigned char *key, unsigned long keylen) +{ + return chacha_setup(&st->chacha, key, keylen, 20); +} + +#endif + +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/encauth/chachapoly/chacha20poly1305_memory.c b/libtomcrypt/src/encauth/chachapoly/chacha20poly1305_memory.c new file mode 100644 index 0000000..54e2011 --- /dev/null +++ b/libtomcrypt/src/encauth/chachapoly/chacha20poly1305_memory.c @@ -0,0 +1,74 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + */ + +#include "tomcrypt.h" + +#ifdef LTC_CHACHA20POLY1305_MODE + +/** + Process an entire GCM packet in one call. + @param key The secret key + @param keylen The length of the secret key + @param iv The initialization vector + @param ivlen The length of the initialization vector + @param aad The additional authentication data (header) + @param aadlen The length of the aad + @param in The plaintext + @param inlen The length of the plaintext (ciphertext length is the same) + @param out The ciphertext + @param tag [out] The MAC tag + @param taglen [in/out] The MAC tag length + @param direction Encrypt or Decrypt mode (CHACHA20POLY1305_ENCRYPT or CHACHA20POLY1305_DECRYPT) + @return CRYPT_OK on success + */ +int chacha20poly1305_memory(const unsigned char *key, unsigned long keylen, + const unsigned char *iv, unsigned long ivlen, + const unsigned char *aad, unsigned long aadlen, + const unsigned char *in, unsigned long inlen, + unsigned char *out, + unsigned char *tag, unsigned long *taglen, + int direction) +{ + chacha20poly1305_state st; + int err; + + LTC_ARGCHK(key != NULL); + LTC_ARGCHK(iv != NULL); + LTC_ARGCHK(in != NULL); + LTC_ARGCHK(out != NULL); + LTC_ARGCHK(tag != NULL); + + if ((err = chacha20poly1305_init(&st, key, keylen)) != CRYPT_OK) { goto LBL_ERR; } + if ((err = chacha20poly1305_setiv(&st, iv, ivlen)) != CRYPT_OK) { goto LBL_ERR; } + if (aad && aadlen > 0) { + if ((err = chacha20poly1305_add_aad(&st, aad, aadlen)) != CRYPT_OK) { goto LBL_ERR; } + } + if (direction == CHACHA20POLY1305_ENCRYPT) { + if ((err = chacha20poly1305_encrypt(&st, in, inlen, out)) != CRYPT_OK) { goto LBL_ERR; } + } + else if (direction == CHACHA20POLY1305_DECRYPT) { + if ((err = chacha20poly1305_decrypt(&st, in, inlen, out)) != CRYPT_OK) { goto LBL_ERR; } + } + else { + err = CRYPT_INVALID_ARG; + goto LBL_ERR; + } + err = chacha20poly1305_done(&st, tag, taglen); +LBL_ERR: +#ifdef LTC_CLEAN_STACK + zeromem(&st, sizeof(chacha20poly1305_state)); +#endif + return err; +} + +#endif + +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/encauth/chachapoly/chacha20poly1305_setiv.c b/libtomcrypt/src/encauth/chachapoly/chacha20poly1305_setiv.c new file mode 100644 index 0000000..b87666e --- /dev/null +++ b/libtomcrypt/src/encauth/chachapoly/chacha20poly1305_setiv.c @@ -0,0 +1,68 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + */ + +#include "tomcrypt.h" + +#ifdef LTC_CHACHA20POLY1305_MODE + +/** + Set IV + counter data to the ChaCha20Poly1305 state and reset the context + @param st The ChaCha20Poly1305 state + @param iv The IV data to add + @param ivlen The length of the IV (must be 12 or 8) + @return CRYPT_OK on success + */ +int chacha20poly1305_setiv(chacha20poly1305_state *st, const unsigned char *iv, unsigned long ivlen) +{ + chacha_state tmp_st; + int i, err; + unsigned char polykey[32]; + + LTC_ARGCHK(st != NULL); + LTC_ARGCHK(iv != NULL); + LTC_ARGCHK(ivlen == 12 || ivlen == 8); + + /* set IV for chacha20 */ + if (ivlen == 12) { + /* IV 96bit */ + if ((err = chacha_ivctr32(&st->chacha, iv, ivlen, 1)) != CRYPT_OK) return err; + } + else { + /* IV 64bit */ + if ((err = chacha_ivctr64(&st->chacha, iv, ivlen, 1)) != CRYPT_OK) return err; + } + + /* copy chacha20 key to temporary state */ + for(i = 0; i < 12; i++) tmp_st.input[i] = st->chacha.input[i]; + tmp_st.rounds = 20; + /* set IV */ + if (ivlen == 12) { + /* IV 32bit */ + if ((err = chacha_ivctr32(&tmp_st, iv, ivlen, 0)) != CRYPT_OK) return err; + } + else { + /* IV 64bit */ + if ((err = chacha_ivctr64(&tmp_st, iv, ivlen, 0)) != CRYPT_OK) return err; + } + /* (re)generate new poly1305 key */ + if ((err = chacha_keystream(&tmp_st, polykey, 32)) != CRYPT_OK) return err; + /* (re)initialise poly1305 */ + if ((err = poly1305_init(&st->poly, polykey, 32)) != CRYPT_OK) return err; + st->ctlen = 0; + st->aadlen = 0; + st->aadflg = 1; + + return CRYPT_OK; +} + +#endif + +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/encauth/chachapoly/chacha20poly1305_setiv_rfc7905.c b/libtomcrypt/src/encauth/chachapoly/chacha20poly1305_setiv_rfc7905.c new file mode 100644 index 0000000..7136a1e --- /dev/null +++ b/libtomcrypt/src/encauth/chachapoly/chacha20poly1305_setiv_rfc7905.c @@ -0,0 +1,40 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + */ + +#include "tomcrypt.h" + +#ifdef LTC_CHACHA20POLY1305_MODE + +/** + Set IV + counter data (with RFC7905-magic) to the ChaCha20Poly1305 state and reset the context + @param st The ChaCha20Poly1305 state + @param iv The IV data to add + @param ivlen The length of the IV (must be 12 or 8) + @param sequence_number 64bit sequence number which is incorporated into IV as described in RFC7905 + @return CRYPT_OK on success + */ +int chacha20poly1305_setiv_rfc7905(chacha20poly1305_state *st, const unsigned char *iv, unsigned long ivlen, ulong64 sequence_number) +{ + int i; + unsigned char combined_iv[12] = { 0 }; + + LTC_ARGCHK(st != NULL); + LTC_ARGCHK(iv != NULL); + LTC_ARGCHK(ivlen == 12); + + STORE64L(sequence_number, combined_iv + 4); + for (i = 0; i < 12; i++) combined_iv[i] = iv[i] ^ combined_iv[i]; + return chacha20poly1305_setiv(st, combined_iv, 12); +} + +#endif + +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/encauth/chachapoly/chacha20poly1305_test.c b/libtomcrypt/src/encauth/chachapoly/chacha20poly1305_test.c new file mode 100644 index 0000000..2ba88dd --- /dev/null +++ b/libtomcrypt/src/encauth/chachapoly/chacha20poly1305_test.c @@ -0,0 +1,134 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + */ + +#include "tomcrypt.h" + +#ifdef LTC_CHACHA20POLY1305_MODE + +int chacha20poly1305_test(void) +{ +#ifndef LTC_TEST + return CRYPT_NOP; +#else + chacha20poly1305_state st1, st2; + unsigned char k[] = { 0x80, 0x81, 0x82, 0x83, 0x84, 0x85, 0x86, 0x87, 0x88, 0x89, 0x8a, 0x8b, 0x8c, 0x8d, 0x8e, 0x8f, 0x90, 0x91, 0x92, 0x93, 0x94, 0x95, 0x96, 0x97, 0x98, 0x99, 0x9a, 0x9b, 0x9c, 0x9d, 0x9e, 0x9f }; + unsigned char i12[] = { 0x07, 0x00, 0x00, 0x00, 0x40, 0x41, 0x42, 0x43, 0x44, 0x45, 0x46, 0x47 }; + unsigned char i8[] = { 0x07, 0x00, 0x00, 0x00, 0x40, 0x41, 0x42, 0x43 }; + unsigned char aad[] = { 0x50, 0x51, 0x52, 0x53, 0xc0, 0xc1, 0xc2, 0xc3, 0xc4, 0xc5, 0xc6, 0xc7 }; + unsigned char enc[] = { 0xD3, 0x1A, 0x8D, 0x34, 0x64, 0x8E, 0x60, 0xDB, 0x7B, 0x86, 0xAF, 0xBC, 0x53, 0xEF, 0x7E, 0xC2, + 0xA4, 0xAD, 0xED, 0x51, 0x29, 0x6E, 0x08, 0xFE, 0xA9, 0xE2, 0xB5, 0xA7, 0x36, 0xEE, 0x62, 0xD6, + 0x3D, 0xBE, 0xA4, 0x5E, 0x8C, 0xA9, 0x67, 0x12, 0x82, 0xFA, 0xFB, 0x69, 0xDA, 0x92, 0x72, 0x8B, + 0x1A, 0x71, 0xDE, 0x0A, 0x9E, 0x06, 0x0B, 0x29, 0x05, 0xD6, 0xA5, 0xB6, 0x7E, 0xCD, 0x3B, 0x36, + 0x92, 0xDD, 0xBD, 0x7F, 0x2D, 0x77, 0x8B, 0x8C, 0x98, 0x03, 0xAE, 0xE3, 0x28, 0x09, 0x1B, 0x58, + 0xFA, 0xB3, 0x24, 0xE4, 0xFA, 0xD6, 0x75, 0x94, 0x55, 0x85, 0x80, 0x8B, 0x48, 0x31, 0xD7, 0xBC, + 0x3F, 0xF4, 0xDE, 0xF0, 0x8E, 0x4B, 0x7A, 0x9D, 0xE5, 0x76, 0xD2, 0x65, 0x86, 0xCE, 0xC6, 0x4B, + 0x61, 0x16 }; + unsigned char tag[] = { 0x1A, 0xE1, 0x0B, 0x59, 0x4F, 0x09, 0xE2, 0x6A, 0x7E, 0x90, 0x2E, 0xCB, 0xD0, 0x60, 0x06, 0x91 }; + char m[] = "Ladies and Gentlemen of the class of '99: If I could offer you only one tip for the future, sunscreen would be it."; + unsigned long mlen = strlen(m); + unsigned long len; + unsigned char rfc7905_pt[] = { 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07, 0x08, 0x09, 0x0A, 0x0B, 0x0C, 0x0D, 0x0E, 0x0F }; + unsigned char rfc7905_enc[] = { 0xE4, 0x62, 0x85, 0xB4, 0x29, 0x95, 0x34, 0x96, 0xAB, 0xFB, 0x67, 0xCD, 0xAE, 0xAC, 0x94, 0x1E }; + unsigned char rfc7905_tag[] = { 0x16, 0x2C, 0x92, 0x48, 0x2A, 0xDB, 0xD3, 0x5D, 0x48, 0xBE, 0xC6, 0xFF, 0x10, 0x9C, 0xBA, 0xE4 }; + unsigned char ct[1000], pt[1000], emac[16], dmac[16]; + int err; + + /* encrypt IV 96bit */ + if ((err = chacha20poly1305_init(&st1, k, sizeof(k))) != CRYPT_OK) return err; + if ((err = chacha20poly1305_setiv(&st1, i12, sizeof(i12))) != CRYPT_OK) return err; + if ((err = chacha20poly1305_add_aad(&st1, aad, sizeof(aad))) != CRYPT_OK) return err; + /* encrypt piece by piece */ + if ((err = chacha20poly1305_encrypt(&st1, (unsigned char *)m, 25, ct)) != CRYPT_OK) return err; + if ((err = chacha20poly1305_encrypt(&st1, (unsigned char *)m + 25, 10, ct + 25)) != CRYPT_OK) return err; + if ((err = chacha20poly1305_encrypt(&st1, (unsigned char *)m + 35, 35, ct + 35)) != CRYPT_OK) return err; + if ((err = chacha20poly1305_encrypt(&st1, (unsigned char *)m + 70, 5, ct + 70)) != CRYPT_OK) return err; + if ((err = chacha20poly1305_encrypt(&st1, (unsigned char *)m + 75, 5, ct + 75)) != CRYPT_OK) return err; + if ((err = chacha20poly1305_encrypt(&st1, (unsigned char *)m + 80, mlen - 80, ct + 80)) != CRYPT_OK) return err; + len = sizeof(emac); + if ((err = chacha20poly1305_done(&st1, emac, &len)) != CRYPT_OK) return err; + + if (compare_testvector(ct, mlen, enc, sizeof(enc), "ENC-CT", 1) != 0) return CRYPT_FAIL_TESTVECTOR; + if (compare_testvector(emac, len, tag, sizeof(tag), "ENC-TAG", 2) != 0) return CRYPT_FAIL_TESTVECTOR; + + /* decrypt IV 96bit */ + if ((err = chacha20poly1305_init(&st2, k, sizeof(k))) != CRYPT_OK) return err; + if ((err = chacha20poly1305_setiv(&st2, i12, sizeof(i12))) != CRYPT_OK) return err; + if ((err = chacha20poly1305_add_aad(&st2, aad, sizeof(aad))) != CRYPT_OK) return err; + if ((err = chacha20poly1305_decrypt(&st2, ct, 21, pt)) != CRYPT_OK) return err; + if ((err = chacha20poly1305_decrypt(&st2, ct + 21, mlen - 21, pt + 21)) != CRYPT_OK) return err; + len = sizeof(dmac); + if ((err = chacha20poly1305_done(&st2, dmac, &len)) != CRYPT_OK) return err; + + if (compare_testvector(pt, mlen, m, mlen, "DEC-PT", 3) != 0) return CRYPT_FAIL_TESTVECTOR; + if (compare_testvector(dmac, len, tag, sizeof(tag), "DEC-TAG", 4) != 0) return CRYPT_FAIL_TESTVECTOR; + + /* chacha20poly1305_memory - encrypt */ + len = sizeof(emac); + if ((err = chacha20poly1305_memory(k, sizeof(k), i12, sizeof(i12), aad, sizeof(aad), (unsigned char *)m, + mlen, ct, emac, &len, CHACHA20POLY1305_ENCRYPT)) != CRYPT_OK) return err; + if (compare_testvector(ct, mlen, enc, sizeof(enc), "ENC-CT2", 1) != 0) return CRYPT_FAIL_TESTVECTOR; + if (compare_testvector(emac, len, tag, sizeof(tag), "ENC-TAG2", 2) != 0) return CRYPT_FAIL_TESTVECTOR; + + /* chacha20poly1305_memory - decrypt */ + len = sizeof(dmac); + if ((err = chacha20poly1305_memory(k, sizeof(k), i12, sizeof(i12), aad, sizeof(aad), + ct, mlen, pt, dmac, &len, CHACHA20POLY1305_DECRYPT)) != CRYPT_OK) return err; + if (compare_testvector(pt, mlen, m, mlen, "DEC-PT2", 3) != 0) return CRYPT_FAIL_TESTVECTOR; + if (compare_testvector(dmac, len, tag, sizeof(tag), "DEC-TAG2", 4) != 0) return CRYPT_FAIL_TESTVECTOR; + + /* encrypt - rfc7905 */ + if ((err = chacha20poly1305_init(&st1, k, sizeof(k))) != CRYPT_OK) return err; + if ((err = chacha20poly1305_setiv_rfc7905(&st1, i12, sizeof(i12), CONST64(0x1122334455667788))) != CRYPT_OK) return err; + if ((err = chacha20poly1305_add_aad(&st1, aad, sizeof(aad))) != CRYPT_OK) return err; + if ((err = chacha20poly1305_encrypt(&st1, rfc7905_pt, 16, ct)) != CRYPT_OK) return err; + len = sizeof(emac); + if ((err = chacha20poly1305_done(&st1, emac, &len)) != CRYPT_OK) return err; + + if (compare_testvector(ct, 16, rfc7905_enc, 16, "ENC-CT3", 1) != 0) return CRYPT_FAIL_TESTVECTOR; + if (compare_testvector(emac, len, rfc7905_tag, 16, "ENC-TAG3", 2) != 0) return CRYPT_FAIL_TESTVECTOR; + + /* decrypt - rfc7905 */ + if ((err = chacha20poly1305_init(&st1, k, sizeof(k))) != CRYPT_OK) return err; + if ((err = chacha20poly1305_setiv_rfc7905(&st1, i12, sizeof(i12), CONST64(0x1122334455667788))) != CRYPT_OK) return err; + if ((err = chacha20poly1305_add_aad(&st1, aad, sizeof(aad))) != CRYPT_OK) return err; + if ((err = chacha20poly1305_decrypt(&st1, ct, 16, pt)) != CRYPT_OK) return err; + len = sizeof(dmac); + if ((err = chacha20poly1305_done(&st1, dmac, &len)) != CRYPT_OK) return err; + + if (compare_testvector(pt, 16, rfc7905_pt, 16, "DEC-CT3", 1) != 0) return CRYPT_FAIL_TESTVECTOR; + if (compare_testvector(dmac, len, rfc7905_tag, 16, "DEC-TAG3", 2) != 0) return CRYPT_FAIL_TESTVECTOR; + + /* encrypt IV 64bit */ + if ((err = chacha20poly1305_init(&st1, k, sizeof(k))) != CRYPT_OK) return err; + if ((err = chacha20poly1305_setiv(&st1, i8, sizeof(i8))) != CRYPT_OK) return err; + if ((err = chacha20poly1305_add_aad(&st1, aad, sizeof(aad))) != CRYPT_OK) return err; + if ((err = chacha20poly1305_encrypt(&st1, (unsigned char *)m, mlen, ct)) != CRYPT_OK) return err; + len = sizeof(emac); + if ((err = chacha20poly1305_done(&st1, emac, &len)) != CRYPT_OK) return err; + + /* decrypt IV 64bit */ + if ((err = chacha20poly1305_init(&st2, k, sizeof(k))) != CRYPT_OK) return err; + if ((err = chacha20poly1305_setiv(&st2, i8, sizeof(i8))) != CRYPT_OK) return err; + if ((err = chacha20poly1305_add_aad(&st2, aad, sizeof(aad))) != CRYPT_OK) return err; + if ((err = chacha20poly1305_decrypt(&st2, ct, mlen, pt)) != CRYPT_OK) return err; + len = sizeof(dmac); + if ((err = chacha20poly1305_done(&st2, dmac, &len)) != CRYPT_OK) return err; + + if (compare_testvector(pt, mlen, m, mlen, "DEC-PT4", 1) != 0) return CRYPT_FAIL_TESTVECTOR; + if (compare_testvector(dmac, len, emac, len, "DEC-TAG4", 2) != 0) return CRYPT_FAIL_TESTVECTOR; + + return CRYPT_OK; +#endif +} + +#endif + +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/encauth/eax/eax_addheader.c b/libtomcrypt/src/encauth/eax/eax_addheader.c index d06e921..5545336 100644 --- a/libtomcrypt/src/encauth/eax/eax_addheader.c +++ b/libtomcrypt/src/encauth/eax/eax_addheader.c @@ -5,25 +5,23 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ -/** +/** @file eax_addheader.c - EAX implementation, add meta-data, by Tom St Denis + EAX implementation, add meta-data, by Tom St Denis */ #include "tomcrypt.h" #ifdef LTC_EAX_MODE -/** - add header (metadata) to the stream +/** + add header (metadata) to the stream @param eax The current EAX state @param header The header (meta-data) data you wish to add to the state @param length The length of the header data @return CRYPT_OK if successful */ -int eax_addheader(eax_state *eax, const unsigned char *header, +int eax_addheader(eax_state *eax, const unsigned char *header, unsigned long length) { LTC_ARGCHK(eax != NULL); @@ -33,6 +31,6 @@ int eax_addheader(eax_state *eax, const unsigned char *header, #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/encauth/eax/eax_decrypt.c b/libtomcrypt/src/encauth/eax/eax_decrypt.c index 185330f..b140716 100644 --- a/libtomcrypt/src/encauth/eax/eax_decrypt.c +++ b/libtomcrypt/src/encauth/eax/eax_decrypt.c @@ -5,11 +5,9 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ -/** +/** @file eax_decrypt.c EAX implementation, decrypt block, by Tom St Denis */ @@ -17,7 +15,7 @@ #ifdef LTC_EAX_MODE -/** +/** Decrypt data with the EAX protocol @param eax The EAX state @param ct The ciphertext @@ -25,11 +23,11 @@ @param length The length (octets) of the ciphertext @return CRYPT_OK if successful */ -int eax_decrypt(eax_state *eax, const unsigned char *ct, unsigned char *pt, +int eax_decrypt(eax_state *eax, const unsigned char *ct, unsigned char *pt, unsigned long length) { int err; - + LTC_ARGCHK(eax != NULL); LTC_ARGCHK(pt != NULL); LTC_ARGCHK(ct != NULL); @@ -45,6 +43,6 @@ int eax_decrypt(eax_state *eax, const unsigned char *ct, unsigned char *pt, #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/encauth/eax/eax_decrypt_verify_memory.c b/libtomcrypt/src/encauth/eax/eax_decrypt_verify_memory.c index 7956142..8c6540f 100644 --- a/libtomcrypt/src/encauth/eax/eax_decrypt_verify_memory.c +++ b/libtomcrypt/src/encauth/eax/eax_decrypt_verify_memory.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /** @@ -57,6 +55,9 @@ int eax_decrypt_verify_memory(int cipher, /* default to zero */ *stat = 0; + /* limit taglen */ + taglen = MIN(taglen, MAXBLOCKSIZE); + /* allocate ram */ buf = XMALLOC(taglen); eax = XMALLOC(sizeof(*eax)); @@ -77,17 +78,17 @@ int eax_decrypt_verify_memory(int cipher, if ((err = eax_decrypt(eax, ct, pt, ctlen)) != CRYPT_OK) { goto LBL_ERR; } - + buflen = taglen; if ((err = eax_done(eax, buf, &buflen)) != CRYPT_OK) { goto LBL_ERR; } /* compare tags */ - if (buflen >= taglen && XMEMCMP(buf, tag, taglen) == 0) { + if (buflen >= taglen && XMEM_NEQ(buf, tag, taglen) == 0) { *stat = 1; } - + err = CRYPT_OK; LBL_ERR: #ifdef LTC_CLEAN_STACK @@ -103,6 +104,6 @@ LBL_ERR: #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/encauth/eax/eax_done.c b/libtomcrypt/src/encauth/eax/eax_done.c index 0bb0b33..b00bfe0 100644 --- a/libtomcrypt/src/encauth/eax/eax_done.c +++ b/libtomcrypt/src/encauth/eax/eax_done.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /** @@ -51,7 +49,7 @@ int eax_done(eax_state *eax, unsigned char *tag, unsigned long *taglen) /* finish ctomac */ len = MAXBLOCKSIZE; if ((err = omac_done(&eax->ctomac, ctmac, &len)) != CRYPT_OK) { - goto LBL_ERR; + goto LBL_ERR; } /* finish headeromac */ @@ -59,7 +57,7 @@ int eax_done(eax_state *eax, unsigned char *tag, unsigned long *taglen) /* note we specifically don't reset len so the two lens are minimal */ if ((err = omac_done(&eax->headeromac, headermac, &len)) != CRYPT_OK) { - goto LBL_ERR; + goto LBL_ERR; } /* terminate the CTR chain */ @@ -89,6 +87,6 @@ LBL_ERR: #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/encauth/eax/eax_encrypt.c b/libtomcrypt/src/encauth/eax/eax_encrypt.c index 79f9dc5..174f263 100644 --- a/libtomcrypt/src/encauth/eax/eax_encrypt.c +++ b/libtomcrypt/src/encauth/eax/eax_encrypt.c @@ -5,13 +5,11 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /** @file eax_encrypt.c - EAX implementation, encrypt block by Tom St Denis + EAX implementation, encrypt block by Tom St Denis */ #include "tomcrypt.h" @@ -25,11 +23,11 @@ @param length The length of the plaintext (octets) @return CRYPT_OK if successful */ -int eax_encrypt(eax_state *eax, const unsigned char *pt, unsigned char *ct, +int eax_encrypt(eax_state *eax, const unsigned char *pt, unsigned char *ct, unsigned long length) { int err; - + LTC_ARGCHK(eax != NULL); LTC_ARGCHK(pt != NULL); LTC_ARGCHK(ct != NULL); @@ -46,6 +44,6 @@ int eax_encrypt(eax_state *eax, const unsigned char *pt, unsigned char *ct, #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/encauth/eax/eax_encrypt_authenticate_memory.c b/libtomcrypt/src/encauth/eax/eax_encrypt_authenticate_memory.c index fc58ce6..9980fc0 100644 --- a/libtomcrypt/src/encauth/eax/eax_encrypt_authenticate_memory.c +++ b/libtomcrypt/src/encauth/eax/eax_encrypt_authenticate_memory.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /** @@ -53,15 +51,15 @@ int eax_encrypt_authenticate_memory(int cipher, eax = XMALLOC(sizeof(*eax)); if ((err = eax_init(eax, cipher, key, keylen, nonce, noncelen, header, headerlen)) != CRYPT_OK) { - goto LBL_ERR; + goto LBL_ERR; } if ((err = eax_encrypt(eax, pt, ct, ptlen)) != CRYPT_OK) { - goto LBL_ERR; + goto LBL_ERR; } - + if ((err = eax_done(eax, tag, taglen)) != CRYPT_OK) { - goto LBL_ERR; + goto LBL_ERR; } err = CRYPT_OK; @@ -72,11 +70,11 @@ LBL_ERR: XFREE(eax); - return err; + return err; } #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/encauth/eax/eax_init.c b/libtomcrypt/src/encauth/eax/eax_init.c index 563eabf..154d7a9 100644 --- a/libtomcrypt/src/encauth/eax/eax_init.c +++ b/libtomcrypt/src/encauth/eax/eax_init.c @@ -5,19 +5,17 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ -/** +/** @file eax_init.c - EAX implementation, initialized EAX state, by Tom St Denis + EAX implementation, initialized EAX state, by Tom St Denis */ #include "tomcrypt.h" #ifdef LTC_EAX_MODE -/** +/** Initialized an EAX state @param eax [out] The EAX state to initialize @param cipher The index of the desired cipher @@ -29,7 +27,7 @@ @param headerlen The header length (octets) @return CRYPT_OK if successful */ -int eax_init(eax_state *eax, int cipher, +int eax_init(eax_state *eax, int cipher, const unsigned char *key, unsigned long keylen, const unsigned char *nonce, unsigned long noncelen, const unsigned char *header, unsigned long headerlen) @@ -69,21 +67,21 @@ int eax_init(eax_state *eax, int cipher, /* N = LTC_OMAC_0K(nonce) */ zeromem(buf, MAXBLOCKSIZE); if ((err = omac_init(omac, cipher, key, keylen)) != CRYPT_OK) { - goto LBL_ERR; + goto LBL_ERR; } /* omac the [0]_n */ if ((err = omac_process(omac, buf, blklen)) != CRYPT_OK) { - goto LBL_ERR; + goto LBL_ERR; } /* omac the nonce */ if ((err = omac_process(omac, nonce, noncelen)) != CRYPT_OK) { - goto LBL_ERR; + goto LBL_ERR; } /* store result */ len = sizeof(eax->N); if ((err = omac_done(omac, eax->N, &len)) != CRYPT_OK) { - goto LBL_ERR; + goto LBL_ERR; } /* H = LTC_OMAC_1K(header) */ @@ -91,17 +89,17 @@ int eax_init(eax_state *eax, int cipher, buf[blklen - 1] = 1; if ((err = omac_init(&eax->headeromac, cipher, key, keylen)) != CRYPT_OK) { - goto LBL_ERR; + goto LBL_ERR; } /* omac the [1]_n */ if ((err = omac_process(&eax->headeromac, buf, blklen)) != CRYPT_OK) { - goto LBL_ERR; + goto LBL_ERR; } /* omac the header */ if (headerlen != 0) { if ((err = omac_process(&eax->headeromac, header, headerlen)) != CRYPT_OK) { - goto LBL_ERR; + goto LBL_ERR; } } @@ -109,19 +107,19 @@ int eax_init(eax_state *eax, int cipher, /* setup the CTR mode */ if ((err = ctr_start(cipher, eax->N, key, keylen, 0, CTR_COUNTER_BIG_ENDIAN, &eax->ctr)) != CRYPT_OK) { - goto LBL_ERR; + goto LBL_ERR; } /* setup the LTC_OMAC for the ciphertext */ - if ((err = omac_init(&eax->ctomac, cipher, key, keylen)) != CRYPT_OK) { - goto LBL_ERR; + if ((err = omac_init(&eax->ctomac, cipher, key, keylen)) != CRYPT_OK) { + goto LBL_ERR; } /* omac [2]_n */ zeromem(buf, MAXBLOCKSIZE); buf[blklen-1] = 2; if ((err = omac_process(&eax->ctomac, buf, blklen)) != CRYPT_OK) { - goto LBL_ERR; + goto LBL_ERR; } err = CRYPT_OK; @@ -137,8 +135,8 @@ LBL_ERR: return err; } -#endif +#endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/encauth/eax/eax_test.c b/libtomcrypt/src/encauth/eax/eax_test.c index 5babef2..7d29ee7 100644 --- a/libtomcrypt/src/encauth/eax/eax_test.c +++ b/libtomcrypt/src/encauth/eax/eax_test.c @@ -5,11 +5,9 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ -/** +/** @file eax_test.c EAX implementation, self-test, by Tom St Denis */ @@ -27,16 +25,16 @@ int eax_test(void) return CRYPT_NOP; #else static const struct { - int keylen, - noncelen, - headerlen, + int keylen, + noncelen, + headerlen, msglen; - unsigned char key[MAXBLOCKSIZE], - nonce[MAXBLOCKSIZE], - header[MAXBLOCKSIZE], + unsigned char key[MAXBLOCKSIZE], + nonce[MAXBLOCKSIZE], + header[MAXBLOCKSIZE], plaintext[MAXBLOCKSIZE], - ciphertext[MAXBLOCKSIZE], + ciphertext[MAXBLOCKSIZE], tag[MAXBLOCKSIZE]; } tests[] = { @@ -107,7 +105,7 @@ int eax_test(void) 0x08, 0x09, 0x0a, 0x0b, 0x0c, 0x0d, 0x0e, 0x0f }, /* nonce */ { 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07, - 0x08, 0x09, 0x0a, 0x0b, 0x0c, 0x0d, 0x0e, 0x0f }, + 0x08, 0x09, 0x0a, 0x0b, 0x0c, 0x0d, 0x0e, 0x0f }, /* header */ { 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07, 0x08, 0x09, 0x0a, 0x0b, 0x0c, 0x0d, 0x0e, 0x0f }, @@ -134,7 +132,7 @@ int eax_test(void) 0x08, 0x09, 0x0a, 0x0b, 0x0c, 0x0d, 0x0e, 0x0f }, /* nonce */ { 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07, - 0x08, 0x09, 0x0a, 0x0b, 0x0c, 0x0d, 0x0e }, + 0x08, 0x09, 0x0a, 0x0b, 0x0c, 0x0d, 0x0e }, /* header */ { 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07, 0x08, 0x09, 0x0a, 0x0b, 0x0c, 0x0d }, @@ -176,7 +174,7 @@ int eax_test(void) { 16, 16, 8, 2, - /* key */ + /* key */ { 0x91, 0x94, 0x5d, 0x3f, 0x4d, 0xcb, 0xee, 0x0b, 0xf4, 0x5e, 0xf5, 0x22, 0x55, 0xf0, 0x95, 0xa4 }, /* nonce */ @@ -210,14 +208,14 @@ int eax_test(void) /* Tag */ { 0x3a, 0x59, 0xf2, 0x38, 0xa2, 0x3e, 0x39, 0x19, 0x9d, 0xc9, 0x26, 0x66, 0x26, 0xc4, 0x0f, 0x80 } -} +} }; int err, x, idx, res; unsigned long len; unsigned char outct[MAXBLOCKSIZE], outtag[MAXBLOCKSIZE]; - /* AES can be under rijndael or aes... try to find it */ + /* AES can be under rijndael or aes... try to find it */ if ((idx = find_cipher("aes")) == -1) { if ((idx = find_cipher("rijndael")) == -1) { return CRYPT_NOP; @@ -231,22 +229,8 @@ int eax_test(void) tests[x].plaintext, tests[x].msglen, outct, outtag, &len)) != CRYPT_OK) { return err; } - if (XMEMCMP(outct, tests[x].ciphertext, tests[x].msglen) || XMEMCMP(outtag, tests[x].tag, len)) { -#if 0 - unsigned long y; - printf("\n\nFailure: \nCT:\n"); - for (y = 0; y < (unsigned long)tests[x].msglen; ) { - printf("0x%02x", outct[y]); - if (y < (unsigned long)(tests[x].msglen-1)) printf(", "); - if (!(++y % 8)) printf("\n"); - } - printf("\nTAG:\n"); - for (y = 0; y < len; ) { - printf("0x%02x", outtag[y]); - if (y < len-1) printf(", "); - if (!(++y % 8)) printf("\n"); - } -#endif + if (compare_testvector(outtag, len, tests[x].tag, len, "EAX Tag", x) || + compare_testvector(outct, tests[x].msglen, tests[x].ciphertext, tests[x].msglen, "EAX CT", x)) { return CRYPT_FAIL_TESTVECTOR; } @@ -256,27 +240,20 @@ int eax_test(void) outct, tests[x].msglen, outct, outtag, len, &res)) != CRYPT_OK) { return err; } - if ((res != 1) || XMEMCMP(outct, tests[x].plaintext, tests[x].msglen)) { -#if 0 - unsigned long y; - printf("\n\nFailure (res == %d): \nPT:\n", res); - for (y = 0; y < (unsigned long)tests[x].msglen; ) { - printf("0x%02x", outct[y]); - if (y < (unsigned long)(tests[x].msglen-1)) printf(", "); - if (!(++y % 8)) printf("\n"); - } - printf("\n\n"); + if ((res != 1) || compare_testvector(outct, tests[x].msglen, tests[x].plaintext, tests[x].msglen, "EAX", x)) { +#ifdef LTC_TEST_DBG + printf("\n\nEAX: Failure-decrypt - res = %d\n", res); #endif return CRYPT_FAIL_TESTVECTOR; } - } - return CRYPT_OK; + } + return CRYPT_OK; #endif /* LTC_TEST */ } #endif /* LTC_EAX_MODE */ -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/encauth/gcm/gcm_add_aad.c b/libtomcrypt/src/encauth/gcm/gcm_add_aad.c index 26e47f6..cacc15b 100644 --- a/libtomcrypt/src/encauth/gcm/gcm_add_aad.c +++ b/libtomcrypt/src/encauth/gcm/gcm_add_aad.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /** @@ -48,6 +46,8 @@ int gcm_add_aad(gcm_state *gcm, /* in IV mode? */ if (gcm->mode == LTC_GCM_MODE_IV) { + /* IV length must be > 0 */ + if (gcm->buflen == 0 && gcm->totlen == 0) return CRYPT_ERROR; /* let's process the IV */ if (gcm->ivmode || gcm->buflen != 12) { for (x = 0; x < (unsigned long)gcm->buflen; x++) { @@ -66,7 +66,7 @@ int gcm_add_aad(gcm_state *gcm, } gcm_mult_h(gcm, gcm->X); - /* copy counter out */ + /* copy counter out */ XMEMCPY(gcm->Y, gcm->X, 16); zeromem(gcm->X, 16); } else { @@ -92,7 +92,7 @@ int gcm_add_aad(gcm_state *gcm, if (gcm->buflen == 0) { for (x = 0; x < (adatalen & ~15); x += 16) { for (y = 0; y < 16; y += sizeof(LTC_FAST_TYPE)) { - *((LTC_FAST_TYPE*)(&gcm->X[y])) ^= *((LTC_FAST_TYPE*)(&adata[x + y])); + *(LTC_FAST_TYPE_PTR_CAST(&gcm->X[y])) ^= *(LTC_FAST_TYPE_PTR_CAST(&adata[x + y])); } gcm_mult_h(gcm, gcm->X); gcm->totlen += 128; @@ -104,9 +104,9 @@ int gcm_add_aad(gcm_state *gcm, /* start adding AAD data to the state */ for (; x < adatalen; x++) { - gcm->X[gcm->buflen++] ^= *adata++; + gcm->X[gcm->buflen++] ^= *adata++; - if (gcm->buflen == 16) { + if (gcm->buflen == 16) { /* GF mult it */ gcm_mult_h(gcm, gcm->X); gcm->buflen = 0; @@ -117,8 +117,8 @@ int gcm_add_aad(gcm_state *gcm, return CRYPT_OK; } #endif - -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ + +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/encauth/gcm/gcm_add_iv.c b/libtomcrypt/src/encauth/gcm/gcm_add_iv.c index 0ac79b6..3fd3861 100644 --- a/libtomcrypt/src/encauth/gcm/gcm_add_iv.c +++ b/libtomcrypt/src/encauth/gcm/gcm_add_iv.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /** @@ -24,7 +22,7 @@ @param IVlen The length of the IV @return CRYPT_OK on success */ -int gcm_add_iv(gcm_state *gcm, +int gcm_add_iv(gcm_state *gcm, const unsigned char *IV, unsigned long IVlen) { unsigned long x, y; @@ -39,7 +37,7 @@ int gcm_add_iv(gcm_state *gcm, if (gcm->mode != LTC_GCM_MODE_IV) { return CRYPT_INVALID_ARG; } - + if (gcm->buflen >= 16 || gcm->buflen < 0) { return CRYPT_INVALID_ARG; } @@ -59,7 +57,7 @@ int gcm_add_iv(gcm_state *gcm, if (gcm->buflen == 0) { for (x = 0; x < (IVlen & ~15); x += 16) { for (y = 0; y < 16; y += sizeof(LTC_FAST_TYPE)) { - *((LTC_FAST_TYPE*)(&gcm->X[y])) ^= *((LTC_FAST_TYPE*)(&IV[x + y])); + *(LTC_FAST_TYPE_PTR_CAST(&gcm->X[y])) ^= *(LTC_FAST_TYPE_PTR_CAST(&IV[x + y])); } gcm_mult_h(gcm, gcm->X); gcm->totlen += 128; @@ -72,7 +70,7 @@ int gcm_add_iv(gcm_state *gcm, for (; x < IVlen; x++) { gcm->buf[gcm->buflen++] = *IV++; - if (gcm->buflen == 16) { + if (gcm->buflen == 16) { /* GF mult it */ for (y = 0; y < 16; y++) { gcm->X[y] ^= gcm->buf[y]; @@ -87,8 +85,8 @@ int gcm_add_iv(gcm_state *gcm, } #endif - -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ + +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/encauth/gcm/gcm_done.c b/libtomcrypt/src/encauth/gcm/gcm_done.c index bbc9bbe..ffd551e 100644 --- a/libtomcrypt/src/encauth/gcm/gcm_done.c +++ b/libtomcrypt/src/encauth/gcm/gcm_done.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /** @@ -24,7 +22,7 @@ @param taglen [in/out] The length of the MAC tag @return CRYPT_OK on success */ -int gcm_done(gcm_state *gcm, +int gcm_done(gcm_state *gcm, unsigned char *tag, unsigned long *taglen) { unsigned long x; @@ -42,6 +40,15 @@ int gcm_done(gcm_state *gcm, return err; } + if (gcm->mode == LTC_GCM_MODE_IV) { + /* let's process the IV */ + if ((err = gcm_add_aad(gcm, NULL, 0)) != CRYPT_OK) return err; + } + + if (gcm->mode == LTC_GCM_MODE_AAD) { + /* let's process the AAD */ + if ((err = gcm_process(gcm, NULL, 0, NULL, 0)) != CRYPT_OK) return err; + } if (gcm->mode != LTC_GCM_MODE_TEXT) { return CRYPT_INVALID_ARG; @@ -78,6 +85,6 @@ int gcm_done(gcm_state *gcm, #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/encauth/gcm/gcm_gf_mult.c b/libtomcrypt/src/encauth/gcm/gcm_gf_mult.c index 72e0624..2e7a906 100644 --- a/libtomcrypt/src/encauth/gcm/gcm_gf_mult.c +++ b/libtomcrypt/src/encauth/gcm/gcm_gf_mult.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /** @@ -15,9 +13,9 @@ */ #include "tomcrypt.h" -#if defined(LTC_GCM_TABLES) || defined(LRW_TABLES) || ((defined(LTC_GCM_MODE) || defined(LTC_GCM_MODE)) && defined(LTC_FAST)) +#if defined(LTC_GCM_TABLES) || defined(LTC_LRW_TABLES) || ((defined(LTC_GCM_MODE) || defined(LTC_GCM_MODE)) && defined(LTC_FAST)) -/* this is x*2^128 mod p(x) ... the results are 16 bytes each stored in a packed format. Since only the +/* this is x*2^128 mod p(x) ... the results are 16 bytes each stored in a packed format. Since only the * lower 16 bits are not zero'ed I removed the upper 14 bytes */ const unsigned char gcm_shift_table[256*2] = { 0x00, 0x00, 0x01, 0xc2, 0x03, 0x84, 0x02, 0x46, 0x07, 0x08, 0x06, 0xca, 0x04, 0x8c, 0x05, 0x4e, @@ -60,7 +58,7 @@ const unsigned char gcm_shift_table[256*2] = { #ifndef LTC_FAST /* right shift */ -static void gcm_rightshift(unsigned char *a) +static void _gcm_rightshift(unsigned char *a) { int x; for (x = 15; x > 0; x--) { @@ -73,28 +71,28 @@ static void gcm_rightshift(unsigned char *a) static const unsigned char mask[] = { 0x80, 0x40, 0x20, 0x10, 0x08, 0x04, 0x02, 0x01 }; static const unsigned char poly[] = { 0x00, 0xE1 }; - + /** GCM GF multiplier (internal use only) bitserial @param a First value @param b Second value @param c Destination for a * b - */ + */ void gcm_gf_mult(const unsigned char *a, const unsigned char *b, unsigned char *c) { unsigned char Z[16], V[16]; - unsigned x, y, z; + unsigned char x, y, z; zeromem(Z, 16); XMEMCPY(V, a, 16); for (x = 0; x < 128; x++) { if (b[x>>3] & mask[x&7]) { for (y = 0; y < 16; y++) { - Z[y] ^= V[y]; + Z[y] ^= V[y]; } } z = V[15] & 0x01; - gcm_rightshift(V); + _gcm_rightshift(V); V[0] ^= poly[z]; } XMEMCPY(c, Z, 16); @@ -113,7 +111,7 @@ void gcm_gf_mult(const unsigned char *a, const unsigned char *b, unsigned char * @param a First value @param b Second value @param c Destination for a * b - */ + */ void gcm_gf_mult(const unsigned char *a, const unsigned char *b, unsigned char *c) { int i, j, k, u; @@ -129,7 +127,7 @@ void gcm_gf_mult(const unsigned char *a, const unsigned char *b, unsigned char * LOAD32H(B[M(1)][i], a + (i<<2)); LOAD32L(pB[i], b + (i<<2)); } -#else +#else for (i = 0; i < 2; i++) { LOAD64H(B[M(1)][i], a + (i<<3)); LOAD64L(pB[i], b + (i<<3)); @@ -154,7 +152,7 @@ void gcm_gf_mult(const unsigned char *a, const unsigned char *b, unsigned char * B[M(9)][i] = B[M(1)][i] ^ B[M(8)][i]; B[M(10)][i] = B[M(2)][i] ^ B[M(8)][i]; B[M(12)][i] = B[M(8)][i] ^ B[M(4)][i]; - + /* now all 3 bit values and the only 4 bit value: 7, 11, 13, 14, 15 */ B[M(7)][i] = B[M(3)][i] ^ B[M(4)][i]; B[M(11)][i] = B[M(3)][i] ^ B[M(8)][i]; @@ -193,7 +191,7 @@ void gcm_gf_mult(const unsigned char *a, const unsigned char *b, unsigned char * for (i = 0; i < 8; i++) { STORE32H(tmp[i], pTmp + (i<<2)); } -#else +#else for (i = 0; i < 4; i++) { STORE64H(tmp[i], pTmp + (i<<3)); } @@ -215,7 +213,7 @@ void gcm_gf_mult(const unsigned char *a, const unsigned char *b, unsigned char * #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ - +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ + diff --git a/libtomcrypt/src/encauth/gcm/gcm_init.c b/libtomcrypt/src/encauth/gcm/gcm_init.c index 8e1c496..072870d 100644 --- a/libtomcrypt/src/encauth/gcm/gcm_init.c +++ b/libtomcrypt/src/encauth/gcm/gcm_init.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /** @@ -25,7 +23,7 @@ @param keylen The length of the secret key @return CRYPT_OK on success */ -int gcm_init(gcm_state *gcm, int cipher, +int gcm_init(gcm_state *gcm, int cipher, const unsigned char *key, int keylen) { int err; @@ -92,8 +90,8 @@ int gcm_init(gcm_state *gcm, int cipher, } gcm->PC[x][y][0] = gcm_shift_table[t<<1]; gcm->PC[x][y][1] ^= gcm_shift_table[(t<<1)+1]; - } - } + } + } #endif @@ -102,6 +100,6 @@ int gcm_init(gcm_state *gcm, int cipher, #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/encauth/gcm/gcm_memory.c b/libtomcrypt/src/encauth/gcm/gcm_memory.c index 451e3fa..7b59960 100644 --- a/libtomcrypt/src/encauth/gcm/gcm_memory.c +++ b/libtomcrypt/src/encauth/gcm/gcm_memory.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /** @@ -22,8 +20,8 @@ @param cipher Index of cipher to use @param key The secret key @param keylen The length of the secret key - @param IV The initial vector - @param IVlen The length of the initial vector + @param IV The initialization vector + @param IVlen The length of the initialization vector @param adata The additional authentication data (header) @param adatalen The length of the adata @param pt The plaintext @@ -39,7 +37,7 @@ int gcm_memory( int cipher, const unsigned char *IV, unsigned long IVlen, const unsigned char *adata, unsigned long adatalen, unsigned char *pt, unsigned long ptlen, - unsigned char *ct, + unsigned char *ct, unsigned char *tag, unsigned long *taglen, int direction) { @@ -50,10 +48,9 @@ int gcm_memory( int cipher, if ((err = cipher_is_valid(cipher)) != CRYPT_OK) { return err; } - + if (cipher_descriptor[cipher].accel_gcm_memory != NULL) { - return - cipher_descriptor[cipher].accel_gcm_memory + return cipher_descriptor[cipher].accel_gcm_memory (key, keylen, IV, IVlen, adata, adatalen, @@ -104,6 +101,6 @@ LTC_ERR: #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/encauth/gcm/gcm_mult_h.c b/libtomcrypt/src/encauth/gcm/gcm_mult_h.c index 2cda6a4..181d1d1 100644 --- a/libtomcrypt/src/encauth/gcm/gcm_mult_h.c +++ b/libtomcrypt/src/encauth/gcm/gcm_mult_h.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /** @@ -25,7 +23,7 @@ void gcm_mult_h(gcm_state *gcm, unsigned char *I) { unsigned char T[16]; #ifdef LTC_GCM_TABLES - int x, y; + int x; #ifdef LTC_GCM_TABLES_SSE2 asm("movdqa (%0),%%xmm0"::"r"(&gcm->PC[0][I[0]][0])); for (x = 1; x < 16; x++) { @@ -33,11 +31,12 @@ void gcm_mult_h(gcm_state *gcm, unsigned char *I) } asm("movdqa %%xmm0,(%0)"::"r"(&T)); #else + int y; XMEMCPY(T, &gcm->PC[0][I[0]][0], 16); for (x = 1; x < 16; x++) { #ifdef LTC_FAST for (y = 0; y < 16; y += sizeof(LTC_FAST_TYPE)) { - *((LTC_FAST_TYPE *)(T + y)) ^= *((LTC_FAST_TYPE *)(&gcm->PC[x][I[x]][y])); + *(LTC_FAST_TYPE_PTR_CAST(T + y)) ^= *(LTC_FAST_TYPE_PTR_CAST(&gcm->PC[x][I[x]][y])); } #else for (y = 0; y < 16; y++) { @@ -46,13 +45,13 @@ void gcm_mult_h(gcm_state *gcm, unsigned char *I) #endif /* LTC_FAST */ } #endif /* LTC_GCM_TABLES_SSE2 */ -#else - gcm_gf_mult(gcm->H, I, T); +#else + gcm_gf_mult(gcm->H, I, T); #endif XMEMCPY(I, T, 16); } #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/encauth/gcm/gcm_process.c b/libtomcrypt/src/encauth/gcm/gcm_process.c index af0444d..b1ec20c 100644 --- a/libtomcrypt/src/encauth/gcm/gcm_process.c +++ b/libtomcrypt/src/encauth/gcm/gcm_process.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /** @@ -17,9 +15,9 @@ #ifdef LTC_GCM_MODE -/** +/** Process plaintext/ciphertext through GCM - @param gcm The GCM state + @param gcm The GCM state @param pt The plaintext @param ptlen The plaintext length (ciphertext length is the same) @param ct The ciphertext @@ -44,11 +42,21 @@ int gcm_process(gcm_state *gcm, if (gcm->buflen > 16 || gcm->buflen < 0) { return CRYPT_INVALID_ARG; } - + if ((err = cipher_is_valid(gcm->cipher)) != CRYPT_OK) { return err; } + /* 0xFFFFFFFE0 = ((2^39)-256)/8 */ + if (gcm->pttotlen / 8 + (ulong64)gcm->buflen + (ulong64)ptlen >= CONST64(0xFFFFFFFE0)) { + return CRYPT_INVALID_ARG; + } + + if (gcm->mode == LTC_GCM_MODE_IV) { + /* let's process the IV */ + if ((err = gcm_add_aad(gcm, NULL, 0)) != CRYPT_OK) return err; + } + /* in AAD mode? */ if (gcm->mode == LTC_GCM_MODE_AAD) { /* let's process the AAD */ @@ -77,12 +85,12 @@ int gcm_process(gcm_state *gcm, x = 0; #ifdef LTC_FAST if (gcm->buflen == 0) { - if (direction == GCM_ENCRYPT) { + if (direction == GCM_ENCRYPT) { for (x = 0; x < (ptlen & ~15); x += 16) { /* ctr encrypt */ for (y = 0; y < 16; y += sizeof(LTC_FAST_TYPE)) { - *((LTC_FAST_TYPE*)(&ct[x + y])) = *((LTC_FAST_TYPE*)(&pt[x+y])) ^ *((LTC_FAST_TYPE*)(&gcm->buf[y])); - *((LTC_FAST_TYPE*)(&gcm->X[y])) ^= *((LTC_FAST_TYPE*)(&ct[x+y])); + *(LTC_FAST_TYPE_PTR_CAST(&ct[x + y])) = *(LTC_FAST_TYPE_PTR_CAST(&pt[x+y])) ^ *(LTC_FAST_TYPE_PTR_CAST(&gcm->buf[y])); + *(LTC_FAST_TYPE_PTR_CAST(&gcm->X[y])) ^= *(LTC_FAST_TYPE_PTR_CAST(&ct[x+y])); } /* GMAC it */ gcm->pttotlen += 128; @@ -99,8 +107,8 @@ int gcm_process(gcm_state *gcm, for (x = 0; x < (ptlen & ~15); x += 16) { /* ctr encrypt */ for (y = 0; y < 16; y += sizeof(LTC_FAST_TYPE)) { - *((LTC_FAST_TYPE*)(&gcm->X[y])) ^= *((LTC_FAST_TYPE*)(&ct[x+y])); - *((LTC_FAST_TYPE*)(&pt[x + y])) = *((LTC_FAST_TYPE*)(&ct[x+y])) ^ *((LTC_FAST_TYPE*)(&gcm->buf[y])); + *(LTC_FAST_TYPE_PTR_CAST(&gcm->X[y])) ^= *(LTC_FAST_TYPE_PTR_CAST(&ct[x+y])); + *(LTC_FAST_TYPE_PTR_CAST(&pt[x + y])) = *(LTC_FAST_TYPE_PTR_CAST(&ct[x+y])) ^ *(LTC_FAST_TYPE_PTR_CAST(&gcm->buf[y])); } /* GMAC it */ gcm->pttotlen += 128; @@ -113,16 +121,16 @@ int gcm_process(gcm_state *gcm, return err; } } - } + } } -#endif +#endif /* process text */ for (; x < ptlen; x++) { if (gcm->buflen == 16) { gcm->pttotlen += 128; gcm_mult_h(gcm, gcm->X); - + /* increment counter */ for (y = 15; y >= 12; y--) { if (++gcm->Y[y] & 255) { break; } @@ -134,12 +142,12 @@ int gcm_process(gcm_state *gcm, } if (direction == GCM_ENCRYPT) { - b = ct[x] = pt[x] ^ gcm->buf[gcm->buflen]; + b = ct[x] = pt[x] ^ gcm->buf[gcm->buflen]; } else { b = ct[x]; pt[x] = ct[x] ^ gcm->buf[gcm->buflen]; } - gcm->X[gcm->buflen++] ^= b; + gcm->X[gcm->buflen++] ^= b; } return CRYPT_OK; @@ -147,6 +155,6 @@ int gcm_process(gcm_state *gcm, #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/encauth/gcm/gcm_reset.c b/libtomcrypt/src/encauth/gcm/gcm_reset.c index c9e13d9..3bd1088 100644 --- a/libtomcrypt/src/encauth/gcm/gcm_reset.c +++ b/libtomcrypt/src/encauth/gcm/gcm_reset.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /** @@ -33,12 +31,12 @@ int gcm_reset(gcm_state *gcm) gcm->buflen = 0; gcm->totlen = 0; gcm->pttotlen = 0; - + return CRYPT_OK; } #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/encauth/gcm/gcm_test.c b/libtomcrypt/src/encauth/gcm/gcm_test.c index 7380c81..5f68b30 100644 --- a/libtomcrypt/src/encauth/gcm/gcm_test.c +++ b/libtomcrypt/src/encauth/gcm/gcm_test.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /** @@ -17,7 +15,7 @@ #ifdef LTC_GCM_MODE -/** +/** Test the GCM code @return CRYPT_OK on success */ @@ -100,18 +98,18 @@ int gcm_test(void) /* test case #3 */ { /* key */ - { 0xfe, 0xff, 0xe9, 0x92, 0x86, 0x65, 0x73, 0x1c, + { 0xfe, 0xff, 0xe9, 0x92, 0x86, 0x65, 0x73, 0x1c, 0x6d, 0x6a, 0x8f, 0x94, 0x67, 0x30, 0x83, 0x08, }, 16, /* PT */ - { 0xd9, 0x31, 0x32, 0x25, 0xf8, 0x84, 0x06, 0xe5, - 0xa5, 0x59, 0x09, 0xc5, 0xaf, 0xf5, 0x26, 0x9a, - 0x86, 0xa7, 0xa9, 0x53, 0x15, 0x34, 0xf7, 0xda, - 0x2e, 0x4c, 0x30, 0x3d, 0x8a, 0x31, 0x8a, 0x72, - 0x1c, 0x3c, 0x0c, 0x95, 0x95, 0x68, 0x09, 0x53, - 0x2f, 0xcf, 0x0e, 0x24, 0x49, 0xa6, 0xb5, 0x25, - 0xb1, 0x6a, 0xed, 0xf5, 0xaa, 0x0d, 0xe6, 0x57, + { 0xd9, 0x31, 0x32, 0x25, 0xf8, 0x84, 0x06, 0xe5, + 0xa5, 0x59, 0x09, 0xc5, 0xaf, 0xf5, 0x26, 0x9a, + 0x86, 0xa7, 0xa9, 0x53, 0x15, 0x34, 0xf7, 0xda, + 0x2e, 0x4c, 0x30, 0x3d, 0x8a, 0x31, 0x8a, 0x72, + 0x1c, 0x3c, 0x0c, 0x95, 0x95, 0x68, 0x09, 0x53, + 0x2f, 0xcf, 0x0e, 0x24, 0x49, 0xa6, 0xb5, 0x25, + 0xb1, 0x6a, 0xed, 0xf5, 0xaa, 0x0d, 0xe6, 0x57, 0xba, 0x63, 0x7b, 0x39, 0x1a, 0xaf, 0xd2, 0x55, }, 64, @@ -120,66 +118,66 @@ int gcm_test(void) 0, /* IV */ - { 0xca, 0xfe, 0xba, 0xbe, 0xfa, 0xce, 0xdb, 0xad, + { 0xca, 0xfe, 0xba, 0xbe, 0xfa, 0xce, 0xdb, 0xad, 0xde, 0xca, 0xf8, 0x88, }, 12, - + /* CT */ - { 0x42, 0x83, 0x1e, 0xc2, 0x21, 0x77, 0x74, 0x24, - 0x4b, 0x72, 0x21, 0xb7, 0x84, 0xd0, 0xd4, 0x9c, - 0xe3, 0xaa, 0x21, 0x2f, 0x2c, 0x02, 0xa4, 0xe0, - 0x35, 0xc1, 0x7e, 0x23, 0x29, 0xac, 0xa1, 0x2e, - 0x21, 0xd5, 0x14, 0xb2, 0x54, 0x66, 0x93, 0x1c, - 0x7d, 0x8f, 0x6a, 0x5a, 0xac, 0x84, 0xaa, 0x05, - 0x1b, 0xa3, 0x0b, 0x39, 0x6a, 0x0a, 0xac, 0x97, + { 0x42, 0x83, 0x1e, 0xc2, 0x21, 0x77, 0x74, 0x24, + 0x4b, 0x72, 0x21, 0xb7, 0x84, 0xd0, 0xd4, 0x9c, + 0xe3, 0xaa, 0x21, 0x2f, 0x2c, 0x02, 0xa4, 0xe0, + 0x35, 0xc1, 0x7e, 0x23, 0x29, 0xac, 0xa1, 0x2e, + 0x21, 0xd5, 0x14, 0xb2, 0x54, 0x66, 0x93, 0x1c, + 0x7d, 0x8f, 0x6a, 0x5a, 0xac, 0x84, 0xaa, 0x05, + 0x1b, 0xa3, 0x0b, 0x39, 0x6a, 0x0a, 0xac, 0x97, 0x3d, 0x58, 0xe0, 0x91, 0x47, 0x3f, 0x59, 0x85, }, /* TAG */ - { 0x4d, 0x5c, 0x2a, 0xf3, 0x27, 0xcd, 0x64, 0xa6, + { 0x4d, 0x5c, 0x2a, 0xf3, 0x27, 0xcd, 0x64, 0xa6, 0x2c, 0xf3, 0x5a, 0xbd, 0x2b, 0xa6, 0xfa, 0xb4, } }, /* test case #4 */ { /* key */ - { 0xfe, 0xff, 0xe9, 0x92, 0x86, 0x65, 0x73, 0x1c, + { 0xfe, 0xff, 0xe9, 0x92, 0x86, 0x65, 0x73, 0x1c, 0x6d, 0x6a, 0x8f, 0x94, 0x67, 0x30, 0x83, 0x08, }, 16, /* PT */ - { 0xd9, 0x31, 0x32, 0x25, 0xf8, 0x84, 0x06, 0xe5, - 0xa5, 0x59, 0x09, 0xc5, 0xaf, 0xf5, 0x26, 0x9a, - 0x86, 0xa7, 0xa9, 0x53, 0x15, 0x34, 0xf7, 0xda, - 0x2e, 0x4c, 0x30, 0x3d, 0x8a, 0x31, 0x8a, 0x72, - 0x1c, 0x3c, 0x0c, 0x95, 0x95, 0x68, 0x09, 0x53, - 0x2f, 0xcf, 0x0e, 0x24, 0x49, 0xa6, 0xb5, 0x25, - 0xb1, 0x6a, 0xed, 0xf5, 0xaa, 0x0d, 0xe6, 0x57, + { 0xd9, 0x31, 0x32, 0x25, 0xf8, 0x84, 0x06, 0xe5, + 0xa5, 0x59, 0x09, 0xc5, 0xaf, 0xf5, 0x26, 0x9a, + 0x86, 0xa7, 0xa9, 0x53, 0x15, 0x34, 0xf7, 0xda, + 0x2e, 0x4c, 0x30, 0x3d, 0x8a, 0x31, 0x8a, 0x72, + 0x1c, 0x3c, 0x0c, 0x95, 0x95, 0x68, 0x09, 0x53, + 0x2f, 0xcf, 0x0e, 0x24, 0x49, 0xa6, 0xb5, 0x25, + 0xb1, 0x6a, 0xed, 0xf5, 0xaa, 0x0d, 0xe6, 0x57, 0xba, 0x63, 0x7b, 0x39, }, 60, /* ADATA */ - { 0xfe, 0xed, 0xfa, 0xce, 0xde, 0xad, 0xbe, 0xef, - 0xfe, 0xed, 0xfa, 0xce, 0xde, 0xad, 0xbe, 0xef, + { 0xfe, 0xed, 0xfa, 0xce, 0xde, 0xad, 0xbe, 0xef, + 0xfe, 0xed, 0xfa, 0xce, 0xde, 0xad, 0xbe, 0xef, 0xab, 0xad, 0xda, 0xd2, }, 20, /* IV */ - { 0xca, 0xfe, 0xba, 0xbe, 0xfa, 0xce, 0xdb, 0xad, + { 0xca, 0xfe, 0xba, 0xbe, 0xfa, 0xce, 0xdb, 0xad, 0xde, 0xca, 0xf8, 0x88, }, 12, /* CT */ - { 0x42, 0x83, 0x1e, 0xc2, 0x21, 0x77, 0x74, 0x24, - 0x4b, 0x72, 0x21, 0xb7, 0x84, 0xd0, 0xd4, 0x9c, - 0xe3, 0xaa, 0x21, 0x2f, 0x2c, 0x02, 0xa4, 0xe0, - 0x35, 0xc1, 0x7e, 0x23, 0x29, 0xac, 0xa1, 0x2e, - 0x21, 0xd5, 0x14, 0xb2, 0x54, 0x66, 0x93, 0x1c, - 0x7d, 0x8f, 0x6a, 0x5a, 0xac, 0x84, 0xaa, 0x05, - 0x1b, 0xa3, 0x0b, 0x39, 0x6a, 0x0a, 0xac, 0x97, + { 0x42, 0x83, 0x1e, 0xc2, 0x21, 0x77, 0x74, 0x24, + 0x4b, 0x72, 0x21, 0xb7, 0x84, 0xd0, 0xd4, 0x9c, + 0xe3, 0xaa, 0x21, 0x2f, 0x2c, 0x02, 0xa4, 0xe0, + 0x35, 0xc1, 0x7e, 0x23, 0x29, 0xac, 0xa1, 0x2e, + 0x21, 0xd5, 0x14, 0xb2, 0x54, 0x66, 0x93, 0x1c, + 0x7d, 0x8f, 0x6a, 0x5a, 0xac, 0x84, 0xaa, 0x05, + 0x1b, 0xa3, 0x0b, 0x39, 0x6a, 0x0a, 0xac, 0x97, 0x3d, 0x58, 0xe0, 0x91, }, /* TAG */ - { 0x5b, 0xc9, 0x4f, 0xbc, 0x32, 0x21, 0xa5, 0xdb, + { 0x5b, 0xc9, 0x4f, 0xbc, 0x32, 0x21, 0xa5, 0xdb, 0x94, 0xfa, 0xe9, 0x5a, 0xe7, 0x12, 0x1a, 0x47, } }, @@ -187,24 +185,24 @@ int gcm_test(void) /* test case #5 */ { /* key */ - { 0xfe, 0xff, 0xe9, 0x92, 0x86, 0x65, 0x73, 0x1c, + { 0xfe, 0xff, 0xe9, 0x92, 0x86, 0x65, 0x73, 0x1c, 0x6d, 0x6a, 0x8f, 0x94, 0x67, 0x30, 0x83, 0x08, }, 16, /* PT */ - { 0xd9, 0x31, 0x32, 0x25, 0xf8, 0x84, 0x06, 0xe5, - 0xa5, 0x59, 0x09, 0xc5, 0xaf, 0xf5, 0x26, 0x9a, - 0x86, 0xa7, 0xa9, 0x53, 0x15, 0x34, 0xf7, 0xda, - 0x2e, 0x4c, 0x30, 0x3d, 0x8a, 0x31, 0x8a, 0x72, - 0x1c, 0x3c, 0x0c, 0x95, 0x95, 0x68, 0x09, 0x53, - 0x2f, 0xcf, 0x0e, 0x24, 0x49, 0xa6, 0xb5, 0x25, - 0xb1, 0x6a, 0xed, 0xf5, 0xaa, 0x0d, 0xe6, 0x57, + { 0xd9, 0x31, 0x32, 0x25, 0xf8, 0x84, 0x06, 0xe5, + 0xa5, 0x59, 0x09, 0xc5, 0xaf, 0xf5, 0x26, 0x9a, + 0x86, 0xa7, 0xa9, 0x53, 0x15, 0x34, 0xf7, 0xda, + 0x2e, 0x4c, 0x30, 0x3d, 0x8a, 0x31, 0x8a, 0x72, + 0x1c, 0x3c, 0x0c, 0x95, 0x95, 0x68, 0x09, 0x53, + 0x2f, 0xcf, 0x0e, 0x24, 0x49, 0xa6, 0xb5, 0x25, + 0xb1, 0x6a, 0xed, 0xf5, 0xaa, 0x0d, 0xe6, 0x57, 0xba, 0x63, 0x7b, 0x39, }, 60, /* ADATA */ - { 0xfe, 0xed, 0xfa, 0xce, 0xde, 0xad, 0xbe, 0xef, - 0xfe, 0xed, 0xfa, 0xce, 0xde, 0xad, 0xbe, 0xef, + { 0xfe, 0xed, 0xfa, 0xce, 0xde, 0xad, 0xbe, 0xef, + 0xfe, 0xed, 0xfa, 0xce, 0xde, 0xad, 0xbe, 0xef, 0xab, 0xad, 0xda, 0xd2, }, 20, @@ -213,112 +211,112 @@ int gcm_test(void) 8, /* CT */ - { 0x61, 0x35, 0x3b, 0x4c, 0x28, 0x06, 0x93, 0x4a, - 0x77, 0x7f, 0xf5, 0x1f, 0xa2, 0x2a, 0x47, 0x55, - 0x69, 0x9b, 0x2a, 0x71, 0x4f, 0xcd, 0xc6, 0xf8, - 0x37, 0x66, 0xe5, 0xf9, 0x7b, 0x6c, 0x74, 0x23, - 0x73, 0x80, 0x69, 0x00, 0xe4, 0x9f, 0x24, 0xb2, - 0x2b, 0x09, 0x75, 0x44, 0xd4, 0x89, 0x6b, 0x42, - 0x49, 0x89, 0xb5, 0xe1, 0xeb, 0xac, 0x0f, 0x07, + { 0x61, 0x35, 0x3b, 0x4c, 0x28, 0x06, 0x93, 0x4a, + 0x77, 0x7f, 0xf5, 0x1f, 0xa2, 0x2a, 0x47, 0x55, + 0x69, 0x9b, 0x2a, 0x71, 0x4f, 0xcd, 0xc6, 0xf8, + 0x37, 0x66, 0xe5, 0xf9, 0x7b, 0x6c, 0x74, 0x23, + 0x73, 0x80, 0x69, 0x00, 0xe4, 0x9f, 0x24, 0xb2, + 0x2b, 0x09, 0x75, 0x44, 0xd4, 0x89, 0x6b, 0x42, + 0x49, 0x89, 0xb5, 0xe1, 0xeb, 0xac, 0x0f, 0x07, 0xc2, 0x3f, 0x45, 0x98, }, /* TAG */ - { 0x36, 0x12, 0xd2, 0xe7, 0x9e, 0x3b, 0x07, 0x85, + { 0x36, 0x12, 0xd2, 0xe7, 0x9e, 0x3b, 0x07, 0x85, 0x56, 0x1b, 0xe1, 0x4a, 0xac, 0xa2, 0xfc, 0xcb, } }, /* test case #6 */ { /* key */ - { 0xfe, 0xff, 0xe9, 0x92, 0x86, 0x65, 0x73, 0x1c, + { 0xfe, 0xff, 0xe9, 0x92, 0x86, 0x65, 0x73, 0x1c, 0x6d, 0x6a, 0x8f, 0x94, 0x67, 0x30, 0x83, 0x08, }, 16, /* PT */ - { 0xd9, 0x31, 0x32, 0x25, 0xf8, 0x84, 0x06, 0xe5, - 0xa5, 0x59, 0x09, 0xc5, 0xaf, 0xf5, 0x26, 0x9a, - 0x86, 0xa7, 0xa9, 0x53, 0x15, 0x34, 0xf7, 0xda, - 0x2e, 0x4c, 0x30, 0x3d, 0x8a, 0x31, 0x8a, 0x72, - 0x1c, 0x3c, 0x0c, 0x95, 0x95, 0x68, 0x09, 0x53, - 0x2f, 0xcf, 0x0e, 0x24, 0x49, 0xa6, 0xb5, 0x25, - 0xb1, 0x6a, 0xed, 0xf5, 0xaa, 0x0d, 0xe6, 0x57, + { 0xd9, 0x31, 0x32, 0x25, 0xf8, 0x84, 0x06, 0xe5, + 0xa5, 0x59, 0x09, 0xc5, 0xaf, 0xf5, 0x26, 0x9a, + 0x86, 0xa7, 0xa9, 0x53, 0x15, 0x34, 0xf7, 0xda, + 0x2e, 0x4c, 0x30, 0x3d, 0x8a, 0x31, 0x8a, 0x72, + 0x1c, 0x3c, 0x0c, 0x95, 0x95, 0x68, 0x09, 0x53, + 0x2f, 0xcf, 0x0e, 0x24, 0x49, 0xa6, 0xb5, 0x25, + 0xb1, 0x6a, 0xed, 0xf5, 0xaa, 0x0d, 0xe6, 0x57, 0xba, 0x63, 0x7b, 0x39, }, 60, /* ADATA */ - { 0xfe, 0xed, 0xfa, 0xce, 0xde, 0xad, 0xbe, 0xef, - 0xfe, 0xed, 0xfa, 0xce, 0xde, 0xad, 0xbe, 0xef, + { 0xfe, 0xed, 0xfa, 0xce, 0xde, 0xad, 0xbe, 0xef, + 0xfe, 0xed, 0xfa, 0xce, 0xde, 0xad, 0xbe, 0xef, 0xab, 0xad, 0xda, 0xd2, }, 20, /* IV */ - { 0x93, 0x13, 0x22, 0x5d, 0xf8, 0x84, 0x06, 0xe5, - 0x55, 0x90, 0x9c, 0x5a, 0xff, 0x52, 0x69, 0xaa, - 0x6a, 0x7a, 0x95, 0x38, 0x53, 0x4f, 0x7d, 0xa1, - 0xe4, 0xc3, 0x03, 0xd2, 0xa3, 0x18, 0xa7, 0x28, - 0xc3, 0xc0, 0xc9, 0x51, 0x56, 0x80, 0x95, 0x39, - 0xfc, 0xf0, 0xe2, 0x42, 0x9a, 0x6b, 0x52, 0x54, - 0x16, 0xae, 0xdb, 0xf5, 0xa0, 0xde, 0x6a, 0x57, + { 0x93, 0x13, 0x22, 0x5d, 0xf8, 0x84, 0x06, 0xe5, + 0x55, 0x90, 0x9c, 0x5a, 0xff, 0x52, 0x69, 0xaa, + 0x6a, 0x7a, 0x95, 0x38, 0x53, 0x4f, 0x7d, 0xa1, + 0xe4, 0xc3, 0x03, 0xd2, 0xa3, 0x18, 0xa7, 0x28, + 0xc3, 0xc0, 0xc9, 0x51, 0x56, 0x80, 0x95, 0x39, + 0xfc, 0xf0, 0xe2, 0x42, 0x9a, 0x6b, 0x52, 0x54, + 0x16, 0xae, 0xdb, 0xf5, 0xa0, 0xde, 0x6a, 0x57, 0xa6, 0x37, 0xb3, 0x9b, }, 60, /* CT */ - { 0x8c, 0xe2, 0x49, 0x98, 0x62, 0x56, 0x15, 0xb6, - 0x03, 0xa0, 0x33, 0xac, 0xa1, 0x3f, 0xb8, 0x94, - 0xbe, 0x91, 0x12, 0xa5, 0xc3, 0xa2, 0x11, 0xa8, - 0xba, 0x26, 0x2a, 0x3c, 0xca, 0x7e, 0x2c, 0xa7, - 0x01, 0xe4, 0xa9, 0xa4, 0xfb, 0xa4, 0x3c, 0x90, - 0xcc, 0xdc, 0xb2, 0x81, 0xd4, 0x8c, 0x7c, 0x6f, - 0xd6, 0x28, 0x75, 0xd2, 0xac, 0xa4, 0x17, 0x03, + { 0x8c, 0xe2, 0x49, 0x98, 0x62, 0x56, 0x15, 0xb6, + 0x03, 0xa0, 0x33, 0xac, 0xa1, 0x3f, 0xb8, 0x94, + 0xbe, 0x91, 0x12, 0xa5, 0xc3, 0xa2, 0x11, 0xa8, + 0xba, 0x26, 0x2a, 0x3c, 0xca, 0x7e, 0x2c, 0xa7, + 0x01, 0xe4, 0xa9, 0xa4, 0xfb, 0xa4, 0x3c, 0x90, + 0xcc, 0xdc, 0xb2, 0x81, 0xd4, 0x8c, 0x7c, 0x6f, + 0xd6, 0x28, 0x75, 0xd2, 0xac, 0xa4, 0x17, 0x03, 0x4c, 0x34, 0xae, 0xe5, }, /* TAG */ - { 0x61, 0x9c, 0xc5, 0xae, 0xff, 0xfe, 0x0b, 0xfa, + { 0x61, 0x9c, 0xc5, 0xae, 0xff, 0xfe, 0x0b, 0xfa, 0x46, 0x2a, 0xf4, 0x3c, 0x16, 0x99, 0xd0, 0x50, } }, /* test case #46 from BG (catches the LTC bug of v1.15) */ { /* key */ - { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, 16, /* PT */ - { 0xa2, 0xaa, 0xb3, 0xad, 0x8b, 0x17, 0xac, 0xdd, - 0xa2, 0x88, 0x42, 0x6c, 0xd7, 0xc4, 0x29, 0xb7, - 0xca, 0x86, 0xb7, 0xac, 0xa0, 0x58, 0x09, 0xc7, + { 0xa2, 0xaa, 0xb3, 0xad, 0x8b, 0x17, 0xac, 0xdd, + 0xa2, 0x88, 0x42, 0x6c, 0xd7, 0xc4, 0x29, 0xb7, + 0xca, 0x86, 0xb7, 0xac, 0xa0, 0x58, 0x09, 0xc7, 0x0c, 0xe8, 0x2d, 0xb2, 0x57, 0x11, 0xcb, 0x53, - 0x02, 0xeb, 0x27, 0x43, 0xb0, 0x36, 0xf3, 0xd7, - 0x50, 0xd6, 0xcf, 0x0d, 0xc0, 0xac, 0xb9, 0x29, - 0x50, 0xd5, 0x46, 0xdb, 0x30, 0x8f, 0x93, 0xb4, + 0x02, 0xeb, 0x27, 0x43, 0xb0, 0x36, 0xf3, 0xd7, + 0x50, 0xd6, 0xcf, 0x0d, 0xc0, 0xac, 0xb9, 0x29, + 0x50, 0xd5, 0x46, 0xdb, 0x30, 0x8f, 0x93, 0xb4, 0xff, 0x24, 0x4a, 0xfa, 0x9d, 0xc7, 0x2b, 0xcd, 0x75, 0x8d, 0x2c }, 67, /* ADATA */ - { 0x68, 0x8e, 0x1a, 0xa9, 0x84, 0xde, 0x92, 0x6d, + { 0x68, 0x8e, 0x1a, 0xa9, 0x84, 0xde, 0x92, 0x6d, 0xc7, 0xb4, 0xc4, 0x7f, 0x44 }, - 13, + 13, /* IV */ - { 0xb7, 0x21, 0x38, 0xb5, 0xa0, 0x5f, 0xf5, 0x07, + { 0xb7, 0x21, 0x38, 0xb5, 0xa0, 0x5f, 0xf5, 0x07, 0x0e, 0x8c, 0xd9, 0x41, 0x83, 0xf7, 0x61, 0xd8 }, 16, /* CT */ - { 0xcb, 0xc8, 0xd2, 0xf1, 0x54, 0x81, 0xa4, 0xcc, - 0x7d, 0xd1, 0xe1, 0x9a, 0xaa, 0x83, 0xde, 0x56, - 0x78, 0x48, 0x3e, 0xc3, 0x59, 0xae, 0x7d, 0xec, + { 0xcb, 0xc8, 0xd2, 0xf1, 0x54, 0x81, 0xa4, 0xcc, + 0x7d, 0xd1, 0xe1, 0x9a, 0xaa, 0x83, 0xde, 0x56, + 0x78, 0x48, 0x3e, 0xc3, 0x59, 0xae, 0x7d, 0xec, 0x2a, 0xb8, 0xd5, 0x34, 0xe0, 0x90, 0x6f, 0x4b, - 0x46, 0x63, 0xfa, 0xff, 0x58, 0xa8, 0xb2, 0xd7, - 0x33, 0xb8, 0x45, 0xee, 0xf7, 0xc9, 0xb3, 0x31, - 0xe9, 0xe1, 0x0e, 0xb2, 0x61, 0x2c, 0x99, 0x5f, + 0x46, 0x63, 0xfa, 0xff, 0x58, 0xa8, 0xb2, 0xd7, + 0x33, 0xb8, 0x45, 0xee, 0xf7, 0xc9, 0xb3, 0x31, + 0xe9, 0xe1, 0x0e, 0xb2, 0x61, 0x2c, 0x99, 0x5f, 0xeb, 0x1a, 0xc1, 0x5a, 0x62, 0x86, 0xcc, 0xe8, 0xb2, 0x97, 0xa8 }, /* TAG */ - { 0x8d, 0x2d, 0x2a, 0x93, 0x72, 0x62, 0x6f, 0x6b, + { 0x8d, 0x2d, 0x2a, 0x93, 0x72, 0x62, 0x6f, 0x6b, 0xee, 0x85, 0x80, 0x27, 0x6a, 0x63, 0x66, 0xbf } } @@ -327,6 +325,7 @@ int gcm_test(void) int idx, err; unsigned long x, y; unsigned char out[2][128], T[2][16]; + gcm_state gcm; /* find aes */ idx = find_cipher("aes"); @@ -337,6 +336,14 @@ int gcm_test(void) } } + /* Special test case for empty AAD + empty PT */ + y = sizeof(T[0]); + if ((err = gcm_init(&gcm, idx, tests[0].K, tests[0].keylen)) != CRYPT_OK) return err; + if ((err = gcm_add_iv(&gcm, tests[0].IV, tests[0].IVlen)) != CRYPT_OK) return err; + /* intentionally skip gcm_add_aad + gcm_process */ + if ((err = gcm_done(&gcm, T[0], &y)) != CRYPT_OK) return err; + if (compare_testvector(T[0], y, tests[0].T, 16, "GCM Encrypt Tag-special", 0)) return CRYPT_FAIL_TESTVECTOR; + for (x = 0; x < (int)(sizeof(tests)/sizeof(tests[0])); x++) { y = sizeof(T[0]); if ((err = gcm_memory(idx, tests[x].K, tests[x].keylen, @@ -347,25 +354,11 @@ int gcm_test(void) return err; } - if (XMEMCMP(out[0], tests[x].C, tests[x].ptlen)) { -#if 0 - printf("\nCiphertext wrong %lu\n", x); - for (y = 0; y < tests[x].ptlen; y++) { - printf("%02x", out[0][y] & 255); - } - printf("\n"); -#endif + if (compare_testvector(out[0], tests[x].ptlen, tests[x].C, tests[x].ptlen, "GCM CT", x)) { return CRYPT_FAIL_TESTVECTOR; } - if (XMEMCMP(T[0], tests[x].T, 16)) { -#if 0 - printf("\nTag on plaintext wrong %lu\n", x); - for (y = 0; y < 16; y++) { - printf("%02x", T[0][y] & 255); - } - printf("\n"); -#endif + if (compare_testvector(T[0], y, tests[x].T, 16, "GCM Encrypt Tag", x)) { return CRYPT_FAIL_TESTVECTOR; } @@ -378,25 +371,11 @@ int gcm_test(void) return err; } - if (XMEMCMP(out[1], tests[x].P, tests[x].ptlen)) { -#if 0 - printf("\nplaintext wrong %lu\n", x); - for (y = 0; y < tests[x].ptlen; y++) { - printf("%02x", out[0][y] & 255); - } - printf("\n"); -#endif + if (compare_testvector(out[1], tests[x].ptlen, tests[x].P, tests[x].ptlen, "GCM PT", x)) { return CRYPT_FAIL_TESTVECTOR; } - if (XMEMCMP(T[1], tests[x].T, 16)) { -#if 0 - printf("\nTag on ciphertext wrong %lu\n", x); - for (y = 0; y < 16; y++) { - printf("%02x", T[1][y] & 255); - } - printf("\n"); -#endif + if (compare_testvector(T[1], y, tests[x].T, 16, "GCM Decrypt Tag", x)) { return CRYPT_FAIL_TESTVECTOR; } @@ -408,6 +387,6 @@ int gcm_test(void) #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/encauth/ocb/ocb_decrypt.c b/libtomcrypt/src/encauth/ocb/ocb_decrypt.c index 61003db..5dc8dad 100644 --- a/libtomcrypt/src/encauth/ocb/ocb_decrypt.c +++ b/libtomcrypt/src/encauth/ocb/ocb_decrypt.c @@ -5,13 +5,11 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /** @file ocb_decrypt.c - OCB implementation, decrypt data, by Tom St Denis + OCB implementation, decrypt data, by Tom St Denis */ #include "tomcrypt.h" @@ -38,7 +36,7 @@ int ocb_decrypt(ocb_state *ocb, const unsigned char *ct, unsigned char *pt) return err; } LTC_ARGCHK(cipher_descriptor[ocb->cipher].ecb_decrypt != NULL); - + /* check length */ if (ocb->block_len != cipher_descriptor[ocb->cipher].block_length) { return CRYPT_INVALID_ARG; @@ -74,6 +72,6 @@ int ocb_decrypt(ocb_state *ocb, const unsigned char *ct, unsigned char *pt) #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/encauth/ocb/ocb_decrypt_verify_memory.c b/libtomcrypt/src/encauth/ocb/ocb_decrypt_verify_memory.c index 6644618..a7a47f0 100644 --- a/libtomcrypt/src/encauth/ocb/ocb_decrypt_verify_memory.c +++ b/libtomcrypt/src/encauth/ocb/ocb_decrypt_verify_memory.c @@ -5,13 +5,11 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ -/** +/** @file ocb_decrypt_verify_memory.c - OCB implementation, helper to decrypt block of memory, by Tom St Denis + OCB implementation, helper to decrypt block of memory, by Tom St Denis */ #include "tomcrypt.h" @@ -33,7 +31,7 @@ */ int ocb_decrypt_verify_memory(int cipher, const unsigned char *key, unsigned long keylen, - const unsigned char *nonce, + const unsigned char *nonce, const unsigned char *ct, unsigned long ctlen, unsigned char *pt, const unsigned char *tag, unsigned long taglen, @@ -56,12 +54,12 @@ int ocb_decrypt_verify_memory(int cipher, } if ((err = ocb_init(ocb, cipher, key, keylen, nonce)) != CRYPT_OK) { - goto LBL_ERR; + goto LBL_ERR; } while (ctlen > (unsigned long)ocb->block_len) { if ((err = ocb_decrypt(ocb, ct, pt)) != CRYPT_OK) { - goto LBL_ERR; + goto LBL_ERR; } ctlen -= ocb->block_len; pt += ocb->block_len; @@ -73,7 +71,7 @@ LBL_ERR: #ifdef LTC_CLEAN_STACK zeromem(ocb, sizeof(ocb_state)); #endif - + XFREE(ocb); return err; @@ -81,6 +79,6 @@ LBL_ERR: #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/encauth/ocb/ocb_done_decrypt.c b/libtomcrypt/src/encauth/ocb/ocb_done_decrypt.c index d604b36..357bd84 100644 --- a/libtomcrypt/src/encauth/ocb/ocb_done_decrypt.c +++ b/libtomcrypt/src/encauth/ocb/ocb_done_decrypt.c @@ -5,11 +5,9 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ -/** +/** @file ocb_done_decrypt.c OCB implementation, terminate decryption, by Tom St Denis */ @@ -28,9 +26,9 @@ @param stat [out] The result of the tag comparison @return CRYPT_OK if the process was successful regardless if the tag is valid */ -int ocb_done_decrypt(ocb_state *ocb, +int ocb_done_decrypt(ocb_state *ocb, const unsigned char *ct, unsigned long ctlen, - unsigned char *pt, + unsigned char *pt, const unsigned char *tag, unsigned long taglen, int *stat) { int err; @@ -57,7 +55,7 @@ int ocb_done_decrypt(ocb_state *ocb, goto LBL_ERR; } - if (taglen <= tagbuflen && XMEMCMP(tagbuf, tag, taglen) == 0) { + if (taglen <= tagbuflen && XMEM_NEQ(tagbuf, tag, taglen) == 0) { *stat = 1; } @@ -75,6 +73,6 @@ LBL_ERR: #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/encauth/ocb/ocb_done_encrypt.c b/libtomcrypt/src/encauth/ocb/ocb_done_encrypt.c index 276d50e..12ea68f 100644 --- a/libtomcrypt/src/encauth/ocb/ocb_done_encrypt.c +++ b/libtomcrypt/src/encauth/ocb/ocb_done_encrypt.c @@ -5,11 +5,9 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ -/** +/** @file ocb_done_encrypt.c OCB implementation, terminate encryption, by Tom St Denis */ @@ -17,7 +15,7 @@ #ifdef LTC_OCB_MODE -/** +/** Terminate an encryption OCB state @param ocb The OCB state @param pt Remaining plaintext (if any) @@ -41,6 +39,6 @@ int ocb_done_encrypt(ocb_state *ocb, const unsigned char *pt, unsigned long ptle #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/encauth/ocb/ocb_encrypt.c b/libtomcrypt/src/encauth/ocb/ocb_encrypt.c index 84afa66..aad76a0 100644 --- a/libtomcrypt/src/encauth/ocb/ocb_encrypt.c +++ b/libtomcrypt/src/encauth/ocb/ocb_encrypt.c @@ -5,11 +5,9 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ -/** +/** @file ocb_encrypt.c OCB implementation, encrypt data, by Tom St Denis */ @@ -67,6 +65,6 @@ int ocb_encrypt(ocb_state *ocb, const unsigned char *pt, unsigned char *ct) #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/encauth/ocb/ocb_encrypt_authenticate_memory.c b/libtomcrypt/src/encauth/ocb/ocb_encrypt_authenticate_memory.c index f81cc4b..1793a64 100644 --- a/libtomcrypt/src/encauth/ocb/ocb_encrypt_authenticate_memory.c +++ b/libtomcrypt/src/encauth/ocb/ocb_encrypt_authenticate_memory.c @@ -5,11 +5,9 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ -/** +/** @file ocb_encrypt_authenticate_memory.c OCB implementation, encrypt block of memory, by Tom St Denis */ @@ -32,7 +30,7 @@ */ int ocb_encrypt_authenticate_memory(int cipher, const unsigned char *key, unsigned long keylen, - const unsigned char *nonce, + const unsigned char *nonce, const unsigned char *pt, unsigned long ptlen, unsigned char *ct, unsigned char *tag, unsigned long *taglen) @@ -79,6 +77,6 @@ LBL_ERR: #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/encauth/ocb/ocb_init.c b/libtomcrypt/src/encauth/ocb/ocb_init.c index 604ae0e..e008a44 100644 --- a/libtomcrypt/src/encauth/ocb/ocb_init.c +++ b/libtomcrypt/src/encauth/ocb/ocb_init.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /** @@ -19,7 +17,7 @@ static const struct { int len; - unsigned char poly_div[MAXBLOCKSIZE], + unsigned char poly_div[MAXBLOCKSIZE], poly_mul[MAXBLOCKSIZE]; } polys[] = { { @@ -27,7 +25,7 @@ static const struct { { 0x80, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x0D }, { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x1B } }, { - 16, + 16, { 0x80, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x43 }, { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, @@ -44,7 +42,7 @@ static const struct { @param nonce The session nonce (length of the block size of the cipher) @return CRYPT_OK if successful */ -int ocb_init(ocb_state *ocb, int cipher, +int ocb_init(ocb_state *ocb, int cipher, const unsigned char *key, unsigned long keylen, const unsigned char *nonce) { int poly, x, y, m, err; @@ -60,20 +58,24 @@ int ocb_init(ocb_state *ocb, int cipher, /* determine which polys to use */ ocb->block_len = cipher_descriptor[cipher].block_length; - for (poly = 0; poly < (int)(sizeof(polys)/sizeof(polys[0])); poly++) { - if (polys[poly].len == ocb->block_len) { + x = (int)(sizeof(polys)/sizeof(polys[0])); + for (poly = 0; poly < x; poly++) { + if (polys[poly].len == ocb->block_len) { break; } } + if (poly == x) { + return CRYPT_INVALID_ARG; /* block_len not found in polys */ + } if (polys[poly].len != ocb->block_len) { return CRYPT_INVALID_ARG; - } + } /* schedule the key */ if ((err = cipher_descriptor[cipher].setup(key, keylen, 0, &ocb->key)) != CRYPT_OK) { return err; } - + /* find L = E[0] */ zeromem(ocb->L, ocb->block_len); if ((err = cipher_descriptor[cipher].ecb_encrypt(ocb->L, ocb->L, &ocb->key)) != CRYPT_OK) { @@ -102,36 +104,36 @@ int ocb_init(ocb_state *ocb, int cipher, ocb->Ls[x][y] ^= polys[poly].poly_mul[y]; } } - } + } - /* find Lr = L / x */ - m = ocb->L[ocb->block_len-1] & 1; + /* find Lr = L / x */ + m = ocb->L[ocb->block_len-1] & 1; - /* shift right */ - for (x = ocb->block_len - 1; x > 0; x--) { - ocb->Lr[x] = ((ocb->L[x] >> 1) | (ocb->L[x-1] << 7)) & 255; - } - ocb->Lr[0] = ocb->L[0] >> 1; + /* shift right */ + for (x = ocb->block_len - 1; x > 0; x--) { + ocb->Lr[x] = ((ocb->L[x] >> 1) | (ocb->L[x-1] << 7)) & 255; + } + ocb->Lr[0] = ocb->L[0] >> 1; - if (m == 1) { - for (x = 0; x < ocb->block_len; x++) { - ocb->Lr[x] ^= polys[poly].poly_div[x]; - } - } + if (m == 1) { + for (x = 0; x < ocb->block_len; x++) { + ocb->Lr[x] ^= polys[poly].poly_div[x]; + } + } - /* set Li, checksum */ - zeromem(ocb->Li, ocb->block_len); - zeromem(ocb->checksum, ocb->block_len); + /* set Li, checksum */ + zeromem(ocb->Li, ocb->block_len); + zeromem(ocb->checksum, ocb->block_len); - /* set other params */ - ocb->block_index = 1; - ocb->cipher = cipher; + /* set other params */ + ocb->block_index = 1; + ocb->cipher = cipher; - return CRYPT_OK; + return CRYPT_OK; } #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/encauth/ocb/ocb_ntz.c b/libtomcrypt/src/encauth/ocb/ocb_ntz.c index c3e42f1..cfdc667 100644 --- a/libtomcrypt/src/encauth/ocb/ocb_ntz.c +++ b/libtomcrypt/src/encauth/ocb/ocb_ntz.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /** @@ -37,6 +35,6 @@ int ocb_ntz(unsigned long x) #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/encauth/ocb/ocb_shift_xor.c b/libtomcrypt/src/encauth/ocb/ocb_shift_xor.c index 145f4c4..8a8ad2d 100644 --- a/libtomcrypt/src/encauth/ocb/ocb_shift_xor.c +++ b/libtomcrypt/src/encauth/ocb/ocb_shift_xor.c @@ -5,11 +5,9 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ -/** +/** @file ocb_shift_xor.c OCB implementation, internal function, by Tom St Denis */ @@ -19,7 +17,7 @@ /** Compute the shift/xor for OCB (internal function) - @param ocb The OCB state + @param ocb The OCB state @param Z The destination of the shift */ void ocb_shift_xor(ocb_state *ocb, unsigned char *Z) @@ -34,6 +32,6 @@ void ocb_shift_xor(ocb_state *ocb, unsigned char *Z) #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/encauth/ocb/ocb_test.c b/libtomcrypt/src/encauth/ocb/ocb_test.c index 8de1a57..74431f7 100644 --- a/libtomcrypt/src/encauth/ocb/ocb_test.c +++ b/libtomcrypt/src/encauth/ocb/ocb_test.c @@ -5,11 +5,9 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ -/** +/** @file ocb_test.c OCB implementation, self-test by Tom St Denis */ @@ -17,7 +15,7 @@ #ifdef LTC_OCB_MODE -/** +/** Test the OCB protocol @return CRYPT_OK if successful */ @@ -52,7 +50,7 @@ int ocb_test(void) /* OCB-AES-128-3B */ { - 3, + 3, /* key */ { 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07, 0x08, 0x09, 0x0a, 0x0b, 0x0c, 0x0d, 0x0e, 0x0f }, @@ -70,7 +68,7 @@ int ocb_test(void) /* OCB-AES-128-16B */ { - 16, + 16, /* key */ { 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07, 0x08, 0x09, 0x0a, 0x0b, 0x0c, 0x0d, 0x0e, 0x0f }, @@ -90,7 +88,7 @@ int ocb_test(void) /* OCB-AES-128-20B */ { - 20, + 20, /* key */ { 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07, 0x08, 0x09, 0x0a, 0x0b, 0x0c, 0x0d, 0x0e, 0x0f }, @@ -99,7 +97,7 @@ int ocb_test(void) 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x01 }, /* pt */ { 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07, - 0x08, 0x09, 0x0a, 0x0b, 0x0c, 0x0d, 0x0e, 0x0f, + 0x08, 0x09, 0x0a, 0x0b, 0x0c, 0x0d, 0x0e, 0x0f, 0x10, 0x11, 0x12, 0x13 }, /* ct */ { 0x01, 0xa0, 0x75, 0xf0, 0xd8, 0x15, 0xb1, 0xa4, @@ -112,7 +110,7 @@ int ocb_test(void) /* OCB-AES-128-32B */ { - 32, + 32, /* key */ { 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07, 0x08, 0x09, 0x0a, 0x0b, 0x0c, 0x0d, 0x0e, 0x0f }, @@ -121,7 +119,7 @@ int ocb_test(void) 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x01 }, /* pt */ { 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07, - 0x08, 0x09, 0x0a, 0x0b, 0x0c, 0x0d, 0x0e, 0x0f, + 0x08, 0x09, 0x0a, 0x0b, 0x0c, 0x0d, 0x0e, 0x0f, 0x10, 0x11, 0x12, 0x13, 0x14, 0x15, 0x16, 0x17, 0x18, 0x19, 0x1a, 0x1b, 0x1c, 0x1d, 0x1e, 0x1f }, /* ct */ @@ -137,7 +135,7 @@ int ocb_test(void) /* OCB-AES-128-34B */ { - 34, + 34, /* key */ { 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07, 0x08, 0x09, 0x0a, 0x0b, 0x0c, 0x0d, 0x0e, 0x0f }, @@ -146,7 +144,7 @@ int ocb_test(void) 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x01 }, /* pt */ { 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07, - 0x08, 0x09, 0x0a, 0x0b, 0x0c, 0x0d, 0x0e, 0x0f, + 0x08, 0x09, 0x0a, 0x0b, 0x0c, 0x0d, 0x0e, 0x0f, 0x10, 0x11, 0x12, 0x13, 0x14, 0x15, 0x16, 0x17, 0x18, 0x19, 0x1a, 0x1b, 0x1c, 0x1d, 0x1e, 0x1f, 0x20, 0x21 }, @@ -168,7 +166,7 @@ int ocb_test(void) unsigned long len; unsigned char outct[MAXBLOCKSIZE], outtag[MAXBLOCKSIZE]; - /* AES can be under rijndael or aes... try to find it */ + /* AES can be under rijndael or aes... try to find it */ if ((idx = find_cipher("aes")) == -1) { if ((idx = find_cipher("rijndael")) == -1) { return CRYPT_NOP; @@ -181,41 +179,21 @@ int ocb_test(void) tests[x].nonce, tests[x].pt, tests[x].ptlen, outct, outtag, &len)) != CRYPT_OK) { return err; } - - if (XMEMCMP(outtag, tests[x].tag, len) || XMEMCMP(outct, tests[x].ct, tests[x].ptlen)) { -#if 0 - unsigned long y; - printf("\n\nFailure: \nCT:\n"); - for (y = 0; y < (unsigned long)tests[x].ptlen; ) { - printf("0x%02x", outct[y]); - if (y < (unsigned long)(tests[x].ptlen-1)) printf(", "); - if (!(++y % 8)) printf("\n"); - } - printf("\nTAG:\n"); - for (y = 0; y < len; ) { - printf("0x%02x", outtag[y]); - if (y < len-1) printf(", "); - if (!(++y % 8)) printf("\n"); - } -#endif + + if (compare_testvector(outtag, len, tests[x].tag, sizeof(tests[x].tag), "OCB Tag", x) || + compare_testvector(outct, tests[x].ptlen, tests[x].ct, tests[x].ptlen, "OCB CT", x)) { return CRYPT_FAIL_TESTVECTOR; } - + if ((err = ocb_decrypt_verify_memory(idx, tests[x].key, 16, tests[x].nonce, outct, tests[x].ptlen, outct, tests[x].tag, len, &res)) != CRYPT_OK) { return err; } - if ((res != 1) || XMEMCMP(tests[x].pt, outct, tests[x].ptlen)) { -#if 0 - unsigned long y; - printf("\n\nFailure-decrypt: \nPT:\n"); - for (y = 0; y < (unsigned long)tests[x].ptlen; ) { - printf("0x%02x", outct[y]); - if (y < (unsigned long)(tests[x].ptlen-1)) printf(", "); - if (!(++y % 8)) printf("\n"); - } - printf("\nres = %d\n\n", res); + if ((res != 1) || compare_testvector(outct, tests[x].ptlen, tests[x].pt, tests[x].ptlen, "OCB", x)) { +#ifdef LTC_TEST_DBG + printf("\n\nOCB: Failure-decrypt - res = %d\n", res); #endif + return CRYPT_FAIL_TESTVECTOR; } } return CRYPT_OK; @@ -232,6 +210,6 @@ int ocb_test(void) -- The setup is somewhat complicated... */ -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/encauth/ocb/s_ocb_done.c b/libtomcrypt/src/encauth/ocb/s_ocb_done.c index 37a7cb7..e0501ed 100644 --- a/libtomcrypt/src/encauth/ocb/s_ocb_done.c +++ b/libtomcrypt/src/encauth/ocb/s_ocb_done.c @@ -5,11 +5,9 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ -/** +/** @file s_ocb_done.c OCB implementation, internal helper, by Tom St Denis */ @@ -22,7 +20,7 @@ * is we XOR the final ciphertext into the checksum so we have to xor it * before we CTR [decrypt] or after [encrypt] * - * the names pt/ptlen/ct really just mean in/inlen/out but this is the way I wrote it... + * the names pt/ptlen/ct really just mean in/inlen/out but this is the way I wrote it... */ /** @@ -74,13 +72,13 @@ int s_ocb_done(ocb_state *ocb, const unsigned char *pt, unsigned long ptlen, } /* compute X[m] = len(pt[m]) XOR Lr XOR Z[m] */ - ocb_shift_xor(ocb, X); + ocb_shift_xor(ocb, X); XMEMCPY(Z, X, ocb->block_len); X[ocb->block_len-1] ^= (ptlen*8)&255; X[ocb->block_len-2] ^= ((ptlen*8)>>8)&255; for (x = 0; x < ocb->block_len; x++) { - X[x] ^= ocb->Lr[x]; + X[x] ^= ocb->Lr[x]; } /* Y[m] = E(X[m])) */ @@ -93,7 +91,7 @@ int s_ocb_done(ocb_state *ocb, const unsigned char *pt, unsigned long ptlen, /* xor C[m] into checksum */ for (x = 0; x < (int)ptlen; x++) { ocb->checksum[x] ^= ct[x]; - } + } } /* C[m] = P[m] xor Y[m] */ @@ -102,7 +100,7 @@ int s_ocb_done(ocb_state *ocb, const unsigned char *pt, unsigned long ptlen, } if (mode == 0) { - /* encrypt mode */ + /* encrypt mode */ /* xor C[m] into checksum */ for (x = 0; x < (int)ptlen; x++) { ocb->checksum[x] ^= ct[x]; @@ -113,7 +111,7 @@ int s_ocb_done(ocb_state *ocb, const unsigned char *pt, unsigned long ptlen, for (x = 0; x < ocb->block_len; x++) { ocb->checksum[x] ^= Y[x] ^ Z[x]; } - + /* encrypt checksum, er... tag!! */ if ((err = cipher_descriptor[ocb->cipher].ecb_encrypt(ocb->checksum, X, &ocb->key)) != CRYPT_OK) { goto error; @@ -132,7 +130,7 @@ int s_ocb_done(ocb_state *ocb, const unsigned char *pt, unsigned long ptlen, zeromem(Z, MAXBLOCKSIZE); zeromem(ocb, sizeof(*ocb)); #endif -error: +error: XFREE(X); XFREE(Y); XFREE(Z); @@ -143,6 +141,6 @@ error: #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/encauth/ocb3/ocb3_add_aad.c b/libtomcrypt/src/encauth/ocb3/ocb3_add_aad.c new file mode 100644 index 0000000..70e3211 --- /dev/null +++ b/libtomcrypt/src/encauth/ocb3/ocb3_add_aad.c @@ -0,0 +1,106 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + */ + +/** + @file ocb3_add_aad.c + OCB implementation, add AAD data, by Karel Miko +*/ +#include "tomcrypt.h" + +#ifdef LTC_OCB3_MODE + +/** + Add one block of AAD data (internal function) + @param ocb The OCB state + @param aad_block [in] AAD data (block_len size) + @return CRYPT_OK if successful +*/ +static int _ocb3_int_aad_add_block(ocb3_state *ocb, const unsigned char *aad_block) +{ + unsigned char tmp[MAXBLOCKSIZE]; + int err; + + /* Offset_i = Offset_{i-1} xor L_{ntz(i)} */ + ocb3_int_xor_blocks(ocb->aOffset_current, ocb->aOffset_current, ocb->L_[ocb3_int_ntz(ocb->ablock_index)], ocb->block_len); + + /* Sum_i = Sum_{i-1} xor ENCIPHER(K, A_i xor Offset_i) */ + ocb3_int_xor_blocks(tmp, aad_block, ocb->aOffset_current, ocb->block_len); + if ((err = cipher_descriptor[ocb->cipher].ecb_encrypt(tmp, tmp, &ocb->key)) != CRYPT_OK) { + return err; + } + ocb3_int_xor_blocks(ocb->aSum_current, ocb->aSum_current, tmp, ocb->block_len); + + ocb->ablock_index++; + + return CRYPT_OK; +} + +/** + Add AAD - additional associated data + @param ocb The OCB state + @param aad The AAD data + @param aadlen The size of AAD data (octets) + @return CRYPT_OK if successful +*/ +int ocb3_add_aad(ocb3_state *ocb, const unsigned char *aad, unsigned long aadlen) +{ + int err, x, full_blocks, full_blocks_len, last_block_len; + unsigned char *data; + unsigned long datalen, l; + + LTC_ARGCHK(ocb != NULL); + if (aadlen == 0) return CRYPT_OK; + LTC_ARGCHK(aad != NULL); + + if (ocb->adata_buffer_bytes > 0) { + l = ocb->block_len - ocb->adata_buffer_bytes; + if (l > aadlen) l = aadlen; + XMEMCPY(ocb->adata_buffer+ocb->adata_buffer_bytes, aad, l); + ocb->adata_buffer_bytes += l; + + if (ocb->adata_buffer_bytes == ocb->block_len) { + if ((err = _ocb3_int_aad_add_block(ocb, ocb->adata_buffer)) != CRYPT_OK) { + return err; + } + ocb->adata_buffer_bytes = 0; + } + + data = (unsigned char *)aad + l; + datalen = aadlen - l; + } + else { + data = (unsigned char *)aad; + datalen = aadlen; + } + + if (datalen == 0) return CRYPT_OK; + + full_blocks = datalen/ocb->block_len; + full_blocks_len = full_blocks * ocb->block_len; + last_block_len = datalen - full_blocks_len; + + for (x=0; x<full_blocks; x++) { + if ((err = _ocb3_int_aad_add_block(ocb, data+x*ocb->block_len)) != CRYPT_OK) { + return err; + } + } + + if (last_block_len>0) { + XMEMCPY(ocb->adata_buffer, data+full_blocks_len, last_block_len); + ocb->adata_buffer_bytes = last_block_len; + } + + return CRYPT_OK; +} + +#endif + +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/encauth/ocb3/ocb3_decrypt.c b/libtomcrypt/src/encauth/ocb3/ocb3_decrypt.c new file mode 100644 index 0000000..4973bd2 --- /dev/null +++ b/libtomcrypt/src/encauth/ocb3/ocb3_decrypt.c @@ -0,0 +1,86 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + */ + +/** + @file ocb3_decrypt.c + OCB implementation, decrypt data, by Tom St Denis +*/ +#include "tomcrypt.h" + +#ifdef LTC_OCB3_MODE + +/** + Decrypt blocks of ciphertext with OCB + @param ocb The OCB state + @param ct The ciphertext (length multiple of the block size of the block cipher) + @param ctlen The length of the input (octets) + @param pt [out] The plaintext (length of ct) + @return CRYPT_OK if successful +*/ +int ocb3_decrypt(ocb3_state *ocb, const unsigned char *ct, unsigned long ctlen, unsigned char *pt) +{ + unsigned char tmp[MAXBLOCKSIZE]; + int err, i, full_blocks; + unsigned char *pt_b, *ct_b; + + LTC_ARGCHK(ocb != NULL); + if (ctlen == 0) return CRYPT_OK; /* no data, nothing to do */ + LTC_ARGCHK(ct != NULL); + LTC_ARGCHK(pt != NULL); + + if ((err = cipher_is_valid(ocb->cipher)) != CRYPT_OK) { + return err; + } + if (ocb->block_len != cipher_descriptor[ocb->cipher].block_length) { + return CRYPT_INVALID_ARG; + } + + if (ctlen % ocb->block_len) { /* ctlen has to bu multiple of block_len */ + return CRYPT_INVALID_ARG; + } + + full_blocks = ctlen/ocb->block_len; + for(i=0; i<full_blocks; i++) { + pt_b = (unsigned char *)pt+i*ocb->block_len; + ct_b = (unsigned char *)ct+i*ocb->block_len; + + /* ocb->Offset_current[] = ocb->Offset_current[] ^ Offset_{ntz(block_index)} */ + ocb3_int_xor_blocks(ocb->Offset_current, ocb->Offset_current, ocb->L_[ocb3_int_ntz(ocb->block_index)], ocb->block_len); + + /* tmp[] = ct[] XOR ocb->Offset_current[] */ + ocb3_int_xor_blocks(tmp, ct_b, ocb->Offset_current, ocb->block_len); + + /* decrypt */ + if ((err = cipher_descriptor[ocb->cipher].ecb_decrypt(tmp, tmp, &ocb->key)) != CRYPT_OK) { + goto LBL_ERR; + } + + /* pt[] = tmp[] XOR ocb->Offset_current[] */ + ocb3_int_xor_blocks(pt_b, tmp, ocb->Offset_current, ocb->block_len); + + /* ocb->checksum[] = ocb->checksum[] XOR pt[] */ + ocb3_int_xor_blocks(ocb->checksum, ocb->checksum, pt_b, ocb->block_len); + + ocb->block_index++; + } + + err = CRYPT_OK; + +LBL_ERR: +#ifdef LTC_CLEAN_STACK + zeromem(tmp, sizeof(tmp)); +#endif + return err; +} + +#endif + +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/encauth/ocb3/ocb3_decrypt_last.c b/libtomcrypt/src/encauth/ocb3/ocb3_decrypt_last.c new file mode 100644 index 0000000..70608dc --- /dev/null +++ b/libtomcrypt/src/encauth/ocb3/ocb3_decrypt_last.c @@ -0,0 +1,110 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + */ + +/** + @file ocb3_decrypt_last.c + OCB implementation, internal helper, by Karel Miko +*/ +#include "tomcrypt.h" + +#ifdef LTC_OCB3_MODE + +/** + Finish an OCB (decryption) stream + @param ocb The OCB state + @param ct The remaining ciphertext + @param ctlen The length of the ciphertext (octets) + @param pt [out] The output buffer + @return CRYPT_OK if successful +*/ +int ocb3_decrypt_last(ocb3_state *ocb, const unsigned char *ct, unsigned long ctlen, unsigned char *pt) +{ + unsigned char iOffset_star[MAXBLOCKSIZE]; + unsigned char iPad[MAXBLOCKSIZE]; + int err, x, full_blocks, full_blocks_len, last_block_len; + + LTC_ARGCHK(ocb != NULL); + if (ct == NULL) LTC_ARGCHK(ctlen == 0); + if (ctlen != 0) { + LTC_ARGCHK(ct != NULL); + LTC_ARGCHK(pt != NULL); + } + + if ((err = cipher_is_valid(ocb->cipher)) != CRYPT_OK) { + goto LBL_ERR; + } + + full_blocks = ctlen/ocb->block_len; + full_blocks_len = full_blocks * ocb->block_len; + last_block_len = ctlen - full_blocks_len; + + /* process full blocks first */ + if (full_blocks>0) { + if ((err = ocb3_decrypt(ocb, ct, full_blocks_len, pt)) != CRYPT_OK) { + goto LBL_ERR; + } + } + + if (last_block_len>0) { + /* Offset_* = Offset_m xor L_* */ + ocb3_int_xor_blocks(iOffset_star, ocb->Offset_current, ocb->L_star, ocb->block_len); + + /* Pad = ENCIPHER(K, Offset_*) */ + if ((err = cipher_descriptor[ocb->cipher].ecb_encrypt(iOffset_star, iPad, &ocb->key)) != CRYPT_OK) { + goto LBL_ERR; + } + + /* P_* = C_* xor Pad[1..bitlen(C_*)] */ + ocb3_int_xor_blocks(pt+full_blocks_len, (unsigned char *)ct+full_blocks_len, iPad, last_block_len); + + /* Checksum_* = Checksum_m xor (P_* || 1 || zeros(127-bitlen(P_*))) */ + ocb3_int_xor_blocks(ocb->checksum, ocb->checksum, pt+full_blocks_len, last_block_len); + for(x=last_block_len; x<ocb->block_len; x++) { + if (x == last_block_len) + ocb->checksum[x] ^= 0x80; + else + ocb->checksum[x] ^= 0x00; + } + + /* Tag = ENCIPHER(K, Checksum_* xor Offset_* xor L_$) xor HASH(K,A) */ + /* at this point we calculate only: Tag_part = ENCIPHER(K, Checksum_* xor Offset_* xor L_$) */ + for(x=0; x<ocb->block_len; x++) { + ocb->tag_part[x] = (ocb->checksum[x] ^ iOffset_star[x]) ^ ocb->L_dollar[x]; + } + if ((err = cipher_descriptor[ocb->cipher].ecb_encrypt(ocb->tag_part, ocb->tag_part, &ocb->key)) != CRYPT_OK) { + goto LBL_ERR; + } + } + else { + /* Tag = ENCIPHER(K, Checksum_m xor Offset_m xor L_$) xor HASH(K,A) */ + /* at this point we calculate only: Tag_part = ENCIPHER(K, Checksum_m xor Offset_m xor L_$) */ + for(x=0; x<ocb->block_len; x++) { + ocb->tag_part[x] = (ocb->checksum[x] ^ ocb->Offset_current[x]) ^ ocb->L_dollar[x]; + } + if ((err = cipher_descriptor[ocb->cipher].ecb_encrypt(ocb->tag_part, ocb->tag_part, &ocb->key)) != CRYPT_OK) { + goto LBL_ERR; + } + } + + err = CRYPT_OK; + +LBL_ERR: +#ifdef LTC_CLEAN_STACK + zeromem(iOffset_star, MAXBLOCKSIZE); + zeromem(iPad, MAXBLOCKSIZE); +#endif + + return err; +} + +#endif + +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/encauth/ocb3/ocb3_decrypt_verify_memory.c b/libtomcrypt/src/encauth/ocb3/ocb3_decrypt_verify_memory.c new file mode 100644 index 0000000..066b62c --- /dev/null +++ b/libtomcrypt/src/encauth/ocb3/ocb3_decrypt_verify_memory.c @@ -0,0 +1,110 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + */ + +/** + @file ocb3_decrypt_verify_memory.c + OCB implementation, helper to decrypt block of memory, by Tom St Denis +*/ +#include "tomcrypt.h" + +#ifdef LTC_OCB3_MODE + +/** + Decrypt and compare the tag with OCB + @param cipher The index of the cipher desired + @param key The secret key + @param keylen The length of the secret key (octets) + @param nonce The session nonce (length of the block size of the block cipher) + @param noncelen The length of the nonce (octets) + @param adata The AAD - additional associated data + @param adatalen The length of AAD (octets) + @param ct The ciphertext + @param ctlen The length of the ciphertext (octets) + @param pt [out] The plaintext + @param tag The tag to compare against + @param taglen The length of the tag (octets) + @param stat [out] The result of the tag comparison (1==valid, 0==invalid) + @return CRYPT_OK if successful regardless of the tag comparison +*/ +int ocb3_decrypt_verify_memory(int cipher, + const unsigned char *key, unsigned long keylen, + const unsigned char *nonce, unsigned long noncelen, + const unsigned char *adata, unsigned long adatalen, + const unsigned char *ct, unsigned long ctlen, + unsigned char *pt, + const unsigned char *tag, unsigned long taglen, + int *stat) +{ + int err; + ocb3_state *ocb; + unsigned char *buf; + unsigned long buflen; + + LTC_ARGCHK(stat != NULL); + + /* default to zero */ + *stat = 0; + + /* limit taglen */ + taglen = MIN(taglen, MAXBLOCKSIZE); + + /* allocate memory */ + buf = XMALLOC(taglen); + ocb = XMALLOC(sizeof(ocb3_state)); + if (ocb == NULL || buf == NULL) { + if (ocb != NULL) { + XFREE(ocb); + } + if (buf != NULL) { + XFREE(buf); + } + return CRYPT_MEM; + } + + if ((err = ocb3_init(ocb, cipher, key, keylen, nonce, noncelen, taglen)) != CRYPT_OK) { + goto LBL_ERR; + } + + if (adata != NULL || adatalen != 0) { + if ((err = ocb3_add_aad(ocb, adata, adatalen)) != CRYPT_OK) { + goto LBL_ERR; + } + } + + if ((err = ocb3_decrypt_last(ocb, ct, ctlen, pt)) != CRYPT_OK) { + goto LBL_ERR; + } + + buflen = taglen; + if ((err = ocb3_done(ocb, buf, &buflen)) != CRYPT_OK) { + goto LBL_ERR; + } + + /* compare tags */ + if (buflen >= taglen && XMEM_NEQ(buf, tag, taglen) == 0) { + *stat = 1; + } + + err = CRYPT_OK; + +LBL_ERR: +#ifdef LTC_CLEAN_STACK + zeromem(ocb, sizeof(ocb3_state)); +#endif + + XFREE(ocb); + XFREE(buf); + return err; +} + +#endif + +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/encauth/ocb3/ocb3_done.c b/libtomcrypt/src/encauth/ocb3/ocb3_done.c new file mode 100644 index 0000000..b913d3a --- /dev/null +++ b/libtomcrypt/src/encauth/ocb3/ocb3_done.c @@ -0,0 +1,92 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + */ + +/** + @file ocb3_done.c + OCB implementation, INTERNAL ONLY helper, by Tom St Denis +*/ +#include "tomcrypt.h" + +#ifdef LTC_OCB3_MODE + +/** + Finish OCB processing and compute the tag + @param ocb The OCB state + @param tag [out] The destination for the authentication tag + @param taglen [in/out] The max size and resulting size of the authentication tag + @return CRYPT_OK if successful +*/ +int ocb3_done(ocb3_state *ocb, unsigned char *tag, unsigned long *taglen) +{ + unsigned char tmp[MAXBLOCKSIZE]; + int err, x; + + LTC_ARGCHK(ocb != NULL); + LTC_ARGCHK(tag != NULL); + LTC_ARGCHK(taglen != NULL); + if ((err = cipher_is_valid(ocb->cipher)) != CRYPT_OK) { + goto LBL_ERR; + } + + /* check taglen */ + if ((int)*taglen < ocb->tag_len) { + *taglen = (unsigned long)ocb->tag_len; + return CRYPT_BUFFER_OVERFLOW; + } + + /* finalize AAD processing */ + + if (ocb->adata_buffer_bytes>0) { + /* Offset_* = Offset_m xor L_* */ + ocb3_int_xor_blocks(ocb->aOffset_current, ocb->aOffset_current, ocb->L_star, ocb->block_len); + + /* CipherInput = (A_* || 1 || zeros(127-bitlen(A_*))) xor Offset_* */ + ocb3_int_xor_blocks(tmp, ocb->adata_buffer, ocb->aOffset_current, ocb->adata_buffer_bytes); + for(x=ocb->adata_buffer_bytes; x<ocb->block_len; x++) { + if (x == ocb->adata_buffer_bytes) { + tmp[x] = 0x80 ^ ocb->aOffset_current[x]; + } + else { + tmp[x] = 0x00 ^ ocb->aOffset_current[x]; + } + } + + /* Sum = Sum_m xor ENCIPHER(K, CipherInput) */ + if ((err = cipher_descriptor[ocb->cipher].ecb_encrypt(tmp, tmp, &ocb->key)) != CRYPT_OK) { + goto LBL_ERR; + } + ocb3_int_xor_blocks(ocb->aSum_current, ocb->aSum_current, tmp, ocb->block_len); + } + + /* finalize TAG computing */ + + /* at this point ocb->aSum_current = HASH(K, A) */ + /* tag = tag ^ HASH(K, A) */ + ocb3_int_xor_blocks(tmp, ocb->tag_part, ocb->aSum_current, ocb->block_len); + + /* copy tag bytes */ + for(x = 0; x < ocb->tag_len; x++) tag[x] = tmp[x]; + *taglen = (unsigned long)ocb->tag_len; + + err = CRYPT_OK; + +LBL_ERR: +#ifdef LTC_CLEAN_STACK + zeromem(tmp, MAXBLOCKSIZE); + zeromem(ocb, sizeof(*ocb)); +#endif + + return err; +} + +#endif + +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/encauth/ocb3/ocb3_encrypt.c b/libtomcrypt/src/encauth/ocb3/ocb3_encrypt.c new file mode 100644 index 0000000..337b025 --- /dev/null +++ b/libtomcrypt/src/encauth/ocb3/ocb3_encrypt.c @@ -0,0 +1,86 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + */ + +/** + @file ocb3_encrypt.c + OCB implementation, encrypt data, by Tom St Denis +*/ +#include "tomcrypt.h" + +#ifdef LTC_OCB3_MODE + +/** + Encrypt blocks of data with OCB + @param ocb The OCB state + @param pt The plaintext (length multiple of the block size of the block cipher) + @param ptlen The length of the input (octets) + @param ct [out] The ciphertext (same size as the pt) + @return CRYPT_OK if successful +*/ +int ocb3_encrypt(ocb3_state *ocb, const unsigned char *pt, unsigned long ptlen, unsigned char *ct) +{ + unsigned char tmp[MAXBLOCKSIZE]; + int err, i, full_blocks; + unsigned char *pt_b, *ct_b; + + LTC_ARGCHK(ocb != NULL); + if (ptlen == 0) return CRYPT_OK; /* no data, nothing to do */ + LTC_ARGCHK(pt != NULL); + LTC_ARGCHK(ct != NULL); + + if ((err = cipher_is_valid(ocb->cipher)) != CRYPT_OK) { + return err; + } + if (ocb->block_len != cipher_descriptor[ocb->cipher].block_length) { + return CRYPT_INVALID_ARG; + } + + if (ptlen % ocb->block_len) { /* ptlen has to bu multiple of block_len */ + return CRYPT_INVALID_ARG; + } + + full_blocks = ptlen/ocb->block_len; + for(i=0; i<full_blocks; i++) { + pt_b = (unsigned char *)pt+i*ocb->block_len; + ct_b = (unsigned char *)ct+i*ocb->block_len; + + /* ocb->Offset_current[] = ocb->Offset_current[] ^ Offset_{ntz(block_index)} */ + ocb3_int_xor_blocks(ocb->Offset_current, ocb->Offset_current, ocb->L_[ocb3_int_ntz(ocb->block_index)], ocb->block_len); + + /* tmp[] = pt[] XOR ocb->Offset_current[] */ + ocb3_int_xor_blocks(tmp, pt_b, ocb->Offset_current, ocb->block_len); + + /* encrypt */ + if ((err = cipher_descriptor[ocb->cipher].ecb_encrypt(tmp, tmp, &ocb->key)) != CRYPT_OK) { + goto LBL_ERR; + } + + /* ct[] = tmp[] XOR ocb->Offset_current[] */ + ocb3_int_xor_blocks(ct_b, tmp, ocb->Offset_current, ocb->block_len); + + /* ocb->checksum[] = ocb->checksum[] XOR pt[] */ + ocb3_int_xor_blocks(ocb->checksum, ocb->checksum, pt_b, ocb->block_len); + + ocb->block_index++; + } + + err = CRYPT_OK; + +LBL_ERR: +#ifdef LTC_CLEAN_STACK + zeromem(tmp, sizeof(tmp)); +#endif + return err; +} + +#endif + +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/encauth/ocb3/ocb3_encrypt_authenticate_memory.c b/libtomcrypt/src/encauth/ocb3/ocb3_encrypt_authenticate_memory.c new file mode 100644 index 0000000..efc1a8f --- /dev/null +++ b/libtomcrypt/src/encauth/ocb3/ocb3_encrypt_authenticate_memory.c @@ -0,0 +1,82 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + */ + +/** + @file ocb3_encrypt_authenticate_memory.c + OCB implementation, encrypt block of memory, by Tom St Denis +*/ +#include "tomcrypt.h" + +#ifdef LTC_OCB3_MODE + +/** + Encrypt and generate an authentication code for a buffer of memory + @param cipher The index of the cipher desired + @param key The secret key + @param keylen The length of the secret key (octets) + @param nonce The session nonce (length of the block ciphers block size) + @param noncelen The length of the nonce (octets) + @param adata The AAD - additional associated data + @param adatalen The length of AAD (octets) + @param pt The plaintext + @param ptlen The length of the plaintext (octets) + @param ct [out] The ciphertext + @param tag [out] The authentication tag + @param taglen [in/out] The max size and resulting size of the authentication tag + @return CRYPT_OK if successful +*/ +int ocb3_encrypt_authenticate_memory(int cipher, + const unsigned char *key, unsigned long keylen, + const unsigned char *nonce, unsigned long noncelen, + const unsigned char *adata, unsigned long adatalen, + const unsigned char *pt, unsigned long ptlen, + unsigned char *ct, + unsigned char *tag, unsigned long *taglen) +{ + int err; + ocb3_state *ocb; + + LTC_ARGCHK(taglen != NULL); + + /* allocate memory */ + ocb = XMALLOC(sizeof(ocb3_state)); + if (ocb == NULL) { + return CRYPT_MEM; + } + + if ((err = ocb3_init(ocb, cipher, key, keylen, nonce, noncelen, *taglen)) != CRYPT_OK) { + goto LBL_ERR; + } + + if (adata != NULL || adatalen != 0) { + if ((err = ocb3_add_aad(ocb, adata, adatalen)) != CRYPT_OK) { + goto LBL_ERR; + } + } + + if ((err = ocb3_encrypt_last(ocb, pt, ptlen, ct)) != CRYPT_OK) { + goto LBL_ERR; + } + + err = ocb3_done(ocb, tag, taglen); + +LBL_ERR: +#ifdef LTC_CLEAN_STACK + zeromem(ocb, sizeof(ocb3_state)); +#endif + + XFREE(ocb); + return err; +} + +#endif + +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/encauth/ocb3/ocb3_encrypt_last.c b/libtomcrypt/src/encauth/ocb3/ocb3_encrypt_last.c new file mode 100644 index 0000000..8110a3c --- /dev/null +++ b/libtomcrypt/src/encauth/ocb3/ocb3_encrypt_last.c @@ -0,0 +1,112 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + */ + +/** + @file ocb3_encrypt_last.c + OCB implementation, internal helper, by Karel Miko +*/ +#include "tomcrypt.h" + +#ifdef LTC_OCB3_MODE + +/** + Finish an OCB (encryption) stream + @param ocb The OCB state + @param pt The remaining plaintext + @param ptlen The length of the plaintext (octets) + @param ct [out] The output buffer + @return CRYPT_OK if successful +*/ +int ocb3_encrypt_last(ocb3_state *ocb, const unsigned char *pt, unsigned long ptlen, unsigned char *ct) +{ + unsigned char iOffset_star[MAXBLOCKSIZE]; + unsigned char iPad[MAXBLOCKSIZE]; + int err, x, full_blocks, full_blocks_len, last_block_len; + + LTC_ARGCHK(ocb != NULL); + if (pt == NULL) LTC_ARGCHK(ptlen == 0); + if (ptlen != 0) { + LTC_ARGCHK(pt != NULL); + LTC_ARGCHK(ct != NULL); + } + + if ((err = cipher_is_valid(ocb->cipher)) != CRYPT_OK) { + goto LBL_ERR; + } + + full_blocks = ptlen/ocb->block_len; + full_blocks_len = full_blocks * ocb->block_len; + last_block_len = ptlen - full_blocks_len; + + /* process full blocks first */ + if (full_blocks>0) { + if ((err = ocb3_encrypt(ocb, pt, full_blocks_len, ct)) != CRYPT_OK) { + goto LBL_ERR; + } + } + + /* at this point: m = ocb->block_index (last block index), Offset_m = ocb->Offset_current */ + + if (last_block_len>0) { + /* Offset_* = Offset_m xor L_* */ + ocb3_int_xor_blocks(iOffset_star, ocb->Offset_current, ocb->L_star, ocb->block_len); + + /* Pad = ENCIPHER(K, Offset_*) */ + if ((err = cipher_descriptor[ocb->cipher].ecb_encrypt(iOffset_star, iPad, &ocb->key)) != CRYPT_OK) { + goto LBL_ERR; + } + + /* C_* = P_* xor Pad[1..bitlen(P_*)] */ + ocb3_int_xor_blocks(ct+full_blocks_len, pt+full_blocks_len, iPad, last_block_len); + + /* Checksum_* = Checksum_m xor (P_* || 1 || zeros(127-bitlen(P_*))) */ + ocb3_int_xor_blocks(ocb->checksum, ocb->checksum, pt+full_blocks_len, last_block_len); + for(x=last_block_len; x<ocb->block_len; x++) { + if (x == last_block_len) + ocb->checksum[x] ^= 0x80; + else + ocb->checksum[x] ^= 0x00; + } + + /* Tag = ENCIPHER(K, Checksum_* xor Offset_* xor L_$) xor HASH(K,A) */ + /* at this point we calculate only: Tag_part = ENCIPHER(K, Checksum_* xor Offset_* xor L_$) */ + for(x=0; x<ocb->block_len; x++) { + ocb->tag_part[x] = (ocb->checksum[x] ^ iOffset_star[x]) ^ ocb->L_dollar[x]; + } + if ((err = cipher_descriptor[ocb->cipher].ecb_encrypt(ocb->tag_part, ocb->tag_part, &ocb->key)) != CRYPT_OK) { + goto LBL_ERR; + } + } + else { + /* Tag = ENCIPHER(K, Checksum_m xor Offset_m xor L_$) xor HASH(K,A) */ + /* at this point we calculate only: Tag_part = ENCIPHER(K, Checksum_m xor Offset_m xor L_$) */ + for(x=0; x<ocb->block_len; x++) { + ocb->tag_part[x] = (ocb->checksum[x] ^ ocb->Offset_current[x]) ^ ocb->L_dollar[x]; + } + if ((err = cipher_descriptor[ocb->cipher].ecb_encrypt(ocb->tag_part, ocb->tag_part, &ocb->key)) != CRYPT_OK) { + goto LBL_ERR; + } + } + + err = CRYPT_OK; + +LBL_ERR: +#ifdef LTC_CLEAN_STACK + zeromem(iOffset_star, MAXBLOCKSIZE); + zeromem(iPad, MAXBLOCKSIZE); +#endif + + return err; +} + +#endif + +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/encauth/ocb3/ocb3_init.c b/libtomcrypt/src/encauth/ocb3/ocb3_init.c new file mode 100644 index 0000000..a3cabae --- /dev/null +++ b/libtomcrypt/src/encauth/ocb3/ocb3_init.c @@ -0,0 +1,196 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + */ + +/** + @file ocb3_init.c + OCB implementation, initialize state, by Tom St Denis +*/ +#include "tomcrypt.h" + +#ifdef LTC_OCB3_MODE + +static void _ocb3_int_calc_offset_zero(ocb3_state *ocb, const unsigned char *nonce, unsigned long noncelen, unsigned long taglen) +{ + int x, y, bottom; + int idx, shift; + unsigned char iNonce[MAXBLOCKSIZE]; + unsigned char iKtop[MAXBLOCKSIZE]; + unsigned char iStretch[MAXBLOCKSIZE+8]; + + /* Nonce = zeros(127-bitlen(N)) || 1 || N */ + zeromem(iNonce, sizeof(iNonce)); + for (x = ocb->block_len-1, y=0; y<(int)noncelen; x--, y++) { + iNonce[x] = nonce[noncelen-y-1]; + } + iNonce[x] = 0x01; + iNonce[0] |= ((taglen*8) % 128) << 1; + + /* bottom = str2num(Nonce[123..128]) */ + bottom = iNonce[ocb->block_len-1] & 0x3F; + + /* Ktop = ENCIPHER(K, Nonce[1..122] || zeros(6)) */ + iNonce[ocb->block_len-1] = iNonce[ocb->block_len-1] & 0xC0; + if ((cipher_descriptor[ocb->cipher].ecb_encrypt(iNonce, iKtop, &ocb->key)) != CRYPT_OK) { + zeromem(ocb->Offset_current, ocb->block_len); + return; + } + + /* Stretch = Ktop || (Ktop[1..64] xor Ktop[9..72]) */ + for (x = 0; x < ocb->block_len; x++) { + iStretch[x] = iKtop[x]; + } + for (y = 0; y < 8; y++) { + iStretch[x+y] = iKtop[y] ^ iKtop[y+1]; + } + + /* Offset_0 = Stretch[1+bottom..128+bottom] */ + idx = bottom / 8; + shift = (bottom % 8); + for (x = 0; x < ocb->block_len; x++) { + ocb->Offset_current[x] = iStretch[idx+x] << shift; + if (shift > 0) { + ocb->Offset_current[x] |= iStretch[idx+x+1] >> (8-shift); + } + } +} + +static const struct { + int len; + unsigned char poly_mul[MAXBLOCKSIZE]; +} polys[] = { +{ + 8, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x1B } +}, { + 16, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x87 } +} +}; + +/** + Initialize an OCB context + @param ocb [out] The destination of the OCB state + @param cipher The index of the desired cipher + @param key The secret key + @param keylen The length of the secret key (octets) + @param nonce The session nonce + @param noncelen The length of the session nonce (octets, up to 15) + @param taglen The length of the tag (octets, up to 16) + @return CRYPT_OK if successful +*/ +int ocb3_init(ocb3_state *ocb, int cipher, + const unsigned char *key, unsigned long keylen, + const unsigned char *nonce, unsigned long noncelen, + unsigned long taglen) +{ + int poly, x, y, m, err; + unsigned char *previous, *current; + + LTC_ARGCHK(ocb != NULL); + LTC_ARGCHK(key != NULL); + LTC_ARGCHK(nonce != NULL); + + /* valid cipher? */ + if ((err = cipher_is_valid(cipher)) != CRYPT_OK) { + return err; + } + ocb->cipher = cipher; + + /* Valid Nonce? + * As of RFC7253: "string of no more than 120 bits" */ + if (noncelen > (120/8)) { + return CRYPT_INVALID_ARG; + } + + /* The blockcipher must have a 128-bit blocksize */ + if (cipher_descriptor[cipher].block_length != 16) { + return CRYPT_INVALID_ARG; + } + + /* The TAGLEN may be any value up to 128 (bits) */ + if (taglen > 16) { + return CRYPT_INVALID_ARG; + } + ocb->tag_len = taglen; + + /* determine which polys to use */ + ocb->block_len = cipher_descriptor[cipher].block_length; + x = (int)(sizeof(polys)/sizeof(polys[0])); + for (poly = 0; poly < x; poly++) { + if (polys[poly].len == ocb->block_len) { + break; + } + } + if (poly == x) { + return CRYPT_INVALID_ARG; /* block_len not found in polys */ + } + if (polys[poly].len != ocb->block_len) { + return CRYPT_INVALID_ARG; + } + + /* schedule the key */ + if ((err = cipher_descriptor[cipher].setup(key, keylen, 0, &ocb->key)) != CRYPT_OK) { + return err; + } + + /* L_* = ENCIPHER(K, zeros(128)) */ + zeromem(ocb->L_star, ocb->block_len); + if ((err = cipher_descriptor[cipher].ecb_encrypt(ocb->L_star, ocb->L_star, &ocb->key)) != CRYPT_OK) { + return err; + } + + /* compute L_$, L_0, L_1, ... */ + for (x = -1; x < 32; x++) { + if (x == -1) { /* gonna compute: L_$ = double(L_*) */ + current = ocb->L_dollar; + previous = ocb->L_star; + } + else if (x == 0) { /* gonna compute: L_0 = double(L_$) */ + current = ocb->L_[0]; + previous = ocb->L_dollar; + } + else { /* gonna compute: L_i = double(L_{i-1}) for every integer i > 0 */ + current = ocb->L_[x]; + previous = ocb->L_[x-1]; + } + m = previous[0] >> 7; + for (y = 0; y < ocb->block_len-1; y++) { + current[y] = ((previous[y] << 1) | (previous[y+1] >> 7)) & 255; + } + current[ocb->block_len-1] = (previous[ocb->block_len-1] << 1) & 255; + if (m == 1) { + /* current[] = current[] XOR polys[poly].poly_mul[]*/ + ocb3_int_xor_blocks(current, current, polys[poly].poly_mul, ocb->block_len); + } + } + + /* initialize ocb->Offset_current = Offset_0 */ + _ocb3_int_calc_offset_zero(ocb, nonce, noncelen, taglen); + + /* initialize checksum to all zeros */ + zeromem(ocb->checksum, ocb->block_len); + + /* set block index */ + ocb->block_index = 1; + + /* initialize AAD related stuff */ + ocb->ablock_index = 1; + ocb->adata_buffer_bytes = 0; + zeromem(ocb->aOffset_current, ocb->block_len); + zeromem(ocb->aSum_current, ocb->block_len); + + return CRYPT_OK; +} + +#endif + +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/encauth/ocb3/ocb3_int_ntz.c b/libtomcrypt/src/encauth/ocb3/ocb3_int_ntz.c new file mode 100644 index 0000000..3c5b18d --- /dev/null +++ b/libtomcrypt/src/encauth/ocb3/ocb3_int_ntz.c @@ -0,0 +1,39 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + */ + +/** + @file ocb3_int_ntz.c + OCB implementation, INTERNAL ONLY helper, by Tom St Denis +*/ +#include "tomcrypt.h" + +#ifdef LTC_OCB3_MODE + +/** + Returns the number of leading zero bits [from lsb up] (internal function) + @param x The 32-bit value to observe + @return The number of bits [from the lsb up] that are zero +*/ +int ocb3_int_ntz(unsigned long x) +{ + int c; + x &= 0xFFFFFFFFUL; + c = 0; + while ((x & 1) == 0) { + ++c; + x >>= 1; + } + return c; +} + +#endif + +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/encauth/ocb3/ocb3_int_xor_blocks.c b/libtomcrypt/src/encauth/ocb3/ocb3_int_xor_blocks.c new file mode 100644 index 0000000..798bddc --- /dev/null +++ b/libtomcrypt/src/encauth/ocb3/ocb3_int_xor_blocks.c @@ -0,0 +1,40 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + */ + +/** + @file ocb3_int_xor_blocks.c + OCB implementation, INTERNAL ONLY helper, by Karel Miko +*/ +#include "tomcrypt.h" + +#ifdef LTC_OCB3_MODE + +/** + Compute xor for two blocks of bytes 'out = block_a XOR block_b' (internal function) + @param out The block of bytes (output) + @param block_a The block of bytes (input) + @param block_b The block of bytes (input) + @param block_len The size of block_a, block_b, out +*/ +void ocb3_int_xor_blocks(unsigned char *out, const unsigned char *block_a, const unsigned char *block_b, unsigned long block_len) +{ + int x; + if (out == block_a) { + for (x = 0; x < (int)block_len; x++) out[x] ^= block_b[x]; + } + else { + for (x = 0; x < (int)block_len; x++) out[x] = block_a[x] ^ block_b[x]; + } +} + +#endif + +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/encauth/ocb3/ocb3_test.c b/libtomcrypt/src/encauth/ocb3/ocb3_test.c new file mode 100644 index 0000000..a3e5062 --- /dev/null +++ b/libtomcrypt/src/encauth/ocb3/ocb3_test.c @@ -0,0 +1,309 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + */ + +/** + @file ocb3_test.c + OCB implementation, self-test by Tom St Denis +*/ +#include "tomcrypt.h" + +#ifdef LTC_OCB3_MODE + +/** + Test the OCB protocol + @return CRYPT_OK if successful +*/ +int ocb3_test(void) +{ +#ifndef LTC_TEST + return CRYPT_NOP; +#else + /* test vectors from: http://tools.ietf.org/html/draft-krovetz-ocb-03 */ + unsigned char key[16] = { 0x00,0x01,0x02,0x03,0x04,0x05,0x06,0x07,0x08,0x09,0x0A,0x0B,0x0C,0x0D,0x0E,0x0F }; + unsigned char nonce[12] = { 0x00,0x01,0x02,0x03,0x04,0x05,0x06,0x07,0x08,0x09,0x0A,0x0B }; + const struct { + int ptlen; + int aadlen; + unsigned char pt[64], aad[64], ct[64], tag[16]; + } tests[] = { + + { /* index:0 */ + 0, /* PLAINTEXT length */ + 0, /* AAD length */ + { 0 }, /* PLAINTEXT */ + { 0 }, /* AAD */ + { 0 }, /* CIPHERTEXT */ + { 0x19,0x7b,0x9c,0x3c,0x44,0x1d,0x3c,0x83,0xea,0xfb,0x2b,0xef,0x63,0x3b,0x91,0x82 }, /* TAG */ + }, + { /* index:1 */ + 8, /* PLAINTEXT length */ + 8, /* AAD length */ + { 0x00,0x01,0x02,0x03,0x04,0x05,0x06,0x07 }, /* PLAINTEXT */ + { 0x00,0x01,0x02,0x03,0x04,0x05,0x06,0x07 }, /* AAD */ + { 0x92,0xb6,0x57,0x13,0x0a,0x74,0xb8,0x5a }, /* CIPHERTEXT */ + { 0x16,0xdc,0x76,0xa4,0x6d,0x47,0xe1,0xea,0xd5,0x37,0x20,0x9e,0x8a,0x96,0xd1,0x4e }, /* TAG */ + }, + { /* index:2 */ + 0, /* PLAINTEXT length */ + 8, /* AAD length */ + { 0 }, /* PLAINTEXT */ + { 0x00,0x01,0x02,0x03,0x04,0x05,0x06,0x07 }, /* AAD */ + { 0 }, /* CIPHERTEXT */ + { 0x98,0xb9,0x15,0x52,0xc8,0xc0,0x09,0x18,0x50,0x44,0xe3,0x0a,0x6e,0xb2,0xfe,0x21 }, /* TAG */ + }, + { /* index:3 */ + 8, /* PLAINTEXT length */ + 0, /* AAD length */ + { 0x00,0x01,0x02,0x03,0x04,0x05,0x06,0x07 }, /* PLAINTEXT */ + { 0 }, /* AAD */ + { 0x92,0xb6,0x57,0x13,0x0a,0x74,0xb8,0x5a }, /* CIPHERTEXT */ + { 0x97,0x1e,0xff,0xca,0xe1,0x9a,0xd4,0x71,0x6f,0x88,0xe8,0x7b,0x87,0x1f,0xbe,0xed }, /* TAG */ + }, + { /* index:4 */ + 16, /* PLAINTEXT length */ + 16, /* AAD length */ + { 0x00,0x01,0x02,0x03,0x04,0x05,0x06,0x07,0x08,0x09,0x0a,0x0b,0x0c,0x0d,0x0e,0x0f }, /* PLAINTEXT */ + { 0x00,0x01,0x02,0x03,0x04,0x05,0x06,0x07,0x08,0x09,0x0a,0x0b,0x0c,0x0d,0x0e,0x0f }, /* AAD */ + { 0xbe,0xa5,0xe8,0x79,0x8d,0xbe,0x71,0x10,0x03,0x1c,0x14,0x4d,0xa0,0xb2,0x61,0x22 }, /* CIPHERTEXT */ + { 0x77,0x6c,0x99,0x24,0xd6,0x72,0x3a,0x1f,0xc4,0x52,0x45,0x32,0xac,0x3e,0x5b,0xeb }, /* TAG */ + }, + { /* index:5 */ + 0, /* PLAINTEXT length */ + 16, /* AAD length */ + { 0 }, /* PLAINTEXT */ + { 0x00,0x01,0x02,0x03,0x04,0x05,0x06,0x07,0x08,0x09,0x0a,0x0b,0x0c,0x0d,0x0e,0x0f }, /* AAD */ + { 0 }, /* CIPHERTEXT */ + { 0x7d,0xdb,0x8e,0x6c,0xea,0x68,0x14,0x86,0x62,0x12,0x50,0x96,0x19,0xb1,0x9c,0xc6 }, /* TAG */ + }, + { /* index:6 */ + 16, /* PLAINTEXT length */ + 0, /* AAD length */ + { 0x00,0x01,0x02,0x03,0x04,0x05,0x06,0x07,0x08,0x09,0x0a,0x0b,0x0c,0x0d,0x0e,0x0f }, /* PLAINTEXT */ + { 0 }, /* AAD */ + { 0xbe,0xa5,0xe8,0x79,0x8d,0xbe,0x71,0x10,0x03,0x1c,0x14,0x4d,0xa0,0xb2,0x61,0x22 }, /* CIPHERTEXT */ + { 0x13,0xcc,0x8b,0x74,0x78,0x07,0x12,0x1a,0x4c,0xbb,0x3e,0x4b,0xd6,0xb4,0x56,0xaf }, /* TAG */ + }, + { /* index:7 */ + 24, /* PLAINTEXT length */ + 24, /* AAD length */ + { 0x00,0x01,0x02,0x03,0x04,0x05,0x06,0x07,0x08,0x09,0x0a,0x0b,0x0c,0x0d,0x0e,0x0f,0x10,0x11,0x12,0x13,0x14,0x15,0x16,0x17 }, /* PLAINTEXT */ + { 0x00,0x01,0x02,0x03,0x04,0x05,0x06,0x07,0x08,0x09,0x0a,0x0b,0x0c,0x0d,0x0e,0x0f,0x10,0x11,0x12,0x13,0x14,0x15,0x16,0x17 }, /* AAD */ + { 0xbe,0xa5,0xe8,0x79,0x8d,0xbe,0x71,0x10,0x03,0x1c,0x14,0x4d,0xa0,0xb2,0x61,0x22,0xfc,0xfc,0xee,0x7a,0x2a,0x8d,0x4d,0x48 }, /* CIPHERTEXT */ + { 0x5f,0xa9,0x4f,0xc3,0xf3,0x88,0x20,0xf1,0xdc,0x3f,0x3d,0x1f,0xd4,0xe5,0x5e,0x1c }, /* TAG */ + }, + { /* index:8 */ + 0, /* PLAINTEXT length */ + 24, /* AAD length */ + { 0 }, /* PLAINTEXT */ + { 0x00,0x01,0x02,0x03,0x04,0x05,0x06,0x07,0x08,0x09,0x0a,0x0b,0x0c,0x0d,0x0e,0x0f,0x10,0x11,0x12,0x13,0x14,0x15,0x16,0x17 }, /* AAD */ + { 0 }, /* CIPHERTEXT */ + { 0x28,0x20,0x26,0xda,0x30,0x68,0xbc,0x9f,0xa1,0x18,0x68,0x1d,0x55,0x9f,0x10,0xf6 }, /* TAG */ + }, + { /* index:9 */ + 24, /* PLAINTEXT length */ + 0, /* AAD length */ + { 0x00,0x01,0x02,0x03,0x04,0x05,0x06,0x07,0x08,0x09,0x0a,0x0b,0x0c,0x0d,0x0e,0x0f,0x10,0x11,0x12,0x13,0x14,0x15,0x16,0x17 }, /* PLAINTEXT */ + { 0 }, /* AAD */ + { 0xbe,0xa5,0xe8,0x79,0x8d,0xbe,0x71,0x10,0x03,0x1c,0x14,0x4d,0xa0,0xb2,0x61,0x22,0xfc,0xfc,0xee,0x7a,0x2a,0x8d,0x4d,0x48 }, /* CIPHERTEXT */ + { 0x6e,0xf2,0xf5,0x25,0x87,0xfd,0xa0,0xed,0x97,0xdc,0x7e,0xed,0xe2,0x41,0xdf,0x68 }, /* TAG */ + }, + { /* index:10 */ + 32, /* PLAINTEXT length */ + 32, /* AAD length */ + { 0x00,0x01,0x02,0x03,0x04,0x05,0x06,0x07,0x08,0x09,0x0a,0x0b,0x0c,0x0d,0x0e,0x0f,0x10,0x11,0x12,0x13,0x14,0x15,0x16,0x17,0x18,0x19,0x1a,0x1b,0x1c,0x1d,0x1e,0x1f }, /* PLAINTEXT */ + { 0x00,0x01,0x02,0x03,0x04,0x05,0x06,0x07,0x08,0x09,0x0a,0x0b,0x0c,0x0d,0x0e,0x0f,0x10,0x11,0x12,0x13,0x14,0x15,0x16,0x17,0x18,0x19,0x1a,0x1b,0x1c,0x1d,0x1e,0x1f }, /* AAD */ + { 0xbe,0xa5,0xe8,0x79,0x8d,0xbe,0x71,0x10,0x03,0x1c,0x14,0x4d,0xa0,0xb2,0x61,0x22,0xce,0xaa,0xb9,0xb0,0x5d,0xf7,0x71,0xa6,0x57,0x14,0x9d,0x53,0x77,0x34,0x63,0xcb }, /* CIPHERTEXT */ + { 0xb2,0xa0,0x40,0xdd,0x3b,0xd5,0x16,0x43,0x72,0xd7,0x6d,0x7b,0xb6,0x82,0x42,0x40 }, /* TAG */ + }, + { /* index:11 */ + 0, /* PLAINTEXT length */ + 32, /* AAD length */ + { 0 }, /* PLAINTEXT */ + { 0x00,0x01,0x02,0x03,0x04,0x05,0x06,0x07,0x08,0x09,0x0a,0x0b,0x0c,0x0d,0x0e,0x0f,0x10,0x11,0x12,0x13,0x14,0x15,0x16,0x17,0x18,0x19,0x1a,0x1b,0x1c,0x1d,0x1e,0x1f }, /* AAD */ + { 0 }, /* CIPHERTEXT */ + { 0xe1,0xe0,0x72,0x63,0x3b,0xad,0xe5,0x1a,0x60,0xe8,0x59,0x51,0xd9,0xc4,0x2a,0x1b }, /* TAG */ + }, + { /* index:12 */ + 32, /* PLAINTEXT length */ + 0, /* AAD length */ + { 0x00,0x01,0x02,0x03,0x04,0x05,0x06,0x07,0x08,0x09,0x0a,0x0b,0x0c,0x0d,0x0e,0x0f,0x10,0x11,0x12,0x13,0x14,0x15,0x16,0x17,0x18,0x19,0x1a,0x1b,0x1c,0x1d,0x1e,0x1f }, /* PLAINTEXT */ + { 0 }, /* AAD */ + { 0xbe,0xa5,0xe8,0x79,0x8d,0xbe,0x71,0x10,0x03,0x1c,0x14,0x4d,0xa0,0xb2,0x61,0x22,0xce,0xaa,0xb9,0xb0,0x5d,0xf7,0x71,0xa6,0x57,0x14,0x9d,0x53,0x77,0x34,0x63,0xcb }, /* CIPHERTEXT */ + { 0x4a,0x3b,0xae,0x82,0x44,0x65,0xcf,0xda,0xf8,0xc4,0x1f,0xc5,0x0c,0x7d,0xf9,0xd9 }, /* TAG */ + }, + { /* index:13 */ + 40, /* PLAINTEXT length */ + 40, /* AAD length */ + { 0x00,0x01,0x02,0x03,0x04,0x05,0x06,0x07,0x08,0x09,0x0a,0x0b,0x0c,0x0d,0x0e,0x0f,0x10,0x11,0x12,0x13,0x14,0x15,0x16,0x17,0x18,0x19,0x1a,0x1b,0x1c,0x1d,0x1e,0x1f,0x20,0x21,0x22,0x23,0x24,0x25,0x26,0x27 }, /* PLAINTEXT */ + { 0x00,0x01,0x02,0x03,0x04,0x05,0x06,0x07,0x08,0x09,0x0a,0x0b,0x0c,0x0d,0x0e,0x0f,0x10,0x11,0x12,0x13,0x14,0x15,0x16,0x17,0x18,0x19,0x1a,0x1b,0x1c,0x1d,0x1e,0x1f,0x20,0x21,0x22,0x23,0x24,0x25,0x26,0x27 }, /* AAD */ + { 0xbe,0xa5,0xe8,0x79,0x8d,0xbe,0x71,0x10,0x03,0x1c,0x14,0x4d,0xa0,0xb2,0x61,0x22,0xce,0xaa,0xb9,0xb0,0x5d,0xf7,0x71,0xa6,0x57,0x14,0x9d,0x53,0x77,0x34,0x63,0xcb,0x68,0xc6,0x57,0x78,0xb0,0x58,0xa6,0x35 }, /* CIPHERTEXT */ + { 0x65,0x9c,0x62,0x32,0x11,0xde,0xea,0x0d,0xe3,0x0d,0x2c,0x38,0x18,0x79,0xf4,0xc8 }, /* TAG */ + }, + { /* index:14 */ + 0, /* PLAINTEXT length */ + 40, /* AAD length */ + { 0 }, /* PLAINTEXT */ + { 0x00,0x01,0x02,0x03,0x04,0x05,0x06,0x07,0x08,0x09,0x0a,0x0b,0x0c,0x0d,0x0e,0x0f,0x10,0x11,0x12,0x13,0x14,0x15,0x16,0x17,0x18,0x19,0x1a,0x1b,0x1c,0x1d,0x1e,0x1f,0x20,0x21,0x22,0x23,0x24,0x25,0x26,0x27 }, /* AAD */ + { 0 }, /* CIPHERTEXT */ + { 0x7a,0xeb,0x7a,0x69,0xa1,0x68,0x7d,0xd0,0x82,0xca,0x27,0xb0,0xd9,0xa3,0x70,0x96 }, /* TAG */ + }, + { /* index:15 */ + 40, /* PLAINTEXT length */ + 0, /* AAD length */ + { 0x00,0x01,0x02,0x03,0x04,0x05,0x06,0x07,0x08,0x09,0x0a,0x0b,0x0c,0x0d,0x0e,0x0f,0x10,0x11,0x12,0x13,0x14,0x15,0x16,0x17,0x18,0x19,0x1a,0x1b,0x1c,0x1d,0x1e,0x1f,0x20,0x21,0x22,0x23,0x24,0x25,0x26,0x27 }, /* PLAINTEXT */ + { 0 }, /* AAD */ + { 0xbe,0xa5,0xe8,0x79,0x8d,0xbe,0x71,0x10,0x03,0x1c,0x14,0x4d,0xa0,0xb2,0x61,0x22,0xce,0xaa,0xb9,0xb0,0x5d,0xf7,0x71,0xa6,0x57,0x14,0x9d,0x53,0x77,0x34,0x63,0xcb,0x68,0xc6,0x57,0x78,0xb0,0x58,0xa6,0x35 }, /* CIPHERTEXT */ + { 0x06,0x0c,0x84,0x67,0xf4,0xab,0xab,0x5e,0x8b,0x3c,0x20,0x67,0xa2,0xe1,0x15,0xdc }, /* TAG */ + }, + +}; + /* As of RFC 7253 - 'Appendix A. Sample Results' + * The next tuple shows a result with a tag length of 96 bits and a + different key. + + K: 0F0E0D0C0B0A09080706050403020100 + + N: BBAA9988776655443322110D + A: 000102030405060708090A0B0C0D0E0F1011121314151617 + 18191A1B1C1D1E1F2021222324252627 + P: 000102030405060708090A0B0C0D0E0F1011121314151617 + 18191A1B1C1D1E1F2021222324252627 + C: 1792A4E31E0755FB03E31B22116E6C2DDF9EFD6E33D536F1 + A0124B0A55BAE884ED93481529C76B6AD0C515F4D1CDD4FD + AC4F02AA + + The C has been split up in C and T (tag) + */ + const unsigned char K[] = { 0x0F,0x0E,0x0D,0x0C,0x0B,0x0A,0x09,0x08, + 0x07,0x06,0x05,0x04,0x03,0x02,0x01,0x00 }; + const unsigned char N[] = { 0xBB,0xAA,0x99,0x88,0x77,0x66,0x55,0x44, + 0x33,0x22,0x11,0x0D }; + const unsigned char A[] = { 0x00,0x01,0x02,0x03,0x04,0x05,0x06,0x07, + 0x08,0x09,0x0A,0x0B,0x0C,0x0D,0x0E,0x0F, + 0x10,0x11,0x12,0x13,0x14,0x15,0x16,0x17, + 0x18,0x19,0x1A,0x1B,0x1C,0x1D,0x1E,0x1F, + 0x20,0x21,0x22,0x23,0x24,0x25,0x26,0x27 }; + const unsigned char P[] = { 0x00,0x01,0x02,0x03,0x04,0x05,0x06,0x07, + 0x08,0x09,0x0A,0x0B,0x0C,0x0D,0x0E,0x0F, + 0x10,0x11,0x12,0x13,0x14,0x15,0x16,0x17, + 0x18,0x19,0x1A,0x1B,0x1C,0x1D,0x1E,0x1F, + 0x20,0x21,0x22,0x23,0x24,0x25,0x26,0x27 }; + const unsigned char C[] = { 0x17,0x92,0xA4,0xE3,0x1E,0x07,0x55,0xFB, + 0x03,0xE3,0x1B,0x22,0x11,0x6E,0x6C,0x2D, + 0xDF,0x9E,0xFD,0x6E,0x33,0xD5,0x36,0xF1, + 0xA0,0x12,0x4B,0x0A,0x55,0xBA,0xE8,0x84, + 0xED,0x93,0x48,0x15,0x29,0xC7,0x6B,0x6A }; + const unsigned char T[] = { 0xD0,0xC5,0x15,0xF4,0xD1,0xCD,0xD4,0xFD, + 0xAC,0x4F,0x02,0xAA }; + + int err, x, idx, res; + unsigned long len; + unsigned char outct[MAXBLOCKSIZE] = { 0 }; + unsigned char outtag[MAXBLOCKSIZE] = { 0 }; + ocb3_state ocb; + + /* AES can be under rijndael or aes... try to find it */ + if ((idx = find_cipher("aes")) == -1) { + if ((idx = find_cipher("rijndael")) == -1) { + return CRYPT_NOP; + } + } + + for (x = 0; x < (int)(sizeof(tests)/sizeof(tests[0])); x++) { + len = 16; /* must be the same as the required taglen */ + if ((err = ocb3_encrypt_authenticate_memory(idx, + key, sizeof(key), + nonce, sizeof(nonce), + tests[x].aadlen != 0 ? tests[x].aad : NULL, tests[x].aadlen, + tests[x].ptlen != 0 ? tests[x].pt : NULL, tests[x].ptlen, + tests[x].ptlen != 0 ? outct : NULL, outtag, &len)) != CRYPT_OK) { + return err; + } + + if (compare_testvector(outtag, len, tests[x].tag, sizeof(tests[x].tag), "OCB3 Tag", x) || + compare_testvector(outct, tests[x].ptlen, tests[x].ct, tests[x].ptlen, "OCB3 CT", x)) { + return CRYPT_FAIL_TESTVECTOR; + } + + if ((err = ocb3_decrypt_verify_memory(idx, + key, sizeof(key), + nonce, sizeof(nonce), + tests[x].aadlen != 0 ? tests[x].aad : NULL, tests[x].aadlen, + tests[x].ptlen != 0 ? outct : NULL, tests[x].ptlen, + tests[x].ptlen != 0 ? outct : NULL, tests[x].tag, len, &res)) != CRYPT_OK) { + return err; + } + if ((res != 1) || compare_testvector(outct, tests[x].ptlen, tests[x].pt, tests[x].ptlen, "OCB3", x)) { +#ifdef LTC_TEST_DBG + printf("\n\nOCB3: Failure-decrypt - res = %d\n", res); +#endif + return CRYPT_FAIL_TESTVECTOR; + } + } + + /* RFC 7253 - test vector with a tag length of 96 bits - part 1 */ + x = 99; + len = 12; + if ((err = ocb3_encrypt_authenticate_memory(idx, + K, sizeof(K), + N, sizeof(N), + A, sizeof(A), + P, sizeof(P), + outct, outtag, &len)) != CRYPT_OK) { + return err; + } + + if (compare_testvector(outtag, len, T, sizeof(T), "OCB3 Tag", x) || + compare_testvector(outct, sizeof(P), C, sizeof(C), "OCB3 CT", x)) { + return CRYPT_FAIL_TESTVECTOR; + } + + if ((err = ocb3_decrypt_verify_memory(idx, + K, sizeof(K), + N, sizeof(N), + A, sizeof(A), + C, sizeof(C), + outct, T, sizeof(T), &res)) != CRYPT_OK) { + return err; + } + if ((res != 1) || compare_testvector(outct, sizeof(C), P, sizeof(P), "OCB3", x)) { +#ifdef LTC_TEST_DBG + printf("\n\nOCB3: Failure-decrypt - res = %d\n", res); +#endif + return CRYPT_FAIL_TESTVECTOR; + } + + /* RFC 7253 - test vector with a tag length of 96 bits - part 2 */ + x = 100; + if ((err = ocb3_init(&ocb, idx, K, sizeof(K), N, sizeof(N), 12)) != CRYPT_OK) return err; + if ((err = ocb3_add_aad(&ocb, A, sizeof(A))) != CRYPT_OK) return err; + if ((err = ocb3_encrypt(&ocb, P, 32, outct)) != CRYPT_OK) return err; + if ((err = ocb3_encrypt_last(&ocb, P+32, sizeof(P)-32, outct+32)) != CRYPT_OK) return err; + len = sizeof(outtag); /* intentionally more than 12 */ + if ((err = ocb3_done(&ocb, outtag, &len)) != CRYPT_OK) return err; + if (compare_testvector(outct, sizeof(P), C, sizeof(C), "OCB3 CT", x)) return CRYPT_FAIL_TESTVECTOR; + if (compare_testvector(outtag, len, T, sizeof(T), "OCB3 Tag.enc", x)) return CRYPT_FAIL_TESTVECTOR; + if ((err = ocb3_init(&ocb, idx, K, sizeof(K), N, sizeof(N), 12)) != CRYPT_OK) return err; + if ((err = ocb3_add_aad(&ocb, A, sizeof(A))) != CRYPT_OK) return err; + if ((err = ocb3_decrypt(&ocb, C, 32, outct)) != CRYPT_OK) return err; + if ((err = ocb3_decrypt_last(&ocb, C+32, sizeof(C)-32, outct+32)) != CRYPT_OK) return err; + len = sizeof(outtag); /* intentionally more than 12 */ + if ((err = ocb3_done(&ocb, outtag, &len)) != CRYPT_OK) return err; + if (compare_testvector(outct, sizeof(C), P, sizeof(P), "OCB3 PT", x)) return CRYPT_FAIL_TESTVECTOR; + if (compare_testvector(outtag, len, T, sizeof(T), "OCB3 Tag.dec", x)) return CRYPT_FAIL_TESTVECTOR; + + return CRYPT_OK; +#endif /* LTC_TEST */ +} + +#endif /* LTC_OCB3_MODE */ + +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/hashes/blake2b.c b/libtomcrypt/src/hashes/blake2b.c new file mode 100644 index 0000000..cd5115c --- /dev/null +++ b/libtomcrypt/src/hashes/blake2b.c @@ -0,0 +1,588 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + */ + +/* + BLAKE2 reference source code package - reference C implementations + + Copyright 2012, Samuel Neves <sneves@dei.uc.pt>. You may use this under the + terms of the CC0, the OpenSSL Licence, or the Apache Public License 2.0, at + your option. The terms of these licenses can be found at: + + - CC0 1.0 Universal : http://creativecommons.org/publicdomain/zero/1.0 + - OpenSSL license : https://www.openssl.org/source/license.html + - Apache 2.0 : http://www.apache.org/licenses/LICENSE-2.0 + + More information about the BLAKE2 hash function can be found at + https://blake2.net. +*/ +/* see also https://www.ietf.org/rfc/rfc7693.txt */ + +#include "tomcrypt.h" + +#ifdef LTC_BLAKE2B + +enum blake2b_constant { + BLAKE2B_BLOCKBYTES = 128, + BLAKE2B_OUTBYTES = 64, + BLAKE2B_KEYBYTES = 64, + BLAKE2B_SALTBYTES = 16, + BLAKE2B_PERSONALBYTES = 16, + BLAKE2B_PARAM_SIZE = 64 +}; + +/* param offsets */ +enum { + O_DIGEST_LENGTH = 0, + O_KEY_LENGTH = 1, + O_FANOUT = 2, + O_DEPTH = 3, + O_LEAF_LENGTH = 4, + O_NODE_OFFSET = 8, + O_XOF_LENGTH = 12, + O_NODE_DEPTH = 16, + O_INNER_LENGTH = 17, + O_RESERVED = 18, + O_SALT = 32, + O_PERSONAL = 48 +}; + +/* +struct blake2b_param { + unsigned char digest_length; + unsigned char key_length; + unsigned char fanout; + unsigned char depth; + ulong32 leaf_length; + ulong32 node_offset; + ulong32 xof_length; + unsigned char node_depth; + unsigned char inner_length; + unsigned char reserved[14]; + unsigned char salt[BLAKE2B_SALTBYTES]; + unsigned char personal[BLAKE2B_PERSONALBYTES]; +}; +*/ + +const struct ltc_hash_descriptor blake2b_160_desc = +{ + "blake2b-160", + 25, + 20, + 128, + { 1, 3, 6, 1, 4, 1, 1722, 12, 2, 1, 5 }, + 11, + &blake2b_160_init, + &blake2b_process, + &blake2b_done, + &blake2b_160_test, + NULL +}; + +const struct ltc_hash_descriptor blake2b_256_desc = +{ + "blake2b-256", + 26, + 32, + 128, + { 1, 3, 6, 1, 4, 1, 1722, 12, 2, 1, 8 }, + 11, + &blake2b_256_init, + &blake2b_process, + &blake2b_done, + &blake2b_256_test, + NULL +}; + +const struct ltc_hash_descriptor blake2b_384_desc = +{ + "blake2b-384", + 27, + 48, + 128, + { 1, 3, 6, 1, 4, 1, 1722, 12, 2, 1, 12 }, + 11, + &blake2b_384_init, + &blake2b_process, + &blake2b_done, + &blake2b_384_test, + NULL +}; + +const struct ltc_hash_descriptor blake2b_512_desc = +{ + "blake2b-512", + 28, + 64, + 128, + { 1, 3, 6, 1, 4, 1, 1722, 12, 2, 1, 16 }, + 11, + &blake2b_512_init, + &blake2b_process, + &blake2b_done, + &blake2b_512_test, + NULL +}; + +static const ulong64 blake2b_IV[8] = +{ + CONST64(0x6a09e667f3bcc908), CONST64(0xbb67ae8584caa73b), + CONST64(0x3c6ef372fe94f82b), CONST64(0xa54ff53a5f1d36f1), + CONST64(0x510e527fade682d1), CONST64(0x9b05688c2b3e6c1f), + CONST64(0x1f83d9abfb41bd6b), CONST64(0x5be0cd19137e2179) +}; + +static const unsigned char blake2b_sigma[12][16] = +{ + { 0, 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15 } , + { 14, 10, 4, 8, 9, 15, 13, 6, 1, 12, 0, 2, 11, 7, 5, 3 } , + { 11, 8, 12, 0, 5, 2, 15, 13, 10, 14, 3, 6, 7, 1, 9, 4 } , + { 7, 9, 3, 1, 13, 12, 11, 14, 2, 6, 5, 10, 4, 0, 15, 8 } , + { 9, 0, 5, 7, 2, 4, 10, 15, 14, 1, 11, 12, 6, 8, 3, 13 } , + { 2, 12, 6, 10, 0, 11, 8, 3, 4, 13, 7, 5, 15, 14, 1, 9 } , + { 12, 5, 1, 15, 14, 13, 4, 10, 0, 7, 6, 3, 9, 2, 8, 11 } , + { 13, 11, 7, 14, 12, 1, 3, 9, 5, 0, 15, 4, 8, 6, 2, 10 } , + { 6, 15, 14, 9, 11, 3, 0, 8, 12, 2, 13, 7, 1, 4, 10, 5 } , + { 10, 2, 8, 4, 7, 6, 1, 5, 15, 11, 9, 14, 3, 12, 13 , 0 } , + { 0, 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15 } , + { 14, 10, 4, 8, 9, 15, 13, 6, 1, 12, 0, 2, 11, 7, 5, 3 } +}; + +static void blake2b_set_lastnode(hash_state *md) { md->blake2b.f[1] = CONST64(0xffffffffffffffff); } + +/* Some helper functions, not necessarily useful */ +static int blake2b_is_lastblock(const hash_state *md) { return md->blake2b.f[0] != 0; } + +static void blake2b_set_lastblock(hash_state *md) +{ + if (md->blake2b.last_node) + blake2b_set_lastnode(md); + + md->blake2b.f[0] = CONST64(0xffffffffffffffff); +} + +static void blake2b_increment_counter(hash_state *md, ulong64 inc) +{ + md->blake2b.t[0] += inc; + if (md->blake2b.t[0] < inc) md->blake2b.t[1]++; +} + +static void blake2b_init0(hash_state *md) +{ + unsigned long i; + XMEMSET(&md->blake2b, 0, sizeof(md->blake2b)); + + for (i = 0; i < 8; ++i) + md->blake2b.h[i] = blake2b_IV[i]; +} + +/* init xors IV with input parameter block */ +static int blake2b_init_param(hash_state *md, const unsigned char *P) +{ + unsigned long i; + + blake2b_init0(md); + + /* IV XOR ParamBlock */ + for (i = 0; i < 8; ++i) { + ulong64 tmp; + LOAD64L(tmp, P + i * 8); + md->blake2b.h[i] ^= tmp; + } + + md->blake2b.outlen = P[O_DIGEST_LENGTH]; + return CRYPT_OK; +} + +int blake2b_init(hash_state *md, unsigned long outlen, const unsigned char *key, unsigned long keylen) +{ + unsigned char P[BLAKE2B_PARAM_SIZE]; + int err; + + LTC_ARGCHK(md != NULL); + + if ((!outlen) || (outlen > BLAKE2B_OUTBYTES)) + return CRYPT_INVALID_ARG; + + if ((key && !keylen) || (keylen && !key) || (keylen > BLAKE2B_KEYBYTES)) + return CRYPT_INVALID_ARG; + + XMEMSET(P, 0, sizeof(P)); + + P[O_DIGEST_LENGTH] = (unsigned char)outlen; + P[O_KEY_LENGTH] = (unsigned char)keylen; + P[O_FANOUT] = 1; + P[O_DEPTH] = 1; + + err = blake2b_init_param(md, P); + if (err != CRYPT_OK) return err; + + if (key) { + unsigned char block[BLAKE2B_BLOCKBYTES]; + + XMEMSET(block, 0, BLAKE2B_BLOCKBYTES); + XMEMCPY(block, key, keylen); + blake2b_process(md, block, BLAKE2B_BLOCKBYTES); + +#ifdef LTC_CLEAN_STACK + zeromem(block, sizeof(block)); +#endif + } + + return CRYPT_OK; +} + +int blake2b_160_init(hash_state *md) { return blake2b_init(md, 20, NULL, 0); } + +int blake2b_256_init(hash_state *md) { return blake2b_init(md, 32, NULL, 0); } + +int blake2b_384_init(hash_state *md) { return blake2b_init(md, 48, NULL, 0); } + +int blake2b_512_init(hash_state *md) { return blake2b_init(md, 64, NULL, 0); } + +#define G(r, i, a, b, c, d) \ + do { \ + a = a + b + m[blake2b_sigma[r][2 * i + 0]]; \ + d = ROR64(d ^ a, 32); \ + c = c + d; \ + b = ROR64(b ^ c, 24); \ + a = a + b + m[blake2b_sigma[r][2 * i + 1]]; \ + d = ROR64(d ^ a, 16); \ + c = c + d; \ + b = ROR64(b ^ c, 63); \ + } while (0) + +#define ROUND(r) \ + do { \ + G(r, 0, v[0], v[4], v[8], v[12]); \ + G(r, 1, v[1], v[5], v[9], v[13]); \ + G(r, 2, v[2], v[6], v[10], v[14]); \ + G(r, 3, v[3], v[7], v[11], v[15]); \ + G(r, 4, v[0], v[5], v[10], v[15]); \ + G(r, 5, v[1], v[6], v[11], v[12]); \ + G(r, 6, v[2], v[7], v[8], v[13]); \ + G(r, 7, v[3], v[4], v[9], v[14]); \ + } while (0) + +#ifdef LTC_CLEAN_STACK +static int _blake2b_compress(hash_state *md, const unsigned char *buf) +#else +static int blake2b_compress(hash_state *md, const unsigned char *buf) +#endif +{ + ulong64 m[16]; + ulong64 v[16]; + unsigned long i; + + for (i = 0; i < 16; ++i) { + LOAD64L(m[i], buf + i * sizeof(m[i])); + } + + for (i = 0; i < 8; ++i) { + v[i] = md->blake2b.h[i]; + } + + v[8] = blake2b_IV[0]; + v[9] = blake2b_IV[1]; + v[10] = blake2b_IV[2]; + v[11] = blake2b_IV[3]; + v[12] = blake2b_IV[4] ^ md->blake2b.t[0]; + v[13] = blake2b_IV[5] ^ md->blake2b.t[1]; + v[14] = blake2b_IV[6] ^ md->blake2b.f[0]; + v[15] = blake2b_IV[7] ^ md->blake2b.f[1]; + + ROUND(0); + ROUND(1); + ROUND(2); + ROUND(3); + ROUND(4); + ROUND(5); + ROUND(6); + ROUND(7); + ROUND(8); + ROUND(9); + ROUND(10); + ROUND(11); + + for (i = 0; i < 8; ++i) { + md->blake2b.h[i] = md->blake2b.h[i] ^ v[i] ^ v[i + 8]; + } + return CRYPT_OK; +} + +#undef G +#undef ROUND + +#ifdef LTC_CLEAN_STACK +static int blake2b_compress(hash_state *md, const unsigned char *buf) +{ + int err; + err = _blake2b_compress(md, buf); + burn_stack(sizeof(ulong64) * 32 + sizeof(unsigned long)); + return err; +} +#endif + +int blake2b_process(hash_state *md, const unsigned char *in, unsigned long inlen) +{ + LTC_ARGCHK(md != NULL); + LTC_ARGCHK(in != NULL); + + if (md->blake2b.curlen > sizeof(md->blake2b.buf)) { + return CRYPT_INVALID_ARG; + } + + if (inlen > 0) { + unsigned long left = md->blake2b.curlen; + unsigned long fill = BLAKE2B_BLOCKBYTES - left; + if (inlen > fill) { + md->blake2b.curlen = 0; + XMEMCPY(md->blake2b.buf + (left % sizeof(md->blake2b.buf)), in, fill); /* Fill buffer */ + blake2b_increment_counter(md, BLAKE2B_BLOCKBYTES); + blake2b_compress(md, md->blake2b.buf); /* Compress */ + in += fill; + inlen -= fill; + while (inlen > BLAKE2B_BLOCKBYTES) { + blake2b_increment_counter(md, BLAKE2B_BLOCKBYTES); + blake2b_compress(md, in); + in += BLAKE2B_BLOCKBYTES; + inlen -= BLAKE2B_BLOCKBYTES; + } + } + XMEMCPY(md->blake2b.buf + md->blake2b.curlen, in, inlen); + md->blake2b.curlen += inlen; + } + return CRYPT_OK; +} + +int blake2b_done(hash_state *md, unsigned char *out) +{ + unsigned char buffer[BLAKE2B_OUTBYTES] = { 0 }; + unsigned long i; + + LTC_ARGCHK(md != NULL); + LTC_ARGCHK(out != NULL); + + /* if(md->blakebs.outlen != outlen) return CRYPT_INVALID_ARG; */ + + if (blake2b_is_lastblock(md)) + return CRYPT_ERROR; + + blake2b_increment_counter(md, md->blake2b.curlen); + blake2b_set_lastblock(md); + XMEMSET(md->blake2b.buf + md->blake2b.curlen, 0, BLAKE2B_BLOCKBYTES - md->blake2b.curlen); /* Padding */ + blake2b_compress(md, md->blake2b.buf); + + for (i = 0; i < 8; ++i) /* Output full hash to temp buffer */ + STORE64L(md->blake2b.h[i], buffer + i * 8); + + XMEMCPY(out, buffer, md->blake2b.outlen); + zeromem(md, sizeof(hash_state)); +#ifdef LTC_CLEAN_STACK + zeromem(buffer, sizeof(buffer)); +#endif + return CRYPT_OK; +} + +/** + Self-test the hash + @return CRYPT_OK if successful, CRYPT_NOP if self-tests have been disabled +*/ +int blake2b_512_test(void) +{ +#ifndef LTC_TEST + return CRYPT_NOP; +#else + static const struct { + const char *msg; + unsigned char hash[64]; + } tests[] = { + { "", + { 0x78, 0x6a, 0x02, 0xf7, 0x42, 0x01, 0x59, 0x03, + 0xc6, 0xc6, 0xfd, 0x85, 0x25, 0x52, 0xd2, 0x72, + 0x91, 0x2f, 0x47, 0x40, 0xe1, 0x58, 0x47, 0x61, + 0x8a, 0x86, 0xe2, 0x17, 0xf7, 0x1f, 0x54, 0x19, + 0xd2, 0x5e, 0x10, 0x31, 0xaf, 0xee, 0x58, 0x53, + 0x13, 0x89, 0x64, 0x44, 0x93, 0x4e, 0xb0, 0x4b, + 0x90, 0x3a, 0x68, 0x5b, 0x14, 0x48, 0xb7, 0x55, + 0xd5, 0x6f, 0x70, 0x1a, 0xfe, 0x9b, 0xe2, 0xce } }, + { "abc", + { 0xba, 0x80, 0xa5, 0x3f, 0x98, 0x1c, 0x4d, 0x0d, + 0x6a, 0x27, 0x97, 0xb6, 0x9f, 0x12, 0xf6, 0xe9, + 0x4c, 0x21, 0x2f, 0x14, 0x68, 0x5a, 0xc4, 0xb7, + 0x4b, 0x12, 0xbb, 0x6f, 0xdb, 0xff, 0xa2, 0xd1, + 0x7d, 0x87, 0xc5, 0x39, 0x2a, 0xab, 0x79, 0x2d, + 0xc2, 0x52, 0xd5, 0xde, 0x45, 0x33, 0xcc, 0x95, + 0x18, 0xd3, 0x8a, 0xa8, 0xdb, 0xf1, 0x92, 0x5a, + 0xb9, 0x23, 0x86, 0xed, 0xd4, 0x00, 0x99, 0x23 } }, + + { NULL, { 0 } } + }; + + int i; + unsigned char tmp[64]; + hash_state md; + + for (i = 0; tests[i].msg != NULL; i++) { + blake2b_512_init(&md); + blake2b_process(&md, (unsigned char *)tests[i].msg, (unsigned long)strlen(tests[i].msg)); + blake2b_done(&md, tmp); + if (compare_testvector(tmp, sizeof(tmp), tests[i].hash, sizeof(tests[i].hash), "BLAKE2B_512", i)) { + return CRYPT_FAIL_TESTVECTOR; + } + } + return CRYPT_OK; +#endif +} + +/** + Self-test the hash + @return CRYPT_OK if successful, CRYPT_NOP if self-tests have been disabled +*/ +int blake2b_384_test(void) +{ +#ifndef LTC_TEST + return CRYPT_NOP; +#else + static const struct { + const char *msg; + unsigned char hash[48]; + } tests[] = { + { "", + { 0xb3, 0x28, 0x11, 0x42, 0x33, 0x77, 0xf5, 0x2d, + 0x78, 0x62, 0x28, 0x6e, 0xe1, 0xa7, 0x2e, 0xe5, + 0x40, 0x52, 0x43, 0x80, 0xfd, 0xa1, 0x72, 0x4a, + 0x6f, 0x25, 0xd7, 0x97, 0x8c, 0x6f, 0xd3, 0x24, + 0x4a, 0x6c, 0xaf, 0x04, 0x98, 0x81, 0x26, 0x73, + 0xc5, 0xe0, 0x5e, 0xf5, 0x83, 0x82, 0x51, 0x00 } }, + { "abc", + { 0x6f, 0x56, 0xa8, 0x2c, 0x8e, 0x7e, 0xf5, 0x26, + 0xdf, 0xe1, 0x82, 0xeb, 0x52, 0x12, 0xf7, 0xdb, + 0x9d, 0xf1, 0x31, 0x7e, 0x57, 0x81, 0x5d, 0xbd, + 0xa4, 0x60, 0x83, 0xfc, 0x30, 0xf5, 0x4e, 0xe6, + 0xc6, 0x6b, 0xa8, 0x3b, 0xe6, 0x4b, 0x30, 0x2d, + 0x7c, 0xba, 0x6c, 0xe1, 0x5b, 0xb5, 0x56, 0xf4 } }, + + { NULL, { 0 } } + }; + + int i; + unsigned char tmp[48]; + hash_state md; + + for (i = 0; tests[i].msg != NULL; i++) { + blake2b_384_init(&md); + blake2b_process(&md, (unsigned char *)tests[i].msg, (unsigned long)strlen(tests[i].msg)); + blake2b_done(&md, tmp); + if (compare_testvector(tmp, sizeof(tmp), tests[i].hash, sizeof(tests[i].hash), "BLAKE2B_384", i)) { + return CRYPT_FAIL_TESTVECTOR; + } + } + return CRYPT_OK; +#endif +} + +/** + Self-test the hash + @return CRYPT_OK if successful, CRYPT_NOP if self-tests have been disabled +*/ +int blake2b_256_test(void) +{ +#ifndef LTC_TEST + return CRYPT_NOP; +#else + static const struct { + const char *msg; + unsigned char hash[32]; + } tests[] = { + { "", + { 0x0e, 0x57, 0x51, 0xc0, 0x26, 0xe5, 0x43, 0xb2, + 0xe8, 0xab, 0x2e, 0xb0, 0x60, 0x99, 0xda, 0xa1, + 0xd1, 0xe5, 0xdf, 0x47, 0x77, 0x8f, 0x77, 0x87, + 0xfa, 0xab, 0x45, 0xcd, 0xf1, 0x2f, 0xe3, 0xa8 } }, + { "abc", + { 0xbd, 0xdd, 0x81, 0x3c, 0x63, 0x42, 0x39, 0x72, + 0x31, 0x71, 0xef, 0x3f, 0xee, 0x98, 0x57, 0x9b, + 0x94, 0x96, 0x4e, 0x3b, 0xb1, 0xcb, 0x3e, 0x42, + 0x72, 0x62, 0xc8, 0xc0, 0x68, 0xd5, 0x23, 0x19 } }, + { "12345678901234567890123456789012345678901234567890" + "12345678901234567890123456789012345678901234567890" + "12345678901234567890123456789012345678901234567890" + "12345678901234567890123456789012345678901234567890" + "12345678901234567890123456789012345678901234567890" + "12345678901234567890123456789012345678901234567890", + { 0x0f, 0x6e, 0x01, 0x8d, 0x38, 0xd6, 0x3f, 0x08, + 0x4d, 0x58, 0xe3, 0x0c, 0x90, 0xfb, 0xa2, 0x41, + 0x5f, 0xca, 0x17, 0xfa, 0x66, 0x26, 0x49, 0xf3, + 0x8a, 0x30, 0x41, 0x7c, 0x57, 0xcd, 0xa8, 0x14 } }, + + { NULL, { 0 } } + }; + + int i; + unsigned char tmp[32]; + hash_state md; + + for (i = 0; tests[i].msg != NULL; i++) { + blake2b_256_init(&md); + blake2b_process(&md, (unsigned char *)tests[i].msg, (unsigned long)strlen(tests[i].msg)); + blake2b_done(&md, tmp); + if (compare_testvector(tmp, sizeof(tmp), tests[i].hash, sizeof(tests[i].hash), "BLAKE2B_256", i)) { + return CRYPT_FAIL_TESTVECTOR; + } + } + return CRYPT_OK; +#endif +} + +/** + Self-test the hash + @return CRYPT_OK if successful, CRYPT_NOP if self-tests have been disabled +*/ +int blake2b_160_test(void) +{ +#ifndef LTC_TEST + return CRYPT_NOP; +#else + static const struct { + const char *msg; + unsigned char hash[20]; + } tests[] = { + { "", + { 0x33, 0x45, 0x52, 0x4a, 0xbf, 0x6b, 0xbe, 0x18, + 0x09, 0x44, 0x92, 0x24, 0xb5, 0x97, 0x2c, 0x41, + 0x79, 0x0b, 0x6c, 0xf2 } }, + { "abc", + { 0x38, 0x42, 0x64, 0xf6, 0x76, 0xf3, 0x95, 0x36, + 0x84, 0x05, 0x23, 0xf2, 0x84, 0x92, 0x1c, 0xdc, + 0x68, 0xb6, 0x84, 0x6b } }, + + { NULL, { 0 } } + }; + + int i; + unsigned char tmp[20]; + hash_state md; + + for (i = 0; tests[i].msg != NULL; i++) { + blake2b_160_init(&md); + blake2b_process(&md, (unsigned char *)tests[i].msg, (unsigned long)strlen(tests[i].msg)); + blake2b_done(&md, tmp); + if (compare_testvector(tmp, sizeof(tmp), tests[i].hash, sizeof(tests[i].hash), "BLAKE2B_160", i)) { + return CRYPT_FAIL_TESTVECTOR; + } + } + return CRYPT_OK; +#endif +} + +#endif + +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/hashes/blake2s.c b/libtomcrypt/src/hashes/blake2s.c new file mode 100644 index 0000000..e3e90f8 --- /dev/null +++ b/libtomcrypt/src/hashes/blake2s.c @@ -0,0 +1,563 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + */ + +/* + BLAKE2 reference source code package - reference C implementations + + Copyright 2012, Samuel Neves <sneves@dei.uc.pt>. You may use this under the + terms of the CC0, the OpenSSL Licence, or the Apache Public License 2.0, at + your option. The terms of these licenses can be found at: + + - CC0 1.0 Universal : http://creativecommons.org/publicdomain/zero/1.0 + - OpenSSL license : https://www.openssl.org/source/license.html + - Apache 2.0 : http://www.apache.org/licenses/LICENSE-2.0 + + More information about the BLAKE2 hash function can be found at + https://blake2.net. +*/ +/* see also https://www.ietf.org/rfc/rfc7693.txt */ + +#include "tomcrypt.h" + +#ifdef LTC_BLAKE2S + +enum blake2s_constant { + BLAKE2S_BLOCKBYTES = 64, + BLAKE2S_OUTBYTES = 32, + BLAKE2S_KEYBYTES = 32, + BLAKE2S_SALTBYTES = 8, + BLAKE2S_PERSONALBYTES = 8, + BLAKE2S_PARAM_SIZE = 32 +}; + +/* param offsets */ +enum { + O_DIGEST_LENGTH = 0, + O_KEY_LENGTH = 1, + O_FANOUT = 2, + O_DEPTH = 3, + O_LEAF_LENGTH = 4, + O_NODE_OFFSET = 8, + O_XOF_LENGTH = 12, + O_NODE_DEPTH = 14, + O_INNER_LENGTH = 15, + O_SALT = 16, + O_PERSONAL = 24 +}; + +/* +struct blake2s_param { + unsigned char digest_length; + unsigned char key_length; + unsigned char fanout; + unsigned char depth; + ulong32 leaf_length; + ulong32 node_offset; + ushort16 xof_length; + unsigned char node_depth; + unsigned char inner_length; + unsigned char salt[BLAKE2S_SALTBYTES]; + unsigned char personal[BLAKE2S_PERSONALBYTES]; +}; +*/ + +const struct ltc_hash_descriptor blake2s_128_desc = +{ + "blake2s-128", + 21, + 16, + 64, + { 1, 3, 6, 1, 4, 1, 1722, 12, 2, 2, 4 }, + 11, + &blake2s_128_init, + &blake2s_process, + &blake2s_done, + &blake2s_128_test, + NULL +}; + +const struct ltc_hash_descriptor blake2s_160_desc = +{ + "blake2s-160", + 22, + 20, + 64, + { 1, 3, 6, 1, 4, 1, 1722, 12, 2, 2, 5 }, + 11, + &blake2s_160_init, + &blake2s_process, + &blake2s_done, + &blake2s_160_test, + NULL +}; + +const struct ltc_hash_descriptor blake2s_224_desc = +{ + "blake2s-224", + 23, + 28, + 64, + { 1, 3, 6, 1, 4, 1, 1722, 12, 2, 2, 7 }, + 11, + &blake2s_224_init, + &blake2s_process, + &blake2s_done, + &blake2s_224_test, + NULL +}; + +const struct ltc_hash_descriptor blake2s_256_desc = +{ + "blake2s-256", + 24, + 32, + 64, + { 1, 3, 6, 1, 4, 1, 1722, 12, 2, 2, 8 }, + 11, + &blake2s_256_init, + &blake2s_process, + &blake2s_done, + &blake2s_256_test, + NULL +}; + +static const ulong32 blake2s_IV[8] = { + 0x6A09E667UL, 0xBB67AE85UL, 0x3C6EF372UL, 0xA54FF53AUL, + 0x510E527FUL, 0x9B05688CUL, 0x1F83D9ABUL, 0x5BE0CD19UL +}; + +static const unsigned char blake2s_sigma[10][16] = { + { 0, 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15 }, + { 14, 10, 4, 8, 9, 15, 13, 6, 1, 12, 0, 2, 11, 7, 5, 3 }, + { 11, 8, 12, 0, 5, 2, 15, 13, 10, 14, 3, 6, 7, 1, 9, 4 }, + { 7, 9, 3, 1, 13, 12, 11, 14, 2, 6, 5, 10, 4, 0, 15, 8 }, + { 9, 0, 5, 7, 2, 4, 10, 15, 14, 1, 11, 12, 6, 8, 3, 13 }, + { 2, 12, 6, 10, 0, 11, 8, 3, 4, 13, 7, 5, 15, 14, 1, 9 }, + { 12, 5, 1, 15, 14, 13, 4, 10, 0, 7, 6, 3, 9, 2, 8, 11 }, + { 13, 11, 7, 14, 12, 1, 3, 9, 5, 0, 15, 4, 8, 6, 2, 10 }, + { 6, 15, 14, 9, 11, 3, 0, 8, 12, 2, 13, 7, 1, 4, 10, 5 }, + { 10, 2, 8, 4, 7, 6, 1, 5, 15, 11, 9, 14, 3, 12, 13, 0 }, +}; + +static void blake2s_set_lastnode(hash_state *md) { md->blake2s.f[1] = 0xffffffffUL; } + +/* Some helper functions, not necessarily useful */ +static int blake2s_is_lastblock(const hash_state *md) { return md->blake2s.f[0] != 0; } + +static void blake2s_set_lastblock(hash_state *md) +{ + if (md->blake2s.last_node) + blake2s_set_lastnode(md); + + md->blake2s.f[0] = 0xffffffffUL; +} + +static void blake2s_increment_counter(hash_state *md, const ulong32 inc) +{ + md->blake2s.t[0] += inc; + if (md->blake2s.t[0] < inc) md->blake2s.t[1]++; +} + +static int blake2s_init0(hash_state *md) +{ + int i; + XMEMSET(&md->blake2s, 0, sizeof(struct blake2s_state)); + + for (i = 0; i < 8; ++i) + md->blake2s.h[i] = blake2s_IV[i]; + + return CRYPT_OK; +} + +/* init2 xors IV with input parameter block */ +static int blake2s_init_param(hash_state *md, const unsigned char *P) +{ + unsigned long i; + + blake2s_init0(md); + + /* IV XOR ParamBlock */ + for (i = 0; i < 8; ++i) { + ulong32 tmp; + LOAD32L(tmp, P + i * 4); + md->blake2s.h[i] ^= tmp; + } + + md->blake2s.outlen = P[O_DIGEST_LENGTH]; + return CRYPT_OK; +} + +int blake2s_init(hash_state *md, unsigned long outlen, const unsigned char *key, unsigned long keylen) +{ + unsigned char P[BLAKE2S_PARAM_SIZE]; + int err; + + LTC_ARGCHK(md != NULL); + + if ((!outlen) || (outlen > BLAKE2S_OUTBYTES)) + return CRYPT_INVALID_ARG; + + if ((key && !keylen) || (keylen && !key) || (keylen > BLAKE2S_KEYBYTES)) + return CRYPT_INVALID_ARG; + + XMEMSET(P, 0, sizeof(P)); + + P[O_DIGEST_LENGTH] = (unsigned char)outlen; + P[O_KEY_LENGTH] = (unsigned char)keylen; + P[O_FANOUT] = 1; + P[O_DEPTH] = 1; + + err = blake2s_init_param(md, P); + if (err != CRYPT_OK) return err; + + if (key) { + unsigned char block[BLAKE2S_BLOCKBYTES]; + + XMEMSET(block, 0, BLAKE2S_BLOCKBYTES); + XMEMCPY(block, key, keylen); + blake2s_process(md, block, BLAKE2S_BLOCKBYTES); + +#ifdef LTC_CLEAN_STACK + zeromem(block, sizeof(block)); +#endif + } + return CRYPT_OK; +} + +int blake2s_128_init(hash_state *md) { return blake2s_init(md, 16, NULL, 0); } + +int blake2s_160_init(hash_state *md) { return blake2s_init(md, 20, NULL, 0); } + +int blake2s_224_init(hash_state *md) { return blake2s_init(md, 28, NULL, 0); } + +int blake2s_256_init(hash_state *md) { return blake2s_init(md, 32, NULL, 0); } + +#define G(r, i, a, b, c, d) \ + do { \ + a = a + b + m[blake2s_sigma[r][2 * i + 0]]; \ + d = ROR(d ^ a, 16); \ + c = c + d; \ + b = ROR(b ^ c, 12); \ + a = a + b + m[blake2s_sigma[r][2 * i + 1]]; \ + d = ROR(d ^ a, 8); \ + c = c + d; \ + b = ROR(b ^ c, 7); \ + } while (0) +#define ROUND(r) \ + do { \ + G(r, 0, v[0], v[4], v[8], v[12]); \ + G(r, 1, v[1], v[5], v[9], v[13]); \ + G(r, 2, v[2], v[6], v[10], v[14]); \ + G(r, 3, v[3], v[7], v[11], v[15]); \ + G(r, 4, v[0], v[5], v[10], v[15]); \ + G(r, 5, v[1], v[6], v[11], v[12]); \ + G(r, 6, v[2], v[7], v[8], v[13]); \ + G(r, 7, v[3], v[4], v[9], v[14]); \ + } while (0) + +#ifdef LTC_CLEAN_STACK +static int _blake2s_compress(hash_state *md, const unsigned char *buf) +#else +static int blake2s_compress(hash_state *md, const unsigned char *buf) +#endif +{ + unsigned long i; + ulong32 m[16]; + ulong32 v[16]; + + for (i = 0; i < 16; ++i) { + LOAD32L(m[i], buf + i * sizeof(m[i])); + } + + for (i = 0; i < 8; ++i) + v[i] = md->blake2s.h[i]; + + v[8] = blake2s_IV[0]; + v[9] = blake2s_IV[1]; + v[10] = blake2s_IV[2]; + v[11] = blake2s_IV[3]; + v[12] = md->blake2s.t[0] ^ blake2s_IV[4]; + v[13] = md->blake2s.t[1] ^ blake2s_IV[5]; + v[14] = md->blake2s.f[0] ^ blake2s_IV[6]; + v[15] = md->blake2s.f[1] ^ blake2s_IV[7]; + + ROUND(0); + ROUND(1); + ROUND(2); + ROUND(3); + ROUND(4); + ROUND(5); + ROUND(6); + ROUND(7); + ROUND(8); + ROUND(9); + + for (i = 0; i < 8; ++i) + md->blake2s.h[i] = md->blake2s.h[i] ^ v[i] ^ v[i + 8]; + + return CRYPT_OK; +} +#undef G +#undef ROUND + +#ifdef LTC_CLEAN_STACK +static int blake2s_compress(hash_state *md, const unsigned char *buf) +{ + int err; + err = _blake2s_compress(md, buf); + burn_stack(sizeof(ulong32) * (32) + sizeof(unsigned long)); + return err; +} +#endif + +int blake2s_process(hash_state *md, const unsigned char *in, unsigned long inlen) +{ + LTC_ARGCHK(md != NULL); + LTC_ARGCHK(in != NULL); + + if (md->blake2s.curlen > sizeof(md->blake2s.buf)) { + return CRYPT_INVALID_ARG; + } + + if (inlen > 0) { + unsigned long left = md->blake2s.curlen; + unsigned long fill = BLAKE2S_BLOCKBYTES - left; + if (inlen > fill) { + md->blake2s.curlen = 0; + XMEMCPY(md->blake2s.buf + (left % sizeof(md->blake2s.buf)), in, fill); /* Fill buffer */ + blake2s_increment_counter(md, BLAKE2S_BLOCKBYTES); + blake2s_compress(md, md->blake2s.buf); /* Compress */ + in += fill; + inlen -= fill; + while (inlen > BLAKE2S_BLOCKBYTES) { + blake2s_increment_counter(md, BLAKE2S_BLOCKBYTES); + blake2s_compress(md, in); + in += BLAKE2S_BLOCKBYTES; + inlen -= BLAKE2S_BLOCKBYTES; + } + } + XMEMCPY(md->blake2s.buf + md->blake2s.curlen, in, inlen); + md->blake2s.curlen += inlen; + } + return CRYPT_OK; +} + +int blake2s_done(hash_state *md, unsigned char *out) +{ + unsigned char buffer[BLAKE2S_OUTBYTES] = { 0 }; + unsigned long i; + + LTC_ARGCHK(md != NULL); + LTC_ARGCHK(out != NULL); + + /* if(md->blake2s.outlen != outlen) return CRYPT_INVALID_ARG; */ + + if (blake2s_is_lastblock(md)) + return CRYPT_ERROR; + + blake2s_increment_counter(md, md->blake2s.curlen); + blake2s_set_lastblock(md); + XMEMSET(md->blake2s.buf + md->blake2s.curlen, 0, BLAKE2S_BLOCKBYTES - md->blake2s.curlen); /* Padding */ + blake2s_compress(md, md->blake2s.buf); + + for (i = 0; i < 8; ++i) /* Output full hash to temp buffer */ + STORE32L(md->blake2s.h[i], buffer + i * 4); + + XMEMCPY(out, buffer, md->blake2s.outlen); + zeromem(md, sizeof(hash_state)); +#ifdef LTC_CLEAN_STACK + zeromem(buffer, sizeof(buffer)); +#endif + return CRYPT_OK; +} + +/** + Self-test the hash + @return CRYPT_OK if successful, CRYPT_NOP if self-tests have been disabled +*/ +int blake2s_256_test(void) +{ +#ifndef LTC_TEST + return CRYPT_NOP; +#else + static const struct { + const char *msg; + unsigned char hash[32]; + } tests[] = { + { "", + { 0x69, 0x21, 0x7a, 0x30, 0x79, 0x90, 0x80, 0x94, + 0xe1, 0x11, 0x21, 0xd0, 0x42, 0x35, 0x4a, 0x7c, + 0x1f, 0x55, 0xb6, 0x48, 0x2c, 0xa1, 0xa5, 0x1e, + 0x1b, 0x25, 0x0d, 0xfd, 0x1e, 0xd0, 0xee, 0xf9 } }, + { "abc", + { 0x50, 0x8c, 0x5e, 0x8c, 0x32, 0x7c, 0x14, 0xe2, + 0xe1, 0xa7, 0x2b, 0xa3, 0x4e, 0xeb, 0x45, 0x2f, + 0x37, 0x45, 0x8b, 0x20, 0x9e, 0xd6, 0x3a, 0x29, + 0x4d, 0x99, 0x9b, 0x4c, 0x86, 0x67, 0x59, 0x82 } }, + { "12345678901234567890123456789012345678901234567890" + "12345678901234567890123456789012345678901234567890" + "12345678901234567890123456789012345678901234567890" + "12345678901234567890123456789012345678901234567890" + "12345678901234567890123456789012345678901234567890" + "12345678901234567890123456789012345678901234567890", + { 0xa3, 0x78, 0x8b, 0x5b, 0x59, 0xee, 0xe4, 0x41, + 0x95, 0x23, 0x58, 0x00, 0xa4, 0xf9, 0xfa, 0x41, + 0x86, 0x0c, 0x7b, 0x1c, 0x35, 0xa2, 0x42, 0x70, + 0x50, 0x80, 0x79, 0x56, 0xe3, 0xbe, 0x31, 0x74 } }, + + { NULL, { 0 } } + }; + + int i; + unsigned char tmp[32]; + hash_state md; + + for (i = 0; tests[i].msg != NULL; i++) { + blake2s_256_init(&md); + blake2s_process(&md, (unsigned char *)tests[i].msg, (unsigned long)strlen(tests[i].msg)); + blake2s_done(&md, tmp); + if (compare_testvector(tmp, sizeof(tmp), tests[i].hash, sizeof(tests[i].hash), "BLAKE2S_256", i)) { + return CRYPT_FAIL_TESTVECTOR; + } + + } + return CRYPT_OK; +#endif +} + +/** + Self-test the hash + @return CRYPT_OK if successful, CRYPT_NOP if self-tests have been disabled +*/ +int blake2s_224_test(void) +{ +#ifndef LTC_TEST + return CRYPT_NOP; +#else + static const struct { + const char *msg; + unsigned char hash[28]; + } tests[] = { + { "", + { 0x1f, 0xa1, 0x29, 0x1e, 0x65, 0x24, 0x8b, 0x37, + 0xb3, 0x43, 0x34, 0x75, 0xb2, 0xa0, 0xdd, 0x63, + 0xd5, 0x4a, 0x11, 0xec, 0xc4, 0xe3, 0xe0, 0x34, + 0xe7, 0xbc, 0x1e, 0xf4 } }, + { "abc", + { 0x0b, 0x03, 0x3f, 0xc2, 0x26, 0xdf, 0x7a, 0xbd, + 0xe2, 0x9f, 0x67, 0xa0, 0x5d, 0x3d, 0xc6, 0x2c, + 0xf2, 0x71, 0xef, 0x3d, 0xfe, 0xa4, 0xd3, 0x87, + 0x40, 0x7f, 0xbd, 0x55 } }, + + { NULL, { 0 } } + }; + + int i; + unsigned char tmp[28]; + hash_state md; + + for (i = 0; tests[i].msg != NULL; i++) { + blake2s_224_init(&md); + blake2s_process(&md, (unsigned char *)tests[i].msg, (unsigned long)strlen(tests[i].msg)); + blake2s_done(&md, tmp); + if (compare_testvector(tmp, sizeof(tmp), tests[i].hash, sizeof(tests[i].hash), "BLAKE2S_224", i)) { + return CRYPT_FAIL_TESTVECTOR; + } + + } + return CRYPT_OK; +#endif +} + +/** + Self-test the hash + @return CRYPT_OK if successful, CRYPT_NOP if self-tests have been disabled +*/ +int blake2s_160_test(void) +{ +#ifndef LTC_TEST + return CRYPT_NOP; +#else + static const struct { + const char *msg; + unsigned char hash[20]; + } tests[] = { + { "", + { 0x35, 0x4c, 0x9c, 0x33, 0xf7, 0x35, 0x96, 0x24, + 0x18, 0xbd, 0xac, 0xb9, 0x47, 0x98, 0x73, 0x42, + 0x9c, 0x34, 0x91, 0x6f} }, + { "abc", + { 0x5a, 0xe3, 0xb9, 0x9b, 0xe2, 0x9b, 0x01, 0x83, + 0x4c, 0x3b, 0x50, 0x85, 0x21, 0xed, 0xe6, 0x04, + 0x38, 0xf8, 0xde, 0x17 } }, + + { NULL, { 0 } } + }; + + int i; + unsigned char tmp[20]; + hash_state md; + + for (i = 0; tests[i].msg != NULL; i++) { + blake2s_160_init(&md); + blake2s_process(&md, (unsigned char *)tests[i].msg, (unsigned long)strlen(tests[i].msg)); + blake2s_done(&md, tmp); + if (compare_testvector(tmp, sizeof(tmp), tests[i].hash, sizeof(tests[i].hash), "BLAKE2S_160", i)) { + return CRYPT_FAIL_TESTVECTOR; + } + + } + return CRYPT_OK; +#endif +} + +/** + Self-test the hash + @return CRYPT_OK if successful, CRYPT_NOP if self-tests have been disabled +*/ +int blake2s_128_test(void) +{ +#ifndef LTC_TEST + return CRYPT_NOP; +#else + static const struct { + const char *msg; + unsigned char hash[16]; + } tests[] = { + { "", + { 0x64, 0x55, 0x0d, 0x6f, 0xfe, 0x2c, 0x0a, 0x01, + 0xa1, 0x4a, 0xba, 0x1e, 0xad, 0xe0, 0x20, 0x0c } }, + { "abc", + { 0xaa, 0x49, 0x38, 0x11, 0x9b, 0x1d, 0xc7, 0xb8, + 0x7c, 0xba, 0xd0, 0xff, 0xd2, 0x00, 0xd0, 0xae } }, + + { NULL, { 0 } } + }; + + int i; + unsigned char tmp[16]; + hash_state md; + + for (i = 0; tests[i].msg != NULL; i++) { + blake2s_128_init(&md); + blake2s_process(&md, (unsigned char *)tests[i].msg, (unsigned long)strlen(tests[i].msg)); + blake2s_done(&md, tmp); + if (compare_testvector(tmp, sizeof(tmp), tests[i].hash, sizeof(tests[i].hash), "BLAKE2S_128", i)) { + return CRYPT_FAIL_TESTVECTOR; + } + } + return CRYPT_OK; +#endif +} + +#endif + +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/hashes/chc/chc.c b/libtomcrypt/src/hashes/chc/chc.c index 2c061e3..0861a88 100644 --- a/libtomcrypt/src/hashes/chc/chc.c +++ b/libtomcrypt/src/hashes/chc/chc.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" @@ -35,8 +33,8 @@ const struct ltc_hash_descriptor chc_desc = { }; /** - Initialize the CHC state with a given cipher - @param cipher The index of the cipher you wish to bind + Initialize the CHC state with a given cipher + @param cipher The index of the cipher you wish to bind @return CRYPT_OK if successful */ int chc_register(int cipher) @@ -70,7 +68,7 @@ int chc_register(int cipher) } /* store into descriptor */ - hash_descriptor[idx].hashsize = + hash_descriptor[idx].hashsize = hash_descriptor[idx].blocksize = cipher_descriptor[cipher].block_length; /* store the idx and block size */ @@ -89,7 +87,7 @@ int chc_init(hash_state *md) symmetric_key *key; unsigned char buf[MAXBLOCKSIZE]; int err; - + LTC_ARGCHK(md != NULL); /* is the cipher valid? */ @@ -105,7 +103,7 @@ int chc_init(hash_state *md) return CRYPT_MEM; } - /* zero key and what not */ + /* zero key and what not */ zeromem(buf, cipher_blocksize); if ((err = cipher_descriptor[cipher_idx].setup(buf, cipher_blocksize, 0, key)) != CRYPT_OK) { XFREE(key); @@ -123,7 +121,7 @@ int chc_init(hash_state *md) return CRYPT_OK; } -/* +/* key <= state T0,T1 <= block T0 <= encrypt T0 @@ -147,17 +145,23 @@ static int chc_compress(hash_state *md, unsigned char *buf) for (x = 0; x < cipher_blocksize; x++) { md->chc.state[x] ^= T[0][x] ^ T[1][x]; } - XFREE(key); #ifdef LTC_CLEAN_STACK zeromem(T, sizeof(T)); - zeromem(&key, sizeof(key)); + zeromem(key, sizeof(*key)); #endif + XFREE(key); return CRYPT_OK; } -/* function for processing blocks */ -int _chc_process(hash_state * md, const unsigned char *buf, unsigned long len); -HASH_PROCESS(_chc_process, chc_compress, chc, (unsigned long)cipher_blocksize) +/** + Function for processing blocks + @param md The hash state + @param buf The data to hash + @param len The length of the data (octets) + @return CRYPT_OK if successful +*/ +static int _chc_process(hash_state * md, const unsigned char *buf, unsigned long len); +static HASH_PROCESS(_chc_process, chc_compress, chc, (unsigned long)cipher_blocksize) /** Process a block of memory though the hash @@ -248,23 +252,26 @@ int chc_done(hash_state *md, unsigned char *out) /** Self-test the hash @return CRYPT_OK if successful, CRYPT_NOP if self-tests have been disabled -*/ +*/ int chc_test(void) { +#ifndef LTC_TEST + return CRYPT_NOP; +#else static const struct { unsigned char *msg, - md[MAXBLOCKSIZE]; + hash[MAXBLOCKSIZE]; int len; } tests[] = { { (unsigned char *)"hello world", - { 0xcf, 0x57, 0x9d, 0xc3, 0x0a, 0x0e, 0xea, 0x61, + { 0xcf, 0x57, 0x9d, 0xc3, 0x0a, 0x0e, 0xea, 0x61, 0x0d, 0x54, 0x47, 0xc4, 0x3c, 0x06, 0xf5, 0x4e }, 16 } }; - int x, oldhashidx, idx; - unsigned char out[MAXBLOCKSIZE]; + int i, oldhashidx, idx; + unsigned char tmp[MAXBLOCKSIZE]; hash_state md; /* AES can be under rijndael or aes... try to find it */ @@ -276,11 +283,11 @@ int chc_test(void) oldhashidx = cipher_idx; chc_register(idx); - for (x = 0; x < (int)(sizeof(tests)/sizeof(tests[0])); x++) { + for (i = 0; i < (int)(sizeof(tests)/sizeof(tests[0])); i++) { chc_init(&md); - chc_process(&md, tests[x].msg, strlen((char *)tests[x].msg)); - chc_done(&md, out); - if (XMEMCMP(out, tests[x].md, tests[x].len)) { + chc_process(&md, tests[i].msg, strlen((char *)tests[i].msg)); + chc_done(&md, tmp); + if (compare_testvector(tmp, tests[i].len, tests[i].hash, tests[i].len, "CHC", i)) { return CRYPT_FAIL_TESTVECTOR; } } @@ -289,10 +296,11 @@ int chc_test(void) } return CRYPT_OK; +#endif } #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/hashes/helper/hash_file.c b/libtomcrypt/src/hashes/helper/hash_file.c index e40c147..b3e79d9 100644 --- a/libtomcrypt/src/hashes/helper/hash_file.c +++ b/libtomcrypt/src/hashes/helper/hash_file.c @@ -5,11 +5,10 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" +#ifndef LTC_NO_FILE /** @file hash_file.c Hash a file, Tom St Denis @@ -24,10 +23,6 @@ */ int hash_file(int hash, const char *fname, unsigned char *out, unsigned long *outlen) { -#ifdef LTC_NO_FILE - (void)hash; (void)fname; (void)out; (void)outlen; - return CRYPT_NOP; -#else FILE *in; int err; LTC_ARGCHK(fname != NULL); @@ -49,10 +44,10 @@ int hash_file(int hash, const char *fname, unsigned char *out, unsigned long *ou } return err; -#endif } +#endif /* #ifndef LTC_NO_FILE */ -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/hashes/helper/hash_filehandle.c b/libtomcrypt/src/hashes/helper/hash_filehandle.c index af8164a..1d72f25 100644 --- a/libtomcrypt/src/hashes/helper/hash_filehandle.c +++ b/libtomcrypt/src/hashes/helper/hash_filehandle.c @@ -5,11 +5,10 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" +#ifndef LTC_NO_FILE /** @file hash_filehandle.c Hash open files, Tom St Denis @@ -25,12 +24,8 @@ */ int hash_filehandle(int hash, FILE *in, unsigned char *out, unsigned long *outlen) { -#ifdef LTC_NO_FILE - (void)hash; (void)in; (void)out; (void)outlen; - return CRYPT_NOP; -#else hash_state md; - unsigned char buf[512]; + unsigned char *buf; size_t x; int err; @@ -38,35 +33,42 @@ int hash_filehandle(int hash, FILE *in, unsigned char *out, unsigned long *outle LTC_ARGCHK(outlen != NULL); LTC_ARGCHK(in != NULL); + if ((buf = XMALLOC(LTC_FILE_READ_BUFSIZE)) == NULL) { + return CRYPT_MEM; + } + if ((err = hash_is_valid(hash)) != CRYPT_OK) { - return err; + goto LBL_ERR; } if (*outlen < hash_descriptor[hash].hashsize) { *outlen = hash_descriptor[hash].hashsize; - return CRYPT_BUFFER_OVERFLOW; + err = CRYPT_BUFFER_OVERFLOW; + goto LBL_ERR; } if ((err = hash_descriptor[hash].init(&md)) != CRYPT_OK) { - return err; + goto LBL_ERR; } - *outlen = hash_descriptor[hash].hashsize; do { - x = fread(buf, 1, sizeof(buf), in); - if ((err = hash_descriptor[hash].process(&md, buf, x)) != CRYPT_OK) { - return err; + x = fread(buf, 1, LTC_FILE_READ_BUFSIZE, in); + if ((err = hash_descriptor[hash].process(&md, buf, (unsigned long)x)) != CRYPT_OK) { + goto LBL_CLEANBUF; + } + } while (x == LTC_FILE_READ_BUFSIZE); + if ((err = hash_descriptor[hash].done(&md, out)) == CRYPT_OK) { + *outlen = hash_descriptor[hash].hashsize; } - } while (x == sizeof(buf)); - err = hash_descriptor[hash].done(&md, out); -#ifdef LTC_CLEAN_STACK - zeromem(buf, sizeof(buf)); -#endif +LBL_CLEANBUF: + zeromem(buf, LTC_FILE_READ_BUFSIZE); +LBL_ERR: + XFREE(buf); return err; -#endif } +#endif /* #ifndef LTC_NO_FILE */ -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/hashes/helper/hash_memory.c b/libtomcrypt/src/hashes/helper/hash_memory.c index 853183a..e8471ac 100644 --- a/libtomcrypt/src/hashes/helper/hash_memory.c +++ b/libtomcrypt/src/hashes/helper/hash_memory.c @@ -5,11 +5,10 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" +#ifdef LTC_HASH_HELPERS /** @file hash_memory.c Hash memory helper, Tom St Denis @@ -63,7 +62,8 @@ LBL_ERR: return err; } +#endif /* #ifdef LTC_HASH_HELPERS */ -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/hashes/helper/hash_memory_multi.c b/libtomcrypt/src/hashes/helper/hash_memory_multi.c index ef39646..d10b458 100644 --- a/libtomcrypt/src/hashes/helper/hash_memory_multi.c +++ b/libtomcrypt/src/hashes/helper/hash_memory_multi.c @@ -5,18 +5,18 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" #include <stdarg.h> + +#ifdef LTC_HASH_HELPERS /** @file hash_memory_multi.c Hash (multiple buffers) memory helper, Tom St Denis */ /** - Hash multiple (non-adjacent) blocks of memory at once. + Hash multiple (non-adjacent) blocks of memory at once. @param hash The index of the hash you wish to use @param out [out] Where to store the digest @param outlen [in/out] Max size and resulting size of the digest @@ -24,7 +24,7 @@ @param inlen The length of the data to hash (octets) @param ... tuples of (data,len) pairs to hash, terminated with a (NULL,x) (x=don't care) @return CRYPT_OK if successful -*/ +*/ int hash_memory_multi(int hash, unsigned char *out, unsigned long *outlen, const unsigned char *in, unsigned long inlen, ...) { @@ -57,7 +57,7 @@ int hash_memory_multi(int hash, unsigned char *out, unsigned long *outlen, } va_start(args, inlen); - curptr = in; + curptr = in; curlen = inlen; for (;;) { /* process buf */ @@ -81,7 +81,8 @@ LBL_ERR: va_end(args); return err; } +#endif /* #ifdef LTC_HASH_HELPERS */ -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/hashes/md2.c b/libtomcrypt/src/hashes/md2.c index 5a65d7e..36cc8ae 100644 --- a/libtomcrypt/src/hashes/md2.c +++ b/libtomcrypt/src/hashes/md2.c @@ -5,14 +5,12 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" /** @param md2.c - LTC_MD2 (RFC 1319) hash function implementation by Tom St Denis + LTC_MD2 (RFC 1319) hash function implementation by Tom St Denis */ #ifdef LTC_MD2 @@ -64,7 +62,7 @@ static void md2_update_chksum(hash_state *md) L = md->md2.chksum[15]; for (j = 0; j < 16; j++) { -/* caution, the RFC says its "C[j] = S[M[i*16+j] xor L]" but the reference source code [and test vectors] say +/* caution, the RFC says its "C[j] = S[M[i*16+j] xor L]" but the reference source code [and test vectors] say otherwise. */ L = (md->md2.chksum[j] ^= PI_SUBST[(int)(md->md2.buf[j] ^ L)] & 255); @@ -75,7 +73,7 @@ static void md2_compress(hash_state *md) { int j, k; unsigned char t; - + /* copy block */ for (j = 0; j < 16; j++) { md->md2.X[16+j] = md->md2.buf[j]; @@ -122,9 +120,9 @@ int md2_process(hash_state *md, const unsigned char *in, unsigned long inlen) unsigned long n; LTC_ARGCHK(md != NULL); LTC_ARGCHK(in != NULL); - if (md-> md2 .curlen > sizeof(md-> md2 .buf)) { - return CRYPT_INVALID_ARG; - } + if (md-> md2 .curlen > sizeof(md-> md2 .buf)) { + return CRYPT_INVALID_ARG; + } while (inlen > 0) { n = MIN(inlen, (16 - md->md2.curlen)); XMEMCPY(md->md2.buf + md->md2.curlen, in, (size_t)n); @@ -186,15 +184,15 @@ int md2_done(hash_state * md, unsigned char *out) /** Self-test the hash @return CRYPT_OK if successful, CRYPT_NOP if self-tests have been disabled -*/ +*/ int md2_test(void) { #ifndef LTC_TEST return CRYPT_NOP; - #else + #else static const struct { - char *msg; - unsigned char md[16]; + const char *msg; + unsigned char hash[16]; } tests[] = { { "", {0x83,0x50,0xe5,0xa3,0xe2,0x4c,0x15,0x3d, @@ -227,25 +225,26 @@ int md2_test(void) } } }; + int i; + unsigned char tmp[16]; hash_state md; - unsigned char buf[16]; for (i = 0; i < (int)(sizeof(tests) / sizeof(tests[0])); i++) { md2_init(&md); md2_process(&md, (unsigned char*)tests[i].msg, (unsigned long)strlen(tests[i].msg)); - md2_done(&md, buf); - if (XMEMCMP(buf, tests[i].md, 16) != 0) { + md2_done(&md, tmp); + if (compare_testvector(tmp, sizeof(tmp), tests[i].hash, sizeof(tests[i].hash), "MD2", i)) { return CRYPT_FAIL_TESTVECTOR; } } - return CRYPT_OK; + return CRYPT_OK; #endif } #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/hashes/md4.c b/libtomcrypt/src/hashes/md4.c index adf916b..09b6e31 100644 --- a/libtomcrypt/src/hashes/md4.c +++ b/libtomcrypt/src/hashes/md4.c @@ -5,14 +5,12 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" /** @param md4.c - Submitted by Dobes Vandermeer (dobes@smartt.com) + Submitted by Dobes Vandermeer (dobes@smartt.com) */ #ifdef LTC_MD4 @@ -23,7 +21,7 @@ const struct ltc_hash_descriptor md4_desc = 6, 16, 64, - + /* OID */ { 1, 2, 840, 113549, 2, 4, }, 6, @@ -56,8 +54,8 @@ const struct ltc_hash_descriptor md4_desc = /* ROTATE_LEFT rotates x left n bits. */ #define ROTATE_LEFT(x, n) ROLc(x, n) -/* FF, GG and HH are transformations for rounds 1, 2 and 3 */ -/* Rotation is separate from addition to prevent recomputation */ +/* FF, GG and HH are transformations for rounds 1, 2 and 3 */ +/* Rotation is separate from addition to prevent recomputation */ #define FF(a, b, c, d, x, s) { \ (a) += F ((b), (c), (d)) + (x); \ @@ -91,61 +89,61 @@ static int md4_compress(hash_state *md, unsigned char *buf) for (i = 0; i < 16; i++) { LOAD32L(x[i], buf + (4*i)); } - - /* Round 1 */ - FF (a, b, c, d, x[ 0], S11); /* 1 */ - FF (d, a, b, c, x[ 1], S12); /* 2 */ - FF (c, d, a, b, x[ 2], S13); /* 3 */ - FF (b, c, d, a, x[ 3], S14); /* 4 */ - FF (a, b, c, d, x[ 4], S11); /* 5 */ - FF (d, a, b, c, x[ 5], S12); /* 6 */ - FF (c, d, a, b, x[ 6], S13); /* 7 */ - FF (b, c, d, a, x[ 7], S14); /* 8 */ - FF (a, b, c, d, x[ 8], S11); /* 9 */ + + /* Round 1 */ + FF (a, b, c, d, x[ 0], S11); /* 1 */ + FF (d, a, b, c, x[ 1], S12); /* 2 */ + FF (c, d, a, b, x[ 2], S13); /* 3 */ + FF (b, c, d, a, x[ 3], S14); /* 4 */ + FF (a, b, c, d, x[ 4], S11); /* 5 */ + FF (d, a, b, c, x[ 5], S12); /* 6 */ + FF (c, d, a, b, x[ 6], S13); /* 7 */ + FF (b, c, d, a, x[ 7], S14); /* 8 */ + FF (a, b, c, d, x[ 8], S11); /* 9 */ FF (d, a, b, c, x[ 9], S12); /* 10 */ - FF (c, d, a, b, x[10], S13); /* 11 */ + FF (c, d, a, b, x[10], S13); /* 11 */ FF (b, c, d, a, x[11], S14); /* 12 */ FF (a, b, c, d, x[12], S11); /* 13 */ - FF (d, a, b, c, x[13], S12); /* 14 */ - FF (c, d, a, b, x[14], S13); /* 15 */ - FF (b, c, d, a, x[15], S14); /* 16 */ - - /* Round 2 */ - GG (a, b, c, d, x[ 0], S21); /* 17 */ - GG (d, a, b, c, x[ 4], S22); /* 18 */ - GG (c, d, a, b, x[ 8], S23); /* 19 */ - GG (b, c, d, a, x[12], S24); /* 20 */ - GG (a, b, c, d, x[ 1], S21); /* 21 */ - GG (d, a, b, c, x[ 5], S22); /* 22 */ - GG (c, d, a, b, x[ 9], S23); /* 23 */ - GG (b, c, d, a, x[13], S24); /* 24 */ - GG (a, b, c, d, x[ 2], S21); /* 25 */ - GG (d, a, b, c, x[ 6], S22); /* 26 */ - GG (c, d, a, b, x[10], S23); /* 27 */ - GG (b, c, d, a, x[14], S24); /* 28 */ - GG (a, b, c, d, x[ 3], S21); /* 29 */ - GG (d, a, b, c, x[ 7], S22); /* 30 */ - GG (c, d, a, b, x[11], S23); /* 31 */ - GG (b, c, d, a, x[15], S24); /* 32 */ - + FF (d, a, b, c, x[13], S12); /* 14 */ + FF (c, d, a, b, x[14], S13); /* 15 */ + FF (b, c, d, a, x[15], S14); /* 16 */ + + /* Round 2 */ + GG (a, b, c, d, x[ 0], S21); /* 17 */ + GG (d, a, b, c, x[ 4], S22); /* 18 */ + GG (c, d, a, b, x[ 8], S23); /* 19 */ + GG (b, c, d, a, x[12], S24); /* 20 */ + GG (a, b, c, d, x[ 1], S21); /* 21 */ + GG (d, a, b, c, x[ 5], S22); /* 22 */ + GG (c, d, a, b, x[ 9], S23); /* 23 */ + GG (b, c, d, a, x[13], S24); /* 24 */ + GG (a, b, c, d, x[ 2], S21); /* 25 */ + GG (d, a, b, c, x[ 6], S22); /* 26 */ + GG (c, d, a, b, x[10], S23); /* 27 */ + GG (b, c, d, a, x[14], S24); /* 28 */ + GG (a, b, c, d, x[ 3], S21); /* 29 */ + GG (d, a, b, c, x[ 7], S22); /* 30 */ + GG (c, d, a, b, x[11], S23); /* 31 */ + GG (b, c, d, a, x[15], S24); /* 32 */ + /* Round 3 */ - HH (a, b, c, d, x[ 0], S31); /* 33 */ - HH (d, a, b, c, x[ 8], S32); /* 34 */ - HH (c, d, a, b, x[ 4], S33); /* 35 */ - HH (b, c, d, a, x[12], S34); /* 36 */ - HH (a, b, c, d, x[ 2], S31); /* 37 */ - HH (d, a, b, c, x[10], S32); /* 38 */ - HH (c, d, a, b, x[ 6], S33); /* 39 */ - HH (b, c, d, a, x[14], S34); /* 40 */ - HH (a, b, c, d, x[ 1], S31); /* 41 */ - HH (d, a, b, c, x[ 9], S32); /* 42 */ - HH (c, d, a, b, x[ 5], S33); /* 43 */ - HH (b, c, d, a, x[13], S34); /* 44 */ - HH (a, b, c, d, x[ 3], S31); /* 45 */ - HH (d, a, b, c, x[11], S32); /* 46 */ - HH (c, d, a, b, x[ 7], S33); /* 47 */ - HH (b, c, d, a, x[15], S34); /* 48 */ - + HH (a, b, c, d, x[ 0], S31); /* 33 */ + HH (d, a, b, c, x[ 8], S32); /* 34 */ + HH (c, d, a, b, x[ 4], S33); /* 35 */ + HH (b, c, d, a, x[12], S34); /* 36 */ + HH (a, b, c, d, x[ 2], S31); /* 37 */ + HH (d, a, b, c, x[10], S32); /* 38 */ + HH (c, d, a, b, x[ 6], S33); /* 39 */ + HH (b, c, d, a, x[14], S34); /* 40 */ + HH (a, b, c, d, x[ 1], S31); /* 41 */ + HH (d, a, b, c, x[ 9], S32); /* 42 */ + HH (c, d, a, b, x[ 5], S33); /* 43 */ + HH (b, c, d, a, x[13], S34); /* 44 */ + HH (a, b, c, d, x[ 3], S31); /* 45 */ + HH (d, a, b, c, x[11], S32); /* 46 */ + HH (c, d, a, b, x[ 7], S33); /* 47 */ + HH (b, c, d, a, x[15], S34); /* 48 */ + /* Update our state */ md->md4.state[0] = md->md4.state[0] + a; @@ -242,54 +240,55 @@ int md4_done(hash_state * md, unsigned char *out) } #ifdef LTC_CLEAN_STACK zeromem(md, sizeof(hash_state)); -#endif +#endif return CRYPT_OK; } /** Self-test the hash @return CRYPT_OK if successful, CRYPT_NOP if self-tests have been disabled -*/ +*/ int md4_test(void) { #ifndef LTC_TEST return CRYPT_NOP; - #else + #else static const struct md4_test_case { - char *input; - unsigned char digest[16]; - } cases[] = { - { "", + const char *input; + unsigned char hash[16]; + } tests[] = { + { "", {0x31, 0xd6, 0xcf, 0xe0, 0xd1, 0x6a, 0xe9, 0x31, 0xb7, 0x3c, 0x59, 0xd7, 0xe0, 0xc0, 0x89, 0xc0} }, { "a", {0xbd, 0xe5, 0x2c, 0xb3, 0x1d, 0xe3, 0x3e, 0x46, 0x24, 0x5e, 0x05, 0xfb, 0xdb, 0xd6, 0xfb, 0x24} }, { "abc", - {0xa4, 0x48, 0x01, 0x7a, 0xaf, 0x21, 0xd8, 0x52, + {0xa4, 0x48, 0x01, 0x7a, 0xaf, 0x21, 0xd8, 0x52, 0x5f, 0xc1, 0x0a, 0xe8, 0x7a, 0xa6, 0x72, 0x9d} }, - { "message digest", - {0xd9, 0x13, 0x0a, 0x81, 0x64, 0x54, 0x9f, 0xe8, + { "message digest", + {0xd9, 0x13, 0x0a, 0x81, 0x64, 0x54, 0x9f, 0xe8, 0x18, 0x87, 0x48, 0x06, 0xe1, 0xc7, 0x01, 0x4b} }, - { "abcdefghijklmnopqrstuvwxyz", - {0xd7, 0x9e, 0x1c, 0x30, 0x8a, 0xa5, 0xbb, 0xcd, + { "abcdefghijklmnopqrstuvwxyz", + {0xd7, 0x9e, 0x1c, 0x30, 0x8a, 0xa5, 0xbb, 0xcd, 0xee, 0xa8, 0xed, 0x63, 0xdf, 0x41, 0x2d, 0xa9} }, - { "ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789", - {0x04, 0x3f, 0x85, 0x82, 0xf2, 0x41, 0xdb, 0x35, + { "ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789", + {0x04, 0x3f, 0x85, 0x82, 0xf2, 0x41, 0xdb, 0x35, 0x1c, 0xe6, 0x27, 0xe1, 0x53, 0xe7, 0xf0, 0xe4} }, - { "12345678901234567890123456789012345678901234567890123456789012345678901234567890", - {0xe3, 0x3b, 0x4d, 0xdc, 0x9c, 0x38, 0xf2, 0x19, + { "12345678901234567890123456789012345678901234567890123456789012345678901234567890", + {0xe3, 0x3b, 0x4d, 0xdc, 0x9c, 0x38, 0xf2, 0x19, 0x9c, 0x3e, 0x7b, 0x16, 0x4f, 0xcc, 0x05, 0x36} }, }; + int i; + unsigned char tmp[16]; hash_state md; - unsigned char digest[16]; - for(i = 0; i < (int)(sizeof(cases) / sizeof(cases[0])); i++) { + for(i = 0; i < (int)(sizeof(tests) / sizeof(tests[0])); i++) { md4_init(&md); - md4_process(&md, (unsigned char *)cases[i].input, (unsigned long)strlen(cases[i].input)); - md4_done(&md, digest); - if (XMEMCMP(digest, cases[i].digest, 16) != 0) { + md4_process(&md, (unsigned char *)tests[i].input, (unsigned long)strlen(tests[i].input)); + md4_done(&md, tmp); + if (compare_testvector(tmp, sizeof(tmp), tests[i].hash, sizeof(tests[i].hash), "MD4", i)) { return CRYPT_FAIL_TESTVECTOR; } @@ -302,6 +301,6 @@ int md4_test(void) -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/hashes/md5.c b/libtomcrypt/src/hashes/md5.c index 4fa1e9e..511329a 100644 --- a/libtomcrypt/src/hashes/md5.c +++ b/libtomcrypt/src/hashes/md5.c @@ -5,15 +5,13 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" /** @file md5.c - LTC_MD5 hash function by Tom St Denis + LTC_MD5 hash function by Tom St Denis */ #ifdef LTC_MD5 @@ -95,7 +93,7 @@ static const ulong32 Korder[64] = { a = (a + I(b,c,d) + M + t); a = ROLc(a, s) + b; -#endif +#endif #ifdef LTC_CLEAN_STACK static int _md5_compress(hash_state *md, unsigned char *buf) @@ -112,7 +110,7 @@ static int md5_compress(hash_state *md, unsigned char *buf) for (i = 0; i < 16; i++) { LOAD32L(W[i], buf + (4*i)); } - + /* copy state */ a = md->md5.state[0]; b = md->md5.state[1]; @@ -309,37 +307,37 @@ int md5_done(hash_state * md, unsigned char *out) /** Self-test the hash @return CRYPT_OK if successful, CRYPT_NOP if self-tests have been disabled -*/ +*/ int md5_test(void) { #ifndef LTC_TEST return CRYPT_NOP; - #else + #else static const struct { - char *msg; + const char *msg; unsigned char hash[16]; } tests[] = { { "", - { 0xd4, 0x1d, 0x8c, 0xd9, 0x8f, 0x00, 0xb2, 0x04, + { 0xd4, 0x1d, 0x8c, 0xd9, 0x8f, 0x00, 0xb2, 0x04, 0xe9, 0x80, 0x09, 0x98, 0xec, 0xf8, 0x42, 0x7e } }, { "a", - {0x0c, 0xc1, 0x75, 0xb9, 0xc0, 0xf1, 0xb6, 0xa8, + {0x0c, 0xc1, 0x75, 0xb9, 0xc0, 0xf1, 0xb6, 0xa8, 0x31, 0xc3, 0x99, 0xe2, 0x69, 0x77, 0x26, 0x61 } }, { "abc", - { 0x90, 0x01, 0x50, 0x98, 0x3c, 0xd2, 0x4f, 0xb0, + { 0x90, 0x01, 0x50, 0x98, 0x3c, 0xd2, 0x4f, 0xb0, 0xd6, 0x96, 0x3f, 0x7d, 0x28, 0xe1, 0x7f, 0x72 } }, - { "message digest", - { 0xf9, 0x6b, 0x69, 0x7d, 0x7c, 0xb7, 0x93, 0x8d, - 0x52, 0x5a, 0x2f, 0x31, 0xaa, 0xf1, 0x61, 0xd0 } }, + { "message digest", + { 0xf9, 0x6b, 0x69, 0x7d, 0x7c, 0xb7, 0x93, 0x8d, + 0x52, 0x5a, 0x2f, 0x31, 0xaa, 0xf1, 0x61, 0xd0 } }, { "abcdefghijklmnopqrstuvwxyz", - { 0xc3, 0xfc, 0xd3, 0xd7, 0x61, 0x92, 0xe4, 0x00, + { 0xc3, 0xfc, 0xd3, 0xd7, 0x61, 0x92, 0xe4, 0x00, 0x7d, 0xfb, 0x49, 0x6c, 0xca, 0x67, 0xe1, 0x3b } }, { "ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789", - { 0xd1, 0x74, 0xab, 0x98, 0xd2, 0x77, 0xd9, 0xf5, + { 0xd1, 0x74, 0xab, 0x98, 0xd2, 0x77, 0xd9, 0xf5, 0xa5, 0x61, 0x1c, 0x2c, 0x9f, 0x41, 0x9d, 0x9f } }, { "12345678901234567890123456789012345678901234567890123456789012345678901234567890", - { 0x57, 0xed, 0xf4, 0xa2, 0x2b, 0xe3, 0xc9, 0x55, - 0xac, 0x49, 0xda, 0x2e, 0x21, 0x07, 0xb6, 0x7a } }, + { 0x57, 0xed, 0xf4, 0xa2, 0x2b, 0xe3, 0xc9, 0x55, + 0xac, 0x49, 0xda, 0x2e, 0x21, 0x07, 0xb6, 0x7a } }, { NULL, { 0 } } }; @@ -351,7 +349,7 @@ int md5_test(void) md5_init(&md); md5_process(&md, (unsigned char *)tests[i].msg, (unsigned long)strlen(tests[i].msg)); md5_done(&md, tmp); - if (XMEMCMP(tmp, tests[i].hash, 16) != 0) { + if (compare_testvector(tmp, sizeof(tmp), tests[i].hash, sizeof(tests[i].hash), "MD5", i)) { return CRYPT_FAIL_TESTVECTOR; } } @@ -363,6 +361,6 @@ int md5_test(void) -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/hashes/rmd128.c b/libtomcrypt/src/hashes/rmd128.c index 58ae927..df1af1a 100644 --- a/libtomcrypt/src/hashes/rmd128.c +++ b/libtomcrypt/src/hashes/rmd128.c @@ -5,15 +5,13 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" /** @param rmd128.c RMD128 Hash function -*/ +*/ /* Implementation of LTC_RIPEMD-128 based on the source by Antoon Bosselaers, ESAT-COSIC * @@ -42,11 +40,11 @@ const struct ltc_hash_descriptor rmd128_desc = }; /* the four basic functions F(), G() and H() */ -#define F(x, y, z) ((x) ^ (y) ^ (z)) -#define G(x, y, z) (((x) & (y)) | (~(x) & (z))) +#define F(x, y, z) ((x) ^ (y) ^ (z)) +#define G(x, y, z) (((x) & (y)) | (~(x) & (z))) #define H(x, y, z) (((x) | ~(y)) ^ (z)) -#define I(x, y, z) (((x) & (z)) | ((y) & ~(z))) - +#define I(x, y, z) (((x) & (z)) | ((y) & ~(z))) + /* the eight basic operations FF() through III() */ #define FF(a, b, c, d, x, s) \ (a) += F((b), (c), (d)) + (x);\ @@ -88,7 +86,7 @@ static int rmd128_compress(hash_state *md, unsigned char *buf) { ulong32 aa,bb,cc,dd,aaa,bbb,ccc,ddd,X[16]; int i; - + /* load words X */ for (i = 0; i < 16; i++){ LOAD32L(X[i], buf + (4 * i)); @@ -117,7 +115,7 @@ static int rmd128_compress(hash_state *md, unsigned char *buf) FF(dd, aa, bb, cc, X[13], 7); FF(cc, dd, aa, bb, X[14], 9); FF(bb, cc, dd, aa, X[15], 8); - + /* round 2 */ GG(aa, bb, cc, dd, X[ 7], 7); GG(dd, aa, bb, cc, X[ 4], 6); @@ -173,7 +171,7 @@ static int rmd128_compress(hash_state *md, unsigned char *buf) II(bb, cc, dd, aa, X[ 2], 12); /* parallel round 1 */ - III(aaa, bbb, ccc, ddd, X[ 5], 8); + III(aaa, bbb, ccc, ddd, X[ 5], 8); III(ddd, aaa, bbb, ccc, X[14], 9); III(ccc, ddd, aaa, bbb, X[ 7], 9); III(bbb, ccc, ddd, aaa, X[ 0], 11); @@ -208,7 +206,7 @@ static int rmd128_compress(hash_state *md, unsigned char *buf) HHH(ccc, ddd, aaa, bbb, X[ 1], 13); HHH(bbb, ccc, ddd, aaa, X[ 2], 11); - /* parallel round 3 */ + /* parallel round 3 */ GGG(aaa, bbb, ccc, ddd, X[15], 9); GGG(ddd, aaa, bbb, ccc, X[ 5], 7); GGG(ccc, ddd, aaa, bbb, X[ 1], 15); @@ -342,21 +340,21 @@ int rmd128_done(hash_state * md, unsigned char *out) #ifdef LTC_CLEAN_STACK zeromem(md, sizeof(hash_state)); #endif - return CRYPT_OK; + return CRYPT_OK; } /** Self-test the hash @return CRYPT_OK if successful, CRYPT_NOP if self-tests have been disabled -*/ +*/ int rmd128_test(void) { #ifndef LTC_TEST return CRYPT_NOP; #else static const struct { - char *msg; - unsigned char md[16]; + const char *msg; + unsigned char hash[16]; } tests[] = { { "", { 0xcd, 0xf2, 0x62, 0x13, 0xa1, 0x50, 0xdc, 0x3e, @@ -383,18 +381,16 @@ int rmd128_test(void) 0xae, 0xa4, 0x62, 0x4c, 0x60, 0xc5, 0xc7, 0x02 } } }; - int x; - unsigned char buf[16]; + + int i; + unsigned char tmp[16]; hash_state md; - for (x = 0; x < (int)(sizeof(tests)/sizeof(tests[0])); x++) { + for (i = 0; i < (int)(sizeof(tests)/sizeof(tests[0])); i++) { rmd128_init(&md); - rmd128_process(&md, (unsigned char *)tests[x].msg, strlen(tests[x].msg)); - rmd128_done(&md, buf); - if (XMEMCMP(buf, tests[x].md, 16) != 0) { - #if 0 - printf("Failed test %d\n", x); - #endif + rmd128_process(&md, (unsigned char *)tests[i].msg, strlen(tests[i].msg)); + rmd128_done(&md, tmp); + if (compare_testvector(tmp, sizeof(tmp), tests[i].hash, sizeof(tests[i].hash), "RIPEMD128", i)) { return CRYPT_FAIL_TESTVECTOR; } } @@ -405,6 +401,6 @@ int rmd128_test(void) #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/hashes/rmd160.c b/libtomcrypt/src/hashes/rmd160.c index 1313e41..8add41e 100644 --- a/libtomcrypt/src/hashes/rmd160.c +++ b/libtomcrypt/src/hashes/rmd160.c @@ -5,15 +5,13 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" /** @file rmd160.c RMD160 hash function -*/ +*/ /* Implementation of LTC_RIPEMD-160 based on the source by Antoon Bosselaers, ESAT-COSIC * @@ -42,12 +40,12 @@ const struct ltc_hash_descriptor rmd160_desc = }; /* the five basic functions F(), G() and H() */ -#define F(x, y, z) ((x) ^ (y) ^ (z)) -#define G(x, y, z) (((x) & (y)) | (~(x) & (z))) +#define F(x, y, z) ((x) ^ (y) ^ (z)) +#define G(x, y, z) (((x) & (y)) | (~(x) & (z))) #define H(x, y, z) (((x) | ~(y)) ^ (z)) -#define I(x, y, z) (((x) & (z)) | ((y) & ~(z))) +#define I(x, y, z) (((x) & (z)) | ((y) & ~(z))) #define J(x, y, z) ((x) ^ ((y) | ~(z))) - + /* the ten basic operations FF() through III() */ #define FF(a, b, c, d, e, x, s) \ (a) += F((b), (c), (d)) + (x);\ @@ -138,7 +136,7 @@ static int rmd160_compress(hash_state *md, unsigned char *buf) FF(cc, dd, ee, aa, bb, X[13], 7); FF(bb, cc, dd, ee, aa, X[14], 9); FF(aa, bb, cc, dd, ee, X[15], 8); - + /* round 2 */ GG(ee, aa, bb, cc, dd, X[ 7], 7); GG(dd, ee, aa, bb, cc, X[ 4], 6); @@ -230,7 +228,7 @@ static int rmd160_compress(hash_state *md, unsigned char *buf) JJJ(aaa, bbb, ccc, ddd, eee, X[12], 6); /* parallel round 2 */ - III(eee, aaa, bbb, ccc, ddd, X[ 6], 9); + III(eee, aaa, bbb, ccc, ddd, X[ 6], 9); III(ddd, eee, aaa, bbb, ccc, X[11], 13); III(ccc, ddd, eee, aaa, bbb, X[ 3], 15); III(bbb, ccc, ddd, eee, aaa, X[ 7], 7); @@ -265,7 +263,7 @@ static int rmd160_compress(hash_state *md, unsigned char *buf) HHH(eee, aaa, bbb, ccc, ddd, X[ 4], 7); HHH(ddd, eee, aaa, bbb, ccc, X[13], 5); - /* parallel round 4 */ + /* parallel round 4 */ GGG(ccc, ddd, eee, aaa, bbb, X[ 8], 15); GGG(bbb, ccc, ddd, eee, aaa, X[ 6], 5); GGG(aaa, bbb, ccc, ddd, eee, X[ 4], 8); @@ -407,15 +405,15 @@ int rmd160_done(hash_state * md, unsigned char *out) /** Self-test the hash @return CRYPT_OK if successful, CRYPT_NOP if self-tests have been disabled -*/ +*/ int rmd160_test(void) { #ifndef LTC_TEST return CRYPT_NOP; #else static const struct { - char *msg; - unsigned char md[20]; + const char *msg; + unsigned char hash[20]; } tests[] = { { "", { 0x9c, 0x11, 0x85, 0xa5, 0xc5, 0xe9, 0xfc, 0x54, 0x61, 0x28, @@ -442,18 +440,16 @@ int rmd160_test(void) 0xa0, 0x6c, 0x27, 0xdc, 0xf4, 0x9a, 0xda, 0x62, 0xeb, 0x2b } } }; - int x; - unsigned char buf[20]; + + int i; + unsigned char tmp[20]; hash_state md; - for (x = 0; x < (int)(sizeof(tests)/sizeof(tests[0])); x++) { + for (i = 0; i < (int)(sizeof(tests)/sizeof(tests[0])); i++) { rmd160_init(&md); - rmd160_process(&md, (unsigned char *)tests[x].msg, strlen(tests[x].msg)); - rmd160_done(&md, buf); - if (XMEMCMP(buf, tests[x].md, 20) != 0) { -#if 0 - printf("Failed test %d\n", x); -#endif + rmd160_process(&md, (unsigned char *)tests[i].msg, strlen(tests[i].msg)); + rmd160_done(&md, tmp); + if (compare_testvector(tmp, sizeof(tmp), tests[i].hash, sizeof(tests[i].hash), "RIPEMD160", i)) { return CRYPT_FAIL_TESTVECTOR; } } @@ -464,6 +460,6 @@ int rmd160_test(void) #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/hashes/rmd256.c b/libtomcrypt/src/hashes/rmd256.c index 0188bf7..5fade82 100644 --- a/libtomcrypt/src/hashes/rmd256.c +++ b/libtomcrypt/src/hashes/rmd256.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" @@ -20,7 +18,7 @@ const struct ltc_hash_descriptor rmd256_desc = { "rmd256", - 8, + 13, 32, 64, @@ -368,8 +366,8 @@ int rmd256_test(void) return CRYPT_NOP; #else static const struct { - char *msg; - unsigned char md[32]; + const char *msg; + unsigned char hash[32]; } tests[] = { { "", { 0x02, 0xba, 0x4c, 0x4e, 0x5f, 0x8e, 0xcd, 0x18, @@ -408,18 +406,16 @@ int rmd256_test(void) 0xa8, 0x9f, 0x7e, 0xa6, 0xde, 0x77, 0xa0, 0xb8 } } }; - int x; - unsigned char buf[32]; + + int i; + unsigned char tmp[32]; hash_state md; - for (x = 0; x < (int)(sizeof(tests)/sizeof(tests[0])); x++) { + for (i = 0; i < (int)(sizeof(tests)/sizeof(tests[0])); i++) { rmd256_init(&md); - rmd256_process(&md, (unsigned char *)tests[x].msg, strlen(tests[x].msg)); - rmd256_done(&md, buf); - if (XMEMCMP(buf, tests[x].md, 32) != 0) { - #if 0 - printf("Failed test %d\n", x); - #endif + rmd256_process(&md, (unsigned char *)tests[i].msg, strlen(tests[i].msg)); + rmd256_done(&md, tmp); + if (compare_testvector(tmp, sizeof(tmp), tests[i].hash, sizeof(tests[i].hash), "RIPEMD256", i)) { return CRYPT_FAIL_TESTVECTOR; } } @@ -429,3 +425,6 @@ int rmd256_test(void) #endif +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/hashes/rmd320.c b/libtomcrypt/src/hashes/rmd320.c index 858d7bb..a4356c4 100644 --- a/libtomcrypt/src/hashes/rmd320.c +++ b/libtomcrypt/src/hashes/rmd320.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" @@ -20,11 +18,12 @@ const struct ltc_hash_descriptor rmd320_desc = { "rmd320", - 9, + 14, 40, 64, - /* OID */ + /* OID ... does not exist + * http://oid-info.com/get/1.3.36.3.2 */ { 0 }, 0, @@ -432,8 +431,8 @@ int rmd320_test(void) return CRYPT_NOP; #else static const struct { - char *msg; - unsigned char md[40]; + const char *msg; + unsigned char hash[40]; } tests[] = { { "", { 0x22, 0xd6, 0x5d, 0x56, 0x61, 0x53, 0x6c, 0xdc, 0x75, 0xc1, @@ -472,18 +471,16 @@ int rmd320_test(void) 0xbc, 0x74, 0x70, 0xa9, 0x69, 0xc9, 0xd0, 0x72, 0xa1, 0xac } } }; - int x; - unsigned char buf[40]; + + int i; + unsigned char tmp[40]; hash_state md; - for (x = 0; x < (int)(sizeof(tests)/sizeof(tests[0])); x++) { + for (i = 0; i < (int)(sizeof(tests)/sizeof(tests[0])); i++) { rmd320_init(&md); - rmd320_process(&md, (unsigned char *)tests[x].msg, strlen(tests[x].msg)); - rmd320_done(&md, buf); - if (XMEMCMP(buf, tests[x].md, 40) != 0) { -#if 0 - printf("Failed test %d\n", x); -#endif + rmd320_process(&md, (unsigned char *)tests[i].msg, strlen(tests[i].msg)); + rmd320_done(&md, tmp); + if (compare_testvector(tmp, sizeof(tmp), tests[i].hash, sizeof(tests[i].hash), "RIPEMD320", i)) { return CRYPT_FAIL_TESTVECTOR; } } @@ -493,3 +490,6 @@ int rmd320_test(void) #endif +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/hashes/sha1.c b/libtomcrypt/src/hashes/sha1.c index 8c846b0..40f0175 100644 --- a/libtomcrypt/src/hashes/sha1.c +++ b/libtomcrypt/src/hashes/sha1.c @@ -5,14 +5,12 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" /** @file sha1.c - LTC_SHA1 code by Tom St Denis + LTC_SHA1 code by Tom St Denis */ @@ -66,7 +64,7 @@ static int sha1_compress(hash_state *md, unsigned char *buf) /* expand it */ for (i = 16; i < 80; i++) { - W[i] = ROL(W[i-3] ^ W[i-8] ^ W[i-14] ^ W[i-16], 1); + W[i] = ROL(W[i-3] ^ W[i-8] ^ W[i-14] ^ W[i-16], 1); } /* compress */ @@ -75,9 +73,9 @@ static int sha1_compress(hash_state *md, unsigned char *buf) #define FF1(a,b,c,d,e,i) e = (ROLc(a, 5) + F1(b,c,d) + e + W[i] + 0x6ed9eba1UL); b = ROLc(b, 30); #define FF2(a,b,c,d,e,i) e = (ROLc(a, 5) + F2(b,c,d) + e + W[i] + 0x8f1bbcdcUL); b = ROLc(b, 30); #define FF3(a,b,c,d,e,i) e = (ROLc(a, 5) + F3(b,c,d) + e + W[i] + 0xca62c1d6UL); b = ROLc(b, 30); - + #ifdef LTC_SMALL_CODE - + for (i = 0; i < 20; ) { FF0(a,b,c,d,e,i++); t = e; e = d; d = c; c = b; b = a; a = t; } @@ -105,7 +103,7 @@ static int sha1_compress(hash_state *md, unsigned char *buf) } /* round two */ - for (; i < 40; ) { + for (; i < 40; ) { FF1(a,b,c,d,e,i++); FF1(e,a,b,c,d,i++); FF1(d,e,a,b,c,i++); @@ -114,7 +112,7 @@ static int sha1_compress(hash_state *md, unsigned char *buf) } /* round three */ - for (; i < 60; ) { + for (; i < 60; ) { FF2(a,b,c,d,e,i++); FF2(e,a,b,c,d,i++); FF2(d,e,a,b,c,i++); @@ -123,7 +121,7 @@ static int sha1_compress(hash_state *md, unsigned char *buf) } /* round four */ - for (; i < 80; ) { + for (; i < 80; ) { FF3(a,b,c,d,e,i++); FF3(e,a,b,c,d,i++); FF3(d,e,a,b,c,i++); @@ -241,14 +239,14 @@ int sha1_done(hash_state * md, unsigned char *out) /** Self-test the hash @return CRYPT_OK if successful, CRYPT_NOP if self-tests have been disabled -*/ +*/ int sha1_test(void) { #ifndef LTC_TEST return CRYPT_NOP; - #else + #else static const struct { - char *msg; + const char *msg; unsigned char hash[20]; } tests[] = { { "abc", @@ -271,7 +269,7 @@ int sha1_test(void) sha1_init(&md); sha1_process(&md, (unsigned char*)tests[i].msg, (unsigned long)strlen(tests[i].msg)); sha1_done(&md, tmp); - if (XMEMCMP(tmp, tests[i].hash, 20) != 0) { + if (compare_testvector(tmp, sizeof(tmp), tests[i].hash, sizeof(tests[i].hash), "SHA1", i)) { return CRYPT_FAIL_TESTVECTOR; } } @@ -283,6 +281,6 @@ int sha1_test(void) -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/hashes/sha2/sha224.c b/libtomcrypt/src/hashes/sha2/sha224.c index 5d7dfb2..773a2c5 100644 --- a/libtomcrypt/src/hashes/sha2/sha224.c +++ b/libtomcrypt/src/hashes/sha2/sha224.c @@ -5,14 +5,16 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /** @param sha224.c LTC_SHA-224 new NIST standard based off of LTC_SHA-256 truncated to 224 bits (Tom St Denis) */ +#include "tomcrypt.h" + +#if defined(LTC_SHA224) && defined(LTC_SHA256) + const struct ltc_hash_descriptor sha224_desc = { "sha224", @@ -72,21 +74,21 @@ int sha224_done(hash_state * md, unsigned char *out) XMEMCPY(out, buf, 28); #ifdef LTC_CLEAN_STACK zeromem(buf, sizeof(buf)); -#endif +#endif return err; } /** Self-test the hash @return CRYPT_OK if successful, CRYPT_NOP if self-tests have been disabled -*/ +*/ int sha224_test(void) { #ifndef LTC_TEST return CRYPT_NOP; - #else + #else static const struct { - char *msg; + const char *msg; unsigned char hash[28]; } tests[] = { { "abc", @@ -111,7 +113,7 @@ int sha224_test(void) sha224_init(&md); sha224_process(&md, (unsigned char*)tests[i].msg, (unsigned long)strlen(tests[i].msg)); sha224_done(&md, tmp); - if (XMEMCMP(tmp, tests[i].hash, 28) != 0) { + if (compare_testvector(tmp, sizeof(tmp), tests[i].hash, sizeof(tests[i].hash), "SHA224", i)) { return CRYPT_FAIL_TESTVECTOR; } } @@ -119,7 +121,9 @@ int sha224_test(void) #endif } +#endif /* defined(LTC_SHA224) && defined(LTC_SHA256) */ + -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/hashes/sha2/sha256.c b/libtomcrypt/src/hashes/sha2/sha256.c index ad1386a..f1dc423 100644 --- a/libtomcrypt/src/hashes/sha2/sha256.c +++ b/libtomcrypt/src/hashes/sha2/sha256.c @@ -5,17 +5,15 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" /** @file sha256.c - LTC_SHA256 by Tom St Denis + LTC_SHA256 by Tom St Denis */ -#ifdef LTC_SHA256 +#ifdef LTC_SHA256 const struct ltc_hash_descriptor sha256_desc = { @@ -27,7 +25,7 @@ const struct ltc_hash_descriptor sha256_desc = /* OID */ { 2, 16, 840, 1, 101, 3, 4, 2, 1, }, 9, - + &sha256_init, &sha256_process, &sha256_done, @@ -56,7 +54,7 @@ static const ulong32 K[64] = { /* Various logical functions */ #define Ch(x,y,z) (z ^ (x & (y ^ z))) -#define Maj(x,y,z) (((x | y) & z) | (x & y)) +#define Maj(x,y,z) (((x | y) & z) | (x & y)) #define S(x, n) RORc((x),(n)) #define R(x, n) (((x)&0xFFFFFFFFUL)>>(n)) #define Sigma0(x) (S(x, 2) ^ S(x, 13) ^ S(x, 22)) @@ -90,10 +88,10 @@ static int sha256_compress(hash_state * md, unsigned char *buf) /* fill W[16..63] */ for (i = 16; i < 64; i++) { W[i] = Gamma1(W[i - 2]) + W[i - 7] + Gamma0(W[i - 15]) + W[i - 16]; - } + } /* Compress */ -#ifdef LTC_SMALL_CODE +#ifdef LTC_SMALL_CODE #define RND(a,b,c,d,e,f,g,h,i) \ t0 = h + Sigma1(e) + Ch(e, f, g) + K[i] + W[i]; \ t1 = Sigma0(a) + Maj(a, b, c); \ @@ -102,10 +100,10 @@ static int sha256_compress(hash_state * md, unsigned char *buf) for (i = 0; i < 64; ++i) { RND(S[0],S[1],S[2],S[3],S[4],S[5],S[6],S[7],i); - t = S[7]; S[7] = S[6]; S[6] = S[5]; S[5] = S[4]; + t = S[7]; S[7] = S[6]; S[6] = S[5]; S[5] = S[4]; S[4] = S[3]; S[3] = S[2]; S[2] = S[1]; S[1] = S[0]; S[0] = t; - } -#else + } +#else #define RND(a,b,c,d,e,f,g,h,i,ki) \ t0 = h + Sigma1(e) + Ch(e, f, g) + ki + W[i]; \ t1 = Sigma0(a) + Maj(a, b, c); \ @@ -177,9 +175,9 @@ static int sha256_compress(hash_state * md, unsigned char *buf) RND(S[2],S[3],S[4],S[5],S[6],S[7],S[0],S[1],62,0xbef9a3f7); RND(S[1],S[2],S[3],S[4],S[5],S[6],S[7],S[0],63,0xc67178f2); -#undef RND - -#endif +#undef RND + +#endif /* feedback */ for (i = 0; i < 8; i++) { @@ -287,14 +285,14 @@ int sha256_done(hash_state * md, unsigned char *out) /** Self-test the hash @return CRYPT_OK if successful, CRYPT_NOP if self-tests have been disabled -*/ +*/ int sha256_test(void) { #ifndef LTC_TEST return CRYPT_NOP; - #else + #else static const struct { - char *msg; + const char *msg; unsigned char hash[32]; } tests[] = { { "abc", @@ -304,9 +302,9 @@ int sha256_test(void) 0xb4, 0x10, 0xff, 0x61, 0xf2, 0x00, 0x15, 0xad } }, { "abcdbcdecdefdefgefghfghighijhijkijkljklmklmnlmnomnopnopq", - { 0x24, 0x8d, 0x6a, 0x61, 0xd2, 0x06, 0x38, 0xb8, + { 0x24, 0x8d, 0x6a, 0x61, 0xd2, 0x06, 0x38, 0xb8, 0xe5, 0xc0, 0x26, 0x93, 0x0c, 0x3e, 0x60, 0x39, - 0xa3, 0x3c, 0xe4, 0x59, 0x64, 0xff, 0x21, 0x67, + 0xa3, 0x3c, 0xe4, 0x59, 0x64, 0xff, 0x21, 0x67, 0xf6, 0xec, 0xed, 0xd4, 0x19, 0xdb, 0x06, 0xc1 } }, }; @@ -319,7 +317,7 @@ int sha256_test(void) sha256_init(&md); sha256_process(&md, (unsigned char*)tests[i].msg, (unsigned long)strlen(tests[i].msg)); sha256_done(&md, tmp); - if (XMEMCMP(tmp, tests[i].hash, 32) != 0) { + if (compare_testvector(tmp, sizeof(tmp), tests[i].hash, sizeof(tests[i].hash), "SHA256", i)) { return CRYPT_FAIL_TESTVECTOR; } } @@ -327,14 +325,10 @@ int sha256_test(void) #endif } -#ifdef LTC_SHA224 -#include "sha224.c" -#endif - #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/hashes/sha2/sha384.c b/libtomcrypt/src/hashes/sha2/sha384.c index cf4d7dc..1623812 100644 --- a/libtomcrypt/src/hashes/sha2/sha384.c +++ b/libtomcrypt/src/hashes/sha2/sha384.c @@ -5,14 +5,16 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ -/** +/** @param sha384.c LTC_SHA384 hash included in sha512.c, Tom St Denis */ +#include "tomcrypt.h" + +#if defined(LTC_SHA384) && defined(LTC_SHA512) + const struct ltc_hash_descriptor sha384_desc = { "sha384", @@ -81,14 +83,14 @@ int sha384_done(hash_state * md, unsigned char *out) /** Self-test the hash @return CRYPT_OK if successful, CRYPT_NOP if self-tests have been disabled -*/ +*/ int sha384_test(void) { #ifndef LTC_TEST return CRYPT_NOP; - #else + #else static const struct { - char *msg; + const char *msg; unsigned char hash[48]; } tests[] = { { "abc", @@ -117,7 +119,7 @@ int sha384_test(void) sha384_init(&md); sha384_process(&md, (unsigned char*)tests[i].msg, (unsigned long)strlen(tests[i].msg)); sha384_done(&md, tmp); - if (XMEMCMP(tmp, tests[i].hash, 48) != 0) { + if (compare_testvector(tmp, sizeof(tmp), tests[i].hash, sizeof(tests[i].hash), "SHA384", i)) { return CRYPT_FAIL_TESTVECTOR; } } @@ -125,11 +127,8 @@ int sha384_test(void) #endif } +#endif /* defined(LTC_SHA384) && defined(LTC_SHA512) */ - - - - -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/hashes/sha2/sha512.c b/libtomcrypt/src/hashes/sha2/sha512.c index 4b7e761..110203a 100644 --- a/libtomcrypt/src/hashes/sha2/sha512.c +++ b/libtomcrypt/src/hashes/sha2/sha512.c @@ -5,14 +5,12 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" /** @param sha512.c - LTC_SHA512 by Tom St Denis + LTC_SHA512 by Tom St Denis */ #ifdef LTC_SHA512 @@ -37,51 +35,51 @@ const struct ltc_hash_descriptor sha512_desc = /* the K array */ static const ulong64 K[80] = { -CONST64(0x428a2f98d728ae22), CONST64(0x7137449123ef65cd), +CONST64(0x428a2f98d728ae22), CONST64(0x7137449123ef65cd), CONST64(0xb5c0fbcfec4d3b2f), CONST64(0xe9b5dba58189dbbc), -CONST64(0x3956c25bf348b538), CONST64(0x59f111f1b605d019), +CONST64(0x3956c25bf348b538), CONST64(0x59f111f1b605d019), CONST64(0x923f82a4af194f9b), CONST64(0xab1c5ed5da6d8118), -CONST64(0xd807aa98a3030242), CONST64(0x12835b0145706fbe), +CONST64(0xd807aa98a3030242), CONST64(0x12835b0145706fbe), CONST64(0x243185be4ee4b28c), CONST64(0x550c7dc3d5ffb4e2), -CONST64(0x72be5d74f27b896f), CONST64(0x80deb1fe3b1696b1), +CONST64(0x72be5d74f27b896f), CONST64(0x80deb1fe3b1696b1), CONST64(0x9bdc06a725c71235), CONST64(0xc19bf174cf692694), -CONST64(0xe49b69c19ef14ad2), CONST64(0xefbe4786384f25e3), +CONST64(0xe49b69c19ef14ad2), CONST64(0xefbe4786384f25e3), CONST64(0x0fc19dc68b8cd5b5), CONST64(0x240ca1cc77ac9c65), -CONST64(0x2de92c6f592b0275), CONST64(0x4a7484aa6ea6e483), +CONST64(0x2de92c6f592b0275), CONST64(0x4a7484aa6ea6e483), CONST64(0x5cb0a9dcbd41fbd4), CONST64(0x76f988da831153b5), -CONST64(0x983e5152ee66dfab), CONST64(0xa831c66d2db43210), +CONST64(0x983e5152ee66dfab), CONST64(0xa831c66d2db43210), CONST64(0xb00327c898fb213f), CONST64(0xbf597fc7beef0ee4), -CONST64(0xc6e00bf33da88fc2), CONST64(0xd5a79147930aa725), +CONST64(0xc6e00bf33da88fc2), CONST64(0xd5a79147930aa725), CONST64(0x06ca6351e003826f), CONST64(0x142929670a0e6e70), -CONST64(0x27b70a8546d22ffc), CONST64(0x2e1b21385c26c926), +CONST64(0x27b70a8546d22ffc), CONST64(0x2e1b21385c26c926), CONST64(0x4d2c6dfc5ac42aed), CONST64(0x53380d139d95b3df), -CONST64(0x650a73548baf63de), CONST64(0x766a0abb3c77b2a8), +CONST64(0x650a73548baf63de), CONST64(0x766a0abb3c77b2a8), CONST64(0x81c2c92e47edaee6), CONST64(0x92722c851482353b), CONST64(0xa2bfe8a14cf10364), CONST64(0xa81a664bbc423001), CONST64(0xc24b8b70d0f89791), CONST64(0xc76c51a30654be30), -CONST64(0xd192e819d6ef5218), CONST64(0xd69906245565a910), +CONST64(0xd192e819d6ef5218), CONST64(0xd69906245565a910), CONST64(0xf40e35855771202a), CONST64(0x106aa07032bbd1b8), -CONST64(0x19a4c116b8d2d0c8), CONST64(0x1e376c085141ab53), +CONST64(0x19a4c116b8d2d0c8), CONST64(0x1e376c085141ab53), CONST64(0x2748774cdf8eeb99), CONST64(0x34b0bcb5e19b48a8), -CONST64(0x391c0cb3c5c95a63), CONST64(0x4ed8aa4ae3418acb), +CONST64(0x391c0cb3c5c95a63), CONST64(0x4ed8aa4ae3418acb), CONST64(0x5b9cca4f7763e373), CONST64(0x682e6ff3d6b2b8a3), -CONST64(0x748f82ee5defb2fc), CONST64(0x78a5636f43172f60), +CONST64(0x748f82ee5defb2fc), CONST64(0x78a5636f43172f60), CONST64(0x84c87814a1f0ab72), CONST64(0x8cc702081a6439ec), -CONST64(0x90befffa23631e28), CONST64(0xa4506cebde82bde9), +CONST64(0x90befffa23631e28), CONST64(0xa4506cebde82bde9), CONST64(0xbef9a3f7b2c67915), CONST64(0xc67178f2e372532b), -CONST64(0xca273eceea26619c), CONST64(0xd186b8c721c0c207), +CONST64(0xca273eceea26619c), CONST64(0xd186b8c721c0c207), CONST64(0xeada7dd6cde0eb1e), CONST64(0xf57d4f7fee6ed178), -CONST64(0x06f067aa72176fba), CONST64(0x0a637dc5a2c898a6), +CONST64(0x06f067aa72176fba), CONST64(0x0a637dc5a2c898a6), CONST64(0x113f9804bef90dae), CONST64(0x1b710b35131c471b), -CONST64(0x28db77f523047d84), CONST64(0x32caab7b40c72493), +CONST64(0x28db77f523047d84), CONST64(0x32caab7b40c72493), CONST64(0x3c9ebe0a15c9bebc), CONST64(0x431d67c49c100d4c), -CONST64(0x4cc5d4becb3e42b6), CONST64(0x597f299cfc657e2a), +CONST64(0x4cc5d4becb3e42b6), CONST64(0x597f299cfc657e2a), CONST64(0x5fcb6fab3ad6faec), CONST64(0x6c44198c4a475817) }; /* Various logical functions */ #define Ch(x,y,z) (z ^ (x & (y ^ z))) -#define Maj(x,y,z) (((x | y) & z) | (x & y)) +#define Maj(x,y,z) (((x | y) & z) | (x & y)) #define S(x, n) ROR64c(x, n) #define R(x, n) (((x)&CONST64(0xFFFFFFFFFFFFFFFF))>>((ulong64)n)) #define Sigma0(x) (S(x, 28) ^ S(x, 34) ^ S(x, 39)) @@ -112,7 +110,7 @@ static int sha512_compress(hash_state * md, unsigned char *buf) /* fill W[16..79] */ for (i = 16; i < 80; i++) { W[i] = Gamma1(W[i - 2]) + W[i - 7] + Gamma0(W[i - 15]) + W[i - 16]; - } + } /* Compress */ #ifdef LTC_SMALL_CODE @@ -135,17 +133,17 @@ static int sha512_compress(hash_state * md, unsigned char *buf) d += t0; \ h = t0 + t1; - for (i = 0; i < 80; i += 8) { - RND(S[0],S[1],S[2],S[3],S[4],S[5],S[6],S[7],i+0); - RND(S[7],S[0],S[1],S[2],S[3],S[4],S[5],S[6],i+1); - RND(S[6],S[7],S[0],S[1],S[2],S[3],S[4],S[5],i+2); - RND(S[5],S[6],S[7],S[0],S[1],S[2],S[3],S[4],i+3); - RND(S[4],S[5],S[6],S[7],S[0],S[1],S[2],S[3],i+4); - RND(S[3],S[4],S[5],S[6],S[7],S[0],S[1],S[2],i+5); - RND(S[2],S[3],S[4],S[5],S[6],S[7],S[0],S[1],i+6); - RND(S[1],S[2],S[3],S[4],S[5],S[6],S[7],S[0],i+7); - } -#endif + for (i = 0; i < 80; i += 8) { + RND(S[0],S[1],S[2],S[3],S[4],S[5],S[6],S[7],i+0); + RND(S[7],S[0],S[1],S[2],S[3],S[4],S[5],S[6],i+1); + RND(S[6],S[7],S[0],S[1],S[2],S[3],S[4],S[5],i+2); + RND(S[5],S[6],S[7],S[0],S[1],S[2],S[3],S[4],i+3); + RND(S[4],S[5],S[6],S[7],S[0],S[1],S[2],S[3],i+4); + RND(S[3],S[4],S[5],S[6],S[7],S[0],S[1],S[2],i+5); + RND(S[2],S[3],S[4],S[5],S[6],S[7],S[0],S[1],i+6); + RND(S[1],S[2],S[3],S[4],S[5],S[6],S[7],S[0],i+7); + } +#endif /* feedback */ @@ -232,7 +230,7 @@ int sha512_done(hash_state * md, unsigned char *out) md->sha512.curlen = 0; } - /* pad upto 120 bytes of zeroes + /* pad upto 120 bytes of zeroes * note: that from 112 to 120 is the 64 MSB of the length. We assume that you won't hash * > 2^64 bits of data... :-) */ @@ -257,14 +255,14 @@ int sha512_done(hash_state * md, unsigned char *out) /** Self-test the hash @return CRYPT_OK if successful, CRYPT_NOP if self-tests have been disabled -*/ +*/ int sha512_test(void) { #ifndef LTC_TEST return CRYPT_NOP; - #else + #else static const struct { - char *msg; + const char *msg; unsigned char hash[64]; } tests[] = { { "abc", @@ -297,7 +295,7 @@ int sha512_test(void) sha512_init(&md); sha512_process(&md, (unsigned char *)tests[i].msg, (unsigned long)strlen(tests[i].msg)); sha512_done(&md, tmp); - if (XMEMCMP(tmp, tests[i].hash, 64) != 0) { + if (compare_testvector(tmp, sizeof(tmp), tests[i].hash, sizeof(tests[i].hash), "SHA512", i)) { return CRYPT_FAIL_TESTVECTOR; } } @@ -305,15 +303,11 @@ int sha512_test(void) #endif } -#ifdef LTC_SHA384 - #include "sha384.c" -#endif - #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/hashes/sha2/sha512_224.c b/libtomcrypt/src/hashes/sha2/sha512_224.c new file mode 100644 index 0000000..48bb938 --- /dev/null +++ b/libtomcrypt/src/hashes/sha2/sha512_224.c @@ -0,0 +1,130 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + */ +/** + @param sha512_224.c + SHA512/224 hash included in sha512.c +*/ + +#include "tomcrypt.h" + +#if defined(LTC_SHA512_224) && defined(LTC_SHA512) + +const struct ltc_hash_descriptor sha512_224_desc = +{ + "sha512-224", + 15, + 28, + 128, + + /* OID */ + { 2, 16, 840, 1, 101, 3, 4, 2, 5, }, + 9, + + &sha512_224_init, + &sha512_process, + &sha512_224_done, + &sha512_224_test, + NULL +}; + +/** + Initialize the hash state + @param md The hash state you wish to initialize + @return CRYPT_OK if successful +*/ +int sha512_224_init(hash_state * md) +{ + LTC_ARGCHK(md != NULL); + + md->sha512.curlen = 0; + md->sha512.length = 0; + md->sha512.state[0] = CONST64(0x8C3D37C819544DA2); + md->sha512.state[1] = CONST64(0x73E1996689DCD4D6); + md->sha512.state[2] = CONST64(0x1DFAB7AE32FF9C82); + md->sha512.state[3] = CONST64(0x679DD514582F9FCF); + md->sha512.state[4] = CONST64(0x0F6D2B697BD44DA8); + md->sha512.state[5] = CONST64(0x77E36F7304C48942); + md->sha512.state[6] = CONST64(0x3F9D85A86A1D36C8); + md->sha512.state[7] = CONST64(0x1112E6AD91D692A1); + return CRYPT_OK; +} + +/** + Terminate the hash to get the digest + @param md The hash state + @param out [out] The destination of the hash (48 bytes) + @return CRYPT_OK if successful +*/ +int sha512_224_done(hash_state * md, unsigned char *out) +{ + unsigned char buf[64]; + + LTC_ARGCHK(md != NULL); + LTC_ARGCHK(out != NULL); + + if (md->sha512.curlen >= sizeof(md->sha512.buf)) { + return CRYPT_INVALID_ARG; + } + + sha512_done(md, buf); + XMEMCPY(out, buf, 28); +#ifdef LTC_CLEAN_STACK + zeromem(buf, sizeof(buf)); +#endif + return CRYPT_OK; +} + +/** + Self-test the hash + @return CRYPT_OK if successful, CRYPT_NOP if self-tests have been disabled +*/ +int sha512_224_test(void) +{ + #ifndef LTC_TEST + return CRYPT_NOP; + #else + static const struct { + const char *msg; + unsigned char hash[28]; + } tests[] = { + { "abc", + { 0x46, 0x34, 0x27, 0x0F, 0x70, 0x7B, 0x6A, 0x54, + 0xDA, 0xAE, 0x75, 0x30, 0x46, 0x08, 0x42, 0xE2, + 0x0E, 0x37, 0xED, 0x26, 0x5C, 0xEE, 0xE9, 0xA4, + 0x3E, 0x89, 0x24, 0xAA } + }, + { "abcdefghbcdefghicdefghijdefghijkefghijklfghijklmghijklmnhijklmnoijklmnopjklmnopqklmnopqrlmnopqrsmnopqrstnopqrstu", + { 0x23, 0xFE, 0xC5, 0xBB, 0x94, 0xD6, 0x0B, 0x23, + 0x30, 0x81, 0x92, 0x64, 0x0B, 0x0C, 0x45, 0x33, + 0x35, 0xD6, 0x64, 0x73, 0x4F, 0xE4, 0x0E, 0x72, + 0x68, 0x67, 0x4A, 0xF9 } + }, + }; + + int i; + unsigned char tmp[28]; + hash_state md; + + for (i = 0; i < (int)(sizeof(tests) / sizeof(tests[0])); i++) { + sha512_224_init(&md); + sha512_224_process(&md, (unsigned char*)tests[i].msg, (unsigned long)strlen(tests[i].msg)); + sha512_224_done(&md, tmp); + if (compare_testvector(tmp, sizeof(tmp), tests[i].hash, sizeof(tests[i].hash), "SHA512-224", i)) { + return CRYPT_FAIL_TESTVECTOR; + } + } + return CRYPT_OK; + #endif +} + +#endif /* defined(LTC_SHA384) && defined(LTC_SHA512) */ + +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/hashes/sha2/sha512_256.c b/libtomcrypt/src/hashes/sha2/sha512_256.c new file mode 100644 index 0000000..943adaa --- /dev/null +++ b/libtomcrypt/src/hashes/sha2/sha512_256.c @@ -0,0 +1,130 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + */ +/** + @param sha512_256.c + SHA512/256 hash included in sha512.c +*/ + +#include "tomcrypt.h" + +#if defined(LTC_SHA512_256) && defined(LTC_SHA512) + +const struct ltc_hash_descriptor sha512_256_desc = +{ + "sha512-256", + 16, + 32, + 128, + + /* OID */ + { 2, 16, 840, 1, 101, 3, 4, 2, 6, }, + 9, + + &sha512_256_init, + &sha512_process, + &sha512_256_done, + &sha512_256_test, + NULL +}; + +/** + Initialize the hash state + @param md The hash state you wish to initialize + @return CRYPT_OK if successful +*/ +int sha512_256_init(hash_state * md) +{ + LTC_ARGCHK(md != NULL); + + md->sha512.curlen = 0; + md->sha512.length = 0; + md->sha512.state[0] = CONST64(0x22312194FC2BF72C); + md->sha512.state[1] = CONST64(0x9F555FA3C84C64C2); + md->sha512.state[2] = CONST64(0x2393B86B6F53B151); + md->sha512.state[3] = CONST64(0x963877195940EABD); + md->sha512.state[4] = CONST64(0x96283EE2A88EFFE3); + md->sha512.state[5] = CONST64(0xBE5E1E2553863992); + md->sha512.state[6] = CONST64(0x2B0199FC2C85B8AA); + md->sha512.state[7] = CONST64(0x0EB72DDC81C52CA2); + return CRYPT_OK; +} + +/** + Terminate the hash to get the digest + @param md The hash state + @param out [out] The destination of the hash (48 bytes) + @return CRYPT_OK if successful +*/ +int sha512_256_done(hash_state * md, unsigned char *out) +{ + unsigned char buf[64]; + + LTC_ARGCHK(md != NULL); + LTC_ARGCHK(out != NULL); + + if (md->sha512.curlen >= sizeof(md->sha512.buf)) { + return CRYPT_INVALID_ARG; + } + + sha512_done(md, buf); + XMEMCPY(out, buf, 32); +#ifdef LTC_CLEAN_STACK + zeromem(buf, sizeof(buf)); +#endif + return CRYPT_OK; +} + +/** + Self-test the hash + @return CRYPT_OK if successful, CRYPT_NOP if self-tests have been disabled +*/ +int sha512_256_test(void) +{ + #ifndef LTC_TEST + return CRYPT_NOP; + #else + static const struct { + const char *msg; + unsigned char hash[32]; + } tests[] = { + { "abc", + { 0x53, 0x04, 0x8E, 0x26, 0x81, 0x94, 0x1E, 0xF9, + 0x9B, 0x2E, 0x29, 0xB7, 0x6B, 0x4C, 0x7D, 0xAB, + 0xE4, 0xC2, 0xD0, 0xC6, 0x34, 0xFC, 0x6D, 0x46, + 0xE0, 0xE2, 0xF1, 0x31, 0x07, 0xE7, 0xAF, 0x23 } + }, + { "abcdefghbcdefghicdefghijdefghijkefghijklfghijklmghijklmnhijklmnoijklmnopjklmnopqklmnopqrlmnopqrsmnopqrstnopqrstu", + { 0x39, 0x28, 0xE1, 0x84, 0xFB, 0x86, 0x90, 0xF8, + 0x40, 0xDA, 0x39, 0x88, 0x12, 0x1D, 0x31, 0xBE, + 0x65, 0xCB, 0x9D, 0x3E, 0xF8, 0x3E, 0xE6, 0x14, + 0x6F, 0xEA, 0xC8, 0x61, 0xE1, 0x9B, 0x56, 0x3A } + }, + }; + + int i; + unsigned char tmp[32]; + hash_state md; + + for (i = 0; i < (int)(sizeof(tests) / sizeof(tests[0])); i++) { + sha512_256_init(&md); + sha512_256_process(&md, (unsigned char*)tests[i].msg, (unsigned long)strlen(tests[i].msg)); + sha512_256_done(&md, tmp); + if (compare_testvector(tmp, sizeof(tmp), tests[i].hash, sizeof(tests[i].hash), "SHA512-265", i)) { + return CRYPT_FAIL_TESTVECTOR; + } + } + return CRYPT_OK; + #endif +} + +#endif /* defined(LTC_SHA384) && defined(LTC_SHA512) */ + +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/hashes/sha3.c b/libtomcrypt/src/hashes/sha3.c new file mode 100644 index 0000000..c6faa0b --- /dev/null +++ b/libtomcrypt/src/hashes/sha3.c @@ -0,0 +1,306 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + */ + +/* based on https://github.com/brainhub/SHA3IUF (public domain) */ + +#include "tomcrypt.h" + +#ifdef LTC_SHA3 + +const struct ltc_hash_descriptor sha3_224_desc = +{ + "sha3-224", /* name of hash */ + 17, /* internal ID */ + 28, /* Size of digest in octets */ + 144, /* Input block size in octets */ + { 2,16,840,1,101,3,4,2,7 }, /* ASN.1 OID */ + 9, /* Length OID */ + &sha3_224_init, + &sha3_process, + &sha3_done, + &sha3_224_test, + NULL +}; + +const struct ltc_hash_descriptor sha3_256_desc = +{ + "sha3-256", /* name of hash */ + 18, /* internal ID */ + 32, /* Size of digest in octets */ + 136, /* Input block size in octets */ + { 2,16,840,1,101,3,4,2,8 }, /* ASN.1 OID */ + 9, /* Length OID */ + &sha3_256_init, + &sha3_process, + &sha3_done, + &sha3_256_test, + NULL +}; + +const struct ltc_hash_descriptor sha3_384_desc = +{ + "sha3-384", /* name of hash */ + 19, /* internal ID */ + 48, /* Size of digest in octets */ + 104, /* Input block size in octets */ + { 2,16,840,1,101,3,4,2,9 }, /* ASN.1 OID */ + 9, /* Length OID */ + &sha3_384_init, + &sha3_process, + &sha3_done, + &sha3_384_test, + NULL +}; + +const struct ltc_hash_descriptor sha3_512_desc = +{ + "sha3-512", /* name of hash */ + 20, /* internal ID */ + 64, /* Size of digest in octets */ + 72, /* Input block size in octets */ + { 2,16,840,1,101,3,4,2,10 }, /* ASN.1 OID */ + 9, /* Length OID */ + &sha3_512_init, + &sha3_process, + &sha3_done, + &sha3_512_test, + NULL +}; + +#define SHA3_KECCAK_SPONGE_WORDS 25 /* 1600 bits > 200 bytes > 25 x ulong64 */ +#define SHA3_KECCAK_ROUNDS 24 + +static const ulong64 keccakf_rndc[24] = { + CONST64(0x0000000000000001), CONST64(0x0000000000008082), + CONST64(0x800000000000808a), CONST64(0x8000000080008000), + CONST64(0x000000000000808b), CONST64(0x0000000080000001), + CONST64(0x8000000080008081), CONST64(0x8000000000008009), + CONST64(0x000000000000008a), CONST64(0x0000000000000088), + CONST64(0x0000000080008009), CONST64(0x000000008000000a), + CONST64(0x000000008000808b), CONST64(0x800000000000008b), + CONST64(0x8000000000008089), CONST64(0x8000000000008003), + CONST64(0x8000000000008002), CONST64(0x8000000000000080), + CONST64(0x000000000000800a), CONST64(0x800000008000000a), + CONST64(0x8000000080008081), CONST64(0x8000000000008080), + CONST64(0x0000000080000001), CONST64(0x8000000080008008) +}; + +static const unsigned keccakf_rotc[24] = { + 1, 3, 6, 10, 15, 21, 28, 36, 45, 55, 2, 14, 27, 41, 56, 8, 25, 43, 62, 18, 39, 61, 20, 44 +}; + +static const unsigned keccakf_piln[24] = { + 10, 7, 11, 17, 18, 3, 5, 16, 8, 21, 24, 4, 15, 23, 19, 13, 12, 2, 20, 14, 22, 9, 6, 1 +}; + +static void keccakf(ulong64 s[25]) +{ + int i, j, round; + ulong64 t, bc[5]; + + for(round = 0; round < SHA3_KECCAK_ROUNDS; round++) { + /* Theta */ + for(i = 0; i < 5; i++) + bc[i] = s[i] ^ s[i + 5] ^ s[i + 10] ^ s[i + 15] ^ s[i + 20]; + + for(i = 0; i < 5; i++) { + t = bc[(i + 4) % 5] ^ ROL64(bc[(i + 1) % 5], 1); + for(j = 0; j < 25; j += 5) + s[j + i] ^= t; + } + /* Rho Pi */ + t = s[1]; + for(i = 0; i < 24; i++) { + j = keccakf_piln[i]; + bc[0] = s[j]; + s[j] = ROL64(t, keccakf_rotc[i]); + t = bc[0]; + } + /* Chi */ + for(j = 0; j < 25; j += 5) { + for(i = 0; i < 5; i++) + bc[i] = s[j + i]; + for(i = 0; i < 5; i++) + s[j + i] ^= (~bc[(i + 1) % 5]) & bc[(i + 2) % 5]; + } + /* Iota */ + s[0] ^= keccakf_rndc[round]; + } +} + +/* Public Inteface */ + +int sha3_224_init(hash_state *md) +{ + LTC_ARGCHK(md != NULL); + XMEMSET(&md->sha3, 0, sizeof(md->sha3)); + md->sha3.capacity_words = 2 * 224 / (8 * sizeof(ulong64)); + return CRYPT_OK; +} + +int sha3_256_init(hash_state *md) +{ + LTC_ARGCHK(md != NULL); + XMEMSET(&md->sha3, 0, sizeof(md->sha3)); + md->sha3.capacity_words = 2 * 256 / (8 * sizeof(ulong64)); + return CRYPT_OK; +} + +int sha3_384_init(hash_state *md) +{ + LTC_ARGCHK(md != NULL); + XMEMSET(&md->sha3, 0, sizeof(md->sha3)); + md->sha3.capacity_words = 2 * 384 / (8 * sizeof(ulong64)); + return CRYPT_OK; +} + +int sha3_512_init(hash_state *md) +{ + LTC_ARGCHK(md != NULL); + XMEMSET(&md->sha3, 0, sizeof(md->sha3)); + md->sha3.capacity_words = 2 * 512 / (8 * sizeof(ulong64)); + return CRYPT_OK; +} + +int sha3_shake_init(hash_state *md, int num) +{ + LTC_ARGCHK(md != NULL); + if (num != 128 && num != 256) return CRYPT_INVALID_ARG; + XMEMSET(&md->sha3, 0, sizeof(md->sha3)); + md->sha3.capacity_words = (unsigned short)(2 * num / (8 * sizeof(ulong64))); + return CRYPT_OK; +} + +int sha3_process(hash_state *md, const unsigned char *in, unsigned long inlen) +{ + /* 0...7 -- how much is needed to have a word */ + unsigned old_tail = (8 - md->sha3.byte_index) & 7; + + unsigned long words; + unsigned tail; + unsigned long i; + + if (inlen == 0) return CRYPT_OK; /* nothing to do */ + LTC_ARGCHK(md != NULL); + LTC_ARGCHK(in != NULL); + + if(inlen < old_tail) { /* have no complete word or haven't started the word yet */ + while (inlen--) md->sha3.saved |= (ulong64) (*(in++)) << ((md->sha3.byte_index++) * 8); + return CRYPT_OK; + } + + if(old_tail) { /* will have one word to process */ + inlen -= old_tail; + while (old_tail--) md->sha3.saved |= (ulong64) (*(in++)) << ((md->sha3.byte_index++) * 8); + /* now ready to add saved to the sponge */ + md->sha3.s[md->sha3.word_index] ^= md->sha3.saved; + md->sha3.byte_index = 0; + md->sha3.saved = 0; + if(++md->sha3.word_index == (SHA3_KECCAK_SPONGE_WORDS - md->sha3.capacity_words)) { + keccakf(md->sha3.s); + md->sha3.word_index = 0; + } + } + + /* now work in full words directly from input */ + words = inlen / sizeof(ulong64); + tail = inlen - words * sizeof(ulong64); + + for(i = 0; i < words; i++, in += sizeof(ulong64)) { + ulong64 t; + LOAD64L(t, in); + md->sha3.s[md->sha3.word_index] ^= t; + if(++md->sha3.word_index == (SHA3_KECCAK_SPONGE_WORDS - md->sha3.capacity_words)) { + keccakf(md->sha3.s); + md->sha3.word_index = 0; + } + } + + /* finally, save the partial word */ + while (tail--) { + md->sha3.saved |= (ulong64) (*(in++)) << ((md->sha3.byte_index++) * 8); + } + return CRYPT_OK; +} + +int sha3_done(hash_state *md, unsigned char *hash) +{ + unsigned i; + + LTC_ARGCHK(md != NULL); + LTC_ARGCHK(hash != NULL); + + md->sha3.s[md->sha3.word_index] ^= (md->sha3.saved ^ (CONST64(0x06) << (md->sha3.byte_index * 8))); + md->sha3.s[SHA3_KECCAK_SPONGE_WORDS - md->sha3.capacity_words - 1] ^= CONST64(0x8000000000000000); + keccakf(md->sha3.s); + + /* store sha3.s[] as little-endian bytes into sha3.sb */ + for(i = 0; i < SHA3_KECCAK_SPONGE_WORDS; i++) { + STORE64L(md->sha3.s[i], md->sha3.sb + i * 8); + } + + XMEMCPY(hash, md->sha3.sb, md->sha3.capacity_words * 4); + return CRYPT_OK; +} + +int sha3_shake_done(hash_state *md, unsigned char *out, unsigned long outlen) +{ + /* IMPORTANT NOTE: sha3_shake_done can be called many times */ + unsigned long idx; + unsigned i; + + if (outlen == 0) return CRYPT_OK; /* nothing to do */ + LTC_ARGCHK(md != NULL); + LTC_ARGCHK(out != NULL); + + if (!md->sha3.xof_flag) { + /* shake_xof operation must be done only once */ + md->sha3.s[md->sha3.word_index] ^= (md->sha3.saved ^ (CONST64(0x1F) << (md->sha3.byte_index * 8))); + md->sha3.s[SHA3_KECCAK_SPONGE_WORDS - md->sha3.capacity_words - 1] ^= CONST64(0x8000000000000000); + keccakf(md->sha3.s); + /* store sha3.s[] as little-endian bytes into sha3.sb */ + for(i = 0; i < SHA3_KECCAK_SPONGE_WORDS; i++) { + STORE64L(md->sha3.s[i], md->sha3.sb + i * 8); + } + md->sha3.byte_index = 0; + md->sha3.xof_flag = 1; + } + + for (idx = 0; idx < outlen; idx++) { + if(md->sha3.byte_index >= (SHA3_KECCAK_SPONGE_WORDS - md->sha3.capacity_words) * 8) { + keccakf(md->sha3.s); + /* store sha3.s[] as little-endian bytes into sha3.sb */ + for(i = 0; i < SHA3_KECCAK_SPONGE_WORDS; i++) { + STORE64L(md->sha3.s[i], md->sha3.sb + i * 8); + } + md->sha3.byte_index = 0; + } + out[idx] = md->sha3.sb[md->sha3.byte_index++]; + } + return CRYPT_OK; +} + +int sha3_shake_memory(int num, const unsigned char *in, unsigned long inlen, unsigned char *out, unsigned long *outlen) +{ + hash_state md; + int err; + LTC_ARGCHK(in != NULL); + LTC_ARGCHK(out != NULL); + LTC_ARGCHK(outlen != NULL); + if ((err = sha3_shake_init(&md, num)) != CRYPT_OK) return err; + if ((err = sha3_shake_process(&md, in, inlen)) != CRYPT_OK) return err; + if ((err = sha3_shake_done(&md, out, *outlen)) != CRYPT_OK) return err; + return CRYPT_OK; +} + +#endif + +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/hashes/sha3_test.c b/libtomcrypt/src/hashes/sha3_test.c new file mode 100644 index 0000000..5ae8650 --- /dev/null +++ b/libtomcrypt/src/hashes/sha3_test.c @@ -0,0 +1,401 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + */ + +/* based on https://github.com/brainhub/SHA3IUF (public domain) */ + +#include "tomcrypt.h" + +#ifdef LTC_SHA3 + +int sha3_224_test(void) +{ +#ifndef LTC_TEST + return CRYPT_NOP; +#else + unsigned char buf[200], hash[224 / 8]; + int i; + hash_state c; + const unsigned char c1 = 0xa3; + + const unsigned char sha3_224_empty[224 / 8] = { + 0x6b, 0x4e, 0x03, 0x42, 0x36, 0x67, 0xdb, 0xb7, + 0x3b, 0x6e, 0x15, 0x45, 0x4f, 0x0e, 0xb1, 0xab, + 0xd4, 0x59, 0x7f, 0x9a, 0x1b, 0x07, 0x8e, 0x3f, + 0x5b, 0x5a, 0x6b, 0xc7 + }; + + const unsigned char sha3_224_0xa3_200_times[224 / 8] = { + 0x93, 0x76, 0x81, 0x6a, 0xba, 0x50, 0x3f, 0x72, + 0xf9, 0x6c, 0xe7, 0xeb, 0x65, 0xac, 0x09, 0x5d, + 0xee, 0xe3, 0xbe, 0x4b, 0xf9, 0xbb, 0xc2, 0xa1, + 0xcb, 0x7e, 0x11, 0xe0 + }; + + XMEMSET(buf, c1, sizeof(buf)); + + /* SHA3-224 on an empty buffer */ + sha3_224_init(&c); + sha3_done(&c, hash); + if (compare_testvector(hash, sizeof(hash), sha3_224_empty, sizeof(sha3_224_empty), "SHA3-224", 0)) { + return CRYPT_FAIL_TESTVECTOR; + } + + /* SHA3-224 in two steps. [FIPS 202] */ + sha3_224_init(&c); + sha3_process(&c, buf, sizeof(buf) / 2); + sha3_process(&c, buf + sizeof(buf) / 2, sizeof(buf) / 2); + sha3_done(&c, hash); + if (compare_testvector(hash, sizeof(hash), sha3_224_0xa3_200_times, sizeof(sha3_224_0xa3_200_times), "SHA3-224", 1)) { + return CRYPT_FAIL_TESTVECTOR; + } + + /* SHA3-224 byte-by-byte: 200 steps. [FIPS 202] */ + i = 200; + sha3_224_init(&c); + while (i--) { + sha3_process(&c, &c1, 1); + } + sha3_done(&c, hash); + if (compare_testvector(hash, sizeof(hash), sha3_224_0xa3_200_times, sizeof(sha3_224_0xa3_200_times), "SHA3-224", 2)) { + return CRYPT_FAIL_TESTVECTOR; + } + + return CRYPT_OK; +#endif +} + +int sha3_256_test(void) +{ +#ifndef LTC_TEST + return CRYPT_NOP; +#else + unsigned char buf[200], hash[256 / 8]; + int i; + hash_state c; + const unsigned char c1 = 0xa3; + + const unsigned char sha3_256_empty[256 / 8] = { + 0xa7, 0xff, 0xc6, 0xf8, 0xbf, 0x1e, 0xd7, 0x66, + 0x51, 0xc1, 0x47, 0x56, 0xa0, 0x61, 0xd6, 0x62, + 0xf5, 0x80, 0xff, 0x4d, 0xe4, 0x3b, 0x49, 0xfa, + 0x82, 0xd8, 0x0a, 0x4b, 0x80, 0xf8, 0x43, 0x4a + }; + const unsigned char sha3_256_0xa3_200_times[256 / 8] = { + 0x79, 0xf3, 0x8a, 0xde, 0xc5, 0xc2, 0x03, 0x07, + 0xa9, 0x8e, 0xf7, 0x6e, 0x83, 0x24, 0xaf, 0xbf, + 0xd4, 0x6c, 0xfd, 0x81, 0xb2, 0x2e, 0x39, 0x73, + 0xc6, 0x5f, 0xa1, 0xbd, 0x9d, 0xe3, 0x17, 0x87 + }; + + XMEMSET(buf, c1, sizeof(buf)); + + /* SHA3-256 on an empty buffer */ + sha3_256_init(&c); + sha3_done(&c, hash); + if (compare_testvector(hash, sizeof(hash), sha3_256_empty, sizeof(sha3_256_empty), "SHA3-256", 0)) { + return CRYPT_FAIL_TESTVECTOR; + } + + /* SHA3-256 as a single buffer. [FIPS 202] */ + sha3_256_init(&c); + sha3_process(&c, buf, sizeof(buf)); + sha3_done(&c, hash); + if (compare_testvector(hash, sizeof(hash), sha3_256_0xa3_200_times, sizeof(sha3_256_0xa3_200_times), "SHA3-256", 1)) { + return CRYPT_FAIL_TESTVECTOR; + } + + /* SHA3-256 in two steps. [FIPS 202] */ + sha3_256_init(&c); + sha3_process(&c, buf, sizeof(buf) / 2); + sha3_process(&c, buf + sizeof(buf) / 2, sizeof(buf) / 2); + sha3_done(&c, hash); + if (compare_testvector(hash, sizeof(hash), sha3_256_0xa3_200_times, sizeof(sha3_256_0xa3_200_times), "SHA3-256", 2)) { + return CRYPT_FAIL_TESTVECTOR; + } + + /* SHA3-256 byte-by-byte: 200 steps. [FIPS 202] */ + i = 200; + sha3_256_init(&c); + while (i--) { + sha3_process(&c, &c1, 1); + } + sha3_done(&c, hash); + if (compare_testvector(hash, sizeof(hash), sha3_256_0xa3_200_times, sizeof(sha3_256_0xa3_200_times), "SHA3-256", 3)) { + return CRYPT_FAIL_TESTVECTOR; + } + + /* SHA3-256 byte-by-byte: 135 bytes. Input from [Keccak]. Output + * matched with sha3sum. */ + sha3_256_init(&c); + sha3_process(&c, (unsigned char*) + "\xb7\x71\xd5\xce\xf5\xd1\xa4\x1a" + "\x93\xd1\x56\x43\xd7\x18\x1d\x2a" + "\x2e\xf0\xa8\xe8\x4d\x91\x81\x2f" + "\x20\xed\x21\xf1\x47\xbe\xf7\x32" + "\xbf\x3a\x60\xef\x40\x67\xc3\x73" + "\x4b\x85\xbc\x8c\xd4\x71\x78\x0f" + "\x10\xdc\x9e\x82\x91\xb5\x83\x39" + "\xa6\x77\xb9\x60\x21\x8f\x71\xe7" + "\x93\xf2\x79\x7a\xea\x34\x94\x06" + "\x51\x28\x29\x06\x5d\x37\xbb\x55" + "\xea\x79\x6f\xa4\xf5\x6f\xd8\x89" + "\x6b\x49\xb2\xcd\x19\xb4\x32\x15" + "\xad\x96\x7c\x71\x2b\x24\xe5\x03" + "\x2d\x06\x52\x32\xe0\x2c\x12\x74" + "\x09\xd2\xed\x41\x46\xb9\xd7\x5d" + "\x76\x3d\x52\xdb\x98\xd9\x49\xd3" + "\xb0\xfe\xd6\xa8\x05\x2f\xbb", 1080 / 8); + sha3_done(&c, hash); + if(compare_testvector(hash, sizeof(hash), + "\xa1\x9e\xee\x92\xbb\x20\x97\xb6" + "\x4e\x82\x3d\x59\x77\x98\xaa\x18" + "\xbe\x9b\x7c\x73\x6b\x80\x59\xab" + "\xfd\x67\x79\xac\x35\xac\x81\xb5", 256 / 8, "SHA3-256", 4)) { + return CRYPT_FAIL_TESTVECTOR; + } + + return CRYPT_OK; +#endif +} + +int sha3_384_test(void) +{ +#ifndef LTC_TEST + return CRYPT_NOP; +#else + unsigned char buf[200], hash[384 / 8]; + int i; + hash_state c; + const unsigned char c1 = 0xa3; + + const unsigned char sha3_384_0xa3_200_times[384 / 8] = { + 0x18, 0x81, 0xde, 0x2c, 0xa7, 0xe4, 0x1e, 0xf9, + 0x5d, 0xc4, 0x73, 0x2b, 0x8f, 0x5f, 0x00, 0x2b, + 0x18, 0x9c, 0xc1, 0xe4, 0x2b, 0x74, 0x16, 0x8e, + 0xd1, 0x73, 0x26, 0x49, 0xce, 0x1d, 0xbc, 0xdd, + 0x76, 0x19, 0x7a, 0x31, 0xfd, 0x55, 0xee, 0x98, + 0x9f, 0x2d, 0x70, 0x50, 0xdd, 0x47, 0x3e, 0x8f + }; + + XMEMSET(buf, c1, sizeof(buf)); + + /* SHA3-384 as a single buffer. [FIPS 202] */ + sha3_384_init(&c); + sha3_process(&c, buf, sizeof(buf)); + sha3_done(&c, hash); + if (compare_testvector(hash, sizeof(hash), sha3_384_0xa3_200_times, sizeof(sha3_384_0xa3_200_times), "SHA3-384", 0)) { + return CRYPT_FAIL_TESTVECTOR; + } + + /* SHA3-384 in two steps. [FIPS 202] */ + sha3_384_init(&c); + sha3_process(&c, buf, sizeof(buf) / 2); + sha3_process(&c, buf + sizeof(buf) / 2, sizeof(buf) / 2); + sha3_done(&c, hash); + if (compare_testvector(hash, sizeof(hash), sha3_384_0xa3_200_times, sizeof(sha3_384_0xa3_200_times), "SHA3-384", 1)) { + return CRYPT_FAIL_TESTVECTOR; + } + + /* SHA3-384 byte-by-byte: 200 steps. [FIPS 202] */ + i = 200; + sha3_384_init(&c); + while (i--) { + sha3_process(&c, &c1, 1); + } + sha3_done(&c, hash); + if (compare_testvector(hash, sizeof(hash), sha3_384_0xa3_200_times, sizeof(sha3_384_0xa3_200_times), "SHA3-384", 2)) { + return CRYPT_FAIL_TESTVECTOR; + } + + return CRYPT_OK; +#endif +} + +int sha3_512_test(void) +{ +#ifndef LTC_TEST + return CRYPT_NOP; +#else + unsigned char buf[200], hash[512 / 8]; + int i; + hash_state c; + const unsigned char c1 = 0xa3; + + const unsigned char sha3_512_0xa3_200_times[512 / 8] = { + 0xe7, 0x6d, 0xfa, 0xd2, 0x20, 0x84, 0xa8, 0xb1, + 0x46, 0x7f, 0xcf, 0x2f, 0xfa, 0x58, 0x36, 0x1b, + 0xec, 0x76, 0x28, 0xed, 0xf5, 0xf3, 0xfd, 0xc0, + 0xe4, 0x80, 0x5d, 0xc4, 0x8c, 0xae, 0xec, 0xa8, + 0x1b, 0x7c, 0x13, 0xc3, 0x0a, 0xdf, 0x52, 0xa3, + 0x65, 0x95, 0x84, 0x73, 0x9a, 0x2d, 0xf4, 0x6b, + 0xe5, 0x89, 0xc5, 0x1c, 0xa1, 0xa4, 0xa8, 0x41, + 0x6d, 0xf6, 0x54, 0x5a, 0x1c, 0xe8, 0xba, 0x00 + }; + + XMEMSET(buf, c1, sizeof(buf)); + + /* SHA3-512 as a single buffer. [FIPS 202] */ + sha3_512_init(&c); + sha3_process(&c, buf, sizeof(buf)); + sha3_done(&c, hash); + if (compare_testvector(hash, sizeof(hash), sha3_512_0xa3_200_times, sizeof(sha3_512_0xa3_200_times), "SHA3-512", 0)) { + return CRYPT_FAIL_TESTVECTOR; + } + + /* SHA3-512 in two steps. [FIPS 202] */ + sha3_512_init(&c); + sha3_process(&c, buf, sizeof(buf) / 2); + sha3_process(&c, buf + sizeof(buf) / 2, sizeof(buf) / 2); + sha3_done(&c, hash); + if (compare_testvector(hash, sizeof(hash), sha3_512_0xa3_200_times, sizeof(sha3_512_0xa3_200_times), "SHA3-512", 1)) { + return CRYPT_FAIL_TESTVECTOR; + } + + /* SHA3-512 byte-by-byte: 200 steps. [FIPS 202] */ + i = 200; + sha3_512_init(&c); + while (i--) { + sha3_process(&c, &c1, 1); + } + sha3_done(&c, hash); + if (compare_testvector(hash, sizeof(hash), sha3_512_0xa3_200_times, sizeof(sha3_512_0xa3_200_times), "SHA3-512", 2)) { + return CRYPT_FAIL_TESTVECTOR; + } + + return CRYPT_OK; +#endif +} + +int sha3_shake_test(void) +{ +#ifndef LTC_TEST + return CRYPT_NOP; +#else + unsigned char buf[200], hash[512]; + int i; + hash_state c; + const unsigned char c1 = 0xa3; + unsigned long len; + + const unsigned char shake256_empty[32] = { + 0xab, 0x0b, 0xae, 0x31, 0x63, 0x39, 0x89, 0x43, + 0x04, 0xe3, 0x58, 0x77, 0xb0, 0xc2, 0x8a, 0x9b, + 0x1f, 0xd1, 0x66, 0xc7, 0x96, 0xb9, 0xcc, 0x25, + 0x8a, 0x06, 0x4a, 0x8f, 0x57, 0xe2, 0x7f, 0x2a + }; + const unsigned char shake256_0xa3_200_times[32] = { + 0x6a, 0x1a, 0x9d, 0x78, 0x46, 0x43, 0x6e, 0x4d, + 0xca, 0x57, 0x28, 0xb6, 0xf7, 0x60, 0xee, 0xf0, + 0xca, 0x92, 0xbf, 0x0b, 0xe5, 0x61, 0x5e, 0x96, + 0x95, 0x9d, 0x76, 0x71, 0x97, 0xa0, 0xbe, 0xeb + }; + const unsigned char shake128_empty[32] = { + 0x43, 0xe4, 0x1b, 0x45, 0xa6, 0x53, 0xf2, 0xa5, + 0xc4, 0x49, 0x2c, 0x1a, 0xdd, 0x54, 0x45, 0x12, + 0xdd, 0xa2, 0x52, 0x98, 0x33, 0x46, 0x2b, 0x71, + 0xa4, 0x1a, 0x45, 0xbe, 0x97, 0x29, 0x0b, 0x6f + }; + const unsigned char shake128_0xa3_200_times[32] = { + 0x44, 0xc9, 0xfb, 0x35, 0x9f, 0xd5, 0x6a, 0xc0, + 0xa9, 0xa7, 0x5a, 0x74, 0x3c, 0xff, 0x68, 0x62, + 0xf1, 0x7d, 0x72, 0x59, 0xab, 0x07, 0x52, 0x16, + 0xc0, 0x69, 0x95, 0x11, 0x64, 0x3b, 0x64, 0x39 + }; + + XMEMSET(buf, c1, sizeof(buf)); + + /* SHAKE256 on an empty buffer */ + sha3_shake_init(&c, 256); + for (i = 0; i < 16; i++) sha3_shake_done(&c, hash, 32); /* get 512 bytes, keep in hash the last 32 */ + if (compare_testvector(hash, sizeof(shake256_empty), shake256_empty, sizeof(shake256_empty), "SHAKE256", 0)) { + return CRYPT_FAIL_TESTVECTOR; + } + + /* SHAKE256 via sha3_shake_memory [FIPS 202] */ + len = 512; + sha3_shake_memory(256, buf, sizeof(buf), hash, &len); + if (compare_testvector(hash + 480, sizeof(shake256_0xa3_200_times), shake256_0xa3_200_times, sizeof(shake256_0xa3_200_times), "SHAKE256", 1)) { + return CRYPT_FAIL_TESTVECTOR; + } + + /* SHAKE256 as a single buffer. [FIPS 202] */ + sha3_shake_init(&c, 256); + sha3_shake_process(&c, buf, sizeof(buf)); + for (i = 0; i < 16; i++) sha3_shake_done(&c, hash, 32); /* get 512 bytes, keep in hash the last 32 */ + if (compare_testvector(hash, sizeof(shake256_0xa3_200_times), shake256_0xa3_200_times, sizeof(shake256_0xa3_200_times), "SHAKE256", 2)) { + return CRYPT_FAIL_TESTVECTOR; + } + + /* SHAKE256 in two steps. [FIPS 202] */ + sha3_shake_init(&c, 256); + sha3_shake_process(&c, buf, sizeof(buf) / 2); + sha3_shake_process(&c, buf + sizeof(buf) / 2, sizeof(buf) / 2); + for (i = 0; i < 16; i++) sha3_shake_done(&c, hash, 32); /* get 512 bytes, keep in hash the last 32 */ + if (compare_testvector(hash, sizeof(shake256_0xa3_200_times), shake256_0xa3_200_times, sizeof(shake256_0xa3_200_times), "SHAKE256", 3)) { + return CRYPT_FAIL_TESTVECTOR; + } + + /* SHAKE256 byte-by-byte: 200 steps. [FIPS 202] */ + i = 200; + sha3_shake_init(&c, 256); + while (i--) sha3_shake_process(&c, &c1, 1); + for (i = 0; i < 16; i++) sha3_shake_done(&c, hash, 32); /* get 512 bytes, keep in hash the last 32 */ + if (compare_testvector(hash, sizeof(shake256_0xa3_200_times), shake256_0xa3_200_times, sizeof(shake256_0xa3_200_times), "SHAKE256", 4)) { + return CRYPT_FAIL_TESTVECTOR; + } + + /* SHAKE128 on an empty buffer */ + sha3_shake_init(&c, 128); + for (i = 0; i < 16; i++) sha3_shake_done(&c, hash, 32); /* get 512 bytes, keep in hash the last 32 */ + if (compare_testvector(hash, sizeof(shake128_empty), shake128_empty, sizeof(shake128_empty), "SHAKE128", 0)) { + return CRYPT_FAIL_TESTVECTOR; + } + + /* SHAKE128 via sha3_shake_memory [FIPS 202] */ + len = 512; + sha3_shake_memory(128, buf, sizeof(buf), hash, &len); + if (compare_testvector(hash + 480, sizeof(shake128_0xa3_200_times), shake128_0xa3_200_times, sizeof(shake128_0xa3_200_times), "SHAKE128", 1)) { + return CRYPT_FAIL_TESTVECTOR; + } + + /* SHAKE128 as a single buffer. [FIPS 202] */ + sha3_shake_init(&c, 128); + sha3_shake_process(&c, buf, sizeof(buf)); + for (i = 0; i < 16; i++) sha3_shake_done(&c, hash, 32); /* get 512 bytes, keep in hash the last 32 */ + if (compare_testvector(hash, sizeof(shake128_0xa3_200_times), shake128_0xa3_200_times, sizeof(shake128_0xa3_200_times), "SHAKE128", 2)) { + return CRYPT_FAIL_TESTVECTOR; + } + + /* SHAKE128 in two steps. [FIPS 202] */ + sha3_shake_init(&c, 128); + sha3_shake_process(&c, buf, sizeof(buf) / 2); + sha3_shake_process(&c, buf + sizeof(buf) / 2, sizeof(buf) / 2); + for (i = 0; i < 16; i++) sha3_shake_done(&c, hash, 32); /* get 512 bytes, keep in hash the last 32 */ + if (compare_testvector(hash, sizeof(shake128_0xa3_200_times), shake128_0xa3_200_times, sizeof(shake128_0xa3_200_times), "SHAKE128", 3)) { + return CRYPT_FAIL_TESTVECTOR; + } + + /* SHAKE128 byte-by-byte: 200 steps. [FIPS 202] */ + i = 200; + sha3_shake_init(&c, 128); + while (i--) sha3_shake_process(&c, &c1, 1); + for (i = 0; i < 16; i++) sha3_shake_done(&c, hash, 32); /* get 512 bytes, keep in hash the last 32 */ + if (compare_testvector(hash, sizeof(shake128_0xa3_200_times), shake128_0xa3_200_times, sizeof(shake128_0xa3_200_times), "SHAKE128", 4)) { + return CRYPT_FAIL_TESTVECTOR; + } + + return CRYPT_OK; +#endif +} + +#endif + +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/hashes/tiger.c b/libtomcrypt/src/hashes/tiger.c index 4d8c659..863f7fa 100644 --- a/libtomcrypt/src/hashes/tiger.c +++ b/libtomcrypt/src/hashes/tiger.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" @@ -558,16 +556,16 @@ static const ulong64 table[4*256] = { #ifdef _MSC_VER #define INLINE __inline #else - #define INLINE -#endif + #define INLINE +#endif /* one round of the hash function */ INLINE static void tiger_round(ulong64 *a, ulong64 *b, ulong64 *c, ulong64 x, int mul) { ulong64 tmp; - tmp = (*c ^= x); - *a -= t1[byte(tmp, 0)] ^ t2[byte(tmp, 2)] ^ t3[byte(tmp, 4)] ^ t4[byte(tmp, 6)]; - tmp = (*b += t4[byte(tmp, 1)] ^ t3[byte(tmp, 3)] ^ t2[byte(tmp,5)] ^ t1[byte(tmp,7)]); + tmp = (*c ^= x); + *a -= t1[byte(tmp, 0)] ^ t2[byte(tmp, 2)] ^ t3[byte(tmp, 4)] ^ t4[byte(tmp, 6)]; + tmp = (*b += t4[byte(tmp, 1)] ^ t3[byte(tmp, 3)] ^ t2[byte(tmp,5)] ^ t1[byte(tmp,7)]); switch (mul) { case 5: *b = (tmp << 2) + tmp; break; case 7: *b = (tmp << 3) - tmp; break; @@ -578,36 +576,36 @@ INLINE static void tiger_round(ulong64 *a, ulong64 *b, ulong64 *c, ulong64 x, in /* one complete pass */ static void pass(ulong64 *a, ulong64 *b, ulong64 *c, ulong64 *x, int mul) { - tiger_round(a,b,c,x[0],mul); - tiger_round(b,c,a,x[1],mul); - tiger_round(c,a,b,x[2],mul); - tiger_round(a,b,c,x[3],mul); - tiger_round(b,c,a,x[4],mul); - tiger_round(c,a,b,x[5],mul); - tiger_round(a,b,c,x[6],mul); - tiger_round(b,c,a,x[7],mul); -} + tiger_round(a,b,c,x[0],mul); + tiger_round(b,c,a,x[1],mul); + tiger_round(c,a,b,x[2],mul); + tiger_round(a,b,c,x[3],mul); + tiger_round(b,c,a,x[4],mul); + tiger_round(c,a,b,x[5],mul); + tiger_round(a,b,c,x[6],mul); + tiger_round(b,c,a,x[7],mul); +} /* The key mixing schedule */ -static void key_schedule(ulong64 *x) +static void key_schedule(ulong64 *x) { - x[0] -= x[7] ^ CONST64(0xA5A5A5A5A5A5A5A5); - x[1] ^= x[0]; - x[2] += x[1]; - x[3] -= x[2] ^ ((~x[1])<<19); - x[4] ^= x[3]; - x[5] += x[4]; - x[6] -= x[5] ^ ((~x[4])>>23); - x[7] ^= x[6]; - x[0] += x[7]; - x[1] -= x[0] ^ ((~x[7])<<19); - x[2] ^= x[1]; - x[3] += x[2]; - x[4] -= x[3] ^ ((~x[2])>>23); - x[5] ^= x[4]; - x[6] += x[5]; + x[0] -= x[7] ^ CONST64(0xA5A5A5A5A5A5A5A5); + x[1] ^= x[0]; + x[2] += x[1]; + x[3] -= x[2] ^ ((~x[1])<<19); + x[4] ^= x[3]; + x[5] += x[4]; + x[6] -= x[5] ^ ((~x[4])>>23); + x[7] ^= x[6]; + x[0] += x[7]; + x[1] -= x[0] ^ ((~x[7])<<19); + x[2] ^= x[1]; + x[3] += x[2]; + x[4] -= x[3] ^ ((~x[2])>>23); + x[5] ^= x[4]; + x[6] += x[5]; x[7] -= x[6] ^ CONST64(0x0123456789ABCDEF); -} +} #ifdef LTC_CLEAN_STACK static int _tiger_compress(hash_state *md, unsigned char *buf) @@ -709,7 +707,7 @@ int tiger_done(hash_state * md, unsigned char *out) /* pad upto 56 bytes of zeroes */ while (md->tiger.curlen < 56) { - md->tiger.buf[md->tiger.curlen++] = (unsigned char)0; + md->tiger.buf[md->tiger.curlen++] = (unsigned char)0; } /* store length */ @@ -730,14 +728,14 @@ int tiger_done(hash_state * md, unsigned char *out) /** Self-test the hash @return CRYPT_OK if successful, CRYPT_NOP if self-tests have been disabled -*/ +*/ int tiger_test(void) { #ifndef LTC_TEST return CRYPT_NOP; - #else + #else static const struct { - char *msg; + const char *msg; unsigned char hash[24]; } tests[] = { { "", @@ -775,7 +773,7 @@ int tiger_test(void) tiger_init(&md); tiger_process(&md, (unsigned char *)tests[i].msg, (unsigned long)strlen(tests[i].msg)); tiger_done(&md, tmp); - if (XMEMCMP(tmp, tests[i].hash, 24) != 0) { + if (compare_testvector(tmp, sizeof(tmp), tests[i].hash, sizeof(tests[i].hash), "TIGER", i)) { return CRYPT_FAIL_TESTVECTOR; } } @@ -809,6 +807,6 @@ Hash of "ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+-ABCDEFG -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/hashes/whirl/whirl.c b/libtomcrypt/src/hashes/whirl/whirl.c index 102d6f1..fe152cd 100644 --- a/libtomcrypt/src/hashes/whirl/whirl.c +++ b/libtomcrypt/src/hashes/whirl/whirl.c @@ -5,13 +5,11 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ -/** +/** @file whirl.c - LTC_WHIRLPOOL (using their new sbox) hash function by Tom St Denis + LTC_WHIRLPOOL (using their new sbox) hash function by Tom St Denis */ #include "tomcrypt.h" @@ -37,6 +35,7 @@ const struct ltc_hash_descriptor whirlpool_desc = }; /* the sboxes */ +#define __LTC_WHIRLTAB_C__ #include "whirltab.c" /* get a_{i,j} */ @@ -44,14 +43,14 @@ const struct ltc_hash_descriptor whirlpool_desc = /* shortcut macro to perform three functions at once */ #define theta_pi_gamma(a, i) \ - SB0(GB(a, i-0, 7)) ^ \ + (SB0(GB(a, i-0, 7)) ^ \ SB1(GB(a, i-1, 6)) ^ \ SB2(GB(a, i-2, 5)) ^ \ SB3(GB(a, i-3, 4)) ^ \ SB4(GB(a, i-4, 3)) ^ \ SB5(GB(a, i-5, 2)) ^ \ SB6(GB(a, i-6, 1)) ^ \ - SB7(GB(a, i-7, 0)) + SB7(GB(a, i-7, 0))) #ifdef LTC_CLEAN_STACK static int _whirlpool_compress(hash_state *md, unsigned char *buf) @@ -61,7 +60,7 @@ static int whirlpool_compress(hash_state *md, unsigned char *buf) { ulong64 K[2][8], T[3][8]; int x, y; - + /* load the block/state */ for (x = 0; x < 8; x++) { K[0][x] = md->whirlpool.state[x]; @@ -70,7 +69,7 @@ static int whirlpool_compress(hash_state *md, unsigned char *buf) T[2][x] = T[0][x]; T[0][x] ^= K[0][x]; } - + /* do rounds 1..10 */ for (x = 0; x < 10; x += 2) { /* odd round */ @@ -80,7 +79,7 @@ static int whirlpool_compress(hash_state *md, unsigned char *buf) } /* xor the constant */ K[1][0] ^= cont[x]; - + /* apply main transform to T[0] into T[1] */ for (y = 0; y < 8; y++) { T[1][y] = theta_pi_gamma(T[0], y) ^ K[1][y]; @@ -93,13 +92,13 @@ static int whirlpool_compress(hash_state *md, unsigned char *buf) } /* xor the constant */ K[0][0] ^= cont[x+1]; - + /* apply main transform to T[1] into T[0] */ for (y = 0; y < 8; y++) { T[0][y] = theta_pi_gamma(T[1], y) ^ K[0][y]; } } - + /* store state */ for (x = 0; x < 8; x++) { md->whirlpool.state[x] ^= T[0][x] ^ T[2][x]; @@ -198,20 +197,20 @@ int whirlpool_done(hash_state * md, unsigned char *out) /** Self-test the hash @return CRYPT_OK if successful, CRYPT_NOP if self-tests have been disabled -*/ +*/ int whirlpool_test(void) { #ifndef LTC_TEST return CRYPT_NOP; - #else + #else static const struct { int len; unsigned char msg[128], hash[64]; } tests[] = { - + /* NULL Message */ { - 0, + 0, { 0x00 }, { 0x19, 0xFA, 0x61, 0xD7, 0x55, 0x22, 0xA4, 0x66, 0x9B, 0x44, 0xE3, 0x9C, 0x1D, 0x2E, 0x17, 0x26, 0xC5, 0x30, 0x23, 0x21, 0x30, 0xD4, 0x07, 0xF8, 0x9A, 0xFE, 0xE0, 0x96, 0x49, 0x97, 0xF7, 0xA7, @@ -279,7 +278,7 @@ int whirlpool_test(void) 0x06, 0xDB, 0x4F, 0xF7, 0x08, 0xA3, 0xA2, 0x8B, 0xC3, 0x7A, 0x92, 0x1E, 0xEE, 0x11, 0xED, 0x7B, 0x6A, 0x53, 0x79, 0x32, 0xCC, 0x5E, 0x94, 0xEE, 0x1E, 0xA6, 0x57, 0x60, 0x7E, 0x36, 0xC9, 0xF7 } }, - + }; int i; @@ -290,14 +289,7 @@ int whirlpool_test(void) whirlpool_init(&md); whirlpool_process(&md, (unsigned char *)tests[i].msg, tests[i].len); whirlpool_done(&md, tmp); - if (XMEMCMP(tmp, tests[i].hash, 64) != 0) { -#if 0 - printf("\nFailed test %d\n", i); - for (i = 0; i < 64; ) { - printf("%02x ", tmp[i]); - if (!(++i & 15)) printf("\n"); - } -#endif + if (compare_testvector(tmp, sizeof(tmp), tests[i].hash, sizeof(tests[i].hash), "WHIRLPOOL", i)) { return CRYPT_FAIL_TESTVECTOR; } } @@ -309,6 +301,6 @@ int whirlpool_test(void) #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/hashes/whirl/whirltab.c b/libtomcrypt/src/hashes/whirl/whirltab.c index 85ba312..4fde89b 100644 --- a/libtomcrypt/src/hashes/whirl/whirltab.c +++ b/libtomcrypt/src/hashes/whirl/whirltab.c @@ -1,71 +1,83 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + */ + /** @file whirltab.c LTC_WHIRLPOOL tables, Tom St Denis -*/ +*/ + +#ifdef __LTC_WHIRLTAB_C__ + static const ulong64 sbox0[] = { -CONST64(0x18186018c07830d8), CONST64(0x23238c2305af4626), CONST64(0xc6c63fc67ef991b8), CONST64(0xe8e887e8136fcdfb), -CONST64(0x878726874ca113cb), CONST64(0xb8b8dab8a9626d11), CONST64(0x0101040108050209), CONST64(0x4f4f214f426e9e0d), -CONST64(0x3636d836adee6c9b), CONST64(0xa6a6a2a6590451ff), CONST64(0xd2d26fd2debdb90c), CONST64(0xf5f5f3f5fb06f70e), -CONST64(0x7979f979ef80f296), CONST64(0x6f6fa16f5fcede30), CONST64(0x91917e91fcef3f6d), CONST64(0x52525552aa07a4f8), -CONST64(0x60609d6027fdc047), CONST64(0xbcbccabc89766535), CONST64(0x9b9b569baccd2b37), CONST64(0x8e8e028e048c018a), -CONST64(0xa3a3b6a371155bd2), CONST64(0x0c0c300c603c186c), CONST64(0x7b7bf17bff8af684), CONST64(0x3535d435b5e16a80), -CONST64(0x1d1d741de8693af5), CONST64(0xe0e0a7e05347ddb3), CONST64(0xd7d77bd7f6acb321), CONST64(0xc2c22fc25eed999c), -CONST64(0x2e2eb82e6d965c43), CONST64(0x4b4b314b627a9629), CONST64(0xfefedffea321e15d), CONST64(0x575741578216aed5), -CONST64(0x15155415a8412abd), CONST64(0x7777c1779fb6eee8), CONST64(0x3737dc37a5eb6e92), CONST64(0xe5e5b3e57b56d79e), -CONST64(0x9f9f469f8cd92313), CONST64(0xf0f0e7f0d317fd23), CONST64(0x4a4a354a6a7f9420), CONST64(0xdada4fda9e95a944), -CONST64(0x58587d58fa25b0a2), CONST64(0xc9c903c906ca8fcf), CONST64(0x2929a429558d527c), CONST64(0x0a0a280a5022145a), -CONST64(0xb1b1feb1e14f7f50), CONST64(0xa0a0baa0691a5dc9), CONST64(0x6b6bb16b7fdad614), CONST64(0x85852e855cab17d9), -CONST64(0xbdbdcebd8173673c), CONST64(0x5d5d695dd234ba8f), CONST64(0x1010401080502090), CONST64(0xf4f4f7f4f303f507), -CONST64(0xcbcb0bcb16c08bdd), CONST64(0x3e3ef83eedc67cd3), CONST64(0x0505140528110a2d), CONST64(0x676781671fe6ce78), -CONST64(0xe4e4b7e47353d597), CONST64(0x27279c2725bb4e02), CONST64(0x4141194132588273), CONST64(0x8b8b168b2c9d0ba7), -CONST64(0xa7a7a6a7510153f6), CONST64(0x7d7de97dcf94fab2), CONST64(0x95956e95dcfb3749), CONST64(0xd8d847d88e9fad56), -CONST64(0xfbfbcbfb8b30eb70), CONST64(0xeeee9fee2371c1cd), CONST64(0x7c7ced7cc791f8bb), CONST64(0x6666856617e3cc71), -CONST64(0xdddd53dda68ea77b), CONST64(0x17175c17b84b2eaf), CONST64(0x4747014702468e45), CONST64(0x9e9e429e84dc211a), -CONST64(0xcaca0fca1ec589d4), CONST64(0x2d2db42d75995a58), CONST64(0xbfbfc6bf9179632e), CONST64(0x07071c07381b0e3f), -CONST64(0xadad8ead012347ac), CONST64(0x5a5a755aea2fb4b0), CONST64(0x838336836cb51bef), CONST64(0x3333cc3385ff66b6), -CONST64(0x636391633ff2c65c), CONST64(0x02020802100a0412), CONST64(0xaaaa92aa39384993), CONST64(0x7171d971afa8e2de), -CONST64(0xc8c807c80ecf8dc6), CONST64(0x19196419c87d32d1), CONST64(0x494939497270923b), CONST64(0xd9d943d9869aaf5f), -CONST64(0xf2f2eff2c31df931), CONST64(0xe3e3abe34b48dba8), CONST64(0x5b5b715be22ab6b9), CONST64(0x88881a8834920dbc), -CONST64(0x9a9a529aa4c8293e), CONST64(0x262698262dbe4c0b), CONST64(0x3232c8328dfa64bf), CONST64(0xb0b0fab0e94a7d59), -CONST64(0xe9e983e91b6acff2), CONST64(0x0f0f3c0f78331e77), CONST64(0xd5d573d5e6a6b733), CONST64(0x80803a8074ba1df4), -CONST64(0xbebec2be997c6127), CONST64(0xcdcd13cd26de87eb), CONST64(0x3434d034bde46889), CONST64(0x48483d487a759032), -CONST64(0xffffdbffab24e354), CONST64(0x7a7af57af78ff48d), CONST64(0x90907a90f4ea3d64), CONST64(0x5f5f615fc23ebe9d), -CONST64(0x202080201da0403d), CONST64(0x6868bd6867d5d00f), CONST64(0x1a1a681ad07234ca), CONST64(0xaeae82ae192c41b7), -CONST64(0xb4b4eab4c95e757d), CONST64(0x54544d549a19a8ce), CONST64(0x93937693ece53b7f), CONST64(0x222288220daa442f), -CONST64(0x64648d6407e9c863), CONST64(0xf1f1e3f1db12ff2a), CONST64(0x7373d173bfa2e6cc), CONST64(0x12124812905a2482), -CONST64(0x40401d403a5d807a), CONST64(0x0808200840281048), CONST64(0xc3c32bc356e89b95), CONST64(0xecec97ec337bc5df), -CONST64(0xdbdb4bdb9690ab4d), CONST64(0xa1a1bea1611f5fc0), CONST64(0x8d8d0e8d1c830791), CONST64(0x3d3df43df5c97ac8), -CONST64(0x97976697ccf1335b), CONST64(0x0000000000000000), CONST64(0xcfcf1bcf36d483f9), CONST64(0x2b2bac2b4587566e), -CONST64(0x7676c57697b3ece1), CONST64(0x8282328264b019e6), CONST64(0xd6d67fd6fea9b128), CONST64(0x1b1b6c1bd87736c3), -CONST64(0xb5b5eeb5c15b7774), CONST64(0xafaf86af112943be), CONST64(0x6a6ab56a77dfd41d), CONST64(0x50505d50ba0da0ea), -CONST64(0x45450945124c8a57), CONST64(0xf3f3ebf3cb18fb38), CONST64(0x3030c0309df060ad), CONST64(0xefef9bef2b74c3c4), -CONST64(0x3f3ffc3fe5c37eda), CONST64(0x55554955921caac7), CONST64(0xa2a2b2a2791059db), CONST64(0xeaea8fea0365c9e9), -CONST64(0x656589650fecca6a), CONST64(0xbabad2bab9686903), CONST64(0x2f2fbc2f65935e4a), CONST64(0xc0c027c04ee79d8e), -CONST64(0xdede5fdebe81a160), CONST64(0x1c1c701ce06c38fc), CONST64(0xfdfdd3fdbb2ee746), CONST64(0x4d4d294d52649a1f), -CONST64(0x92927292e4e03976), CONST64(0x7575c9758fbceafa), CONST64(0x06061806301e0c36), CONST64(0x8a8a128a249809ae), -CONST64(0xb2b2f2b2f940794b), CONST64(0xe6e6bfe66359d185), CONST64(0x0e0e380e70361c7e), CONST64(0x1f1f7c1ff8633ee7), -CONST64(0x6262956237f7c455), CONST64(0xd4d477d4eea3b53a), CONST64(0xa8a89aa829324d81), CONST64(0x96966296c4f43152), -CONST64(0xf9f9c3f99b3aef62), CONST64(0xc5c533c566f697a3), CONST64(0x2525942535b14a10), CONST64(0x59597959f220b2ab), -CONST64(0x84842a8454ae15d0), CONST64(0x7272d572b7a7e4c5), CONST64(0x3939e439d5dd72ec), CONST64(0x4c4c2d4c5a619816), -CONST64(0x5e5e655eca3bbc94), CONST64(0x7878fd78e785f09f), CONST64(0x3838e038ddd870e5), CONST64(0x8c8c0a8c14860598), -CONST64(0xd1d163d1c6b2bf17), CONST64(0xa5a5aea5410b57e4), CONST64(0xe2e2afe2434dd9a1), CONST64(0x616199612ff8c24e), -CONST64(0xb3b3f6b3f1457b42), CONST64(0x2121842115a54234), CONST64(0x9c9c4a9c94d62508), CONST64(0x1e1e781ef0663cee), -CONST64(0x4343114322528661), CONST64(0xc7c73bc776fc93b1), CONST64(0xfcfcd7fcb32be54f), CONST64(0x0404100420140824), -CONST64(0x51515951b208a2e3), CONST64(0x99995e99bcc72f25), CONST64(0x6d6da96d4fc4da22), CONST64(0x0d0d340d68391a65), -CONST64(0xfafacffa8335e979), CONST64(0xdfdf5bdfb684a369), CONST64(0x7e7ee57ed79bfca9), CONST64(0x242490243db44819), -CONST64(0x3b3bec3bc5d776fe), CONST64(0xabab96ab313d4b9a), CONST64(0xcece1fce3ed181f0), CONST64(0x1111441188552299), -CONST64(0x8f8f068f0c890383), CONST64(0x4e4e254e4a6b9c04), CONST64(0xb7b7e6b7d1517366), CONST64(0xebeb8beb0b60cbe0), -CONST64(0x3c3cf03cfdcc78c1), CONST64(0x81813e817cbf1ffd), CONST64(0x94946a94d4fe3540), CONST64(0xf7f7fbf7eb0cf31c), -CONST64(0xb9b9deb9a1676f18), CONST64(0x13134c13985f268b), CONST64(0x2c2cb02c7d9c5851), CONST64(0xd3d36bd3d6b8bb05), -CONST64(0xe7e7bbe76b5cd38c), CONST64(0x6e6ea56e57cbdc39), CONST64(0xc4c437c46ef395aa), CONST64(0x03030c03180f061b), -CONST64(0x565645568a13acdc), CONST64(0x44440d441a49885e), CONST64(0x7f7fe17fdf9efea0), CONST64(0xa9a99ea921374f88), -CONST64(0x2a2aa82a4d825467), CONST64(0xbbbbd6bbb16d6b0a), CONST64(0xc1c123c146e29f87), CONST64(0x53535153a202a6f1), -CONST64(0xdcdc57dcae8ba572), CONST64(0x0b0b2c0b58271653), CONST64(0x9d9d4e9d9cd32701), CONST64(0x6c6cad6c47c1d82b), -CONST64(0x3131c43195f562a4), CONST64(0x7474cd7487b9e8f3), CONST64(0xf6f6fff6e309f115), CONST64(0x464605460a438c4c), -CONST64(0xacac8aac092645a5), CONST64(0x89891e893c970fb5), CONST64(0x14145014a04428b4), CONST64(0xe1e1a3e15b42dfba), -CONST64(0x16165816b04e2ca6), CONST64(0x3a3ae83acdd274f7), CONST64(0x6969b9696fd0d206), CONST64(0x09092409482d1241), -CONST64(0x7070dd70a7ade0d7), CONST64(0xb6b6e2b6d954716f), CONST64(0xd0d067d0ceb7bd1e), CONST64(0xeded93ed3b7ec7d6), -CONST64(0xcccc17cc2edb85e2), CONST64(0x424215422a578468), CONST64(0x98985a98b4c22d2c), CONST64(0xa4a4aaa4490e55ed), +CONST64(0x18186018c07830d8), CONST64(0x23238c2305af4626), CONST64(0xc6c63fc67ef991b8), CONST64(0xe8e887e8136fcdfb), +CONST64(0x878726874ca113cb), CONST64(0xb8b8dab8a9626d11), CONST64(0x0101040108050209), CONST64(0x4f4f214f426e9e0d), +CONST64(0x3636d836adee6c9b), CONST64(0xa6a6a2a6590451ff), CONST64(0xd2d26fd2debdb90c), CONST64(0xf5f5f3f5fb06f70e), +CONST64(0x7979f979ef80f296), CONST64(0x6f6fa16f5fcede30), CONST64(0x91917e91fcef3f6d), CONST64(0x52525552aa07a4f8), +CONST64(0x60609d6027fdc047), CONST64(0xbcbccabc89766535), CONST64(0x9b9b569baccd2b37), CONST64(0x8e8e028e048c018a), +CONST64(0xa3a3b6a371155bd2), CONST64(0x0c0c300c603c186c), CONST64(0x7b7bf17bff8af684), CONST64(0x3535d435b5e16a80), +CONST64(0x1d1d741de8693af5), CONST64(0xe0e0a7e05347ddb3), CONST64(0xd7d77bd7f6acb321), CONST64(0xc2c22fc25eed999c), +CONST64(0x2e2eb82e6d965c43), CONST64(0x4b4b314b627a9629), CONST64(0xfefedffea321e15d), CONST64(0x575741578216aed5), +CONST64(0x15155415a8412abd), CONST64(0x7777c1779fb6eee8), CONST64(0x3737dc37a5eb6e92), CONST64(0xe5e5b3e57b56d79e), +CONST64(0x9f9f469f8cd92313), CONST64(0xf0f0e7f0d317fd23), CONST64(0x4a4a354a6a7f9420), CONST64(0xdada4fda9e95a944), +CONST64(0x58587d58fa25b0a2), CONST64(0xc9c903c906ca8fcf), CONST64(0x2929a429558d527c), CONST64(0x0a0a280a5022145a), +CONST64(0xb1b1feb1e14f7f50), CONST64(0xa0a0baa0691a5dc9), CONST64(0x6b6bb16b7fdad614), CONST64(0x85852e855cab17d9), +CONST64(0xbdbdcebd8173673c), CONST64(0x5d5d695dd234ba8f), CONST64(0x1010401080502090), CONST64(0xf4f4f7f4f303f507), +CONST64(0xcbcb0bcb16c08bdd), CONST64(0x3e3ef83eedc67cd3), CONST64(0x0505140528110a2d), CONST64(0x676781671fe6ce78), +CONST64(0xe4e4b7e47353d597), CONST64(0x27279c2725bb4e02), CONST64(0x4141194132588273), CONST64(0x8b8b168b2c9d0ba7), +CONST64(0xa7a7a6a7510153f6), CONST64(0x7d7de97dcf94fab2), CONST64(0x95956e95dcfb3749), CONST64(0xd8d847d88e9fad56), +CONST64(0xfbfbcbfb8b30eb70), CONST64(0xeeee9fee2371c1cd), CONST64(0x7c7ced7cc791f8bb), CONST64(0x6666856617e3cc71), +CONST64(0xdddd53dda68ea77b), CONST64(0x17175c17b84b2eaf), CONST64(0x4747014702468e45), CONST64(0x9e9e429e84dc211a), +CONST64(0xcaca0fca1ec589d4), CONST64(0x2d2db42d75995a58), CONST64(0xbfbfc6bf9179632e), CONST64(0x07071c07381b0e3f), +CONST64(0xadad8ead012347ac), CONST64(0x5a5a755aea2fb4b0), CONST64(0x838336836cb51bef), CONST64(0x3333cc3385ff66b6), +CONST64(0x636391633ff2c65c), CONST64(0x02020802100a0412), CONST64(0xaaaa92aa39384993), CONST64(0x7171d971afa8e2de), +CONST64(0xc8c807c80ecf8dc6), CONST64(0x19196419c87d32d1), CONST64(0x494939497270923b), CONST64(0xd9d943d9869aaf5f), +CONST64(0xf2f2eff2c31df931), CONST64(0xe3e3abe34b48dba8), CONST64(0x5b5b715be22ab6b9), CONST64(0x88881a8834920dbc), +CONST64(0x9a9a529aa4c8293e), CONST64(0x262698262dbe4c0b), CONST64(0x3232c8328dfa64bf), CONST64(0xb0b0fab0e94a7d59), +CONST64(0xe9e983e91b6acff2), CONST64(0x0f0f3c0f78331e77), CONST64(0xd5d573d5e6a6b733), CONST64(0x80803a8074ba1df4), +CONST64(0xbebec2be997c6127), CONST64(0xcdcd13cd26de87eb), CONST64(0x3434d034bde46889), CONST64(0x48483d487a759032), +CONST64(0xffffdbffab24e354), CONST64(0x7a7af57af78ff48d), CONST64(0x90907a90f4ea3d64), CONST64(0x5f5f615fc23ebe9d), +CONST64(0x202080201da0403d), CONST64(0x6868bd6867d5d00f), CONST64(0x1a1a681ad07234ca), CONST64(0xaeae82ae192c41b7), +CONST64(0xb4b4eab4c95e757d), CONST64(0x54544d549a19a8ce), CONST64(0x93937693ece53b7f), CONST64(0x222288220daa442f), +CONST64(0x64648d6407e9c863), CONST64(0xf1f1e3f1db12ff2a), CONST64(0x7373d173bfa2e6cc), CONST64(0x12124812905a2482), +CONST64(0x40401d403a5d807a), CONST64(0x0808200840281048), CONST64(0xc3c32bc356e89b95), CONST64(0xecec97ec337bc5df), +CONST64(0xdbdb4bdb9690ab4d), CONST64(0xa1a1bea1611f5fc0), CONST64(0x8d8d0e8d1c830791), CONST64(0x3d3df43df5c97ac8), +CONST64(0x97976697ccf1335b), CONST64(0x0000000000000000), CONST64(0xcfcf1bcf36d483f9), CONST64(0x2b2bac2b4587566e), +CONST64(0x7676c57697b3ece1), CONST64(0x8282328264b019e6), CONST64(0xd6d67fd6fea9b128), CONST64(0x1b1b6c1bd87736c3), +CONST64(0xb5b5eeb5c15b7774), CONST64(0xafaf86af112943be), CONST64(0x6a6ab56a77dfd41d), CONST64(0x50505d50ba0da0ea), +CONST64(0x45450945124c8a57), CONST64(0xf3f3ebf3cb18fb38), CONST64(0x3030c0309df060ad), CONST64(0xefef9bef2b74c3c4), +CONST64(0x3f3ffc3fe5c37eda), CONST64(0x55554955921caac7), CONST64(0xa2a2b2a2791059db), CONST64(0xeaea8fea0365c9e9), +CONST64(0x656589650fecca6a), CONST64(0xbabad2bab9686903), CONST64(0x2f2fbc2f65935e4a), CONST64(0xc0c027c04ee79d8e), +CONST64(0xdede5fdebe81a160), CONST64(0x1c1c701ce06c38fc), CONST64(0xfdfdd3fdbb2ee746), CONST64(0x4d4d294d52649a1f), +CONST64(0x92927292e4e03976), CONST64(0x7575c9758fbceafa), CONST64(0x06061806301e0c36), CONST64(0x8a8a128a249809ae), +CONST64(0xb2b2f2b2f940794b), CONST64(0xe6e6bfe66359d185), CONST64(0x0e0e380e70361c7e), CONST64(0x1f1f7c1ff8633ee7), +CONST64(0x6262956237f7c455), CONST64(0xd4d477d4eea3b53a), CONST64(0xa8a89aa829324d81), CONST64(0x96966296c4f43152), +CONST64(0xf9f9c3f99b3aef62), CONST64(0xc5c533c566f697a3), CONST64(0x2525942535b14a10), CONST64(0x59597959f220b2ab), +CONST64(0x84842a8454ae15d0), CONST64(0x7272d572b7a7e4c5), CONST64(0x3939e439d5dd72ec), CONST64(0x4c4c2d4c5a619816), +CONST64(0x5e5e655eca3bbc94), CONST64(0x7878fd78e785f09f), CONST64(0x3838e038ddd870e5), CONST64(0x8c8c0a8c14860598), +CONST64(0xd1d163d1c6b2bf17), CONST64(0xa5a5aea5410b57e4), CONST64(0xe2e2afe2434dd9a1), CONST64(0x616199612ff8c24e), +CONST64(0xb3b3f6b3f1457b42), CONST64(0x2121842115a54234), CONST64(0x9c9c4a9c94d62508), CONST64(0x1e1e781ef0663cee), +CONST64(0x4343114322528661), CONST64(0xc7c73bc776fc93b1), CONST64(0xfcfcd7fcb32be54f), CONST64(0x0404100420140824), +CONST64(0x51515951b208a2e3), CONST64(0x99995e99bcc72f25), CONST64(0x6d6da96d4fc4da22), CONST64(0x0d0d340d68391a65), +CONST64(0xfafacffa8335e979), CONST64(0xdfdf5bdfb684a369), CONST64(0x7e7ee57ed79bfca9), CONST64(0x242490243db44819), +CONST64(0x3b3bec3bc5d776fe), CONST64(0xabab96ab313d4b9a), CONST64(0xcece1fce3ed181f0), CONST64(0x1111441188552299), +CONST64(0x8f8f068f0c890383), CONST64(0x4e4e254e4a6b9c04), CONST64(0xb7b7e6b7d1517366), CONST64(0xebeb8beb0b60cbe0), +CONST64(0x3c3cf03cfdcc78c1), CONST64(0x81813e817cbf1ffd), CONST64(0x94946a94d4fe3540), CONST64(0xf7f7fbf7eb0cf31c), +CONST64(0xb9b9deb9a1676f18), CONST64(0x13134c13985f268b), CONST64(0x2c2cb02c7d9c5851), CONST64(0xd3d36bd3d6b8bb05), +CONST64(0xe7e7bbe76b5cd38c), CONST64(0x6e6ea56e57cbdc39), CONST64(0xc4c437c46ef395aa), CONST64(0x03030c03180f061b), +CONST64(0x565645568a13acdc), CONST64(0x44440d441a49885e), CONST64(0x7f7fe17fdf9efea0), CONST64(0xa9a99ea921374f88), +CONST64(0x2a2aa82a4d825467), CONST64(0xbbbbd6bbb16d6b0a), CONST64(0xc1c123c146e29f87), CONST64(0x53535153a202a6f1), +CONST64(0xdcdc57dcae8ba572), CONST64(0x0b0b2c0b58271653), CONST64(0x9d9d4e9d9cd32701), CONST64(0x6c6cad6c47c1d82b), +CONST64(0x3131c43195f562a4), CONST64(0x7474cd7487b9e8f3), CONST64(0xf6f6fff6e309f115), CONST64(0x464605460a438c4c), +CONST64(0xacac8aac092645a5), CONST64(0x89891e893c970fb5), CONST64(0x14145014a04428b4), CONST64(0xe1e1a3e15b42dfba), +CONST64(0x16165816b04e2ca6), CONST64(0x3a3ae83acdd274f7), CONST64(0x6969b9696fd0d206), CONST64(0x09092409482d1241), +CONST64(0x7070dd70a7ade0d7), CONST64(0xb6b6e2b6d954716f), CONST64(0xd0d067d0ceb7bd1e), CONST64(0xeded93ed3b7ec7d6), +CONST64(0xcccc17cc2edb85e2), CONST64(0x424215422a578468), CONST64(0x98985a98b4c22d2c), CONST64(0xa4a4aaa4490e55ed), CONST64(0x2828a0285d885075), CONST64(0x5c5c6d5cda31b886), CONST64(0xf8f8c7f8933fed6b), CONST64(0x8686228644a411c2) }; @@ -93,471 +105,471 @@ CONST64(0x2828a0285d885075), CONST64(0x5c5c6d5cda31b886), CONST64(0xf8f8c7f8933f static const ulong64 sbox1[] = { -CONST64(0xd818186018c07830), CONST64(0x2623238c2305af46), CONST64(0xb8c6c63fc67ef991), CONST64(0xfbe8e887e8136fcd), -CONST64(0xcb878726874ca113), CONST64(0x11b8b8dab8a9626d), CONST64(0x0901010401080502), CONST64(0x0d4f4f214f426e9e), -CONST64(0x9b3636d836adee6c), CONST64(0xffa6a6a2a6590451), CONST64(0x0cd2d26fd2debdb9), CONST64(0x0ef5f5f3f5fb06f7), -CONST64(0x967979f979ef80f2), CONST64(0x306f6fa16f5fcede), CONST64(0x6d91917e91fcef3f), CONST64(0xf852525552aa07a4), -CONST64(0x4760609d6027fdc0), CONST64(0x35bcbccabc897665), CONST64(0x379b9b569baccd2b), CONST64(0x8a8e8e028e048c01), -CONST64(0xd2a3a3b6a371155b), CONST64(0x6c0c0c300c603c18), CONST64(0x847b7bf17bff8af6), CONST64(0x803535d435b5e16a), -CONST64(0xf51d1d741de8693a), CONST64(0xb3e0e0a7e05347dd), CONST64(0x21d7d77bd7f6acb3), CONST64(0x9cc2c22fc25eed99), -CONST64(0x432e2eb82e6d965c), CONST64(0x294b4b314b627a96), CONST64(0x5dfefedffea321e1), CONST64(0xd5575741578216ae), -CONST64(0xbd15155415a8412a), CONST64(0xe87777c1779fb6ee), CONST64(0x923737dc37a5eb6e), CONST64(0x9ee5e5b3e57b56d7), -CONST64(0x139f9f469f8cd923), CONST64(0x23f0f0e7f0d317fd), CONST64(0x204a4a354a6a7f94), CONST64(0x44dada4fda9e95a9), -CONST64(0xa258587d58fa25b0), CONST64(0xcfc9c903c906ca8f), CONST64(0x7c2929a429558d52), CONST64(0x5a0a0a280a502214), -CONST64(0x50b1b1feb1e14f7f), CONST64(0xc9a0a0baa0691a5d), CONST64(0x146b6bb16b7fdad6), CONST64(0xd985852e855cab17), -CONST64(0x3cbdbdcebd817367), CONST64(0x8f5d5d695dd234ba), CONST64(0x9010104010805020), CONST64(0x07f4f4f7f4f303f5), -CONST64(0xddcbcb0bcb16c08b), CONST64(0xd33e3ef83eedc67c), CONST64(0x2d0505140528110a), CONST64(0x78676781671fe6ce), -CONST64(0x97e4e4b7e47353d5), CONST64(0x0227279c2725bb4e), CONST64(0x7341411941325882), CONST64(0xa78b8b168b2c9d0b), -CONST64(0xf6a7a7a6a7510153), CONST64(0xb27d7de97dcf94fa), CONST64(0x4995956e95dcfb37), CONST64(0x56d8d847d88e9fad), -CONST64(0x70fbfbcbfb8b30eb), CONST64(0xcdeeee9fee2371c1), CONST64(0xbb7c7ced7cc791f8), CONST64(0x716666856617e3cc), -CONST64(0x7bdddd53dda68ea7), CONST64(0xaf17175c17b84b2e), CONST64(0x454747014702468e), CONST64(0x1a9e9e429e84dc21), -CONST64(0xd4caca0fca1ec589), CONST64(0x582d2db42d75995a), CONST64(0x2ebfbfc6bf917963), CONST64(0x3f07071c07381b0e), -CONST64(0xacadad8ead012347), CONST64(0xb05a5a755aea2fb4), CONST64(0xef838336836cb51b), CONST64(0xb63333cc3385ff66), -CONST64(0x5c636391633ff2c6), CONST64(0x1202020802100a04), CONST64(0x93aaaa92aa393849), CONST64(0xde7171d971afa8e2), -CONST64(0xc6c8c807c80ecf8d), CONST64(0xd119196419c87d32), CONST64(0x3b49493949727092), CONST64(0x5fd9d943d9869aaf), -CONST64(0x31f2f2eff2c31df9), CONST64(0xa8e3e3abe34b48db), CONST64(0xb95b5b715be22ab6), CONST64(0xbc88881a8834920d), -CONST64(0x3e9a9a529aa4c829), CONST64(0x0b262698262dbe4c), CONST64(0xbf3232c8328dfa64), CONST64(0x59b0b0fab0e94a7d), -CONST64(0xf2e9e983e91b6acf), CONST64(0x770f0f3c0f78331e), CONST64(0x33d5d573d5e6a6b7), CONST64(0xf480803a8074ba1d), -CONST64(0x27bebec2be997c61), CONST64(0xebcdcd13cd26de87), CONST64(0x893434d034bde468), CONST64(0x3248483d487a7590), -CONST64(0x54ffffdbffab24e3), CONST64(0x8d7a7af57af78ff4), CONST64(0x6490907a90f4ea3d), CONST64(0x9d5f5f615fc23ebe), -CONST64(0x3d202080201da040), CONST64(0x0f6868bd6867d5d0), CONST64(0xca1a1a681ad07234), CONST64(0xb7aeae82ae192c41), -CONST64(0x7db4b4eab4c95e75), CONST64(0xce54544d549a19a8), CONST64(0x7f93937693ece53b), CONST64(0x2f222288220daa44), -CONST64(0x6364648d6407e9c8), CONST64(0x2af1f1e3f1db12ff), CONST64(0xcc7373d173bfa2e6), CONST64(0x8212124812905a24), -CONST64(0x7a40401d403a5d80), CONST64(0x4808082008402810), CONST64(0x95c3c32bc356e89b), CONST64(0xdfecec97ec337bc5), -CONST64(0x4ddbdb4bdb9690ab), CONST64(0xc0a1a1bea1611f5f), CONST64(0x918d8d0e8d1c8307), CONST64(0xc83d3df43df5c97a), -CONST64(0x5b97976697ccf133), CONST64(0x0000000000000000), CONST64(0xf9cfcf1bcf36d483), CONST64(0x6e2b2bac2b458756), -CONST64(0xe17676c57697b3ec), CONST64(0xe68282328264b019), CONST64(0x28d6d67fd6fea9b1), CONST64(0xc31b1b6c1bd87736), -CONST64(0x74b5b5eeb5c15b77), CONST64(0xbeafaf86af112943), CONST64(0x1d6a6ab56a77dfd4), CONST64(0xea50505d50ba0da0), -CONST64(0x5745450945124c8a), CONST64(0x38f3f3ebf3cb18fb), CONST64(0xad3030c0309df060), CONST64(0xc4efef9bef2b74c3), -CONST64(0xda3f3ffc3fe5c37e), CONST64(0xc755554955921caa), CONST64(0xdba2a2b2a2791059), CONST64(0xe9eaea8fea0365c9), -CONST64(0x6a656589650fecca), CONST64(0x03babad2bab96869), CONST64(0x4a2f2fbc2f65935e), CONST64(0x8ec0c027c04ee79d), -CONST64(0x60dede5fdebe81a1), CONST64(0xfc1c1c701ce06c38), CONST64(0x46fdfdd3fdbb2ee7), CONST64(0x1f4d4d294d52649a), -CONST64(0x7692927292e4e039), CONST64(0xfa7575c9758fbcea), CONST64(0x3606061806301e0c), CONST64(0xae8a8a128a249809), -CONST64(0x4bb2b2f2b2f94079), CONST64(0x85e6e6bfe66359d1), CONST64(0x7e0e0e380e70361c), CONST64(0xe71f1f7c1ff8633e), -CONST64(0x556262956237f7c4), CONST64(0x3ad4d477d4eea3b5), CONST64(0x81a8a89aa829324d), CONST64(0x5296966296c4f431), -CONST64(0x62f9f9c3f99b3aef), CONST64(0xa3c5c533c566f697), CONST64(0x102525942535b14a), CONST64(0xab59597959f220b2), -CONST64(0xd084842a8454ae15), CONST64(0xc57272d572b7a7e4), CONST64(0xec3939e439d5dd72), CONST64(0x164c4c2d4c5a6198), -CONST64(0x945e5e655eca3bbc), CONST64(0x9f7878fd78e785f0), CONST64(0xe53838e038ddd870), CONST64(0x988c8c0a8c148605), -CONST64(0x17d1d163d1c6b2bf), CONST64(0xe4a5a5aea5410b57), CONST64(0xa1e2e2afe2434dd9), CONST64(0x4e616199612ff8c2), -CONST64(0x42b3b3f6b3f1457b), CONST64(0x342121842115a542), CONST64(0x089c9c4a9c94d625), CONST64(0xee1e1e781ef0663c), -CONST64(0x6143431143225286), CONST64(0xb1c7c73bc776fc93), CONST64(0x4ffcfcd7fcb32be5), CONST64(0x2404041004201408), -CONST64(0xe351515951b208a2), CONST64(0x2599995e99bcc72f), CONST64(0x226d6da96d4fc4da), CONST64(0x650d0d340d68391a), -CONST64(0x79fafacffa8335e9), CONST64(0x69dfdf5bdfb684a3), CONST64(0xa97e7ee57ed79bfc), CONST64(0x19242490243db448), -CONST64(0xfe3b3bec3bc5d776), CONST64(0x9aabab96ab313d4b), CONST64(0xf0cece1fce3ed181), CONST64(0x9911114411885522), -CONST64(0x838f8f068f0c8903), CONST64(0x044e4e254e4a6b9c), CONST64(0x66b7b7e6b7d15173), CONST64(0xe0ebeb8beb0b60cb), -CONST64(0xc13c3cf03cfdcc78), CONST64(0xfd81813e817cbf1f), CONST64(0x4094946a94d4fe35), CONST64(0x1cf7f7fbf7eb0cf3), -CONST64(0x18b9b9deb9a1676f), CONST64(0x8b13134c13985f26), CONST64(0x512c2cb02c7d9c58), CONST64(0x05d3d36bd3d6b8bb), -CONST64(0x8ce7e7bbe76b5cd3), CONST64(0x396e6ea56e57cbdc), CONST64(0xaac4c437c46ef395), CONST64(0x1b03030c03180f06), -CONST64(0xdc565645568a13ac), CONST64(0x5e44440d441a4988), CONST64(0xa07f7fe17fdf9efe), CONST64(0x88a9a99ea921374f), -CONST64(0x672a2aa82a4d8254), CONST64(0x0abbbbd6bbb16d6b), CONST64(0x87c1c123c146e29f), CONST64(0xf153535153a202a6), -CONST64(0x72dcdc57dcae8ba5), CONST64(0x530b0b2c0b582716), CONST64(0x019d9d4e9d9cd327), CONST64(0x2b6c6cad6c47c1d8), -CONST64(0xa43131c43195f562), CONST64(0xf37474cd7487b9e8), CONST64(0x15f6f6fff6e309f1), CONST64(0x4c464605460a438c), -CONST64(0xa5acac8aac092645), CONST64(0xb589891e893c970f), CONST64(0xb414145014a04428), CONST64(0xbae1e1a3e15b42df), -CONST64(0xa616165816b04e2c), CONST64(0xf73a3ae83acdd274), CONST64(0x066969b9696fd0d2), CONST64(0x4109092409482d12), -CONST64(0xd77070dd70a7ade0), CONST64(0x6fb6b6e2b6d95471), CONST64(0x1ed0d067d0ceb7bd), CONST64(0xd6eded93ed3b7ec7), -CONST64(0xe2cccc17cc2edb85), CONST64(0x68424215422a5784), CONST64(0x2c98985a98b4c22d), CONST64(0xeda4a4aaa4490e55), +CONST64(0xd818186018c07830), CONST64(0x2623238c2305af46), CONST64(0xb8c6c63fc67ef991), CONST64(0xfbe8e887e8136fcd), +CONST64(0xcb878726874ca113), CONST64(0x11b8b8dab8a9626d), CONST64(0x0901010401080502), CONST64(0x0d4f4f214f426e9e), +CONST64(0x9b3636d836adee6c), CONST64(0xffa6a6a2a6590451), CONST64(0x0cd2d26fd2debdb9), CONST64(0x0ef5f5f3f5fb06f7), +CONST64(0x967979f979ef80f2), CONST64(0x306f6fa16f5fcede), CONST64(0x6d91917e91fcef3f), CONST64(0xf852525552aa07a4), +CONST64(0x4760609d6027fdc0), CONST64(0x35bcbccabc897665), CONST64(0x379b9b569baccd2b), CONST64(0x8a8e8e028e048c01), +CONST64(0xd2a3a3b6a371155b), CONST64(0x6c0c0c300c603c18), CONST64(0x847b7bf17bff8af6), CONST64(0x803535d435b5e16a), +CONST64(0xf51d1d741de8693a), CONST64(0xb3e0e0a7e05347dd), CONST64(0x21d7d77bd7f6acb3), CONST64(0x9cc2c22fc25eed99), +CONST64(0x432e2eb82e6d965c), CONST64(0x294b4b314b627a96), CONST64(0x5dfefedffea321e1), CONST64(0xd5575741578216ae), +CONST64(0xbd15155415a8412a), CONST64(0xe87777c1779fb6ee), CONST64(0x923737dc37a5eb6e), CONST64(0x9ee5e5b3e57b56d7), +CONST64(0x139f9f469f8cd923), CONST64(0x23f0f0e7f0d317fd), CONST64(0x204a4a354a6a7f94), CONST64(0x44dada4fda9e95a9), +CONST64(0xa258587d58fa25b0), CONST64(0xcfc9c903c906ca8f), CONST64(0x7c2929a429558d52), CONST64(0x5a0a0a280a502214), +CONST64(0x50b1b1feb1e14f7f), CONST64(0xc9a0a0baa0691a5d), CONST64(0x146b6bb16b7fdad6), CONST64(0xd985852e855cab17), +CONST64(0x3cbdbdcebd817367), CONST64(0x8f5d5d695dd234ba), CONST64(0x9010104010805020), CONST64(0x07f4f4f7f4f303f5), +CONST64(0xddcbcb0bcb16c08b), CONST64(0xd33e3ef83eedc67c), CONST64(0x2d0505140528110a), CONST64(0x78676781671fe6ce), +CONST64(0x97e4e4b7e47353d5), CONST64(0x0227279c2725bb4e), CONST64(0x7341411941325882), CONST64(0xa78b8b168b2c9d0b), +CONST64(0xf6a7a7a6a7510153), CONST64(0xb27d7de97dcf94fa), CONST64(0x4995956e95dcfb37), CONST64(0x56d8d847d88e9fad), +CONST64(0x70fbfbcbfb8b30eb), CONST64(0xcdeeee9fee2371c1), CONST64(0xbb7c7ced7cc791f8), CONST64(0x716666856617e3cc), +CONST64(0x7bdddd53dda68ea7), CONST64(0xaf17175c17b84b2e), CONST64(0x454747014702468e), CONST64(0x1a9e9e429e84dc21), +CONST64(0xd4caca0fca1ec589), CONST64(0x582d2db42d75995a), CONST64(0x2ebfbfc6bf917963), CONST64(0x3f07071c07381b0e), +CONST64(0xacadad8ead012347), CONST64(0xb05a5a755aea2fb4), CONST64(0xef838336836cb51b), CONST64(0xb63333cc3385ff66), +CONST64(0x5c636391633ff2c6), CONST64(0x1202020802100a04), CONST64(0x93aaaa92aa393849), CONST64(0xde7171d971afa8e2), +CONST64(0xc6c8c807c80ecf8d), CONST64(0xd119196419c87d32), CONST64(0x3b49493949727092), CONST64(0x5fd9d943d9869aaf), +CONST64(0x31f2f2eff2c31df9), CONST64(0xa8e3e3abe34b48db), CONST64(0xb95b5b715be22ab6), CONST64(0xbc88881a8834920d), +CONST64(0x3e9a9a529aa4c829), CONST64(0x0b262698262dbe4c), CONST64(0xbf3232c8328dfa64), CONST64(0x59b0b0fab0e94a7d), +CONST64(0xf2e9e983e91b6acf), CONST64(0x770f0f3c0f78331e), CONST64(0x33d5d573d5e6a6b7), CONST64(0xf480803a8074ba1d), +CONST64(0x27bebec2be997c61), CONST64(0xebcdcd13cd26de87), CONST64(0x893434d034bde468), CONST64(0x3248483d487a7590), +CONST64(0x54ffffdbffab24e3), CONST64(0x8d7a7af57af78ff4), CONST64(0x6490907a90f4ea3d), CONST64(0x9d5f5f615fc23ebe), +CONST64(0x3d202080201da040), CONST64(0x0f6868bd6867d5d0), CONST64(0xca1a1a681ad07234), CONST64(0xb7aeae82ae192c41), +CONST64(0x7db4b4eab4c95e75), CONST64(0xce54544d549a19a8), CONST64(0x7f93937693ece53b), CONST64(0x2f222288220daa44), +CONST64(0x6364648d6407e9c8), CONST64(0x2af1f1e3f1db12ff), CONST64(0xcc7373d173bfa2e6), CONST64(0x8212124812905a24), +CONST64(0x7a40401d403a5d80), CONST64(0x4808082008402810), CONST64(0x95c3c32bc356e89b), CONST64(0xdfecec97ec337bc5), +CONST64(0x4ddbdb4bdb9690ab), CONST64(0xc0a1a1bea1611f5f), CONST64(0x918d8d0e8d1c8307), CONST64(0xc83d3df43df5c97a), +CONST64(0x5b97976697ccf133), CONST64(0x0000000000000000), CONST64(0xf9cfcf1bcf36d483), CONST64(0x6e2b2bac2b458756), +CONST64(0xe17676c57697b3ec), CONST64(0xe68282328264b019), CONST64(0x28d6d67fd6fea9b1), CONST64(0xc31b1b6c1bd87736), +CONST64(0x74b5b5eeb5c15b77), CONST64(0xbeafaf86af112943), CONST64(0x1d6a6ab56a77dfd4), CONST64(0xea50505d50ba0da0), +CONST64(0x5745450945124c8a), CONST64(0x38f3f3ebf3cb18fb), CONST64(0xad3030c0309df060), CONST64(0xc4efef9bef2b74c3), +CONST64(0xda3f3ffc3fe5c37e), CONST64(0xc755554955921caa), CONST64(0xdba2a2b2a2791059), CONST64(0xe9eaea8fea0365c9), +CONST64(0x6a656589650fecca), CONST64(0x03babad2bab96869), CONST64(0x4a2f2fbc2f65935e), CONST64(0x8ec0c027c04ee79d), +CONST64(0x60dede5fdebe81a1), CONST64(0xfc1c1c701ce06c38), CONST64(0x46fdfdd3fdbb2ee7), CONST64(0x1f4d4d294d52649a), +CONST64(0x7692927292e4e039), CONST64(0xfa7575c9758fbcea), CONST64(0x3606061806301e0c), CONST64(0xae8a8a128a249809), +CONST64(0x4bb2b2f2b2f94079), CONST64(0x85e6e6bfe66359d1), CONST64(0x7e0e0e380e70361c), CONST64(0xe71f1f7c1ff8633e), +CONST64(0x556262956237f7c4), CONST64(0x3ad4d477d4eea3b5), CONST64(0x81a8a89aa829324d), CONST64(0x5296966296c4f431), +CONST64(0x62f9f9c3f99b3aef), CONST64(0xa3c5c533c566f697), CONST64(0x102525942535b14a), CONST64(0xab59597959f220b2), +CONST64(0xd084842a8454ae15), CONST64(0xc57272d572b7a7e4), CONST64(0xec3939e439d5dd72), CONST64(0x164c4c2d4c5a6198), +CONST64(0x945e5e655eca3bbc), CONST64(0x9f7878fd78e785f0), CONST64(0xe53838e038ddd870), CONST64(0x988c8c0a8c148605), +CONST64(0x17d1d163d1c6b2bf), CONST64(0xe4a5a5aea5410b57), CONST64(0xa1e2e2afe2434dd9), CONST64(0x4e616199612ff8c2), +CONST64(0x42b3b3f6b3f1457b), CONST64(0x342121842115a542), CONST64(0x089c9c4a9c94d625), CONST64(0xee1e1e781ef0663c), +CONST64(0x6143431143225286), CONST64(0xb1c7c73bc776fc93), CONST64(0x4ffcfcd7fcb32be5), CONST64(0x2404041004201408), +CONST64(0xe351515951b208a2), CONST64(0x2599995e99bcc72f), CONST64(0x226d6da96d4fc4da), CONST64(0x650d0d340d68391a), +CONST64(0x79fafacffa8335e9), CONST64(0x69dfdf5bdfb684a3), CONST64(0xa97e7ee57ed79bfc), CONST64(0x19242490243db448), +CONST64(0xfe3b3bec3bc5d776), CONST64(0x9aabab96ab313d4b), CONST64(0xf0cece1fce3ed181), CONST64(0x9911114411885522), +CONST64(0x838f8f068f0c8903), CONST64(0x044e4e254e4a6b9c), CONST64(0x66b7b7e6b7d15173), CONST64(0xe0ebeb8beb0b60cb), +CONST64(0xc13c3cf03cfdcc78), CONST64(0xfd81813e817cbf1f), CONST64(0x4094946a94d4fe35), CONST64(0x1cf7f7fbf7eb0cf3), +CONST64(0x18b9b9deb9a1676f), CONST64(0x8b13134c13985f26), CONST64(0x512c2cb02c7d9c58), CONST64(0x05d3d36bd3d6b8bb), +CONST64(0x8ce7e7bbe76b5cd3), CONST64(0x396e6ea56e57cbdc), CONST64(0xaac4c437c46ef395), CONST64(0x1b03030c03180f06), +CONST64(0xdc565645568a13ac), CONST64(0x5e44440d441a4988), CONST64(0xa07f7fe17fdf9efe), CONST64(0x88a9a99ea921374f), +CONST64(0x672a2aa82a4d8254), CONST64(0x0abbbbd6bbb16d6b), CONST64(0x87c1c123c146e29f), CONST64(0xf153535153a202a6), +CONST64(0x72dcdc57dcae8ba5), CONST64(0x530b0b2c0b582716), CONST64(0x019d9d4e9d9cd327), CONST64(0x2b6c6cad6c47c1d8), +CONST64(0xa43131c43195f562), CONST64(0xf37474cd7487b9e8), CONST64(0x15f6f6fff6e309f1), CONST64(0x4c464605460a438c), +CONST64(0xa5acac8aac092645), CONST64(0xb589891e893c970f), CONST64(0xb414145014a04428), CONST64(0xbae1e1a3e15b42df), +CONST64(0xa616165816b04e2c), CONST64(0xf73a3ae83acdd274), CONST64(0x066969b9696fd0d2), CONST64(0x4109092409482d12), +CONST64(0xd77070dd70a7ade0), CONST64(0x6fb6b6e2b6d95471), CONST64(0x1ed0d067d0ceb7bd), CONST64(0xd6eded93ed3b7ec7), +CONST64(0xe2cccc17cc2edb85), CONST64(0x68424215422a5784), CONST64(0x2c98985a98b4c22d), CONST64(0xeda4a4aaa4490e55), CONST64(0x752828a0285d8850), CONST64(0x865c5c6d5cda31b8), CONST64(0x6bf8f8c7f8933fed), CONST64(0xc28686228644a411) }; static const ulong64 sbox2[] = { -CONST64(0x30d818186018c078), CONST64(0x462623238c2305af), CONST64(0x91b8c6c63fc67ef9), CONST64(0xcdfbe8e887e8136f), -CONST64(0x13cb878726874ca1), CONST64(0x6d11b8b8dab8a962), CONST64(0x0209010104010805), CONST64(0x9e0d4f4f214f426e), -CONST64(0x6c9b3636d836adee), CONST64(0x51ffa6a6a2a65904), CONST64(0xb90cd2d26fd2debd), CONST64(0xf70ef5f5f3f5fb06), -CONST64(0xf2967979f979ef80), CONST64(0xde306f6fa16f5fce), CONST64(0x3f6d91917e91fcef), CONST64(0xa4f852525552aa07), -CONST64(0xc04760609d6027fd), CONST64(0x6535bcbccabc8976), CONST64(0x2b379b9b569baccd), CONST64(0x018a8e8e028e048c), -CONST64(0x5bd2a3a3b6a37115), CONST64(0x186c0c0c300c603c), CONST64(0xf6847b7bf17bff8a), CONST64(0x6a803535d435b5e1), -CONST64(0x3af51d1d741de869), CONST64(0xddb3e0e0a7e05347), CONST64(0xb321d7d77bd7f6ac), CONST64(0x999cc2c22fc25eed), -CONST64(0x5c432e2eb82e6d96), CONST64(0x96294b4b314b627a), CONST64(0xe15dfefedffea321), CONST64(0xaed5575741578216), -CONST64(0x2abd15155415a841), CONST64(0xeee87777c1779fb6), CONST64(0x6e923737dc37a5eb), CONST64(0xd79ee5e5b3e57b56), -CONST64(0x23139f9f469f8cd9), CONST64(0xfd23f0f0e7f0d317), CONST64(0x94204a4a354a6a7f), CONST64(0xa944dada4fda9e95), -CONST64(0xb0a258587d58fa25), CONST64(0x8fcfc9c903c906ca), CONST64(0x527c2929a429558d), CONST64(0x145a0a0a280a5022), -CONST64(0x7f50b1b1feb1e14f), CONST64(0x5dc9a0a0baa0691a), CONST64(0xd6146b6bb16b7fda), CONST64(0x17d985852e855cab), -CONST64(0x673cbdbdcebd8173), CONST64(0xba8f5d5d695dd234), CONST64(0x2090101040108050), CONST64(0xf507f4f4f7f4f303), -CONST64(0x8bddcbcb0bcb16c0), CONST64(0x7cd33e3ef83eedc6), CONST64(0x0a2d050514052811), CONST64(0xce78676781671fe6), -CONST64(0xd597e4e4b7e47353), CONST64(0x4e0227279c2725bb), CONST64(0x8273414119413258), CONST64(0x0ba78b8b168b2c9d), -CONST64(0x53f6a7a7a6a75101), CONST64(0xfab27d7de97dcf94), CONST64(0x374995956e95dcfb), CONST64(0xad56d8d847d88e9f), -CONST64(0xeb70fbfbcbfb8b30), CONST64(0xc1cdeeee9fee2371), CONST64(0xf8bb7c7ced7cc791), CONST64(0xcc716666856617e3), -CONST64(0xa77bdddd53dda68e), CONST64(0x2eaf17175c17b84b), CONST64(0x8e45474701470246), CONST64(0x211a9e9e429e84dc), -CONST64(0x89d4caca0fca1ec5), CONST64(0x5a582d2db42d7599), CONST64(0x632ebfbfc6bf9179), CONST64(0x0e3f07071c07381b), -CONST64(0x47acadad8ead0123), CONST64(0xb4b05a5a755aea2f), CONST64(0x1bef838336836cb5), CONST64(0x66b63333cc3385ff), -CONST64(0xc65c636391633ff2), CONST64(0x041202020802100a), CONST64(0x4993aaaa92aa3938), CONST64(0xe2de7171d971afa8), -CONST64(0x8dc6c8c807c80ecf), CONST64(0x32d119196419c87d), CONST64(0x923b494939497270), CONST64(0xaf5fd9d943d9869a), -CONST64(0xf931f2f2eff2c31d), CONST64(0xdba8e3e3abe34b48), CONST64(0xb6b95b5b715be22a), CONST64(0x0dbc88881a883492), -CONST64(0x293e9a9a529aa4c8), CONST64(0x4c0b262698262dbe), CONST64(0x64bf3232c8328dfa), CONST64(0x7d59b0b0fab0e94a), -CONST64(0xcff2e9e983e91b6a), CONST64(0x1e770f0f3c0f7833), CONST64(0xb733d5d573d5e6a6), CONST64(0x1df480803a8074ba), -CONST64(0x6127bebec2be997c), CONST64(0x87ebcdcd13cd26de), CONST64(0x68893434d034bde4), CONST64(0x903248483d487a75), -CONST64(0xe354ffffdbffab24), CONST64(0xf48d7a7af57af78f), CONST64(0x3d6490907a90f4ea), CONST64(0xbe9d5f5f615fc23e), -CONST64(0x403d202080201da0), CONST64(0xd00f6868bd6867d5), CONST64(0x34ca1a1a681ad072), CONST64(0x41b7aeae82ae192c), -CONST64(0x757db4b4eab4c95e), CONST64(0xa8ce54544d549a19), CONST64(0x3b7f93937693ece5), CONST64(0x442f222288220daa), -CONST64(0xc86364648d6407e9), CONST64(0xff2af1f1e3f1db12), CONST64(0xe6cc7373d173bfa2), CONST64(0x248212124812905a), -CONST64(0x807a40401d403a5d), CONST64(0x1048080820084028), CONST64(0x9b95c3c32bc356e8), CONST64(0xc5dfecec97ec337b), -CONST64(0xab4ddbdb4bdb9690), CONST64(0x5fc0a1a1bea1611f), CONST64(0x07918d8d0e8d1c83), CONST64(0x7ac83d3df43df5c9), -CONST64(0x335b97976697ccf1), CONST64(0x0000000000000000), CONST64(0x83f9cfcf1bcf36d4), CONST64(0x566e2b2bac2b4587), -CONST64(0xece17676c57697b3), CONST64(0x19e68282328264b0), CONST64(0xb128d6d67fd6fea9), CONST64(0x36c31b1b6c1bd877), -CONST64(0x7774b5b5eeb5c15b), CONST64(0x43beafaf86af1129), CONST64(0xd41d6a6ab56a77df), CONST64(0xa0ea50505d50ba0d), -CONST64(0x8a5745450945124c), CONST64(0xfb38f3f3ebf3cb18), CONST64(0x60ad3030c0309df0), CONST64(0xc3c4efef9bef2b74), -CONST64(0x7eda3f3ffc3fe5c3), CONST64(0xaac755554955921c), CONST64(0x59dba2a2b2a27910), CONST64(0xc9e9eaea8fea0365), -CONST64(0xca6a656589650fec), CONST64(0x6903babad2bab968), CONST64(0x5e4a2f2fbc2f6593), CONST64(0x9d8ec0c027c04ee7), -CONST64(0xa160dede5fdebe81), CONST64(0x38fc1c1c701ce06c), CONST64(0xe746fdfdd3fdbb2e), CONST64(0x9a1f4d4d294d5264), -CONST64(0x397692927292e4e0), CONST64(0xeafa7575c9758fbc), CONST64(0x0c3606061806301e), CONST64(0x09ae8a8a128a2498), -CONST64(0x794bb2b2f2b2f940), CONST64(0xd185e6e6bfe66359), CONST64(0x1c7e0e0e380e7036), CONST64(0x3ee71f1f7c1ff863), -CONST64(0xc4556262956237f7), CONST64(0xb53ad4d477d4eea3), CONST64(0x4d81a8a89aa82932), CONST64(0x315296966296c4f4), -CONST64(0xef62f9f9c3f99b3a), CONST64(0x97a3c5c533c566f6), CONST64(0x4a102525942535b1), CONST64(0xb2ab59597959f220), -CONST64(0x15d084842a8454ae), CONST64(0xe4c57272d572b7a7), CONST64(0x72ec3939e439d5dd), CONST64(0x98164c4c2d4c5a61), -CONST64(0xbc945e5e655eca3b), CONST64(0xf09f7878fd78e785), CONST64(0x70e53838e038ddd8), CONST64(0x05988c8c0a8c1486), -CONST64(0xbf17d1d163d1c6b2), CONST64(0x57e4a5a5aea5410b), CONST64(0xd9a1e2e2afe2434d), CONST64(0xc24e616199612ff8), -CONST64(0x7b42b3b3f6b3f145), CONST64(0x42342121842115a5), CONST64(0x25089c9c4a9c94d6), CONST64(0x3cee1e1e781ef066), -CONST64(0x8661434311432252), CONST64(0x93b1c7c73bc776fc), CONST64(0xe54ffcfcd7fcb32b), CONST64(0x0824040410042014), -CONST64(0xa2e351515951b208), CONST64(0x2f2599995e99bcc7), CONST64(0xda226d6da96d4fc4), CONST64(0x1a650d0d340d6839), -CONST64(0xe979fafacffa8335), CONST64(0xa369dfdf5bdfb684), CONST64(0xfca97e7ee57ed79b), CONST64(0x4819242490243db4), -CONST64(0x76fe3b3bec3bc5d7), CONST64(0x4b9aabab96ab313d), CONST64(0x81f0cece1fce3ed1), CONST64(0x2299111144118855), -CONST64(0x03838f8f068f0c89), CONST64(0x9c044e4e254e4a6b), CONST64(0x7366b7b7e6b7d151), CONST64(0xcbe0ebeb8beb0b60), -CONST64(0x78c13c3cf03cfdcc), CONST64(0x1ffd81813e817cbf), CONST64(0x354094946a94d4fe), CONST64(0xf31cf7f7fbf7eb0c), -CONST64(0x6f18b9b9deb9a167), CONST64(0x268b13134c13985f), CONST64(0x58512c2cb02c7d9c), CONST64(0xbb05d3d36bd3d6b8), -CONST64(0xd38ce7e7bbe76b5c), CONST64(0xdc396e6ea56e57cb), CONST64(0x95aac4c437c46ef3), CONST64(0x061b03030c03180f), -CONST64(0xacdc565645568a13), CONST64(0x885e44440d441a49), CONST64(0xfea07f7fe17fdf9e), CONST64(0x4f88a9a99ea92137), -CONST64(0x54672a2aa82a4d82), CONST64(0x6b0abbbbd6bbb16d), CONST64(0x9f87c1c123c146e2), CONST64(0xa6f153535153a202), -CONST64(0xa572dcdc57dcae8b), CONST64(0x16530b0b2c0b5827), CONST64(0x27019d9d4e9d9cd3), CONST64(0xd82b6c6cad6c47c1), -CONST64(0x62a43131c43195f5), CONST64(0xe8f37474cd7487b9), CONST64(0xf115f6f6fff6e309), CONST64(0x8c4c464605460a43), -CONST64(0x45a5acac8aac0926), CONST64(0x0fb589891e893c97), CONST64(0x28b414145014a044), CONST64(0xdfbae1e1a3e15b42), -CONST64(0x2ca616165816b04e), CONST64(0x74f73a3ae83acdd2), CONST64(0xd2066969b9696fd0), CONST64(0x124109092409482d), -CONST64(0xe0d77070dd70a7ad), CONST64(0x716fb6b6e2b6d954), CONST64(0xbd1ed0d067d0ceb7), CONST64(0xc7d6eded93ed3b7e), -CONST64(0x85e2cccc17cc2edb), CONST64(0x8468424215422a57), CONST64(0x2d2c98985a98b4c2), CONST64(0x55eda4a4aaa4490e), +CONST64(0x30d818186018c078), CONST64(0x462623238c2305af), CONST64(0x91b8c6c63fc67ef9), CONST64(0xcdfbe8e887e8136f), +CONST64(0x13cb878726874ca1), CONST64(0x6d11b8b8dab8a962), CONST64(0x0209010104010805), CONST64(0x9e0d4f4f214f426e), +CONST64(0x6c9b3636d836adee), CONST64(0x51ffa6a6a2a65904), CONST64(0xb90cd2d26fd2debd), CONST64(0xf70ef5f5f3f5fb06), +CONST64(0xf2967979f979ef80), CONST64(0xde306f6fa16f5fce), CONST64(0x3f6d91917e91fcef), CONST64(0xa4f852525552aa07), +CONST64(0xc04760609d6027fd), CONST64(0x6535bcbccabc8976), CONST64(0x2b379b9b569baccd), CONST64(0x018a8e8e028e048c), +CONST64(0x5bd2a3a3b6a37115), CONST64(0x186c0c0c300c603c), CONST64(0xf6847b7bf17bff8a), CONST64(0x6a803535d435b5e1), +CONST64(0x3af51d1d741de869), CONST64(0xddb3e0e0a7e05347), CONST64(0xb321d7d77bd7f6ac), CONST64(0x999cc2c22fc25eed), +CONST64(0x5c432e2eb82e6d96), CONST64(0x96294b4b314b627a), CONST64(0xe15dfefedffea321), CONST64(0xaed5575741578216), +CONST64(0x2abd15155415a841), CONST64(0xeee87777c1779fb6), CONST64(0x6e923737dc37a5eb), CONST64(0xd79ee5e5b3e57b56), +CONST64(0x23139f9f469f8cd9), CONST64(0xfd23f0f0e7f0d317), CONST64(0x94204a4a354a6a7f), CONST64(0xa944dada4fda9e95), +CONST64(0xb0a258587d58fa25), CONST64(0x8fcfc9c903c906ca), CONST64(0x527c2929a429558d), CONST64(0x145a0a0a280a5022), +CONST64(0x7f50b1b1feb1e14f), CONST64(0x5dc9a0a0baa0691a), CONST64(0xd6146b6bb16b7fda), CONST64(0x17d985852e855cab), +CONST64(0x673cbdbdcebd8173), CONST64(0xba8f5d5d695dd234), CONST64(0x2090101040108050), CONST64(0xf507f4f4f7f4f303), +CONST64(0x8bddcbcb0bcb16c0), CONST64(0x7cd33e3ef83eedc6), CONST64(0x0a2d050514052811), CONST64(0xce78676781671fe6), +CONST64(0xd597e4e4b7e47353), CONST64(0x4e0227279c2725bb), CONST64(0x8273414119413258), CONST64(0x0ba78b8b168b2c9d), +CONST64(0x53f6a7a7a6a75101), CONST64(0xfab27d7de97dcf94), CONST64(0x374995956e95dcfb), CONST64(0xad56d8d847d88e9f), +CONST64(0xeb70fbfbcbfb8b30), CONST64(0xc1cdeeee9fee2371), CONST64(0xf8bb7c7ced7cc791), CONST64(0xcc716666856617e3), +CONST64(0xa77bdddd53dda68e), CONST64(0x2eaf17175c17b84b), CONST64(0x8e45474701470246), CONST64(0x211a9e9e429e84dc), +CONST64(0x89d4caca0fca1ec5), CONST64(0x5a582d2db42d7599), CONST64(0x632ebfbfc6bf9179), CONST64(0x0e3f07071c07381b), +CONST64(0x47acadad8ead0123), CONST64(0xb4b05a5a755aea2f), CONST64(0x1bef838336836cb5), CONST64(0x66b63333cc3385ff), +CONST64(0xc65c636391633ff2), CONST64(0x041202020802100a), CONST64(0x4993aaaa92aa3938), CONST64(0xe2de7171d971afa8), +CONST64(0x8dc6c8c807c80ecf), CONST64(0x32d119196419c87d), CONST64(0x923b494939497270), CONST64(0xaf5fd9d943d9869a), +CONST64(0xf931f2f2eff2c31d), CONST64(0xdba8e3e3abe34b48), CONST64(0xb6b95b5b715be22a), CONST64(0x0dbc88881a883492), +CONST64(0x293e9a9a529aa4c8), CONST64(0x4c0b262698262dbe), CONST64(0x64bf3232c8328dfa), CONST64(0x7d59b0b0fab0e94a), +CONST64(0xcff2e9e983e91b6a), CONST64(0x1e770f0f3c0f7833), CONST64(0xb733d5d573d5e6a6), CONST64(0x1df480803a8074ba), +CONST64(0x6127bebec2be997c), CONST64(0x87ebcdcd13cd26de), CONST64(0x68893434d034bde4), CONST64(0x903248483d487a75), +CONST64(0xe354ffffdbffab24), CONST64(0xf48d7a7af57af78f), CONST64(0x3d6490907a90f4ea), CONST64(0xbe9d5f5f615fc23e), +CONST64(0x403d202080201da0), CONST64(0xd00f6868bd6867d5), CONST64(0x34ca1a1a681ad072), CONST64(0x41b7aeae82ae192c), +CONST64(0x757db4b4eab4c95e), CONST64(0xa8ce54544d549a19), CONST64(0x3b7f93937693ece5), CONST64(0x442f222288220daa), +CONST64(0xc86364648d6407e9), CONST64(0xff2af1f1e3f1db12), CONST64(0xe6cc7373d173bfa2), CONST64(0x248212124812905a), +CONST64(0x807a40401d403a5d), CONST64(0x1048080820084028), CONST64(0x9b95c3c32bc356e8), CONST64(0xc5dfecec97ec337b), +CONST64(0xab4ddbdb4bdb9690), CONST64(0x5fc0a1a1bea1611f), CONST64(0x07918d8d0e8d1c83), CONST64(0x7ac83d3df43df5c9), +CONST64(0x335b97976697ccf1), CONST64(0x0000000000000000), CONST64(0x83f9cfcf1bcf36d4), CONST64(0x566e2b2bac2b4587), +CONST64(0xece17676c57697b3), CONST64(0x19e68282328264b0), CONST64(0xb128d6d67fd6fea9), CONST64(0x36c31b1b6c1bd877), +CONST64(0x7774b5b5eeb5c15b), CONST64(0x43beafaf86af1129), CONST64(0xd41d6a6ab56a77df), CONST64(0xa0ea50505d50ba0d), +CONST64(0x8a5745450945124c), CONST64(0xfb38f3f3ebf3cb18), CONST64(0x60ad3030c0309df0), CONST64(0xc3c4efef9bef2b74), +CONST64(0x7eda3f3ffc3fe5c3), CONST64(0xaac755554955921c), CONST64(0x59dba2a2b2a27910), CONST64(0xc9e9eaea8fea0365), +CONST64(0xca6a656589650fec), CONST64(0x6903babad2bab968), CONST64(0x5e4a2f2fbc2f6593), CONST64(0x9d8ec0c027c04ee7), +CONST64(0xa160dede5fdebe81), CONST64(0x38fc1c1c701ce06c), CONST64(0xe746fdfdd3fdbb2e), CONST64(0x9a1f4d4d294d5264), +CONST64(0x397692927292e4e0), CONST64(0xeafa7575c9758fbc), CONST64(0x0c3606061806301e), CONST64(0x09ae8a8a128a2498), +CONST64(0x794bb2b2f2b2f940), CONST64(0xd185e6e6bfe66359), CONST64(0x1c7e0e0e380e7036), CONST64(0x3ee71f1f7c1ff863), +CONST64(0xc4556262956237f7), CONST64(0xb53ad4d477d4eea3), CONST64(0x4d81a8a89aa82932), CONST64(0x315296966296c4f4), +CONST64(0xef62f9f9c3f99b3a), CONST64(0x97a3c5c533c566f6), CONST64(0x4a102525942535b1), CONST64(0xb2ab59597959f220), +CONST64(0x15d084842a8454ae), CONST64(0xe4c57272d572b7a7), CONST64(0x72ec3939e439d5dd), CONST64(0x98164c4c2d4c5a61), +CONST64(0xbc945e5e655eca3b), CONST64(0xf09f7878fd78e785), CONST64(0x70e53838e038ddd8), CONST64(0x05988c8c0a8c1486), +CONST64(0xbf17d1d163d1c6b2), CONST64(0x57e4a5a5aea5410b), CONST64(0xd9a1e2e2afe2434d), CONST64(0xc24e616199612ff8), +CONST64(0x7b42b3b3f6b3f145), CONST64(0x42342121842115a5), CONST64(0x25089c9c4a9c94d6), CONST64(0x3cee1e1e781ef066), +CONST64(0x8661434311432252), CONST64(0x93b1c7c73bc776fc), CONST64(0xe54ffcfcd7fcb32b), CONST64(0x0824040410042014), +CONST64(0xa2e351515951b208), CONST64(0x2f2599995e99bcc7), CONST64(0xda226d6da96d4fc4), CONST64(0x1a650d0d340d6839), +CONST64(0xe979fafacffa8335), CONST64(0xa369dfdf5bdfb684), CONST64(0xfca97e7ee57ed79b), CONST64(0x4819242490243db4), +CONST64(0x76fe3b3bec3bc5d7), CONST64(0x4b9aabab96ab313d), CONST64(0x81f0cece1fce3ed1), CONST64(0x2299111144118855), +CONST64(0x03838f8f068f0c89), CONST64(0x9c044e4e254e4a6b), CONST64(0x7366b7b7e6b7d151), CONST64(0xcbe0ebeb8beb0b60), +CONST64(0x78c13c3cf03cfdcc), CONST64(0x1ffd81813e817cbf), CONST64(0x354094946a94d4fe), CONST64(0xf31cf7f7fbf7eb0c), +CONST64(0x6f18b9b9deb9a167), CONST64(0x268b13134c13985f), CONST64(0x58512c2cb02c7d9c), CONST64(0xbb05d3d36bd3d6b8), +CONST64(0xd38ce7e7bbe76b5c), CONST64(0xdc396e6ea56e57cb), CONST64(0x95aac4c437c46ef3), CONST64(0x061b03030c03180f), +CONST64(0xacdc565645568a13), CONST64(0x885e44440d441a49), CONST64(0xfea07f7fe17fdf9e), CONST64(0x4f88a9a99ea92137), +CONST64(0x54672a2aa82a4d82), CONST64(0x6b0abbbbd6bbb16d), CONST64(0x9f87c1c123c146e2), CONST64(0xa6f153535153a202), +CONST64(0xa572dcdc57dcae8b), CONST64(0x16530b0b2c0b5827), CONST64(0x27019d9d4e9d9cd3), CONST64(0xd82b6c6cad6c47c1), +CONST64(0x62a43131c43195f5), CONST64(0xe8f37474cd7487b9), CONST64(0xf115f6f6fff6e309), CONST64(0x8c4c464605460a43), +CONST64(0x45a5acac8aac0926), CONST64(0x0fb589891e893c97), CONST64(0x28b414145014a044), CONST64(0xdfbae1e1a3e15b42), +CONST64(0x2ca616165816b04e), CONST64(0x74f73a3ae83acdd2), CONST64(0xd2066969b9696fd0), CONST64(0x124109092409482d), +CONST64(0xe0d77070dd70a7ad), CONST64(0x716fb6b6e2b6d954), CONST64(0xbd1ed0d067d0ceb7), CONST64(0xc7d6eded93ed3b7e), +CONST64(0x85e2cccc17cc2edb), CONST64(0x8468424215422a57), CONST64(0x2d2c98985a98b4c2), CONST64(0x55eda4a4aaa4490e), CONST64(0x50752828a0285d88), CONST64(0xb8865c5c6d5cda31), CONST64(0xed6bf8f8c7f8933f), CONST64(0x11c28686228644a4) }; static const ulong64 sbox3[] = { -CONST64(0x7830d818186018c0), CONST64(0xaf462623238c2305), CONST64(0xf991b8c6c63fc67e), CONST64(0x6fcdfbe8e887e813), -CONST64(0xa113cb878726874c), CONST64(0x626d11b8b8dab8a9), CONST64(0x0502090101040108), CONST64(0x6e9e0d4f4f214f42), -CONST64(0xee6c9b3636d836ad), CONST64(0x0451ffa6a6a2a659), CONST64(0xbdb90cd2d26fd2de), CONST64(0x06f70ef5f5f3f5fb), -CONST64(0x80f2967979f979ef), CONST64(0xcede306f6fa16f5f), CONST64(0xef3f6d91917e91fc), CONST64(0x07a4f852525552aa), -CONST64(0xfdc04760609d6027), CONST64(0x766535bcbccabc89), CONST64(0xcd2b379b9b569bac), CONST64(0x8c018a8e8e028e04), -CONST64(0x155bd2a3a3b6a371), CONST64(0x3c186c0c0c300c60), CONST64(0x8af6847b7bf17bff), CONST64(0xe16a803535d435b5), -CONST64(0x693af51d1d741de8), CONST64(0x47ddb3e0e0a7e053), CONST64(0xacb321d7d77bd7f6), CONST64(0xed999cc2c22fc25e), -CONST64(0x965c432e2eb82e6d), CONST64(0x7a96294b4b314b62), CONST64(0x21e15dfefedffea3), CONST64(0x16aed55757415782), -CONST64(0x412abd15155415a8), CONST64(0xb6eee87777c1779f), CONST64(0xeb6e923737dc37a5), CONST64(0x56d79ee5e5b3e57b), -CONST64(0xd923139f9f469f8c), CONST64(0x17fd23f0f0e7f0d3), CONST64(0x7f94204a4a354a6a), CONST64(0x95a944dada4fda9e), -CONST64(0x25b0a258587d58fa), CONST64(0xca8fcfc9c903c906), CONST64(0x8d527c2929a42955), CONST64(0x22145a0a0a280a50), -CONST64(0x4f7f50b1b1feb1e1), CONST64(0x1a5dc9a0a0baa069), CONST64(0xdad6146b6bb16b7f), CONST64(0xab17d985852e855c), -CONST64(0x73673cbdbdcebd81), CONST64(0x34ba8f5d5d695dd2), CONST64(0x5020901010401080), CONST64(0x03f507f4f4f7f4f3), -CONST64(0xc08bddcbcb0bcb16), CONST64(0xc67cd33e3ef83eed), CONST64(0x110a2d0505140528), CONST64(0xe6ce78676781671f), -CONST64(0x53d597e4e4b7e473), CONST64(0xbb4e0227279c2725), CONST64(0x5882734141194132), CONST64(0x9d0ba78b8b168b2c), -CONST64(0x0153f6a7a7a6a751), CONST64(0x94fab27d7de97dcf), CONST64(0xfb374995956e95dc), CONST64(0x9fad56d8d847d88e), -CONST64(0x30eb70fbfbcbfb8b), CONST64(0x71c1cdeeee9fee23), CONST64(0x91f8bb7c7ced7cc7), CONST64(0xe3cc716666856617), -CONST64(0x8ea77bdddd53dda6), CONST64(0x4b2eaf17175c17b8), CONST64(0x468e454747014702), CONST64(0xdc211a9e9e429e84), -CONST64(0xc589d4caca0fca1e), CONST64(0x995a582d2db42d75), CONST64(0x79632ebfbfc6bf91), CONST64(0x1b0e3f07071c0738), -CONST64(0x2347acadad8ead01), CONST64(0x2fb4b05a5a755aea), CONST64(0xb51bef838336836c), CONST64(0xff66b63333cc3385), -CONST64(0xf2c65c636391633f), CONST64(0x0a04120202080210), CONST64(0x384993aaaa92aa39), CONST64(0xa8e2de7171d971af), -CONST64(0xcf8dc6c8c807c80e), CONST64(0x7d32d119196419c8), CONST64(0x70923b4949394972), CONST64(0x9aaf5fd9d943d986), -CONST64(0x1df931f2f2eff2c3), CONST64(0x48dba8e3e3abe34b), CONST64(0x2ab6b95b5b715be2), CONST64(0x920dbc88881a8834), -CONST64(0xc8293e9a9a529aa4), CONST64(0xbe4c0b262698262d), CONST64(0xfa64bf3232c8328d), CONST64(0x4a7d59b0b0fab0e9), -CONST64(0x6acff2e9e983e91b), CONST64(0x331e770f0f3c0f78), CONST64(0xa6b733d5d573d5e6), CONST64(0xba1df480803a8074), -CONST64(0x7c6127bebec2be99), CONST64(0xde87ebcdcd13cd26), CONST64(0xe468893434d034bd), CONST64(0x75903248483d487a), -CONST64(0x24e354ffffdbffab), CONST64(0x8ff48d7a7af57af7), CONST64(0xea3d6490907a90f4), CONST64(0x3ebe9d5f5f615fc2), -CONST64(0xa0403d202080201d), CONST64(0xd5d00f6868bd6867), CONST64(0x7234ca1a1a681ad0), CONST64(0x2c41b7aeae82ae19), -CONST64(0x5e757db4b4eab4c9), CONST64(0x19a8ce54544d549a), CONST64(0xe53b7f93937693ec), CONST64(0xaa442f222288220d), -CONST64(0xe9c86364648d6407), CONST64(0x12ff2af1f1e3f1db), CONST64(0xa2e6cc7373d173bf), CONST64(0x5a24821212481290), -CONST64(0x5d807a40401d403a), CONST64(0x2810480808200840), CONST64(0xe89b95c3c32bc356), CONST64(0x7bc5dfecec97ec33), -CONST64(0x90ab4ddbdb4bdb96), CONST64(0x1f5fc0a1a1bea161), CONST64(0x8307918d8d0e8d1c), CONST64(0xc97ac83d3df43df5), -CONST64(0xf1335b97976697cc), CONST64(0x0000000000000000), CONST64(0xd483f9cfcf1bcf36), CONST64(0x87566e2b2bac2b45), -CONST64(0xb3ece17676c57697), CONST64(0xb019e68282328264), CONST64(0xa9b128d6d67fd6fe), CONST64(0x7736c31b1b6c1bd8), -CONST64(0x5b7774b5b5eeb5c1), CONST64(0x2943beafaf86af11), CONST64(0xdfd41d6a6ab56a77), CONST64(0x0da0ea50505d50ba), -CONST64(0x4c8a574545094512), CONST64(0x18fb38f3f3ebf3cb), CONST64(0xf060ad3030c0309d), CONST64(0x74c3c4efef9bef2b), -CONST64(0xc37eda3f3ffc3fe5), CONST64(0x1caac75555495592), CONST64(0x1059dba2a2b2a279), CONST64(0x65c9e9eaea8fea03), -CONST64(0xecca6a656589650f), CONST64(0x686903babad2bab9), CONST64(0x935e4a2f2fbc2f65), CONST64(0xe79d8ec0c027c04e), -CONST64(0x81a160dede5fdebe), CONST64(0x6c38fc1c1c701ce0), CONST64(0x2ee746fdfdd3fdbb), CONST64(0x649a1f4d4d294d52), -CONST64(0xe0397692927292e4), CONST64(0xbceafa7575c9758f), CONST64(0x1e0c360606180630), CONST64(0x9809ae8a8a128a24), -CONST64(0x40794bb2b2f2b2f9), CONST64(0x59d185e6e6bfe663), CONST64(0x361c7e0e0e380e70), CONST64(0x633ee71f1f7c1ff8), -CONST64(0xf7c4556262956237), CONST64(0xa3b53ad4d477d4ee), CONST64(0x324d81a8a89aa829), CONST64(0xf4315296966296c4), -CONST64(0x3aef62f9f9c3f99b), CONST64(0xf697a3c5c533c566), CONST64(0xb14a102525942535), CONST64(0x20b2ab59597959f2), -CONST64(0xae15d084842a8454), CONST64(0xa7e4c57272d572b7), CONST64(0xdd72ec3939e439d5), CONST64(0x6198164c4c2d4c5a), -CONST64(0x3bbc945e5e655eca), CONST64(0x85f09f7878fd78e7), CONST64(0xd870e53838e038dd), CONST64(0x8605988c8c0a8c14), -CONST64(0xb2bf17d1d163d1c6), CONST64(0x0b57e4a5a5aea541), CONST64(0x4dd9a1e2e2afe243), CONST64(0xf8c24e616199612f), -CONST64(0x457b42b3b3f6b3f1), CONST64(0xa542342121842115), CONST64(0xd625089c9c4a9c94), CONST64(0x663cee1e1e781ef0), -CONST64(0x5286614343114322), CONST64(0xfc93b1c7c73bc776), CONST64(0x2be54ffcfcd7fcb3), CONST64(0x1408240404100420), -CONST64(0x08a2e351515951b2), CONST64(0xc72f2599995e99bc), CONST64(0xc4da226d6da96d4f), CONST64(0x391a650d0d340d68), -CONST64(0x35e979fafacffa83), CONST64(0x84a369dfdf5bdfb6), CONST64(0x9bfca97e7ee57ed7), CONST64(0xb44819242490243d), -CONST64(0xd776fe3b3bec3bc5), CONST64(0x3d4b9aabab96ab31), CONST64(0xd181f0cece1fce3e), CONST64(0x5522991111441188), -CONST64(0x8903838f8f068f0c), CONST64(0x6b9c044e4e254e4a), CONST64(0x517366b7b7e6b7d1), CONST64(0x60cbe0ebeb8beb0b), -CONST64(0xcc78c13c3cf03cfd), CONST64(0xbf1ffd81813e817c), CONST64(0xfe354094946a94d4), CONST64(0x0cf31cf7f7fbf7eb), -CONST64(0x676f18b9b9deb9a1), CONST64(0x5f268b13134c1398), CONST64(0x9c58512c2cb02c7d), CONST64(0xb8bb05d3d36bd3d6), -CONST64(0x5cd38ce7e7bbe76b), CONST64(0xcbdc396e6ea56e57), CONST64(0xf395aac4c437c46e), CONST64(0x0f061b03030c0318), -CONST64(0x13acdc565645568a), CONST64(0x49885e44440d441a), CONST64(0x9efea07f7fe17fdf), CONST64(0x374f88a9a99ea921), -CONST64(0x8254672a2aa82a4d), CONST64(0x6d6b0abbbbd6bbb1), CONST64(0xe29f87c1c123c146), CONST64(0x02a6f153535153a2), -CONST64(0x8ba572dcdc57dcae), CONST64(0x2716530b0b2c0b58), CONST64(0xd327019d9d4e9d9c), CONST64(0xc1d82b6c6cad6c47), -CONST64(0xf562a43131c43195), CONST64(0xb9e8f37474cd7487), CONST64(0x09f115f6f6fff6e3), CONST64(0x438c4c464605460a), -CONST64(0x2645a5acac8aac09), CONST64(0x970fb589891e893c), CONST64(0x4428b414145014a0), CONST64(0x42dfbae1e1a3e15b), -CONST64(0x4e2ca616165816b0), CONST64(0xd274f73a3ae83acd), CONST64(0xd0d2066969b9696f), CONST64(0x2d12410909240948), -CONST64(0xade0d77070dd70a7), CONST64(0x54716fb6b6e2b6d9), CONST64(0xb7bd1ed0d067d0ce), CONST64(0x7ec7d6eded93ed3b), -CONST64(0xdb85e2cccc17cc2e), CONST64(0x578468424215422a), CONST64(0xc22d2c98985a98b4), CONST64(0x0e55eda4a4aaa449), +CONST64(0x7830d818186018c0), CONST64(0xaf462623238c2305), CONST64(0xf991b8c6c63fc67e), CONST64(0x6fcdfbe8e887e813), +CONST64(0xa113cb878726874c), CONST64(0x626d11b8b8dab8a9), CONST64(0x0502090101040108), CONST64(0x6e9e0d4f4f214f42), +CONST64(0xee6c9b3636d836ad), CONST64(0x0451ffa6a6a2a659), CONST64(0xbdb90cd2d26fd2de), CONST64(0x06f70ef5f5f3f5fb), +CONST64(0x80f2967979f979ef), CONST64(0xcede306f6fa16f5f), CONST64(0xef3f6d91917e91fc), CONST64(0x07a4f852525552aa), +CONST64(0xfdc04760609d6027), CONST64(0x766535bcbccabc89), CONST64(0xcd2b379b9b569bac), CONST64(0x8c018a8e8e028e04), +CONST64(0x155bd2a3a3b6a371), CONST64(0x3c186c0c0c300c60), CONST64(0x8af6847b7bf17bff), CONST64(0xe16a803535d435b5), +CONST64(0x693af51d1d741de8), CONST64(0x47ddb3e0e0a7e053), CONST64(0xacb321d7d77bd7f6), CONST64(0xed999cc2c22fc25e), +CONST64(0x965c432e2eb82e6d), CONST64(0x7a96294b4b314b62), CONST64(0x21e15dfefedffea3), CONST64(0x16aed55757415782), +CONST64(0x412abd15155415a8), CONST64(0xb6eee87777c1779f), CONST64(0xeb6e923737dc37a5), CONST64(0x56d79ee5e5b3e57b), +CONST64(0xd923139f9f469f8c), CONST64(0x17fd23f0f0e7f0d3), CONST64(0x7f94204a4a354a6a), CONST64(0x95a944dada4fda9e), +CONST64(0x25b0a258587d58fa), CONST64(0xca8fcfc9c903c906), CONST64(0x8d527c2929a42955), CONST64(0x22145a0a0a280a50), +CONST64(0x4f7f50b1b1feb1e1), CONST64(0x1a5dc9a0a0baa069), CONST64(0xdad6146b6bb16b7f), CONST64(0xab17d985852e855c), +CONST64(0x73673cbdbdcebd81), CONST64(0x34ba8f5d5d695dd2), CONST64(0x5020901010401080), CONST64(0x03f507f4f4f7f4f3), +CONST64(0xc08bddcbcb0bcb16), CONST64(0xc67cd33e3ef83eed), CONST64(0x110a2d0505140528), CONST64(0xe6ce78676781671f), +CONST64(0x53d597e4e4b7e473), CONST64(0xbb4e0227279c2725), CONST64(0x5882734141194132), CONST64(0x9d0ba78b8b168b2c), +CONST64(0x0153f6a7a7a6a751), CONST64(0x94fab27d7de97dcf), CONST64(0xfb374995956e95dc), CONST64(0x9fad56d8d847d88e), +CONST64(0x30eb70fbfbcbfb8b), CONST64(0x71c1cdeeee9fee23), CONST64(0x91f8bb7c7ced7cc7), CONST64(0xe3cc716666856617), +CONST64(0x8ea77bdddd53dda6), CONST64(0x4b2eaf17175c17b8), CONST64(0x468e454747014702), CONST64(0xdc211a9e9e429e84), +CONST64(0xc589d4caca0fca1e), CONST64(0x995a582d2db42d75), CONST64(0x79632ebfbfc6bf91), CONST64(0x1b0e3f07071c0738), +CONST64(0x2347acadad8ead01), CONST64(0x2fb4b05a5a755aea), CONST64(0xb51bef838336836c), CONST64(0xff66b63333cc3385), +CONST64(0xf2c65c636391633f), CONST64(0x0a04120202080210), CONST64(0x384993aaaa92aa39), CONST64(0xa8e2de7171d971af), +CONST64(0xcf8dc6c8c807c80e), CONST64(0x7d32d119196419c8), CONST64(0x70923b4949394972), CONST64(0x9aaf5fd9d943d986), +CONST64(0x1df931f2f2eff2c3), CONST64(0x48dba8e3e3abe34b), CONST64(0x2ab6b95b5b715be2), CONST64(0x920dbc88881a8834), +CONST64(0xc8293e9a9a529aa4), CONST64(0xbe4c0b262698262d), CONST64(0xfa64bf3232c8328d), CONST64(0x4a7d59b0b0fab0e9), +CONST64(0x6acff2e9e983e91b), CONST64(0x331e770f0f3c0f78), CONST64(0xa6b733d5d573d5e6), CONST64(0xba1df480803a8074), +CONST64(0x7c6127bebec2be99), CONST64(0xde87ebcdcd13cd26), CONST64(0xe468893434d034bd), CONST64(0x75903248483d487a), +CONST64(0x24e354ffffdbffab), CONST64(0x8ff48d7a7af57af7), CONST64(0xea3d6490907a90f4), CONST64(0x3ebe9d5f5f615fc2), +CONST64(0xa0403d202080201d), CONST64(0xd5d00f6868bd6867), CONST64(0x7234ca1a1a681ad0), CONST64(0x2c41b7aeae82ae19), +CONST64(0x5e757db4b4eab4c9), CONST64(0x19a8ce54544d549a), CONST64(0xe53b7f93937693ec), CONST64(0xaa442f222288220d), +CONST64(0xe9c86364648d6407), CONST64(0x12ff2af1f1e3f1db), CONST64(0xa2e6cc7373d173bf), CONST64(0x5a24821212481290), +CONST64(0x5d807a40401d403a), CONST64(0x2810480808200840), CONST64(0xe89b95c3c32bc356), CONST64(0x7bc5dfecec97ec33), +CONST64(0x90ab4ddbdb4bdb96), CONST64(0x1f5fc0a1a1bea161), CONST64(0x8307918d8d0e8d1c), CONST64(0xc97ac83d3df43df5), +CONST64(0xf1335b97976697cc), CONST64(0x0000000000000000), CONST64(0xd483f9cfcf1bcf36), CONST64(0x87566e2b2bac2b45), +CONST64(0xb3ece17676c57697), CONST64(0xb019e68282328264), CONST64(0xa9b128d6d67fd6fe), CONST64(0x7736c31b1b6c1bd8), +CONST64(0x5b7774b5b5eeb5c1), CONST64(0x2943beafaf86af11), CONST64(0xdfd41d6a6ab56a77), CONST64(0x0da0ea50505d50ba), +CONST64(0x4c8a574545094512), CONST64(0x18fb38f3f3ebf3cb), CONST64(0xf060ad3030c0309d), CONST64(0x74c3c4efef9bef2b), +CONST64(0xc37eda3f3ffc3fe5), CONST64(0x1caac75555495592), CONST64(0x1059dba2a2b2a279), CONST64(0x65c9e9eaea8fea03), +CONST64(0xecca6a656589650f), CONST64(0x686903babad2bab9), CONST64(0x935e4a2f2fbc2f65), CONST64(0xe79d8ec0c027c04e), +CONST64(0x81a160dede5fdebe), CONST64(0x6c38fc1c1c701ce0), CONST64(0x2ee746fdfdd3fdbb), CONST64(0x649a1f4d4d294d52), +CONST64(0xe0397692927292e4), CONST64(0xbceafa7575c9758f), CONST64(0x1e0c360606180630), CONST64(0x9809ae8a8a128a24), +CONST64(0x40794bb2b2f2b2f9), CONST64(0x59d185e6e6bfe663), CONST64(0x361c7e0e0e380e70), CONST64(0x633ee71f1f7c1ff8), +CONST64(0xf7c4556262956237), CONST64(0xa3b53ad4d477d4ee), CONST64(0x324d81a8a89aa829), CONST64(0xf4315296966296c4), +CONST64(0x3aef62f9f9c3f99b), CONST64(0xf697a3c5c533c566), CONST64(0xb14a102525942535), CONST64(0x20b2ab59597959f2), +CONST64(0xae15d084842a8454), CONST64(0xa7e4c57272d572b7), CONST64(0xdd72ec3939e439d5), CONST64(0x6198164c4c2d4c5a), +CONST64(0x3bbc945e5e655eca), CONST64(0x85f09f7878fd78e7), CONST64(0xd870e53838e038dd), CONST64(0x8605988c8c0a8c14), +CONST64(0xb2bf17d1d163d1c6), CONST64(0x0b57e4a5a5aea541), CONST64(0x4dd9a1e2e2afe243), CONST64(0xf8c24e616199612f), +CONST64(0x457b42b3b3f6b3f1), CONST64(0xa542342121842115), CONST64(0xd625089c9c4a9c94), CONST64(0x663cee1e1e781ef0), +CONST64(0x5286614343114322), CONST64(0xfc93b1c7c73bc776), CONST64(0x2be54ffcfcd7fcb3), CONST64(0x1408240404100420), +CONST64(0x08a2e351515951b2), CONST64(0xc72f2599995e99bc), CONST64(0xc4da226d6da96d4f), CONST64(0x391a650d0d340d68), +CONST64(0x35e979fafacffa83), CONST64(0x84a369dfdf5bdfb6), CONST64(0x9bfca97e7ee57ed7), CONST64(0xb44819242490243d), +CONST64(0xd776fe3b3bec3bc5), CONST64(0x3d4b9aabab96ab31), CONST64(0xd181f0cece1fce3e), CONST64(0x5522991111441188), +CONST64(0x8903838f8f068f0c), CONST64(0x6b9c044e4e254e4a), CONST64(0x517366b7b7e6b7d1), CONST64(0x60cbe0ebeb8beb0b), +CONST64(0xcc78c13c3cf03cfd), CONST64(0xbf1ffd81813e817c), CONST64(0xfe354094946a94d4), CONST64(0x0cf31cf7f7fbf7eb), +CONST64(0x676f18b9b9deb9a1), CONST64(0x5f268b13134c1398), CONST64(0x9c58512c2cb02c7d), CONST64(0xb8bb05d3d36bd3d6), +CONST64(0x5cd38ce7e7bbe76b), CONST64(0xcbdc396e6ea56e57), CONST64(0xf395aac4c437c46e), CONST64(0x0f061b03030c0318), +CONST64(0x13acdc565645568a), CONST64(0x49885e44440d441a), CONST64(0x9efea07f7fe17fdf), CONST64(0x374f88a9a99ea921), +CONST64(0x8254672a2aa82a4d), CONST64(0x6d6b0abbbbd6bbb1), CONST64(0xe29f87c1c123c146), CONST64(0x02a6f153535153a2), +CONST64(0x8ba572dcdc57dcae), CONST64(0x2716530b0b2c0b58), CONST64(0xd327019d9d4e9d9c), CONST64(0xc1d82b6c6cad6c47), +CONST64(0xf562a43131c43195), CONST64(0xb9e8f37474cd7487), CONST64(0x09f115f6f6fff6e3), CONST64(0x438c4c464605460a), +CONST64(0x2645a5acac8aac09), CONST64(0x970fb589891e893c), CONST64(0x4428b414145014a0), CONST64(0x42dfbae1e1a3e15b), +CONST64(0x4e2ca616165816b0), CONST64(0xd274f73a3ae83acd), CONST64(0xd0d2066969b9696f), CONST64(0x2d12410909240948), +CONST64(0xade0d77070dd70a7), CONST64(0x54716fb6b6e2b6d9), CONST64(0xb7bd1ed0d067d0ce), CONST64(0x7ec7d6eded93ed3b), +CONST64(0xdb85e2cccc17cc2e), CONST64(0x578468424215422a), CONST64(0xc22d2c98985a98b4), CONST64(0x0e55eda4a4aaa449), CONST64(0x8850752828a0285d), CONST64(0x31b8865c5c6d5cda), CONST64(0x3fed6bf8f8c7f893), CONST64(0xa411c28686228644) }; static const ulong64 sbox4[] = { -CONST64(0xc07830d818186018), CONST64(0x05af462623238c23), CONST64(0x7ef991b8c6c63fc6), CONST64(0x136fcdfbe8e887e8), -CONST64(0x4ca113cb87872687), CONST64(0xa9626d11b8b8dab8), CONST64(0x0805020901010401), CONST64(0x426e9e0d4f4f214f), -CONST64(0xadee6c9b3636d836), CONST64(0x590451ffa6a6a2a6), CONST64(0xdebdb90cd2d26fd2), CONST64(0xfb06f70ef5f5f3f5), -CONST64(0xef80f2967979f979), CONST64(0x5fcede306f6fa16f), CONST64(0xfcef3f6d91917e91), CONST64(0xaa07a4f852525552), -CONST64(0x27fdc04760609d60), CONST64(0x89766535bcbccabc), CONST64(0xaccd2b379b9b569b), CONST64(0x048c018a8e8e028e), -CONST64(0x71155bd2a3a3b6a3), CONST64(0x603c186c0c0c300c), CONST64(0xff8af6847b7bf17b), CONST64(0xb5e16a803535d435), -CONST64(0xe8693af51d1d741d), CONST64(0x5347ddb3e0e0a7e0), CONST64(0xf6acb321d7d77bd7), CONST64(0x5eed999cc2c22fc2), -CONST64(0x6d965c432e2eb82e), CONST64(0x627a96294b4b314b), CONST64(0xa321e15dfefedffe), CONST64(0x8216aed557574157), -CONST64(0xa8412abd15155415), CONST64(0x9fb6eee87777c177), CONST64(0xa5eb6e923737dc37), CONST64(0x7b56d79ee5e5b3e5), -CONST64(0x8cd923139f9f469f), CONST64(0xd317fd23f0f0e7f0), CONST64(0x6a7f94204a4a354a), CONST64(0x9e95a944dada4fda), -CONST64(0xfa25b0a258587d58), CONST64(0x06ca8fcfc9c903c9), CONST64(0x558d527c2929a429), CONST64(0x5022145a0a0a280a), -CONST64(0xe14f7f50b1b1feb1), CONST64(0x691a5dc9a0a0baa0), CONST64(0x7fdad6146b6bb16b), CONST64(0x5cab17d985852e85), -CONST64(0x8173673cbdbdcebd), CONST64(0xd234ba8f5d5d695d), CONST64(0x8050209010104010), CONST64(0xf303f507f4f4f7f4), -CONST64(0x16c08bddcbcb0bcb), CONST64(0xedc67cd33e3ef83e), CONST64(0x28110a2d05051405), CONST64(0x1fe6ce7867678167), -CONST64(0x7353d597e4e4b7e4), CONST64(0x25bb4e0227279c27), CONST64(0x3258827341411941), CONST64(0x2c9d0ba78b8b168b), -CONST64(0x510153f6a7a7a6a7), CONST64(0xcf94fab27d7de97d), CONST64(0xdcfb374995956e95), CONST64(0x8e9fad56d8d847d8), -CONST64(0x8b30eb70fbfbcbfb), CONST64(0x2371c1cdeeee9fee), CONST64(0xc791f8bb7c7ced7c), CONST64(0x17e3cc7166668566), -CONST64(0xa68ea77bdddd53dd), CONST64(0xb84b2eaf17175c17), CONST64(0x02468e4547470147), CONST64(0x84dc211a9e9e429e), -CONST64(0x1ec589d4caca0fca), CONST64(0x75995a582d2db42d), CONST64(0x9179632ebfbfc6bf), CONST64(0x381b0e3f07071c07), -CONST64(0x012347acadad8ead), CONST64(0xea2fb4b05a5a755a), CONST64(0x6cb51bef83833683), CONST64(0x85ff66b63333cc33), -CONST64(0x3ff2c65c63639163), CONST64(0x100a041202020802), CONST64(0x39384993aaaa92aa), CONST64(0xafa8e2de7171d971), -CONST64(0x0ecf8dc6c8c807c8), CONST64(0xc87d32d119196419), CONST64(0x7270923b49493949), CONST64(0x869aaf5fd9d943d9), -CONST64(0xc31df931f2f2eff2), CONST64(0x4b48dba8e3e3abe3), CONST64(0xe22ab6b95b5b715b), CONST64(0x34920dbc88881a88), -CONST64(0xa4c8293e9a9a529a), CONST64(0x2dbe4c0b26269826), CONST64(0x8dfa64bf3232c832), CONST64(0xe94a7d59b0b0fab0), -CONST64(0x1b6acff2e9e983e9), CONST64(0x78331e770f0f3c0f), CONST64(0xe6a6b733d5d573d5), CONST64(0x74ba1df480803a80), -CONST64(0x997c6127bebec2be), CONST64(0x26de87ebcdcd13cd), CONST64(0xbde468893434d034), CONST64(0x7a75903248483d48), -CONST64(0xab24e354ffffdbff), CONST64(0xf78ff48d7a7af57a), CONST64(0xf4ea3d6490907a90), CONST64(0xc23ebe9d5f5f615f), -CONST64(0x1da0403d20208020), CONST64(0x67d5d00f6868bd68), CONST64(0xd07234ca1a1a681a), CONST64(0x192c41b7aeae82ae), -CONST64(0xc95e757db4b4eab4), CONST64(0x9a19a8ce54544d54), CONST64(0xece53b7f93937693), CONST64(0x0daa442f22228822), -CONST64(0x07e9c86364648d64), CONST64(0xdb12ff2af1f1e3f1), CONST64(0xbfa2e6cc7373d173), CONST64(0x905a248212124812), -CONST64(0x3a5d807a40401d40), CONST64(0x4028104808082008), CONST64(0x56e89b95c3c32bc3), CONST64(0x337bc5dfecec97ec), -CONST64(0x9690ab4ddbdb4bdb), CONST64(0x611f5fc0a1a1bea1), CONST64(0x1c8307918d8d0e8d), CONST64(0xf5c97ac83d3df43d), -CONST64(0xccf1335b97976697), CONST64(0x0000000000000000), CONST64(0x36d483f9cfcf1bcf), CONST64(0x4587566e2b2bac2b), -CONST64(0x97b3ece17676c576), CONST64(0x64b019e682823282), CONST64(0xfea9b128d6d67fd6), CONST64(0xd87736c31b1b6c1b), -CONST64(0xc15b7774b5b5eeb5), CONST64(0x112943beafaf86af), CONST64(0x77dfd41d6a6ab56a), CONST64(0xba0da0ea50505d50), -CONST64(0x124c8a5745450945), CONST64(0xcb18fb38f3f3ebf3), CONST64(0x9df060ad3030c030), CONST64(0x2b74c3c4efef9bef), -CONST64(0xe5c37eda3f3ffc3f), CONST64(0x921caac755554955), CONST64(0x791059dba2a2b2a2), CONST64(0x0365c9e9eaea8fea), -CONST64(0x0fecca6a65658965), CONST64(0xb9686903babad2ba), CONST64(0x65935e4a2f2fbc2f), CONST64(0x4ee79d8ec0c027c0), -CONST64(0xbe81a160dede5fde), CONST64(0xe06c38fc1c1c701c), CONST64(0xbb2ee746fdfdd3fd), CONST64(0x52649a1f4d4d294d), -CONST64(0xe4e0397692927292), CONST64(0x8fbceafa7575c975), CONST64(0x301e0c3606061806), CONST64(0x249809ae8a8a128a), -CONST64(0xf940794bb2b2f2b2), CONST64(0x6359d185e6e6bfe6), CONST64(0x70361c7e0e0e380e), CONST64(0xf8633ee71f1f7c1f), -CONST64(0x37f7c45562629562), CONST64(0xeea3b53ad4d477d4), CONST64(0x29324d81a8a89aa8), CONST64(0xc4f4315296966296), -CONST64(0x9b3aef62f9f9c3f9), CONST64(0x66f697a3c5c533c5), CONST64(0x35b14a1025259425), CONST64(0xf220b2ab59597959), -CONST64(0x54ae15d084842a84), CONST64(0xb7a7e4c57272d572), CONST64(0xd5dd72ec3939e439), CONST64(0x5a6198164c4c2d4c), -CONST64(0xca3bbc945e5e655e), CONST64(0xe785f09f7878fd78), CONST64(0xddd870e53838e038), CONST64(0x148605988c8c0a8c), -CONST64(0xc6b2bf17d1d163d1), CONST64(0x410b57e4a5a5aea5), CONST64(0x434dd9a1e2e2afe2), CONST64(0x2ff8c24e61619961), -CONST64(0xf1457b42b3b3f6b3), CONST64(0x15a5423421218421), CONST64(0x94d625089c9c4a9c), CONST64(0xf0663cee1e1e781e), -CONST64(0x2252866143431143), CONST64(0x76fc93b1c7c73bc7), CONST64(0xb32be54ffcfcd7fc), CONST64(0x2014082404041004), -CONST64(0xb208a2e351515951), CONST64(0xbcc72f2599995e99), CONST64(0x4fc4da226d6da96d), CONST64(0x68391a650d0d340d), -CONST64(0x8335e979fafacffa), CONST64(0xb684a369dfdf5bdf), CONST64(0xd79bfca97e7ee57e), CONST64(0x3db4481924249024), -CONST64(0xc5d776fe3b3bec3b), CONST64(0x313d4b9aabab96ab), CONST64(0x3ed181f0cece1fce), CONST64(0x8855229911114411), -CONST64(0x0c8903838f8f068f), CONST64(0x4a6b9c044e4e254e), CONST64(0xd1517366b7b7e6b7), CONST64(0x0b60cbe0ebeb8beb), -CONST64(0xfdcc78c13c3cf03c), CONST64(0x7cbf1ffd81813e81), CONST64(0xd4fe354094946a94), CONST64(0xeb0cf31cf7f7fbf7), -CONST64(0xa1676f18b9b9deb9), CONST64(0x985f268b13134c13), CONST64(0x7d9c58512c2cb02c), CONST64(0xd6b8bb05d3d36bd3), -CONST64(0x6b5cd38ce7e7bbe7), CONST64(0x57cbdc396e6ea56e), CONST64(0x6ef395aac4c437c4), CONST64(0x180f061b03030c03), -CONST64(0x8a13acdc56564556), CONST64(0x1a49885e44440d44), CONST64(0xdf9efea07f7fe17f), CONST64(0x21374f88a9a99ea9), -CONST64(0x4d8254672a2aa82a), CONST64(0xb16d6b0abbbbd6bb), CONST64(0x46e29f87c1c123c1), CONST64(0xa202a6f153535153), -CONST64(0xae8ba572dcdc57dc), CONST64(0x582716530b0b2c0b), CONST64(0x9cd327019d9d4e9d), CONST64(0x47c1d82b6c6cad6c), -CONST64(0x95f562a43131c431), CONST64(0x87b9e8f37474cd74), CONST64(0xe309f115f6f6fff6), CONST64(0x0a438c4c46460546), -CONST64(0x092645a5acac8aac), CONST64(0x3c970fb589891e89), CONST64(0xa04428b414145014), CONST64(0x5b42dfbae1e1a3e1), -CONST64(0xb04e2ca616165816), CONST64(0xcdd274f73a3ae83a), CONST64(0x6fd0d2066969b969), CONST64(0x482d124109092409), -CONST64(0xa7ade0d77070dd70), CONST64(0xd954716fb6b6e2b6), CONST64(0xceb7bd1ed0d067d0), CONST64(0x3b7ec7d6eded93ed), -CONST64(0x2edb85e2cccc17cc), CONST64(0x2a57846842421542), CONST64(0xb4c22d2c98985a98), CONST64(0x490e55eda4a4aaa4), +CONST64(0xc07830d818186018), CONST64(0x05af462623238c23), CONST64(0x7ef991b8c6c63fc6), CONST64(0x136fcdfbe8e887e8), +CONST64(0x4ca113cb87872687), CONST64(0xa9626d11b8b8dab8), CONST64(0x0805020901010401), CONST64(0x426e9e0d4f4f214f), +CONST64(0xadee6c9b3636d836), CONST64(0x590451ffa6a6a2a6), CONST64(0xdebdb90cd2d26fd2), CONST64(0xfb06f70ef5f5f3f5), +CONST64(0xef80f2967979f979), CONST64(0x5fcede306f6fa16f), CONST64(0xfcef3f6d91917e91), CONST64(0xaa07a4f852525552), +CONST64(0x27fdc04760609d60), CONST64(0x89766535bcbccabc), CONST64(0xaccd2b379b9b569b), CONST64(0x048c018a8e8e028e), +CONST64(0x71155bd2a3a3b6a3), CONST64(0x603c186c0c0c300c), CONST64(0xff8af6847b7bf17b), CONST64(0xb5e16a803535d435), +CONST64(0xe8693af51d1d741d), CONST64(0x5347ddb3e0e0a7e0), CONST64(0xf6acb321d7d77bd7), CONST64(0x5eed999cc2c22fc2), +CONST64(0x6d965c432e2eb82e), CONST64(0x627a96294b4b314b), CONST64(0xa321e15dfefedffe), CONST64(0x8216aed557574157), +CONST64(0xa8412abd15155415), CONST64(0x9fb6eee87777c177), CONST64(0xa5eb6e923737dc37), CONST64(0x7b56d79ee5e5b3e5), +CONST64(0x8cd923139f9f469f), CONST64(0xd317fd23f0f0e7f0), CONST64(0x6a7f94204a4a354a), CONST64(0x9e95a944dada4fda), +CONST64(0xfa25b0a258587d58), CONST64(0x06ca8fcfc9c903c9), CONST64(0x558d527c2929a429), CONST64(0x5022145a0a0a280a), +CONST64(0xe14f7f50b1b1feb1), CONST64(0x691a5dc9a0a0baa0), CONST64(0x7fdad6146b6bb16b), CONST64(0x5cab17d985852e85), +CONST64(0x8173673cbdbdcebd), CONST64(0xd234ba8f5d5d695d), CONST64(0x8050209010104010), CONST64(0xf303f507f4f4f7f4), +CONST64(0x16c08bddcbcb0bcb), CONST64(0xedc67cd33e3ef83e), CONST64(0x28110a2d05051405), CONST64(0x1fe6ce7867678167), +CONST64(0x7353d597e4e4b7e4), CONST64(0x25bb4e0227279c27), CONST64(0x3258827341411941), CONST64(0x2c9d0ba78b8b168b), +CONST64(0x510153f6a7a7a6a7), CONST64(0xcf94fab27d7de97d), CONST64(0xdcfb374995956e95), CONST64(0x8e9fad56d8d847d8), +CONST64(0x8b30eb70fbfbcbfb), CONST64(0x2371c1cdeeee9fee), CONST64(0xc791f8bb7c7ced7c), CONST64(0x17e3cc7166668566), +CONST64(0xa68ea77bdddd53dd), CONST64(0xb84b2eaf17175c17), CONST64(0x02468e4547470147), CONST64(0x84dc211a9e9e429e), +CONST64(0x1ec589d4caca0fca), CONST64(0x75995a582d2db42d), CONST64(0x9179632ebfbfc6bf), CONST64(0x381b0e3f07071c07), +CONST64(0x012347acadad8ead), CONST64(0xea2fb4b05a5a755a), CONST64(0x6cb51bef83833683), CONST64(0x85ff66b63333cc33), +CONST64(0x3ff2c65c63639163), CONST64(0x100a041202020802), CONST64(0x39384993aaaa92aa), CONST64(0xafa8e2de7171d971), +CONST64(0x0ecf8dc6c8c807c8), CONST64(0xc87d32d119196419), CONST64(0x7270923b49493949), CONST64(0x869aaf5fd9d943d9), +CONST64(0xc31df931f2f2eff2), CONST64(0x4b48dba8e3e3abe3), CONST64(0xe22ab6b95b5b715b), CONST64(0x34920dbc88881a88), +CONST64(0xa4c8293e9a9a529a), CONST64(0x2dbe4c0b26269826), CONST64(0x8dfa64bf3232c832), CONST64(0xe94a7d59b0b0fab0), +CONST64(0x1b6acff2e9e983e9), CONST64(0x78331e770f0f3c0f), CONST64(0xe6a6b733d5d573d5), CONST64(0x74ba1df480803a80), +CONST64(0x997c6127bebec2be), CONST64(0x26de87ebcdcd13cd), CONST64(0xbde468893434d034), CONST64(0x7a75903248483d48), +CONST64(0xab24e354ffffdbff), CONST64(0xf78ff48d7a7af57a), CONST64(0xf4ea3d6490907a90), CONST64(0xc23ebe9d5f5f615f), +CONST64(0x1da0403d20208020), CONST64(0x67d5d00f6868bd68), CONST64(0xd07234ca1a1a681a), CONST64(0x192c41b7aeae82ae), +CONST64(0xc95e757db4b4eab4), CONST64(0x9a19a8ce54544d54), CONST64(0xece53b7f93937693), CONST64(0x0daa442f22228822), +CONST64(0x07e9c86364648d64), CONST64(0xdb12ff2af1f1e3f1), CONST64(0xbfa2e6cc7373d173), CONST64(0x905a248212124812), +CONST64(0x3a5d807a40401d40), CONST64(0x4028104808082008), CONST64(0x56e89b95c3c32bc3), CONST64(0x337bc5dfecec97ec), +CONST64(0x9690ab4ddbdb4bdb), CONST64(0x611f5fc0a1a1bea1), CONST64(0x1c8307918d8d0e8d), CONST64(0xf5c97ac83d3df43d), +CONST64(0xccf1335b97976697), CONST64(0x0000000000000000), CONST64(0x36d483f9cfcf1bcf), CONST64(0x4587566e2b2bac2b), +CONST64(0x97b3ece17676c576), CONST64(0x64b019e682823282), CONST64(0xfea9b128d6d67fd6), CONST64(0xd87736c31b1b6c1b), +CONST64(0xc15b7774b5b5eeb5), CONST64(0x112943beafaf86af), CONST64(0x77dfd41d6a6ab56a), CONST64(0xba0da0ea50505d50), +CONST64(0x124c8a5745450945), CONST64(0xcb18fb38f3f3ebf3), CONST64(0x9df060ad3030c030), CONST64(0x2b74c3c4efef9bef), +CONST64(0xe5c37eda3f3ffc3f), CONST64(0x921caac755554955), CONST64(0x791059dba2a2b2a2), CONST64(0x0365c9e9eaea8fea), +CONST64(0x0fecca6a65658965), CONST64(0xb9686903babad2ba), CONST64(0x65935e4a2f2fbc2f), CONST64(0x4ee79d8ec0c027c0), +CONST64(0xbe81a160dede5fde), CONST64(0xe06c38fc1c1c701c), CONST64(0xbb2ee746fdfdd3fd), CONST64(0x52649a1f4d4d294d), +CONST64(0xe4e0397692927292), CONST64(0x8fbceafa7575c975), CONST64(0x301e0c3606061806), CONST64(0x249809ae8a8a128a), +CONST64(0xf940794bb2b2f2b2), CONST64(0x6359d185e6e6bfe6), CONST64(0x70361c7e0e0e380e), CONST64(0xf8633ee71f1f7c1f), +CONST64(0x37f7c45562629562), CONST64(0xeea3b53ad4d477d4), CONST64(0x29324d81a8a89aa8), CONST64(0xc4f4315296966296), +CONST64(0x9b3aef62f9f9c3f9), CONST64(0x66f697a3c5c533c5), CONST64(0x35b14a1025259425), CONST64(0xf220b2ab59597959), +CONST64(0x54ae15d084842a84), CONST64(0xb7a7e4c57272d572), CONST64(0xd5dd72ec3939e439), CONST64(0x5a6198164c4c2d4c), +CONST64(0xca3bbc945e5e655e), CONST64(0xe785f09f7878fd78), CONST64(0xddd870e53838e038), CONST64(0x148605988c8c0a8c), +CONST64(0xc6b2bf17d1d163d1), CONST64(0x410b57e4a5a5aea5), CONST64(0x434dd9a1e2e2afe2), CONST64(0x2ff8c24e61619961), +CONST64(0xf1457b42b3b3f6b3), CONST64(0x15a5423421218421), CONST64(0x94d625089c9c4a9c), CONST64(0xf0663cee1e1e781e), +CONST64(0x2252866143431143), CONST64(0x76fc93b1c7c73bc7), CONST64(0xb32be54ffcfcd7fc), CONST64(0x2014082404041004), +CONST64(0xb208a2e351515951), CONST64(0xbcc72f2599995e99), CONST64(0x4fc4da226d6da96d), CONST64(0x68391a650d0d340d), +CONST64(0x8335e979fafacffa), CONST64(0xb684a369dfdf5bdf), CONST64(0xd79bfca97e7ee57e), CONST64(0x3db4481924249024), +CONST64(0xc5d776fe3b3bec3b), CONST64(0x313d4b9aabab96ab), CONST64(0x3ed181f0cece1fce), CONST64(0x8855229911114411), +CONST64(0x0c8903838f8f068f), CONST64(0x4a6b9c044e4e254e), CONST64(0xd1517366b7b7e6b7), CONST64(0x0b60cbe0ebeb8beb), +CONST64(0xfdcc78c13c3cf03c), CONST64(0x7cbf1ffd81813e81), CONST64(0xd4fe354094946a94), CONST64(0xeb0cf31cf7f7fbf7), +CONST64(0xa1676f18b9b9deb9), CONST64(0x985f268b13134c13), CONST64(0x7d9c58512c2cb02c), CONST64(0xd6b8bb05d3d36bd3), +CONST64(0x6b5cd38ce7e7bbe7), CONST64(0x57cbdc396e6ea56e), CONST64(0x6ef395aac4c437c4), CONST64(0x180f061b03030c03), +CONST64(0x8a13acdc56564556), CONST64(0x1a49885e44440d44), CONST64(0xdf9efea07f7fe17f), CONST64(0x21374f88a9a99ea9), +CONST64(0x4d8254672a2aa82a), CONST64(0xb16d6b0abbbbd6bb), CONST64(0x46e29f87c1c123c1), CONST64(0xa202a6f153535153), +CONST64(0xae8ba572dcdc57dc), CONST64(0x582716530b0b2c0b), CONST64(0x9cd327019d9d4e9d), CONST64(0x47c1d82b6c6cad6c), +CONST64(0x95f562a43131c431), CONST64(0x87b9e8f37474cd74), CONST64(0xe309f115f6f6fff6), CONST64(0x0a438c4c46460546), +CONST64(0x092645a5acac8aac), CONST64(0x3c970fb589891e89), CONST64(0xa04428b414145014), CONST64(0x5b42dfbae1e1a3e1), +CONST64(0xb04e2ca616165816), CONST64(0xcdd274f73a3ae83a), CONST64(0x6fd0d2066969b969), CONST64(0x482d124109092409), +CONST64(0xa7ade0d77070dd70), CONST64(0xd954716fb6b6e2b6), CONST64(0xceb7bd1ed0d067d0), CONST64(0x3b7ec7d6eded93ed), +CONST64(0x2edb85e2cccc17cc), CONST64(0x2a57846842421542), CONST64(0xb4c22d2c98985a98), CONST64(0x490e55eda4a4aaa4), CONST64(0x5d8850752828a028), CONST64(0xda31b8865c5c6d5c), CONST64(0x933fed6bf8f8c7f8), CONST64(0x44a411c286862286) }; static const ulong64 sbox5[] = { -CONST64(0x18c07830d8181860), CONST64(0x2305af462623238c), CONST64(0xc67ef991b8c6c63f), CONST64(0xe8136fcdfbe8e887), -CONST64(0x874ca113cb878726), CONST64(0xb8a9626d11b8b8da), CONST64(0x0108050209010104), CONST64(0x4f426e9e0d4f4f21), -CONST64(0x36adee6c9b3636d8), CONST64(0xa6590451ffa6a6a2), CONST64(0xd2debdb90cd2d26f), CONST64(0xf5fb06f70ef5f5f3), -CONST64(0x79ef80f2967979f9), CONST64(0x6f5fcede306f6fa1), CONST64(0x91fcef3f6d91917e), CONST64(0x52aa07a4f8525255), -CONST64(0x6027fdc04760609d), CONST64(0xbc89766535bcbcca), CONST64(0x9baccd2b379b9b56), CONST64(0x8e048c018a8e8e02), -CONST64(0xa371155bd2a3a3b6), CONST64(0x0c603c186c0c0c30), CONST64(0x7bff8af6847b7bf1), CONST64(0x35b5e16a803535d4), -CONST64(0x1de8693af51d1d74), CONST64(0xe05347ddb3e0e0a7), CONST64(0xd7f6acb321d7d77b), CONST64(0xc25eed999cc2c22f), -CONST64(0x2e6d965c432e2eb8), CONST64(0x4b627a96294b4b31), CONST64(0xfea321e15dfefedf), CONST64(0x578216aed5575741), -CONST64(0x15a8412abd151554), CONST64(0x779fb6eee87777c1), CONST64(0x37a5eb6e923737dc), CONST64(0xe57b56d79ee5e5b3), -CONST64(0x9f8cd923139f9f46), CONST64(0xf0d317fd23f0f0e7), CONST64(0x4a6a7f94204a4a35), CONST64(0xda9e95a944dada4f), -CONST64(0x58fa25b0a258587d), CONST64(0xc906ca8fcfc9c903), CONST64(0x29558d527c2929a4), CONST64(0x0a5022145a0a0a28), -CONST64(0xb1e14f7f50b1b1fe), CONST64(0xa0691a5dc9a0a0ba), CONST64(0x6b7fdad6146b6bb1), CONST64(0x855cab17d985852e), -CONST64(0xbd8173673cbdbdce), CONST64(0x5dd234ba8f5d5d69), CONST64(0x1080502090101040), CONST64(0xf4f303f507f4f4f7), -CONST64(0xcb16c08bddcbcb0b), CONST64(0x3eedc67cd33e3ef8), CONST64(0x0528110a2d050514), CONST64(0x671fe6ce78676781), -CONST64(0xe47353d597e4e4b7), CONST64(0x2725bb4e0227279c), CONST64(0x4132588273414119), CONST64(0x8b2c9d0ba78b8b16), -CONST64(0xa7510153f6a7a7a6), CONST64(0x7dcf94fab27d7de9), CONST64(0x95dcfb374995956e), CONST64(0xd88e9fad56d8d847), -CONST64(0xfb8b30eb70fbfbcb), CONST64(0xee2371c1cdeeee9f), CONST64(0x7cc791f8bb7c7ced), CONST64(0x6617e3cc71666685), -CONST64(0xdda68ea77bdddd53), CONST64(0x17b84b2eaf17175c), CONST64(0x4702468e45474701), CONST64(0x9e84dc211a9e9e42), -CONST64(0xca1ec589d4caca0f), CONST64(0x2d75995a582d2db4), CONST64(0xbf9179632ebfbfc6), CONST64(0x07381b0e3f07071c), -CONST64(0xad012347acadad8e), CONST64(0x5aea2fb4b05a5a75), CONST64(0x836cb51bef838336), CONST64(0x3385ff66b63333cc), -CONST64(0x633ff2c65c636391), CONST64(0x02100a0412020208), CONST64(0xaa39384993aaaa92), CONST64(0x71afa8e2de7171d9), -CONST64(0xc80ecf8dc6c8c807), CONST64(0x19c87d32d1191964), CONST64(0x497270923b494939), CONST64(0xd9869aaf5fd9d943), -CONST64(0xf2c31df931f2f2ef), CONST64(0xe34b48dba8e3e3ab), CONST64(0x5be22ab6b95b5b71), CONST64(0x8834920dbc88881a), -CONST64(0x9aa4c8293e9a9a52), CONST64(0x262dbe4c0b262698), CONST64(0x328dfa64bf3232c8), CONST64(0xb0e94a7d59b0b0fa), -CONST64(0xe91b6acff2e9e983), CONST64(0x0f78331e770f0f3c), CONST64(0xd5e6a6b733d5d573), CONST64(0x8074ba1df480803a), -CONST64(0xbe997c6127bebec2), CONST64(0xcd26de87ebcdcd13), CONST64(0x34bde468893434d0), CONST64(0x487a75903248483d), -CONST64(0xffab24e354ffffdb), CONST64(0x7af78ff48d7a7af5), CONST64(0x90f4ea3d6490907a), CONST64(0x5fc23ebe9d5f5f61), -CONST64(0x201da0403d202080), CONST64(0x6867d5d00f6868bd), CONST64(0x1ad07234ca1a1a68), CONST64(0xae192c41b7aeae82), -CONST64(0xb4c95e757db4b4ea), CONST64(0x549a19a8ce54544d), CONST64(0x93ece53b7f939376), CONST64(0x220daa442f222288), -CONST64(0x6407e9c86364648d), CONST64(0xf1db12ff2af1f1e3), CONST64(0x73bfa2e6cc7373d1), CONST64(0x12905a2482121248), -CONST64(0x403a5d807a40401d), CONST64(0x0840281048080820), CONST64(0xc356e89b95c3c32b), CONST64(0xec337bc5dfecec97), -CONST64(0xdb9690ab4ddbdb4b), CONST64(0xa1611f5fc0a1a1be), CONST64(0x8d1c8307918d8d0e), CONST64(0x3df5c97ac83d3df4), -CONST64(0x97ccf1335b979766), CONST64(0x0000000000000000), CONST64(0xcf36d483f9cfcf1b), CONST64(0x2b4587566e2b2bac), -CONST64(0x7697b3ece17676c5), CONST64(0x8264b019e6828232), CONST64(0xd6fea9b128d6d67f), CONST64(0x1bd87736c31b1b6c), -CONST64(0xb5c15b7774b5b5ee), CONST64(0xaf112943beafaf86), CONST64(0x6a77dfd41d6a6ab5), CONST64(0x50ba0da0ea50505d), -CONST64(0x45124c8a57454509), CONST64(0xf3cb18fb38f3f3eb), CONST64(0x309df060ad3030c0), CONST64(0xef2b74c3c4efef9b), -CONST64(0x3fe5c37eda3f3ffc), CONST64(0x55921caac7555549), CONST64(0xa2791059dba2a2b2), CONST64(0xea0365c9e9eaea8f), -CONST64(0x650fecca6a656589), CONST64(0xbab9686903babad2), CONST64(0x2f65935e4a2f2fbc), CONST64(0xc04ee79d8ec0c027), -CONST64(0xdebe81a160dede5f), CONST64(0x1ce06c38fc1c1c70), CONST64(0xfdbb2ee746fdfdd3), CONST64(0x4d52649a1f4d4d29), -CONST64(0x92e4e03976929272), CONST64(0x758fbceafa7575c9), CONST64(0x06301e0c36060618), CONST64(0x8a249809ae8a8a12), -CONST64(0xb2f940794bb2b2f2), CONST64(0xe66359d185e6e6bf), CONST64(0x0e70361c7e0e0e38), CONST64(0x1ff8633ee71f1f7c), -CONST64(0x6237f7c455626295), CONST64(0xd4eea3b53ad4d477), CONST64(0xa829324d81a8a89a), CONST64(0x96c4f43152969662), -CONST64(0xf99b3aef62f9f9c3), CONST64(0xc566f697a3c5c533), CONST64(0x2535b14a10252594), CONST64(0x59f220b2ab595979), -CONST64(0x8454ae15d084842a), CONST64(0x72b7a7e4c57272d5), CONST64(0x39d5dd72ec3939e4), CONST64(0x4c5a6198164c4c2d), -CONST64(0x5eca3bbc945e5e65), CONST64(0x78e785f09f7878fd), CONST64(0x38ddd870e53838e0), CONST64(0x8c148605988c8c0a), -CONST64(0xd1c6b2bf17d1d163), CONST64(0xa5410b57e4a5a5ae), CONST64(0xe2434dd9a1e2e2af), CONST64(0x612ff8c24e616199), -CONST64(0xb3f1457b42b3b3f6), CONST64(0x2115a54234212184), CONST64(0x9c94d625089c9c4a), CONST64(0x1ef0663cee1e1e78), -CONST64(0x4322528661434311), CONST64(0xc776fc93b1c7c73b), CONST64(0xfcb32be54ffcfcd7), CONST64(0x0420140824040410), -CONST64(0x51b208a2e3515159), CONST64(0x99bcc72f2599995e), CONST64(0x6d4fc4da226d6da9), CONST64(0x0d68391a650d0d34), -CONST64(0xfa8335e979fafacf), CONST64(0xdfb684a369dfdf5b), CONST64(0x7ed79bfca97e7ee5), CONST64(0x243db44819242490), -CONST64(0x3bc5d776fe3b3bec), CONST64(0xab313d4b9aabab96), CONST64(0xce3ed181f0cece1f), CONST64(0x1188552299111144), -CONST64(0x8f0c8903838f8f06), CONST64(0x4e4a6b9c044e4e25), CONST64(0xb7d1517366b7b7e6), CONST64(0xeb0b60cbe0ebeb8b), -CONST64(0x3cfdcc78c13c3cf0), CONST64(0x817cbf1ffd81813e), CONST64(0x94d4fe354094946a), CONST64(0xf7eb0cf31cf7f7fb), -CONST64(0xb9a1676f18b9b9de), CONST64(0x13985f268b13134c), CONST64(0x2c7d9c58512c2cb0), CONST64(0xd3d6b8bb05d3d36b), -CONST64(0xe76b5cd38ce7e7bb), CONST64(0x6e57cbdc396e6ea5), CONST64(0xc46ef395aac4c437), CONST64(0x03180f061b03030c), -CONST64(0x568a13acdc565645), CONST64(0x441a49885e44440d), CONST64(0x7fdf9efea07f7fe1), CONST64(0xa921374f88a9a99e), -CONST64(0x2a4d8254672a2aa8), CONST64(0xbbb16d6b0abbbbd6), CONST64(0xc146e29f87c1c123), CONST64(0x53a202a6f1535351), -CONST64(0xdcae8ba572dcdc57), CONST64(0x0b582716530b0b2c), CONST64(0x9d9cd327019d9d4e), CONST64(0x6c47c1d82b6c6cad), -CONST64(0x3195f562a43131c4), CONST64(0x7487b9e8f37474cd), CONST64(0xf6e309f115f6f6ff), CONST64(0x460a438c4c464605), -CONST64(0xac092645a5acac8a), CONST64(0x893c970fb589891e), CONST64(0x14a04428b4141450), CONST64(0xe15b42dfbae1e1a3), -CONST64(0x16b04e2ca6161658), CONST64(0x3acdd274f73a3ae8), CONST64(0x696fd0d2066969b9), CONST64(0x09482d1241090924), -CONST64(0x70a7ade0d77070dd), CONST64(0xb6d954716fb6b6e2), CONST64(0xd0ceb7bd1ed0d067), CONST64(0xed3b7ec7d6eded93), -CONST64(0xcc2edb85e2cccc17), CONST64(0x422a578468424215), CONST64(0x98b4c22d2c98985a), CONST64(0xa4490e55eda4a4aa), +CONST64(0x18c07830d8181860), CONST64(0x2305af462623238c), CONST64(0xc67ef991b8c6c63f), CONST64(0xe8136fcdfbe8e887), +CONST64(0x874ca113cb878726), CONST64(0xb8a9626d11b8b8da), CONST64(0x0108050209010104), CONST64(0x4f426e9e0d4f4f21), +CONST64(0x36adee6c9b3636d8), CONST64(0xa6590451ffa6a6a2), CONST64(0xd2debdb90cd2d26f), CONST64(0xf5fb06f70ef5f5f3), +CONST64(0x79ef80f2967979f9), CONST64(0x6f5fcede306f6fa1), CONST64(0x91fcef3f6d91917e), CONST64(0x52aa07a4f8525255), +CONST64(0x6027fdc04760609d), CONST64(0xbc89766535bcbcca), CONST64(0x9baccd2b379b9b56), CONST64(0x8e048c018a8e8e02), +CONST64(0xa371155bd2a3a3b6), CONST64(0x0c603c186c0c0c30), CONST64(0x7bff8af6847b7bf1), CONST64(0x35b5e16a803535d4), +CONST64(0x1de8693af51d1d74), CONST64(0xe05347ddb3e0e0a7), CONST64(0xd7f6acb321d7d77b), CONST64(0xc25eed999cc2c22f), +CONST64(0x2e6d965c432e2eb8), CONST64(0x4b627a96294b4b31), CONST64(0xfea321e15dfefedf), CONST64(0x578216aed5575741), +CONST64(0x15a8412abd151554), CONST64(0x779fb6eee87777c1), CONST64(0x37a5eb6e923737dc), CONST64(0xe57b56d79ee5e5b3), +CONST64(0x9f8cd923139f9f46), CONST64(0xf0d317fd23f0f0e7), CONST64(0x4a6a7f94204a4a35), CONST64(0xda9e95a944dada4f), +CONST64(0x58fa25b0a258587d), CONST64(0xc906ca8fcfc9c903), CONST64(0x29558d527c2929a4), CONST64(0x0a5022145a0a0a28), +CONST64(0xb1e14f7f50b1b1fe), CONST64(0xa0691a5dc9a0a0ba), CONST64(0x6b7fdad6146b6bb1), CONST64(0x855cab17d985852e), +CONST64(0xbd8173673cbdbdce), CONST64(0x5dd234ba8f5d5d69), CONST64(0x1080502090101040), CONST64(0xf4f303f507f4f4f7), +CONST64(0xcb16c08bddcbcb0b), CONST64(0x3eedc67cd33e3ef8), CONST64(0x0528110a2d050514), CONST64(0x671fe6ce78676781), +CONST64(0xe47353d597e4e4b7), CONST64(0x2725bb4e0227279c), CONST64(0x4132588273414119), CONST64(0x8b2c9d0ba78b8b16), +CONST64(0xa7510153f6a7a7a6), CONST64(0x7dcf94fab27d7de9), CONST64(0x95dcfb374995956e), CONST64(0xd88e9fad56d8d847), +CONST64(0xfb8b30eb70fbfbcb), CONST64(0xee2371c1cdeeee9f), CONST64(0x7cc791f8bb7c7ced), CONST64(0x6617e3cc71666685), +CONST64(0xdda68ea77bdddd53), CONST64(0x17b84b2eaf17175c), CONST64(0x4702468e45474701), CONST64(0x9e84dc211a9e9e42), +CONST64(0xca1ec589d4caca0f), CONST64(0x2d75995a582d2db4), CONST64(0xbf9179632ebfbfc6), CONST64(0x07381b0e3f07071c), +CONST64(0xad012347acadad8e), CONST64(0x5aea2fb4b05a5a75), CONST64(0x836cb51bef838336), CONST64(0x3385ff66b63333cc), +CONST64(0x633ff2c65c636391), CONST64(0x02100a0412020208), CONST64(0xaa39384993aaaa92), CONST64(0x71afa8e2de7171d9), +CONST64(0xc80ecf8dc6c8c807), CONST64(0x19c87d32d1191964), CONST64(0x497270923b494939), CONST64(0xd9869aaf5fd9d943), +CONST64(0xf2c31df931f2f2ef), CONST64(0xe34b48dba8e3e3ab), CONST64(0x5be22ab6b95b5b71), CONST64(0x8834920dbc88881a), +CONST64(0x9aa4c8293e9a9a52), CONST64(0x262dbe4c0b262698), CONST64(0x328dfa64bf3232c8), CONST64(0xb0e94a7d59b0b0fa), +CONST64(0xe91b6acff2e9e983), CONST64(0x0f78331e770f0f3c), CONST64(0xd5e6a6b733d5d573), CONST64(0x8074ba1df480803a), +CONST64(0xbe997c6127bebec2), CONST64(0xcd26de87ebcdcd13), CONST64(0x34bde468893434d0), CONST64(0x487a75903248483d), +CONST64(0xffab24e354ffffdb), CONST64(0x7af78ff48d7a7af5), CONST64(0x90f4ea3d6490907a), CONST64(0x5fc23ebe9d5f5f61), +CONST64(0x201da0403d202080), CONST64(0x6867d5d00f6868bd), CONST64(0x1ad07234ca1a1a68), CONST64(0xae192c41b7aeae82), +CONST64(0xb4c95e757db4b4ea), CONST64(0x549a19a8ce54544d), CONST64(0x93ece53b7f939376), CONST64(0x220daa442f222288), +CONST64(0x6407e9c86364648d), CONST64(0xf1db12ff2af1f1e3), CONST64(0x73bfa2e6cc7373d1), CONST64(0x12905a2482121248), +CONST64(0x403a5d807a40401d), CONST64(0x0840281048080820), CONST64(0xc356e89b95c3c32b), CONST64(0xec337bc5dfecec97), +CONST64(0xdb9690ab4ddbdb4b), CONST64(0xa1611f5fc0a1a1be), CONST64(0x8d1c8307918d8d0e), CONST64(0x3df5c97ac83d3df4), +CONST64(0x97ccf1335b979766), CONST64(0x0000000000000000), CONST64(0xcf36d483f9cfcf1b), CONST64(0x2b4587566e2b2bac), +CONST64(0x7697b3ece17676c5), CONST64(0x8264b019e6828232), CONST64(0xd6fea9b128d6d67f), CONST64(0x1bd87736c31b1b6c), +CONST64(0xb5c15b7774b5b5ee), CONST64(0xaf112943beafaf86), CONST64(0x6a77dfd41d6a6ab5), CONST64(0x50ba0da0ea50505d), +CONST64(0x45124c8a57454509), CONST64(0xf3cb18fb38f3f3eb), CONST64(0x309df060ad3030c0), CONST64(0xef2b74c3c4efef9b), +CONST64(0x3fe5c37eda3f3ffc), CONST64(0x55921caac7555549), CONST64(0xa2791059dba2a2b2), CONST64(0xea0365c9e9eaea8f), +CONST64(0x650fecca6a656589), CONST64(0xbab9686903babad2), CONST64(0x2f65935e4a2f2fbc), CONST64(0xc04ee79d8ec0c027), +CONST64(0xdebe81a160dede5f), CONST64(0x1ce06c38fc1c1c70), CONST64(0xfdbb2ee746fdfdd3), CONST64(0x4d52649a1f4d4d29), +CONST64(0x92e4e03976929272), CONST64(0x758fbceafa7575c9), CONST64(0x06301e0c36060618), CONST64(0x8a249809ae8a8a12), +CONST64(0xb2f940794bb2b2f2), CONST64(0xe66359d185e6e6bf), CONST64(0x0e70361c7e0e0e38), CONST64(0x1ff8633ee71f1f7c), +CONST64(0x6237f7c455626295), CONST64(0xd4eea3b53ad4d477), CONST64(0xa829324d81a8a89a), CONST64(0x96c4f43152969662), +CONST64(0xf99b3aef62f9f9c3), CONST64(0xc566f697a3c5c533), CONST64(0x2535b14a10252594), CONST64(0x59f220b2ab595979), +CONST64(0x8454ae15d084842a), CONST64(0x72b7a7e4c57272d5), CONST64(0x39d5dd72ec3939e4), CONST64(0x4c5a6198164c4c2d), +CONST64(0x5eca3bbc945e5e65), CONST64(0x78e785f09f7878fd), CONST64(0x38ddd870e53838e0), CONST64(0x8c148605988c8c0a), +CONST64(0xd1c6b2bf17d1d163), CONST64(0xa5410b57e4a5a5ae), CONST64(0xe2434dd9a1e2e2af), CONST64(0x612ff8c24e616199), +CONST64(0xb3f1457b42b3b3f6), CONST64(0x2115a54234212184), CONST64(0x9c94d625089c9c4a), CONST64(0x1ef0663cee1e1e78), +CONST64(0x4322528661434311), CONST64(0xc776fc93b1c7c73b), CONST64(0xfcb32be54ffcfcd7), CONST64(0x0420140824040410), +CONST64(0x51b208a2e3515159), CONST64(0x99bcc72f2599995e), CONST64(0x6d4fc4da226d6da9), CONST64(0x0d68391a650d0d34), +CONST64(0xfa8335e979fafacf), CONST64(0xdfb684a369dfdf5b), CONST64(0x7ed79bfca97e7ee5), CONST64(0x243db44819242490), +CONST64(0x3bc5d776fe3b3bec), CONST64(0xab313d4b9aabab96), CONST64(0xce3ed181f0cece1f), CONST64(0x1188552299111144), +CONST64(0x8f0c8903838f8f06), CONST64(0x4e4a6b9c044e4e25), CONST64(0xb7d1517366b7b7e6), CONST64(0xeb0b60cbe0ebeb8b), +CONST64(0x3cfdcc78c13c3cf0), CONST64(0x817cbf1ffd81813e), CONST64(0x94d4fe354094946a), CONST64(0xf7eb0cf31cf7f7fb), +CONST64(0xb9a1676f18b9b9de), CONST64(0x13985f268b13134c), CONST64(0x2c7d9c58512c2cb0), CONST64(0xd3d6b8bb05d3d36b), +CONST64(0xe76b5cd38ce7e7bb), CONST64(0x6e57cbdc396e6ea5), CONST64(0xc46ef395aac4c437), CONST64(0x03180f061b03030c), +CONST64(0x568a13acdc565645), CONST64(0x441a49885e44440d), CONST64(0x7fdf9efea07f7fe1), CONST64(0xa921374f88a9a99e), +CONST64(0x2a4d8254672a2aa8), CONST64(0xbbb16d6b0abbbbd6), CONST64(0xc146e29f87c1c123), CONST64(0x53a202a6f1535351), +CONST64(0xdcae8ba572dcdc57), CONST64(0x0b582716530b0b2c), CONST64(0x9d9cd327019d9d4e), CONST64(0x6c47c1d82b6c6cad), +CONST64(0x3195f562a43131c4), CONST64(0x7487b9e8f37474cd), CONST64(0xf6e309f115f6f6ff), CONST64(0x460a438c4c464605), +CONST64(0xac092645a5acac8a), CONST64(0x893c970fb589891e), CONST64(0x14a04428b4141450), CONST64(0xe15b42dfbae1e1a3), +CONST64(0x16b04e2ca6161658), CONST64(0x3acdd274f73a3ae8), CONST64(0x696fd0d2066969b9), CONST64(0x09482d1241090924), +CONST64(0x70a7ade0d77070dd), CONST64(0xb6d954716fb6b6e2), CONST64(0xd0ceb7bd1ed0d067), CONST64(0xed3b7ec7d6eded93), +CONST64(0xcc2edb85e2cccc17), CONST64(0x422a578468424215), CONST64(0x98b4c22d2c98985a), CONST64(0xa4490e55eda4a4aa), CONST64(0x285d8850752828a0), CONST64(0x5cda31b8865c5c6d), CONST64(0xf8933fed6bf8f8c7), CONST64(0x8644a411c2868622) }; static const ulong64 sbox6[] = { -CONST64(0x6018c07830d81818), CONST64(0x8c2305af46262323), CONST64(0x3fc67ef991b8c6c6), CONST64(0x87e8136fcdfbe8e8), -CONST64(0x26874ca113cb8787), CONST64(0xdab8a9626d11b8b8), CONST64(0x0401080502090101), CONST64(0x214f426e9e0d4f4f), -CONST64(0xd836adee6c9b3636), CONST64(0xa2a6590451ffa6a6), CONST64(0x6fd2debdb90cd2d2), CONST64(0xf3f5fb06f70ef5f5), -CONST64(0xf979ef80f2967979), CONST64(0xa16f5fcede306f6f), CONST64(0x7e91fcef3f6d9191), CONST64(0x5552aa07a4f85252), -CONST64(0x9d6027fdc0476060), CONST64(0xcabc89766535bcbc), CONST64(0x569baccd2b379b9b), CONST64(0x028e048c018a8e8e), -CONST64(0xb6a371155bd2a3a3), CONST64(0x300c603c186c0c0c), CONST64(0xf17bff8af6847b7b), CONST64(0xd435b5e16a803535), -CONST64(0x741de8693af51d1d), CONST64(0xa7e05347ddb3e0e0), CONST64(0x7bd7f6acb321d7d7), CONST64(0x2fc25eed999cc2c2), -CONST64(0xb82e6d965c432e2e), CONST64(0x314b627a96294b4b), CONST64(0xdffea321e15dfefe), CONST64(0x41578216aed55757), -CONST64(0x5415a8412abd1515), CONST64(0xc1779fb6eee87777), CONST64(0xdc37a5eb6e923737), CONST64(0xb3e57b56d79ee5e5), -CONST64(0x469f8cd923139f9f), CONST64(0xe7f0d317fd23f0f0), CONST64(0x354a6a7f94204a4a), CONST64(0x4fda9e95a944dada), -CONST64(0x7d58fa25b0a25858), CONST64(0x03c906ca8fcfc9c9), CONST64(0xa429558d527c2929), CONST64(0x280a5022145a0a0a), -CONST64(0xfeb1e14f7f50b1b1), CONST64(0xbaa0691a5dc9a0a0), CONST64(0xb16b7fdad6146b6b), CONST64(0x2e855cab17d98585), -CONST64(0xcebd8173673cbdbd), CONST64(0x695dd234ba8f5d5d), CONST64(0x4010805020901010), CONST64(0xf7f4f303f507f4f4), -CONST64(0x0bcb16c08bddcbcb), CONST64(0xf83eedc67cd33e3e), CONST64(0x140528110a2d0505), CONST64(0x81671fe6ce786767), -CONST64(0xb7e47353d597e4e4), CONST64(0x9c2725bb4e022727), CONST64(0x1941325882734141), CONST64(0x168b2c9d0ba78b8b), -CONST64(0xa6a7510153f6a7a7), CONST64(0xe97dcf94fab27d7d), CONST64(0x6e95dcfb37499595), CONST64(0x47d88e9fad56d8d8), -CONST64(0xcbfb8b30eb70fbfb), CONST64(0x9fee2371c1cdeeee), CONST64(0xed7cc791f8bb7c7c), CONST64(0x856617e3cc716666), -CONST64(0x53dda68ea77bdddd), CONST64(0x5c17b84b2eaf1717), CONST64(0x014702468e454747), CONST64(0x429e84dc211a9e9e), -CONST64(0x0fca1ec589d4caca), CONST64(0xb42d75995a582d2d), CONST64(0xc6bf9179632ebfbf), CONST64(0x1c07381b0e3f0707), -CONST64(0x8ead012347acadad), CONST64(0x755aea2fb4b05a5a), CONST64(0x36836cb51bef8383), CONST64(0xcc3385ff66b63333), -CONST64(0x91633ff2c65c6363), CONST64(0x0802100a04120202), CONST64(0x92aa39384993aaaa), CONST64(0xd971afa8e2de7171), -CONST64(0x07c80ecf8dc6c8c8), CONST64(0x6419c87d32d11919), CONST64(0x39497270923b4949), CONST64(0x43d9869aaf5fd9d9), -CONST64(0xeff2c31df931f2f2), CONST64(0xabe34b48dba8e3e3), CONST64(0x715be22ab6b95b5b), CONST64(0x1a8834920dbc8888), -CONST64(0x529aa4c8293e9a9a), CONST64(0x98262dbe4c0b2626), CONST64(0xc8328dfa64bf3232), CONST64(0xfab0e94a7d59b0b0), -CONST64(0x83e91b6acff2e9e9), CONST64(0x3c0f78331e770f0f), CONST64(0x73d5e6a6b733d5d5), CONST64(0x3a8074ba1df48080), -CONST64(0xc2be997c6127bebe), CONST64(0x13cd26de87ebcdcd), CONST64(0xd034bde468893434), CONST64(0x3d487a7590324848), -CONST64(0xdbffab24e354ffff), CONST64(0xf57af78ff48d7a7a), CONST64(0x7a90f4ea3d649090), CONST64(0x615fc23ebe9d5f5f), -CONST64(0x80201da0403d2020), CONST64(0xbd6867d5d00f6868), CONST64(0x681ad07234ca1a1a), CONST64(0x82ae192c41b7aeae), -CONST64(0xeab4c95e757db4b4), CONST64(0x4d549a19a8ce5454), CONST64(0x7693ece53b7f9393), CONST64(0x88220daa442f2222), -CONST64(0x8d6407e9c8636464), CONST64(0xe3f1db12ff2af1f1), CONST64(0xd173bfa2e6cc7373), CONST64(0x4812905a24821212), -CONST64(0x1d403a5d807a4040), CONST64(0x2008402810480808), CONST64(0x2bc356e89b95c3c3), CONST64(0x97ec337bc5dfecec), -CONST64(0x4bdb9690ab4ddbdb), CONST64(0xbea1611f5fc0a1a1), CONST64(0x0e8d1c8307918d8d), CONST64(0xf43df5c97ac83d3d), -CONST64(0x6697ccf1335b9797), CONST64(0x0000000000000000), CONST64(0x1bcf36d483f9cfcf), CONST64(0xac2b4587566e2b2b), -CONST64(0xc57697b3ece17676), CONST64(0x328264b019e68282), CONST64(0x7fd6fea9b128d6d6), CONST64(0x6c1bd87736c31b1b), -CONST64(0xeeb5c15b7774b5b5), CONST64(0x86af112943beafaf), CONST64(0xb56a77dfd41d6a6a), CONST64(0x5d50ba0da0ea5050), -CONST64(0x0945124c8a574545), CONST64(0xebf3cb18fb38f3f3), CONST64(0xc0309df060ad3030), CONST64(0x9bef2b74c3c4efef), -CONST64(0xfc3fe5c37eda3f3f), CONST64(0x4955921caac75555), CONST64(0xb2a2791059dba2a2), CONST64(0x8fea0365c9e9eaea), -CONST64(0x89650fecca6a6565), CONST64(0xd2bab9686903baba), CONST64(0xbc2f65935e4a2f2f), CONST64(0x27c04ee79d8ec0c0), -CONST64(0x5fdebe81a160dede), CONST64(0x701ce06c38fc1c1c), CONST64(0xd3fdbb2ee746fdfd), CONST64(0x294d52649a1f4d4d), -CONST64(0x7292e4e039769292), CONST64(0xc9758fbceafa7575), CONST64(0x1806301e0c360606), CONST64(0x128a249809ae8a8a), -CONST64(0xf2b2f940794bb2b2), CONST64(0xbfe66359d185e6e6), CONST64(0x380e70361c7e0e0e), CONST64(0x7c1ff8633ee71f1f), -CONST64(0x956237f7c4556262), CONST64(0x77d4eea3b53ad4d4), CONST64(0x9aa829324d81a8a8), CONST64(0x6296c4f431529696), -CONST64(0xc3f99b3aef62f9f9), CONST64(0x33c566f697a3c5c5), CONST64(0x942535b14a102525), CONST64(0x7959f220b2ab5959), -CONST64(0x2a8454ae15d08484), CONST64(0xd572b7a7e4c57272), CONST64(0xe439d5dd72ec3939), CONST64(0x2d4c5a6198164c4c), -CONST64(0x655eca3bbc945e5e), CONST64(0xfd78e785f09f7878), CONST64(0xe038ddd870e53838), CONST64(0x0a8c148605988c8c), -CONST64(0x63d1c6b2bf17d1d1), CONST64(0xaea5410b57e4a5a5), CONST64(0xafe2434dd9a1e2e2), CONST64(0x99612ff8c24e6161), -CONST64(0xf6b3f1457b42b3b3), CONST64(0x842115a542342121), CONST64(0x4a9c94d625089c9c), CONST64(0x781ef0663cee1e1e), -CONST64(0x1143225286614343), CONST64(0x3bc776fc93b1c7c7), CONST64(0xd7fcb32be54ffcfc), CONST64(0x1004201408240404), -CONST64(0x5951b208a2e35151), CONST64(0x5e99bcc72f259999), CONST64(0xa96d4fc4da226d6d), CONST64(0x340d68391a650d0d), -CONST64(0xcffa8335e979fafa), CONST64(0x5bdfb684a369dfdf), CONST64(0xe57ed79bfca97e7e), CONST64(0x90243db448192424), -CONST64(0xec3bc5d776fe3b3b), CONST64(0x96ab313d4b9aabab), CONST64(0x1fce3ed181f0cece), CONST64(0x4411885522991111), -CONST64(0x068f0c8903838f8f), CONST64(0x254e4a6b9c044e4e), CONST64(0xe6b7d1517366b7b7), CONST64(0x8beb0b60cbe0ebeb), -CONST64(0xf03cfdcc78c13c3c), CONST64(0x3e817cbf1ffd8181), CONST64(0x6a94d4fe35409494), CONST64(0xfbf7eb0cf31cf7f7), -CONST64(0xdeb9a1676f18b9b9), CONST64(0x4c13985f268b1313), CONST64(0xb02c7d9c58512c2c), CONST64(0x6bd3d6b8bb05d3d3), -CONST64(0xbbe76b5cd38ce7e7), CONST64(0xa56e57cbdc396e6e), CONST64(0x37c46ef395aac4c4), CONST64(0x0c03180f061b0303), -CONST64(0x45568a13acdc5656), CONST64(0x0d441a49885e4444), CONST64(0xe17fdf9efea07f7f), CONST64(0x9ea921374f88a9a9), -CONST64(0xa82a4d8254672a2a), CONST64(0xd6bbb16d6b0abbbb), CONST64(0x23c146e29f87c1c1), CONST64(0x5153a202a6f15353), -CONST64(0x57dcae8ba572dcdc), CONST64(0x2c0b582716530b0b), CONST64(0x4e9d9cd327019d9d), CONST64(0xad6c47c1d82b6c6c), -CONST64(0xc43195f562a43131), CONST64(0xcd7487b9e8f37474), CONST64(0xfff6e309f115f6f6), CONST64(0x05460a438c4c4646), -CONST64(0x8aac092645a5acac), CONST64(0x1e893c970fb58989), CONST64(0x5014a04428b41414), CONST64(0xa3e15b42dfbae1e1), -CONST64(0x5816b04e2ca61616), CONST64(0xe83acdd274f73a3a), CONST64(0xb9696fd0d2066969), CONST64(0x2409482d12410909), -CONST64(0xdd70a7ade0d77070), CONST64(0xe2b6d954716fb6b6), CONST64(0x67d0ceb7bd1ed0d0), CONST64(0x93ed3b7ec7d6eded), -CONST64(0x17cc2edb85e2cccc), CONST64(0x15422a5784684242), CONST64(0x5a98b4c22d2c9898), CONST64(0xaaa4490e55eda4a4), +CONST64(0x6018c07830d81818), CONST64(0x8c2305af46262323), CONST64(0x3fc67ef991b8c6c6), CONST64(0x87e8136fcdfbe8e8), +CONST64(0x26874ca113cb8787), CONST64(0xdab8a9626d11b8b8), CONST64(0x0401080502090101), CONST64(0x214f426e9e0d4f4f), +CONST64(0xd836adee6c9b3636), CONST64(0xa2a6590451ffa6a6), CONST64(0x6fd2debdb90cd2d2), CONST64(0xf3f5fb06f70ef5f5), +CONST64(0xf979ef80f2967979), CONST64(0xa16f5fcede306f6f), CONST64(0x7e91fcef3f6d9191), CONST64(0x5552aa07a4f85252), +CONST64(0x9d6027fdc0476060), CONST64(0xcabc89766535bcbc), CONST64(0x569baccd2b379b9b), CONST64(0x028e048c018a8e8e), +CONST64(0xb6a371155bd2a3a3), CONST64(0x300c603c186c0c0c), CONST64(0xf17bff8af6847b7b), CONST64(0xd435b5e16a803535), +CONST64(0x741de8693af51d1d), CONST64(0xa7e05347ddb3e0e0), CONST64(0x7bd7f6acb321d7d7), CONST64(0x2fc25eed999cc2c2), +CONST64(0xb82e6d965c432e2e), CONST64(0x314b627a96294b4b), CONST64(0xdffea321e15dfefe), CONST64(0x41578216aed55757), +CONST64(0x5415a8412abd1515), CONST64(0xc1779fb6eee87777), CONST64(0xdc37a5eb6e923737), CONST64(0xb3e57b56d79ee5e5), +CONST64(0x469f8cd923139f9f), CONST64(0xe7f0d317fd23f0f0), CONST64(0x354a6a7f94204a4a), CONST64(0x4fda9e95a944dada), +CONST64(0x7d58fa25b0a25858), CONST64(0x03c906ca8fcfc9c9), CONST64(0xa429558d527c2929), CONST64(0x280a5022145a0a0a), +CONST64(0xfeb1e14f7f50b1b1), CONST64(0xbaa0691a5dc9a0a0), CONST64(0xb16b7fdad6146b6b), CONST64(0x2e855cab17d98585), +CONST64(0xcebd8173673cbdbd), CONST64(0x695dd234ba8f5d5d), CONST64(0x4010805020901010), CONST64(0xf7f4f303f507f4f4), +CONST64(0x0bcb16c08bddcbcb), CONST64(0xf83eedc67cd33e3e), CONST64(0x140528110a2d0505), CONST64(0x81671fe6ce786767), +CONST64(0xb7e47353d597e4e4), CONST64(0x9c2725bb4e022727), CONST64(0x1941325882734141), CONST64(0x168b2c9d0ba78b8b), +CONST64(0xa6a7510153f6a7a7), CONST64(0xe97dcf94fab27d7d), CONST64(0x6e95dcfb37499595), CONST64(0x47d88e9fad56d8d8), +CONST64(0xcbfb8b30eb70fbfb), CONST64(0x9fee2371c1cdeeee), CONST64(0xed7cc791f8bb7c7c), CONST64(0x856617e3cc716666), +CONST64(0x53dda68ea77bdddd), CONST64(0x5c17b84b2eaf1717), CONST64(0x014702468e454747), CONST64(0x429e84dc211a9e9e), +CONST64(0x0fca1ec589d4caca), CONST64(0xb42d75995a582d2d), CONST64(0xc6bf9179632ebfbf), CONST64(0x1c07381b0e3f0707), +CONST64(0x8ead012347acadad), CONST64(0x755aea2fb4b05a5a), CONST64(0x36836cb51bef8383), CONST64(0xcc3385ff66b63333), +CONST64(0x91633ff2c65c6363), CONST64(0x0802100a04120202), CONST64(0x92aa39384993aaaa), CONST64(0xd971afa8e2de7171), +CONST64(0x07c80ecf8dc6c8c8), CONST64(0x6419c87d32d11919), CONST64(0x39497270923b4949), CONST64(0x43d9869aaf5fd9d9), +CONST64(0xeff2c31df931f2f2), CONST64(0xabe34b48dba8e3e3), CONST64(0x715be22ab6b95b5b), CONST64(0x1a8834920dbc8888), +CONST64(0x529aa4c8293e9a9a), CONST64(0x98262dbe4c0b2626), CONST64(0xc8328dfa64bf3232), CONST64(0xfab0e94a7d59b0b0), +CONST64(0x83e91b6acff2e9e9), CONST64(0x3c0f78331e770f0f), CONST64(0x73d5e6a6b733d5d5), CONST64(0x3a8074ba1df48080), +CONST64(0xc2be997c6127bebe), CONST64(0x13cd26de87ebcdcd), CONST64(0xd034bde468893434), CONST64(0x3d487a7590324848), +CONST64(0xdbffab24e354ffff), CONST64(0xf57af78ff48d7a7a), CONST64(0x7a90f4ea3d649090), CONST64(0x615fc23ebe9d5f5f), +CONST64(0x80201da0403d2020), CONST64(0xbd6867d5d00f6868), CONST64(0x681ad07234ca1a1a), CONST64(0x82ae192c41b7aeae), +CONST64(0xeab4c95e757db4b4), CONST64(0x4d549a19a8ce5454), CONST64(0x7693ece53b7f9393), CONST64(0x88220daa442f2222), +CONST64(0x8d6407e9c8636464), CONST64(0xe3f1db12ff2af1f1), CONST64(0xd173bfa2e6cc7373), CONST64(0x4812905a24821212), +CONST64(0x1d403a5d807a4040), CONST64(0x2008402810480808), CONST64(0x2bc356e89b95c3c3), CONST64(0x97ec337bc5dfecec), +CONST64(0x4bdb9690ab4ddbdb), CONST64(0xbea1611f5fc0a1a1), CONST64(0x0e8d1c8307918d8d), CONST64(0xf43df5c97ac83d3d), +CONST64(0x6697ccf1335b9797), CONST64(0x0000000000000000), CONST64(0x1bcf36d483f9cfcf), CONST64(0xac2b4587566e2b2b), +CONST64(0xc57697b3ece17676), CONST64(0x328264b019e68282), CONST64(0x7fd6fea9b128d6d6), CONST64(0x6c1bd87736c31b1b), +CONST64(0xeeb5c15b7774b5b5), CONST64(0x86af112943beafaf), CONST64(0xb56a77dfd41d6a6a), CONST64(0x5d50ba0da0ea5050), +CONST64(0x0945124c8a574545), CONST64(0xebf3cb18fb38f3f3), CONST64(0xc0309df060ad3030), CONST64(0x9bef2b74c3c4efef), +CONST64(0xfc3fe5c37eda3f3f), CONST64(0x4955921caac75555), CONST64(0xb2a2791059dba2a2), CONST64(0x8fea0365c9e9eaea), +CONST64(0x89650fecca6a6565), CONST64(0xd2bab9686903baba), CONST64(0xbc2f65935e4a2f2f), CONST64(0x27c04ee79d8ec0c0), +CONST64(0x5fdebe81a160dede), CONST64(0x701ce06c38fc1c1c), CONST64(0xd3fdbb2ee746fdfd), CONST64(0x294d52649a1f4d4d), +CONST64(0x7292e4e039769292), CONST64(0xc9758fbceafa7575), CONST64(0x1806301e0c360606), CONST64(0x128a249809ae8a8a), +CONST64(0xf2b2f940794bb2b2), CONST64(0xbfe66359d185e6e6), CONST64(0x380e70361c7e0e0e), CONST64(0x7c1ff8633ee71f1f), +CONST64(0x956237f7c4556262), CONST64(0x77d4eea3b53ad4d4), CONST64(0x9aa829324d81a8a8), CONST64(0x6296c4f431529696), +CONST64(0xc3f99b3aef62f9f9), CONST64(0x33c566f697a3c5c5), CONST64(0x942535b14a102525), CONST64(0x7959f220b2ab5959), +CONST64(0x2a8454ae15d08484), CONST64(0xd572b7a7e4c57272), CONST64(0xe439d5dd72ec3939), CONST64(0x2d4c5a6198164c4c), +CONST64(0x655eca3bbc945e5e), CONST64(0xfd78e785f09f7878), CONST64(0xe038ddd870e53838), CONST64(0x0a8c148605988c8c), +CONST64(0x63d1c6b2bf17d1d1), CONST64(0xaea5410b57e4a5a5), CONST64(0xafe2434dd9a1e2e2), CONST64(0x99612ff8c24e6161), +CONST64(0xf6b3f1457b42b3b3), CONST64(0x842115a542342121), CONST64(0x4a9c94d625089c9c), CONST64(0x781ef0663cee1e1e), +CONST64(0x1143225286614343), CONST64(0x3bc776fc93b1c7c7), CONST64(0xd7fcb32be54ffcfc), CONST64(0x1004201408240404), +CONST64(0x5951b208a2e35151), CONST64(0x5e99bcc72f259999), CONST64(0xa96d4fc4da226d6d), CONST64(0x340d68391a650d0d), +CONST64(0xcffa8335e979fafa), CONST64(0x5bdfb684a369dfdf), CONST64(0xe57ed79bfca97e7e), CONST64(0x90243db448192424), +CONST64(0xec3bc5d776fe3b3b), CONST64(0x96ab313d4b9aabab), CONST64(0x1fce3ed181f0cece), CONST64(0x4411885522991111), +CONST64(0x068f0c8903838f8f), CONST64(0x254e4a6b9c044e4e), CONST64(0xe6b7d1517366b7b7), CONST64(0x8beb0b60cbe0ebeb), +CONST64(0xf03cfdcc78c13c3c), CONST64(0x3e817cbf1ffd8181), CONST64(0x6a94d4fe35409494), CONST64(0xfbf7eb0cf31cf7f7), +CONST64(0xdeb9a1676f18b9b9), CONST64(0x4c13985f268b1313), CONST64(0xb02c7d9c58512c2c), CONST64(0x6bd3d6b8bb05d3d3), +CONST64(0xbbe76b5cd38ce7e7), CONST64(0xa56e57cbdc396e6e), CONST64(0x37c46ef395aac4c4), CONST64(0x0c03180f061b0303), +CONST64(0x45568a13acdc5656), CONST64(0x0d441a49885e4444), CONST64(0xe17fdf9efea07f7f), CONST64(0x9ea921374f88a9a9), +CONST64(0xa82a4d8254672a2a), CONST64(0xd6bbb16d6b0abbbb), CONST64(0x23c146e29f87c1c1), CONST64(0x5153a202a6f15353), +CONST64(0x57dcae8ba572dcdc), CONST64(0x2c0b582716530b0b), CONST64(0x4e9d9cd327019d9d), CONST64(0xad6c47c1d82b6c6c), +CONST64(0xc43195f562a43131), CONST64(0xcd7487b9e8f37474), CONST64(0xfff6e309f115f6f6), CONST64(0x05460a438c4c4646), +CONST64(0x8aac092645a5acac), CONST64(0x1e893c970fb58989), CONST64(0x5014a04428b41414), CONST64(0xa3e15b42dfbae1e1), +CONST64(0x5816b04e2ca61616), CONST64(0xe83acdd274f73a3a), CONST64(0xb9696fd0d2066969), CONST64(0x2409482d12410909), +CONST64(0xdd70a7ade0d77070), CONST64(0xe2b6d954716fb6b6), CONST64(0x67d0ceb7bd1ed0d0), CONST64(0x93ed3b7ec7d6eded), +CONST64(0x17cc2edb85e2cccc), CONST64(0x15422a5784684242), CONST64(0x5a98b4c22d2c9898), CONST64(0xaaa4490e55eda4a4), CONST64(0xa0285d8850752828), CONST64(0x6d5cda31b8865c5c), CONST64(0xc7f8933fed6bf8f8), CONST64(0x228644a411c28686) }; static const ulong64 sbox7[] = { -CONST64(0x186018c07830d818), CONST64(0x238c2305af462623), CONST64(0xc63fc67ef991b8c6), CONST64(0xe887e8136fcdfbe8), -CONST64(0x8726874ca113cb87), CONST64(0xb8dab8a9626d11b8), CONST64(0x0104010805020901), CONST64(0x4f214f426e9e0d4f), -CONST64(0x36d836adee6c9b36), CONST64(0xa6a2a6590451ffa6), CONST64(0xd26fd2debdb90cd2), CONST64(0xf5f3f5fb06f70ef5), -CONST64(0x79f979ef80f29679), CONST64(0x6fa16f5fcede306f), CONST64(0x917e91fcef3f6d91), CONST64(0x525552aa07a4f852), -CONST64(0x609d6027fdc04760), CONST64(0xbccabc89766535bc), CONST64(0x9b569baccd2b379b), CONST64(0x8e028e048c018a8e), -CONST64(0xa3b6a371155bd2a3), CONST64(0x0c300c603c186c0c), CONST64(0x7bf17bff8af6847b), CONST64(0x35d435b5e16a8035), -CONST64(0x1d741de8693af51d), CONST64(0xe0a7e05347ddb3e0), CONST64(0xd77bd7f6acb321d7), CONST64(0xc22fc25eed999cc2), -CONST64(0x2eb82e6d965c432e), CONST64(0x4b314b627a96294b), CONST64(0xfedffea321e15dfe), CONST64(0x5741578216aed557), -CONST64(0x155415a8412abd15), CONST64(0x77c1779fb6eee877), CONST64(0x37dc37a5eb6e9237), CONST64(0xe5b3e57b56d79ee5), -CONST64(0x9f469f8cd923139f), CONST64(0xf0e7f0d317fd23f0), CONST64(0x4a354a6a7f94204a), CONST64(0xda4fda9e95a944da), -CONST64(0x587d58fa25b0a258), CONST64(0xc903c906ca8fcfc9), CONST64(0x29a429558d527c29), CONST64(0x0a280a5022145a0a), -CONST64(0xb1feb1e14f7f50b1), CONST64(0xa0baa0691a5dc9a0), CONST64(0x6bb16b7fdad6146b), CONST64(0x852e855cab17d985), -CONST64(0xbdcebd8173673cbd), CONST64(0x5d695dd234ba8f5d), CONST64(0x1040108050209010), CONST64(0xf4f7f4f303f507f4), -CONST64(0xcb0bcb16c08bddcb), CONST64(0x3ef83eedc67cd33e), CONST64(0x05140528110a2d05), CONST64(0x6781671fe6ce7867), -CONST64(0xe4b7e47353d597e4), CONST64(0x279c2725bb4e0227), CONST64(0x4119413258827341), CONST64(0x8b168b2c9d0ba78b), -CONST64(0xa7a6a7510153f6a7), CONST64(0x7de97dcf94fab27d), CONST64(0x956e95dcfb374995), CONST64(0xd847d88e9fad56d8), -CONST64(0xfbcbfb8b30eb70fb), CONST64(0xee9fee2371c1cdee), CONST64(0x7ced7cc791f8bb7c), CONST64(0x66856617e3cc7166), -CONST64(0xdd53dda68ea77bdd), CONST64(0x175c17b84b2eaf17), CONST64(0x47014702468e4547), CONST64(0x9e429e84dc211a9e), -CONST64(0xca0fca1ec589d4ca), CONST64(0x2db42d75995a582d), CONST64(0xbfc6bf9179632ebf), CONST64(0x071c07381b0e3f07), -CONST64(0xad8ead012347acad), CONST64(0x5a755aea2fb4b05a), CONST64(0x8336836cb51bef83), CONST64(0x33cc3385ff66b633), -CONST64(0x6391633ff2c65c63), CONST64(0x020802100a041202), CONST64(0xaa92aa39384993aa), CONST64(0x71d971afa8e2de71), -CONST64(0xc807c80ecf8dc6c8), CONST64(0x196419c87d32d119), CONST64(0x4939497270923b49), CONST64(0xd943d9869aaf5fd9), -CONST64(0xf2eff2c31df931f2), CONST64(0xe3abe34b48dba8e3), CONST64(0x5b715be22ab6b95b), CONST64(0x881a8834920dbc88), -CONST64(0x9a529aa4c8293e9a), CONST64(0x2698262dbe4c0b26), CONST64(0x32c8328dfa64bf32), CONST64(0xb0fab0e94a7d59b0), -CONST64(0xe983e91b6acff2e9), CONST64(0x0f3c0f78331e770f), CONST64(0xd573d5e6a6b733d5), CONST64(0x803a8074ba1df480), -CONST64(0xbec2be997c6127be), CONST64(0xcd13cd26de87ebcd), CONST64(0x34d034bde4688934), CONST64(0x483d487a75903248), -CONST64(0xffdbffab24e354ff), CONST64(0x7af57af78ff48d7a), CONST64(0x907a90f4ea3d6490), CONST64(0x5f615fc23ebe9d5f), -CONST64(0x2080201da0403d20), CONST64(0x68bd6867d5d00f68), CONST64(0x1a681ad07234ca1a), CONST64(0xae82ae192c41b7ae), -CONST64(0xb4eab4c95e757db4), CONST64(0x544d549a19a8ce54), CONST64(0x937693ece53b7f93), CONST64(0x2288220daa442f22), -CONST64(0x648d6407e9c86364), CONST64(0xf1e3f1db12ff2af1), CONST64(0x73d173bfa2e6cc73), CONST64(0x124812905a248212), -CONST64(0x401d403a5d807a40), CONST64(0x0820084028104808), CONST64(0xc32bc356e89b95c3), CONST64(0xec97ec337bc5dfec), -CONST64(0xdb4bdb9690ab4ddb), CONST64(0xa1bea1611f5fc0a1), CONST64(0x8d0e8d1c8307918d), CONST64(0x3df43df5c97ac83d), -CONST64(0x976697ccf1335b97), CONST64(0x0000000000000000), CONST64(0xcf1bcf36d483f9cf), CONST64(0x2bac2b4587566e2b), -CONST64(0x76c57697b3ece176), CONST64(0x82328264b019e682), CONST64(0xd67fd6fea9b128d6), CONST64(0x1b6c1bd87736c31b), -CONST64(0xb5eeb5c15b7774b5), CONST64(0xaf86af112943beaf), CONST64(0x6ab56a77dfd41d6a), CONST64(0x505d50ba0da0ea50), -CONST64(0x450945124c8a5745), CONST64(0xf3ebf3cb18fb38f3), CONST64(0x30c0309df060ad30), CONST64(0xef9bef2b74c3c4ef), -CONST64(0x3ffc3fe5c37eda3f), CONST64(0x554955921caac755), CONST64(0xa2b2a2791059dba2), CONST64(0xea8fea0365c9e9ea), -CONST64(0x6589650fecca6a65), CONST64(0xbad2bab9686903ba), CONST64(0x2fbc2f65935e4a2f), CONST64(0xc027c04ee79d8ec0), -CONST64(0xde5fdebe81a160de), CONST64(0x1c701ce06c38fc1c), CONST64(0xfdd3fdbb2ee746fd), CONST64(0x4d294d52649a1f4d), -CONST64(0x927292e4e0397692), CONST64(0x75c9758fbceafa75), CONST64(0x061806301e0c3606), CONST64(0x8a128a249809ae8a), -CONST64(0xb2f2b2f940794bb2), CONST64(0xe6bfe66359d185e6), CONST64(0x0e380e70361c7e0e), CONST64(0x1f7c1ff8633ee71f), -CONST64(0x62956237f7c45562), CONST64(0xd477d4eea3b53ad4), CONST64(0xa89aa829324d81a8), CONST64(0x966296c4f4315296), -CONST64(0xf9c3f99b3aef62f9), CONST64(0xc533c566f697a3c5), CONST64(0x25942535b14a1025), CONST64(0x597959f220b2ab59), -CONST64(0x842a8454ae15d084), CONST64(0x72d572b7a7e4c572), CONST64(0x39e439d5dd72ec39), CONST64(0x4c2d4c5a6198164c), -CONST64(0x5e655eca3bbc945e), CONST64(0x78fd78e785f09f78), CONST64(0x38e038ddd870e538), CONST64(0x8c0a8c148605988c), -CONST64(0xd163d1c6b2bf17d1), CONST64(0xa5aea5410b57e4a5), CONST64(0xe2afe2434dd9a1e2), CONST64(0x6199612ff8c24e61), -CONST64(0xb3f6b3f1457b42b3), CONST64(0x21842115a5423421), CONST64(0x9c4a9c94d625089c), CONST64(0x1e781ef0663cee1e), -CONST64(0x4311432252866143), CONST64(0xc73bc776fc93b1c7), CONST64(0xfcd7fcb32be54ffc), CONST64(0x0410042014082404), -CONST64(0x515951b208a2e351), CONST64(0x995e99bcc72f2599), CONST64(0x6da96d4fc4da226d), CONST64(0x0d340d68391a650d), -CONST64(0xfacffa8335e979fa), CONST64(0xdf5bdfb684a369df), CONST64(0x7ee57ed79bfca97e), CONST64(0x2490243db4481924), -CONST64(0x3bec3bc5d776fe3b), CONST64(0xab96ab313d4b9aab), CONST64(0xce1fce3ed181f0ce), CONST64(0x1144118855229911), -CONST64(0x8f068f0c8903838f), CONST64(0x4e254e4a6b9c044e), CONST64(0xb7e6b7d1517366b7), CONST64(0xeb8beb0b60cbe0eb), -CONST64(0x3cf03cfdcc78c13c), CONST64(0x813e817cbf1ffd81), CONST64(0x946a94d4fe354094), CONST64(0xf7fbf7eb0cf31cf7), -CONST64(0xb9deb9a1676f18b9), CONST64(0x134c13985f268b13), CONST64(0x2cb02c7d9c58512c), CONST64(0xd36bd3d6b8bb05d3), -CONST64(0xe7bbe76b5cd38ce7), CONST64(0x6ea56e57cbdc396e), CONST64(0xc437c46ef395aac4), CONST64(0x030c03180f061b03), -CONST64(0x5645568a13acdc56), CONST64(0x440d441a49885e44), CONST64(0x7fe17fdf9efea07f), CONST64(0xa99ea921374f88a9), -CONST64(0x2aa82a4d8254672a), CONST64(0xbbd6bbb16d6b0abb), CONST64(0xc123c146e29f87c1), CONST64(0x535153a202a6f153), -CONST64(0xdc57dcae8ba572dc), CONST64(0x0b2c0b582716530b), CONST64(0x9d4e9d9cd327019d), CONST64(0x6cad6c47c1d82b6c), -CONST64(0x31c43195f562a431), CONST64(0x74cd7487b9e8f374), CONST64(0xf6fff6e309f115f6), CONST64(0x4605460a438c4c46), -CONST64(0xac8aac092645a5ac), CONST64(0x891e893c970fb589), CONST64(0x145014a04428b414), CONST64(0xe1a3e15b42dfbae1), -CONST64(0x165816b04e2ca616), CONST64(0x3ae83acdd274f73a), CONST64(0x69b9696fd0d20669), CONST64(0x092409482d124109), -CONST64(0x70dd70a7ade0d770), CONST64(0xb6e2b6d954716fb6), CONST64(0xd067d0ceb7bd1ed0), CONST64(0xed93ed3b7ec7d6ed), -CONST64(0xcc17cc2edb85e2cc), CONST64(0x4215422a57846842), CONST64(0x985a98b4c22d2c98), CONST64(0xa4aaa4490e55eda4), +CONST64(0x186018c07830d818), CONST64(0x238c2305af462623), CONST64(0xc63fc67ef991b8c6), CONST64(0xe887e8136fcdfbe8), +CONST64(0x8726874ca113cb87), CONST64(0xb8dab8a9626d11b8), CONST64(0x0104010805020901), CONST64(0x4f214f426e9e0d4f), +CONST64(0x36d836adee6c9b36), CONST64(0xa6a2a6590451ffa6), CONST64(0xd26fd2debdb90cd2), CONST64(0xf5f3f5fb06f70ef5), +CONST64(0x79f979ef80f29679), CONST64(0x6fa16f5fcede306f), CONST64(0x917e91fcef3f6d91), CONST64(0x525552aa07a4f852), +CONST64(0x609d6027fdc04760), CONST64(0xbccabc89766535bc), CONST64(0x9b569baccd2b379b), CONST64(0x8e028e048c018a8e), +CONST64(0xa3b6a371155bd2a3), CONST64(0x0c300c603c186c0c), CONST64(0x7bf17bff8af6847b), CONST64(0x35d435b5e16a8035), +CONST64(0x1d741de8693af51d), CONST64(0xe0a7e05347ddb3e0), CONST64(0xd77bd7f6acb321d7), CONST64(0xc22fc25eed999cc2), +CONST64(0x2eb82e6d965c432e), CONST64(0x4b314b627a96294b), CONST64(0xfedffea321e15dfe), CONST64(0x5741578216aed557), +CONST64(0x155415a8412abd15), CONST64(0x77c1779fb6eee877), CONST64(0x37dc37a5eb6e9237), CONST64(0xe5b3e57b56d79ee5), +CONST64(0x9f469f8cd923139f), CONST64(0xf0e7f0d317fd23f0), CONST64(0x4a354a6a7f94204a), CONST64(0xda4fda9e95a944da), +CONST64(0x587d58fa25b0a258), CONST64(0xc903c906ca8fcfc9), CONST64(0x29a429558d527c29), CONST64(0x0a280a5022145a0a), +CONST64(0xb1feb1e14f7f50b1), CONST64(0xa0baa0691a5dc9a0), CONST64(0x6bb16b7fdad6146b), CONST64(0x852e855cab17d985), +CONST64(0xbdcebd8173673cbd), CONST64(0x5d695dd234ba8f5d), CONST64(0x1040108050209010), CONST64(0xf4f7f4f303f507f4), +CONST64(0xcb0bcb16c08bddcb), CONST64(0x3ef83eedc67cd33e), CONST64(0x05140528110a2d05), CONST64(0x6781671fe6ce7867), +CONST64(0xe4b7e47353d597e4), CONST64(0x279c2725bb4e0227), CONST64(0x4119413258827341), CONST64(0x8b168b2c9d0ba78b), +CONST64(0xa7a6a7510153f6a7), CONST64(0x7de97dcf94fab27d), CONST64(0x956e95dcfb374995), CONST64(0xd847d88e9fad56d8), +CONST64(0xfbcbfb8b30eb70fb), CONST64(0xee9fee2371c1cdee), CONST64(0x7ced7cc791f8bb7c), CONST64(0x66856617e3cc7166), +CONST64(0xdd53dda68ea77bdd), CONST64(0x175c17b84b2eaf17), CONST64(0x47014702468e4547), CONST64(0x9e429e84dc211a9e), +CONST64(0xca0fca1ec589d4ca), CONST64(0x2db42d75995a582d), CONST64(0xbfc6bf9179632ebf), CONST64(0x071c07381b0e3f07), +CONST64(0xad8ead012347acad), CONST64(0x5a755aea2fb4b05a), CONST64(0x8336836cb51bef83), CONST64(0x33cc3385ff66b633), +CONST64(0x6391633ff2c65c63), CONST64(0x020802100a041202), CONST64(0xaa92aa39384993aa), CONST64(0x71d971afa8e2de71), +CONST64(0xc807c80ecf8dc6c8), CONST64(0x196419c87d32d119), CONST64(0x4939497270923b49), CONST64(0xd943d9869aaf5fd9), +CONST64(0xf2eff2c31df931f2), CONST64(0xe3abe34b48dba8e3), CONST64(0x5b715be22ab6b95b), CONST64(0x881a8834920dbc88), +CONST64(0x9a529aa4c8293e9a), CONST64(0x2698262dbe4c0b26), CONST64(0x32c8328dfa64bf32), CONST64(0xb0fab0e94a7d59b0), +CONST64(0xe983e91b6acff2e9), CONST64(0x0f3c0f78331e770f), CONST64(0xd573d5e6a6b733d5), CONST64(0x803a8074ba1df480), +CONST64(0xbec2be997c6127be), CONST64(0xcd13cd26de87ebcd), CONST64(0x34d034bde4688934), CONST64(0x483d487a75903248), +CONST64(0xffdbffab24e354ff), CONST64(0x7af57af78ff48d7a), CONST64(0x907a90f4ea3d6490), CONST64(0x5f615fc23ebe9d5f), +CONST64(0x2080201da0403d20), CONST64(0x68bd6867d5d00f68), CONST64(0x1a681ad07234ca1a), CONST64(0xae82ae192c41b7ae), +CONST64(0xb4eab4c95e757db4), CONST64(0x544d549a19a8ce54), CONST64(0x937693ece53b7f93), CONST64(0x2288220daa442f22), +CONST64(0x648d6407e9c86364), CONST64(0xf1e3f1db12ff2af1), CONST64(0x73d173bfa2e6cc73), CONST64(0x124812905a248212), +CONST64(0x401d403a5d807a40), CONST64(0x0820084028104808), CONST64(0xc32bc356e89b95c3), CONST64(0xec97ec337bc5dfec), +CONST64(0xdb4bdb9690ab4ddb), CONST64(0xa1bea1611f5fc0a1), CONST64(0x8d0e8d1c8307918d), CONST64(0x3df43df5c97ac83d), +CONST64(0x976697ccf1335b97), CONST64(0x0000000000000000), CONST64(0xcf1bcf36d483f9cf), CONST64(0x2bac2b4587566e2b), +CONST64(0x76c57697b3ece176), CONST64(0x82328264b019e682), CONST64(0xd67fd6fea9b128d6), CONST64(0x1b6c1bd87736c31b), +CONST64(0xb5eeb5c15b7774b5), CONST64(0xaf86af112943beaf), CONST64(0x6ab56a77dfd41d6a), CONST64(0x505d50ba0da0ea50), +CONST64(0x450945124c8a5745), CONST64(0xf3ebf3cb18fb38f3), CONST64(0x30c0309df060ad30), CONST64(0xef9bef2b74c3c4ef), +CONST64(0x3ffc3fe5c37eda3f), CONST64(0x554955921caac755), CONST64(0xa2b2a2791059dba2), CONST64(0xea8fea0365c9e9ea), +CONST64(0x6589650fecca6a65), CONST64(0xbad2bab9686903ba), CONST64(0x2fbc2f65935e4a2f), CONST64(0xc027c04ee79d8ec0), +CONST64(0xde5fdebe81a160de), CONST64(0x1c701ce06c38fc1c), CONST64(0xfdd3fdbb2ee746fd), CONST64(0x4d294d52649a1f4d), +CONST64(0x927292e4e0397692), CONST64(0x75c9758fbceafa75), CONST64(0x061806301e0c3606), CONST64(0x8a128a249809ae8a), +CONST64(0xb2f2b2f940794bb2), CONST64(0xe6bfe66359d185e6), CONST64(0x0e380e70361c7e0e), CONST64(0x1f7c1ff8633ee71f), +CONST64(0x62956237f7c45562), CONST64(0xd477d4eea3b53ad4), CONST64(0xa89aa829324d81a8), CONST64(0x966296c4f4315296), +CONST64(0xf9c3f99b3aef62f9), CONST64(0xc533c566f697a3c5), CONST64(0x25942535b14a1025), CONST64(0x597959f220b2ab59), +CONST64(0x842a8454ae15d084), CONST64(0x72d572b7a7e4c572), CONST64(0x39e439d5dd72ec39), CONST64(0x4c2d4c5a6198164c), +CONST64(0x5e655eca3bbc945e), CONST64(0x78fd78e785f09f78), CONST64(0x38e038ddd870e538), CONST64(0x8c0a8c148605988c), +CONST64(0xd163d1c6b2bf17d1), CONST64(0xa5aea5410b57e4a5), CONST64(0xe2afe2434dd9a1e2), CONST64(0x6199612ff8c24e61), +CONST64(0xb3f6b3f1457b42b3), CONST64(0x21842115a5423421), CONST64(0x9c4a9c94d625089c), CONST64(0x1e781ef0663cee1e), +CONST64(0x4311432252866143), CONST64(0xc73bc776fc93b1c7), CONST64(0xfcd7fcb32be54ffc), CONST64(0x0410042014082404), +CONST64(0x515951b208a2e351), CONST64(0x995e99bcc72f2599), CONST64(0x6da96d4fc4da226d), CONST64(0x0d340d68391a650d), +CONST64(0xfacffa8335e979fa), CONST64(0xdf5bdfb684a369df), CONST64(0x7ee57ed79bfca97e), CONST64(0x2490243db4481924), +CONST64(0x3bec3bc5d776fe3b), CONST64(0xab96ab313d4b9aab), CONST64(0xce1fce3ed181f0ce), CONST64(0x1144118855229911), +CONST64(0x8f068f0c8903838f), CONST64(0x4e254e4a6b9c044e), CONST64(0xb7e6b7d1517366b7), CONST64(0xeb8beb0b60cbe0eb), +CONST64(0x3cf03cfdcc78c13c), CONST64(0x813e817cbf1ffd81), CONST64(0x946a94d4fe354094), CONST64(0xf7fbf7eb0cf31cf7), +CONST64(0xb9deb9a1676f18b9), CONST64(0x134c13985f268b13), CONST64(0x2cb02c7d9c58512c), CONST64(0xd36bd3d6b8bb05d3), +CONST64(0xe7bbe76b5cd38ce7), CONST64(0x6ea56e57cbdc396e), CONST64(0xc437c46ef395aac4), CONST64(0x030c03180f061b03), +CONST64(0x5645568a13acdc56), CONST64(0x440d441a49885e44), CONST64(0x7fe17fdf9efea07f), CONST64(0xa99ea921374f88a9), +CONST64(0x2aa82a4d8254672a), CONST64(0xbbd6bbb16d6b0abb), CONST64(0xc123c146e29f87c1), CONST64(0x535153a202a6f153), +CONST64(0xdc57dcae8ba572dc), CONST64(0x0b2c0b582716530b), CONST64(0x9d4e9d9cd327019d), CONST64(0x6cad6c47c1d82b6c), +CONST64(0x31c43195f562a431), CONST64(0x74cd7487b9e8f374), CONST64(0xf6fff6e309f115f6), CONST64(0x4605460a438c4c46), +CONST64(0xac8aac092645a5ac), CONST64(0x891e893c970fb589), CONST64(0x145014a04428b414), CONST64(0xe1a3e15b42dfbae1), +CONST64(0x165816b04e2ca616), CONST64(0x3ae83acdd274f73a), CONST64(0x69b9696fd0d20669), CONST64(0x092409482d124109), +CONST64(0x70dd70a7ade0d770), CONST64(0xb6e2b6d954716fb6), CONST64(0xd067d0ceb7bd1ed0), CONST64(0xed93ed3b7ec7d6ed), +CONST64(0xcc17cc2edb85e2cc), CONST64(0x4215422a57846842), CONST64(0x985a98b4c22d2c98), CONST64(0xa4aaa4490e55eda4), CONST64(0x28a0285d88507528), CONST64(0x5c6d5cda31b8865c), CONST64(0xf8c7f8933fed6bf8), CONST64(0x86228644a411c286) }; @@ -577,7 +589,8 @@ CONST64(0xca2dbf07ad5a8333), CONST64(0x6302aa71c81949d9), }; +#endif /* __LTC_WHIRLTAB_C__ */ -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/headers/tomcrypt.h b/libtomcrypt/src/headers/tomcrypt.h index ad4b7ec..1a56611 100644 --- a/libtomcrypt/src/headers/tomcrypt.h +++ b/libtomcrypt/src/headers/tomcrypt.h @@ -1,9 +1,19 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + */ + #ifndef TOMCRYPT_H_ #define TOMCRYPT_H_ #include <assert.h> #include <stdio.h> #include <string.h> #include <stdlib.h> +#include <stddef.h> #include <time.h> #include <ctype.h> #include <limits.h> @@ -16,8 +26,8 @@ extern "C" { #endif /* version */ -#define CRYPT 0x0117 -#define SCRYPT "1.17" +#define CRYPT 0x0118 +#define SCRYPT "1.18.1" /* max size of either a cipher/hash block or symmetric key [largest of the two] */ #define MAXBLOCKSIZE 128 @@ -55,13 +65,19 @@ enum { CRYPT_FILE_NOTFOUND, /* File Not Found */ CRYPT_PK_INVALID_TYPE, /* Invalid type of PK key */ - CRYPT_PK_INVALID_SYSTEM,/* Invalid PK system specified */ - CRYPT_PK_DUP, /* Duplicate key already in key ring */ - CRYPT_PK_NOT_FOUND, /* Key not found in keyring */ + + CRYPT_OVERFLOW, /* An overflow of a value was detected/prevented */ + + CRYPT_UNUSED1, /* UNUSED1 */ + + CRYPT_INPUT_TOO_LONG, /* The input was longer than expected. */ + CRYPT_PK_INVALID_SIZE, /* Invalid size input for PK parameters */ CRYPT_INVALID_PRIME_SIZE,/* Invalid size of prime requested */ - CRYPT_PK_INVALID_PADDING /* Invalid padding on input */ + CRYPT_PK_INVALID_PADDING, /* Invalid padding on input */ + + CRYPT_HASH_OVERFLOW /* Hash applied to too many bits */ }; #include <tomcrypt_cfg.h> @@ -83,6 +99,6 @@ enum { #endif /* TOMCRYPT_H_ */ -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/headers/tomcrypt_argchk.h b/libtomcrypt/src/headers/tomcrypt_argchk.h index 63a6ef0..3994aa2 100644 --- a/libtomcrypt/src/headers/tomcrypt_argchk.h +++ b/libtomcrypt/src/headers/tomcrypt_argchk.h @@ -1,5 +1,14 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + */ + /* Defines the LTC_ARGCHK macro used within the library */ -/* ARGTYPE is defined in mycrypt_cfg.h */ +/* ARGTYPE is defined in tomcrypt_cfg.h */ #if ARGTYPE == 0 #include <signal.h> @@ -13,9 +22,15 @@ /* this is the default LibTomCrypt macro */ -void crypt_argchk(char *v, char *s, int d) ATTRIB_NORETURN; -#define LTC_ARGCHK(x) if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } -#define LTC_ARGCHKVD(x) LTC_ARGCHK(x) +#if defined(__clang__) || defined(__GNUC_MINOR__) +#define NORETURN __attribute__ ((noreturn)) +#else +#define NORETURN +#endif + +void crypt_argchk(const char *v, const char *s, int d) NORETURN; +#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) +#define LTC_ARGCHKVD(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) #elif ARGTYPE == 1 @@ -41,6 +56,6 @@ void crypt_argchk(char *v, char *s, int d) ATTRIB_NORETURN; #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/headers/tomcrypt_cfg.h b/libtomcrypt/src/headers/tomcrypt_cfg.h index f7ad3cc..af2a095 100644 --- a/libtomcrypt/src/headers/tomcrypt_cfg.h +++ b/libtomcrypt/src/headers/tomcrypt_cfg.h @@ -1,3 +1,12 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + */ + /* This is the build config file. * * With this you can setup what to inlcude/exclude automatically during any build. Just comment @@ -8,15 +17,13 @@ #define TOMCRYPT_CFG_H #if defined(_WIN32) || defined(_MSC_VER) -#define LTC_CALL __cdecl -#else -#ifndef LTC_CALL + #define LTC_CALL __cdecl +#elif !defined(LTC_CALL) #define LTC_CALL #endif -#endif #ifndef LTC_EXPORT -#define LTC_EXPORT + #define LTC_EXPORT #endif /* certain platforms use macros for these, making the prototypes broken */ @@ -43,94 +50,234 @@ LTC_EXPORT int LTC_CALL XSTRCMP(const char *s1, const char *s2); #endif +/* some compilers do not like "inline" (or maybe "static inline"), namely: HP cc, IBM xlc */ +#if defined(__HP_cc) || defined(__xlc__) + #define LTC_INLINE +#elif defined(_MSC_VER) + #define LTC_INLINE __inline +#else + #define LTC_INLINE inline +#endif + /* type of argument checking, 0=default, 1=fatal and 2=error+continue, 3=nothing */ #ifndef ARGTYPE #define ARGTYPE 0 #endif -/* Controls endianess and size of registers. Leave uncommented to get platform neutral [slower] code - * +#undef LTC_ENCRYPT +#define LTC_ENCRYPT 0 +#undef LTC_DECRYPT +#define LTC_DECRYPT 1 + +/* Controls endianess and size of registers. Leave uncommented to get platform neutral [slower] code + * * Note: in order to use the optimized macros your platform must support unaligned 32 and 64 bit read/writes. * The x86 platforms allow this but some others [ARM for instance] do not. On those platforms you **MUST** * use the portable [slower] macros. */ - -/* detect x86-32 machines somewhat */ -#if !defined(__STRICT_ANSI__) && (defined(INTEL_CC) || (defined(_MSC_VER) && defined(WIN32)) || (defined(__GNUC__) && (defined(__DJGPP__) || defined(__CYGWIN__) || defined(__MINGW32__) || defined(__i386__)))) +/* detect x86/i386 32bit */ +#if defined(__i386__) || defined(__i386) || defined(_M_IX86) #define ENDIAN_LITTLE #define ENDIAN_32BITWORD #define LTC_FAST - #define LTC_FAST_TYPE unsigned long -#endif - -/* detects MIPS R5900 processors (PS2) */ -#if (defined(__R5900) || defined(R5900) || defined(__R5900__)) && (defined(_mips) || defined(__mips__) || defined(mips)) - #define ENDIAN_LITTLE - #define ENDIAN_64BITWORD #endif -/* detect amd64 */ -#if !defined(__STRICT_ANSI__) && defined(__x86_64__) +/* detect amd64/x64 */ +#if defined(__x86_64__) || defined(_M_X64) || defined(_M_AMD64) #define ENDIAN_LITTLE #define ENDIAN_64BITWORD #define LTC_FAST - #define LTC_FAST_TYPE unsigned long #endif /* detect PPC32 */ -#if !defined(__STRICT_ANSI__) && defined(LTC_PPC32) +#if defined(LTC_PPC32) #define ENDIAN_BIG #define ENDIAN_32BITWORD #define LTC_FAST - #define LTC_FAST_TYPE unsigned long -#endif +#endif + +/* detects MIPS R5900 processors (PS2) */ +#if (defined(__R5900) || defined(R5900) || defined(__R5900__)) && (defined(_mips) || defined(__mips__) || defined(mips)) + #define ENDIAN_64BITWORD + #if defined(_MIPSEB) || defined(__MIPSEB) || defined(__MIPSEB__) + #define ENDIAN_BIG + #endif + #define ENDIAN_LITTLE + #endif +#endif + +/* detect AIX */ +#if defined(_AIX) && defined(_BIG_ENDIAN) + #define ENDIAN_BIG + #if defined(__LP64__) || defined(_ARCH_PPC64) + #define ENDIAN_64BITWORD + #else + #define ENDIAN_32BITWORD + #endif +#endif -/* detect sparc and sparc64 */ -#if defined(__sparc__) +/* detect HP-UX */ +#if defined(__hpux) || defined(__hpux__) #define ENDIAN_BIG - #if defined(__arch64__) + #if defined(__ia64) || defined(__ia64__) || defined(__LP64__) #define ENDIAN_64BITWORD #else #define ENDIAN_32BITWORD #endif #endif +/* detect Apple OS X */ +#if defined(__APPLE__) && defined(__MACH__) + #if defined(__LITTLE_ENDIAN__) || defined(__x86_64__) + #define ENDIAN_LITTLE + #else + #define ENDIAN_BIG + #endif + #if defined(__LP64__) || defined(__x86_64__) + #define ENDIAN_64BITWORD + #else + #define ENDIAN_32BITWORD + #endif +#endif -#ifdef LTC_NO_FAST - #ifdef LTC_FAST - #undef LTC_FAST +/* detect SPARC and SPARC64 */ +#if defined(__sparc__) || defined(__sparc) + #define ENDIAN_BIG + #if defined(__arch64__) || defined(__sparcv9) || defined(__sparc_v9__) + #define ENDIAN_64BITWORD + #else + #define ENDIAN_32BITWORD + #endif +#endif + +/* detect IBM S390(x) */ +#if defined(__s390x__) || defined(__s390__) + #define ENDIAN_BIG + #if defined(__s390x__) + #define ENDIAN_64BITWORD + #else + #define ENDIAN_32BITWORD + #endif +#endif + +/* detect PPC64 */ +#if defined(__powerpc64__) || defined(__ppc64__) || defined(__PPC64__) + #define ENDIAN_64BITWORD + #if __BYTE_ORDER__ == __ORDER_BIG_ENDIAN__ + #define ENDIAN_BIG + #elif __BYTE_ORDER__ == __ORDER_LITTLE_ENDIAN__ + #define ENDIAN_LITTLE #endif + #define LTC_FAST +#endif + +/* endianness fallback */ +#if !defined(ENDIAN_BIG) && !defined(ENDIAN_LITTLE) + #if defined(_BYTE_ORDER) && _BYTE_ORDER == _BIG_ENDIAN || \ + defined(__BYTE_ORDER) && __BYTE_ORDER == __BIG_ENDIAN || \ + defined(__BYTE_ORDER__) && __BYTE_ORDER__ == __ORDER_BIG_ENDIAN__ || \ + defined(__BIG_ENDIAN__) || \ + defined(__ARMEB__) || defined(__THUMBEB__) || defined(__AARCH64EB__) || \ + defined(_MIPSEB) || defined(__MIPSEB) || defined(__MIPSEB__) + #define ENDIAN_BIG + #elif defined(_BYTE_ORDER) && _BYTE_ORDER == _LITTLE_ENDIAN || \ + defined(__BYTE_ORDER) && __BYTE_ORDER == __LITTLE_ENDIAN || \ + defined(__BYTE_ORDER__) && __BYTE_ORDER__ == __ORDER_LITTLE_ENDIAN__ || \ + defined(__LITTLE_ENDIAN__) || \ + defined(__ARMEL__) || defined(__THUMBEL__) || defined(__AARCH64EL__) || \ + defined(_MIPSEL) || defined(__MIPSEL) || defined(__MIPSEL__) + #define ENDIAN_LITTLE + #else + #error Cannot detect endianness + #endif +#endif + +/* ulong64: 64-bit data type */ +#ifdef _MSC_VER + #define CONST64(n) n ## ui64 + typedef unsigned __int64 ulong64; +#else + #define CONST64(n) n ## ULL + typedef unsigned long long ulong64; +#endif + +/* ulong32: "32-bit at least" data type */ +#if defined(__x86_64__) || defined(_M_X64) || defined(_M_AMD64) || \ + defined(__powerpc64__) || defined(__ppc64__) || defined(__PPC64__) || \ + defined(__s390x__) || defined(__arch64__) || defined(__aarch64__) || \ + defined(__sparcv9) || defined(__sparc_v9__) || defined(__sparc64__) || \ + defined(__ia64) || defined(__ia64__) || defined(__itanium__) || defined(_M_IA64) || \ + defined(__LP64__) || defined(_LP64) || defined(__64BIT__) + typedef unsigned ulong32; + #if !defined(ENDIAN_64BITWORD) && !defined(ENDIAN_32BITWORD) + #define ENDIAN_64BITWORD + #endif +#else + typedef unsigned long ulong32; + #if !defined(ENDIAN_64BITWORD) && !defined(ENDIAN_32BITWORD) + #define ENDIAN_32BITWORD + #endif +#endif + +#if defined(ENDIAN_64BITWORD) && !defined(_MSC_VER) +typedef unsigned long long ltc_mp_digit; +#else +typedef unsigned long ltc_mp_digit; #endif /* No asm is a quick way to disable anything "not portable" */ #ifdef LTC_NO_ASM - #undef ENDIAN_LITTLE - #undef ENDIAN_BIG + #define ENDIAN_NEUTRAL #undef ENDIAN_32BITWORD #undef ENDIAN_64BITWORD #undef LTC_FAST - #undef LTC_FAST_TYPE #define LTC_NO_ROLC - #define LTC_NO_BSWAP + #define LTC_NO_BSWAP #endif -/* #define ENDIAN_LITTLE */ -/* #define ENDIAN_BIG */ +/* No LTC_FAST if: explicitly disabled OR non-gcc/non-clang compiler OR old gcc OR using -ansi -std=c99 */ +#if defined(LTC_NO_FAST) || (__GNUC__ < 4) || defined(__STRICT_ANSI__) + #undef LTC_FAST +#endif -/* #define ENDIAN_32BITWORD */ -/* #define ENDIAN_64BITWORD */ +#ifdef LTC_FAST + #define LTC_FAST_TYPE_PTR_CAST(x) ((LTC_FAST_TYPE*)(void*)(x)) + #ifdef ENDIAN_64BITWORD + typedef ulong64 __attribute__((__may_alias__)) LTC_FAST_TYPE; + #else + typedef ulong32 __attribute__((__may_alias__)) LTC_FAST_TYPE; + #endif +#endif -#if (defined(ENDIAN_BIG) || defined(ENDIAN_LITTLE)) && !(defined(ENDIAN_32BITWORD) || defined(ENDIAN_64BITWORD)) - #error You must specify a word size as well as endianess in tomcrypt_cfg.h +#if !defined(ENDIAN_NEUTRAL) && (defined(ENDIAN_BIG) || defined(ENDIAN_LITTLE)) && !(defined(ENDIAN_32BITWORD) || defined(ENDIAN_64BITWORD)) + #error You must specify a word size as well as endianess in tomcrypt_cfg.h #endif #if !(defined(ENDIAN_BIG) || defined(ENDIAN_LITTLE)) #define ENDIAN_NEUTRAL #endif +#if (defined(ENDIAN_32BITWORD) && defined(ENDIAN_64BITWORD)) + #error Cannot be 32 and 64 bit words... +#endif + +/* gcc 4.3 and up has a bswap builtin; detect it by gcc version. + * clang also supports the bswap builtin, and although clang pretends + * to be gcc (macro-wise, anyway), clang pretends to be a version + * prior to gcc 4.3, so we can't detect bswap that way. Instead, + * clang has a __has_builtin mechanism that can be used to check + * for builtins: + * http://clang.llvm.org/docs/LanguageExtensions.html#feature_check */ +#ifndef __has_builtin + #define __has_builtin(x) 0 +#endif +#if !defined(LTC_NO_BSWAP) && defined(__GNUC__) && \ + ((__GNUC__ * 100 + __GNUC_MINOR__ >= 403) || \ + (__has_builtin(__builtin_bswap32) && __has_builtin(__builtin_bswap64))) + #define LTC_HAVE_BSWAP_BUILTIN #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/headers/tomcrypt_cipher.h b/libtomcrypt/src/headers/tomcrypt_cipher.h index f23fd97..2ed201d 100644 --- a/libtomcrypt/src/headers/tomcrypt_cipher.h +++ b/libtomcrypt/src/headers/tomcrypt_cipher.h @@ -1,6 +1,15 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + */ + /* ---- SYMMETRIC KEY STUFF ----- * - * We put each of the ciphers scheduled keys in their own structs then we put all of + * We put each of the ciphers scheduled keys in their own structs then we put all of * the key formats in one union. This makes the function prototypes easier to use. */ #ifdef LTC_BLOWFISH @@ -109,7 +118,7 @@ struct noekeon_key { }; #endif -#ifdef LTC_SKIPJACK +#ifdef LTC_SKIPJACK struct skipjack_key { unsigned char key[10]; }; @@ -117,18 +126,18 @@ struct skipjack_key { #ifdef LTC_KHAZAD struct khazad_key { - ulong64 roundKeyEnc[8 + 1]; - ulong64 roundKeyDec[8 + 1]; + ulong64 roundKeyEnc[8 + 1]; + ulong64 roundKeyDec[8 + 1]; }; #endif #ifdef LTC_ANUBIS -struct anubis_key { - int keyBits; - int R; - ulong32 roundKeyEnc[18 + 1][4]; - ulong32 roundKeyDec[18 + 1][4]; -}; +struct anubis_key { + int keyBits; + int R; + ulong32 roundKeyEnc[18 + 1][4]; + ulong32 roundKeyDec[18 + 1][4]; +}; #endif #ifdef LTC_MULTI2 @@ -138,6 +147,13 @@ struct multi2_key { }; #endif +#ifdef LTC_CAMELLIA +struct camellia_key { + int R; + ulong64 kw[4], k[24], kl[6]; +}; +#endif + typedef union Symmetric_key { #ifdef LTC_DES struct des_key des; @@ -175,7 +191,7 @@ typedef union Symmetric_key { #endif #ifdef LTC_NOEKEON struct noekeon_key noekeon; -#endif +#endif #ifdef LTC_SKIPJACK struct skipjack_key skipjack; #endif @@ -190,10 +206,13 @@ typedef union Symmetric_key { #endif #ifdef LTC_KASUMI struct kasumi_key kasumi; -#endif +#endif #ifdef LTC_MULTI2 struct multi2_key multi2; #endif +#ifdef LTC_CAMELLIA + struct camellia_key camellia; +#endif void *data; } symmetric_key; @@ -201,10 +220,10 @@ typedef union Symmetric_key { /** A block cipher ECB structure */ typedef struct { /** The index of the cipher chosen */ - int cipher, + int cipher, /** The block size of the given cipher */ blocklen; - /** The scheduled key */ + /** The scheduled key */ symmetric_key key; } symmetric_ECB; #endif @@ -213,14 +232,14 @@ typedef struct { /** A block cipher CFB structure */ typedef struct { /** The index of the cipher chosen */ - int cipher, - /** The block size of the given cipher */ - blocklen, + int cipher, + /** The block size of the given cipher */ + blocklen, /** The padding offset */ padlen; /** The current IV */ - unsigned char IV[MAXBLOCKSIZE], - /** The pad used to encrypt/decrypt */ + unsigned char IV[MAXBLOCKSIZE], + /** The pad used to encrypt/decrypt */ pad[MAXBLOCKSIZE]; /** The scheduled key */ symmetric_key key; @@ -231,9 +250,9 @@ typedef struct { /** A block cipher OFB structure */ typedef struct { /** The index of the cipher chosen */ - int cipher, - /** The block size of the given cipher */ - blocklen, + int cipher, + /** The block size of the given cipher */ + blocklen, /** The padding offset */ padlen; /** The current IV */ @@ -247,8 +266,8 @@ typedef struct { /** A block cipher CBC structure */ typedef struct { /** The index of the cipher chosen */ - int cipher, - /** The block size of the given cipher */ + int cipher, + /** The block size of the given cipher */ blocklen; /** The current IV */ unsigned char IV[MAXBLOCKSIZE]; @@ -263,18 +282,18 @@ typedef struct { typedef struct { /** The index of the cipher chosen */ int cipher, - /** The block size of the given cipher */ - blocklen, + /** The block size of the given cipher */ + blocklen, /** The padding offset */ - padlen, + padlen, /** The mode (endianess) of the CTR, 0==little, 1==big */ mode, /** counter width */ ctrlen; - /** The counter */ - unsigned char ctr[MAXBLOCKSIZE], - /** The pad used to encrypt/decrypt */ + /** The counter */ + unsigned char ctr[MAXBLOCKSIZE], + /** The pad used to encrypt/decrypt */ pad[MAXBLOCKSIZE]; /** The scheduled key */ symmetric_key key; @@ -290,7 +309,7 @@ typedef struct { /** The current IV */ unsigned char IV[16], - + /** the tweak key */ tweak[16], @@ -300,7 +319,7 @@ typedef struct { /** The scheduled symmetric key */ symmetric_key key; -#ifdef LRW_TABLES +#ifdef LTC_LRW_TABLES /** The pre-computed multiplication table */ unsigned char PC[16][256][16]; #endif @@ -311,9 +330,9 @@ typedef struct { /** A block cipher F8 structure */ typedef struct { /** The index of the cipher chosen */ - int cipher, - /** The block size of the given cipher */ - blocklen, + int cipher, + /** The block size of the given cipher */ + blocklen, /** The padding offset */ padlen; /** The current IV */ @@ -330,18 +349,18 @@ typedef struct { /** cipher descriptor table, last entry has "name == NULL" to mark the end of table */ extern struct ltc_cipher_descriptor { /** name of cipher */ - char *name; + const char *name; /** internal ID */ unsigned char ID; /** min keysize (octets) */ - int min_key_length, + int min_key_length, /** max keysize (octets) */ - max_key_length, + max_key_length, /** block size (octets) */ - block_length, + block_length, /** default number of rounds */ default_rounds; - /** Setup the cipher + /** Setup the cipher @param key The input symmetric key @param keylen The length of the input key (octets) @param num_rounds The requested number of rounds (0==default) @@ -368,10 +387,10 @@ extern struct ltc_cipher_descriptor { */ int (*test)(void); - /** Terminate the context + /** Terminate the context @param skey The scheduled key */ - void (*done)(symmetric_key *skey); + void (*done)(symmetric_key *skey); /** Determine a key size @param keysize [in/out] The size of the key desired and the suggested size @@ -380,7 +399,7 @@ extern struct ltc_cipher_descriptor { int (*keysize)(int *keysize); /** Accelerators **/ - /** Accelerated ECB encryption + /** Accelerated ECB encryption @param pt Plaintext @param ct Ciphertext @param blocks The number of complete blocks to process @@ -389,7 +408,7 @@ extern struct ltc_cipher_descriptor { */ int (*accel_ecb_encrypt)(const unsigned char *pt, unsigned char *ct, unsigned long blocks, symmetric_key *skey); - /** Accelerated ECB decryption + /** Accelerated ECB decryption @param pt Plaintext @param ct Ciphertext @param blocks The number of complete blocks to process @@ -398,7 +417,7 @@ extern struct ltc_cipher_descriptor { */ int (*accel_ecb_decrypt)(const unsigned char *ct, unsigned char *pt, unsigned long blocks, symmetric_key *skey); - /** Accelerated CBC encryption + /** Accelerated CBC encryption @param pt Plaintext @param ct Ciphertext @param blocks The number of complete blocks to process @@ -408,7 +427,7 @@ extern struct ltc_cipher_descriptor { */ int (*accel_cbc_encrypt)(const unsigned char *pt, unsigned char *ct, unsigned long blocks, unsigned char *IV, symmetric_key *skey); - /** Accelerated CBC decryption + /** Accelerated CBC decryption @param pt Plaintext @param ct Ciphertext @param blocks The number of complete blocks to process @@ -418,7 +437,7 @@ extern struct ltc_cipher_descriptor { */ int (*accel_cbc_decrypt)(const unsigned char *ct, unsigned char *pt, unsigned long blocks, unsigned char *IV, symmetric_key *skey); - /** Accelerated CTR encryption + /** Accelerated CTR encryption @param pt Plaintext @param ct Ciphertext @param blocks The number of complete blocks to process @@ -429,7 +448,7 @@ extern struct ltc_cipher_descriptor { */ int (*accel_ctr_encrypt)(const unsigned char *pt, unsigned char *ct, unsigned long blocks, unsigned char *IV, int mode, symmetric_key *skey); - /** Accelerated LRW + /** Accelerated LRW @param pt Plaintext @param ct Ciphertext @param blocks The number of complete blocks to process @@ -440,7 +459,7 @@ extern struct ltc_cipher_descriptor { */ int (*accel_lrw_encrypt)(const unsigned char *pt, unsigned char *ct, unsigned long blocks, unsigned char *IV, const unsigned char *tweak, symmetric_key *skey); - /** Accelerated LRW + /** Accelerated LRW @param ct Ciphertext @param pt Plaintext @param blocks The number of complete blocks to process @@ -480,8 +499,8 @@ extern struct ltc_cipher_descriptor { /** Accelerated GCM packet (one shot) @param key The secret key @param keylen The length of the secret key - @param IV The initial vector - @param IVlen The length of the initial vector + @param IV The initialization vector + @param IVlen The length of the initialization vector @param adata The additional authentication data (header) @param adatalen The length of the adata @param pt The plaintext @@ -497,14 +516,14 @@ extern struct ltc_cipher_descriptor { const unsigned char *IV, unsigned long IVlen, const unsigned char *adata, unsigned long adatalen, unsigned char *pt, unsigned long ptlen, - unsigned char *ct, + unsigned char *ct, unsigned char *tag, unsigned long *taglen, int direction); - /** Accelerated one shot LTC_OMAC + /** Accelerated one shot LTC_OMAC @param key The secret key - @param keylen The key length (octets) - @param in The message + @param keylen The key length (octets) + @param in The message @param inlen Length of message (octets) @param out [out] Destination for tag @param outlen [in/out] Initial and final size of out @@ -515,10 +534,10 @@ extern struct ltc_cipher_descriptor { const unsigned char *in, unsigned long inlen, unsigned char *out, unsigned long *outlen); - /** Accelerated one shot XCBC + /** Accelerated one shot XCBC @param key The secret key - @param keylen The key length (octets) - @param in The message + @param keylen The key length (octets) + @param in The message @param inlen Length of message (octets) @param out [out] Destination for tag @param outlen [in/out] Initial and final size of out @@ -529,10 +548,10 @@ extern struct ltc_cipher_descriptor { const unsigned char *in, unsigned long inlen, unsigned char *out, unsigned long *outlen); - /** Accelerated one shot F9 + /** Accelerated one shot F9 @param key The secret key - @param keylen The key length (octets) - @param in The message + @param keylen The key length (octets) + @param in The message @param inlen Length of message (octets) @param out [out] Destination for tag @param outlen [in/out] Initial and final size of out @@ -543,6 +562,36 @@ extern struct ltc_cipher_descriptor { const unsigned char *key, unsigned long keylen, const unsigned char *in, unsigned long inlen, unsigned char *out, unsigned long *outlen); + + /** Accelerated XTS encryption + @param pt Plaintext + @param ct Ciphertext + @param blocks The number of complete blocks to process + @param tweak The 128-bit encryption tweak (input/output). + The tweak should not be encrypted on input, but + next tweak will be copied encrypted on output. + @param skey1 The first scheduled key context + @param skey2 The second scheduled key context + @return CRYPT_OK if successful + */ + int (*accel_xts_encrypt)(const unsigned char *pt, unsigned char *ct, + unsigned long blocks, unsigned char *tweak, symmetric_key *skey1, + symmetric_key *skey2); + + /** Accelerated XTS decryption + @param ct Ciphertext + @param pt Plaintext + @param blocks The number of complete blocks to process + @param tweak The 128-bit encryption tweak (input/output). + The tweak should not be encrypted on input, but + next tweak will be copied encrypted on output. + @param skey1 The first scheduled key context + @param skey2 The second scheduled key context + @return CRYPT_OK if successful + */ + int (*accel_xts_decrypt)(const unsigned char *ct, unsigned char *pt, + unsigned long blocks, unsigned char *tweak, symmetric_key *skey1, + symmetric_key *skey2); } cipher_descriptor[]; #ifdef LTC_BLOWFISH @@ -577,6 +626,7 @@ extern const struct ltc_cipher_descriptor rc6_desc; #ifdef LTC_RC2 int rc2_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey); +int rc2_setup_ex(const unsigned char *key, int keylen, int bits, int num_rounds, symmetric_key *skey); int rc2_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key *skey); int rc2_ecb_decrypt(const unsigned char *ct, unsigned char *pt, symmetric_key *skey); int rc2_test(void); @@ -756,8 +806,18 @@ int multi2_keysize(int *keysize); extern const struct ltc_cipher_descriptor multi2_desc; #endif +#ifdef LTC_CAMELLIA +int camellia_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey); +int camellia_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key *skey); +int camellia_ecb_decrypt(const unsigned char *ct, unsigned char *pt, symmetric_key *skey); +int camellia_test(void); +void camellia_done(symmetric_key *skey); +int camellia_keysize(int *keysize); +extern const struct ltc_cipher_descriptor camellia_desc; +#endif + #ifdef LTC_ECB_MODE -int ecb_start(int cipher, const unsigned char *key, +int ecb_start(int cipher, const unsigned char *key, int keylen, int num_rounds, symmetric_ECB *ecb); int ecb_encrypt(const unsigned char *pt, unsigned char *ct, unsigned long len, symmetric_ECB *ecb); int ecb_decrypt(const unsigned char *ct, unsigned char *pt, unsigned long len, symmetric_ECB *ecb); @@ -765,7 +825,7 @@ int ecb_done(symmetric_ECB *ecb); #endif #ifdef LTC_CFB_MODE -int cfb_start(int cipher, const unsigned char *IV, const unsigned char *key, +int cfb_start(int cipher, const unsigned char *IV, const unsigned char *key, int keylen, int num_rounds, symmetric_CFB *cfb); int cfb_encrypt(const unsigned char *pt, unsigned char *ct, unsigned long len, symmetric_CFB *cfb); int cfb_decrypt(const unsigned char *ct, unsigned char *pt, unsigned long len, symmetric_CFB *cfb); @@ -775,7 +835,7 @@ int cfb_done(symmetric_CFB *cfb); #endif #ifdef LTC_OFB_MODE -int ofb_start(int cipher, const unsigned char *IV, const unsigned char *key, +int ofb_start(int cipher, const unsigned char *IV, const unsigned char *key, int keylen, int num_rounds, symmetric_OFB *ofb); int ofb_encrypt(const unsigned char *pt, unsigned char *ct, unsigned long len, symmetric_OFB *ofb); int ofb_decrypt(const unsigned char *ct, unsigned char *pt, unsigned long len, symmetric_OFB *ofb); @@ -815,14 +875,14 @@ int ctr_test(void); #ifdef LTC_LRW_MODE -#define LRW_ENCRYPT 0 -#define LRW_DECRYPT 1 +#define LRW_ENCRYPT LTC_ENCRYPT +#define LRW_DECRYPT LTC_DECRYPT int lrw_start( int cipher, const unsigned char *IV, const unsigned char *key, int keylen, const unsigned char *tweak, - int num_rounds, + int num_rounds, symmetric_LRW *lrw); int lrw_encrypt(const unsigned char *pt, unsigned char *ct, unsigned long len, symmetric_LRW *lrw); int lrw_decrypt(const unsigned char *ct, unsigned char *pt, unsigned long len, symmetric_LRW *lrw); @@ -833,11 +893,11 @@ int lrw_test(void); /* don't call */ int lrw_process(const unsigned char *pt, unsigned char *ct, unsigned long len, int mode, symmetric_LRW *lrw); -#endif +#endif #ifdef LTC_F8_MODE -int f8_start( int cipher, const unsigned char *IV, - const unsigned char *key, int keylen, +int f8_start( int cipher, const unsigned char *IV, + const unsigned char *key, int keylen, const unsigned char *salt_key, int skeylen, int num_rounds, symmetric_F8 *f8); int f8_encrypt(const unsigned char *pt, unsigned char *ct, unsigned long len, symmetric_F8 *f8); @@ -855,21 +915,21 @@ typedef struct { } symmetric_xts; int xts_start( int cipher, - const unsigned char *key1, - const unsigned char *key2, + const unsigned char *key1, + const unsigned char *key2, unsigned long keylen, - int num_rounds, + int num_rounds, symmetric_xts *xts); int xts_encrypt( const unsigned char *pt, unsigned long ptlen, unsigned char *ct, - const unsigned char *tweak, + unsigned char *tweak, symmetric_xts *xts); int xts_decrypt( const unsigned char *ct, unsigned long ptlen, unsigned char *pt, - const unsigned char *tweak, + unsigned char *tweak, symmetric_xts *xts); void xts_done(symmetric_xts *xts); @@ -882,10 +942,67 @@ int find_cipher_any(const char *name, int blocklen, int keylen); int find_cipher_id(unsigned char ID); int register_cipher(const struct ltc_cipher_descriptor *cipher); int unregister_cipher(const struct ltc_cipher_descriptor *cipher); +int register_all_ciphers(void); int cipher_is_valid(int idx); LTC_MUTEX_PROTO(ltc_cipher_mutex) -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ---- stream ciphers ---- */ + +#ifdef LTC_CHACHA + +typedef struct { + ulong32 input[16]; + unsigned char kstream[64]; + unsigned long ksleft; + unsigned long ivlen; + int rounds; +} chacha_state; + +int chacha_setup(chacha_state *st, const unsigned char *key, unsigned long keylen, int rounds); +int chacha_ivctr32(chacha_state *st, const unsigned char *iv, unsigned long ivlen, ulong32 counter); +int chacha_ivctr64(chacha_state *st, const unsigned char *iv, unsigned long ivlen, ulong64 counter); +int chacha_crypt(chacha_state *st, const unsigned char *in, unsigned long inlen, unsigned char *out); +int chacha_keystream(chacha_state *st, unsigned char *out, unsigned long outlen); +int chacha_done(chacha_state *st); +int chacha_test(void); + +#endif /* LTC_CHACHA */ + +#ifdef LTC_RC4_STREAM + +typedef struct { + unsigned int x, y; + unsigned char buf[256]; +} rc4_state; + +int rc4_stream_setup(rc4_state *st, const unsigned char *key, unsigned long keylen); +int rc4_stream_crypt(rc4_state *st, const unsigned char *in, unsigned long inlen, unsigned char *out); +int rc4_stream_keystream(rc4_state *st, unsigned char *out, unsigned long outlen); +int rc4_stream_done(rc4_state *st); +int rc4_stream_test(void); + +#endif /* LTC_RC4_STREAM */ + +#ifdef LTC_SOBER128_STREAM + +typedef struct { + ulong32 R[17], /* Working storage for the shift register */ + initR[17], /* saved register contents */ + konst, /* key dependent constant */ + sbuf; /* partial word encryption buffer */ + int nbuf; /* number of part-word stream bits buffered */ +} sober128_state; + +int sober128_stream_setup(sober128_state *st, const unsigned char *key, unsigned long keylen); +int sober128_stream_setiv(sober128_state *st, const unsigned char *iv, unsigned long ivlen); +int sober128_stream_crypt(sober128_state *st, const unsigned char *in, unsigned long inlen, unsigned char *out); +int sober128_stream_keystream(sober128_state *st, unsigned char *out, unsigned long outlen); +int sober128_stream_done(sober128_state *st); +int sober128_stream_test(void); + +#endif /* LTC_SOBER128_STREAM */ + +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/headers/tomcrypt_custom.h b/libtomcrypt/src/headers/tomcrypt_custom.h index 0d59e31..6fb0f27 100644 --- a/libtomcrypt/src/headers/tomcrypt_custom.h +++ b/libtomcrypt/src/headers/tomcrypt_custom.h @@ -1,8 +1,16 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + */ + #ifndef TOMCRYPT_CUSTOM_H_ #define TOMCRYPT_CUSTOM_H_ -/* compile options depend on Dropbear options.h */ -#include "options.h" +#include "tomcrypt_dropbear.h" void * m_malloc(size_t size); /* m_calloc is limited in size, enough for libtomcrypt */ @@ -17,86 +25,139 @@ void m_free_direct(void* ptr); /* macros for various libc functions you can change for embedded targets */ #ifndef XMALLOC - #ifdef malloc - #define LTC_NO_PROTOTYPES - #endif #define XMALLOC malloc #endif #ifndef XREALLOC - #ifdef realloc - #define LTC_NO_PROTOTYPES - #endif #define XREALLOC realloc #endif #ifndef XCALLOC - #ifdef calloc - #define LTC_NO_PROTOTYPES - #endif #define XCALLOC calloc #endif #ifndef XFREE - #ifdef free - #define LTC_NO_PROTOTYPES - #endif #define XFREE free #endif #ifndef XMEMSET - #ifdef memset - #define LTC_NO_PROTOTYPES - #endif #define XMEMSET memset #endif #ifndef XMEMCPY - #ifdef memcpy - #define LTC_NO_PROTOTYPES - #endif #define XMEMCPY memcpy #endif +#ifndef XMEMMOVE +#define XMEMMOVE memmove +#endif #ifndef XMEMCMP - #ifdef memcmp - #define LTC_NO_PROTOTYPES - #endif #define XMEMCMP memcmp #endif +/* A memory compare function that has to run in constant time, + * c.f. mem_neq() API summary. + */ +#ifndef XMEM_NEQ +#define XMEM_NEQ mem_neq +#endif #ifndef XSTRCMP - #ifdef strcmp - #define LTC_NO_PROTOTYPES - #endif #define XSTRCMP strcmp #endif #ifndef XCLOCK #define XCLOCK clock #endif -#ifndef XCLOCKS_PER_SEC -#define XCLOCKS_PER_SEC CLOCKS_PER_SEC + +#ifndef XQSORT +#define XQSORT qsort #endif +#if ( defined(malloc) || defined(realloc) || defined(calloc) || defined(free) || \ + defined(memset) || defined(memcpy) || defined(memcmp) || defined(strcmp) || \ + defined(clock) || defined(qsort) ) && !defined(LTC_NO_PROTOTYPES) +#define LTC_NO_PROTOTYPES +#endif + +/* shortcut to disable automatic inclusion */ +#if defined LTC_NOTHING && !defined LTC_EASY + #define LTC_NO_CIPHERS + #define LTC_NO_MODES + #define LTC_NO_HASHES + #define LTC_NO_MACS #define LTC_NO_PRNGS #define LTC_NO_PK -#ifdef DROPBEAR_SMALL_CODE -#define LTC_SMALL_CODE -#endif -/* These spit out warnings etc */ -#define LTC_NO_ROLC -#ifndef XQSORT - #ifdef qsort - #define LTC_NO_PROTOTYPES - #endif -#define XQSORT qsort + #define LTC_NO_PKCS + #define LTC_NO_MISC +#endif /* LTC_NOTHING */ + +/* Easy button? */ +#ifdef LTC_EASY + #define LTC_NO_CIPHERS + #define LTC_RIJNDAEL + #define LTC_BLOWFISH + #define LTC_DES + #define LTC_CAST5 + + #define LTC_NO_MODES + #define LTC_ECB_MODE + #define LTC_CBC_MODE + #define LTC_CTR_MODE + + #define LTC_NO_HASHES + #define LTC_SHA1 + #define LTC_SHA3 + #define LTC_SHA512 + #define LTC_SHA384 + #define LTC_SHA256 + #define LTC_SHA224 + #define LTC_HASH_HELPERS + + #define LTC_NO_MACS + #define LTC_HMAC + #define LTC_OMAC + #define LTC_CCM_MODE + + #define LTC_NO_PRNGS + #define LTC_SPRNG + #define LTC_YARROW + #define LTC_DEVRANDOM + #define LTC_TRY_URANDOM_FIRST + #define LTC_RNG_GET_BYTES + #define LTC_RNG_MAKE_PRNG + + #define LTC_NO_PK + #define LTC_MRSA + #define LTC_MECC + + #define LTC_NO_MISC + #define LTC_BASE64 #endif +/* The minimal set of functionality to run the tests */ +#ifdef LTC_MINIMAL + #define LTC_RIJNDAEL + #define LTC_SHA256 + #define LTC_YARROW + #define LTC_CTR_MODE + + #define LTC_RNG_MAKE_PRNG + #define LTC_RNG_GET_BYTES + #define LTC_DEVRANDOM + #define LTC_TRY_URANDOM_FIRST + + #undef LTC_NO_FILE +#endif /* Enable self-test test vector checking */ -/* Not for dropbear */ -/*#define LTC_TEST*/ +#ifndef LTC_NO_TEST + #define LTC_TEST +#endif +/* Enable extended self-tests */ +/* #define LTC_TEST_EXT */ + +/* Use small code where possible */ +/* #define LTC_SMALL_CODE */ /* clean the stack of functions which put private information on stack */ /* #define LTC_CLEAN_STACK */ /* disable all file related functions */ -#define LTC_NO_FILE +/* #define LTC_NO_FILE */ /* disable all forms of ASM */ /* #define LTC_NO_ASM */ @@ -107,93 +168,430 @@ void m_free_direct(void* ptr); /* disable BSWAP on x86 */ /* #define LTC_NO_BSWAP */ +/* ---> math provider? <--- */ +#ifndef LTC_NO_MATH -#ifdef DROPBEAR_BLOWFISH -#define LTC_BLOWFISH -#endif +/* LibTomMath */ +/* #define LTM_DESC */ -#ifdef DROPBEAR_AES -#define LTC_RIJNDAEL -#endif +/* TomsFastMath */ +/* #define TFM_DESC */ -#ifdef DROPBEAR_TWOFISH -#define LTC_TWOFISH +/* GNU Multiple Precision Arithmetic Library */ +/* #define GMP_DESC */ + +#endif /* LTC_NO_MATH */ + +/* ---> Symmetric Block Ciphers <--- */ +#ifndef LTC_NO_CIPHERS +#define LTC_BLOWFISH +#define LTC_RC2 +#define LTC_RC5 +#define LTC_RC6 +#define LTC_SAFERP +#define LTC_RIJNDAEL +#define LTC_XTEA /* _TABLES tells it to use tables during setup, _SMALL means to use the smaller scheduled key format * (saves 4KB of ram), _ALL_TABLES enables all tables during setup */ -/* enabling just TWOFISH_SMALL will make the binary ~1kB smaller, turning on - * TWOFISH_TABLES will make it a few kB bigger, but perhaps reduces runtime - * memory usage? */ -#define LTC_TWOFISH_SMALL -/*#define LTC_TWOFISH_TABLES*/ +#define LTC_TWOFISH +#ifndef LTC_NO_TABLES + #define LTC_TWOFISH_TABLES + /* #define LTC_TWOFISH_ALL_TABLES */ +#else + #define LTC_TWOFISH_SMALL #endif - -#ifdef DROPBEAR_3DES +/* #define LTC_TWOFISH_SMALL */ +/* LTC_DES includes EDE triple-DES */ #define LTC_DES -#endif - +#define LTC_CAST5 +#define LTC_NOEKEON +#define LTC_SKIPJACK +#define LTC_SAFER +#define LTC_KHAZAD +#define LTC_ANUBIS +#define LTC_ANUBIS_TWEAK +#define LTC_KSEED +#define LTC_KASUMI +#define LTC_MULTI2 +#define LTC_CAMELLIA + +/* stream ciphers */ +#define LTC_CHACHA +#define LTC_RC4_STREAM +#define LTC_SOBER128_STREAM + +#endif /* LTC_NO_CIPHERS */ + + +/* ---> Block Cipher Modes of Operation <--- */ +#ifndef LTC_NO_MODES + +#define LTC_CFB_MODE +#define LTC_OFB_MODE +#define LTC_ECB_MODE #define LTC_CBC_MODE - -#ifdef DROPBEAR_ENABLE_CTR_MODE #define LTC_CTR_MODE + +/* F8 chaining mode */ +#define LTC_F8_MODE + +/* LRW mode */ +#define LTC_LRW_MODE +#ifndef LTC_NO_TABLES + /* like GCM mode this will enable 16 8x128 tables [64KB] that make + * seeking very fast. + */ + #define LTC_LRW_TABLES #endif -#define LTC_SHA1 +/* XTS mode */ +#define LTC_XTS_MODE -#ifdef DROPBEAR_MD5 +#endif /* LTC_NO_MODES */ + +/* ---> One-Way Hash Functions <--- */ +#ifndef LTC_NO_HASHES + +#define LTC_CHC_HASH +#define LTC_WHIRLPOOL +#define LTC_SHA3 +#define LTC_SHA512 +#define LTC_SHA512_256 +#define LTC_SHA512_224 +#define LTC_SHA384 +#define LTC_SHA256 +#define LTC_SHA224 +#define LTC_TIGER +#define LTC_SHA1 #define LTC_MD5 +#define LTC_MD4 +#define LTC_MD2 +#define LTC_RIPEMD128 +#define LTC_RIPEMD160 +#define LTC_RIPEMD256 +#define LTC_RIPEMD320 +#define LTC_BLAKE2S +#define LTC_BLAKE2B + +#define LTC_HASH_HELPERS + +#endif /* LTC_NO_HASHES */ + + +/* ---> MAC functions <--- */ +#ifndef LTC_NO_MACS + +#define LTC_HMAC +#define LTC_OMAC +#define LTC_PMAC +#define LTC_XCBC +#define LTC_F9_MODE +#define LTC_PELICAN +#define LTC_POLY1305 +#define LTC_BLAKE2SMAC +#define LTC_BLAKE2BMAC + +/* ---> Encrypt + Authenticate Modes <--- */ + +#define LTC_EAX_MODE + +#define LTC_OCB_MODE +#define LTC_OCB3_MODE +#define LTC_CCM_MODE +#define LTC_GCM_MODE +#define LTC_CHACHA20POLY1305_MODE + +/* Use 64KiB tables */ +#ifndef LTC_NO_TABLES + #define LTC_GCM_TABLES #endif -#ifdef DROPBEAR_SHA256 -#define LTC_SHA256 +/* USE SSE2? requires GCC works on x86_32 and x86_64*/ +#ifdef LTC_GCM_TABLES +/* #define LTC_GCM_TABLES_SSE2 */ #endif -#ifdef DROPBEAR_SHA384 -#define LTC_SHA384 + +#endif /* LTC_NO_MACS */ + + +/* --> Pseudo Random Number Generators <--- */ +#ifndef LTC_NO_PRNGS + +/* Yarrow */ +#define LTC_YARROW + +/* a PRNG that simply reads from an available system source */ +#define LTC_SPRNG + +/* The RC4 stream cipher based PRNG */ +#define LTC_RC4 + +/* The ChaCha20 stream cipher based PRNG */ +#define LTC_CHACHA20_PRNG + +/* Fortuna PRNG */ +#define LTC_FORTUNA + +/* Greg's SOBER128 stream cipher based PRNG */ +#define LTC_SOBER128 + +/* the *nix style /dev/random device */ +#define LTC_DEVRANDOM +/* try /dev/urandom before trying /dev/random + * are you sure you want to disable this? http://www.2uo.de/myths-about-urandom/ */ +#define LTC_TRY_URANDOM_FIRST +/* rng_get_bytes() */ +#define LTC_RNG_GET_BYTES +/* rng_make_prng() */ +#define LTC_RNG_MAKE_PRNG + +/* enable the ltc_rng hook to integrate e.g. embedded hardware RNG's easily */ +/* #define LTC_PRNG_ENABLE_LTC_RNG */ + +#endif /* LTC_NO_PRNGS */ + +#ifdef LTC_YARROW + +/* which descriptor of AES to use? */ +/* 0 = rijndael_enc 1 = aes_enc, 2 = rijndael [full], 3 = aes [full] */ +#ifdef ENCRYPT_ONLY + #define LTC_YARROW_AES 0 +#else + #define LTC_YARROW_AES 2 #endif -#ifdef DROPBEAR_SHA512 -#define LTC_SHA512 + #endif -#define LTC_HMAC +#ifdef LTC_FORTUNA + +#ifndef LTC_FORTUNA_WD +/* reseed every N calls to the read function */ +#define LTC_FORTUNA_WD 10 +#endif + +#ifndef LTC_FORTUNA_POOLS +/* number of pools (4..32) can save a bit of ram by lowering the count */ +#define LTC_FORTUNA_POOLS 32 +#endif + +#endif /* LTC_FORTUNA */ + -#ifdef DROPBEAR_ECC +/* ---> Public Key Crypto <--- */ +#ifndef LTC_NO_PK + +/* Include RSA support */ +#define LTC_MRSA + +/* Include Diffie-Hellman support */ +/* is_prime fails for GMP */ +#define LTC_MDH +/* Supported Key Sizes */ +#define LTC_DH768 +#define LTC_DH1024 +#define LTC_DH1536 +#define LTC_DH2048 + +#ifndef TFM_DESC +/* tfm has a problem in fp_isprime for larger key sizes */ +#define LTC_DH3072 +#define LTC_DH4096 +#define LTC_DH6144 +#define LTC_DH8192 +#endif + +/* Include Katja (a Rabin variant like RSA) */ +/* #define LTC_MKAT */ + +/* Digital Signature Algorithm */ +#define LTC_MDSA + +/* ECC */ #define LTC_MECC + +/* use Shamir's trick for point mul (speeds up signature verification) */ #define LTC_ECC_SHAMIR + +#if defined(TFM_DESC) && defined(LTC_MECC) + #define LTC_MECC_ACCEL +#endif + +/* do we want fixed point ECC */ +/* #define LTC_MECC_FP */ + +#endif /* LTC_NO_PK */ + +#if defined(LTC_MRSA) && !defined(LTC_NO_RSA_BLINDING) +/* Enable RSA blinding when doing private key operations by default */ +#define LTC_RSA_BLINDING +#endif /* LTC_NO_RSA_BLINDING */ + +#if defined(LTC_MRSA) && !defined(LTC_NO_RSA_CRT_HARDENING) +/* Enable RSA CRT hardening when doing private key operations by default */ +#define LTC_RSA_CRT_HARDENING +#endif /* LTC_NO_RSA_CRT_HARDENING */ + +#if defined(LTC_MECC) && !defined(LTC_NO_ECC_TIMING_RESISTANT) +/* Enable ECC timing resistant version by default */ #define LTC_ECC_TIMING_RESISTANT -#define MPI -#define LTM_DESC -#ifdef DROPBEAR_ECC_256 -#define ECC256 #endif -#ifdef DROPBEAR_ECC_384 -#define ECC384 + +/* PKCS #1 (RSA) and #5 (Password Handling) stuff */ +#ifndef LTC_NO_PKCS + +#define LTC_PKCS_1 +#define LTC_PKCS_5 + +/* Include ASN.1 DER (required by DSA/RSA) */ +#define LTC_DER + +#endif /* LTC_NO_PKCS */ + +/* misc stuff */ +#ifndef LTC_NO_MISC + +/* Various tidbits of modern neatoness */ +#define LTC_BASE64 +/* ... and it's URL safe version */ +#define LTC_BASE64_URL + +/* Keep LTC_NO_HKDF for compatibility reasons + * superseeded by LTC_NO_MISC*/ +#ifndef LTC_NO_HKDF +/* HKDF Key Derivation/Expansion stuff */ +#define LTC_HKDF +#endif /* LTC_NO_HKDF */ + +#define LTC_ADLER32 + +#define LTC_CRC32 + +#endif /* LTC_NO_MISC */ + +/* cleanup */ + +#ifdef LTC_MECC +/* Supported ECC Key Sizes */ +#ifndef LTC_NO_CURVES + #define LTC_ECC112 + #define LTC_ECC128 + #define LTC_ECC160 + #define LTC_ECC192 + #define LTC_ECC224 + #define LTC_ECC256 + #define LTC_ECC384 + #define LTC_ECC521 #endif -#ifdef DROPBEAR_ECC_521 -#define ECC521 #endif + +#if defined(LTC_MECC) || defined(LTC_MRSA) || defined(LTC_MDSA) || defined(LTC_MKAT) + /* Include the MPI functionality? (required by the PK algorithms) */ + #define LTC_MPI + + #ifndef LTC_PK_MAX_RETRIES + /* iterations limit for retry-loops */ + #define LTC_PK_MAX_RETRIES 20 + #endif #endif -/* Various tidbits of modern neatoness */ -#define LTC_BASE64 +#ifdef LTC_MRSA + #define LTC_PKCS_1 +#endif + +#if defined(LTC_PELICAN) && !defined(LTC_RIJNDAEL) + #error Pelican-MAC requires LTC_RIJNDAEL +#endif + +#if defined(LTC_EAX_MODE) && !(defined(LTC_CTR_MODE) && defined(LTC_OMAC)) + #error LTC_EAX_MODE requires CTR and LTC_OMAC mode +#endif + +#if defined(LTC_YARROW) && !defined(LTC_CTR_MODE) + #error LTC_YARROW requires LTC_CTR_MODE chaining mode to be defined! +#endif + +#if defined(LTC_DER) && !defined(LTC_MPI) + #error ASN.1 DER requires MPI functionality +#endif -/* default no pthread functions */ +/* Dropbear patched out LTC_MECC */ +#if (defined(LTC_MDSA) || defined(LTC_MRSA) || /*defined(LTC_MECC) ||*/ defined(LTC_MKAT)) && !defined(LTC_DER) + #error PK requires ASN.1 DER functionality, make sure LTC_DER is enabled +#endif + +#if defined(LTC_CHACHA20POLY1305_MODE) && (!defined(LTC_CHACHA) || !defined(LTC_POLY1305)) + #error LTC_CHACHA20POLY1305_MODE requires LTC_CHACHA + LTC_POLY1305 +#endif + +#if defined(LTC_CHACHA20_PRNG) && !defined(LTC_CHACHA) + #error LTC_CHACHA20_PRNG requires LTC_CHACHA +#endif + +#if defined(LTC_RC4) && !defined(LTC_RC4_STREAM) + #error LTC_RC4 requires LTC_RC4_STREAM +#endif + +#if defined(LTC_SOBER128) && !defined(LTC_SOBER128_STREAM) + #error LTC_SOBER128 requires LTC_SOBER128_STREAM +#endif + +#if defined(LTC_BLAKE2SMAC) && !defined(LTC_BLAKE2S) + #error LTC_BLAKE2SMAC requires LTC_BLAKE2S +#endif + +#if defined(LTC_BLAKE2BMAC) && !defined(LTC_BLAKE2B) + #error LTC_BLAKE2BMAC requires LTC_BLAKE2B +#endif + +#if defined(LTC_SPRNG) && !defined(LTC_RNG_GET_BYTES) + #error LTC_SPRNG requires LTC_RNG_GET_BYTES +#endif + +#if defined(LTC_NO_MATH) && (defined(LTM_DESC) || defined(TFM_DESC) || defined(GMP_DESC)) + #error LTC_NO_MATH defined, but also a math descriptor +#endif + +/* THREAD management */ +#ifdef LTC_PTHREAD + +#include <pthread.h> + +#define LTC_MUTEX_GLOBAL(x) pthread_mutex_t x = PTHREAD_MUTEX_INITIALIZER; +#define LTC_MUTEX_PROTO(x) extern pthread_mutex_t x; +#define LTC_MUTEX_TYPE(x) pthread_mutex_t x; +#define LTC_MUTEX_INIT(x) LTC_ARGCHK(pthread_mutex_init(x, NULL) == 0); +#define LTC_MUTEX_LOCK(x) LTC_ARGCHK(pthread_mutex_lock(x) == 0); +#define LTC_MUTEX_UNLOCK(x) LTC_ARGCHK(pthread_mutex_unlock(x) == 0); +#define LTC_MUTEX_DESTROY(x) LTC_ARGCHK(pthread_mutex_destroy(x) == 0); + +#else + +/* default no functions */ #define LTC_MUTEX_GLOBAL(x) #define LTC_MUTEX_PROTO(x) #define LTC_MUTEX_TYPE(x) #define LTC_MUTEX_INIT(x) #define LTC_MUTEX_LOCK(x) #define LTC_MUTEX_UNLOCK(x) -#define FORTUNA_POOLS 0 +#define LTC_MUTEX_DESTROY(x) + +#endif /* Debuggers */ -/* define this if you use Valgrind, note: it CHANGES the way SOBER-128 and LTC_RC4 work (see the code) */ +/* define this if you use Valgrind, note: it CHANGES the way SOBER-128 and RC4 work (see the code) */ /* #define LTC_VALGRIND */ #endif +#ifndef LTC_NO_FILE + /* buffer size for reading from a file via fread(..) */ + #ifndef LTC_FILE_READ_BUFSIZE + #define LTC_FILE_READ_BUFSIZE 8192 + #endif +#endif - -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/headers/tomcrypt_dropbear.h b/libtomcrypt/src/headers/tomcrypt_dropbear.h new file mode 100644 index 0000000..b0ce45b --- /dev/null +++ b/libtomcrypt/src/headers/tomcrypt_dropbear.h @@ -0,0 +1,84 @@ +/* compile options depend on Dropbear options.h */ +#include "options.h" + +/* Dropbear config */ + +#define LTC_NOTHING + +/* Use small code where possible */ +#if DROPBEAR_SMALL_CODE +#define LTC_SMALL_CODE +#endif + +#if DROPBEAR_BLOWFISH +#define LTC_BLOWFISH +#endif +#if DROPBEAR_AES +#define LTC_RIJNDAEL +#endif +/* _TABLES tells it to use tables during setup, _SMALL means to use the smaller scheduled key format + * (saves 4KB of ram), _ALL_TABLES enables all tables during setup */ +#if DROPBEAR_TWOFISH +#define LTC_TWOFISH +#define LTC_TWOFISH_SMALL +#endif + +#if DROPBEAR_3DES +#define LTC_DES +#endif + +#if DROPBEAR_ENABLE_CTR_MODE +#define LTC_CBC_MODE +#endif + +#if DROPBEAR_ENABLE_CTR_MODE +#define LTC_CTR_MODE +#endif + + +#if DROPBEAR_SHA512 +#define LTC_SHA512 +#endif + +#if DROPBEAR_SHA384 +#define LTC_SHA384 +#endif + +#if DROPBEAR_SHA256 +#define LTC_SHA256 +#endif + +#define LTC_SHA1 + +#if DROPBEAR_MD5 +#define LTC_MD5 +#endif + +/* ECC */ +#if DROPBEAR_ECC +#define LTC_MECC +#define LTM_DESC + +/* use Shamir's trick for point mul (speeds up signature verification) */ +#define LTC_ECC_SHAMIR + +#if DROPBEAR_ECC_256 +#define LTC_ECC256 +#endif +#if DROPBEAR_ECC_384 +#define LTC_ECC384 +#endif +#if DROPBEAR_ECC_521 +#define LTC_ECC521 +#endif + +#endif /* DROPBEAR_ECC */ + +#define LTC_HMAC +#define LTC_HASH_HELPERS + +#define LTC_NO_TEST + +#define LTC_BASE64 + +/* end Dropbear config */ diff --git a/libtomcrypt/src/headers/tomcrypt_hash.h b/libtomcrypt/src/headers/tomcrypt_hash.h index 56b272a..ef494f7 100644 --- a/libtomcrypt/src/headers/tomcrypt_hash.h +++ b/libtomcrypt/src/headers/tomcrypt_hash.h @@ -1,4 +1,25 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + */ + /* ---- HASH FUNCTIONS ---- */ +#ifdef LTC_SHA3 +struct sha3_state { + ulong64 saved; /* the portion of the input message that we didn't consume yet */ + ulong64 s[25]; + unsigned char sb[25 * 8]; /* used for storing `ulong64 s[25]` as little-endian bytes */ + unsigned short byte_index; /* 0..7--the next byte after the set one (starts from 0; 0--none are buffered) */ + unsigned short word_index; /* 0..24--the next word to integrate input (starts from 0) */ + unsigned short capacity_words; /* the double size of the hash output in words (e.g. 16 for Keccak 512) */ + unsigned short xof_flag; +}; +#endif + #ifdef LTC_SHA512 struct sha512_state { ulong64 length, state[8]; @@ -102,6 +123,30 @@ struct chc_state { }; #endif +#ifdef LTC_BLAKE2S +struct blake2s_state { + ulong32 h[8]; + ulong32 t[2]; + ulong32 f[2]; + unsigned char buf[64]; + unsigned long curlen; + unsigned long outlen; + unsigned char last_node; +}; +#endif + +#ifdef LTC_BLAKE2B +struct blake2b_state { + ulong64 h[8]; + ulong64 t[2]; + ulong64 f[2]; + unsigned char buf[128]; + unsigned long curlen; + unsigned long outlen; + unsigned char last_node; +}; +#endif + typedef union Hash_state { char dummy[1]; #ifdef LTC_CHC_HASH @@ -110,6 +155,9 @@ typedef union Hash_state { #ifdef LTC_WHIRLPOOL struct whirlpool_state whirlpool; #endif +#ifdef LTC_SHA3 + struct sha3_state sha3; +#endif #ifdef LTC_SHA512 struct sha512_state sha512; #endif @@ -143,13 +191,20 @@ typedef union Hash_state { #ifdef LTC_RIPEMD320 struct rmd320_state rmd320; #endif +#ifdef LTC_BLAKE2S + struct blake2s_state blake2s; +#endif +#ifdef LTC_BLAKE2B + struct blake2b_state blake2b; +#endif + void *data; } hash_state; /** hash descriptor */ extern struct ltc_hash_descriptor { /** name of hash */ - char *name; + const char *name; /** internal ID */ unsigned char ID; /** Size of digest in octets */ @@ -166,7 +221,7 @@ extern struct ltc_hash_descriptor { @return CRYPT_OK if successful */ int (*init)(hash_state *hash); - /** Process a block of data + /** Process a block of data @param hash The hash state @param in The data to hash @param inlen The length of the data (octets) @@ -186,7 +241,7 @@ extern struct ltc_hash_descriptor { /* accelerated hmac callback: if you need to-do multiple packets just use the generic hmac_memory and provide a hash callback */ int (*hmac_block)(const unsigned char *key, unsigned long keylen, - const unsigned char *in, unsigned long inlen, + const unsigned char *in, unsigned long inlen, unsigned char *out, unsigned long *outlen); } hash_descriptor[]; @@ -208,6 +263,30 @@ int whirlpool_test(void); extern const struct ltc_hash_descriptor whirlpool_desc; #endif +#ifdef LTC_SHA3 +int sha3_512_init(hash_state * md); +int sha3_512_test(void); +extern const struct ltc_hash_descriptor sha3_512_desc; +int sha3_384_init(hash_state * md); +int sha3_384_test(void); +extern const struct ltc_hash_descriptor sha3_384_desc; +int sha3_256_init(hash_state * md); +int sha3_256_test(void); +extern const struct ltc_hash_descriptor sha3_256_desc; +int sha3_224_init(hash_state * md); +int sha3_224_test(void); +extern const struct ltc_hash_descriptor sha3_224_desc; +/* process + done are the same for all variants */ +int sha3_process(hash_state * md, const unsigned char *in, unsigned long inlen); +int sha3_done(hash_state *md, unsigned char *hash); +/* SHAKE128 + SHAKE256 */ +int sha3_shake_init(hash_state *md, int num); +#define sha3_shake_process(a,b,c) sha3_process(a,b,c) +int sha3_shake_done(hash_state *md, unsigned char *out, unsigned long outlen); +int sha3_shake_test(void); +int sha3_shake_memory(int num, const unsigned char *in, unsigned long inlen, unsigned char *out, unsigned long *outlen); +#endif + #ifdef LTC_SHA512 int sha512_init(hash_state * md); int sha512_process(hash_state * md, const unsigned char *in, unsigned long inlen); @@ -227,6 +306,28 @@ int sha384_test(void); extern const struct ltc_hash_descriptor sha384_desc; #endif +#ifdef LTC_SHA512_256 +#ifndef LTC_SHA512 + #error LTC_SHA512 is required for LTC_SHA512_256 +#endif +int sha512_256_init(hash_state * md); +#define sha512_256_process sha512_process +int sha512_256_done(hash_state * md, unsigned char *hash); +int sha512_256_test(void); +extern const struct ltc_hash_descriptor sha512_256_desc; +#endif + +#ifdef LTC_SHA512_224 +#ifndef LTC_SHA512 + #error LTC_SHA512 is required for LTC_SHA512_224 +#endif +int sha512_224_init(hash_state * md); +#define sha512_224_process sha512_process +int sha512_224_done(hash_state * md, unsigned char *hash); +int sha512_224_test(void); +extern const struct ltc_hash_descriptor sha512_224_desc; +#endif + #ifdef LTC_SHA256 int sha256_init(hash_state * md); int sha256_process(hash_state * md, const unsigned char *in, unsigned long inlen); @@ -254,6 +355,50 @@ int sha1_test(void); extern const struct ltc_hash_descriptor sha1_desc; #endif +#ifdef LTC_BLAKE2S +extern const struct ltc_hash_descriptor blake2s_256_desc; +int blake2s_256_init(hash_state * md); +int blake2s_256_test(void); + +extern const struct ltc_hash_descriptor blake2s_224_desc; +int blake2s_224_init(hash_state * md); +int blake2s_224_test(void); + +extern const struct ltc_hash_descriptor blake2s_160_desc; +int blake2s_160_init(hash_state * md); +int blake2s_160_test(void); + +extern const struct ltc_hash_descriptor blake2s_128_desc; +int blake2s_128_init(hash_state * md); +int blake2s_128_test(void); + +int blake2s_init(hash_state * md, unsigned long outlen, const unsigned char *key, unsigned long keylen); +int blake2s_process(hash_state * md, const unsigned char *in, unsigned long inlen); +int blake2s_done(hash_state * md, unsigned char *hash); +#endif + +#ifdef LTC_BLAKE2B +extern const struct ltc_hash_descriptor blake2b_512_desc; +int blake2b_512_init(hash_state * md); +int blake2b_512_test(void); + +extern const struct ltc_hash_descriptor blake2b_384_desc; +int blake2b_384_init(hash_state * md); +int blake2b_384_test(void); + +extern const struct ltc_hash_descriptor blake2b_256_desc; +int blake2b_256_init(hash_state * md); +int blake2b_256_test(void); + +extern const struct ltc_hash_descriptor blake2b_160_desc; +int blake2b_160_init(hash_state * md); +int blake2b_160_test(void); + +int blake2b_init(hash_state * md, unsigned long outlen, const unsigned char *key, unsigned long keylen); +int blake2b_process(hash_state * md, const unsigned char *in, unsigned long inlen); +int blake2b_done(hash_state * md, unsigned char *hash); +#endif + #ifdef LTC_MD5 int md5_init(hash_state * md); int md5_process(hash_state * md, const unsigned char *in, unsigned long inlen); @@ -325,17 +470,21 @@ int find_hash_oid(const unsigned long *ID, unsigned long IDlen); int find_hash_any(const char *name, int digestlen); int register_hash(const struct ltc_hash_descriptor *hash); int unregister_hash(const struct ltc_hash_descriptor *hash); +int register_all_hashes(void); int hash_is_valid(int idx); LTC_MUTEX_PROTO(ltc_hash_mutex) -int hash_memory(int hash, - const unsigned char *in, unsigned long inlen, +int hash_memory(int hash, + const unsigned char *in, unsigned long inlen, unsigned char *out, unsigned long *outlen); int hash_memory_multi(int hash, unsigned char *out, unsigned long *outlen, const unsigned char *in, unsigned long inlen, ...); + +#ifndef LTC_NO_FILE int hash_filehandle(int hash, FILE *in, unsigned char *out, unsigned long *outlen); int hash_file(int hash, const char *fname, unsigned char *out, unsigned long *outlen); +#endif /* a simple macro for making hash "process" functions */ #define HASH_PROCESS(func_name, compress_name, state_var, block_size) \ @@ -348,6 +497,9 @@ int func_name (hash_state * md, const unsigned char *in, unsigned long inlen) if (md-> state_var .curlen > sizeof(md-> state_var .buf)) { \ return CRYPT_INVALID_ARG; \ } \ + if ((md-> state_var .length + inlen) < md-> state_var .length) { \ + return CRYPT_HASH_OVERFLOW; \ + } \ while (inlen > 0) { \ if (md-> state_var .curlen == 0 && inlen >= block_size) { \ if ((err = compress_name (md, (unsigned char *)in)) != CRYPT_OK) { \ @@ -358,7 +510,7 @@ int func_name (hash_state * md, const unsigned char *in, unsigned long inlen) inlen -= block_size; \ } else { \ n = MIN(inlen, (block_size - md-> state_var .curlen)); \ - memcpy(md-> state_var .buf + md-> state_var.curlen, in, (size_t)n); \ + XMEMCPY(md-> state_var .buf + md-> state_var.curlen, in, (size_t)n); \ md-> state_var .curlen += n; \ in += n; \ inlen -= n; \ @@ -374,6 +526,6 @@ int func_name (hash_state * md, const unsigned char *in, unsigned long inlen) return CRYPT_OK; \ } -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/headers/tomcrypt_mac.h b/libtomcrypt/src/headers/tomcrypt_mac.h index d030d73..04f825d 100644 --- a/libtomcrypt/src/headers/tomcrypt_mac.h +++ b/libtomcrypt/src/headers/tomcrypt_mac.h @@ -1,3 +1,12 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + */ + #ifdef LTC_HMAC typedef struct Hmac_state { hash_state md; @@ -10,23 +19,23 @@ int hmac_init(hmac_state *hmac, int hash, const unsigned char *key, unsigned lon int hmac_process(hmac_state *hmac, const unsigned char *in, unsigned long inlen); int hmac_done(hmac_state *hmac, unsigned char *out, unsigned long *outlen); int hmac_test(void); -int hmac_memory(int hash, +int hmac_memory(int hash, const unsigned char *key, unsigned long keylen, - const unsigned char *in, unsigned long inlen, + const unsigned char *in, unsigned long inlen, unsigned char *out, unsigned long *outlen); -int hmac_memory_multi(int hash, +int hmac_memory_multi(int hash, const unsigned char *key, unsigned long keylen, unsigned char *out, unsigned long *outlen, const unsigned char *in, unsigned long inlen, ...); int hmac_file(int hash, const char *fname, const unsigned char *key, - unsigned long keylen, + unsigned long keylen, unsigned char *dst, unsigned long *dstlen); #endif #ifdef LTC_OMAC typedef struct { - int cipher_idx, + int cipher_idx, buflen, blklen; unsigned char block[MAXBLOCKSIZE], @@ -38,17 +47,17 @@ typedef struct { int omac_init(omac_state *omac, int cipher, const unsigned char *key, unsigned long keylen); int omac_process(omac_state *omac, const unsigned char *in, unsigned long inlen); int omac_done(omac_state *omac, unsigned char *out, unsigned long *outlen); -int omac_memory(int cipher, +int omac_memory(int cipher, const unsigned char *key, unsigned long keylen, const unsigned char *in, unsigned long inlen, unsigned char *out, unsigned long *outlen); -int omac_memory_multi(int cipher, +int omac_memory_multi(int cipher, const unsigned char *key, unsigned long keylen, unsigned char *out, unsigned long *outlen, const unsigned char *in, unsigned long inlen, ...); -int omac_file(int cipher, +int omac_file(int cipher, const unsigned char *key, unsigned long keylen, - const char *filename, + const char *filename, unsigned char *out, unsigned long *outlen); int omac_test(void); #endif /* LTC_OMAC */ @@ -73,19 +82,19 @@ int pmac_init(pmac_state *pmac, int cipher, const unsigned char *key, unsigned l int pmac_process(pmac_state *pmac, const unsigned char *in, unsigned long inlen); int pmac_done(pmac_state *pmac, unsigned char *out, unsigned long *outlen); -int pmac_memory(int cipher, +int pmac_memory(int cipher, const unsigned char *key, unsigned long keylen, const unsigned char *msg, unsigned long msglen, unsigned char *out, unsigned long *outlen); -int pmac_memory_multi(int cipher, +int pmac_memory_multi(int cipher, const unsigned char *key, unsigned long keylen, unsigned char *out, unsigned long *outlen, const unsigned char *in, unsigned long inlen, ...); -int pmac_file(int cipher, +int pmac_file(int cipher, const unsigned char *key, unsigned long keylen, - const char *filename, + const char *filename, unsigned char *out, unsigned long *outlen); int pmac_test(void); @@ -96,6 +105,47 @@ void pmac_shift_xor(pmac_state *pmac); #endif /* PMAC */ +#ifdef LTC_POLY1305 +typedef struct { + ulong32 r[5]; + ulong32 h[5]; + ulong32 pad[4]; + unsigned long leftover; + unsigned char buffer[16]; + int final; +} poly1305_state; + +int poly1305_init(poly1305_state *st, const unsigned char *key, unsigned long keylen); +int poly1305_process(poly1305_state *st, const unsigned char *in, unsigned long inlen); +int poly1305_done(poly1305_state *st, unsigned char *mac, unsigned long *maclen); +int poly1305_memory(const unsigned char *key, unsigned long keylen, const unsigned char *in, unsigned long inlen, unsigned char *mac, unsigned long *maclen); +int poly1305_memory_multi(const unsigned char *key, unsigned long keylen, unsigned char *mac, unsigned long *maclen, const unsigned char *in, unsigned long inlen, ...); +int poly1305_file(const char *fname, const unsigned char *key, unsigned long keylen, unsigned char *mac, unsigned long *maclen); +int poly1305_test(void); +#endif /* LTC_POLY1305 */ + +#ifdef LTC_BLAKE2SMAC +typedef hash_state blake2smac_state; +int blake2smac_init(blake2smac_state *st, unsigned long outlen, const unsigned char *key, unsigned long keylen); +int blake2smac_process(blake2smac_state *st, const unsigned char *in, unsigned long inlen); +int blake2smac_done(blake2smac_state *st, unsigned char *mac, unsigned long *maclen); +int blake2smac_memory(const unsigned char *key, unsigned long keylen, const unsigned char *in, unsigned long inlen, unsigned char *mac, unsigned long *maclen); +int blake2smac_memory_multi(const unsigned char *key, unsigned long keylen, unsigned char *mac, unsigned long *maclen, const unsigned char *in, unsigned long inlen, ...); +int blake2smac_file(const char *fname, const unsigned char *key, unsigned long keylen, unsigned char *mac, unsigned long *maclen); +int blake2smac_test(void); +#endif /* LTC_BLAKE2SMAC */ + +#ifdef LTC_BLAKE2BMAC +typedef hash_state blake2bmac_state; +int blake2bmac_init(blake2bmac_state *st, unsigned long outlen, const unsigned char *key, unsigned long keylen); +int blake2bmac_process(blake2bmac_state *st, const unsigned char *in, unsigned long inlen); +int blake2bmac_done(blake2bmac_state *st, unsigned char *mac, unsigned long *maclen); +int blake2bmac_memory(const unsigned char *key, unsigned long keylen, const unsigned char *in, unsigned long inlen, unsigned char *mac, unsigned long *maclen); +int blake2bmac_memory_multi(const unsigned char *key, unsigned long keylen, unsigned char *mac, unsigned long *maclen, const unsigned char *in, unsigned long inlen, ...); +int blake2bmac_file(const char *fname, const unsigned char *key, unsigned long keylen, unsigned char *mac, unsigned long *maclen); +int blake2bmac_test(void); +#endif /* LTC_BLAKE2BMAC */ + #ifdef LTC_EAX_MODE #if !(defined(LTC_OMAC) && defined(LTC_CTR_MODE)) @@ -152,32 +202,32 @@ typedef struct { block_len; /* length of block */ } ocb_state; -int ocb_init(ocb_state *ocb, int cipher, +int ocb_init(ocb_state *ocb, int cipher, const unsigned char *key, unsigned long keylen, const unsigned char *nonce); int ocb_encrypt(ocb_state *ocb, const unsigned char *pt, unsigned char *ct); int ocb_decrypt(ocb_state *ocb, const unsigned char *ct, unsigned char *pt); -int ocb_done_encrypt(ocb_state *ocb, +int ocb_done_encrypt(ocb_state *ocb, const unsigned char *pt, unsigned long ptlen, - unsigned char *ct, + unsigned char *ct, unsigned char *tag, unsigned long *taglen); -int ocb_done_decrypt(ocb_state *ocb, +int ocb_done_decrypt(ocb_state *ocb, const unsigned char *ct, unsigned long ctlen, - unsigned char *pt, + unsigned char *pt, const unsigned char *tag, unsigned long taglen, int *stat); int ocb_encrypt_authenticate_memory(int cipher, const unsigned char *key, unsigned long keylen, - const unsigned char *nonce, + const unsigned char *nonce, const unsigned char *pt, unsigned long ptlen, unsigned char *ct, unsigned char *tag, unsigned long *taglen); int ocb_decrypt_verify_memory(int cipher, const unsigned char *key, unsigned long keylen, - const unsigned char *nonce, + const unsigned char *nonce, const unsigned char *ct, unsigned long ctlen, unsigned char *pt, const unsigned char *tag, unsigned long taglen, @@ -193,10 +243,111 @@ int s_ocb_done(ocb_state *ocb, const unsigned char *pt, unsigned long ptlen, #endif /* LTC_OCB_MODE */ +#ifdef LTC_OCB3_MODE +typedef struct { + unsigned char Offset_0[MAXBLOCKSIZE], /* Offset_0 value */ + Offset_current[MAXBLOCKSIZE], /* Offset_{current_block_index} value */ + L_dollar[MAXBLOCKSIZE], /* L_$ value */ + L_star[MAXBLOCKSIZE], /* L_* value */ + L_[32][MAXBLOCKSIZE], /* L_{i} values */ + tag_part[MAXBLOCKSIZE], /* intermediate result of tag calculation */ + checksum[MAXBLOCKSIZE]; /* current checksum */ + + /* AAD related members */ + unsigned char aSum_current[MAXBLOCKSIZE], /* AAD related helper variable */ + aOffset_current[MAXBLOCKSIZE], /* AAD related helper variable */ + adata_buffer[MAXBLOCKSIZE]; /* AAD buffer */ + int adata_buffer_bytes; /* bytes in AAD buffer */ + unsigned long ablock_index; /* index # for current adata (AAD) block */ + + symmetric_key key; /* scheduled key for cipher */ + unsigned long block_index; /* index # for current data block */ + int cipher, /* cipher idx */ + tag_len, /* length of tag */ + block_len; /* length of block */ +} ocb3_state; + +int ocb3_init(ocb3_state *ocb, int cipher, + const unsigned char *key, unsigned long keylen, + const unsigned char *nonce, unsigned long noncelen, + unsigned long taglen); + +int ocb3_encrypt(ocb3_state *ocb, const unsigned char *pt, unsigned long ptlen, unsigned char *ct); +int ocb3_decrypt(ocb3_state *ocb, const unsigned char *ct, unsigned long ctlen, unsigned char *pt); +int ocb3_encrypt_last(ocb3_state *ocb, const unsigned char *pt, unsigned long ptlen, unsigned char *ct); +int ocb3_decrypt_last(ocb3_state *ocb, const unsigned char *ct, unsigned long ctlen, unsigned char *pt); +int ocb3_add_aad(ocb3_state *ocb, const unsigned char *aad, unsigned long aadlen); +int ocb3_done(ocb3_state *ocb, unsigned char *tag, unsigned long *taglen); + +int ocb3_encrypt_authenticate_memory(int cipher, + const unsigned char *key, unsigned long keylen, + const unsigned char *nonce, unsigned long noncelen, + const unsigned char *adata, unsigned long adatalen, + const unsigned char *pt, unsigned long ptlen, + unsigned char *ct, + unsigned char *tag, unsigned long *taglen); + +int ocb3_decrypt_verify_memory(int cipher, + const unsigned char *key, unsigned long keylen, + const unsigned char *nonce, unsigned long noncelen, + const unsigned char *adata, unsigned long adatalen, + const unsigned char *ct, unsigned long ctlen, + unsigned char *pt, + const unsigned char *tag, unsigned long taglen, + int *stat); + +int ocb3_test(void); + +#ifdef LTC_SOURCE +/* internal helper functions */ +int ocb3_int_ntz(unsigned long x); +void ocb3_int_xor_blocks(unsigned char *out, const unsigned char *block_a, const unsigned char *block_b, unsigned long block_len); +#endif /* LTC_SOURCE */ + +#endif /* LTC_OCB3_MODE */ + #ifdef LTC_CCM_MODE -#define CCM_ENCRYPT 0 -#define CCM_DECRYPT 1 +#define CCM_ENCRYPT LTC_ENCRYPT +#define CCM_DECRYPT LTC_DECRYPT + +typedef struct { + symmetric_key K; + int cipher, /* which cipher */ + taglen, /* length of the tag */ + x; /* index in PAD */ + + unsigned long L, /* L value */ + ptlen, /* length that will be enc / dec */ + current_ptlen, /* current processed length */ + aadlen, /* length of the aad */ + current_aadlen, /* length of the currently provided add */ + noncelen; /* length of the nonce */ + + unsigned char PAD[16], + ctr[16], + CTRPAD[16], + CTRlen; +} ccm_state; + +int ccm_init(ccm_state *ccm, int cipher, + const unsigned char *key, int keylen, int ptlen, int taglen, int aad_len); + +int ccm_reset(ccm_state *ccm); + +int ccm_add_nonce(ccm_state *ccm, + const unsigned char *nonce, unsigned long noncelen); + +int ccm_add_aad(ccm_state *ccm, + const unsigned char *adata, unsigned long adatalen); + +int ccm_process(ccm_state *ccm, + unsigned char *pt, unsigned long ptlen, + unsigned char *ct, + int direction); + +int ccm_done(ccm_state *ccm, + unsigned char *tag, unsigned long *taglen); int ccm_memory(int cipher, const unsigned char *key, unsigned long keylen, @@ -218,20 +369,20 @@ void gcm_gf_mult(const unsigned char *a, const unsigned char *b, unsigned char * /* table shared between GCM and LRW */ -#if defined(LTC_GCM_TABLES) || defined(LRW_TABLES) || ((defined(LTC_GCM_MODE) || defined(LTC_GCM_MODE)) && defined(LTC_FAST)) +#if defined(LTC_GCM_TABLES) || defined(LTC_LRW_TABLES) || ((defined(LTC_GCM_MODE) || defined(LTC_GCM_MODE)) && defined(LTC_FAST)) extern const unsigned char gcm_shift_table[]; #endif #ifdef LTC_GCM_MODE -#define GCM_ENCRYPT 0 -#define GCM_DECRYPT 1 +#define GCM_ENCRYPT LTC_ENCRYPT +#define GCM_DECRYPT LTC_DECRYPT #define LTC_GCM_MODE_IV 0 #define LTC_GCM_MODE_AAD 1 #define LTC_GCM_MODE_TEXT 2 -typedef struct { +typedef struct { symmetric_key K; unsigned char H[16], /* multiplier */ X[16], /* accumulator */ @@ -253,7 +404,7 @@ typedef struct { __attribute__ ((aligned (16))) #endif ; -#endif +#endif } gcm_state; void gcm_mult_h(gcm_state *gcm, unsigned char *I); @@ -263,7 +414,7 @@ int gcm_init(gcm_state *gcm, int cipher, int gcm_reset(gcm_state *gcm); -int gcm_add_iv(gcm_state *gcm, +int gcm_add_iv(gcm_state *gcm, const unsigned char *IV, unsigned long IVlen); int gcm_add_aad(gcm_state *gcm, @@ -274,7 +425,7 @@ int gcm_process(gcm_state *gcm, unsigned char *ct, int direction); -int gcm_done(gcm_state *gcm, +int gcm_done(gcm_state *gcm, unsigned char *tag, unsigned long *taglen); int gcm_memory( int cipher, @@ -282,7 +433,7 @@ int gcm_memory( int cipher, const unsigned char *IV, unsigned long IVlen, const unsigned char *adata, unsigned long adatalen, unsigned char *pt, unsigned long ptlen, - unsigned char *ct, + unsigned char *ct, unsigned char *tag, unsigned long *taglen, int direction); int gcm_test(void); @@ -328,17 +479,17 @@ typedef struct { int xcbc_init(xcbc_state *xcbc, int cipher, const unsigned char *key, unsigned long keylen); int xcbc_process(xcbc_state *xcbc, const unsigned char *in, unsigned long inlen); int xcbc_done(xcbc_state *xcbc, unsigned char *out, unsigned long *outlen); -int xcbc_memory(int cipher, +int xcbc_memory(int cipher, const unsigned char *key, unsigned long keylen, const unsigned char *in, unsigned long inlen, unsigned char *out, unsigned long *outlen); -int xcbc_memory_multi(int cipher, +int xcbc_memory_multi(int cipher, const unsigned char *key, unsigned long keylen, unsigned char *out, unsigned long *outlen, const unsigned char *in, unsigned long inlen, ...); -int xcbc_file(int cipher, +int xcbc_file(int cipher, const unsigned char *key, unsigned long keylen, - const char *filename, + const char *filename, unsigned char *out, unsigned long *outlen); int xcbc_test(void); @@ -362,23 +513,53 @@ typedef struct { int f9_init(f9_state *f9, int cipher, const unsigned char *key, unsigned long keylen); int f9_process(f9_state *f9, const unsigned char *in, unsigned long inlen); int f9_done(f9_state *f9, unsigned char *out, unsigned long *outlen); -int f9_memory(int cipher, +int f9_memory(int cipher, const unsigned char *key, unsigned long keylen, const unsigned char *in, unsigned long inlen, unsigned char *out, unsigned long *outlen); -int f9_memory_multi(int cipher, +int f9_memory_multi(int cipher, const unsigned char *key, unsigned long keylen, unsigned char *out, unsigned long *outlen, const unsigned char *in, unsigned long inlen, ...); -int f9_file(int cipher, +int f9_file(int cipher, const unsigned char *key, unsigned long keylen, - const char *filename, + const char *filename, unsigned char *out, unsigned long *outlen); int f9_test(void); #endif +#ifdef LTC_CHACHA20POLY1305_MODE -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +typedef struct { + poly1305_state poly; + chacha_state chacha; + ulong64 aadlen; + ulong64 ctlen; + int aadflg; +} chacha20poly1305_state; + +#define CHACHA20POLY1305_ENCRYPT LTC_ENCRYPT +#define CHACHA20POLY1305_DECRYPT LTC_DECRYPT + +int chacha20poly1305_init(chacha20poly1305_state *st, const unsigned char *key, unsigned long keylen); +int chacha20poly1305_setiv(chacha20poly1305_state *st, const unsigned char *iv, unsigned long ivlen); +int chacha20poly1305_setiv_rfc7905(chacha20poly1305_state *st, const unsigned char *iv, unsigned long ivlen, ulong64 sequence_number); +int chacha20poly1305_add_aad(chacha20poly1305_state *st, const unsigned char *in, unsigned long inlen); +int chacha20poly1305_encrypt(chacha20poly1305_state *st, const unsigned char *in, unsigned long inlen, unsigned char *out); +int chacha20poly1305_decrypt(chacha20poly1305_state *st, const unsigned char *in, unsigned long inlen, unsigned char *out); +int chacha20poly1305_done(chacha20poly1305_state *st, unsigned char *tag, unsigned long *taglen); +int chacha20poly1305_memory(const unsigned char *key, unsigned long keylen, + const unsigned char *iv, unsigned long ivlen, + const unsigned char *aad, unsigned long aadlen, + const unsigned char *in, unsigned long inlen, + unsigned char *out, + unsigned char *tag, unsigned long *taglen, + int direction); +int chacha20poly1305_test(void); + +#endif /* LTC_CHACHA20POLY1305_MODE */ + +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/headers/tomcrypt_macros.h b/libtomcrypt/src/headers/tomcrypt_macros.h index 6e4d757..94e368f 100644 --- a/libtomcrypt/src/headers/tomcrypt_macros.h +++ b/libtomcrypt/src/headers/tomcrypt_macros.h @@ -1,73 +1,73 @@ -/* fix for MSVC ...evil! */ -#ifdef _MSC_VER - #define CONST64(n) n ## ui64 - typedef unsigned __int64 ulong64; -#else - #define CONST64(n) n ## ULL - typedef unsigned long long ulong64; -#endif - -/* this is the "32-bit at least" data type - * Re-define it to suit your platform but it must be at least 32-bits +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. */ -#if defined(__x86_64__) || (defined(__sparc__) && defined(__arch64__)) - typedef unsigned ulong32; -#else - typedef unsigned long ulong32; -#endif /* ---- HELPER MACROS ---- */ #ifdef ENDIAN_NEUTRAL #define STORE32L(x, y) \ - { (y)[3] = (unsigned char)(((x)>>24)&255); (y)[2] = (unsigned char)(((x)>>16)&255); \ - (y)[1] = (unsigned char)(((x)>>8)&255); (y)[0] = (unsigned char)((x)&255); } + do { (y)[3] = (unsigned char)(((x)>>24)&255); (y)[2] = (unsigned char)(((x)>>16)&255); \ + (y)[1] = (unsigned char)(((x)>>8)&255); (y)[0] = (unsigned char)((x)&255); } while(0) #define LOAD32L(x, y) \ - { x = ((unsigned long)((y)[3] & 255)<<24) | \ - ((unsigned long)((y)[2] & 255)<<16) | \ - ((unsigned long)((y)[1] & 255)<<8) | \ - ((unsigned long)((y)[0] & 255)); } + do { x = ((ulong32)((y)[3] & 255)<<24) | \ + ((ulong32)((y)[2] & 255)<<16) | \ + ((ulong32)((y)[1] & 255)<<8) | \ + ((ulong32)((y)[0] & 255)); } while(0) #define STORE64L(x, y) \ - { (y)[7] = (unsigned char)(((x)>>56)&255); (y)[6] = (unsigned char)(((x)>>48)&255); \ + do { (y)[7] = (unsigned char)(((x)>>56)&255); (y)[6] = (unsigned char)(((x)>>48)&255); \ (y)[5] = (unsigned char)(((x)>>40)&255); (y)[4] = (unsigned char)(((x)>>32)&255); \ (y)[3] = (unsigned char)(((x)>>24)&255); (y)[2] = (unsigned char)(((x)>>16)&255); \ - (y)[1] = (unsigned char)(((x)>>8)&255); (y)[0] = (unsigned char)((x)&255); } + (y)[1] = (unsigned char)(((x)>>8)&255); (y)[0] = (unsigned char)((x)&255); } while(0) #define LOAD64L(x, y) \ - { x = (((ulong64)((y)[7] & 255))<<56)|(((ulong64)((y)[6] & 255))<<48)| \ + do { x = (((ulong64)((y)[7] & 255))<<56)|(((ulong64)((y)[6] & 255))<<48)| \ (((ulong64)((y)[5] & 255))<<40)|(((ulong64)((y)[4] & 255))<<32)| \ (((ulong64)((y)[3] & 255))<<24)|(((ulong64)((y)[2] & 255))<<16)| \ - (((ulong64)((y)[1] & 255))<<8)|(((ulong64)((y)[0] & 255))); } + (((ulong64)((y)[1] & 255))<<8)|(((ulong64)((y)[0] & 255))); } while(0) #define STORE32H(x, y) \ - { (y)[0] = (unsigned char)(((x)>>24)&255); (y)[1] = (unsigned char)(((x)>>16)&255); \ - (y)[2] = (unsigned char)(((x)>>8)&255); (y)[3] = (unsigned char)((x)&255); } + do { (y)[0] = (unsigned char)(((x)>>24)&255); (y)[1] = (unsigned char)(((x)>>16)&255); \ + (y)[2] = (unsigned char)(((x)>>8)&255); (y)[3] = (unsigned char)((x)&255); } while(0) #define LOAD32H(x, y) \ - { x = ((unsigned long)((y)[0] & 255)<<24) | \ - ((unsigned long)((y)[1] & 255)<<16) | \ - ((unsigned long)((y)[2] & 255)<<8) | \ - ((unsigned long)((y)[3] & 255)); } + do { x = ((ulong32)((y)[0] & 255)<<24) | \ + ((ulong32)((y)[1] & 255)<<16) | \ + ((ulong32)((y)[2] & 255)<<8) | \ + ((ulong32)((y)[3] & 255)); } while(0) #define STORE64H(x, y) \ - { (y)[0] = (unsigned char)(((x)>>56)&255); (y)[1] = (unsigned char)(((x)>>48)&255); \ +do { (y)[0] = (unsigned char)(((x)>>56)&255); (y)[1] = (unsigned char)(((x)>>48)&255); \ (y)[2] = (unsigned char)(((x)>>40)&255); (y)[3] = (unsigned char)(((x)>>32)&255); \ (y)[4] = (unsigned char)(((x)>>24)&255); (y)[5] = (unsigned char)(((x)>>16)&255); \ - (y)[6] = (unsigned char)(((x)>>8)&255); (y)[7] = (unsigned char)((x)&255); } + (y)[6] = (unsigned char)(((x)>>8)&255); (y)[7] = (unsigned char)((x)&255); } while(0) #define LOAD64H(x, y) \ - { x = (((ulong64)((y)[0] & 255))<<56)|(((ulong64)((y)[1] & 255))<<48) | \ +do { x = (((ulong64)((y)[0] & 255))<<56)|(((ulong64)((y)[1] & 255))<<48) | \ (((ulong64)((y)[2] & 255))<<40)|(((ulong64)((y)[3] & 255))<<32) | \ (((ulong64)((y)[4] & 255))<<24)|(((ulong64)((y)[5] & 255))<<16) | \ - (((ulong64)((y)[6] & 255))<<8)|(((ulong64)((y)[7] & 255))); } + (((ulong64)((y)[6] & 255))<<8)|(((ulong64)((y)[7] & 255))); } while(0) + + +#elif defined(ENDIAN_LITTLE) -#endif /* ENDIAN_NEUTRAL */ +#ifdef LTC_HAVE_BSWAP_BUILTIN -#ifdef ENDIAN_LITTLE +#define STORE32H(x, y) \ +do { ulong32 __t = __builtin_bswap32 ((x)); \ + XMEMCPY ((y), &__t, 4); } while(0) -#if !defined(LTC_NO_BSWAP) && (defined(INTEL_CC) || (defined(__GNUC__) && (defined(__DJGPP__) || defined(__CYGWIN__) || defined(__MINGW32__) || defined(__i386__) || defined(__x86_64__)))) +#define LOAD32H(x, y) \ +do { XMEMCPY (&(x), (y), 4); \ + (x) = __builtin_bswap32 ((x)); } while(0) + +#elif !defined(LTC_NO_BSWAP) && (defined(INTEL_CC) || (defined(__GNUC__) && (defined(__DJGPP__) || defined(__CYGWIN__) || defined(__MINGW32__) || defined(__i386__) || defined(__x86_64__)))) #define STORE32H(x, y) \ asm __volatile__ ( \ @@ -85,144 +85,152 @@ asm __volatile__ ( \ #else #define STORE32H(x, y) \ - { (y)[0] = (unsigned char)(((x)>>24)&255); (y)[1] = (unsigned char)(((x)>>16)&255); \ - (y)[2] = (unsigned char)(((x)>>8)&255); (y)[3] = (unsigned char)((x)&255); } + do { (y)[0] = (unsigned char)(((x)>>24)&255); (y)[1] = (unsigned char)(((x)>>16)&255); \ + (y)[2] = (unsigned char)(((x)>>8)&255); (y)[3] = (unsigned char)((x)&255); } while(0) #define LOAD32H(x, y) \ - { x = ((unsigned long)((y)[0] & 255)<<24) | \ - ((unsigned long)((y)[1] & 255)<<16) | \ - ((unsigned long)((y)[2] & 255)<<8) | \ - ((unsigned long)((y)[3] & 255)); } + do { x = ((ulong32)((y)[0] & 255)<<24) | \ + ((ulong32)((y)[1] & 255)<<16) | \ + ((ulong32)((y)[2] & 255)<<8) | \ + ((ulong32)((y)[3] & 255)); } while(0) #endif +#ifdef LTC_HAVE_BSWAP_BUILTIN + +#define STORE64H(x, y) \ +do { ulong64 __t = __builtin_bswap64 ((x)); \ + XMEMCPY ((y), &__t, 8); } while(0) + +#define LOAD64H(x, y) \ +do { XMEMCPY (&(x), (y), 8); \ + (x) = __builtin_bswap64 ((x)); } while(0) /* x86_64 processor */ -#if !defined(LTC_NO_BSWAP) && (defined(__GNUC__) && defined(__x86_64__)) +#elif !defined(LTC_NO_BSWAP) && (defined(__GNUC__) && defined(__x86_64__)) #define STORE64H(x, y) \ asm __volatile__ ( \ "bswapq %0 \n\t" \ "movq %0,(%1)\n\t" \ "bswapq %0 \n\t" \ - ::"r"(x), "r"(y)); + ::"r"(x), "r"(y): "memory"); #define LOAD64H(x, y) \ asm __volatile__ ( \ "movq (%1),%0\n\t" \ "bswapq %0\n\t" \ - :"=r"(x): "r"(y)); + :"=r"(x): "r"(y): "memory"); #else #define STORE64H(x, y) \ - { (y)[0] = (unsigned char)(((x)>>56)&255); (y)[1] = (unsigned char)(((x)>>48)&255); \ +do { (y)[0] = (unsigned char)(((x)>>56)&255); (y)[1] = (unsigned char)(((x)>>48)&255); \ (y)[2] = (unsigned char)(((x)>>40)&255); (y)[3] = (unsigned char)(((x)>>32)&255); \ (y)[4] = (unsigned char)(((x)>>24)&255); (y)[5] = (unsigned char)(((x)>>16)&255); \ - (y)[6] = (unsigned char)(((x)>>8)&255); (y)[7] = (unsigned char)((x)&255); } + (y)[6] = (unsigned char)(((x)>>8)&255); (y)[7] = (unsigned char)((x)&255); } while(0) #define LOAD64H(x, y) \ - { x = (((ulong64)((y)[0] & 255))<<56)|(((ulong64)((y)[1] & 255))<<48) | \ +do { x = (((ulong64)((y)[0] & 255))<<56)|(((ulong64)((y)[1] & 255))<<48) | \ (((ulong64)((y)[2] & 255))<<40)|(((ulong64)((y)[3] & 255))<<32) | \ (((ulong64)((y)[4] & 255))<<24)|(((ulong64)((y)[5] & 255))<<16) | \ - (((ulong64)((y)[6] & 255))<<8)|(((ulong64)((y)[7] & 255))); } + (((ulong64)((y)[6] & 255))<<8)|(((ulong64)((y)[7] & 255))); } while(0) #endif -#ifdef ENDIAN_32BITWORD +#ifdef ENDIAN_32BITWORD #define STORE32L(x, y) \ - { ulong32 __t = (x); XMEMCPY(y, &__t, 4); } + do { ulong32 __t = (x); XMEMCPY(y, &__t, 4); } while(0) #define LOAD32L(x, y) \ - XMEMCPY(&(x), y, 4); + do { XMEMCPY(&(x), y, 4); } while(0) #define STORE64L(x, y) \ - { (y)[7] = (unsigned char)(((x)>>56)&255); (y)[6] = (unsigned char)(((x)>>48)&255); \ + do { (y)[7] = (unsigned char)(((x)>>56)&255); (y)[6] = (unsigned char)(((x)>>48)&255); \ (y)[5] = (unsigned char)(((x)>>40)&255); (y)[4] = (unsigned char)(((x)>>32)&255); \ (y)[3] = (unsigned char)(((x)>>24)&255); (y)[2] = (unsigned char)(((x)>>16)&255); \ - (y)[1] = (unsigned char)(((x)>>8)&255); (y)[0] = (unsigned char)((x)&255); } + (y)[1] = (unsigned char)(((x)>>8)&255); (y)[0] = (unsigned char)((x)&255); } while(0) #define LOAD64L(x, y) \ - { x = (((ulong64)((y)[7] & 255))<<56)|(((ulong64)((y)[6] & 255))<<48)| \ + do { x = (((ulong64)((y)[7] & 255))<<56)|(((ulong64)((y)[6] & 255))<<48)| \ (((ulong64)((y)[5] & 255))<<40)|(((ulong64)((y)[4] & 255))<<32)| \ (((ulong64)((y)[3] & 255))<<24)|(((ulong64)((y)[2] & 255))<<16)| \ - (((ulong64)((y)[1] & 255))<<8)|(((ulong64)((y)[0] & 255))); } + (((ulong64)((y)[1] & 255))<<8)|(((ulong64)((y)[0] & 255))); } while(0) #else /* 64-bit words then */ #define STORE32L(x, y) \ - { ulong32 __t = (x); XMEMCPY(y, &__t, 4); } + do { ulong32 __t = (x); XMEMCPY(y, &__t, 4); } while(0) #define LOAD32L(x, y) \ - { XMEMCPY(&(x), y, 4); x &= 0xFFFFFFFF; } + do { XMEMCPY(&(x), y, 4); x &= 0xFFFFFFFF; } while(0) #define STORE64L(x, y) \ - { ulong64 __t = (x); XMEMCPY(y, &__t, 8); } + do { ulong64 __t = (x); XMEMCPY(y, &__t, 8); } while(0) #define LOAD64L(x, y) \ - { XMEMCPY(&(x), y, 8); } + do { XMEMCPY(&(x), y, 8); } while(0) #endif /* ENDIAN_64BITWORD */ -#endif /* ENDIAN_LITTLE */ +#elif defined(ENDIAN_BIG) -#ifdef ENDIAN_BIG #define STORE32L(x, y) \ - { (y)[3] = (unsigned char)(((x)>>24)&255); (y)[2] = (unsigned char)(((x)>>16)&255); \ - (y)[1] = (unsigned char)(((x)>>8)&255); (y)[0] = (unsigned char)((x)&255); } + do { (y)[3] = (unsigned char)(((x)>>24)&255); (y)[2] = (unsigned char)(((x)>>16)&255); \ + (y)[1] = (unsigned char)(((x)>>8)&255); (y)[0] = (unsigned char)((x)&255); } while(0) #define LOAD32L(x, y) \ - { x = ((unsigned long)((y)[3] & 255)<<24) | \ - ((unsigned long)((y)[2] & 255)<<16) | \ - ((unsigned long)((y)[1] & 255)<<8) | \ - ((unsigned long)((y)[0] & 255)); } + do { x = ((ulong32)((y)[3] & 255)<<24) | \ + ((ulong32)((y)[2] & 255)<<16) | \ + ((ulong32)((y)[1] & 255)<<8) | \ + ((ulong32)((y)[0] & 255)); } while(0) #define STORE64L(x, y) \ - { (y)[7] = (unsigned char)(((x)>>56)&255); (y)[6] = (unsigned char)(((x)>>48)&255); \ +do { (y)[7] = (unsigned char)(((x)>>56)&255); (y)[6] = (unsigned char)(((x)>>48)&255); \ (y)[5] = (unsigned char)(((x)>>40)&255); (y)[4] = (unsigned char)(((x)>>32)&255); \ (y)[3] = (unsigned char)(((x)>>24)&255); (y)[2] = (unsigned char)(((x)>>16)&255); \ - (y)[1] = (unsigned char)(((x)>>8)&255); (y)[0] = (unsigned char)((x)&255); } + (y)[1] = (unsigned char)(((x)>>8)&255); (y)[0] = (unsigned char)((x)&255); } while(0) #define LOAD64L(x, y) \ - { x = (((ulong64)((y)[7] & 255))<<56)|(((ulong64)((y)[6] & 255))<<48) | \ +do { x = (((ulong64)((y)[7] & 255))<<56)|(((ulong64)((y)[6] & 255))<<48) | \ (((ulong64)((y)[5] & 255))<<40)|(((ulong64)((y)[4] & 255))<<32) | \ (((ulong64)((y)[3] & 255))<<24)|(((ulong64)((y)[2] & 255))<<16) | \ - (((ulong64)((y)[1] & 255))<<8)|(((ulong64)((y)[0] & 255))); } + (((ulong64)((y)[1] & 255))<<8)|(((ulong64)((y)[0] & 255))); } while(0) -#ifdef ENDIAN_32BITWORD +#ifdef ENDIAN_32BITWORD #define STORE32H(x, y) \ - { ulong32 __t = (x); XMEMCPY(y, &__t, 4); } + do { ulong32 __t = (x); XMEMCPY(y, &__t, 4); } while(0) #define LOAD32H(x, y) \ - XMEMCPY(&(x), y, 4); + do { XMEMCPY(&(x), y, 4); } while(0) #define STORE64H(x, y) \ - { (y)[0] = (unsigned char)(((x)>>56)&255); (y)[1] = (unsigned char)(((x)>>48)&255); \ + do { (y)[0] = (unsigned char)(((x)>>56)&255); (y)[1] = (unsigned char)(((x)>>48)&255); \ (y)[2] = (unsigned char)(((x)>>40)&255); (y)[3] = (unsigned char)(((x)>>32)&255); \ (y)[4] = (unsigned char)(((x)>>24)&255); (y)[5] = (unsigned char)(((x)>>16)&255); \ - (y)[6] = (unsigned char)(((x)>>8)&255); (y)[7] = (unsigned char)((x)&255); } + (y)[6] = (unsigned char)(((x)>>8)&255); (y)[7] = (unsigned char)((x)&255); } while(0) #define LOAD64H(x, y) \ - { x = (((ulong64)((y)[0] & 255))<<56)|(((ulong64)((y)[1] & 255))<<48)| \ + do { x = (((ulong64)((y)[0] & 255))<<56)|(((ulong64)((y)[1] & 255))<<48)| \ (((ulong64)((y)[2] & 255))<<40)|(((ulong64)((y)[3] & 255))<<32)| \ (((ulong64)((y)[4] & 255))<<24)|(((ulong64)((y)[5] & 255))<<16)| \ - (((ulong64)((y)[6] & 255))<<8)| (((ulong64)((y)[7] & 255))); } + (((ulong64)((y)[6] & 255))<<8)| (((ulong64)((y)[7] & 255))); } while(0) #else /* 64-bit words then */ #define STORE32H(x, y) \ - { ulong32 __t = (x); XMEMCPY(y, &__t, 4); } + do { ulong32 __t = (x); XMEMCPY(y, &__t, 4); } while(0) #define LOAD32H(x, y) \ - { XMEMCPY(&(x), y, 4); x &= 0xFFFFFFFF; } + do { XMEMCPY(&(x), y, 4); x &= 0xFFFFFFFF; } while(0) #define STORE64H(x, y) \ - { ulong64 __t = (x); XMEMCPY(y, &__t, 8); } + do { ulong64 __t = (x); XMEMCPY(y, &__t, 8); } while(0) #define LOAD64H(x, y) \ - { XMEMCPY(&(x), y, 8); } + do { XMEMCPY(&(x), y, 8); } while(0) #endif /* ENDIAN_64BITWORD */ #endif /* ENDIAN_BIG */ @@ -233,6 +241,7 @@ asm __volatile__ ( \ /* 32-bit Rotates */ #if defined(_MSC_VER) +#define LTC_ROx_ASM /* instrinsic rotate */ #include <stdlib.h> @@ -243,8 +252,9 @@ asm __volatile__ ( \ #define ROLc(x,n) _lrotl(x,n) #elif !defined(__STRICT_ANSI__) && defined(__GNUC__) && (defined(__i386__) || defined(__x86_64__)) && !defined(INTEL_CC) && !defined(LTC_NO_ASM) +#define LTC_ROx_ASM -static inline unsigned ROL(unsigned word, int i) +static inline ulong32 ROL(ulong32 word, int i) { asm ("roll %%cl,%0" :"=r" (word) @@ -252,7 +262,7 @@ static inline unsigned ROL(unsigned word, int i) return word; } -static inline unsigned ROR(unsigned word, int i) +static inline ulong32 ROR(ulong32 word, int i) { asm ("rorl %%cl,%0" :"=r" (word) @@ -262,21 +272,22 @@ static inline unsigned ROR(unsigned word, int i) #ifndef LTC_NO_ROLC -static inline unsigned ROLc(unsigned word, const int i) -{ - asm ("roll %2,%0" - :"=r" (word) - :"0" (word),"I" (i)); - return word; -} - -static inline unsigned RORc(unsigned word, const int i) -{ - asm ("rorl %2,%0" - :"=r" (word) - :"0" (word),"I" (i)); - return word; -} +#define ROLc(word,i) ({ \ + ulong32 __ROLc_tmp = (word); \ + __asm__ ("roll %2, %0" : \ + "=r" (__ROLc_tmp) : \ + "0" (__ROLc_tmp), \ + "I" (i)); \ + __ROLc_tmp; \ + }) +#define RORc(word,i) ({ \ + ulong32 __RORc_tmp = (word); \ + __asm__ ("rorl %2, %0" : \ + "=r" (__RORc_tmp) : \ + "0" (__RORc_tmp), \ + "I" (i)); \ + __RORc_tmp; \ + }) #else @@ -286,8 +297,9 @@ static inline unsigned RORc(unsigned word, const int i) #endif #elif !defined(__STRICT_ANSI__) && defined(LTC_PPC32) +#define LTC_ROx_ASM -static inline unsigned ROL(unsigned word, int i) +static inline ulong32 ROL(ulong32 word, int i) { asm ("rotlw %0,%0,%2" :"=r" (word) @@ -295,7 +307,7 @@ static inline unsigned ROL(unsigned word, int i) return word; } -static inline unsigned ROR(unsigned word, int i) +static inline ulong32 ROR(ulong32 word, int i) { asm ("rotlw %0,%0,%2" :"=r" (word) @@ -305,7 +317,7 @@ static inline unsigned ROR(unsigned word, int i) #ifndef LTC_NO_ROLC -static inline unsigned ROLc(unsigned word, const int i) +static inline ulong32 ROLc(ulong32 word, const int i) { asm ("rotlwi %0,%0,%2" :"=r" (word) @@ -313,7 +325,7 @@ static inline unsigned ROLc(unsigned word, const int i) return word; } -static inline unsigned RORc(unsigned word, const int i) +static inline ulong32 RORc(ulong32 word, const int i) { asm ("rotrwi %0,%0,%2" :"=r" (word) @@ -332,18 +344,18 @@ static inline unsigned RORc(unsigned word, const int i) #else /* rotates the hard way */ -#define ROL(x, y) ( (((unsigned long)(x)<<(unsigned long)((y)&31)) | (((unsigned long)(x)&0xFFFFFFFFUL)>>(unsigned long)(32-((y)&31)))) & 0xFFFFFFFFUL) -#define ROR(x, y) ( ((((unsigned long)(x)&0xFFFFFFFFUL)>>(unsigned long)((y)&31)) | ((unsigned long)(x)<<(unsigned long)(32-((y)&31)))) & 0xFFFFFFFFUL) -#define ROLc(x, y) ( (((unsigned long)(x)<<(unsigned long)((y)&31)) | (((unsigned long)(x)&0xFFFFFFFFUL)>>(unsigned long)(32-((y)&31)))) & 0xFFFFFFFFUL) -#define RORc(x, y) ( ((((unsigned long)(x)&0xFFFFFFFFUL)>>(unsigned long)((y)&31)) | ((unsigned long)(x)<<(unsigned long)(32-((y)&31)))) & 0xFFFFFFFFUL) +#define ROL(x, y) ( (((ulong32)(x)<<(ulong32)((y)&31)) | (((ulong32)(x)&0xFFFFFFFFUL)>>(ulong32)((32-((y)&31))&31))) & 0xFFFFFFFFUL) +#define ROR(x, y) ( ((((ulong32)(x)&0xFFFFFFFFUL)>>(ulong32)((y)&31)) | ((ulong32)(x)<<(ulong32)((32-((y)&31))&31))) & 0xFFFFFFFFUL) +#define ROLc(x, y) ( (((ulong32)(x)<<(ulong32)((y)&31)) | (((ulong32)(x)&0xFFFFFFFFUL)>>(ulong32)((32-((y)&31))&31))) & 0xFFFFFFFFUL) +#define RORc(x, y) ( ((((ulong32)(x)&0xFFFFFFFFUL)>>(ulong32)((y)&31)) | ((ulong32)(x)<<(ulong32)((32-((y)&31))&31))) & 0xFFFFFFFFUL) #endif /* 64-bit Rotates */ -#if !defined(__STRICT_ANSI__) && defined(__GNUC__) && defined(__x86_64__) && !defined(LTC_NO_ASM) +#if !defined(__STRICT_ANSI__) && defined(__GNUC__) && defined(__x86_64__) && !defined(_WIN64) && !defined(LTC_NO_ASM) -static inline unsigned long ROL64(unsigned long word, int i) +static inline ulong64 ROL64(ulong64 word, int i) { asm("rolq %%cl,%0" :"=r" (word) @@ -351,7 +363,7 @@ static inline unsigned long ROL64(unsigned long word, int i) return word; } -static inline unsigned long ROR64(unsigned long word, int i) +static inline ulong64 ROR64(ulong64 word, int i) { asm("rorq %%cl,%0" :"=r" (word) @@ -361,21 +373,22 @@ static inline unsigned long ROR64(unsigned long word, int i) #ifndef LTC_NO_ROLC -static inline unsigned long ROL64c(unsigned long word, const int i) -{ - asm("rolq %2,%0" - :"=r" (word) - :"0" (word),"J" (i)); - return word; -} - -static inline unsigned long ROR64c(unsigned long word, const int i) -{ - asm("rorq %2,%0" - :"=r" (word) - :"0" (word),"J" (i)); - return word; -} +#define ROL64c(word,i) ({ \ + ulong64 __ROL64c_tmp = word; \ + __asm__ ("rolq %2, %0" : \ + "=r" (__ROL64c_tmp) : \ + "0" (__ROL64c_tmp), \ + "J" (i)); \ + __ROL64c_tmp; \ + }) +#define ROR64c(word,i) ({ \ + ulong64 __ROR64c_tmp = word; \ + __asm__ ("rorq %2, %0" : \ + "=r" (__ROR64c_tmp) : \ + "0" (__ROR64c_tmp), \ + "J" (i)); \ + __ROR64c_tmp; \ + }) #else /* LTC_NO_ROLC */ @@ -388,19 +401,19 @@ static inline unsigned long ROR64c(unsigned long word, const int i) #define ROL64(x, y) \ ( (((x)<<((ulong64)(y)&63)) | \ - (((x)&CONST64(0xFFFFFFFFFFFFFFFF))>>((ulong64)64-((y)&63)))) & CONST64(0xFFFFFFFFFFFFFFFF)) + (((x)&CONST64(0xFFFFFFFFFFFFFFFF))>>(((ulong64)64-((y)&63))&63))) & CONST64(0xFFFFFFFFFFFFFFFF)) #define ROR64(x, y) \ ( ((((x)&CONST64(0xFFFFFFFFFFFFFFFF))>>((ulong64)(y)&CONST64(63))) | \ - ((x)<<((ulong64)(64-((y)&CONST64(63)))))) & CONST64(0xFFFFFFFFFFFFFFFF)) + ((x)<<(((ulong64)64-((y)&63))&63))) & CONST64(0xFFFFFFFFFFFFFFFF)) #define ROL64c(x, y) \ ( (((x)<<((ulong64)(y)&63)) | \ - (((x)&CONST64(0xFFFFFFFFFFFFFFFF))>>((ulong64)64-((y)&63)))) & CONST64(0xFFFFFFFFFFFFFFFF)) + (((x)&CONST64(0xFFFFFFFFFFFFFFFF))>>(((ulong64)64-((y)&63))&63))) & CONST64(0xFFFFFFFFFFFFFFFF)) #define ROR64c(x, y) \ ( ((((x)&CONST64(0xFFFFFFFFFFFFFFFF))>>((ulong64)(y)&CONST64(63))) | \ - ((x)<<((ulong64)(64-((y)&CONST64(63)))))) & CONST64(0xFFFFFFFFFFFFFFFF)) + ((x)<<(((ulong64)64-((y)&63))&63))) & CONST64(0xFFFFFFFFFFFFFFFF)) #endif @@ -412,13 +425,22 @@ static inline unsigned long ROR64c(unsigned long word, const int i) #define MIN(x, y) ( ((x)<(y))?(x):(y) ) #endif +#ifndef LTC_UNUSED_PARAM + #define LTC_UNUSED_PARAM(x) (void)(x) +#endif + /* extract a byte portably */ #ifdef _MSC_VER #define byte(x, n) ((unsigned char)((x) >> (8 * (n)))) #else #define byte(x, n) (((x) >> (8 * (n))) & 255) -#endif +#endif + +/* there is no snprintf before Visual C++ 2015 */ +#if defined(_MSC_VER) && _MSC_VER < 1900 +#define snprintf _snprintf +#endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/headers/tomcrypt_math.h b/libtomcrypt/src/headers/tomcrypt_math.h index aee6105..d8e7e36 100644 --- a/libtomcrypt/src/headers/tomcrypt_math.h +++ b/libtomcrypt/src/headers/tomcrypt_math.h @@ -1,3 +1,12 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + */ + /** math functions **/ #define LTC_MP_LT -1 @@ -15,10 +24,19 @@ typedef void rsa_key; #endif +#ifndef LTC_MILLER_RABIN_REPS + /* Number of rounds of the Miller-Rabin test + * "Reasonable values of reps are between 15 and 50." c.f. gmp doc of mpz_probab_prime_p() + * As of https://security.stackexchange.com/a/4546 we should use 40 rounds */ + #define LTC_MILLER_RABIN_REPS 40 +#endif + +int radix_to_bin(const void *in, int radix, void *out, unsigned long *len); + /** math descriptor */ typedef struct { /** Name of the math provider */ - char *name; + const char *name; /** Bits per digit, amount of bits must fit in an unsigned long */ int bits_per_digit; @@ -30,15 +48,15 @@ typedef struct { @return CRYPT_OK on success */ int (*init)(void **a); - - /** init copy + + /** init copy @param dst The number to initialize and write to @param src The number to copy from @return CRYPT_OK on success */ int (*init_copy)(void **dst, void *src); - /** deinit + /** deinit @param a The number to free @return CRYPT_OK on success */ @@ -52,35 +70,36 @@ typedef struct { @return CRYPT_OK on success */ int (*neg)(void *src, void *dst); - - /** copy + + /** copy @param src The number to copy from - @param dst The number to write to + @param dst The number to write to @return CRYPT_OK on success */ int (*copy)(void *src, void *dst); /* ---- trivial low level functions ---- */ - /** set small constant + /** set small constant @param a Number to write to - @param n Source upto bits_per_digit (actually meant for very small constants) - @return CRYPT_OK on succcess + @param n Source upto bits_per_digit (actually meant for very small constants) + @return CRYPT_OK on success */ - int (*set_int)(void *a, unsigned long n); + int (*set_int)(void *a, ltc_mp_digit n); - /** get small constant - @param a Number to read, only fetches upto bits_per_digit from the number - @return The lower bits_per_digit of the integer (unsigned) + /** get small constant + @param a Small number to read, + only fetches up to bits_per_digit from the number + @return The lower bits_per_digit of the integer (unsigned) */ unsigned long (*get_int)(void *a); - /** get digit n + /** get digit n @param a The number to read from @param n The number of the digit to fetch @return The bits_per_digit sized n'th digit of a */ - unsigned long (*get_digit)(void *a, int n); + ltc_mp_digit (*get_digit)(void *a, int n); /** Get the number of digits that represent the number @param a The number to count @@ -91,16 +110,20 @@ typedef struct { /** compare two integers @param a The left side integer @param b The right side integer - @return LTC_MP_LT if a < b, LTC_MP_GT if a > b and LTC_MP_EQ otherwise. (signed comparison) + @return LTC_MP_LT if a < b, + LTC_MP_GT if a > b and + LTC_MP_EQ otherwise. (signed comparison) */ int (*compare)(void *a, void *b); - /** compare against int + /** compare against int @param a The left side integer @param b The right side integer (upto bits_per_digit) - @return LTC_MP_LT if a < b, LTC_MP_GT if a > b and LTC_MP_EQ otherwise. (signed comparison) + @return LTC_MP_LT if a < b, + LTC_MP_GT if a > b and + LTC_MP_EQ otherwise. (signed comparison) */ - int (*compare_d)(void *a, unsigned long n); + int (*compare_d)(void *a, ltc_mp_digit n); /** Count the number of bits used to represent the integer @param a The integer to count @@ -108,7 +131,7 @@ typedef struct { */ int (*count_bits)(void * a); - /** Count the number of LSB bits which are zero + /** Count the number of LSB bits which are zero @param a The integer to count @return The number of contiguous zero LSB bits */ @@ -122,8 +145,8 @@ typedef struct { int (*twoexpt)(void *a , int n); /* ---- radix conversions ---- */ - - /** read ascii string + + /** read ascii string @param a The integer to store into @param str The string to read @param radix The radix the integer has been represented in (2-64) @@ -139,13 +162,13 @@ typedef struct { */ int (*write_radix)(void *a, char *str, int radix); - /** get size as unsigned char string - @param a The integer to get the size (when stored in array of octets) - @return The length of the integer + /** get size as unsigned char string + @param a The integer to get the size (when stored in array of octets) + @return The length of the integer in octets */ unsigned long (*unsigned_size)(void *a); - /** store an integer as an array of octets + /** store an integer as an array of octets @param src The integer to store @param dst The buffer to store the integer in @return CRYPT_OK on success @@ -154,15 +177,17 @@ typedef struct { /** read an array of octets and store as integer @param dst The integer to load - @param src The array of octets - @param len The number of octets + @param src The array of octets + @param len The number of octets @return CRYPT_OK on success */ - int (*unsigned_read)(void *dst, unsigned char *src, unsigned long len); + int (*unsigned_read)( void *dst, + unsigned char *src, + unsigned long len); /* ---- basic math ---- */ - /** add two integers + /** add two integers @param a The first source integer @param b The second source integer @param c The destination of "a + b" @@ -170,16 +195,16 @@ typedef struct { */ int (*add)(void *a, void *b, void *c); - - /** add two integers + /** add two integers @param a The first source integer - @param b The second source integer (single digit of upto bits_per_digit in length) + @param b The second source integer + (single digit of upto bits_per_digit in length) @param c The destination of "a + b" @return CRYPT_OK on success */ - int (*addi)(void *a, unsigned long b, void *c); + int (*addi)(void *a, ltc_mp_digit b, void *c); - /** subtract two integers + /** subtract two integers @param a The first source integer @param b The second source integer @param c The destination of "a - b" @@ -187,29 +212,32 @@ typedef struct { */ int (*sub)(void *a, void *b, void *c); - /** subtract two integers + /** subtract two integers @param a The first source integer - @param b The second source integer (single digit of upto bits_per_digit in length) + @param b The second source integer + (single digit of upto bits_per_digit in length) @param c The destination of "a - b" @return CRYPT_OK on success */ - int (*subi)(void *a, unsigned long b, void *c); + int (*subi)(void *a, ltc_mp_digit b, void *c); - /** multiply two integers + /** multiply two integers @param a The first source integer - @param b The second source integer (single digit of upto bits_per_digit in length) + @param b The second source integer + (single digit of upto bits_per_digit in length) @param c The destination of "a * b" @return CRYPT_OK on success */ int (*mul)(void *a, void *b, void *c); - /** multiply two integers + /** multiply two integers @param a The first source integer - @param b The second source integer (single digit of upto bits_per_digit in length) + @param b The second source integer + (single digit of upto bits_per_digit in length) @param c The destination of "a * b" @return CRYPT_OK on success */ - int (*muli)(void *a, unsigned long b, void *c); + int (*muli)(void *a, ltc_mp_digit b, void *c); /** Square an integer @param a The integer to square @@ -227,9 +255,9 @@ typedef struct { */ int (*mpdiv)(void *a, void *b, void *c, void *d); - /** divide by two + /** divide by two @param a The integer to divide (shift right) - @param b The destination + @param b The destination @return CRYPT_OK on success */ int (*div_2)(void *a, void *b); @@ -240,9 +268,9 @@ typedef struct { @param c The destination for the residue @return CRYPT_OK on success */ - int (*modi)(void *a, unsigned long b, unsigned long *c); + int (*modi)(void *a, ltc_mp_digit b, ltc_mp_digit *c); - /** gcd + /** gcd @param a The first integer @param b The second integer @param c The destination for (a, b) @@ -250,7 +278,7 @@ typedef struct { */ int (*gcd)(void *a, void *b, void *c); - /** lcm + /** lcm @param a The first integer @param b The second integer @param c The destination for [a, b] @@ -260,7 +288,7 @@ typedef struct { /** Modular multiplication @param a The first source - @param b The second source + @param b The second source @param c The modulus @param d The destination (a*b mod c) @return CRYPT_OK on success @@ -277,7 +305,7 @@ typedef struct { /** Modular inversion @param a The value to invert - @param b The modulus + @param b The modulus @param c The destination (1/a mod b) @return CRYPT_OK on success */ @@ -285,14 +313,14 @@ typedef struct { /* ---- reduction ---- */ - /** setup montgomery - @param a The modulus - @param b The destination for the reduction digit + /** setup Montgomery + @param a The modulus + @param b The destination for the reduction digit @return CRYPT_OK on success */ int (*montgomery_setup)(void *a, void **b); - /** get normalization value + /** get normalization value @param a The destination for the normalization value @param b The modulus @return CRYPT_OK on success @@ -310,7 +338,7 @@ typedef struct { /** clean up (frees memory) @param a The value "b" from montgomery_setup() @return CRYPT_OK on success - */ + */ void (*montgomery_deinit)(void *a); /* ---- exponentiation ---- */ @@ -326,24 +354,30 @@ typedef struct { /** Primality testing @param a The integer to test - @param b The destination of the result (FP_YES if prime) + @param b The number of Miller-Rabin tests that shall be executed + @param c The destination of the result (FP_YES if prime) @return CRYPT_OK on success */ - int (*isprime)(void *a, int *b); + int (*isprime)(void *a, int b, int *c); /* ---- (optional) ecc point math ---- */ /** ECC GF(p) point multiplication (from the NIST curves) @param k The integer to multiply the point by @param G The point to multiply - @param R The destination for kG + @param R The destination for kG @param modulus The modulus for the field - @param map Boolean indicated whether to map back to affine or not (can be ignored if you work in affine only) + @param map Boolean indicated whether to map back to affine or not + (can be ignored if you work in affine only) @return CRYPT_OK on success */ - int (*ecc_ptmul)(void *k, ecc_point *G, ecc_point *R, void *modulus, int map); + int (*ecc_ptmul)( void *k, + ecc_point *G, + ecc_point *R, + void *modulus, + int map); - /** ECC GF(p) point addition + /** ECC GF(p) point addition @param P The first point @param Q The second point @param R The destination of P + Q @@ -351,24 +385,33 @@ typedef struct { @param mp The "b" value from montgomery_setup() @return CRYPT_OK on success */ - int (*ecc_ptadd)(ecc_point *P, ecc_point *Q, ecc_point *R, void *modulus, void *mp); + int (*ecc_ptadd)(ecc_point *P, + ecc_point *Q, + ecc_point *R, + void *modulus, + void *mp); - /** ECC GF(p) point double + /** ECC GF(p) point double @param P The first point @param R The destination of 2P @param modulus The modulus @param mp The "b" value from montgomery_setup() @return CRYPT_OK on success */ - int (*ecc_ptdbl)(ecc_point *P, ecc_point *R, void *modulus, void *mp); + int (*ecc_ptdbl)(ecc_point *P, + ecc_point *R, + void *modulus, + void *mp); - /** ECC mapping from projective to affine, currently uses (x,y,z) => (x/z^2, y/z^3, 1) + /** ECC mapping from projective to affine, + currently uses (x,y,z) => (x/z^2, y/z^3, 1) @param P The point to map @param modulus The modulus @param mp The "b" value from montgomery_setup() @return CRYPT_OK on success - @remark The mapping can be different but keep in mind a ecc_point only has three - integers (x,y,z) so if you use a different mapping you have to make it fit. + @remark The mapping can be different but keep in mind a + ecc_point only has three integers (x,y,z) so if + you use a different mapping you have to make it fit. */ int (*ecc_map)(ecc_point *P, void *modulus, void *mp); @@ -377,10 +420,10 @@ typedef struct { @param kA What to multiple A by @param B Second point to multiply @param kB What to multiple B by - @param C [out] Destination point (can overlap with A or B - @param modulus Modulus for curve + @param C [out] Destination point (can overlap with A or B) + @param modulus Modulus for curve @return CRYPT_OK on success - */ + */ int (*ecc_mul2add)(ecc_point *A, void *kA, ecc_point *B, void *kB, ecc_point *C, @@ -388,35 +431,70 @@ typedef struct { /* ---- (optional) rsa optimized math (for internal CRT) ---- */ - /** RSA Key Generation + /** RSA Key Generation @param prng An active PRNG state @param wprng The index of the PRNG desired - @param size The size of the modulus (key size) desired (octets) - @param e The "e" value (public key). e==65537 is a good choice + @param size The size of the key in octets + @param e The "e" value (public key). + e==65537 is a good choice @param key [out] Destination of a newly created private key pair @return CRYPT_OK if successful, upon error all allocated ram is freed */ - int (*rsa_keygen)(prng_state *prng, int wprng, int size, long e, rsa_key *key); - + int (*rsa_keygen)(prng_state *prng, + int wprng, + int size, + long e, + rsa_key *key); /** RSA exponentiation @param in The octet array representing the base @param inlen The length of the input @param out The destination (to be stored in an octet array format) - @param outlen The length of the output buffer and the resulting size (zero padded to the size of the modulus) + @param outlen The length of the output buffer and the resulting size + (zero padded to the size of the modulus) @param which PK_PUBLIC for public RSA and PK_PRIVATE for private RSA - @param key The RSA key to use + @param key The RSA key to use @return CRYPT_OK on success */ int (*rsa_me)(const unsigned char *in, unsigned long inlen, unsigned char *out, unsigned long *outlen, int which, rsa_key *key); + +/* ---- basic math continued ---- */ + + /** Modular addition + @param a The first source + @param b The second source + @param c The modulus + @param d The destination (a + b mod c) + @return CRYPT_OK on success + */ + int (*addmod)(void *a, void *b, void *c, void *d); + + /** Modular substraction + @param a The first source + @param b The second source + @param c The modulus + @param d The destination (a - b mod c) + @return CRYPT_OK on success + */ + int (*submod)(void *a, void *b, void *c, void *d); + +/* ---- misc stuff ---- */ + + /** Make a pseudo-random mpi + @param a The mpi to make random + @param size The desired length + @return CRYPT_OK on success + */ + int (*rand)(void *a, int size); } ltc_math_descriptor; extern ltc_math_descriptor ltc_mp; int ltc_init_multi(void **a, ...); void ltc_deinit_multi(void *a, ...); +void ltc_cleanup_multi(void **a, ...); #ifdef LTM_DESC extern const ltc_math_descriptor ltm_desc; @@ -439,6 +517,7 @@ extern const ltc_math_descriptor gmp_desc; #define mp_init_multi ltc_init_multi #define mp_clear(a) ltc_mp.deinit(a) #define mp_clear_multi ltc_deinit_multi +#define mp_cleanup_multi ltc_cleanup_multi #define mp_init_copy(a, b) ltc_mp.init_copy(a, b) #define mp_neg(a, b) ltc_mp.neg(a, b) @@ -475,6 +554,8 @@ extern const ltc_math_descriptor gmp_desc; #define mp_gcd(a, b, c) ltc_mp.gcd(a, b, c) #define mp_lcm(a, b, c) ltc_mp.lcm(a, b, c) +#define mp_addmod(a, b, c, d) ltc_mp.addmod(a, b, c, d) +#define mp_submod(a, b, c, d) ltc_mp.submod(a, b, c, d) #define mp_mulmod(a, b, c, d) ltc_mp.mulmod(a, b, c, d) #define mp_sqrmod(a, b, c) ltc_mp.sqrmod(a, b, c) #define mp_invmod(a, b, c) ltc_mp.invmod(a, b, c) @@ -485,16 +566,18 @@ extern const ltc_math_descriptor gmp_desc; #define mp_montgomery_free(a) ltc_mp.montgomery_deinit(a) #define mp_exptmod(a,b,c,d) ltc_mp.exptmod(a,b,c,d) -#define mp_prime_is_prime(a, b, c) ltc_mp.isprime(a, c) +#define mp_prime_is_prime(a, b, c) ltc_mp.isprime(a, b, c) #define mp_iszero(a) (mp_cmp_d(a, 0) == LTC_MP_EQ ? LTC_MP_YES : LTC_MP_NO) #define mp_isodd(a) (mp_get_digit_count(a) > 0 ? (mp_get_digit(a, 0) & 1 ? LTC_MP_YES : LTC_MP_NO) : LTC_MP_NO) -#define mp_exch(a, b) do { void *ABC__tmp = a; a = b; b = ABC__tmp; } while(0); +#define mp_exch(a, b) do { void *ABC__tmp = a; a = b; b = ABC__tmp; } while(0) #define mp_tohex(a, b) mp_toradix(a, b, 16) +#define mp_rand(a, b) ltc_mp.rand(a, b) + #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/headers/tomcrypt_misc.h b/libtomcrypt/src/headers/tomcrypt_misc.h index 239ad77..f21f30b 100644 --- a/libtomcrypt/src/headers/tomcrypt_misc.h +++ b/libtomcrypt/src/headers/tomcrypt_misc.h @@ -1,14 +1,61 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + */ + /* ---- LTC_BASE64 Routines ---- */ #ifdef LTC_BASE64 -int base64_encode(const unsigned char *in, unsigned long len, +int base64_encode(const unsigned char *in, unsigned long len, + unsigned char *out, unsigned long *outlen); + +int base64_decode(const unsigned char *in, unsigned long len, + unsigned char *out, unsigned long *outlen); +int base64_strict_decode(const unsigned char *in, unsigned long len, + unsigned char *out, unsigned long *outlen); +#endif + +#ifdef LTC_BASE64_URL +int base64url_encode(const unsigned char *in, unsigned long len, + unsigned char *out, unsigned long *outlen); +int base64url_strict_encode(const unsigned char *in, unsigned long inlen, unsigned char *out, unsigned long *outlen); -int base64_decode(const unsigned char *in, unsigned long len, +int base64url_decode(const unsigned char *in, unsigned long len, + unsigned char *out, unsigned long *outlen); +int base64url_strict_decode(const unsigned char *in, unsigned long len, unsigned char *out, unsigned long *outlen); #endif +/* ===> LTC_HKDF -- RFC5869 HMAC-based Key Derivation Function <=== */ +#ifdef LTC_HKDF + +int hkdf_test(void); + +int hkdf_extract(int hash_idx, + const unsigned char *salt, unsigned long saltlen, + const unsigned char *in, unsigned long inlen, + unsigned char *out, unsigned long *outlen); + +int hkdf_expand(int hash_idx, + const unsigned char *info, unsigned long infolen, + const unsigned char *in, unsigned long inlen, + unsigned char *out, unsigned long outlen); + +int hkdf(int hash_idx, + const unsigned char *salt, unsigned long saltlen, + const unsigned char *info, unsigned long infolen, + const unsigned char *in, unsigned long inlen, + unsigned char *out, unsigned long outlen); + +#endif /* LTC_HKDF */ + /* ---- MEM routines ---- */ -void zeromem(void *dst, size_t len); +int mem_neq(const void *a, const void *b, size_t len); +void zeromem(volatile void *dst, size_t len); void burn_stack(unsigned long len); const char *error_to_string(int err); @@ -18,6 +65,49 @@ extern const char *crypt_build_settings; /* ---- HMM ---- */ int crypt_fsa(void *mp, ...); -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ---- Dynamic language support ---- */ +int crypt_get_constant(const char* namein, int *valueout); +int crypt_list_all_constants(char *names_list, unsigned int *names_list_size); + +int crypt_get_size(const char* namein, unsigned int *sizeout); +int crypt_list_all_sizes(char *names_list, unsigned int *names_list_size); + +#ifdef LTM_DESC +void init_LTM(void); +#endif +#ifdef TFM_DESC +void init_TFM(void); +#endif +#ifdef GMP_DESC +void init_GMP(void); +#endif + +#ifdef LTC_ADLER32 +typedef struct adler32_state_s +{ + unsigned short s[2]; +} adler32_state; + +void adler32_init(adler32_state *ctx); +void adler32_update(adler32_state *ctx, const unsigned char *input, unsigned long length); +void adler32_finish(adler32_state *ctx, void *hash, unsigned long size); +int adler32_test(void); +#endif + +#ifdef LTC_CRC32 +typedef struct crc32_state_s +{ + ulong32 crc; +} crc32_state; + +void crc32_init(crc32_state *ctx); +void crc32_update(crc32_state *ctx, const unsigned char *input, unsigned long length); +void crc32_finish(crc32_state *ctx, void *hash, unsigned long size); +int crc32_test(void); +#endif + +int compare_testvector(const void* is, const unsigned long is_len, const void* should, const unsigned long should_len, const char* what, int which); + +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/headers/tomcrypt_pk.h b/libtomcrypt/src/headers/tomcrypt_pk.h index cc05f6c..4ea6f88 100644 --- a/libtomcrypt/src/headers/tomcrypt_pk.h +++ b/libtomcrypt/src/headers/tomcrypt_pk.h @@ -1,3 +1,12 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + */ + /* ---- NUMBER THEORY ---- */ enum { @@ -5,59 +14,82 @@ enum { PK_PRIVATE=1 }; +/* Indicates standard output formats that can be read e.g. by OpenSSL or GnuTLS */ +#define PK_STD 0x1000 + int rand_prime(void *N, long len, prng_state *prng, int wprng); +#ifdef LTC_SOURCE +/* internal helper functions */ +int rand_bn_bits(void *N, int bits, prng_state *prng, int wprng); +int rand_bn_upto(void *N, void *limit, prng_state *prng, int wprng); + +enum public_key_algorithms { + PKA_RSA, + PKA_DSA +}; + +typedef struct Oid { + unsigned long OID[16]; + /** Number of OID digits in use */ + unsigned long OIDlen; +} oid_st; + +int pk_get_oid(int pk, oid_st *st); +#endif /* LTC_SOURCE */ + /* ---- RSA ---- */ #ifdef LTC_MRSA -/* Min and Max RSA key sizes (in bits) */ -#define MIN_RSA_SIZE 1024 -#define MAX_RSA_SIZE 4096 - -/** RSA LTC_PKCS style key */ +/** RSA PKCS style key */ typedef struct Rsa_key { /** Type of key, PK_PRIVATE or PK_PUBLIC */ int type; /** The public exponent */ - void *e; + void *e; /** The private exponent */ - void *d; + void *d; /** The modulus */ - void *N; + void *N; /** The p factor of N */ - void *p; + void *p; /** The q factor of N */ - void *q; + void *q; /** The 1/q mod p CRT param */ - void *qP; + void *qP; /** The d mod (p - 1) CRT param */ - void *dP; + void *dP; /** The d mod (q - 1) CRT param */ void *dQ; } rsa_key; int rsa_make_key(prng_state *prng, int wprng, int size, long e, rsa_key *key); +int rsa_get_size(rsa_key *key); + int rsa_exptmod(const unsigned char *in, unsigned long inlen, unsigned char *out, unsigned long *outlen, int which, rsa_key *key); void rsa_free(rsa_key *key); -/* These use LTC_PKCS #1 v2.0 padding */ +/* These use PKCS #1 v2.0 padding */ #define rsa_encrypt_key(_in, _inlen, _out, _outlen, _lparam, _lparamlen, _prng, _prng_idx, _hash_idx, _key) \ - rsa_encrypt_key_ex(_in, _inlen, _out, _outlen, _lparam, _lparamlen, _prng, _prng_idx, _hash_idx, LTC_LTC_PKCS_1_OAEP, _key) + rsa_encrypt_key_ex(_in, _inlen, _out, _outlen, _lparam, _lparamlen, _prng, _prng_idx, _hash_idx, LTC_PKCS_1_OAEP, _key) #define rsa_decrypt_key(_in, _inlen, _out, _outlen, _lparam, _lparamlen, _hash_idx, _stat, _key) \ - rsa_decrypt_key_ex(_in, _inlen, _out, _outlen, _lparam, _lparamlen, _hash_idx, LTC_LTC_PKCS_1_OAEP, _stat, _key) + rsa_decrypt_key_ex(_in, _inlen, _out, _outlen, _lparam, _lparamlen, _hash_idx, LTC_PKCS_1_OAEP, _stat, _key) #define rsa_sign_hash(_in, _inlen, _out, _outlen, _prng, _prng_idx, _hash_idx, _saltlen, _key) \ - rsa_sign_hash_ex(_in, _inlen, _out, _outlen, LTC_LTC_PKCS_1_PSS, _prng, _prng_idx, _hash_idx, _saltlen, _key) + rsa_sign_hash_ex(_in, _inlen, _out, _outlen, LTC_PKCS_1_PSS, _prng, _prng_idx, _hash_idx, _saltlen, _key) #define rsa_verify_hash(_sig, _siglen, _hash, _hashlen, _hash_idx, _saltlen, _stat, _key) \ - rsa_verify_hash_ex(_sig, _siglen, _hash, _hashlen, LTC_LTC_PKCS_1_PSS, _hash_idx, _saltlen, _stat, _key) + rsa_verify_hash_ex(_sig, _siglen, _hash, _hashlen, LTC_PKCS_1_PSS, _hash_idx, _saltlen, _stat, _key) + +#define rsa_sign_saltlen_get_max(_hash_idx, _key) \ + rsa_sign_saltlen_get_max_ex(LTC_PKCS_1_PSS, _hash_idx, _key) -/* These can be switched between LTC_PKCS #1 v2.x and LTC_PKCS #1 v1.5 paddings */ +/* These can be switched between PKCS #1 v2.x and PKCS #1 v1.5 paddings */ int rsa_encrypt_key_ex(const unsigned char *in, unsigned long inlen, unsigned char *out, unsigned long *outlen, const unsigned char *lparam, unsigned long lparamlen, @@ -82,35 +114,52 @@ int rsa_verify_hash_ex(const unsigned char *sig, unsigned long siglen, int hash_idx, unsigned long saltlen, int *stat, rsa_key *key); -/* LTC_PKCS #1 import/export */ +int rsa_sign_saltlen_get_max_ex(int padding, int hash_idx, rsa_key *key); + +/* PKCS #1 import/export */ int rsa_export(unsigned char *out, unsigned long *outlen, int type, rsa_key *key); int rsa_import(const unsigned char *in, unsigned long inlen, rsa_key *key); - + +int rsa_import_x509(const unsigned char *in, unsigned long inlen, rsa_key *key); +int rsa_import_pkcs8(const unsigned char *in, unsigned long inlen, + const void *passwd, unsigned long passwdlen, rsa_key *key); + +int rsa_set_key(const unsigned char *N, unsigned long Nlen, + const unsigned char *e, unsigned long elen, + const unsigned char *d, unsigned long dlen, + rsa_key *key); +int rsa_set_factors(const unsigned char *p, unsigned long plen, + const unsigned char *q, unsigned long qlen, + rsa_key *key); +int rsa_set_crt_params(const unsigned char *dP, unsigned long dPlen, + const unsigned char *dQ, unsigned long dQlen, + const unsigned char *qP, unsigned long qPlen, + rsa_key *key); #endif /* ---- Katja ---- */ -#ifdef MKAT +#ifdef LTC_MKAT /* Min and Max KAT key sizes (in bits) */ #define MIN_KAT_SIZE 1024 #define MAX_KAT_SIZE 4096 -/** Katja LTC_PKCS style key */ +/** Katja PKCS style key */ typedef struct KAT_key { /** Type of key, PK_PRIVATE or PK_PUBLIC */ int type; /** The private exponent */ - void *d; + void *d; /** The modulus */ - void *N; + void *N; /** The p factor of N */ - void *p; + void *p; /** The q factor of N */ - void *q; + void *q; /** The 1/q mod p CRT param */ - void *qP; + void *qP; /** The d mod (p - 1) CRT param */ - void *dP; + void *dP; /** The d mod (q - 1) CRT param */ void *dQ; /** The pq param */ @@ -125,24 +174,71 @@ int katja_exptmod(const unsigned char *in, unsigned long inlen, void katja_free(katja_key *key); -/* These use LTC_PKCS #1 v2.0 padding */ +/* These use PKCS #1 v2.0 padding */ int katja_encrypt_key(const unsigned char *in, unsigned long inlen, unsigned char *out, unsigned long *outlen, const unsigned char *lparam, unsigned long lparamlen, prng_state *prng, int prng_idx, int hash_idx, katja_key *key); - + int katja_decrypt_key(const unsigned char *in, unsigned long inlen, - unsigned char *out, unsigned long *outlen, + unsigned char *out, unsigned long *outlen, const unsigned char *lparam, unsigned long lparamlen, int hash_idx, int *stat, katja_key *key); -/* LTC_PKCS #1 import/export */ +/* PKCS #1 import/export */ int katja_export(unsigned char *out, unsigned long *outlen, int type, katja_key *key); int katja_import(const unsigned char *in, unsigned long inlen, katja_key *key); - + #endif +/* ---- DH Routines ---- */ +#ifdef LTC_MDH + +typedef struct { + int type; + void *x; + void *y; + void *base; + void *prime; +} dh_key; + +int dh_get_groupsize(dh_key *key); + +int dh_export(unsigned char *out, unsigned long *outlen, int type, dh_key *key); +int dh_import(const unsigned char *in, unsigned long inlen, dh_key *key); + +int dh_set_pg(const unsigned char *p, unsigned long plen, + const unsigned char *g, unsigned long glen, + dh_key *key); +int dh_set_pg_dhparam(const unsigned char *dhparam, unsigned long dhparamlen, dh_key *key); +int dh_set_pg_groupsize(int groupsize, dh_key *key); + +int dh_set_key(const unsigned char *in, unsigned long inlen, int type, dh_key *key); +int dh_generate_key(prng_state *prng, int wprng, dh_key *key); + +int dh_shared_secret(dh_key *private_key, dh_key *public_key, + unsigned char *out, unsigned long *outlen); + +void dh_free(dh_key *key); + +int dh_export_key(void *out, unsigned long *outlen, int type, dh_key *key); + +#ifdef LTC_SOURCE +typedef struct { + int size; + const char *name, *base, *prime; +} ltc_dh_set_type; + +extern const ltc_dh_set_type ltc_dh_sets[]; + +/* internal helper functions */ +int dh_check_pubkey(dh_key *key); +#endif + +#endif /* LTC_MDH */ + + /* ---- ECC Routines ---- */ #ifdef LTC_MECC @@ -158,22 +254,22 @@ typedef struct { int size; /** name of curve */ - char *name; + const char *name; /** The prime that defines the field the curve is in (encoded in hex) */ - char *prime; + const char *prime; /** The fields B param (hex) */ - char *B; + const char *B; /** The order of the curve (hex) */ - char *order; - + const char *order; + /** The x co-ordinate of the base point on the curve (hex) */ - char *Gx; - + const char *Gx; + /** The y co-ordinate of the base point on the curve (hex) */ - char *Gy; + const char *Gy; } ltc_ecc_set_type; /** A point on a ECC curve, stored in Jacbobian format such that (x,y,z) => (x/z^2, y/z^3, 1) when interpretted as affine */ @@ -196,8 +292,8 @@ typedef struct { /** Index into the ltc_ecc_sets[] for the parameters of this curve; if -1, then this key is using user supplied curve in dp */ int idx; - /** pointer to domain parameters; either points to NIST curves (identified by idx >= 0) or user supplied curve */ - const ltc_ecc_set_type *dp; + /** pointer to domain parameters; either points to NIST curves (identified by idx >= 0) or user supplied curve */ + const ltc_ecc_set_type *dp; /** The public key */ ecc_point pubkey; @@ -225,24 +321,32 @@ int ecc_ansi_x963_export(ecc_key *key, unsigned char *out, unsigned long *outlen int ecc_ansi_x963_import(const unsigned char *in, unsigned long inlen, ecc_key *key); int ecc_ansi_x963_import_ex(const unsigned char *in, unsigned long inlen, ecc_key *key, ltc_ecc_set_type *dp); -int ecc_shared_secret(ecc_key *private_key, ecc_key *public_key, +int ecc_shared_secret(ecc_key *private_key, ecc_key *public_key, unsigned char *out, unsigned long *outlen); int ecc_encrypt_key(const unsigned char *in, unsigned long inlen, - unsigned char *out, unsigned long *outlen, - prng_state *prng, int wprng, int hash, + unsigned char *out, unsigned long *outlen, + prng_state *prng, int wprng, int hash, ecc_key *key); int ecc_decrypt_key(const unsigned char *in, unsigned long inlen, - unsigned char *out, unsigned long *outlen, + unsigned char *out, unsigned long *outlen, ecc_key *key); -int ecc_sign_hash(const unsigned char *in, unsigned long inlen, - unsigned char *out, unsigned long *outlen, +int ecc_sign_hash_rfc7518(const unsigned char *in, unsigned long inlen, + unsigned char *out, unsigned long *outlen, + prng_state *prng, int wprng, ecc_key *key); + +int ecc_sign_hash(const unsigned char *in, unsigned long inlen, + unsigned char *out, unsigned long *outlen, prng_state *prng, int wprng, ecc_key *key); +int ecc_verify_hash_rfc7518(const unsigned char *sig, unsigned long siglen, + const unsigned char *hash, unsigned long hashlen, + int *stat, ecc_key *key); + int ecc_verify_hash(const unsigned char *sig, unsigned long siglen, - const unsigned char *hash, unsigned long hashlen, + const unsigned char *hash, unsigned long hashlen, int *stat, ecc_key *key); /* low level functions */ @@ -251,7 +355,7 @@ void ltc_ecc_del_point(ecc_point *p); int ltc_ecc_is_valid_idx(int n); /* point ops (mp == montgomery digit) */ -#if !defined(LTC_MECC_ACCEL) || defined(LTM_LTC_DESC) || defined(GMP_LTC_DESC) +#if !defined(LTC_MECC_ACCEL) || defined(LTM_DESC) || defined(GMP_DESC) /* R = 2P */ int ltc_ecc_projective_dbl_point(ecc_point *P, ecc_point *R, void *modulus, void *mp); @@ -309,7 +413,7 @@ int ltc_ecc_map(ecc_point *P, void *modulus, void *mp); /** DSA key structure */ typedef struct { /** The key type, PK_PRIVATE or PK_PUBLIC */ - int type; + int type; /** The order of the sub-group used in octets */ int qord; @@ -331,6 +435,17 @@ typedef struct { } dsa_key; int dsa_make_key(prng_state *prng, int wprng, int group_size, int modulus_size, dsa_key *key); + +int dsa_set_pqg(const unsigned char *p, unsigned long plen, + const unsigned char *q, unsigned long qlen, + const unsigned char *g, unsigned long glen, + dsa_key *key); +int dsa_set_pqg_dsaparam(const unsigned char *dsaparam, unsigned long dsaparamlen, dsa_key *key); +int dsa_generate_pqg(prng_state *prng, int wprng, int group_size, int modulus_size, dsa_key *key); + +int dsa_set_key(const unsigned char *in, unsigned long inlen, int type, dsa_key *key); +int dsa_generate_key(prng_state *prng, int wprng, dsa_key *key); + void dsa_free(dsa_key *key); int dsa_sign_hash_raw(const unsigned char *in, unsigned long inlen, @@ -342,26 +457,31 @@ int dsa_sign_hash(const unsigned char *in, unsigned long inlen, prng_state *prng, int wprng, dsa_key *key); int dsa_verify_hash_raw( void *r, void *s, - const unsigned char *hash, unsigned long hashlen, + const unsigned char *hash, unsigned long hashlen, int *stat, dsa_key *key); int dsa_verify_hash(const unsigned char *sig, unsigned long siglen, - const unsigned char *hash, unsigned long hashlen, + const unsigned char *hash, unsigned long hashlen, int *stat, dsa_key *key); int dsa_encrypt_key(const unsigned char *in, unsigned long inlen, - unsigned char *out, unsigned long *outlen, - prng_state *prng, int wprng, int hash, + unsigned char *out, unsigned long *outlen, + prng_state *prng, int wprng, int hash, dsa_key *key); - + int dsa_decrypt_key(const unsigned char *in, unsigned long inlen, - unsigned char *out, unsigned long *outlen, + unsigned char *out, unsigned long *outlen, dsa_key *key); - + int dsa_import(const unsigned char *in, unsigned long inlen, dsa_key *key); int dsa_export(unsigned char *out, unsigned long *outlen, int type, dsa_key *key); int dsa_verify_key(dsa_key *key, int *stat); - +#ifdef LTC_SOURCE +/* internal helper functions */ +int dsa_int_validate_xy(dsa_key *key, int *stat); +int dsa_int_validate_pqg(dsa_key *key, int *stat); +int dsa_int_validate_primes(dsa_key *key, int *stat); +#endif int dsa_shared_secret(void *private_key, void *base, dsa_key *public_key, unsigned char *out, unsigned long *outlen); @@ -370,29 +490,39 @@ int dsa_shared_secret(void *private_key, void *base, #ifdef LTC_DER /* DER handling */ -enum { +typedef enum ltc_asn1_type_ { + /* 0 */ LTC_ASN1_EOL, LTC_ASN1_BOOLEAN, LTC_ASN1_INTEGER, LTC_ASN1_SHORT_INTEGER, LTC_ASN1_BIT_STRING, + /* 5 */ LTC_ASN1_OCTET_STRING, LTC_ASN1_NULL, LTC_ASN1_OBJECT_IDENTIFIER, LTC_ASN1_IA5_STRING, LTC_ASN1_PRINTABLE_STRING, + /* 10 */ LTC_ASN1_UTF8_STRING, LTC_ASN1_UTCTIME, LTC_ASN1_CHOICE, LTC_ASN1_SEQUENCE, LTC_ASN1_SET, - LTC_ASN1_SETOF -}; + /* 15 */ + LTC_ASN1_SETOF, + LTC_ASN1_RAW_BIT_STRING, + LTC_ASN1_TELETEX_STRING, + LTC_ASN1_CONSTRUCTED, + LTC_ASN1_CONTEXT_SPECIFIC, + /* 20 */ + LTC_ASN1_GENERALIZEDTIME, +} ltc_asn1_type; /** A LTC ASN.1 list type */ typedef struct ltc_asn1_list_ { /** The LTC ASN.1 enumerated type identifier */ - int type; + ltc_asn1_type type; /** The data to encode or place for decoding */ void *data; /** The size of the input or resulting output */ @@ -411,22 +541,37 @@ typedef struct ltc_asn1_list_ { LTC_MACRO_list[LTC_MACRO_temp].data = (void*)(Data); \ LTC_MACRO_list[LTC_MACRO_temp].size = (Size); \ LTC_MACRO_list[LTC_MACRO_temp].used = 0; \ - } while (0); + } while (0) /* SEQUENCE */ int der_encode_sequence_ex(ltc_asn1_list *list, unsigned long inlen, unsigned char *out, unsigned long *outlen, int type_of); - -#define der_encode_sequence(list, inlen, out, outlen) der_encode_sequence_ex(list, inlen, out, outlen, LTC_ASN1_SEQUENCE) + +#define der_encode_sequence(list, inlen, out, outlen) der_encode_sequence_ex(list, inlen, out, outlen, LTC_ASN1_SEQUENCE) int der_decode_sequence_ex(const unsigned char *in, unsigned long inlen, ltc_asn1_list *list, unsigned long outlen, int ordered); - + #define der_decode_sequence(in, inlen, list, outlen) der_decode_sequence_ex(in, inlen, list, outlen, 1) int der_length_sequence(ltc_asn1_list *list, unsigned long inlen, unsigned long *outlen); + +#ifdef LTC_SOURCE +/* internal helper functions */ +int der_length_sequence_ex(ltc_asn1_list *list, unsigned long inlen, + unsigned long *outlen, unsigned long *payloadlen); +/* SUBJECT PUBLIC KEY INFO */ +int der_encode_subject_public_key_info(unsigned char *out, unsigned long *outlen, + unsigned int algorithm, void* public_key, unsigned long public_key_len, + unsigned long parameters_type, void* parameters, unsigned long parameters_len); + +int der_decode_subject_public_key_info(const unsigned char *in, unsigned long inlen, + unsigned int algorithm, void* public_key, unsigned long* public_key_len, + unsigned long parameters_type, ltc_asn1_list* parameters, unsigned long parameters_len); +#endif /* LTC_SOURCE */ + /* SET */ #define der_decode_set(in, inlen, list, outlen) der_decode_sequence_ex(in, inlen, list, outlen, 0) #define der_length_set der_length_sequence @@ -435,22 +580,23 @@ int der_encode_set(ltc_asn1_list *list, unsigned long inlen, int der_encode_setof(ltc_asn1_list *list, unsigned long inlen, unsigned char *out, unsigned long *outlen); - + /* VA list handy helpers with triplets of <type, size, data> */ int der_encode_sequence_multi(unsigned char *out, unsigned long *outlen, ...); int der_decode_sequence_multi(const unsigned char *in, unsigned long inlen, ...); /* FLEXI DECODER handle unknown list decoder */ int der_decode_sequence_flexi(const unsigned char *in, unsigned long *inlen, ltc_asn1_list **out); -void der_free_sequence_flexi(ltc_asn1_list *list); +#define der_free_sequence_flexi der_sequence_free void der_sequence_free(ltc_asn1_list *in); +void der_sequence_shrink(ltc_asn1_list *in); /* BOOLEAN */ int der_length_boolean(unsigned long *outlen); -int der_encode_boolean(int in, +int der_encode_boolean(int in, unsigned char *out, unsigned long *outlen); int der_decode_boolean(const unsigned char *in, unsigned long inlen, - int *out); + int *out); /* INTEGER */ int der_encode_integer(void *num, unsigned char *out, unsigned long *outlen); int der_decode_integer(const unsigned char *in, unsigned long inlen, void *num); @@ -466,6 +612,10 @@ int der_encode_bit_string(const unsigned char *in, unsigned long inlen, unsigned char *out, unsigned long *outlen); int der_decode_bit_string(const unsigned char *in, unsigned long inlen, unsigned char *out, unsigned long *outlen); +int der_encode_raw_bit_string(const unsigned char *in, unsigned long inlen, + unsigned char *out, unsigned long *outlen); +int der_decode_raw_bit_string(const unsigned char *in, unsigned long inlen, + unsigned char *out, unsigned long *outlen); int der_length_bit_string(unsigned long nbits, unsigned long *outlen); /* OCTET STRING */ @@ -493,7 +643,19 @@ int der_length_ia5_string(const unsigned char *octets, unsigned long noctets, un int der_ia5_char_encode(int c); int der_ia5_value_decode(int v); -/* Printable STRING */ +/* TELETEX STRING */ +int der_decode_teletex_string(const unsigned char *in, unsigned long inlen, + unsigned char *out, unsigned long *outlen); +int der_length_teletex_string(const unsigned char *octets, unsigned long noctets, unsigned long *outlen); + +#ifdef LTC_SOURCE +/* internal helper functions */ +int der_teletex_char_encode(int c); +int der_teletex_value_decode(int v); +#endif /* LTC_SOURCE */ + + +/* PRINTABLE STRING */ int der_encode_printable_string(const unsigned char *in, unsigned long inlen, unsigned char *out, unsigned long *outlen); int der_decode_printable_string(const unsigned char *in, unsigned long inlen, @@ -504,10 +666,17 @@ int der_printable_char_encode(int c); int der_printable_value_decode(int v); /* UTF-8 */ -#if (defined(SIZE_MAX) || __STDC_VERSION__ >= 199901L || defined(WCHAR_MAX) || defined(_WCHAR_T) || defined(_WCHAR_T_DEFINED) || defined (__WCHAR_TYPE__)) && !defined(LTC_NO_WCHAR) +#if (defined(SIZE_MAX) || __STDC_VERSION__ >= 199901L || defined(WCHAR_MAX) || defined(__WCHAR_MAX__) || defined(_WCHAR_T) || defined(_WCHAR_T_DEFINED) || defined (__WCHAR_TYPE__)) && !defined(LTC_NO_WCHAR) #include <wchar.h> +#if defined(__WCHAR_MAX__) +#define LTC_WCHAR_MAX __WCHAR_MAX__ +#elif defined(WCHAR_MAX) +#define LTC_WCHAR_MAX WCHAR_MAX +#endif +/* please note that it might happen that LTC_WCHAR_MAX is undefined */ #else typedef ulong32 wchar_t; +#define LTC_WCHAR_MAX 0xFFFFFFFF #endif int der_encode_utf8_string(const wchar_t *in, unsigned long inlen, @@ -516,6 +685,10 @@ int der_encode_utf8_string(const wchar_t *in, unsigned long inlen, int der_decode_utf8_string(const unsigned char *in, unsigned long inlen, wchar_t *out, unsigned long *outlen); unsigned long der_utf8_charsize(const wchar_t c); +#ifdef LTC_SOURCE +/* internal helper functions */ +int der_utf8_valid_char(const wchar_t c); +#endif /* LTC_SOURCE */ int der_length_utf8_string(const wchar_t *in, unsigned long noctets, unsigned long *outlen); @@ -536,7 +709,7 @@ typedef struct { off_mm; /* timezone offset minutes */ } ltc_utctime; -int der_encode_utctime(ltc_utctime *utctime, +int der_encode_utctime(ltc_utctime *utctime, unsigned char *out, unsigned long *outlen); int der_decode_utctime(const unsigned char *in, unsigned long *inlen, @@ -544,9 +717,31 @@ int der_decode_utctime(const unsigned char *in, unsigned long *inlen, int der_length_utctime(ltc_utctime *utctime, unsigned long *outlen); +/* GeneralizedTime */ +typedef struct { + unsigned YYYY, /* year */ + MM, /* month */ + DD, /* day */ + hh, /* hour */ + mm, /* minute */ + ss, /* second */ + fs, /* fractional seconds */ + off_dir, /* timezone offset direction 0 == +, 1 == - */ + off_hh, /* timezone offset hours */ + off_mm; /* timezone offset minutes */ +} ltc_generalizedtime; + +int der_encode_generalizedtime(ltc_generalizedtime *gtime, + unsigned char *out, unsigned long *outlen); + +int der_decode_generalizedtime(const unsigned char *in, unsigned long *inlen, + ltc_generalizedtime *out); + +int der_length_generalizedtime(ltc_generalizedtime *gtime, unsigned long *outlen); + #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/headers/tomcrypt_pkcs.h b/libtomcrypt/src/headers/tomcrypt_pkcs.h index 8c8c7e4..247e538 100644 --- a/libtomcrypt/src/headers/tomcrypt_pkcs.h +++ b/libtomcrypt/src/headers/tomcrypt_pkcs.h @@ -1,19 +1,29 @@ -/* LTC_PKCS Header Info */ - -/* ===> LTC_PKCS #1 -- RSA Cryptography <=== */ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + */ + +/* PKCS Header Info */ + +/* ===> PKCS #1 -- RSA Cryptography <=== */ #ifdef LTC_PKCS_1 enum ltc_pkcs_1_v1_5_blocks { - LTC_LTC_PKCS_1_EMSA = 1, /* Block type 1 (LTC_PKCS #1 v1.5 signature padding) */ - LTC_LTC_PKCS_1_EME = 2 /* Block type 2 (LTC_PKCS #1 v1.5 encryption padding) */ + LTC_PKCS_1_EMSA = 1, /* Block type 1 (PKCS #1 v1.5 signature padding) */ + LTC_PKCS_1_EME = 2 /* Block type 2 (PKCS #1 v1.5 encryption padding) */ }; enum ltc_pkcs_1_paddings { - LTC_LTC_PKCS_1_V1_5 = 1, /* LTC_PKCS #1 v1.5 padding (\sa ltc_pkcs_1_v1_5_blocks) */ - LTC_LTC_PKCS_1_OAEP = 2, /* LTC_PKCS #1 v2.0 encryption padding */ - LTC_LTC_PKCS_1_PSS = 3 /* LTC_PKCS #1 v2.1 signature padding */ + LTC_PKCS_1_V1_5 = 1, /* PKCS #1 v1.5 padding (\sa ltc_pkcs_1_v1_5_blocks) */ + LTC_PKCS_1_OAEP = 2, /* PKCS #1 v2.0 encryption padding */ + LTC_PKCS_1_PSS = 3, /* PKCS #1 v2.1 signature padding */ + LTC_PKCS_1_V1_5_NA1 = 4 /* PKCS #1 v1.5 padding - No ASN.1 (\sa ltc_pkcs_1_v1_5_blocks) */ }; int pkcs_1_mgf1( int hash_idx, @@ -24,20 +34,20 @@ int pkcs_1_i2osp(void *n, unsigned long modulus_len, unsigned char *out); int pkcs_1_os2ip(void *n, unsigned char *in, unsigned long inlen); /* *** v1.5 padding */ -int pkcs_1_v1_5_encode(const unsigned char *msg, +int pkcs_1_v1_5_encode(const unsigned char *msg, unsigned long msglen, int block_type, unsigned long modulus_bitlen, - prng_state *prng, + prng_state *prng, int prng_idx, - unsigned char *out, + unsigned char *out, unsigned long *outlen); -int pkcs_1_v1_5_decode(const unsigned char *msg, +int pkcs_1_v1_5_decode(const unsigned char *msg, unsigned long msglen, int block_type, unsigned long modulus_bitlen, - unsigned char *out, + unsigned char *out, unsigned long *outlen, int *is_valid); @@ -55,7 +65,7 @@ int pkcs_1_oaep_decode(const unsigned char *msg, unsigned long msglen, int *res); int pkcs_1_pss_encode(const unsigned char *msghash, unsigned long msghashlen, - unsigned long saltlen, prng_state *prng, + unsigned long saltlen, prng_state *prng, int prng_idx, int hash_idx, unsigned long modulus_bitlen, unsigned char *out, unsigned long *outlen); @@ -67,23 +77,32 @@ int pkcs_1_pss_decode(const unsigned char *msghash, unsigned long msghashlen, #endif /* LTC_PKCS_1 */ -/* ===> LTC_PKCS #5 -- Password Based Cryptography <=== */ +/* ===> PKCS #5 -- Password Based Cryptography <=== */ #ifdef LTC_PKCS_5 -/* Algorithm #1 (old) */ -int pkcs_5_alg1(const unsigned char *password, unsigned long password_len, - const unsigned char *salt, +/* Algorithm #1 (PBKDF1) */ +int pkcs_5_alg1(const unsigned char *password, unsigned long password_len, + const unsigned char *salt, int iteration_count, int hash_idx, unsigned char *out, unsigned long *outlen); -/* Algorithm #2 (new) */ -int pkcs_5_alg2(const unsigned char *password, unsigned long password_len, +/* Algorithm #1 (PBKDF1) - OpenSSL-compatible variant for arbitrarily-long keys. + Compatible with EVP_BytesToKey() */ +int pkcs_5_alg1_openssl(const unsigned char *password, + unsigned long password_len, + const unsigned char *salt, + int iteration_count, int hash_idx, + unsigned char *out, unsigned long *outlen); + +/* Algorithm #2 (PBKDF2) */ +int pkcs_5_alg2(const unsigned char *password, unsigned long password_len, const unsigned char *salt, unsigned long salt_len, int iteration_count, int hash_idx, unsigned char *out, unsigned long *outlen); +int pkcs_5_test (void); #endif /* LTC_PKCS_5 */ -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/headers/tomcrypt_prng.h b/libtomcrypt/src/headers/tomcrypt_prng.h index 508159d..c516b8c 100644 --- a/libtomcrypt/src/headers/tomcrypt_prng.h +++ b/libtomcrypt/src/headers/tomcrypt_prng.h @@ -1,17 +1,32 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + */ + /* ---- PRNG Stuff ---- */ #ifdef LTC_YARROW struct yarrow_prng { int cipher, hash; unsigned char pool[MAXBLOCKSIZE]; symmetric_CTR ctr; - LTC_MUTEX_TYPE(prng_lock) }; #endif #ifdef LTC_RC4 struct rc4_prng { - int x, y; - unsigned char buf[256]; + rc4_state s; +}; +#endif + +#ifdef LTC_CHACHA20_PRNG +struct chacha20_prng { + chacha_state s; /* chacha state */ + unsigned char ent[40]; /* entropy buffer */ + unsigned long idx; /* entropy counter */ }; #endif @@ -23,50 +38,50 @@ struct fortuna_prng { unsigned char K[32], /* the current key */ IV[16]; /* IV for CTR mode */ - + unsigned long pool_idx, /* current pool we will add to */ pool0_len, /* length of 0'th pool */ - wd; + wd; ulong64 reset_cnt; /* number of times we have reset */ - LTC_MUTEX_TYPE(prng_lock) }; #endif #ifdef LTC_SOBER128 struct sober128_prng { - ulong32 R[17], /* Working storage for the shift register */ - initR[17], /* saved register contents */ - konst, /* key dependent constant */ - sbuf; /* partial word encryption buffer */ - - int nbuf, /* number of part-word stream bits buffered */ - flag, /* first add_entropy call or not? */ - set; /* did we call add_entropy to set key? */ - + sober128_state s; /* sober128 state */ + unsigned char ent[40]; /* entropy buffer */ + unsigned long idx; /* entropy counter */ }; #endif -typedef union Prng_state { - char dummy[1]; +typedef struct { + union { + char dummy[1]; #ifdef LTC_YARROW - struct yarrow_prng yarrow; + struct yarrow_prng yarrow; #endif #ifdef LTC_RC4 - struct rc4_prng rc4; + struct rc4_prng rc4; +#endif +#ifdef LTC_CHACHA20_PRNG + struct chacha20_prng chacha; #endif #ifdef LTC_FORTUNA - struct fortuna_prng fortuna; + struct fortuna_prng fortuna; #endif #ifdef LTC_SOBER128 - struct sober128_prng sober128; + struct sober128_prng sober128; #endif + }; + short ready; /* ready flag 0-1 */ + LTC_MUTEX_TYPE(lock) /* lock */ } prng_state; /** PRNG descriptor */ extern struct ltc_prng_descriptor { /** Name of the PRNG */ - char *name; + const char *name; /** size in bytes of exported state */ int export_size; /** Start a PRNG state @@ -98,7 +113,7 @@ extern struct ltc_prng_descriptor { @return CRYPT_OK if successful */ int (*done)(prng_state *prng); - /** Export a PRNG state + /** Export a PRNG state @param out [out] The destination for the state @param outlen [in/out] The max size and resulting size of the PRNG state @param prng The PRNG to export @@ -154,6 +169,18 @@ int rc4_test(void); extern const struct ltc_prng_descriptor rc4_desc; #endif +#ifdef LTC_CHACHA20_PRNG +int chacha20_prng_start(prng_state *prng); +int chacha20_prng_add_entropy(const unsigned char *in, unsigned long inlen, prng_state *prng); +int chacha20_prng_ready(prng_state *prng); +unsigned long chacha20_prng_read(unsigned char *out, unsigned long outlen, prng_state *prng); +int chacha20_prng_done(prng_state *prng); +int chacha20_prng_export(unsigned char *out, unsigned long *outlen, prng_state *prng); +int chacha20_prng_import(const unsigned char *in, unsigned long inlen, prng_state *prng); +int chacha20_prng_test(void); +extern const struct ltc_prng_descriptor chacha20_prng_desc; +#endif + #ifdef LTC_SPRNG int sprng_start(prng_state *prng); int sprng_add_entropy(const unsigned char *in, unsigned long inlen, prng_state *prng); @@ -181,19 +208,25 @@ extern const struct ltc_prng_descriptor sober128_desc; int find_prng(const char *name); int register_prng(const struct ltc_prng_descriptor *prng); int unregister_prng(const struct ltc_prng_descriptor *prng); +int register_all_prngs(void); int prng_is_valid(int idx); LTC_MUTEX_PROTO(ltc_prng_mutex) /* Slow RNG you **might** be able to use to seed a PRNG with. Be careful as this * might not work on all platforms as planned */ -unsigned long rng_get_bytes(unsigned char *out, - unsigned long outlen, +unsigned long rng_get_bytes(unsigned char *out, + unsigned long outlen, void (*callback)(void)); int rng_make_prng(int bits, int wprng, prng_state *prng, void (*callback)(void)); +#ifdef LTC_PRNG_ENABLE_LTC_RNG +extern unsigned long (*ltc_rng)(unsigned char *out, unsigned long outlen, + void (*callback)(void)); +#endif + -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/mac/blake2/blake2bmac.c b/libtomcrypt/src/mac/blake2/blake2bmac.c new file mode 100644 index 0000000..1c80b1c --- /dev/null +++ b/libtomcrypt/src/mac/blake2/blake2bmac.c @@ -0,0 +1,66 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + */ + +#include "tomcrypt.h" + +#ifdef LTC_BLAKE2BMAC + +/** + Initialize an BLAKE2B MAC context. + @param st The BLAKE2B MAC state + @param outlen The size of the MAC output (octets) + @param key The secret key + @param keylen The length of the secret key (octets) + @return CRYPT_OK if successful +*/ +int blake2bmac_init(blake2bmac_state *st, unsigned long outlen, const unsigned char *key, unsigned long keylen) +{ + LTC_ARGCHK(st != NULL); + LTC_ARGCHK(key != NULL); + return blake2b_init(st, outlen, key, keylen); +} + +/** + Process data through BLAKE2B MAC + @param st The BLAKE2B MAC state + @param in The data to send through HMAC + @param inlen The length of the data to HMAC (octets) + @return CRYPT_OK if successful +*/ +int blake2bmac_process(blake2bmac_state *st, const unsigned char *in, unsigned long inlen) +{ + if (inlen == 0) return CRYPT_OK; /* nothing to do */ + LTC_ARGCHK(st != NULL); + LTC_ARGCHK(in != NULL); + return blake2b_process(st, in, inlen); +} + +/** + Terminate a BLAKE2B MAC session + @param st The BLAKE2B MAC state + @param mac [out] The destination of the BLAKE2B MAC authentication tag + @param maclen [in/out] The max size and resulting size of the BLAKE2B MAC authentication tag + @return CRYPT_OK if successful +*/ +int blake2bmac_done(blake2bmac_state *st, unsigned char *mac, unsigned long *maclen) +{ + LTC_ARGCHK(st != NULL); + LTC_ARGCHK(mac != NULL); + LTC_ARGCHK(maclen != NULL); + LTC_ARGCHK(*maclen >= st->blake2b.outlen); + + *maclen = st->blake2b.outlen; + return blake2b_done(st, mac); +} + +#endif + +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/mac/blake2/blake2bmac_file.c b/libtomcrypt/src/mac/blake2/blake2bmac_file.c new file mode 100644 index 0000000..64c9e4d --- /dev/null +++ b/libtomcrypt/src/mac/blake2/blake2bmac_file.c @@ -0,0 +1,83 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + */ + +#include "tomcrypt.h" + +#ifdef LTC_BLAKE2BMAC + +/** + BLAKE2B MAC a file + @param fname The name of the file you wish to BLAKE2B MAC + @param key The secret key + @param keylen The length of the secret key + @param mac [out] The BLAKE2B MAC authentication tag + @param maclen [in/out] The max size and resulting size of the authentication tag + @return CRYPT_OK if successful, CRYPT_NOP if file support has been disabled +*/ +int blake2bmac_file(const char *fname, const unsigned char *key, unsigned long keylen, unsigned char *mac, unsigned long *maclen) +{ +#ifdef LTC_NO_FILE + return CRYPT_NOP; +#else + blake2bmac_state st; + FILE *in; + unsigned char *buf; + size_t x; + int err; + + LTC_ARGCHK(fname != NULL); + LTC_ARGCHK(key != NULL); + LTC_ARGCHK(mac != NULL); + LTC_ARGCHK(maclen != NULL); + + if ((buf = XMALLOC(LTC_FILE_READ_BUFSIZE)) == NULL) { + return CRYPT_MEM; + } + + if ((err = blake2bmac_init(&st, *maclen, key, keylen)) != CRYPT_OK) { + goto LBL_ERR; + } + + in = fopen(fname, "rb"); + if (in == NULL) { + err = CRYPT_FILE_NOTFOUND; + goto LBL_ERR; + } + + do { + x = fread(buf, 1, LTC_FILE_READ_BUFSIZE, in); + if ((err = blake2bmac_process(&st, buf, (unsigned long)x)) != CRYPT_OK) { + fclose(in); + goto LBL_CLEANBUF; + } + } while (x == LTC_FILE_READ_BUFSIZE); + + if (fclose(in) != 0) { + err = CRYPT_ERROR; + goto LBL_CLEANBUF; + } + + err = blake2bmac_done(&st, mac, maclen); + +LBL_CLEANBUF: + zeromem(buf, LTC_FILE_READ_BUFSIZE); +LBL_ERR: +#ifdef LTC_CLEAN_STACK + zeromem(&st, sizeof(blake2bmac_state)); +#endif + XFREE(buf); + return err; +#endif +} + +#endif + +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/mac/blake2/blake2bmac_memory.c b/libtomcrypt/src/mac/blake2/blake2bmac_memory.c new file mode 100644 index 0000000..45ddd6f --- /dev/null +++ b/libtomcrypt/src/mac/blake2/blake2bmac_memory.c @@ -0,0 +1,48 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + */ + +#include "tomcrypt.h" + +#ifdef LTC_BLAKE2BMAC + +/** + BLAKE2B MAC a block of memory to produce the authentication tag + @param key The secret key + @param keylen The length of the secret key (octets) + @param in The data to BLAKE2B MAC + @param inlen The length of the data to BLAKE2B MAC (octets) + @param mac [out] Destination of the authentication tag + @param maclen [in/out] Max size and resulting size of authentication tag + @return CRYPT_OK if successful +*/ +int blake2bmac_memory(const unsigned char *key, unsigned long keylen, const unsigned char *in, unsigned long inlen, unsigned char *mac, unsigned long *maclen) +{ + blake2bmac_state st; + int err; + + LTC_ARGCHK(key != NULL); + LTC_ARGCHK(in != NULL); + LTC_ARGCHK(mac != NULL); + LTC_ARGCHK(maclen != NULL); + + if ((err = blake2bmac_init(&st, *maclen, key, keylen)) != CRYPT_OK) { goto LBL_ERR; } + if ((err = blake2bmac_process(&st, in, inlen)) != CRYPT_OK) { goto LBL_ERR; } + err = blake2bmac_done(&st, mac, maclen); +LBL_ERR: +#ifdef LTC_CLEAN_STACK + zeromem(&st, sizeof(blake2bmac_state)); +#endif + return err; +} + +#endif + +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/mac/blake2/blake2bmac_memory_multi.c b/libtomcrypt/src/mac/blake2/blake2bmac_memory_multi.c new file mode 100644 index 0000000..2b875d7 --- /dev/null +++ b/libtomcrypt/src/mac/blake2/blake2bmac_memory_multi.c @@ -0,0 +1,62 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + */ + +#include "tomcrypt.h" +#include <stdarg.h> + +#ifdef LTC_BLAKE2BMAC + +/** + BLAKE2B MAC multiple blocks of memory to produce the authentication tag + @param key The secret key + @param keylen The length of the secret key (octets) + @param mac [out] Destination of the authentication tag + @param maclen [in/out] Max size and resulting size of authentication tag + @param in The data to BLAKE2B MAC + @param inlen The length of the data to BLAKE2B MAC (octets) + @param ... tuples of (data,len) pairs to BLAKE2B MAC, terminated with a (NULL,x) (x=don't care) + @return CRYPT_OK if successful +*/ +int blake2bmac_memory_multi(const unsigned char *key, unsigned long keylen, unsigned char *mac, unsigned long *maclen, const unsigned char *in, unsigned long inlen, ...) +{ + blake2bmac_state st; + int err; + va_list args; + const unsigned char *curptr; + unsigned long curlen; + + LTC_ARGCHK(key != NULL); + LTC_ARGCHK(in != NULL); + LTC_ARGCHK(mac != NULL); + LTC_ARGCHK(maclen != NULL); + + va_start(args, inlen); + curptr = in; + curlen = inlen; + if ((err = blake2bmac_init(&st, *maclen, key, keylen)) != CRYPT_OK) { goto LBL_ERR; } + for (;;) { + if ((err = blake2bmac_process(&st, curptr, curlen)) != CRYPT_OK) { goto LBL_ERR; } + curptr = va_arg(args, const unsigned char*); + if (curptr == NULL) break; + curlen = va_arg(args, unsigned long); + } + err = blake2bmac_done(&st, mac, maclen); +LBL_ERR: +#ifdef LTC_CLEAN_STACK + zeromem(&st, sizeof(blake2bmac_state)); +#endif + va_end(args); + return err; +} + +#endif + +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/mac/blake2/blake2bmac_test.c b/libtomcrypt/src/mac/blake2/blake2bmac_test.c new file mode 100644 index 0000000..ae70056 --- /dev/null +++ b/libtomcrypt/src/mac/blake2/blake2bmac_test.c @@ -0,0 +1,314 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + */ + +#include "tomcrypt.h" + +#ifdef LTC_BLAKE2BMAC + +int blake2bmac_test(void) +{ +#ifndef LTC_TEST + return CRYPT_NOP; +#else + static const unsigned char tests[256][64] = { + /* source: https://github.com/BLAKE2/BLAKE2/blob/master/testvectors/blake2b-kat.txt */ + { 0x10, 0xeb, 0xb6, 0x77, 0x00, 0xb1, 0x86, 0x8e, 0xfb, 0x44, 0x17, 0x98, 0x7a, 0xcf, 0x46, 0x90, 0xae, 0x9d, 0x97, 0x2f, 0xb7, 0xa5, 0x90, 0xc2, 0xf0, 0x28, 0x71, 0x79, 0x9a, 0xaa, 0x47, 0x86, 0xb5, 0xe9, 0x96, 0xe8, 0xf0, 0xf4, 0xeb, 0x98, 0x1f, 0xc2, 0x14, 0xb0, 0x05, 0xf4, 0x2d, 0x2f, 0xf4, 0x23, 0x34, 0x99, 0x39, 0x16, 0x53, 0xdf, 0x7a, 0xef, 0xcb, 0xc1, 0x3f, 0xc5, 0x15, 0x68 }, + { 0x96, 0x1f, 0x6d, 0xd1, 0xe4, 0xdd, 0x30, 0xf6, 0x39, 0x01, 0x69, 0x0c, 0x51, 0x2e, 0x78, 0xe4, 0xb4, 0x5e, 0x47, 0x42, 0xed, 0x19, 0x7c, 0x3c, 0x5e, 0x45, 0xc5, 0x49, 0xfd, 0x25, 0xf2, 0xe4, 0x18, 0x7b, 0x0b, 0xc9, 0xfe, 0x30, 0x49, 0x2b, 0x16, 0xb0, 0xd0, 0xbc, 0x4e, 0xf9, 0xb0, 0xf3, 0x4c, 0x70, 0x03, 0xfa, 0xc0, 0x9a, 0x5e, 0xf1, 0x53, 0x2e, 0x69, 0x43, 0x02, 0x34, 0xce, 0xbd }, + { 0xda, 0x2c, 0xfb, 0xe2, 0xd8, 0x40, 0x9a, 0x0f, 0x38, 0x02, 0x61, 0x13, 0x88, 0x4f, 0x84, 0xb5, 0x01, 0x56, 0x37, 0x1a, 0xe3, 0x04, 0xc4, 0x43, 0x01, 0x73, 0xd0, 0x8a, 0x99, 0xd9, 0xfb, 0x1b, 0x98, 0x31, 0x64, 0xa3, 0x77, 0x07, 0x06, 0xd5, 0x37, 0xf4, 0x9e, 0x0c, 0x91, 0x6d, 0x9f, 0x32, 0xb9, 0x5c, 0xc3, 0x7a, 0x95, 0xb9, 0x9d, 0x85, 0x74, 0x36, 0xf0, 0x23, 0x2c, 0x88, 0xa9, 0x65 }, + { 0x33, 0xd0, 0x82, 0x5d, 0xdd, 0xf7, 0xad, 0xa9, 0x9b, 0x0e, 0x7e, 0x30, 0x71, 0x04, 0xad, 0x07, 0xca, 0x9c, 0xfd, 0x96, 0x92, 0x21, 0x4f, 0x15, 0x61, 0x35, 0x63, 0x15, 0xe7, 0x84, 0xf3, 0xe5, 0xa1, 0x7e, 0x36, 0x4a, 0xe9, 0xdb, 0xb1, 0x4c, 0xb2, 0x03, 0x6d, 0xf9, 0x32, 0xb7, 0x7f, 0x4b, 0x29, 0x27, 0x61, 0x36, 0x5f, 0xb3, 0x28, 0xde, 0x7a, 0xfd, 0xc6, 0xd8, 0x99, 0x8f, 0x5f, 0xc1 }, + { 0xbe, 0xaa, 0x5a, 0x3d, 0x08, 0xf3, 0x80, 0x71, 0x43, 0xcf, 0x62, 0x1d, 0x95, 0xcd, 0x69, 0x05, 0x14, 0xd0, 0xb4, 0x9e, 0xff, 0xf9, 0xc9, 0x1d, 0x24, 0xb5, 0x92, 0x41, 0xec, 0x0e, 0xef, 0xa5, 0xf6, 0x01, 0x96, 0xd4, 0x07, 0x04, 0x8b, 0xba, 0x8d, 0x21, 0x46, 0x82, 0x8e, 0xbc, 0xb0, 0x48, 0x8d, 0x88, 0x42, 0xfd, 0x56, 0xbb, 0x4f, 0x6d, 0xf8, 0xe1, 0x9c, 0x4b, 0x4d, 0xaa, 0xb8, 0xac }, + { 0x09, 0x80, 0x84, 0xb5, 0x1f, 0xd1, 0x3d, 0xea, 0xe5, 0xf4, 0x32, 0x0d, 0xe9, 0x4a, 0x68, 0x8e, 0xe0, 0x7b, 0xae, 0xa2, 0x80, 0x04, 0x86, 0x68, 0x9a, 0x86, 0x36, 0x11, 0x7b, 0x46, 0xc1, 0xf4, 0xc1, 0xf6, 0xaf, 0x7f, 0x74, 0xae, 0x7c, 0x85, 0x76, 0x00, 0x45, 0x6a, 0x58, 0xa3, 0xaf, 0x25, 0x1d, 0xc4, 0x72, 0x3a, 0x64, 0xcc, 0x7c, 0x0a, 0x5a, 0xb6, 0xd9, 0xca, 0xc9, 0x1c, 0x20, 0xbb }, + { 0x60, 0x44, 0x54, 0x0d, 0x56, 0x08, 0x53, 0xeb, 0x1c, 0x57, 0xdf, 0x00, 0x77, 0xdd, 0x38, 0x10, 0x94, 0x78, 0x1c, 0xdb, 0x90, 0x73, 0xe5, 0xb1, 0xb3, 0xd3, 0xf6, 0xc7, 0x82, 0x9e, 0x12, 0x06, 0x6b, 0xba, 0xca, 0x96, 0xd9, 0x89, 0xa6, 0x90, 0xde, 0x72, 0xca, 0x31, 0x33, 0xa8, 0x36, 0x52, 0xba, 0x28, 0x4a, 0x6d, 0x62, 0x94, 0x2b, 0x27, 0x1f, 0xfa, 0x26, 0x20, 0xc9, 0xe7, 0x5b, 0x1f }, + { 0x7a, 0x8c, 0xfe, 0x9b, 0x90, 0xf7, 0x5f, 0x7e, 0xcb, 0x3a, 0xcc, 0x05, 0x3a, 0xae, 0xd6, 0x19, 0x31, 0x12, 0xb6, 0xf6, 0xa4, 0xae, 0xeb, 0x3f, 0x65, 0xd3, 0xde, 0x54, 0x19, 0x42, 0xde, 0xb9, 0xe2, 0x22, 0x81, 0x52, 0xa3, 0xc4, 0xbb, 0xbe, 0x72, 0xfc, 0x3b, 0x12, 0x62, 0x95, 0x28, 0xcf, 0xbb, 0x09, 0xfe, 0x63, 0x0f, 0x04, 0x74, 0x33, 0x9f, 0x54, 0xab, 0xf4, 0x53, 0xe2, 0xed, 0x52 }, + { 0x38, 0x0b, 0xea, 0xf6, 0xea, 0x7c, 0xc9, 0x36, 0x5e, 0x27, 0x0e, 0xf0, 0xe6, 0xf3, 0xa6, 0x4f, 0xb9, 0x02, 0xac, 0xae, 0x51, 0xdd, 0x55, 0x12, 0xf8, 0x42, 0x59, 0xad, 0x2c, 0x91, 0xf4, 0xbc, 0x41, 0x08, 0xdb, 0x73, 0x19, 0x2a, 0x5b, 0xbf, 0xb0, 0xcb, 0xcf, 0x71, 0xe4, 0x6c, 0x3e, 0x21, 0xae, 0xe1, 0xc5, 0xe8, 0x60, 0xdc, 0x96, 0xe8, 0xeb, 0x0b, 0x7b, 0x84, 0x26, 0xe6, 0xab, 0xe9 }, + { 0x60, 0xfe, 0x3c, 0x45, 0x35, 0xe1, 0xb5, 0x9d, 0x9a, 0x61, 0xea, 0x85, 0x00, 0xbf, 0xac, 0x41, 0xa6, 0x9d, 0xff, 0xb1, 0xce, 0xad, 0xd9, 0xac, 0xa3, 0x23, 0xe9, 0xa6, 0x25, 0xb6, 0x4d, 0xa5, 0x76, 0x3b, 0xad, 0x72, 0x26, 0xda, 0x02, 0xb9, 0xc8, 0xc4, 0xf1, 0xa5, 0xde, 0x14, 0x0a, 0xc5, 0xa6, 0xc1, 0x12, 0x4e, 0x4f, 0x71, 0x8c, 0xe0, 0xb2, 0x8e, 0xa4, 0x73, 0x93, 0xaa, 0x66, 0x37 }, + { 0x4f, 0xe1, 0x81, 0xf5, 0x4a, 0xd6, 0x3a, 0x29, 0x83, 0xfe, 0xaa, 0xf7, 0x7d, 0x1e, 0x72, 0x35, 0xc2, 0xbe, 0xb1, 0x7f, 0xa3, 0x28, 0xb6, 0xd9, 0x50, 0x5b, 0xda, 0x32, 0x7d, 0xf1, 0x9f, 0xc3, 0x7f, 0x02, 0xc4, 0xb6, 0xf0, 0x36, 0x8c, 0xe2, 0x31, 0x47, 0x31, 0x3a, 0x8e, 0x57, 0x38, 0xb5, 0xfa, 0x2a, 0x95, 0xb2, 0x9d, 0xe1, 0xc7, 0xf8, 0x26, 0x4e, 0xb7, 0x7b, 0x69, 0xf5, 0x85, 0xcd }, + { 0xf2, 0x28, 0x77, 0x3c, 0xe3, 0xf3, 0xa4, 0x2b, 0x5f, 0x14, 0x4d, 0x63, 0x23, 0x7a, 0x72, 0xd9, 0x96, 0x93, 0xad, 0xb8, 0x83, 0x7d, 0x0e, 0x11, 0x2a, 0x8a, 0x0f, 0x8f, 0xff, 0xf2, 0xc3, 0x62, 0x85, 0x7a, 0xc4, 0x9c, 0x11, 0xec, 0x74, 0x0d, 0x15, 0x00, 0x74, 0x9d, 0xac, 0x9b, 0x1f, 0x45, 0x48, 0x10, 0x8b, 0xf3, 0x15, 0x57, 0x94, 0xdc, 0xc9, 0xe4, 0x08, 0x28, 0x49, 0xe2, 0xb8, 0x5b }, + { 0x96, 0x24, 0x52, 0xa8, 0x45, 0x5c, 0xc5, 0x6c, 0x85, 0x11, 0x31, 0x7e, 0x3b, 0x1f, 0x3b, 0x2c, 0x37, 0xdf, 0x75, 0xf5, 0x88, 0xe9, 0x43, 0x25, 0xfd, 0xd7, 0x70, 0x70, 0x35, 0x9c, 0xf6, 0x3a, 0x9a, 0xe6, 0xe9, 0x30, 0x93, 0x6f, 0xdf, 0x8e, 0x1e, 0x08, 0xff, 0xca, 0x44, 0x0c, 0xfb, 0x72, 0xc2, 0x8f, 0x06, 0xd8, 0x9a, 0x21, 0x51, 0xd1, 0xc4, 0x6c, 0xd5, 0xb2, 0x68, 0xef, 0x85, 0x63 }, + { 0x43, 0xd4, 0x4b, 0xfa, 0x18, 0x76, 0x8c, 0x59, 0x89, 0x6b, 0xf7, 0xed, 0x17, 0x65, 0xcb, 0x2d, 0x14, 0xaf, 0x8c, 0x26, 0x02, 0x66, 0x03, 0x90, 0x99, 0xb2, 0x5a, 0x60, 0x3e, 0x4d, 0xdc, 0x50, 0x39, 0xd6, 0xef, 0x3a, 0x91, 0x84, 0x7d, 0x10, 0x88, 0xd4, 0x01, 0xc0, 0xc7, 0xe8, 0x47, 0x78, 0x1a, 0x8a, 0x59, 0x0d, 0x33, 0xa3, 0xc6, 0xcb, 0x4d, 0xf0, 0xfa, 0xb1, 0xc2, 0xf2, 0x23, 0x55 }, + { 0xdc, 0xff, 0xa9, 0xd5, 0x8c, 0x2a, 0x4c, 0xa2, 0xcd, 0xbb, 0x0c, 0x7a, 0xa4, 0xc4, 0xc1, 0xd4, 0x51, 0x65, 0x19, 0x00, 0x89, 0xf4, 0xe9, 0x83, 0xbb, 0x1c, 0x2c, 0xab, 0x4a, 0xae, 0xff, 0x1f, 0xa2, 0xb5, 0xee, 0x51, 0x6f, 0xec, 0xd7, 0x80, 0x54, 0x02, 0x40, 0xbf, 0x37, 0xe5, 0x6c, 0x8b, 0xcc, 0xa7, 0xfa, 0xb9, 0x80, 0xe1, 0xe6, 0x1c, 0x94, 0x00, 0xd8, 0xa9, 0xa5, 0xb1, 0x4a, 0xc6 }, + { 0x6f, 0xbf, 0x31, 0xb4, 0x5a, 0xb0, 0xc0, 0xb8, 0xda, 0xd1, 0xc0, 0xf5, 0xf4, 0x06, 0x13, 0x79, 0x91, 0x2d, 0xde, 0x5a, 0xa9, 0x22, 0x09, 0x9a, 0x03, 0x0b, 0x72, 0x5c, 0x73, 0x34, 0x6c, 0x52, 0x42, 0x91, 0xad, 0xef, 0x89, 0xd2, 0xf6, 0xfd, 0x8d, 0xfc, 0xda, 0x6d, 0x07, 0xda, 0xd8, 0x11, 0xa9, 0x31, 0x45, 0x36, 0xc2, 0x91, 0x5e, 0xd4, 0x5d, 0xa3, 0x49, 0x47, 0xe8, 0x3d, 0xe3, 0x4e }, + { 0xa0, 0xc6, 0x5b, 0xdd, 0xde, 0x8a, 0xde, 0xf5, 0x72, 0x82, 0xb0, 0x4b, 0x11, 0xe7, 0xbc, 0x8a, 0xab, 0x10, 0x5b, 0x99, 0x23, 0x1b, 0x75, 0x0c, 0x02, 0x1f, 0x4a, 0x73, 0x5c, 0xb1, 0xbc, 0xfa, 0xb8, 0x75, 0x53, 0xbb, 0xa3, 0xab, 0xb0, 0xc3, 0xe6, 0x4a, 0x0b, 0x69, 0x55, 0x28, 0x51, 0x85, 0xa0, 0xbd, 0x35, 0xfb, 0x8c, 0xfd, 0xe5, 0x57, 0x32, 0x9b, 0xeb, 0xb1, 0xf6, 0x29, 0xee, 0x93 }, + { 0xf9, 0x9d, 0x81, 0x55, 0x50, 0x55, 0x8e, 0x81, 0xec, 0xa2, 0xf9, 0x67, 0x18, 0xae, 0xd1, 0x0d, 0x86, 0xf3, 0xf1, 0xcf, 0xb6, 0x75, 0xcc, 0xe0, 0x6b, 0x0e, 0xff, 0x02, 0xf6, 0x17, 0xc5, 0xa4, 0x2c, 0x5a, 0xa7, 0x60, 0x27, 0x0f, 0x26, 0x79, 0xda, 0x26, 0x77, 0xc5, 0xae, 0xb9, 0x4f, 0x11, 0x42, 0x27, 0x7f, 0x21, 0xc7, 0xf7, 0x9f, 0x3c, 0x4f, 0x0c, 0xce, 0x4e, 0xd8, 0xee, 0x62, 0xb1 }, + { 0x95, 0x39, 0x1d, 0xa8, 0xfc, 0x7b, 0x91, 0x7a, 0x20, 0x44, 0xb3, 0xd6, 0xf5, 0x37, 0x4e, 0x1c, 0xa0, 0x72, 0xb4, 0x14, 0x54, 0xd5, 0x72, 0xc7, 0x35, 0x6c, 0x05, 0xfd, 0x4b, 0xc1, 0xe0, 0xf4, 0x0b, 0x8b, 0xb8, 0xb4, 0xa9, 0xf6, 0xbc, 0xe9, 0xbe, 0x2c, 0x46, 0x23, 0xc3, 0x99, 0xb0, 0xdc, 0xa0, 0xda, 0xb0, 0x5c, 0xb7, 0x28, 0x1b, 0x71, 0xa2, 0x1b, 0x0e, 0xbc, 0xd9, 0xe5, 0x56, 0x70 }, + { 0x04, 0xb9, 0xcd, 0x3d, 0x20, 0xd2, 0x21, 0xc0, 0x9a, 0xc8, 0x69, 0x13, 0xd3, 0xdc, 0x63, 0x04, 0x19, 0x89, 0xa9, 0xa1, 0xe6, 0x94, 0xf1, 0xe6, 0x39, 0xa3, 0xba, 0x7e, 0x45, 0x18, 0x40, 0xf7, 0x50, 0xc2, 0xfc, 0x19, 0x1d, 0x56, 0xad, 0x61, 0xf2, 0xe7, 0x93, 0x6b, 0xc0, 0xac, 0x8e, 0x09, 0x4b, 0x60, 0xca, 0xee, 0xd8, 0x78, 0xc1, 0x87, 0x99, 0x04, 0x54, 0x02, 0xd6, 0x1c, 0xea, 0xf9 }, + { 0xec, 0x0e, 0x0e, 0xf7, 0x07, 0xe4, 0xed, 0x6c, 0x0c, 0x66, 0xf9, 0xe0, 0x89, 0xe4, 0x95, 0x4b, 0x05, 0x80, 0x30, 0xd2, 0xdd, 0x86, 0x39, 0x8f, 0xe8, 0x40, 0x59, 0x63, 0x1f, 0x9e, 0xe5, 0x91, 0xd9, 0xd7, 0x73, 0x75, 0x35, 0x51, 0x49, 0x17, 0x8c, 0x0c, 0xf8, 0xf8, 0xe7, 0xc4, 0x9e, 0xd2, 0xa5, 0xe4, 0xf9, 0x54, 0x88, 0xa2, 0x24, 0x70, 0x67, 0xc2, 0x08, 0x51, 0x0f, 0xad, 0xc4, 0x4c }, + { 0x9a, 0x37, 0xcc, 0xe2, 0x73, 0xb7, 0x9c, 0x09, 0x91, 0x36, 0x77, 0x51, 0x0e, 0xaf, 0x76, 0x88, 0xe8, 0x9b, 0x33, 0x14, 0xd3, 0x53, 0x2f, 0xd2, 0x76, 0x4c, 0x39, 0xde, 0x02, 0x2a, 0x29, 0x45, 0xb5, 0x71, 0x0d, 0x13, 0x51, 0x7a, 0xf8, 0xdd, 0xc0, 0x31, 0x66, 0x24, 0xe7, 0x3b, 0xec, 0x1c, 0xe6, 0x7d, 0xf1, 0x52, 0x28, 0x30, 0x20, 0x36, 0xf3, 0x30, 0xab, 0x0c, 0xb4, 0xd2, 0x18, 0xdd }, + { 0x4c, 0xf9, 0xbb, 0x8f, 0xb3, 0xd4, 0xde, 0x8b, 0x38, 0xb2, 0xf2, 0x62, 0xd3, 0xc4, 0x0f, 0x46, 0xdf, 0xe7, 0x47, 0xe8, 0xfc, 0x0a, 0x41, 0x4c, 0x19, 0x3d, 0x9f, 0xcf, 0x75, 0x31, 0x06, 0xce, 0x47, 0xa1, 0x8f, 0x17, 0x2f, 0x12, 0xe8, 0xa2, 0xf1, 0xc2, 0x67, 0x26, 0x54, 0x53, 0x58, 0xe5, 0xee, 0x28, 0xc9, 0xe2, 0x21, 0x3a, 0x87, 0x87, 0xaa, 0xfb, 0xc5, 0x16, 0xd2, 0x34, 0x31, 0x52 }, + { 0x64, 0xe0, 0xc6, 0x3a, 0xf9, 0xc8, 0x08, 0xfd, 0x89, 0x31, 0x37, 0x12, 0x98, 0x67, 0xfd, 0x91, 0x93, 0x9d, 0x53, 0xf2, 0xaf, 0x04, 0xbe, 0x4f, 0xa2, 0x68, 0x00, 0x61, 0x00, 0x06, 0x9b, 0x2d, 0x69, 0xda, 0xa5, 0xc5, 0xd8, 0xed, 0x7f, 0xdd, 0xcb, 0x2a, 0x70, 0xee, 0xec, 0xdf, 0x2b, 0x10, 0x5d, 0xd4, 0x6a, 0x1e, 0x3b, 0x73, 0x11, 0x72, 0x8f, 0x63, 0x9a, 0xb4, 0x89, 0x32, 0x6b, 0xc9 }, + { 0x5e, 0x9c, 0x93, 0x15, 0x8d, 0x65, 0x9b, 0x2d, 0xef, 0x06, 0xb0, 0xc3, 0xc7, 0x56, 0x50, 0x45, 0x54, 0x26, 0x62, 0xd6, 0xee, 0xe8, 0xa9, 0x6a, 0x89, 0xb7, 0x8a, 0xde, 0x09, 0xfe, 0x8b, 0x3d, 0xcc, 0x09, 0x6d, 0x4f, 0xe4, 0x88, 0x15, 0xd8, 0x8d, 0x8f, 0x82, 0x62, 0x01, 0x56, 0x60, 0x2a, 0xf5, 0x41, 0x95, 0x5e, 0x1f, 0x6c, 0xa3, 0x0d, 0xce, 0x14, 0xe2, 0x54, 0xc3, 0x26, 0xb8, 0x8f }, + { 0x77, 0x75, 0xdf, 0xf8, 0x89, 0x45, 0x8d, 0xd1, 0x1a, 0xef, 0x41, 0x72, 0x76, 0x85, 0x3e, 0x21, 0x33, 0x5e, 0xb8, 0x8e, 0x4d, 0xec, 0x9c, 0xfb, 0x4e, 0x9e, 0xdb, 0x49, 0x82, 0x00, 0x88, 0x55, 0x1a, 0x2c, 0xa6, 0x03, 0x39, 0xf1, 0x20, 0x66, 0x10, 0x11, 0x69, 0xf0, 0xdf, 0xe8, 0x4b, 0x09, 0x8f, 0xdd, 0xb1, 0x48, 0xd9, 0xda, 0x6b, 0x3d, 0x61, 0x3d, 0xf2, 0x63, 0x88, 0x9a, 0xd6, 0x4b }, + { 0xf0, 0xd2, 0x80, 0x5a, 0xfb, 0xb9, 0x1f, 0x74, 0x39, 0x51, 0x35, 0x1a, 0x6d, 0x02, 0x4f, 0x93, 0x53, 0xa2, 0x3c, 0x7c, 0xe1, 0xfc, 0x2b, 0x05, 0x1b, 0x3a, 0x8b, 0x96, 0x8c, 0x23, 0x3f, 0x46, 0xf5, 0x0f, 0x80, 0x6e, 0xcb, 0x15, 0x68, 0xff, 0xaa, 0x0b, 0x60, 0x66, 0x1e, 0x33, 0x4b, 0x21, 0xdd, 0xe0, 0x4f, 0x8f, 0xa1, 0x55, 0xac, 0x74, 0x0e, 0xeb, 0x42, 0xe2, 0x0b, 0x60, 0xd7, 0x64 }, + { 0x86, 0xa2, 0xaf, 0x31, 0x6e, 0x7d, 0x77, 0x54, 0x20, 0x1b, 0x94, 0x2e, 0x27, 0x53, 0x64, 0xac, 0x12, 0xea, 0x89, 0x62, 0xab, 0x5b, 0xd8, 0xd7, 0xfb, 0x27, 0x6d, 0xc5, 0xfb, 0xff, 0xc8, 0xf9, 0xa2, 0x8c, 0xae, 0x4e, 0x48, 0x67, 0xdf, 0x67, 0x80, 0xd9, 0xb7, 0x25, 0x24, 0x16, 0x09, 0x27, 0xc8, 0x55, 0xda, 0x5b, 0x60, 0x78, 0xe0, 0xb5, 0x54, 0xaa, 0x91, 0xe3, 0x1c, 0xb9, 0xca, 0x1d }, + { 0x10, 0xbd, 0xf0, 0xca, 0xa0, 0x80, 0x27, 0x05, 0xe7, 0x06, 0x36, 0x9b, 0xaf, 0x8a, 0x3f, 0x79, 0xd7, 0x2c, 0x0a, 0x03, 0xa8, 0x06, 0x75, 0xa7, 0xbb, 0xb0, 0x0b, 0xe3, 0xa4, 0x5e, 0x51, 0x64, 0x24, 0xd1, 0xee, 0x88, 0xef, 0xb5, 0x6f, 0x6d, 0x57, 0x77, 0x54, 0x5a, 0xe6, 0xe2, 0x77, 0x65, 0xc3, 0xa8, 0xf5, 0xe4, 0x93, 0xfc, 0x30, 0x89, 0x15, 0x63, 0x89, 0x33, 0xa1, 0xdf, 0xee, 0x55 }, + { 0xb0, 0x17, 0x81, 0x09, 0x2b, 0x17, 0x48, 0x45, 0x9e, 0x2e, 0x4e, 0xc1, 0x78, 0x69, 0x66, 0x27, 0xbf, 0x4e, 0xba, 0xfe, 0xbb, 0xa7, 0x74, 0xec, 0xf0, 0x18, 0xb7, 0x9a, 0x68, 0xae, 0xb8, 0x49, 0x17, 0xbf, 0x0b, 0x84, 0xbb, 0x79, 0xd1, 0x7b, 0x74, 0x31, 0x51, 0x14, 0x4c, 0xd6, 0x6b, 0x7b, 0x33, 0xa4, 0xb9, 0xe5, 0x2c, 0x76, 0xc4, 0xe1, 0x12, 0x05, 0x0f, 0xf5, 0x38, 0x5b, 0x7f, 0x0b }, + { 0xc6, 0xdb, 0xc6, 0x1d, 0xec, 0x6e, 0xae, 0xac, 0x81, 0xe3, 0xd5, 0xf7, 0x55, 0x20, 0x3c, 0x8e, 0x22, 0x05, 0x51, 0x53, 0x4a, 0x0b, 0x2f, 0xd1, 0x05, 0xa9, 0x18, 0x89, 0x94, 0x5a, 0x63, 0x85, 0x50, 0x20, 0x4f, 0x44, 0x09, 0x3d, 0xd9, 0x98, 0xc0, 0x76, 0x20, 0x5d, 0xff, 0xad, 0x70, 0x3a, 0x0e, 0x5c, 0xd3, 0xc7, 0xf4, 0x38, 0xa7, 0xe6, 0x34, 0xcd, 0x59, 0xfe, 0xde, 0xdb, 0x53, 0x9e }, + { 0xeb, 0xa5, 0x1a, 0xcf, 0xfb, 0x4c, 0xea, 0x31, 0xdb, 0x4b, 0x8d, 0x87, 0xe9, 0xbf, 0x7d, 0xd4, 0x8f, 0xe9, 0x7b, 0x02, 0x53, 0xae, 0x67, 0xaa, 0x58, 0x0f, 0x9a, 0xc4, 0xa9, 0xd9, 0x41, 0xf2, 0xbe, 0xa5, 0x18, 0xee, 0x28, 0x68, 0x18, 0xcc, 0x9f, 0x63, 0x3f, 0x2a, 0x3b, 0x9f, 0xb6, 0x8e, 0x59, 0x4b, 0x48, 0xcd, 0xd6, 0xd5, 0x15, 0xbf, 0x1d, 0x52, 0xba, 0x6c, 0x85, 0xa2, 0x03, 0xa7 }, + { 0x86, 0x22, 0x1f, 0x3a, 0xda, 0x52, 0x03, 0x7b, 0x72, 0x22, 0x4f, 0x10, 0x5d, 0x79, 0x99, 0x23, 0x1c, 0x5e, 0x55, 0x34, 0xd0, 0x3d, 0xa9, 0xd9, 0xc0, 0xa1, 0x2a, 0xcb, 0x68, 0x46, 0x0c, 0xd3, 0x75, 0xda, 0xf8, 0xe2, 0x43, 0x86, 0x28, 0x6f, 0x96, 0x68, 0xf7, 0x23, 0x26, 0xdb, 0xf9, 0x9b, 0xa0, 0x94, 0x39, 0x24, 0x37, 0xd3, 0x98, 0xe9, 0x5b, 0xb8, 0x16, 0x1d, 0x71, 0x7f, 0x89, 0x91 }, + { 0x55, 0x95, 0xe0, 0x5c, 0x13, 0xa7, 0xec, 0x4d, 0xc8, 0xf4, 0x1f, 0xb7, 0x0c, 0xb5, 0x0a, 0x71, 0xbc, 0xe1, 0x7c, 0x02, 0x4f, 0xf6, 0xde, 0x7a, 0xf6, 0x18, 0xd0, 0xcc, 0x4e, 0x9c, 0x32, 0xd9, 0x57, 0x0d, 0x6d, 0x3e, 0xa4, 0x5b, 0x86, 0x52, 0x54, 0x91, 0x03, 0x0c, 0x0d, 0x8f, 0x2b, 0x18, 0x36, 0xd5, 0x77, 0x8c, 0x1c, 0xe7, 0x35, 0xc1, 0x77, 0x07, 0xdf, 0x36, 0x4d, 0x05, 0x43, 0x47 }, + { 0xce, 0x0f, 0x4f, 0x6a, 0xca, 0x89, 0x59, 0x0a, 0x37, 0xfe, 0x03, 0x4d, 0xd7, 0x4d, 0xd5, 0xfa, 0x65, 0xeb, 0x1c, 0xbd, 0x0a, 0x41, 0x50, 0x8a, 0xad, 0xdc, 0x09, 0x35, 0x1a, 0x3c, 0xea, 0x6d, 0x18, 0xcb, 0x21, 0x89, 0xc5, 0x4b, 0x70, 0x0c, 0x00, 0x9f, 0x4c, 0xbf, 0x05, 0x21, 0xc7, 0xea, 0x01, 0xbe, 0x61, 0xc5, 0xae, 0x09, 0xcb, 0x54, 0xf2, 0x7b, 0xc1, 0xb4, 0x4d, 0x65, 0x8c, 0x82 }, + { 0x7e, 0xe8, 0x0b, 0x06, 0xa2, 0x15, 0xa3, 0xbc, 0xa9, 0x70, 0xc7, 0x7c, 0xda, 0x87, 0x61, 0x82, 0x2b, 0xc1, 0x03, 0xd4, 0x4f, 0xa4, 0xb3, 0x3f, 0x4d, 0x07, 0xdc, 0xb9, 0x97, 0xe3, 0x6d, 0x55, 0x29, 0x8b, 0xce, 0xae, 0x12, 0x24, 0x1b, 0x3f, 0xa0, 0x7f, 0xa6, 0x3b, 0xe5, 0x57, 0x60, 0x68, 0xda, 0x38, 0x7b, 0x8d, 0x58, 0x59, 0xae, 0xab, 0x70, 0x13, 0x69, 0x84, 0x8b, 0x17, 0x6d, 0x42 }, + { 0x94, 0x0a, 0x84, 0xb6, 0xa8, 0x4d, 0x10, 0x9a, 0xab, 0x20, 0x8c, 0x02, 0x4c, 0x6c, 0xe9, 0x64, 0x76, 0x76, 0xba, 0x0a, 0xaa, 0x11, 0xf8, 0x6d, 0xbb, 0x70, 0x18, 0xf9, 0xfd, 0x22, 0x20, 0xa6, 0xd9, 0x01, 0xa9, 0x02, 0x7f, 0x9a, 0xbc, 0xf9, 0x35, 0x37, 0x27, 0x27, 0xcb, 0xf0, 0x9e, 0xbd, 0x61, 0xa2, 0xa2, 0xee, 0xb8, 0x76, 0x53, 0xe8, 0xec, 0xad, 0x1b, 0xab, 0x85, 0xdc, 0x83, 0x27 }, + { 0x20, 0x20, 0xb7, 0x82, 0x64, 0xa8, 0x2d, 0x9f, 0x41, 0x51, 0x14, 0x1a, 0xdb, 0xa8, 0xd4, 0x4b, 0xf2, 0x0c, 0x5e, 0xc0, 0x62, 0xee, 0xe9, 0xb5, 0x95, 0xa1, 0x1f, 0x9e, 0x84, 0x90, 0x1b, 0xf1, 0x48, 0xf2, 0x98, 0xe0, 0xc9, 0xf8, 0x77, 0x7d, 0xcd, 0xbc, 0x7c, 0xc4, 0x67, 0x0a, 0xac, 0x35, 0x6c, 0xc2, 0xad, 0x8c, 0xcb, 0x16, 0x29, 0xf1, 0x6f, 0x6a, 0x76, 0xbc, 0xef, 0xbe, 0xe7, 0x60 }, + { 0xd1, 0xb8, 0x97, 0xb0, 0xe0, 0x75, 0xba, 0x68, 0xab, 0x57, 0x2a, 0xdf, 0x9d, 0x9c, 0x43, 0x66, 0x63, 0xe4, 0x3e, 0xb3, 0xd8, 0xe6, 0x2d, 0x92, 0xfc, 0x49, 0xc9, 0xbe, 0x21, 0x4e, 0x6f, 0x27, 0x87, 0x3f, 0xe2, 0x15, 0xa6, 0x51, 0x70, 0xe6, 0xbe, 0xa9, 0x02, 0x40, 0x8a, 0x25, 0xb4, 0x95, 0x06, 0xf4, 0x7b, 0xab, 0xd0, 0x7c, 0xec, 0xf7, 0x11, 0x3e, 0xc1, 0x0c, 0x5d, 0xd3, 0x12, 0x52 }, + { 0xb1, 0x4d, 0x0c, 0x62, 0xab, 0xfa, 0x46, 0x9a, 0x35, 0x71, 0x77, 0xe5, 0x94, 0xc1, 0x0c, 0x19, 0x42, 0x43, 0xed, 0x20, 0x25, 0xab, 0x8a, 0xa5, 0xad, 0x2f, 0xa4, 0x1a, 0xd3, 0x18, 0xe0, 0xff, 0x48, 0xcd, 0x5e, 0x60, 0xbe, 0xc0, 0x7b, 0x13, 0x63, 0x4a, 0x71, 0x1d, 0x23, 0x26, 0xe4, 0x88, 0xa9, 0x85, 0xf3, 0x1e, 0x31, 0x15, 0x33, 0x99, 0xe7, 0x30, 0x88, 0xef, 0xc8, 0x6a, 0x5c, 0x55 }, + { 0x41, 0x69, 0xc5, 0xcc, 0x80, 0x8d, 0x26, 0x97, 0xdc, 0x2a, 0x82, 0x43, 0x0d, 0xc2, 0x3e, 0x3c, 0xd3, 0x56, 0xdc, 0x70, 0xa9, 0x45, 0x66, 0x81, 0x05, 0x02, 0xb8, 0xd6, 0x55, 0xb3, 0x9a, 0xbf, 0x9e, 0x7f, 0x90, 0x2f, 0xe7, 0x17, 0xe0, 0x38, 0x92, 0x19, 0x85, 0x9e, 0x19, 0x45, 0xdf, 0x1a, 0xf6, 0xad, 0xa4, 0x2e, 0x4c, 0xcd, 0xa5, 0x5a, 0x19, 0x7b, 0x71, 0x00, 0xa3, 0x0c, 0x30, 0xa1 }, + { 0x25, 0x8a, 0x4e, 0xdb, 0x11, 0x3d, 0x66, 0xc8, 0x39, 0xc8, 0xb1, 0xc9, 0x1f, 0x15, 0xf3, 0x5a, 0xde, 0x60, 0x9f, 0x11, 0xcd, 0x7f, 0x86, 0x81, 0xa4, 0x04, 0x5b, 0x9f, 0xef, 0x7b, 0x0b, 0x24, 0xc8, 0x2c, 0xda, 0x06, 0xa5, 0xf2, 0x06, 0x7b, 0x36, 0x88, 0x25, 0xe3, 0x91, 0x4e, 0x53, 0xd6, 0x94, 0x8e, 0xde, 0x92, 0xef, 0xd6, 0xe8, 0x38, 0x7f, 0xa2, 0xe5, 0x37, 0x23, 0x9b, 0x5b, 0xee }, + { 0x79, 0xd2, 0xd8, 0x69, 0x6d, 0x30, 0xf3, 0x0f, 0xb3, 0x46, 0x57, 0x76, 0x11, 0x71, 0xa1, 0x1e, 0x6c, 0x3f, 0x1e, 0x64, 0xcb, 0xe7, 0xbe, 0xbe, 0xe1, 0x59, 0xcb, 0x95, 0xbf, 0xaf, 0x81, 0x2b, 0x4f, 0x41, 0x1e, 0x2f, 0x26, 0xd9, 0xc4, 0x21, 0xdc, 0x2c, 0x28, 0x4a, 0x33, 0x42, 0xd8, 0x23, 0xec, 0x29, 0x38, 0x49, 0xe4, 0x2d, 0x1e, 0x46, 0xb0, 0xa4, 0xac, 0x1e, 0x3c, 0x86, 0xab, 0xaa }, + { 0x8b, 0x94, 0x36, 0x01, 0x0d, 0xc5, 0xde, 0xe9, 0x92, 0xae, 0x38, 0xae, 0xa9, 0x7f, 0x2c, 0xd6, 0x3b, 0x94, 0x6d, 0x94, 0xfe, 0xdd, 0x2e, 0xc9, 0x67, 0x1d, 0xcd, 0xe3, 0xbd, 0x4c, 0xe9, 0x56, 0x4d, 0x55, 0x5c, 0x66, 0xc1, 0x5b, 0xb2, 0xb9, 0x00, 0xdf, 0x72, 0xed, 0xb6, 0xb8, 0x91, 0xeb, 0xca, 0xdf, 0xef, 0xf6, 0x3c, 0x9e, 0xa4, 0x03, 0x6a, 0x99, 0x8b, 0xe7, 0x97, 0x39, 0x81, 0xe7 }, + { 0xc8, 0xf6, 0x8e, 0x69, 0x6e, 0xd2, 0x82, 0x42, 0xbf, 0x99, 0x7f, 0x5b, 0x3b, 0x34, 0x95, 0x95, 0x08, 0xe4, 0x2d, 0x61, 0x38, 0x10, 0xf1, 0xe2, 0xa4, 0x35, 0xc9, 0x6e, 0xd2, 0xff, 0x56, 0x0c, 0x70, 0x22, 0xf3, 0x61, 0xa9, 0x23, 0x4b, 0x98, 0x37, 0xfe, 0xee, 0x90, 0xbf, 0x47, 0x92, 0x2e, 0xe0, 0xfd, 0x5f, 0x8d, 0xdf, 0x82, 0x37, 0x18, 0xd8, 0x6d, 0x1e, 0x16, 0xc6, 0x09, 0x00, 0x71 }, + { 0xb0, 0x2d, 0x3e, 0xee, 0x48, 0x60, 0xd5, 0x86, 0x8b, 0x2c, 0x39, 0xce, 0x39, 0xbf, 0xe8, 0x10, 0x11, 0x29, 0x05, 0x64, 0xdd, 0x67, 0x8c, 0x85, 0xe8, 0x78, 0x3f, 0x29, 0x30, 0x2d, 0xfc, 0x13, 0x99, 0xba, 0x95, 0xb6, 0xb5, 0x3c, 0xd9, 0xeb, 0xbf, 0x40, 0x0c, 0xca, 0x1d, 0xb0, 0xab, 0x67, 0xe1, 0x9a, 0x32, 0x5f, 0x2d, 0x11, 0x58, 0x12, 0xd2, 0x5d, 0x00, 0x97, 0x8a, 0xd1, 0xbc, 0xa4 }, + { 0x76, 0x93, 0xea, 0x73, 0xaf, 0x3a, 0xc4, 0xda, 0xd2, 0x1c, 0xa0, 0xd8, 0xda, 0x85, 0xb3, 0x11, 0x8a, 0x7d, 0x1c, 0x60, 0x24, 0xcf, 0xaf, 0x55, 0x76, 0x99, 0x86, 0x82, 0x17, 0xbc, 0x0c, 0x2f, 0x44, 0xa1, 0x99, 0xbc, 0x6c, 0x0e, 0xdd, 0x51, 0x97, 0x98, 0xba, 0x05, 0xbd, 0x5b, 0x1b, 0x44, 0x84, 0x34, 0x6a, 0x47, 0xc2, 0xca, 0xdf, 0x6b, 0xf3, 0x0b, 0x78, 0x5c, 0xc8, 0x8b, 0x2b, 0xaf }, + { 0xa0, 0xe5, 0xc1, 0xc0, 0x03, 0x1c, 0x02, 0xe4, 0x8b, 0x7f, 0x09, 0xa5, 0xe8, 0x96, 0xee, 0x9a, 0xef, 0x2f, 0x17, 0xfc, 0x9e, 0x18, 0xe9, 0x97, 0xd7, 0xf6, 0xca, 0xc7, 0xae, 0x31, 0x64, 0x22, 0xc2, 0xb1, 0xe7, 0x79, 0x84, 0xe5, 0xf3, 0xa7, 0x3c, 0xb4, 0x5d, 0xee, 0xd5, 0xd3, 0xf8, 0x46, 0x00, 0x10, 0x5e, 0x6e, 0xe3, 0x8f, 0x2d, 0x09, 0x0c, 0x7d, 0x04, 0x42, 0xea, 0x34, 0xc4, 0x6d }, + { 0x41, 0xda, 0xa6, 0xad, 0xcf, 0xdb, 0x69, 0xf1, 0x44, 0x0c, 0x37, 0xb5, 0x96, 0x44, 0x01, 0x65, 0xc1, 0x5a, 0xda, 0x59, 0x68, 0x13, 0xe2, 0xe2, 0x2f, 0x06, 0x0f, 0xcd, 0x55, 0x1f, 0x24, 0xde, 0xe8, 0xe0, 0x4b, 0xa6, 0x89, 0x03, 0x87, 0x88, 0x6c, 0xee, 0xc4, 0xa7, 0xa0, 0xd7, 0xfc, 0x6b, 0x44, 0x50, 0x63, 0x92, 0xec, 0x38, 0x22, 0xc0, 0xd8, 0xc1, 0xac, 0xfc, 0x7d, 0x5a, 0xeb, 0xe8 }, + { 0x14, 0xd4, 0xd4, 0x0d, 0x59, 0x84, 0xd8, 0x4c, 0x5c, 0xf7, 0x52, 0x3b, 0x77, 0x98, 0xb2, 0x54, 0xe2, 0x75, 0xa3, 0xa8, 0xcc, 0x0a, 0x1b, 0xd0, 0x6e, 0xbc, 0x0b, 0xee, 0x72, 0x68, 0x56, 0xac, 0xc3, 0xcb, 0xf5, 0x16, 0xff, 0x66, 0x7c, 0xda, 0x20, 0x58, 0xad, 0x5c, 0x34, 0x12, 0x25, 0x44, 0x60, 0xa8, 0x2c, 0x92, 0x18, 0x70, 0x41, 0x36, 0x3c, 0xc7, 0x7a, 0x4d, 0xc2, 0x15, 0xe4, 0x87 }, + { 0xd0, 0xe7, 0xa1, 0xe2, 0xb9, 0xa4, 0x47, 0xfe, 0xe8, 0x3e, 0x22, 0x77, 0xe9, 0xff, 0x80, 0x10, 0xc2, 0xf3, 0x75, 0xae, 0x12, 0xfa, 0x7a, 0xaa, 0x8c, 0xa5, 0xa6, 0x31, 0x78, 0x68, 0xa2, 0x6a, 0x36, 0x7a, 0x0b, 0x69, 0xfb, 0xc1, 0xcf, 0x32, 0xa5, 0x5d, 0x34, 0xeb, 0x37, 0x06, 0x63, 0x01, 0x6f, 0x3d, 0x21, 0x10, 0x23, 0x0e, 0xba, 0x75, 0x40, 0x28, 0xa5, 0x6f, 0x54, 0xac, 0xf5, 0x7c }, + { 0xe7, 0x71, 0xaa, 0x8d, 0xb5, 0xa3, 0xe0, 0x43, 0xe8, 0x17, 0x8f, 0x39, 0xa0, 0x85, 0x7b, 0xa0, 0x4a, 0x3f, 0x18, 0xe4, 0xaa, 0x05, 0x74, 0x3c, 0xf8, 0xd2, 0x22, 0xb0, 0xb0, 0x95, 0x82, 0x53, 0x50, 0xba, 0x42, 0x2f, 0x63, 0x38, 0x2a, 0x23, 0xd9, 0x2e, 0x41, 0x49, 0x07, 0x4e, 0x81, 0x6a, 0x36, 0xc1, 0xcd, 0x28, 0x28, 0x4d, 0x14, 0x62, 0x67, 0x94, 0x0b, 0x31, 0xf8, 0x81, 0x8e, 0xa2 }, + { 0xfe, 0xb4, 0xfd, 0x6f, 0x9e, 0x87, 0xa5, 0x6b, 0xef, 0x39, 0x8b, 0x32, 0x84, 0xd2, 0xbd, 0xa5, 0xb5, 0xb0, 0xe1, 0x66, 0x58, 0x3a, 0x66, 0xb6, 0x1e, 0x53, 0x84, 0x57, 0xff, 0x05, 0x84, 0x87, 0x2c, 0x21, 0xa3, 0x29, 0x62, 0xb9, 0x92, 0x8f, 0xfa, 0xb5, 0x8d, 0xe4, 0xaf, 0x2e, 0xdd, 0x4e, 0x15, 0xd8, 0xb3, 0x55, 0x70, 0x52, 0x32, 0x07, 0xff, 0x4e, 0x2a, 0x5a, 0xa7, 0x75, 0x4c, 0xaa }, + { 0x46, 0x2f, 0x17, 0xbf, 0x00, 0x5f, 0xb1, 0xc1, 0xb9, 0xe6, 0x71, 0x77, 0x9f, 0x66, 0x52, 0x09, 0xec, 0x28, 0x73, 0xe3, 0xe4, 0x11, 0xf9, 0x8d, 0xab, 0xf2, 0x40, 0xa1, 0xd5, 0xec, 0x3f, 0x95, 0xce, 0x67, 0x96, 0xb6, 0xfc, 0x23, 0xfe, 0x17, 0x19, 0x03, 0xb5, 0x02, 0x02, 0x34, 0x67, 0xde, 0xc7, 0x27, 0x3f, 0xf7, 0x48, 0x79, 0xb9, 0x29, 0x67, 0xa2, 0xa4, 0x3a, 0x5a, 0x18, 0x3d, 0x33 }, + { 0xd3, 0x33, 0x81, 0x93, 0xb6, 0x45, 0x53, 0xdb, 0xd3, 0x8d, 0x14, 0x4b, 0xea, 0x71, 0xc5, 0x91, 0x5b, 0xb1, 0x10, 0xe2, 0xd8, 0x81, 0x80, 0xdb, 0xc5, 0xdb, 0x36, 0x4f, 0xd6, 0x17, 0x1d, 0xf3, 0x17, 0xfc, 0x72, 0x68, 0x83, 0x1b, 0x5a, 0xef, 0x75, 0xe4, 0x34, 0x2b, 0x2f, 0xad, 0x87, 0x97, 0xba, 0x39, 0xed, 0xdc, 0xef, 0x80, 0xe6, 0xec, 0x08, 0x15, 0x93, 0x50, 0xb1, 0xad, 0x69, 0x6d }, + { 0xe1, 0x59, 0x0d, 0x58, 0x5a, 0x3d, 0x39, 0xf7, 0xcb, 0x59, 0x9a, 0xbd, 0x47, 0x90, 0x70, 0x96, 0x64, 0x09, 0xa6, 0x84, 0x6d, 0x43, 0x77, 0xac, 0xf4, 0x47, 0x1d, 0x06, 0x5d, 0x5d, 0xb9, 0x41, 0x29, 0xcc, 0x9b, 0xe9, 0x25, 0x73, 0xb0, 0x5e, 0xd2, 0x26, 0xbe, 0x1e, 0x9b, 0x7c, 0xb0, 0xca, 0xbe, 0x87, 0x91, 0x85, 0x89, 0xf8, 0x0d, 0xad, 0xd4, 0xef, 0x5e, 0xf2, 0x5a, 0x93, 0xd2, 0x8e }, + { 0xf8, 0xf3, 0x72, 0x6a, 0xc5, 0xa2, 0x6c, 0xc8, 0x01, 0x32, 0x49, 0x3a, 0x6f, 0xed, 0xcb, 0x0e, 0x60, 0x76, 0x0c, 0x09, 0xcf, 0xc8, 0x4c, 0xad, 0x17, 0x81, 0x75, 0x98, 0x68, 0x19, 0x66, 0x5e, 0x76, 0x84, 0x2d, 0x7b, 0x9f, 0xed, 0xf7, 0x6d, 0xdd, 0xeb, 0xf5, 0xd3, 0xf5, 0x6f, 0xaa, 0xad, 0x44, 0x77, 0x58, 0x7a, 0xf2, 0x16, 0x06, 0xd3, 0x96, 0xae, 0x57, 0x0d, 0x8e, 0x71, 0x9a, 0xf2 }, + { 0x30, 0x18, 0x60, 0x55, 0xc0, 0x79, 0x49, 0x94, 0x81, 0x83, 0xc8, 0x50, 0xe9, 0xa7, 0x56, 0xcc, 0x09, 0x93, 0x7e, 0x24, 0x7d, 0x9d, 0x92, 0x8e, 0x86, 0x9e, 0x20, 0xba, 0xfc, 0x3c, 0xd9, 0x72, 0x17, 0x19, 0xd3, 0x4e, 0x04, 0xa0, 0x89, 0x9b, 0x92, 0xc7, 0x36, 0x08, 0x45, 0x50, 0x18, 0x68, 0x86, 0xef, 0xba, 0x2e, 0x79, 0x0d, 0x8b, 0xe6, 0xeb, 0xf0, 0x40, 0xb2, 0x09, 0xc4, 0x39, 0xa4 }, + { 0xf3, 0xc4, 0x27, 0x6c, 0xb8, 0x63, 0x63, 0x77, 0x12, 0xc2, 0x41, 0xc4, 0x44, 0xc5, 0xcc, 0x1e, 0x35, 0x54, 0xe0, 0xfd, 0xdb, 0x17, 0x4d, 0x03, 0x58, 0x19, 0xdd, 0x83, 0xeb, 0x70, 0x0b, 0x4c, 0xe8, 0x8d, 0xf3, 0xab, 0x38, 0x41, 0xba, 0x02, 0x08, 0x5e, 0x1a, 0x99, 0xb4, 0xe1, 0x73, 0x10, 0xc5, 0x34, 0x10, 0x75, 0xc0, 0x45, 0x8b, 0xa3, 0x76, 0xc9, 0x5a, 0x68, 0x18, 0xfb, 0xb3, 0xe2 }, + { 0x0a, 0xa0, 0x07, 0xc4, 0xdd, 0x9d, 0x58, 0x32, 0x39, 0x30, 0x40, 0xa1, 0x58, 0x3c, 0x93, 0x0b, 0xca, 0x7d, 0xc5, 0xe7, 0x7e, 0xa5, 0x3a, 0xdd, 0x7e, 0x2b, 0x3f, 0x7c, 0x8e, 0x23, 0x13, 0x68, 0x04, 0x35, 0x20, 0xd4, 0xa3, 0xef, 0x53, 0xc9, 0x69, 0xb6, 0xbb, 0xfd, 0x02, 0x59, 0x46, 0xf6, 0x32, 0xbd, 0x7f, 0x76, 0x5d, 0x53, 0xc2, 0x10, 0x03, 0xb8, 0xf9, 0x83, 0xf7, 0x5e, 0x2a, 0x6a }, + { 0x08, 0xe9, 0x46, 0x47, 0x20, 0x53, 0x3b, 0x23, 0xa0, 0x4e, 0xc2, 0x4f, 0x7a, 0xe8, 0xc1, 0x03, 0x14, 0x5f, 0x76, 0x53, 0x87, 0xd7, 0x38, 0x77, 0x7d, 0x3d, 0x34, 0x34, 0x77, 0xfd, 0x1c, 0x58, 0xdb, 0x05, 0x21, 0x42, 0xca, 0xb7, 0x54, 0xea, 0x67, 0x43, 0x78, 0xe1, 0x87, 0x66, 0xc5, 0x35, 0x42, 0xf7, 0x19, 0x70, 0x17, 0x1c, 0xc4, 0xf8, 0x16, 0x94, 0x24, 0x6b, 0x71, 0x7d, 0x75, 0x64 }, + { 0xd3, 0x7f, 0xf7, 0xad, 0x29, 0x79, 0x93, 0xe7, 0xec, 0x21, 0xe0, 0xf1, 0xb4, 0xb5, 0xae, 0x71, 0x9c, 0xdc, 0x83, 0xc5, 0xdb, 0x68, 0x75, 0x27, 0xf2, 0x75, 0x16, 0xcb, 0xff, 0xa8, 0x22, 0x88, 0x8a, 0x68, 0x10, 0xee, 0x5c, 0x1c, 0xa7, 0xbf, 0xe3, 0x32, 0x11, 0x19, 0xbe, 0x1a, 0xb7, 0xbf, 0xa0, 0xa5, 0x02, 0x67, 0x1c, 0x83, 0x29, 0x49, 0x4d, 0xf7, 0xad, 0x6f, 0x52, 0x2d, 0x44, 0x0f }, + { 0xdd, 0x90, 0x42, 0xf6, 0xe4, 0x64, 0xdc, 0xf8, 0x6b, 0x12, 0x62, 0xf6, 0xac, 0xcf, 0xaf, 0xbd, 0x8c, 0xfd, 0x90, 0x2e, 0xd3, 0xed, 0x89, 0xab, 0xf7, 0x8f, 0xfa, 0x48, 0x2d, 0xbd, 0xee, 0xb6, 0x96, 0x98, 0x42, 0x39, 0x4c, 0x9a, 0x11, 0x68, 0xae, 0x3d, 0x48, 0x1a, 0x01, 0x78, 0x42, 0xf6, 0x60, 0x00, 0x2d, 0x42, 0x44, 0x7c, 0x6b, 0x22, 0xf7, 0xb7, 0x2f, 0x21, 0xaa, 0xe0, 0x21, 0xc9 }, + { 0xbd, 0x96, 0x5b, 0xf3, 0x1e, 0x87, 0xd7, 0x03, 0x27, 0x53, 0x6f, 0x2a, 0x34, 0x1c, 0xeb, 0xc4, 0x76, 0x8e, 0xca, 0x27, 0x5f, 0xa0, 0x5e, 0xf9, 0x8f, 0x7f, 0x1b, 0x71, 0xa0, 0x35, 0x12, 0x98, 0xde, 0x00, 0x6f, 0xba, 0x73, 0xfe, 0x67, 0x33, 0xed, 0x01, 0xd7, 0x58, 0x01, 0xb4, 0xa9, 0x28, 0xe5, 0x42, 0x31, 0xb3, 0x8e, 0x38, 0xc5, 0x62, 0xb2, 0xe3, 0x3e, 0xa1, 0x28, 0x49, 0x92, 0xfa }, + { 0x65, 0x67, 0x6d, 0x80, 0x06, 0x17, 0x97, 0x2f, 0xbd, 0x87, 0xe4, 0xb9, 0x51, 0x4e, 0x1c, 0x67, 0x40, 0x2b, 0x7a, 0x33, 0x10, 0x96, 0xd3, 0xbf, 0xac, 0x22, 0xf1, 0xab, 0xb9, 0x53, 0x74, 0xab, 0xc9, 0x42, 0xf1, 0x6e, 0x9a, 0xb0, 0xea, 0xd3, 0x3b, 0x87, 0xc9, 0x19, 0x68, 0xa6, 0xe5, 0x09, 0xe1, 0x19, 0xff, 0x07, 0x78, 0x7b, 0x3e, 0xf4, 0x83, 0xe1, 0xdc, 0xdc, 0xcf, 0x6e, 0x30, 0x22 }, + { 0x93, 0x9f, 0xa1, 0x89, 0x69, 0x9c, 0x5d, 0x2c, 0x81, 0xdd, 0xd1, 0xff, 0xc1, 0xfa, 0x20, 0x7c, 0x97, 0x0b, 0x6a, 0x36, 0x85, 0xbb, 0x29, 0xce, 0x1d, 0x3e, 0x99, 0xd4, 0x2f, 0x2f, 0x74, 0x42, 0xda, 0x53, 0xe9, 0x5a, 0x72, 0x90, 0x73, 0x14, 0xf4, 0x58, 0x83, 0x99, 0xa3, 0xff, 0x5b, 0x0a, 0x92, 0xbe, 0xb3, 0xf6, 0xbe, 0x26, 0x94, 0xf9, 0xf8, 0x6e, 0xcf, 0x29, 0x52, 0xd5, 0xb4, 0x1c }, + { 0xc5, 0x16, 0x54, 0x17, 0x01, 0x86, 0x3f, 0x91, 0x00, 0x5f, 0x31, 0x41, 0x08, 0xce, 0xec, 0xe3, 0xc6, 0x43, 0xe0, 0x4f, 0xc8, 0xc4, 0x2f, 0xd2, 0xff, 0x55, 0x62, 0x20, 0xe6, 0x16, 0xaa, 0xa6, 0xa4, 0x8a, 0xeb, 0x97, 0xa8, 0x4b, 0xad, 0x74, 0x78, 0x2e, 0x8d, 0xff, 0x96, 0xa1, 0xa2, 0xfa, 0x94, 0x93, 0x39, 0xd7, 0x22, 0xed, 0xca, 0xa3, 0x2b, 0x57, 0x06, 0x70, 0x41, 0xdf, 0x88, 0xcc }, + { 0x98, 0x7f, 0xd6, 0xe0, 0xd6, 0x85, 0x7c, 0x55, 0x3e, 0xae, 0xbb, 0x3d, 0x34, 0x97, 0x0a, 0x2c, 0x2f, 0x6e, 0x89, 0xa3, 0x54, 0x8f, 0x49, 0x25, 0x21, 0x72, 0x2b, 0x80, 0xa1, 0xc2, 0x1a, 0x15, 0x38, 0x92, 0x34, 0x6d, 0x2c, 0xba, 0x64, 0x44, 0x21, 0x2d, 0x56, 0xda, 0x9a, 0x26, 0xe3, 0x24, 0xdc, 0xcb, 0xc0, 0xdc, 0xde, 0x85, 0xd4, 0xd2, 0xee, 0x43, 0x99, 0xee, 0xc5, 0xa6, 0x4e, 0x8f }, + { 0xae, 0x56, 0xde, 0xb1, 0xc2, 0x32, 0x8d, 0x9c, 0x40, 0x17, 0x70, 0x6b, 0xce, 0x6e, 0x99, 0xd4, 0x13, 0x49, 0x05, 0x3b, 0xa9, 0xd3, 0x36, 0xd6, 0x77, 0xc4, 0xc2, 0x7d, 0x9f, 0xd5, 0x0a, 0xe6, 0xae, 0xe1, 0x7e, 0x85, 0x31, 0x54, 0xe1, 0xf4, 0xfe, 0x76, 0x72, 0x34, 0x6d, 0xa2, 0xea, 0xa3, 0x1e, 0xea, 0x53, 0xfc, 0xf2, 0x4a, 0x22, 0x80, 0x4f, 0x11, 0xd0, 0x3d, 0xa6, 0xab, 0xfc, 0x2b }, + { 0x49, 0xd6, 0xa6, 0x08, 0xc9, 0xbd, 0xe4, 0x49, 0x18, 0x70, 0x49, 0x85, 0x72, 0xac, 0x31, 0xaa, 0xc3, 0xfa, 0x40, 0x93, 0x8b, 0x38, 0xa7, 0x81, 0x8f, 0x72, 0x38, 0x3e, 0xb0, 0x40, 0xad, 0x39, 0x53, 0x2b, 0xc0, 0x65, 0x71, 0xe1, 0x3d, 0x76, 0x7e, 0x69, 0x45, 0xab, 0x77, 0xc0, 0xbd, 0xc3, 0xb0, 0x28, 0x42, 0x53, 0x34, 0x3f, 0x9f, 0x6c, 0x12, 0x44, 0xeb, 0xf2, 0xff, 0x0d, 0xf8, 0x66 }, + { 0xda, 0x58, 0x2a, 0xd8, 0xc5, 0x37, 0x0b, 0x44, 0x69, 0xaf, 0x86, 0x2a, 0xa6, 0x46, 0x7a, 0x22, 0x93, 0xb2, 0xb2, 0x8b, 0xd8, 0x0a, 0xe0, 0xe9, 0x1f, 0x42, 0x5a, 0xd3, 0xd4, 0x72, 0x49, 0xfd, 0xf9, 0x88, 0x25, 0xcc, 0x86, 0xf1, 0x40, 0x28, 0xc3, 0x30, 0x8c, 0x98, 0x04, 0xc7, 0x8b, 0xfe, 0xee, 0xee, 0x46, 0x14, 0x44, 0xce, 0x24, 0x36, 0x87, 0xe1, 0xa5, 0x05, 0x22, 0x45, 0x6a, 0x1d }, + { 0xd5, 0x26, 0x6a, 0xa3, 0x33, 0x11, 0x94, 0xae, 0xf8, 0x52, 0xee, 0xd8, 0x6d, 0x7b, 0x5b, 0x26, 0x33, 0xa0, 0xaf, 0x1c, 0x73, 0x59, 0x06, 0xf2, 0xe1, 0x32, 0x79, 0xf1, 0x49, 0x31, 0xa9, 0xfc, 0x3b, 0x0e, 0xac, 0x5c, 0xe9, 0x24, 0x52, 0x73, 0xbd, 0x1a, 0xa9, 0x29, 0x05, 0xab, 0xe1, 0x62, 0x78, 0xef, 0x7e, 0xfd, 0x47, 0x69, 0x47, 0x89, 0xa7, 0x28, 0x3b, 0x77, 0xda, 0x3c, 0x70, 0xf8 }, + { 0x29, 0x62, 0x73, 0x4c, 0x28, 0x25, 0x21, 0x86, 0xa9, 0xa1, 0x11, 0x1c, 0x73, 0x2a, 0xd4, 0xde, 0x45, 0x06, 0xd4, 0xb4, 0x48, 0x09, 0x16, 0x30, 0x3e, 0xb7, 0x99, 0x1d, 0x65, 0x9c, 0xcd, 0xa0, 0x7a, 0x99, 0x11, 0x91, 0x4b, 0xc7, 0x5c, 0x41, 0x8a, 0xb7, 0xa4, 0x54, 0x17, 0x57, 0xad, 0x05, 0x47, 0x96, 0xe2, 0x67, 0x97, 0xfe, 0xaf, 0x36, 0xe9, 0xf6, 0xad, 0x43, 0xf1, 0x4b, 0x35, 0xa4 }, + { 0xe8, 0xb7, 0x9e, 0xc5, 0xd0, 0x6e, 0x11, 0x1b, 0xdf, 0xaf, 0xd7, 0x1e, 0x9f, 0x57, 0x60, 0xf0, 0x0a, 0xc8, 0xac, 0x5d, 0x8b, 0xf7, 0x68, 0xf9, 0xff, 0x6f, 0x08, 0xb8, 0xf0, 0x26, 0x09, 0x6b, 0x1c, 0xc3, 0xa4, 0xc9, 0x73, 0x33, 0x30, 0x19, 0xf1, 0xe3, 0x55, 0x3e, 0x77, 0xda, 0x3f, 0x98, 0xcb, 0x9f, 0x54, 0x2e, 0x0a, 0x90, 0xe5, 0xf8, 0xa9, 0x40, 0xcc, 0x58, 0xe5, 0x98, 0x44, 0xb3 }, + { 0xdf, 0xb3, 0x20, 0xc4, 0x4f, 0x9d, 0x41, 0xd1, 0xef, 0xdc, 0xc0, 0x15, 0xf0, 0x8d, 0xd5, 0x53, 0x9e, 0x52, 0x6e, 0x39, 0xc8, 0x7d, 0x50, 0x9a, 0xe6, 0x81, 0x2a, 0x96, 0x9e, 0x54, 0x31, 0xbf, 0x4f, 0xa7, 0xd9, 0x1f, 0xfd, 0x03, 0xb9, 0x81, 0xe0, 0xd5, 0x44, 0xcf, 0x72, 0xd7, 0xb1, 0xc0, 0x37, 0x4f, 0x88, 0x01, 0x48, 0x2e, 0x6d, 0xea, 0x2e, 0xf9, 0x03, 0x87, 0x7e, 0xba, 0x67, 0x5e }, + { 0xd8, 0x86, 0x75, 0x11, 0x8f, 0xdb, 0x55, 0xa5, 0xfb, 0x36, 0x5a, 0xc2, 0xaf, 0x1d, 0x21, 0x7b, 0xf5, 0x26, 0xce, 0x1e, 0xe9, 0xc9, 0x4b, 0x2f, 0x00, 0x90, 0xb2, 0xc5, 0x8a, 0x06, 0xca, 0x58, 0x18, 0x7d, 0x7f, 0xe5, 0x7c, 0x7b, 0xed, 0x9d, 0x26, 0xfc, 0xa0, 0x67, 0xb4, 0x11, 0x0e, 0xef, 0xcd, 0x9a, 0x0a, 0x34, 0x5d, 0xe8, 0x72, 0xab, 0xe2, 0x0d, 0xe3, 0x68, 0x00, 0x1b, 0x07, 0x45 }, + { 0xb8, 0x93, 0xf2, 0xfc, 0x41, 0xf7, 0xb0, 0xdd, 0x6e, 0x2f, 0x6a, 0xa2, 0xe0, 0x37, 0x0c, 0x0c, 0xff, 0x7d, 0xf0, 0x9e, 0x3a, 0xcf, 0xcc, 0x0e, 0x92, 0x0b, 0x6e, 0x6f, 0xad, 0x0e, 0xf7, 0x47, 0xc4, 0x06, 0x68, 0x41, 0x7d, 0x34, 0x2b, 0x80, 0xd2, 0x35, 0x1e, 0x8c, 0x17, 0x5f, 0x20, 0x89, 0x7a, 0x06, 0x2e, 0x97, 0x65, 0xe6, 0xc6, 0x7b, 0x53, 0x9b, 0x6b, 0xa8, 0xb9, 0x17, 0x05, 0x45 }, + { 0x6c, 0x67, 0xec, 0x56, 0x97, 0xac, 0xcd, 0x23, 0x5c, 0x59, 0xb4, 0x86, 0xd7, 0xb7, 0x0b, 0xae, 0xed, 0xcb, 0xd4, 0xaa, 0x64, 0xeb, 0xd4, 0xee, 0xf3, 0xc7, 0xea, 0xc1, 0x89, 0x56, 0x1a, 0x72, 0x62, 0x50, 0xae, 0xc4, 0xd4, 0x8c, 0xad, 0xca, 0xfb, 0xbe, 0x2c, 0xe3, 0xc1, 0x6c, 0xe2, 0xd6, 0x91, 0xa8, 0xcc, 0xe0, 0x6e, 0x88, 0x79, 0x55, 0x6d, 0x44, 0x83, 0xed, 0x71, 0x65, 0xc0, 0x63 }, + { 0xf1, 0xaa, 0x2b, 0x04, 0x4f, 0x8f, 0x0c, 0x63, 0x8a, 0x3f, 0x36, 0x2e, 0x67, 0x7b, 0x5d, 0x89, 0x1d, 0x6f, 0xd2, 0xab, 0x07, 0x65, 0xf6, 0xee, 0x1e, 0x49, 0x87, 0xde, 0x05, 0x7e, 0xad, 0x35, 0x78, 0x83, 0xd9, 0xb4, 0x05, 0xb9, 0xd6, 0x09, 0xee, 0xa1, 0xb8, 0x69, 0xd9, 0x7f, 0xb1, 0x6d, 0x9b, 0x51, 0x01, 0x7c, 0x55, 0x3f, 0x3b, 0x93, 0xc0, 0xa1, 0xe0, 0xf1, 0x29, 0x6f, 0xed, 0xcd }, + { 0xcb, 0xaa, 0x25, 0x95, 0x72, 0xd4, 0xae, 0xbf, 0xc1, 0x91, 0x7a, 0xcd, 0xdc, 0x58, 0x2b, 0x9f, 0x8d, 0xfa, 0xa9, 0x28, 0xa1, 0x98, 0xca, 0x7a, 0xcd, 0x0f, 0x2a, 0xa7, 0x6a, 0x13, 0x4a, 0x90, 0x25, 0x2e, 0x62, 0x98, 0xa6, 0x5b, 0x08, 0x18, 0x6a, 0x35, 0x0d, 0x5b, 0x76, 0x26, 0x69, 0x9f, 0x8c, 0xb7, 0x21, 0xa3, 0xea, 0x59, 0x21, 0xb7, 0x53, 0xae, 0x3a, 0x2d, 0xce, 0x24, 0xba, 0x3a }, + { 0xfa, 0x15, 0x49, 0xc9, 0x79, 0x6c, 0xd4, 0xd3, 0x03, 0xdc, 0xf4, 0x52, 0xc1, 0xfb, 0xd5, 0x74, 0x4f, 0xd9, 0xb9, 0xb4, 0x70, 0x03, 0xd9, 0x20, 0xb9, 0x2d, 0xe3, 0x48, 0x39, 0xd0, 0x7e, 0xf2, 0xa2, 0x9d, 0xed, 0x68, 0xf6, 0xfc, 0x9e, 0x6c, 0x45, 0xe0, 0x71, 0xa2, 0xe4, 0x8b, 0xd5, 0x0c, 0x50, 0x84, 0xe9, 0x6b, 0x65, 0x7d, 0xd0, 0x40, 0x40, 0x45, 0xa1, 0xdd, 0xef, 0xe2, 0x82, 0xed }, + { 0x5c, 0xf2, 0xac, 0x89, 0x7a, 0xb4, 0x44, 0xdc, 0xb5, 0xc8, 0xd8, 0x7c, 0x49, 0x5d, 0xbd, 0xb3, 0x4e, 0x18, 0x38, 0xb6, 0xb6, 0x29, 0x42, 0x7c, 0xaa, 0x51, 0x70, 0x2a, 0xd0, 0xf9, 0x68, 0x85, 0x25, 0xf1, 0x3b, 0xec, 0x50, 0x3a, 0x3c, 0x3a, 0x2c, 0x80, 0xa6, 0x5e, 0x0b, 0x57, 0x15, 0xe8, 0xaf, 0xab, 0x00, 0xff, 0xa5, 0x6e, 0xc4, 0x55, 0xa4, 0x9a, 0x1a, 0xd3, 0x0a, 0xa2, 0x4f, 0xcd }, + { 0x9a, 0xaf, 0x80, 0x20, 0x7b, 0xac, 0xe1, 0x7b, 0xb7, 0xab, 0x14, 0x57, 0x57, 0xd5, 0x69, 0x6b, 0xde, 0x32, 0x40, 0x6e, 0xf2, 0x2b, 0x44, 0x29, 0x2e, 0xf6, 0x5d, 0x45, 0x19, 0xc3, 0xbb, 0x2a, 0xd4, 0x1a, 0x59, 0xb6, 0x2c, 0xc3, 0xe9, 0x4b, 0x6f, 0xa9, 0x6d, 0x32, 0xa7, 0xfa, 0xad, 0xae, 0x28, 0xaf, 0x7d, 0x35, 0x09, 0x72, 0x19, 0xaa, 0x3f, 0xd8, 0xcd, 0xa3, 0x1e, 0x40, 0xc2, 0x75 }, + { 0xaf, 0x88, 0xb1, 0x63, 0x40, 0x2c, 0x86, 0x74, 0x5c, 0xb6, 0x50, 0xc2, 0x98, 0x8f, 0xb9, 0x52, 0x11, 0xb9, 0x4b, 0x03, 0xef, 0x29, 0x0e, 0xed, 0x96, 0x62, 0x03, 0x42, 0x41, 0xfd, 0x51, 0xcf, 0x39, 0x8f, 0x80, 0x73, 0xe3, 0x69, 0x35, 0x4c, 0x43, 0xea, 0xe1, 0x05, 0x2f, 0x9b, 0x63, 0xb0, 0x81, 0x91, 0xca, 0xa1, 0x38, 0xaa, 0x54, 0xfe, 0xa8, 0x89, 0xcc, 0x70, 0x24, 0x23, 0x68, 0x97 }, + { 0x48, 0xfa, 0x7d, 0x64, 0xe1, 0xce, 0xee, 0x27, 0xb9, 0x86, 0x4d, 0xb5, 0xad, 0xa4, 0xb5, 0x3d, 0x00, 0xc9, 0xbc, 0x76, 0x26, 0x55, 0x58, 0x13, 0xd3, 0xcd, 0x67, 0x30, 0xab, 0x3c, 0xc0, 0x6f, 0xf3, 0x42, 0xd7, 0x27, 0x90, 0x5e, 0x33, 0x17, 0x1b, 0xde, 0x6e, 0x84, 0x76, 0xe7, 0x7f, 0xb1, 0x72, 0x08, 0x61, 0xe9, 0x4b, 0x73, 0xa2, 0xc5, 0x38, 0xd2, 0x54, 0x74, 0x62, 0x85, 0xf4, 0x30 }, + { 0x0e, 0x6f, 0xd9, 0x7a, 0x85, 0xe9, 0x04, 0xf8, 0x7b, 0xfe, 0x85, 0xbb, 0xeb, 0x34, 0xf6, 0x9e, 0x1f, 0x18, 0x10, 0x5c, 0xf4, 0xed, 0x4f, 0x87, 0xae, 0xc3, 0x6c, 0x6e, 0x8b, 0x5f, 0x68, 0xbd, 0x2a, 0x6f, 0x3d, 0xc8, 0xa9, 0xec, 0xb2, 0xb6, 0x1d, 0xb4, 0xee, 0xdb, 0x6b, 0x2e, 0xa1, 0x0b, 0xf9, 0xcb, 0x02, 0x51, 0xfb, 0x0f, 0x8b, 0x34, 0x4a, 0xbf, 0x7f, 0x36, 0x6b, 0x6d, 0xe5, 0xab }, + { 0x06, 0x62, 0x2d, 0xa5, 0x78, 0x71, 0x76, 0x28, 0x7f, 0xdc, 0x8f, 0xed, 0x44, 0x0b, 0xad, 0x18, 0x7d, 0x83, 0x00, 0x99, 0xc9, 0x4e, 0x6d, 0x04, 0xc8, 0xe9, 0xc9, 0x54, 0xcd, 0xa7, 0x0c, 0x8b, 0xb9, 0xe1, 0xfc, 0x4a, 0x6d, 0x0b, 0xaa, 0x83, 0x1b, 0x9b, 0x78, 0xef, 0x66, 0x48, 0x68, 0x1a, 0x48, 0x67, 0xa1, 0x1d, 0xa9, 0x3e, 0xe3, 0x6e, 0x5e, 0x6a, 0x37, 0xd8, 0x7f, 0xc6, 0x3f, 0x6f }, + { 0x1d, 0xa6, 0x77, 0x2b, 0x58, 0xfa, 0xbf, 0x9c, 0x61, 0xf6, 0x8d, 0x41, 0x2c, 0x82, 0xf1, 0x82, 0xc0, 0x23, 0x6d, 0x7d, 0x57, 0x5e, 0xf0, 0xb5, 0x8d, 0xd2, 0x24, 0x58, 0xd6, 0x43, 0xcd, 0x1d, 0xfc, 0x93, 0xb0, 0x38, 0x71, 0xc3, 0x16, 0xd8, 0x43, 0x0d, 0x31, 0x29, 0x95, 0xd4, 0x19, 0x7f, 0x08, 0x74, 0xc9, 0x91, 0x72, 0xba, 0x00, 0x4a, 0x01, 0xee, 0x29, 0x5a, 0xba, 0xc2, 0x4e, 0x46 }, + { 0x3c, 0xd2, 0xd9, 0x32, 0x0b, 0x7b, 0x1d, 0x5f, 0xb9, 0xaa, 0xb9, 0x51, 0xa7, 0x60, 0x23, 0xfa, 0x66, 0x7b, 0xe1, 0x4a, 0x91, 0x24, 0xe3, 0x94, 0x51, 0x39, 0x18, 0xa3, 0xf4, 0x40, 0x96, 0xae, 0x49, 0x04, 0xba, 0x0f, 0xfc, 0x15, 0x0b, 0x63, 0xbc, 0x7a, 0xb1, 0xee, 0xb9, 0xa6, 0xe2, 0x57, 0xe5, 0xc8, 0xf0, 0x00, 0xa7, 0x03, 0x94, 0xa5, 0xaf, 0xd8, 0x42, 0x71, 0x5d, 0xe1, 0x5f, 0x29 }, + { 0x04, 0xcd, 0xc1, 0x4f, 0x74, 0x34, 0xe0, 0xb4, 0xbe, 0x70, 0xcb, 0x41, 0xdb, 0x4c, 0x77, 0x9a, 0x88, 0xea, 0xef, 0x6a, 0xcc, 0xeb, 0xcb, 0x41, 0xf2, 0xd4, 0x2f, 0xff, 0xe7, 0xf3, 0x2a, 0x8e, 0x28, 0x1b, 0x5c, 0x10, 0x3a, 0x27, 0x02, 0x1d, 0x0d, 0x08, 0x36, 0x22, 0x50, 0x75, 0x3c, 0xdf, 0x70, 0x29, 0x21, 0x95, 0xa5, 0x3a, 0x48, 0x72, 0x8c, 0xeb, 0x58, 0x44, 0xc2, 0xd9, 0x8b, 0xab }, + { 0x90, 0x71, 0xb7, 0xa8, 0xa0, 0x75, 0xd0, 0x09, 0x5b, 0x8f, 0xb3, 0xae, 0x51, 0x13, 0x78, 0x57, 0x35, 0xab, 0x98, 0xe2, 0xb5, 0x2f, 0xaf, 0x91, 0xd5, 0xb8, 0x9e, 0x44, 0xaa, 0xc5, 0xb5, 0xd4, 0xeb, 0xbf, 0x91, 0x22, 0x3b, 0x0f, 0xf4, 0xc7, 0x19, 0x05, 0xda, 0x55, 0x34, 0x2e, 0x64, 0x65, 0x5d, 0x6e, 0xf8, 0xc8, 0x9a, 0x47, 0x68, 0xc3, 0xf9, 0x3a, 0x6d, 0xc0, 0x36, 0x6b, 0x5b, 0xc8 }, + { 0xeb, 0xb3, 0x02, 0x40, 0xdd, 0x96, 0xc7, 0xbc, 0x8d, 0x0a, 0xbe, 0x49, 0xaa, 0x4e, 0xdc, 0xbb, 0x4a, 0xfd, 0xc5, 0x1f, 0xf9, 0xaa, 0xf7, 0x20, 0xd3, 0xf9, 0xe7, 0xfb, 0xb0, 0xf9, 0xc6, 0xd6, 0x57, 0x13, 0x50, 0x50, 0x17, 0x69, 0xfc, 0x4e, 0xbd, 0x0b, 0x21, 0x41, 0x24, 0x7f, 0xf4, 0x00, 0xd4, 0xfd, 0x4b, 0xe4, 0x14, 0xed, 0xf3, 0x77, 0x57, 0xbb, 0x90, 0xa3, 0x2a, 0xc5, 0xc6, 0x5a }, + { 0x85, 0x32, 0xc5, 0x8b, 0xf3, 0xc8, 0x01, 0x5d, 0x9d, 0x1c, 0xbe, 0x00, 0xee, 0xf1, 0xf5, 0x08, 0x2f, 0x8f, 0x36, 0x32, 0xfb, 0xe9, 0xf1, 0xed, 0x4f, 0x9d, 0xfb, 0x1f, 0xa7, 0x9e, 0x82, 0x83, 0x06, 0x6d, 0x77, 0xc4, 0x4c, 0x4a, 0xf9, 0x43, 0xd7, 0x6b, 0x30, 0x03, 0x64, 0xae, 0xcb, 0xd0, 0x64, 0x8c, 0x8a, 0x89, 0x39, 0xbd, 0x20, 0x41, 0x23, 0xf4, 0xb5, 0x62, 0x60, 0x42, 0x2d, 0xec }, + { 0xfe, 0x98, 0x46, 0xd6, 0x4f, 0x7c, 0x77, 0x08, 0x69, 0x6f, 0x84, 0x0e, 0x2d, 0x76, 0xcb, 0x44, 0x08, 0xb6, 0x59, 0x5c, 0x2f, 0x81, 0xec, 0x6a, 0x28, 0xa7, 0xf2, 0xf2, 0x0c, 0xb8, 0x8c, 0xfe, 0x6a, 0xc0, 0xb9, 0xe9, 0xb8, 0x24, 0x4f, 0x08, 0xbd, 0x70, 0x95, 0xc3, 0x50, 0xc1, 0xd0, 0x84, 0x2f, 0x64, 0xfb, 0x01, 0xbb, 0x7f, 0x53, 0x2d, 0xfc, 0xd4, 0x73, 0x71, 0xb0, 0xae, 0xeb, 0x79 }, + { 0x28, 0xf1, 0x7e, 0xa6, 0xfb, 0x6c, 0x42, 0x09, 0x2d, 0xc2, 0x64, 0x25, 0x7e, 0x29, 0x74, 0x63, 0x21, 0xfb, 0x5b, 0xda, 0xea, 0x98, 0x73, 0xc2, 0xa7, 0xfa, 0x9d, 0x8f, 0x53, 0x81, 0x8e, 0x89, 0x9e, 0x16, 0x1b, 0xc7, 0x7d, 0xfe, 0x80, 0x90, 0xaf, 0xd8, 0x2b, 0xf2, 0x26, 0x6c, 0x5c, 0x1b, 0xc9, 0x30, 0xa8, 0xd1, 0x54, 0x76, 0x24, 0x43, 0x9e, 0x66, 0x2e, 0xf6, 0x95, 0xf2, 0x6f, 0x24 }, + { 0xec, 0x6b, 0x7d, 0x7f, 0x03, 0x0d, 0x48, 0x50, 0xac, 0xae, 0x3c, 0xb6, 0x15, 0xc2, 0x1d, 0xd2, 0x52, 0x06, 0xd6, 0x3e, 0x84, 0xd1, 0xdb, 0x8d, 0x95, 0x73, 0x70, 0x73, 0x7b, 0xa0, 0xe9, 0x84, 0x67, 0xea, 0x0c, 0xe2, 0x74, 0xc6, 0x61, 0x99, 0x90, 0x1e, 0xae, 0xc1, 0x8a, 0x08, 0x52, 0x57, 0x15, 0xf5, 0x3b, 0xfd, 0xb0, 0xaa, 0xcb, 0x61, 0x3d, 0x34, 0x2e, 0xbd, 0xce, 0xed, 0xdc, 0x3b }, + { 0xb4, 0x03, 0xd3, 0x69, 0x1c, 0x03, 0xb0, 0xd3, 0x41, 0x8d, 0xf3, 0x27, 0xd5, 0x86, 0x0d, 0x34, 0xbb, 0xfc, 0xc4, 0x51, 0x9b, 0xfb, 0xce, 0x36, 0xbf, 0x33, 0xb2, 0x08, 0x38, 0x5f, 0xad, 0xb9, 0x18, 0x6b, 0xc7, 0x8a, 0x76, 0xc4, 0x89, 0xd8, 0x9f, 0xd5, 0x7e, 0x7d, 0xc7, 0x54, 0x12, 0xd2, 0x3b, 0xcd, 0x1d, 0xae, 0x84, 0x70, 0xce, 0x92, 0x74, 0x75, 0x4b, 0xb8, 0x58, 0x5b, 0x13, 0xc5 }, + { 0x31, 0xfc, 0x79, 0x73, 0x8b, 0x87, 0x72, 0xb3, 0xf5, 0x5c, 0xd8, 0x17, 0x88, 0x13, 0xb3, 0xb5, 0x2d, 0x0d, 0xb5, 0xa4, 0x19, 0xd3, 0x0b, 0xa9, 0x49, 0x5c, 0x4b, 0x9d, 0xa0, 0x21, 0x9f, 0xac, 0x6d, 0xf8, 0xe7, 0xc2, 0x3a, 0x81, 0x15, 0x51, 0xa6, 0x2b, 0x82, 0x7f, 0x25, 0x6e, 0xcd, 0xb8, 0x12, 0x4a, 0xc8, 0xa6, 0x79, 0x2c, 0xcf, 0xec, 0xc3, 0xb3, 0x01, 0x27, 0x22, 0xe9, 0x44, 0x63 }, + { 0xbb, 0x20, 0x39, 0xec, 0x28, 0x70, 0x91, 0xbc, 0xc9, 0x64, 0x2f, 0xc9, 0x00, 0x49, 0xe7, 0x37, 0x32, 0xe0, 0x2e, 0x57, 0x7e, 0x28, 0x62, 0xb3, 0x22, 0x16, 0xae, 0x9b, 0xed, 0xcd, 0x73, 0x0c, 0x4c, 0x28, 0x4e, 0xf3, 0x96, 0x8c, 0x36, 0x8b, 0x7d, 0x37, 0x58, 0x4f, 0x97, 0xbd, 0x4b, 0x4d, 0xc6, 0xef, 0x61, 0x27, 0xac, 0xfe, 0x2e, 0x6a, 0xe2, 0x50, 0x91, 0x24, 0xe6, 0x6c, 0x8a, 0xf4 }, + { 0xf5, 0x3d, 0x68, 0xd1, 0x3f, 0x45, 0xed, 0xfc, 0xb9, 0xbd, 0x41, 0x5e, 0x28, 0x31, 0xe9, 0x38, 0x35, 0x0d, 0x53, 0x80, 0xd3, 0x43, 0x22, 0x78, 0xfc, 0x1c, 0x0c, 0x38, 0x1f, 0xcb, 0x7c, 0x65, 0xc8, 0x2d, 0xaf, 0xe0, 0x51, 0xd8, 0xc8, 0xb0, 0xd4, 0x4e, 0x09, 0x74, 0xa0, 0xe5, 0x9e, 0xc7, 0xbf, 0x7e, 0xd0, 0x45, 0x9f, 0x86, 0xe9, 0x6f, 0x32, 0x9f, 0xc7, 0x97, 0x52, 0x51, 0x0f, 0xd3 }, + { 0x8d, 0x56, 0x8c, 0x79, 0x84, 0xf0, 0xec, 0xdf, 0x76, 0x40, 0xfb, 0xc4, 0x83, 0xb5, 0xd8, 0xc9, 0xf8, 0x66, 0x34, 0xf6, 0xf4, 0x32, 0x91, 0x84, 0x1b, 0x30, 0x9a, 0x35, 0x0a, 0xb9, 0xc1, 0x13, 0x7d, 0x24, 0x06, 0x6b, 0x09, 0xda, 0x99, 0x44, 0xba, 0xc5, 0x4d, 0x5b, 0xb6, 0x58, 0x0d, 0x83, 0x60, 0x47, 0xaa, 0xc7, 0x4a, 0xb7, 0x24, 0xb8, 0x87, 0xeb, 0xf9, 0x3d, 0x4b, 0x32, 0xec, 0xa9 }, + { 0xc0, 0xb6, 0x5c, 0xe5, 0xa9, 0x6f, 0xf7, 0x74, 0xc4, 0x56, 0xca, 0xc3, 0xb5, 0xf2, 0xc4, 0xcd, 0x35, 0x9b, 0x4f, 0xf5, 0x3e, 0xf9, 0x3a, 0x3d, 0xa0, 0x77, 0x8b, 0xe4, 0x90, 0x0d, 0x1e, 0x8d, 0xa1, 0x60, 0x1e, 0x76, 0x9e, 0x8f, 0x1b, 0x02, 0xd2, 0xa2, 0xf8, 0xc5, 0xb9, 0xfa, 0x10, 0xb4, 0x4f, 0x1c, 0x18, 0x69, 0x85, 0x46, 0x8f, 0xee, 0xb0, 0x08, 0x73, 0x02, 0x83, 0xa6, 0x65, 0x7d }, + { 0x49, 0x00, 0xbb, 0xa6, 0xf5, 0xfb, 0x10, 0x3e, 0xce, 0x8e, 0xc9, 0x6a, 0xda, 0x13, 0xa5, 0xc3, 0xc8, 0x54, 0x88, 0xe0, 0x55, 0x51, 0xda, 0x6b, 0x6b, 0x33, 0xd9, 0x88, 0xe6, 0x11, 0xec, 0x0f, 0xe2, 0xe3, 0xc2, 0xaa, 0x48, 0xea, 0x6a, 0xe8, 0x98, 0x6a, 0x3a, 0x23, 0x1b, 0x22, 0x3c, 0x5d, 0x27, 0xce, 0xc2, 0xea, 0xdd, 0xe9, 0x1c, 0xe0, 0x79, 0x81, 0xee, 0x65, 0x28, 0x62, 0xd1, 0xe4 }, + { 0xc7, 0xf5, 0xc3, 0x7c, 0x72, 0x85, 0xf9, 0x27, 0xf7, 0x64, 0x43, 0x41, 0x4d, 0x43, 0x57, 0xff, 0x78, 0x96, 0x47, 0xd7, 0xa0, 0x05, 0xa5, 0xa7, 0x87, 0xe0, 0x3c, 0x34, 0x6b, 0x57, 0xf4, 0x9f, 0x21, 0xb6, 0x4f, 0xa9, 0xcf, 0x4b, 0x7e, 0x45, 0x57, 0x3e, 0x23, 0x04, 0x90, 0x17, 0x56, 0x71, 0x21, 0xa9, 0xc3, 0xd4, 0xb2, 0xb7, 0x3e, 0xc5, 0xe9, 0x41, 0x35, 0x77, 0x52, 0x5d, 0xb4, 0x5a }, + { 0xec, 0x70, 0x96, 0x33, 0x07, 0x36, 0xfd, 0xb2, 0xd6, 0x4b, 0x56, 0x53, 0xe7, 0x47, 0x5d, 0xa7, 0x46, 0xc2, 0x3a, 0x46, 0x13, 0xa8, 0x26, 0x87, 0xa2, 0x80, 0x62, 0xd3, 0x23, 0x63, 0x64, 0x28, 0x4a, 0xc0, 0x17, 0x20, 0xff, 0xb4, 0x06, 0xcf, 0xe2, 0x65, 0xc0, 0xdf, 0x62, 0x6a, 0x18, 0x8c, 0x9e, 0x59, 0x63, 0xac, 0xe5, 0xd3, 0xd5, 0xbb, 0x36, 0x3e, 0x32, 0xc3, 0x8c, 0x21, 0x90, 0xa6 }, + { 0x82, 0xe7, 0x44, 0xc7, 0x5f, 0x46, 0x49, 0xec, 0x52, 0xb8, 0x07, 0x71, 0xa7, 0x7d, 0x47, 0x5a, 0x3b, 0xc0, 0x91, 0x98, 0x95, 0x56, 0x96, 0x0e, 0x27, 0x6a, 0x5f, 0x9e, 0xad, 0x92, 0xa0, 0x3f, 0x71, 0x87, 0x42, 0xcd, 0xcf, 0xea, 0xee, 0x5c, 0xb8, 0x5c, 0x44, 0xaf, 0x19, 0x8a, 0xdc, 0x43, 0xa4, 0xa4, 0x28, 0xf5, 0xf0, 0xc2, 0xdd, 0xb0, 0xbe, 0x36, 0x05, 0x9f, 0x06, 0xd7, 0xdf, 0x73 }, + { 0x28, 0x34, 0xb7, 0xa7, 0x17, 0x0f, 0x1f, 0x5b, 0x68, 0x55, 0x9a, 0xb7, 0x8c, 0x10, 0x50, 0xec, 0x21, 0xc9, 0x19, 0x74, 0x0b, 0x78, 0x4a, 0x90, 0x72, 0xf6, 0xe5, 0xd6, 0x9f, 0x82, 0x8d, 0x70, 0xc9, 0x19, 0xc5, 0x03, 0x9f, 0xb1, 0x48, 0xe3, 0x9e, 0x2c, 0x8a, 0x52, 0x11, 0x83, 0x78, 0xb0, 0x64, 0xca, 0x8d, 0x50, 0x01, 0xcd, 0x10, 0xa5, 0x47, 0x83, 0x87, 0xb9, 0x66, 0x71, 0x5e, 0xd6 }, + { 0x16, 0xb4, 0xad, 0xa8, 0x83, 0xf7, 0x2f, 0x85, 0x3b, 0xb7, 0xef, 0x25, 0x3e, 0xfc, 0xab, 0x0c, 0x3e, 0x21, 0x61, 0x68, 0x7a, 0xd6, 0x15, 0x43, 0xa0, 0xd2, 0x82, 0x4f, 0x91, 0xc1, 0xf8, 0x13, 0x47, 0xd8, 0x6b, 0xe7, 0x09, 0xb1, 0x69, 0x96, 0xe1, 0x7f, 0x2d, 0xd4, 0x86, 0x92, 0x7b, 0x02, 0x88, 0xad, 0x38, 0xd1, 0x30, 0x63, 0xc4, 0xa9, 0x67, 0x2c, 0x39, 0x39, 0x7d, 0x37, 0x89, 0xb6 }, + { 0x78, 0xd0, 0x48, 0xf3, 0xa6, 0x9d, 0x8b, 0x54, 0xae, 0x0e, 0xd6, 0x3a, 0x57, 0x3a, 0xe3, 0x50, 0xd8, 0x9f, 0x7c, 0x6c, 0xf1, 0xf3, 0x68, 0x89, 0x30, 0xde, 0x89, 0x9a, 0xfa, 0x03, 0x76, 0x97, 0x62, 0x9b, 0x31, 0x4e, 0x5c, 0xd3, 0x03, 0xaa, 0x62, 0xfe, 0xea, 0x72, 0xa2, 0x5b, 0xf4, 0x2b, 0x30, 0x4b, 0x6c, 0x6b, 0xcb, 0x27, 0xfa, 0xe2, 0x1c, 0x16, 0xd9, 0x25, 0xe1, 0xfb, 0xda, 0xc3 }, + { 0x0f, 0x74, 0x6a, 0x48, 0x74, 0x92, 0x87, 0xad, 0xa7, 0x7a, 0x82, 0x96, 0x1f, 0x05, 0xa4, 0xda, 0x4a, 0xbd, 0xb7, 0xd7, 0x7b, 0x12, 0x20, 0xf8, 0x36, 0xd0, 0x9e, 0xc8, 0x14, 0x35, 0x9c, 0x0e, 0xc0, 0x23, 0x9b, 0x8c, 0x7b, 0x9f, 0xf9, 0xe0, 0x2f, 0x56, 0x9d, 0x1b, 0x30, 0x1e, 0xf6, 0x7c, 0x46, 0x12, 0xd1, 0xde, 0x4f, 0x73, 0x0f, 0x81, 0xc1, 0x2c, 0x40, 0xcc, 0x06, 0x3c, 0x5c, 0xaa }, + { 0xf0, 0xfc, 0x85, 0x9d, 0x3b, 0xd1, 0x95, 0xfb, 0xdc, 0x2d, 0x59, 0x1e, 0x4c, 0xda, 0xc1, 0x51, 0x79, 0xec, 0x0f, 0x1d, 0xc8, 0x21, 0xc1, 0x1d, 0xf1, 0xf0, 0xc1, 0xd2, 0x6e, 0x62, 0x60, 0xaa, 0xa6, 0x5b, 0x79, 0xfa, 0xfa, 0xca, 0xfd, 0x7d, 0x3a, 0xd6, 0x1e, 0x60, 0x0f, 0x25, 0x09, 0x05, 0xf5, 0x87, 0x8c, 0x87, 0x45, 0x28, 0x97, 0x64, 0x7a, 0x35, 0xb9, 0x95, 0xbc, 0xad, 0xc3, 0xa3 }, + { 0x26, 0x20, 0xf6, 0x87, 0xe8, 0x62, 0x5f, 0x6a, 0x41, 0x24, 0x60, 0xb4, 0x2e, 0x2c, 0xef, 0x67, 0x63, 0x42, 0x08, 0xce, 0x10, 0xa0, 0xcb, 0xd4, 0xdf, 0xf7, 0x04, 0x4a, 0x41, 0xb7, 0x88, 0x00, 0x77, 0xe9, 0xf8, 0xdc, 0x3b, 0x8d, 0x12, 0x16, 0xd3, 0x37, 0x6a, 0x21, 0xe0, 0x15, 0xb5, 0x8f, 0xb2, 0x79, 0xb5, 0x21, 0xd8, 0x3f, 0x93, 0x88, 0xc7, 0x38, 0x2c, 0x85, 0x05, 0x59, 0x0b, 0x9b }, + { 0x22, 0x7e, 0x3a, 0xed, 0x8d, 0x2c, 0xb1, 0x0b, 0x91, 0x8f, 0xcb, 0x04, 0xf9, 0xde, 0x3e, 0x6d, 0x0a, 0x57, 0xe0, 0x84, 0x76, 0xd9, 0x37, 0x59, 0xcd, 0x7b, 0x2e, 0xd5, 0x4a, 0x1c, 0xbf, 0x02, 0x39, 0xc5, 0x28, 0xfb, 0x04, 0xbb, 0xf2, 0x88, 0x25, 0x3e, 0x60, 0x1d, 0x3b, 0xc3, 0x8b, 0x21, 0x79, 0x4a, 0xfe, 0xf9, 0x0b, 0x17, 0x09, 0x4a, 0x18, 0x2c, 0xac, 0x55, 0x77, 0x45, 0xe7, 0x5f }, + { 0x1a, 0x92, 0x99, 0x01, 0xb0, 0x9c, 0x25, 0xf2, 0x7d, 0x6b, 0x35, 0xbe, 0x7b, 0x2f, 0x1c, 0x47, 0x45, 0x13, 0x1f, 0xde, 0xbc, 0xa7, 0xf3, 0xe2, 0x45, 0x19, 0x26, 0x72, 0x04, 0x34, 0xe0, 0xdb, 0x6e, 0x74, 0xfd, 0x69, 0x3a, 0xd2, 0x9b, 0x77, 0x7d, 0xc3, 0x35, 0x5c, 0x59, 0x2a, 0x36, 0x1c, 0x48, 0x73, 0xb0, 0x11, 0x33, 0xa5, 0x7c, 0x2e, 0x3b, 0x70, 0x75, 0xcb, 0xdb, 0x86, 0xf4, 0xfc }, + { 0x5f, 0xd7, 0x96, 0x8b, 0xc2, 0xfe, 0x34, 0xf2, 0x20, 0xb5, 0xe3, 0xdc, 0x5a, 0xf9, 0x57, 0x17, 0x42, 0xd7, 0x3b, 0x7d, 0x60, 0x81, 0x9f, 0x28, 0x88, 0xb6, 0x29, 0x07, 0x2b, 0x96, 0xa9, 0xd8, 0xab, 0x2d, 0x91, 0xb8, 0x2d, 0x0a, 0x9a, 0xab, 0xa6, 0x1b, 0xbd, 0x39, 0x95, 0x81, 0x32, 0xfc, 0xc4, 0x25, 0x70, 0x23, 0xd1, 0xec, 0xa5, 0x91, 0xb3, 0x05, 0x4e, 0x2d, 0xc8, 0x1c, 0x82, 0x00 }, + { 0xdf, 0xcc, 0xe8, 0xcf, 0x32, 0x87, 0x0c, 0xc6, 0xa5, 0x03, 0xea, 0xda, 0xfc, 0x87, 0xfd, 0x6f, 0x78, 0x91, 0x8b, 0x9b, 0x4d, 0x07, 0x37, 0xdb, 0x68, 0x10, 0xbe, 0x99, 0x6b, 0x54, 0x97, 0xe7, 0xe5, 0xcc, 0x80, 0xe3, 0x12, 0xf6, 0x1e, 0x71, 0xff, 0x3e, 0x96, 0x24, 0x43, 0x60, 0x73, 0x15, 0x64, 0x03, 0xf7, 0x35, 0xf5, 0x6b, 0x0b, 0x01, 0x84, 0x5c, 0x18, 0xf6, 0xca, 0xf7, 0x72, 0xe6 }, + { 0x02, 0xf7, 0xef, 0x3a, 0x9c, 0xe0, 0xff, 0xf9, 0x60, 0xf6, 0x70, 0x32, 0xb2, 0x96, 0xef, 0xca, 0x30, 0x61, 0xf4, 0x93, 0x4d, 0x69, 0x07, 0x49, 0xf2, 0xd0, 0x1c, 0x35, 0xc8, 0x1c, 0x14, 0xf3, 0x9a, 0x67, 0xfa, 0x35, 0x0b, 0xc8, 0xa0, 0x35, 0x9b, 0xf1, 0x72, 0x4b, 0xff, 0xc3, 0xbc, 0xa6, 0xd7, 0xc7, 0xbb, 0xa4, 0x79, 0x1f, 0xd5, 0x22, 0xa3, 0xad, 0x35, 0x3c, 0x02, 0xec, 0x5a, 0xa8 }, + { 0x64, 0xbe, 0x5c, 0x6a, 0xba, 0x65, 0xd5, 0x94, 0x84, 0x4a, 0xe7, 0x8b, 0xb0, 0x22, 0xe5, 0xbe, 0xbe, 0x12, 0x7f, 0xd6, 0xb6, 0xff, 0xa5, 0xa1, 0x37, 0x03, 0x85, 0x5a, 0xb6, 0x3b, 0x62, 0x4d, 0xcd, 0x1a, 0x36, 0x3f, 0x99, 0x20, 0x3f, 0x63, 0x2e, 0xc3, 0x86, 0xf3, 0xea, 0x76, 0x7f, 0xc9, 0x92, 0xe8, 0xed, 0x96, 0x86, 0x58, 0x6a, 0xa2, 0x75, 0x55, 0xa8, 0x59, 0x9d, 0x5b, 0x80, 0x8f }, + { 0xf7, 0x85, 0x85, 0x50, 0x5c, 0x4e, 0xaa, 0x54, 0xa8, 0xb5, 0xbe, 0x70, 0xa6, 0x1e, 0x73, 0x5e, 0x0f, 0xf9, 0x7a, 0xf9, 0x44, 0xdd, 0xb3, 0x00, 0x1e, 0x35, 0xd8, 0x6c, 0x4e, 0x21, 0x99, 0xd9, 0x76, 0x10, 0x4b, 0x6a, 0xe3, 0x17, 0x50, 0xa3, 0x6a, 0x72, 0x6e, 0xd2, 0x85, 0x06, 0x4f, 0x59, 0x81, 0xb5, 0x03, 0x88, 0x9f, 0xef, 0x82, 0x2f, 0xcd, 0xc2, 0x89, 0x8d, 0xdd, 0xb7, 0x88, 0x9a }, + { 0xe4, 0xb5, 0x56, 0x60, 0x33, 0x86, 0x95, 0x72, 0xed, 0xfd, 0x87, 0x47, 0x9a, 0x5b, 0xb7, 0x3c, 0x80, 0xe8, 0x75, 0x9b, 0x91, 0x23, 0x28, 0x79, 0xd9, 0x6b, 0x1d, 0xda, 0x36, 0xc0, 0x12, 0x07, 0x6e, 0xe5, 0xa2, 0xed, 0x7a, 0xe2, 0xde, 0x63, 0xef, 0x84, 0x06, 0xa0, 0x6a, 0xea, 0x82, 0xc1, 0x88, 0x03, 0x1b, 0x56, 0x0b, 0xea, 0xfb, 0x58, 0x3f, 0xb3, 0xde, 0x9e, 0x57, 0x95, 0x2a, 0x7e }, + { 0xe1, 0xb3, 0xe7, 0xed, 0x86, 0x7f, 0x6c, 0x94, 0x84, 0xa2, 0xa9, 0x7f, 0x77, 0x15, 0xf2, 0x5e, 0x25, 0x29, 0x4e, 0x99, 0x2e, 0x41, 0xf6, 0xa7, 0xc1, 0x61, 0xff, 0xc2, 0xad, 0xc6, 0xda, 0xae, 0xb7, 0x11, 0x31, 0x02, 0xd5, 0xe6, 0x09, 0x02, 0x87, 0xfe, 0x6a, 0xd9, 0x4c, 0xe5, 0xd6, 0xb7, 0x39, 0xc6, 0xca, 0x24, 0x0b, 0x05, 0xc7, 0x6f, 0xb7, 0x3f, 0x25, 0xdd, 0x02, 0x4b, 0xf9, 0x35 }, + { 0x85, 0xfd, 0x08, 0x5f, 0xdc, 0x12, 0xa0, 0x80, 0x98, 0x3d, 0xf0, 0x7b, 0xd7, 0x01, 0x2b, 0x0d, 0x40, 0x2a, 0x0f, 0x40, 0x43, 0xfc, 0xb2, 0x77, 0x5a, 0xdf, 0x0b, 0xad, 0x17, 0x4f, 0x9b, 0x08, 0xd1, 0x67, 0x6e, 0x47, 0x69, 0x85, 0x78, 0x5c, 0x0a, 0x5d, 0xcc, 0x41, 0xdb, 0xff, 0x6d, 0x95, 0xef, 0x4d, 0x66, 0xa3, 0xfb, 0xdc, 0x4a, 0x74, 0xb8, 0x2b, 0xa5, 0x2d, 0xa0, 0x51, 0x2b, 0x74 }, + { 0xae, 0xd8, 0xfa, 0x76, 0x4b, 0x0f, 0xbf, 0xf8, 0x21, 0xe0, 0x52, 0x33, 0xd2, 0xf7, 0xb0, 0x90, 0x0e, 0xc4, 0x4d, 0x82, 0x6f, 0x95, 0xe9, 0x3c, 0x34, 0x3c, 0x1b, 0xc3, 0xba, 0x5a, 0x24, 0x37, 0x4b, 0x1d, 0x61, 0x6e, 0x7e, 0x7a, 0xba, 0x45, 0x3a, 0x0a, 0xda, 0x5e, 0x4f, 0xab, 0x53, 0x82, 0x40, 0x9e, 0x0d, 0x42, 0xce, 0x9c, 0x2b, 0xc7, 0xfb, 0x39, 0xa9, 0x9c, 0x34, 0x0c, 0x20, 0xf0 }, + { 0x7b, 0xa3, 0xb2, 0xe2, 0x97, 0x23, 0x35, 0x22, 0xee, 0xb3, 0x43, 0xbd, 0x3e, 0xbc, 0xfd, 0x83, 0x5a, 0x04, 0x00, 0x77, 0x35, 0xe8, 0x7f, 0x0c, 0xa3, 0x00, 0xcb, 0xee, 0x6d, 0x41, 0x65, 0x65, 0x16, 0x21, 0x71, 0x58, 0x1e, 0x40, 0x20, 0xff, 0x4c, 0xf1, 0x76, 0x45, 0x0f, 0x12, 0x91, 0xea, 0x22, 0x85, 0xcb, 0x9e, 0xbf, 0xfe, 0x4c, 0x56, 0x66, 0x06, 0x27, 0x68, 0x51, 0x45, 0x05, 0x1c }, + { 0xde, 0x74, 0x8b, 0xcf, 0x89, 0xec, 0x88, 0x08, 0x47, 0x21, 0xe1, 0x6b, 0x85, 0xf3, 0x0a, 0xdb, 0x1a, 0x61, 0x34, 0xd6, 0x64, 0xb5, 0x84, 0x35, 0x69, 0xba, 0xbc, 0x5b, 0xbd, 0x1a, 0x15, 0xca, 0x9b, 0x61, 0x80, 0x3c, 0x90, 0x1a, 0x4f, 0xef, 0x32, 0x96, 0x5a, 0x17, 0x49, 0xc9, 0xf3, 0xa4, 0xe2, 0x43, 0xe1, 0x73, 0x93, 0x9d, 0xc5, 0xa8, 0xdc, 0x49, 0x5c, 0x67, 0x1a, 0xb5, 0x21, 0x45 }, + { 0xaa, 0xf4, 0xd2, 0xbd, 0xf2, 0x00, 0xa9, 0x19, 0x70, 0x6d, 0x98, 0x42, 0xdc, 0xe1, 0x6c, 0x98, 0x14, 0x0d, 0x34, 0xbc, 0x43, 0x3d, 0xf3, 0x20, 0xab, 0xa9, 0xbd, 0x42, 0x9e, 0x54, 0x9a, 0xa7, 0xa3, 0x39, 0x76, 0x52, 0xa4, 0xd7, 0x68, 0x27, 0x77, 0x86, 0xcf, 0x99, 0x3c, 0xde, 0x23, 0x38, 0x67, 0x3e, 0xd2, 0xe6, 0xb6, 0x6c, 0x96, 0x1f, 0xef, 0xb8, 0x2c, 0xd2, 0x0c, 0x93, 0x33, 0x8f }, + { 0xc4, 0x08, 0x21, 0x89, 0x68, 0xb7, 0x88, 0xbf, 0x86, 0x4f, 0x09, 0x97, 0xe6, 0xbc, 0x4c, 0x3d, 0xba, 0x68, 0xb2, 0x76, 0xe2, 0x12, 0x5a, 0x48, 0x43, 0x29, 0x60, 0x52, 0xff, 0x93, 0xbf, 0x57, 0x67, 0xb8, 0xcd, 0xce, 0x71, 0x31, 0xf0, 0x87, 0x64, 0x30, 0xc1, 0x16, 0x5f, 0xec, 0x6c, 0x4f, 0x47, 0xad, 0xaa, 0x4f, 0xd8, 0xbc, 0xfa, 0xce, 0xf4, 0x63, 0xb5, 0xd3, 0xd0, 0xfa, 0x61, 0xa0 }, + { 0x76, 0xd2, 0xd8, 0x19, 0xc9, 0x2b, 0xce, 0x55, 0xfa, 0x8e, 0x09, 0x2a, 0xb1, 0xbf, 0x9b, 0x9e, 0xab, 0x23, 0x7a, 0x25, 0x26, 0x79, 0x86, 0xca, 0xcf, 0x2b, 0x8e, 0xe1, 0x4d, 0x21, 0x4d, 0x73, 0x0d, 0xc9, 0xa5, 0xaa, 0x2d, 0x7b, 0x59, 0x6e, 0x86, 0xa1, 0xfd, 0x8f, 0xa0, 0x80, 0x4c, 0x77, 0x40, 0x2d, 0x2f, 0xcd, 0x45, 0x08, 0x36, 0x88, 0xb2, 0x18, 0xb1, 0xcd, 0xfa, 0x0d, 0xcb, 0xcb }, + { 0x72, 0x06, 0x5e, 0xe4, 0xdd, 0x91, 0xc2, 0xd8, 0x50, 0x9f, 0xa1, 0xfc, 0x28, 0xa3, 0x7c, 0x7f, 0xc9, 0xfa, 0x7d, 0x5b, 0x3f, 0x8a, 0xd3, 0xd0, 0xd7, 0xa2, 0x56, 0x26, 0xb5, 0x7b, 0x1b, 0x44, 0x78, 0x8d, 0x4c, 0xaf, 0x80, 0x62, 0x90, 0x42, 0x5f, 0x98, 0x90, 0xa3, 0xa2, 0xa3, 0x5a, 0x90, 0x5a, 0xb4, 0xb3, 0x7a, 0xcf, 0xd0, 0xda, 0x6e, 0x45, 0x17, 0xb2, 0x52, 0x5c, 0x96, 0x51, 0xe4 }, + { 0x64, 0x47, 0x5d, 0xfe, 0x76, 0x00, 0xd7, 0x17, 0x1b, 0xea, 0x0b, 0x39, 0x4e, 0x27, 0xc9, 0xb0, 0x0d, 0x8e, 0x74, 0xdd, 0x1e, 0x41, 0x6a, 0x79, 0x47, 0x36, 0x82, 0xad, 0x3d, 0xfd, 0xbb, 0x70, 0x66, 0x31, 0x55, 0x80, 0x55, 0xcf, 0xc8, 0xa4, 0x0e, 0x07, 0xbd, 0x01, 0x5a, 0x45, 0x40, 0xdc, 0xde, 0xa1, 0x58, 0x83, 0xcb, 0xbf, 0x31, 0x41, 0x2d, 0xf1, 0xde, 0x1c, 0xd4, 0x15, 0x2b, 0x91 }, + { 0x12, 0xcd, 0x16, 0x74, 0xa4, 0x48, 0x8a, 0x5d, 0x7c, 0x2b, 0x31, 0x60, 0xd2, 0xe2, 0xc4, 0xb5, 0x83, 0x71, 0xbe, 0xda, 0xd7, 0x93, 0x41, 0x8d, 0x6f, 0x19, 0xc6, 0xee, 0x38, 0x5d, 0x70, 0xb3, 0xe0, 0x67, 0x39, 0x36, 0x9d, 0x4d, 0xf9, 0x10, 0xed, 0xb0, 0xb0, 0xa5, 0x4c, 0xbf, 0xf4, 0x3d, 0x54, 0x54, 0x4c, 0xd3, 0x7a, 0xb3, 0xa0, 0x6c, 0xfa, 0x0a, 0x3d, 0xda, 0xc8, 0xb6, 0x6c, 0x89 }, + { 0x60, 0x75, 0x69, 0x66, 0x47, 0x9d, 0xed, 0xc6, 0xdd, 0x4b, 0xcf, 0xf8, 0xea, 0x7d, 0x1d, 0x4c, 0xe4, 0xd4, 0xaf, 0x2e, 0x7b, 0x09, 0x7e, 0x32, 0xe3, 0x76, 0x35, 0x18, 0x44, 0x11, 0x47, 0xcc, 0x12, 0xb3, 0xc0, 0xee, 0x6d, 0x2e, 0xca, 0xbf, 0x11, 0x98, 0xce, 0xc9, 0x2e, 0x86, 0xa3, 0x61, 0x6f, 0xba, 0x4f, 0x4e, 0x87, 0x2f, 0x58, 0x25, 0x33, 0x0a, 0xdb, 0xb4, 0xc1, 0xde, 0xe4, 0x44 }, + { 0xa7, 0x80, 0x3b, 0xcb, 0x71, 0xbc, 0x1d, 0x0f, 0x43, 0x83, 0xdd, 0xe1, 0xe0, 0x61, 0x2e, 0x04, 0xf8, 0x72, 0xb7, 0x15, 0xad, 0x30, 0x81, 0x5c, 0x22, 0x49, 0xcf, 0x34, 0xab, 0xb8, 0xb0, 0x24, 0x91, 0x5c, 0xb2, 0xfc, 0x9f, 0x4e, 0x7c, 0xc4, 0xc8, 0xcf, 0xd4, 0x5b, 0xe2, 0xd5, 0xa9, 0x1e, 0xab, 0x09, 0x41, 0xc7, 0xd2, 0x70, 0xe2, 0xda, 0x4c, 0xa4, 0xa9, 0xf7, 0xac, 0x68, 0x66, 0x3a }, + { 0xb8, 0x4e, 0xf6, 0xa7, 0x22, 0x9a, 0x34, 0xa7, 0x50, 0xd9, 0xa9, 0x8e, 0xe2, 0x52, 0x98, 0x71, 0x81, 0x6b, 0x87, 0xfb, 0xe3, 0xbc, 0x45, 0xb4, 0x5f, 0xa5, 0xae, 0x82, 0xd5, 0x14, 0x15, 0x40, 0x21, 0x11, 0x65, 0xc3, 0xc5, 0xd7, 0xa7, 0x47, 0x6b, 0xa5, 0xa4, 0xaa, 0x06, 0xd6, 0x64, 0x76, 0xf0, 0xd9, 0xdc, 0x49, 0xa3, 0xf1, 0xee, 0x72, 0xc3, 0xac, 0xab, 0xd4, 0x98, 0x96, 0x74, 0x14 }, + { 0xfa, 0xe4, 0xb6, 0xd8, 0xef, 0xc3, 0xf8, 0xc8, 0xe6, 0x4d, 0x00, 0x1d, 0xab, 0xec, 0x3a, 0x21, 0xf5, 0x44, 0xe8, 0x27, 0x14, 0x74, 0x52, 0x51, 0xb2, 0xb4, 0xb3, 0x93, 0xf2, 0xf4, 0x3e, 0x0d, 0xa3, 0xd4, 0x03, 0xc6, 0x4d, 0xb9, 0x5a, 0x2c, 0xb6, 0xe2, 0x3e, 0xbb, 0x7b, 0x9e, 0x94, 0xcd, 0xd5, 0xdd, 0xac, 0x54, 0xf0, 0x7c, 0x4a, 0x61, 0xbd, 0x3c, 0xb1, 0x0a, 0xa6, 0xf9, 0x3b, 0x49 }, + { 0x34, 0xf7, 0x28, 0x66, 0x05, 0xa1, 0x22, 0x36, 0x95, 0x40, 0x14, 0x1d, 0xed, 0x79, 0xb8, 0x95, 0x72, 0x55, 0xda, 0x2d, 0x41, 0x55, 0xab, 0xbf, 0x5a, 0x8d, 0xbb, 0x89, 0xc8, 0xeb, 0x7e, 0xde, 0x8e, 0xee, 0xf1, 0xda, 0xa4, 0x6d, 0xc2, 0x9d, 0x75, 0x1d, 0x04, 0x5d, 0xc3, 0xb1, 0xd6, 0x58, 0xbb, 0x64, 0xb8, 0x0f, 0xf8, 0x58, 0x9e, 0xdd, 0xb3, 0x82, 0x4b, 0x13, 0xda, 0x23, 0x5a, 0x6b }, + { 0x3b, 0x3b, 0x48, 0x43, 0x4b, 0xe2, 0x7b, 0x9e, 0xab, 0xab, 0xba, 0x43, 0xbf, 0x6b, 0x35, 0xf1, 0x4b, 0x30, 0xf6, 0xa8, 0x8d, 0xc2, 0xe7, 0x50, 0xc3, 0x58, 0x47, 0x0d, 0x6b, 0x3a, 0xa3, 0xc1, 0x8e, 0x47, 0xdb, 0x40, 0x17, 0xfa, 0x55, 0x10, 0x6d, 0x82, 0x52, 0xf0, 0x16, 0x37, 0x1a, 0x00, 0xf5, 0xf8, 0xb0, 0x70, 0xb7, 0x4b, 0xa5, 0xf2, 0x3c, 0xff, 0xc5, 0x51, 0x1c, 0x9f, 0x09, 0xf0 }, + { 0xba, 0x28, 0x9e, 0xbd, 0x65, 0x62, 0xc4, 0x8c, 0x3e, 0x10, 0xa8, 0xad, 0x6c, 0xe0, 0x2e, 0x73, 0x43, 0x3d, 0x1e, 0x93, 0xd7, 0xc9, 0x27, 0x9d, 0x4d, 0x60, 0xa7, 0xe8, 0x79, 0xee, 0x11, 0xf4, 0x41, 0xa0, 0x00, 0xf4, 0x8e, 0xd9, 0xf7, 0xc4, 0xed, 0x87, 0xa4, 0x51, 0x36, 0xd7, 0xdc, 0xcd, 0xca, 0x48, 0x21, 0x09, 0xc7, 0x8a, 0x51, 0x06, 0x2b, 0x3b, 0xa4, 0x04, 0x4a, 0xda, 0x24, 0x69 }, + { 0x02, 0x29, 0x39, 0xe2, 0x38, 0x6c, 0x5a, 0x37, 0x04, 0x98, 0x56, 0xc8, 0x50, 0xa2, 0xbb, 0x10, 0xa1, 0x3d, 0xfe, 0xa4, 0x21, 0x2b, 0x4c, 0x73, 0x2a, 0x88, 0x40, 0xa9, 0xff, 0xa5, 0xfa, 0xf5, 0x48, 0x75, 0xc5, 0x44, 0x88, 0x16, 0xb2, 0x78, 0x5a, 0x00, 0x7d, 0xa8, 0xa8, 0xd2, 0xbc, 0x7d, 0x71, 0xa5, 0x4e, 0x4e, 0x65, 0x71, 0xf1, 0x0b, 0x60, 0x0c, 0xbd, 0xb2, 0x5d, 0x13, 0xed, 0xe3 }, + { 0xe6, 0xfe, 0xc1, 0x9d, 0x89, 0xce, 0x87, 0x17, 0xb1, 0xa0, 0x87, 0x02, 0x46, 0x70, 0xfe, 0x02, 0x6f, 0x6c, 0x7c, 0xbd, 0xa1, 0x1c, 0xae, 0xf9, 0x59, 0xbb, 0x2d, 0x35, 0x1b, 0xf8, 0x56, 0xf8, 0x05, 0x5d, 0x1c, 0x0e, 0xbd, 0xaa, 0xa9, 0xd1, 0xb1, 0x78, 0x86, 0xfc, 0x2c, 0x56, 0x2b, 0x5e, 0x99, 0x64, 0x2f, 0xc0, 0x64, 0x71, 0x0c, 0x0d, 0x34, 0x88, 0xa0, 0x2b, 0x5e, 0xd7, 0xf6, 0xfd }, + { 0x94, 0xc9, 0x6f, 0x02, 0xa8, 0xf5, 0x76, 0xac, 0xa3, 0x2b, 0xa6, 0x1c, 0x2b, 0x20, 0x6f, 0x90, 0x72, 0x85, 0xd9, 0x29, 0x9b, 0x83, 0xac, 0x17, 0x5c, 0x20, 0x9a, 0x8d, 0x43, 0xd5, 0x3b, 0xfe, 0x68, 0x3d, 0xd1, 0xd8, 0x3e, 0x75, 0x49, 0xcb, 0x90, 0x6c, 0x28, 0xf5, 0x9a, 0xb7, 0xc4, 0x6f, 0x87, 0x51, 0x36, 0x6a, 0x28, 0xc3, 0x9d, 0xd5, 0xfe, 0x26, 0x93, 0xc9, 0x01, 0x96, 0x66, 0xc8 }, + { 0x31, 0xa0, 0xcd, 0x21, 0x5e, 0xbd, 0x2c, 0xb6, 0x1d, 0xe5, 0xb9, 0xed, 0xc9, 0x1e, 0x61, 0x95, 0xe3, 0x1c, 0x59, 0xa5, 0x64, 0x8d, 0x5c, 0x9f, 0x73, 0x7e, 0x12, 0x5b, 0x26, 0x05, 0x70, 0x8f, 0x2e, 0x32, 0x5a, 0xb3, 0x38, 0x1c, 0x8d, 0xce, 0x1a, 0x3e, 0x95, 0x88, 0x86, 0xf1, 0xec, 0xdc, 0x60, 0x31, 0x8f, 0x88, 0x2c, 0xfe, 0x20, 0xa2, 0x41, 0x91, 0x35, 0x2e, 0x61, 0x7b, 0x0f, 0x21 }, + { 0x91, 0xab, 0x50, 0x4a, 0x52, 0x2d, 0xce, 0x78, 0x77, 0x9f, 0x4c, 0x6c, 0x6b, 0xa2, 0xe6, 0xb6, 0xdb, 0x55, 0x65, 0xc7, 0x6d, 0x3e, 0x7e, 0x7c, 0x92, 0x0c, 0xaf, 0x7f, 0x75, 0x7e, 0xf9, 0xdb, 0x7c, 0x8f, 0xcf, 0x10, 0xe5, 0x7f, 0x03, 0x37, 0x9e, 0xa9, 0xbf, 0x75, 0xeb, 0x59, 0x89, 0x5d, 0x96, 0xe1, 0x49, 0x80, 0x0b, 0x6a, 0xae, 0x01, 0xdb, 0x77, 0x8b, 0xb9, 0x0a, 0xfb, 0xc9, 0x89 }, + { 0xd8, 0x5c, 0xab, 0xc6, 0xbd, 0x5b, 0x1a, 0x01, 0xa5, 0xaf, 0xd8, 0xc6, 0x73, 0x47, 0x40, 0xda, 0x9f, 0xd1, 0xc1, 0xac, 0xc6, 0xdb, 0x29, 0xbf, 0xc8, 0xa2, 0xe5, 0xb6, 0x68, 0xb0, 0x28, 0xb6, 0xb3, 0x15, 0x4b, 0xfb, 0x87, 0x03, 0xfa, 0x31, 0x80, 0x25, 0x1d, 0x58, 0x9a, 0xd3, 0x80, 0x40, 0xce, 0xb7, 0x07, 0xc4, 0xba, 0xd1, 0xb5, 0x34, 0x3c, 0xb4, 0x26, 0xb6, 0x1e, 0xaa, 0x49, 0xc1 }, + { 0xd6, 0x2e, 0xfb, 0xec, 0x2c, 0xa9, 0xc1, 0xf8, 0xbd, 0x66, 0xce, 0x8b, 0x3f, 0x6a, 0x89, 0x8c, 0xb3, 0xf7, 0x56, 0x6b, 0xa6, 0x56, 0x8c, 0x61, 0x8a, 0xd1, 0xfe, 0xb2, 0xb6, 0x5b, 0x76, 0xc3, 0xce, 0x1d, 0xd2, 0x0f, 0x73, 0x95, 0x37, 0x2f, 0xaf, 0x28, 0x42, 0x7f, 0x61, 0xc9, 0x27, 0x80, 0x49, 0xcf, 0x01, 0x40, 0xdf, 0x43, 0x4f, 0x56, 0x33, 0x04, 0x8c, 0x86, 0xb8, 0x1e, 0x03, 0x99 }, + { 0x7c, 0x8f, 0xdc, 0x61, 0x75, 0x43, 0x9e, 0x2c, 0x3d, 0xb1, 0x5b, 0xaf, 0xa7, 0xfb, 0x06, 0x14, 0x3a, 0x6a, 0x23, 0xbc, 0x90, 0xf4, 0x49, 0xe7, 0x9d, 0xee, 0xf7, 0x3c, 0x3d, 0x49, 0x2a, 0x67, 0x17, 0x15, 0xc1, 0x93, 0xb6, 0xfe, 0xa9, 0xf0, 0x36, 0x05, 0x0b, 0x94, 0x60, 0x69, 0x85, 0x6b, 0x89, 0x7e, 0x08, 0xc0, 0x07, 0x68, 0xf5, 0xee, 0x5d, 0xdc, 0xf7, 0x0b, 0x7c, 0xd6, 0xd0, 0xe0 }, + { 0x58, 0x60, 0x2e, 0xe7, 0x46, 0x8e, 0x6b, 0xc9, 0xdf, 0x21, 0xbd, 0x51, 0xb2, 0x3c, 0x00, 0x5f, 0x72, 0xd6, 0xcb, 0x01, 0x3f, 0x0a, 0x1b, 0x48, 0xcb, 0xec, 0x5e, 0xca, 0x29, 0x92, 0x99, 0xf9, 0x7f, 0x09, 0xf5, 0x4a, 0x9a, 0x01, 0x48, 0x3e, 0xae, 0xb3, 0x15, 0xa6, 0x47, 0x8b, 0xad, 0x37, 0xba, 0x47, 0xca, 0x13, 0x47, 0xc7, 0xc8, 0xfc, 0x9e, 0x66, 0x95, 0x59, 0x2c, 0x91, 0xd7, 0x23 }, + { 0x27, 0xf5, 0xb7, 0x9e, 0xd2, 0x56, 0xb0, 0x50, 0x99, 0x3d, 0x79, 0x34, 0x96, 0xed, 0xf4, 0x80, 0x7c, 0x1d, 0x85, 0xa7, 0xb0, 0xa6, 0x7c, 0x9c, 0x4f, 0xa9, 0x98, 0x60, 0x75, 0x0b, 0x0a, 0xe6, 0x69, 0x89, 0x67, 0x0a, 0x8f, 0xfd, 0x78, 0x56, 0xd7, 0xce, 0x41, 0x15, 0x99, 0xe5, 0x8c, 0x4d, 0x77, 0xb2, 0x32, 0xa6, 0x2b, 0xef, 0x64, 0xd1, 0x52, 0x75, 0xbe, 0x46, 0xa6, 0x82, 0x35, 0xff }, + { 0x39, 0x57, 0xa9, 0x76, 0xb9, 0xf1, 0x88, 0x7b, 0xf0, 0x04, 0xa8, 0xdc, 0xa9, 0x42, 0xc9, 0x2d, 0x2b, 0x37, 0xea, 0x52, 0x60, 0x0f, 0x25, 0xe0, 0xc9, 0xbc, 0x57, 0x07, 0xd0, 0x27, 0x9c, 0x00, 0xc6, 0xe8, 0x5a, 0x83, 0x9b, 0x0d, 0x2d, 0x8e, 0xb5, 0x9c, 0x51, 0xd9, 0x47, 0x88, 0xeb, 0xe6, 0x24, 0x74, 0xa7, 0x91, 0xca, 0xdf, 0x52, 0xcc, 0xcf, 0x20, 0xf5, 0x07, 0x0b, 0x65, 0x73, 0xfc }, + { 0xea, 0xa2, 0x37, 0x6d, 0x55, 0x38, 0x0b, 0xf7, 0x72, 0xec, 0xca, 0x9c, 0xb0, 0xaa, 0x46, 0x68, 0xc9, 0x5c, 0x70, 0x71, 0x62, 0xfa, 0x86, 0xd5, 0x18, 0xc8, 0xce, 0x0c, 0xa9, 0xbf, 0x73, 0x62, 0xb9, 0xf2, 0xa0, 0xad, 0xc3, 0xff, 0x59, 0x92, 0x2d, 0xf9, 0x21, 0xb9, 0x45, 0x67, 0xe8, 0x1e, 0x45, 0x2f, 0x6c, 0x1a, 0x07, 0xfc, 0x81, 0x7c, 0xeb, 0xe9, 0x96, 0x04, 0xb3, 0x50, 0x5d, 0x38 }, + { 0xc1, 0xe2, 0xc7, 0x8b, 0x6b, 0x27, 0x34, 0xe2, 0x48, 0x0e, 0xc5, 0x50, 0x43, 0x4c, 0xb5, 0xd6, 0x13, 0x11, 0x1a, 0xdc, 0xc2, 0x1d, 0x47, 0x55, 0x45, 0xc3, 0xb1, 0xb7, 0xe6, 0xff, 0x12, 0x44, 0x44, 0x76, 0xe5, 0xc0, 0x55, 0x13, 0x2e, 0x22, 0x29, 0xdc, 0x0f, 0x80, 0x70, 0x44, 0xbb, 0x91, 0x9b, 0x1a, 0x56, 0x62, 0xdd, 0x38, 0xa9, 0xee, 0x65, 0xe2, 0x43, 0xa3, 0x91, 0x1a, 0xed, 0x1a }, + { 0x8a, 0xb4, 0x87, 0x13, 0x38, 0x9d, 0xd0, 0xfc, 0xf9, 0xf9, 0x65, 0xd3, 0xce, 0x66, 0xb1, 0xe5, 0x59, 0xa1, 0xf8, 0xc5, 0x87, 0x41, 0xd6, 0x76, 0x83, 0xcd, 0x97, 0x13, 0x54, 0xf4, 0x52, 0xe6, 0x2d, 0x02, 0x07, 0xa6, 0x5e, 0x43, 0x6c, 0x5d, 0x5d, 0x8f, 0x8e, 0xe7, 0x1c, 0x6a, 0xbf, 0xe5, 0x0e, 0x66, 0x90, 0x04, 0xc3, 0x02, 0xb3, 0x1a, 0x7e, 0xa8, 0x31, 0x1d, 0x4a, 0x91, 0x60, 0x51 }, + { 0x24, 0xce, 0x0a, 0xdd, 0xaa, 0x4c, 0x65, 0x03, 0x8b, 0xd1, 0xb1, 0xc0, 0xf1, 0x45, 0x2a, 0x0b, 0x12, 0x87, 0x77, 0xaa, 0xbc, 0x94, 0xa2, 0x9d, 0xf2, 0xfd, 0x6c, 0x7e, 0x2f, 0x85, 0xf8, 0xab, 0x9a, 0xc7, 0xef, 0xf5, 0x16, 0xb0, 0xe0, 0xa8, 0x25, 0xc8, 0x4a, 0x24, 0xcf, 0xe4, 0x92, 0xea, 0xad, 0x0a, 0x63, 0x08, 0xe4, 0x6d, 0xd4, 0x2f, 0xe8, 0x33, 0x3a, 0xb9, 0x71, 0xbb, 0x30, 0xca }, + { 0x51, 0x54, 0xf9, 0x29, 0xee, 0x03, 0x04, 0x5b, 0x6b, 0x0c, 0x00, 0x04, 0xfa, 0x77, 0x8e, 0xde, 0xe1, 0xd1, 0x39, 0x89, 0x32, 0x67, 0xcc, 0x84, 0x82, 0x5a, 0xd7, 0xb3, 0x6c, 0x63, 0xde, 0x32, 0x79, 0x8e, 0x4a, 0x16, 0x6d, 0x24, 0x68, 0x65, 0x61, 0x35, 0x4f, 0x63, 0xb0, 0x07, 0x09, 0xa1, 0x36, 0x4b, 0x3c, 0x24, 0x1d, 0xe3, 0xfe, 0xbf, 0x07, 0x54, 0x04, 0x58, 0x97, 0x46, 0x7c, 0xd4 }, + { 0xe7, 0x4e, 0x90, 0x79, 0x20, 0xfd, 0x87, 0xbd, 0x5a, 0xd6, 0x36, 0xdd, 0x11, 0x08, 0x5e, 0x50, 0xee, 0x70, 0x45, 0x9c, 0x44, 0x3e, 0x1c, 0xe5, 0x80, 0x9a, 0xf2, 0xbc, 0x2e, 0xba, 0x39, 0xf9, 0xe6, 0xd7, 0x12, 0x8e, 0x0e, 0x37, 0x12, 0xc3, 0x16, 0xda, 0x06, 0xf4, 0x70, 0x5d, 0x78, 0xa4, 0x83, 0x8e, 0x28, 0x12, 0x1d, 0x43, 0x44, 0xa2, 0xc7, 0x9c, 0x5e, 0x0d, 0xb3, 0x07, 0xa6, 0x77 }, + { 0xbf, 0x91, 0xa2, 0x23, 0x34, 0xba, 0xc2, 0x0f, 0x3f, 0xd8, 0x06, 0x63, 0xb3, 0xcd, 0x06, 0xc4, 0xe8, 0x80, 0x2f, 0x30, 0xe6, 0xb5, 0x9f, 0x90, 0xd3, 0x03, 0x5c, 0xc9, 0x79, 0x8a, 0x21, 0x7e, 0xd5, 0xa3, 0x1a, 0xbb, 0xda, 0x7f, 0xa6, 0x84, 0x28, 0x27, 0xbd, 0xf2, 0xa7, 0xa1, 0xc2, 0x1f, 0x6f, 0xcf, 0xcc, 0xbb, 0x54, 0xc6, 0xc5, 0x29, 0x26, 0xf3, 0x2d, 0xa8, 0x16, 0x26, 0x9b, 0xe1 }, + { 0xd9, 0xd5, 0xc7, 0x4b, 0xe5, 0x12, 0x1b, 0x0b, 0xd7, 0x42, 0xf2, 0x6b, 0xff, 0xb8, 0xc8, 0x9f, 0x89, 0x17, 0x1f, 0x3f, 0x93, 0x49, 0x13, 0x49, 0x2b, 0x09, 0x03, 0xc2, 0x71, 0xbb, 0xe2, 0xb3, 0x39, 0x5e, 0xf2, 0x59, 0x66, 0x9b, 0xef, 0x43, 0xb5, 0x7f, 0x7f, 0xcc, 0x30, 0x27, 0xdb, 0x01, 0x82, 0x3f, 0x6b, 0xae, 0xe6, 0x6e, 0x4f, 0x9f, 0xea, 0xd4, 0xd6, 0x72, 0x6c, 0x74, 0x1f, 0xce }, + { 0x50, 0xc8, 0xb8, 0xcf, 0x34, 0xcd, 0x87, 0x9f, 0x80, 0xe2, 0xfa, 0xab, 0x32, 0x30, 0xb0, 0xc0, 0xe1, 0xcc, 0x3e, 0x9d, 0xca, 0xde, 0xb1, 0xb9, 0xd9, 0x7a, 0xb9, 0x23, 0x41, 0x5d, 0xd9, 0xa1, 0xfe, 0x38, 0xad, 0xdd, 0x5c, 0x11, 0x75, 0x6c, 0x67, 0x99, 0x0b, 0x25, 0x6e, 0x95, 0xad, 0x6d, 0x8f, 0x9f, 0xed, 0xce, 0x10, 0xbf, 0x1c, 0x90, 0x67, 0x9c, 0xde, 0x0e, 0xcf, 0x1b, 0xe3, 0x47 }, + { 0x0a, 0x38, 0x6e, 0x7c, 0xd5, 0xdd, 0x9b, 0x77, 0xa0, 0x35, 0xe0, 0x9f, 0xe6, 0xfe, 0xe2, 0xc8, 0xce, 0x61, 0xb5, 0x38, 0x3c, 0x87, 0xea, 0x43, 0x20, 0x50, 0x59, 0xc5, 0xe4, 0xcd, 0x4f, 0x44, 0x08, 0x31, 0x9b, 0xb0, 0xa8, 0x23, 0x60, 0xf6, 0xa5, 0x8e, 0x6c, 0x9c, 0xe3, 0xf4, 0x87, 0xc4, 0x46, 0x06, 0x3b, 0xf8, 0x13, 0xbc, 0x6b, 0xa5, 0x35, 0xe1, 0x7f, 0xc1, 0x82, 0x6c, 0xfc, 0x91 }, + { 0x1f, 0x14, 0x59, 0xcb, 0x6b, 0x61, 0xcb, 0xac, 0x5f, 0x0e, 0xfe, 0x8f, 0xc4, 0x87, 0x53, 0x8f, 0x42, 0x54, 0x89, 0x87, 0xfc, 0xd5, 0x62, 0x21, 0xcf, 0xa7, 0xbe, 0xb2, 0x25, 0x04, 0x76, 0x9e, 0x79, 0x2c, 0x45, 0xad, 0xfb, 0x1d, 0x6b, 0x3d, 0x60, 0xd7, 0xb7, 0x49, 0xc8, 0xa7, 0x5b, 0x0b, 0xdf, 0x14, 0xe8, 0xea, 0x72, 0x1b, 0x95, 0xdc, 0xa5, 0x38, 0xca, 0x6e, 0x25, 0x71, 0x12, 0x09 }, + { 0xe5, 0x8b, 0x38, 0x36, 0xb7, 0xd8, 0xfe, 0xdb, 0xb5, 0x0c, 0xa5, 0x72, 0x5c, 0x65, 0x71, 0xe7, 0x4c, 0x07, 0x85, 0xe9, 0x78, 0x21, 0xda, 0xb8, 0xb6, 0x29, 0x8c, 0x10, 0xe4, 0xc0, 0x79, 0xd4, 0xa6, 0xcd, 0xf2, 0x2f, 0x0f, 0xed, 0xb5, 0x50, 0x32, 0x92, 0x5c, 0x16, 0x74, 0x81, 0x15, 0xf0, 0x1a, 0x10, 0x5e, 0x77, 0xe0, 0x0c, 0xee, 0x3d, 0x07, 0x92, 0x4d, 0xc0, 0xd8, 0xf9, 0x06, 0x59 }, + { 0xb9, 0x29, 0xcc, 0x65, 0x05, 0xf0, 0x20, 0x15, 0x86, 0x72, 0xde, 0xda, 0x56, 0xd0, 0xdb, 0x08, 0x1a, 0x2e, 0xe3, 0x4c, 0x00, 0xc1, 0x10, 0x00, 0x29, 0xbd, 0xf8, 0xea, 0x98, 0x03, 0x4f, 0xa4, 0xbf, 0x3e, 0x86, 0x55, 0xec, 0x69, 0x7f, 0xe3, 0x6f, 0x40, 0x55, 0x3c, 0x5b, 0xb4, 0x68, 0x01, 0x64, 0x4a, 0x62, 0x7d, 0x33, 0x42, 0xf4, 0xfc, 0x92, 0xb6, 0x1f, 0x03, 0x29, 0x0f, 0xb3, 0x81 }, + { 0x72, 0xd3, 0x53, 0x99, 0x4b, 0x49, 0xd3, 0xe0, 0x31, 0x53, 0x92, 0x9a, 0x1e, 0x4d, 0x4f, 0x18, 0x8e, 0xe5, 0x8a, 0xb9, 0xe7, 0x2e, 0xe8, 0xe5, 0x12, 0xf2, 0x9b, 0xc7, 0x73, 0x91, 0x38, 0x19, 0xce, 0x05, 0x7d, 0xdd, 0x70, 0x02, 0xc0, 0x43, 0x3e, 0xe0, 0xa1, 0x61, 0x14, 0xe3, 0xd1, 0x56, 0xdd, 0x2c, 0x4a, 0x7e, 0x80, 0xee, 0x53, 0x37, 0x8b, 0x86, 0x70, 0xf2, 0x3e, 0x33, 0xef, 0x56 }, + { 0xc7, 0x0e, 0xf9, 0xbf, 0xd7, 0x75, 0xd4, 0x08, 0x17, 0x67, 0x37, 0xa0, 0x73, 0x6d, 0x68, 0x51, 0x7c, 0xe1, 0xaa, 0xad, 0x7e, 0x81, 0xa9, 0x3c, 0x8c, 0x1e, 0xd9, 0x67, 0xea, 0x21, 0x4f, 0x56, 0xc8, 0xa3, 0x77, 0xb1, 0x76, 0x3e, 0x67, 0x66, 0x15, 0xb6, 0x0f, 0x39, 0x88, 0x24, 0x1e, 0xae, 0x6e, 0xab, 0x96, 0x85, 0xa5, 0x12, 0x49, 0x29, 0xd2, 0x81, 0x88, 0xf2, 0x9e, 0xab, 0x06, 0xf7 }, + { 0xc2, 0x30, 0xf0, 0x80, 0x26, 0x79, 0xcb, 0x33, 0x82, 0x2e, 0xf8, 0xb3, 0xb2, 0x1b, 0xf7, 0xa9, 0xa2, 0x89, 0x42, 0x09, 0x29, 0x01, 0xd7, 0xda, 0xc3, 0x76, 0x03, 0x00, 0x83, 0x10, 0x26, 0xcf, 0x35, 0x4c, 0x92, 0x32, 0xdf, 0x3e, 0x08, 0x4d, 0x99, 0x03, 0x13, 0x0c, 0x60, 0x1f, 0x63, 0xc1, 0xf4, 0xa4, 0xa4, 0xb8, 0x10, 0x6e, 0x46, 0x8c, 0xd4, 0x43, 0xbb, 0xe5, 0xa7, 0x34, 0xf4, 0x5f }, + { 0x6f, 0x43, 0x09, 0x4c, 0xaf, 0xb5, 0xeb, 0xf1, 0xf7, 0xa4, 0x93, 0x7e, 0xc5, 0x0f, 0x56, 0xa4, 0xc9, 0xda, 0x30, 0x3c, 0xbb, 0x55, 0xac, 0x1f, 0x27, 0xf1, 0xf1, 0x97, 0x6c, 0xd9, 0x6b, 0xed, 0xa9, 0x46, 0x4f, 0x0e, 0x7b, 0x9c, 0x54, 0x62, 0x0b, 0x8a, 0x9f, 0xba, 0x98, 0x31, 0x64, 0xb8, 0xbe, 0x35, 0x78, 0x42, 0x5a, 0x02, 0x4f, 0x5f, 0xe1, 0x99, 0xc3, 0x63, 0x56, 0xb8, 0x89, 0x72 }, + { 0x37, 0x45, 0x27, 0x3f, 0x4c, 0x38, 0x22, 0x5d, 0xb2, 0x33, 0x73, 0x81, 0x87, 0x1a, 0x0c, 0x6a, 0xaf, 0xd3, 0xaf, 0x9b, 0x01, 0x8c, 0x88, 0xaa, 0x02, 0x02, 0x58, 0x50, 0xa5, 0xdc, 0x3a, 0x42, 0xa1, 0xa3, 0xe0, 0x3e, 0x56, 0xcb, 0xf1, 0xb0, 0x87, 0x6d, 0x63, 0xa4, 0x41, 0xf1, 0xd2, 0x85, 0x6a, 0x39, 0xb8, 0x80, 0x1e, 0xb5, 0xaf, 0x32, 0x52, 0x01, 0xc4, 0x15, 0xd6, 0x5e, 0x97, 0xfe }, + { 0xc5, 0x0c, 0x44, 0xcc, 0xa3, 0xec, 0x3e, 0xda, 0xae, 0x77, 0x9a, 0x7e, 0x17, 0x94, 0x50, 0xeb, 0xdd, 0xa2, 0xf9, 0x70, 0x67, 0xc6, 0x90, 0xaa, 0x6c, 0x5a, 0x4a, 0xc7, 0xc3, 0x01, 0x39, 0xbb, 0x27, 0xc0, 0xdf, 0x4d, 0xb3, 0x22, 0x0e, 0x63, 0xcb, 0x11, 0x0d, 0x64, 0xf3, 0x7f, 0xfe, 0x07, 0x8d, 0xb7, 0x26, 0x53, 0xe2, 0xda, 0xac, 0xf9, 0x3a, 0xe3, 0xf0, 0xa2, 0xd1, 0xa7, 0xeb, 0x2e }, + { 0x8a, 0xef, 0x26, 0x3e, 0x38, 0x5c, 0xbc, 0x61, 0xe1, 0x9b, 0x28, 0x91, 0x42, 0x43, 0x26, 0x2a, 0xf5, 0xaf, 0xe8, 0x72, 0x6a, 0xf3, 0xce, 0x39, 0xa7, 0x9c, 0x27, 0x02, 0x8c, 0xf3, 0xec, 0xd3, 0xf8, 0xd2, 0xdf, 0xd9, 0xcf, 0xc9, 0xad, 0x91, 0xb5, 0x8f, 0x6f, 0x20, 0x77, 0x8f, 0xd5, 0xf0, 0x28, 0x94, 0xa3, 0xd9, 0x1c, 0x7d, 0x57, 0xd1, 0xe4, 0xb8, 0x66, 0xa7, 0xf3, 0x64, 0xb6, 0xbe }, + { 0x28, 0x69, 0x61, 0x41, 0xde, 0x6e, 0x2d, 0x9b, 0xcb, 0x32, 0x35, 0x57, 0x8a, 0x66, 0x16, 0x6c, 0x14, 0x48, 0xd3, 0xe9, 0x05, 0xa1, 0xb4, 0x82, 0xd4, 0x23, 0xbe, 0x4b, 0xc5, 0x36, 0x9b, 0xc8, 0xc7, 0x4d, 0xae, 0x0a, 0xcc, 0x9c, 0xc1, 0x23, 0xe1, 0xd8, 0xdd, 0xce, 0x9f, 0x97, 0x91, 0x7e, 0x8c, 0x01, 0x9c, 0x55, 0x2d, 0xa3, 0x2d, 0x39, 0xd2, 0x21, 0x9b, 0x9a, 0xbf, 0x0f, 0xa8, 0xc8 }, + { 0x2f, 0xb9, 0xeb, 0x20, 0x85, 0x83, 0x01, 0x81, 0x90, 0x3a, 0x9d, 0xaf, 0xe3, 0xdb, 0x42, 0x8e, 0xe1, 0x5b, 0xe7, 0x66, 0x22, 0x24, 0xef, 0xd6, 0x43, 0x37, 0x1f, 0xb2, 0x56, 0x46, 0xae, 0xe7, 0x16, 0xe5, 0x31, 0xec, 0xa6, 0x9b, 0x2b, 0xdc, 0x82, 0x33, 0xf1, 0xa8, 0x08, 0x1f, 0xa4, 0x3d, 0xa1, 0x50, 0x03, 0x02, 0x97, 0x5a, 0x77, 0xf4, 0x2f, 0xa5, 0x92, 0x13, 0x67, 0x10, 0xe9, 0xdc }, + { 0x66, 0xf9, 0xa7, 0x14, 0x3f, 0x7a, 0x33, 0x14, 0xa6, 0x69, 0xbf, 0x2e, 0x24, 0xbb, 0xb3, 0x50, 0x14, 0x26, 0x1d, 0x63, 0x9f, 0x49, 0x5b, 0x6c, 0x9c, 0x1f, 0x10, 0x4f, 0xe8, 0xe3, 0x20, 0xac, 0xa6, 0x0d, 0x45, 0x50, 0xd6, 0x9d, 0x52, 0xed, 0xbd, 0x5a, 0x3c, 0xde, 0xb4, 0x01, 0x4a, 0xe6, 0x5b, 0x1d, 0x87, 0xaa, 0x77, 0x0b, 0x69, 0xae, 0x5c, 0x15, 0xf4, 0x33, 0x0b, 0x0b, 0x0a, 0xd8 }, + { 0xf4, 0xc4, 0xdd, 0x1d, 0x59, 0x4c, 0x35, 0x65, 0xe3, 0xe2, 0x5c, 0xa4, 0x3d, 0xad, 0x82, 0xf6, 0x2a, 0xbe, 0xa4, 0x83, 0x5e, 0xd4, 0xcd, 0x81, 0x1b, 0xcd, 0x97, 0x5e, 0x46, 0x27, 0x98, 0x28, 0xd4, 0x4d, 0x4c, 0x62, 0xc3, 0x67, 0x9f, 0x1b, 0x7f, 0x7b, 0x9d, 0xd4, 0x57, 0x1d, 0x7b, 0x49, 0x55, 0x73, 0x47, 0xb8, 0xc5, 0x46, 0x0c, 0xbd, 0xc1, 0xbe, 0xf6, 0x90, 0xfb, 0x2a, 0x08, 0xc0 }, + { 0x8f, 0x1d, 0xc9, 0x64, 0x9c, 0x3a, 0x84, 0x55, 0x1f, 0x8f, 0x6e, 0x91, 0xca, 0xc6, 0x82, 0x42, 0xa4, 0x3b, 0x1f, 0x8f, 0x32, 0x8e, 0xe9, 0x22, 0x80, 0x25, 0x73, 0x87, 0xfa, 0x75, 0x59, 0xaa, 0x6d, 0xb1, 0x2e, 0x4a, 0xea, 0xdc, 0x2d, 0x26, 0x09, 0x91, 0x78, 0x74, 0x9c, 0x68, 0x64, 0xb3, 0x57, 0xf3, 0xf8, 0x3b, 0x2f, 0xb3, 0xef, 0xa8, 0xd2, 0xa8, 0xdb, 0x05, 0x6b, 0xed, 0x6b, 0xcc }, + { 0x31, 0x39, 0xc1, 0xa7, 0xf9, 0x7a, 0xfd, 0x16, 0x75, 0xd4, 0x60, 0xeb, 0xbc, 0x07, 0xf2, 0x72, 0x8a, 0xa1, 0x50, 0xdf, 0x84, 0x96, 0x24, 0x51, 0x1e, 0xe0, 0x4b, 0x74, 0x3b, 0xa0, 0xa8, 0x33, 0x09, 0x2f, 0x18, 0xc1, 0x2d, 0xc9, 0x1b, 0x4d, 0xd2, 0x43, 0xf3, 0x33, 0x40, 0x2f, 0x59, 0xfe, 0x28, 0xab, 0xdb, 0xbb, 0xae, 0x30, 0x1e, 0x7b, 0x65, 0x9c, 0x7a, 0x26, 0xd5, 0xc0, 0xf9, 0x79 }, + { 0x06, 0xf9, 0x4a, 0x29, 0x96, 0x15, 0x8a, 0x81, 0x9f, 0xe3, 0x4c, 0x40, 0xde, 0x3c, 0xf0, 0x37, 0x9f, 0xd9, 0xfb, 0x85, 0xb3, 0xe3, 0x63, 0xba, 0x39, 0x26, 0xa0, 0xe7, 0xd9, 0x60, 0xe3, 0xf4, 0xc2, 0xe0, 0xc7, 0x0c, 0x7c, 0xe0, 0xcc, 0xb2, 0xa6, 0x4f, 0xc2, 0x98, 0x69, 0xf6, 0xe7, 0xab, 0x12, 0xbd, 0x4d, 0x3f, 0x14, 0xfc, 0xe9, 0x43, 0x27, 0x90, 0x27, 0xe7, 0x85, 0xfb, 0x5c, 0x29 }, + { 0xc2, 0x9c, 0x39, 0x9e, 0xf3, 0xee, 0xe8, 0x96, 0x1e, 0x87, 0x56, 0x5c, 0x1c, 0xe2, 0x63, 0x92, 0x5f, 0xc3, 0xd0, 0xce, 0x26, 0x7d, 0x13, 0xe4, 0x8d, 0xd9, 0xe7, 0x32, 0xee, 0x67, 0xb0, 0xf6, 0x9f, 0xad, 0x56, 0x40, 0x1b, 0x0f, 0x10, 0xfc, 0xaa, 0xc1, 0x19, 0x20, 0x10, 0x46, 0xcc, 0xa2, 0x8c, 0x5b, 0x14, 0xab, 0xde, 0xa3, 0x21, 0x2a, 0xe6, 0x55, 0x62, 0xf7, 0xf1, 0x38, 0xdb, 0x3d }, + { 0x4c, 0xec, 0x4c, 0x9d, 0xf5, 0x2e, 0xef, 0x05, 0xc3, 0xf6, 0xfa, 0xaa, 0x97, 0x91, 0xbc, 0x74, 0x45, 0x93, 0x71, 0x83, 0x22, 0x4e, 0xcc, 0x37, 0xa1, 0xe5, 0x8d, 0x01, 0x32, 0xd3, 0x56, 0x17, 0x53, 0x1d, 0x7e, 0x79, 0x5f, 0x52, 0xaf, 0x7b, 0x1e, 0xb9, 0xd1, 0x47, 0xde, 0x12, 0x92, 0xd3, 0x45, 0xfe, 0x34, 0x18, 0x23, 0xf8, 0xe6, 0xbc, 0x1e, 0x5b, 0xad, 0xca, 0x5c, 0x65, 0x61, 0x08 }, + { 0x89, 0x8b, 0xfb, 0xae, 0x93, 0xb3, 0xe1, 0x8d, 0x00, 0x69, 0x7e, 0xab, 0x7d, 0x97, 0x04, 0xfa, 0x36, 0xec, 0x33, 0x9d, 0x07, 0x61, 0x31, 0xce, 0xfd, 0xf3, 0x0e, 0xdb, 0xe8, 0xd9, 0xcc, 0x81, 0xc3, 0xa8, 0x0b, 0x12, 0x96, 0x59, 0xb1, 0x63, 0xa3, 0x23, 0xba, 0xb9, 0x79, 0x3d, 0x4f, 0xee, 0xd9, 0x2d, 0x54, 0xda, 0xe9, 0x66, 0xc7, 0x75, 0x29, 0x76, 0x4a, 0x09, 0xbe, 0x88, 0xdb, 0x45 }, + { 0xee, 0x9b, 0xd0, 0x46, 0x9d, 0x3a, 0xaf, 0x4f, 0x14, 0x03, 0x5b, 0xe4, 0x8a, 0x2c, 0x3b, 0x84, 0xd9, 0xb4, 0xb1, 0xff, 0xf1, 0xd9, 0x45, 0xe1, 0xf1, 0xc1, 0xd3, 0x89, 0x80, 0xa9, 0x51, 0xbe, 0x19, 0x7b, 0x25, 0xfe, 0x22, 0xc7, 0x31, 0xf2, 0x0a, 0xea, 0xcc, 0x93, 0x0b, 0xa9, 0xc4, 0xa1, 0xf4, 0x76, 0x22, 0x27, 0x61, 0x7a, 0xd3, 0x50, 0xfd, 0xab, 0xb4, 0xe8, 0x02, 0x73, 0xa0, 0xf4 }, + { 0x3d, 0x4d, 0x31, 0x13, 0x30, 0x05, 0x81, 0xcd, 0x96, 0xac, 0xbf, 0x09, 0x1c, 0x3d, 0x0f, 0x3c, 0x31, 0x01, 0x38, 0xcd, 0x69, 0x79, 0xe6, 0x02, 0x6c, 0xde, 0x62, 0x3e, 0x2d, 0xd1, 0xb2, 0x4d, 0x4a, 0x86, 0x38, 0xbe, 0xd1, 0x07, 0x33, 0x44, 0x78, 0x3a, 0xd0, 0x64, 0x9c, 0xc6, 0x30, 0x5c, 0xce, 0xc0, 0x4b, 0xeb, 0x49, 0xf3, 0x1c, 0x63, 0x30, 0x88, 0xa9, 0x9b, 0x65, 0x13, 0x02, 0x67 }, + { 0x95, 0xc0, 0x59, 0x1a, 0xd9, 0x1f, 0x92, 0x1a, 0xc7, 0xbe, 0x6d, 0x9c, 0xe3, 0x7e, 0x06, 0x63, 0xed, 0x80, 0x11, 0xc1, 0xcf, 0xd6, 0xd0, 0x16, 0x2a, 0x55, 0x72, 0xe9, 0x43, 0x68, 0xba, 0xc0, 0x20, 0x24, 0x48, 0x5e, 0x6a, 0x39, 0x85, 0x4a, 0xa4, 0x6f, 0xe3, 0x8e, 0x97, 0xd6, 0xc6, 0xb1, 0x94, 0x7c, 0xd2, 0x72, 0xd8, 0x6b, 0x06, 0xbb, 0x5b, 0x2f, 0x78, 0xb9, 0xb6, 0x8d, 0x55, 0x9d }, + { 0x22, 0x7b, 0x79, 0xde, 0xd3, 0x68, 0x15, 0x3b, 0xf4, 0x6c, 0x0a, 0x3c, 0xa9, 0x78, 0xbf, 0xdb, 0xef, 0x31, 0xf3, 0x02, 0x4a, 0x56, 0x65, 0x84, 0x24, 0x68, 0x49, 0x0b, 0x0f, 0xf7, 0x48, 0xae, 0x04, 0xe7, 0x83, 0x2e, 0xd4, 0xc9, 0xf4, 0x9d, 0xe9, 0xb1, 0x70, 0x67, 0x09, 0xd6, 0x23, 0xe5, 0xc8, 0xc1, 0x5e, 0x3c, 0xae, 0xca, 0xe8, 0xd5, 0xe4, 0x33, 0x43, 0x0f, 0xf7, 0x2f, 0x20, 0xeb }, + { 0x5d, 0x34, 0xf3, 0x95, 0x2f, 0x01, 0x05, 0xee, 0xf8, 0x8a, 0xe8, 0xb6, 0x4c, 0x6c, 0xe9, 0x5e, 0xbf, 0xad, 0xe0, 0xe0, 0x2c, 0x69, 0xb0, 0x87, 0x62, 0xa8, 0x71, 0x2d, 0x2e, 0x49, 0x11, 0xad, 0x3f, 0x94, 0x1f, 0xc4, 0x03, 0x4d, 0xc9, 0xb2, 0xe4, 0x79, 0xfd, 0xbc, 0xd2, 0x79, 0xb9, 0x02, 0xfa, 0xf5, 0xd8, 0x38, 0xbb, 0x2e, 0x0c, 0x64, 0x95, 0xd3, 0x72, 0xb5, 0xb7, 0x02, 0x98, 0x13 }, + { 0x7f, 0x93, 0x9b, 0xf8, 0x35, 0x3a, 0xbc, 0xe4, 0x9e, 0x77, 0xf1, 0x4f, 0x37, 0x50, 0xaf, 0x20, 0xb7, 0xb0, 0x39, 0x02, 0xe1, 0xa1, 0xe7, 0xfb, 0x6a, 0xaf, 0x76, 0xd0, 0x25, 0x9c, 0xd4, 0x01, 0xa8, 0x31, 0x90, 0xf1, 0x56, 0x40, 0xe7, 0x4f, 0x3e, 0x6c, 0x5a, 0x90, 0xe8, 0x39, 0xc7, 0x82, 0x1f, 0x64, 0x74, 0x75, 0x7f, 0x75, 0xc7, 0xbf, 0x90, 0x02, 0x08, 0x4d, 0xdc, 0x7a, 0x62, 0xdc }, + { 0x06, 0x2b, 0x61, 0xa2, 0xf9, 0xa3, 0x3a, 0x71, 0xd7, 0xd0, 0xa0, 0x61, 0x19, 0x64, 0x4c, 0x70, 0xb0, 0x71, 0x6a, 0x50, 0x4d, 0xe7, 0xe5, 0xe1, 0xbe, 0x49, 0xbd, 0x7b, 0x86, 0xe7, 0xed, 0x68, 0x17, 0x71, 0x4f, 0x9f, 0x0f, 0xc3, 0x13, 0xd0, 0x61, 0x29, 0x59, 0x7e, 0x9a, 0x22, 0x35, 0xec, 0x85, 0x21, 0xde, 0x36, 0xf7, 0x29, 0x0a, 0x90, 0xcc, 0xfc, 0x1f, 0xfa, 0x6d, 0x0a, 0xee, 0x29 }, + { 0xf2, 0x9e, 0x01, 0xee, 0xae, 0x64, 0x31, 0x1e, 0xb7, 0xf1, 0xc6, 0x42, 0x2f, 0x94, 0x6b, 0xf7, 0xbe, 0xa3, 0x63, 0x79, 0x52, 0x3e, 0x7b, 0x2b, 0xba, 0xba, 0x7d, 0x1d, 0x34, 0xa2, 0x2d, 0x5e, 0xa5, 0xf1, 0xc5, 0xa0, 0x9d, 0x5c, 0xe1, 0xfe, 0x68, 0x2c, 0xce, 0xd9, 0xa4, 0x79, 0x8d, 0x1a, 0x05, 0xb4, 0x6c, 0xd7, 0x2d, 0xff, 0x5c, 0x1b, 0x35, 0x54, 0x40, 0xb2, 0xa2, 0xd4, 0x76, 0xbc }, + { 0xec, 0x38, 0xcd, 0x3b, 0xba, 0xb3, 0xef, 0x35, 0xd7, 0xcb, 0x6d, 0x5c, 0x91, 0x42, 0x98, 0x35, 0x1d, 0x8a, 0x9d, 0xc9, 0x7f, 0xce, 0xe0, 0x51, 0xa8, 0xa0, 0x2f, 0x58, 0xe3, 0xed, 0x61, 0x84, 0xd0, 0xb7, 0x81, 0x0a, 0x56, 0x15, 0x41, 0x1a, 0xb1, 0xb9, 0x52, 0x09, 0xc3, 0xc8, 0x10, 0x11, 0x4f, 0xde, 0xb2, 0x24, 0x52, 0x08, 0x4e, 0x77, 0xf3, 0xf8, 0x47, 0xc6, 0xdb, 0xaa, 0xfe, 0x16 }, + { 0xc2, 0xae, 0xf5, 0xe0, 0xca, 0x43, 0xe8, 0x26, 0x41, 0x56, 0x5b, 0x8c, 0xb9, 0x43, 0xaa, 0x8b, 0xa5, 0x35, 0x50, 0xca, 0xef, 0x79, 0x3b, 0x65, 0x32, 0xfa, 0xfa, 0xd9, 0x4b, 0x81, 0x60, 0x82, 0xf0, 0x11, 0x3a, 0x3e, 0xa2, 0xf6, 0x36, 0x08, 0xab, 0x40, 0x43, 0x7e, 0xcc, 0x0f, 0x02, 0x29, 0xcb, 0x8f, 0xa2, 0x24, 0xdc, 0xf1, 0xc4, 0x78, 0xa6, 0x7d, 0x9b, 0x64, 0x16, 0x2b, 0x92, 0xd1 }, + { 0x15, 0xf5, 0x34, 0xef, 0xff, 0x71, 0x05, 0xcd, 0x1c, 0x25, 0x4d, 0x07, 0x4e, 0x27, 0xd5, 0x89, 0x8b, 0x89, 0x31, 0x3b, 0x7d, 0x36, 0x6d, 0xc2, 0xd7, 0xd8, 0x71, 0x13, 0xfa, 0x7d, 0x53, 0xaa, 0xe1, 0x3f, 0x6d, 0xba, 0x48, 0x7a, 0xd8, 0x10, 0x3d, 0x5e, 0x85, 0x4c, 0x91, 0xfd, 0xb6, 0xe1, 0xe7, 0x4b, 0x2e, 0xf6, 0xd1, 0x43, 0x17, 0x69, 0xc3, 0x07, 0x67, 0xdd, 0xe0, 0x67, 0xa3, 0x5c }, + { 0x89, 0xac, 0xbc, 0xa0, 0xb1, 0x69, 0x89, 0x7a, 0x0a, 0x27, 0x14, 0xc2, 0xdf, 0x8c, 0x95, 0xb5, 0xb7, 0x9c, 0xb6, 0x93, 0x90, 0x14, 0x2b, 0x7d, 0x60, 0x18, 0xbb, 0x3e, 0x30, 0x76, 0xb0, 0x99, 0xb7, 0x9a, 0x96, 0x41, 0x52, 0xa9, 0xd9, 0x12, 0xb1, 0xb8, 0x64, 0x12, 0xb7, 0xe3, 0x72, 0xe9, 0xce, 0xca, 0xd7, 0xf2, 0x5d, 0x4c, 0xba, 0xb8, 0xa3, 0x17, 0xbe, 0x36, 0x49, 0x2a, 0x67, 0xd7 }, + { 0xe3, 0xc0, 0x73, 0x91, 0x90, 0xed, 0x84, 0x9c, 0x9c, 0x96, 0x2f, 0xd9, 0xdb, 0xb5, 0x5e, 0x20, 0x7e, 0x62, 0x4f, 0xca, 0xc1, 0xeb, 0x41, 0x76, 0x91, 0x51, 0x54, 0x99, 0xee, 0xa8, 0xd8, 0x26, 0x7b, 0x7e, 0x8f, 0x12, 0x87, 0xa6, 0x36, 0x33, 0xaf, 0x50, 0x11, 0xfd, 0xe8, 0xc4, 0xdd, 0xf5, 0x5b, 0xfd, 0xf7, 0x22, 0xed, 0xf8, 0x88, 0x31, 0x41, 0x4f, 0x2c, 0xfa, 0xed, 0x59, 0xcb, 0x9a }, + { 0x8d, 0x6c, 0xf8, 0x7c, 0x08, 0x38, 0x0d, 0x2d, 0x15, 0x06, 0xee, 0xe4, 0x6f, 0xd4, 0x22, 0x2d, 0x21, 0xd8, 0xc0, 0x4e, 0x58, 0x5f, 0xbf, 0xd0, 0x82, 0x69, 0xc9, 0x8f, 0x70, 0x28, 0x33, 0xa1, 0x56, 0x32, 0x6a, 0x07, 0x24, 0x65, 0x64, 0x00, 0xee, 0x09, 0x35, 0x1d, 0x57, 0xb4, 0x40, 0x17, 0x5e, 0x2a, 0x5d, 0xe9, 0x3c, 0xc5, 0xf8, 0x0d, 0xb6, 0xda, 0xf8, 0x35, 0x76, 0xcf, 0x75, 0xfa }, + { 0xda, 0x24, 0xbe, 0xde, 0x38, 0x36, 0x66, 0xd5, 0x63, 0xee, 0xed, 0x37, 0xf6, 0x31, 0x9b, 0xaf, 0x20, 0xd5, 0xc7, 0x5d, 0x16, 0x35, 0xa6, 0xba, 0x5e, 0xf4, 0xcf, 0xa1, 0xac, 0x95, 0x48, 0x7e, 0x96, 0xf8, 0xc0, 0x8a, 0xf6, 0x00, 0xaa, 0xb8, 0x7c, 0x98, 0x6e, 0xba, 0xd4, 0x9f, 0xc7, 0x0a, 0x58, 0xb4, 0x89, 0x0b, 0x9c, 0x87, 0x6e, 0x09, 0x10, 0x16, 0xda, 0xf4, 0x9e, 0x1d, 0x32, 0x2e }, + { 0xf9, 0xd1, 0xd1, 0xb1, 0xe8, 0x7e, 0xa7, 0xae, 0x75, 0x3a, 0x02, 0x97, 0x50, 0xcc, 0x1c, 0xf3, 0xd0, 0x15, 0x7d, 0x41, 0x80, 0x5e, 0x24, 0x5c, 0x56, 0x17, 0xbb, 0x93, 0x4e, 0x73, 0x2f, 0x0a, 0xe3, 0x18, 0x0b, 0x78, 0xe0, 0x5b, 0xfe, 0x76, 0xc7, 0xc3, 0x05, 0x1e, 0x3e, 0x3a, 0xc7, 0x8b, 0x9b, 0x50, 0xc0, 0x51, 0x42, 0x65, 0x7e, 0x1e, 0x03, 0x21, 0x5d, 0x6e, 0xc7, 0xbf, 0xd0, 0xfc }, + { 0x11, 0xb7, 0xbc, 0x16, 0x68, 0x03, 0x20, 0x48, 0xaa, 0x43, 0x34, 0x3d, 0xe4, 0x76, 0x39, 0x5e, 0x81, 0x4b, 0xbb, 0xc2, 0x23, 0x67, 0x8d, 0xb9, 0x51, 0xa1, 0xb0, 0x3a, 0x02, 0x1e, 0xfa, 0xc9, 0x48, 0xcf, 0xbe, 0x21, 0x5f, 0x97, 0xfe, 0x9a, 0x72, 0xa2, 0xf6, 0xbc, 0x03, 0x9e, 0x39, 0x56, 0xbf, 0xa4, 0x17, 0xc1, 0xa9, 0xf1, 0x0d, 0x6d, 0x7b, 0xa5, 0xd3, 0xd3, 0x2f, 0xf3, 0x23, 0xe5 }, + { 0xb8, 0xd9, 0x00, 0x0e, 0x4f, 0xc2, 0xb0, 0x66, 0xed, 0xb9, 0x1a, 0xfe, 0xe8, 0xe7, 0xeb, 0x0f, 0x24, 0xe3, 0xa2, 0x01, 0xdb, 0x8b, 0x67, 0x93, 0xc0, 0x60, 0x85, 0x81, 0xe6, 0x28, 0xed, 0x0b, 0xcc, 0x4e, 0x5a, 0xa6, 0x78, 0x79, 0x92, 0xa4, 0xbc, 0xc4, 0x4e, 0x28, 0x80, 0x93, 0xe6, 0x3e, 0xe8, 0x3a, 0xbd, 0x0b, 0xc3, 0xec, 0x6d, 0x09, 0x34, 0xa6, 0x74, 0xa4, 0xda, 0x13, 0x83, 0x8a }, + { 0xce, 0x32, 0x5e, 0x29, 0x4f, 0x9b, 0x67, 0x19, 0xd6, 0xb6, 0x12, 0x78, 0x27, 0x6a, 0xe0, 0x6a, 0x25, 0x64, 0xc0, 0x3b, 0xb0, 0xb7, 0x83, 0xfa, 0xfe, 0x78, 0x5b, 0xdf, 0x89, 0xc7, 0xd5, 0xac, 0xd8, 0x3e, 0x78, 0x75, 0x6d, 0x30, 0x1b, 0x44, 0x56, 0x99, 0x02, 0x4e, 0xae, 0xb7, 0x7b, 0x54, 0xd4, 0x77, 0x33, 0x6e, 0xc2, 0xa4, 0xf3, 0x32, 0xf2, 0xb3, 0xf8, 0x87, 0x65, 0xdd, 0xb0, 0xc3 }, + { 0x29, 0xac, 0xc3, 0x0e, 0x96, 0x03, 0xae, 0x2f, 0xcc, 0xf9, 0x0b, 0xf9, 0x7e, 0x6c, 0xc4, 0x63, 0xeb, 0xe2, 0x8c, 0x1b, 0x2f, 0x9b, 0x4b, 0x76, 0x5e, 0x70, 0x53, 0x7c, 0x25, 0xc7, 0x02, 0xa2, 0x9d, 0xcb, 0xfb, 0xf1, 0x4c, 0x99, 0xc5, 0x43, 0x45, 0xba, 0x2b, 0x51, 0xf1, 0x7b, 0x77, 0xb5, 0xf1, 0x5d, 0xb9, 0x2b, 0xba, 0xd8, 0xfa, 0x95, 0xc4, 0x71, 0xf5, 0xd0, 0x70, 0xa1, 0x37, 0xcc }, + { 0x33, 0x79, 0xcb, 0xaa, 0xe5, 0x62, 0xa8, 0x7b, 0x4c, 0x04, 0x25, 0x55, 0x0f, 0xfd, 0xd6, 0xbf, 0xe1, 0x20, 0x3f, 0x0d, 0x66, 0x6c, 0xc7, 0xea, 0x09, 0x5b, 0xe4, 0x07, 0xa5, 0xdf, 0xe6, 0x1e, 0xe9, 0x14, 0x41, 0xcd, 0x51, 0x54, 0xb3, 0xe5, 0x3b, 0x4f, 0x5f, 0xb3, 0x1a, 0xd4, 0xc7, 0xa9, 0xad, 0x5c, 0x7a, 0xf4, 0xae, 0x67, 0x9a, 0xa5, 0x1a, 0x54, 0x00, 0x3a, 0x54, 0xca, 0x6b, 0x2d }, + { 0x30, 0x95, 0xa3, 0x49, 0xd2, 0x45, 0x70, 0x8c, 0x7c, 0xf5, 0x50, 0x11, 0x87, 0x03, 0xd7, 0x30, 0x2c, 0x27, 0xb6, 0x0a, 0xf5, 0xd4, 0xe6, 0x7f, 0xc9, 0x78, 0xf8, 0xa4, 0xe6, 0x09, 0x53, 0xc7, 0xa0, 0x4f, 0x92, 0xfc, 0xf4, 0x1a, 0xee, 0x64, 0x32, 0x1c, 0xcb, 0x70, 0x7a, 0x89, 0x58, 0x51, 0x55, 0x2b, 0x1e, 0x37, 0xb0, 0x0b, 0xc5, 0xe6, 0xb7, 0x2f, 0xa5, 0xbc, 0xef, 0x9e, 0x3f, 0xff }, + { 0x07, 0x26, 0x2d, 0x73, 0x8b, 0x09, 0x32, 0x1f, 0x4d, 0xbc, 0xce, 0xc4, 0xbb, 0x26, 0xf4, 0x8c, 0xb0, 0xf0, 0xed, 0x24, 0x6c, 0xe0, 0xb3, 0x1b, 0x9a, 0x6e, 0x7b, 0xc6, 0x83, 0x04, 0x9f, 0x1f, 0x3e, 0x55, 0x45, 0xf2, 0x8c, 0xe9, 0x32, 0xdd, 0x98, 0x5c, 0x5a, 0xb0, 0xf4, 0x3b, 0xd6, 0xde, 0x07, 0x70, 0x56, 0x0a, 0xf3, 0x29, 0x06, 0x5e, 0xd2, 0xe4, 0x9d, 0x34, 0x62, 0x4c, 0x2c, 0xbb }, + { 0xb6, 0x40, 0x5e, 0xca, 0x8e, 0xe3, 0x31, 0x6c, 0x87, 0x06, 0x1c, 0xc6, 0xec, 0x18, 0xdb, 0xa5, 0x3e, 0x6c, 0x25, 0x0c, 0x63, 0xba, 0x1f, 0x3b, 0xae, 0x9e, 0x55, 0xdd, 0x34, 0x98, 0x03, 0x6a, 0xf0, 0x8c, 0xd2, 0x72, 0xaa, 0x24, 0xd7, 0x13, 0xc6, 0x02, 0x0d, 0x77, 0xab, 0x2f, 0x39, 0x19, 0xaf, 0x1a, 0x32, 0xf3, 0x07, 0x42, 0x06, 0x18, 0xab, 0x97, 0xe7, 0x39, 0x53, 0x99, 0x4f, 0xb4 }, + { 0x7e, 0xe6, 0x82, 0xf6, 0x31, 0x48, 0xee, 0x45, 0xf6, 0xe5, 0x31, 0x5d, 0xa8, 0x1e, 0x5c, 0x6e, 0x55, 0x7c, 0x2c, 0x34, 0x64, 0x1f, 0xc5, 0x09, 0xc7, 0xa5, 0x70, 0x10, 0x88, 0xc3, 0x8a, 0x74, 0x75, 0x61, 0x68, 0xe2, 0xcd, 0x8d, 0x35, 0x1e, 0x88, 0xfd, 0x1a, 0x45, 0x1f, 0x36, 0x0a, 0x01, 0xf5, 0xb2, 0x58, 0x0f, 0x9b, 0x5a, 0x2e, 0x8c, 0xfc, 0x13, 0x8f, 0x3d, 0xd5, 0x9a, 0x3f, 0xfc }, + { 0x1d, 0x26, 0x3c, 0x17, 0x9d, 0x6b, 0x26, 0x8f, 0x6f, 0xa0, 0x16, 0xf3, 0xa4, 0xf2, 0x9e, 0x94, 0x38, 0x91, 0x12, 0x5e, 0xd8, 0x59, 0x3c, 0x81, 0x25, 0x60, 0x59, 0xf5, 0xa7, 0xb4, 0x4a, 0xf2, 0xdc, 0xb2, 0x03, 0x0d, 0x17, 0x5c, 0x00, 0xe6, 0x2e, 0xca, 0xf7, 0xee, 0x96, 0x68, 0x2a, 0xa0, 0x7a, 0xb2, 0x0a, 0x61, 0x10, 0x24, 0xa2, 0x85, 0x32, 0xb1, 0xc2, 0x5b, 0x86, 0x65, 0x79, 0x02 }, + { 0x10, 0x6d, 0x13, 0x2c, 0xbd, 0xb4, 0xcd, 0x25, 0x97, 0x81, 0x28, 0x46, 0xe2, 0xbc, 0x1b, 0xf7, 0x32, 0xfe, 0xc5, 0xf0, 0xa5, 0xf6, 0x5d, 0xbb, 0x39, 0xec, 0x4e, 0x6d, 0xc6, 0x4a, 0xb2, 0xce, 0x6d, 0x24, 0x63, 0x0d, 0x0f, 0x15, 0xa8, 0x05, 0xc3, 0x54, 0x00, 0x25, 0xd8, 0x4a, 0xfa, 0x98, 0xe3, 0x67, 0x03, 0xc3, 0xdb, 0xee, 0x71, 0x3e, 0x72, 0xdd, 0xe8, 0x46, 0x5b, 0xc1, 0xbe, 0x7e }, + { 0x0e, 0x79, 0x96, 0x82, 0x26, 0x65, 0x06, 0x67, 0xa8, 0xd8, 0x62, 0xea, 0x8d, 0xa4, 0x89, 0x1a, 0xf5, 0x6a, 0x4e, 0x3a, 0x8b, 0x6d, 0x17, 0x50, 0xe3, 0x94, 0xf0, 0xde, 0xa7, 0x6d, 0x64, 0x0d, 0x85, 0x07, 0x7b, 0xce, 0xc2, 0xcc, 0x86, 0x88, 0x6e, 0x50, 0x67, 0x51, 0xb4, 0xf6, 0xa5, 0x83, 0x8f, 0x7f, 0x0b, 0x5f, 0xef, 0x76, 0x5d, 0x9d, 0xc9, 0x0d, 0xcd, 0xcb, 0xaf, 0x07, 0x9f, 0x08 }, + { 0x52, 0x11, 0x56, 0xa8, 0x2a, 0xb0, 0xc4, 0xe5, 0x66, 0xe5, 0x84, 0x4d, 0x5e, 0x31, 0xad, 0x9a, 0xaf, 0x14, 0x4b, 0xbd, 0x5a, 0x46, 0x4f, 0xdc, 0xa3, 0x4d, 0xbd, 0x57, 0x17, 0xe8, 0xff, 0x71, 0x1d, 0x3f, 0xfe, 0xbb, 0xfa, 0x08, 0x5d, 0x67, 0xfe, 0x99, 0x6a, 0x34, 0xf6, 0xd3, 0xe4, 0xe6, 0x0b, 0x13, 0x96, 0xbf, 0x4b, 0x16, 0x10, 0xc2, 0x63, 0xbd, 0xbb, 0x83, 0x4d, 0x56, 0x08, 0x16 }, + { 0x1a, 0xba, 0x88, 0xbe, 0xfc, 0x55, 0xbc, 0x25, 0xef, 0xbc, 0xe0, 0x2d, 0xb8, 0xb9, 0x93, 0x3e, 0x46, 0xf5, 0x76, 0x61, 0xba, 0xea, 0xbe, 0xb2, 0x1c, 0xc2, 0x57, 0x4d, 0x2a, 0x51, 0x8a, 0x3c, 0xba, 0x5d, 0xc5, 0xa3, 0x8e, 0x49, 0x71, 0x34, 0x40, 0xb2, 0x5f, 0x9c, 0x74, 0x4e, 0x75, 0xf6, 0xb8, 0x5c, 0x9d, 0x8f, 0x46, 0x81, 0xf6, 0x76, 0x16, 0x0f, 0x61, 0x05, 0x35, 0x7b, 0x84, 0x06 }, + { 0x5a, 0x99, 0x49, 0xfc, 0xb2, 0xc4, 0x73, 0xcd, 0xa9, 0x68, 0xac, 0x1b, 0x5d, 0x08, 0x56, 0x6d, 0xc2, 0xd8, 0x16, 0xd9, 0x60, 0xf5, 0x7e, 0x63, 0xb8, 0x98, 0xfa, 0x70, 0x1c, 0xf8, 0xeb, 0xd3, 0xf5, 0x9b, 0x12, 0x4d, 0x95, 0xbf, 0xbb, 0xed, 0xc5, 0xf1, 0xcf, 0x0e, 0x17, 0xd5, 0xea, 0xed, 0x0c, 0x02, 0xc5, 0x0b, 0x69, 0xd8, 0xa4, 0x02, 0xca, 0xbc, 0xca, 0x44, 0x33, 0xb5, 0x1f, 0xd4 }, + { 0xb0, 0xce, 0xad, 0x09, 0x80, 0x7c, 0x67, 0x2a, 0xf2, 0xeb, 0x2b, 0x0f, 0x06, 0xdd, 0xe4, 0x6c, 0xf5, 0x37, 0x0e, 0x15, 0xa4, 0x09, 0x6b, 0x1a, 0x7d, 0x7c, 0xbb, 0x36, 0xec, 0x31, 0xc2, 0x05, 0xfb, 0xef, 0xca, 0x00, 0xb7, 0xa4, 0x16, 0x2f, 0xa8, 0x9f, 0xb4, 0xfb, 0x3e, 0xb7, 0x8d, 0x79, 0x77, 0x0c, 0x23, 0xf4, 0x4e, 0x72, 0x06, 0x66, 0x4c, 0xe3, 0xcd, 0x93, 0x1c, 0x29, 0x1e, 0x5d }, + { 0xbb, 0x66, 0x64, 0x93, 0x1e, 0xc9, 0x70, 0x44, 0xe4, 0x5b, 0x2a, 0xe4, 0x20, 0xae, 0x1c, 0x55, 0x1a, 0x88, 0x74, 0xbc, 0x93, 0x7d, 0x08, 0xe9, 0x69, 0x39, 0x9c, 0x39, 0x64, 0xeb, 0xdb, 0xa8, 0x34, 0x6c, 0xdd, 0x5d, 0x09, 0xca, 0xaf, 0xe4, 0xc2, 0x8b, 0xa7, 0xec, 0x78, 0x81, 0x91, 0xce, 0xca, 0x65, 0xdd, 0xd6, 0xf9, 0x5f, 0x18, 0x58, 0x3e, 0x04, 0x0d, 0x0f, 0x30, 0xd0, 0x36, 0x4d }, + { 0x65, 0xbc, 0x77, 0x0a, 0x5f, 0xaa, 0x37, 0x92, 0x36, 0x98, 0x03, 0x68, 0x3e, 0x84, 0x4b, 0x0b, 0xe7, 0xee, 0x96, 0xf2, 0x9f, 0x6d, 0x6a, 0x35, 0x56, 0x80, 0x06, 0xbd, 0x55, 0x90, 0xf9, 0xa4, 0xef, 0x63, 0x9b, 0x7a, 0x80, 0x61, 0xc7, 0xb0, 0x42, 0x4b, 0x66, 0xb6, 0x0a, 0xc3, 0x4a, 0xf3, 0x11, 0x99, 0x05, 0xf3, 0x3a, 0x9d, 0x8c, 0x3a, 0xe1, 0x83, 0x82, 0xca, 0x9b, 0x68, 0x99, 0x00 }, + { 0xea, 0x9b, 0x4d, 0xca, 0x33, 0x33, 0x36, 0xaa, 0xf8, 0x39, 0xa4, 0x5c, 0x6e, 0xaa, 0x48, 0xb8, 0xcb, 0x4c, 0x7d, 0xda, 0xbf, 0xfe, 0xa4, 0xf6, 0x43, 0xd6, 0x35, 0x7e, 0xa6, 0x62, 0x8a, 0x48, 0x0a, 0x5b, 0x45, 0xf2, 0xb0, 0x52, 0xc1, 0xb0, 0x7d, 0x1f, 0xed, 0xca, 0x91, 0x8b, 0x6f, 0x11, 0x39, 0xd8, 0x0f, 0x74, 0xc2, 0x45, 0x10, 0xdc, 0xba, 0xa4, 0xbe, 0x70, 0xea, 0xcc, 0x1b, 0x06 }, + { 0xe6, 0x34, 0x2f, 0xb4, 0xa7, 0x80, 0xad, 0x97, 0x5d, 0x0e, 0x24, 0xbc, 0xe1, 0x49, 0x98, 0x9b, 0x91, 0xd3, 0x60, 0x55, 0x7e, 0x87, 0x99, 0x4f, 0x6b, 0x45, 0x7b, 0x89, 0x55, 0x75, 0xcc, 0x02, 0xd0, 0xc1, 0x5b, 0xad, 0x3c, 0xe7, 0x57, 0x7f, 0x4c, 0x63, 0x92, 0x7f, 0xf1, 0x3f, 0x3e, 0x38, 0x1f, 0xf7, 0xe7, 0x2b, 0xdb, 0xe7, 0x45, 0x32, 0x48, 0x44, 0xa9, 0xd2, 0x7e, 0x3f, 0x1c, 0x01 }, + { 0x3e, 0x20, 0x9c, 0x9b, 0x33, 0xe8, 0xe4, 0x61, 0x17, 0x8a, 0xb4, 0x6b, 0x1c, 0x64, 0xb4, 0x9a, 0x07, 0xfb, 0x74, 0x5f, 0x1c, 0x8b, 0xc9, 0x5f, 0xbf, 0xb9, 0x4c, 0x6b, 0x87, 0xc6, 0x95, 0x16, 0x65, 0x1b, 0x26, 0x4e, 0xf9, 0x80, 0x93, 0x7f, 0xad, 0x41, 0x23, 0x8b, 0x91, 0xdd, 0xc0, 0x11, 0xa5, 0xdd, 0x77, 0x7c, 0x7e, 0xfd, 0x44, 0x94, 0xb4, 0xb6, 0xec, 0xd3, 0xa9, 0xc2, 0x2a, 0xc0 }, + { 0xfd, 0x6a, 0x3d, 0x5b, 0x18, 0x75, 0xd8, 0x04, 0x86, 0xd6, 0xe6, 0x96, 0x94, 0xa5, 0x6d, 0xbb, 0x04, 0xa9, 0x9a, 0x4d, 0x05, 0x1f, 0x15, 0xdb, 0x26, 0x89, 0x77, 0x6b, 0xa1, 0xc4, 0x88, 0x2e, 0x6d, 0x46, 0x2a, 0x60, 0x3b, 0x70, 0x15, 0xdc, 0x9f, 0x4b, 0x74, 0x50, 0xf0, 0x53, 0x94, 0x30, 0x3b, 0x86, 0x52, 0xcf, 0xb4, 0x04, 0xa2, 0x66, 0x96, 0x2c, 0x41, 0xba, 0xe6, 0xe1, 0x8a, 0x94 }, + { 0x95, 0x1e, 0x27, 0x51, 0x7e, 0x6b, 0xad, 0x9e, 0x41, 0x95, 0xfc, 0x86, 0x71, 0xde, 0xe3, 0xe7, 0xe9, 0xbe, 0x69, 0xce, 0xe1, 0x42, 0x2c, 0xb9, 0xfe, 0xcf, 0xce, 0x0d, 0xba, 0x87, 0x5f, 0x7b, 0x31, 0x0b, 0x93, 0xee, 0x3a, 0x3d, 0x55, 0x8f, 0x94, 0x1f, 0x63, 0x5f, 0x66, 0x8f, 0xf8, 0x32, 0xd2, 0xc1, 0xd0, 0x33, 0xc5, 0xe2, 0xf0, 0x99, 0x7e, 0x4c, 0x66, 0xf1, 0x47, 0x34, 0x4e, 0x02 }, + { 0x8e, 0xba, 0x2f, 0x87, 0x4f, 0x1a, 0xe8, 0x40, 0x41, 0x90, 0x3c, 0x7c, 0x42, 0x53, 0xc8, 0x22, 0x92, 0x53, 0x0f, 0xc8, 0x50, 0x95, 0x50, 0xbf, 0xdc, 0x34, 0xc9, 0x5c, 0x7e, 0x28, 0x89, 0xd5, 0x65, 0x0b, 0x0a, 0xd8, 0xcb, 0x98, 0x8e, 0x5c, 0x48, 0x94, 0xcb, 0x87, 0xfb, 0xfb, 0xb1, 0x96, 0x12, 0xea, 0x93, 0xcc, 0xc4, 0xc5, 0xca, 0xd1, 0x71, 0x58, 0xb9, 0x76, 0x34, 0x64, 0xb4, 0x92 }, + { 0x16, 0xf7, 0x12, 0xea, 0xa1, 0xb7, 0xc6, 0x35, 0x47, 0x19, 0xa8, 0xe7, 0xdb, 0xdf, 0xaf, 0x55, 0xe4, 0x06, 0x3a, 0x4d, 0x27, 0x7d, 0x94, 0x75, 0x50, 0x01, 0x9b, 0x38, 0xdf, 0xb5, 0x64, 0x83, 0x09, 0x11, 0x05, 0x7d, 0x50, 0x50, 0x61, 0x36, 0xe2, 0x39, 0x4c, 0x3b, 0x28, 0x94, 0x5c, 0xc9, 0x64, 0x96, 0x7d, 0x54, 0xe3, 0x00, 0x0c, 0x21, 0x81, 0x62, 0x6c, 0xfb, 0x9b, 0x73, 0xef, 0xd2 }, + { 0xc3, 0x96, 0x39, 0xe7, 0xd5, 0xc7, 0xfb, 0x8c, 0xdd, 0x0f, 0xd3, 0xe6, 0xa5, 0x20, 0x96, 0x03, 0x94, 0x37, 0x12, 0x2f, 0x21, 0xc7, 0x8f, 0x16, 0x79, 0xce, 0xa9, 0xd7, 0x8a, 0x73, 0x4c, 0x56, 0xec, 0xbe, 0xb2, 0x86, 0x54, 0xb4, 0xf1, 0x8e, 0x34, 0x2c, 0x33, 0x1f, 0x6f, 0x72, 0x29, 0xec, 0x4b, 0x4b, 0xc2, 0x81, 0xb2, 0xd8, 0x0a, 0x6e, 0xb5, 0x00, 0x43, 0xf3, 0x17, 0x96, 0xc8, 0x8c }, + { 0x72, 0xd0, 0x81, 0xaf, 0x99, 0xf8, 0xa1, 0x73, 0xdc, 0xc9, 0xa0, 0xac, 0x4e, 0xb3, 0x55, 0x74, 0x05, 0x63, 0x9a, 0x29, 0x08, 0x4b, 0x54, 0xa4, 0x01, 0x72, 0x91, 0x2a, 0x2f, 0x8a, 0x39, 0x51, 0x29, 0xd5, 0x53, 0x6f, 0x09, 0x18, 0xe9, 0x02, 0xf9, 0xe8, 0xfa, 0x60, 0x00, 0x99, 0x5f, 0x41, 0x68, 0xdd, 0xc5, 0xf8, 0x93, 0x01, 0x1b, 0xe6, 0xa0, 0xdb, 0xc9, 0xb8, 0xa1, 0xa3, 0xf5, 0xbb }, + { 0xc1, 0x1a, 0xa8, 0x1e, 0x5e, 0xfd, 0x24, 0xd5, 0xfc, 0x27, 0xee, 0x58, 0x6c, 0xfd, 0x88, 0x47, 0xfb, 0xb0, 0xe2, 0x76, 0x01, 0xcc, 0xec, 0xe5, 0xec, 0xca, 0x01, 0x98, 0xe3, 0xc7, 0x76, 0x53, 0x93, 0xbb, 0x74, 0x45, 0x7c, 0x7e, 0x7a, 0x27, 0xeb, 0x91, 0x70, 0x35, 0x0e, 0x1f, 0xb5, 0x38, 0x57, 0x17, 0x75, 0x06, 0xbe, 0x3e, 0x76, 0x2c, 0xc0, 0xf1, 0x4d, 0x8c, 0x3a, 0xfe, 0x90, 0x77 }, + { 0xc2, 0x8f, 0x21, 0x50, 0xb4, 0x52, 0xe6, 0xc0, 0xc4, 0x24, 0xbc, 0xde, 0x6f, 0x8d, 0x72, 0x00, 0x7f, 0x93, 0x10, 0xfe, 0xd7, 0xf2, 0xf8, 0x7d, 0xe0, 0xdb, 0xb6, 0x4f, 0x44, 0x79, 0xd6, 0xc1, 0x44, 0x1b, 0xa6, 0x6f, 0x44, 0xb2, 0xac, 0xce, 0xe6, 0x16, 0x09, 0x17, 0x7e, 0xd3, 0x40, 0x12, 0x8b, 0x40, 0x7e, 0xce, 0xc7, 0xc6, 0x4b, 0xbe, 0x50, 0xd6, 0x3d, 0x22, 0xd8, 0x62, 0x77, 0x27 }, + { 0xf6, 0x3d, 0x88, 0x12, 0x28, 0x77, 0xec, 0x30, 0xb8, 0xc8, 0xb0, 0x0d, 0x22, 0xe8, 0x90, 0x00, 0xa9, 0x66, 0x42, 0x61, 0x12, 0xbd, 0x44, 0x16, 0x6e, 0x2f, 0x52, 0x5b, 0x76, 0x9c, 0xcb, 0xe9, 0xb2, 0x86, 0xd4, 0x37, 0xa0, 0x12, 0x91, 0x30, 0xdd, 0xe1, 0xa8, 0x6c, 0x43, 0xe0, 0x4b, 0xed, 0xb5, 0x94, 0xe6, 0x71, 0xd9, 0x82, 0x83, 0xaf, 0xe6, 0x4c, 0xe3, 0x31, 0xde, 0x98, 0x28, 0xfd }, + { 0x34, 0x8b, 0x05, 0x32, 0x88, 0x0b, 0x88, 0xa6, 0x61, 0x4a, 0x8d, 0x74, 0x08, 0xc3, 0xf9, 0x13, 0x35, 0x7f, 0xbb, 0x60, 0xe9, 0x95, 0xc6, 0x02, 0x05, 0xbe, 0x91, 0x39, 0xe7, 0x49, 0x98, 0xae, 0xde, 0x7f, 0x45, 0x81, 0xe4, 0x2f, 0x6b, 0x52, 0x69, 0x8f, 0x7f, 0xa1, 0x21, 0x97, 0x08, 0xc1, 0x44, 0x98, 0x06, 0x7f, 0xd1, 0xe0, 0x95, 0x02, 0xde, 0x83, 0xa7, 0x7d, 0xd2, 0x81, 0x15, 0x0c }, + { 0x51, 0x33, 0xdc, 0x8b, 0xef, 0x72, 0x53, 0x59, 0xdf, 0xf5, 0x97, 0x92, 0xd8, 0x5e, 0xaf, 0x75, 0xb7, 0xe1, 0xdc, 0xd1, 0x97, 0x8b, 0x01, 0xc3, 0x5b, 0x1b, 0x85, 0xfc, 0xeb, 0xc6, 0x33, 0x88, 0xad, 0x99, 0xa1, 0x7b, 0x63, 0x46, 0xa2, 0x17, 0xdc, 0x1a, 0x96, 0x22, 0xeb, 0xd1, 0x22, 0xec, 0xf6, 0x91, 0x3c, 0x4d, 0x31, 0xa6, 0xb5, 0x2a, 0x69, 0x5b, 0x86, 0xaf, 0x00, 0xd7, 0x41, 0xa0 }, + { 0x27, 0x53, 0xc4, 0xc0, 0xe9, 0x8e, 0xca, 0xd8, 0x06, 0xe8, 0x87, 0x80, 0xec, 0x27, 0xfc, 0xcd, 0x0f, 0x5c, 0x1a, 0xb5, 0x47, 0xf9, 0xe4, 0xbf, 0x16, 0x59, 0xd1, 0x92, 0xc2, 0x3a, 0xa2, 0xcc, 0x97, 0x1b, 0x58, 0xb6, 0x80, 0x25, 0x80, 0xba, 0xef, 0x8a, 0xdc, 0x3b, 0x77, 0x6e, 0xf7, 0x08, 0x6b, 0x25, 0x45, 0xc2, 0x98, 0x7f, 0x34, 0x8e, 0xe3, 0x71, 0x9c, 0xde, 0xf2, 0x58, 0xc4, 0x03 }, + { 0xb1, 0x66, 0x35, 0x73, 0xce, 0x4b, 0x9d, 0x8c, 0xae, 0xfc, 0x86, 0x50, 0x12, 0xf3, 0xe3, 0x97, 0x14, 0xb9, 0x89, 0x8a, 0x5d, 0xa6, 0xce, 0x17, 0xc2, 0x5a, 0x6a, 0x47, 0x93, 0x1a, 0x9d, 0xdb, 0x9b, 0xbe, 0x98, 0xad, 0xaa, 0x55, 0x3b, 0xee, 0xd4, 0x36, 0xe8, 0x95, 0x78, 0x45, 0x54, 0x16, 0xc2, 0xa5, 0x2a, 0x52, 0x5c, 0xf2, 0x86, 0x2b, 0x8d, 0x1d, 0x49, 0xa2, 0x53, 0x1b, 0x73, 0x91 }, + { 0x64, 0xf5, 0x8b, 0xd6, 0xbf, 0xc8, 0x56, 0xf5, 0xe8, 0x73, 0xb2, 0xa2, 0x95, 0x6e, 0xa0, 0xed, 0xa0, 0xd6, 0xdb, 0x0d, 0xa3, 0x9c, 0x8c, 0x7f, 0xc6, 0x7c, 0x9f, 0x9f, 0xee, 0xfc, 0xff, 0x30, 0x72, 0xcd, 0xf9, 0xe6, 0xea, 0x37, 0xf6, 0x9a, 0x44, 0xf0, 0xc6, 0x1a, 0xa0, 0xda, 0x36, 0x93, 0xc2, 0xdb, 0x5b, 0x54, 0x96, 0x0c, 0x02, 0x81, 0xa0, 0x88, 0x15, 0x1d, 0xb4, 0x2b, 0x11, 0xe8 }, + { 0x07, 0x64, 0xc7, 0xbe, 0x28, 0x12, 0x5d, 0x90, 0x65, 0xc4, 0xb9, 0x8a, 0x69, 0xd6, 0x0a, 0xed, 0xe7, 0x03, 0x54, 0x7c, 0x66, 0xa1, 0x2e, 0x17, 0xe1, 0xc6, 0x18, 0x99, 0x41, 0x32, 0xf5, 0xef, 0x82, 0x48, 0x2c, 0x1e, 0x3f, 0xe3, 0x14, 0x6c, 0xc6, 0x53, 0x76, 0xcc, 0x10, 0x9f, 0x01, 0x38, 0xed, 0x9a, 0x80, 0xe4, 0x9f, 0x1f, 0x3c, 0x7d, 0x61, 0x0d, 0x2f, 0x24, 0x32, 0xf2, 0x06, 0x05 }, + { 0xf7, 0x48, 0x78, 0x43, 0x98, 0xa2, 0xff, 0x03, 0xeb, 0xeb, 0x07, 0xe1, 0x55, 0xe6, 0x61, 0x16, 0xa8, 0x39, 0x74, 0x1a, 0x33, 0x6e, 0x32, 0xda, 0x71, 0xec, 0x69, 0x60, 0x01, 0xf0, 0xad, 0x1b, 0x25, 0xcd, 0x48, 0xc6, 0x9c, 0xfc, 0xa7, 0x26, 0x5e, 0xca, 0x1d, 0xd7, 0x19, 0x04, 0xa0, 0xce, 0x74, 0x8a, 0xc4, 0x12, 0x4f, 0x35, 0x71, 0x07, 0x6d, 0xfa, 0x71, 0x16, 0xa9, 0xcf, 0x00, 0xe9 }, + { 0x3f, 0x0d, 0xbc, 0x01, 0x86, 0xbc, 0xeb, 0x6b, 0x78, 0x5b, 0xa7, 0x8d, 0x2a, 0x2a, 0x01, 0x3c, 0x91, 0x0b, 0xe1, 0x57, 0xbd, 0xaf, 0xfa, 0xe8, 0x1b, 0xb6, 0x66, 0x3b, 0x1a, 0x73, 0x72, 0x2f, 0x7f, 0x12, 0x28, 0x79, 0x5f, 0x3e, 0xca, 0xda, 0x87, 0xcf, 0x6e, 0xf0, 0x07, 0x84, 0x74, 0xaf, 0x73, 0xf3, 0x1e, 0xca, 0x0c, 0xc2, 0x00, 0xed, 0x97, 0x5b, 0x68, 0x93, 0xf7, 0x61, 0xcb, 0x6d }, + { 0xd4, 0x76, 0x2c, 0xd4, 0x59, 0x98, 0x76, 0xca, 0x75, 0xb2, 0xb8, 0xfe, 0x24, 0x99, 0x44, 0xdb, 0xd2, 0x7a, 0xce, 0x74, 0x1f, 0xda, 0xb9, 0x36, 0x16, 0xcb, 0xc6, 0xe4, 0x25, 0x46, 0x0f, 0xeb, 0x51, 0xd4, 0xe7, 0xad, 0xcc, 0x38, 0x18, 0x0e, 0x7f, 0xc4, 0x7c, 0x89, 0x02, 0x4a, 0x7f, 0x56, 0x19, 0x1a, 0xdb, 0x87, 0x8d, 0xfd, 0xe4, 0xea, 0xd6, 0x22, 0x23, 0xf5, 0xa2, 0x61, 0x0e, 0xfe }, + { 0xcd, 0x36, 0xb3, 0xd5, 0xb4, 0xc9, 0x1b, 0x90, 0xfc, 0xbb, 0xa7, 0x95, 0x13, 0xcf, 0xee, 0x19, 0x07, 0xd8, 0x64, 0x5a, 0x16, 0x2a, 0xfd, 0x0c, 0xd4, 0xcf, 0x41, 0x92, 0xd4, 0xa5, 0xf4, 0xc8, 0x92, 0x18, 0x3a, 0x8e, 0xac, 0xdb, 0x2b, 0x6b, 0x6a, 0x9d, 0x9a, 0xa8, 0xc1, 0x1a, 0xc1, 0xb2, 0x61, 0xb3, 0x80, 0xdb, 0xee, 0x24, 0xca, 0x46, 0x8f, 0x1b, 0xfd, 0x04, 0x3c, 0x58, 0xee, 0xfe }, + { 0x98, 0x59, 0x34, 0x52, 0x28, 0x16, 0x61, 0xa5, 0x3c, 0x48, 0xa9, 0xd8, 0xcd, 0x79, 0x08, 0x26, 0xc1, 0xa1, 0xce, 0x56, 0x77, 0x38, 0x05, 0x3d, 0x0b, 0xee, 0x4a, 0x91, 0xa3, 0xd5, 0xbd, 0x92, 0xee, 0xfd, 0xba, 0xbe, 0xbe, 0x32, 0x04, 0xf2, 0x03, 0x1c, 0xa5, 0xf7, 0x81, 0xbd, 0xa9, 0x9e, 0xf5, 0xd8, 0xae, 0x56, 0xe5, 0xb0, 0x4a, 0x9e, 0x1e, 0xcd, 0x21, 0xb0, 0xeb, 0x05, 0xd3, 0xe1 }, + { 0x77, 0x1f, 0x57, 0xdd, 0x27, 0x75, 0xcc, 0xda, 0xb5, 0x59, 0x21, 0xd3, 0xe8, 0xe3, 0x0c, 0xcf, 0x48, 0x4d, 0x61, 0xfe, 0x1c, 0x1b, 0x9c, 0x2a, 0xe8, 0x19, 0xd0, 0xfb, 0x2a, 0x12, 0xfa, 0xb9, 0xbe, 0x70, 0xc4, 0xa7, 0xa1, 0x38, 0xda, 0x84, 0xe8, 0x28, 0x04, 0x35, 0xda, 0xad, 0xe5, 0xbb, 0xe6, 0x6a, 0xf0, 0x83, 0x6a, 0x15, 0x4f, 0x81, 0x7f, 0xb1, 0x7f, 0x33, 0x97, 0xe7, 0x25, 0xa3 }, + { 0xc6, 0x08, 0x97, 0xc6, 0xf8, 0x28, 0xe2, 0x1f, 0x16, 0xfb, 0xb5, 0xf1, 0x5b, 0x32, 0x3f, 0x87, 0xb6, 0xc8, 0x95, 0x5e, 0xab, 0xf1, 0xd3, 0x80, 0x61, 0xf7, 0x07, 0xf6, 0x08, 0xab, 0xdd, 0x99, 0x3f, 0xac, 0x30, 0x70, 0x63, 0x3e, 0x28, 0x6c, 0xf8, 0x33, 0x9c, 0xe2, 0x95, 0xdd, 0x35, 0x2d, 0xf4, 0xb4, 0xb4, 0x0b, 0x2f, 0x29, 0xda, 0x1d, 0xd5, 0x0b, 0x3a, 0x05, 0xd0, 0x79, 0xe6, 0xbb }, + { 0x82, 0x10, 0xcd, 0x2c, 0x2d, 0x3b, 0x13, 0x5c, 0x2c, 0xf0, 0x7f, 0xa0, 0xd1, 0x43, 0x3c, 0xd7, 0x71, 0xf3, 0x25, 0xd0, 0x75, 0xc6, 0x46, 0x9d, 0x9c, 0x7f, 0x1b, 0xa0, 0x94, 0x3c, 0xd4, 0xab, 0x09, 0x80, 0x8c, 0xab, 0xf4, 0xac, 0xb9, 0xce, 0x5b, 0xb8, 0x8b, 0x49, 0x89, 0x29, 0xb4, 0xb8, 0x47, 0xf6, 0x81, 0xad, 0x2c, 0x49, 0x0d, 0x04, 0x2d, 0xb2, 0xae, 0xc9, 0x42, 0x14, 0xb0, 0x6b }, + { 0x1d, 0x4e, 0xdf, 0xff, 0xd8, 0xfd, 0x80, 0xf7, 0xe4, 0x10, 0x78, 0x40, 0xfa, 0x3a, 0xa3, 0x1e, 0x32, 0x59, 0x84, 0x91, 0xe4, 0xaf, 0x70, 0x13, 0xc1, 0x97, 0xa6, 0x5b, 0x7f, 0x36, 0xdd, 0x3a, 0xc4, 0xb4, 0x78, 0x45, 0x61, 0x11, 0xcd, 0x43, 0x09, 0xd9, 0x24, 0x35, 0x10, 0x78, 0x2f, 0xa3, 0x1b, 0x7c, 0x4c, 0x95, 0xfa, 0x95, 0x15, 0x20, 0xd0, 0x20, 0xeb, 0x7e, 0x5c, 0x36, 0xe4, 0xef }, + { 0xaf, 0x8e, 0x6e, 0x91, 0xfa, 0xb4, 0x6c, 0xe4, 0x87, 0x3e, 0x1a, 0x50, 0xa8, 0xef, 0x44, 0x8c, 0xc2, 0x91, 0x21, 0xf7, 0xf7, 0x4d, 0xee, 0xf3, 0x4a, 0x71, 0xef, 0x89, 0xcc, 0x00, 0xd9, 0x27, 0x4b, 0xc6, 0xc2, 0x45, 0x4b, 0xbb, 0x32, 0x30, 0xd8, 0xb2, 0xec, 0x94, 0xc6, 0x2b, 0x1d, 0xec, 0x85, 0xf3, 0x59, 0x3b, 0xfa, 0x30, 0xea, 0x6f, 0x7a, 0x44, 0xd7, 0xc0, 0x94, 0x65, 0xa2, 0x53 }, + { 0x29, 0xfd, 0x38, 0x4e, 0xd4, 0x90, 0x6f, 0x2d, 0x13, 0xaa, 0x9f, 0xe7, 0xaf, 0x90, 0x59, 0x90, 0x93, 0x8b, 0xed, 0x80, 0x7f, 0x18, 0x32, 0x45, 0x4a, 0x37, 0x2a, 0xb4, 0x12, 0xee, 0xa1, 0xf5, 0x62, 0x5a, 0x1f, 0xcc, 0x9a, 0xc8, 0x34, 0x3b, 0x7c, 0x67, 0xc5, 0xab, 0xa6, 0xe0, 0xb1, 0xcc, 0x46, 0x44, 0x65, 0x49, 0x13, 0x69, 0x2c, 0x6b, 0x39, 0xeb, 0x91, 0x87, 0xce, 0xac, 0xd3, 0xec }, + { 0xa2, 0x68, 0xc7, 0x88, 0x5d, 0x98, 0x74, 0xa5, 0x1c, 0x44, 0xdf, 0xfe, 0xd8, 0xea, 0x53, 0xe9, 0x4f, 0x78, 0x45, 0x6e, 0x0b, 0x2e, 0xd9, 0x9f, 0xf5, 0xa3, 0x92, 0x47, 0x60, 0x81, 0x38, 0x26, 0xd9, 0x60, 0xa1, 0x5e, 0xdb, 0xed, 0xbb, 0x5d, 0xe5, 0x22, 0x6b, 0xa4, 0xb0, 0x74, 0xe7, 0x1b, 0x05, 0xc5, 0x5b, 0x97, 0x56, 0xbb, 0x79, 0xe5, 0x5c, 0x02, 0x75, 0x4c, 0x2c, 0x7b, 0x6c, 0x8a }, + { 0x0c, 0xf8, 0x54, 0x54, 0x88, 0xd5, 0x6a, 0x86, 0x81, 0x7c, 0xd7, 0xec, 0xb1, 0x0f, 0x71, 0x16, 0xb7, 0xea, 0x53, 0x0a, 0x45, 0xb6, 0xea, 0x49, 0x7b, 0x6c, 0x72, 0xc9, 0x97, 0xe0, 0x9e, 0x3d, 0x0d, 0xa8, 0x69, 0x8f, 0x46, 0xbb, 0x00, 0x6f, 0xc9, 0x77, 0xc2, 0xcd, 0x3d, 0x11, 0x77, 0x46, 0x3a, 0xc9, 0x05, 0x7f, 0xdd, 0x16, 0x62, 0xc8, 0x5d, 0x0c, 0x12, 0x64, 0x43, 0xc1, 0x04, 0x73 }, + { 0xb3, 0x96, 0x14, 0x26, 0x8f, 0xdd, 0x87, 0x81, 0x51, 0x5e, 0x2c, 0xfe, 0xbf, 0x89, 0xb4, 0xd5, 0x40, 0x2b, 0xab, 0x10, 0xc2, 0x26, 0xe6, 0x34, 0x4e, 0x6b, 0x9a, 0xe0, 0x00, 0xfb, 0x0d, 0x6c, 0x79, 0xcb, 0x2f, 0x3e, 0xc8, 0x0e, 0x80, 0xea, 0xeb, 0x19, 0x80, 0xd2, 0xf8, 0x69, 0x89, 0x16, 0xbd, 0x2e, 0x9f, 0x74, 0x72, 0x36, 0x65, 0x51, 0x16, 0x64, 0x9c, 0xd3, 0xca, 0x23, 0xa8, 0x37 }, + { 0x74, 0xbe, 0xf0, 0x92, 0xfc, 0x6f, 0x1e, 0x5d, 0xba, 0x36, 0x63, 0xa3, 0xfb, 0x00, 0x3b, 0x2a, 0x5b, 0xa2, 0x57, 0x49, 0x65, 0x36, 0xd9, 0x9f, 0x62, 0xb9, 0xd7, 0x3f, 0x8f, 0x9e, 0xb3, 0xce, 0x9f, 0xf3, 0xee, 0xc7, 0x09, 0xeb, 0x88, 0x36, 0x55, 0xec, 0x9e, 0xb8, 0x96, 0xb9, 0x12, 0x8f, 0x2a, 0xfc, 0x89, 0xcf, 0x7d, 0x1a, 0xb5, 0x8a, 0x72, 0xf4, 0xa3, 0xbf, 0x03, 0x4d, 0x2b, 0x4a }, + { 0x3a, 0x98, 0x8d, 0x38, 0xd7, 0x56, 0x11, 0xf3, 0xef, 0x38, 0xb8, 0x77, 0x49, 0x80, 0xb3, 0x3e, 0x57, 0x3b, 0x6c, 0x57, 0xbe, 0xe0, 0x46, 0x9b, 0xa5, 0xee, 0xd9, 0xb4, 0x4f, 0x29, 0x94, 0x5e, 0x73, 0x47, 0x96, 0x7f, 0xba, 0x2c, 0x16, 0x2e, 0x1c, 0x3b, 0xe7, 0xf3, 0x10, 0xf2, 0xf7, 0x5e, 0xe2, 0x38, 0x1e, 0x7b, 0xfd, 0x6b, 0x3f, 0x0b, 0xae, 0xa8, 0xd9, 0x5d, 0xfb, 0x1d, 0xaf, 0xb1 }, + { 0x58, 0xae, 0xdf, 0xce, 0x6f, 0x67, 0xdd, 0xc8, 0x5a, 0x28, 0xc9, 0x92, 0xf1, 0xc0, 0xbd, 0x09, 0x69, 0xf0, 0x41, 0xe6, 0x6f, 0x1e, 0xe8, 0x80, 0x20, 0xa1, 0x25, 0xcb, 0xfc, 0xfe, 0xbc, 0xd6, 0x17, 0x09, 0xc9, 0xc4, 0xeb, 0xa1, 0x92, 0xc1, 0x5e, 0x69, 0xf0, 0x20, 0xd4, 0x62, 0x48, 0x60, 0x19, 0xfa, 0x8d, 0xea, 0x0c, 0xd7, 0xa4, 0x29, 0x21, 0xa1, 0x9d, 0x2f, 0xe5, 0x46, 0xd4, 0x3d }, + { 0x93, 0x47, 0xbd, 0x29, 0x14, 0x73, 0xe6, 0xb4, 0xe3, 0x68, 0x43, 0x7b, 0x8e, 0x56, 0x1e, 0x06, 0x5f, 0x64, 0x9a, 0x6d, 0x8a, 0xda, 0x47, 0x9a, 0xd0, 0x9b, 0x19, 0x99, 0xa8, 0xf2, 0x6b, 0x91, 0xcf, 0x61, 0x20, 0xfd, 0x3b, 0xfe, 0x01, 0x4e, 0x83, 0xf2, 0x3a, 0xcf, 0xa4, 0xc0, 0xad, 0x7b, 0x37, 0x12, 0xb2, 0xc3, 0xc0, 0x73, 0x32, 0x70, 0x66, 0x31, 0x12, 0xcc, 0xd9, 0x28, 0x5c, 0xd9 }, + { 0xb3, 0x21, 0x63, 0xe7, 0xc5, 0xdb, 0xb5, 0xf5, 0x1f, 0xdc, 0x11, 0xd2, 0xea, 0xc8, 0x75, 0xef, 0xbb, 0xcb, 0x7e, 0x76, 0x99, 0x09, 0x0a, 0x7e, 0x7f, 0xf8, 0xa8, 0xd5, 0x07, 0x95, 0xaf, 0x5d, 0x74, 0xd9, 0xff, 0x98, 0x54, 0x3e, 0xf8, 0xcd, 0xf8, 0x9a, 0xc1, 0x3d, 0x04, 0x85, 0x27, 0x87, 0x56, 0xe0, 0xef, 0x00, 0xc8, 0x17, 0x74, 0x56, 0x61, 0xe1, 0xd5, 0x9f, 0xe3, 0x8e, 0x75, 0x37 }, + { 0x10, 0x85, 0xd7, 0x83, 0x07, 0xb1, 0xc4, 0xb0, 0x08, 0xc5, 0x7a, 0x2e, 0x7e, 0x5b, 0x23, 0x46, 0x58, 0xa0, 0xa8, 0x2e, 0x4f, 0xf1, 0xe4, 0xaa, 0xac, 0x72, 0xb3, 0x12, 0xfd, 0xa0, 0xfe, 0x27, 0xd2, 0x33, 0xbc, 0x5b, 0x10, 0xe9, 0xcc, 0x17, 0xfd, 0xc7, 0x69, 0x7b, 0x54, 0x0c, 0x7d, 0x95, 0xeb, 0x21, 0x5a, 0x19, 0xa1, 0xa0, 0xe2, 0x0e, 0x1a, 0xbf, 0xa1, 0x26, 0xef, 0xd5, 0x68, 0xc7 }, + { 0x4e, 0x5c, 0x73, 0x4c, 0x7d, 0xde, 0x01, 0x1d, 0x83, 0xea, 0xc2, 0xb7, 0x34, 0x7b, 0x37, 0x35, 0x94, 0xf9, 0x2d, 0x70, 0x91, 0xb9, 0xca, 0x34, 0xcb, 0x9c, 0x6f, 0x39, 0xbd, 0xf5, 0xa8, 0xd2, 0xf1, 0x34, 0x37, 0x9e, 0x16, 0xd8, 0x22, 0xf6, 0x52, 0x21, 0x70, 0xcc, 0xf2, 0xdd, 0xd5, 0x5c, 0x84, 0xb9, 0xe6, 0xc6, 0x4f, 0xc9, 0x27, 0xac, 0x4c, 0xf8, 0xdf, 0xb2, 0xa1, 0x77, 0x01, 0xf2 }, + { 0x69, 0x5d, 0x83, 0xbd, 0x99, 0x0a, 0x11, 0x17, 0xb3, 0xd0, 0xce, 0x06, 0xcc, 0x88, 0x80, 0x27, 0xd1, 0x2a, 0x05, 0x4c, 0x26, 0x77, 0xfd, 0x82, 0xf0, 0xd4, 0xfb, 0xfc, 0x93, 0x57, 0x55, 0x23, 0xe7, 0x99, 0x1a, 0x5e, 0x35, 0xa3, 0x75, 0x2e, 0x9b, 0x70, 0xce, 0x62, 0x99, 0x2e, 0x26, 0x8a, 0x87, 0x77, 0x44, 0xcd, 0xd4, 0x35, 0xf5, 0xf1, 0x30, 0x86, 0x9c, 0x9a, 0x20, 0x74, 0xb3, 0x38 }, + { 0xa6, 0x21, 0x37, 0x43, 0x56, 0x8e, 0x3b, 0x31, 0x58, 0xb9, 0x18, 0x43, 0x01, 0xf3, 0x69, 0x08, 0x47, 0x55, 0x4c, 0x68, 0x45, 0x7c, 0xb4, 0x0f, 0xc9, 0xa4, 0xb8, 0xcf, 0xd8, 0xd4, 0xa1, 0x18, 0xc3, 0x01, 0xa0, 0x77, 0x37, 0xae, 0xda, 0x0f, 0x92, 0x9c, 0x68, 0x91, 0x3c, 0x5f, 0x51, 0xc8, 0x03, 0x94, 0xf5, 0x3b, 0xff, 0x1c, 0x3e, 0x83, 0xb2, 0xe4, 0x0c, 0xa9, 0x7e, 0xba, 0x9e, 0x15 }, + { 0xd4, 0x44, 0xbf, 0xa2, 0x36, 0x2a, 0x96, 0xdf, 0x21, 0x3d, 0x07, 0x0e, 0x33, 0xfa, 0x84, 0x1f, 0x51, 0x33, 0x4e, 0x4e, 0x76, 0x86, 0x6b, 0x81, 0x39, 0xe8, 0xaf, 0x3b, 0xb3, 0x39, 0x8b, 0xe2, 0xdf, 0xad, 0xdc, 0xbc, 0x56, 0xb9, 0x14, 0x6d, 0xe9, 0xf6, 0x81, 0x18, 0xdc, 0x58, 0x29, 0xe7, 0x4b, 0x0c, 0x28, 0xd7, 0x71, 0x19, 0x07, 0xb1, 0x21, 0xf9, 0x16, 0x1c, 0xb9, 0x2b, 0x69, 0xa9 }, + { 0x14, 0x27, 0x09, 0xd6, 0x2e, 0x28, 0xfc, 0xcc, 0xd0, 0xaf, 0x97, 0xfa, 0xd0, 0xf8, 0x46, 0x5b, 0x97, 0x1e, 0x82, 0x20, 0x1d, 0xc5, 0x10, 0x70, 0xfa, 0xa0, 0x37, 0x2a, 0xa4, 0x3e, 0x92, 0x48, 0x4b, 0xe1, 0xc1, 0xe7, 0x3b, 0xa1, 0x09, 0x06, 0xd5, 0xd1, 0x85, 0x3d, 0xb6, 0xa4, 0x10, 0x6e, 0x0a, 0x7b, 0xf9, 0x80, 0x0d, 0x37, 0x3d, 0x6d, 0xee, 0x2d, 0x46, 0xd6, 0x2e, 0xf2, 0xa4, 0x61 }, + }; + unsigned char inp[1000], out[1000]; + unsigned char key[] = { 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07, 0x08, 0x09, 0x0a, 0x0b, 0x0c, 0x0d, 0x0e, 0x0f, 0x10, 0x11, 0x12, 0x13, 0x14, 0x15, 0x16, 0x17, 0x18, 0x19, 0x1a, 0x1b, 0x1c, 0x1d, 0x1e, 0x1f, 0x20, 0x21, 0x22, 0x23, 0x24, 0x25, 0x26, 0x27, 0x28, 0x29, 0x2a, 0x2b, 0x2c, 0x2d, 0x2e, 0x2f, 0x30, 0x31, 0x32, 0x33, 0x34, 0x35, 0x36, 0x37, 0x38, 0x39, 0x3a, 0x3b, 0x3c, 0x3d, 0x3e, 0x3f }; + unsigned long ilen, klen = sizeof(key), mlen = 64; + blake2bmac_state st; + + for (ilen = 0; ilen < 256; ilen++) inp[ilen] = (unsigned char)ilen; + + for (ilen = 0; ilen < 256; ilen++) { + const unsigned char *mac = tests[ilen]; + unsigned long olen = mlen; + /* process piece by piece */ + if (ilen > 15) { + blake2bmac_init(&st, olen, key, klen); + blake2bmac_process(&st, (unsigned char*)inp, 5); + blake2bmac_process(&st, (unsigned char*)inp + 5, 4); + blake2bmac_process(&st, (unsigned char*)inp + 9, 3); + blake2bmac_process(&st, (unsigned char*)inp + 12, 2); + blake2bmac_process(&st, (unsigned char*)inp + 14, 1); + blake2bmac_process(&st, (unsigned char*)inp + 15, ilen - 15); + blake2bmac_done(&st, out, &olen); + if (compare_testvector(out, olen, mac, mlen, "BLAKE2B MAC multi", ilen) != 0) return CRYPT_FAIL_TESTVECTOR; + } + /* process in one go */ + blake2bmac_init(&st, olen, key, klen); + blake2bmac_process(&st, (unsigned char*)inp, ilen); + blake2bmac_done(&st, out, &olen); + if (compare_testvector(out, olen, mac, mlen, "BLAKE2B MAC single", ilen) != 0) return CRYPT_FAIL_TESTVECTOR; + } + return CRYPT_OK; +#endif +} + +#endif + +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/mac/blake2/blake2smac.c b/libtomcrypt/src/mac/blake2/blake2smac.c new file mode 100644 index 0000000..080241b --- /dev/null +++ b/libtomcrypt/src/mac/blake2/blake2smac.c @@ -0,0 +1,66 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + */ + +#include "tomcrypt.h" + +#ifdef LTC_BLAKE2SMAC + +/** + Initialize an BLAKE2S MAC context. + @param st The BLAKE2S MAC state + @param outlen The size of the MAC output (octets) + @param key The secret key + @param keylen The length of the secret key (octets) + @return CRYPT_OK if successful +*/ +int blake2smac_init(blake2smac_state *st, unsigned long outlen, const unsigned char *key, unsigned long keylen) +{ + LTC_ARGCHK(st != NULL); + LTC_ARGCHK(key != NULL); + return blake2s_init(st, outlen, key, keylen); +} + +/** + Process data through BLAKE2S MAC + @param st The BLAKE2S MAC state + @param in The data to send through HMAC + @param inlen The length of the data to HMAC (octets) + @return CRYPT_OK if successful +*/ +int blake2smac_process(blake2smac_state *st, const unsigned char *in, unsigned long inlen) +{ + if (inlen == 0) return CRYPT_OK; /* nothing to do */ + LTC_ARGCHK(st != NULL); + LTC_ARGCHK(in != NULL); + return blake2s_process(st, in, inlen); +} + +/** + Terminate a BLAKE2S MAC session + @param st The BLAKE2S MAC state + @param mac [out] The destination of the BLAKE2S MAC authentication tag + @param maclen [in/out] The max size and resulting size of the BLAKE2S MAC authentication tag + @return CRYPT_OK if successful +*/ +int blake2smac_done(blake2smac_state *st, unsigned char *mac, unsigned long *maclen) +{ + LTC_ARGCHK(st != NULL); + LTC_ARGCHK(mac != NULL); + LTC_ARGCHK(maclen != NULL); + LTC_ARGCHK(*maclen >= st->blake2s.outlen); + + *maclen = st->blake2s.outlen; + return blake2s_done(st, mac); +} + +#endif + +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/mac/blake2/blake2smac_file.c b/libtomcrypt/src/mac/blake2/blake2smac_file.c new file mode 100644 index 0000000..c5248a2 --- /dev/null +++ b/libtomcrypt/src/mac/blake2/blake2smac_file.c @@ -0,0 +1,83 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + */ + +#include "tomcrypt.h" + +#ifdef LTC_BLAKE2SMAC + +/** + BLAKE2S MAC a file + @param fname The name of the file you wish to BLAKE2S MAC + @param key The secret key + @param keylen The length of the secret key + @param mac [out] The BLAKE2S MAC authentication tag + @param maclen [in/out] The max size and resulting size of the authentication tag + @return CRYPT_OK if successful, CRYPT_NOP if file support has been disabled +*/ +int blake2smac_file(const char *fname, const unsigned char *key, unsigned long keylen, unsigned char *mac, unsigned long *maclen) +{ +#ifdef LTC_NO_FILE + return CRYPT_NOP; +#else + blake2smac_state st; + FILE *in; + unsigned char *buf; + size_t x; + int err; + + LTC_ARGCHK(fname != NULL); + LTC_ARGCHK(key != NULL); + LTC_ARGCHK(mac != NULL); + LTC_ARGCHK(maclen != NULL); + + if ((buf = XMALLOC(LTC_FILE_READ_BUFSIZE)) == NULL) { + return CRYPT_MEM; + } + + if ((err = blake2smac_init(&st, *maclen, key, keylen)) != CRYPT_OK) { + goto LBL_ERR; + } + + in = fopen(fname, "rb"); + if (in == NULL) { + err = CRYPT_FILE_NOTFOUND; + goto LBL_ERR; + } + + do { + x = fread(buf, 1, LTC_FILE_READ_BUFSIZE, in); + if ((err = blake2smac_process(&st, buf, (unsigned long)x)) != CRYPT_OK) { + fclose(in); + goto LBL_CLEANBUF; + } + } while (x == LTC_FILE_READ_BUFSIZE); + + if (fclose(in) != 0) { + err = CRYPT_ERROR; + goto LBL_CLEANBUF; + } + + err = blake2smac_done(&st, mac, maclen); + +LBL_CLEANBUF: + zeromem(buf, LTC_FILE_READ_BUFSIZE); +LBL_ERR: +#ifdef LTC_CLEAN_STACK + zeromem(&st, sizeof(blake2smac_state)); +#endif + XFREE(buf); + return err; +#endif +} + +#endif + +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/mac/blake2/blake2smac_memory.c b/libtomcrypt/src/mac/blake2/blake2smac_memory.c new file mode 100644 index 0000000..1661fb0 --- /dev/null +++ b/libtomcrypt/src/mac/blake2/blake2smac_memory.c @@ -0,0 +1,48 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + */ + +#include "tomcrypt.h" + +#ifdef LTC_BLAKE2SMAC + +/** + BLAKE2S MAC a block of memory to produce the authentication tag + @param key The secret key + @param keylen The length of the secret key (octets) + @param in The data to BLAKE2S MAC + @param inlen The length of the data to BLAKE2S MAC (octets) + @param mac [out] Destination of the authentication tag + @param maclen [in/out] Max size and resulting size of authentication tag + @return CRYPT_OK if successful +*/ +int blake2smac_memory(const unsigned char *key, unsigned long keylen, const unsigned char *in, unsigned long inlen, unsigned char *mac, unsigned long *maclen) +{ + blake2smac_state st; + int err; + + LTC_ARGCHK(key != NULL); + LTC_ARGCHK(in != NULL); + LTC_ARGCHK(mac != NULL); + LTC_ARGCHK(maclen != NULL); + + if ((err = blake2smac_init(&st, *maclen, key, keylen)) != CRYPT_OK) { goto LBL_ERR; } + if ((err = blake2smac_process(&st, in, inlen)) != CRYPT_OK) { goto LBL_ERR; } + err = blake2smac_done(&st, mac, maclen); +LBL_ERR: +#ifdef LTC_CLEAN_STACK + zeromem(&st, sizeof(blake2smac_state)); +#endif + return err; +} + +#endif + +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/mac/blake2/blake2smac_memory_multi.c b/libtomcrypt/src/mac/blake2/blake2smac_memory_multi.c new file mode 100644 index 0000000..0985c42 --- /dev/null +++ b/libtomcrypt/src/mac/blake2/blake2smac_memory_multi.c @@ -0,0 +1,62 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + */ + +#include "tomcrypt.h" +#include <stdarg.h> + +#ifdef LTC_BLAKE2SMAC + +/** + BLAKE2S MAC multiple blocks of memory to produce the authentication tag + @param key The secret key + @param keylen The length of the secret key (octets) + @param mac [out] Destination of the authentication tag + @param maclen [in/out] Max size and resulting size of authentication tag + @param in The data to BLAKE2S MAC + @param inlen The length of the data to BLAKE2S MAC (octets) + @param ... tuples of (data,len) pairs to BLAKE2S MAC, terminated with a (NULL,x) (x=don't care) + @return CRYPT_OK if successful +*/ +int blake2smac_memory_multi(const unsigned char *key, unsigned long keylen, unsigned char *mac, unsigned long *maclen, const unsigned char *in, unsigned long inlen, ...) +{ + blake2smac_state st; + int err; + va_list args; + const unsigned char *curptr; + unsigned long curlen; + + LTC_ARGCHK(key != NULL); + LTC_ARGCHK(in != NULL); + LTC_ARGCHK(mac != NULL); + LTC_ARGCHK(maclen != NULL); + + va_start(args, inlen); + curptr = in; + curlen = inlen; + if ((err = blake2smac_init(&st, *maclen, key, keylen)) != CRYPT_OK) { goto LBL_ERR; } + for (;;) { + if ((err = blake2smac_process(&st, curptr, curlen)) != CRYPT_OK) { goto LBL_ERR; } + curptr = va_arg(args, const unsigned char*); + if (curptr == NULL) break; + curlen = va_arg(args, unsigned long); + } + err = blake2smac_done(&st, mac, maclen); +LBL_ERR: +#ifdef LTC_CLEAN_STACK + zeromem(&st, sizeof(blake2smac_state)); +#endif + va_end(args); + return err; +} + +#endif + +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/mac/blake2/blake2smac_test.c b/libtomcrypt/src/mac/blake2/blake2smac_test.c new file mode 100644 index 0000000..a44ab8d --- /dev/null +++ b/libtomcrypt/src/mac/blake2/blake2smac_test.c @@ -0,0 +1,314 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + */ + +#include "tomcrypt.h" + +#ifdef LTC_BLAKE2SMAC + +int blake2smac_test(void) +{ +#ifndef LTC_TEST + return CRYPT_NOP; +#else + static const unsigned char tests[256][32] = { + /* source: https://github.com/BLAKE2/BLAKE2/blob/master/testvectors/blake2s-kat.txt */ + { 0x48, 0xa8, 0x99, 0x7d, 0xa4, 0x07, 0x87, 0x6b, 0x3d, 0x79, 0xc0, 0xd9, 0x23, 0x25, 0xad, 0x3b, 0x89, 0xcb, 0xb7, 0x54, 0xd8, 0x6a, 0xb7, 0x1a, 0xee, 0x04, 0x7a, 0xd3, 0x45, 0xfd, 0x2c, 0x49 }, + { 0x40, 0xd1, 0x5f, 0xee, 0x7c, 0x32, 0x88, 0x30, 0x16, 0x6a, 0xc3, 0xf9, 0x18, 0x65, 0x0f, 0x80, 0x7e, 0x7e, 0x01, 0xe1, 0x77, 0x25, 0x8c, 0xdc, 0x0a, 0x39, 0xb1, 0x1f, 0x59, 0x80, 0x66, 0xf1 }, + { 0x6b, 0xb7, 0x13, 0x00, 0x64, 0x4c, 0xd3, 0x99, 0x1b, 0x26, 0xcc, 0xd4, 0xd2, 0x74, 0xac, 0xd1, 0xad, 0xea, 0xb8, 0xb1, 0xd7, 0x91, 0x45, 0x46, 0xc1, 0x19, 0x8b, 0xbe, 0x9f, 0xc9, 0xd8, 0x03 }, + { 0x1d, 0x22, 0x0d, 0xbe, 0x2e, 0xe1, 0x34, 0x66, 0x1f, 0xdf, 0x6d, 0x9e, 0x74, 0xb4, 0x17, 0x04, 0x71, 0x05, 0x56, 0xf2, 0xf6, 0xe5, 0xa0, 0x91, 0xb2, 0x27, 0x69, 0x74, 0x45, 0xdb, 0xea, 0x6b }, + { 0xf6, 0xc3, 0xfb, 0xad, 0xb4, 0xcc, 0x68, 0x7a, 0x00, 0x64, 0xa5, 0xbe, 0x6e, 0x79, 0x1b, 0xec, 0x63, 0xb8, 0x68, 0xad, 0x62, 0xfb, 0xa6, 0x1b, 0x37, 0x57, 0xef, 0x9c, 0xa5, 0x2e, 0x05, 0xb2 }, + { 0x49, 0xc1, 0xf2, 0x11, 0x88, 0xdf, 0xd7, 0x69, 0xae, 0xa0, 0xe9, 0x11, 0xdd, 0x6b, 0x41, 0xf1, 0x4d, 0xab, 0x10, 0x9d, 0x2b, 0x85, 0x97, 0x7a, 0xa3, 0x08, 0x8b, 0x5c, 0x70, 0x7e, 0x85, 0x98 }, + { 0xfd, 0xd8, 0x99, 0x3d, 0xcd, 0x43, 0xf6, 0x96, 0xd4, 0x4f, 0x3c, 0xea, 0x0f, 0xf3, 0x53, 0x45, 0x23, 0x4e, 0xc8, 0xee, 0x08, 0x3e, 0xb3, 0xca, 0xda, 0x01, 0x7c, 0x7f, 0x78, 0xc1, 0x71, 0x43 }, + { 0xe6, 0xc8, 0x12, 0x56, 0x37, 0x43, 0x8d, 0x09, 0x05, 0xb7, 0x49, 0xf4, 0x65, 0x60, 0xac, 0x89, 0xfd, 0x47, 0x1c, 0xf8, 0x69, 0x2e, 0x28, 0xfa, 0xb9, 0x82, 0xf7, 0x3f, 0x01, 0x9b, 0x83, 0xa9 }, + { 0x19, 0xfc, 0x8c, 0xa6, 0x97, 0x9d, 0x60, 0xe6, 0xed, 0xd3, 0xb4, 0x54, 0x1e, 0x2f, 0x96, 0x7c, 0xed, 0x74, 0x0d, 0xf6, 0xec, 0x1e, 0xae, 0xbb, 0xfe, 0x81, 0x38, 0x32, 0xe9, 0x6b, 0x29, 0x74 }, + { 0xa6, 0xad, 0x77, 0x7c, 0xe8, 0x81, 0xb5, 0x2b, 0xb5, 0xa4, 0x42, 0x1a, 0xb6, 0xcd, 0xd2, 0xdf, 0xba, 0x13, 0xe9, 0x63, 0x65, 0x2d, 0x4d, 0x6d, 0x12, 0x2a, 0xee, 0x46, 0x54, 0x8c, 0x14, 0xa7 }, + { 0xf5, 0xc4, 0xb2, 0xba, 0x1a, 0x00, 0x78, 0x1b, 0x13, 0xab, 0xa0, 0x42, 0x52, 0x42, 0xc6, 0x9c, 0xb1, 0x55, 0x2f, 0x3f, 0x71, 0xa9, 0xa3, 0xbb, 0x22, 0xb4, 0xa6, 0xb4, 0x27, 0x7b, 0x46, 0xdd }, + { 0xe3, 0x3c, 0x4c, 0x9b, 0xd0, 0xcc, 0x7e, 0x45, 0xc8, 0x0e, 0x65, 0xc7, 0x7f, 0xa5, 0x99, 0x7f, 0xec, 0x70, 0x02, 0x73, 0x85, 0x41, 0x50, 0x9e, 0x68, 0xa9, 0x42, 0x38, 0x91, 0xe8, 0x22, 0xa3 }, + { 0xfb, 0xa1, 0x61, 0x69, 0xb2, 0xc3, 0xee, 0x10, 0x5b, 0xe6, 0xe1, 0xe6, 0x50, 0xe5, 0xcb, 0xf4, 0x07, 0x46, 0xb6, 0x75, 0x3d, 0x03, 0x6a, 0xb5, 0x51, 0x79, 0x01, 0x4a, 0xd7, 0xef, 0x66, 0x51 }, + { 0xf5, 0xc4, 0xbe, 0xc6, 0xd6, 0x2f, 0xc6, 0x08, 0xbf, 0x41, 0xcc, 0x11, 0x5f, 0x16, 0xd6, 0x1c, 0x7e, 0xfd, 0x3f, 0xf6, 0xc6, 0x56, 0x92, 0xbb, 0xe0, 0xaf, 0xff, 0xb1, 0xfe, 0xde, 0x74, 0x75 }, + { 0xa4, 0x86, 0x2e, 0x76, 0xdb, 0x84, 0x7f, 0x05, 0xba, 0x17, 0xed, 0xe5, 0xda, 0x4e, 0x7f, 0x91, 0xb5, 0x92, 0x5c, 0xf1, 0xad, 0x4b, 0xa1, 0x27, 0x32, 0xc3, 0x99, 0x57, 0x42, 0xa5, 0xcd, 0x6e }, + { 0x65, 0xf4, 0xb8, 0x60, 0xcd, 0x15, 0xb3, 0x8e, 0xf8, 0x14, 0xa1, 0xa8, 0x04, 0x31, 0x4a, 0x55, 0xbe, 0x95, 0x3c, 0xaa, 0x65, 0xfd, 0x75, 0x8a, 0xd9, 0x89, 0xff, 0x34, 0xa4, 0x1c, 0x1e, 0xea }, + { 0x19, 0xba, 0x23, 0x4f, 0x0a, 0x4f, 0x38, 0x63, 0x7d, 0x18, 0x39, 0xf9, 0xd9, 0xf7, 0x6a, 0xd9, 0x1c, 0x85, 0x22, 0x30, 0x71, 0x43, 0xc9, 0x7d, 0x5f, 0x93, 0xf6, 0x92, 0x74, 0xce, 0xc9, 0xa7 }, + { 0x1a, 0x67, 0x18, 0x6c, 0xa4, 0xa5, 0xcb, 0x8e, 0x65, 0xfc, 0xa0, 0xe2, 0xec, 0xbc, 0x5d, 0xdc, 0x14, 0xae, 0x38, 0x1b, 0xb8, 0xbf, 0xfe, 0xb9, 0xe0, 0xa1, 0x03, 0x44, 0x9e, 0x3e, 0xf0, 0x3c }, + { 0xaf, 0xbe, 0xa3, 0x17, 0xb5, 0xa2, 0xe8, 0x9c, 0x0b, 0xd9, 0x0c, 0xcf, 0x5d, 0x7f, 0xd0, 0xed, 0x57, 0xfe, 0x58, 0x5e, 0x4b, 0xe3, 0x27, 0x1b, 0x0a, 0x6b, 0xf0, 0xf5, 0x78, 0x6b, 0x0f, 0x26 }, + { 0xf1, 0xb0, 0x15, 0x58, 0xce, 0x54, 0x12, 0x62, 0xf5, 0xec, 0x34, 0x29, 0x9d, 0x6f, 0xb4, 0x09, 0x00, 0x09, 0xe3, 0x43, 0x4b, 0xe2, 0xf4, 0x91, 0x05, 0xcf, 0x46, 0xaf, 0x4d, 0x2d, 0x41, 0x24 }, + { 0x13, 0xa0, 0xa0, 0xc8, 0x63, 0x35, 0x63, 0x5e, 0xaa, 0x74, 0xca, 0x2d, 0x5d, 0x48, 0x8c, 0x79, 0x7b, 0xbb, 0x4f, 0x47, 0xdc, 0x07, 0x10, 0x50, 0x15, 0xed, 0x6a, 0x1f, 0x33, 0x09, 0xef, 0xce }, + { 0x15, 0x80, 0xaf, 0xee, 0xbe, 0xbb, 0x34, 0x6f, 0x94, 0xd5, 0x9f, 0xe6, 0x2d, 0xa0, 0xb7, 0x92, 0x37, 0xea, 0xd7, 0xb1, 0x49, 0x1f, 0x56, 0x67, 0xa9, 0x0e, 0x45, 0xed, 0xf6, 0xca, 0x8b, 0x03 }, + { 0x20, 0xbe, 0x1a, 0x87, 0x5b, 0x38, 0xc5, 0x73, 0xdd, 0x7f, 0xaa, 0xa0, 0xde, 0x48, 0x9d, 0x65, 0x5c, 0x11, 0xef, 0xb6, 0xa5, 0x52, 0x69, 0x8e, 0x07, 0xa2, 0xd3, 0x31, 0xb5, 0xf6, 0x55, 0xc3 }, + { 0xbe, 0x1f, 0xe3, 0xc4, 0xc0, 0x40, 0x18, 0xc5, 0x4c, 0x4a, 0x0f, 0x6b, 0x9a, 0x2e, 0xd3, 0xc5, 0x3a, 0xbe, 0x3a, 0x9f, 0x76, 0xb4, 0xd2, 0x6d, 0xe5, 0x6f, 0xc9, 0xae, 0x95, 0x05, 0x9a, 0x99 }, + { 0xe3, 0xe3, 0xac, 0xe5, 0x37, 0xeb, 0x3e, 0xdd, 0x84, 0x63, 0xd9, 0xad, 0x35, 0x82, 0xe1, 0x3c, 0xf8, 0x65, 0x33, 0xff, 0xde, 0x43, 0xd6, 0x68, 0xdd, 0x2e, 0x93, 0xbb, 0xdb, 0xd7, 0x19, 0x5a }, + { 0x11, 0x0c, 0x50, 0xc0, 0xbf, 0x2c, 0x6e, 0x7a, 0xeb, 0x7e, 0x43, 0x5d, 0x92, 0xd1, 0x32, 0xab, 0x66, 0x55, 0x16, 0x8e, 0x78, 0xa2, 0xde, 0xcd, 0xec, 0x33, 0x30, 0x77, 0x76, 0x84, 0xd9, 0xc1 }, + { 0xe9, 0xba, 0x8f, 0x50, 0x5c, 0x9c, 0x80, 0xc0, 0x86, 0x66, 0xa7, 0x01, 0xf3, 0x36, 0x7e, 0x6c, 0xc6, 0x65, 0xf3, 0x4b, 0x22, 0xe7, 0x3c, 0x3c, 0x04, 0x17, 0xeb, 0x1c, 0x22, 0x06, 0x08, 0x2f }, + { 0x26, 0xcd, 0x66, 0xfc, 0xa0, 0x23, 0x79, 0xc7, 0x6d, 0xf1, 0x23, 0x17, 0x05, 0x2b, 0xca, 0xfd, 0x6c, 0xd8, 0xc3, 0xa7, 0xb8, 0x90, 0xd8, 0x05, 0xf3, 0x6c, 0x49, 0x98, 0x97, 0x82, 0x43, 0x3a }, + { 0x21, 0x3f, 0x35, 0x96, 0xd6, 0xe3, 0xa5, 0xd0, 0xe9, 0x93, 0x2c, 0xd2, 0x15, 0x91, 0x46, 0x01, 0x5e, 0x2a, 0xbc, 0x94, 0x9f, 0x47, 0x29, 0xee, 0x26, 0x32, 0xfe, 0x1e, 0xdb, 0x78, 0xd3, 0x37 }, + { 0x10, 0x15, 0xd7, 0x01, 0x08, 0xe0, 0x3b, 0xe1, 0xc7, 0x02, 0xfe, 0x97, 0x25, 0x36, 0x07, 0xd1, 0x4a, 0xee, 0x59, 0x1f, 0x24, 0x13, 0xea, 0x67, 0x87, 0x42, 0x7b, 0x64, 0x59, 0xff, 0x21, 0x9a }, + { 0x3c, 0xa9, 0x89, 0xde, 0x10, 0xcf, 0xe6, 0x09, 0x90, 0x94, 0x72, 0xc8, 0xd3, 0x56, 0x10, 0x80, 0x5b, 0x2f, 0x97, 0x77, 0x34, 0xcf, 0x65, 0x2c, 0xc6, 0x4b, 0x3b, 0xfc, 0x88, 0x2d, 0x5d, 0x89 }, + { 0xb6, 0x15, 0x6f, 0x72, 0xd3, 0x80, 0xee, 0x9e, 0xa6, 0xac, 0xd1, 0x90, 0x46, 0x4f, 0x23, 0x07, 0xa5, 0xc1, 0x79, 0xef, 0x01, 0xfd, 0x71, 0xf9, 0x9f, 0x2d, 0x0f, 0x7a, 0x57, 0x36, 0x0a, 0xea }, + { 0xc0, 0x3b, 0xc6, 0x42, 0xb2, 0x09, 0x59, 0xcb, 0xe1, 0x33, 0xa0, 0x30, 0x3e, 0x0c, 0x1a, 0xbf, 0xf3, 0xe3, 0x1e, 0xc8, 0xe1, 0xa3, 0x28, 0xec, 0x85, 0x65, 0xc3, 0x6d, 0xec, 0xff, 0x52, 0x65 }, + { 0x2c, 0x3e, 0x08, 0x17, 0x6f, 0x76, 0x0c, 0x62, 0x64, 0xc3, 0xa2, 0xcd, 0x66, 0xfe, 0xc6, 0xc3, 0xd7, 0x8d, 0xe4, 0x3f, 0xc1, 0x92, 0x45, 0x7b, 0x2a, 0x4a, 0x66, 0x0a, 0x1e, 0x0e, 0xb2, 0x2b }, + { 0xf7, 0x38, 0xc0, 0x2f, 0x3c, 0x1b, 0x19, 0x0c, 0x51, 0x2b, 0x1a, 0x32, 0xde, 0xab, 0xf3, 0x53, 0x72, 0x8e, 0x0e, 0x9a, 0xb0, 0x34, 0x49, 0x0e, 0x3c, 0x34, 0x09, 0x94, 0x6a, 0x97, 0xae, 0xec }, + { 0x8b, 0x18, 0x80, 0xdf, 0x30, 0x1c, 0xc9, 0x63, 0x41, 0x88, 0x11, 0x08, 0x89, 0x64, 0x83, 0x92, 0x87, 0xff, 0x7f, 0xe3, 0x1c, 0x49, 0xea, 0x6e, 0xbd, 0x9e, 0x48, 0xbd, 0xee, 0xe4, 0x97, 0xc5 }, + { 0x1e, 0x75, 0xcb, 0x21, 0xc6, 0x09, 0x89, 0x02, 0x03, 0x75, 0xf1, 0xa7, 0xa2, 0x42, 0x83, 0x9f, 0x0b, 0x0b, 0x68, 0x97, 0x3a, 0x4c, 0x2a, 0x05, 0xcf, 0x75, 0x55, 0xed, 0x5a, 0xae, 0xc4, 0xc1 }, + { 0x62, 0xbf, 0x8a, 0x9c, 0x32, 0xa5, 0xbc, 0xcf, 0x29, 0x0b, 0x6c, 0x47, 0x4d, 0x75, 0xb2, 0xa2, 0xa4, 0x09, 0x3f, 0x1a, 0x9e, 0x27, 0x13, 0x94, 0x33, 0xa8, 0xf2, 0xb3, 0xbc, 0xe7, 0xb8, 0xd7 }, + { 0x16, 0x6c, 0x83, 0x50, 0xd3, 0x17, 0x3b, 0x5e, 0x70, 0x2b, 0x78, 0x3d, 0xfd, 0x33, 0xc6, 0x6e, 0xe0, 0x43, 0x27, 0x42, 0xe9, 0xb9, 0x2b, 0x99, 0x7f, 0xd2, 0x3c, 0x60, 0xdc, 0x67, 0x56, 0xca }, + { 0x04, 0x4a, 0x14, 0xd8, 0x22, 0xa9, 0x0c, 0xac, 0xf2, 0xf5, 0xa1, 0x01, 0x42, 0x8a, 0xdc, 0x8f, 0x41, 0x09, 0x38, 0x6c, 0xcb, 0x15, 0x8b, 0xf9, 0x05, 0xc8, 0x61, 0x8b, 0x8e, 0xe2, 0x4e, 0xc3 }, + { 0x38, 0x7d, 0x39, 0x7e, 0xa4, 0x3a, 0x99, 0x4b, 0xe8, 0x4d, 0x2d, 0x54, 0x4a, 0xfb, 0xe4, 0x81, 0xa2, 0x00, 0x0f, 0x55, 0x25, 0x26, 0x96, 0xbb, 0xa2, 0xc5, 0x0c, 0x8e, 0xbd, 0x10, 0x13, 0x47 }, + { 0x56, 0xf8, 0xcc, 0xf1, 0xf8, 0x64, 0x09, 0xb4, 0x6c, 0xe3, 0x61, 0x66, 0xae, 0x91, 0x65, 0x13, 0x84, 0x41, 0x57, 0x75, 0x89, 0xdb, 0x08, 0xcb, 0xc5, 0xf6, 0x6c, 0xa2, 0x97, 0x43, 0xb9, 0xfd }, + { 0x97, 0x06, 0xc0, 0x92, 0xb0, 0x4d, 0x91, 0xf5, 0x3d, 0xff, 0x91, 0xfa, 0x37, 0xb7, 0x49, 0x3d, 0x28, 0xb5, 0x76, 0xb5, 0xd7, 0x10, 0x46, 0x9d, 0xf7, 0x94, 0x01, 0x66, 0x22, 0x36, 0xfc, 0x03 }, + { 0x87, 0x79, 0x68, 0x68, 0x6c, 0x06, 0x8c, 0xe2, 0xf7, 0xe2, 0xad, 0xcf, 0xf6, 0x8b, 0xf8, 0x74, 0x8e, 0xdf, 0x3c, 0xf8, 0x62, 0xcf, 0xb4, 0xd3, 0x94, 0x7a, 0x31, 0x06, 0x95, 0x80, 0x54, 0xe3 }, + { 0x88, 0x17, 0xe5, 0x71, 0x98, 0x79, 0xac, 0xf7, 0x02, 0x47, 0x87, 0xec, 0xcd, 0xb2, 0x71, 0x03, 0x55, 0x66, 0xcf, 0xa3, 0x33, 0xe0, 0x49, 0x40, 0x7c, 0x01, 0x78, 0xcc, 0xc5, 0x7a, 0x5b, 0x9f }, + { 0x89, 0x38, 0x24, 0x9e, 0x4b, 0x50, 0xca, 0xda, 0xcc, 0xdf, 0x5b, 0x18, 0x62, 0x13, 0x26, 0xcb, 0xb1, 0x52, 0x53, 0xe3, 0x3a, 0x20, 0xf5, 0x63, 0x6e, 0x99, 0x5d, 0x72, 0x47, 0x8d, 0xe4, 0x72 }, + { 0xf1, 0x64, 0xab, 0xba, 0x49, 0x63, 0xa4, 0x4d, 0x10, 0x72, 0x57, 0xe3, 0x23, 0x2d, 0x90, 0xac, 0xa5, 0xe6, 0x6a, 0x14, 0x08, 0x24, 0x8c, 0x51, 0x74, 0x1e, 0x99, 0x1d, 0xb5, 0x22, 0x77, 0x56 }, + { 0xd0, 0x55, 0x63, 0xe2, 0xb1, 0xcb, 0xa0, 0xc4, 0xa2, 0xa1, 0xe8, 0xbd, 0xe3, 0xa1, 0xa0, 0xd9, 0xf5, 0xb4, 0x0c, 0x85, 0xa0, 0x70, 0xd6, 0xf5, 0xfb, 0x21, 0x06, 0x6e, 0xad, 0x5d, 0x06, 0x01 }, + { 0x03, 0xfb, 0xb1, 0x63, 0x84, 0xf0, 0xa3, 0x86, 0x6f, 0x4c, 0x31, 0x17, 0x87, 0x76, 0x66, 0xef, 0xbf, 0x12, 0x45, 0x97, 0x56, 0x4b, 0x29, 0x3d, 0x4a, 0xab, 0x0d, 0x26, 0x9f, 0xab, 0xdd, 0xfa }, + { 0x5f, 0xa8, 0x48, 0x6a, 0xc0, 0xe5, 0x29, 0x64, 0xd1, 0x88, 0x1b, 0xbe, 0x33, 0x8e, 0xb5, 0x4b, 0xe2, 0xf7, 0x19, 0x54, 0x92, 0x24, 0x89, 0x20, 0x57, 0xb4, 0xda, 0x04, 0xba, 0x8b, 0x34, 0x75 }, + { 0xcd, 0xfa, 0xbc, 0xee, 0x46, 0x91, 0x11, 0x11, 0x23, 0x6a, 0x31, 0x70, 0x8b, 0x25, 0x39, 0xd7, 0x1f, 0xc2, 0x11, 0xd9, 0xb0, 0x9c, 0x0d, 0x85, 0x30, 0xa1, 0x1e, 0x1d, 0xbf, 0x6e, 0xed, 0x01 }, + { 0x4f, 0x82, 0xde, 0x03, 0xb9, 0x50, 0x47, 0x93, 0xb8, 0x2a, 0x07, 0xa0, 0xbd, 0xcd, 0xff, 0x31, 0x4d, 0x75, 0x9e, 0x7b, 0x62, 0xd2, 0x6b, 0x78, 0x49, 0x46, 0xb0, 0xd3, 0x6f, 0x91, 0x6f, 0x52 }, + { 0x25, 0x9e, 0xc7, 0xf1, 0x73, 0xbc, 0xc7, 0x6a, 0x09, 0x94, 0xc9, 0x67, 0xb4, 0xf5, 0xf0, 0x24, 0xc5, 0x60, 0x57, 0xfb, 0x79, 0xc9, 0x65, 0xc4, 0xfa, 0xe4, 0x18, 0x75, 0xf0, 0x6a, 0x0e, 0x4c }, + { 0x19, 0x3c, 0xc8, 0xe7, 0xc3, 0xe0, 0x8b, 0xb3, 0x0f, 0x54, 0x37, 0xaa, 0x27, 0xad, 0xe1, 0xf1, 0x42, 0x36, 0x9b, 0x24, 0x6a, 0x67, 0x5b, 0x23, 0x83, 0xe6, 0xda, 0x9b, 0x49, 0xa9, 0x80, 0x9e }, + { 0x5c, 0x10, 0x89, 0x6f, 0x0e, 0x28, 0x56, 0xb2, 0xa2, 0xee, 0xe0, 0xfe, 0x4a, 0x2c, 0x16, 0x33, 0x56, 0x5d, 0x18, 0xf0, 0xe9, 0x3e, 0x1f, 0xab, 0x26, 0xc3, 0x73, 0xe8, 0xf8, 0x29, 0x65, 0x4d }, + { 0xf1, 0x60, 0x12, 0xd9, 0x3f, 0x28, 0x85, 0x1a, 0x1e, 0xb9, 0x89, 0xf5, 0xd0, 0xb4, 0x3f, 0x3f, 0x39, 0xca, 0x73, 0xc9, 0xa6, 0x2d, 0x51, 0x81, 0xbf, 0xf2, 0x37, 0x53, 0x6b, 0xd3, 0x48, 0xc3 }, + { 0x29, 0x66, 0xb3, 0xcf, 0xae, 0x1e, 0x44, 0xea, 0x99, 0x6d, 0xc5, 0xd6, 0x86, 0xcf, 0x25, 0xfa, 0x05, 0x3f, 0xb6, 0xf6, 0x72, 0x01, 0xb9, 0xe4, 0x6e, 0xad, 0xe8, 0x5d, 0x0a, 0xd6, 0xb8, 0x06 }, + { 0xdd, 0xb8, 0x78, 0x24, 0x85, 0xe9, 0x00, 0xbc, 0x60, 0xbc, 0xf4, 0xc3, 0x3a, 0x6f, 0xd5, 0x85, 0x68, 0x0c, 0xc6, 0x83, 0xd5, 0x16, 0xef, 0xa0, 0x3e, 0xb9, 0x98, 0x5f, 0xad, 0x87, 0x15, 0xfb }, + { 0x4c, 0x4d, 0x6e, 0x71, 0xae, 0xa0, 0x57, 0x86, 0x41, 0x31, 0x48, 0xfc, 0x7a, 0x78, 0x6b, 0x0e, 0xca, 0xf5, 0x82, 0xcf, 0xf1, 0x20, 0x9f, 0x5a, 0x80, 0x9f, 0xba, 0x85, 0x04, 0xce, 0x66, 0x2c }, + { 0xfb, 0x4c, 0x5e, 0x86, 0xd7, 0xb2, 0x22, 0x9b, 0x99, 0xb8, 0xba, 0x6d, 0x94, 0xc2, 0x47, 0xef, 0x96, 0x4a, 0xa3, 0xa2, 0xba, 0xe8, 0xed, 0xc7, 0x75, 0x69, 0xf2, 0x8d, 0xbb, 0xff, 0x2d, 0x4e }, + { 0xe9, 0x4f, 0x52, 0x6d, 0xe9, 0x01, 0x96, 0x33, 0xec, 0xd5, 0x4a, 0xc6, 0x12, 0x0f, 0x23, 0x95, 0x8d, 0x77, 0x18, 0xf1, 0xe7, 0x71, 0x7b, 0xf3, 0x29, 0x21, 0x1a, 0x4f, 0xae, 0xed, 0x4e, 0x6d }, + { 0xcb, 0xd6, 0x66, 0x0a, 0x10, 0xdb, 0x3f, 0x23, 0xf7, 0xa0, 0x3d, 0x4b, 0x9d, 0x40, 0x44, 0xc7, 0x93, 0x2b, 0x28, 0x01, 0xac, 0x89, 0xd6, 0x0b, 0xc9, 0xeb, 0x92, 0xd6, 0x5a, 0x46, 0xc2, 0xa0 }, + { 0x88, 0x18, 0xbb, 0xd3, 0xdb, 0x4d, 0xc1, 0x23, 0xb2, 0x5c, 0xbb, 0xa5, 0xf5, 0x4c, 0x2b, 0xc4, 0xb3, 0xfc, 0xf9, 0xbf, 0x7d, 0x7a, 0x77, 0x09, 0xf4, 0xae, 0x58, 0x8b, 0x26, 0x7c, 0x4e, 0xce }, + { 0xc6, 0x53, 0x82, 0x51, 0x3f, 0x07, 0x46, 0x0d, 0xa3, 0x98, 0x33, 0xcb, 0x66, 0x6c, 0x5e, 0xd8, 0x2e, 0x61, 0xb9, 0xe9, 0x98, 0xf4, 0xb0, 0xc4, 0x28, 0x7c, 0xee, 0x56, 0xc3, 0xcc, 0x9b, 0xcd }, + { 0x89, 0x75, 0xb0, 0x57, 0x7f, 0xd3, 0x55, 0x66, 0xd7, 0x50, 0xb3, 0x62, 0xb0, 0x89, 0x7a, 0x26, 0xc3, 0x99, 0x13, 0x6d, 0xf0, 0x7b, 0xab, 0xab, 0xbd, 0xe6, 0x20, 0x3f, 0xf2, 0x95, 0x4e, 0xd4 }, + { 0x21, 0xfe, 0x0c, 0xeb, 0x00, 0x52, 0xbe, 0x7f, 0xb0, 0xf0, 0x04, 0x18, 0x7c, 0xac, 0xd7, 0xde, 0x67, 0xfa, 0x6e, 0xb0, 0x93, 0x8d, 0x92, 0x76, 0x77, 0xf2, 0x39, 0x8c, 0x13, 0x23, 0x17, 0xa8 }, + { 0x2e, 0xf7, 0x3f, 0x3c, 0x26, 0xf1, 0x2d, 0x93, 0x88, 0x9f, 0x3c, 0x78, 0xb6, 0xa6, 0x6c, 0x1d, 0x52, 0xb6, 0x49, 0xdc, 0x9e, 0x85, 0x6e, 0x2c, 0x17, 0x2e, 0xa7, 0xc5, 0x8a, 0xc2, 0xb5, 0xe3 }, + { 0x38, 0x8a, 0x3c, 0xd5, 0x6d, 0x73, 0x86, 0x7a, 0xbb, 0x5f, 0x84, 0x01, 0x49, 0x2b, 0x6e, 0x26, 0x81, 0xeb, 0x69, 0x85, 0x1e, 0x76, 0x7f, 0xd8, 0x42, 0x10, 0xa5, 0x60, 0x76, 0xfb, 0x3d, 0xd3 }, + { 0xaf, 0x53, 0x3e, 0x02, 0x2f, 0xc9, 0x43, 0x9e, 0x4e, 0x3c, 0xb8, 0x38, 0xec, 0xd1, 0x86, 0x92, 0x23, 0x2a, 0xdf, 0x6f, 0xe9, 0x83, 0x95, 0x26, 0xd3, 0xc3, 0xdd, 0x1b, 0x71, 0x91, 0x0b, 0x1a }, + { 0x75, 0x1c, 0x09, 0xd4, 0x1a, 0x93, 0x43, 0x88, 0x2a, 0x81, 0xcd, 0x13, 0xee, 0x40, 0x81, 0x8d, 0x12, 0xeb, 0x44, 0xc6, 0xc7, 0xf4, 0x0d, 0xf1, 0x6e, 0x4a, 0xea, 0x8f, 0xab, 0x91, 0x97, 0x2a }, + { 0x5b, 0x73, 0xdd, 0xb6, 0x8d, 0x9d, 0x2b, 0x0a, 0xa2, 0x65, 0xa0, 0x79, 0x88, 0xd6, 0xb8, 0x8a, 0xe9, 0xaa, 0xc5, 0x82, 0xaf, 0x83, 0x03, 0x2f, 0x8a, 0x9b, 0x21, 0xa2, 0xe1, 0xb7, 0xbf, 0x18 }, + { 0x3d, 0xa2, 0x91, 0x26, 0xc7, 0xc5, 0xd7, 0xf4, 0x3e, 0x64, 0x24, 0x2a, 0x79, 0xfe, 0xaa, 0x4e, 0xf3, 0x45, 0x9c, 0xde, 0xcc, 0xc8, 0x98, 0xed, 0x59, 0xa9, 0x7f, 0x6e, 0xc9, 0x3b, 0x9d, 0xab }, + { 0x56, 0x6d, 0xc9, 0x20, 0x29, 0x3d, 0xa5, 0xcb, 0x4f, 0xe0, 0xaa, 0x8a, 0xbd, 0xa8, 0xbb, 0xf5, 0x6f, 0x55, 0x23, 0x13, 0xbf, 0xf1, 0x90, 0x46, 0x64, 0x1e, 0x36, 0x15, 0xc1, 0xe3, 0xed, 0x3f }, + { 0x41, 0x15, 0xbe, 0xa0, 0x2f, 0x73, 0xf9, 0x7f, 0x62, 0x9e, 0x5c, 0x55, 0x90, 0x72, 0x0c, 0x01, 0xe7, 0xe4, 0x49, 0xae, 0x2a, 0x66, 0x97, 0xd4, 0xd2, 0x78, 0x33, 0x21, 0x30, 0x36, 0x92, 0xf9 }, + { 0x4c, 0xe0, 0x8f, 0x47, 0x62, 0x46, 0x8a, 0x76, 0x70, 0x01, 0x21, 0x64, 0x87, 0x8d, 0x68, 0x34, 0x0c, 0x52, 0xa3, 0x5e, 0x66, 0xc1, 0x88, 0x4d, 0x5c, 0x86, 0x48, 0x89, 0xab, 0xc9, 0x66, 0x77 }, + { 0x81, 0xea, 0x0b, 0x78, 0x04, 0x12, 0x4e, 0x0c, 0x22, 0xea, 0x5f, 0xc7, 0x11, 0x04, 0xa2, 0xaf, 0xcb, 0x52, 0xa1, 0xfa, 0x81, 0x6f, 0x3e, 0xcb, 0x7d, 0xcb, 0x5d, 0x9d, 0xea, 0x17, 0x86, 0xd0 }, + { 0xfe, 0x36, 0x27, 0x33, 0xb0, 0x5f, 0x6b, 0xed, 0xaf, 0x93, 0x79, 0xd7, 0xf7, 0x93, 0x6e, 0xde, 0x20, 0x9b, 0x1f, 0x83, 0x23, 0xc3, 0x92, 0x25, 0x49, 0xd9, 0xe7, 0x36, 0x81, 0xb5, 0xdb, 0x7b }, + { 0xef, 0xf3, 0x7d, 0x30, 0xdf, 0xd2, 0x03, 0x59, 0xbe, 0x4e, 0x73, 0xfd, 0xf4, 0x0d, 0x27, 0x73, 0x4b, 0x3d, 0xf9, 0x0a, 0x97, 0xa5, 0x5e, 0xd7, 0x45, 0x29, 0x72, 0x94, 0xca, 0x85, 0xd0, 0x9f }, + { 0x17, 0x2f, 0xfc, 0x67, 0x15, 0x3d, 0x12, 0xe0, 0xca, 0x76, 0xa8, 0xb6, 0xcd, 0x5d, 0x47, 0x31, 0x88, 0x5b, 0x39, 0xce, 0x0c, 0xac, 0x93, 0xa8, 0x97, 0x2a, 0x18, 0x00, 0x6c, 0x8b, 0x8b, 0xaf }, + { 0xc4, 0x79, 0x57, 0xf1, 0xcc, 0x88, 0xe8, 0x3e, 0xf9, 0x44, 0x58, 0x39, 0x70, 0x9a, 0x48, 0x0a, 0x03, 0x6b, 0xed, 0x5f, 0x88, 0xac, 0x0f, 0xcc, 0x8e, 0x1e, 0x70, 0x3f, 0xfa, 0xac, 0x13, 0x2c }, + { 0x30, 0xf3, 0x54, 0x83, 0x70, 0xcf, 0xdc, 0xed, 0xa5, 0xc3, 0x7b, 0x56, 0x9b, 0x61, 0x75, 0xe7, 0x99, 0xee, 0xf1, 0xa6, 0x2a, 0xaa, 0x94, 0x32, 0x45, 0xae, 0x76, 0x69, 0xc2, 0x27, 0xa7, 0xb5 }, + { 0xc9, 0x5d, 0xcb, 0x3c, 0xf1, 0xf2, 0x7d, 0x0e, 0xef, 0x2f, 0x25, 0xd2, 0x41, 0x38, 0x70, 0x90, 0x4a, 0x87, 0x7c, 0x4a, 0x56, 0xc2, 0xde, 0x1e, 0x83, 0xe2, 0xbc, 0x2a, 0xe2, 0xe4, 0x68, 0x21 }, + { 0xd5, 0xd0, 0xb5, 0xd7, 0x05, 0x43, 0x4c, 0xd4, 0x6b, 0x18, 0x57, 0x49, 0xf6, 0x6b, 0xfb, 0x58, 0x36, 0xdc, 0xdf, 0x6e, 0xe5, 0x49, 0xa2, 0xb7, 0xa4, 0xae, 0xe7, 0xf5, 0x80, 0x07, 0xca, 0xaf }, + { 0xbb, 0xc1, 0x24, 0xa7, 0x12, 0xf1, 0x5d, 0x07, 0xc3, 0x00, 0xe0, 0x5b, 0x66, 0x83, 0x89, 0xa4, 0x39, 0xc9, 0x17, 0x77, 0xf7, 0x21, 0xf8, 0x32, 0x0c, 0x1c, 0x90, 0x78, 0x06, 0x6d, 0x2c, 0x7e }, + { 0xa4, 0x51, 0xb4, 0x8c, 0x35, 0xa6, 0xc7, 0x85, 0x4c, 0xfa, 0xae, 0x60, 0x26, 0x2e, 0x76, 0x99, 0x08, 0x16, 0x38, 0x2a, 0xc0, 0x66, 0x7e, 0x5a, 0x5c, 0x9e, 0x1b, 0x46, 0xc4, 0x34, 0x2d, 0xdf }, + { 0xb0, 0xd1, 0x50, 0xfb, 0x55, 0xe7, 0x78, 0xd0, 0x11, 0x47, 0xf0, 0xb5, 0xd8, 0x9d, 0x99, 0xec, 0xb2, 0x0f, 0xf0, 0x7e, 0x5e, 0x67, 0x60, 0xd6, 0xb6, 0x45, 0xeb, 0x5b, 0x65, 0x4c, 0x62, 0x2b }, + { 0x34, 0xf7, 0x37, 0xc0, 0xab, 0x21, 0x99, 0x51, 0xee, 0xe8, 0x9a, 0x9f, 0x8d, 0xac, 0x29, 0x9c, 0x9d, 0x4c, 0x38, 0xf3, 0x3f, 0xa4, 0x94, 0xc5, 0xc6, 0xee, 0xfc, 0x92, 0xb6, 0xdb, 0x08, 0xbc }, + { 0x1a, 0x62, 0xcc, 0x3a, 0x00, 0x80, 0x0d, 0xcb, 0xd9, 0x98, 0x91, 0x08, 0x0c, 0x1e, 0x09, 0x84, 0x58, 0x19, 0x3a, 0x8c, 0xc9, 0xf9, 0x70, 0xea, 0x99, 0xfb, 0xef, 0xf0, 0x03, 0x18, 0xc2, 0x89 }, + { 0xcf, 0xce, 0x55, 0xeb, 0xaf, 0xc8, 0x40, 0xd7, 0xae, 0x48, 0x28, 0x1c, 0x7f, 0xd5, 0x7e, 0xc8, 0xb4, 0x82, 0xd4, 0xb7, 0x04, 0x43, 0x74, 0x95, 0x49, 0x5a, 0xc4, 0x14, 0xcf, 0x4a, 0x37, 0x4b }, + { 0x67, 0x46, 0xfa, 0xcf, 0x71, 0x14, 0x6d, 0x99, 0x9d, 0xab, 0xd0, 0x5d, 0x09, 0x3a, 0xe5, 0x86, 0x64, 0x8d, 0x1e, 0xe2, 0x8e, 0x72, 0x61, 0x7b, 0x99, 0xd0, 0xf0, 0x08, 0x6e, 0x1e, 0x45, 0xbf }, + { 0x57, 0x1c, 0xed, 0x28, 0x3b, 0x3f, 0x23, 0xb4, 0xe7, 0x50, 0xbf, 0x12, 0xa2, 0xca, 0xf1, 0x78, 0x18, 0x47, 0xbd, 0x89, 0x0e, 0x43, 0x60, 0x3c, 0xdc, 0x59, 0x76, 0x10, 0x2b, 0x7b, 0xb1, 0x1b }, + { 0xcf, 0xcb, 0x76, 0x5b, 0x04, 0x8e, 0x35, 0x02, 0x2c, 0x5d, 0x08, 0x9d, 0x26, 0xe8, 0x5a, 0x36, 0xb0, 0x05, 0xa2, 0xb8, 0x04, 0x93, 0xd0, 0x3a, 0x14, 0x4e, 0x09, 0xf4, 0x09, 0xb6, 0xaf, 0xd1 }, + { 0x40, 0x50, 0xc7, 0xa2, 0x77, 0x05, 0xbb, 0x27, 0xf4, 0x20, 0x89, 0xb2, 0x99, 0xf3, 0xcb, 0xe5, 0x05, 0x4e, 0xad, 0x68, 0x72, 0x7e, 0x8e, 0xf9, 0x31, 0x8c, 0xe6, 0xf2, 0x5c, 0xd6, 0xf3, 0x1d }, + { 0x18, 0x40, 0x70, 0xbd, 0x5d, 0x26, 0x5f, 0xbd, 0xc1, 0x42, 0xcd, 0x1c, 0x5c, 0xd0, 0xd7, 0xe4, 0x14, 0xe7, 0x03, 0x69, 0xa2, 0x66, 0xd6, 0x27, 0xc8, 0xfb, 0xa8, 0x4f, 0xa5, 0xe8, 0x4c, 0x34 }, + { 0x9e, 0xdd, 0xa9, 0xa4, 0x44, 0x39, 0x02, 0xa9, 0x58, 0x8c, 0x0d, 0x0c, 0xcc, 0x62, 0xb9, 0x30, 0x21, 0x84, 0x79, 0xa6, 0x84, 0x1e, 0x6f, 0xe7, 0xd4, 0x30, 0x03, 0xf0, 0x4b, 0x1f, 0xd6, 0x43 }, + { 0xe4, 0x12, 0xfe, 0xef, 0x79, 0x08, 0x32, 0x4a, 0x6d, 0xa1, 0x84, 0x16, 0x29, 0xf3, 0x5d, 0x3d, 0x35, 0x86, 0x42, 0x01, 0x93, 0x10, 0xec, 0x57, 0xc6, 0x14, 0x83, 0x6b, 0x63, 0xd3, 0x07, 0x63 }, + { 0x1a, 0x2b, 0x8e, 0xdf, 0xf3, 0xf9, 0xac, 0xc1, 0x55, 0x4f, 0xcb, 0xae, 0x3c, 0xf1, 0xd6, 0x29, 0x8c, 0x64, 0x62, 0xe2, 0x2e, 0x5e, 0xb0, 0x25, 0x96, 0x84, 0xf8, 0x35, 0x01, 0x2b, 0xd1, 0x3f }, + { 0x28, 0x8c, 0x4a, 0xd9, 0xb9, 0x40, 0x97, 0x62, 0xea, 0x07, 0xc2, 0x4a, 0x41, 0xf0, 0x4f, 0x69, 0xa7, 0xd7, 0x4b, 0xee, 0x2d, 0x95, 0x43, 0x53, 0x74, 0xbd, 0xe9, 0x46, 0xd7, 0x24, 0x1c, 0x7b }, + { 0x80, 0x56, 0x91, 0xbb, 0x28, 0x67, 0x48, 0xcf, 0xb5, 0x91, 0xd3, 0xae, 0xbe, 0x7e, 0x6f, 0x4e, 0x4d, 0xc6, 0xe2, 0x80, 0x8c, 0x65, 0x14, 0x3c, 0xc0, 0x04, 0xe4, 0xeb, 0x6f, 0xd0, 0x9d, 0x43 }, + { 0xd4, 0xac, 0x8d, 0x3a, 0x0a, 0xfc, 0x6c, 0xfa, 0x7b, 0x46, 0x0a, 0xe3, 0x00, 0x1b, 0xae, 0xb3, 0x6d, 0xad, 0xb3, 0x7d, 0xa0, 0x7d, 0x2e, 0x8a, 0xc9, 0x18, 0x22, 0xdf, 0x34, 0x8a, 0xed, 0x3d }, + { 0xc3, 0x76, 0x61, 0x70, 0x14, 0xd2, 0x01, 0x58, 0xbc, 0xed, 0x3d, 0x3b, 0xa5, 0x52, 0xb6, 0xec, 0xcf, 0x84, 0xe6, 0x2a, 0xa3, 0xeb, 0x65, 0x0e, 0x90, 0x02, 0x9c, 0x84, 0xd1, 0x3e, 0xea, 0x69 }, + { 0xc4, 0x1f, 0x09, 0xf4, 0x3c, 0xec, 0xae, 0x72, 0x93, 0xd6, 0x00, 0x7c, 0xa0, 0xa3, 0x57, 0x08, 0x7d, 0x5a, 0xe5, 0x9b, 0xe5, 0x00, 0xc1, 0xcd, 0x5b, 0x28, 0x9e, 0xe8, 0x10, 0xc7, 0xb0, 0x82 }, + { 0x03, 0xd1, 0xce, 0xd1, 0xfb, 0xa5, 0xc3, 0x91, 0x55, 0xc4, 0x4b, 0x77, 0x65, 0xcb, 0x76, 0x0c, 0x78, 0x70, 0x8d, 0xcf, 0xc8, 0x0b, 0x0b, 0xd8, 0xad, 0xe3, 0xa5, 0x6d, 0xa8, 0x83, 0x0b, 0x29 }, + { 0x09, 0xbd, 0xe6, 0xf1, 0x52, 0x21, 0x8d, 0xc9, 0x2c, 0x41, 0xd7, 0xf4, 0x53, 0x87, 0xe6, 0x3e, 0x58, 0x69, 0xd8, 0x07, 0xec, 0x70, 0xb8, 0x21, 0x40, 0x5d, 0xbd, 0x88, 0x4b, 0x7f, 0xcf, 0x4b }, + { 0x71, 0xc9, 0x03, 0x6e, 0x18, 0x17, 0x9b, 0x90, 0xb3, 0x7d, 0x39, 0xe9, 0xf0, 0x5e, 0xb8, 0x9c, 0xc5, 0xfc, 0x34, 0x1f, 0xd7, 0xc4, 0x77, 0xd0, 0xd7, 0x49, 0x32, 0x85, 0xfa, 0xca, 0x08, 0xa4 }, + { 0x59, 0x16, 0x83, 0x3e, 0xbb, 0x05, 0xcd, 0x91, 0x9c, 0xa7, 0xfe, 0x83, 0xb6, 0x92, 0xd3, 0x20, 0x5b, 0xef, 0x72, 0x39, 0x2b, 0x2c, 0xf6, 0xbb, 0x0a, 0x6d, 0x43, 0xf9, 0x94, 0xf9, 0x5f, 0x11 }, + { 0xf6, 0x3a, 0xab, 0x3e, 0xc6, 0x41, 0xb3, 0xb0, 0x24, 0x96, 0x4c, 0x2b, 0x43, 0x7c, 0x04, 0xf6, 0x04, 0x3c, 0x4c, 0x7e, 0x02, 0x79, 0x23, 0x99, 0x95, 0x40, 0x19, 0x58, 0xf8, 0x6b, 0xbe, 0x54 }, + { 0xf1, 0x72, 0xb1, 0x80, 0xbf, 0xb0, 0x97, 0x40, 0x49, 0x31, 0x20, 0xb6, 0x32, 0x6c, 0xbd, 0xc5, 0x61, 0xe4, 0x77, 0xde, 0xf9, 0xbb, 0xcf, 0xd2, 0x8c, 0xc8, 0xc1, 0xc5, 0xe3, 0x37, 0x9a, 0x31 }, + { 0xcb, 0x9b, 0x89, 0xcc, 0x18, 0x38, 0x1d, 0xd9, 0x14, 0x1a, 0xde, 0x58, 0x86, 0x54, 0xd4, 0xe6, 0xa2, 0x31, 0xd5, 0xbf, 0x49, 0xd4, 0xd5, 0x9a, 0xc2, 0x7d, 0x86, 0x9c, 0xbe, 0x10, 0x0c, 0xf3 }, + { 0x7b, 0xd8, 0x81, 0x50, 0x46, 0xfd, 0xd8, 0x10, 0xa9, 0x23, 0xe1, 0x98, 0x4a, 0xae, 0xbd, 0xcd, 0xf8, 0x4d, 0x87, 0xc8, 0x99, 0x2d, 0x68, 0xb5, 0xee, 0xb4, 0x60, 0xf9, 0x3e, 0xb3, 0xc8, 0xd7 }, + { 0x60, 0x7b, 0xe6, 0x68, 0x62, 0xfd, 0x08, 0xee, 0x5b, 0x19, 0xfa, 0xca, 0xc0, 0x9d, 0xfd, 0xbc, 0xd4, 0x0c, 0x31, 0x21, 0x01, 0xd6, 0x6e, 0x6e, 0xbd, 0x2b, 0x84, 0x1f, 0x1b, 0x9a, 0x93, 0x25 }, + { 0x9f, 0xe0, 0x3b, 0xbe, 0x69, 0xab, 0x18, 0x34, 0xf5, 0x21, 0x9b, 0x0d, 0xa8, 0x8a, 0x08, 0xb3, 0x0a, 0x66, 0xc5, 0x91, 0x3f, 0x01, 0x51, 0x96, 0x3c, 0x36, 0x05, 0x60, 0xdb, 0x03, 0x87, 0xb3 }, + { 0x90, 0xa8, 0x35, 0x85, 0x71, 0x7b, 0x75, 0xf0, 0xe9, 0xb7, 0x25, 0xe0, 0x55, 0xee, 0xee, 0xb9, 0xe7, 0xa0, 0x28, 0xea, 0x7e, 0x6c, 0xbc, 0x07, 0xb2, 0x09, 0x17, 0xec, 0x03, 0x63, 0xe3, 0x8c }, + { 0x33, 0x6e, 0xa0, 0x53, 0x0f, 0x4a, 0x74, 0x69, 0x12, 0x6e, 0x02, 0x18, 0x58, 0x7e, 0xbb, 0xde, 0x33, 0x58, 0xa0, 0xb3, 0x1c, 0x29, 0xd2, 0x00, 0xf7, 0xdc, 0x7e, 0xb1, 0x5c, 0x6a, 0xad, 0xd8 }, + { 0xa7, 0x9e, 0x76, 0xdc, 0x0a, 0xbc, 0xa4, 0x39, 0x6f, 0x07, 0x47, 0xcd, 0x7b, 0x74, 0x8d, 0xf9, 0x13, 0x00, 0x76, 0x26, 0xb1, 0xd6, 0x59, 0xda, 0x0c, 0x1f, 0x78, 0xb9, 0x30, 0x3d, 0x01, 0xa3 }, + { 0x44, 0xe7, 0x8a, 0x77, 0x37, 0x56, 0xe0, 0x95, 0x15, 0x19, 0x50, 0x4d, 0x70, 0x38, 0xd2, 0x8d, 0x02, 0x13, 0xa3, 0x7e, 0x0c, 0xe3, 0x75, 0x37, 0x17, 0x57, 0xbc, 0x99, 0x63, 0x11, 0xe3, 0xb8 }, + { 0x77, 0xac, 0x01, 0x2a, 0x3f, 0x75, 0x4d, 0xcf, 0xea, 0xb5, 0xeb, 0x99, 0x6b, 0xe9, 0xcd, 0x2d, 0x1f, 0x96, 0x11, 0x1b, 0x6e, 0x49, 0xf3, 0x99, 0x4d, 0xf1, 0x81, 0xf2, 0x85, 0x69, 0xd8, 0x25 }, + { 0xce, 0x5a, 0x10, 0xdb, 0x6f, 0xcc, 0xda, 0xf1, 0x40, 0xaa, 0xa4, 0xde, 0xd6, 0x25, 0x0a, 0x9c, 0x06, 0xe9, 0x22, 0x2b, 0xc9, 0xf9, 0xf3, 0x65, 0x8a, 0x4a, 0xff, 0x93, 0x5f, 0x2b, 0x9f, 0x3a }, + { 0xec, 0xc2, 0x03, 0xa7, 0xfe, 0x2b, 0xe4, 0xab, 0xd5, 0x5b, 0xb5, 0x3e, 0x6e, 0x67, 0x35, 0x72, 0xe0, 0x07, 0x8d, 0xa8, 0xcd, 0x37, 0x5e, 0xf4, 0x30, 0xcc, 0x97, 0xf9, 0xf8, 0x00, 0x83, 0xaf }, + { 0x14, 0xa5, 0x18, 0x6d, 0xe9, 0xd7, 0xa1, 0x8b, 0x04, 0x12, 0xb8, 0x56, 0x3e, 0x51, 0xcc, 0x54, 0x33, 0x84, 0x0b, 0x4a, 0x12, 0x9a, 0x8f, 0xf9, 0x63, 0xb3, 0x3a, 0x3c, 0x4a, 0xfe, 0x8e, 0xbb }, + { 0x13, 0xf8, 0xef, 0x95, 0xcb, 0x86, 0xe6, 0xa6, 0x38, 0x93, 0x1c, 0x8e, 0x10, 0x76, 0x73, 0xeb, 0x76, 0xba, 0x10, 0xd7, 0xc2, 0xcd, 0x70, 0xb9, 0xd9, 0x92, 0x0b, 0xbe, 0xed, 0x92, 0x94, 0x09 }, + { 0x0b, 0x33, 0x8f, 0x4e, 0xe1, 0x2f, 0x2d, 0xfc, 0xb7, 0x87, 0x13, 0x37, 0x79, 0x41, 0xe0, 0xb0, 0x63, 0x21, 0x52, 0x58, 0x1d, 0x13, 0x32, 0x51, 0x6e, 0x4a, 0x2c, 0xab, 0x19, 0x42, 0xcc, 0xa4 }, + { 0xea, 0xab, 0x0e, 0xc3, 0x7b, 0x3b, 0x8a, 0xb7, 0x96, 0xe9, 0xf5, 0x72, 0x38, 0xde, 0x14, 0xa2, 0x64, 0xa0, 0x76, 0xf3, 0x88, 0x7d, 0x86, 0xe2, 0x9b, 0xb5, 0x90, 0x6d, 0xb5, 0xa0, 0x0e, 0x02 }, + { 0x23, 0xcb, 0x68, 0xb8, 0xc0, 0xe6, 0xdc, 0x26, 0xdc, 0x27, 0x76, 0x6d, 0xdc, 0x0a, 0x13, 0xa9, 0x94, 0x38, 0xfd, 0x55, 0x61, 0x7a, 0xa4, 0x09, 0x5d, 0x8f, 0x96, 0x97, 0x20, 0xc8, 0x72, 0xdf }, + { 0x09, 0x1d, 0x8e, 0xe3, 0x0d, 0x6f, 0x29, 0x68, 0xd4, 0x6b, 0x68, 0x7d, 0xd6, 0x52, 0x92, 0x66, 0x57, 0x42, 0xde, 0x0b, 0xb8, 0x3d, 0xcc, 0x00, 0x04, 0xc7, 0x2c, 0xe1, 0x00, 0x07, 0xa5, 0x49 }, + { 0x7f, 0x50, 0x7a, 0xbc, 0x6d, 0x19, 0xba, 0x00, 0xc0, 0x65, 0xa8, 0x76, 0xec, 0x56, 0x57, 0x86, 0x88, 0x82, 0xd1, 0x8a, 0x22, 0x1b, 0xc4, 0x6c, 0x7a, 0x69, 0x12, 0x54, 0x1f, 0x5b, 0xc7, 0xba }, + { 0xa0, 0x60, 0x7c, 0x24, 0xe1, 0x4e, 0x8c, 0x22, 0x3d, 0xb0, 0xd7, 0x0b, 0x4d, 0x30, 0xee, 0x88, 0x01, 0x4d, 0x60, 0x3f, 0x43, 0x7e, 0x9e, 0x02, 0xaa, 0x7d, 0xaf, 0xa3, 0xcd, 0xfb, 0xad, 0x94 }, + { 0xdd, 0xbf, 0xea, 0x75, 0xcc, 0x46, 0x78, 0x82, 0xeb, 0x34, 0x83, 0xce, 0x5e, 0x2e, 0x75, 0x6a, 0x4f, 0x47, 0x01, 0xb7, 0x6b, 0x44, 0x55, 0x19, 0xe8, 0x9f, 0x22, 0xd6, 0x0f, 0xa8, 0x6e, 0x06 }, + { 0x0c, 0x31, 0x1f, 0x38, 0xc3, 0x5a, 0x4f, 0xb9, 0x0d, 0x65, 0x1c, 0x28, 0x9d, 0x48, 0x68, 0x56, 0xcd, 0x14, 0x13, 0xdf, 0x9b, 0x06, 0x77, 0xf5, 0x3e, 0xce, 0x2c, 0xd9, 0xe4, 0x77, 0xc6, 0x0a }, + { 0x46, 0xa7, 0x3a, 0x8d, 0xd3, 0xe7, 0x0f, 0x59, 0xd3, 0x94, 0x2c, 0x01, 0xdf, 0x59, 0x9d, 0xef, 0x78, 0x3c, 0x9d, 0xa8, 0x2f, 0xd8, 0x32, 0x22, 0xcd, 0x66, 0x2b, 0x53, 0xdc, 0xe7, 0xdb, 0xdf }, + { 0xad, 0x03, 0x8f, 0xf9, 0xb1, 0x4d, 0xe8, 0x4a, 0x80, 0x1e, 0x4e, 0x62, 0x1c, 0xe5, 0xdf, 0x02, 0x9d, 0xd9, 0x35, 0x20, 0xd0, 0xc2, 0xfa, 0x38, 0xbf, 0xf1, 0x76, 0xa8, 0xb1, 0xd1, 0x69, 0x8c }, + { 0xab, 0x70, 0xc5, 0xdf, 0xbd, 0x1e, 0xa8, 0x17, 0xfe, 0xd0, 0xcd, 0x06, 0x72, 0x93, 0xab, 0xf3, 0x19, 0xe5, 0xd7, 0x90, 0x1c, 0x21, 0x41, 0xd5, 0xd9, 0x9b, 0x23, 0xf0, 0x3a, 0x38, 0xe7, 0x48 }, + { 0x1f, 0xff, 0xda, 0x67, 0x93, 0x2b, 0x73, 0xc8, 0xec, 0xaf, 0x00, 0x9a, 0x34, 0x91, 0xa0, 0x26, 0x95, 0x3b, 0xab, 0xfe, 0x1f, 0x66, 0x3b, 0x06, 0x97, 0xc3, 0xc4, 0xae, 0x8b, 0x2e, 0x7d, 0xcb }, + { 0xb0, 0xd2, 0xcc, 0x19, 0x47, 0x2d, 0xd5, 0x7f, 0x2b, 0x17, 0xef, 0xc0, 0x3c, 0x8d, 0x58, 0xc2, 0x28, 0x3d, 0xbb, 0x19, 0xda, 0x57, 0x2f, 0x77, 0x55, 0x85, 0x5a, 0xa9, 0x79, 0x43, 0x17, 0xa0 }, + { 0xa0, 0xd1, 0x9a, 0x6e, 0xe3, 0x39, 0x79, 0xc3, 0x25, 0x51, 0x0e, 0x27, 0x66, 0x22, 0xdf, 0x41, 0xf7, 0x15, 0x83, 0xd0, 0x75, 0x01, 0xb8, 0x70, 0x71, 0x12, 0x9a, 0x0a, 0xd9, 0x47, 0x32, 0xa5 }, + { 0x72, 0x46, 0x42, 0xa7, 0x03, 0x2d, 0x10, 0x62, 0xb8, 0x9e, 0x52, 0xbe, 0xa3, 0x4b, 0x75, 0xdf, 0x7d, 0x8f, 0xe7, 0x72, 0xd9, 0xfe, 0x3c, 0x93, 0xdd, 0xf3, 0xc4, 0x54, 0x5a, 0xb5, 0xa9, 0x9b }, + { 0xad, 0xe5, 0xea, 0xa7, 0xe6, 0x1f, 0x67, 0x2d, 0x58, 0x7e, 0xa0, 0x3d, 0xae, 0x7d, 0x7b, 0x55, 0x22, 0x9c, 0x01, 0xd0, 0x6b, 0xc0, 0xa5, 0x70, 0x14, 0x36, 0xcb, 0xd1, 0x83, 0x66, 0xa6, 0x26 }, + { 0x01, 0x3b, 0x31, 0xeb, 0xd2, 0x28, 0xfc, 0xdd, 0xa5, 0x1f, 0xab, 0xb0, 0x3b, 0xb0, 0x2d, 0x60, 0xac, 0x20, 0xca, 0x21, 0x5a, 0xaf, 0xa8, 0x3b, 0xdd, 0x85, 0x5e, 0x37, 0x55, 0xa3, 0x5f, 0x0b }, + { 0x33, 0x2e, 0xd4, 0x0b, 0xb1, 0x0d, 0xde, 0x3c, 0x95, 0x4a, 0x75, 0xd7, 0xb8, 0x99, 0x9d, 0x4b, 0x26, 0xa1, 0xc0, 0x63, 0xc1, 0xdc, 0x6e, 0x32, 0xc1, 0xd9, 0x1b, 0xab, 0x7b, 0xbb, 0x7d, 0x16 }, + { 0xc7, 0xa1, 0x97, 0xb3, 0xa0, 0x5b, 0x56, 0x6b, 0xcc, 0x9f, 0xac, 0xd2, 0x0e, 0x44, 0x1d, 0x6f, 0x6c, 0x28, 0x60, 0xac, 0x96, 0x51, 0xcd, 0x51, 0xd6, 0xb9, 0xd2, 0xcd, 0xee, 0xea, 0x03, 0x90 }, + { 0xbd, 0x9c, 0xf6, 0x4e, 0xa8, 0x95, 0x3c, 0x03, 0x71, 0x08, 0xe6, 0xf6, 0x54, 0x91, 0x4f, 0x39, 0x58, 0xb6, 0x8e, 0x29, 0xc1, 0x67, 0x00, 0xdc, 0x18, 0x4d, 0x94, 0xa2, 0x17, 0x08, 0xff, 0x60 }, + { 0x88, 0x35, 0xb0, 0xac, 0x02, 0x11, 0x51, 0xdf, 0x71, 0x64, 0x74, 0xce, 0x27, 0xce, 0x4d, 0x3c, 0x15, 0xf0, 0xb2, 0xda, 0xb4, 0x80, 0x03, 0xcf, 0x3f, 0x3e, 0xfd, 0x09, 0x45, 0x10, 0x6b, 0x9a }, + { 0x3b, 0xfe, 0xfa, 0x33, 0x01, 0xaa, 0x55, 0xc0, 0x80, 0x19, 0x0c, 0xff, 0xda, 0x8e, 0xae, 0x51, 0xd9, 0xaf, 0x48, 0x8b, 0x4c, 0x1f, 0x24, 0xc3, 0xd9, 0xa7, 0x52, 0x42, 0xfd, 0x8e, 0xa0, 0x1d }, + { 0x08, 0x28, 0x4d, 0x14, 0x99, 0x3c, 0xd4, 0x7d, 0x53, 0xeb, 0xae, 0xcf, 0x0d, 0xf0, 0x47, 0x8c, 0xc1, 0x82, 0xc8, 0x9c, 0x00, 0xe1, 0x85, 0x9c, 0x84, 0x85, 0x16, 0x86, 0xdd, 0xf2, 0xc1, 0xb7 }, + { 0x1e, 0xd7, 0xef, 0x9f, 0x04, 0xc2, 0xac, 0x8d, 0xb6, 0xa8, 0x64, 0xdb, 0x13, 0x10, 0x87, 0xf2, 0x70, 0x65, 0x09, 0x8e, 0x69, 0xc3, 0xfe, 0x78, 0x71, 0x8d, 0x9b, 0x94, 0x7f, 0x4a, 0x39, 0xd0 }, + { 0xc1, 0x61, 0xf2, 0xdc, 0xd5, 0x7e, 0x9c, 0x14, 0x39, 0xb3, 0x1a, 0x9d, 0xd4, 0x3d, 0x8f, 0x3d, 0x7d, 0xd8, 0xf0, 0xeb, 0x7c, 0xfa, 0xc6, 0xfb, 0x25, 0xa0, 0xf2, 0x8e, 0x30, 0x6f, 0x06, 0x61 }, + { 0xc0, 0x19, 0x69, 0xad, 0x34, 0xc5, 0x2c, 0xaf, 0x3d, 0xc4, 0xd8, 0x0d, 0x19, 0x73, 0x5c, 0x29, 0x73, 0x1a, 0xc6, 0xe7, 0xa9, 0x20, 0x85, 0xab, 0x92, 0x50, 0xc4, 0x8d, 0xea, 0x48, 0xa3, 0xfc }, + { 0x17, 0x20, 0xb3, 0x65, 0x56, 0x19, 0xd2, 0xa5, 0x2b, 0x35, 0x21, 0xae, 0x0e, 0x49, 0xe3, 0x45, 0xcb, 0x33, 0x89, 0xeb, 0xd6, 0x20, 0x8a, 0xca, 0xf9, 0xf1, 0x3f, 0xda, 0xcc, 0xa8, 0xbe, 0x49 }, + { 0x75, 0x62, 0x88, 0x36, 0x1c, 0x83, 0xe2, 0x4c, 0x61, 0x7c, 0xf9, 0x5c, 0x90, 0x5b, 0x22, 0xd0, 0x17, 0xcd, 0xc8, 0x6f, 0x0b, 0xf1, 0xd6, 0x58, 0xf4, 0x75, 0x6c, 0x73, 0x79, 0x87, 0x3b, 0x7f }, + { 0xe7, 0xd0, 0xed, 0xa3, 0x45, 0x26, 0x93, 0xb7, 0x52, 0xab, 0xcd, 0xa1, 0xb5, 0x5e, 0x27, 0x6f, 0x82, 0x69, 0x8f, 0x5f, 0x16, 0x05, 0x40, 0x3e, 0xff, 0x83, 0x0b, 0xea, 0x00, 0x71, 0xa3, 0x94 }, + { 0x2c, 0x82, 0xec, 0xaa, 0x6b, 0x84, 0x80, 0x3e, 0x04, 0x4a, 0xf6, 0x31, 0x18, 0xaf, 0xe5, 0x44, 0x68, 0x7c, 0xb6, 0xe6, 0xc7, 0xdf, 0x49, 0xed, 0x76, 0x2d, 0xfd, 0x7c, 0x86, 0x93, 0xa1, 0xbc }, + { 0x61, 0x36, 0xcb, 0xf4, 0xb4, 0x41, 0x05, 0x6f, 0xa1, 0xe2, 0x72, 0x24, 0x98, 0x12, 0x5d, 0x6d, 0xed, 0x45, 0xe1, 0x7b, 0x52, 0x14, 0x39, 0x59, 0xc7, 0xf4, 0xd4, 0xe3, 0x95, 0x21, 0x8a, 0xc2 }, + { 0x72, 0x1d, 0x32, 0x45, 0xaa, 0xfe, 0xf2, 0x7f, 0x6a, 0x62, 0x4f, 0x47, 0x95, 0x4b, 0x6c, 0x25, 0x50, 0x79, 0x52, 0x6f, 0xfa, 0x25, 0xe9, 0xff, 0x77, 0xe5, 0xdc, 0xff, 0x47, 0x3b, 0x15, 0x97 }, + { 0x9d, 0xd2, 0xfb, 0xd8, 0xce, 0xf1, 0x6c, 0x35, 0x3c, 0x0a, 0xc2, 0x11, 0x91, 0xd5, 0x09, 0xeb, 0x28, 0xdd, 0x9e, 0x3e, 0x0d, 0x8c, 0xea, 0x5d, 0x26, 0xca, 0x83, 0x93, 0x93, 0x85, 0x1c, 0x3a }, + { 0xb2, 0x39, 0x4c, 0xea, 0xcd, 0xeb, 0xf2, 0x1b, 0xf9, 0xdf, 0x2c, 0xed, 0x98, 0xe5, 0x8f, 0x1c, 0x3a, 0x4b, 0xbb, 0xff, 0x66, 0x0d, 0xd9, 0x00, 0xf6, 0x22, 0x02, 0xd6, 0x78, 0x5c, 0xc4, 0x6e }, + { 0x57, 0x08, 0x9f, 0x22, 0x27, 0x49, 0xad, 0x78, 0x71, 0x76, 0x5f, 0x06, 0x2b, 0x11, 0x4f, 0x43, 0xba, 0x20, 0xec, 0x56, 0x42, 0x2a, 0x8b, 0x1e, 0x3f, 0x87, 0x19, 0x2c, 0x0e, 0xa7, 0x18, 0xc6 }, + { 0xe4, 0x9a, 0x94, 0x59, 0x96, 0x1c, 0xd3, 0x3c, 0xdf, 0x4a, 0xae, 0x1b, 0x10, 0x78, 0xa5, 0xde, 0xa7, 0xc0, 0x40, 0xe0, 0xfe, 0xa3, 0x40, 0xc9, 0x3a, 0x72, 0x48, 0x72, 0xfc, 0x4a, 0xf8, 0x06 }, + { 0xed, 0xe6, 0x7f, 0x72, 0x0e, 0xff, 0xd2, 0xca, 0x9c, 0x88, 0x99, 0x41, 0x52, 0xd0, 0x20, 0x1d, 0xee, 0x6b, 0x0a, 0x2d, 0x2c, 0x07, 0x7a, 0xca, 0x6d, 0xae, 0x29, 0xf7, 0x3f, 0x8b, 0x63, 0x09 }, + { 0xe0, 0xf4, 0x34, 0xbf, 0x22, 0xe3, 0x08, 0x80, 0x39, 0xc2, 0x1f, 0x71, 0x9f, 0xfc, 0x67, 0xf0, 0xf2, 0xcb, 0x5e, 0x98, 0xa7, 0xa0, 0x19, 0x4c, 0x76, 0xe9, 0x6b, 0xf4, 0xe8, 0xe1, 0x7e, 0x61 }, + { 0x27, 0x7c, 0x04, 0xe2, 0x85, 0x34, 0x84, 0xa4, 0xeb, 0xa9, 0x10, 0xad, 0x33, 0x6d, 0x01, 0xb4, 0x77, 0xb6, 0x7c, 0xc2, 0x00, 0xc5, 0x9f, 0x3c, 0x8d, 0x77, 0xee, 0xf8, 0x49, 0x4f, 0x29, 0xcd }, + { 0x15, 0x6d, 0x57, 0x47, 0xd0, 0xc9, 0x9c, 0x7f, 0x27, 0x09, 0x7d, 0x7b, 0x7e, 0x00, 0x2b, 0x2e, 0x18, 0x5c, 0xb7, 0x2d, 0x8d, 0xd7, 0xeb, 0x42, 0x4a, 0x03, 0x21, 0x52, 0x81, 0x61, 0x21, 0x9f }, + { 0x20, 0xdd, 0xd1, 0xed, 0x9b, 0x1c, 0xa8, 0x03, 0x94, 0x6d, 0x64, 0xa8, 0x3a, 0xe4, 0x65, 0x9d, 0xa6, 0x7f, 0xba, 0x7a, 0x1a, 0x3e, 0xdd, 0xb1, 0xe1, 0x03, 0xc0, 0xf5, 0xe0, 0x3e, 0x3a, 0x2c }, + { 0xf0, 0xaf, 0x60, 0x4d, 0x3d, 0xab, 0xbf, 0x9a, 0x0f, 0x2a, 0x7d, 0x3d, 0xda, 0x6b, 0xd3, 0x8b, 0xba, 0x72, 0xc6, 0xd0, 0x9b, 0xe4, 0x94, 0xfc, 0xef, 0x71, 0x3f, 0xf1, 0x01, 0x89, 0xb6, 0xe6 }, + { 0x98, 0x02, 0xbb, 0x87, 0xde, 0xf4, 0xcc, 0x10, 0xc4, 0xa5, 0xfd, 0x49, 0xaa, 0x58, 0xdf, 0xe2, 0xf3, 0xfd, 0xdb, 0x46, 0xb4, 0x70, 0x88, 0x14, 0xea, 0xd8, 0x1d, 0x23, 0xba, 0x95, 0x13, 0x9b }, + { 0x4f, 0x8c, 0xe1, 0xe5, 0x1d, 0x2f, 0xe7, 0xf2, 0x40, 0x43, 0xa9, 0x04, 0xd8, 0x98, 0xeb, 0xfc, 0x91, 0x97, 0x54, 0x18, 0x75, 0x34, 0x13, 0xaa, 0x09, 0x9b, 0x79, 0x5e, 0xcb, 0x35, 0xce, 0xdb }, + { 0xbd, 0xdc, 0x65, 0x14, 0xd7, 0xee, 0x6a, 0xce, 0x0a, 0x4a, 0xc1, 0xd0, 0xe0, 0x68, 0x11, 0x22, 0x88, 0xcb, 0xcf, 0x56, 0x04, 0x54, 0x64, 0x27, 0x05, 0x63, 0x01, 0x77, 0xcb, 0xa6, 0x08, 0xbd }, + { 0xd6, 0x35, 0x99, 0x4f, 0x62, 0x91, 0x51, 0x7b, 0x02, 0x81, 0xff, 0xdd, 0x49, 0x6a, 0xfa, 0x86, 0x27, 0x12, 0xe5, 0xb3, 0xc4, 0xe5, 0x2e, 0x4c, 0xd5, 0xfd, 0xae, 0x8c, 0x0e, 0x72, 0xfb, 0x08 }, + { 0x87, 0x8d, 0x9c, 0xa6, 0x00, 0xcf, 0x87, 0xe7, 0x69, 0xcc, 0x30, 0x5c, 0x1b, 0x35, 0x25, 0x51, 0x86, 0x61, 0x5a, 0x73, 0xa0, 0xda, 0x61, 0x3b, 0x5f, 0x1c, 0x98, 0xdb, 0xf8, 0x12, 0x83, 0xea }, + { 0xa6, 0x4e, 0xbe, 0x5d, 0xc1, 0x85, 0xde, 0x9f, 0xdd, 0xe7, 0x60, 0x7b, 0x69, 0x98, 0x70, 0x2e, 0xb2, 0x34, 0x56, 0x18, 0x49, 0x57, 0x30, 0x7d, 0x2f, 0xa7, 0x2e, 0x87, 0xa4, 0x77, 0x02, 0xd6 }, + { 0xce, 0x50, 0xea, 0xb7, 0xb5, 0xeb, 0x52, 0xbd, 0xc9, 0xad, 0x8e, 0x5a, 0x48, 0x0a, 0xb7, 0x80, 0xca, 0x93, 0x20, 0xe4, 0x43, 0x60, 0xb1, 0xfe, 0x37, 0xe0, 0x3f, 0x2f, 0x7a, 0xd7, 0xde, 0x01 }, + { 0xee, 0xdd, 0xb7, 0xc0, 0xdb, 0x6e, 0x30, 0xab, 0xe6, 0x6d, 0x79, 0xe3, 0x27, 0x51, 0x1e, 0x61, 0xfc, 0xeb, 0xbc, 0x29, 0xf1, 0x59, 0xb4, 0x0a, 0x86, 0xb0, 0x46, 0xec, 0xf0, 0x51, 0x38, 0x23 }, + { 0x78, 0x7f, 0xc9, 0x34, 0x40, 0xc1, 0xec, 0x96, 0xb5, 0xad, 0x01, 0xc1, 0x6c, 0xf7, 0x79, 0x16, 0xa1, 0x40, 0x5f, 0x94, 0x26, 0x35, 0x6e, 0xc9, 0x21, 0xd8, 0xdf, 0xf3, 0xea, 0x63, 0xb7, 0xe0 }, + { 0x7f, 0x0d, 0x5e, 0xab, 0x47, 0xee, 0xfd, 0xa6, 0x96, 0xc0, 0xbf, 0x0f, 0xbf, 0x86, 0xab, 0x21, 0x6f, 0xce, 0x46, 0x1e, 0x93, 0x03, 0xab, 0xa6, 0xac, 0x37, 0x41, 0x20, 0xe8, 0x90, 0xe8, 0xdf }, + { 0xb6, 0x80, 0x04, 0xb4, 0x2f, 0x14, 0xad, 0x02, 0x9f, 0x4c, 0x2e, 0x03, 0xb1, 0xd5, 0xeb, 0x76, 0xd5, 0x71, 0x60, 0xe2, 0x64, 0x76, 0xd2, 0x11, 0x31, 0xbe, 0xf2, 0x0a, 0xda, 0x7d, 0x27, 0xf4 }, + { 0xb0, 0xc4, 0xeb, 0x18, 0xae, 0x25, 0x0b, 0x51, 0xa4, 0x13, 0x82, 0xea, 0xd9, 0x2d, 0x0d, 0xc7, 0x45, 0x5f, 0x93, 0x79, 0xfc, 0x98, 0x84, 0x42, 0x8e, 0x47, 0x70, 0x60, 0x8d, 0xb0, 0xfa, 0xec }, + { 0xf9, 0x2b, 0x7a, 0x87, 0x0c, 0x05, 0x9f, 0x4d, 0x46, 0x46, 0x4c, 0x82, 0x4e, 0xc9, 0x63, 0x55, 0x14, 0x0b, 0xdc, 0xe6, 0x81, 0x32, 0x2c, 0xc3, 0xa9, 0x92, 0xff, 0x10, 0x3e, 0x3f, 0xea, 0x52 }, + { 0x53, 0x64, 0x31, 0x26, 0x14, 0x81, 0x33, 0x98, 0xcc, 0x52, 0x5d, 0x4c, 0x4e, 0x14, 0x6e, 0xde, 0xb3, 0x71, 0x26, 0x5f, 0xba, 0x19, 0x13, 0x3a, 0x2c, 0x3d, 0x21, 0x59, 0x29, 0x8a, 0x17, 0x42 }, + { 0xf6, 0x62, 0x0e, 0x68, 0xd3, 0x7f, 0xb2, 0xaf, 0x50, 0x00, 0xfc, 0x28, 0xe2, 0x3b, 0x83, 0x22, 0x97, 0xec, 0xd8, 0xbc, 0xe9, 0x9e, 0x8b, 0xe4, 0xd0, 0x4e, 0x85, 0x30, 0x9e, 0x3d, 0x33, 0x74 }, + { 0x53, 0x16, 0xa2, 0x79, 0x69, 0xd7, 0xfe, 0x04, 0xff, 0x27, 0xb2, 0x83, 0x96, 0x1b, 0xff, 0xc3, 0xbf, 0x5d, 0xfb, 0x32, 0xfb, 0x6a, 0x89, 0xd1, 0x01, 0xc6, 0xc3, 0xb1, 0x93, 0x7c, 0x28, 0x71 }, + { 0x81, 0xd1, 0x66, 0x4f, 0xdf, 0x3c, 0xb3, 0x3c, 0x24, 0xee, 0xba, 0xc0, 0xbd, 0x64, 0x24, 0x4b, 0x77, 0xc4, 0xab, 0xea, 0x90, 0xbb, 0xe8, 0xb5, 0xee, 0x0b, 0x2a, 0xaf, 0xcf, 0x2d, 0x6a, 0x53 }, + { 0x34, 0x57, 0x82, 0xf2, 0x95, 0xb0, 0x88, 0x03, 0x52, 0xe9, 0x24, 0xa0, 0x46, 0x7b, 0x5f, 0xbc, 0x3e, 0x8f, 0x3b, 0xfb, 0xc3, 0xc7, 0xe4, 0x8b, 0x67, 0x09, 0x1f, 0xb5, 0xe8, 0x0a, 0x94, 0x42 }, + { 0x79, 0x41, 0x11, 0xea, 0x6c, 0xd6, 0x5e, 0x31, 0x1f, 0x74, 0xee, 0x41, 0xd4, 0x76, 0xcb, 0x63, 0x2c, 0xe1, 0xe4, 0xb0, 0x51, 0xdc, 0x1d, 0x9e, 0x9d, 0x06, 0x1a, 0x19, 0xe1, 0xd0, 0xbb, 0x49 }, + { 0x2a, 0x85, 0xda, 0xf6, 0x13, 0x88, 0x16, 0xb9, 0x9b, 0xf8, 0xd0, 0x8b, 0xa2, 0x11, 0x4b, 0x7a, 0xb0, 0x79, 0x75, 0xa7, 0x84, 0x20, 0xc1, 0xa3, 0xb0, 0x6a, 0x77, 0x7c, 0x22, 0xdd, 0x8b, 0xcb }, + { 0x89, 0xb0, 0xd5, 0xf2, 0x89, 0xec, 0x16, 0x40, 0x1a, 0x06, 0x9a, 0x96, 0x0d, 0x0b, 0x09, 0x3e, 0x62, 0x5d, 0xa3, 0xcf, 0x41, 0xee, 0x29, 0xb5, 0x9b, 0x93, 0x0c, 0x58, 0x20, 0x14, 0x54, 0x55 }, + { 0xd0, 0xfd, 0xcb, 0x54, 0x39, 0x43, 0xfc, 0x27, 0xd2, 0x08, 0x64, 0xf5, 0x21, 0x81, 0x47, 0x1b, 0x94, 0x2c, 0xc7, 0x7c, 0xa6, 0x75, 0xbc, 0xb3, 0x0d, 0xf3, 0x1d, 0x35, 0x8e, 0xf7, 0xb1, 0xeb }, + { 0xb1, 0x7e, 0xa8, 0xd7, 0x70, 0x63, 0xc7, 0x09, 0xd4, 0xdc, 0x6b, 0x87, 0x94, 0x13, 0xc3, 0x43, 0xe3, 0x79, 0x0e, 0x9e, 0x62, 0xca, 0x85, 0xb7, 0x90, 0x0b, 0x08, 0x6f, 0x6b, 0x75, 0xc6, 0x72 }, + { 0xe7, 0x1a, 0x3e, 0x2c, 0x27, 0x4d, 0xb8, 0x42, 0xd9, 0x21, 0x14, 0xf2, 0x17, 0xe2, 0xc0, 0xea, 0xc8, 0xb4, 0x50, 0x93, 0xfd, 0xfd, 0x9d, 0xf4, 0xca, 0x71, 0x62, 0x39, 0x48, 0x62, 0xd5, 0x01 }, + { 0xc0, 0x47, 0x67, 0x59, 0xab, 0x7a, 0xa3, 0x33, 0x23, 0x4f, 0x6b, 0x44, 0xf5, 0xfd, 0x85, 0x83, 0x90, 0xec, 0x23, 0x69, 0x4c, 0x62, 0x2c, 0xb9, 0x86, 0xe7, 0x69, 0xc7, 0x8e, 0xdd, 0x73, 0x3e }, + { 0x9a, 0xb8, 0xea, 0xbb, 0x14, 0x16, 0x43, 0x4d, 0x85, 0x39, 0x13, 0x41, 0xd5, 0x69, 0x93, 0xc5, 0x54, 0x58, 0x16, 0x7d, 0x44, 0x18, 0xb1, 0x9a, 0x0f, 0x2a, 0xd8, 0xb7, 0x9a, 0x83, 0xa7, 0x5b }, + { 0x79, 0x92, 0xd0, 0xbb, 0xb1, 0x5e, 0x23, 0x82, 0x6f, 0x44, 0x3e, 0x00, 0x50, 0x5d, 0x68, 0xd3, 0xed, 0x73, 0x72, 0x99, 0x5a, 0x5c, 0x3e, 0x49, 0x86, 0x54, 0x10, 0x2f, 0xbc, 0xd0, 0x96, 0x4e }, + { 0xc0, 0x21, 0xb3, 0x00, 0x85, 0x15, 0x14, 0x35, 0xdf, 0x33, 0xb0, 0x07, 0xcc, 0xec, 0xc6, 0x9d, 0xf1, 0x26, 0x9f, 0x39, 0xba, 0x25, 0x09, 0x2b, 0xed, 0x59, 0xd9, 0x32, 0xac, 0x0f, 0xdc, 0x28 }, + { 0x91, 0xa2, 0x5e, 0xc0, 0xec, 0x0d, 0x9a, 0x56, 0x7f, 0x89, 0xc4, 0xbf, 0xe1, 0xa6, 0x5a, 0x0e, 0x43, 0x2d, 0x07, 0x06, 0x4b, 0x41, 0x90, 0xe2, 0x7d, 0xfb, 0x81, 0x90, 0x1f, 0xd3, 0x13, 0x9b }, + { 0x59, 0x50, 0xd3, 0x9a, 0x23, 0xe1, 0x54, 0x5f, 0x30, 0x12, 0x70, 0xaa, 0x1a, 0x12, 0xf2, 0xe6, 0xc4, 0x53, 0x77, 0x6e, 0x4d, 0x63, 0x55, 0xde, 0x42, 0x5c, 0xc1, 0x53, 0xf9, 0x81, 0x88, 0x67 }, + { 0xd7, 0x9f, 0x14, 0x72, 0x0c, 0x61, 0x0a, 0xf1, 0x79, 0xa3, 0x76, 0x5d, 0x4b, 0x7c, 0x09, 0x68, 0xf9, 0x77, 0x96, 0x2d, 0xbf, 0x65, 0x5b, 0x52, 0x12, 0x72, 0xb6, 0xf1, 0xe1, 0x94, 0x48, 0x8e }, + { 0xe9, 0x53, 0x1b, 0xfc, 0x8b, 0x02, 0x99, 0x5a, 0xea, 0xa7, 0x5b, 0xa2, 0x70, 0x31, 0xfa, 0xdb, 0xcb, 0xf4, 0xa0, 0xda, 0xb8, 0x96, 0x1d, 0x92, 0x96, 0xcd, 0x7e, 0x84, 0xd2, 0x5d, 0x60, 0x06 }, + { 0x34, 0xe9, 0xc2, 0x6a, 0x01, 0xd7, 0xf1, 0x61, 0x81, 0xb4, 0x54, 0xa9, 0xd1, 0x62, 0x3c, 0x23, 0x3c, 0xb9, 0x9d, 0x31, 0xc6, 0x94, 0x65, 0x6e, 0x94, 0x13, 0xac, 0xa3, 0xe9, 0x18, 0x69, 0x2f }, + { 0xd9, 0xd7, 0x42, 0x2f, 0x43, 0x7b, 0xd4, 0x39, 0xdd, 0xd4, 0xd8, 0x83, 0xda, 0xe2, 0xa0, 0x83, 0x50, 0x17, 0x34, 0x14, 0xbe, 0x78, 0x15, 0x51, 0x33, 0xff, 0xf1, 0x96, 0x4c, 0x3d, 0x79, 0x72 }, + { 0x4a, 0xee, 0x0c, 0x7a, 0xaf, 0x07, 0x54, 0x14, 0xff, 0x17, 0x93, 0xea, 0xd7, 0xea, 0xca, 0x60, 0x17, 0x75, 0xc6, 0x15, 0xdb, 0xd6, 0x0b, 0x64, 0x0b, 0x0a, 0x9f, 0x0c, 0xe5, 0x05, 0xd4, 0x35 }, + { 0x6b, 0xfd, 0xd1, 0x54, 0x59, 0xc8, 0x3b, 0x99, 0xf0, 0x96, 0xbf, 0xb4, 0x9e, 0xe8, 0x7b, 0x06, 0x3d, 0x69, 0xc1, 0x97, 0x4c, 0x69, 0x28, 0xac, 0xfc, 0xfb, 0x40, 0x99, 0xf8, 0xc4, 0xef, 0x67 }, + { 0x9f, 0xd1, 0xc4, 0x08, 0xfd, 0x75, 0xc3, 0x36, 0x19, 0x3a, 0x2a, 0x14, 0xd9, 0x4f, 0x6a, 0xf5, 0xad, 0xf0, 0x50, 0xb8, 0x03, 0x87, 0xb4, 0xb0, 0x10, 0xfb, 0x29, 0xf4, 0xcc, 0x72, 0x70, 0x7c }, + { 0x13, 0xc8, 0x84, 0x80, 0xa5, 0xd0, 0x0d, 0x6c, 0x8c, 0x7a, 0xd2, 0x11, 0x0d, 0x76, 0xa8, 0x2d, 0x9b, 0x70, 0xf4, 0xfa, 0x66, 0x96, 0xd4, 0xe5, 0xdd, 0x42, 0xa0, 0x66, 0xdc, 0xaf, 0x99, 0x20 }, + { 0x82, 0x0e, 0x72, 0x5e, 0xe2, 0x5f, 0xe8, 0xfd, 0x3a, 0x8d, 0x5a, 0xbe, 0x4c, 0x46, 0xc3, 0xba, 0x88, 0x9d, 0xe6, 0xfa, 0x91, 0x91, 0xaa, 0x22, 0xba, 0x67, 0xd5, 0x70, 0x54, 0x21, 0x54, 0x2b }, + { 0x32, 0xd9, 0x3a, 0x0e, 0xb0, 0x2f, 0x42, 0xfb, 0xbc, 0xaf, 0x2b, 0xad, 0x00, 0x85, 0xb2, 0x82, 0xe4, 0x60, 0x46, 0xa4, 0xdf, 0x7a, 0xd1, 0x06, 0x57, 0xc9, 0xd6, 0x47, 0x63, 0x75, 0xb9, 0x3e }, + { 0xad, 0xc5, 0x18, 0x79, 0x05, 0xb1, 0x66, 0x9c, 0xd8, 0xec, 0x9c, 0x72, 0x1e, 0x19, 0x53, 0x78, 0x6b, 0x9d, 0x89, 0xa9, 0xba, 0xe3, 0x07, 0x80, 0xf1, 0xe1, 0xea, 0xb2, 0x4a, 0x00, 0x52, 0x3c }, + { 0xe9, 0x07, 0x56, 0xff, 0x7f, 0x9a, 0xd8, 0x10, 0xb2, 0x39, 0xa1, 0x0c, 0xed, 0x2c, 0xf9, 0xb2, 0x28, 0x43, 0x54, 0xc1, 0xf8, 0xc7, 0xe0, 0xac, 0xcc, 0x24, 0x61, 0xdc, 0x79, 0x6d, 0x6e, 0x89 }, + { 0x12, 0x51, 0xf7, 0x6e, 0x56, 0x97, 0x84, 0x81, 0x87, 0x53, 0x59, 0x80, 0x1d, 0xb5, 0x89, 0xa0, 0xb2, 0x2f, 0x86, 0xd8, 0xd6, 0x34, 0xdc, 0x04, 0x50, 0x6f, 0x32, 0x2e, 0xd7, 0x8f, 0x17, 0xe8 }, + { 0x3a, 0xfa, 0x89, 0x9f, 0xd9, 0x80, 0xe7, 0x3e, 0xcb, 0x7f, 0x4d, 0x8b, 0x8f, 0x29, 0x1d, 0xc9, 0xaf, 0x79, 0x6b, 0xc6, 0x5d, 0x27, 0xf9, 0x74, 0xc6, 0xf1, 0x93, 0xc9, 0x19, 0x1a, 0x09, 0xfd }, + { 0xaa, 0x30, 0x5b, 0xe2, 0x6e, 0x5d, 0xed, 0xdc, 0x3c, 0x10, 0x10, 0xcb, 0xc2, 0x13, 0xf9, 0x5f, 0x05, 0x1c, 0x78, 0x5c, 0x5b, 0x43, 0x1e, 0x6a, 0x7c, 0xd0, 0x48, 0xf1, 0x61, 0x78, 0x75, 0x28 }, + { 0x8e, 0xa1, 0x88, 0x4f, 0xf3, 0x2e, 0x9d, 0x10, 0xf0, 0x39, 0xb4, 0x07, 0xd0, 0xd4, 0x4e, 0x7e, 0x67, 0x0a, 0xbd, 0x88, 0x4a, 0xee, 0xe0, 0xfb, 0x75, 0x7a, 0xe9, 0x4e, 0xaa, 0x97, 0x37, 0x3d }, + { 0xd4, 0x82, 0xb2, 0x15, 0x5d, 0x4d, 0xec, 0x6b, 0x47, 0x36, 0xa1, 0xf1, 0x61, 0x7b, 0x53, 0xaa, 0xa3, 0x73, 0x10, 0x27, 0x7d, 0x3f, 0xef, 0x0c, 0x37, 0xad, 0x41, 0x76, 0x8f, 0xc2, 0x35, 0xb4 }, + { 0x4d, 0x41, 0x39, 0x71, 0x38, 0x7e, 0x7a, 0x88, 0x98, 0xa8, 0xdc, 0x2a, 0x27, 0x50, 0x07, 0x78, 0x53, 0x9e, 0xa2, 0x14, 0xa2, 0xdf, 0xe9, 0xb3, 0xd7, 0xe8, 0xeb, 0xdc, 0xe5, 0xcf, 0x3d, 0xb3 }, + { 0x69, 0x6e, 0x5d, 0x46, 0xe6, 0xc5, 0x7e, 0x87, 0x96, 0xe4, 0x73, 0x5d, 0x08, 0x91, 0x6e, 0x0b, 0x79, 0x29, 0xb3, 0xcf, 0x29, 0x8c, 0x29, 0x6d, 0x22, 0xe9, 0xd3, 0x01, 0x96, 0x53, 0x37, 0x1c }, + { 0x1f, 0x56, 0x47, 0xc1, 0xd3, 0xb0, 0x88, 0x22, 0x88, 0x85, 0x86, 0x5c, 0x89, 0x40, 0x90, 0x8b, 0xf4, 0x0d, 0x1a, 0x82, 0x72, 0x82, 0x19, 0x73, 0xb1, 0x60, 0x00, 0x8e, 0x7a, 0x3c, 0xe2, 0xeb }, + { 0xb6, 0xe7, 0x6c, 0x33, 0x0f, 0x02, 0x1a, 0x5b, 0xda, 0x65, 0x87, 0x50, 0x10, 0xb0, 0xed, 0xf0, 0x91, 0x26, 0xc0, 0xf5, 0x10, 0xea, 0x84, 0x90, 0x48, 0x19, 0x20, 0x03, 0xae, 0xf4, 0xc6, 0x1c }, + { 0x3c, 0xd9, 0x52, 0xa0, 0xbe, 0xad, 0xa4, 0x1a, 0xbb, 0x42, 0x4c, 0xe4, 0x7f, 0x94, 0xb4, 0x2b, 0xe6, 0x4e, 0x1f, 0xfb, 0x0f, 0xd0, 0x78, 0x22, 0x76, 0x80, 0x79, 0x46, 0xd0, 0xd0, 0xbc, 0x55 }, + { 0x98, 0xd9, 0x26, 0x77, 0x43, 0x9b, 0x41, 0xb7, 0xbb, 0x51, 0x33, 0x12, 0xaf, 0xb9, 0x2b, 0xcc, 0x8e, 0xe9, 0x68, 0xb2, 0xe3, 0xb2, 0x38, 0xce, 0xcb, 0x9b, 0x0f, 0x34, 0xc9, 0xbb, 0x63, 0xd0 }, + { 0xec, 0xbc, 0xa2, 0xcf, 0x08, 0xae, 0x57, 0xd5, 0x17, 0xad, 0x16, 0x15, 0x8a, 0x32, 0xbf, 0xa7, 0xdc, 0x03, 0x82, 0xea, 0xed, 0xa1, 0x28, 0xe9, 0x18, 0x86, 0x73, 0x4c, 0x24, 0xa0, 0xb2, 0x9d }, + { 0x94, 0x2c, 0xc7, 0xc0, 0xb5, 0x2e, 0x2b, 0x16, 0xa4, 0xb8, 0x9f, 0xa4, 0xfc, 0x7e, 0x0b, 0xf6, 0x09, 0xe2, 0x9a, 0x08, 0xc1, 0xa8, 0x54, 0x34, 0x52, 0xb7, 0x7c, 0x7b, 0xfd, 0x11, 0xbb, 0x28 }, + { 0x8a, 0x06, 0x5d, 0x8b, 0x61, 0xa0, 0xdf, 0xfb, 0x17, 0x0d, 0x56, 0x27, 0x73, 0x5a, 0x76, 0xb0, 0xe9, 0x50, 0x60, 0x37, 0x80, 0x8c, 0xba, 0x16, 0xc3, 0x45, 0x00, 0x7c, 0x9f, 0x79, 0xcf, 0x8f }, + { 0x1b, 0x9f, 0xa1, 0x97, 0x14, 0x65, 0x9c, 0x78, 0xff, 0x41, 0x38, 0x71, 0x84, 0x92, 0x15, 0x36, 0x10, 0x29, 0xac, 0x80, 0x2b, 0x1c, 0xbc, 0xd5, 0x4e, 0x40, 0x8b, 0xd8, 0x72, 0x87, 0xf8, 0x1f }, + { 0x8d, 0xab, 0x07, 0x1b, 0xcd, 0x6c, 0x72, 0x92, 0xa9, 0xef, 0x72, 0x7b, 0x4a, 0xe0, 0xd8, 0x67, 0x13, 0x30, 0x1d, 0xa8, 0x61, 0x8d, 0x9a, 0x48, 0xad, 0xce, 0x55, 0xf3, 0x03, 0xa8, 0x69, 0xa1 }, + { 0x82, 0x53, 0xe3, 0xe7, 0xc7, 0xb6, 0x84, 0xb9, 0xcb, 0x2b, 0xeb, 0x01, 0x4c, 0xe3, 0x30, 0xff, 0x3d, 0x99, 0xd1, 0x7a, 0xbb, 0xdb, 0xab, 0xe4, 0xf4, 0xd6, 0x74, 0xde, 0xd5, 0x3f, 0xfc, 0x6b }, + { 0xf1, 0x95, 0xf3, 0x21, 0xe9, 0xe3, 0xd6, 0xbd, 0x7d, 0x07, 0x45, 0x04, 0xdd, 0x2a, 0xb0, 0xe6, 0x24, 0x1f, 0x92, 0xe7, 0x84, 0xb1, 0xaa, 0x27, 0x1f, 0xf6, 0x48, 0xb1, 0xca, 0xb6, 0xd7, 0xf6 }, + { 0x27, 0xe4, 0xcc, 0x72, 0x09, 0x0f, 0x24, 0x12, 0x66, 0x47, 0x6a, 0x7c, 0x09, 0x49, 0x5f, 0x2d, 0xb1, 0x53, 0xd5, 0xbc, 0xbd, 0x76, 0x19, 0x03, 0xef, 0x79, 0x27, 0x5e, 0xc5, 0x6b, 0x2e, 0xd8 }, + { 0x89, 0x9c, 0x24, 0x05, 0x78, 0x8e, 0x25, 0xb9, 0x9a, 0x18, 0x46, 0x35, 0x5e, 0x64, 0x6d, 0x77, 0xcf, 0x40, 0x00, 0x83, 0x41, 0x5f, 0x7d, 0xc5, 0xaf, 0xe6, 0x9d, 0x6e, 0x17, 0xc0, 0x00, 0x23 }, + { 0xa5, 0x9b, 0x78, 0xc4, 0x90, 0x57, 0x44, 0x07, 0x6b, 0xfe, 0xe8, 0x94, 0xde, 0x70, 0x7d, 0x4f, 0x12, 0x0b, 0x5c, 0x68, 0x93, 0xea, 0x04, 0x00, 0x29, 0x7d, 0x0b, 0xb8, 0x34, 0x72, 0x76, 0x32 }, + { 0x59, 0xdc, 0x78, 0xb1, 0x05, 0x64, 0x97, 0x07, 0xa2, 0xbb, 0x44, 0x19, 0xc4, 0x8f, 0x00, 0x54, 0x00, 0xd3, 0x97, 0x3d, 0xe3, 0x73, 0x66, 0x10, 0x23, 0x04, 0x35, 0xb1, 0x04, 0x24, 0xb2, 0x4f }, + { 0xc0, 0x14, 0x9d, 0x1d, 0x7e, 0x7a, 0x63, 0x53, 0xa6, 0xd9, 0x06, 0xef, 0xe7, 0x28, 0xf2, 0xf3, 0x29, 0xfe, 0x14, 0xa4, 0x14, 0x9a, 0x3e, 0xa7, 0x76, 0x09, 0xbc, 0x42, 0xb9, 0x75, 0xdd, 0xfa }, + { 0xa3, 0x2f, 0x24, 0x14, 0x74, 0xa6, 0xc1, 0x69, 0x32, 0xe9, 0x24, 0x3b, 0xe0, 0xcf, 0x09, 0xbc, 0xdc, 0x7e, 0x0c, 0xa0, 0xe7, 0xa6, 0xa1, 0xb9, 0xb1, 0xa0, 0xf0, 0x1e, 0x41, 0x50, 0x23, 0x77 }, + { 0xb2, 0x39, 0xb2, 0xe4, 0xf8, 0x18, 0x41, 0x36, 0x1c, 0x13, 0x39, 0xf6, 0x8e, 0x2c, 0x35, 0x9f, 0x92, 0x9a, 0xf9, 0xad, 0x9f, 0x34, 0xe0, 0x1a, 0xab, 0x46, 0x31, 0xad, 0x6d, 0x55, 0x00, 0xb0 }, + { 0x85, 0xfb, 0x41, 0x9c, 0x70, 0x02, 0xa3, 0xe0, 0xb4, 0xb6, 0xea, 0x09, 0x3b, 0x4c, 0x1a, 0xc6, 0x93, 0x66, 0x45, 0xb6, 0x5d, 0xac, 0x5a, 0xc1, 0x5a, 0x85, 0x28, 0xb7, 0xb9, 0x4c, 0x17, 0x54 }, + { 0x96, 0x19, 0x72, 0x06, 0x25, 0xf1, 0x90, 0xb9, 0x3a, 0x3f, 0xad, 0x18, 0x6a, 0xb3, 0x14, 0x18, 0x96, 0x33, 0xc0, 0xd3, 0xa0, 0x1e, 0x6f, 0x9b, 0xc8, 0xc4, 0xa8, 0xf8, 0x2f, 0x38, 0x3d, 0xbf }, + { 0x7d, 0x62, 0x0d, 0x90, 0xfe, 0x69, 0xfa, 0x46, 0x9a, 0x65, 0x38, 0x38, 0x89, 0x70, 0xa1, 0xaa, 0x09, 0xbb, 0x48, 0xa2, 0xd5, 0x9b, 0x34, 0x7b, 0x97, 0xe8, 0xce, 0x71, 0xf4, 0x8c, 0x7f, 0x46 }, + { 0x29, 0x43, 0x83, 0x56, 0x85, 0x96, 0xfb, 0x37, 0xc7, 0x5b, 0xba, 0xcd, 0x97, 0x9c, 0x5f, 0xf6, 0xf2, 0x0a, 0x55, 0x6b, 0xf8, 0x87, 0x9c, 0xc7, 0x29, 0x24, 0x85, 0x5d, 0xf9, 0xb8, 0x24, 0x0e }, + { 0x16, 0xb1, 0x8a, 0xb3, 0x14, 0x35, 0x9c, 0x2b, 0x83, 0x3c, 0x1c, 0x69, 0x86, 0xd4, 0x8c, 0x55, 0xa9, 0xfc, 0x97, 0xcd, 0xe9, 0xa3, 0xc1, 0xf1, 0x0a, 0x31, 0x77, 0x14, 0x0f, 0x73, 0xf7, 0x38 }, + { 0x8c, 0xbb, 0xdd, 0x14, 0xbc, 0x33, 0xf0, 0x4c, 0xf4, 0x58, 0x13, 0xe4, 0xa1, 0x53, 0xa2, 0x73, 0xd3, 0x6a, 0xda, 0xd5, 0xce, 0x71, 0xf4, 0x99, 0xee, 0xb8, 0x7f, 0xb8, 0xac, 0x63, 0xb7, 0x29 }, + { 0x69, 0xc9, 0xa4, 0x98, 0xdb, 0x17, 0x4e, 0xca, 0xef, 0xcc, 0x5a, 0x3a, 0xc9, 0xfd, 0xed, 0xf0, 0xf8, 0x13, 0xa5, 0xbe, 0xc7, 0x27, 0xf1, 0xe7, 0x75, 0xba, 0xbd, 0xec, 0x77, 0x18, 0x81, 0x6e }, + { 0xb4, 0x62, 0xc3, 0xbe, 0x40, 0x44, 0x8f, 0x1d, 0x4f, 0x80, 0x62, 0x62, 0x54, 0xe5, 0x35, 0xb0, 0x8b, 0xc9, 0xcd, 0xcf, 0xf5, 0x99, 0xa7, 0x68, 0x57, 0x8d, 0x4b, 0x28, 0x81, 0xa8, 0xe3, 0xf0 }, + { 0x55, 0x3e, 0x9d, 0x9c, 0x5f, 0x36, 0x0a, 0xc0, 0xb7, 0x4a, 0x7d, 0x44, 0xe5, 0xa3, 0x91, 0xda, 0xd4, 0xce, 0xd0, 0x3e, 0x0c, 0x24, 0x18, 0x3b, 0x7e, 0x8e, 0xca, 0xbd, 0xf1, 0x71, 0x5a, 0x64 }, + { 0x7a, 0x7c, 0x55, 0xa5, 0x6f, 0xa9, 0xae, 0x51, 0xe6, 0x55, 0xe0, 0x19, 0x75, 0xd8, 0xa6, 0xff, 0x4a, 0xe9, 0xe4, 0xb4, 0x86, 0xfc, 0xbe, 0x4e, 0xac, 0x04, 0x45, 0x88, 0xf2, 0x45, 0xeb, 0xea }, + { 0x2a, 0xfd, 0xf3, 0xc8, 0x2a, 0xbc, 0x48, 0x67, 0xf5, 0xde, 0x11, 0x12, 0x86, 0xc2, 0xb3, 0xbe, 0x7d, 0x6e, 0x48, 0x65, 0x7b, 0xa9, 0x23, 0xcf, 0xbf, 0x10, 0x1a, 0x6d, 0xfc, 0xf9, 0xdb, 0x9a }, + { 0x41, 0x03, 0x7d, 0x2e, 0xdc, 0xdc, 0xe0, 0xc4, 0x9b, 0x7f, 0xb4, 0xa6, 0xaa, 0x09, 0x99, 0xca, 0x66, 0x97, 0x6c, 0x74, 0x83, 0xaf, 0xe6, 0x31, 0xd4, 0xed, 0xa2, 0x83, 0x14, 0x4f, 0x6d, 0xfc }, + { 0xc4, 0x46, 0x6f, 0x84, 0x97, 0xca, 0x2e, 0xeb, 0x45, 0x83, 0xa0, 0xb0, 0x8e, 0x9d, 0x9a, 0xc7, 0x43, 0x95, 0x70, 0x9f, 0xda, 0x10, 0x9d, 0x24, 0xf2, 0xe4, 0x46, 0x21, 0x96, 0x77, 0x9c, 0x5d }, + { 0x75, 0xf6, 0x09, 0x33, 0x8a, 0xa6, 0x7d, 0x96, 0x9a, 0x2a, 0xe2, 0xa2, 0x36, 0x2b, 0x2d, 0xa9, 0xd7, 0x7c, 0x69, 0x5d, 0xfd, 0x1d, 0xf7, 0x22, 0x4a, 0x69, 0x01, 0xdb, 0x93, 0x2c, 0x33, 0x64 }, + { 0x68, 0x60, 0x6c, 0xeb, 0x98, 0x9d, 0x54, 0x88, 0xfc, 0x7c, 0xf6, 0x49, 0xf3, 0xd7, 0xc2, 0x72, 0xef, 0x05, 0x5d, 0xa1, 0xa9, 0x3f, 0xae, 0xcd, 0x55, 0xfe, 0x06, 0xf6, 0x96, 0x70, 0x98, 0xca }, + { 0x44, 0x34, 0x6b, 0xde, 0xb7, 0xe0, 0x52, 0xf6, 0x25, 0x50, 0x48, 0xf0, 0xd9, 0xb4, 0x2c, 0x42, 0x5b, 0xab, 0x9c, 0x3d, 0xd2, 0x41, 0x68, 0x21, 0x2c, 0x3e, 0xcf, 0x1e, 0xbf, 0x34, 0xe6, 0xae }, + { 0x8e, 0x9c, 0xf6, 0xe1, 0xf3, 0x66, 0x47, 0x1f, 0x2a, 0xc7, 0xd2, 0xee, 0x9b, 0x5e, 0x62, 0x66, 0xfd, 0xa7, 0x1f, 0x8f, 0x2e, 0x41, 0x09, 0xf2, 0x23, 0x7e, 0xd5, 0xf8, 0x81, 0x3f, 0xc7, 0x18 }, + { 0x84, 0xbb, 0xeb, 0x84, 0x06, 0xd2, 0x50, 0x95, 0x1f, 0x8c, 0x1b, 0x3e, 0x86, 0xa7, 0xc0, 0x10, 0x08, 0x29, 0x21, 0x83, 0x3d, 0xfd, 0x95, 0x55, 0xa2, 0xf9, 0x09, 0xb1, 0x08, 0x6e, 0xb4, 0xb8 }, + { 0xee, 0x66, 0x6f, 0x3e, 0xef, 0x0f, 0x7e, 0x2a, 0x9c, 0x22, 0x29, 0x58, 0xc9, 0x7e, 0xaf, 0x35, 0xf5, 0x1c, 0xed, 0x39, 0x3d, 0x71, 0x44, 0x85, 0xab, 0x09, 0xa0, 0x69, 0x34, 0x0f, 0xdf, 0x88 }, + { 0xc1, 0x53, 0xd3, 0x4a, 0x65, 0xc4, 0x7b, 0x4a, 0x62, 0xc5, 0xca, 0xcf, 0x24, 0x01, 0x09, 0x75, 0xd0, 0x35, 0x6b, 0x2f, 0x32, 0xc8, 0xf5, 0xda, 0x53, 0x0d, 0x33, 0x88, 0x16, 0xad, 0x5d, 0xe6 }, + { 0x9f, 0xc5, 0x45, 0x01, 0x09, 0xe1, 0xb7, 0x79, 0xf6, 0xc7, 0xae, 0x79, 0xd5, 0x6c, 0x27, 0x63, 0x5c, 0x8d, 0xd4, 0x26, 0xc5, 0xa9, 0xd5, 0x4e, 0x25, 0x78, 0xdb, 0x98, 0x9b, 0x8c, 0x3b, 0x4e }, + { 0xd1, 0x2b, 0xf3, 0x73, 0x2e, 0xf4, 0xaf, 0x5c, 0x22, 0xfa, 0x90, 0x35, 0x6a, 0xf8, 0xfc, 0x50, 0xfc, 0xb4, 0x0f, 0x8f, 0x2e, 0xa5, 0xc8, 0x59, 0x47, 0x37, 0xa3, 0xb3, 0xd5, 0xab, 0xdb, 0xd7 }, + { 0x11, 0x03, 0x0b, 0x92, 0x89, 0xbb, 0xa5, 0xaf, 0x65, 0x26, 0x06, 0x72, 0xab, 0x6f, 0xee, 0x88, 0xb8, 0x74, 0x20, 0xac, 0xef, 0x4a, 0x17, 0x89, 0xa2, 0x07, 0x3b, 0x7e, 0xc2, 0xf2, 0xa0, 0x9e }, + { 0x69, 0xcb, 0x19, 0x2b, 0x84, 0x44, 0x00, 0x5c, 0x8c, 0x0c, 0xeb, 0x12, 0xc8, 0x46, 0x86, 0x07, 0x68, 0x18, 0x8c, 0xda, 0x0a, 0xec, 0x27, 0xa9, 0xc8, 0xa5, 0x5c, 0xde, 0xe2, 0x12, 0x36, 0x32 }, + { 0xdb, 0x44, 0x4c, 0x15, 0x59, 0x7b, 0x5f, 0x1a, 0x03, 0xd1, 0xf9, 0xed, 0xd1, 0x6e, 0x4a, 0x9f, 0x43, 0xa6, 0x67, 0xcc, 0x27, 0x51, 0x75, 0xdf, 0xa2, 0xb7, 0x04, 0xe3, 0xbb, 0x1a, 0x9b, 0x83 }, + { 0x3f, 0xb7, 0x35, 0x06, 0x1a, 0xbc, 0x51, 0x9d, 0xfe, 0x97, 0x9e, 0x54, 0xc1, 0xee, 0x5b, 0xfa, 0xd0, 0xa9, 0xd8, 0x58, 0xb3, 0x31, 0x5b, 0xad, 0x34, 0xbd, 0xe9, 0x99, 0xef, 0xd7, 0x24, 0xdd }, + }; + unsigned char inp[1000], out[1000]; + unsigned char key[] = { 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07, 0x08, 0x09, 0x0a, 0x0b, 0x0c, 0x0d, 0x0e, 0x0f, 0x10, 0x11, 0x12, 0x13, 0x14, 0x15, 0x16, 0x17, 0x18, 0x19, 0x1a, 0x1b, 0x1c, 0x1d, 0x1e, 0x1f }; + unsigned long ilen, klen = sizeof(key), mlen = 32; + blake2smac_state st; + + for (ilen = 0; ilen < 256; ilen++) inp[ilen] = (unsigned char)ilen; + + for (ilen = 0; ilen < 256; ilen++) { + const unsigned char *mac = tests[ilen]; + unsigned long olen = mlen; + /* process piece by piece */ + if (ilen > 15) { + blake2smac_init(&st, olen, key, klen); + blake2smac_process(&st, (unsigned char*)inp, 5); + blake2smac_process(&st, (unsigned char*)inp + 5, 4); + blake2smac_process(&st, (unsigned char*)inp + 9, 3); + blake2smac_process(&st, (unsigned char*)inp + 12, 2); + blake2smac_process(&st, (unsigned char*)inp + 14, 1); + blake2smac_process(&st, (unsigned char*)inp + 15, ilen - 15); + blake2smac_done(&st, out, &olen); + if (compare_testvector(out, olen, mac, mlen, "BLAKE2S MAC multi", ilen) != 0) return CRYPT_FAIL_TESTVECTOR; + } + /* process in one go */ + blake2smac_init(&st, olen, key, klen); + blake2smac_process(&st, (unsigned char*)inp, ilen); + blake2smac_done(&st, out, &olen); + if (compare_testvector(out, olen, mac, mlen, "BLAKE2S MAC single", ilen) != 0) return CRYPT_FAIL_TESTVECTOR; + } + return CRYPT_OK; +#endif +} + +#endif + +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/mac/f9/f9_done.c b/libtomcrypt/src/mac/f9/f9_done.c index 8da4c73..8d2ccb0 100644 --- a/libtomcrypt/src/mac/f9/f9_done.c +++ b/libtomcrypt/src/mac/f9/f9_done.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" @@ -62,7 +60,7 @@ int f9_done(f9_state *f9, unsigned char *out, unsigned long *outlen) out[x] = f9->ACC[x]; } *outlen = x; - + #ifdef LTC_CLEAN_STACK zeromem(f9, sizeof(*f9)); #endif @@ -71,7 +69,7 @@ int f9_done(f9_state *f9, unsigned char *out, unsigned long *outlen) #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/mac/f9/f9_file.c b/libtomcrypt/src/mac/f9/f9_file.c index 88216a9..a6e6532 100644 --- a/libtomcrypt/src/mac/f9/f9_file.c +++ b/libtomcrypt/src/mac/f9/f9_file.c @@ -5,12 +5,10 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" -/** +/** @file f9_file.c f9 support, process a file, Tom St Denis */ @@ -22,62 +20,72 @@ @param cipher The index of the cipher desired @param key The secret key @param keylen The length of the secret key (octets) - @param filename The name of the file you wish to f9 + @param fname The name of the file you wish to f9 @param out [out] Where the authentication tag is to be stored @param outlen [in/out] The max size and resulting size of the authentication tag @return CRYPT_OK if successful, CRYPT_NOP if file support has been disabled */ int f9_file(int cipher, const unsigned char *key, unsigned long keylen, - const char *filename, + const char *fname, unsigned char *out, unsigned long *outlen) { #ifdef LTC_NO_FILE return CRYPT_NOP; #else - int err, x; + size_t x; + int err; f9_state f9; FILE *in; - unsigned char buf[512]; + unsigned char *buf; - LTC_ARGCHK(key != NULL); - LTC_ARGCHK(filename != NULL); - LTC_ARGCHK(out != NULL); - LTC_ARGCHK(outlen != NULL); + LTC_ARGCHK(key != NULL); + LTC_ARGCHK(fname != NULL); + LTC_ARGCHK(out != NULL); + LTC_ARGCHK(outlen != NULL); - in = fopen(filename, "rb"); - if (in == NULL) { - return CRYPT_FILE_NOTFOUND; + if ((buf = XMALLOC(LTC_FILE_READ_BUFSIZE)) == NULL) { + return CRYPT_MEM; } if ((err = f9_init(&f9, cipher, key, keylen)) != CRYPT_OK) { - fclose(in); - return err; + goto LBL_ERR; + } + + in = fopen(fname, "rb"); + if (in == NULL) { + err = CRYPT_FILE_NOTFOUND; + goto LBL_ERR; } do { - x = fread(buf, 1, sizeof(buf), in); - if ((err = f9_process(&f9, buf, x)) != CRYPT_OK) { + x = fread(buf, 1, LTC_FILE_READ_BUFSIZE, in); + if ((err = f9_process(&f9, buf, (unsigned long)x)) != CRYPT_OK) { fclose(in); - return err; + goto LBL_CLEANBUF; } - } while (x == sizeof(buf)); - fclose(in); + } while (x == LTC_FILE_READ_BUFSIZE); - if ((err = f9_done(&f9, out, outlen)) != CRYPT_OK) { - return err; + if (fclose(in) != 0) { + err = CRYPT_ERROR; + goto LBL_CLEANBUF; } + err = f9_done(&f9, out, outlen); + +LBL_CLEANBUF: + zeromem(buf, LTC_FILE_READ_BUFSIZE); +LBL_ERR: #ifdef LTC_CLEAN_STACK - zeromem(buf, sizeof(buf)); + zeromem(&f9, sizeof(f9_state)); #endif - - return CRYPT_OK; + XFREE(buf); + return err; #endif } #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/mac/f9/f9_init.c b/libtomcrypt/src/mac/f9/f9_init.c index b6b878f..ba59b20 100644 --- a/libtomcrypt/src/mac/f9/f9_init.c +++ b/libtomcrypt/src/mac/f9/f9_init.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" @@ -45,12 +43,12 @@ int f9_init(f9_state *f9, int cipher, const unsigned char *key, unsigned long ke if ((err = cipher_descriptor[cipher].setup(key, keylen, 0, &f9->key)) != CRYPT_OK) { goto done; } - + /* make the second key */ for (x = 0; (unsigned)x < keylen; x++) { f9->akey[x] = key[x] ^ 0xAA; } - + /* setup struct */ zeromem(f9->IV, cipher_descriptor[cipher].block_length); zeromem(f9->ACC, cipher_descriptor[cipher].block_length); @@ -64,7 +62,7 @@ done: #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/mac/f9/f9_memory.c b/libtomcrypt/src/mac/f9/f9_memory.c index 0850dc3..70c694b 100644 --- a/libtomcrypt/src/mac/f9/f9_memory.c +++ b/libtomcrypt/src/mac/f9/f9_memory.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" @@ -17,7 +15,7 @@ #ifdef LTC_F9_MODE -/** f9-MAC a block of memory +/** f9-MAC a block of memory @param cipher Index of cipher to use @param key [in] Secret key @param keylen Length of key in octets @@ -27,7 +25,7 @@ @param outlen [in/out] Output size and final tag size Return CRYPT_OK on success. */ -int f9_memory(int cipher, +int f9_memory(int cipher, const unsigned char *key, unsigned long keylen, const unsigned char *in, unsigned long inlen, unsigned char *out, unsigned long *outlen) @@ -66,6 +64,6 @@ done: #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/mac/f9/f9_memory_multi.c b/libtomcrypt/src/mac/f9/f9_memory_multi.c index 7a13ff9..2c1d31a 100644 --- a/libtomcrypt/src/mac/f9/f9_memory_multi.c +++ b/libtomcrypt/src/mac/f9/f9_memory_multi.c @@ -5,13 +5,11 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" #include <stdarg.h> -/** +/** @file f9_memory_multi.c f9 support, process multiple blocks of memory, Tom St Denis */ @@ -19,7 +17,7 @@ #ifdef LTC_F9_MODE /** - f9 multiple blocks of memory + f9 multiple blocks of memory @param cipher The index of the desired cipher @param key The secret key @param keylen The length of the secret key (octets) @@ -30,7 +28,7 @@ @param ... tuples of (data,len) pairs to f9, terminated with a (NULL,x) (x=don't care) @return CRYPT_OK if successful */ -int f9_memory_multi(int cipher, +int f9_memory_multi(int cipher, const unsigned char *key, unsigned long keylen, unsigned char *out, unsigned long *outlen, const unsigned char *in, unsigned long inlen, ...) @@ -57,7 +55,7 @@ int f9_memory_multi(int cipher, goto LBL_ERR; } va_start(args, inlen); - curptr = in; + curptr = in; curlen = inlen; for (;;) { /* process buf */ @@ -80,11 +78,11 @@ LBL_ERR: #endif XFREE(f9); va_end(args); - return err; + return err; } #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/mac/f9/f9_process.c b/libtomcrypt/src/mac/f9/f9_process.c index bf54d71..ba4d39f 100644 --- a/libtomcrypt/src/mac/f9/f9_process.c +++ b/libtomcrypt/src/mac/f9/f9_process.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" @@ -44,35 +42,35 @@ int f9_process(f9_state *f9, const unsigned char *in, unsigned long inlen) if (f9->buflen == 0) { while (inlen >= (unsigned long)f9->blocksize) { for (x = 0; x < f9->blocksize; x += sizeof(LTC_FAST_TYPE)) { - *((LTC_FAST_TYPE*)&(f9->IV[x])) ^= *((LTC_FAST_TYPE*)&(in[x])); + *(LTC_FAST_TYPE_PTR_CAST(&(f9->IV[x]))) ^= *(LTC_FAST_TYPE_PTR_CAST(&(in[x]))); } cipher_descriptor[f9->cipher].ecb_encrypt(f9->IV, f9->IV, &f9->key); for (x = 0; x < f9->blocksize; x += sizeof(LTC_FAST_TYPE)) { - *((LTC_FAST_TYPE*)&(f9->ACC[x])) ^= *((LTC_FAST_TYPE*)&(f9->IV[x])); + *(LTC_FAST_TYPE_PTR_CAST(&(f9->ACC[x]))) ^= *(LTC_FAST_TYPE_PTR_CAST(&(f9->IV[x]))); } in += f9->blocksize; inlen -= f9->blocksize; } - } + } #endif while (inlen) { - if (f9->buflen == f9->blocksize) { + if (f9->buflen == f9->blocksize) { cipher_descriptor[f9->cipher].ecb_encrypt(f9->IV, f9->IV, &f9->key); for (x = 0; x < f9->blocksize; x++) { f9->ACC[x] ^= f9->IV[x]; } f9->buflen = 0; - } - f9->IV[f9->buflen++] ^= *in++; - --inlen; - } - return CRYPT_OK; + } + f9->IV[f9->buflen++] ^= *in++; + --inlen; + } + return CRYPT_OK; } #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/mac/f9/f9_test.c b/libtomcrypt/src/mac/f9/f9_test.c index b92c630..ca23acc 100644 --- a/libtomcrypt/src/mac/f9/f9_test.c +++ b/libtomcrypt/src/mac/f9/f9_test.c @@ -5,14 +5,12 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" /** @file f9_test.c - f9 Support, Test F9 mode + f9 Support, Test F9 mode */ #ifdef LTC_F9_MODE @@ -39,7 +37,7 @@ int f9_test(void) { 105, { 0x83, 0xFD, 0x23, 0xA2, 0x44, 0xA7, 0x4C, 0xF3, 0x58, 0xDA, 0x30, 0x19, 0xF1, 0x72, 0x26, 0x35 }, - { 0x36, 0xAF, 0x61, 0x44, 0x4F, 0x30, 0x2A, 0xD2, + { 0x36, 0xAF, 0x61, 0x44, 0x4F, 0x30, 0x2A, 0xD2, 0x35, 0xC6, 0x87, 0x16, 0x63, 0x3C, 0x66, 0xFB, 0x75, 0x0C, 0x26, 0x68, 0x65, 0xD5, 0x3C, 0x11, 0xEA, 0x05, 0xB1, 0xE9, 0xFA, 0x49, 0xC8, 0x39, 0x8D, 0x48, 0xE1, 0xEF, 0xA5, 0x90, 0x9D, 0x39, 0x47, 0x90, 0x28, 0x37, 0xF5, 0xAE, 0x96, 0xD5, 0xA0, 0x5B, 0xC8, 0xD6, 0x1C, 0xA8, 0xDB, 0xEF, 0x1B, 0x13, 0xA4, 0xB4, 0xAB, 0xFE, 0x4F, 0xB1, 0x00, 0x60, 0x45, 0xB6, 0x74, 0xBB, 0x54, 0x72, 0x93, 0x04, 0xC3, 0x82, 0xBE, 0x53, 0xA5, 0xAF, 0x05, 0x55, 0x61, 0x76, 0xF6, 0xEA, 0xA2, 0xEF, 0x1D, 0x05, 0xE4, 0xB0, 0x83, 0x18, 0x1E, 0xE6, 0x74, 0xCD, 0xA5, 0xA4, 0x85, 0xF7, 0x4D, 0x7A, @@ -61,7 +59,7 @@ int f9_test(void) if ((err = f9_memory(idx, tests[x].K, 16, tests[x].M, tests[x].msglen, T, &taglen)) != CRYPT_OK) { return err; } - if (taglen != 4 || XMEMCMP(T, tests[x].T, 4)) { + if (compare_testvector(T, taglen, tests[x].T, 4, "F9", x)) { return CRYPT_FAIL_TESTVECTOR; } } @@ -72,7 +70,7 @@ int f9_test(void) #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/mac/hmac/hmac_done.c b/libtomcrypt/src/mac/hmac/hmac_done.c index 9046110..221df99 100644 --- a/libtomcrypt/src/mac/hmac/hmac_done.c +++ b/libtomcrypt/src/mac/hmac/hmac_done.c @@ -5,14 +5,12 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" /** @file hmac_done.c - LTC_HMAC support, terminate stream, Tom St Denis/Dobes Vandermeer + HMAC support, terminate stream, Tom St Denis/Dobes Vandermeer */ #ifdef LTC_HMAC @@ -20,10 +18,10 @@ #define LTC_HMAC_BLOCKSIZE hash_descriptor[hash].blocksize /** - Terminate an LTC_HMAC session - @param hmac The LTC_HMAC state - @param out [out] The destination of the LTC_HMAC authentication tag - @param outlen [in/out] The max size and resulting size of the LTC_HMAC authentication tag + Terminate an HMAC session + @param hmac The HMAC state + @param out [out] The destination of the HMAC authentication tag + @param outlen [in/out] The max size and resulting size of the HMAC authentication tag @return CRYPT_OK if successful */ int hmac_done(hmac_state *hmac, unsigned char *out, unsigned long *outlen) @@ -48,7 +46,7 @@ int hmac_done(hmac_state *hmac, unsigned char *out, unsigned long *outlen) goto LBL_ERR; } - /* Create the second LTC_HMAC vector vector for step (3) */ + /* Create the second HMAC vector vector for step (3) */ for(i=0; i < LTC_HMAC_BLOCKSIZE; i++) { buf[i] = hmac->key[i] ^ 0x5C; } @@ -87,6 +85,6 @@ LBL_ERR: #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/mac/hmac/hmac_file.c b/libtomcrypt/src/mac/hmac/hmac_file.c index d9841bd..c106941 100644 --- a/libtomcrypt/src/mac/hmac/hmac_file.c +++ b/libtomcrypt/src/mac/hmac/hmac_file.c @@ -5,30 +5,28 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" /** @file hmac_file.c - LTC_HMAC support, process a file, Tom St Denis/Dobes Vandermeer + HMAC support, process a file, Tom St Denis/Dobes Vandermeer */ #ifdef LTC_HMAC /** - LTC_HMAC a file + HMAC a file @param hash The index of the hash you wish to use - @param fname The name of the file you wish to LTC_HMAC + @param fname The name of the file you wish to HMAC @param key The secret key @param keylen The length of the secret key - @param out [out] The LTC_HMAC authentication tag + @param out [out] The HMAC authentication tag @param outlen [in/out] The max size and resulting size of the authentication tag @return CRYPT_OK if successful, CRYPT_NOP if file support has been disabled */ -int hmac_file(int hash, const char *fname, - const unsigned char *key, unsigned long keylen, +int hmac_file(int hash, const char *fname, + const unsigned char *key, unsigned long keylen, unsigned char *out, unsigned long *outlen) { #ifdef LTC_NO_FILE @@ -37,7 +35,7 @@ int hmac_file(int hash, const char *fname, #else hmac_state hmac; FILE *in; - unsigned char buf[512]; + unsigned char *buf; size_t x; int err; @@ -45,50 +43,53 @@ int hmac_file(int hash, const char *fname, LTC_ARGCHK(key != NULL); LTC_ARGCHK(out != NULL); LTC_ARGCHK(outlen != NULL); - - if((err = hash_is_valid(hash)) != CRYPT_OK) { - return err; + + if ((buf = XMALLOC(LTC_FILE_READ_BUFSIZE)) == NULL) { + return CRYPT_MEM; + } + + if ((err = hash_is_valid(hash)) != CRYPT_OK) { + goto LBL_ERR; } if ((err = hmac_init(&hmac, hash, key, keylen)) != CRYPT_OK) { - return err; + goto LBL_ERR; } in = fopen(fname, "rb"); if (in == NULL) { - return CRYPT_FILE_NOTFOUND; + err = CRYPT_FILE_NOTFOUND; + goto LBL_ERR; } - /* process the file contents */ do { - x = fread(buf, 1, sizeof(buf), in); + x = fread(buf, 1, LTC_FILE_READ_BUFSIZE, in); if ((err = hmac_process(&hmac, buf, (unsigned long)x)) != CRYPT_OK) { - /* we don't trap this error since we're already returning an error! */ - fclose(in); - return err; + fclose(in); /* we don't trap this error since we're already returning an error! */ + goto LBL_CLEANBUF; } - } while (x == sizeof(buf)); + } while (x == LTC_FILE_READ_BUFSIZE); if (fclose(in) != 0) { - return CRYPT_ERROR; + err = CRYPT_ERROR; + goto LBL_CLEANBUF; } - /* get final hmac */ - if ((err = hmac_done(&hmac, out, outlen)) != CRYPT_OK) { - return err; - } + err = hmac_done(&hmac, out, outlen); +LBL_CLEANBUF: + zeromem(buf, LTC_FILE_READ_BUFSIZE); +LBL_ERR: #ifdef LTC_CLEAN_STACK - /* clear memory */ - zeromem(buf, sizeof(buf)); -#endif - return CRYPT_OK; + zeromem(&hmac, sizeof(hmac_state)); +#endif + XFREE(buf); + return err; #endif } #endif - -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/mac/hmac/hmac_init.c b/libtomcrypt/src/mac/hmac/hmac_init.c index 262002e..57eca7b 100644 --- a/libtomcrypt/src/mac/hmac/hmac_init.c +++ b/libtomcrypt/src/mac/hmac/hmac_init.c @@ -5,14 +5,12 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" /** @file hmac_init.c - LTC_HMAC support, initialize state, Tom St Denis/Dobes Vandermeer + HMAC support, initialize state, Tom St Denis/Dobes Vandermeer */ #ifdef LTC_HMAC @@ -20,8 +18,8 @@ #define LTC_HMAC_BLOCKSIZE hash_descriptor[hash].blocksize /** - Initialize an LTC_HMAC context. - @param hmac The LTC_HMAC state + Initialize an HMAC context. + @param hmac The HMAC state @param hash The index of the hash you want to use @param key The secret key @param keylen The length of the secret key (octets) @@ -61,18 +59,16 @@ int hmac_init(hmac_state *hmac, int hash, const unsigned char *key, unsigned lon if ((err = hash_memory(hash, key, keylen, hmac->key, &z)) != CRYPT_OK) { goto LBL_ERR; } - if(hashsize < LTC_HMAC_BLOCKSIZE) { - zeromem((hmac->key) + hashsize, (size_t)(LTC_HMAC_BLOCKSIZE - hashsize)); - } keylen = hashsize; } else { XMEMCPY(hmac->key, key, (size_t)keylen); + } + if(keylen < LTC_HMAC_BLOCKSIZE) { zeromem((hmac->key) + keylen, (size_t)(LTC_HMAC_BLOCKSIZE - keylen)); } - } - /* Create the initial vector for step (3) */ + /* Create the initialization vector for step (3) */ for(i=0; i < LTC_HMAC_BLOCKSIZE; i++) { buf[i] = hmac->key[i] ^ 0x36; } @@ -99,6 +95,6 @@ done: #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/mac/hmac/hmac_memory.c b/libtomcrypt/src/mac/hmac/hmac_memory.c index 9df80ea..9a3a199 100644 --- a/libtomcrypt/src/mac/hmac/hmac_memory.c +++ b/libtomcrypt/src/mac/hmac/hmac_memory.c @@ -5,32 +5,30 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" /** @file hmac_memory.c - LTC_HMAC support, process a block of memory, Tom St Denis/Dobes Vandermeer + HMAC support, process a block of memory, Tom St Denis/Dobes Vandermeer */ #ifdef LTC_HMAC /** - LTC_HMAC a block of memory to produce the authentication tag - @param hash The index of the hash to use - @param key The secret key + HMAC a block of memory to produce the authentication tag + @param hash The index of the hash to use + @param key The secret key @param keylen The length of the secret key (octets) - @param in The data to LTC_HMAC - @param inlen The length of the data to LTC_HMAC (octets) + @param in The data to HMAC + @param inlen The length of the data to HMAC (octets) @param out [out] Destination of the authentication tag @param outlen [in/out] Max size and resulting size of authentication tag @return CRYPT_OK if successful */ -int hmac_memory(int hash, +int hmac_memory(int hash, const unsigned char *key, unsigned long keylen, - const unsigned char *in, unsigned long inlen, + const unsigned char *in, unsigned long inlen, unsigned char *out, unsigned long *outlen) { hmac_state *hmac; @@ -38,7 +36,7 @@ int hmac_memory(int hash, LTC_ARGCHK(key != NULL); LTC_ARGCHK(in != NULL); - LTC_ARGCHK(out != NULL); + LTC_ARGCHK(out != NULL); LTC_ARGCHK(outlen != NULL); /* make sure hash descriptor is valid */ @@ -77,12 +75,12 @@ LBL_ERR: #endif XFREE(hmac); - return err; + return err; } #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/mac/hmac/hmac_memory_multi.c b/libtomcrypt/src/mac/hmac/hmac_memory_multi.c index c3d461b..6e3d0fe 100644 --- a/libtomcrypt/src/mac/hmac/hmac_memory_multi.c +++ b/libtomcrypt/src/mac/hmac/hmac_memory_multi.c @@ -5,32 +5,30 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" #include <stdarg.h> /** @file hmac_memory_multi.c - LTC_HMAC support, process multiple blocks of memory, Tom St Denis/Dobes Vandermeer + HMAC support, process multiple blocks of memory, Tom St Denis/Dobes Vandermeer */ #ifdef LTC_HMAC /** - LTC_HMAC multiple blocks of memory to produce the authentication tag - @param hash The index of the hash to use - @param key The secret key + HMAC multiple blocks of memory to produce the authentication tag + @param hash The index of the hash to use + @param key The secret key @param keylen The length of the secret key (octets) @param out [out] Destination of the authentication tag @param outlen [in/out] Max size and resulting size of authentication tag - @param in The data to LTC_HMAC - @param inlen The length of the data to LTC_HMAC (octets) - @param ... tuples of (data,len) pairs to LTC_HMAC, terminated with a (NULL,x) (x=don't care) + @param in The data to HMAC + @param inlen The length of the data to HMAC (octets) + @param ... tuples of (data,len) pairs to HMAC, terminated with a (NULL,x) (x=don't care) @return CRYPT_OK if successful */ -int hmac_memory_multi(int hash, +int hmac_memory_multi(int hash, const unsigned char *key, unsigned long keylen, unsigned char *out, unsigned long *outlen, const unsigned char *in, unsigned long inlen, ...) @@ -44,7 +42,7 @@ int hmac_memory_multi(int hash, LTC_ARGCHK(key != NULL); LTC_ARGCHK(in != NULL); - LTC_ARGCHK(out != NULL); + LTC_ARGCHK(out != NULL); LTC_ARGCHK(outlen != NULL); /* allocate ram for hmac state */ @@ -58,7 +56,7 @@ int hmac_memory_multi(int hash, } va_start(args, inlen); - curptr = in; + curptr = in; curlen = inlen; for (;;) { /* process buf */ @@ -81,12 +79,12 @@ LBL_ERR: #endif XFREE(hmac); va_end(args); - return err; + return err; } #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/mac/hmac/hmac_process.c b/libtomcrypt/src/mac/hmac/hmac_process.c index 802de1f..8da62c1 100644 --- a/libtomcrypt/src/mac/hmac/hmac_process.c +++ b/libtomcrypt/src/mac/hmac/hmac_process.c @@ -5,23 +5,21 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" /** @file hmac_process.c - LTC_HMAC support, process data, Tom St Denis/Dobes Vandermeer + HMAC support, process data, Tom St Denis/Dobes Vandermeer */ #ifdef LTC_HMAC -/** - Process data through LTC_HMAC +/** + Process data through HMAC @param hmac The hmac state - @param in The data to send through LTC_HMAC - @param inlen The length of the data to LTC_HMAC (octets) + @param in The data to send through HMAC + @param inlen The length of the data to HMAC (octets) @return CRYPT_OK if successful */ int hmac_process(hmac_state *hmac, const unsigned char *in, unsigned long inlen) @@ -38,6 +36,6 @@ int hmac_process(hmac_state *hmac, const unsigned char *in, unsigned long inlen) #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/mac/hmac/hmac_test.c b/libtomcrypt/src/mac/hmac/hmac_test.c index af43da6..1570a76 100644 --- a/libtomcrypt/src/mac/hmac/hmac_test.c +++ b/libtomcrypt/src/mac/hmac/hmac_test.c @@ -5,14 +5,12 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" /** @file hmac_test.c - LTC_HMAC support, self-test, Tom St Denis/Dobes Vandermeer + HMAC support, self-test, Tom St Denis/Dobes Vandermeer/Steffen Jaeckel */ #ifdef LTC_HMAC @@ -27,239 +25,571 @@ Request for Comments: 2202 IBM Category: Informational R. Glenn NIST September 1997 - Test Cases for LTC_HMAC-LTC_MD5 and LTC_HMAC-LTC_SHA-1 + + Test Cases for HMAC-MD5 and HMAC-SHA-1 + +******************************************************************************* + +Network Working Group J. Kapp +Request for Comments: 2286 Reaper Technologies +Category: Informational February 1998 + + Test Cases for HMAC-RIPEMD160 and HMAC-RIPEMD128 + +******************************************************************************* + +Network Working Group M. Nystrom +Request for Comments: 4231 RSA Security +Category: Standards Track December 2005 + + Identifiers and Test Vectors for HMAC-SHA-224, HMAC-SHA-256, + HMAC-SHA-384, and HMAC-SHA-512 */ /** - LTC_HMAC self-test + HMAC self-test @return CRYPT_OK if successful, CRYPT_NOP if tests have been disabled. */ int hmac_test(void) { #ifndef LTC_TEST return CRYPT_NOP; - #else + #else unsigned char digest[MAXBLOCKSIZE]; int i; + static const unsigned char hmac_test_case_keys[][136] = { + { /* 1 */ + 0x0b, 0x0b, 0x0b, 0x0b, 0x0b, 0x0b, 0x0b, 0x0b, + 0x0b, 0x0b, 0x0b, 0x0b, 0x0b, 0x0b, 0x0b, 0x0b, + 0x0b, 0x0b, 0x0b, 0x0b + }, +#ifdef LTC_TEST_EXT + { /* 2 */ + 0x4a, 0x65, 0x66, 0x65 + }, + { /* 4 */ + 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07, 0x08, 0x09, 0x0a, + 0x0b, 0x0c, 0x0d, 0x0e, 0x0f, 0x10, 0x11, 0x12, 0x13, 0x14, + 0x15, 0x16, 0x17, 0x18, 0x19 + }, + { /* 5 */ + 0x0c, 0x0c, 0x0c, 0x0c, 0x0c, 0x0c, 0x0c, 0x0c, + 0x0c, 0x0c, 0x0c, 0x0c, 0x0c, 0x0c, 0x0c, 0x0c, + 0x0c, 0x0c, 0x0c, 0x0c + }, + { /* 3, 6, 7 */ + 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, + 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, + 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, + 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, + 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, + + 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, + 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, + 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, + 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, + 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, + + 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, + 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, + 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, + 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, + 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, + + 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, + 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa + } +#endif /* LTC_TEST_EXT */ + }; + + + static const unsigned char hmac_test_case_data[][153] = { + { + "Hi There" + }, +#ifdef LTC_TEST_EXT + { + "what do ya want for nothing?" + }, + { + 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, + 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, + 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, + 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, + 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd + }, + { + 0xcd, 0xcd, 0xcd, 0xcd, 0xcd, 0xcd, 0xcd, 0xcd, 0xcd, 0xcd, + 0xcd, 0xcd, 0xcd, 0xcd, 0xcd, 0xcd, 0xcd, 0xcd, 0xcd, 0xcd, + 0xcd, 0xcd, 0xcd, 0xcd, 0xcd, 0xcd, 0xcd, 0xcd, 0xcd, 0xcd, + 0xcd, 0xcd, 0xcd, 0xcd, 0xcd, 0xcd, 0xcd, 0xcd, 0xcd, 0xcd, + 0xcd, 0xcd, 0xcd, 0xcd, 0xcd, 0xcd, 0xcd, 0xcd, 0xcd, 0xcd + }, + { + "Test With Truncation" + }, + { + "Test Using Larger Than Block-Size Key - Hash Key First" + }, + { + "Test Using Larger Than Block-Size Key and Larger Than One Block-Size Data" + }, + { + "This is a test using a larger than block-size key and a larger than block-size data. The key needs to be hashed before being used by the HMAC algorithm." + } +#endif /* LTC_TEST_EXT */ + }; + static const struct hmac_test_case { - int num; - char *algo; - unsigned char key[128]; + const char *num; + const char *algo; + const unsigned char *key; unsigned long keylen; - unsigned char data[128]; + const unsigned char *data; unsigned long datalen; unsigned char digest[MAXBLOCKSIZE]; } cases[] = { /* - 3. Test Cases for LTC_HMAC-LTC_SHA-1 - - test_case = 1 - key = 0x0c0c0c0c0c0c0c0c0c0c0c0c0c0c0c0c0c0c0c0c - key_len = 20 - data = "Hi Ther 20 - digest = 0x4c1a03424b55e07fe7f27be1d58bb9324a9a5a04 - digest-96 = 0x4c1a03424b55e07fe7f27be1 + RFC 2202 3. Test Cases for HMAC-SHA-1 */ - { 5, "sha1", - {0x0c, 0x0c, 0x0c, 0x0c, 0x0c, 0x0c, 0x0c, 0x0c, - 0x0c, 0x0c, 0x0c, 0x0c, 0x0c, 0x0c, 0x0c, 0x0c, - 0x0c, 0x0c, 0x0c, 0x0c}, 20, - "Test With Truncation", 20, + { "rfc2202 3.1", "sha1", + hmac_test_case_keys[0], 20, + hmac_test_case_data[0], 8, + {0xb6, 0x17, 0x31, 0x86, 0x55, 0x05, 0x72, 0x64, + 0xe2, 0x8b, 0xc0, 0xb6, 0xfb, 0x37, 0x8c, 0x8e, + 0xf1, 0x46, 0xbe, 0x00} }, + +#ifdef LTC_TEST_EXT + { "rfc2202 3.2", "sha1", + hmac_test_case_keys[1], 4, + hmac_test_case_data[1], 28, + {0xef, 0xfc, 0xdf, 0x6a, 0xe5, 0xeb, 0x2f, 0xa2, + 0xd2, 0x74, 0x16, 0xd5, 0xf1, 0x84, 0xdf, 0x9c, + 0x25, 0x9a, 0x7c, 0x79} }, + + { "rfc2202 3.3", "sha1", + hmac_test_case_keys[4], 20, + hmac_test_case_data[2], 50, + {0x12, 0x5d, 0x73, 0x42, 0xb9, 0xac, 0x11, 0xcd, + 0x91, 0xa3, 0x9a, 0xf4, 0x8a, 0xa1, 0x7b, 0x4f, + 0x63, 0xf1, 0x75, 0xd3} }, + + { "rfc2202 3.4", "sha1", + hmac_test_case_keys[2], 25, + hmac_test_case_data[3], 50, + {0x4c, 0x90, 0x07, 0xf4, 0x02, 0x62, 0x50, 0xc6, + 0xbc, 0x84, 0x14, 0xf9, 0xbf, 0x50, 0xc8, 0x6c, + 0x2d, 0x72, 0x35, 0xda} }, + + { "rfc2202 3.5", "sha1", + hmac_test_case_keys[3], 20, + hmac_test_case_data[4], 20, {0x4c, 0x1a, 0x03, 0x42, 0x4b, 0x55, 0xe0, 0x7f, 0xe7, 0xf2, 0x7b, 0xe1, 0xd5, 0x8b, 0xb9, 0x32, 0x4a, 0x9a, 0x5a, 0x04} }, - /* - test_case = 6 - key = 0xaa repeated 80 times - key_len = 80 - data = "Test Using Larger Than Block-Size Key - Hash Key First" - data_len = 54 - digest = 0xaa4ae5e15272d00e95705637ce8a3b55ed402112 - */ - { 6, "sha1", - {0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, - 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, - 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, - 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, - 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, - 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, - 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, - 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, - 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, - 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa}, 80, - "Test Using Larger Than Block-Size Key - Hash Key First", 54, + { "rfc2202 3.6", "sha1", + hmac_test_case_keys[4], 80, + hmac_test_case_data[5], 54, {0xaa, 0x4a, 0xe5, 0xe1, 0x52, 0x72, 0xd0, 0x0e, - 0x95, 0x70, 0x56, 0x37, 0xce, 0x8a, 0x3b, 0x55, + 0x95, 0x70, 0x56, 0x37, 0xce, 0x8a, 0x3b, 0x55, 0xed, 0x40, 0x21, 0x12} }, - /* - test_case = 7 - key = 0xaa repeated 80 times - key_len = 80 - data = "Test Using Larger Than Block-Size Key and Larger - Than One Block-Size Data" - data_len = 73 - digest = 0xe8e99d0f45237d786d6bbaa7965c7808bbff1a91 - */ - { 7, "sha1", - {0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, - 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, - 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, - 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, - 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, - 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, - 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, - 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, - 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, - 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa}, 80, - "Test Using Larger Than Block-Size Key and Larger Than One Block-Size Data", 73, + { "rfc2202 3.7", "sha1", + hmac_test_case_keys[4], 80, + hmac_test_case_data[6], 73, {0xe8, 0xe9, 0x9d, 0x0f, 0x45, 0x23, 0x7d, 0x78, 0x6d, 0x6b, 0xba, 0xa7, 0x96, 0x5c, 0x78, 0x08, 0xbb, 0xff, 0x1a, 0x91} }, +#endif /* LTC_TEST_EXT */ /* - 2. Test Cases for LTC_HMAC-LTC_MD5 - - test_case = 1 - key = 0x0b 0b 0b 0b - 0b 0b 0b 0b - 0b 0b 0b 0b - 0b 0b 0b 0b - key_len = 16 - data = "Hi There" - data_len = 8 - digest = 0x92 94 72 7a - 36 38 bb 1c - 13 f4 8e f8 - 15 8b fc 9d + RFC 2202 2. Test Cases for HMAC-MD5 */ - { 1, "md5", - {0x0b, 0x0b, 0x0b, 0x0b, 0x0b, 0x0b, 0x0b, 0x0b, - 0x0b, 0x0b, 0x0b, 0x0b, 0x0b, 0x0b, 0x0b, 0x0b}, 16, - "Hi There", 8, - {0x92, 0x94, 0x72, 0x7a, 0x36, 0x38, 0xbb, 0x1c, + { "rfc2202 2.1", "md5", + hmac_test_case_keys[0], 16, + hmac_test_case_data[0], 8, + {0x92, 0x94, 0x72, 0x7a, 0x36, 0x38, 0xbb, 0x1c, 0x13, 0xf4, 0x8e, 0xf8, 0x15, 0x8b, 0xfc, 0x9d} }, - /* - test_case = 2 - key = "Jefe" - key_len = 4 - data = "what do ya want for nothing?" - data_len = 28 - digest = 0x750c783e6ab0b503eaa86e310a5db738 - */ - { 2, "md5", - "Jefe", 4, - "what do ya want for nothing?", 28, - {0x75, 0x0c, 0x78, 0x3e, 0x6a, 0xb0, 0xb5, 0x03, + +#ifdef LTC_TEST_EXT + { "rfc2202 2.2", "md5", + hmac_test_case_keys[1], 4, + hmac_test_case_data[1], 28, + {0x75, 0x0c, 0x78, 0x3e, 0x6a, 0xb0, 0xb5, 0x03, 0xea, 0xa8, 0x6e, 0x31, 0x0a, 0x5d, 0xb7, 0x38} }, - /* - test_case = 3 - key = 0xaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaa - key_len 16 - data = 0xdd repeated 50 times - data_len = 50 - digest = 0x56be34521d144c88dbb8c733f0e8b3f6 - */ - { 3, "md5", - {0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, - 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa}, 16, - {0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, - 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, - 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, - 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, - 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd}, 50, + { "rfc2202 2.3", "md5", + hmac_test_case_keys[4], 16, + hmac_test_case_data[2], 50, {0x56, 0xbe, 0x34, 0x52, 0x1d, 0x14, 0x4c, 0x88, 0xdb, 0xb8, 0xc7, 0x33, 0xf0, 0xe8, 0xb3, 0xf6} }, - /* - test_case = 4 - key = 0x0102030405060708090a0b0c0d0e0f10111213141516171819 - key_len 25 - data = 0xcd repeated 50 times - data_len = 50 - digest = 0x697eaf0aca3a3aea3a75164746ffaa79 - */ - { 4, "md5", - {0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07, 0x08, 0x09, 0x0a, - 0x0b, 0x0c, 0x0d, 0x0e, 0x0f, 0x10, 0x11, 0x12, 0x13, 0x14, - 0x15, 0x16, 0x17, 0x18, 0x19}, 25, - {0xcd, 0xcd, 0xcd, 0xcd, 0xcd, 0xcd, 0xcd, 0xcd, 0xcd, 0xcd, - 0xcd, 0xcd, 0xcd, 0xcd, 0xcd, 0xcd, 0xcd, 0xcd, 0xcd, 0xcd, - 0xcd, 0xcd, 0xcd, 0xcd, 0xcd, 0xcd, 0xcd, 0xcd, 0xcd, 0xcd, - 0xcd, 0xcd, 0xcd, 0xcd, 0xcd, 0xcd, 0xcd, 0xcd, 0xcd, 0xcd, - 0xcd, 0xcd, 0xcd, 0xcd, 0xcd, 0xcd, 0xcd, 0xcd, 0xcd, 0xcd}, 50, - {0x69, 0x7e, 0xaf, 0x0a, 0xca, 0x3a, 0x3a, 0xea, + { "rfc2202 2.4", "md5", + hmac_test_case_keys[2], 25, + hmac_test_case_data[3], 50, + {0x69, 0x7e, 0xaf, 0x0a, 0xca, 0x3a, 0x3a, 0xea, 0x3a, 0x75, 0x16, 0x47, 0x46, 0xff, 0xaa, 0x79} }, + { "rfc2202 2.5", "md5", + hmac_test_case_keys[3], 16, + hmac_test_case_data[4], 20, + {0x56, 0x46, 0x1e, 0xf2, 0x34, 0x2e, 0xdc, 0x00, + 0xf9, 0xba, 0xb9, 0x95, 0x69, 0x0e, 0xfd, 0x4c} }, + + { "rfc2202 2.6", "md5", + hmac_test_case_keys[4], 80, + hmac_test_case_data[5], 54, + {0x6b, 0x1a, 0xb7, 0xfe, 0x4b, 0xd7, 0xbf, 0x8f, + 0x0b, 0x62, 0xe6, 0xce, 0x61, 0xb9, 0xd0, 0xcd} }, + + { "rfc2202 2.7", "md5", + hmac_test_case_keys[4], 80, + hmac_test_case_data[6], 73, + {0x6f, 0x63, 0x0f, 0xad, 0x67, 0xcd, 0xa0, 0xee, + 0x1f, 0xb1, 0xf5, 0x62, 0xdb, 0x3a, 0xa5, 0x3e} }, +#endif /* LTC_TEST_EXT */ /* - - test_case = 5 - key = 0x0c0c0c0c0c0c0c0c0c0c0c0c0c0c0c0c - key_len = 16 - data = "Test With Truncation" - data_len = 20 - digest = 0x56461ef2342edc00f9bab995690efd4c - digest-96 0x56461ef2342edc00f9bab995 + RFC 2286 2. Test Cases for HMAC-RIPEMD160 */ - { 5, "md5", - {0x0c, 0x0c, 0x0c, 0x0c, 0x0c, 0x0c, 0x0c, 0x0c, - 0x0c, 0x0c, 0x0c, 0x0c, 0x0c, 0x0c, 0x0c, 0x0c}, 16, - "Test With Truncation", 20, - {0x56, 0x46, 0x1e, 0xf2, 0x34, 0x2e, 0xdc, 0x00, - 0xf9, 0xba, 0xb9, 0x95, 0x69, 0x0e, 0xfd, 0x4c} }, + { "rfc2286 2.1", "rmd160", + hmac_test_case_keys[0], 20, + hmac_test_case_data[0], 8, + {0x24, 0xcb, 0x4b, 0xd6, 0x7d, 0x20, 0xfc, 0x1a, + 0x5d, 0x2e, 0xd7, 0x73, 0x2d, 0xcc, 0x39, 0x37, + 0x7f, 0x0a, 0x56, 0x68} }, - /* +#ifdef LTC_TEST_EXT + { "rfc2286 2.2", "rmd160", + hmac_test_case_keys[1], 4, + hmac_test_case_data[1], 28, + {0xdd, 0xa6, 0xc0, 0x21, 0x3a, 0x48, 0x5a, 0x9e, + 0x24, 0xf4, 0x74, 0x20, 0x64, 0xa7, 0xf0, 0x33, + 0xb4, 0x3c, 0x40, 0x69} }, - test_case = 6 - key = 0xaa repeated 80 times - key_len = 80 - data = "Test Using Larger Than Block-Size Key - Hash -Key First" - data_len = 54 - digest = 0x6b1ab7fe4bd7bf8f0b62e6ce61b9d0cd - */ - { 6, "md5", - {0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, - 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, - 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, - 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, - 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, - - 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, - 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, - 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, - 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, - 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa}, 80, - "Test Using Larger Than Block-Size Key - Hash Key First", 54, - {0x6b, 0x1a, 0xb7, 0xfe, 0x4b, 0xd7, 0xbf, 0x8f, - 0x0b, 0x62, 0xe6, 0xce, 0x61, 0xb9, 0xd0, 0xcd} }, + { "rfc2286 2.3", "rmd160", + hmac_test_case_keys[4], 20, + hmac_test_case_data[2], 50, + {0xb0, 0xb1, 0x05, 0x36, 0x0d, 0xe7, 0x59, 0x96, + 0x0a, 0xb4, 0xf3, 0x52, 0x98, 0xe1, 0x16, 0xe2, + 0x95, 0xd8, 0xe7, 0xc1} }, + + { "rfc2286 2.4", "rmd160", + hmac_test_case_keys[2], 25, + hmac_test_case_data[3], 50, + {0xd5, 0xca, 0x86, 0x2f, 0x4d, 0x21, 0xd5, 0xe6, + 0x10, 0xe1, 0x8b, 0x4c, 0xf1, 0xbe, 0xb9, 0x7a, + 0x43, 0x65, 0xec, 0xf4} }, + + { "rfc2286 2.5", "rmd160", + hmac_test_case_keys[3], 20, + hmac_test_case_data[4], 20, + {0x76, 0x19, 0x69, 0x39, 0x78, 0xf9, 0x1d, 0x90, + 0x53, 0x9a, 0xe7, 0x86, 0x50, 0x0f, 0xf3, 0xd8, + 0xe0, 0x51, 0x8e, 0x39} }, + + { "rfc2286 2.6", "rmd160", + hmac_test_case_keys[4], 80, + hmac_test_case_data[5], 54, + {0x64, 0x66, 0xca, 0x07, 0xac, 0x5e, 0xac, 0x29, + 0xe1, 0xbd, 0x52, 0x3e, 0x5a, 0xda, 0x76, 0x05, + 0xb7, 0x91, 0xfd, 0x8b} }, + + { "rfc2286 2.7", "rmd160", + hmac_test_case_keys[4], 80, + hmac_test_case_data[6], 73, + {0x69, 0xea, 0x60, 0x79, 0x8d, 0x71, 0x61, 0x6c, + 0xce, 0x5f, 0xd0, 0x87, 0x1e, 0x23, 0x75, 0x4c, + 0xd7, 0x5d, 0x5a, 0x0a} }, +#endif /* LTC_TEST_EXT */ /* + RFC 2286 3. Test Cases for HMAC-RIPEMD128 + */ + { "rfc2286 3.1", "rmd128", + hmac_test_case_keys[0], 16, + hmac_test_case_data[0], 8, + {0xfb, 0xf6, 0x1f, 0x94, 0x92, 0xaa, 0x4b, 0xbf, + 0x81, 0xc1, 0x72, 0xe8, 0x4e, 0x07, 0x34, 0xdb} }, + +#ifdef LTC_TEST_EXT + { "rfc2286 3.2", "rmd128", + hmac_test_case_keys[1], 4, + hmac_test_case_data[1], 28, + {0x87, 0x5f, 0x82, 0x88, 0x62, 0xb6, 0xb3, 0x34, + 0xb4, 0x27, 0xc5, 0x5f, 0x9f, 0x7f, 0xf0, 0x9b} }, + + { "rfc2286 3.3", "rmd128", + hmac_test_case_keys[4], 16, + hmac_test_case_data[2], 50, + {0x09, 0xf0, 0xb2, 0x84, 0x6d, 0x2f, 0x54, 0x3d, + 0xa3, 0x63, 0xcb, 0xec, 0x8d, 0x62, 0xa3, 0x8d} }, + + { "rfc2286 3.4", "rmd128", + hmac_test_case_keys[2], 25, + hmac_test_case_data[3], 50, + {0xbd, 0xbb, 0xd7, 0xcf, 0x03, 0xe4, 0x4b, 0x5a, + 0xa6, 0x0a, 0xf8, 0x15, 0xbe, 0x4d, 0x22, 0x94} }, - test_case = 7 - key = 0xaa repeated 80 times - key_len = 80 - data = "Test Using Larger Than Block-Size Key and Larger - Than One Block-Size Data" - data_len = 73 - digest = 0x6f630fad67cda0ee1fb1f562db3aa53e + { "rfc2286 3.5", "rmd128", + hmac_test_case_keys[3], 16, + hmac_test_case_data[4], 20, + {0xe7, 0x98, 0x08, 0xf2, 0x4b, 0x25, 0xfd, 0x03, + 0x1c, 0x15, 0x5f, 0x0d, 0x55, 0x1d, 0x9a, 0x3a} }, + + { "rfc2286 3.6", "rmd128", + hmac_test_case_keys[4], 80, + hmac_test_case_data[5], 54, + {0xdc, 0x73, 0x29, 0x28, 0xde, 0x98, 0x10, 0x4a, + 0x1f, 0x59, 0xd3, 0x73, 0xc1, 0x50, 0xac, 0xbb} }, + + { "rfc2286 3.7", "rmd128", + hmac_test_case_keys[4], 80, + hmac_test_case_data[6], 73, + {0x5c, 0x6b, 0xec, 0x96, 0x79, 0x3e, 0x16, 0xd4, + 0x06, 0x90, 0xc2, 0x37, 0x63, 0x5f, 0x30, 0xc5} }, +#endif /* LTC_TEST_EXT */ + + /* + RFC 4231 4. Test Vectors + Ch. 4.6 with truncated output left out to simplify tests */ - { 7, "md5", - {0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, - 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, - 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, - 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, - 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, - 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, - 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, - 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, - 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, - 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa}, 80, - "Test Using Larger Than Block-Size Key and Larger Than One Block-Size Data", 73, - {0x6f, 0x63, 0x0f, 0xad, 0x67, 0xcd, 0xa0, 0xee, - 0x1f, 0xb1, 0xf5, 0x62, 0xdb, 0x3a, 0xa5, 0x3e} } + { "rfc4231 4.2", "sha224", + hmac_test_case_keys[0], 20, + hmac_test_case_data[0], 8, + {0x89, 0x6f, 0xb1, 0x12, 0x8a, 0xbb, 0xdf, 0x19, + 0x68, 0x32, 0x10, 0x7c, 0xd4, 0x9d, 0xf3, 0x3f, + 0x47, 0xb4, 0xb1, 0x16, 0x99, 0x12, 0xba, 0x4f, + 0x53, 0x68, 0x4b, 0x22} }, + +#ifdef LTC_TEST_EXT + { "rfc4231 4.3", "sha224", + hmac_test_case_keys[1], 4, + hmac_test_case_data[1], 28, + {0xa3, 0x0e, 0x01, 0x09, 0x8b, 0xc6, 0xdb, 0xbf, + 0x45, 0x69, 0x0f, 0x3a, 0x7e, 0x9e, 0x6d, 0x0f, + 0x8b, 0xbe, 0xa2, 0xa3, 0x9e, 0x61, 0x48, 0x00, + 0x8f, 0xd0, 0x5e, 0x44} }, + + { "rfc4231 4.4", "sha224", + hmac_test_case_keys[4], 20, + hmac_test_case_data[2], 50, + {0x7f, 0xb3, 0xcb, 0x35, 0x88, 0xc6, 0xc1, 0xf6, + 0xff, 0xa9, 0x69, 0x4d, 0x7d, 0x6a, 0xd2, 0x64, + 0x93, 0x65, 0xb0, 0xc1, 0xf6, 0x5d, 0x69, 0xd1, + 0xec, 0x83, 0x33, 0xea} }, + + { "rfc4231 4.5", "sha224", + hmac_test_case_keys[2], 25, + hmac_test_case_data[3], 50, + {0x6c, 0x11, 0x50, 0x68, 0x74, 0x01, 0x3c, 0xac, + 0x6a, 0x2a, 0xbc, 0x1b, 0xb3, 0x82, 0x62, 0x7c, + 0xec, 0x6a, 0x90, 0xd8, 0x6e, 0xfc, 0x01, 0x2d, + 0xe7, 0xaf, 0xec, 0x5a} }, + + { "rfc4231 4.7", "sha224", + hmac_test_case_keys[4], 131, + hmac_test_case_data[5], 54, + {0x95, 0xe9, 0xa0, 0xdb, 0x96, 0x20, 0x95, 0xad, + 0xae, 0xbe, 0x9b, 0x2d, 0x6f, 0x0d, 0xbc, 0xe2, + 0xd4, 0x99, 0xf1, 0x12, 0xf2, 0xd2, 0xb7, 0x27, + 0x3f, 0xa6, 0x87, 0x0e} }, + + { "rfc4231 4.8", "sha224", + hmac_test_case_keys[4], 131, + hmac_test_case_data[7], 152, + {0x3a, 0x85, 0x41, 0x66, 0xac, 0x5d, 0x9f, 0x02, + 0x3f, 0x54, 0xd5, 0x17, 0xd0, 0xb3, 0x9d, 0xbd, + 0x94, 0x67, 0x70, 0xdb, 0x9c, 0x2b, 0x95, 0xc9, + 0xf6, 0xf5, 0x65, 0xd1} }, +#endif /* LTC_TEST_EXT */ + + { "rfc4231 4.2", "sha256", + hmac_test_case_keys[0], 20, + hmac_test_case_data[0], 8, + {0xb0, 0x34, 0x4c, 0x61, 0xd8, 0xdb, 0x38, 0x53, + 0x5c, 0xa8, 0xaf, 0xce, 0xaf, 0x0b, 0xf1, 0x2b, + 0x88, 0x1d, 0xc2, 0x00, 0xc9, 0x83, 0x3d, 0xa7, + 0x26, 0xe9, 0x37, 0x6c, 0x2e, 0x32, 0xcf, 0xf7} }, + +#ifdef LTC_TEST_EXT + { "rfc4231 4.3", "sha256", + hmac_test_case_keys[1], 4, + hmac_test_case_data[1], 28, + {0x5b, 0xdc, 0xc1, 0x46, 0xbf, 0x60, 0x75, 0x4e, + 0x6a, 0x04, 0x24, 0x26, 0x08, 0x95, 0x75, 0xc7, + 0x5a, 0x00, 0x3f, 0x08, 0x9d, 0x27, 0x39, 0x83, + 0x9d, 0xec, 0x58, 0xb9, 0x64, 0xec, 0x38, 0x43} }, + + { "rfc4231 4.4", "sha256", + hmac_test_case_keys[4], 20, + hmac_test_case_data[2], 50, + {0x77, 0x3e, 0xa9, 0x1e, 0x36, 0x80, 0x0e, 0x46, + 0x85, 0x4d, 0xb8, 0xeb, 0xd0, 0x91, 0x81, 0xa7, + 0x29, 0x59, 0x09, 0x8b, 0x3e, 0xf8, 0xc1, 0x22, + 0xd9, 0x63, 0x55, 0x14, 0xce, 0xd5, 0x65, 0xfe} }, + + { "rfc4231 4.5", "sha256", + hmac_test_case_keys[2], 25, + hmac_test_case_data[3], 50, + {0x82, 0x55, 0x8a, 0x38, 0x9a, 0x44, 0x3c, 0x0e, + 0xa4, 0xcc, 0x81, 0x98, 0x99, 0xf2, 0x08, 0x3a, + 0x85, 0xf0, 0xfa, 0xa3, 0xe5, 0x78, 0xf8, 0x07, + 0x7a, 0x2e, 0x3f, 0xf4, 0x67, 0x29, 0x66, 0x5b} }, + + { "rfc4231 4.7", "sha256", + hmac_test_case_keys[4], 131, + hmac_test_case_data[5], 54, + {0x60, 0xe4, 0x31, 0x59, 0x1e, 0xe0, 0xb6, 0x7f, + 0x0d, 0x8a, 0x26, 0xaa, 0xcb, 0xf5, 0xb7, 0x7f, + 0x8e, 0x0b, 0xc6, 0x21, 0x37, 0x28, 0xc5, 0x14, + 0x05, 0x46, 0x04, 0x0f, 0x0e, 0xe3, 0x7f, 0x54} }, + + { "rfc4231 4.8", "sha256", + hmac_test_case_keys[4], 131, + hmac_test_case_data[7], 152, + {0x9b, 0x09, 0xff, 0xa7, 0x1b, 0x94, 0x2f, 0xcb, + 0x27, 0x63, 0x5f, 0xbc, 0xd5, 0xb0, 0xe9, 0x44, + 0xbf, 0xdc, 0x63, 0x64, 0x4f, 0x07, 0x13, 0x93, + 0x8a, 0x7f, 0x51, 0x53, 0x5c, 0x3a, 0x35, 0xe2} }, +#endif /* LTC_TEST_EXT */ + + { "rfc4231 4.2", "sha384", + hmac_test_case_keys[0], 20, + hmac_test_case_data[0], 8, + {0xaf, 0xd0, 0x39, 0x44, 0xd8, 0x48, 0x95, 0x62, + 0x6b, 0x08, 0x25, 0xf4, 0xab, 0x46, 0x90, 0x7f, + 0x15, 0xf9, 0xda, 0xdb, 0xe4, 0x10, 0x1e, 0xc6, + 0x82, 0xaa, 0x03, 0x4c, 0x7c, 0xeb, 0xc5, 0x9c, + 0xfa, 0xea, 0x9e, 0xa9, 0x07, 0x6e, 0xde, 0x7f, + 0x4a, 0xf1, 0x52, 0xe8, 0xb2, 0xfa, 0x9c, 0xb6} }, + +#ifdef LTC_TEST_EXT + { "rfc4231 4.3", "sha384", + hmac_test_case_keys[1], 4, + hmac_test_case_data[1], 28, + {0xaf, 0x45, 0xd2, 0xe3, 0x76, 0x48, 0x40, 0x31, + 0x61, 0x7f, 0x78, 0xd2, 0xb5, 0x8a, 0x6b, 0x1b, + 0x9c, 0x7e, 0xf4, 0x64, 0xf5, 0xa0, 0x1b, 0x47, + 0xe4, 0x2e, 0xc3, 0x73, 0x63, 0x22, 0x44, 0x5e, + 0x8e, 0x22, 0x40, 0xca, 0x5e, 0x69, 0xe2, 0xc7, + 0x8b, 0x32, 0x39, 0xec, 0xfa, 0xb2, 0x16, 0x49} }, + + { "rfc4231 4.4", "sha384", + hmac_test_case_keys[4], 20, + hmac_test_case_data[2], 50, + {0x88, 0x06, 0x26, 0x08, 0xd3, 0xe6, 0xad, 0x8a, + 0x0a, 0xa2, 0xac, 0xe0, 0x14, 0xc8, 0xa8, 0x6f, + 0x0a, 0xa6, 0x35, 0xd9, 0x47, 0xac, 0x9f, 0xeb, + 0xe8, 0x3e, 0xf4, 0xe5, 0x59, 0x66, 0x14, 0x4b, + 0x2a, 0x5a, 0xb3, 0x9d, 0xc1, 0x38, 0x14, 0xb9, + 0x4e, 0x3a, 0xb6, 0xe1, 0x01, 0xa3, 0x4f, 0x27} }, + + { "rfc4231 4.5", "sha384", + hmac_test_case_keys[2], 25, + hmac_test_case_data[3], 50, + {0x3e, 0x8a, 0x69, 0xb7, 0x78, 0x3c, 0x25, 0x85, + 0x19, 0x33, 0xab, 0x62, 0x90, 0xaf, 0x6c, 0xa7, + 0x7a, 0x99, 0x81, 0x48, 0x08, 0x50, 0x00, 0x9c, + 0xc5, 0x57, 0x7c, 0x6e, 0x1f, 0x57, 0x3b, 0x4e, + 0x68, 0x01, 0xdd, 0x23, 0xc4, 0xa7, 0xd6, 0x79, + 0xcc, 0xf8, 0xa3, 0x86, 0xc6, 0x74, 0xcf, 0xfb} }, + + { "rfc4231 4.7", "sha384", + hmac_test_case_keys[4], 131, + hmac_test_case_data[5], 54, + {0x4e, 0xce, 0x08, 0x44, 0x85, 0x81, 0x3e, 0x90, + 0x88, 0xd2, 0xc6, 0x3a, 0x04, 0x1b, 0xc5, 0xb4, + 0x4f, 0x9e, 0xf1, 0x01, 0x2a, 0x2b, 0x58, 0x8f, + 0x3c, 0xd1, 0x1f, 0x05, 0x03, 0x3a, 0xc4, 0xc6, + 0x0c, 0x2e, 0xf6, 0xab, 0x40, 0x30, 0xfe, 0x82, + 0x96, 0x24, 0x8d, 0xf1, 0x63, 0xf4, 0x49, 0x52} }, + + { "rfc4231 4.8", "sha384", + hmac_test_case_keys[4], 131, + hmac_test_case_data[7], 152, + {0x66, 0x17, 0x17, 0x8e, 0x94, 0x1f, 0x02, 0x0d, + 0x35, 0x1e, 0x2f, 0x25, 0x4e, 0x8f, 0xd3, 0x2c, + 0x60, 0x24, 0x20, 0xfe, 0xb0, 0xb8, 0xfb, 0x9a, + 0xdc, 0xce, 0xbb, 0x82, 0x46, 0x1e, 0x99, 0xc5, + 0xa6, 0x78, 0xcc, 0x31, 0xe7, 0x99, 0x17, 0x6d, + 0x38, 0x60, 0xe6, 0x11, 0x0c, 0x46, 0x52, 0x3e} }, +#endif /* LTC_TEST_EXT */ + + { "rfc4231 4.2", "sha512", + hmac_test_case_keys[0], 20, + hmac_test_case_data[0], 8, + {0x87, 0xaa, 0x7c, 0xde, 0xa5, 0xef, 0x61, 0x9d, + 0x4f, 0xf0, 0xb4, 0x24, 0x1a, 0x1d, 0x6c, 0xb0, + 0x23, 0x79, 0xf4, 0xe2, 0xce, 0x4e, 0xc2, 0x78, + 0x7a, 0xd0, 0xb3, 0x05, 0x45, 0xe1, 0x7c, 0xde, + 0xda, 0xa8, 0x33, 0xb7, 0xd6, 0xb8, 0xa7, 0x02, + 0x03, 0x8b, 0x27, 0x4e, 0xae, 0xa3, 0xf4, 0xe4, + 0xbe, 0x9d, 0x91, 0x4e, 0xeb, 0x61, 0xf1, 0x70, + 0x2e, 0x69, 0x6c, 0x20, 0x3a, 0x12, 0x68, 0x54} }, + +#ifdef LTC_TEST_EXT + { "rfc4231 4.3", "sha512", + hmac_test_case_keys[1], 4, + hmac_test_case_data[1], 28, + {0x16, 0x4b, 0x7a, 0x7b, 0xfc, 0xf8, 0x19, 0xe2, + 0xe3, 0x95, 0xfb, 0xe7, 0x3b, 0x56, 0xe0, 0xa3, + 0x87, 0xbd, 0x64, 0x22, 0x2e, 0x83, 0x1f, 0xd6, + 0x10, 0x27, 0x0c, 0xd7, 0xea, 0x25, 0x05, 0x54, + 0x97, 0x58, 0xbf, 0x75, 0xc0, 0x5a, 0x99, 0x4a, + 0x6d, 0x03, 0x4f, 0x65, 0xf8, 0xf0, 0xe6, 0xfd, + 0xca, 0xea, 0xb1, 0xa3, 0x4d, 0x4a, 0x6b, 0x4b, + 0x63, 0x6e, 0x07, 0x0a, 0x38, 0xbc, 0xe7, 0x37} }, + + { "rfc4231 4.4", "sha512", + hmac_test_case_keys[4], 20, + hmac_test_case_data[2], 50, + {0xfa, 0x73, 0xb0, 0x08, 0x9d, 0x56, 0xa2, 0x84, + 0xef, 0xb0, 0xf0, 0x75, 0x6c, 0x89, 0x0b, 0xe9, + 0xb1, 0xb5, 0xdb, 0xdd, 0x8e, 0xe8, 0x1a, 0x36, + 0x55, 0xf8, 0x3e, 0x33, 0xb2, 0x27, 0x9d, 0x39, + 0xbf, 0x3e, 0x84, 0x82, 0x79, 0xa7, 0x22, 0xc8, + 0x06, 0xb4, 0x85, 0xa4, 0x7e, 0x67, 0xc8, 0x07, + 0xb9, 0x46, 0xa3, 0x37, 0xbe, 0xe8, 0x94, 0x26, + 0x74, 0x27, 0x88, 0x59, 0xe1, 0x32, 0x92, 0xfb} }, + + { "rfc4231 4.5", "sha512", + hmac_test_case_keys[2], 25, + hmac_test_case_data[3], 50, + {0xb0, 0xba, 0x46, 0x56, 0x37, 0x45, 0x8c, 0x69, + 0x90, 0xe5, 0xa8, 0xc5, 0xf6, 0x1d, 0x4a, 0xf7, + 0xe5, 0x76, 0xd9, 0x7f, 0xf9, 0x4b, 0x87, 0x2d, + 0xe7, 0x6f, 0x80, 0x50, 0x36, 0x1e, 0xe3, 0xdb, + 0xa9, 0x1c, 0xa5, 0xc1, 0x1a, 0xa2, 0x5e, 0xb4, + 0xd6, 0x79, 0x27, 0x5c, 0xc5, 0x78, 0x80, 0x63, + 0xa5, 0xf1, 0x97, 0x41, 0x12, 0x0c, 0x4f, 0x2d, + 0xe2, 0xad, 0xeb, 0xeb, 0x10, 0xa2, 0x98, 0xdd} }, + + { "rfc4231 4.7", "sha512", + hmac_test_case_keys[4], 131, + hmac_test_case_data[5], 54, + {0x80, 0xb2, 0x42, 0x63, 0xc7, 0xc1, 0xa3, 0xeb, + 0xb7, 0x14, 0x93, 0xc1, 0xdd, 0x7b, 0xe8, 0xb4, + 0x9b, 0x46, 0xd1, 0xf4, 0x1b, 0x4a, 0xee, 0xc1, + 0x12, 0x1b, 0x01, 0x37, 0x83, 0xf8, 0xf3, 0x52, + 0x6b, 0x56, 0xd0, 0x37, 0xe0, 0x5f, 0x25, 0x98, + 0xbd, 0x0f, 0xd2, 0x21, 0x5d, 0x6a, 0x1e, 0x52, + 0x95, 0xe6, 0x4f, 0x73, 0xf6, 0x3f, 0x0a, 0xec, + 0x8b, 0x91, 0x5a, 0x98, 0x5d, 0x78, 0x65, 0x98} }, + + { "rfc4231 4.8", "sha512", + hmac_test_case_keys[4], 131, + hmac_test_case_data[7], 152, + {0xe3, 0x7b, 0x6a, 0x77, 0x5d, 0xc8, 0x7d, 0xba, + 0xa4, 0xdf, 0xa9, 0xf9, 0x6e, 0x5e, 0x3f, 0xfd, + 0xde, 0xbd, 0x71, 0xf8, 0x86, 0x72, 0x89, 0x86, + 0x5d, 0xf5, 0xa3, 0x2d, 0x20, 0xcd, 0xc9, 0x44, + 0xb6, 0x02, 0x2c, 0xac, 0x3c, 0x49, 0x82, 0xb1, + 0x0d, 0x5e, 0xeb, 0x55, 0xc3, 0xe4, 0xde, 0x15, + 0x13, 0x46, 0x76, 0xfb, 0x6d, 0xe0, 0x44, 0x60, + 0x65, 0xc9, 0x74, 0x40, 0xfa, 0x8c, 0x6a, 0x58} }, +#endif /* LTC_TEST_EXT */ + }; unsigned long outlen; @@ -271,30 +601,14 @@ Key First" ++tested; outlen = sizeof(digest); if((err = hmac_memory(hash, cases[i].key, cases[i].keylen, cases[i].data, cases[i].datalen, digest, &outlen)) != CRYPT_OK) { -#if 0 - printf("LTC_HMAC-%s test #%d, %s\n", cases[i].algo, cases[i].num, error_to_string(err)); +#ifdef LTC_TEST_DBG + printf("HMAC-%s test %s, %s\n", cases[i].algo, cases[i].num, error_to_string(err)); #endif return err; } - if(XMEMCMP(digest, cases[i].digest, (size_t)hash_descriptor[hash].hashsize) != 0) { + if(compare_testvector(digest, outlen, cases[i].digest, (size_t)hash_descriptor[hash].hashsize, cases[i].num, i)) { failed++; -#if 0 - unsigned int j; - printf("\nLTC_HMAC-%s test #%d:\n", cases[i].algo, cases[i].num); - printf( "Result: 0x"); - for(j=0; j < hash_descriptor[hash].hashsize; j++) { - printf("%2x ", digest[j]); - } - printf("\nCorrect: 0x"); - for(j=0; j < hash_descriptor[hash].hashsize; j++) { - printf("%2x ", cases[i].digest[j]); - } - printf("\n"); - return CRYPT_ERROR; -#endif - } else { - /* printf("LTC_HMAC-%s test #%d: Passed\n", cases[i].algo, cases[i].num); */ } } @@ -311,6 +625,6 @@ Key First" #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/mac/omac/omac_done.c b/libtomcrypt/src/mac/omac/omac_done.c index 796bdf9..bf22523 100644 --- a/libtomcrypt/src/mac/omac/omac_done.c +++ b/libtomcrypt/src/mac/omac/omac_done.c @@ -5,21 +5,19 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" -/** +/** @file omac_done.c - LTC_OMAC1 support, terminate a stream, Tom St Denis + OMAC1 support, terminate a stream, Tom St Denis */ #ifdef LTC_OMAC /** - Terminate an LTC_OMAC stream - @param omac The LTC_OMAC state + Terminate an OMAC stream + @param omac The OMAC state @param out [out] Destination for the authentication tag @param outlen [in/out] The max size and resulting size of the authentication tag @return CRYPT_OK if successful @@ -65,7 +63,7 @@ int omac_done(omac_state *omac, unsigned char *out, unsigned long *outlen) return err; } cipher_descriptor[omac->cipher_idx].done(&omac->key); - + /* output it */ for (x = 0; x < (unsigned)omac->blklen && x < *outlen; x++) { out[x] = omac->block[x]; @@ -81,6 +79,6 @@ int omac_done(omac_state *omac, unsigned char *out, unsigned long *outlen) #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/mac/omac/omac_file.c b/libtomcrypt/src/mac/omac/omac_file.c index 54871e0..a9104e8 100644 --- a/libtomcrypt/src/mac/omac/omac_file.c +++ b/libtomcrypt/src/mac/omac/omac_file.c @@ -5,79 +5,87 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" -/** +/** @file omac_file.c - LTC_OMAC1 support, process a file, Tom St Denis + OMAC1 support, process a file, Tom St Denis */ #ifdef LTC_OMAC /** - LTC_OMAC a file + OMAC a file @param cipher The index of the cipher desired @param key The secret key @param keylen The length of the secret key (octets) - @param filename The name of the file you wish to LTC_OMAC + @param filename The name of the file you wish to OMAC @param out [out] Where the authentication tag is to be stored @param outlen [in/out] The max size and resulting size of the authentication tag @return CRYPT_OK if successful, CRYPT_NOP if file support has been disabled */ -int omac_file(int cipher, +int omac_file(int cipher, const unsigned char *key, unsigned long keylen, - const char *filename, + const char *filename, unsigned char *out, unsigned long *outlen) { #ifdef LTC_NO_FILE return CRYPT_NOP; #else - int err, x; + size_t x; + int err; omac_state omac; FILE *in; - unsigned char buf[512]; + unsigned char *buf; LTC_ARGCHK(key != NULL); LTC_ARGCHK(filename != NULL); LTC_ARGCHK(out != NULL); LTC_ARGCHK(outlen != NULL); - in = fopen(filename, "rb"); - if (in == NULL) { - return CRYPT_FILE_NOTFOUND; + if ((buf = XMALLOC(LTC_FILE_READ_BUFSIZE)) == NULL) { + return CRYPT_MEM; } if ((err = omac_init(&omac, cipher, key, keylen)) != CRYPT_OK) { - fclose(in); - return err; + goto LBL_ERR; + } + + in = fopen(filename, "rb"); + if (in == NULL) { + err = CRYPT_FILE_NOTFOUND; + goto LBL_ERR; } do { - x = fread(buf, 1, sizeof(buf), in); - if ((err = omac_process(&omac, buf, x)) != CRYPT_OK) { + x = fread(buf, 1, LTC_FILE_READ_BUFSIZE, in); + if ((err = omac_process(&omac, buf, (unsigned long)x)) != CRYPT_OK) { fclose(in); - return err; + goto LBL_CLEANBUF; } - } while (x == sizeof(buf)); - fclose(in); + } while (x == LTC_FILE_READ_BUFSIZE); - if ((err = omac_done(&omac, out, outlen)) != CRYPT_OK) { - return err; + if (fclose(in) != 0) { + err = CRYPT_ERROR; + goto LBL_CLEANBUF; } + err = omac_done(&omac, out, outlen); + +LBL_CLEANBUF: + zeromem(buf, LTC_FILE_READ_BUFSIZE); +LBL_ERR: #ifdef LTC_CLEAN_STACK - zeromem(buf, sizeof(buf)); + zeromem(&omac, sizeof(omac_state)); #endif - - return CRYPT_OK; + XFREE(buf); + return err; #endif } #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/mac/omac/omac_init.c b/libtomcrypt/src/mac/omac/omac_init.c index 36a4a3d..55de2a6 100644 --- a/libtomcrypt/src/mac/omac/omac_init.c +++ b/libtomcrypt/src/mac/omac/omac_init.c @@ -5,22 +5,20 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" -/** +/** @file omac_init.c - LTC_OMAC1 support, initialize state, by Tom St Denis + OMAC1 support, initialize state, by Tom St Denis */ #ifdef LTC_OMAC /** - Initialize an LTC_OMAC state - @param omac The LTC_OMAC state to initialize + Initialize an OMAC state + @param omac The OMAC state to initialize @param cipher The index of the desired cipher @param key The secret key @param keylen The length of the secret key (octets) @@ -77,7 +75,7 @@ int omac_init(omac_state *omac, int cipher, const unsigned char *key, unsigned l omac->Lu[x][y] = ((omac->Lu[x][y] << 1) | (omac->Lu[x][y+1] >> 7)) & 255; } omac->Lu[x][len - 1] = ((omac->Lu[x][len - 1] << 1) ^ (msb ? mask : 0)) & 255; - + /* copy up as require */ if (x == 0) { XMEMCPY(omac->Lu[1], omac->Lu[0], sizeof(omac->Lu[0])); @@ -96,6 +94,6 @@ int omac_init(omac_state *omac, int cipher, const unsigned char *key, unsigned l #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/mac/omac/omac_memory.c b/libtomcrypt/src/mac/omac/omac_memory.c index c9f3392..1b57db8 100644 --- a/libtomcrypt/src/mac/omac/omac_memory.c +++ b/libtomcrypt/src/mac/omac/omac_memory.c @@ -5,30 +5,28 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" -/** +/** @file omac_memory.c - LTC_OMAC1 support, process a block of memory, Tom St Denis + OMAC1 support, process a block of memory, Tom St Denis */ #ifdef LTC_OMAC /** - LTC_OMAC a block of memory + OMAC a block of memory @param cipher The index of the desired cipher @param key The secret key @param keylen The length of the secret key (octets) - @param in The data to send through LTC_OMAC - @param inlen The length of the data to send through LTC_OMAC (octets) + @param in The data to send through OMAC + @param inlen The length of the data to send through OMAC (octets) @param out [out] The destination of the authentication tag @param outlen [in/out] The max size and resulting size of the authentication tag (octets) @return CRYPT_OK if successful */ -int omac_memory(int cipher, +int omac_memory(int cipher, const unsigned char *key, unsigned long keylen, const unsigned char *in, unsigned long inlen, unsigned char *out, unsigned long *outlen) @@ -75,11 +73,11 @@ LBL_ERR: #endif XFREE(omac); - return err; + return err; } #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/mac/omac/omac_memory_multi.c b/libtomcrypt/src/mac/omac/omac_memory_multi.c index 3db8270..50f26e6 100644 --- a/libtomcrypt/src/mac/omac/omac_memory_multi.c +++ b/libtomcrypt/src/mac/omac/omac_memory_multi.c @@ -5,32 +5,30 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" #include <stdarg.h> -/** +/** @file omac_memory_multi.c - LTC_OMAC1 support, process multiple blocks of memory, Tom St Denis + OMAC1 support, process multiple blocks of memory, Tom St Denis */ #ifdef LTC_OMAC /** - LTC_OMAC multiple blocks of memory + OMAC multiple blocks of memory @param cipher The index of the desired cipher @param key The secret key @param keylen The length of the secret key (octets) @param out [out] The destination of the authentication tag @param outlen [in/out] The max size and resulting size of the authentication tag (octets) - @param in The data to send through LTC_OMAC - @param inlen The length of the data to send through LTC_OMAC (octets) - @param ... tuples of (data,len) pairs to LTC_OMAC, terminated with a (NULL,x) (x=don't care) + @param in The data to send through OMAC + @param inlen The length of the data to send through OMAC (octets) + @param ... tuples of (data,len) pairs to OMAC, terminated with a (NULL,x) (x=don't care) @return CRYPT_OK if successful */ -int omac_memory_multi(int cipher, +int omac_memory_multi(int cipher, const unsigned char *key, unsigned long keylen, unsigned char *out, unsigned long *outlen, const unsigned char *in, unsigned long inlen, ...) @@ -57,7 +55,7 @@ int omac_memory_multi(int cipher, goto LBL_ERR; } va_start(args, inlen); - curptr = in; + curptr = in; curlen = inlen; for (;;) { /* process buf */ @@ -80,11 +78,11 @@ LBL_ERR: #endif XFREE(omac); va_end(args); - return err; + return err; } #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/mac/omac/omac_process.c b/libtomcrypt/src/mac/omac/omac_process.c index a70b179..4ae2bd1 100644 --- a/libtomcrypt/src/mac/omac/omac_process.c +++ b/libtomcrypt/src/mac/omac/omac_process.c @@ -5,29 +5,27 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" -/** +/** @file omac_process.c - LTC_OMAC1 support, process data, Tom St Denis + OMAC1 support, process data, Tom St Denis */ #ifdef LTC_OMAC -/** - Process data through LTC_OMAC - @param omac The LTC_OMAC state - @param in The input data to send through LTC_OMAC +/** + Process data through OMAC + @param omac The OMAC state + @param in The input data to send through OMAC @param inlen The length of the input (octets) @return CRYPT_OK if successful */ int omac_process(omac_state *omac, const unsigned char *in, unsigned long inlen) { - unsigned long n, x, blklen; + unsigned long n, x; int err; LTC_ARGCHK(omac != NULL); @@ -42,23 +40,26 @@ int omac_process(omac_state *omac, const unsigned char *in, unsigned long inlen) } #ifdef LTC_FAST - blklen = cipher_descriptor[omac->cipher_idx].block_length; - if (omac->buflen == 0 && inlen > blklen) { - unsigned long y; - for (x = 0; x < (inlen - blklen); x += blklen) { - for (y = 0; y < blklen; y += sizeof(LTC_FAST_TYPE)) { - *((LTC_FAST_TYPE*)(&omac->prev[y])) ^= *((LTC_FAST_TYPE*)(&in[y])); - } - in += blklen; - if ((err = cipher_descriptor[omac->cipher_idx].ecb_encrypt(omac->prev, omac->prev, &omac->key)) != CRYPT_OK) { - return err; - } - } - inlen -= x; - } + { + unsigned long blklen = cipher_descriptor[omac->cipher_idx].block_length; + + if (omac->buflen == 0 && inlen > blklen) { + unsigned long y; + for (x = 0; x < (inlen - blklen); x += blklen) { + for (y = 0; y < blklen; y += sizeof(LTC_FAST_TYPE)) { + *(LTC_FAST_TYPE_PTR_CAST(&omac->prev[y])) ^= *(LTC_FAST_TYPE_PTR_CAST(&in[y])); + } + in += blklen; + if ((err = cipher_descriptor[omac->cipher_idx].ecb_encrypt(omac->prev, omac->prev, &omac->key)) != CRYPT_OK) { + return err; + } + } + inlen -= x; + } + } #endif - while (inlen != 0) { + while (inlen != 0) { /* ok if the block is full we xor in prev, encrypt and replace prev */ if (omac->buflen == omac->blklen) { for (x = 0; x < (unsigned long)omac->blklen; x++) { @@ -84,6 +85,6 @@ int omac_process(omac_state *omac, const unsigned char *in, unsigned long inlen) #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/mac/omac/omac_test.c b/libtomcrypt/src/mac/omac/omac_test.c index 10f5725..9bf392c 100644 --- a/libtomcrypt/src/mac/omac/omac_test.c +++ b/libtomcrypt/src/mac/omac/omac_test.c @@ -5,20 +5,18 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" -/** +/** @file omac_test.c - LTC_OMAC1 support, self-test, by Tom St Denis + OMAC1 support, self-test, by Tom St Denis */ #ifdef LTC_OMAC /** - Test the LTC_OMAC setup + Test the OMAC setup @return CRYPT_OK if successful, CRYPT_NOP if tests have been disabled */ int omac_test(void) @@ -26,48 +24,48 @@ int omac_test(void) #if !defined(LTC_TEST) return CRYPT_NOP; #else - static const struct { + static const struct { int keylen, msglen; unsigned char key[16], msg[64], tag[16]; } tests[] = { { 16, 0, - { 0x2b, 0x7e, 0x15, 0x16, 0x28, 0xae, 0xd2, 0xa6, + { 0x2b, 0x7e, 0x15, 0x16, 0x28, 0xae, 0xd2, 0xa6, 0xab, 0xf7, 0x15, 0x88, 0x09, 0xcf, 0x4f, 0x3c }, { 0x00 }, { 0xbb, 0x1d, 0x69, 0x29, 0xe9, 0x59, 0x37, 0x28, 0x7f, 0xa3, 0x7d, 0x12, 0x9b, 0x75, 0x67, 0x46 } }, - { 16, 16, - { 0x2b, 0x7e, 0x15, 0x16, 0x28, 0xae, 0xd2, 0xa6, + { 16, 16, + { 0x2b, 0x7e, 0x15, 0x16, 0x28, 0xae, 0xd2, 0xa6, 0xab, 0xf7, 0x15, 0x88, 0x09, 0xcf, 0x4f, 0x3c }, { 0x6b, 0xc1, 0xbe, 0xe2, 0x2e, 0x40, 0x9f, 0x96, 0xe9, 0x3d, 0x7e, 0x11, 0x73, 0x93, 0x17, 0x2a }, - { 0x07, 0x0a, 0x16, 0xb4, 0x6b, 0x4d, 0x41, 0x44, + { 0x07, 0x0a, 0x16, 0xb4, 0x6b, 0x4d, 0x41, 0x44, 0xf7, 0x9b, 0xdd, 0x9d, 0xd0, 0x4a, 0x28, 0x7c } }, - { 16, 40, - { 0x2b, 0x7e, 0x15, 0x16, 0x28, 0xae, 0xd2, 0xa6, + { 16, 40, + { 0x2b, 0x7e, 0x15, 0x16, 0x28, 0xae, 0xd2, 0xa6, 0xab, 0xf7, 0x15, 0x88, 0x09, 0xcf, 0x4f, 0x3c }, { 0x6b, 0xc1, 0xbe, 0xe2, 0x2e, 0x40, 0x9f, 0x96, 0xe9, 0x3d, 0x7e, 0x11, 0x73, 0x93, 0x17, 0x2a, - 0xae, 0x2d, 0x8a, 0x57, 0x1e, 0x03, 0xac, 0x9c, + 0xae, 0x2d, 0x8a, 0x57, 0x1e, 0x03, 0xac, 0x9c, 0x9e, 0xb7, 0x6f, 0xac, 0x45, 0xaf, 0x8e, 0x51, 0x30, 0xc8, 0x1c, 0x46, 0xa3, 0x5c, 0xe4, 0x11 }, { 0xdf, 0xa6, 0x67, 0x47, 0xde, 0x9a, 0xe6, 0x30, 0x30, 0xca, 0x32, 0x61, 0x14, 0x97, 0xc8, 0x27 } }, - { 16, 64, - { 0x2b, 0x7e, 0x15, 0x16, 0x28, 0xae, 0xd2, 0xa6, + { 16, 64, + { 0x2b, 0x7e, 0x15, 0x16, 0x28, 0xae, 0xd2, 0xa6, 0xab, 0xf7, 0x15, 0x88, 0x09, 0xcf, 0x4f, 0x3c }, { 0x6b, 0xc1, 0xbe, 0xe2, 0x2e, 0x40, 0x9f, 0x96, 0xe9, 0x3d, 0x7e, 0x11, 0x73, 0x93, 0x17, 0x2a, - 0xae, 0x2d, 0x8a, 0x57, 0x1e, 0x03, 0xac, 0x9c, + 0xae, 0x2d, 0x8a, 0x57, 0x1e, 0x03, 0xac, 0x9c, 0x9e, 0xb7, 0x6f, 0xac, 0x45, 0xaf, 0x8e, 0x51, 0x30, 0xc8, 0x1c, 0x46, 0xa3, 0x5c, 0xe4, 0x11, 0xe5, 0xfb, 0xc1, 0x19, 0x1a, 0x0a, 0x52, 0xef, 0xf6, 0x9f, 0x24, 0x45, 0xdf, 0x4f, 0x9b, 0x17, 0xad, 0x2b, 0x41, 0x7b, 0xe6, 0x6c, 0x37, 0x10 }, - { 0x51, 0xf0, 0xbe, 0xbf, 0x7e, 0x3b, 0x9d, 0x92, + { 0x51, 0xf0, 0xbe, 0xbf, 0x7e, 0x3b, 0x9d, 0x92, 0xfc, 0x49, 0x74, 0x17, 0x79, 0x36, 0x3c, 0xfe } } @@ -77,7 +75,7 @@ int omac_test(void) unsigned long len; - /* AES can be under rijndael or aes... try to find it */ + /* AES can be under rijndael or aes... try to find it */ if ((idx = find_cipher("aes")) == -1) { if ((idx = find_cipher("rijndael")) == -1) { return CRYPT_NOP; @@ -85,26 +83,21 @@ int omac_test(void) } for (x = 0; x < (int)(sizeof(tests)/sizeof(tests[0])); x++) { - len = sizeof(out); + len = sizeof(out); if ((err = omac_memory(idx, tests[x].key, tests[x].keylen, tests[x].msg, tests[x].msglen, out, &len)) != CRYPT_OK) { return err; } - if (XMEMCMP(out, tests[x].tag, 16) != 0) { -#if 0 - int y; - printf("\n\nTag: "); - for (y = 0; y < 16; y++) printf("%02x", out[y]); printf("\n\n"); -#endif + if (compare_testvector(out, len, tests[x].tag, sizeof(tests[x].tag), "OMAC", x) != 0) { return CRYPT_FAIL_TESTVECTOR; } } return CRYPT_OK; #endif -} +} #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/mac/pelican/pelican.c b/libtomcrypt/src/mac/pelican/pelican.c index 47640a3..6a4dde6 100644 --- a/libtomcrypt/src/mac/pelican/pelican.c +++ b/libtomcrypt/src/mac/pelican/pelican.c @@ -5,18 +5,17 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" -/** +/** @file pelican.c - Pelican MAC, initialize state, by Tom St Denis + Pelican MAC, initialize state, by Tom St Denis */ #ifdef LTC_PELICAN +#define __LTC_AES_TAB_C__ #define ENCRYPT_ONLY #define PELI_TAB #include "../../ciphers/aes/aes_tab.c" @@ -24,14 +23,14 @@ /** Initialize a Pelican state @param pelmac The Pelican state to initialize - @param key The secret key + @param key The secret key @param keylen The length of the secret key (octets) @return CRYPT_OK if successful */ int pelican_init(pelican_state *pelmac, const unsigned char *key, unsigned long keylen) { int err; - + LTC_ARGCHK(pelmac != NULL); LTC_ARGCHK(key != NULL); @@ -49,10 +48,10 @@ int pelican_init(pelican_state *pelmac, const unsigned char *key, unsigned long aes_ecb_encrypt(pelmac->state, pelmac->state, &pelmac->K); pelmac->buflen = 0; - return CRYPT_OK; + return CRYPT_OK; } -static void four_rounds(pelican_state *pelmac) +static void _four_rounds(pelican_state *pelmac) { ulong32 s0, s1, s2, s3, t0, t1, t2, t3; int r; @@ -90,7 +89,7 @@ static void four_rounds(pelican_state *pelmac) STORE32H(s3, pelmac->state + 12); } -/** +/** Process a block of text through Pelican @param pelmac The Pelican MAC state @param in The input @@ -113,9 +112,9 @@ int pelican_process(pelican_state *pelmac, const unsigned char *in, unsigned lon while (inlen & ~15) { int x; for (x = 0; x < 16; x += sizeof(LTC_FAST_TYPE)) { - *((LTC_FAST_TYPE*)((unsigned char *)pelmac->state + x)) ^= *((LTC_FAST_TYPE*)((unsigned char *)in + x)); + *(LTC_FAST_TYPE_PTR_CAST((unsigned char *)pelmac->state + x)) ^= *(LTC_FAST_TYPE_PTR_CAST((unsigned char *)in + x)); } - four_rounds(pelmac); + _four_rounds(pelmac); in += 16; inlen -= 16; } @@ -125,7 +124,7 @@ int pelican_process(pelican_state *pelmac, const unsigned char *in, unsigned lon while (inlen--) { pelmac->state[pelmac->buflen++] ^= *in++; if (pelmac->buflen == 16) { - four_rounds(pelmac); + _four_rounds(pelmac); pelmac->buflen = 0; } } @@ -149,17 +148,17 @@ int pelican_done(pelican_state *pelmac, unsigned char *out) } if (pelmac->buflen == 16) { - four_rounds(pelmac); + _four_rounds(pelmac); pelmac->buflen = 0; } pelmac->state[pelmac->buflen++] ^= 0x80; aes_ecb_encrypt(pelmac->state, out, &pelmac->K); aes_done(&pelmac->K); return CRYPT_OK; -} +} #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/mac/pelican/pelican_memory.c b/libtomcrypt/src/mac/pelican/pelican_memory.c index 6eabaa1..08607a0 100644 --- a/libtomcrypt/src/mac/pelican/pelican_memory.c +++ b/libtomcrypt/src/mac/pelican/pelican_memory.c @@ -5,14 +5,12 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" -/** +/** @file pelican_memory.c - Pelican MAC, MAC a block of memory, by Tom St Denis + Pelican MAC, MAC a block of memory, by Tom St Denis */ #ifdef LTC_PELICAN @@ -23,7 +21,7 @@ @param keylen The length of the key (octets) @param in The input to MAC @param inlen The length of the input (octets) - @param out [out] The output TAG + @param out [out] The output TAG @return CRYPT_OK on success */ int pelican_memory(const unsigned char *key, unsigned long keylen, @@ -34,7 +32,7 @@ int pelican_memory(const unsigned char *key, unsigned long keylen, int err; pel = XMALLOC(sizeof(*pel)); - if (pel == NULL) { + if (pel == NULL) { return CRYPT_MEM; } @@ -47,13 +45,13 @@ int pelican_memory(const unsigned char *key, unsigned long keylen, return err; } err = pelican_done(pel, out); - XFREE(pel); + XFREE(pel); return err; } #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/mac/pelican/pelican_test.c b/libtomcrypt/src/mac/pelican/pelican_test.c index e743faa..32a7df3 100644 --- a/libtomcrypt/src/mac/pelican/pelican_test.c +++ b/libtomcrypt/src/mac/pelican/pelican_test.c @@ -5,14 +5,12 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" -/** +/** @file pelican_test.c - Pelican MAC, test, by Tom St Denis + Pelican MAC, test, by Tom St Denis */ #ifdef LTC_PELICAN @@ -31,7 +29,7 @@ int pelican_test(void) { 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07, 0x08, 0x09, 0x0A, 0x0B, 0x0C, 0x0D, 0x0E, 0x0F }, { 0 }, - { 0xeb, 0x58, 0x37, 0x15, 0xf8, 0x34, 0xde, 0xe5, + { 0xeb, 0x58, 0x37, 0x15, 0xf8, 0x34, 0xde, 0xe5, 0xa4, 0xd1, 0x6e, 0xe4, 0xb9, 0xd7, 0x76, 0x0e, }, 16, 0 }, @@ -41,7 +39,7 @@ int pelican_test(void) { 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07, 0x08, 0x09, 0x0A, 0x0B, 0x0C, 0x0D, 0x0E, 0x0F }, { 0x00, 0x01, 0x02 }, - { 0x1c, 0x97, 0x40, 0x60, 0x6c, 0x58, 0x17, 0x2d, + { 0x1c, 0x97, 0x40, 0x60, 0x6c, 0x58, 0x17, 0x2d, 0x03, 0x94, 0x19, 0x70, 0x81, 0xc4, 0x38, 0x54, }, 16, 3 }, @@ -52,7 +50,7 @@ int pelican_test(void) 0x08, 0x09, 0x0A, 0x0B, 0x0C, 0x0D, 0x0E, 0x0F }, { 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07, 0x08, 0x09, 0x0A, 0x0B, 0x0C, 0x0D, 0x0E, 0x0F }, - { 0x03, 0xcc, 0x46, 0xb8, 0xac, 0xa7, 0x9c, 0x36, + { 0x03, 0xcc, 0x46, 0xb8, 0xac, 0xa7, 0x9c, 0x36, 0x1e, 0x8c, 0x6e, 0xa6, 0x7b, 0x89, 0x32, 0x49, }, 16, 16 }, @@ -65,7 +63,7 @@ int pelican_test(void) 0x08, 0x09, 0x0A, 0x0B, 0x0C, 0x0D, 0x0E, 0x0F, 0x10, 0x11, 0x12, 0x13, 0x14, 0x15, 0x16, 0x17, 0x18, 0x19, 0x1A, 0x1B, 0x1C, 0x1D, 0x1E, 0x1F }, - { 0x89, 0xcc, 0x36, 0x58, 0x1b, 0xdd, 0x4d, 0xb5, + { 0x89, 0xcc, 0x36, 0x58, 0x1b, 0xdd, 0x4d, 0xb5, 0x78, 0xbb, 0xac, 0xf0, 0xff, 0x8b, 0x08, 0x15, }, 16, 32 }, @@ -79,7 +77,7 @@ int pelican_test(void) 0x10, 0x11, 0x12, 0x13, 0x14, 0x15, 0x16, 0x17, 0x18, 0x19, 0x1A, 0x1B, 0x1C, 0x1D, 0x1E, 0x1F, 0x20, 0x21, 0x23 }, - { 0x4a, 0x7d, 0x45, 0x4d, 0xcd, 0xb5, 0xda, 0x8d, + { 0x4a, 0x7d, 0x45, 0x4d, 0xcd, 0xb5, 0xda, 0x8d, 0x48, 0x78, 0x16, 0x48, 0x5d, 0x45, 0x95, 0x99, }, 16, 35 }, @@ -87,8 +85,8 @@ int pelican_test(void) int x, err; unsigned char out[16]; pelican_state pel; - - for (x = 0; x < (int)(sizeof(tests)/sizeof(tests[0])); x++) { + + for (x = 0; x < (int)(sizeof(tests)/sizeof(tests[0])); x++) { if ((err = pelican_init(&pel, tests[x].K, tests[x].keylen)) != CRYPT_OK) { return err; } @@ -99,12 +97,7 @@ int pelican_test(void) return err; } - if (XMEMCMP(out, tests[x].T, 16)) { -#if 0 - int y; - printf("\nFailed test %d\n", x); - printf("{ "); for (y = 0; y < 16; ) { printf("0x%02x, ", out[y]); if (!(++y & 7)) printf("\n"); } printf(" }\n"); -#endif + if (compare_testvector(out, 16, tests[x].T, 16, "PELICAN", x)) { return CRYPT_FAIL_TESTVECTOR; } } @@ -115,6 +108,6 @@ int pelican_test(void) #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/mac/pmac/pmac_done.c b/libtomcrypt/src/mac/pmac/pmac_done.c index 88076c6..de7a5aa 100644 --- a/libtomcrypt/src/mac/pmac/pmac_done.c +++ b/libtomcrypt/src/mac/pmac/pmac_done.c @@ -5,14 +5,12 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" -/** +/** @file pmac_done.c - PMAC implementation, terminate a session, by Tom St Denis + PMAC implementation, terminate a session, by Tom St Denis */ #ifdef LTC_PMAC @@ -69,6 +67,6 @@ int pmac_done(pmac_state *state, unsigned char *out, unsigned long *outlen) #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/mac/pmac/pmac_file.c b/libtomcrypt/src/mac/pmac/pmac_file.c index c7a9f74..abe04f1 100644 --- a/libtomcrypt/src/mac/pmac/pmac_file.c +++ b/libtomcrypt/src/mac/pmac/pmac_file.c @@ -5,20 +5,18 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" -/** +/** @file pmac_file.c - PMAC implementation, process a file, by Tom St Denis + PMAC implementation, process a file, by Tom St Denis */ #ifdef LTC_PMAC /** - PMAC a file + PMAC a file @param cipher The index of the cipher desired @param key The secret key @param keylen The length of the secret key (octets) @@ -27,18 +25,19 @@ @param outlen [in/out] Max size and resulting size of the authentication tag @return CRYPT_OK if successful, CRYPT_NOP if file support has been disabled */ -int pmac_file(int cipher, +int pmac_file(int cipher, const unsigned char *key, unsigned long keylen, - const char *filename, + const char *filename, unsigned char *out, unsigned long *outlen) { #ifdef LTC_NO_FILE return CRYPT_NOP; #else - int err, x; + size_t x; + int err; pmac_state pmac; FILE *in; - unsigned char buf[512]; + unsigned char *buf; LTC_ARGCHK(key != NULL); @@ -46,39 +45,48 @@ int pmac_file(int cipher, LTC_ARGCHK(out != NULL); LTC_ARGCHK(outlen != NULL); - in = fopen(filename, "rb"); - if (in == NULL) { - return CRYPT_FILE_NOTFOUND; + if ((buf = XMALLOC(LTC_FILE_READ_BUFSIZE)) == NULL) { + return CRYPT_MEM; } if ((err = pmac_init(&pmac, cipher, key, keylen)) != CRYPT_OK) { - fclose(in); - return err; + goto LBL_ERR; + } + + in = fopen(filename, "rb"); + if (in == NULL) { + err = CRYPT_FILE_NOTFOUND; + goto LBL_ERR; } do { - x = fread(buf, 1, sizeof(buf), in); - if ((err = pmac_process(&pmac, buf, x)) != CRYPT_OK) { + x = fread(buf, 1, LTC_FILE_READ_BUFSIZE, in); + if ((err = pmac_process(&pmac, buf, (unsigned long)x)) != CRYPT_OK) { fclose(in); - return err; + goto LBL_CLEANBUF; } - } while (x == sizeof(buf)); - fclose(in); + } while (x == LTC_FILE_READ_BUFSIZE); - if ((err = pmac_done(&pmac, out, outlen)) != CRYPT_OK) { - return err; + if (fclose(in) != 0) { + err = CRYPT_ERROR; + goto LBL_CLEANBUF; } + err = pmac_done(&pmac, out, outlen); + +LBL_CLEANBUF: + zeromem(buf, LTC_FILE_READ_BUFSIZE); +LBL_ERR: #ifdef LTC_CLEAN_STACK - zeromem(buf, sizeof(buf)); + zeromem(&pmac, sizeof(pmac_state)); #endif - - return CRYPT_OK; + XFREE(buf); + return err; #endif } #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/mac/pmac/pmac_init.c b/libtomcrypt/src/mac/pmac/pmac_init.c index e4cf571..b1bb400 100644 --- a/libtomcrypt/src/mac/pmac/pmac_init.c +++ b/libtomcrypt/src/mac/pmac/pmac_init.c @@ -5,21 +5,19 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" -/** +/** @file pmac_init.c - PMAC implementation, initialize state, by Tom St Denis + PMAC implementation, initialize state, by Tom St Denis */ #ifdef LTC_PMAC static const struct { int len; - unsigned char poly_div[MAXBLOCKSIZE], + unsigned char poly_div[MAXBLOCKSIZE], poly_mul[MAXBLOCKSIZE]; } polys[] = { { @@ -27,7 +25,7 @@ static const struct { { 0x80, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x0D }, { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x1B } }, { - 16, + 16, { 0x80, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x43 }, { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, @@ -39,7 +37,7 @@ static const struct { Initialize a PMAC state @param pmac The PMAC state to initialize @param cipher The index of the desired cipher - @param key The secret key + @param key The secret key @param keylen The length of the secret key (octets) @return CRYPT_OK if successful */ @@ -59,10 +57,13 @@ int pmac_init(pmac_state *pmac, int cipher, const unsigned char *key, unsigned l /* determine which polys to use */ pmac->block_len = cipher_descriptor[cipher].block_length; for (poly = 0; poly < (int)(sizeof(polys)/sizeof(polys[0])); poly++) { - if (polys[poly].len == pmac->block_len) { + if (polys[poly].len == pmac->block_len) { break; } } + if (poly >= (int)(sizeof(polys)/sizeof(polys[0]))) { + return CRYPT_INVALID_ARG; + } if (polys[poly].len != pmac->block_len) { return CRYPT_INVALID_ARG; } @@ -78,7 +79,7 @@ int pmac_init(pmac_state *pmac, int cipher, const unsigned char *key, unsigned l if ((err = cipher_descriptor[cipher].setup(key, keylen, 0, &pmac->key)) != CRYPT_OK) { return err; } - + /* allocate L */ L = XMALLOC(pmac->block_len); if (L == NULL) { @@ -107,41 +108,41 @@ int pmac_init(pmac_state *pmac, int cipher, const unsigned char *key, unsigned l } } - /* find Lr = L / x */ - m = L[pmac->block_len-1] & 1; + /* find Lr = L / x */ + m = L[pmac->block_len-1] & 1; - /* shift right */ - for (x = pmac->block_len - 1; x > 0; x--) { - pmac->Lr[x] = ((L[x] >> 1) | (L[x-1] << 7)) & 255; - } - pmac->Lr[0] = L[0] >> 1; + /* shift right */ + for (x = pmac->block_len - 1; x > 0; x--) { + pmac->Lr[x] = ((L[x] >> 1) | (L[x-1] << 7)) & 255; + } + pmac->Lr[0] = L[0] >> 1; - if (m == 1) { - for (x = 0; x < pmac->block_len; x++) { - pmac->Lr[x] ^= polys[poly].poly_div[x]; - } - } + if (m == 1) { + for (x = 0; x < pmac->block_len; x++) { + pmac->Lr[x] ^= polys[poly].poly_div[x]; + } + } - /* zero buffer, counters, etc... */ - pmac->block_index = 1; - pmac->cipher_idx = cipher; - pmac->buflen = 0; - zeromem(pmac->block, sizeof(pmac->block)); - zeromem(pmac->Li, sizeof(pmac->Li)); - zeromem(pmac->checksum, sizeof(pmac->checksum)); - err = CRYPT_OK; + /* zero buffer, counters, etc... */ + pmac->block_index = 1; + pmac->cipher_idx = cipher; + pmac->buflen = 0; + zeromem(pmac->block, sizeof(pmac->block)); + zeromem(pmac->Li, sizeof(pmac->Li)); + zeromem(pmac->checksum, sizeof(pmac->checksum)); + err = CRYPT_OK; error: #ifdef LTC_CLEAN_STACK - zeromem(L, pmac->block_len); + zeromem(L, pmac->block_len); #endif - XFREE(L); + XFREE(L); - return err; + return err; } #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/mac/pmac/pmac_memory.c b/libtomcrypt/src/mac/pmac/pmac_memory.c index 70b9616..7842781 100644 --- a/libtomcrypt/src/mac/pmac/pmac_memory.c +++ b/libtomcrypt/src/mac/pmac/pmac_memory.c @@ -5,14 +5,12 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" -/** +/** @file pmac_memory.c - PMAC implementation, process a block of memory, by Tom St Denis + PMAC implementation, process a block of memory, by Tom St Denis */ #ifdef LTC_PMAC @@ -28,7 +26,7 @@ @param outlen [in/out] The max size and resulting size of the authentication tag @return CRYPT_OK if successful */ -int pmac_memory(int cipher, +int pmac_memory(int cipher, const unsigned char *key, unsigned long keylen, const unsigned char *in, unsigned long inlen, unsigned char *out, unsigned long *outlen) @@ -46,7 +44,7 @@ int pmac_memory(int cipher, if (pmac == NULL) { return CRYPT_MEM; } - + if ((err = pmac_init(pmac, cipher, key, keylen)) != CRYPT_OK) { goto LBL_ERR; } @@ -64,11 +62,11 @@ LBL_ERR: #endif XFREE(pmac); - return err; + return err; } #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/mac/pmac/pmac_memory_multi.c b/libtomcrypt/src/mac/pmac/pmac_memory_multi.c index 36783d3..f3de4b5 100644 --- a/libtomcrypt/src/mac/pmac/pmac_memory_multi.c +++ b/libtomcrypt/src/mac/pmac/pmac_memory_multi.c @@ -5,15 +5,13 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" #include <stdarg.h> -/** +/** @file pmac_memory_multi.c - PMAC implementation, process multiple blocks of memory, by Tom St Denis + PMAC implementation, process multiple blocks of memory, by Tom St Denis */ #ifdef LTC_PMAC @@ -30,7 +28,7 @@ @param ... tuples of (data,len) pairs to PMAC, terminated with a (NULL,x) (x=don't care) @return CRYPT_OK if successful */ -int pmac_memory_multi(int cipher, +int pmac_memory_multi(int cipher, const unsigned char *key, unsigned long keylen, unsigned char *out, unsigned long *outlen, const unsigned char *in, unsigned long inlen, ...) @@ -51,12 +49,12 @@ int pmac_memory_multi(int cipher, if (pmac == NULL) { return CRYPT_MEM; } - + if ((err = pmac_init(pmac, cipher, key, keylen)) != CRYPT_OK) { goto LBL_ERR; } va_start(args, inlen); - curptr = in; + curptr = in; curlen = inlen; for (;;) { /* process buf */ @@ -79,11 +77,11 @@ LBL_ERR: #endif XFREE(pmac); va_end(args); - return err; + return err; } #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/mac/pmac/pmac_ntz.c b/libtomcrypt/src/mac/pmac/pmac_ntz.c index b5137da..2c7dec5 100644 --- a/libtomcrypt/src/mac/pmac/pmac_ntz.c +++ b/libtomcrypt/src/mac/pmac/pmac_ntz.c @@ -5,14 +5,12 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" -/** +/** @file pmac_ntz.c - PMAC implementation, internal function, by Tom St Denis + PMAC implementation, internal function, by Tom St Denis */ #ifdef LTC_PMAC @@ -34,6 +32,6 @@ int pmac_ntz(unsigned long x) #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/mac/pmac/pmac_process.c b/libtomcrypt/src/mac/pmac/pmac_process.c index e32e65f..018fa27 100644 --- a/libtomcrypt/src/mac/pmac/pmac_process.c +++ b/libtomcrypt/src/mac/pmac/pmac_process.c @@ -5,14 +5,12 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" -/** +/** @file pmac_process.c - PMAC implementation, process data, by Tom St Denis + PMAC implementation, process data, by Tom St Denis */ @@ -48,13 +46,13 @@ int pmac_process(pmac_state *pmac, const unsigned char *in, unsigned long inlen) for (x = 0; x < (inlen - 16); x += 16) { pmac_shift_xor(pmac); for (y = 0; y < 16; y += sizeof(LTC_FAST_TYPE)) { - *((LTC_FAST_TYPE*)(&Z[y])) = *((LTC_FAST_TYPE*)(&in[y])) ^ *((LTC_FAST_TYPE*)(&pmac->Li[y])); + *(LTC_FAST_TYPE_PTR_CAST(&Z[y])) = *(LTC_FAST_TYPE_PTR_CAST(&in[y])) ^ *(LTC_FAST_TYPE_PTR_CAST(&pmac->Li[y])); } if ((err = cipher_descriptor[pmac->cipher_idx].ecb_encrypt(Z, Z, &pmac->key)) != CRYPT_OK) { return err; } for (y = 0; y < 16; y += sizeof(LTC_FAST_TYPE)) { - *((LTC_FAST_TYPE*)(&pmac->checksum[y])) ^= *((LTC_FAST_TYPE*)(&Z[y])); + *(LTC_FAST_TYPE_PTR_CAST(&pmac->checksum[y])) ^= *(LTC_FAST_TYPE_PTR_CAST(&Z[y])); } in += 16; } @@ -62,7 +60,7 @@ int pmac_process(pmac_state *pmac, const unsigned char *in, unsigned long inlen) } #endif - while (inlen != 0) { + while (inlen != 0) { /* ok if the block is full we xor in prev, encrypt and replace prev */ if (pmac->buflen == pmac->block_len) { pmac_shift_xor(pmac); @@ -95,6 +93,6 @@ int pmac_process(pmac_state *pmac, const unsigned char *in, unsigned long inlen) #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/mac/pmac/pmac_shift_xor.c b/libtomcrypt/src/mac/pmac/pmac_shift_xor.c index 122cadb..49d48f9 100644 --- a/libtomcrypt/src/mac/pmac/pmac_shift_xor.c +++ b/libtomcrypt/src/mac/pmac/pmac_shift_xor.c @@ -5,14 +5,12 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" -/** +/** @file pmac_shift_xor.c - PMAC implementation, internal function, by Tom St Denis + PMAC implementation, internal function, by Tom St Denis */ #ifdef LTC_PMAC @@ -27,8 +25,8 @@ void pmac_shift_xor(pmac_state *pmac) y = pmac_ntz(pmac->block_index++); #ifdef LTC_FAST for (x = 0; x < pmac->block_len; x += sizeof(LTC_FAST_TYPE)) { - *((LTC_FAST_TYPE*)((unsigned char *)pmac->Li + x)) ^= - *((LTC_FAST_TYPE*)((unsigned char *)pmac->Ls[y] + x)); + *(LTC_FAST_TYPE_PTR_CAST((unsigned char *)pmac->Li + x)) ^= + *(LTC_FAST_TYPE_PTR_CAST((unsigned char *)pmac->Ls[y] + x)); } #else for (x = 0; x < pmac->block_len; x++) { @@ -39,6 +37,6 @@ void pmac_shift_xor(pmac_state *pmac) #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/mac/pmac/pmac_test.c b/libtomcrypt/src/mac/pmac/pmac_test.c index 5d2e42a..19329c6 100644 --- a/libtomcrypt/src/mac/pmac/pmac_test.c +++ b/libtomcrypt/src/mac/pmac/pmac_test.c @@ -5,20 +5,18 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" -/** +/** @file pmac_test.c - PMAC implementation, self-test, by Tom St Denis + PMAC implementation, self-test, by Tom St Denis */ #ifdef LTC_PMAC -/** +/** Test the LTC_OMAC implementation @return CRYPT_OK if successful, CRYPT_NOP if testing has been disabled */ @@ -27,7 +25,7 @@ int pmac_test(void) #if !defined(LTC_TEST) return CRYPT_NOP; #else - static const struct { + static const struct { int msglen; unsigned char key[16], msg[34], tag[16]; } tests[] = { @@ -125,7 +123,7 @@ int pmac_test(void) unsigned long len; unsigned char outtag[MAXBLOCKSIZE]; - /* AES can be under rijndael or aes... try to find it */ + /* AES can be under rijndael or aes... try to find it */ if ((idx = find_cipher("aes")) == -1) { if ((idx = find_cipher("rijndael")) == -1) { return CRYPT_NOP; @@ -137,29 +135,20 @@ int pmac_test(void) if ((err = pmac_memory(idx, tests[x].key, 16, tests[x].msg, tests[x].msglen, outtag, &len)) != CRYPT_OK) { return err; } - - if (XMEMCMP(outtag, tests[x].tag, len)) { -#if 0 - unsigned long y; - printf("\nTAG:\n"); - for (y = 0; y < len; ) { - printf("0x%02x", outtag[y]); - if (y < len-1) printf(", "); - if (!(++y % 8)) printf("\n"); - } -#endif + + if (compare_testvector(outtag, len, tests[x].tag, sizeof(tests[x].tag), "PMAC", x)) { return CRYPT_FAIL_TESTVECTOR; } - } - return CRYPT_OK; + } + return CRYPT_OK; #endif /* LTC_TEST */ } #endif /* PMAC_MODE */ - -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ + +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/mac/poly1305/poly1305.c b/libtomcrypt/src/mac/poly1305/poly1305.c new file mode 100644 index 0000000..f709f72 --- /dev/null +++ b/libtomcrypt/src/mac/poly1305/poly1305.c @@ -0,0 +1,268 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + */ + +/* The implementation is based on: + * Public Domain poly1305 from Andrew Moon + * https://github.com/floodyberry/poly1305-donna + */ + +#include "tomcrypt.h" + +#ifdef LTC_POLY1305 + +/* internal only */ +static void _poly1305_block(poly1305_state *st, const unsigned char *in, unsigned long inlen) +{ + const unsigned long hibit = (st->final) ? 0 : (1UL << 24); /* 1 << 128 */ + ulong32 r0,r1,r2,r3,r4; + ulong32 s1,s2,s3,s4; + ulong32 h0,h1,h2,h3,h4; + ulong32 tmp; + ulong64 d0,d1,d2,d3,d4; + ulong32 c; + + r0 = st->r[0]; + r1 = st->r[1]; + r2 = st->r[2]; + r3 = st->r[3]; + r4 = st->r[4]; + + s1 = r1 * 5; + s2 = r2 * 5; + s3 = r3 * 5; + s4 = r4 * 5; + + h0 = st->h[0]; + h1 = st->h[1]; + h2 = st->h[2]; + h3 = st->h[3]; + h4 = st->h[4]; + + while (inlen >= 16) { + /* h += in[i] */ + LOAD32L(tmp, in+ 0); h0 += (tmp ) & 0x3ffffff; + LOAD32L(tmp, in+ 3); h1 += (tmp >> 2) & 0x3ffffff; + LOAD32L(tmp, in+ 6); h2 += (tmp >> 4) & 0x3ffffff; + LOAD32L(tmp, in+ 9); h3 += (tmp >> 6) & 0x3ffffff; + LOAD32L(tmp, in+12); h4 += (tmp >> 8) | hibit; + + /* h *= r */ + d0 = ((ulong64)h0 * r0) + ((ulong64)h1 * s4) + ((ulong64)h2 * s3) + ((ulong64)h3 * s2) + ((ulong64)h4 * s1); + d1 = ((ulong64)h0 * r1) + ((ulong64)h1 * r0) + ((ulong64)h2 * s4) + ((ulong64)h3 * s3) + ((ulong64)h4 * s2); + d2 = ((ulong64)h0 * r2) + ((ulong64)h1 * r1) + ((ulong64)h2 * r0) + ((ulong64)h3 * s4) + ((ulong64)h4 * s3); + d3 = ((ulong64)h0 * r3) + ((ulong64)h1 * r2) + ((ulong64)h2 * r1) + ((ulong64)h3 * r0) + ((ulong64)h4 * s4); + d4 = ((ulong64)h0 * r4) + ((ulong64)h1 * r3) + ((ulong64)h2 * r2) + ((ulong64)h3 * r1) + ((ulong64)h4 * r0); + + /* (partial) h %= p */ + c = (ulong32)(d0 >> 26); h0 = (ulong32)d0 & 0x3ffffff; + d1 += c; c = (ulong32)(d1 >> 26); h1 = (ulong32)d1 & 0x3ffffff; + d2 += c; c = (ulong32)(d2 >> 26); h2 = (ulong32)d2 & 0x3ffffff; + d3 += c; c = (ulong32)(d3 >> 26); h3 = (ulong32)d3 & 0x3ffffff; + d4 += c; c = (ulong32)(d4 >> 26); h4 = (ulong32)d4 & 0x3ffffff; + h0 += c * 5; c = (h0 >> 26); h0 = h0 & 0x3ffffff; + h1 += c; + + in += 16; + inlen -= 16; + } + + st->h[0] = h0; + st->h[1] = h1; + st->h[2] = h2; + st->h[3] = h3; + st->h[4] = h4; +} + +/** + Initialize an POLY1305 context. + @param st The POLY1305 state + @param key The secret key + @param keylen The length of the secret key (octets) + @return CRYPT_OK if successful +*/ +int poly1305_init(poly1305_state *st, const unsigned char *key, unsigned long keylen) +{ + LTC_ARGCHK(st != NULL); + LTC_ARGCHK(key != NULL); + LTC_ARGCHK(keylen == 32); + + /* r &= 0xffffffc0ffffffc0ffffffc0fffffff */ + LOAD32L(st->r[0], key + 0); st->r[0] = (st->r[0] ) & 0x3ffffff; + LOAD32L(st->r[1], key + 3); st->r[1] = (st->r[1] >> 2) & 0x3ffff03; + LOAD32L(st->r[2], key + 6); st->r[2] = (st->r[2] >> 4) & 0x3ffc0ff; + LOAD32L(st->r[3], key + 9); st->r[3] = (st->r[3] >> 6) & 0x3f03fff; + LOAD32L(st->r[4], key + 12); st->r[4] = (st->r[4] >> 8) & 0x00fffff; + + /* h = 0 */ + st->h[0] = 0; + st->h[1] = 0; + st->h[2] = 0; + st->h[3] = 0; + st->h[4] = 0; + + /* save pad for later */ + LOAD32L(st->pad[0], key + 16); + LOAD32L(st->pad[1], key + 20); + LOAD32L(st->pad[2], key + 24); + LOAD32L(st->pad[3], key + 28); + + st->leftover = 0; + st->final = 0; + return CRYPT_OK; +} + +/** + Process data through POLY1305 + @param st The POLY1305 state + @param in The data to send through HMAC + @param inlen The length of the data to HMAC (octets) + @return CRYPT_OK if successful +*/ +int poly1305_process(poly1305_state *st, const unsigned char *in, unsigned long inlen) +{ + unsigned long i; + + if (inlen == 0) return CRYPT_OK; /* nothing to do */ + LTC_ARGCHK(st != NULL); + LTC_ARGCHK(in != NULL); + + /* handle leftover */ + if (st->leftover) { + unsigned long want = (16 - st->leftover); + if (want > inlen) want = inlen; + for (i = 0; i < want; i++) st->buffer[st->leftover + i] = in[i]; + inlen -= want; + in += want; + st->leftover += want; + if (st->leftover < 16) return CRYPT_OK; + _poly1305_block(st, st->buffer, 16); + st->leftover = 0; + } + + /* process full blocks */ + if (inlen >= 16) { + unsigned long want = (inlen & ~(16 - 1)); + _poly1305_block(st, in, want); + in += want; + inlen -= want; + } + + /* store leftover */ + if (inlen) { + for (i = 0; i < inlen; i++) st->buffer[st->leftover + i] = in[i]; + st->leftover += inlen; + } + return CRYPT_OK; +} + +/** + Terminate a POLY1305 session + @param st The POLY1305 state + @param mac [out] The destination of the POLY1305 authentication tag + @param maclen [in/out] The max size and resulting size of the POLY1305 authentication tag + @return CRYPT_OK if successful +*/ +int poly1305_done(poly1305_state *st, unsigned char *mac, unsigned long *maclen) +{ + ulong32 h0,h1,h2,h3,h4,c; + ulong32 g0,g1,g2,g3,g4; + ulong64 f; + ulong32 mask; + + LTC_ARGCHK(st != NULL); + LTC_ARGCHK(mac != NULL); + LTC_ARGCHK(maclen != NULL); + LTC_ARGCHK(*maclen >= 16); + + /* process the remaining block */ + if (st->leftover) { + unsigned long i = st->leftover; + st->buffer[i++] = 1; + for (; i < 16; i++) st->buffer[i] = 0; + st->final = 1; + _poly1305_block(st, st->buffer, 16); + } + + /* fully carry h */ + h0 = st->h[0]; + h1 = st->h[1]; + h2 = st->h[2]; + h3 = st->h[3]; + h4 = st->h[4]; + + c = h1 >> 26; h1 = h1 & 0x3ffffff; + h2 += c; c = h2 >> 26; h2 = h2 & 0x3ffffff; + h3 += c; c = h3 >> 26; h3 = h3 & 0x3ffffff; + h4 += c; c = h4 >> 26; h4 = h4 & 0x3ffffff; + h0 += c * 5; c = h0 >> 26; h0 = h0 & 0x3ffffff; + h1 += c; + + /* compute h + -p */ + g0 = h0 + 5; c = g0 >> 26; g0 &= 0x3ffffff; + g1 = h1 + c; c = g1 >> 26; g1 &= 0x3ffffff; + g2 = h2 + c; c = g2 >> 26; g2 &= 0x3ffffff; + g3 = h3 + c; c = g3 >> 26; g3 &= 0x3ffffff; + g4 = h4 + c - (1UL << 26); + + /* select h if h < p, or h + -p if h >= p */ + mask = (g4 >> 31) - 1; + g0 &= mask; + g1 &= mask; + g2 &= mask; + g3 &= mask; + g4 &= mask; + mask = ~mask; + h0 = (h0 & mask) | g0; + h1 = (h1 & mask) | g1; + h2 = (h2 & mask) | g2; + h3 = (h3 & mask) | g3; + h4 = (h4 & mask) | g4; + + /* h = h % (2^128) */ + h0 = ((h0 ) | (h1 << 26)) & 0xffffffff; + h1 = ((h1 >> 6) | (h2 << 20)) & 0xffffffff; + h2 = ((h2 >> 12) | (h3 << 14)) & 0xffffffff; + h3 = ((h3 >> 18) | (h4 << 8)) & 0xffffffff; + + /* mac = (h + pad) % (2^128) */ + f = (ulong64)h0 + st->pad[0] ; h0 = (ulong32)f; + f = (ulong64)h1 + st->pad[1] + (f >> 32); h1 = (ulong32)f; + f = (ulong64)h2 + st->pad[2] + (f >> 32); h2 = (ulong32)f; + f = (ulong64)h3 + st->pad[3] + (f >> 32); h3 = (ulong32)f; + + STORE32L(h0, mac + 0); + STORE32L(h1, mac + 4); + STORE32L(h2, mac + 8); + STORE32L(h3, mac + 12); + + /* zero out the state */ + st->h[0] = 0; + st->h[1] = 0; + st->h[2] = 0; + st->h[3] = 0; + st->h[4] = 0; + st->r[0] = 0; + st->r[1] = 0; + st->r[2] = 0; + st->r[3] = 0; + st->r[4] = 0; + st->pad[0] = 0; + st->pad[1] = 0; + st->pad[2] = 0; + st->pad[3] = 0; + + *maclen = 16; + return CRYPT_OK; +} + +#endif + +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/mac/poly1305/poly1305_file.c b/libtomcrypt/src/mac/poly1305/poly1305_file.c new file mode 100644 index 0000000..7726305 --- /dev/null +++ b/libtomcrypt/src/mac/poly1305/poly1305_file.c @@ -0,0 +1,88 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + */ + +/* The implementation is based on: + * Public Domain poly1305 from Andrew Moon + * https://github.com/floodyberry/poly1305-donna + */ + +#include "tomcrypt.h" + +#ifdef LTC_POLY1305 + +/** + POLY1305 a file + @param fname The name of the file you wish to POLY1305 + @param key The secret key + @param keylen The length of the secret key + @param mac [out] The POLY1305 authentication tag + @param maclen [in/out] The max size and resulting size of the authentication tag + @return CRYPT_OK if successful, CRYPT_NOP if file support has been disabled +*/ +int poly1305_file(const char *fname, const unsigned char *key, unsigned long keylen, unsigned char *mac, unsigned long *maclen) +{ +#ifdef LTC_NO_FILE + return CRYPT_NOP; +#else + poly1305_state st; + FILE *in; + unsigned char *buf; + size_t x; + int err; + + LTC_ARGCHK(fname != NULL); + LTC_ARGCHK(key != NULL); + LTC_ARGCHK(mac != NULL); + LTC_ARGCHK(maclen != NULL); + + if ((buf = XMALLOC(LTC_FILE_READ_BUFSIZE)) == NULL) { + return CRYPT_MEM; + } + + if ((err = poly1305_init(&st, key, keylen)) != CRYPT_OK) { + goto LBL_ERR; + } + + in = fopen(fname, "rb"); + if (in == NULL) { + err = CRYPT_FILE_NOTFOUND; + goto LBL_ERR; + } + + do { + x = fread(buf, 1, LTC_FILE_READ_BUFSIZE, in); + if ((err = poly1305_process(&st, buf, (unsigned long)x)) != CRYPT_OK) { + fclose(in); + goto LBL_CLEANBUF; + } + } while (x == LTC_FILE_READ_BUFSIZE); + + if (fclose(in) != 0) { + err = CRYPT_ERROR; + goto LBL_CLEANBUF; + } + + err = poly1305_done(&st, mac, maclen); + +LBL_CLEANBUF: + zeromem(buf, LTC_FILE_READ_BUFSIZE); +LBL_ERR: +#ifdef LTC_CLEAN_STACK + zeromem(&st, sizeof(poly1305_state)); +#endif + XFREE(buf); + return err; +#endif +} + +#endif + +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/mac/poly1305/poly1305_memory.c b/libtomcrypt/src/mac/poly1305/poly1305_memory.c new file mode 100644 index 0000000..a827f8d --- /dev/null +++ b/libtomcrypt/src/mac/poly1305/poly1305_memory.c @@ -0,0 +1,53 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + */ + +/* The implementation is based on: + * Public Domain poly1305 from Andrew Moon + * https://github.com/floodyberry/poly1305-donna + */ + +#include "tomcrypt.h" + +#ifdef LTC_POLY1305 + +/** + POLY1305 a block of memory to produce the authentication tag + @param key The secret key + @param keylen The length of the secret key (octets) + @param in The data to POLY1305 + @param inlen The length of the data to POLY1305 (octets) + @param mac [out] Destination of the authentication tag + @param maclen [in/out] Max size and resulting size of authentication tag + @return CRYPT_OK if successful +*/ +int poly1305_memory(const unsigned char *key, unsigned long keylen, const unsigned char *in, unsigned long inlen, unsigned char *mac, unsigned long *maclen) +{ + poly1305_state st; + int err; + + LTC_ARGCHK(key != NULL); + LTC_ARGCHK(in != NULL); + LTC_ARGCHK(mac != NULL); + LTC_ARGCHK(maclen != NULL); + + if ((err = poly1305_init(&st, key, keylen)) != CRYPT_OK) { goto LBL_ERR; } + if ((err = poly1305_process(&st, in, inlen)) != CRYPT_OK) { goto LBL_ERR; } + err = poly1305_done(&st, mac, maclen); +LBL_ERR: +#ifdef LTC_CLEAN_STACK + zeromem(&st, sizeof(poly1305_state)); +#endif + return err; +} + +#endif + +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/mac/poly1305/poly1305_memory_multi.c b/libtomcrypt/src/mac/poly1305/poly1305_memory_multi.c new file mode 100644 index 0000000..f22f255 --- /dev/null +++ b/libtomcrypt/src/mac/poly1305/poly1305_memory_multi.c @@ -0,0 +1,67 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + */ + +/* The implementation is based on: + * Public Domain poly1305 from Andrew Moon + * https://github.com/floodyberry/poly1305-donna + */ + +#include "tomcrypt.h" +#include <stdarg.h> + +#ifdef LTC_POLY1305 + +/** + POLY1305 multiple blocks of memory to produce the authentication tag + @param key The secret key + @param keylen The length of the secret key (octets) + @param mac [out] Destination of the authentication tag + @param maclen [in/out] Max size and resulting size of authentication tag + @param in The data to POLY1305 + @param inlen The length of the data to POLY1305 (octets) + @param ... tuples of (data,len) pairs to POLY1305, terminated with a (NULL,x) (x=don't care) + @return CRYPT_OK if successful +*/ +int poly1305_memory_multi(const unsigned char *key, unsigned long keylen, unsigned char *mac, unsigned long *maclen, const unsigned char *in, unsigned long inlen, ...) +{ + poly1305_state st; + int err; + va_list args; + const unsigned char *curptr; + unsigned long curlen; + + LTC_ARGCHK(key != NULL); + LTC_ARGCHK(in != NULL); + LTC_ARGCHK(mac != NULL); + LTC_ARGCHK(maclen != NULL); + + va_start(args, inlen); + curptr = in; + curlen = inlen; + if ((err = poly1305_init(&st, key, keylen)) != CRYPT_OK) { goto LBL_ERR; } + for (;;) { + if ((err = poly1305_process(&st, curptr, curlen)) != CRYPT_OK) { goto LBL_ERR; } + curptr = va_arg(args, const unsigned char*); + if (curptr == NULL) break; + curlen = va_arg(args, unsigned long); + } + err = poly1305_done(&st, mac, maclen); +LBL_ERR: +#ifdef LTC_CLEAN_STACK + zeromem(&st, sizeof(poly1305_state)); +#endif + va_end(args); + return err; +} + +#endif + +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/mac/poly1305/poly1305_test.c b/libtomcrypt/src/mac/poly1305/poly1305_test.c new file mode 100644 index 0000000..5e4535b --- /dev/null +++ b/libtomcrypt/src/mac/poly1305/poly1305_test.c @@ -0,0 +1,56 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + */ + +/* The implementation is based on: + * Public Domain poly1305 from Andrew Moon + * https://github.com/floodyberry/poly1305-donna + */ + +#include "tomcrypt.h" + +#ifdef LTC_POLY1305 + +int poly1305_test(void) +{ +#ifndef LTC_TEST + return CRYPT_NOP; +#else + /* https://tools.ietf.org/html/rfc7539#section-2.5.2 */ + unsigned char k[] = { 0x85, 0xd6, 0xbe, 0x78, 0x57, 0x55, 0x6d, 0x33, 0x7f, 0x44, 0x52, 0xfe, 0x42, 0xd5, 0x06, 0xa8, 0x01, 0x03, 0x80, 0x8a, 0xfb, 0x0d, 0xb2, 0xfd, 0x4a, 0xbf, 0xf6, 0xaf, 0x41, 0x49, 0xf5, 0x1b }; + unsigned char tag[] = { 0xA8, 0x06, 0x1D, 0xC1, 0x30, 0x51, 0x36, 0xC6, 0xC2, 0x2B, 0x8B, 0xAF, 0x0C, 0x01, 0x27, 0xA9 }; + char m[] = "Cryptographic Forum Research Group"; + unsigned long len = 16, mlen = strlen(m); + unsigned char out[1000]; + poly1305_state st; + int err; + + /* process piece by piece */ + if ((err = poly1305_init(&st, k, 32)) != CRYPT_OK) return err; + if ((err = poly1305_process(&st, (unsigned char*)m, 5)) != CRYPT_OK) return err; + if ((err = poly1305_process(&st, (unsigned char*)m + 5, 4)) != CRYPT_OK) return err; + if ((err = poly1305_process(&st, (unsigned char*)m + 9, 3)) != CRYPT_OK) return err; + if ((err = poly1305_process(&st, (unsigned char*)m + 12, 2)) != CRYPT_OK) return err; + if ((err = poly1305_process(&st, (unsigned char*)m + 14, 1)) != CRYPT_OK) return err; + if ((err = poly1305_process(&st, (unsigned char*)m + 15, mlen - 15)) != CRYPT_OK) return err; + if ((err = poly1305_done(&st, out, &len)) != CRYPT_OK) return err; + if (compare_testvector(out, len, tag, sizeof(tag), "POLY1305-TV1", 1) != 0) return CRYPT_FAIL_TESTVECTOR; + /* process in one go */ + if ((err = poly1305_init(&st, k, 32)) != CRYPT_OK) return err; + if ((err = poly1305_process(&st, (unsigned char*)m, mlen)) != CRYPT_OK) return err; + if ((err = poly1305_done(&st, out, &len)) != CRYPT_OK) return err; + if (compare_testvector(out, len, tag, sizeof(tag), "POLY1305-TV2", 1) != 0) return CRYPT_FAIL_TESTVECTOR; + return CRYPT_OK; +#endif +} + +#endif + +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/mac/xcbc/xcbc_done.c b/libtomcrypt/src/mac/xcbc/xcbc_done.c index 6640eeb..133d16f 100644 --- a/libtomcrypt/src/mac/xcbc/xcbc_done.c +++ b/libtomcrypt/src/mac/xcbc/xcbc_done.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" @@ -62,7 +60,7 @@ int xcbc_done(xcbc_state *xcbc, unsigned char *out, unsigned long *outlen) out[x] = xcbc->IV[x]; } *outlen = x; - + #ifdef LTC_CLEAN_STACK zeromem(xcbc, sizeof(*xcbc)); #endif @@ -71,7 +69,7 @@ int xcbc_done(xcbc_state *xcbc, unsigned char *out, unsigned long *outlen) #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/mac/xcbc/xcbc_file.c b/libtomcrypt/src/mac/xcbc/xcbc_file.c index 3d75b4e..f121cd0 100644 --- a/libtomcrypt/src/mac/xcbc/xcbc_file.c +++ b/libtomcrypt/src/mac/xcbc/xcbc_file.c @@ -5,12 +5,10 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" -/** +/** @file xcbc_file.c XCBC support, process a file, Tom St Denis */ @@ -27,57 +25,67 @@ @param outlen [in/out] The max size and resulting size of the authentication tag @return CRYPT_OK if successful, CRYPT_NOP if file support has been disabled */ -int xcbc_file(int cipher, +int xcbc_file(int cipher, const unsigned char *key, unsigned long keylen, - const char *filename, + const char *filename, unsigned char *out, unsigned long *outlen) { #ifdef LTC_NO_FILE return CRYPT_NOP; #else - int err, x; + size_t x; + int err; xcbc_state xcbc; FILE *in; - unsigned char buf[512]; + unsigned char *buf; LTC_ARGCHK(key != NULL); LTC_ARGCHK(filename != NULL); LTC_ARGCHK(out != NULL); LTC_ARGCHK(outlen != NULL); - in = fopen(filename, "rb"); - if (in == NULL) { - return CRYPT_FILE_NOTFOUND; + if ((buf = XMALLOC(LTC_FILE_READ_BUFSIZE)) == NULL) { + return CRYPT_MEM; } if ((err = xcbc_init(&xcbc, cipher, key, keylen)) != CRYPT_OK) { - fclose(in); - return err; + goto LBL_ERR; + } + + in = fopen(filename, "rb"); + if (in == NULL) { + err = CRYPT_FILE_NOTFOUND; + goto LBL_ERR; } do { - x = fread(buf, 1, sizeof(buf), in); - if ((err = xcbc_process(&xcbc, buf, x)) != CRYPT_OK) { + x = fread(buf, 1, LTC_FILE_READ_BUFSIZE, in); + if ((err = xcbc_process(&xcbc, buf, (unsigned long)x)) != CRYPT_OK) { fclose(in); - return err; + goto LBL_CLEANBUF; } - } while (x == sizeof(buf)); - fclose(in); + } while (x == LTC_FILE_READ_BUFSIZE); - if ((err = xcbc_done(&xcbc, out, outlen)) != CRYPT_OK) { - return err; + if (fclose(in) != 0) { + err = CRYPT_ERROR; + goto LBL_CLEANBUF; } + err = xcbc_done(&xcbc, out, outlen); + +LBL_CLEANBUF: + zeromem(buf, LTC_FILE_READ_BUFSIZE); +LBL_ERR: #ifdef LTC_CLEAN_STACK - zeromem(buf, sizeof(buf)); + zeromem(&xcbc, sizeof(xcbc_state)); #endif - - return CRYPT_OK; + XFREE(buf); + return err; #endif } #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/mac/xcbc/xcbc_init.c b/libtomcrypt/src/mac/xcbc/xcbc_init.c index 94c9d79..4eccd5e 100644 --- a/libtomcrypt/src/mac/xcbc/xcbc_init.c +++ b/libtomcrypt/src/mac/xcbc/xcbc_init.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" @@ -71,7 +69,7 @@ int xcbc_init(xcbc_state *xcbc, int cipher, const unsigned char *key, unsigned l if ((err = cipher_descriptor[cipher].setup(key, keylen, 0, skey)) != CRYPT_OK) { goto done; } - + /* make the three keys */ for (y = 0; y < 3; y++) { for (x = 0; x < cipher_descriptor[cipher].block_length; x++) { @@ -80,10 +78,10 @@ int xcbc_init(xcbc_state *xcbc, int cipher, const unsigned char *key, unsigned l cipher_descriptor[cipher].ecb_encrypt(xcbc->K[y], xcbc->K[y], skey); } } - + /* setup K1 */ err = cipher_descriptor[cipher].setup(xcbc->K[0], k1, 0, &xcbc->key); - + /* setup struct */ zeromem(xcbc->IV, cipher_descriptor[cipher].block_length); xcbc->blocksize = cipher_descriptor[cipher].block_length; @@ -91,7 +89,7 @@ int xcbc_init(xcbc_state *xcbc, int cipher, const unsigned char *key, unsigned l xcbc->buflen = 0; done: cipher_descriptor[cipher].done(skey); - if (skey != NULL) { + if (skey != NULL) { #ifdef LTC_CLEAN_STACK zeromem(skey, sizeof(*skey)); #endif @@ -102,7 +100,7 @@ done: #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/mac/xcbc/xcbc_memory.c b/libtomcrypt/src/mac/xcbc/xcbc_memory.c index 124817a..a1bc045 100644 --- a/libtomcrypt/src/mac/xcbc/xcbc_memory.c +++ b/libtomcrypt/src/mac/xcbc/xcbc_memory.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" @@ -17,7 +15,7 @@ #ifdef LTC_XCBC -/** XCBC-MAC a block of memory +/** XCBC-MAC a block of memory @param cipher Index of cipher to use @param key [in] Secret key @param keylen Length of key in octets @@ -27,7 +25,7 @@ @param outlen [in/out] Output size and final tag size Return CRYPT_OK on success. */ -int xcbc_memory(int cipher, +int xcbc_memory(int cipher, const unsigned char *key, unsigned long keylen, const unsigned char *in, unsigned long inlen, unsigned char *out, unsigned long *outlen) @@ -66,6 +64,6 @@ done: #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/mac/xcbc/xcbc_memory_multi.c b/libtomcrypt/src/mac/xcbc/xcbc_memory_multi.c index a237907..a5b9d91 100644 --- a/libtomcrypt/src/mac/xcbc/xcbc_memory_multi.c +++ b/libtomcrypt/src/mac/xcbc/xcbc_memory_multi.c @@ -5,13 +5,11 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" #include <stdarg.h> -/** +/** @file xcbc_memory_multi.c XCBC support, process multiple blocks of memory, Tom St Denis */ @@ -19,7 +17,7 @@ #ifdef LTC_XCBC /** - XCBC multiple blocks of memory + XCBC multiple blocks of memory @param cipher The index of the desired cipher @param key The secret key @param keylen The length of the secret key (octets) @@ -30,7 +28,7 @@ @param ... tuples of (data,len) pairs to XCBC, terminated with a (NULL,x) (x=don't care) @return CRYPT_OK if successful */ -int xcbc_memory_multi(int cipher, +int xcbc_memory_multi(int cipher, const unsigned char *key, unsigned long keylen, unsigned char *out, unsigned long *outlen, const unsigned char *in, unsigned long inlen, ...) @@ -57,7 +55,7 @@ int xcbc_memory_multi(int cipher, goto LBL_ERR; } va_start(args, inlen); - curptr = in; + curptr = in; curlen = inlen; for (;;) { /* process buf */ @@ -80,11 +78,11 @@ LBL_ERR: #endif XFREE(xcbc); va_end(args); - return err; + return err; } #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/mac/xcbc/xcbc_process.c b/libtomcrypt/src/mac/xcbc/xcbc_process.c index 46ab4a0..12e25c5 100644 --- a/libtomcrypt/src/mac/xcbc/xcbc_process.c +++ b/libtomcrypt/src/mac/xcbc/xcbc_process.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" @@ -47,29 +45,29 @@ int xcbc_process(xcbc_state *xcbc, const unsigned char *in, unsigned long inlen) if (xcbc->buflen == 0) { while (inlen > (unsigned long)xcbc->blocksize) { for (x = 0; x < xcbc->blocksize; x += sizeof(LTC_FAST_TYPE)) { - *((LTC_FAST_TYPE*)&(xcbc->IV[x])) ^= *((LTC_FAST_TYPE*)&(in[x])); + *(LTC_FAST_TYPE_PTR_CAST(&(xcbc->IV[x]))) ^= *(LTC_FAST_TYPE_PTR_CAST(&(in[x]))); } cipher_descriptor[xcbc->cipher].ecb_encrypt(xcbc->IV, xcbc->IV, &xcbc->key); in += xcbc->blocksize; inlen -= xcbc->blocksize; } - } + } #endif while (inlen) { - if (xcbc->buflen == xcbc->blocksize) { + if (xcbc->buflen == xcbc->blocksize) { cipher_descriptor[xcbc->cipher].ecb_encrypt(xcbc->IV, xcbc->IV, &xcbc->key); xcbc->buflen = 0; - } - xcbc->IV[xcbc->buflen++] ^= *in++; - --inlen; - } - return CRYPT_OK; + } + xcbc->IV[xcbc->buflen++] ^= *in++; + --inlen; + } + return CRYPT_OK; } #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/mac/xcbc/xcbc_test.c b/libtomcrypt/src/mac/xcbc/xcbc_test.c index 1bd5840..6a0ecdf 100644 --- a/libtomcrypt/src/mac/xcbc/xcbc_test.c +++ b/libtomcrypt/src/mac/xcbc/xcbc_test.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" @@ -31,64 +29,64 @@ int xcbc_test(void) } tests[] = { { 0, - { 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07, + { 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07, 0x08, 0x09, 0x0a, 0x0b, 0x0c, 0x0d, 0x0e, 0x0f }, { 0 }, - { 0x75, 0xf0, 0x25, 0x1d, 0x52, 0x8a, 0xc0, 0x1c, + { 0x75, 0xf0, 0x25, 0x1d, 0x52, 0x8a, 0xc0, 0x1c, 0x45, 0x73, 0xdf, 0xd5, 0x84, 0xd7, 0x9f, 0x29 } }, { 3, - { 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07, + { 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07, 0x08, 0x09, 0x0a, 0x0b, 0x0c, 0x0d, 0x0e, 0x0f }, { 0x00, 0x01, 0x02 }, - { 0x5b, 0x37, 0x65, 0x80, 0xae, 0x2f, 0x19, 0xaf, + { 0x5b, 0x37, 0x65, 0x80, 0xae, 0x2f, 0x19, 0xaf, 0xe7, 0x21, 0x9c, 0xee, 0xf1, 0x72, 0x75, 0x6f } }, { 16, - { 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07, + { 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07, 0x08, 0x09, 0x0a, 0x0b, 0x0c, 0x0d, 0x0e, 0x0f }, - { 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07, + { 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07, 0x08, 0x09, 0x0a, 0x0b, 0x0c, 0x0d, 0x0e, 0x0f }, - { 0xd2, 0xa2, 0x46, 0xfa, 0x34, 0x9b, 0x68, 0xa7, + { 0xd2, 0xa2, 0x46, 0xfa, 0x34, 0x9b, 0x68, 0xa7, 0x99, 0x98, 0xa4, 0x39, 0x4f, 0xf7, 0xa2, 0x63 } }, { 32, - { 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07, + { 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07, 0x08, 0x09, 0x0a, 0x0b, 0x0c, 0x0d, 0x0e, 0x0f }, - { 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07, - 0x08, 0x09, 0x0a, 0x0b, 0x0c, 0x0d, 0x0e, 0x0f, + { 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07, + 0x08, 0x09, 0x0a, 0x0b, 0x0c, 0x0d, 0x0e, 0x0f, 0x10, 0x11, 0x12, 0x13, 0x14, 0x15, 0x16, 0x17, 0x18, 0x19, 0x1a, 0x1b, 0x1c, 0x1d, 0x1e, 0x1f }, - { 0xf5, 0x4f, 0x0e, 0xc8, 0xd2, 0xb9, 0xf3, 0xd3, + { 0xf5, 0x4f, 0x0e, 0xc8, 0xd2, 0xb9, 0xf3, 0xd3, 0x68, 0x07, 0x73, 0x4b, 0xd5, 0x28, 0x3f, 0xd4 } }, { 34, - { 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07, + { 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07, 0x08, 0x09, 0x0a, 0x0b, 0x0c, 0x0d, 0x0e, 0x0f }, - { 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07, - 0x08, 0x09, 0x0a, 0x0b, 0x0c, 0x0d, 0x0e, 0x0f, + { 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07, + 0x08, 0x09, 0x0a, 0x0b, 0x0c, 0x0d, 0x0e, 0x0f, 0x10, 0x11, 0x12, 0x13, 0x14, 0x15, 0x16, 0x17, 0x18, 0x19, 0x1a, 0x1b, 0x1c, 0x1d, 0x1e, 0x1f, 0x20, 0x21 }, - { 0xbe, 0xcb, 0xb3, 0xbc, 0xcd, 0xb5, 0x18, 0xa3, + { 0xbe, 0xcb, 0xb3, 0xbc, 0xcd, 0xb5, 0x18, 0xa3, 0x06, 0x77, 0xd5, 0x48, 0x1f, 0xb6, 0xb4, 0xd8 }, }, @@ -99,7 +97,7 @@ int xcbc_test(void) unsigned long taglen; int err, x, idx; - /* AES can be under rijndael or aes... try to find it */ + /* AES can be under rijndael or aes... try to find it */ if ((idx = find_cipher("aes")) == -1) { if ((idx = find_cipher("rijndael")) == -1) { return CRYPT_NOP; @@ -111,7 +109,7 @@ int xcbc_test(void) if ((err = xcbc_memory(idx, tests[x].K, 16, tests[x].M, tests[x].msglen, T, &taglen)) != CRYPT_OK) { return err; } - if (taglen != 16 || XMEMCMP(T, tests[x].T, 16)) { + if (compare_testvector(T, taglen, tests[x].T, 16, "XCBC", x)) { return CRYPT_FAIL_TESTVECTOR; } } @@ -122,7 +120,7 @@ int xcbc_test(void) #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/math/fp/ltc_ecc_fp_mulmod.c b/libtomcrypt/src/math/fp/ltc_ecc_fp_mulmod.c index b9819e3..24ed019 100644 --- a/libtomcrypt/src/math/fp/ltc_ecc_fp_mulmod.c +++ b/libtomcrypt/src/math/fp/ltc_ecc_fp_mulmod.c @@ -5,15 +5,13 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" /** @file ltc_ecc_fp_mulmod.c ECC Crypto, Tom St Denis -*/ +*/ #if defined(LTC_MECC) && defined(LTC_MECC_FP) #include <limits.h> @@ -30,12 +28,12 @@ #if (FP_LUT > 12) || (FP_LUT < 2) #error FP_LUT must be between 2 and 12 inclusively -#endif +#endif /** Our FP cache */ static struct { ecc_point *g, /* cached COPY of base point */ - *LUT[1U<<FP_LUT]; /* fixed point lookup */ + *LUT[1U<<FP_LUT]; /* fixed point lookup */ void *mu; /* copy of the montgomery constant */ int lru_count; /* amount of times this entry has been used */ int lock; /* flag to indicate cache eviction permitted (0) or not (1) */ @@ -47,524 +45,524 @@ LTC_MUTEX_GLOBAL(ltc_ecc_fp_lock) static const struct { int ham, terma, termb; } lut_orders[] = { - { 0, 0, 0 }, { 1, 0, 0 }, { 1, 0, 0 }, { 2, 1, 2 }, { 1, 0, 0 }, { 2, 1, 4 }, { 2, 2, 4 }, { 3, 3, 4 }, - { 1, 0, 0 }, { 2, 1, 8 }, { 2, 2, 8 }, { 3, 3, 8 }, { 2, 4, 8 }, { 3, 5, 8 }, { 3, 6, 8 }, { 4, 7, 8 }, - { 1, 0, 0 }, { 2, 1, 16 }, { 2, 2, 16 }, { 3, 3, 16 }, { 2, 4, 16 }, { 3, 5, 16 }, { 3, 6, 16 }, { 4, 7, 16 }, - { 2, 8, 16 }, { 3, 9, 16 }, { 3, 10, 16 }, { 4, 11, 16 }, { 3, 12, 16 }, { 4, 13, 16 }, { 4, 14, 16 }, { 5, 15, 16 }, - { 1, 0, 0 }, { 2, 1, 32 }, { 2, 2, 32 }, { 3, 3, 32 }, { 2, 4, 32 }, { 3, 5, 32 }, { 3, 6, 32 }, { 4, 7, 32 }, - { 2, 8, 32 }, { 3, 9, 32 }, { 3, 10, 32 }, { 4, 11, 32 }, { 3, 12, 32 }, { 4, 13, 32 }, { 4, 14, 32 }, { 5, 15, 32 }, - { 2, 16, 32 }, { 3, 17, 32 }, { 3, 18, 32 }, { 4, 19, 32 }, { 3, 20, 32 }, { 4, 21, 32 }, { 4, 22, 32 }, { 5, 23, 32 }, - { 3, 24, 32 }, { 4, 25, 32 }, { 4, 26, 32 }, { 5, 27, 32 }, { 4, 28, 32 }, { 5, 29, 32 }, { 5, 30, 32 }, { 6, 31, 32 }, + { 0, 0, 0 }, { 1, 0, 0 }, { 1, 0, 0 }, { 2, 1, 2 }, { 1, 0, 0 }, { 2, 1, 4 }, { 2, 2, 4 }, { 3, 3, 4 }, + { 1, 0, 0 }, { 2, 1, 8 }, { 2, 2, 8 }, { 3, 3, 8 }, { 2, 4, 8 }, { 3, 5, 8 }, { 3, 6, 8 }, { 4, 7, 8 }, + { 1, 0, 0 }, { 2, 1, 16 }, { 2, 2, 16 }, { 3, 3, 16 }, { 2, 4, 16 }, { 3, 5, 16 }, { 3, 6, 16 }, { 4, 7, 16 }, + { 2, 8, 16 }, { 3, 9, 16 }, { 3, 10, 16 }, { 4, 11, 16 }, { 3, 12, 16 }, { 4, 13, 16 }, { 4, 14, 16 }, { 5, 15, 16 }, + { 1, 0, 0 }, { 2, 1, 32 }, { 2, 2, 32 }, { 3, 3, 32 }, { 2, 4, 32 }, { 3, 5, 32 }, { 3, 6, 32 }, { 4, 7, 32 }, + { 2, 8, 32 }, { 3, 9, 32 }, { 3, 10, 32 }, { 4, 11, 32 }, { 3, 12, 32 }, { 4, 13, 32 }, { 4, 14, 32 }, { 5, 15, 32 }, + { 2, 16, 32 }, { 3, 17, 32 }, { 3, 18, 32 }, { 4, 19, 32 }, { 3, 20, 32 }, { 4, 21, 32 }, { 4, 22, 32 }, { 5, 23, 32 }, + { 3, 24, 32 }, { 4, 25, 32 }, { 4, 26, 32 }, { 5, 27, 32 }, { 4, 28, 32 }, { 5, 29, 32 }, { 5, 30, 32 }, { 6, 31, 32 }, #if FP_LUT > 6 - { 1, 0, 0 }, { 2, 1, 64 }, { 2, 2, 64 }, { 3, 3, 64 }, { 2, 4, 64 }, { 3, 5, 64 }, { 3, 6, 64 }, { 4, 7, 64 }, - { 2, 8, 64 }, { 3, 9, 64 }, { 3, 10, 64 }, { 4, 11, 64 }, { 3, 12, 64 }, { 4, 13, 64 }, { 4, 14, 64 }, { 5, 15, 64 }, - { 2, 16, 64 }, { 3, 17, 64 }, { 3, 18, 64 }, { 4, 19, 64 }, { 3, 20, 64 }, { 4, 21, 64 }, { 4, 22, 64 }, { 5, 23, 64 }, - { 3, 24, 64 }, { 4, 25, 64 }, { 4, 26, 64 }, { 5, 27, 64 }, { 4, 28, 64 }, { 5, 29, 64 }, { 5, 30, 64 }, { 6, 31, 64 }, - { 2, 32, 64 }, { 3, 33, 64 }, { 3, 34, 64 }, { 4, 35, 64 }, { 3, 36, 64 }, { 4, 37, 64 }, { 4, 38, 64 }, { 5, 39, 64 }, - { 3, 40, 64 }, { 4, 41, 64 }, { 4, 42, 64 }, { 5, 43, 64 }, { 4, 44, 64 }, { 5, 45, 64 }, { 5, 46, 64 }, { 6, 47, 64 }, - { 3, 48, 64 }, { 4, 49, 64 }, { 4, 50, 64 }, { 5, 51, 64 }, { 4, 52, 64 }, { 5, 53, 64 }, { 5, 54, 64 }, { 6, 55, 64 }, - { 4, 56, 64 }, { 5, 57, 64 }, { 5, 58, 64 }, { 6, 59, 64 }, { 5, 60, 64 }, { 6, 61, 64 }, { 6, 62, 64 }, { 7, 63, 64 }, + { 1, 0, 0 }, { 2, 1, 64 }, { 2, 2, 64 }, { 3, 3, 64 }, { 2, 4, 64 }, { 3, 5, 64 }, { 3, 6, 64 }, { 4, 7, 64 }, + { 2, 8, 64 }, { 3, 9, 64 }, { 3, 10, 64 }, { 4, 11, 64 }, { 3, 12, 64 }, { 4, 13, 64 }, { 4, 14, 64 }, { 5, 15, 64 }, + { 2, 16, 64 }, { 3, 17, 64 }, { 3, 18, 64 }, { 4, 19, 64 }, { 3, 20, 64 }, { 4, 21, 64 }, { 4, 22, 64 }, { 5, 23, 64 }, + { 3, 24, 64 }, { 4, 25, 64 }, { 4, 26, 64 }, { 5, 27, 64 }, { 4, 28, 64 }, { 5, 29, 64 }, { 5, 30, 64 }, { 6, 31, 64 }, + { 2, 32, 64 }, { 3, 33, 64 }, { 3, 34, 64 }, { 4, 35, 64 }, { 3, 36, 64 }, { 4, 37, 64 }, { 4, 38, 64 }, { 5, 39, 64 }, + { 3, 40, 64 }, { 4, 41, 64 }, { 4, 42, 64 }, { 5, 43, 64 }, { 4, 44, 64 }, { 5, 45, 64 }, { 5, 46, 64 }, { 6, 47, 64 }, + { 3, 48, 64 }, { 4, 49, 64 }, { 4, 50, 64 }, { 5, 51, 64 }, { 4, 52, 64 }, { 5, 53, 64 }, { 5, 54, 64 }, { 6, 55, 64 }, + { 4, 56, 64 }, { 5, 57, 64 }, { 5, 58, 64 }, { 6, 59, 64 }, { 5, 60, 64 }, { 6, 61, 64 }, { 6, 62, 64 }, { 7, 63, 64 }, #if FP_LUT > 7 - { 1, 0, 0 }, { 2, 1, 128 }, { 2, 2, 128 }, { 3, 3, 128 }, { 2, 4, 128 }, { 3, 5, 128 }, { 3, 6, 128 }, { 4, 7, 128 }, - { 2, 8, 128 }, { 3, 9, 128 }, { 3, 10, 128 }, { 4, 11, 128 }, { 3, 12, 128 }, { 4, 13, 128 }, { 4, 14, 128 }, { 5, 15, 128 }, - { 2, 16, 128 }, { 3, 17, 128 }, { 3, 18, 128 }, { 4, 19, 128 }, { 3, 20, 128 }, { 4, 21, 128 }, { 4, 22, 128 }, { 5, 23, 128 }, - { 3, 24, 128 }, { 4, 25, 128 }, { 4, 26, 128 }, { 5, 27, 128 }, { 4, 28, 128 }, { 5, 29, 128 }, { 5, 30, 128 }, { 6, 31, 128 }, - { 2, 32, 128 }, { 3, 33, 128 }, { 3, 34, 128 }, { 4, 35, 128 }, { 3, 36, 128 }, { 4, 37, 128 }, { 4, 38, 128 }, { 5, 39, 128 }, - { 3, 40, 128 }, { 4, 41, 128 }, { 4, 42, 128 }, { 5, 43, 128 }, { 4, 44, 128 }, { 5, 45, 128 }, { 5, 46, 128 }, { 6, 47, 128 }, - { 3, 48, 128 }, { 4, 49, 128 }, { 4, 50, 128 }, { 5, 51, 128 }, { 4, 52, 128 }, { 5, 53, 128 }, { 5, 54, 128 }, { 6, 55, 128 }, - { 4, 56, 128 }, { 5, 57, 128 }, { 5, 58, 128 }, { 6, 59, 128 }, { 5, 60, 128 }, { 6, 61, 128 }, { 6, 62, 128 }, { 7, 63, 128 }, - { 2, 64, 128 }, { 3, 65, 128 }, { 3, 66, 128 }, { 4, 67, 128 }, { 3, 68, 128 }, { 4, 69, 128 }, { 4, 70, 128 }, { 5, 71, 128 }, - { 3, 72, 128 }, { 4, 73, 128 }, { 4, 74, 128 }, { 5, 75, 128 }, { 4, 76, 128 }, { 5, 77, 128 }, { 5, 78, 128 }, { 6, 79, 128 }, - { 3, 80, 128 }, { 4, 81, 128 }, { 4, 82, 128 }, { 5, 83, 128 }, { 4, 84, 128 }, { 5, 85, 128 }, { 5, 86, 128 }, { 6, 87, 128 }, - { 4, 88, 128 }, { 5, 89, 128 }, { 5, 90, 128 }, { 6, 91, 128 }, { 5, 92, 128 }, { 6, 93, 128 }, { 6, 94, 128 }, { 7, 95, 128 }, - { 3, 96, 128 }, { 4, 97, 128 }, { 4, 98, 128 }, { 5, 99, 128 }, { 4, 100, 128 }, { 5, 101, 128 }, { 5, 102, 128 }, { 6, 103, 128 }, - { 4, 104, 128 }, { 5, 105, 128 }, { 5, 106, 128 }, { 6, 107, 128 }, { 5, 108, 128 }, { 6, 109, 128 }, { 6, 110, 128 }, { 7, 111, 128 }, - { 4, 112, 128 }, { 5, 113, 128 }, { 5, 114, 128 }, { 6, 115, 128 }, { 5, 116, 128 }, { 6, 117, 128 }, { 6, 118, 128 }, { 7, 119, 128 }, - { 5, 120, 128 }, { 6, 121, 128 }, { 6, 122, 128 }, { 7, 123, 128 }, { 6, 124, 128 }, { 7, 125, 128 }, { 7, 126, 128 }, { 8, 127, 128 }, + { 1, 0, 0 }, { 2, 1, 128 }, { 2, 2, 128 }, { 3, 3, 128 }, { 2, 4, 128 }, { 3, 5, 128 }, { 3, 6, 128 }, { 4, 7, 128 }, + { 2, 8, 128 }, { 3, 9, 128 }, { 3, 10, 128 }, { 4, 11, 128 }, { 3, 12, 128 }, { 4, 13, 128 }, { 4, 14, 128 }, { 5, 15, 128 }, + { 2, 16, 128 }, { 3, 17, 128 }, { 3, 18, 128 }, { 4, 19, 128 }, { 3, 20, 128 }, { 4, 21, 128 }, { 4, 22, 128 }, { 5, 23, 128 }, + { 3, 24, 128 }, { 4, 25, 128 }, { 4, 26, 128 }, { 5, 27, 128 }, { 4, 28, 128 }, { 5, 29, 128 }, { 5, 30, 128 }, { 6, 31, 128 }, + { 2, 32, 128 }, { 3, 33, 128 }, { 3, 34, 128 }, { 4, 35, 128 }, { 3, 36, 128 }, { 4, 37, 128 }, { 4, 38, 128 }, { 5, 39, 128 }, + { 3, 40, 128 }, { 4, 41, 128 }, { 4, 42, 128 }, { 5, 43, 128 }, { 4, 44, 128 }, { 5, 45, 128 }, { 5, 46, 128 }, { 6, 47, 128 }, + { 3, 48, 128 }, { 4, 49, 128 }, { 4, 50, 128 }, { 5, 51, 128 }, { 4, 52, 128 }, { 5, 53, 128 }, { 5, 54, 128 }, { 6, 55, 128 }, + { 4, 56, 128 }, { 5, 57, 128 }, { 5, 58, 128 }, { 6, 59, 128 }, { 5, 60, 128 }, { 6, 61, 128 }, { 6, 62, 128 }, { 7, 63, 128 }, + { 2, 64, 128 }, { 3, 65, 128 }, { 3, 66, 128 }, { 4, 67, 128 }, { 3, 68, 128 }, { 4, 69, 128 }, { 4, 70, 128 }, { 5, 71, 128 }, + { 3, 72, 128 }, { 4, 73, 128 }, { 4, 74, 128 }, { 5, 75, 128 }, { 4, 76, 128 }, { 5, 77, 128 }, { 5, 78, 128 }, { 6, 79, 128 }, + { 3, 80, 128 }, { 4, 81, 128 }, { 4, 82, 128 }, { 5, 83, 128 }, { 4, 84, 128 }, { 5, 85, 128 }, { 5, 86, 128 }, { 6, 87, 128 }, + { 4, 88, 128 }, { 5, 89, 128 }, { 5, 90, 128 }, { 6, 91, 128 }, { 5, 92, 128 }, { 6, 93, 128 }, { 6, 94, 128 }, { 7, 95, 128 }, + { 3, 96, 128 }, { 4, 97, 128 }, { 4, 98, 128 }, { 5, 99, 128 }, { 4, 100, 128 }, { 5, 101, 128 }, { 5, 102, 128 }, { 6, 103, 128 }, + { 4, 104, 128 }, { 5, 105, 128 }, { 5, 106, 128 }, { 6, 107, 128 }, { 5, 108, 128 }, { 6, 109, 128 }, { 6, 110, 128 }, { 7, 111, 128 }, + { 4, 112, 128 }, { 5, 113, 128 }, { 5, 114, 128 }, { 6, 115, 128 }, { 5, 116, 128 }, { 6, 117, 128 }, { 6, 118, 128 }, { 7, 119, 128 }, + { 5, 120, 128 }, { 6, 121, 128 }, { 6, 122, 128 }, { 7, 123, 128 }, { 6, 124, 128 }, { 7, 125, 128 }, { 7, 126, 128 }, { 8, 127, 128 }, #if FP_LUT > 8 - { 1, 0, 0 }, { 2, 1, 256 }, { 2, 2, 256 }, { 3, 3, 256 }, { 2, 4, 256 }, { 3, 5, 256 }, { 3, 6, 256 }, { 4, 7, 256 }, - { 2, 8, 256 }, { 3, 9, 256 }, { 3, 10, 256 }, { 4, 11, 256 }, { 3, 12, 256 }, { 4, 13, 256 }, { 4, 14, 256 }, { 5, 15, 256 }, - { 2, 16, 256 }, { 3, 17, 256 }, { 3, 18, 256 }, { 4, 19, 256 }, { 3, 20, 256 }, { 4, 21, 256 }, { 4, 22, 256 }, { 5, 23, 256 }, - { 3, 24, 256 }, { 4, 25, 256 }, { 4, 26, 256 }, { 5, 27, 256 }, { 4, 28, 256 }, { 5, 29, 256 }, { 5, 30, 256 }, { 6, 31, 256 }, - { 2, 32, 256 }, { 3, 33, 256 }, { 3, 34, 256 }, { 4, 35, 256 }, { 3, 36, 256 }, { 4, 37, 256 }, { 4, 38, 256 }, { 5, 39, 256 }, - { 3, 40, 256 }, { 4, 41, 256 }, { 4, 42, 256 }, { 5, 43, 256 }, { 4, 44, 256 }, { 5, 45, 256 }, { 5, 46, 256 }, { 6, 47, 256 }, - { 3, 48, 256 }, { 4, 49, 256 }, { 4, 50, 256 }, { 5, 51, 256 }, { 4, 52, 256 }, { 5, 53, 256 }, { 5, 54, 256 }, { 6, 55, 256 }, - { 4, 56, 256 }, { 5, 57, 256 }, { 5, 58, 256 }, { 6, 59, 256 }, { 5, 60, 256 }, { 6, 61, 256 }, { 6, 62, 256 }, { 7, 63, 256 }, - { 2, 64, 256 }, { 3, 65, 256 }, { 3, 66, 256 }, { 4, 67, 256 }, { 3, 68, 256 }, { 4, 69, 256 }, { 4, 70, 256 }, { 5, 71, 256 }, - { 3, 72, 256 }, { 4, 73, 256 }, { 4, 74, 256 }, { 5, 75, 256 }, { 4, 76, 256 }, { 5, 77, 256 }, { 5, 78, 256 }, { 6, 79, 256 }, - { 3, 80, 256 }, { 4, 81, 256 }, { 4, 82, 256 }, { 5, 83, 256 }, { 4, 84, 256 }, { 5, 85, 256 }, { 5, 86, 256 }, { 6, 87, 256 }, - { 4, 88, 256 }, { 5, 89, 256 }, { 5, 90, 256 }, { 6, 91, 256 }, { 5, 92, 256 }, { 6, 93, 256 }, { 6, 94, 256 }, { 7, 95, 256 }, - { 3, 96, 256 }, { 4, 97, 256 }, { 4, 98, 256 }, { 5, 99, 256 }, { 4, 100, 256 }, { 5, 101, 256 }, { 5, 102, 256 }, { 6, 103, 256 }, - { 4, 104, 256 }, { 5, 105, 256 }, { 5, 106, 256 }, { 6, 107, 256 }, { 5, 108, 256 }, { 6, 109, 256 }, { 6, 110, 256 }, { 7, 111, 256 }, - { 4, 112, 256 }, { 5, 113, 256 }, { 5, 114, 256 }, { 6, 115, 256 }, { 5, 116, 256 }, { 6, 117, 256 }, { 6, 118, 256 }, { 7, 119, 256 }, - { 5, 120, 256 }, { 6, 121, 256 }, { 6, 122, 256 }, { 7, 123, 256 }, { 6, 124, 256 }, { 7, 125, 256 }, { 7, 126, 256 }, { 8, 127, 256 }, - { 2, 128, 256 }, { 3, 129, 256 }, { 3, 130, 256 }, { 4, 131, 256 }, { 3, 132, 256 }, { 4, 133, 256 }, { 4, 134, 256 }, { 5, 135, 256 }, - { 3, 136, 256 }, { 4, 137, 256 }, { 4, 138, 256 }, { 5, 139, 256 }, { 4, 140, 256 }, { 5, 141, 256 }, { 5, 142, 256 }, { 6, 143, 256 }, - { 3, 144, 256 }, { 4, 145, 256 }, { 4, 146, 256 }, { 5, 147, 256 }, { 4, 148, 256 }, { 5, 149, 256 }, { 5, 150, 256 }, { 6, 151, 256 }, - { 4, 152, 256 }, { 5, 153, 256 }, { 5, 154, 256 }, { 6, 155, 256 }, { 5, 156, 256 }, { 6, 157, 256 }, { 6, 158, 256 }, { 7, 159, 256 }, - { 3, 160, 256 }, { 4, 161, 256 }, { 4, 162, 256 }, { 5, 163, 256 }, { 4, 164, 256 }, { 5, 165, 256 }, { 5, 166, 256 }, { 6, 167, 256 }, - { 4, 168, 256 }, { 5, 169, 256 }, { 5, 170, 256 }, { 6, 171, 256 }, { 5, 172, 256 }, { 6, 173, 256 }, { 6, 174, 256 }, { 7, 175, 256 }, - { 4, 176, 256 }, { 5, 177, 256 }, { 5, 178, 256 }, { 6, 179, 256 }, { 5, 180, 256 }, { 6, 181, 256 }, { 6, 182, 256 }, { 7, 183, 256 }, - { 5, 184, 256 }, { 6, 185, 256 }, { 6, 186, 256 }, { 7, 187, 256 }, { 6, 188, 256 }, { 7, 189, 256 }, { 7, 190, 256 }, { 8, 191, 256 }, - { 3, 192, 256 }, { 4, 193, 256 }, { 4, 194, 256 }, { 5, 195, 256 }, { 4, 196, 256 }, { 5, 197, 256 }, { 5, 198, 256 }, { 6, 199, 256 }, - { 4, 200, 256 }, { 5, 201, 256 }, { 5, 202, 256 }, { 6, 203, 256 }, { 5, 204, 256 }, { 6, 205, 256 }, { 6, 206, 256 }, { 7, 207, 256 }, - { 4, 208, 256 }, { 5, 209, 256 }, { 5, 210, 256 }, { 6, 211, 256 }, { 5, 212, 256 }, { 6, 213, 256 }, { 6, 214, 256 }, { 7, 215, 256 }, - { 5, 216, 256 }, { 6, 217, 256 }, { 6, 218, 256 }, { 7, 219, 256 }, { 6, 220, 256 }, { 7, 221, 256 }, { 7, 222, 256 }, { 8, 223, 256 }, - { 4, 224, 256 }, { 5, 225, 256 }, { 5, 226, 256 }, { 6, 227, 256 }, { 5, 228, 256 }, { 6, 229, 256 }, { 6, 230, 256 }, { 7, 231, 256 }, - { 5, 232, 256 }, { 6, 233, 256 }, { 6, 234, 256 }, { 7, 235, 256 }, { 6, 236, 256 }, { 7, 237, 256 }, { 7, 238, 256 }, { 8, 239, 256 }, - { 5, 240, 256 }, { 6, 241, 256 }, { 6, 242, 256 }, { 7, 243, 256 }, { 6, 244, 256 }, { 7, 245, 256 }, { 7, 246, 256 }, { 8, 247, 256 }, - { 6, 248, 256 }, { 7, 249, 256 }, { 7, 250, 256 }, { 8, 251, 256 }, { 7, 252, 256 }, { 8, 253, 256 }, { 8, 254, 256 }, { 9, 255, 256 }, + { 1, 0, 0 }, { 2, 1, 256 }, { 2, 2, 256 }, { 3, 3, 256 }, { 2, 4, 256 }, { 3, 5, 256 }, { 3, 6, 256 }, { 4, 7, 256 }, + { 2, 8, 256 }, { 3, 9, 256 }, { 3, 10, 256 }, { 4, 11, 256 }, { 3, 12, 256 }, { 4, 13, 256 }, { 4, 14, 256 }, { 5, 15, 256 }, + { 2, 16, 256 }, { 3, 17, 256 }, { 3, 18, 256 }, { 4, 19, 256 }, { 3, 20, 256 }, { 4, 21, 256 }, { 4, 22, 256 }, { 5, 23, 256 }, + { 3, 24, 256 }, { 4, 25, 256 }, { 4, 26, 256 }, { 5, 27, 256 }, { 4, 28, 256 }, { 5, 29, 256 }, { 5, 30, 256 }, { 6, 31, 256 }, + { 2, 32, 256 }, { 3, 33, 256 }, { 3, 34, 256 }, { 4, 35, 256 }, { 3, 36, 256 }, { 4, 37, 256 }, { 4, 38, 256 }, { 5, 39, 256 }, + { 3, 40, 256 }, { 4, 41, 256 }, { 4, 42, 256 }, { 5, 43, 256 }, { 4, 44, 256 }, { 5, 45, 256 }, { 5, 46, 256 }, { 6, 47, 256 }, + { 3, 48, 256 }, { 4, 49, 256 }, { 4, 50, 256 }, { 5, 51, 256 }, { 4, 52, 256 }, { 5, 53, 256 }, { 5, 54, 256 }, { 6, 55, 256 }, + { 4, 56, 256 }, { 5, 57, 256 }, { 5, 58, 256 }, { 6, 59, 256 }, { 5, 60, 256 }, { 6, 61, 256 }, { 6, 62, 256 }, { 7, 63, 256 }, + { 2, 64, 256 }, { 3, 65, 256 }, { 3, 66, 256 }, { 4, 67, 256 }, { 3, 68, 256 }, { 4, 69, 256 }, { 4, 70, 256 }, { 5, 71, 256 }, + { 3, 72, 256 }, { 4, 73, 256 }, { 4, 74, 256 }, { 5, 75, 256 }, { 4, 76, 256 }, { 5, 77, 256 }, { 5, 78, 256 }, { 6, 79, 256 }, + { 3, 80, 256 }, { 4, 81, 256 }, { 4, 82, 256 }, { 5, 83, 256 }, { 4, 84, 256 }, { 5, 85, 256 }, { 5, 86, 256 }, { 6, 87, 256 }, + { 4, 88, 256 }, { 5, 89, 256 }, { 5, 90, 256 }, { 6, 91, 256 }, { 5, 92, 256 }, { 6, 93, 256 }, { 6, 94, 256 }, { 7, 95, 256 }, + { 3, 96, 256 }, { 4, 97, 256 }, { 4, 98, 256 }, { 5, 99, 256 }, { 4, 100, 256 }, { 5, 101, 256 }, { 5, 102, 256 }, { 6, 103, 256 }, + { 4, 104, 256 }, { 5, 105, 256 }, { 5, 106, 256 }, { 6, 107, 256 }, { 5, 108, 256 }, { 6, 109, 256 }, { 6, 110, 256 }, { 7, 111, 256 }, + { 4, 112, 256 }, { 5, 113, 256 }, { 5, 114, 256 }, { 6, 115, 256 }, { 5, 116, 256 }, { 6, 117, 256 }, { 6, 118, 256 }, { 7, 119, 256 }, + { 5, 120, 256 }, { 6, 121, 256 }, { 6, 122, 256 }, { 7, 123, 256 }, { 6, 124, 256 }, { 7, 125, 256 }, { 7, 126, 256 }, { 8, 127, 256 }, + { 2, 128, 256 }, { 3, 129, 256 }, { 3, 130, 256 }, { 4, 131, 256 }, { 3, 132, 256 }, { 4, 133, 256 }, { 4, 134, 256 }, { 5, 135, 256 }, + { 3, 136, 256 }, { 4, 137, 256 }, { 4, 138, 256 }, { 5, 139, 256 }, { 4, 140, 256 }, { 5, 141, 256 }, { 5, 142, 256 }, { 6, 143, 256 }, + { 3, 144, 256 }, { 4, 145, 256 }, { 4, 146, 256 }, { 5, 147, 256 }, { 4, 148, 256 }, { 5, 149, 256 }, { 5, 150, 256 }, { 6, 151, 256 }, + { 4, 152, 256 }, { 5, 153, 256 }, { 5, 154, 256 }, { 6, 155, 256 }, { 5, 156, 256 }, { 6, 157, 256 }, { 6, 158, 256 }, { 7, 159, 256 }, + { 3, 160, 256 }, { 4, 161, 256 }, { 4, 162, 256 }, { 5, 163, 256 }, { 4, 164, 256 }, { 5, 165, 256 }, { 5, 166, 256 }, { 6, 167, 256 }, + { 4, 168, 256 }, { 5, 169, 256 }, { 5, 170, 256 }, { 6, 171, 256 }, { 5, 172, 256 }, { 6, 173, 256 }, { 6, 174, 256 }, { 7, 175, 256 }, + { 4, 176, 256 }, { 5, 177, 256 }, { 5, 178, 256 }, { 6, 179, 256 }, { 5, 180, 256 }, { 6, 181, 256 }, { 6, 182, 256 }, { 7, 183, 256 }, + { 5, 184, 256 }, { 6, 185, 256 }, { 6, 186, 256 }, { 7, 187, 256 }, { 6, 188, 256 }, { 7, 189, 256 }, { 7, 190, 256 }, { 8, 191, 256 }, + { 3, 192, 256 }, { 4, 193, 256 }, { 4, 194, 256 }, { 5, 195, 256 }, { 4, 196, 256 }, { 5, 197, 256 }, { 5, 198, 256 }, { 6, 199, 256 }, + { 4, 200, 256 }, { 5, 201, 256 }, { 5, 202, 256 }, { 6, 203, 256 }, { 5, 204, 256 }, { 6, 205, 256 }, { 6, 206, 256 }, { 7, 207, 256 }, + { 4, 208, 256 }, { 5, 209, 256 }, { 5, 210, 256 }, { 6, 211, 256 }, { 5, 212, 256 }, { 6, 213, 256 }, { 6, 214, 256 }, { 7, 215, 256 }, + { 5, 216, 256 }, { 6, 217, 256 }, { 6, 218, 256 }, { 7, 219, 256 }, { 6, 220, 256 }, { 7, 221, 256 }, { 7, 222, 256 }, { 8, 223, 256 }, + { 4, 224, 256 }, { 5, 225, 256 }, { 5, 226, 256 }, { 6, 227, 256 }, { 5, 228, 256 }, { 6, 229, 256 }, { 6, 230, 256 }, { 7, 231, 256 }, + { 5, 232, 256 }, { 6, 233, 256 }, { 6, 234, 256 }, { 7, 235, 256 }, { 6, 236, 256 }, { 7, 237, 256 }, { 7, 238, 256 }, { 8, 239, 256 }, + { 5, 240, 256 }, { 6, 241, 256 }, { 6, 242, 256 }, { 7, 243, 256 }, { 6, 244, 256 }, { 7, 245, 256 }, { 7, 246, 256 }, { 8, 247, 256 }, + { 6, 248, 256 }, { 7, 249, 256 }, { 7, 250, 256 }, { 8, 251, 256 }, { 7, 252, 256 }, { 8, 253, 256 }, { 8, 254, 256 }, { 9, 255, 256 }, #if FP_LUT > 9 - { 1, 0, 0 }, { 2, 1, 512 }, { 2, 2, 512 }, { 3, 3, 512 }, { 2, 4, 512 }, { 3, 5, 512 }, { 3, 6, 512 }, { 4, 7, 512 }, - { 2, 8, 512 }, { 3, 9, 512 }, { 3, 10, 512 }, { 4, 11, 512 }, { 3, 12, 512 }, { 4, 13, 512 }, { 4, 14, 512 }, { 5, 15, 512 }, - { 2, 16, 512 }, { 3, 17, 512 }, { 3, 18, 512 }, { 4, 19, 512 }, { 3, 20, 512 }, { 4, 21, 512 }, { 4, 22, 512 }, { 5, 23, 512 }, - { 3, 24, 512 }, { 4, 25, 512 }, { 4, 26, 512 }, { 5, 27, 512 }, { 4, 28, 512 }, { 5, 29, 512 }, { 5, 30, 512 }, { 6, 31, 512 }, - { 2, 32, 512 }, { 3, 33, 512 }, { 3, 34, 512 }, { 4, 35, 512 }, { 3, 36, 512 }, { 4, 37, 512 }, { 4, 38, 512 }, { 5, 39, 512 }, - { 3, 40, 512 }, { 4, 41, 512 }, { 4, 42, 512 }, { 5, 43, 512 }, { 4, 44, 512 }, { 5, 45, 512 }, { 5, 46, 512 }, { 6, 47, 512 }, - { 3, 48, 512 }, { 4, 49, 512 }, { 4, 50, 512 }, { 5, 51, 512 }, { 4, 52, 512 }, { 5, 53, 512 }, { 5, 54, 512 }, { 6, 55, 512 }, - { 4, 56, 512 }, { 5, 57, 512 }, { 5, 58, 512 }, { 6, 59, 512 }, { 5, 60, 512 }, { 6, 61, 512 }, { 6, 62, 512 }, { 7, 63, 512 }, - { 2, 64, 512 }, { 3, 65, 512 }, { 3, 66, 512 }, { 4, 67, 512 }, { 3, 68, 512 }, { 4, 69, 512 }, { 4, 70, 512 }, { 5, 71, 512 }, - { 3, 72, 512 }, { 4, 73, 512 }, { 4, 74, 512 }, { 5, 75, 512 }, { 4, 76, 512 }, { 5, 77, 512 }, { 5, 78, 512 }, { 6, 79, 512 }, - { 3, 80, 512 }, { 4, 81, 512 }, { 4, 82, 512 }, { 5, 83, 512 }, { 4, 84, 512 }, { 5, 85, 512 }, { 5, 86, 512 }, { 6, 87, 512 }, - { 4, 88, 512 }, { 5, 89, 512 }, { 5, 90, 512 }, { 6, 91, 512 }, { 5, 92, 512 }, { 6, 93, 512 }, { 6, 94, 512 }, { 7, 95, 512 }, - { 3, 96, 512 }, { 4, 97, 512 }, { 4, 98, 512 }, { 5, 99, 512 }, { 4, 100, 512 }, { 5, 101, 512 }, { 5, 102, 512 }, { 6, 103, 512 }, - { 4, 104, 512 }, { 5, 105, 512 }, { 5, 106, 512 }, { 6, 107, 512 }, { 5, 108, 512 }, { 6, 109, 512 }, { 6, 110, 512 }, { 7, 111, 512 }, - { 4, 112, 512 }, { 5, 113, 512 }, { 5, 114, 512 }, { 6, 115, 512 }, { 5, 116, 512 }, { 6, 117, 512 }, { 6, 118, 512 }, { 7, 119, 512 }, - { 5, 120, 512 }, { 6, 121, 512 }, { 6, 122, 512 }, { 7, 123, 512 }, { 6, 124, 512 }, { 7, 125, 512 }, { 7, 126, 512 }, { 8, 127, 512 }, - { 2, 128, 512 }, { 3, 129, 512 }, { 3, 130, 512 }, { 4, 131, 512 }, { 3, 132, 512 }, { 4, 133, 512 }, { 4, 134, 512 }, { 5, 135, 512 }, - { 3, 136, 512 }, { 4, 137, 512 }, { 4, 138, 512 }, { 5, 139, 512 }, { 4, 140, 512 }, { 5, 141, 512 }, { 5, 142, 512 }, { 6, 143, 512 }, - { 3, 144, 512 }, { 4, 145, 512 }, { 4, 146, 512 }, { 5, 147, 512 }, { 4, 148, 512 }, { 5, 149, 512 }, { 5, 150, 512 }, { 6, 151, 512 }, - { 4, 152, 512 }, { 5, 153, 512 }, { 5, 154, 512 }, { 6, 155, 512 }, { 5, 156, 512 }, { 6, 157, 512 }, { 6, 158, 512 }, { 7, 159, 512 }, - { 3, 160, 512 }, { 4, 161, 512 }, { 4, 162, 512 }, { 5, 163, 512 }, { 4, 164, 512 }, { 5, 165, 512 }, { 5, 166, 512 }, { 6, 167, 512 }, - { 4, 168, 512 }, { 5, 169, 512 }, { 5, 170, 512 }, { 6, 171, 512 }, { 5, 172, 512 }, { 6, 173, 512 }, { 6, 174, 512 }, { 7, 175, 512 }, - { 4, 176, 512 }, { 5, 177, 512 }, { 5, 178, 512 }, { 6, 179, 512 }, { 5, 180, 512 }, { 6, 181, 512 }, { 6, 182, 512 }, { 7, 183, 512 }, - { 5, 184, 512 }, { 6, 185, 512 }, { 6, 186, 512 }, { 7, 187, 512 }, { 6, 188, 512 }, { 7, 189, 512 }, { 7, 190, 512 }, { 8, 191, 512 }, - { 3, 192, 512 }, { 4, 193, 512 }, { 4, 194, 512 }, { 5, 195, 512 }, { 4, 196, 512 }, { 5, 197, 512 }, { 5, 198, 512 }, { 6, 199, 512 }, - { 4, 200, 512 }, { 5, 201, 512 }, { 5, 202, 512 }, { 6, 203, 512 }, { 5, 204, 512 }, { 6, 205, 512 }, { 6, 206, 512 }, { 7, 207, 512 }, - { 4, 208, 512 }, { 5, 209, 512 }, { 5, 210, 512 }, { 6, 211, 512 }, { 5, 212, 512 }, { 6, 213, 512 }, { 6, 214, 512 }, { 7, 215, 512 }, - { 5, 216, 512 }, { 6, 217, 512 }, { 6, 218, 512 }, { 7, 219, 512 }, { 6, 220, 512 }, { 7, 221, 512 }, { 7, 222, 512 }, { 8, 223, 512 }, - { 4, 224, 512 }, { 5, 225, 512 }, { 5, 226, 512 }, { 6, 227, 512 }, { 5, 228, 512 }, { 6, 229, 512 }, { 6, 230, 512 }, { 7, 231, 512 }, - { 5, 232, 512 }, { 6, 233, 512 }, { 6, 234, 512 }, { 7, 235, 512 }, { 6, 236, 512 }, { 7, 237, 512 }, { 7, 238, 512 }, { 8, 239, 512 }, - { 5, 240, 512 }, { 6, 241, 512 }, { 6, 242, 512 }, { 7, 243, 512 }, { 6, 244, 512 }, { 7, 245, 512 }, { 7, 246, 512 }, { 8, 247, 512 }, - { 6, 248, 512 }, { 7, 249, 512 }, { 7, 250, 512 }, { 8, 251, 512 }, { 7, 252, 512 }, { 8, 253, 512 }, { 8, 254, 512 }, { 9, 255, 512 }, - { 2, 256, 512 }, { 3, 257, 512 }, { 3, 258, 512 }, { 4, 259, 512 }, { 3, 260, 512 }, { 4, 261, 512 }, { 4, 262, 512 }, { 5, 263, 512 }, - { 3, 264, 512 }, { 4, 265, 512 }, { 4, 266, 512 }, { 5, 267, 512 }, { 4, 268, 512 }, { 5, 269, 512 }, { 5, 270, 512 }, { 6, 271, 512 }, - { 3, 272, 512 }, { 4, 273, 512 }, { 4, 274, 512 }, { 5, 275, 512 }, { 4, 276, 512 }, { 5, 277, 512 }, { 5, 278, 512 }, { 6, 279, 512 }, - { 4, 280, 512 }, { 5, 281, 512 }, { 5, 282, 512 }, { 6, 283, 512 }, { 5, 284, 512 }, { 6, 285, 512 }, { 6, 286, 512 }, { 7, 287, 512 }, - { 3, 288, 512 }, { 4, 289, 512 }, { 4, 290, 512 }, { 5, 291, 512 }, { 4, 292, 512 }, { 5, 293, 512 }, { 5, 294, 512 }, { 6, 295, 512 }, - { 4, 296, 512 }, { 5, 297, 512 }, { 5, 298, 512 }, { 6, 299, 512 }, { 5, 300, 512 }, { 6, 301, 512 }, { 6, 302, 512 }, { 7, 303, 512 }, - { 4, 304, 512 }, { 5, 305, 512 }, { 5, 306, 512 }, { 6, 307, 512 }, { 5, 308, 512 }, { 6, 309, 512 }, { 6, 310, 512 }, { 7, 311, 512 }, - { 5, 312, 512 }, { 6, 313, 512 }, { 6, 314, 512 }, { 7, 315, 512 }, { 6, 316, 512 }, { 7, 317, 512 }, { 7, 318, 512 }, { 8, 319, 512 }, - { 3, 320, 512 }, { 4, 321, 512 }, { 4, 322, 512 }, { 5, 323, 512 }, { 4, 324, 512 }, { 5, 325, 512 }, { 5, 326, 512 }, { 6, 327, 512 }, - { 4, 328, 512 }, { 5, 329, 512 }, { 5, 330, 512 }, { 6, 331, 512 }, { 5, 332, 512 }, { 6, 333, 512 }, { 6, 334, 512 }, { 7, 335, 512 }, - { 4, 336, 512 }, { 5, 337, 512 }, { 5, 338, 512 }, { 6, 339, 512 }, { 5, 340, 512 }, { 6, 341, 512 }, { 6, 342, 512 }, { 7, 343, 512 }, - { 5, 344, 512 }, { 6, 345, 512 }, { 6, 346, 512 }, { 7, 347, 512 }, { 6, 348, 512 }, { 7, 349, 512 }, { 7, 350, 512 }, { 8, 351, 512 }, - { 4, 352, 512 }, { 5, 353, 512 }, { 5, 354, 512 }, { 6, 355, 512 }, { 5, 356, 512 }, { 6, 357, 512 }, { 6, 358, 512 }, { 7, 359, 512 }, - { 5, 360, 512 }, { 6, 361, 512 }, { 6, 362, 512 }, { 7, 363, 512 }, { 6, 364, 512 }, { 7, 365, 512 }, { 7, 366, 512 }, { 8, 367, 512 }, - { 5, 368, 512 }, { 6, 369, 512 }, { 6, 370, 512 }, { 7, 371, 512 }, { 6, 372, 512 }, { 7, 373, 512 }, { 7, 374, 512 }, { 8, 375, 512 }, - { 6, 376, 512 }, { 7, 377, 512 }, { 7, 378, 512 }, { 8, 379, 512 }, { 7, 380, 512 }, { 8, 381, 512 }, { 8, 382, 512 }, { 9, 383, 512 }, - { 3, 384, 512 }, { 4, 385, 512 }, { 4, 386, 512 }, { 5, 387, 512 }, { 4, 388, 512 }, { 5, 389, 512 }, { 5, 390, 512 }, { 6, 391, 512 }, - { 4, 392, 512 }, { 5, 393, 512 }, { 5, 394, 512 }, { 6, 395, 512 }, { 5, 396, 512 }, { 6, 397, 512 }, { 6, 398, 512 }, { 7, 399, 512 }, - { 4, 400, 512 }, { 5, 401, 512 }, { 5, 402, 512 }, { 6, 403, 512 }, { 5, 404, 512 }, { 6, 405, 512 }, { 6, 406, 512 }, { 7, 407, 512 }, - { 5, 408, 512 }, { 6, 409, 512 }, { 6, 410, 512 }, { 7, 411, 512 }, { 6, 412, 512 }, { 7, 413, 512 }, { 7, 414, 512 }, { 8, 415, 512 }, - { 4, 416, 512 }, { 5, 417, 512 }, { 5, 418, 512 }, { 6, 419, 512 }, { 5, 420, 512 }, { 6, 421, 512 }, { 6, 422, 512 }, { 7, 423, 512 }, - { 5, 424, 512 }, { 6, 425, 512 }, { 6, 426, 512 }, { 7, 427, 512 }, { 6, 428, 512 }, { 7, 429, 512 }, { 7, 430, 512 }, { 8, 431, 512 }, - { 5, 432, 512 }, { 6, 433, 512 }, { 6, 434, 512 }, { 7, 435, 512 }, { 6, 436, 512 }, { 7, 437, 512 }, { 7, 438, 512 }, { 8, 439, 512 }, - { 6, 440, 512 }, { 7, 441, 512 }, { 7, 442, 512 }, { 8, 443, 512 }, { 7, 444, 512 }, { 8, 445, 512 }, { 8, 446, 512 }, { 9, 447, 512 }, - { 4, 448, 512 }, { 5, 449, 512 }, { 5, 450, 512 }, { 6, 451, 512 }, { 5, 452, 512 }, { 6, 453, 512 }, { 6, 454, 512 }, { 7, 455, 512 }, - { 5, 456, 512 }, { 6, 457, 512 }, { 6, 458, 512 }, { 7, 459, 512 }, { 6, 460, 512 }, { 7, 461, 512 }, { 7, 462, 512 }, { 8, 463, 512 }, - { 5, 464, 512 }, { 6, 465, 512 }, { 6, 466, 512 }, { 7, 467, 512 }, { 6, 468, 512 }, { 7, 469, 512 }, { 7, 470, 512 }, { 8, 471, 512 }, - { 6, 472, 512 }, { 7, 473, 512 }, { 7, 474, 512 }, { 8, 475, 512 }, { 7, 476, 512 }, { 8, 477, 512 }, { 8, 478, 512 }, { 9, 479, 512 }, - { 5, 480, 512 }, { 6, 481, 512 }, { 6, 482, 512 }, { 7, 483, 512 }, { 6, 484, 512 }, { 7, 485, 512 }, { 7, 486, 512 }, { 8, 487, 512 }, - { 6, 488, 512 }, { 7, 489, 512 }, { 7, 490, 512 }, { 8, 491, 512 }, { 7, 492, 512 }, { 8, 493, 512 }, { 8, 494, 512 }, { 9, 495, 512 }, - { 6, 496, 512 }, { 7, 497, 512 }, { 7, 498, 512 }, { 8, 499, 512 }, { 7, 500, 512 }, { 8, 501, 512 }, { 8, 502, 512 }, { 9, 503, 512 }, - { 7, 504, 512 }, { 8, 505, 512 }, { 8, 506, 512 }, { 9, 507, 512 }, { 8, 508, 512 }, { 9, 509, 512 }, { 9, 510, 512 }, { 10, 511, 512 }, + { 1, 0, 0 }, { 2, 1, 512 }, { 2, 2, 512 }, { 3, 3, 512 }, { 2, 4, 512 }, { 3, 5, 512 }, { 3, 6, 512 }, { 4, 7, 512 }, + { 2, 8, 512 }, { 3, 9, 512 }, { 3, 10, 512 }, { 4, 11, 512 }, { 3, 12, 512 }, { 4, 13, 512 }, { 4, 14, 512 }, { 5, 15, 512 }, + { 2, 16, 512 }, { 3, 17, 512 }, { 3, 18, 512 }, { 4, 19, 512 }, { 3, 20, 512 }, { 4, 21, 512 }, { 4, 22, 512 }, { 5, 23, 512 }, + { 3, 24, 512 }, { 4, 25, 512 }, { 4, 26, 512 }, { 5, 27, 512 }, { 4, 28, 512 }, { 5, 29, 512 }, { 5, 30, 512 }, { 6, 31, 512 }, + { 2, 32, 512 }, { 3, 33, 512 }, { 3, 34, 512 }, { 4, 35, 512 }, { 3, 36, 512 }, { 4, 37, 512 }, { 4, 38, 512 }, { 5, 39, 512 }, + { 3, 40, 512 }, { 4, 41, 512 }, { 4, 42, 512 }, { 5, 43, 512 }, { 4, 44, 512 }, { 5, 45, 512 }, { 5, 46, 512 }, { 6, 47, 512 }, + { 3, 48, 512 }, { 4, 49, 512 }, { 4, 50, 512 }, { 5, 51, 512 }, { 4, 52, 512 }, { 5, 53, 512 }, { 5, 54, 512 }, { 6, 55, 512 }, + { 4, 56, 512 }, { 5, 57, 512 }, { 5, 58, 512 }, { 6, 59, 512 }, { 5, 60, 512 }, { 6, 61, 512 }, { 6, 62, 512 }, { 7, 63, 512 }, + { 2, 64, 512 }, { 3, 65, 512 }, { 3, 66, 512 }, { 4, 67, 512 }, { 3, 68, 512 }, { 4, 69, 512 }, { 4, 70, 512 }, { 5, 71, 512 }, + { 3, 72, 512 }, { 4, 73, 512 }, { 4, 74, 512 }, { 5, 75, 512 }, { 4, 76, 512 }, { 5, 77, 512 }, { 5, 78, 512 }, { 6, 79, 512 }, + { 3, 80, 512 }, { 4, 81, 512 }, { 4, 82, 512 }, { 5, 83, 512 }, { 4, 84, 512 }, { 5, 85, 512 }, { 5, 86, 512 }, { 6, 87, 512 }, + { 4, 88, 512 }, { 5, 89, 512 }, { 5, 90, 512 }, { 6, 91, 512 }, { 5, 92, 512 }, { 6, 93, 512 }, { 6, 94, 512 }, { 7, 95, 512 }, + { 3, 96, 512 }, { 4, 97, 512 }, { 4, 98, 512 }, { 5, 99, 512 }, { 4, 100, 512 }, { 5, 101, 512 }, { 5, 102, 512 }, { 6, 103, 512 }, + { 4, 104, 512 }, { 5, 105, 512 }, { 5, 106, 512 }, { 6, 107, 512 }, { 5, 108, 512 }, { 6, 109, 512 }, { 6, 110, 512 }, { 7, 111, 512 }, + { 4, 112, 512 }, { 5, 113, 512 }, { 5, 114, 512 }, { 6, 115, 512 }, { 5, 116, 512 }, { 6, 117, 512 }, { 6, 118, 512 }, { 7, 119, 512 }, + { 5, 120, 512 }, { 6, 121, 512 }, { 6, 122, 512 }, { 7, 123, 512 }, { 6, 124, 512 }, { 7, 125, 512 }, { 7, 126, 512 }, { 8, 127, 512 }, + { 2, 128, 512 }, { 3, 129, 512 }, { 3, 130, 512 }, { 4, 131, 512 }, { 3, 132, 512 }, { 4, 133, 512 }, { 4, 134, 512 }, { 5, 135, 512 }, + { 3, 136, 512 }, { 4, 137, 512 }, { 4, 138, 512 }, { 5, 139, 512 }, { 4, 140, 512 }, { 5, 141, 512 }, { 5, 142, 512 }, { 6, 143, 512 }, + { 3, 144, 512 }, { 4, 145, 512 }, { 4, 146, 512 }, { 5, 147, 512 }, { 4, 148, 512 }, { 5, 149, 512 }, { 5, 150, 512 }, { 6, 151, 512 }, + { 4, 152, 512 }, { 5, 153, 512 }, { 5, 154, 512 }, { 6, 155, 512 }, { 5, 156, 512 }, { 6, 157, 512 }, { 6, 158, 512 }, { 7, 159, 512 }, + { 3, 160, 512 }, { 4, 161, 512 }, { 4, 162, 512 }, { 5, 163, 512 }, { 4, 164, 512 }, { 5, 165, 512 }, { 5, 166, 512 }, { 6, 167, 512 }, + { 4, 168, 512 }, { 5, 169, 512 }, { 5, 170, 512 }, { 6, 171, 512 }, { 5, 172, 512 }, { 6, 173, 512 }, { 6, 174, 512 }, { 7, 175, 512 }, + { 4, 176, 512 }, { 5, 177, 512 }, { 5, 178, 512 }, { 6, 179, 512 }, { 5, 180, 512 }, { 6, 181, 512 }, { 6, 182, 512 }, { 7, 183, 512 }, + { 5, 184, 512 }, { 6, 185, 512 }, { 6, 186, 512 }, { 7, 187, 512 }, { 6, 188, 512 }, { 7, 189, 512 }, { 7, 190, 512 }, { 8, 191, 512 }, + { 3, 192, 512 }, { 4, 193, 512 }, { 4, 194, 512 }, { 5, 195, 512 }, { 4, 196, 512 }, { 5, 197, 512 }, { 5, 198, 512 }, { 6, 199, 512 }, + { 4, 200, 512 }, { 5, 201, 512 }, { 5, 202, 512 }, { 6, 203, 512 }, { 5, 204, 512 }, { 6, 205, 512 }, { 6, 206, 512 }, { 7, 207, 512 }, + { 4, 208, 512 }, { 5, 209, 512 }, { 5, 210, 512 }, { 6, 211, 512 }, { 5, 212, 512 }, { 6, 213, 512 }, { 6, 214, 512 }, { 7, 215, 512 }, + { 5, 216, 512 }, { 6, 217, 512 }, { 6, 218, 512 }, { 7, 219, 512 }, { 6, 220, 512 }, { 7, 221, 512 }, { 7, 222, 512 }, { 8, 223, 512 }, + { 4, 224, 512 }, { 5, 225, 512 }, { 5, 226, 512 }, { 6, 227, 512 }, { 5, 228, 512 }, { 6, 229, 512 }, { 6, 230, 512 }, { 7, 231, 512 }, + { 5, 232, 512 }, { 6, 233, 512 }, { 6, 234, 512 }, { 7, 235, 512 }, { 6, 236, 512 }, { 7, 237, 512 }, { 7, 238, 512 }, { 8, 239, 512 }, + { 5, 240, 512 }, { 6, 241, 512 }, { 6, 242, 512 }, { 7, 243, 512 }, { 6, 244, 512 }, { 7, 245, 512 }, { 7, 246, 512 }, { 8, 247, 512 }, + { 6, 248, 512 }, { 7, 249, 512 }, { 7, 250, 512 }, { 8, 251, 512 }, { 7, 252, 512 }, { 8, 253, 512 }, { 8, 254, 512 }, { 9, 255, 512 }, + { 2, 256, 512 }, { 3, 257, 512 }, { 3, 258, 512 }, { 4, 259, 512 }, { 3, 260, 512 }, { 4, 261, 512 }, { 4, 262, 512 }, { 5, 263, 512 }, + { 3, 264, 512 }, { 4, 265, 512 }, { 4, 266, 512 }, { 5, 267, 512 }, { 4, 268, 512 }, { 5, 269, 512 }, { 5, 270, 512 }, { 6, 271, 512 }, + { 3, 272, 512 }, { 4, 273, 512 }, { 4, 274, 512 }, { 5, 275, 512 }, { 4, 276, 512 }, { 5, 277, 512 }, { 5, 278, 512 }, { 6, 279, 512 }, + { 4, 280, 512 }, { 5, 281, 512 }, { 5, 282, 512 }, { 6, 283, 512 }, { 5, 284, 512 }, { 6, 285, 512 }, { 6, 286, 512 }, { 7, 287, 512 }, + { 3, 288, 512 }, { 4, 289, 512 }, { 4, 290, 512 }, { 5, 291, 512 }, { 4, 292, 512 }, { 5, 293, 512 }, { 5, 294, 512 }, { 6, 295, 512 }, + { 4, 296, 512 }, { 5, 297, 512 }, { 5, 298, 512 }, { 6, 299, 512 }, { 5, 300, 512 }, { 6, 301, 512 }, { 6, 302, 512 }, { 7, 303, 512 }, + { 4, 304, 512 }, { 5, 305, 512 }, { 5, 306, 512 }, { 6, 307, 512 }, { 5, 308, 512 }, { 6, 309, 512 }, { 6, 310, 512 }, { 7, 311, 512 }, + { 5, 312, 512 }, { 6, 313, 512 }, { 6, 314, 512 }, { 7, 315, 512 }, { 6, 316, 512 }, { 7, 317, 512 }, { 7, 318, 512 }, { 8, 319, 512 }, + { 3, 320, 512 }, { 4, 321, 512 }, { 4, 322, 512 }, { 5, 323, 512 }, { 4, 324, 512 }, { 5, 325, 512 }, { 5, 326, 512 }, { 6, 327, 512 }, + { 4, 328, 512 }, { 5, 329, 512 }, { 5, 330, 512 }, { 6, 331, 512 }, { 5, 332, 512 }, { 6, 333, 512 }, { 6, 334, 512 }, { 7, 335, 512 }, + { 4, 336, 512 }, { 5, 337, 512 }, { 5, 338, 512 }, { 6, 339, 512 }, { 5, 340, 512 }, { 6, 341, 512 }, { 6, 342, 512 }, { 7, 343, 512 }, + { 5, 344, 512 }, { 6, 345, 512 }, { 6, 346, 512 }, { 7, 347, 512 }, { 6, 348, 512 }, { 7, 349, 512 }, { 7, 350, 512 }, { 8, 351, 512 }, + { 4, 352, 512 }, { 5, 353, 512 }, { 5, 354, 512 }, { 6, 355, 512 }, { 5, 356, 512 }, { 6, 357, 512 }, { 6, 358, 512 }, { 7, 359, 512 }, + { 5, 360, 512 }, { 6, 361, 512 }, { 6, 362, 512 }, { 7, 363, 512 }, { 6, 364, 512 }, { 7, 365, 512 }, { 7, 366, 512 }, { 8, 367, 512 }, + { 5, 368, 512 }, { 6, 369, 512 }, { 6, 370, 512 }, { 7, 371, 512 }, { 6, 372, 512 }, { 7, 373, 512 }, { 7, 374, 512 }, { 8, 375, 512 }, + { 6, 376, 512 }, { 7, 377, 512 }, { 7, 378, 512 }, { 8, 379, 512 }, { 7, 380, 512 }, { 8, 381, 512 }, { 8, 382, 512 }, { 9, 383, 512 }, + { 3, 384, 512 }, { 4, 385, 512 }, { 4, 386, 512 }, { 5, 387, 512 }, { 4, 388, 512 }, { 5, 389, 512 }, { 5, 390, 512 }, { 6, 391, 512 }, + { 4, 392, 512 }, { 5, 393, 512 }, { 5, 394, 512 }, { 6, 395, 512 }, { 5, 396, 512 }, { 6, 397, 512 }, { 6, 398, 512 }, { 7, 399, 512 }, + { 4, 400, 512 }, { 5, 401, 512 }, { 5, 402, 512 }, { 6, 403, 512 }, { 5, 404, 512 }, { 6, 405, 512 }, { 6, 406, 512 }, { 7, 407, 512 }, + { 5, 408, 512 }, { 6, 409, 512 }, { 6, 410, 512 }, { 7, 411, 512 }, { 6, 412, 512 }, { 7, 413, 512 }, { 7, 414, 512 }, { 8, 415, 512 }, + { 4, 416, 512 }, { 5, 417, 512 }, { 5, 418, 512 }, { 6, 419, 512 }, { 5, 420, 512 }, { 6, 421, 512 }, { 6, 422, 512 }, { 7, 423, 512 }, + { 5, 424, 512 }, { 6, 425, 512 }, { 6, 426, 512 }, { 7, 427, 512 }, { 6, 428, 512 }, { 7, 429, 512 }, { 7, 430, 512 }, { 8, 431, 512 }, + { 5, 432, 512 }, { 6, 433, 512 }, { 6, 434, 512 }, { 7, 435, 512 }, { 6, 436, 512 }, { 7, 437, 512 }, { 7, 438, 512 }, { 8, 439, 512 }, + { 6, 440, 512 }, { 7, 441, 512 }, { 7, 442, 512 }, { 8, 443, 512 }, { 7, 444, 512 }, { 8, 445, 512 }, { 8, 446, 512 }, { 9, 447, 512 }, + { 4, 448, 512 }, { 5, 449, 512 }, { 5, 450, 512 }, { 6, 451, 512 }, { 5, 452, 512 }, { 6, 453, 512 }, { 6, 454, 512 }, { 7, 455, 512 }, + { 5, 456, 512 }, { 6, 457, 512 }, { 6, 458, 512 }, { 7, 459, 512 }, { 6, 460, 512 }, { 7, 461, 512 }, { 7, 462, 512 }, { 8, 463, 512 }, + { 5, 464, 512 }, { 6, 465, 512 }, { 6, 466, 512 }, { 7, 467, 512 }, { 6, 468, 512 }, { 7, 469, 512 }, { 7, 470, 512 }, { 8, 471, 512 }, + { 6, 472, 512 }, { 7, 473, 512 }, { 7, 474, 512 }, { 8, 475, 512 }, { 7, 476, 512 }, { 8, 477, 512 }, { 8, 478, 512 }, { 9, 479, 512 }, + { 5, 480, 512 }, { 6, 481, 512 }, { 6, 482, 512 }, { 7, 483, 512 }, { 6, 484, 512 }, { 7, 485, 512 }, { 7, 486, 512 }, { 8, 487, 512 }, + { 6, 488, 512 }, { 7, 489, 512 }, { 7, 490, 512 }, { 8, 491, 512 }, { 7, 492, 512 }, { 8, 493, 512 }, { 8, 494, 512 }, { 9, 495, 512 }, + { 6, 496, 512 }, { 7, 497, 512 }, { 7, 498, 512 }, { 8, 499, 512 }, { 7, 500, 512 }, { 8, 501, 512 }, { 8, 502, 512 }, { 9, 503, 512 }, + { 7, 504, 512 }, { 8, 505, 512 }, { 8, 506, 512 }, { 9, 507, 512 }, { 8, 508, 512 }, { 9, 509, 512 }, { 9, 510, 512 }, { 10, 511, 512 }, #if FP_LUT > 10 - { 1, 0, 0 }, { 2, 1, 1024 }, { 2, 2, 1024 }, { 3, 3, 1024 }, { 2, 4, 1024 }, { 3, 5, 1024 }, { 3, 6, 1024 }, { 4, 7, 1024 }, - { 2, 8, 1024 }, { 3, 9, 1024 }, { 3, 10, 1024 }, { 4, 11, 1024 }, { 3, 12, 1024 }, { 4, 13, 1024 }, { 4, 14, 1024 }, { 5, 15, 1024 }, - { 2, 16, 1024 }, { 3, 17, 1024 }, { 3, 18, 1024 }, { 4, 19, 1024 }, { 3, 20, 1024 }, { 4, 21, 1024 }, { 4, 22, 1024 }, { 5, 23, 1024 }, - { 3, 24, 1024 }, { 4, 25, 1024 }, { 4, 26, 1024 }, { 5, 27, 1024 }, { 4, 28, 1024 }, { 5, 29, 1024 }, { 5, 30, 1024 }, { 6, 31, 1024 }, - { 2, 32, 1024 }, { 3, 33, 1024 }, { 3, 34, 1024 }, { 4, 35, 1024 }, { 3, 36, 1024 }, { 4, 37, 1024 }, { 4, 38, 1024 }, { 5, 39, 1024 }, - { 3, 40, 1024 }, { 4, 41, 1024 }, { 4, 42, 1024 }, { 5, 43, 1024 }, { 4, 44, 1024 }, { 5, 45, 1024 }, { 5, 46, 1024 }, { 6, 47, 1024 }, - { 3, 48, 1024 }, { 4, 49, 1024 }, { 4, 50, 1024 }, { 5, 51, 1024 }, { 4, 52, 1024 }, { 5, 53, 1024 }, { 5, 54, 1024 }, { 6, 55, 1024 }, - { 4, 56, 1024 }, { 5, 57, 1024 }, { 5, 58, 1024 }, { 6, 59, 1024 }, { 5, 60, 1024 }, { 6, 61, 1024 }, { 6, 62, 1024 }, { 7, 63, 1024 }, - { 2, 64, 1024 }, { 3, 65, 1024 }, { 3, 66, 1024 }, { 4, 67, 1024 }, { 3, 68, 1024 }, { 4, 69, 1024 }, { 4, 70, 1024 }, { 5, 71, 1024 }, - { 3, 72, 1024 }, { 4, 73, 1024 }, { 4, 74, 1024 }, { 5, 75, 1024 }, { 4, 76, 1024 }, { 5, 77, 1024 }, { 5, 78, 1024 }, { 6, 79, 1024 }, - { 3, 80, 1024 }, { 4, 81, 1024 }, { 4, 82, 1024 }, { 5, 83, 1024 }, { 4, 84, 1024 }, { 5, 85, 1024 }, { 5, 86, 1024 }, { 6, 87, 1024 }, - { 4, 88, 1024 }, { 5, 89, 1024 }, { 5, 90, 1024 }, { 6, 91, 1024 }, { 5, 92, 1024 }, { 6, 93, 1024 }, { 6, 94, 1024 }, { 7, 95, 1024 }, - { 3, 96, 1024 }, { 4, 97, 1024 }, { 4, 98, 1024 }, { 5, 99, 1024 }, { 4, 100, 1024 }, { 5, 101, 1024 }, { 5, 102, 1024 }, { 6, 103, 1024 }, - { 4, 104, 1024 }, { 5, 105, 1024 }, { 5, 106, 1024 }, { 6, 107, 1024 }, { 5, 108, 1024 }, { 6, 109, 1024 }, { 6, 110, 1024 }, { 7, 111, 1024 }, - { 4, 112, 1024 }, { 5, 113, 1024 }, { 5, 114, 1024 }, { 6, 115, 1024 }, { 5, 116, 1024 }, { 6, 117, 1024 }, { 6, 118, 1024 }, { 7, 119, 1024 }, - { 5, 120, 1024 }, { 6, 121, 1024 }, { 6, 122, 1024 }, { 7, 123, 1024 }, { 6, 124, 1024 }, { 7, 125, 1024 }, { 7, 126, 1024 }, { 8, 127, 1024 }, - { 2, 128, 1024 }, { 3, 129, 1024 }, { 3, 130, 1024 }, { 4, 131, 1024 }, { 3, 132, 1024 }, { 4, 133, 1024 }, { 4, 134, 1024 }, { 5, 135, 1024 }, - { 3, 136, 1024 }, { 4, 137, 1024 }, { 4, 138, 1024 }, { 5, 139, 1024 }, { 4, 140, 1024 }, { 5, 141, 1024 }, { 5, 142, 1024 }, { 6, 143, 1024 }, - { 3, 144, 1024 }, { 4, 145, 1024 }, { 4, 146, 1024 }, { 5, 147, 1024 }, { 4, 148, 1024 }, { 5, 149, 1024 }, { 5, 150, 1024 }, { 6, 151, 1024 }, - { 4, 152, 1024 }, { 5, 153, 1024 }, { 5, 154, 1024 }, { 6, 155, 1024 }, { 5, 156, 1024 }, { 6, 157, 1024 }, { 6, 158, 1024 }, { 7, 159, 1024 }, - { 3, 160, 1024 }, { 4, 161, 1024 }, { 4, 162, 1024 }, { 5, 163, 1024 }, { 4, 164, 1024 }, { 5, 165, 1024 }, { 5, 166, 1024 }, { 6, 167, 1024 }, - { 4, 168, 1024 }, { 5, 169, 1024 }, { 5, 170, 1024 }, { 6, 171, 1024 }, { 5, 172, 1024 }, { 6, 173, 1024 }, { 6, 174, 1024 }, { 7, 175, 1024 }, - { 4, 176, 1024 }, { 5, 177, 1024 }, { 5, 178, 1024 }, { 6, 179, 1024 }, { 5, 180, 1024 }, { 6, 181, 1024 }, { 6, 182, 1024 }, { 7, 183, 1024 }, - { 5, 184, 1024 }, { 6, 185, 1024 }, { 6, 186, 1024 }, { 7, 187, 1024 }, { 6, 188, 1024 }, { 7, 189, 1024 }, { 7, 190, 1024 }, { 8, 191, 1024 }, - { 3, 192, 1024 }, { 4, 193, 1024 }, { 4, 194, 1024 }, { 5, 195, 1024 }, { 4, 196, 1024 }, { 5, 197, 1024 }, { 5, 198, 1024 }, { 6, 199, 1024 }, - { 4, 200, 1024 }, { 5, 201, 1024 }, { 5, 202, 1024 }, { 6, 203, 1024 }, { 5, 204, 1024 }, { 6, 205, 1024 }, { 6, 206, 1024 }, { 7, 207, 1024 }, - { 4, 208, 1024 }, { 5, 209, 1024 }, { 5, 210, 1024 }, { 6, 211, 1024 }, { 5, 212, 1024 }, { 6, 213, 1024 }, { 6, 214, 1024 }, { 7, 215, 1024 }, - { 5, 216, 1024 }, { 6, 217, 1024 }, { 6, 218, 1024 }, { 7, 219, 1024 }, { 6, 220, 1024 }, { 7, 221, 1024 }, { 7, 222, 1024 }, { 8, 223, 1024 }, - { 4, 224, 1024 }, { 5, 225, 1024 }, { 5, 226, 1024 }, { 6, 227, 1024 }, { 5, 228, 1024 }, { 6, 229, 1024 }, { 6, 230, 1024 }, { 7, 231, 1024 }, - { 5, 232, 1024 }, { 6, 233, 1024 }, { 6, 234, 1024 }, { 7, 235, 1024 }, { 6, 236, 1024 }, { 7, 237, 1024 }, { 7, 238, 1024 }, { 8, 239, 1024 }, - { 5, 240, 1024 }, { 6, 241, 1024 }, { 6, 242, 1024 }, { 7, 243, 1024 }, { 6, 244, 1024 }, { 7, 245, 1024 }, { 7, 246, 1024 }, { 8, 247, 1024 }, - { 6, 248, 1024 }, { 7, 249, 1024 }, { 7, 250, 1024 }, { 8, 251, 1024 }, { 7, 252, 1024 }, { 8, 253, 1024 }, { 8, 254, 1024 }, { 9, 255, 1024 }, - { 2, 256, 1024 }, { 3, 257, 1024 }, { 3, 258, 1024 }, { 4, 259, 1024 }, { 3, 260, 1024 }, { 4, 261, 1024 }, { 4, 262, 1024 }, { 5, 263, 1024 }, - { 3, 264, 1024 }, { 4, 265, 1024 }, { 4, 266, 1024 }, { 5, 267, 1024 }, { 4, 268, 1024 }, { 5, 269, 1024 }, { 5, 270, 1024 }, { 6, 271, 1024 }, - { 3, 272, 1024 }, { 4, 273, 1024 }, { 4, 274, 1024 }, { 5, 275, 1024 }, { 4, 276, 1024 }, { 5, 277, 1024 }, { 5, 278, 1024 }, { 6, 279, 1024 }, - { 4, 280, 1024 }, { 5, 281, 1024 }, { 5, 282, 1024 }, { 6, 283, 1024 }, { 5, 284, 1024 }, { 6, 285, 1024 }, { 6, 286, 1024 }, { 7, 287, 1024 }, - { 3, 288, 1024 }, { 4, 289, 1024 }, { 4, 290, 1024 }, { 5, 291, 1024 }, { 4, 292, 1024 }, { 5, 293, 1024 }, { 5, 294, 1024 }, { 6, 295, 1024 }, - { 4, 296, 1024 }, { 5, 297, 1024 }, { 5, 298, 1024 }, { 6, 299, 1024 }, { 5, 300, 1024 }, { 6, 301, 1024 }, { 6, 302, 1024 }, { 7, 303, 1024 }, - { 4, 304, 1024 }, { 5, 305, 1024 }, { 5, 306, 1024 }, { 6, 307, 1024 }, { 5, 308, 1024 }, { 6, 309, 1024 }, { 6, 310, 1024 }, { 7, 311, 1024 }, - { 5, 312, 1024 }, { 6, 313, 1024 }, { 6, 314, 1024 }, { 7, 315, 1024 }, { 6, 316, 1024 }, { 7, 317, 1024 }, { 7, 318, 1024 }, { 8, 319, 1024 }, - { 3, 320, 1024 }, { 4, 321, 1024 }, { 4, 322, 1024 }, { 5, 323, 1024 }, { 4, 324, 1024 }, { 5, 325, 1024 }, { 5, 326, 1024 }, { 6, 327, 1024 }, - { 4, 328, 1024 }, { 5, 329, 1024 }, { 5, 330, 1024 }, { 6, 331, 1024 }, { 5, 332, 1024 }, { 6, 333, 1024 }, { 6, 334, 1024 }, { 7, 335, 1024 }, - { 4, 336, 1024 }, { 5, 337, 1024 }, { 5, 338, 1024 }, { 6, 339, 1024 }, { 5, 340, 1024 }, { 6, 341, 1024 }, { 6, 342, 1024 }, { 7, 343, 1024 }, - { 5, 344, 1024 }, { 6, 345, 1024 }, { 6, 346, 1024 }, { 7, 347, 1024 }, { 6, 348, 1024 }, { 7, 349, 1024 }, { 7, 350, 1024 }, { 8, 351, 1024 }, - { 4, 352, 1024 }, { 5, 353, 1024 }, { 5, 354, 1024 }, { 6, 355, 1024 }, { 5, 356, 1024 }, { 6, 357, 1024 }, { 6, 358, 1024 }, { 7, 359, 1024 }, - { 5, 360, 1024 }, { 6, 361, 1024 }, { 6, 362, 1024 }, { 7, 363, 1024 }, { 6, 364, 1024 }, { 7, 365, 1024 }, { 7, 366, 1024 }, { 8, 367, 1024 }, - { 5, 368, 1024 }, { 6, 369, 1024 }, { 6, 370, 1024 }, { 7, 371, 1024 }, { 6, 372, 1024 }, { 7, 373, 1024 }, { 7, 374, 1024 }, { 8, 375, 1024 }, - { 6, 376, 1024 }, { 7, 377, 1024 }, { 7, 378, 1024 }, { 8, 379, 1024 }, { 7, 380, 1024 }, { 8, 381, 1024 }, { 8, 382, 1024 }, { 9, 383, 1024 }, - { 3, 384, 1024 }, { 4, 385, 1024 }, { 4, 386, 1024 }, { 5, 387, 1024 }, { 4, 388, 1024 }, { 5, 389, 1024 }, { 5, 390, 1024 }, { 6, 391, 1024 }, - { 4, 392, 1024 }, { 5, 393, 1024 }, { 5, 394, 1024 }, { 6, 395, 1024 }, { 5, 396, 1024 }, { 6, 397, 1024 }, { 6, 398, 1024 }, { 7, 399, 1024 }, - { 4, 400, 1024 }, { 5, 401, 1024 }, { 5, 402, 1024 }, { 6, 403, 1024 }, { 5, 404, 1024 }, { 6, 405, 1024 }, { 6, 406, 1024 }, { 7, 407, 1024 }, - { 5, 408, 1024 }, { 6, 409, 1024 }, { 6, 410, 1024 }, { 7, 411, 1024 }, { 6, 412, 1024 }, { 7, 413, 1024 }, { 7, 414, 1024 }, { 8, 415, 1024 }, - { 4, 416, 1024 }, { 5, 417, 1024 }, { 5, 418, 1024 }, { 6, 419, 1024 }, { 5, 420, 1024 }, { 6, 421, 1024 }, { 6, 422, 1024 }, { 7, 423, 1024 }, - { 5, 424, 1024 }, { 6, 425, 1024 }, { 6, 426, 1024 }, { 7, 427, 1024 }, { 6, 428, 1024 }, { 7, 429, 1024 }, { 7, 430, 1024 }, { 8, 431, 1024 }, - { 5, 432, 1024 }, { 6, 433, 1024 }, { 6, 434, 1024 }, { 7, 435, 1024 }, { 6, 436, 1024 }, { 7, 437, 1024 }, { 7, 438, 1024 }, { 8, 439, 1024 }, - { 6, 440, 1024 }, { 7, 441, 1024 }, { 7, 442, 1024 }, { 8, 443, 1024 }, { 7, 444, 1024 }, { 8, 445, 1024 }, { 8, 446, 1024 }, { 9, 447, 1024 }, - { 4, 448, 1024 }, { 5, 449, 1024 }, { 5, 450, 1024 }, { 6, 451, 1024 }, { 5, 452, 1024 }, { 6, 453, 1024 }, { 6, 454, 1024 }, { 7, 455, 1024 }, - { 5, 456, 1024 }, { 6, 457, 1024 }, { 6, 458, 1024 }, { 7, 459, 1024 }, { 6, 460, 1024 }, { 7, 461, 1024 }, { 7, 462, 1024 }, { 8, 463, 1024 }, - { 5, 464, 1024 }, { 6, 465, 1024 }, { 6, 466, 1024 }, { 7, 467, 1024 }, { 6, 468, 1024 }, { 7, 469, 1024 }, { 7, 470, 1024 }, { 8, 471, 1024 }, - { 6, 472, 1024 }, { 7, 473, 1024 }, { 7, 474, 1024 }, { 8, 475, 1024 }, { 7, 476, 1024 }, { 8, 477, 1024 }, { 8, 478, 1024 }, { 9, 479, 1024 }, - { 5, 480, 1024 }, { 6, 481, 1024 }, { 6, 482, 1024 }, { 7, 483, 1024 }, { 6, 484, 1024 }, { 7, 485, 1024 }, { 7, 486, 1024 }, { 8, 487, 1024 }, - { 6, 488, 1024 }, { 7, 489, 1024 }, { 7, 490, 1024 }, { 8, 491, 1024 }, { 7, 492, 1024 }, { 8, 493, 1024 }, { 8, 494, 1024 }, { 9, 495, 1024 }, - { 6, 496, 1024 }, { 7, 497, 1024 }, { 7, 498, 1024 }, { 8, 499, 1024 }, { 7, 500, 1024 }, { 8, 501, 1024 }, { 8, 502, 1024 }, { 9, 503, 1024 }, - { 7, 504, 1024 }, { 8, 505, 1024 }, { 8, 506, 1024 }, { 9, 507, 1024 }, { 8, 508, 1024 }, { 9, 509, 1024 }, { 9, 510, 1024 }, { 10, 511, 1024 }, - { 2, 512, 1024 }, { 3, 513, 1024 }, { 3, 514, 1024 }, { 4, 515, 1024 }, { 3, 516, 1024 }, { 4, 517, 1024 }, { 4, 518, 1024 }, { 5, 519, 1024 }, - { 3, 520, 1024 }, { 4, 521, 1024 }, { 4, 522, 1024 }, { 5, 523, 1024 }, { 4, 524, 1024 }, { 5, 525, 1024 }, { 5, 526, 1024 }, { 6, 527, 1024 }, - { 3, 528, 1024 }, { 4, 529, 1024 }, { 4, 530, 1024 }, { 5, 531, 1024 }, { 4, 532, 1024 }, { 5, 533, 1024 }, { 5, 534, 1024 }, { 6, 535, 1024 }, - { 4, 536, 1024 }, { 5, 537, 1024 }, { 5, 538, 1024 }, { 6, 539, 1024 }, { 5, 540, 1024 }, { 6, 541, 1024 }, { 6, 542, 1024 }, { 7, 543, 1024 }, - { 3, 544, 1024 }, { 4, 545, 1024 }, { 4, 546, 1024 }, { 5, 547, 1024 }, { 4, 548, 1024 }, { 5, 549, 1024 }, { 5, 550, 1024 }, { 6, 551, 1024 }, - { 4, 552, 1024 }, { 5, 553, 1024 }, { 5, 554, 1024 }, { 6, 555, 1024 }, { 5, 556, 1024 }, { 6, 557, 1024 }, { 6, 558, 1024 }, { 7, 559, 1024 }, - { 4, 560, 1024 }, { 5, 561, 1024 }, { 5, 562, 1024 }, { 6, 563, 1024 }, { 5, 564, 1024 }, { 6, 565, 1024 }, { 6, 566, 1024 }, { 7, 567, 1024 }, - { 5, 568, 1024 }, { 6, 569, 1024 }, { 6, 570, 1024 }, { 7, 571, 1024 }, { 6, 572, 1024 }, { 7, 573, 1024 }, { 7, 574, 1024 }, { 8, 575, 1024 }, - { 3, 576, 1024 }, { 4, 577, 1024 }, { 4, 578, 1024 }, { 5, 579, 1024 }, { 4, 580, 1024 }, { 5, 581, 1024 }, { 5, 582, 1024 }, { 6, 583, 1024 }, - { 4, 584, 1024 }, { 5, 585, 1024 }, { 5, 586, 1024 }, { 6, 587, 1024 }, { 5, 588, 1024 }, { 6, 589, 1024 }, { 6, 590, 1024 }, { 7, 591, 1024 }, - { 4, 592, 1024 }, { 5, 593, 1024 }, { 5, 594, 1024 }, { 6, 595, 1024 }, { 5, 596, 1024 }, { 6, 597, 1024 }, { 6, 598, 1024 }, { 7, 599, 1024 }, - { 5, 600, 1024 }, { 6, 601, 1024 }, { 6, 602, 1024 }, { 7, 603, 1024 }, { 6, 604, 1024 }, { 7, 605, 1024 }, { 7, 606, 1024 }, { 8, 607, 1024 }, - { 4, 608, 1024 }, { 5, 609, 1024 }, { 5, 610, 1024 }, { 6, 611, 1024 }, { 5, 612, 1024 }, { 6, 613, 1024 }, { 6, 614, 1024 }, { 7, 615, 1024 }, - { 5, 616, 1024 }, { 6, 617, 1024 }, { 6, 618, 1024 }, { 7, 619, 1024 }, { 6, 620, 1024 }, { 7, 621, 1024 }, { 7, 622, 1024 }, { 8, 623, 1024 }, - { 5, 624, 1024 }, { 6, 625, 1024 }, { 6, 626, 1024 }, { 7, 627, 1024 }, { 6, 628, 1024 }, { 7, 629, 1024 }, { 7, 630, 1024 }, { 8, 631, 1024 }, - { 6, 632, 1024 }, { 7, 633, 1024 }, { 7, 634, 1024 }, { 8, 635, 1024 }, { 7, 636, 1024 }, { 8, 637, 1024 }, { 8, 638, 1024 }, { 9, 639, 1024 }, - { 3, 640, 1024 }, { 4, 641, 1024 }, { 4, 642, 1024 }, { 5, 643, 1024 }, { 4, 644, 1024 }, { 5, 645, 1024 }, { 5, 646, 1024 }, { 6, 647, 1024 }, - { 4, 648, 1024 }, { 5, 649, 1024 }, { 5, 650, 1024 }, { 6, 651, 1024 }, { 5, 652, 1024 }, { 6, 653, 1024 }, { 6, 654, 1024 }, { 7, 655, 1024 }, - { 4, 656, 1024 }, { 5, 657, 1024 }, { 5, 658, 1024 }, { 6, 659, 1024 }, { 5, 660, 1024 }, { 6, 661, 1024 }, { 6, 662, 1024 }, { 7, 663, 1024 }, - { 5, 664, 1024 }, { 6, 665, 1024 }, { 6, 666, 1024 }, { 7, 667, 1024 }, { 6, 668, 1024 }, { 7, 669, 1024 }, { 7, 670, 1024 }, { 8, 671, 1024 }, - { 4, 672, 1024 }, { 5, 673, 1024 }, { 5, 674, 1024 }, { 6, 675, 1024 }, { 5, 676, 1024 }, { 6, 677, 1024 }, { 6, 678, 1024 }, { 7, 679, 1024 }, - { 5, 680, 1024 }, { 6, 681, 1024 }, { 6, 682, 1024 }, { 7, 683, 1024 }, { 6, 684, 1024 }, { 7, 685, 1024 }, { 7, 686, 1024 }, { 8, 687, 1024 }, - { 5, 688, 1024 }, { 6, 689, 1024 }, { 6, 690, 1024 }, { 7, 691, 1024 }, { 6, 692, 1024 }, { 7, 693, 1024 }, { 7, 694, 1024 }, { 8, 695, 1024 }, - { 6, 696, 1024 }, { 7, 697, 1024 }, { 7, 698, 1024 }, { 8, 699, 1024 }, { 7, 700, 1024 }, { 8, 701, 1024 }, { 8, 702, 1024 }, { 9, 703, 1024 }, - { 4, 704, 1024 }, { 5, 705, 1024 }, { 5, 706, 1024 }, { 6, 707, 1024 }, { 5, 708, 1024 }, { 6, 709, 1024 }, { 6, 710, 1024 }, { 7, 711, 1024 }, - { 5, 712, 1024 }, { 6, 713, 1024 }, { 6, 714, 1024 }, { 7, 715, 1024 }, { 6, 716, 1024 }, { 7, 717, 1024 }, { 7, 718, 1024 }, { 8, 719, 1024 }, - { 5, 720, 1024 }, { 6, 721, 1024 }, { 6, 722, 1024 }, { 7, 723, 1024 }, { 6, 724, 1024 }, { 7, 725, 1024 }, { 7, 726, 1024 }, { 8, 727, 1024 }, - { 6, 728, 1024 }, { 7, 729, 1024 }, { 7, 730, 1024 }, { 8, 731, 1024 }, { 7, 732, 1024 }, { 8, 733, 1024 }, { 8, 734, 1024 }, { 9, 735, 1024 }, - { 5, 736, 1024 }, { 6, 737, 1024 }, { 6, 738, 1024 }, { 7, 739, 1024 }, { 6, 740, 1024 }, { 7, 741, 1024 }, { 7, 742, 1024 }, { 8, 743, 1024 }, - { 6, 744, 1024 }, { 7, 745, 1024 }, { 7, 746, 1024 }, { 8, 747, 1024 }, { 7, 748, 1024 }, { 8, 749, 1024 }, { 8, 750, 1024 }, { 9, 751, 1024 }, - { 6, 752, 1024 }, { 7, 753, 1024 }, { 7, 754, 1024 }, { 8, 755, 1024 }, { 7, 756, 1024 }, { 8, 757, 1024 }, { 8, 758, 1024 }, { 9, 759, 1024 }, - { 7, 760, 1024 }, { 8, 761, 1024 }, { 8, 762, 1024 }, { 9, 763, 1024 }, { 8, 764, 1024 }, { 9, 765, 1024 }, { 9, 766, 1024 }, { 10, 767, 1024 }, - { 3, 768, 1024 }, { 4, 769, 1024 }, { 4, 770, 1024 }, { 5, 771, 1024 }, { 4, 772, 1024 }, { 5, 773, 1024 }, { 5, 774, 1024 }, { 6, 775, 1024 }, - { 4, 776, 1024 }, { 5, 777, 1024 }, { 5, 778, 1024 }, { 6, 779, 1024 }, { 5, 780, 1024 }, { 6, 781, 1024 }, { 6, 782, 1024 }, { 7, 783, 1024 }, - { 4, 784, 1024 }, { 5, 785, 1024 }, { 5, 786, 1024 }, { 6, 787, 1024 }, { 5, 788, 1024 }, { 6, 789, 1024 }, { 6, 790, 1024 }, { 7, 791, 1024 }, - { 5, 792, 1024 }, { 6, 793, 1024 }, { 6, 794, 1024 }, { 7, 795, 1024 }, { 6, 796, 1024 }, { 7, 797, 1024 }, { 7, 798, 1024 }, { 8, 799, 1024 }, - { 4, 800, 1024 }, { 5, 801, 1024 }, { 5, 802, 1024 }, { 6, 803, 1024 }, { 5, 804, 1024 }, { 6, 805, 1024 }, { 6, 806, 1024 }, { 7, 807, 1024 }, - { 5, 808, 1024 }, { 6, 809, 1024 }, { 6, 810, 1024 }, { 7, 811, 1024 }, { 6, 812, 1024 }, { 7, 813, 1024 }, { 7, 814, 1024 }, { 8, 815, 1024 }, - { 5, 816, 1024 }, { 6, 817, 1024 }, { 6, 818, 1024 }, { 7, 819, 1024 }, { 6, 820, 1024 }, { 7, 821, 1024 }, { 7, 822, 1024 }, { 8, 823, 1024 }, - { 6, 824, 1024 }, { 7, 825, 1024 }, { 7, 826, 1024 }, { 8, 827, 1024 }, { 7, 828, 1024 }, { 8, 829, 1024 }, { 8, 830, 1024 }, { 9, 831, 1024 }, - { 4, 832, 1024 }, { 5, 833, 1024 }, { 5, 834, 1024 }, { 6, 835, 1024 }, { 5, 836, 1024 }, { 6, 837, 1024 }, { 6, 838, 1024 }, { 7, 839, 1024 }, - { 5, 840, 1024 }, { 6, 841, 1024 }, { 6, 842, 1024 }, { 7, 843, 1024 }, { 6, 844, 1024 }, { 7, 845, 1024 }, { 7, 846, 1024 }, { 8, 847, 1024 }, - { 5, 848, 1024 }, { 6, 849, 1024 }, { 6, 850, 1024 }, { 7, 851, 1024 }, { 6, 852, 1024 }, { 7, 853, 1024 }, { 7, 854, 1024 }, { 8, 855, 1024 }, - { 6, 856, 1024 }, { 7, 857, 1024 }, { 7, 858, 1024 }, { 8, 859, 1024 }, { 7, 860, 1024 }, { 8, 861, 1024 }, { 8, 862, 1024 }, { 9, 863, 1024 }, - { 5, 864, 1024 }, { 6, 865, 1024 }, { 6, 866, 1024 }, { 7, 867, 1024 }, { 6, 868, 1024 }, { 7, 869, 1024 }, { 7, 870, 1024 }, { 8, 871, 1024 }, - { 6, 872, 1024 }, { 7, 873, 1024 }, { 7, 874, 1024 }, { 8, 875, 1024 }, { 7, 876, 1024 }, { 8, 877, 1024 }, { 8, 878, 1024 }, { 9, 879, 1024 }, - { 6, 880, 1024 }, { 7, 881, 1024 }, { 7, 882, 1024 }, { 8, 883, 1024 }, { 7, 884, 1024 }, { 8, 885, 1024 }, { 8, 886, 1024 }, { 9, 887, 1024 }, - { 7, 888, 1024 }, { 8, 889, 1024 }, { 8, 890, 1024 }, { 9, 891, 1024 }, { 8, 892, 1024 }, { 9, 893, 1024 }, { 9, 894, 1024 }, { 10, 895, 1024 }, - { 4, 896, 1024 }, { 5, 897, 1024 }, { 5, 898, 1024 }, { 6, 899, 1024 }, { 5, 900, 1024 }, { 6, 901, 1024 }, { 6, 902, 1024 }, { 7, 903, 1024 }, - { 5, 904, 1024 }, { 6, 905, 1024 }, { 6, 906, 1024 }, { 7, 907, 1024 }, { 6, 908, 1024 }, { 7, 909, 1024 }, { 7, 910, 1024 }, { 8, 911, 1024 }, - { 5, 912, 1024 }, { 6, 913, 1024 }, { 6, 914, 1024 }, { 7, 915, 1024 }, { 6, 916, 1024 }, { 7, 917, 1024 }, { 7, 918, 1024 }, { 8, 919, 1024 }, - { 6, 920, 1024 }, { 7, 921, 1024 }, { 7, 922, 1024 }, { 8, 923, 1024 }, { 7, 924, 1024 }, { 8, 925, 1024 }, { 8, 926, 1024 }, { 9, 927, 1024 }, - { 5, 928, 1024 }, { 6, 929, 1024 }, { 6, 930, 1024 }, { 7, 931, 1024 }, { 6, 932, 1024 }, { 7, 933, 1024 }, { 7, 934, 1024 }, { 8, 935, 1024 }, - { 6, 936, 1024 }, { 7, 937, 1024 }, { 7, 938, 1024 }, { 8, 939, 1024 }, { 7, 940, 1024 }, { 8, 941, 1024 }, { 8, 942, 1024 }, { 9, 943, 1024 }, - { 6, 944, 1024 }, { 7, 945, 1024 }, { 7, 946, 1024 }, { 8, 947, 1024 }, { 7, 948, 1024 }, { 8, 949, 1024 }, { 8, 950, 1024 }, { 9, 951, 1024 }, - { 7, 952, 1024 }, { 8, 953, 1024 }, { 8, 954, 1024 }, { 9, 955, 1024 }, { 8, 956, 1024 }, { 9, 957, 1024 }, { 9, 958, 1024 }, { 10, 959, 1024 }, - { 5, 960, 1024 }, { 6, 961, 1024 }, { 6, 962, 1024 }, { 7, 963, 1024 }, { 6, 964, 1024 }, { 7, 965, 1024 }, { 7, 966, 1024 }, { 8, 967, 1024 }, - { 6, 968, 1024 }, { 7, 969, 1024 }, { 7, 970, 1024 }, { 8, 971, 1024 }, { 7, 972, 1024 }, { 8, 973, 1024 }, { 8, 974, 1024 }, { 9, 975, 1024 }, - { 6, 976, 1024 }, { 7, 977, 1024 }, { 7, 978, 1024 }, { 8, 979, 1024 }, { 7, 980, 1024 }, { 8, 981, 1024 }, { 8, 982, 1024 }, { 9, 983, 1024 }, - { 7, 984, 1024 }, { 8, 985, 1024 }, { 8, 986, 1024 }, { 9, 987, 1024 }, { 8, 988, 1024 }, { 9, 989, 1024 }, { 9, 990, 1024 }, { 10, 991, 1024 }, - { 6, 992, 1024 }, { 7, 993, 1024 }, { 7, 994, 1024 }, { 8, 995, 1024 }, { 7, 996, 1024 }, { 8, 997, 1024 }, { 8, 998, 1024 }, { 9, 999, 1024 }, - { 7, 1000, 1024 }, { 8, 1001, 1024 }, { 8, 1002, 1024 }, { 9, 1003, 1024 }, { 8, 1004, 1024 }, { 9, 1005, 1024 }, { 9, 1006, 1024 }, { 10, 1007, 1024 }, - { 7, 1008, 1024 }, { 8, 1009, 1024 }, { 8, 1010, 1024 }, { 9, 1011, 1024 }, { 8, 1012, 1024 }, { 9, 1013, 1024 }, { 9, 1014, 1024 }, { 10, 1015, 1024 }, - { 8, 1016, 1024 }, { 9, 1017, 1024 }, { 9, 1018, 1024 }, { 10, 1019, 1024 }, { 9, 1020, 1024 }, { 10, 1021, 1024 }, { 10, 1022, 1024 }, { 11, 1023, 1024 }, + { 1, 0, 0 }, { 2, 1, 1024 }, { 2, 2, 1024 }, { 3, 3, 1024 }, { 2, 4, 1024 }, { 3, 5, 1024 }, { 3, 6, 1024 }, { 4, 7, 1024 }, + { 2, 8, 1024 }, { 3, 9, 1024 }, { 3, 10, 1024 }, { 4, 11, 1024 }, { 3, 12, 1024 }, { 4, 13, 1024 }, { 4, 14, 1024 }, { 5, 15, 1024 }, + { 2, 16, 1024 }, { 3, 17, 1024 }, { 3, 18, 1024 }, { 4, 19, 1024 }, { 3, 20, 1024 }, { 4, 21, 1024 }, { 4, 22, 1024 }, { 5, 23, 1024 }, + { 3, 24, 1024 }, { 4, 25, 1024 }, { 4, 26, 1024 }, { 5, 27, 1024 }, { 4, 28, 1024 }, { 5, 29, 1024 }, { 5, 30, 1024 }, { 6, 31, 1024 }, + { 2, 32, 1024 }, { 3, 33, 1024 }, { 3, 34, 1024 }, { 4, 35, 1024 }, { 3, 36, 1024 }, { 4, 37, 1024 }, { 4, 38, 1024 }, { 5, 39, 1024 }, + { 3, 40, 1024 }, { 4, 41, 1024 }, { 4, 42, 1024 }, { 5, 43, 1024 }, { 4, 44, 1024 }, { 5, 45, 1024 }, { 5, 46, 1024 }, { 6, 47, 1024 }, + { 3, 48, 1024 }, { 4, 49, 1024 }, { 4, 50, 1024 }, { 5, 51, 1024 }, { 4, 52, 1024 }, { 5, 53, 1024 }, { 5, 54, 1024 }, { 6, 55, 1024 }, + { 4, 56, 1024 }, { 5, 57, 1024 }, { 5, 58, 1024 }, { 6, 59, 1024 }, { 5, 60, 1024 }, { 6, 61, 1024 }, { 6, 62, 1024 }, { 7, 63, 1024 }, + { 2, 64, 1024 }, { 3, 65, 1024 }, { 3, 66, 1024 }, { 4, 67, 1024 }, { 3, 68, 1024 }, { 4, 69, 1024 }, { 4, 70, 1024 }, { 5, 71, 1024 }, + { 3, 72, 1024 }, { 4, 73, 1024 }, { 4, 74, 1024 }, { 5, 75, 1024 }, { 4, 76, 1024 }, { 5, 77, 1024 }, { 5, 78, 1024 }, { 6, 79, 1024 }, + { 3, 80, 1024 }, { 4, 81, 1024 }, { 4, 82, 1024 }, { 5, 83, 1024 }, { 4, 84, 1024 }, { 5, 85, 1024 }, { 5, 86, 1024 }, { 6, 87, 1024 }, + { 4, 88, 1024 }, { 5, 89, 1024 }, { 5, 90, 1024 }, { 6, 91, 1024 }, { 5, 92, 1024 }, { 6, 93, 1024 }, { 6, 94, 1024 }, { 7, 95, 1024 }, + { 3, 96, 1024 }, { 4, 97, 1024 }, { 4, 98, 1024 }, { 5, 99, 1024 }, { 4, 100, 1024 }, { 5, 101, 1024 }, { 5, 102, 1024 }, { 6, 103, 1024 }, + { 4, 104, 1024 }, { 5, 105, 1024 }, { 5, 106, 1024 }, { 6, 107, 1024 }, { 5, 108, 1024 }, { 6, 109, 1024 }, { 6, 110, 1024 }, { 7, 111, 1024 }, + { 4, 112, 1024 }, { 5, 113, 1024 }, { 5, 114, 1024 }, { 6, 115, 1024 }, { 5, 116, 1024 }, { 6, 117, 1024 }, { 6, 118, 1024 }, { 7, 119, 1024 }, + { 5, 120, 1024 }, { 6, 121, 1024 }, { 6, 122, 1024 }, { 7, 123, 1024 }, { 6, 124, 1024 }, { 7, 125, 1024 }, { 7, 126, 1024 }, { 8, 127, 1024 }, + { 2, 128, 1024 }, { 3, 129, 1024 }, { 3, 130, 1024 }, { 4, 131, 1024 }, { 3, 132, 1024 }, { 4, 133, 1024 }, { 4, 134, 1024 }, { 5, 135, 1024 }, + { 3, 136, 1024 }, { 4, 137, 1024 }, { 4, 138, 1024 }, { 5, 139, 1024 }, { 4, 140, 1024 }, { 5, 141, 1024 }, { 5, 142, 1024 }, { 6, 143, 1024 }, + { 3, 144, 1024 }, { 4, 145, 1024 }, { 4, 146, 1024 }, { 5, 147, 1024 }, { 4, 148, 1024 }, { 5, 149, 1024 }, { 5, 150, 1024 }, { 6, 151, 1024 }, + { 4, 152, 1024 }, { 5, 153, 1024 }, { 5, 154, 1024 }, { 6, 155, 1024 }, { 5, 156, 1024 }, { 6, 157, 1024 }, { 6, 158, 1024 }, { 7, 159, 1024 }, + { 3, 160, 1024 }, { 4, 161, 1024 }, { 4, 162, 1024 }, { 5, 163, 1024 }, { 4, 164, 1024 }, { 5, 165, 1024 }, { 5, 166, 1024 }, { 6, 167, 1024 }, + { 4, 168, 1024 }, { 5, 169, 1024 }, { 5, 170, 1024 }, { 6, 171, 1024 }, { 5, 172, 1024 }, { 6, 173, 1024 }, { 6, 174, 1024 }, { 7, 175, 1024 }, + { 4, 176, 1024 }, { 5, 177, 1024 }, { 5, 178, 1024 }, { 6, 179, 1024 }, { 5, 180, 1024 }, { 6, 181, 1024 }, { 6, 182, 1024 }, { 7, 183, 1024 }, + { 5, 184, 1024 }, { 6, 185, 1024 }, { 6, 186, 1024 }, { 7, 187, 1024 }, { 6, 188, 1024 }, { 7, 189, 1024 }, { 7, 190, 1024 }, { 8, 191, 1024 }, + { 3, 192, 1024 }, { 4, 193, 1024 }, { 4, 194, 1024 }, { 5, 195, 1024 }, { 4, 196, 1024 }, { 5, 197, 1024 }, { 5, 198, 1024 }, { 6, 199, 1024 }, + { 4, 200, 1024 }, { 5, 201, 1024 }, { 5, 202, 1024 }, { 6, 203, 1024 }, { 5, 204, 1024 }, { 6, 205, 1024 }, { 6, 206, 1024 }, { 7, 207, 1024 }, + { 4, 208, 1024 }, { 5, 209, 1024 }, { 5, 210, 1024 }, { 6, 211, 1024 }, { 5, 212, 1024 }, { 6, 213, 1024 }, { 6, 214, 1024 }, { 7, 215, 1024 }, + { 5, 216, 1024 }, { 6, 217, 1024 }, { 6, 218, 1024 }, { 7, 219, 1024 }, { 6, 220, 1024 }, { 7, 221, 1024 }, { 7, 222, 1024 }, { 8, 223, 1024 }, + { 4, 224, 1024 }, { 5, 225, 1024 }, { 5, 226, 1024 }, { 6, 227, 1024 }, { 5, 228, 1024 }, { 6, 229, 1024 }, { 6, 230, 1024 }, { 7, 231, 1024 }, + { 5, 232, 1024 }, { 6, 233, 1024 }, { 6, 234, 1024 }, { 7, 235, 1024 }, { 6, 236, 1024 }, { 7, 237, 1024 }, { 7, 238, 1024 }, { 8, 239, 1024 }, + { 5, 240, 1024 }, { 6, 241, 1024 }, { 6, 242, 1024 }, { 7, 243, 1024 }, { 6, 244, 1024 }, { 7, 245, 1024 }, { 7, 246, 1024 }, { 8, 247, 1024 }, + { 6, 248, 1024 }, { 7, 249, 1024 }, { 7, 250, 1024 }, { 8, 251, 1024 }, { 7, 252, 1024 }, { 8, 253, 1024 }, { 8, 254, 1024 }, { 9, 255, 1024 }, + { 2, 256, 1024 }, { 3, 257, 1024 }, { 3, 258, 1024 }, { 4, 259, 1024 }, { 3, 260, 1024 }, { 4, 261, 1024 }, { 4, 262, 1024 }, { 5, 263, 1024 }, + { 3, 264, 1024 }, { 4, 265, 1024 }, { 4, 266, 1024 }, { 5, 267, 1024 }, { 4, 268, 1024 }, { 5, 269, 1024 }, { 5, 270, 1024 }, { 6, 271, 1024 }, + { 3, 272, 1024 }, { 4, 273, 1024 }, { 4, 274, 1024 }, { 5, 275, 1024 }, { 4, 276, 1024 }, { 5, 277, 1024 }, { 5, 278, 1024 }, { 6, 279, 1024 }, + { 4, 280, 1024 }, { 5, 281, 1024 }, { 5, 282, 1024 }, { 6, 283, 1024 }, { 5, 284, 1024 }, { 6, 285, 1024 }, { 6, 286, 1024 }, { 7, 287, 1024 }, + { 3, 288, 1024 }, { 4, 289, 1024 }, { 4, 290, 1024 }, { 5, 291, 1024 }, { 4, 292, 1024 }, { 5, 293, 1024 }, { 5, 294, 1024 }, { 6, 295, 1024 }, + { 4, 296, 1024 }, { 5, 297, 1024 }, { 5, 298, 1024 }, { 6, 299, 1024 }, { 5, 300, 1024 }, { 6, 301, 1024 }, { 6, 302, 1024 }, { 7, 303, 1024 }, + { 4, 304, 1024 }, { 5, 305, 1024 }, { 5, 306, 1024 }, { 6, 307, 1024 }, { 5, 308, 1024 }, { 6, 309, 1024 }, { 6, 310, 1024 }, { 7, 311, 1024 }, + { 5, 312, 1024 }, { 6, 313, 1024 }, { 6, 314, 1024 }, { 7, 315, 1024 }, { 6, 316, 1024 }, { 7, 317, 1024 }, { 7, 318, 1024 }, { 8, 319, 1024 }, + { 3, 320, 1024 }, { 4, 321, 1024 }, { 4, 322, 1024 }, { 5, 323, 1024 }, { 4, 324, 1024 }, { 5, 325, 1024 }, { 5, 326, 1024 }, { 6, 327, 1024 }, + { 4, 328, 1024 }, { 5, 329, 1024 }, { 5, 330, 1024 }, { 6, 331, 1024 }, { 5, 332, 1024 }, { 6, 333, 1024 }, { 6, 334, 1024 }, { 7, 335, 1024 }, + { 4, 336, 1024 }, { 5, 337, 1024 }, { 5, 338, 1024 }, { 6, 339, 1024 }, { 5, 340, 1024 }, { 6, 341, 1024 }, { 6, 342, 1024 }, { 7, 343, 1024 }, + { 5, 344, 1024 }, { 6, 345, 1024 }, { 6, 346, 1024 }, { 7, 347, 1024 }, { 6, 348, 1024 }, { 7, 349, 1024 }, { 7, 350, 1024 }, { 8, 351, 1024 }, + { 4, 352, 1024 }, { 5, 353, 1024 }, { 5, 354, 1024 }, { 6, 355, 1024 }, { 5, 356, 1024 }, { 6, 357, 1024 }, { 6, 358, 1024 }, { 7, 359, 1024 }, + { 5, 360, 1024 }, { 6, 361, 1024 }, { 6, 362, 1024 }, { 7, 363, 1024 }, { 6, 364, 1024 }, { 7, 365, 1024 }, { 7, 366, 1024 }, { 8, 367, 1024 }, + { 5, 368, 1024 }, { 6, 369, 1024 }, { 6, 370, 1024 }, { 7, 371, 1024 }, { 6, 372, 1024 }, { 7, 373, 1024 }, { 7, 374, 1024 }, { 8, 375, 1024 }, + { 6, 376, 1024 }, { 7, 377, 1024 }, { 7, 378, 1024 }, { 8, 379, 1024 }, { 7, 380, 1024 }, { 8, 381, 1024 }, { 8, 382, 1024 }, { 9, 383, 1024 }, + { 3, 384, 1024 }, { 4, 385, 1024 }, { 4, 386, 1024 }, { 5, 387, 1024 }, { 4, 388, 1024 }, { 5, 389, 1024 }, { 5, 390, 1024 }, { 6, 391, 1024 }, + { 4, 392, 1024 }, { 5, 393, 1024 }, { 5, 394, 1024 }, { 6, 395, 1024 }, { 5, 396, 1024 }, { 6, 397, 1024 }, { 6, 398, 1024 }, { 7, 399, 1024 }, + { 4, 400, 1024 }, { 5, 401, 1024 }, { 5, 402, 1024 }, { 6, 403, 1024 }, { 5, 404, 1024 }, { 6, 405, 1024 }, { 6, 406, 1024 }, { 7, 407, 1024 }, + { 5, 408, 1024 }, { 6, 409, 1024 }, { 6, 410, 1024 }, { 7, 411, 1024 }, { 6, 412, 1024 }, { 7, 413, 1024 }, { 7, 414, 1024 }, { 8, 415, 1024 }, + { 4, 416, 1024 }, { 5, 417, 1024 }, { 5, 418, 1024 }, { 6, 419, 1024 }, { 5, 420, 1024 }, { 6, 421, 1024 }, { 6, 422, 1024 }, { 7, 423, 1024 }, + { 5, 424, 1024 }, { 6, 425, 1024 }, { 6, 426, 1024 }, { 7, 427, 1024 }, { 6, 428, 1024 }, { 7, 429, 1024 }, { 7, 430, 1024 }, { 8, 431, 1024 }, + { 5, 432, 1024 }, { 6, 433, 1024 }, { 6, 434, 1024 }, { 7, 435, 1024 }, { 6, 436, 1024 }, { 7, 437, 1024 }, { 7, 438, 1024 }, { 8, 439, 1024 }, + { 6, 440, 1024 }, { 7, 441, 1024 }, { 7, 442, 1024 }, { 8, 443, 1024 }, { 7, 444, 1024 }, { 8, 445, 1024 }, { 8, 446, 1024 }, { 9, 447, 1024 }, + { 4, 448, 1024 }, { 5, 449, 1024 }, { 5, 450, 1024 }, { 6, 451, 1024 }, { 5, 452, 1024 }, { 6, 453, 1024 }, { 6, 454, 1024 }, { 7, 455, 1024 }, + { 5, 456, 1024 }, { 6, 457, 1024 }, { 6, 458, 1024 }, { 7, 459, 1024 }, { 6, 460, 1024 }, { 7, 461, 1024 }, { 7, 462, 1024 }, { 8, 463, 1024 }, + { 5, 464, 1024 }, { 6, 465, 1024 }, { 6, 466, 1024 }, { 7, 467, 1024 }, { 6, 468, 1024 }, { 7, 469, 1024 }, { 7, 470, 1024 }, { 8, 471, 1024 }, + { 6, 472, 1024 }, { 7, 473, 1024 }, { 7, 474, 1024 }, { 8, 475, 1024 }, { 7, 476, 1024 }, { 8, 477, 1024 }, { 8, 478, 1024 }, { 9, 479, 1024 }, + { 5, 480, 1024 }, { 6, 481, 1024 }, { 6, 482, 1024 }, { 7, 483, 1024 }, { 6, 484, 1024 }, { 7, 485, 1024 }, { 7, 486, 1024 }, { 8, 487, 1024 }, + { 6, 488, 1024 }, { 7, 489, 1024 }, { 7, 490, 1024 }, { 8, 491, 1024 }, { 7, 492, 1024 }, { 8, 493, 1024 }, { 8, 494, 1024 }, { 9, 495, 1024 }, + { 6, 496, 1024 }, { 7, 497, 1024 }, { 7, 498, 1024 }, { 8, 499, 1024 }, { 7, 500, 1024 }, { 8, 501, 1024 }, { 8, 502, 1024 }, { 9, 503, 1024 }, + { 7, 504, 1024 }, { 8, 505, 1024 }, { 8, 506, 1024 }, { 9, 507, 1024 }, { 8, 508, 1024 }, { 9, 509, 1024 }, { 9, 510, 1024 }, { 10, 511, 1024 }, + { 2, 512, 1024 }, { 3, 513, 1024 }, { 3, 514, 1024 }, { 4, 515, 1024 }, { 3, 516, 1024 }, { 4, 517, 1024 }, { 4, 518, 1024 }, { 5, 519, 1024 }, + { 3, 520, 1024 }, { 4, 521, 1024 }, { 4, 522, 1024 }, { 5, 523, 1024 }, { 4, 524, 1024 }, { 5, 525, 1024 }, { 5, 526, 1024 }, { 6, 527, 1024 }, + { 3, 528, 1024 }, { 4, 529, 1024 }, { 4, 530, 1024 }, { 5, 531, 1024 }, { 4, 532, 1024 }, { 5, 533, 1024 }, { 5, 534, 1024 }, { 6, 535, 1024 }, + { 4, 536, 1024 }, { 5, 537, 1024 }, { 5, 538, 1024 }, { 6, 539, 1024 }, { 5, 540, 1024 }, { 6, 541, 1024 }, { 6, 542, 1024 }, { 7, 543, 1024 }, + { 3, 544, 1024 }, { 4, 545, 1024 }, { 4, 546, 1024 }, { 5, 547, 1024 }, { 4, 548, 1024 }, { 5, 549, 1024 }, { 5, 550, 1024 }, { 6, 551, 1024 }, + { 4, 552, 1024 }, { 5, 553, 1024 }, { 5, 554, 1024 }, { 6, 555, 1024 }, { 5, 556, 1024 }, { 6, 557, 1024 }, { 6, 558, 1024 }, { 7, 559, 1024 }, + { 4, 560, 1024 }, { 5, 561, 1024 }, { 5, 562, 1024 }, { 6, 563, 1024 }, { 5, 564, 1024 }, { 6, 565, 1024 }, { 6, 566, 1024 }, { 7, 567, 1024 }, + { 5, 568, 1024 }, { 6, 569, 1024 }, { 6, 570, 1024 }, { 7, 571, 1024 }, { 6, 572, 1024 }, { 7, 573, 1024 }, { 7, 574, 1024 }, { 8, 575, 1024 }, + { 3, 576, 1024 }, { 4, 577, 1024 }, { 4, 578, 1024 }, { 5, 579, 1024 }, { 4, 580, 1024 }, { 5, 581, 1024 }, { 5, 582, 1024 }, { 6, 583, 1024 }, + { 4, 584, 1024 }, { 5, 585, 1024 }, { 5, 586, 1024 }, { 6, 587, 1024 }, { 5, 588, 1024 }, { 6, 589, 1024 }, { 6, 590, 1024 }, { 7, 591, 1024 }, + { 4, 592, 1024 }, { 5, 593, 1024 }, { 5, 594, 1024 }, { 6, 595, 1024 }, { 5, 596, 1024 }, { 6, 597, 1024 }, { 6, 598, 1024 }, { 7, 599, 1024 }, + { 5, 600, 1024 }, { 6, 601, 1024 }, { 6, 602, 1024 }, { 7, 603, 1024 }, { 6, 604, 1024 }, { 7, 605, 1024 }, { 7, 606, 1024 }, { 8, 607, 1024 }, + { 4, 608, 1024 }, { 5, 609, 1024 }, { 5, 610, 1024 }, { 6, 611, 1024 }, { 5, 612, 1024 }, { 6, 613, 1024 }, { 6, 614, 1024 }, { 7, 615, 1024 }, + { 5, 616, 1024 }, { 6, 617, 1024 }, { 6, 618, 1024 }, { 7, 619, 1024 }, { 6, 620, 1024 }, { 7, 621, 1024 }, { 7, 622, 1024 }, { 8, 623, 1024 }, + { 5, 624, 1024 }, { 6, 625, 1024 }, { 6, 626, 1024 }, { 7, 627, 1024 }, { 6, 628, 1024 }, { 7, 629, 1024 }, { 7, 630, 1024 }, { 8, 631, 1024 }, + { 6, 632, 1024 }, { 7, 633, 1024 }, { 7, 634, 1024 }, { 8, 635, 1024 }, { 7, 636, 1024 }, { 8, 637, 1024 }, { 8, 638, 1024 }, { 9, 639, 1024 }, + { 3, 640, 1024 }, { 4, 641, 1024 }, { 4, 642, 1024 }, { 5, 643, 1024 }, { 4, 644, 1024 }, { 5, 645, 1024 }, { 5, 646, 1024 }, { 6, 647, 1024 }, + { 4, 648, 1024 }, { 5, 649, 1024 }, { 5, 650, 1024 }, { 6, 651, 1024 }, { 5, 652, 1024 }, { 6, 653, 1024 }, { 6, 654, 1024 }, { 7, 655, 1024 }, + { 4, 656, 1024 }, { 5, 657, 1024 }, { 5, 658, 1024 }, { 6, 659, 1024 }, { 5, 660, 1024 }, { 6, 661, 1024 }, { 6, 662, 1024 }, { 7, 663, 1024 }, + { 5, 664, 1024 }, { 6, 665, 1024 }, { 6, 666, 1024 }, { 7, 667, 1024 }, { 6, 668, 1024 }, { 7, 669, 1024 }, { 7, 670, 1024 }, { 8, 671, 1024 }, + { 4, 672, 1024 }, { 5, 673, 1024 }, { 5, 674, 1024 }, { 6, 675, 1024 }, { 5, 676, 1024 }, { 6, 677, 1024 }, { 6, 678, 1024 }, { 7, 679, 1024 }, + { 5, 680, 1024 }, { 6, 681, 1024 }, { 6, 682, 1024 }, { 7, 683, 1024 }, { 6, 684, 1024 }, { 7, 685, 1024 }, { 7, 686, 1024 }, { 8, 687, 1024 }, + { 5, 688, 1024 }, { 6, 689, 1024 }, { 6, 690, 1024 }, { 7, 691, 1024 }, { 6, 692, 1024 }, { 7, 693, 1024 }, { 7, 694, 1024 }, { 8, 695, 1024 }, + { 6, 696, 1024 }, { 7, 697, 1024 }, { 7, 698, 1024 }, { 8, 699, 1024 }, { 7, 700, 1024 }, { 8, 701, 1024 }, { 8, 702, 1024 }, { 9, 703, 1024 }, + { 4, 704, 1024 }, { 5, 705, 1024 }, { 5, 706, 1024 }, { 6, 707, 1024 }, { 5, 708, 1024 }, { 6, 709, 1024 }, { 6, 710, 1024 }, { 7, 711, 1024 }, + { 5, 712, 1024 }, { 6, 713, 1024 }, { 6, 714, 1024 }, { 7, 715, 1024 }, { 6, 716, 1024 }, { 7, 717, 1024 }, { 7, 718, 1024 }, { 8, 719, 1024 }, + { 5, 720, 1024 }, { 6, 721, 1024 }, { 6, 722, 1024 }, { 7, 723, 1024 }, { 6, 724, 1024 }, { 7, 725, 1024 }, { 7, 726, 1024 }, { 8, 727, 1024 }, + { 6, 728, 1024 }, { 7, 729, 1024 }, { 7, 730, 1024 }, { 8, 731, 1024 }, { 7, 732, 1024 }, { 8, 733, 1024 }, { 8, 734, 1024 }, { 9, 735, 1024 }, + { 5, 736, 1024 }, { 6, 737, 1024 }, { 6, 738, 1024 }, { 7, 739, 1024 }, { 6, 740, 1024 }, { 7, 741, 1024 }, { 7, 742, 1024 }, { 8, 743, 1024 }, + { 6, 744, 1024 }, { 7, 745, 1024 }, { 7, 746, 1024 }, { 8, 747, 1024 }, { 7, 748, 1024 }, { 8, 749, 1024 }, { 8, 750, 1024 }, { 9, 751, 1024 }, + { 6, 752, 1024 }, { 7, 753, 1024 }, { 7, 754, 1024 }, { 8, 755, 1024 }, { 7, 756, 1024 }, { 8, 757, 1024 }, { 8, 758, 1024 }, { 9, 759, 1024 }, + { 7, 760, 1024 }, { 8, 761, 1024 }, { 8, 762, 1024 }, { 9, 763, 1024 }, { 8, 764, 1024 }, { 9, 765, 1024 }, { 9, 766, 1024 }, { 10, 767, 1024 }, + { 3, 768, 1024 }, { 4, 769, 1024 }, { 4, 770, 1024 }, { 5, 771, 1024 }, { 4, 772, 1024 }, { 5, 773, 1024 }, { 5, 774, 1024 }, { 6, 775, 1024 }, + { 4, 776, 1024 }, { 5, 777, 1024 }, { 5, 778, 1024 }, { 6, 779, 1024 }, { 5, 780, 1024 }, { 6, 781, 1024 }, { 6, 782, 1024 }, { 7, 783, 1024 }, + { 4, 784, 1024 }, { 5, 785, 1024 }, { 5, 786, 1024 }, { 6, 787, 1024 }, { 5, 788, 1024 }, { 6, 789, 1024 }, { 6, 790, 1024 }, { 7, 791, 1024 }, + { 5, 792, 1024 }, { 6, 793, 1024 }, { 6, 794, 1024 }, { 7, 795, 1024 }, { 6, 796, 1024 }, { 7, 797, 1024 }, { 7, 798, 1024 }, { 8, 799, 1024 }, + { 4, 800, 1024 }, { 5, 801, 1024 }, { 5, 802, 1024 }, { 6, 803, 1024 }, { 5, 804, 1024 }, { 6, 805, 1024 }, { 6, 806, 1024 }, { 7, 807, 1024 }, + { 5, 808, 1024 }, { 6, 809, 1024 }, { 6, 810, 1024 }, { 7, 811, 1024 }, { 6, 812, 1024 }, { 7, 813, 1024 }, { 7, 814, 1024 }, { 8, 815, 1024 }, + { 5, 816, 1024 }, { 6, 817, 1024 }, { 6, 818, 1024 }, { 7, 819, 1024 }, { 6, 820, 1024 }, { 7, 821, 1024 }, { 7, 822, 1024 }, { 8, 823, 1024 }, + { 6, 824, 1024 }, { 7, 825, 1024 }, { 7, 826, 1024 }, { 8, 827, 1024 }, { 7, 828, 1024 }, { 8, 829, 1024 }, { 8, 830, 1024 }, { 9, 831, 1024 }, + { 4, 832, 1024 }, { 5, 833, 1024 }, { 5, 834, 1024 }, { 6, 835, 1024 }, { 5, 836, 1024 }, { 6, 837, 1024 }, { 6, 838, 1024 }, { 7, 839, 1024 }, + { 5, 840, 1024 }, { 6, 841, 1024 }, { 6, 842, 1024 }, { 7, 843, 1024 }, { 6, 844, 1024 }, { 7, 845, 1024 }, { 7, 846, 1024 }, { 8, 847, 1024 }, + { 5, 848, 1024 }, { 6, 849, 1024 }, { 6, 850, 1024 }, { 7, 851, 1024 }, { 6, 852, 1024 }, { 7, 853, 1024 }, { 7, 854, 1024 }, { 8, 855, 1024 }, + { 6, 856, 1024 }, { 7, 857, 1024 }, { 7, 858, 1024 }, { 8, 859, 1024 }, { 7, 860, 1024 }, { 8, 861, 1024 }, { 8, 862, 1024 }, { 9, 863, 1024 }, + { 5, 864, 1024 }, { 6, 865, 1024 }, { 6, 866, 1024 }, { 7, 867, 1024 }, { 6, 868, 1024 }, { 7, 869, 1024 }, { 7, 870, 1024 }, { 8, 871, 1024 }, + { 6, 872, 1024 }, { 7, 873, 1024 }, { 7, 874, 1024 }, { 8, 875, 1024 }, { 7, 876, 1024 }, { 8, 877, 1024 }, { 8, 878, 1024 }, { 9, 879, 1024 }, + { 6, 880, 1024 }, { 7, 881, 1024 }, { 7, 882, 1024 }, { 8, 883, 1024 }, { 7, 884, 1024 }, { 8, 885, 1024 }, { 8, 886, 1024 }, { 9, 887, 1024 }, + { 7, 888, 1024 }, { 8, 889, 1024 }, { 8, 890, 1024 }, { 9, 891, 1024 }, { 8, 892, 1024 }, { 9, 893, 1024 }, { 9, 894, 1024 }, { 10, 895, 1024 }, + { 4, 896, 1024 }, { 5, 897, 1024 }, { 5, 898, 1024 }, { 6, 899, 1024 }, { 5, 900, 1024 }, { 6, 901, 1024 }, { 6, 902, 1024 }, { 7, 903, 1024 }, + { 5, 904, 1024 }, { 6, 905, 1024 }, { 6, 906, 1024 }, { 7, 907, 1024 }, { 6, 908, 1024 }, { 7, 909, 1024 }, { 7, 910, 1024 }, { 8, 911, 1024 }, + { 5, 912, 1024 }, { 6, 913, 1024 }, { 6, 914, 1024 }, { 7, 915, 1024 }, { 6, 916, 1024 }, { 7, 917, 1024 }, { 7, 918, 1024 }, { 8, 919, 1024 }, + { 6, 920, 1024 }, { 7, 921, 1024 }, { 7, 922, 1024 }, { 8, 923, 1024 }, { 7, 924, 1024 }, { 8, 925, 1024 }, { 8, 926, 1024 }, { 9, 927, 1024 }, + { 5, 928, 1024 }, { 6, 929, 1024 }, { 6, 930, 1024 }, { 7, 931, 1024 }, { 6, 932, 1024 }, { 7, 933, 1024 }, { 7, 934, 1024 }, { 8, 935, 1024 }, + { 6, 936, 1024 }, { 7, 937, 1024 }, { 7, 938, 1024 }, { 8, 939, 1024 }, { 7, 940, 1024 }, { 8, 941, 1024 }, { 8, 942, 1024 }, { 9, 943, 1024 }, + { 6, 944, 1024 }, { 7, 945, 1024 }, { 7, 946, 1024 }, { 8, 947, 1024 }, { 7, 948, 1024 }, { 8, 949, 1024 }, { 8, 950, 1024 }, { 9, 951, 1024 }, + { 7, 952, 1024 }, { 8, 953, 1024 }, { 8, 954, 1024 }, { 9, 955, 1024 }, { 8, 956, 1024 }, { 9, 957, 1024 }, { 9, 958, 1024 }, { 10, 959, 1024 }, + { 5, 960, 1024 }, { 6, 961, 1024 }, { 6, 962, 1024 }, { 7, 963, 1024 }, { 6, 964, 1024 }, { 7, 965, 1024 }, { 7, 966, 1024 }, { 8, 967, 1024 }, + { 6, 968, 1024 }, { 7, 969, 1024 }, { 7, 970, 1024 }, { 8, 971, 1024 }, { 7, 972, 1024 }, { 8, 973, 1024 }, { 8, 974, 1024 }, { 9, 975, 1024 }, + { 6, 976, 1024 }, { 7, 977, 1024 }, { 7, 978, 1024 }, { 8, 979, 1024 }, { 7, 980, 1024 }, { 8, 981, 1024 }, { 8, 982, 1024 }, { 9, 983, 1024 }, + { 7, 984, 1024 }, { 8, 985, 1024 }, { 8, 986, 1024 }, { 9, 987, 1024 }, { 8, 988, 1024 }, { 9, 989, 1024 }, { 9, 990, 1024 }, { 10, 991, 1024 }, + { 6, 992, 1024 }, { 7, 993, 1024 }, { 7, 994, 1024 }, { 8, 995, 1024 }, { 7, 996, 1024 }, { 8, 997, 1024 }, { 8, 998, 1024 }, { 9, 999, 1024 }, + { 7, 1000, 1024 }, { 8, 1001, 1024 }, { 8, 1002, 1024 }, { 9, 1003, 1024 }, { 8, 1004, 1024 }, { 9, 1005, 1024 }, { 9, 1006, 1024 }, { 10, 1007, 1024 }, + { 7, 1008, 1024 }, { 8, 1009, 1024 }, { 8, 1010, 1024 }, { 9, 1011, 1024 }, { 8, 1012, 1024 }, { 9, 1013, 1024 }, { 9, 1014, 1024 }, { 10, 1015, 1024 }, + { 8, 1016, 1024 }, { 9, 1017, 1024 }, { 9, 1018, 1024 }, { 10, 1019, 1024 }, { 9, 1020, 1024 }, { 10, 1021, 1024 }, { 10, 1022, 1024 }, { 11, 1023, 1024 }, #if FP_LUT > 11 - { 1, 0, 0 }, { 2, 1, 2048 }, { 2, 2, 2048 }, { 3, 3, 2048 }, { 2, 4, 2048 }, { 3, 5, 2048 }, { 3, 6, 2048 }, { 4, 7, 2048 }, - { 2, 8, 2048 }, { 3, 9, 2048 }, { 3, 10, 2048 }, { 4, 11, 2048 }, { 3, 12, 2048 }, { 4, 13, 2048 }, { 4, 14, 2048 }, { 5, 15, 2048 }, - { 2, 16, 2048 }, { 3, 17, 2048 }, { 3, 18, 2048 }, { 4, 19, 2048 }, { 3, 20, 2048 }, { 4, 21, 2048 }, { 4, 22, 2048 }, { 5, 23, 2048 }, - { 3, 24, 2048 }, { 4, 25, 2048 }, { 4, 26, 2048 }, { 5, 27, 2048 }, { 4, 28, 2048 }, { 5, 29, 2048 }, { 5, 30, 2048 }, { 6, 31, 2048 }, - { 2, 32, 2048 }, { 3, 33, 2048 }, { 3, 34, 2048 }, { 4, 35, 2048 }, { 3, 36, 2048 }, { 4, 37, 2048 }, { 4, 38, 2048 }, { 5, 39, 2048 }, - { 3, 40, 2048 }, { 4, 41, 2048 }, { 4, 42, 2048 }, { 5, 43, 2048 }, { 4, 44, 2048 }, { 5, 45, 2048 }, { 5, 46, 2048 }, { 6, 47, 2048 }, - { 3, 48, 2048 }, { 4, 49, 2048 }, { 4, 50, 2048 }, { 5, 51, 2048 }, { 4, 52, 2048 }, { 5, 53, 2048 }, { 5, 54, 2048 }, { 6, 55, 2048 }, - { 4, 56, 2048 }, { 5, 57, 2048 }, { 5, 58, 2048 }, { 6, 59, 2048 }, { 5, 60, 2048 }, { 6, 61, 2048 }, { 6, 62, 2048 }, { 7, 63, 2048 }, - { 2, 64, 2048 }, { 3, 65, 2048 }, { 3, 66, 2048 }, { 4, 67, 2048 }, { 3, 68, 2048 }, { 4, 69, 2048 }, { 4, 70, 2048 }, { 5, 71, 2048 }, - { 3, 72, 2048 }, { 4, 73, 2048 }, { 4, 74, 2048 }, { 5, 75, 2048 }, { 4, 76, 2048 }, { 5, 77, 2048 }, { 5, 78, 2048 }, { 6, 79, 2048 }, - { 3, 80, 2048 }, { 4, 81, 2048 }, { 4, 82, 2048 }, { 5, 83, 2048 }, { 4, 84, 2048 }, { 5, 85, 2048 }, { 5, 86, 2048 }, { 6, 87, 2048 }, - { 4, 88, 2048 }, { 5, 89, 2048 }, { 5, 90, 2048 }, { 6, 91, 2048 }, { 5, 92, 2048 }, { 6, 93, 2048 }, { 6, 94, 2048 }, { 7, 95, 2048 }, - { 3, 96, 2048 }, { 4, 97, 2048 }, { 4, 98, 2048 }, { 5, 99, 2048 }, { 4, 100, 2048 }, { 5, 101, 2048 }, { 5, 102, 2048 }, { 6, 103, 2048 }, - { 4, 104, 2048 }, { 5, 105, 2048 }, { 5, 106, 2048 }, { 6, 107, 2048 }, { 5, 108, 2048 }, { 6, 109, 2048 }, { 6, 110, 2048 }, { 7, 111, 2048 }, - { 4, 112, 2048 }, { 5, 113, 2048 }, { 5, 114, 2048 }, { 6, 115, 2048 }, { 5, 116, 2048 }, { 6, 117, 2048 }, { 6, 118, 2048 }, { 7, 119, 2048 }, - { 5, 120, 2048 }, { 6, 121, 2048 }, { 6, 122, 2048 }, { 7, 123, 2048 }, { 6, 124, 2048 }, { 7, 125, 2048 }, { 7, 126, 2048 }, { 8, 127, 2048 }, - { 2, 128, 2048 }, { 3, 129, 2048 }, { 3, 130, 2048 }, { 4, 131, 2048 }, { 3, 132, 2048 }, { 4, 133, 2048 }, { 4, 134, 2048 }, { 5, 135, 2048 }, - { 3, 136, 2048 }, { 4, 137, 2048 }, { 4, 138, 2048 }, { 5, 139, 2048 }, { 4, 140, 2048 }, { 5, 141, 2048 }, { 5, 142, 2048 }, { 6, 143, 2048 }, - { 3, 144, 2048 }, { 4, 145, 2048 }, { 4, 146, 2048 }, { 5, 147, 2048 }, { 4, 148, 2048 }, { 5, 149, 2048 }, { 5, 150, 2048 }, { 6, 151, 2048 }, - { 4, 152, 2048 }, { 5, 153, 2048 }, { 5, 154, 2048 }, { 6, 155, 2048 }, { 5, 156, 2048 }, { 6, 157, 2048 }, { 6, 158, 2048 }, { 7, 159, 2048 }, - { 3, 160, 2048 }, { 4, 161, 2048 }, { 4, 162, 2048 }, { 5, 163, 2048 }, { 4, 164, 2048 }, { 5, 165, 2048 }, { 5, 166, 2048 }, { 6, 167, 2048 }, - { 4, 168, 2048 }, { 5, 169, 2048 }, { 5, 170, 2048 }, { 6, 171, 2048 }, { 5, 172, 2048 }, { 6, 173, 2048 }, { 6, 174, 2048 }, { 7, 175, 2048 }, - { 4, 176, 2048 }, { 5, 177, 2048 }, { 5, 178, 2048 }, { 6, 179, 2048 }, { 5, 180, 2048 }, { 6, 181, 2048 }, { 6, 182, 2048 }, { 7, 183, 2048 }, - { 5, 184, 2048 }, { 6, 185, 2048 }, { 6, 186, 2048 }, { 7, 187, 2048 }, { 6, 188, 2048 }, { 7, 189, 2048 }, { 7, 190, 2048 }, { 8, 191, 2048 }, - { 3, 192, 2048 }, { 4, 193, 2048 }, { 4, 194, 2048 }, { 5, 195, 2048 }, { 4, 196, 2048 }, { 5, 197, 2048 }, { 5, 198, 2048 }, { 6, 199, 2048 }, - { 4, 200, 2048 }, { 5, 201, 2048 }, { 5, 202, 2048 }, { 6, 203, 2048 }, { 5, 204, 2048 }, { 6, 205, 2048 }, { 6, 206, 2048 }, { 7, 207, 2048 }, - { 4, 208, 2048 }, { 5, 209, 2048 }, { 5, 210, 2048 }, { 6, 211, 2048 }, { 5, 212, 2048 }, { 6, 213, 2048 }, { 6, 214, 2048 }, { 7, 215, 2048 }, - { 5, 216, 2048 }, { 6, 217, 2048 }, { 6, 218, 2048 }, { 7, 219, 2048 }, { 6, 220, 2048 }, { 7, 221, 2048 }, { 7, 222, 2048 }, { 8, 223, 2048 }, - { 4, 224, 2048 }, { 5, 225, 2048 }, { 5, 226, 2048 }, { 6, 227, 2048 }, { 5, 228, 2048 }, { 6, 229, 2048 }, { 6, 230, 2048 }, { 7, 231, 2048 }, - { 5, 232, 2048 }, { 6, 233, 2048 }, { 6, 234, 2048 }, { 7, 235, 2048 }, { 6, 236, 2048 }, { 7, 237, 2048 }, { 7, 238, 2048 }, { 8, 239, 2048 }, - { 5, 240, 2048 }, { 6, 241, 2048 }, { 6, 242, 2048 }, { 7, 243, 2048 }, { 6, 244, 2048 }, { 7, 245, 2048 }, { 7, 246, 2048 }, { 8, 247, 2048 }, - { 6, 248, 2048 }, { 7, 249, 2048 }, { 7, 250, 2048 }, { 8, 251, 2048 }, { 7, 252, 2048 }, { 8, 253, 2048 }, { 8, 254, 2048 }, { 9, 255, 2048 }, - { 2, 256, 2048 }, { 3, 257, 2048 }, { 3, 258, 2048 }, { 4, 259, 2048 }, { 3, 260, 2048 }, { 4, 261, 2048 }, { 4, 262, 2048 }, { 5, 263, 2048 }, - { 3, 264, 2048 }, { 4, 265, 2048 }, { 4, 266, 2048 }, { 5, 267, 2048 }, { 4, 268, 2048 }, { 5, 269, 2048 }, { 5, 270, 2048 }, { 6, 271, 2048 }, - { 3, 272, 2048 }, { 4, 273, 2048 }, { 4, 274, 2048 }, { 5, 275, 2048 }, { 4, 276, 2048 }, { 5, 277, 2048 }, { 5, 278, 2048 }, { 6, 279, 2048 }, - { 4, 280, 2048 }, { 5, 281, 2048 }, { 5, 282, 2048 }, { 6, 283, 2048 }, { 5, 284, 2048 }, { 6, 285, 2048 }, { 6, 286, 2048 }, { 7, 287, 2048 }, - { 3, 288, 2048 }, { 4, 289, 2048 }, { 4, 290, 2048 }, { 5, 291, 2048 }, { 4, 292, 2048 }, { 5, 293, 2048 }, { 5, 294, 2048 }, { 6, 295, 2048 }, - { 4, 296, 2048 }, { 5, 297, 2048 }, { 5, 298, 2048 }, { 6, 299, 2048 }, { 5, 300, 2048 }, { 6, 301, 2048 }, { 6, 302, 2048 }, { 7, 303, 2048 }, - { 4, 304, 2048 }, { 5, 305, 2048 }, { 5, 306, 2048 }, { 6, 307, 2048 }, { 5, 308, 2048 }, { 6, 309, 2048 }, { 6, 310, 2048 }, { 7, 311, 2048 }, - { 5, 312, 2048 }, { 6, 313, 2048 }, { 6, 314, 2048 }, { 7, 315, 2048 }, { 6, 316, 2048 }, { 7, 317, 2048 }, { 7, 318, 2048 }, { 8, 319, 2048 }, - { 3, 320, 2048 }, { 4, 321, 2048 }, { 4, 322, 2048 }, { 5, 323, 2048 }, { 4, 324, 2048 }, { 5, 325, 2048 }, { 5, 326, 2048 }, { 6, 327, 2048 }, - { 4, 328, 2048 }, { 5, 329, 2048 }, { 5, 330, 2048 }, { 6, 331, 2048 }, { 5, 332, 2048 }, { 6, 333, 2048 }, { 6, 334, 2048 }, { 7, 335, 2048 }, - { 4, 336, 2048 }, { 5, 337, 2048 }, { 5, 338, 2048 }, { 6, 339, 2048 }, { 5, 340, 2048 }, { 6, 341, 2048 }, { 6, 342, 2048 }, { 7, 343, 2048 }, - { 5, 344, 2048 }, { 6, 345, 2048 }, { 6, 346, 2048 }, { 7, 347, 2048 }, { 6, 348, 2048 }, { 7, 349, 2048 }, { 7, 350, 2048 }, { 8, 351, 2048 }, - { 4, 352, 2048 }, { 5, 353, 2048 }, { 5, 354, 2048 }, { 6, 355, 2048 }, { 5, 356, 2048 }, { 6, 357, 2048 }, { 6, 358, 2048 }, { 7, 359, 2048 }, - { 5, 360, 2048 }, { 6, 361, 2048 }, { 6, 362, 2048 }, { 7, 363, 2048 }, { 6, 364, 2048 }, { 7, 365, 2048 }, { 7, 366, 2048 }, { 8, 367, 2048 }, - { 5, 368, 2048 }, { 6, 369, 2048 }, { 6, 370, 2048 }, { 7, 371, 2048 }, { 6, 372, 2048 }, { 7, 373, 2048 }, { 7, 374, 2048 }, { 8, 375, 2048 }, - { 6, 376, 2048 }, { 7, 377, 2048 }, { 7, 378, 2048 }, { 8, 379, 2048 }, { 7, 380, 2048 }, { 8, 381, 2048 }, { 8, 382, 2048 }, { 9, 383, 2048 }, - { 3, 384, 2048 }, { 4, 385, 2048 }, { 4, 386, 2048 }, { 5, 387, 2048 }, { 4, 388, 2048 }, { 5, 389, 2048 }, { 5, 390, 2048 }, { 6, 391, 2048 }, - { 4, 392, 2048 }, { 5, 393, 2048 }, { 5, 394, 2048 }, { 6, 395, 2048 }, { 5, 396, 2048 }, { 6, 397, 2048 }, { 6, 398, 2048 }, { 7, 399, 2048 }, - { 4, 400, 2048 }, { 5, 401, 2048 }, { 5, 402, 2048 }, { 6, 403, 2048 }, { 5, 404, 2048 }, { 6, 405, 2048 }, { 6, 406, 2048 }, { 7, 407, 2048 }, - { 5, 408, 2048 }, { 6, 409, 2048 }, { 6, 410, 2048 }, { 7, 411, 2048 }, { 6, 412, 2048 }, { 7, 413, 2048 }, { 7, 414, 2048 }, { 8, 415, 2048 }, - { 4, 416, 2048 }, { 5, 417, 2048 }, { 5, 418, 2048 }, { 6, 419, 2048 }, { 5, 420, 2048 }, { 6, 421, 2048 }, { 6, 422, 2048 }, { 7, 423, 2048 }, - { 5, 424, 2048 }, { 6, 425, 2048 }, { 6, 426, 2048 }, { 7, 427, 2048 }, { 6, 428, 2048 }, { 7, 429, 2048 }, { 7, 430, 2048 }, { 8, 431, 2048 }, - { 5, 432, 2048 }, { 6, 433, 2048 }, { 6, 434, 2048 }, { 7, 435, 2048 }, { 6, 436, 2048 }, { 7, 437, 2048 }, { 7, 438, 2048 }, { 8, 439, 2048 }, - { 6, 440, 2048 }, { 7, 441, 2048 }, { 7, 442, 2048 }, { 8, 443, 2048 }, { 7, 444, 2048 }, { 8, 445, 2048 }, { 8, 446, 2048 }, { 9, 447, 2048 }, - { 4, 448, 2048 }, { 5, 449, 2048 }, { 5, 450, 2048 }, { 6, 451, 2048 }, { 5, 452, 2048 }, { 6, 453, 2048 }, { 6, 454, 2048 }, { 7, 455, 2048 }, - { 5, 456, 2048 }, { 6, 457, 2048 }, { 6, 458, 2048 }, { 7, 459, 2048 }, { 6, 460, 2048 }, { 7, 461, 2048 }, { 7, 462, 2048 }, { 8, 463, 2048 }, - { 5, 464, 2048 }, { 6, 465, 2048 }, { 6, 466, 2048 }, { 7, 467, 2048 }, { 6, 468, 2048 }, { 7, 469, 2048 }, { 7, 470, 2048 }, { 8, 471, 2048 }, - { 6, 472, 2048 }, { 7, 473, 2048 }, { 7, 474, 2048 }, { 8, 475, 2048 }, { 7, 476, 2048 }, { 8, 477, 2048 }, { 8, 478, 2048 }, { 9, 479, 2048 }, - { 5, 480, 2048 }, { 6, 481, 2048 }, { 6, 482, 2048 }, { 7, 483, 2048 }, { 6, 484, 2048 }, { 7, 485, 2048 }, { 7, 486, 2048 }, { 8, 487, 2048 }, - { 6, 488, 2048 }, { 7, 489, 2048 }, { 7, 490, 2048 }, { 8, 491, 2048 }, { 7, 492, 2048 }, { 8, 493, 2048 }, { 8, 494, 2048 }, { 9, 495, 2048 }, - { 6, 496, 2048 }, { 7, 497, 2048 }, { 7, 498, 2048 }, { 8, 499, 2048 }, { 7, 500, 2048 }, { 8, 501, 2048 }, { 8, 502, 2048 }, { 9, 503, 2048 }, - { 7, 504, 2048 }, { 8, 505, 2048 }, { 8, 506, 2048 }, { 9, 507, 2048 }, { 8, 508, 2048 }, { 9, 509, 2048 }, { 9, 510, 2048 }, { 10, 511, 2048 }, - { 2, 512, 2048 }, { 3, 513, 2048 }, { 3, 514, 2048 }, { 4, 515, 2048 }, { 3, 516, 2048 }, { 4, 517, 2048 }, { 4, 518, 2048 }, { 5, 519, 2048 }, - { 3, 520, 2048 }, { 4, 521, 2048 }, { 4, 522, 2048 }, { 5, 523, 2048 }, { 4, 524, 2048 }, { 5, 525, 2048 }, { 5, 526, 2048 }, { 6, 527, 2048 }, - { 3, 528, 2048 }, { 4, 529, 2048 }, { 4, 530, 2048 }, { 5, 531, 2048 }, { 4, 532, 2048 }, { 5, 533, 2048 }, { 5, 534, 2048 }, { 6, 535, 2048 }, - { 4, 536, 2048 }, { 5, 537, 2048 }, { 5, 538, 2048 }, { 6, 539, 2048 }, { 5, 540, 2048 }, { 6, 541, 2048 }, { 6, 542, 2048 }, { 7, 543, 2048 }, - { 3, 544, 2048 }, { 4, 545, 2048 }, { 4, 546, 2048 }, { 5, 547, 2048 }, { 4, 548, 2048 }, { 5, 549, 2048 }, { 5, 550, 2048 }, { 6, 551, 2048 }, - { 4, 552, 2048 }, { 5, 553, 2048 }, { 5, 554, 2048 }, { 6, 555, 2048 }, { 5, 556, 2048 }, { 6, 557, 2048 }, { 6, 558, 2048 }, { 7, 559, 2048 }, - { 4, 560, 2048 }, { 5, 561, 2048 }, { 5, 562, 2048 }, { 6, 563, 2048 }, { 5, 564, 2048 }, { 6, 565, 2048 }, { 6, 566, 2048 }, { 7, 567, 2048 }, - { 5, 568, 2048 }, { 6, 569, 2048 }, { 6, 570, 2048 }, { 7, 571, 2048 }, { 6, 572, 2048 }, { 7, 573, 2048 }, { 7, 574, 2048 }, { 8, 575, 2048 }, - { 3, 576, 2048 }, { 4, 577, 2048 }, { 4, 578, 2048 }, { 5, 579, 2048 }, { 4, 580, 2048 }, { 5, 581, 2048 }, { 5, 582, 2048 }, { 6, 583, 2048 }, - { 4, 584, 2048 }, { 5, 585, 2048 }, { 5, 586, 2048 }, { 6, 587, 2048 }, { 5, 588, 2048 }, { 6, 589, 2048 }, { 6, 590, 2048 }, { 7, 591, 2048 }, - { 4, 592, 2048 }, { 5, 593, 2048 }, { 5, 594, 2048 }, { 6, 595, 2048 }, { 5, 596, 2048 }, { 6, 597, 2048 }, { 6, 598, 2048 }, { 7, 599, 2048 }, - { 5, 600, 2048 }, { 6, 601, 2048 }, { 6, 602, 2048 }, { 7, 603, 2048 }, { 6, 604, 2048 }, { 7, 605, 2048 }, { 7, 606, 2048 }, { 8, 607, 2048 }, - { 4, 608, 2048 }, { 5, 609, 2048 }, { 5, 610, 2048 }, { 6, 611, 2048 }, { 5, 612, 2048 }, { 6, 613, 2048 }, { 6, 614, 2048 }, { 7, 615, 2048 }, - { 5, 616, 2048 }, { 6, 617, 2048 }, { 6, 618, 2048 }, { 7, 619, 2048 }, { 6, 620, 2048 }, { 7, 621, 2048 }, { 7, 622, 2048 }, { 8, 623, 2048 }, - { 5, 624, 2048 }, { 6, 625, 2048 }, { 6, 626, 2048 }, { 7, 627, 2048 }, { 6, 628, 2048 }, { 7, 629, 2048 }, { 7, 630, 2048 }, { 8, 631, 2048 }, - { 6, 632, 2048 }, { 7, 633, 2048 }, { 7, 634, 2048 }, { 8, 635, 2048 }, { 7, 636, 2048 }, { 8, 637, 2048 }, { 8, 638, 2048 }, { 9, 639, 2048 }, - { 3, 640, 2048 }, { 4, 641, 2048 }, { 4, 642, 2048 }, { 5, 643, 2048 }, { 4, 644, 2048 }, { 5, 645, 2048 }, { 5, 646, 2048 }, { 6, 647, 2048 }, - { 4, 648, 2048 }, { 5, 649, 2048 }, { 5, 650, 2048 }, { 6, 651, 2048 }, { 5, 652, 2048 }, { 6, 653, 2048 }, { 6, 654, 2048 }, { 7, 655, 2048 }, - { 4, 656, 2048 }, { 5, 657, 2048 }, { 5, 658, 2048 }, { 6, 659, 2048 }, { 5, 660, 2048 }, { 6, 661, 2048 }, { 6, 662, 2048 }, { 7, 663, 2048 }, - { 5, 664, 2048 }, { 6, 665, 2048 }, { 6, 666, 2048 }, { 7, 667, 2048 }, { 6, 668, 2048 }, { 7, 669, 2048 }, { 7, 670, 2048 }, { 8, 671, 2048 }, - { 4, 672, 2048 }, { 5, 673, 2048 }, { 5, 674, 2048 }, { 6, 675, 2048 }, { 5, 676, 2048 }, { 6, 677, 2048 }, { 6, 678, 2048 }, { 7, 679, 2048 }, - { 5, 680, 2048 }, { 6, 681, 2048 }, { 6, 682, 2048 }, { 7, 683, 2048 }, { 6, 684, 2048 }, { 7, 685, 2048 }, { 7, 686, 2048 }, { 8, 687, 2048 }, - { 5, 688, 2048 }, { 6, 689, 2048 }, { 6, 690, 2048 }, { 7, 691, 2048 }, { 6, 692, 2048 }, { 7, 693, 2048 }, { 7, 694, 2048 }, { 8, 695, 2048 }, - { 6, 696, 2048 }, { 7, 697, 2048 }, { 7, 698, 2048 }, { 8, 699, 2048 }, { 7, 700, 2048 }, { 8, 701, 2048 }, { 8, 702, 2048 }, { 9, 703, 2048 }, - { 4, 704, 2048 }, { 5, 705, 2048 }, { 5, 706, 2048 }, { 6, 707, 2048 }, { 5, 708, 2048 }, { 6, 709, 2048 }, { 6, 710, 2048 }, { 7, 711, 2048 }, - { 5, 712, 2048 }, { 6, 713, 2048 }, { 6, 714, 2048 }, { 7, 715, 2048 }, { 6, 716, 2048 }, { 7, 717, 2048 }, { 7, 718, 2048 }, { 8, 719, 2048 }, - { 5, 720, 2048 }, { 6, 721, 2048 }, { 6, 722, 2048 }, { 7, 723, 2048 }, { 6, 724, 2048 }, { 7, 725, 2048 }, { 7, 726, 2048 }, { 8, 727, 2048 }, - { 6, 728, 2048 }, { 7, 729, 2048 }, { 7, 730, 2048 }, { 8, 731, 2048 }, { 7, 732, 2048 }, { 8, 733, 2048 }, { 8, 734, 2048 }, { 9, 735, 2048 }, - { 5, 736, 2048 }, { 6, 737, 2048 }, { 6, 738, 2048 }, { 7, 739, 2048 }, { 6, 740, 2048 }, { 7, 741, 2048 }, { 7, 742, 2048 }, { 8, 743, 2048 }, - { 6, 744, 2048 }, { 7, 745, 2048 }, { 7, 746, 2048 }, { 8, 747, 2048 }, { 7, 748, 2048 }, { 8, 749, 2048 }, { 8, 750, 2048 }, { 9, 751, 2048 }, - { 6, 752, 2048 }, { 7, 753, 2048 }, { 7, 754, 2048 }, { 8, 755, 2048 }, { 7, 756, 2048 }, { 8, 757, 2048 }, { 8, 758, 2048 }, { 9, 759, 2048 }, - { 7, 760, 2048 }, { 8, 761, 2048 }, { 8, 762, 2048 }, { 9, 763, 2048 }, { 8, 764, 2048 }, { 9, 765, 2048 }, { 9, 766, 2048 }, { 10, 767, 2048 }, - { 3, 768, 2048 }, { 4, 769, 2048 }, { 4, 770, 2048 }, { 5, 771, 2048 }, { 4, 772, 2048 }, { 5, 773, 2048 }, { 5, 774, 2048 }, { 6, 775, 2048 }, - { 4, 776, 2048 }, { 5, 777, 2048 }, { 5, 778, 2048 }, { 6, 779, 2048 }, { 5, 780, 2048 }, { 6, 781, 2048 }, { 6, 782, 2048 }, { 7, 783, 2048 }, - { 4, 784, 2048 }, { 5, 785, 2048 }, { 5, 786, 2048 }, { 6, 787, 2048 }, { 5, 788, 2048 }, { 6, 789, 2048 }, { 6, 790, 2048 }, { 7, 791, 2048 }, - { 5, 792, 2048 }, { 6, 793, 2048 }, { 6, 794, 2048 }, { 7, 795, 2048 }, { 6, 796, 2048 }, { 7, 797, 2048 }, { 7, 798, 2048 }, { 8, 799, 2048 }, - { 4, 800, 2048 }, { 5, 801, 2048 }, { 5, 802, 2048 }, { 6, 803, 2048 }, { 5, 804, 2048 }, { 6, 805, 2048 }, { 6, 806, 2048 }, { 7, 807, 2048 }, - { 5, 808, 2048 }, { 6, 809, 2048 }, { 6, 810, 2048 }, { 7, 811, 2048 }, { 6, 812, 2048 }, { 7, 813, 2048 }, { 7, 814, 2048 }, { 8, 815, 2048 }, - { 5, 816, 2048 }, { 6, 817, 2048 }, { 6, 818, 2048 }, { 7, 819, 2048 }, { 6, 820, 2048 }, { 7, 821, 2048 }, { 7, 822, 2048 }, { 8, 823, 2048 }, - { 6, 824, 2048 }, { 7, 825, 2048 }, { 7, 826, 2048 }, { 8, 827, 2048 }, { 7, 828, 2048 }, { 8, 829, 2048 }, { 8, 830, 2048 }, { 9, 831, 2048 }, - { 4, 832, 2048 }, { 5, 833, 2048 }, { 5, 834, 2048 }, { 6, 835, 2048 }, { 5, 836, 2048 }, { 6, 837, 2048 }, { 6, 838, 2048 }, { 7, 839, 2048 }, - { 5, 840, 2048 }, { 6, 841, 2048 }, { 6, 842, 2048 }, { 7, 843, 2048 }, { 6, 844, 2048 }, { 7, 845, 2048 }, { 7, 846, 2048 }, { 8, 847, 2048 }, - { 5, 848, 2048 }, { 6, 849, 2048 }, { 6, 850, 2048 }, { 7, 851, 2048 }, { 6, 852, 2048 }, { 7, 853, 2048 }, { 7, 854, 2048 }, { 8, 855, 2048 }, - { 6, 856, 2048 }, { 7, 857, 2048 }, { 7, 858, 2048 }, { 8, 859, 2048 }, { 7, 860, 2048 }, { 8, 861, 2048 }, { 8, 862, 2048 }, { 9, 863, 2048 }, - { 5, 864, 2048 }, { 6, 865, 2048 }, { 6, 866, 2048 }, { 7, 867, 2048 }, { 6, 868, 2048 }, { 7, 869, 2048 }, { 7, 870, 2048 }, { 8, 871, 2048 }, - { 6, 872, 2048 }, { 7, 873, 2048 }, { 7, 874, 2048 }, { 8, 875, 2048 }, { 7, 876, 2048 }, { 8, 877, 2048 }, { 8, 878, 2048 }, { 9, 879, 2048 }, - { 6, 880, 2048 }, { 7, 881, 2048 }, { 7, 882, 2048 }, { 8, 883, 2048 }, { 7, 884, 2048 }, { 8, 885, 2048 }, { 8, 886, 2048 }, { 9, 887, 2048 }, - { 7, 888, 2048 }, { 8, 889, 2048 }, { 8, 890, 2048 }, { 9, 891, 2048 }, { 8, 892, 2048 }, { 9, 893, 2048 }, { 9, 894, 2048 }, { 10, 895, 2048 }, - { 4, 896, 2048 }, { 5, 897, 2048 }, { 5, 898, 2048 }, { 6, 899, 2048 }, { 5, 900, 2048 }, { 6, 901, 2048 }, { 6, 902, 2048 }, { 7, 903, 2048 }, - { 5, 904, 2048 }, { 6, 905, 2048 }, { 6, 906, 2048 }, { 7, 907, 2048 }, { 6, 908, 2048 }, { 7, 909, 2048 }, { 7, 910, 2048 }, { 8, 911, 2048 }, - { 5, 912, 2048 }, { 6, 913, 2048 }, { 6, 914, 2048 }, { 7, 915, 2048 }, { 6, 916, 2048 }, { 7, 917, 2048 }, { 7, 918, 2048 }, { 8, 919, 2048 }, - { 6, 920, 2048 }, { 7, 921, 2048 }, { 7, 922, 2048 }, { 8, 923, 2048 }, { 7, 924, 2048 }, { 8, 925, 2048 }, { 8, 926, 2048 }, { 9, 927, 2048 }, - { 5, 928, 2048 }, { 6, 929, 2048 }, { 6, 930, 2048 }, { 7, 931, 2048 }, { 6, 932, 2048 }, { 7, 933, 2048 }, { 7, 934, 2048 }, { 8, 935, 2048 }, - { 6, 936, 2048 }, { 7, 937, 2048 }, { 7, 938, 2048 }, { 8, 939, 2048 }, { 7, 940, 2048 }, { 8, 941, 2048 }, { 8, 942, 2048 }, { 9, 943, 2048 }, - { 6, 944, 2048 }, { 7, 945, 2048 }, { 7, 946, 2048 }, { 8, 947, 2048 }, { 7, 948, 2048 }, { 8, 949, 2048 }, { 8, 950, 2048 }, { 9, 951, 2048 }, - { 7, 952, 2048 }, { 8, 953, 2048 }, { 8, 954, 2048 }, { 9, 955, 2048 }, { 8, 956, 2048 }, { 9, 957, 2048 }, { 9, 958, 2048 }, { 10, 959, 2048 }, - { 5, 960, 2048 }, { 6, 961, 2048 }, { 6, 962, 2048 }, { 7, 963, 2048 }, { 6, 964, 2048 }, { 7, 965, 2048 }, { 7, 966, 2048 }, { 8, 967, 2048 }, - { 6, 968, 2048 }, { 7, 969, 2048 }, { 7, 970, 2048 }, { 8, 971, 2048 }, { 7, 972, 2048 }, { 8, 973, 2048 }, { 8, 974, 2048 }, { 9, 975, 2048 }, - { 6, 976, 2048 }, { 7, 977, 2048 }, { 7, 978, 2048 }, { 8, 979, 2048 }, { 7, 980, 2048 }, { 8, 981, 2048 }, { 8, 982, 2048 }, { 9, 983, 2048 }, - { 7, 984, 2048 }, { 8, 985, 2048 }, { 8, 986, 2048 }, { 9, 987, 2048 }, { 8, 988, 2048 }, { 9, 989, 2048 }, { 9, 990, 2048 }, { 10, 991, 2048 }, - { 6, 992, 2048 }, { 7, 993, 2048 }, { 7, 994, 2048 }, { 8, 995, 2048 }, { 7, 996, 2048 }, { 8, 997, 2048 }, { 8, 998, 2048 }, { 9, 999, 2048 }, - { 7, 1000, 2048 }, { 8, 1001, 2048 }, { 8, 1002, 2048 }, { 9, 1003, 2048 }, { 8, 1004, 2048 }, { 9, 1005, 2048 }, { 9, 1006, 2048 }, { 10, 1007, 2048 }, - { 7, 1008, 2048 }, { 8, 1009, 2048 }, { 8, 1010, 2048 }, { 9, 1011, 2048 }, { 8, 1012, 2048 }, { 9, 1013, 2048 }, { 9, 1014, 2048 }, { 10, 1015, 2048 }, - { 8, 1016, 2048 }, { 9, 1017, 2048 }, { 9, 1018, 2048 }, { 10, 1019, 2048 }, { 9, 1020, 2048 }, { 10, 1021, 2048 }, { 10, 1022, 2048 }, { 11, 1023, 2048 }, - { 2, 1024, 2048 }, { 3, 1025, 2048 }, { 3, 1026, 2048 }, { 4, 1027, 2048 }, { 3, 1028, 2048 }, { 4, 1029, 2048 }, { 4, 1030, 2048 }, { 5, 1031, 2048 }, - { 3, 1032, 2048 }, { 4, 1033, 2048 }, { 4, 1034, 2048 }, { 5, 1035, 2048 }, { 4, 1036, 2048 }, { 5, 1037, 2048 }, { 5, 1038, 2048 }, { 6, 1039, 2048 }, - { 3, 1040, 2048 }, { 4, 1041, 2048 }, { 4, 1042, 2048 }, { 5, 1043, 2048 }, { 4, 1044, 2048 }, { 5, 1045, 2048 }, { 5, 1046, 2048 }, { 6, 1047, 2048 }, - { 4, 1048, 2048 }, { 5, 1049, 2048 }, { 5, 1050, 2048 }, { 6, 1051, 2048 }, { 5, 1052, 2048 }, { 6, 1053, 2048 }, { 6, 1054, 2048 }, { 7, 1055, 2048 }, - { 3, 1056, 2048 }, { 4, 1057, 2048 }, { 4, 1058, 2048 }, { 5, 1059, 2048 }, { 4, 1060, 2048 }, { 5, 1061, 2048 }, { 5, 1062, 2048 }, { 6, 1063, 2048 }, - { 4, 1064, 2048 }, { 5, 1065, 2048 }, { 5, 1066, 2048 }, { 6, 1067, 2048 }, { 5, 1068, 2048 }, { 6, 1069, 2048 }, { 6, 1070, 2048 }, { 7, 1071, 2048 }, - { 4, 1072, 2048 }, { 5, 1073, 2048 }, { 5, 1074, 2048 }, { 6, 1075, 2048 }, { 5, 1076, 2048 }, { 6, 1077, 2048 }, { 6, 1078, 2048 }, { 7, 1079, 2048 }, - { 5, 1080, 2048 }, { 6, 1081, 2048 }, { 6, 1082, 2048 }, { 7, 1083, 2048 }, { 6, 1084, 2048 }, { 7, 1085, 2048 }, { 7, 1086, 2048 }, { 8, 1087, 2048 }, - { 3, 1088, 2048 }, { 4, 1089, 2048 }, { 4, 1090, 2048 }, { 5, 1091, 2048 }, { 4, 1092, 2048 }, { 5, 1093, 2048 }, { 5, 1094, 2048 }, { 6, 1095, 2048 }, - { 4, 1096, 2048 }, { 5, 1097, 2048 }, { 5, 1098, 2048 }, { 6, 1099, 2048 }, { 5, 1100, 2048 }, { 6, 1101, 2048 }, { 6, 1102, 2048 }, { 7, 1103, 2048 }, - { 4, 1104, 2048 }, { 5, 1105, 2048 }, { 5, 1106, 2048 }, { 6, 1107, 2048 }, { 5, 1108, 2048 }, { 6, 1109, 2048 }, { 6, 1110, 2048 }, { 7, 1111, 2048 }, - { 5, 1112, 2048 }, { 6, 1113, 2048 }, { 6, 1114, 2048 }, { 7, 1115, 2048 }, { 6, 1116, 2048 }, { 7, 1117, 2048 }, { 7, 1118, 2048 }, { 8, 1119, 2048 }, - { 4, 1120, 2048 }, { 5, 1121, 2048 }, { 5, 1122, 2048 }, { 6, 1123, 2048 }, { 5, 1124, 2048 }, { 6, 1125, 2048 }, { 6, 1126, 2048 }, { 7, 1127, 2048 }, - { 5, 1128, 2048 }, { 6, 1129, 2048 }, { 6, 1130, 2048 }, { 7, 1131, 2048 }, { 6, 1132, 2048 }, { 7, 1133, 2048 }, { 7, 1134, 2048 }, { 8, 1135, 2048 }, - { 5, 1136, 2048 }, { 6, 1137, 2048 }, { 6, 1138, 2048 }, { 7, 1139, 2048 }, { 6, 1140, 2048 }, { 7, 1141, 2048 }, { 7, 1142, 2048 }, { 8, 1143, 2048 }, - { 6, 1144, 2048 }, { 7, 1145, 2048 }, { 7, 1146, 2048 }, { 8, 1147, 2048 }, { 7, 1148, 2048 }, { 8, 1149, 2048 }, { 8, 1150, 2048 }, { 9, 1151, 2048 }, - { 3, 1152, 2048 }, { 4, 1153, 2048 }, { 4, 1154, 2048 }, { 5, 1155, 2048 }, { 4, 1156, 2048 }, { 5, 1157, 2048 }, { 5, 1158, 2048 }, { 6, 1159, 2048 }, - { 4, 1160, 2048 }, { 5, 1161, 2048 }, { 5, 1162, 2048 }, { 6, 1163, 2048 }, { 5, 1164, 2048 }, { 6, 1165, 2048 }, { 6, 1166, 2048 }, { 7, 1167, 2048 }, - { 4, 1168, 2048 }, { 5, 1169, 2048 }, { 5, 1170, 2048 }, { 6, 1171, 2048 }, { 5, 1172, 2048 }, { 6, 1173, 2048 }, { 6, 1174, 2048 }, { 7, 1175, 2048 }, - { 5, 1176, 2048 }, { 6, 1177, 2048 }, { 6, 1178, 2048 }, { 7, 1179, 2048 }, { 6, 1180, 2048 }, { 7, 1181, 2048 }, { 7, 1182, 2048 }, { 8, 1183, 2048 }, - { 4, 1184, 2048 }, { 5, 1185, 2048 }, { 5, 1186, 2048 }, { 6, 1187, 2048 }, { 5, 1188, 2048 }, { 6, 1189, 2048 }, { 6, 1190, 2048 }, { 7, 1191, 2048 }, - { 5, 1192, 2048 }, { 6, 1193, 2048 }, { 6, 1194, 2048 }, { 7, 1195, 2048 }, { 6, 1196, 2048 }, { 7, 1197, 2048 }, { 7, 1198, 2048 }, { 8, 1199, 2048 }, - { 5, 1200, 2048 }, { 6, 1201, 2048 }, { 6, 1202, 2048 }, { 7, 1203, 2048 }, { 6, 1204, 2048 }, { 7, 1205, 2048 }, { 7, 1206, 2048 }, { 8, 1207, 2048 }, - { 6, 1208, 2048 }, { 7, 1209, 2048 }, { 7, 1210, 2048 }, { 8, 1211, 2048 }, { 7, 1212, 2048 }, { 8, 1213, 2048 }, { 8, 1214, 2048 }, { 9, 1215, 2048 }, - { 4, 1216, 2048 }, { 5, 1217, 2048 }, { 5, 1218, 2048 }, { 6, 1219, 2048 }, { 5, 1220, 2048 }, { 6, 1221, 2048 }, { 6, 1222, 2048 }, { 7, 1223, 2048 }, - { 5, 1224, 2048 }, { 6, 1225, 2048 }, { 6, 1226, 2048 }, { 7, 1227, 2048 }, { 6, 1228, 2048 }, { 7, 1229, 2048 }, { 7, 1230, 2048 }, { 8, 1231, 2048 }, - { 5, 1232, 2048 }, { 6, 1233, 2048 }, { 6, 1234, 2048 }, { 7, 1235, 2048 }, { 6, 1236, 2048 }, { 7, 1237, 2048 }, { 7, 1238, 2048 }, { 8, 1239, 2048 }, - { 6, 1240, 2048 }, { 7, 1241, 2048 }, { 7, 1242, 2048 }, { 8, 1243, 2048 }, { 7, 1244, 2048 }, { 8, 1245, 2048 }, { 8, 1246, 2048 }, { 9, 1247, 2048 }, - { 5, 1248, 2048 }, { 6, 1249, 2048 }, { 6, 1250, 2048 }, { 7, 1251, 2048 }, { 6, 1252, 2048 }, { 7, 1253, 2048 }, { 7, 1254, 2048 }, { 8, 1255, 2048 }, - { 6, 1256, 2048 }, { 7, 1257, 2048 }, { 7, 1258, 2048 }, { 8, 1259, 2048 }, { 7, 1260, 2048 }, { 8, 1261, 2048 }, { 8, 1262, 2048 }, { 9, 1263, 2048 }, - { 6, 1264, 2048 }, { 7, 1265, 2048 }, { 7, 1266, 2048 }, { 8, 1267, 2048 }, { 7, 1268, 2048 }, { 8, 1269, 2048 }, { 8, 1270, 2048 }, { 9, 1271, 2048 }, - { 7, 1272, 2048 }, { 8, 1273, 2048 }, { 8, 1274, 2048 }, { 9, 1275, 2048 }, { 8, 1276, 2048 }, { 9, 1277, 2048 }, { 9, 1278, 2048 }, { 10, 1279, 2048 }, - { 3, 1280, 2048 }, { 4, 1281, 2048 }, { 4, 1282, 2048 }, { 5, 1283, 2048 }, { 4, 1284, 2048 }, { 5, 1285, 2048 }, { 5, 1286, 2048 }, { 6, 1287, 2048 }, - { 4, 1288, 2048 }, { 5, 1289, 2048 }, { 5, 1290, 2048 }, { 6, 1291, 2048 }, { 5, 1292, 2048 }, { 6, 1293, 2048 }, { 6, 1294, 2048 }, { 7, 1295, 2048 }, - { 4, 1296, 2048 }, { 5, 1297, 2048 }, { 5, 1298, 2048 }, { 6, 1299, 2048 }, { 5, 1300, 2048 }, { 6, 1301, 2048 }, { 6, 1302, 2048 }, { 7, 1303, 2048 }, - { 5, 1304, 2048 }, { 6, 1305, 2048 }, { 6, 1306, 2048 }, { 7, 1307, 2048 }, { 6, 1308, 2048 }, { 7, 1309, 2048 }, { 7, 1310, 2048 }, { 8, 1311, 2048 }, - { 4, 1312, 2048 }, { 5, 1313, 2048 }, { 5, 1314, 2048 }, { 6, 1315, 2048 }, { 5, 1316, 2048 }, { 6, 1317, 2048 }, { 6, 1318, 2048 }, { 7, 1319, 2048 }, - { 5, 1320, 2048 }, { 6, 1321, 2048 }, { 6, 1322, 2048 }, { 7, 1323, 2048 }, { 6, 1324, 2048 }, { 7, 1325, 2048 }, { 7, 1326, 2048 }, { 8, 1327, 2048 }, - { 5, 1328, 2048 }, { 6, 1329, 2048 }, { 6, 1330, 2048 }, { 7, 1331, 2048 }, { 6, 1332, 2048 }, { 7, 1333, 2048 }, { 7, 1334, 2048 }, { 8, 1335, 2048 }, - { 6, 1336, 2048 }, { 7, 1337, 2048 }, { 7, 1338, 2048 }, { 8, 1339, 2048 }, { 7, 1340, 2048 }, { 8, 1341, 2048 }, { 8, 1342, 2048 }, { 9, 1343, 2048 }, - { 4, 1344, 2048 }, { 5, 1345, 2048 }, { 5, 1346, 2048 }, { 6, 1347, 2048 }, { 5, 1348, 2048 }, { 6, 1349, 2048 }, { 6, 1350, 2048 }, { 7, 1351, 2048 }, - { 5, 1352, 2048 }, { 6, 1353, 2048 }, { 6, 1354, 2048 }, { 7, 1355, 2048 }, { 6, 1356, 2048 }, { 7, 1357, 2048 }, { 7, 1358, 2048 }, { 8, 1359, 2048 }, - { 5, 1360, 2048 }, { 6, 1361, 2048 }, { 6, 1362, 2048 }, { 7, 1363, 2048 }, { 6, 1364, 2048 }, { 7, 1365, 2048 }, { 7, 1366, 2048 }, { 8, 1367, 2048 }, - { 6, 1368, 2048 }, { 7, 1369, 2048 }, { 7, 1370, 2048 }, { 8, 1371, 2048 }, { 7, 1372, 2048 }, { 8, 1373, 2048 }, { 8, 1374, 2048 }, { 9, 1375, 2048 }, - { 5, 1376, 2048 }, { 6, 1377, 2048 }, { 6, 1378, 2048 }, { 7, 1379, 2048 }, { 6, 1380, 2048 }, { 7, 1381, 2048 }, { 7, 1382, 2048 }, { 8, 1383, 2048 }, - { 6, 1384, 2048 }, { 7, 1385, 2048 }, { 7, 1386, 2048 }, { 8, 1387, 2048 }, { 7, 1388, 2048 }, { 8, 1389, 2048 }, { 8, 1390, 2048 }, { 9, 1391, 2048 }, - { 6, 1392, 2048 }, { 7, 1393, 2048 }, { 7, 1394, 2048 }, { 8, 1395, 2048 }, { 7, 1396, 2048 }, { 8, 1397, 2048 }, { 8, 1398, 2048 }, { 9, 1399, 2048 }, - { 7, 1400, 2048 }, { 8, 1401, 2048 }, { 8, 1402, 2048 }, { 9, 1403, 2048 }, { 8, 1404, 2048 }, { 9, 1405, 2048 }, { 9, 1406, 2048 }, { 10, 1407, 2048 }, - { 4, 1408, 2048 }, { 5, 1409, 2048 }, { 5, 1410, 2048 }, { 6, 1411, 2048 }, { 5, 1412, 2048 }, { 6, 1413, 2048 }, { 6, 1414, 2048 }, { 7, 1415, 2048 }, - { 5, 1416, 2048 }, { 6, 1417, 2048 }, { 6, 1418, 2048 }, { 7, 1419, 2048 }, { 6, 1420, 2048 }, { 7, 1421, 2048 }, { 7, 1422, 2048 }, { 8, 1423, 2048 }, - { 5, 1424, 2048 }, { 6, 1425, 2048 }, { 6, 1426, 2048 }, { 7, 1427, 2048 }, { 6, 1428, 2048 }, { 7, 1429, 2048 }, { 7, 1430, 2048 }, { 8, 1431, 2048 }, - { 6, 1432, 2048 }, { 7, 1433, 2048 }, { 7, 1434, 2048 }, { 8, 1435, 2048 }, { 7, 1436, 2048 }, { 8, 1437, 2048 }, { 8, 1438, 2048 }, { 9, 1439, 2048 }, - { 5, 1440, 2048 }, { 6, 1441, 2048 }, { 6, 1442, 2048 }, { 7, 1443, 2048 }, { 6, 1444, 2048 }, { 7, 1445, 2048 }, { 7, 1446, 2048 }, { 8, 1447, 2048 }, - { 6, 1448, 2048 }, { 7, 1449, 2048 }, { 7, 1450, 2048 }, { 8, 1451, 2048 }, { 7, 1452, 2048 }, { 8, 1453, 2048 }, { 8, 1454, 2048 }, { 9, 1455, 2048 }, - { 6, 1456, 2048 }, { 7, 1457, 2048 }, { 7, 1458, 2048 }, { 8, 1459, 2048 }, { 7, 1460, 2048 }, { 8, 1461, 2048 }, { 8, 1462, 2048 }, { 9, 1463, 2048 }, - { 7, 1464, 2048 }, { 8, 1465, 2048 }, { 8, 1466, 2048 }, { 9, 1467, 2048 }, { 8, 1468, 2048 }, { 9, 1469, 2048 }, { 9, 1470, 2048 }, { 10, 1471, 2048 }, - { 5, 1472, 2048 }, { 6, 1473, 2048 }, { 6, 1474, 2048 }, { 7, 1475, 2048 }, { 6, 1476, 2048 }, { 7, 1477, 2048 }, { 7, 1478, 2048 }, { 8, 1479, 2048 }, - { 6, 1480, 2048 }, { 7, 1481, 2048 }, { 7, 1482, 2048 }, { 8, 1483, 2048 }, { 7, 1484, 2048 }, { 8, 1485, 2048 }, { 8, 1486, 2048 }, { 9, 1487, 2048 }, - { 6, 1488, 2048 }, { 7, 1489, 2048 }, { 7, 1490, 2048 }, { 8, 1491, 2048 }, { 7, 1492, 2048 }, { 8, 1493, 2048 }, { 8, 1494, 2048 }, { 9, 1495, 2048 }, - { 7, 1496, 2048 }, { 8, 1497, 2048 }, { 8, 1498, 2048 }, { 9, 1499, 2048 }, { 8, 1500, 2048 }, { 9, 1501, 2048 }, { 9, 1502, 2048 }, { 10, 1503, 2048 }, - { 6, 1504, 2048 }, { 7, 1505, 2048 }, { 7, 1506, 2048 }, { 8, 1507, 2048 }, { 7, 1508, 2048 }, { 8, 1509, 2048 }, { 8, 1510, 2048 }, { 9, 1511, 2048 }, - { 7, 1512, 2048 }, { 8, 1513, 2048 }, { 8, 1514, 2048 }, { 9, 1515, 2048 }, { 8, 1516, 2048 }, { 9, 1517, 2048 }, { 9, 1518, 2048 }, { 10, 1519, 2048 }, - { 7, 1520, 2048 }, { 8, 1521, 2048 }, { 8, 1522, 2048 }, { 9, 1523, 2048 }, { 8, 1524, 2048 }, { 9, 1525, 2048 }, { 9, 1526, 2048 }, { 10, 1527, 2048 }, - { 8, 1528, 2048 }, { 9, 1529, 2048 }, { 9, 1530, 2048 }, { 10, 1531, 2048 }, { 9, 1532, 2048 }, { 10, 1533, 2048 }, { 10, 1534, 2048 }, { 11, 1535, 2048 }, - { 3, 1536, 2048 }, { 4, 1537, 2048 }, { 4, 1538, 2048 }, { 5, 1539, 2048 }, { 4, 1540, 2048 }, { 5, 1541, 2048 }, { 5, 1542, 2048 }, { 6, 1543, 2048 }, - { 4, 1544, 2048 }, { 5, 1545, 2048 }, { 5, 1546, 2048 }, { 6, 1547, 2048 }, { 5, 1548, 2048 }, { 6, 1549, 2048 }, { 6, 1550, 2048 }, { 7, 1551, 2048 }, - { 4, 1552, 2048 }, { 5, 1553, 2048 }, { 5, 1554, 2048 }, { 6, 1555, 2048 }, { 5, 1556, 2048 }, { 6, 1557, 2048 }, { 6, 1558, 2048 }, { 7, 1559, 2048 }, - { 5, 1560, 2048 }, { 6, 1561, 2048 }, { 6, 1562, 2048 }, { 7, 1563, 2048 }, { 6, 1564, 2048 }, { 7, 1565, 2048 }, { 7, 1566, 2048 }, { 8, 1567, 2048 }, - { 4, 1568, 2048 }, { 5, 1569, 2048 }, { 5, 1570, 2048 }, { 6, 1571, 2048 }, { 5, 1572, 2048 }, { 6, 1573, 2048 }, { 6, 1574, 2048 }, { 7, 1575, 2048 }, - { 5, 1576, 2048 }, { 6, 1577, 2048 }, { 6, 1578, 2048 }, { 7, 1579, 2048 }, { 6, 1580, 2048 }, { 7, 1581, 2048 }, { 7, 1582, 2048 }, { 8, 1583, 2048 }, - { 5, 1584, 2048 }, { 6, 1585, 2048 }, { 6, 1586, 2048 }, { 7, 1587, 2048 }, { 6, 1588, 2048 }, { 7, 1589, 2048 }, { 7, 1590, 2048 }, { 8, 1591, 2048 }, - { 6, 1592, 2048 }, { 7, 1593, 2048 }, { 7, 1594, 2048 }, { 8, 1595, 2048 }, { 7, 1596, 2048 }, { 8, 1597, 2048 }, { 8, 1598, 2048 }, { 9, 1599, 2048 }, - { 4, 1600, 2048 }, { 5, 1601, 2048 }, { 5, 1602, 2048 }, { 6, 1603, 2048 }, { 5, 1604, 2048 }, { 6, 1605, 2048 }, { 6, 1606, 2048 }, { 7, 1607, 2048 }, - { 5, 1608, 2048 }, { 6, 1609, 2048 }, { 6, 1610, 2048 }, { 7, 1611, 2048 }, { 6, 1612, 2048 }, { 7, 1613, 2048 }, { 7, 1614, 2048 }, { 8, 1615, 2048 }, - { 5, 1616, 2048 }, { 6, 1617, 2048 }, { 6, 1618, 2048 }, { 7, 1619, 2048 }, { 6, 1620, 2048 }, { 7, 1621, 2048 }, { 7, 1622, 2048 }, { 8, 1623, 2048 }, - { 6, 1624, 2048 }, { 7, 1625, 2048 }, { 7, 1626, 2048 }, { 8, 1627, 2048 }, { 7, 1628, 2048 }, { 8, 1629, 2048 }, { 8, 1630, 2048 }, { 9, 1631, 2048 }, - { 5, 1632, 2048 }, { 6, 1633, 2048 }, { 6, 1634, 2048 }, { 7, 1635, 2048 }, { 6, 1636, 2048 }, { 7, 1637, 2048 }, { 7, 1638, 2048 }, { 8, 1639, 2048 }, - { 6, 1640, 2048 }, { 7, 1641, 2048 }, { 7, 1642, 2048 }, { 8, 1643, 2048 }, { 7, 1644, 2048 }, { 8, 1645, 2048 }, { 8, 1646, 2048 }, { 9, 1647, 2048 }, - { 6, 1648, 2048 }, { 7, 1649, 2048 }, { 7, 1650, 2048 }, { 8, 1651, 2048 }, { 7, 1652, 2048 }, { 8, 1653, 2048 }, { 8, 1654, 2048 }, { 9, 1655, 2048 }, - { 7, 1656, 2048 }, { 8, 1657, 2048 }, { 8, 1658, 2048 }, { 9, 1659, 2048 }, { 8, 1660, 2048 }, { 9, 1661, 2048 }, { 9, 1662, 2048 }, { 10, 1663, 2048 }, - { 4, 1664, 2048 }, { 5, 1665, 2048 }, { 5, 1666, 2048 }, { 6, 1667, 2048 }, { 5, 1668, 2048 }, { 6, 1669, 2048 }, { 6, 1670, 2048 }, { 7, 1671, 2048 }, - { 5, 1672, 2048 }, { 6, 1673, 2048 }, { 6, 1674, 2048 }, { 7, 1675, 2048 }, { 6, 1676, 2048 }, { 7, 1677, 2048 }, { 7, 1678, 2048 }, { 8, 1679, 2048 }, - { 5, 1680, 2048 }, { 6, 1681, 2048 }, { 6, 1682, 2048 }, { 7, 1683, 2048 }, { 6, 1684, 2048 }, { 7, 1685, 2048 }, { 7, 1686, 2048 }, { 8, 1687, 2048 }, - { 6, 1688, 2048 }, { 7, 1689, 2048 }, { 7, 1690, 2048 }, { 8, 1691, 2048 }, { 7, 1692, 2048 }, { 8, 1693, 2048 }, { 8, 1694, 2048 }, { 9, 1695, 2048 }, - { 5, 1696, 2048 }, { 6, 1697, 2048 }, { 6, 1698, 2048 }, { 7, 1699, 2048 }, { 6, 1700, 2048 }, { 7, 1701, 2048 }, { 7, 1702, 2048 }, { 8, 1703, 2048 }, - { 6, 1704, 2048 }, { 7, 1705, 2048 }, { 7, 1706, 2048 }, { 8, 1707, 2048 }, { 7, 1708, 2048 }, { 8, 1709, 2048 }, { 8, 1710, 2048 }, { 9, 1711, 2048 }, - { 6, 1712, 2048 }, { 7, 1713, 2048 }, { 7, 1714, 2048 }, { 8, 1715, 2048 }, { 7, 1716, 2048 }, { 8, 1717, 2048 }, { 8, 1718, 2048 }, { 9, 1719, 2048 }, - { 7, 1720, 2048 }, { 8, 1721, 2048 }, { 8, 1722, 2048 }, { 9, 1723, 2048 }, { 8, 1724, 2048 }, { 9, 1725, 2048 }, { 9, 1726, 2048 }, { 10, 1727, 2048 }, - { 5, 1728, 2048 }, { 6, 1729, 2048 }, { 6, 1730, 2048 }, { 7, 1731, 2048 }, { 6, 1732, 2048 }, { 7, 1733, 2048 }, { 7, 1734, 2048 }, { 8, 1735, 2048 }, - { 6, 1736, 2048 }, { 7, 1737, 2048 }, { 7, 1738, 2048 }, { 8, 1739, 2048 }, { 7, 1740, 2048 }, { 8, 1741, 2048 }, { 8, 1742, 2048 }, { 9, 1743, 2048 }, - { 6, 1744, 2048 }, { 7, 1745, 2048 }, { 7, 1746, 2048 }, { 8, 1747, 2048 }, { 7, 1748, 2048 }, { 8, 1749, 2048 }, { 8, 1750, 2048 }, { 9, 1751, 2048 }, - { 7, 1752, 2048 }, { 8, 1753, 2048 }, { 8, 1754, 2048 }, { 9, 1755, 2048 }, { 8, 1756, 2048 }, { 9, 1757, 2048 }, { 9, 1758, 2048 }, { 10, 1759, 2048 }, - { 6, 1760, 2048 }, { 7, 1761, 2048 }, { 7, 1762, 2048 }, { 8, 1763, 2048 }, { 7, 1764, 2048 }, { 8, 1765, 2048 }, { 8, 1766, 2048 }, { 9, 1767, 2048 }, - { 7, 1768, 2048 }, { 8, 1769, 2048 }, { 8, 1770, 2048 }, { 9, 1771, 2048 }, { 8, 1772, 2048 }, { 9, 1773, 2048 }, { 9, 1774, 2048 }, { 10, 1775, 2048 }, - { 7, 1776, 2048 }, { 8, 1777, 2048 }, { 8, 1778, 2048 }, { 9, 1779, 2048 }, { 8, 1780, 2048 }, { 9, 1781, 2048 }, { 9, 1782, 2048 }, { 10, 1783, 2048 }, - { 8, 1784, 2048 }, { 9, 1785, 2048 }, { 9, 1786, 2048 }, { 10, 1787, 2048 }, { 9, 1788, 2048 }, { 10, 1789, 2048 }, { 10, 1790, 2048 }, { 11, 1791, 2048 }, - { 4, 1792, 2048 }, { 5, 1793, 2048 }, { 5, 1794, 2048 }, { 6, 1795, 2048 }, { 5, 1796, 2048 }, { 6, 1797, 2048 }, { 6, 1798, 2048 }, { 7, 1799, 2048 }, - { 5, 1800, 2048 }, { 6, 1801, 2048 }, { 6, 1802, 2048 }, { 7, 1803, 2048 }, { 6, 1804, 2048 }, { 7, 1805, 2048 }, { 7, 1806, 2048 }, { 8, 1807, 2048 }, - { 5, 1808, 2048 }, { 6, 1809, 2048 }, { 6, 1810, 2048 }, { 7, 1811, 2048 }, { 6, 1812, 2048 }, { 7, 1813, 2048 }, { 7, 1814, 2048 }, { 8, 1815, 2048 }, - { 6, 1816, 2048 }, { 7, 1817, 2048 }, { 7, 1818, 2048 }, { 8, 1819, 2048 }, { 7, 1820, 2048 }, { 8, 1821, 2048 }, { 8, 1822, 2048 }, { 9, 1823, 2048 }, - { 5, 1824, 2048 }, { 6, 1825, 2048 }, { 6, 1826, 2048 }, { 7, 1827, 2048 }, { 6, 1828, 2048 }, { 7, 1829, 2048 }, { 7, 1830, 2048 }, { 8, 1831, 2048 }, - { 6, 1832, 2048 }, { 7, 1833, 2048 }, { 7, 1834, 2048 }, { 8, 1835, 2048 }, { 7, 1836, 2048 }, { 8, 1837, 2048 }, { 8, 1838, 2048 }, { 9, 1839, 2048 }, - { 6, 1840, 2048 }, { 7, 1841, 2048 }, { 7, 1842, 2048 }, { 8, 1843, 2048 }, { 7, 1844, 2048 }, { 8, 1845, 2048 }, { 8, 1846, 2048 }, { 9, 1847, 2048 }, - { 7, 1848, 2048 }, { 8, 1849, 2048 }, { 8, 1850, 2048 }, { 9, 1851, 2048 }, { 8, 1852, 2048 }, { 9, 1853, 2048 }, { 9, 1854, 2048 }, { 10, 1855, 2048 }, - { 5, 1856, 2048 }, { 6, 1857, 2048 }, { 6, 1858, 2048 }, { 7, 1859, 2048 }, { 6, 1860, 2048 }, { 7, 1861, 2048 }, { 7, 1862, 2048 }, { 8, 1863, 2048 }, - { 6, 1864, 2048 }, { 7, 1865, 2048 }, { 7, 1866, 2048 }, { 8, 1867, 2048 }, { 7, 1868, 2048 }, { 8, 1869, 2048 }, { 8, 1870, 2048 }, { 9, 1871, 2048 }, - { 6, 1872, 2048 }, { 7, 1873, 2048 }, { 7, 1874, 2048 }, { 8, 1875, 2048 }, { 7, 1876, 2048 }, { 8, 1877, 2048 }, { 8, 1878, 2048 }, { 9, 1879, 2048 }, - { 7, 1880, 2048 }, { 8, 1881, 2048 }, { 8, 1882, 2048 }, { 9, 1883, 2048 }, { 8, 1884, 2048 }, { 9, 1885, 2048 }, { 9, 1886, 2048 }, { 10, 1887, 2048 }, - { 6, 1888, 2048 }, { 7, 1889, 2048 }, { 7, 1890, 2048 }, { 8, 1891, 2048 }, { 7, 1892, 2048 }, { 8, 1893, 2048 }, { 8, 1894, 2048 }, { 9, 1895, 2048 }, - { 7, 1896, 2048 }, { 8, 1897, 2048 }, { 8, 1898, 2048 }, { 9, 1899, 2048 }, { 8, 1900, 2048 }, { 9, 1901, 2048 }, { 9, 1902, 2048 }, { 10, 1903, 2048 }, - { 7, 1904, 2048 }, { 8, 1905, 2048 }, { 8, 1906, 2048 }, { 9, 1907, 2048 }, { 8, 1908, 2048 }, { 9, 1909, 2048 }, { 9, 1910, 2048 }, { 10, 1911, 2048 }, - { 8, 1912, 2048 }, { 9, 1913, 2048 }, { 9, 1914, 2048 }, { 10, 1915, 2048 }, { 9, 1916, 2048 }, { 10, 1917, 2048 }, { 10, 1918, 2048 }, { 11, 1919, 2048 }, - { 5, 1920, 2048 }, { 6, 1921, 2048 }, { 6, 1922, 2048 }, { 7, 1923, 2048 }, { 6, 1924, 2048 }, { 7, 1925, 2048 }, { 7, 1926, 2048 }, { 8, 1927, 2048 }, - { 6, 1928, 2048 }, { 7, 1929, 2048 }, { 7, 1930, 2048 }, { 8, 1931, 2048 }, { 7, 1932, 2048 }, { 8, 1933, 2048 }, { 8, 1934, 2048 }, { 9, 1935, 2048 }, - { 6, 1936, 2048 }, { 7, 1937, 2048 }, { 7, 1938, 2048 }, { 8, 1939, 2048 }, { 7, 1940, 2048 }, { 8, 1941, 2048 }, { 8, 1942, 2048 }, { 9, 1943, 2048 }, - { 7, 1944, 2048 }, { 8, 1945, 2048 }, { 8, 1946, 2048 }, { 9, 1947, 2048 }, { 8, 1948, 2048 }, { 9, 1949, 2048 }, { 9, 1950, 2048 }, { 10, 1951, 2048 }, - { 6, 1952, 2048 }, { 7, 1953, 2048 }, { 7, 1954, 2048 }, { 8, 1955, 2048 }, { 7, 1956, 2048 }, { 8, 1957, 2048 }, { 8, 1958, 2048 }, { 9, 1959, 2048 }, - { 7, 1960, 2048 }, { 8, 1961, 2048 }, { 8, 1962, 2048 }, { 9, 1963, 2048 }, { 8, 1964, 2048 }, { 9, 1965, 2048 }, { 9, 1966, 2048 }, { 10, 1967, 2048 }, - { 7, 1968, 2048 }, { 8, 1969, 2048 }, { 8, 1970, 2048 }, { 9, 1971, 2048 }, { 8, 1972, 2048 }, { 9, 1973, 2048 }, { 9, 1974, 2048 }, { 10, 1975, 2048 }, - { 8, 1976, 2048 }, { 9, 1977, 2048 }, { 9, 1978, 2048 }, { 10, 1979, 2048 }, { 9, 1980, 2048 }, { 10, 1981, 2048 }, { 10, 1982, 2048 }, { 11, 1983, 2048 }, - { 6, 1984, 2048 }, { 7, 1985, 2048 }, { 7, 1986, 2048 }, { 8, 1987, 2048 }, { 7, 1988, 2048 }, { 8, 1989, 2048 }, { 8, 1990, 2048 }, { 9, 1991, 2048 }, - { 7, 1992, 2048 }, { 8, 1993, 2048 }, { 8, 1994, 2048 }, { 9, 1995, 2048 }, { 8, 1996, 2048 }, { 9, 1997, 2048 }, { 9, 1998, 2048 }, { 10, 1999, 2048 }, - { 7, 2000, 2048 }, { 8, 2001, 2048 }, { 8, 2002, 2048 }, { 9, 2003, 2048 }, { 8, 2004, 2048 }, { 9, 2005, 2048 }, { 9, 2006, 2048 }, { 10, 2007, 2048 }, - { 8, 2008, 2048 }, { 9, 2009, 2048 }, { 9, 2010, 2048 }, { 10, 2011, 2048 }, { 9, 2012, 2048 }, { 10, 2013, 2048 }, { 10, 2014, 2048 }, { 11, 2015, 2048 }, - { 7, 2016, 2048 }, { 8, 2017, 2048 }, { 8, 2018, 2048 }, { 9, 2019, 2048 }, { 8, 2020, 2048 }, { 9, 2021, 2048 }, { 9, 2022, 2048 }, { 10, 2023, 2048 }, - { 8, 2024, 2048 }, { 9, 2025, 2048 }, { 9, 2026, 2048 }, { 10, 2027, 2048 }, { 9, 2028, 2048 }, { 10, 2029, 2048 }, { 10, 2030, 2048 }, { 11, 2031, 2048 }, - { 8, 2032, 2048 }, { 9, 2033, 2048 }, { 9, 2034, 2048 }, { 10, 2035, 2048 }, { 9, 2036, 2048 }, { 10, 2037, 2048 }, { 10, 2038, 2048 }, { 11, 2039, 2048 }, - { 9, 2040, 2048 }, { 10, 2041, 2048 }, { 10, 2042, 2048 }, { 11, 2043, 2048 }, { 10, 2044, 2048 }, { 11, 2045, 2048 }, { 11, 2046, 2048 }, { 12, 2047, 2048 }, + { 1, 0, 0 }, { 2, 1, 2048 }, { 2, 2, 2048 }, { 3, 3, 2048 }, { 2, 4, 2048 }, { 3, 5, 2048 }, { 3, 6, 2048 }, { 4, 7, 2048 }, + { 2, 8, 2048 }, { 3, 9, 2048 }, { 3, 10, 2048 }, { 4, 11, 2048 }, { 3, 12, 2048 }, { 4, 13, 2048 }, { 4, 14, 2048 }, { 5, 15, 2048 }, + { 2, 16, 2048 }, { 3, 17, 2048 }, { 3, 18, 2048 }, { 4, 19, 2048 }, { 3, 20, 2048 }, { 4, 21, 2048 }, { 4, 22, 2048 }, { 5, 23, 2048 }, + { 3, 24, 2048 }, { 4, 25, 2048 }, { 4, 26, 2048 }, { 5, 27, 2048 }, { 4, 28, 2048 }, { 5, 29, 2048 }, { 5, 30, 2048 }, { 6, 31, 2048 }, + { 2, 32, 2048 }, { 3, 33, 2048 }, { 3, 34, 2048 }, { 4, 35, 2048 }, { 3, 36, 2048 }, { 4, 37, 2048 }, { 4, 38, 2048 }, { 5, 39, 2048 }, + { 3, 40, 2048 }, { 4, 41, 2048 }, { 4, 42, 2048 }, { 5, 43, 2048 }, { 4, 44, 2048 }, { 5, 45, 2048 }, { 5, 46, 2048 }, { 6, 47, 2048 }, + { 3, 48, 2048 }, { 4, 49, 2048 }, { 4, 50, 2048 }, { 5, 51, 2048 }, { 4, 52, 2048 }, { 5, 53, 2048 }, { 5, 54, 2048 }, { 6, 55, 2048 }, + { 4, 56, 2048 }, { 5, 57, 2048 }, { 5, 58, 2048 }, { 6, 59, 2048 }, { 5, 60, 2048 }, { 6, 61, 2048 }, { 6, 62, 2048 }, { 7, 63, 2048 }, + { 2, 64, 2048 }, { 3, 65, 2048 }, { 3, 66, 2048 }, { 4, 67, 2048 }, { 3, 68, 2048 }, { 4, 69, 2048 }, { 4, 70, 2048 }, { 5, 71, 2048 }, + { 3, 72, 2048 }, { 4, 73, 2048 }, { 4, 74, 2048 }, { 5, 75, 2048 }, { 4, 76, 2048 }, { 5, 77, 2048 }, { 5, 78, 2048 }, { 6, 79, 2048 }, + { 3, 80, 2048 }, { 4, 81, 2048 }, { 4, 82, 2048 }, { 5, 83, 2048 }, { 4, 84, 2048 }, { 5, 85, 2048 }, { 5, 86, 2048 }, { 6, 87, 2048 }, + { 4, 88, 2048 }, { 5, 89, 2048 }, { 5, 90, 2048 }, { 6, 91, 2048 }, { 5, 92, 2048 }, { 6, 93, 2048 }, { 6, 94, 2048 }, { 7, 95, 2048 }, + { 3, 96, 2048 }, { 4, 97, 2048 }, { 4, 98, 2048 }, { 5, 99, 2048 }, { 4, 100, 2048 }, { 5, 101, 2048 }, { 5, 102, 2048 }, { 6, 103, 2048 }, + { 4, 104, 2048 }, { 5, 105, 2048 }, { 5, 106, 2048 }, { 6, 107, 2048 }, { 5, 108, 2048 }, { 6, 109, 2048 }, { 6, 110, 2048 }, { 7, 111, 2048 }, + { 4, 112, 2048 }, { 5, 113, 2048 }, { 5, 114, 2048 }, { 6, 115, 2048 }, { 5, 116, 2048 }, { 6, 117, 2048 }, { 6, 118, 2048 }, { 7, 119, 2048 }, + { 5, 120, 2048 }, { 6, 121, 2048 }, { 6, 122, 2048 }, { 7, 123, 2048 }, { 6, 124, 2048 }, { 7, 125, 2048 }, { 7, 126, 2048 }, { 8, 127, 2048 }, + { 2, 128, 2048 }, { 3, 129, 2048 }, { 3, 130, 2048 }, { 4, 131, 2048 }, { 3, 132, 2048 }, { 4, 133, 2048 }, { 4, 134, 2048 }, { 5, 135, 2048 }, + { 3, 136, 2048 }, { 4, 137, 2048 }, { 4, 138, 2048 }, { 5, 139, 2048 }, { 4, 140, 2048 }, { 5, 141, 2048 }, { 5, 142, 2048 }, { 6, 143, 2048 }, + { 3, 144, 2048 }, { 4, 145, 2048 }, { 4, 146, 2048 }, { 5, 147, 2048 }, { 4, 148, 2048 }, { 5, 149, 2048 }, { 5, 150, 2048 }, { 6, 151, 2048 }, + { 4, 152, 2048 }, { 5, 153, 2048 }, { 5, 154, 2048 }, { 6, 155, 2048 }, { 5, 156, 2048 }, { 6, 157, 2048 }, { 6, 158, 2048 }, { 7, 159, 2048 }, + { 3, 160, 2048 }, { 4, 161, 2048 }, { 4, 162, 2048 }, { 5, 163, 2048 }, { 4, 164, 2048 }, { 5, 165, 2048 }, { 5, 166, 2048 }, { 6, 167, 2048 }, + { 4, 168, 2048 }, { 5, 169, 2048 }, { 5, 170, 2048 }, { 6, 171, 2048 }, { 5, 172, 2048 }, { 6, 173, 2048 }, { 6, 174, 2048 }, { 7, 175, 2048 }, + { 4, 176, 2048 }, { 5, 177, 2048 }, { 5, 178, 2048 }, { 6, 179, 2048 }, { 5, 180, 2048 }, { 6, 181, 2048 }, { 6, 182, 2048 }, { 7, 183, 2048 }, + { 5, 184, 2048 }, { 6, 185, 2048 }, { 6, 186, 2048 }, { 7, 187, 2048 }, { 6, 188, 2048 }, { 7, 189, 2048 }, { 7, 190, 2048 }, { 8, 191, 2048 }, + { 3, 192, 2048 }, { 4, 193, 2048 }, { 4, 194, 2048 }, { 5, 195, 2048 }, { 4, 196, 2048 }, { 5, 197, 2048 }, { 5, 198, 2048 }, { 6, 199, 2048 }, + { 4, 200, 2048 }, { 5, 201, 2048 }, { 5, 202, 2048 }, { 6, 203, 2048 }, { 5, 204, 2048 }, { 6, 205, 2048 }, { 6, 206, 2048 }, { 7, 207, 2048 }, + { 4, 208, 2048 }, { 5, 209, 2048 }, { 5, 210, 2048 }, { 6, 211, 2048 }, { 5, 212, 2048 }, { 6, 213, 2048 }, { 6, 214, 2048 }, { 7, 215, 2048 }, + { 5, 216, 2048 }, { 6, 217, 2048 }, { 6, 218, 2048 }, { 7, 219, 2048 }, { 6, 220, 2048 }, { 7, 221, 2048 }, { 7, 222, 2048 }, { 8, 223, 2048 }, + { 4, 224, 2048 }, { 5, 225, 2048 }, { 5, 226, 2048 }, { 6, 227, 2048 }, { 5, 228, 2048 }, { 6, 229, 2048 }, { 6, 230, 2048 }, { 7, 231, 2048 }, + { 5, 232, 2048 }, { 6, 233, 2048 }, { 6, 234, 2048 }, { 7, 235, 2048 }, { 6, 236, 2048 }, { 7, 237, 2048 }, { 7, 238, 2048 }, { 8, 239, 2048 }, + { 5, 240, 2048 }, { 6, 241, 2048 }, { 6, 242, 2048 }, { 7, 243, 2048 }, { 6, 244, 2048 }, { 7, 245, 2048 }, { 7, 246, 2048 }, { 8, 247, 2048 }, + { 6, 248, 2048 }, { 7, 249, 2048 }, { 7, 250, 2048 }, { 8, 251, 2048 }, { 7, 252, 2048 }, { 8, 253, 2048 }, { 8, 254, 2048 }, { 9, 255, 2048 }, + { 2, 256, 2048 }, { 3, 257, 2048 }, { 3, 258, 2048 }, { 4, 259, 2048 }, { 3, 260, 2048 }, { 4, 261, 2048 }, { 4, 262, 2048 }, { 5, 263, 2048 }, + { 3, 264, 2048 }, { 4, 265, 2048 }, { 4, 266, 2048 }, { 5, 267, 2048 }, { 4, 268, 2048 }, { 5, 269, 2048 }, { 5, 270, 2048 }, { 6, 271, 2048 }, + { 3, 272, 2048 }, { 4, 273, 2048 }, { 4, 274, 2048 }, { 5, 275, 2048 }, { 4, 276, 2048 }, { 5, 277, 2048 }, { 5, 278, 2048 }, { 6, 279, 2048 }, + { 4, 280, 2048 }, { 5, 281, 2048 }, { 5, 282, 2048 }, { 6, 283, 2048 }, { 5, 284, 2048 }, { 6, 285, 2048 }, { 6, 286, 2048 }, { 7, 287, 2048 }, + { 3, 288, 2048 }, { 4, 289, 2048 }, { 4, 290, 2048 }, { 5, 291, 2048 }, { 4, 292, 2048 }, { 5, 293, 2048 }, { 5, 294, 2048 }, { 6, 295, 2048 }, + { 4, 296, 2048 }, { 5, 297, 2048 }, { 5, 298, 2048 }, { 6, 299, 2048 }, { 5, 300, 2048 }, { 6, 301, 2048 }, { 6, 302, 2048 }, { 7, 303, 2048 }, + { 4, 304, 2048 }, { 5, 305, 2048 }, { 5, 306, 2048 }, { 6, 307, 2048 }, { 5, 308, 2048 }, { 6, 309, 2048 }, { 6, 310, 2048 }, { 7, 311, 2048 }, + { 5, 312, 2048 }, { 6, 313, 2048 }, { 6, 314, 2048 }, { 7, 315, 2048 }, { 6, 316, 2048 }, { 7, 317, 2048 }, { 7, 318, 2048 }, { 8, 319, 2048 }, + { 3, 320, 2048 }, { 4, 321, 2048 }, { 4, 322, 2048 }, { 5, 323, 2048 }, { 4, 324, 2048 }, { 5, 325, 2048 }, { 5, 326, 2048 }, { 6, 327, 2048 }, + { 4, 328, 2048 }, { 5, 329, 2048 }, { 5, 330, 2048 }, { 6, 331, 2048 }, { 5, 332, 2048 }, { 6, 333, 2048 }, { 6, 334, 2048 }, { 7, 335, 2048 }, + { 4, 336, 2048 }, { 5, 337, 2048 }, { 5, 338, 2048 }, { 6, 339, 2048 }, { 5, 340, 2048 }, { 6, 341, 2048 }, { 6, 342, 2048 }, { 7, 343, 2048 }, + { 5, 344, 2048 }, { 6, 345, 2048 }, { 6, 346, 2048 }, { 7, 347, 2048 }, { 6, 348, 2048 }, { 7, 349, 2048 }, { 7, 350, 2048 }, { 8, 351, 2048 }, + { 4, 352, 2048 }, { 5, 353, 2048 }, { 5, 354, 2048 }, { 6, 355, 2048 }, { 5, 356, 2048 }, { 6, 357, 2048 }, { 6, 358, 2048 }, { 7, 359, 2048 }, + { 5, 360, 2048 }, { 6, 361, 2048 }, { 6, 362, 2048 }, { 7, 363, 2048 }, { 6, 364, 2048 }, { 7, 365, 2048 }, { 7, 366, 2048 }, { 8, 367, 2048 }, + { 5, 368, 2048 }, { 6, 369, 2048 }, { 6, 370, 2048 }, { 7, 371, 2048 }, { 6, 372, 2048 }, { 7, 373, 2048 }, { 7, 374, 2048 }, { 8, 375, 2048 }, + { 6, 376, 2048 }, { 7, 377, 2048 }, { 7, 378, 2048 }, { 8, 379, 2048 }, { 7, 380, 2048 }, { 8, 381, 2048 }, { 8, 382, 2048 }, { 9, 383, 2048 }, + { 3, 384, 2048 }, { 4, 385, 2048 }, { 4, 386, 2048 }, { 5, 387, 2048 }, { 4, 388, 2048 }, { 5, 389, 2048 }, { 5, 390, 2048 }, { 6, 391, 2048 }, + { 4, 392, 2048 }, { 5, 393, 2048 }, { 5, 394, 2048 }, { 6, 395, 2048 }, { 5, 396, 2048 }, { 6, 397, 2048 }, { 6, 398, 2048 }, { 7, 399, 2048 }, + { 4, 400, 2048 }, { 5, 401, 2048 }, { 5, 402, 2048 }, { 6, 403, 2048 }, { 5, 404, 2048 }, { 6, 405, 2048 }, { 6, 406, 2048 }, { 7, 407, 2048 }, + { 5, 408, 2048 }, { 6, 409, 2048 }, { 6, 410, 2048 }, { 7, 411, 2048 }, { 6, 412, 2048 }, { 7, 413, 2048 }, { 7, 414, 2048 }, { 8, 415, 2048 }, + { 4, 416, 2048 }, { 5, 417, 2048 }, { 5, 418, 2048 }, { 6, 419, 2048 }, { 5, 420, 2048 }, { 6, 421, 2048 }, { 6, 422, 2048 }, { 7, 423, 2048 }, + { 5, 424, 2048 }, { 6, 425, 2048 }, { 6, 426, 2048 }, { 7, 427, 2048 }, { 6, 428, 2048 }, { 7, 429, 2048 }, { 7, 430, 2048 }, { 8, 431, 2048 }, + { 5, 432, 2048 }, { 6, 433, 2048 }, { 6, 434, 2048 }, { 7, 435, 2048 }, { 6, 436, 2048 }, { 7, 437, 2048 }, { 7, 438, 2048 }, { 8, 439, 2048 }, + { 6, 440, 2048 }, { 7, 441, 2048 }, { 7, 442, 2048 }, { 8, 443, 2048 }, { 7, 444, 2048 }, { 8, 445, 2048 }, { 8, 446, 2048 }, { 9, 447, 2048 }, + { 4, 448, 2048 }, { 5, 449, 2048 }, { 5, 450, 2048 }, { 6, 451, 2048 }, { 5, 452, 2048 }, { 6, 453, 2048 }, { 6, 454, 2048 }, { 7, 455, 2048 }, + { 5, 456, 2048 }, { 6, 457, 2048 }, { 6, 458, 2048 }, { 7, 459, 2048 }, { 6, 460, 2048 }, { 7, 461, 2048 }, { 7, 462, 2048 }, { 8, 463, 2048 }, + { 5, 464, 2048 }, { 6, 465, 2048 }, { 6, 466, 2048 }, { 7, 467, 2048 }, { 6, 468, 2048 }, { 7, 469, 2048 }, { 7, 470, 2048 }, { 8, 471, 2048 }, + { 6, 472, 2048 }, { 7, 473, 2048 }, { 7, 474, 2048 }, { 8, 475, 2048 }, { 7, 476, 2048 }, { 8, 477, 2048 }, { 8, 478, 2048 }, { 9, 479, 2048 }, + { 5, 480, 2048 }, { 6, 481, 2048 }, { 6, 482, 2048 }, { 7, 483, 2048 }, { 6, 484, 2048 }, { 7, 485, 2048 }, { 7, 486, 2048 }, { 8, 487, 2048 }, + { 6, 488, 2048 }, { 7, 489, 2048 }, { 7, 490, 2048 }, { 8, 491, 2048 }, { 7, 492, 2048 }, { 8, 493, 2048 }, { 8, 494, 2048 }, { 9, 495, 2048 }, + { 6, 496, 2048 }, { 7, 497, 2048 }, { 7, 498, 2048 }, { 8, 499, 2048 }, { 7, 500, 2048 }, { 8, 501, 2048 }, { 8, 502, 2048 }, { 9, 503, 2048 }, + { 7, 504, 2048 }, { 8, 505, 2048 }, { 8, 506, 2048 }, { 9, 507, 2048 }, { 8, 508, 2048 }, { 9, 509, 2048 }, { 9, 510, 2048 }, { 10, 511, 2048 }, + { 2, 512, 2048 }, { 3, 513, 2048 }, { 3, 514, 2048 }, { 4, 515, 2048 }, { 3, 516, 2048 }, { 4, 517, 2048 }, { 4, 518, 2048 }, { 5, 519, 2048 }, + { 3, 520, 2048 }, { 4, 521, 2048 }, { 4, 522, 2048 }, { 5, 523, 2048 }, { 4, 524, 2048 }, { 5, 525, 2048 }, { 5, 526, 2048 }, { 6, 527, 2048 }, + { 3, 528, 2048 }, { 4, 529, 2048 }, { 4, 530, 2048 }, { 5, 531, 2048 }, { 4, 532, 2048 }, { 5, 533, 2048 }, { 5, 534, 2048 }, { 6, 535, 2048 }, + { 4, 536, 2048 }, { 5, 537, 2048 }, { 5, 538, 2048 }, { 6, 539, 2048 }, { 5, 540, 2048 }, { 6, 541, 2048 }, { 6, 542, 2048 }, { 7, 543, 2048 }, + { 3, 544, 2048 }, { 4, 545, 2048 }, { 4, 546, 2048 }, { 5, 547, 2048 }, { 4, 548, 2048 }, { 5, 549, 2048 }, { 5, 550, 2048 }, { 6, 551, 2048 }, + { 4, 552, 2048 }, { 5, 553, 2048 }, { 5, 554, 2048 }, { 6, 555, 2048 }, { 5, 556, 2048 }, { 6, 557, 2048 }, { 6, 558, 2048 }, { 7, 559, 2048 }, + { 4, 560, 2048 }, { 5, 561, 2048 }, { 5, 562, 2048 }, { 6, 563, 2048 }, { 5, 564, 2048 }, { 6, 565, 2048 }, { 6, 566, 2048 }, { 7, 567, 2048 }, + { 5, 568, 2048 }, { 6, 569, 2048 }, { 6, 570, 2048 }, { 7, 571, 2048 }, { 6, 572, 2048 }, { 7, 573, 2048 }, { 7, 574, 2048 }, { 8, 575, 2048 }, + { 3, 576, 2048 }, { 4, 577, 2048 }, { 4, 578, 2048 }, { 5, 579, 2048 }, { 4, 580, 2048 }, { 5, 581, 2048 }, { 5, 582, 2048 }, { 6, 583, 2048 }, + { 4, 584, 2048 }, { 5, 585, 2048 }, { 5, 586, 2048 }, { 6, 587, 2048 }, { 5, 588, 2048 }, { 6, 589, 2048 }, { 6, 590, 2048 }, { 7, 591, 2048 }, + { 4, 592, 2048 }, { 5, 593, 2048 }, { 5, 594, 2048 }, { 6, 595, 2048 }, { 5, 596, 2048 }, { 6, 597, 2048 }, { 6, 598, 2048 }, { 7, 599, 2048 }, + { 5, 600, 2048 }, { 6, 601, 2048 }, { 6, 602, 2048 }, { 7, 603, 2048 }, { 6, 604, 2048 }, { 7, 605, 2048 }, { 7, 606, 2048 }, { 8, 607, 2048 }, + { 4, 608, 2048 }, { 5, 609, 2048 }, { 5, 610, 2048 }, { 6, 611, 2048 }, { 5, 612, 2048 }, { 6, 613, 2048 }, { 6, 614, 2048 }, { 7, 615, 2048 }, + { 5, 616, 2048 }, { 6, 617, 2048 }, { 6, 618, 2048 }, { 7, 619, 2048 }, { 6, 620, 2048 }, { 7, 621, 2048 }, { 7, 622, 2048 }, { 8, 623, 2048 }, + { 5, 624, 2048 }, { 6, 625, 2048 }, { 6, 626, 2048 }, { 7, 627, 2048 }, { 6, 628, 2048 }, { 7, 629, 2048 }, { 7, 630, 2048 }, { 8, 631, 2048 }, + { 6, 632, 2048 }, { 7, 633, 2048 }, { 7, 634, 2048 }, { 8, 635, 2048 }, { 7, 636, 2048 }, { 8, 637, 2048 }, { 8, 638, 2048 }, { 9, 639, 2048 }, + { 3, 640, 2048 }, { 4, 641, 2048 }, { 4, 642, 2048 }, { 5, 643, 2048 }, { 4, 644, 2048 }, { 5, 645, 2048 }, { 5, 646, 2048 }, { 6, 647, 2048 }, + { 4, 648, 2048 }, { 5, 649, 2048 }, { 5, 650, 2048 }, { 6, 651, 2048 }, { 5, 652, 2048 }, { 6, 653, 2048 }, { 6, 654, 2048 }, { 7, 655, 2048 }, + { 4, 656, 2048 }, { 5, 657, 2048 }, { 5, 658, 2048 }, { 6, 659, 2048 }, { 5, 660, 2048 }, { 6, 661, 2048 }, { 6, 662, 2048 }, { 7, 663, 2048 }, + { 5, 664, 2048 }, { 6, 665, 2048 }, { 6, 666, 2048 }, { 7, 667, 2048 }, { 6, 668, 2048 }, { 7, 669, 2048 }, { 7, 670, 2048 }, { 8, 671, 2048 }, + { 4, 672, 2048 }, { 5, 673, 2048 }, { 5, 674, 2048 }, { 6, 675, 2048 }, { 5, 676, 2048 }, { 6, 677, 2048 }, { 6, 678, 2048 }, { 7, 679, 2048 }, + { 5, 680, 2048 }, { 6, 681, 2048 }, { 6, 682, 2048 }, { 7, 683, 2048 }, { 6, 684, 2048 }, { 7, 685, 2048 }, { 7, 686, 2048 }, { 8, 687, 2048 }, + { 5, 688, 2048 }, { 6, 689, 2048 }, { 6, 690, 2048 }, { 7, 691, 2048 }, { 6, 692, 2048 }, { 7, 693, 2048 }, { 7, 694, 2048 }, { 8, 695, 2048 }, + { 6, 696, 2048 }, { 7, 697, 2048 }, { 7, 698, 2048 }, { 8, 699, 2048 }, { 7, 700, 2048 }, { 8, 701, 2048 }, { 8, 702, 2048 }, { 9, 703, 2048 }, + { 4, 704, 2048 }, { 5, 705, 2048 }, { 5, 706, 2048 }, { 6, 707, 2048 }, { 5, 708, 2048 }, { 6, 709, 2048 }, { 6, 710, 2048 }, { 7, 711, 2048 }, + { 5, 712, 2048 }, { 6, 713, 2048 }, { 6, 714, 2048 }, { 7, 715, 2048 }, { 6, 716, 2048 }, { 7, 717, 2048 }, { 7, 718, 2048 }, { 8, 719, 2048 }, + { 5, 720, 2048 }, { 6, 721, 2048 }, { 6, 722, 2048 }, { 7, 723, 2048 }, { 6, 724, 2048 }, { 7, 725, 2048 }, { 7, 726, 2048 }, { 8, 727, 2048 }, + { 6, 728, 2048 }, { 7, 729, 2048 }, { 7, 730, 2048 }, { 8, 731, 2048 }, { 7, 732, 2048 }, { 8, 733, 2048 }, { 8, 734, 2048 }, { 9, 735, 2048 }, + { 5, 736, 2048 }, { 6, 737, 2048 }, { 6, 738, 2048 }, { 7, 739, 2048 }, { 6, 740, 2048 }, { 7, 741, 2048 }, { 7, 742, 2048 }, { 8, 743, 2048 }, + { 6, 744, 2048 }, { 7, 745, 2048 }, { 7, 746, 2048 }, { 8, 747, 2048 }, { 7, 748, 2048 }, { 8, 749, 2048 }, { 8, 750, 2048 }, { 9, 751, 2048 }, + { 6, 752, 2048 }, { 7, 753, 2048 }, { 7, 754, 2048 }, { 8, 755, 2048 }, { 7, 756, 2048 }, { 8, 757, 2048 }, { 8, 758, 2048 }, { 9, 759, 2048 }, + { 7, 760, 2048 }, { 8, 761, 2048 }, { 8, 762, 2048 }, { 9, 763, 2048 }, { 8, 764, 2048 }, { 9, 765, 2048 }, { 9, 766, 2048 }, { 10, 767, 2048 }, + { 3, 768, 2048 }, { 4, 769, 2048 }, { 4, 770, 2048 }, { 5, 771, 2048 }, { 4, 772, 2048 }, { 5, 773, 2048 }, { 5, 774, 2048 }, { 6, 775, 2048 }, + { 4, 776, 2048 }, { 5, 777, 2048 }, { 5, 778, 2048 }, { 6, 779, 2048 }, { 5, 780, 2048 }, { 6, 781, 2048 }, { 6, 782, 2048 }, { 7, 783, 2048 }, + { 4, 784, 2048 }, { 5, 785, 2048 }, { 5, 786, 2048 }, { 6, 787, 2048 }, { 5, 788, 2048 }, { 6, 789, 2048 }, { 6, 790, 2048 }, { 7, 791, 2048 }, + { 5, 792, 2048 }, { 6, 793, 2048 }, { 6, 794, 2048 }, { 7, 795, 2048 }, { 6, 796, 2048 }, { 7, 797, 2048 }, { 7, 798, 2048 }, { 8, 799, 2048 }, + { 4, 800, 2048 }, { 5, 801, 2048 }, { 5, 802, 2048 }, { 6, 803, 2048 }, { 5, 804, 2048 }, { 6, 805, 2048 }, { 6, 806, 2048 }, { 7, 807, 2048 }, + { 5, 808, 2048 }, { 6, 809, 2048 }, { 6, 810, 2048 }, { 7, 811, 2048 }, { 6, 812, 2048 }, { 7, 813, 2048 }, { 7, 814, 2048 }, { 8, 815, 2048 }, + { 5, 816, 2048 }, { 6, 817, 2048 }, { 6, 818, 2048 }, { 7, 819, 2048 }, { 6, 820, 2048 }, { 7, 821, 2048 }, { 7, 822, 2048 }, { 8, 823, 2048 }, + { 6, 824, 2048 }, { 7, 825, 2048 }, { 7, 826, 2048 }, { 8, 827, 2048 }, { 7, 828, 2048 }, { 8, 829, 2048 }, { 8, 830, 2048 }, { 9, 831, 2048 }, + { 4, 832, 2048 }, { 5, 833, 2048 }, { 5, 834, 2048 }, { 6, 835, 2048 }, { 5, 836, 2048 }, { 6, 837, 2048 }, { 6, 838, 2048 }, { 7, 839, 2048 }, + { 5, 840, 2048 }, { 6, 841, 2048 }, { 6, 842, 2048 }, { 7, 843, 2048 }, { 6, 844, 2048 }, { 7, 845, 2048 }, { 7, 846, 2048 }, { 8, 847, 2048 }, + { 5, 848, 2048 }, { 6, 849, 2048 }, { 6, 850, 2048 }, { 7, 851, 2048 }, { 6, 852, 2048 }, { 7, 853, 2048 }, { 7, 854, 2048 }, { 8, 855, 2048 }, + { 6, 856, 2048 }, { 7, 857, 2048 }, { 7, 858, 2048 }, { 8, 859, 2048 }, { 7, 860, 2048 }, { 8, 861, 2048 }, { 8, 862, 2048 }, { 9, 863, 2048 }, + { 5, 864, 2048 }, { 6, 865, 2048 }, { 6, 866, 2048 }, { 7, 867, 2048 }, { 6, 868, 2048 }, { 7, 869, 2048 }, { 7, 870, 2048 }, { 8, 871, 2048 }, + { 6, 872, 2048 }, { 7, 873, 2048 }, { 7, 874, 2048 }, { 8, 875, 2048 }, { 7, 876, 2048 }, { 8, 877, 2048 }, { 8, 878, 2048 }, { 9, 879, 2048 }, + { 6, 880, 2048 }, { 7, 881, 2048 }, { 7, 882, 2048 }, { 8, 883, 2048 }, { 7, 884, 2048 }, { 8, 885, 2048 }, { 8, 886, 2048 }, { 9, 887, 2048 }, + { 7, 888, 2048 }, { 8, 889, 2048 }, { 8, 890, 2048 }, { 9, 891, 2048 }, { 8, 892, 2048 }, { 9, 893, 2048 }, { 9, 894, 2048 }, { 10, 895, 2048 }, + { 4, 896, 2048 }, { 5, 897, 2048 }, { 5, 898, 2048 }, { 6, 899, 2048 }, { 5, 900, 2048 }, { 6, 901, 2048 }, { 6, 902, 2048 }, { 7, 903, 2048 }, + { 5, 904, 2048 }, { 6, 905, 2048 }, { 6, 906, 2048 }, { 7, 907, 2048 }, { 6, 908, 2048 }, { 7, 909, 2048 }, { 7, 910, 2048 }, { 8, 911, 2048 }, + { 5, 912, 2048 }, { 6, 913, 2048 }, { 6, 914, 2048 }, { 7, 915, 2048 }, { 6, 916, 2048 }, { 7, 917, 2048 }, { 7, 918, 2048 }, { 8, 919, 2048 }, + { 6, 920, 2048 }, { 7, 921, 2048 }, { 7, 922, 2048 }, { 8, 923, 2048 }, { 7, 924, 2048 }, { 8, 925, 2048 }, { 8, 926, 2048 }, { 9, 927, 2048 }, + { 5, 928, 2048 }, { 6, 929, 2048 }, { 6, 930, 2048 }, { 7, 931, 2048 }, { 6, 932, 2048 }, { 7, 933, 2048 }, { 7, 934, 2048 }, { 8, 935, 2048 }, + { 6, 936, 2048 }, { 7, 937, 2048 }, { 7, 938, 2048 }, { 8, 939, 2048 }, { 7, 940, 2048 }, { 8, 941, 2048 }, { 8, 942, 2048 }, { 9, 943, 2048 }, + { 6, 944, 2048 }, { 7, 945, 2048 }, { 7, 946, 2048 }, { 8, 947, 2048 }, { 7, 948, 2048 }, { 8, 949, 2048 }, { 8, 950, 2048 }, { 9, 951, 2048 }, + { 7, 952, 2048 }, { 8, 953, 2048 }, { 8, 954, 2048 }, { 9, 955, 2048 }, { 8, 956, 2048 }, { 9, 957, 2048 }, { 9, 958, 2048 }, { 10, 959, 2048 }, + { 5, 960, 2048 }, { 6, 961, 2048 }, { 6, 962, 2048 }, { 7, 963, 2048 }, { 6, 964, 2048 }, { 7, 965, 2048 }, { 7, 966, 2048 }, { 8, 967, 2048 }, + { 6, 968, 2048 }, { 7, 969, 2048 }, { 7, 970, 2048 }, { 8, 971, 2048 }, { 7, 972, 2048 }, { 8, 973, 2048 }, { 8, 974, 2048 }, { 9, 975, 2048 }, + { 6, 976, 2048 }, { 7, 977, 2048 }, { 7, 978, 2048 }, { 8, 979, 2048 }, { 7, 980, 2048 }, { 8, 981, 2048 }, { 8, 982, 2048 }, { 9, 983, 2048 }, + { 7, 984, 2048 }, { 8, 985, 2048 }, { 8, 986, 2048 }, { 9, 987, 2048 }, { 8, 988, 2048 }, { 9, 989, 2048 }, { 9, 990, 2048 }, { 10, 991, 2048 }, + { 6, 992, 2048 }, { 7, 993, 2048 }, { 7, 994, 2048 }, { 8, 995, 2048 }, { 7, 996, 2048 }, { 8, 997, 2048 }, { 8, 998, 2048 }, { 9, 999, 2048 }, + { 7, 1000, 2048 }, { 8, 1001, 2048 }, { 8, 1002, 2048 }, { 9, 1003, 2048 }, { 8, 1004, 2048 }, { 9, 1005, 2048 }, { 9, 1006, 2048 }, { 10, 1007, 2048 }, + { 7, 1008, 2048 }, { 8, 1009, 2048 }, { 8, 1010, 2048 }, { 9, 1011, 2048 }, { 8, 1012, 2048 }, { 9, 1013, 2048 }, { 9, 1014, 2048 }, { 10, 1015, 2048 }, + { 8, 1016, 2048 }, { 9, 1017, 2048 }, { 9, 1018, 2048 }, { 10, 1019, 2048 }, { 9, 1020, 2048 }, { 10, 1021, 2048 }, { 10, 1022, 2048 }, { 11, 1023, 2048 }, + { 2, 1024, 2048 }, { 3, 1025, 2048 }, { 3, 1026, 2048 }, { 4, 1027, 2048 }, { 3, 1028, 2048 }, { 4, 1029, 2048 }, { 4, 1030, 2048 }, { 5, 1031, 2048 }, + { 3, 1032, 2048 }, { 4, 1033, 2048 }, { 4, 1034, 2048 }, { 5, 1035, 2048 }, { 4, 1036, 2048 }, { 5, 1037, 2048 }, { 5, 1038, 2048 }, { 6, 1039, 2048 }, + { 3, 1040, 2048 }, { 4, 1041, 2048 }, { 4, 1042, 2048 }, { 5, 1043, 2048 }, { 4, 1044, 2048 }, { 5, 1045, 2048 }, { 5, 1046, 2048 }, { 6, 1047, 2048 }, + { 4, 1048, 2048 }, { 5, 1049, 2048 }, { 5, 1050, 2048 }, { 6, 1051, 2048 }, { 5, 1052, 2048 }, { 6, 1053, 2048 }, { 6, 1054, 2048 }, { 7, 1055, 2048 }, + { 3, 1056, 2048 }, { 4, 1057, 2048 }, { 4, 1058, 2048 }, { 5, 1059, 2048 }, { 4, 1060, 2048 }, { 5, 1061, 2048 }, { 5, 1062, 2048 }, { 6, 1063, 2048 }, + { 4, 1064, 2048 }, { 5, 1065, 2048 }, { 5, 1066, 2048 }, { 6, 1067, 2048 }, { 5, 1068, 2048 }, { 6, 1069, 2048 }, { 6, 1070, 2048 }, { 7, 1071, 2048 }, + { 4, 1072, 2048 }, { 5, 1073, 2048 }, { 5, 1074, 2048 }, { 6, 1075, 2048 }, { 5, 1076, 2048 }, { 6, 1077, 2048 }, { 6, 1078, 2048 }, { 7, 1079, 2048 }, + { 5, 1080, 2048 }, { 6, 1081, 2048 }, { 6, 1082, 2048 }, { 7, 1083, 2048 }, { 6, 1084, 2048 }, { 7, 1085, 2048 }, { 7, 1086, 2048 }, { 8, 1087, 2048 }, + { 3, 1088, 2048 }, { 4, 1089, 2048 }, { 4, 1090, 2048 }, { 5, 1091, 2048 }, { 4, 1092, 2048 }, { 5, 1093, 2048 }, { 5, 1094, 2048 }, { 6, 1095, 2048 }, + { 4, 1096, 2048 }, { 5, 1097, 2048 }, { 5, 1098, 2048 }, { 6, 1099, 2048 }, { 5, 1100, 2048 }, { 6, 1101, 2048 }, { 6, 1102, 2048 }, { 7, 1103, 2048 }, + { 4, 1104, 2048 }, { 5, 1105, 2048 }, { 5, 1106, 2048 }, { 6, 1107, 2048 }, { 5, 1108, 2048 }, { 6, 1109, 2048 }, { 6, 1110, 2048 }, { 7, 1111, 2048 }, + { 5, 1112, 2048 }, { 6, 1113, 2048 }, { 6, 1114, 2048 }, { 7, 1115, 2048 }, { 6, 1116, 2048 }, { 7, 1117, 2048 }, { 7, 1118, 2048 }, { 8, 1119, 2048 }, + { 4, 1120, 2048 }, { 5, 1121, 2048 }, { 5, 1122, 2048 }, { 6, 1123, 2048 }, { 5, 1124, 2048 }, { 6, 1125, 2048 }, { 6, 1126, 2048 }, { 7, 1127, 2048 }, + { 5, 1128, 2048 }, { 6, 1129, 2048 }, { 6, 1130, 2048 }, { 7, 1131, 2048 }, { 6, 1132, 2048 }, { 7, 1133, 2048 }, { 7, 1134, 2048 }, { 8, 1135, 2048 }, + { 5, 1136, 2048 }, { 6, 1137, 2048 }, { 6, 1138, 2048 }, { 7, 1139, 2048 }, { 6, 1140, 2048 }, { 7, 1141, 2048 }, { 7, 1142, 2048 }, { 8, 1143, 2048 }, + { 6, 1144, 2048 }, { 7, 1145, 2048 }, { 7, 1146, 2048 }, { 8, 1147, 2048 }, { 7, 1148, 2048 }, { 8, 1149, 2048 }, { 8, 1150, 2048 }, { 9, 1151, 2048 }, + { 3, 1152, 2048 }, { 4, 1153, 2048 }, { 4, 1154, 2048 }, { 5, 1155, 2048 }, { 4, 1156, 2048 }, { 5, 1157, 2048 }, { 5, 1158, 2048 }, { 6, 1159, 2048 }, + { 4, 1160, 2048 }, { 5, 1161, 2048 }, { 5, 1162, 2048 }, { 6, 1163, 2048 }, { 5, 1164, 2048 }, { 6, 1165, 2048 }, { 6, 1166, 2048 }, { 7, 1167, 2048 }, + { 4, 1168, 2048 }, { 5, 1169, 2048 }, { 5, 1170, 2048 }, { 6, 1171, 2048 }, { 5, 1172, 2048 }, { 6, 1173, 2048 }, { 6, 1174, 2048 }, { 7, 1175, 2048 }, + { 5, 1176, 2048 }, { 6, 1177, 2048 }, { 6, 1178, 2048 }, { 7, 1179, 2048 }, { 6, 1180, 2048 }, { 7, 1181, 2048 }, { 7, 1182, 2048 }, { 8, 1183, 2048 }, + { 4, 1184, 2048 }, { 5, 1185, 2048 }, { 5, 1186, 2048 }, { 6, 1187, 2048 }, { 5, 1188, 2048 }, { 6, 1189, 2048 }, { 6, 1190, 2048 }, { 7, 1191, 2048 }, + { 5, 1192, 2048 }, { 6, 1193, 2048 }, { 6, 1194, 2048 }, { 7, 1195, 2048 }, { 6, 1196, 2048 }, { 7, 1197, 2048 }, { 7, 1198, 2048 }, { 8, 1199, 2048 }, + { 5, 1200, 2048 }, { 6, 1201, 2048 }, { 6, 1202, 2048 }, { 7, 1203, 2048 }, { 6, 1204, 2048 }, { 7, 1205, 2048 }, { 7, 1206, 2048 }, { 8, 1207, 2048 }, + { 6, 1208, 2048 }, { 7, 1209, 2048 }, { 7, 1210, 2048 }, { 8, 1211, 2048 }, { 7, 1212, 2048 }, { 8, 1213, 2048 }, { 8, 1214, 2048 }, { 9, 1215, 2048 }, + { 4, 1216, 2048 }, { 5, 1217, 2048 }, { 5, 1218, 2048 }, { 6, 1219, 2048 }, { 5, 1220, 2048 }, { 6, 1221, 2048 }, { 6, 1222, 2048 }, { 7, 1223, 2048 }, + { 5, 1224, 2048 }, { 6, 1225, 2048 }, { 6, 1226, 2048 }, { 7, 1227, 2048 }, { 6, 1228, 2048 }, { 7, 1229, 2048 }, { 7, 1230, 2048 }, { 8, 1231, 2048 }, + { 5, 1232, 2048 }, { 6, 1233, 2048 }, { 6, 1234, 2048 }, { 7, 1235, 2048 }, { 6, 1236, 2048 }, { 7, 1237, 2048 }, { 7, 1238, 2048 }, { 8, 1239, 2048 }, + { 6, 1240, 2048 }, { 7, 1241, 2048 }, { 7, 1242, 2048 }, { 8, 1243, 2048 }, { 7, 1244, 2048 }, { 8, 1245, 2048 }, { 8, 1246, 2048 }, { 9, 1247, 2048 }, + { 5, 1248, 2048 }, { 6, 1249, 2048 }, { 6, 1250, 2048 }, { 7, 1251, 2048 }, { 6, 1252, 2048 }, { 7, 1253, 2048 }, { 7, 1254, 2048 }, { 8, 1255, 2048 }, + { 6, 1256, 2048 }, { 7, 1257, 2048 }, { 7, 1258, 2048 }, { 8, 1259, 2048 }, { 7, 1260, 2048 }, { 8, 1261, 2048 }, { 8, 1262, 2048 }, { 9, 1263, 2048 }, + { 6, 1264, 2048 }, { 7, 1265, 2048 }, { 7, 1266, 2048 }, { 8, 1267, 2048 }, { 7, 1268, 2048 }, { 8, 1269, 2048 }, { 8, 1270, 2048 }, { 9, 1271, 2048 }, + { 7, 1272, 2048 }, { 8, 1273, 2048 }, { 8, 1274, 2048 }, { 9, 1275, 2048 }, { 8, 1276, 2048 }, { 9, 1277, 2048 }, { 9, 1278, 2048 }, { 10, 1279, 2048 }, + { 3, 1280, 2048 }, { 4, 1281, 2048 }, { 4, 1282, 2048 }, { 5, 1283, 2048 }, { 4, 1284, 2048 }, { 5, 1285, 2048 }, { 5, 1286, 2048 }, { 6, 1287, 2048 }, + { 4, 1288, 2048 }, { 5, 1289, 2048 }, { 5, 1290, 2048 }, { 6, 1291, 2048 }, { 5, 1292, 2048 }, { 6, 1293, 2048 }, { 6, 1294, 2048 }, { 7, 1295, 2048 }, + { 4, 1296, 2048 }, { 5, 1297, 2048 }, { 5, 1298, 2048 }, { 6, 1299, 2048 }, { 5, 1300, 2048 }, { 6, 1301, 2048 }, { 6, 1302, 2048 }, { 7, 1303, 2048 }, + { 5, 1304, 2048 }, { 6, 1305, 2048 }, { 6, 1306, 2048 }, { 7, 1307, 2048 }, { 6, 1308, 2048 }, { 7, 1309, 2048 }, { 7, 1310, 2048 }, { 8, 1311, 2048 }, + { 4, 1312, 2048 }, { 5, 1313, 2048 }, { 5, 1314, 2048 }, { 6, 1315, 2048 }, { 5, 1316, 2048 }, { 6, 1317, 2048 }, { 6, 1318, 2048 }, { 7, 1319, 2048 }, + { 5, 1320, 2048 }, { 6, 1321, 2048 }, { 6, 1322, 2048 }, { 7, 1323, 2048 }, { 6, 1324, 2048 }, { 7, 1325, 2048 }, { 7, 1326, 2048 }, { 8, 1327, 2048 }, + { 5, 1328, 2048 }, { 6, 1329, 2048 }, { 6, 1330, 2048 }, { 7, 1331, 2048 }, { 6, 1332, 2048 }, { 7, 1333, 2048 }, { 7, 1334, 2048 }, { 8, 1335, 2048 }, + { 6, 1336, 2048 }, { 7, 1337, 2048 }, { 7, 1338, 2048 }, { 8, 1339, 2048 }, { 7, 1340, 2048 }, { 8, 1341, 2048 }, { 8, 1342, 2048 }, { 9, 1343, 2048 }, + { 4, 1344, 2048 }, { 5, 1345, 2048 }, { 5, 1346, 2048 }, { 6, 1347, 2048 }, { 5, 1348, 2048 }, { 6, 1349, 2048 }, { 6, 1350, 2048 }, { 7, 1351, 2048 }, + { 5, 1352, 2048 }, { 6, 1353, 2048 }, { 6, 1354, 2048 }, { 7, 1355, 2048 }, { 6, 1356, 2048 }, { 7, 1357, 2048 }, { 7, 1358, 2048 }, { 8, 1359, 2048 }, + { 5, 1360, 2048 }, { 6, 1361, 2048 }, { 6, 1362, 2048 }, { 7, 1363, 2048 }, { 6, 1364, 2048 }, { 7, 1365, 2048 }, { 7, 1366, 2048 }, { 8, 1367, 2048 }, + { 6, 1368, 2048 }, { 7, 1369, 2048 }, { 7, 1370, 2048 }, { 8, 1371, 2048 }, { 7, 1372, 2048 }, { 8, 1373, 2048 }, { 8, 1374, 2048 }, { 9, 1375, 2048 }, + { 5, 1376, 2048 }, { 6, 1377, 2048 }, { 6, 1378, 2048 }, { 7, 1379, 2048 }, { 6, 1380, 2048 }, { 7, 1381, 2048 }, { 7, 1382, 2048 }, { 8, 1383, 2048 }, + { 6, 1384, 2048 }, { 7, 1385, 2048 }, { 7, 1386, 2048 }, { 8, 1387, 2048 }, { 7, 1388, 2048 }, { 8, 1389, 2048 }, { 8, 1390, 2048 }, { 9, 1391, 2048 }, + { 6, 1392, 2048 }, { 7, 1393, 2048 }, { 7, 1394, 2048 }, { 8, 1395, 2048 }, { 7, 1396, 2048 }, { 8, 1397, 2048 }, { 8, 1398, 2048 }, { 9, 1399, 2048 }, + { 7, 1400, 2048 }, { 8, 1401, 2048 }, { 8, 1402, 2048 }, { 9, 1403, 2048 }, { 8, 1404, 2048 }, { 9, 1405, 2048 }, { 9, 1406, 2048 }, { 10, 1407, 2048 }, + { 4, 1408, 2048 }, { 5, 1409, 2048 }, { 5, 1410, 2048 }, { 6, 1411, 2048 }, { 5, 1412, 2048 }, { 6, 1413, 2048 }, { 6, 1414, 2048 }, { 7, 1415, 2048 }, + { 5, 1416, 2048 }, { 6, 1417, 2048 }, { 6, 1418, 2048 }, { 7, 1419, 2048 }, { 6, 1420, 2048 }, { 7, 1421, 2048 }, { 7, 1422, 2048 }, { 8, 1423, 2048 }, + { 5, 1424, 2048 }, { 6, 1425, 2048 }, { 6, 1426, 2048 }, { 7, 1427, 2048 }, { 6, 1428, 2048 }, { 7, 1429, 2048 }, { 7, 1430, 2048 }, { 8, 1431, 2048 }, + { 6, 1432, 2048 }, { 7, 1433, 2048 }, { 7, 1434, 2048 }, { 8, 1435, 2048 }, { 7, 1436, 2048 }, { 8, 1437, 2048 }, { 8, 1438, 2048 }, { 9, 1439, 2048 }, + { 5, 1440, 2048 }, { 6, 1441, 2048 }, { 6, 1442, 2048 }, { 7, 1443, 2048 }, { 6, 1444, 2048 }, { 7, 1445, 2048 }, { 7, 1446, 2048 }, { 8, 1447, 2048 }, + { 6, 1448, 2048 }, { 7, 1449, 2048 }, { 7, 1450, 2048 }, { 8, 1451, 2048 }, { 7, 1452, 2048 }, { 8, 1453, 2048 }, { 8, 1454, 2048 }, { 9, 1455, 2048 }, + { 6, 1456, 2048 }, { 7, 1457, 2048 }, { 7, 1458, 2048 }, { 8, 1459, 2048 }, { 7, 1460, 2048 }, { 8, 1461, 2048 }, { 8, 1462, 2048 }, { 9, 1463, 2048 }, + { 7, 1464, 2048 }, { 8, 1465, 2048 }, { 8, 1466, 2048 }, { 9, 1467, 2048 }, { 8, 1468, 2048 }, { 9, 1469, 2048 }, { 9, 1470, 2048 }, { 10, 1471, 2048 }, + { 5, 1472, 2048 }, { 6, 1473, 2048 }, { 6, 1474, 2048 }, { 7, 1475, 2048 }, { 6, 1476, 2048 }, { 7, 1477, 2048 }, { 7, 1478, 2048 }, { 8, 1479, 2048 }, + { 6, 1480, 2048 }, { 7, 1481, 2048 }, { 7, 1482, 2048 }, { 8, 1483, 2048 }, { 7, 1484, 2048 }, { 8, 1485, 2048 }, { 8, 1486, 2048 }, { 9, 1487, 2048 }, + { 6, 1488, 2048 }, { 7, 1489, 2048 }, { 7, 1490, 2048 }, { 8, 1491, 2048 }, { 7, 1492, 2048 }, { 8, 1493, 2048 }, { 8, 1494, 2048 }, { 9, 1495, 2048 }, + { 7, 1496, 2048 }, { 8, 1497, 2048 }, { 8, 1498, 2048 }, { 9, 1499, 2048 }, { 8, 1500, 2048 }, { 9, 1501, 2048 }, { 9, 1502, 2048 }, { 10, 1503, 2048 }, + { 6, 1504, 2048 }, { 7, 1505, 2048 }, { 7, 1506, 2048 }, { 8, 1507, 2048 }, { 7, 1508, 2048 }, { 8, 1509, 2048 }, { 8, 1510, 2048 }, { 9, 1511, 2048 }, + { 7, 1512, 2048 }, { 8, 1513, 2048 }, { 8, 1514, 2048 }, { 9, 1515, 2048 }, { 8, 1516, 2048 }, { 9, 1517, 2048 }, { 9, 1518, 2048 }, { 10, 1519, 2048 }, + { 7, 1520, 2048 }, { 8, 1521, 2048 }, { 8, 1522, 2048 }, { 9, 1523, 2048 }, { 8, 1524, 2048 }, { 9, 1525, 2048 }, { 9, 1526, 2048 }, { 10, 1527, 2048 }, + { 8, 1528, 2048 }, { 9, 1529, 2048 }, { 9, 1530, 2048 }, { 10, 1531, 2048 }, { 9, 1532, 2048 }, { 10, 1533, 2048 }, { 10, 1534, 2048 }, { 11, 1535, 2048 }, + { 3, 1536, 2048 }, { 4, 1537, 2048 }, { 4, 1538, 2048 }, { 5, 1539, 2048 }, { 4, 1540, 2048 }, { 5, 1541, 2048 }, { 5, 1542, 2048 }, { 6, 1543, 2048 }, + { 4, 1544, 2048 }, { 5, 1545, 2048 }, { 5, 1546, 2048 }, { 6, 1547, 2048 }, { 5, 1548, 2048 }, { 6, 1549, 2048 }, { 6, 1550, 2048 }, { 7, 1551, 2048 }, + { 4, 1552, 2048 }, { 5, 1553, 2048 }, { 5, 1554, 2048 }, { 6, 1555, 2048 }, { 5, 1556, 2048 }, { 6, 1557, 2048 }, { 6, 1558, 2048 }, { 7, 1559, 2048 }, + { 5, 1560, 2048 }, { 6, 1561, 2048 }, { 6, 1562, 2048 }, { 7, 1563, 2048 }, { 6, 1564, 2048 }, { 7, 1565, 2048 }, { 7, 1566, 2048 }, { 8, 1567, 2048 }, + { 4, 1568, 2048 }, { 5, 1569, 2048 }, { 5, 1570, 2048 }, { 6, 1571, 2048 }, { 5, 1572, 2048 }, { 6, 1573, 2048 }, { 6, 1574, 2048 }, { 7, 1575, 2048 }, + { 5, 1576, 2048 }, { 6, 1577, 2048 }, { 6, 1578, 2048 }, { 7, 1579, 2048 }, { 6, 1580, 2048 }, { 7, 1581, 2048 }, { 7, 1582, 2048 }, { 8, 1583, 2048 }, + { 5, 1584, 2048 }, { 6, 1585, 2048 }, { 6, 1586, 2048 }, { 7, 1587, 2048 }, { 6, 1588, 2048 }, { 7, 1589, 2048 }, { 7, 1590, 2048 }, { 8, 1591, 2048 }, + { 6, 1592, 2048 }, { 7, 1593, 2048 }, { 7, 1594, 2048 }, { 8, 1595, 2048 }, { 7, 1596, 2048 }, { 8, 1597, 2048 }, { 8, 1598, 2048 }, { 9, 1599, 2048 }, + { 4, 1600, 2048 }, { 5, 1601, 2048 }, { 5, 1602, 2048 }, { 6, 1603, 2048 }, { 5, 1604, 2048 }, { 6, 1605, 2048 }, { 6, 1606, 2048 }, { 7, 1607, 2048 }, + { 5, 1608, 2048 }, { 6, 1609, 2048 }, { 6, 1610, 2048 }, { 7, 1611, 2048 }, { 6, 1612, 2048 }, { 7, 1613, 2048 }, { 7, 1614, 2048 }, { 8, 1615, 2048 }, + { 5, 1616, 2048 }, { 6, 1617, 2048 }, { 6, 1618, 2048 }, { 7, 1619, 2048 }, { 6, 1620, 2048 }, { 7, 1621, 2048 }, { 7, 1622, 2048 }, { 8, 1623, 2048 }, + { 6, 1624, 2048 }, { 7, 1625, 2048 }, { 7, 1626, 2048 }, { 8, 1627, 2048 }, { 7, 1628, 2048 }, { 8, 1629, 2048 }, { 8, 1630, 2048 }, { 9, 1631, 2048 }, + { 5, 1632, 2048 }, { 6, 1633, 2048 }, { 6, 1634, 2048 }, { 7, 1635, 2048 }, { 6, 1636, 2048 }, { 7, 1637, 2048 }, { 7, 1638, 2048 }, { 8, 1639, 2048 }, + { 6, 1640, 2048 }, { 7, 1641, 2048 }, { 7, 1642, 2048 }, { 8, 1643, 2048 }, { 7, 1644, 2048 }, { 8, 1645, 2048 }, { 8, 1646, 2048 }, { 9, 1647, 2048 }, + { 6, 1648, 2048 }, { 7, 1649, 2048 }, { 7, 1650, 2048 }, { 8, 1651, 2048 }, { 7, 1652, 2048 }, { 8, 1653, 2048 }, { 8, 1654, 2048 }, { 9, 1655, 2048 }, + { 7, 1656, 2048 }, { 8, 1657, 2048 }, { 8, 1658, 2048 }, { 9, 1659, 2048 }, { 8, 1660, 2048 }, { 9, 1661, 2048 }, { 9, 1662, 2048 }, { 10, 1663, 2048 }, + { 4, 1664, 2048 }, { 5, 1665, 2048 }, { 5, 1666, 2048 }, { 6, 1667, 2048 }, { 5, 1668, 2048 }, { 6, 1669, 2048 }, { 6, 1670, 2048 }, { 7, 1671, 2048 }, + { 5, 1672, 2048 }, { 6, 1673, 2048 }, { 6, 1674, 2048 }, { 7, 1675, 2048 }, { 6, 1676, 2048 }, { 7, 1677, 2048 }, { 7, 1678, 2048 }, { 8, 1679, 2048 }, + { 5, 1680, 2048 }, { 6, 1681, 2048 }, { 6, 1682, 2048 }, { 7, 1683, 2048 }, { 6, 1684, 2048 }, { 7, 1685, 2048 }, { 7, 1686, 2048 }, { 8, 1687, 2048 }, + { 6, 1688, 2048 }, { 7, 1689, 2048 }, { 7, 1690, 2048 }, { 8, 1691, 2048 }, { 7, 1692, 2048 }, { 8, 1693, 2048 }, { 8, 1694, 2048 }, { 9, 1695, 2048 }, + { 5, 1696, 2048 }, { 6, 1697, 2048 }, { 6, 1698, 2048 }, { 7, 1699, 2048 }, { 6, 1700, 2048 }, { 7, 1701, 2048 }, { 7, 1702, 2048 }, { 8, 1703, 2048 }, + { 6, 1704, 2048 }, { 7, 1705, 2048 }, { 7, 1706, 2048 }, { 8, 1707, 2048 }, { 7, 1708, 2048 }, { 8, 1709, 2048 }, { 8, 1710, 2048 }, { 9, 1711, 2048 }, + { 6, 1712, 2048 }, { 7, 1713, 2048 }, { 7, 1714, 2048 }, { 8, 1715, 2048 }, { 7, 1716, 2048 }, { 8, 1717, 2048 }, { 8, 1718, 2048 }, { 9, 1719, 2048 }, + { 7, 1720, 2048 }, { 8, 1721, 2048 }, { 8, 1722, 2048 }, { 9, 1723, 2048 }, { 8, 1724, 2048 }, { 9, 1725, 2048 }, { 9, 1726, 2048 }, { 10, 1727, 2048 }, + { 5, 1728, 2048 }, { 6, 1729, 2048 }, { 6, 1730, 2048 }, { 7, 1731, 2048 }, { 6, 1732, 2048 }, { 7, 1733, 2048 }, { 7, 1734, 2048 }, { 8, 1735, 2048 }, + { 6, 1736, 2048 }, { 7, 1737, 2048 }, { 7, 1738, 2048 }, { 8, 1739, 2048 }, { 7, 1740, 2048 }, { 8, 1741, 2048 }, { 8, 1742, 2048 }, { 9, 1743, 2048 }, + { 6, 1744, 2048 }, { 7, 1745, 2048 }, { 7, 1746, 2048 }, { 8, 1747, 2048 }, { 7, 1748, 2048 }, { 8, 1749, 2048 }, { 8, 1750, 2048 }, { 9, 1751, 2048 }, + { 7, 1752, 2048 }, { 8, 1753, 2048 }, { 8, 1754, 2048 }, { 9, 1755, 2048 }, { 8, 1756, 2048 }, { 9, 1757, 2048 }, { 9, 1758, 2048 }, { 10, 1759, 2048 }, + { 6, 1760, 2048 }, { 7, 1761, 2048 }, { 7, 1762, 2048 }, { 8, 1763, 2048 }, { 7, 1764, 2048 }, { 8, 1765, 2048 }, { 8, 1766, 2048 }, { 9, 1767, 2048 }, + { 7, 1768, 2048 }, { 8, 1769, 2048 }, { 8, 1770, 2048 }, { 9, 1771, 2048 }, { 8, 1772, 2048 }, { 9, 1773, 2048 }, { 9, 1774, 2048 }, { 10, 1775, 2048 }, + { 7, 1776, 2048 }, { 8, 1777, 2048 }, { 8, 1778, 2048 }, { 9, 1779, 2048 }, { 8, 1780, 2048 }, { 9, 1781, 2048 }, { 9, 1782, 2048 }, { 10, 1783, 2048 }, + { 8, 1784, 2048 }, { 9, 1785, 2048 }, { 9, 1786, 2048 }, { 10, 1787, 2048 }, { 9, 1788, 2048 }, { 10, 1789, 2048 }, { 10, 1790, 2048 }, { 11, 1791, 2048 }, + { 4, 1792, 2048 }, { 5, 1793, 2048 }, { 5, 1794, 2048 }, { 6, 1795, 2048 }, { 5, 1796, 2048 }, { 6, 1797, 2048 }, { 6, 1798, 2048 }, { 7, 1799, 2048 }, + { 5, 1800, 2048 }, { 6, 1801, 2048 }, { 6, 1802, 2048 }, { 7, 1803, 2048 }, { 6, 1804, 2048 }, { 7, 1805, 2048 }, { 7, 1806, 2048 }, { 8, 1807, 2048 }, + { 5, 1808, 2048 }, { 6, 1809, 2048 }, { 6, 1810, 2048 }, { 7, 1811, 2048 }, { 6, 1812, 2048 }, { 7, 1813, 2048 }, { 7, 1814, 2048 }, { 8, 1815, 2048 }, + { 6, 1816, 2048 }, { 7, 1817, 2048 }, { 7, 1818, 2048 }, { 8, 1819, 2048 }, { 7, 1820, 2048 }, { 8, 1821, 2048 }, { 8, 1822, 2048 }, { 9, 1823, 2048 }, + { 5, 1824, 2048 }, { 6, 1825, 2048 }, { 6, 1826, 2048 }, { 7, 1827, 2048 }, { 6, 1828, 2048 }, { 7, 1829, 2048 }, { 7, 1830, 2048 }, { 8, 1831, 2048 }, + { 6, 1832, 2048 }, { 7, 1833, 2048 }, { 7, 1834, 2048 }, { 8, 1835, 2048 }, { 7, 1836, 2048 }, { 8, 1837, 2048 }, { 8, 1838, 2048 }, { 9, 1839, 2048 }, + { 6, 1840, 2048 }, { 7, 1841, 2048 }, { 7, 1842, 2048 }, { 8, 1843, 2048 }, { 7, 1844, 2048 }, { 8, 1845, 2048 }, { 8, 1846, 2048 }, { 9, 1847, 2048 }, + { 7, 1848, 2048 }, { 8, 1849, 2048 }, { 8, 1850, 2048 }, { 9, 1851, 2048 }, { 8, 1852, 2048 }, { 9, 1853, 2048 }, { 9, 1854, 2048 }, { 10, 1855, 2048 }, + { 5, 1856, 2048 }, { 6, 1857, 2048 }, { 6, 1858, 2048 }, { 7, 1859, 2048 }, { 6, 1860, 2048 }, { 7, 1861, 2048 }, { 7, 1862, 2048 }, { 8, 1863, 2048 }, + { 6, 1864, 2048 }, { 7, 1865, 2048 }, { 7, 1866, 2048 }, { 8, 1867, 2048 }, { 7, 1868, 2048 }, { 8, 1869, 2048 }, { 8, 1870, 2048 }, { 9, 1871, 2048 }, + { 6, 1872, 2048 }, { 7, 1873, 2048 }, { 7, 1874, 2048 }, { 8, 1875, 2048 }, { 7, 1876, 2048 }, { 8, 1877, 2048 }, { 8, 1878, 2048 }, { 9, 1879, 2048 }, + { 7, 1880, 2048 }, { 8, 1881, 2048 }, { 8, 1882, 2048 }, { 9, 1883, 2048 }, { 8, 1884, 2048 }, { 9, 1885, 2048 }, { 9, 1886, 2048 }, { 10, 1887, 2048 }, + { 6, 1888, 2048 }, { 7, 1889, 2048 }, { 7, 1890, 2048 }, { 8, 1891, 2048 }, { 7, 1892, 2048 }, { 8, 1893, 2048 }, { 8, 1894, 2048 }, { 9, 1895, 2048 }, + { 7, 1896, 2048 }, { 8, 1897, 2048 }, { 8, 1898, 2048 }, { 9, 1899, 2048 }, { 8, 1900, 2048 }, { 9, 1901, 2048 }, { 9, 1902, 2048 }, { 10, 1903, 2048 }, + { 7, 1904, 2048 }, { 8, 1905, 2048 }, { 8, 1906, 2048 }, { 9, 1907, 2048 }, { 8, 1908, 2048 }, { 9, 1909, 2048 }, { 9, 1910, 2048 }, { 10, 1911, 2048 }, + { 8, 1912, 2048 }, { 9, 1913, 2048 }, { 9, 1914, 2048 }, { 10, 1915, 2048 }, { 9, 1916, 2048 }, { 10, 1917, 2048 }, { 10, 1918, 2048 }, { 11, 1919, 2048 }, + { 5, 1920, 2048 }, { 6, 1921, 2048 }, { 6, 1922, 2048 }, { 7, 1923, 2048 }, { 6, 1924, 2048 }, { 7, 1925, 2048 }, { 7, 1926, 2048 }, { 8, 1927, 2048 }, + { 6, 1928, 2048 }, { 7, 1929, 2048 }, { 7, 1930, 2048 }, { 8, 1931, 2048 }, { 7, 1932, 2048 }, { 8, 1933, 2048 }, { 8, 1934, 2048 }, { 9, 1935, 2048 }, + { 6, 1936, 2048 }, { 7, 1937, 2048 }, { 7, 1938, 2048 }, { 8, 1939, 2048 }, { 7, 1940, 2048 }, { 8, 1941, 2048 }, { 8, 1942, 2048 }, { 9, 1943, 2048 }, + { 7, 1944, 2048 }, { 8, 1945, 2048 }, { 8, 1946, 2048 }, { 9, 1947, 2048 }, { 8, 1948, 2048 }, { 9, 1949, 2048 }, { 9, 1950, 2048 }, { 10, 1951, 2048 }, + { 6, 1952, 2048 }, { 7, 1953, 2048 }, { 7, 1954, 2048 }, { 8, 1955, 2048 }, { 7, 1956, 2048 }, { 8, 1957, 2048 }, { 8, 1958, 2048 }, { 9, 1959, 2048 }, + { 7, 1960, 2048 }, { 8, 1961, 2048 }, { 8, 1962, 2048 }, { 9, 1963, 2048 }, { 8, 1964, 2048 }, { 9, 1965, 2048 }, { 9, 1966, 2048 }, { 10, 1967, 2048 }, + { 7, 1968, 2048 }, { 8, 1969, 2048 }, { 8, 1970, 2048 }, { 9, 1971, 2048 }, { 8, 1972, 2048 }, { 9, 1973, 2048 }, { 9, 1974, 2048 }, { 10, 1975, 2048 }, + { 8, 1976, 2048 }, { 9, 1977, 2048 }, { 9, 1978, 2048 }, { 10, 1979, 2048 }, { 9, 1980, 2048 }, { 10, 1981, 2048 }, { 10, 1982, 2048 }, { 11, 1983, 2048 }, + { 6, 1984, 2048 }, { 7, 1985, 2048 }, { 7, 1986, 2048 }, { 8, 1987, 2048 }, { 7, 1988, 2048 }, { 8, 1989, 2048 }, { 8, 1990, 2048 }, { 9, 1991, 2048 }, + { 7, 1992, 2048 }, { 8, 1993, 2048 }, { 8, 1994, 2048 }, { 9, 1995, 2048 }, { 8, 1996, 2048 }, { 9, 1997, 2048 }, { 9, 1998, 2048 }, { 10, 1999, 2048 }, + { 7, 2000, 2048 }, { 8, 2001, 2048 }, { 8, 2002, 2048 }, { 9, 2003, 2048 }, { 8, 2004, 2048 }, { 9, 2005, 2048 }, { 9, 2006, 2048 }, { 10, 2007, 2048 }, + { 8, 2008, 2048 }, { 9, 2009, 2048 }, { 9, 2010, 2048 }, { 10, 2011, 2048 }, { 9, 2012, 2048 }, { 10, 2013, 2048 }, { 10, 2014, 2048 }, { 11, 2015, 2048 }, + { 7, 2016, 2048 }, { 8, 2017, 2048 }, { 8, 2018, 2048 }, { 9, 2019, 2048 }, { 8, 2020, 2048 }, { 9, 2021, 2048 }, { 9, 2022, 2048 }, { 10, 2023, 2048 }, + { 8, 2024, 2048 }, { 9, 2025, 2048 }, { 9, 2026, 2048 }, { 10, 2027, 2048 }, { 9, 2028, 2048 }, { 10, 2029, 2048 }, { 10, 2030, 2048 }, { 11, 2031, 2048 }, + { 8, 2032, 2048 }, { 9, 2033, 2048 }, { 9, 2034, 2048 }, { 10, 2035, 2048 }, { 9, 2036, 2048 }, { 10, 2037, 2048 }, { 10, 2038, 2048 }, { 11, 2039, 2048 }, + { 9, 2040, 2048 }, { 10, 2041, 2048 }, { 10, 2042, 2048 }, { 11, 2043, 2048 }, { 10, 2044, 2048 }, { 11, 2045, 2048 }, { 11, 2046, 2048 }, { 12, 2047, 2048 }, #endif #endif #endif @@ -574,7 +572,7 @@ static const struct { }; /* find a hole and free as required, return -1 if no hole found */ -static int find_hole(void) +static int _find_hole(void) { unsigned x; int y, z; @@ -610,13 +608,13 @@ static int find_hole(void) } /* determine if a base is already in the cache and if so, where */ -static int find_base(ecc_point *g) +static int _find_base(ecc_point *g) { int x; for (x = 0; x < FP_ENTRIES; x++) { - if (fp_cache[x].g != NULL && - mp_cmp(fp_cache[x].g->x, g->x) == LTC_MP_EQ && - mp_cmp(fp_cache[x].g->y, g->y) == LTC_MP_EQ && + if (fp_cache[x].g != NULL && + mp_cmp(fp_cache[x].g->x, g->x) == LTC_MP_EQ && + mp_cmp(fp_cache[x].g->y, g->y) == LTC_MP_EQ && mp_cmp(fp_cache[x].g->z, g->z) == LTC_MP_EQ) { break; } @@ -628,7 +626,7 @@ static int find_base(ecc_point *g) } /* add a new base to the cache */ -static int add_entry(int idx, ecc_point *g) +static int _add_entry(int idx, ecc_point *g) { unsigned x, y; @@ -645,7 +643,7 @@ static int add_entry(int idx, ecc_point *g) ltc_ecc_del_point(fp_cache[idx].g); fp_cache[idx].g = NULL; return CRYPT_MEM; - } + } for (x = 0; x < (1U<<FP_LUT); x++) { fp_cache[idx].LUT[x] = ltc_ecc_new_point(); @@ -660,18 +658,18 @@ static int add_entry(int idx, ecc_point *g) return CRYPT_MEM; } } - + fp_cache[idx].lru_count = 0; return CRYPT_OK; } -/* build the LUT by spacing the bits of the input by #modulus/FP_LUT bits apart - * - * The algorithm builds patterns in increasing bit order by first making all +/* build the LUT by spacing the bits of the input by #modulus/FP_LUT bits apart + * + * The algorithm builds patterns in increasing bit order by first making all * single bit input patterns, then all two bit input patterns and so on */ -static int build_lut(int idx, void *modulus, void *mp, void *mu) -{ +static int _build_lut(int idx, void *modulus, void *mp, void *mu) +{ unsigned x, y, err, bitlen, lut_gap; void *tmp; @@ -681,65 +679,65 @@ static int build_lut(int idx, void *modulus, void *mp, void *mu) if ((sizeof(lut_orders) / sizeof(lut_orders[0])) < (1U<<FP_LUT)) { err = CRYPT_INVALID_ARG; goto DONE; - } + } /* get bitlen and round up to next multiple of FP_LUT */ bitlen = mp_unsigned_bin_size(modulus) << 3; x = bitlen % FP_LUT; if (x) { bitlen += FP_LUT - x; - } + } lut_gap = bitlen / FP_LUT; /* init the mu */ if ((err = mp_init_copy(&fp_cache[idx].mu, mu)) != CRYPT_OK) { goto ERR; } - + /* copy base */ - if ((mp_mulmod(fp_cache[idx].g->x, mu, modulus, fp_cache[idx].LUT[1]->x) != CRYPT_OK) || - (mp_mulmod(fp_cache[idx].g->y, mu, modulus, fp_cache[idx].LUT[1]->y) != CRYPT_OK) || + if ((mp_mulmod(fp_cache[idx].g->x, mu, modulus, fp_cache[idx].LUT[1]->x) != CRYPT_OK) || + (mp_mulmod(fp_cache[idx].g->y, mu, modulus, fp_cache[idx].LUT[1]->y) != CRYPT_OK) || (mp_mulmod(fp_cache[idx].g->z, mu, modulus, fp_cache[idx].LUT[1]->z) != CRYPT_OK)) { goto ERR; } - + /* make all single bit entries */ for (x = 1; x < FP_LUT; x++) { - if ((mp_copy(fp_cache[idx].LUT[1<<(x-1)]->x, fp_cache[idx].LUT[1<<x]->x) != CRYPT_OK) || - (mp_copy(fp_cache[idx].LUT[1<<(x-1)]->y, fp_cache[idx].LUT[1<<x]->y) != CRYPT_OK) || + if ((mp_copy(fp_cache[idx].LUT[1<<(x-1)]->x, fp_cache[idx].LUT[1<<x]->x) != CRYPT_OK) || + (mp_copy(fp_cache[idx].LUT[1<<(x-1)]->y, fp_cache[idx].LUT[1<<x]->y) != CRYPT_OK) || (mp_copy(fp_cache[idx].LUT[1<<(x-1)]->z, fp_cache[idx].LUT[1<<x]->z) != CRYPT_OK)) { goto ERR; } - + /* now double it bitlen/FP_LUT times */ for (y = 0; y < lut_gap; y++) { if ((err = ltc_mp.ecc_ptdbl(fp_cache[idx].LUT[1<<x], fp_cache[idx].LUT[1<<x], modulus, mp)) != CRYPT_OK) { goto ERR; } - } + } } - + /* now make all entries in increase order of hamming weight */ for (x = 2; x <= FP_LUT; x++) { for (y = 0; y < (1UL<<FP_LUT); y++) { if (lut_orders[y].ham != (int)x) continue; - + /* perform the add */ - if ((err = ltc_mp.ecc_ptadd(fp_cache[idx].LUT[lut_orders[y].terma], fp_cache[idx].LUT[lut_orders[y].termb], + if ((err = ltc_mp.ecc_ptadd(fp_cache[idx].LUT[lut_orders[y].terma], fp_cache[idx].LUT[lut_orders[y].termb], fp_cache[idx].LUT[y], modulus, mp)) != CRYPT_OK) { goto ERR; } } } - + /* now map all entries back to affine space to make point addition faster */ if ((err = mp_init(&tmp)) != CRYPT_OK) { goto ERR; } for (x = 1; x < (1UL<<FP_LUT); x++) { /* convert z to normal from montgomery */ if ((err = mp_montgomery_reduce(fp_cache[idx].LUT[x]->z, modulus, mp)) != CRYPT_OK) { goto ERR; } - + /* invert it */ if ((err = mp_invmod(fp_cache[idx].LUT[x]->z, modulus, fp_cache[idx].LUT[x]->z)) != CRYPT_OK) { goto ERR; } /* now square it */ if ((err = mp_sqrmod(fp_cache[idx].LUT[x]->z, modulus, tmp)) != CRYPT_OK) { goto ERR; } - + /* fix x */ if ((err = mp_mulmod(fp_cache[idx].LUT[x]->x, tmp, modulus, fp_cache[idx].LUT[x]->x)) != CRYPT_OK) { goto ERR; } @@ -755,10 +753,10 @@ static int build_lut(int idx, void *modulus, void *mp, void *mu) } mp_clear(tmp); - return CRYPT_OK; + return CRYPT_OK; ERR: err = CRYPT_MEM; -DONE: +DONE: for (y = 0; y < (1U<<FP_LUT); y++) { ltc_ecc_del_point(fp_cache[idx].LUT[y]); fp_cache[idx].LUT[y] = NULL; @@ -777,7 +775,7 @@ DONE: } /* perform a fixed point ECC mulmod */ -static int accel_fp_mul(int idx, void *k, ecc_point *R, void *modulus, void *mp, int map) +static int _accel_fp_mul(int idx, void *k, ecc_point *R, void *modulus, void *mp, int map) { unsigned char kb[128]; int x; @@ -791,13 +789,13 @@ static int accel_fp_mul(int idx, void *k, ecc_point *R, void *modulus, void *mp, for (x = 0; ltc_ecc_sets[x].size; x++) { if (y <= (unsigned)ltc_ecc_sets[x].size) break; } - + /* back off if we are on the 521 bit curve */ if (y == 66) --x; - + if ((err = mp_init(&order)) != CRYPT_OK) { return err; - } + } if ((err = mp_read_radix(order, ltc_ecc_sets[x].order, 16)) != CRYPT_OK) { mp_clear(&order); return err; @@ -820,44 +818,44 @@ static int accel_fp_mul(int idx, void *k, ecc_point *R, void *modulus, void *mp, mp_clear(order); } else { tk = k; - } - + } + /* get bitlen and round up to next multiple of FP_LUT */ bitlen = mp_unsigned_bin_size(modulus) << 3; x = bitlen % FP_LUT; if (x) { bitlen += FP_LUT - x; - } + } lut_gap = bitlen / FP_LUT; - + /* get the k value */ if (mp_unsigned_bin_size(tk) > (sizeof(kb) - 2)) { if (tk != k) { mp_clear(tk); - } + } return CRYPT_BUFFER_OVERFLOW; } - + /* store k */ zeromem(kb, sizeof(kb)); if ((err = mp_to_unsigned_bin(tk, kb)) != CRYPT_OK) { if (tk != k) { mp_clear(tk); - } + } return err; } - + /* let's reverse kb so it's little endian */ x = 0; y = mp_unsigned_bin_size(tk) - 1; if (tk != k) { mp_clear(tk); - } + } while ((unsigned)x < y) { z = kb[x]; kb[x] = kb[y]; kb[y] = z; ++x; --y; - } - + } + /* at this point we can start, yipee */ first = 1; for (x = lut_gap-1; x >= 0; x--) { @@ -867,26 +865,26 @@ static int accel_fp_mul(int idx, void *k, ecc_point *R, void *modulus, void *mp, z |= ((kb[bitpos>>3] >> (bitpos&7)) & 1) << y; bitpos += lut_gap; /* it's y*lut_gap + x, but here we can avoid the mult in each loop */ } - + /* double if not first */ if (!first) { if ((err = ltc_mp.ecc_ptdbl(R, R, modulus, mp)) != CRYPT_OK) { return err; } } - - /* add if not first, otherwise copy */ + + /* add if not first, otherwise copy */ if (!first && z) { if ((err = ltc_mp.ecc_ptadd(R, fp_cache[idx].LUT[z], R, modulus, mp)) != CRYPT_OK) { return err; } } else if (z) { - if ((mp_copy(fp_cache[idx].LUT[z]->x, R->x) != CRYPT_OK) || - (mp_copy(fp_cache[idx].LUT[z]->y, R->y) != CRYPT_OK) || + if ((mp_copy(fp_cache[idx].LUT[z]->x, R->x) != CRYPT_OK) || + (mp_copy(fp_cache[idx].LUT[z]->y, R->y) != CRYPT_OK) || (mp_copy(fp_cache[idx].mu, R->z) != CRYPT_OK)) { return CRYPT_MEM; } - first = 0; + first = 0; } - } + } z = 0; zeromem(kb, sizeof(kb)); /* map R back from projective space */ @@ -900,7 +898,7 @@ static int accel_fp_mul(int idx, void *k, ecc_point *R, void *modulus, void *mp, #ifdef LTC_ECC_SHAMIR /* perform a fixed point ECC mulmod */ -static int accel_fp_mul2add(int idx1, int idx2, +static int _accel_fp_mul2add(int idx1, int idx2, void *kA, void *kB, ecc_point *R, void *modulus, void *mp) { @@ -916,13 +914,13 @@ static int accel_fp_mul2add(int idx1, int idx2, for (x = 0; ltc_ecc_sets[x].size; x++) { if (y <= (unsigned)ltc_ecc_sets[x].size) break; } - + /* back off if we are on the 521 bit curve */ if (y == 66) --x; - + if ((err = mp_init(&order)) != CRYPT_OK) { return err; - } + } if ((err = mp_read_radix(order, ltc_ecc_sets[x].order, 16)) != CRYPT_OK) { mp_clear(&order); return err; @@ -945,7 +943,7 @@ static int accel_fp_mul2add(int idx1, int idx2, mp_clear(order); } else { tka = kA; - } + } /* if it's smaller than modulus we fine */ if (mp_unsigned_bin_size(kB) > mp_unsigned_bin_size(modulus)) { @@ -954,13 +952,13 @@ static int accel_fp_mul2add(int idx1, int idx2, for (x = 0; ltc_ecc_sets[x].size; x++) { if (y <= (unsigned)ltc_ecc_sets[x].size) break; } - + /* back off if we are on the 521 bit curve */ if (y == 66) --x; - + if ((err = mp_init(&order)) != CRYPT_OK) { return err; - } + } if ((err = mp_read_radix(order, ltc_ecc_sets[x].order, 16)) != CRYPT_OK) { mp_clear(&order); return err; @@ -983,55 +981,55 @@ static int accel_fp_mul2add(int idx1, int idx2, mp_clear(order); } else { tkb = kB; - } + } /* get bitlen and round up to next multiple of FP_LUT */ bitlen = mp_unsigned_bin_size(modulus) << 3; x = bitlen % FP_LUT; if (x) { bitlen += FP_LUT - x; - } + } lut_gap = bitlen / FP_LUT; - + /* get the k value */ if ((mp_unsigned_bin_size(tka) > (sizeof(kb[0]) - 2)) || (mp_unsigned_bin_size(tkb) > (sizeof(kb[0]) - 2)) ) { if (tka != kA) { mp_clear(tka); - } + } if (tkb != kB) { mp_clear(tkb); - } + } return CRYPT_BUFFER_OVERFLOW; } - + /* store k */ zeromem(kb, sizeof(kb)); if ((err = mp_to_unsigned_bin(tka, kb[0])) != CRYPT_OK) { if (tka != kA) { mp_clear(tka); - } + } if (tkb != kB) { mp_clear(tkb); - } + } return err; } - + /* let's reverse kb so it's little endian */ x = 0; y = mp_unsigned_bin_size(tka) - 1; if (tka != kA) { mp_clear(tka); - } + } while ((unsigned)x < y) { z = kb[0][x]; kb[0][x] = kb[0][y]; kb[0][y] = z; ++x; --y; - } - + } + /* store b */ if ((err = mp_to_unsigned_bin(tkb, kb[1])) != CRYPT_OK) { if (tkb != kB) { mp_clear(tkb); - } + } return err; } @@ -1039,11 +1037,11 @@ static int accel_fp_mul2add(int idx1, int idx2, y = mp_unsigned_bin_size(tkb) - 1; if (tkb != kB) { mp_clear(tkb); - } + } while ((unsigned)x < y) { z = kb[1][x]; kb[1][x] = kb[1][y]; kb[1][y] = z; ++x; --y; - } + } /* at this point we can start, yipee */ first = 1; @@ -1055,15 +1053,15 @@ static int accel_fp_mul2add(int idx1, int idx2, zB |= ((kb[1][bitpos>>3] >> (bitpos&7)) & 1) << y; bitpos += lut_gap; /* it's y*lut_gap + x, but here we can avoid the mult in each loop */ } - + /* double if not first */ if (!first) { if ((err = ltc_mp.ecc_ptdbl(R, R, modulus, mp)) != CRYPT_OK) { return err; } } - - /* add if not first, otherwise copy */ + + /* add if not first, otherwise copy */ if (!first) { if (zA) { if ((err = ltc_mp.ecc_ptadd(R, fp_cache[idx1].LUT[zA], R, modulus, mp)) != CRYPT_OK) { @@ -1077,10 +1075,10 @@ static int accel_fp_mul2add(int idx1, int idx2, } } else { if (zA) { - if ((mp_copy(fp_cache[idx1].LUT[zA]->x, R->x) != CRYPT_OK) || - (mp_copy(fp_cache[idx1].LUT[zA]->y, R->y) != CRYPT_OK) || + if ((mp_copy(fp_cache[idx1].LUT[zA]->x, R->x) != CRYPT_OK) || + (mp_copy(fp_cache[idx1].LUT[zA]->y, R->y) != CRYPT_OK) || (mp_copy(fp_cache[idx1].mu, R->z) != CRYPT_OK)) { return CRYPT_MEM; } - first = 0; + first = 0; } if (zB && first == 0) { if (zB) { @@ -1089,13 +1087,13 @@ static int accel_fp_mul2add(int idx1, int idx2, } } } else if (zB && first == 1) { - if ((mp_copy(fp_cache[idx2].LUT[zB]->x, R->x) != CRYPT_OK) || - (mp_copy(fp_cache[idx2].LUT[zB]->y, R->y) != CRYPT_OK) || + if ((mp_copy(fp_cache[idx2].LUT[zB]->x, R->x) != CRYPT_OK) || + (mp_copy(fp_cache[idx2].LUT[zB]->y, R->y) != CRYPT_OK) || (mp_copy(fp_cache[idx2].mu, R->z) != CRYPT_OK)) { return CRYPT_MEM; } - first = 0; + first = 0; } } - } + } zeromem(kb, sizeof(kb)); return ltc_ecc_map(R, modulus, mp); } @@ -1107,27 +1105,27 @@ static int accel_fp_mul2add(int idx1, int idx2, @param B Second point to multiply @param kB What to multiple B by @param C [out] Destination point (can overlap with A or B) - @param modulus Modulus for curve + @param modulus Modulus for curve @return CRYPT_OK on success -*/ +*/ int ltc_ecc_fp_mul2add(ecc_point *A, void *kA, ecc_point *B, void *kB, ecc_point *C, void *modulus) { int idx1, idx2, err; void *mp, *mu; - + mp = NULL; mu = NULL; LTC_MUTEX_LOCK(<c_ecc_fp_lock); /* find point */ - idx1 = find_base(A); + idx1 = _find_base(A); /* no entry? */ if (idx1 == -1) { /* find hole and add it */ - if ((idx1 = find_hole()) >= 0) { - if ((err = add_entry(idx1, A)) != CRYPT_OK) { + if ((idx1 = _find_hole()) >= 0) { + if ((err = _add_entry(idx1, A)) != CRYPT_OK) { goto LBL_ERR; } } @@ -1138,13 +1136,13 @@ int ltc_ecc_fp_mul2add(ecc_point *A, void *kA, } /* find point */ - idx2 = find_base(B); + idx2 = _find_base(B); /* no entry? */ if (idx2 == -1) { /* find hole and add it */ - if ((idx2 = find_hole()) >= 0) { - if ((err = add_entry(idx2, B)) != CRYPT_OK) { + if ((idx2 = _find_hole()) >= 0) { + if ((err = _add_entry(idx2, B)) != CRYPT_OK) { goto LBL_ERR; } } @@ -1165,12 +1163,12 @@ int ltc_ecc_fp_mul2add(ecc_point *A, void *kA, } if ((err = mp_montgomery_normalization(mu, modulus)) != CRYPT_OK) { goto LBL_ERR; - } - + } + /* build the LUT */ - if ((err = build_lut(idx1, modulus, mp, mu)) != CRYPT_OK) { + if ((err = _build_lut(idx1, modulus, mp, mu)) != CRYPT_OK) { goto LBL_ERR;; - } + } } /* if it's 2 build the LUT, if it's higher just use the LUT */ @@ -1185,13 +1183,13 @@ int ltc_ecc_fp_mul2add(ecc_point *A, void *kA, } if ((err = mp_montgomery_normalization(mu, modulus)) != CRYPT_OK) { goto LBL_ERR; - } + } } - + /* build the LUT */ - if ((err = build_lut(idx2, modulus, mp, mu)) != CRYPT_OK) { + if ((err = _build_lut(idx2, modulus, mp, mu)) != CRYPT_OK) { goto LBL_ERR;; - } + } } @@ -1200,7 +1198,7 @@ int ltc_ecc_fp_mul2add(ecc_point *A, void *kA, /* compute mp */ if ((err = mp_montgomery_setup(modulus, &mp)) != CRYPT_OK) { goto LBL_ERR; } } - err = accel_fp_mul2add(idx1, idx2, kA, kB, C, modulus, mp); + err = _accel_fp_mul2add(idx1, idx2, kA, kB, C, modulus, mp); } else { err = ltc_ecc_mul2add(A, kA, B, kB, C, modulus); } @@ -1208,10 +1206,10 @@ LBL_ERR: LTC_MUTEX_UNLOCK(<c_ecc_fp_lock); if (mp != NULL) { mp_montgomery_free(mp); - } + } if (mu != NULL) { mp_clear(mu); - } + } return err; } #endif @@ -1223,25 +1221,25 @@ LBL_ERR: @param modulus The modulus for the curve @param map [boolean] If non-zero maps the point back to affine co-ordinates, otherwise it's left in jacobian-montgomery form @return CRYPT_OK if successful -*/ +*/ int ltc_ecc_fp_mulmod(void *k, ecc_point *G, ecc_point *R, void *modulus, int map) { int idx, err; void *mp, *mu; - + mp = NULL; mu = NULL; LTC_MUTEX_LOCK(<c_ecc_fp_lock); /* find point */ - idx = find_base(G); + idx = _find_base(G); /* no entry? */ if (idx == -1) { /* find hole and add it */ - idx = find_hole(); + idx = _find_hole(); if (idx >= 0) { - if ((err = add_entry(idx, G)) != CRYPT_OK) { + if ((err = _add_entry(idx, G)) != CRYPT_OK) { goto LBL_ERR; } } @@ -1251,7 +1249,7 @@ int ltc_ecc_fp_mulmod(void *k, ecc_point *G, ecc_point *R, void *modulus, int ma ++(fp_cache[idx].lru_count); } - + /* if it's 2 build the LUT, if it's higher just use the LUT */ if (idx >= 0 && fp_cache[idx].lru_count == 2) { /* compute mp */ @@ -1263,12 +1261,12 @@ int ltc_ecc_fp_mulmod(void *k, ecc_point *G, ecc_point *R, void *modulus, int ma } if ((err = mp_montgomery_normalization(mu, modulus)) != CRYPT_OK) { goto LBL_ERR; - } - + } + /* build the LUT */ - if ((err = build_lut(idx, modulus, mp, mu)) != CRYPT_OK) { + if ((err = _build_lut(idx, modulus, mp, mu)) != CRYPT_OK) { goto LBL_ERR;; - } + } } if (idx >= 0 && fp_cache[idx].lru_count >= 2) { @@ -1276,7 +1274,7 @@ int ltc_ecc_fp_mulmod(void *k, ecc_point *G, ecc_point *R, void *modulus, int ma /* compute mp */ if ((err = mp_montgomery_setup(modulus, &mp)) != CRYPT_OK) { goto LBL_ERR; } } - err = accel_fp_mul(idx, k, R, modulus, mp, map); + err = _accel_fp_mul(idx, k, R, modulus, mp, map); } else { err = ltc_ecc_mulmod(k, G, R, modulus, map); } @@ -1284,15 +1282,15 @@ LBL_ERR: LTC_MUTEX_UNLOCK(<c_ecc_fp_lock); if (mp != NULL) { mp_montgomery_free(mp); - } + } if (mu != NULL) { mp_clear(mu); - } + } return err; } /* helper function for freeing the cache ... must be called with the cache mutex locked */ -static void ltc_ecc_fp_free_cache(void) +static void _ltc_ecc_fp_free_cache(void) { unsigned x, y; for (x = 0; x < FP_ENTRIES; x++) { @@ -1309,21 +1307,21 @@ static void ltc_ecc_fp_free_cache(void) } fp_cache[x].lru_count = 0; fp_cache[x].lock = 0; - } + } } -} +} /** Free the Fixed Point cache */ void ltc_ecc_fp_free(void) { LTC_MUTEX_LOCK(<c_ecc_fp_lock); - ltc_ecc_fp_free_cache(); + _ltc_ecc_fp_free_cache(); LTC_MUTEX_UNLOCK(<c_ecc_fp_lock); } /** Add a point to the cache and initialize the LUT @param g The point to add - @param modulus Modulus for curve + @param modulus Modulus for curve @param lock Flag to indicate if this entry should be locked into the cache or not @return CRYPT_OK on success */ @@ -1336,7 +1334,7 @@ ltc_ecc_fp_add_point(ecc_point *g, void *modulus, int lock) void *mu = NULL; LTC_MUTEX_LOCK(<c_ecc_fp_lock); - if ((idx = find_base(g)) >= 0) { + if ((idx = _find_base(g)) >= 0) { /* it is already in the cache ... just check that the LUT is initialized */ if(fp_cache[idx].lru_count >= 2) { LTC_MUTEX_UNLOCK(<c_ecc_fp_lock); @@ -1344,11 +1342,11 @@ ltc_ecc_fp_add_point(ecc_point *g, void *modulus, int lock) } } - if(idx == -1 && (idx = find_hole()) == -1) { + if(idx == -1 && (idx = _find_hole()) == -1) { err = CRYPT_BUFFER_OVERFLOW; goto LBL_ERR; } - if ((err = add_entry(idx, g)) != CRYPT_OK) { + if ((err = _add_entry(idx, g)) != CRYPT_OK) { goto LBL_ERR; } /* compute mp */ @@ -1362,26 +1360,26 @@ ltc_ecc_fp_add_point(ecc_point *g, void *modulus, int lock) } if ((err = mp_montgomery_normalization(mu, modulus)) != CRYPT_OK) { goto LBL_ERR; - } - + } + /* build the LUT */ - if ((err = build_lut(idx, modulus, mp, mu)) != CRYPT_OK) { + if ((err = _build_lut(idx, modulus, mp, mu)) != CRYPT_OK) { goto LBL_ERR; - } + } fp_cache[idx].lru_count = 2; fp_cache[idx].lock = lock; LBL_ERR: LTC_MUTEX_UNLOCK(<c_ecc_fp_lock); if (mp != NULL) { mp_montgomery_free(mp); - } + } if (mu != NULL) { mp_clear(mu); - } + } return err; } -/** Prevent/permit the FP cache from being updated +/** Prevent/permit the FP cache from being updated @param flag If flag is 0, remove cache lock (unlock), otherwise lock it */ void ltc_ecc_fp_tablelock(int lock) @@ -1416,7 +1414,7 @@ int ltc_ecc_fp_save_state(unsigned char **out, unsigned long *outlen) LTC_MUTEX_LOCK(<c_ecc_fp_lock); /* - * build the list; + * build the list; Cache DEFINITIONS ::= BEGIN CacheDump ::= SEQUENCE { @@ -1426,12 +1424,12 @@ int ltc_ecc_fp_save_state(unsigned char **out, unsigned long *outlen) cache SEQUENCE OF INTEGER } END - * + * */ /* - * The cache itself is a point (3 INTEGERS), - * the LUT as pairs of INTEGERS (2 * 1<<FP_LUT), - * and the mu INTEGER + * The cache itself is a point (3 INTEGERS), + * the LUT as pairs of INTEGERS (2 * 1<<FP_LUT), + * and the mu INTEGER */ cache_entry = XCALLOC(FP_ENTRIES*(2*(1U<<FP_LUT)+4)+3, sizeof(ltc_asn1_list)); if (cache_entry == NULL) @@ -1492,7 +1490,7 @@ int ltc_ecc_fp_restore_state(unsigned char *in, unsigned long inlen) LTC_ARGCHK(in != NULL); if (inlen == 0) { return CRYPT_INVALID_ARG; - } + } /* zero indecies */ i = 0; @@ -1503,16 +1501,16 @@ int ltc_ecc_fp_restore_state(unsigned char *in, unsigned long inlen) /* * start with an empty cache */ - ltc_ecc_fp_free_cache(); + _ltc_ecc_fp_free_cache(); /* * decode the input packet: It consists of a sequence with a few * integers (including the FP_ENTRIES and FP_LUT sizes), followed by a * SEQUENCE which is the cache itself. - * - * use standard decoding for the first part, then flexible for the second + * + * use standard decoding for the first part, then flexible for the second */ - if((err = der_decode_sequence_multi(in, inlen, + if((err = der_decode_sequence_multi(in, inlen, LTC_ASN1_SHORT_INTEGER, 1, &num_entries, LTC_ASN1_SHORT_INTEGER, 1, &fp_entries, LTC_ASN1_SHORT_INTEGER, 1, &fp_lut, @@ -1540,7 +1538,7 @@ int ltc_ecc_fp_restore_state(unsigned char *in, unsigned long inlen) LTC_SET_ASN1(asn1_list, j++, LTC_ASN1_INTEGER, fp_cache[i].g->y, 1); LTC_SET_ASN1(asn1_list, j++, LTC_ASN1_INTEGER, fp_cache[i].g->z, 1); for (x = 0; x < (1U<<FP_LUT); x++) { - /* since we don't store z in the cache, don't use ltc_ecc_new_point() + /* since we don't store z in the cache, don't use ltc_ecc_new_point() * (which allocates space for z, only to have to free it later) */ ecc_point *p = XCALLOC(1, sizeof(*p)); @@ -1573,7 +1571,7 @@ int ltc_ecc_fp_restore_state(unsigned char *in, unsigned long inlen) ERR_OUT: if(asn1_list) XFREE(asn1_list); - ltc_ecc_fp_free_cache(); + _ltc_ecc_fp_free_cache(); LTC_MUTEX_UNLOCK(<c_ecc_fp_lock); return err; } @@ -1581,7 +1579,7 @@ ERR_OUT: #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/math/gmp_desc.c b/libtomcrypt/src/math/gmp_desc.c index c61bafe..d80d87f 100644 --- a/libtomcrypt/src/math/gmp_desc.c +++ b/libtomcrypt/src/math/gmp_desc.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #define DESC_DEF_ONLY @@ -18,7 +16,7 @@ #include <gmp.h> static int init(void **a) -{ +{ LTC_ARGCHK(a != NULL); *a = XCALLOC(1, sizeof(__mpz_struct)); @@ -61,7 +59,7 @@ static int init_copy(void **a, void *b) } /* ---- trivial ---- */ -static int set_int(void *a, unsigned long b) +static int set_int(void *a, ltc_mp_digit b) { LTC_ARGCHK(a != NULL); mpz_set_ui(((__mpz_struct *)a), b); @@ -74,7 +72,7 @@ static unsigned long get_int(void *a) return mpz_get_ui(a); } -static unsigned long get_digit(void *a, int n) +static ltc_mp_digit get_digit(void *a, int n) { LTC_ARGCHK(a != NULL); return mpz_getlimbn(a, n); @@ -85,7 +83,7 @@ static int get_digit_count(void *a) LTC_ARGCHK(a != NULL); return mpz_size(a); } - + static int compare(void *a, void *b) { int ret; @@ -101,7 +99,7 @@ static int compare(void *a, void *b) } } -static int compare_d(void *a, unsigned long b) +static int compare_d(void *a, ltc_mp_digit b) { int ret; LTC_ARGCHK(a != NULL); @@ -138,13 +136,49 @@ static int twoexpt(void *a, int n) /* ---- conversions ---- */ +static const char rmap[] = "0123456789ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz+/"; + /* read ascii string */ static int read_radix(void *a, const char *b, int radix) { + int ret; LTC_ARGCHK(a != NULL); LTC_ARGCHK(b != NULL); - mpz_set_str(a, b, radix); - return CRYPT_OK; + if (radix == 64) { + /* Sadly, GMP only supports radixes up to 62, but we need 64. + * So, although this is not the most elegant or efficient way, + * let's just convert the base 64 string (6 bits per digit) to + * an octal string (3 bits per digit) that's twice as long. */ + char c, *tmp, *q; + const char *p; + int i; + tmp = XMALLOC (1 + 2 * strlen (b)); + if (tmp == NULL) { + return CRYPT_MEM; + } + p = b; + q = tmp; + while ((c = *p++) != 0) { + for (i = 0; i < 64; i++) { + if (c == rmap[i]) + break; + } + if (i == 64) { + XFREE (tmp); + /* printf ("c = '%c'\n", c); */ + return CRYPT_ERROR; + } + *q++ = '0' + (i / 8); + *q++ = '0' + (i % 8); + } + *q = 0; + ret = mpz_set_str(a, tmp, 8); + /* printf ("ret = %d for '%s'\n", ret, tmp); */ + XFREE (tmp); + } else { + ret = mpz_set_str(a, b, radix); + } + return (ret == 0 ? CRYPT_OK : CRYPT_ERROR); } /* write one */ @@ -152,6 +186,11 @@ static int write_radix(void *a, char *b, int radix) { LTC_ARGCHK(a != NULL); LTC_ARGCHK(b != NULL); + if (radix >= 11 && radix <= 36) + /* If radix is positive, GMP uses lowercase, and if negative, uppercase. + * We want it to use uppercase, to match the test vectors (presumably + * generated with LibTomMath). */ + radix = -radix; mpz_get_str(b, radix, a); return CRYPT_OK; } @@ -193,8 +232,8 @@ static int add(void *a, void *b, void *c) mpz_add(c, a, b); return CRYPT_OK; } - -static int addi(void *a, unsigned long b, void *c) + +static int addi(void *a, ltc_mp_digit b, void *c) { LTC_ARGCHK(a != NULL); LTC_ARGCHK(c != NULL); @@ -212,7 +251,7 @@ static int sub(void *a, void *b, void *c) return CRYPT_OK; } -static int subi(void *a, unsigned long b, void *c) +static int subi(void *a, ltc_mp_digit b, void *c) { LTC_ARGCHK(a != NULL); LTC_ARGCHK(c != NULL); @@ -230,7 +269,7 @@ static int mul(void *a, void *b, void *c) return CRYPT_OK; } -static int muli(void *a, unsigned long b, void *c) +static int muli(void *a, ltc_mp_digit b, void *c) { LTC_ARGCHK(a != NULL); LTC_ARGCHK(c != NULL); @@ -276,14 +315,14 @@ static int div_2(void *a, void *b) } /* modi */ -static int modi(void *a, unsigned long b, unsigned long *c) +static int modi(void *a, ltc_mp_digit b, ltc_mp_digit *c) { LTC_ARGCHK(a != NULL); LTC_ARGCHK(c != NULL); - + *c = mpz_fdiv_ui(a, b); return CRYPT_OK; -} +} /* gcd */ static int gcd(void *a, void *b, void *c) @@ -305,6 +344,28 @@ static int lcm(void *a, void *b, void *c) return CRYPT_OK; } +static int addmod(void *a, void *b, void *c, void *d) +{ + LTC_ARGCHK(a != NULL); + LTC_ARGCHK(b != NULL); + LTC_ARGCHK(c != NULL); + LTC_ARGCHK(d != NULL); + mpz_add(d, a, b); + mpz_mod(d, d, c); + return CRYPT_OK; +} + +static int submod(void *a, void *b, void *c, void *d) +{ + LTC_ARGCHK(a != NULL); + LTC_ARGCHK(b != NULL); + LTC_ARGCHK(c != NULL); + LTC_ARGCHK(d != NULL); + mpz_sub(d, a, b); + mpz_mod(d, d, c); + return CRYPT_OK; +} + static int mulmod(void *a, void *b, void *c, void *d) { LTC_ARGCHK(a != NULL); @@ -367,6 +428,7 @@ static int montgomery_reduce(void *a, void *b, void *c) /* clean up */ static void montgomery_deinit(void *a) { + LTC_UNUSED_PARAM(a); } static int exptmod(void *a, void *b, void *c, void *d) @@ -377,13 +439,23 @@ static int exptmod(void *a, void *b, void *c, void *d) LTC_ARGCHK(d != NULL); mpz_powm(d, a, b, c); return CRYPT_OK; -} +} -static int isprime(void *a, int *b) +static int isprime(void *a, int b, int *c) { LTC_ARGCHK(a != NULL); - LTC_ARGCHK(b != NULL); - *b = mpz_probab_prime_p(a, 8) > 0 ? LTC_MP_YES : LTC_MP_NO; + LTC_ARGCHK(c != NULL); + if (b == 0) { + b = LTC_MILLER_RABIN_REPS; + } /* if */ + *c = mpz_probab_prime_p(a, b) > 0 ? LTC_MP_YES : LTC_MP_NO; + return CRYPT_OK; +} + +static int set_rand(void *a, int size) +{ + LTC_ARGCHK(a != NULL); + mpz_random(a, size); return CRYPT_OK; } @@ -458,21 +530,25 @@ const ltc_math_descriptor gmp_desc = { NULL, #endif /* LTC_ECC_SHAMIR */ #else - NULL, NULL, NULL, NULL, NULL + NULL, NULL, NULL, NULL, NULL, #endif /* LTC_MECC */ #ifdef LTC_MRSA &rsa_make_key, &rsa_exptmod, #else - NULL, NULL + NULL, NULL, #endif - + &addmod, + &submod, + + &set_rand, + }; #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/math/ltm_desc.c b/libtomcrypt/src/math/ltm_desc.c index de0d898..3e2a0c9 100644 --- a/libtomcrypt/src/math/ltm_desc.c +++ b/libtomcrypt/src/math/ltm_desc.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #define DESC_DEF_ONLY @@ -25,7 +23,7 @@ static const struct { }; /** - Convert a MPI error to a LTC error (Possibly the most powerful function ever! Oh wait... no) + Convert a MPI error to a LTC error (Possibly the most powerful function ever! Oh wait... no) @param err The error to convert @return The equivalent LTC error code or CRYPT_ERROR if none found */ @@ -34,7 +32,7 @@ static int mpi_to_ltc_error(int err) int x; for (x = 0; x < (int)(sizeof(mpi_to_ltc_codes)/sizeof(mpi_to_ltc_codes[0])); x++) { - if (err == mpi_to_ltc_codes[x].mpi_code) { + if (err == mpi_to_ltc_codes[x].mpi_code) { return mpi_to_ltc_codes[x].ltc_code; } } @@ -51,7 +49,7 @@ static int init(void **a) if (*a == NULL) { return CRYPT_MEM; } - + if ((err = mpi_to_ltc_error(mp_init(*a))) != CRYPT_OK) { XFREE(*a); } @@ -88,7 +86,7 @@ static int init_copy(void **a, void *b) } /* ---- trivial ---- */ -static int set_int(void *a, unsigned long b) +static int set_int(void *a, ltc_mp_digit b) { LTC_ARGCHK(a != NULL); return mpi_to_ltc_error(mp_set_int(a, b)); @@ -100,7 +98,7 @@ static unsigned long get_int(void *a) return mp_get_int(a); } -static unsigned long get_digit(void *a, int n) +static ltc_mp_digit get_digit(void *a, int n) { mp_int *A; LTC_ARGCHK(a != NULL); @@ -115,7 +113,7 @@ static int get_digit_count(void *a) A = a; return A->used; } - + static int compare(void *a, void *b) { int ret; @@ -126,11 +124,11 @@ static int compare(void *a, void *b) case MP_LT: return LTC_MP_LT; case MP_EQ: return LTC_MP_EQ; case MP_GT: return LTC_MP_GT; + default: return 0; } - return 0; } -static int compare_d(void *a, unsigned long b) +static int compare_d(void *a, ltc_mp_digit b) { int ret; LTC_ARGCHK(a != NULL); @@ -139,8 +137,8 @@ static int compare_d(void *a, unsigned long b) case MP_LT: return LTC_MP_LT; case MP_EQ: return LTC_MP_EQ; case MP_GT: return LTC_MP_GT; + default: return 0; } - return 0; } static int count_bits(void *a) @@ -211,8 +209,8 @@ static int add(void *a, void *b, void *c) LTC_ARGCHK(c != NULL); return mpi_to_ltc_error(mp_add(a, b, c)); } - -static int addi(void *a, unsigned long b, void *c) + +static int addi(void *a, ltc_mp_digit b, void *c) { LTC_ARGCHK(a != NULL); LTC_ARGCHK(c != NULL); @@ -228,7 +226,7 @@ static int sub(void *a, void *b, void *c) return mpi_to_ltc_error(mp_sub(a, b, c)); } -static int subi(void *a, unsigned long b, void *c) +static int subi(void *a, ltc_mp_digit b, void *c) { LTC_ARGCHK(a != NULL); LTC_ARGCHK(c != NULL); @@ -244,7 +242,7 @@ static int mul(void *a, void *b, void *c) return mpi_to_ltc_error(mp_mul(a, b, c)); } -static int muli(void *a, unsigned long b, void *c) +static int muli(void *a, ltc_mp_digit b, void *c) { LTC_ARGCHK(a != NULL); LTC_ARGCHK(c != NULL); @@ -275,7 +273,7 @@ static int div_2(void *a, void *b) } /* modi */ -static int modi(void *a, unsigned long b, unsigned long *c) +static int modi(void *a, ltc_mp_digit b, ltc_mp_digit *c) { mp_digit tmp; int err; @@ -288,7 +286,7 @@ static int modi(void *a, unsigned long b, unsigned long *c) } *c = tmp; return CRYPT_OK; -} +} /* gcd */ static int gcd(void *a, void *b, void *c) @@ -308,6 +306,24 @@ static int lcm(void *a, void *b, void *c) return mpi_to_ltc_error(mp_lcm(a, b, c)); } +static int addmod(void *a, void *b, void *c, void *d) +{ + LTC_ARGCHK(a != NULL); + LTC_ARGCHK(b != NULL); + LTC_ARGCHK(c != NULL); + LTC_ARGCHK(d != NULL); + return mpi_to_ltc_error(mp_addmod(a,b,c,d)); +} + +static int submod(void *a, void *b, void *c, void *d) +{ + LTC_ARGCHK(a != NULL); + LTC_ARGCHK(b != NULL); + LTC_ARGCHK(c != NULL); + LTC_ARGCHK(d != NULL); + return mpi_to_ltc_error(mp_submod(a,b,c,d)); +} + static int mulmod(void *a, void *b, void *c, void *d) { LTC_ARGCHK(a != NULL); @@ -380,17 +396,26 @@ static int exptmod(void *a, void *b, void *c, void *d) LTC_ARGCHK(c != NULL); LTC_ARGCHK(d != NULL); return mpi_to_ltc_error(mp_exptmod(a,b,c,d)); -} +} -static int isprime(void *a, int *b) +static int isprime(void *a, int b, int *c) { int err; LTC_ARGCHK(a != NULL); - LTC_ARGCHK(b != NULL); - err = mpi_to_ltc_error(mp_prime_is_prime(a, 8, b)); - *b = (*b == MP_YES) ? LTC_MP_YES : LTC_MP_NO; + LTC_ARGCHK(c != NULL); + if (b == 0) { + b = LTC_MILLER_RABIN_REPS; + } /* if */ + err = mpi_to_ltc_error(mp_prime_is_prime(a, b, c)); + *c = (*c == MP_YES) ? LTC_MP_YES : LTC_MP_NO; return err; -} +} + +static int set_rand(void *a, int size) +{ + LTC_ARGCHK(a != NULL); + return mpi_to_ltc_error(mp_rand(a, size)); +} const ltc_math_descriptor ltm_desc = { @@ -436,7 +461,7 @@ const ltc_math_descriptor ltm_desc = { &mulmod, &sqrmod, &invmod, - + &montgomery_setup, &montgomery_normalization, &montgomery_reduce, @@ -448,7 +473,7 @@ const ltc_math_descriptor ltm_desc = { #ifdef LTC_MECC #ifdef LTC_MECC_FP <c_ecc_fp_mulmod, -#else +#else <c_ecc_mulmod, #endif <c_ecc_projective_add_point, @@ -471,13 +496,18 @@ const ltc_math_descriptor ltm_desc = { &rsa_make_key, &rsa_exptmod, #else - NULL, NULL + NULL, NULL, #endif + &addmod, + &submod, + + &set_rand, + }; #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/math/multi.c b/libtomcrypt/src/math/multi.c index 593f353..da5bb60 100644 --- a/libtomcrypt/src/math/multi.c +++ b/libtomcrypt/src/math/multi.c @@ -5,12 +5,10 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" -#ifdef MPI +#ifdef LTC_MPI #include <stdarg.h> int ltc_init_multi(void **a, ...) @@ -32,13 +30,14 @@ int ltc_init_multi(void **a, ...) cur = va_arg(clean_list, void**); } va_end(clean_list); + va_end(args); return CRYPT_MEM; } ++np; cur = va_arg(args, void**); } va_end(args); - return CRYPT_OK; + return CRYPT_OK; } void ltc_deinit_multi(void *a, ...) @@ -54,8 +53,25 @@ void ltc_deinit_multi(void *a, ...) va_end(args); } +void ltc_cleanup_multi(void **a, ...) +{ + void **cur = a; + va_list args; + + va_start(args, a); + while (cur != NULL) { + if (*cur != NULL) { + mp_clear(*cur); + *cur = NULL; + } + cur = va_arg(args, void**); + } + va_end(args); + return; +} + #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/math/radix_to_bin.c b/libtomcrypt/src/math/radix_to_bin.c new file mode 100644 index 0000000..409bd20 --- /dev/null +++ b/libtomcrypt/src/math/radix_to_bin.c @@ -0,0 +1,62 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + */ +#include "tomcrypt.h" + +/** + @file radix_to_bin.c + Convert data from a specific radix to binary. + Steffen Jaeckel +*/ + +/** + Convert data from a specific radix to binary + + The default MPI descriptors #ltm_desc, #tfm_desc and #gmp_desc + have the following restrictions on parameters: + + \p in - NUL-terminated char buffer + + \p radix - 2..64 + + @param in The input + @param radix The radix of the input + @param out The output buffer + @param len [in/out] The length of the output buffer + + @return CRYPT_OK on success. +*/ +int radix_to_bin(const void *in, int radix, void *out, unsigned long *len) +{ + unsigned long l; + void* mpi; + int err; + + LTC_ARGCHK(in != NULL); + LTC_ARGCHK(len != NULL); + + if ((err = mp_init(&mpi)) != CRYPT_OK) return err; + if ((err = mp_read_radix(mpi, in, radix)) != CRYPT_OK) goto LBL_ERR; + + if ((l = mp_unsigned_bin_size(mpi)) > *len) { + *len = l; + err = CRYPT_BUFFER_OVERFLOW; + goto LBL_ERR; + } + *len = l; + + if ((err = mp_to_unsigned_bin(mpi, out)) != CRYPT_OK) goto LBL_ERR; + +LBL_ERR: + mp_clear(mpi); + return err; +} + +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/math/rand_bn.c b/libtomcrypt/src/math/rand_bn.c new file mode 100644 index 0000000..a42ba64 --- /dev/null +++ b/libtomcrypt/src/math/rand_bn.c @@ -0,0 +1,75 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + */ +#include "tomcrypt.h" + +#ifdef LTC_MDSA +/** + Generate a random number N with given bitlength (note: MSB can be 0) +*/ + +int rand_bn_bits(void *N, int bits, prng_state *prng, int wprng) +{ + int res, bytes; + unsigned char *buf, mask; + + LTC_ARGCHK(N != NULL); + LTC_ARGCHK(bits > 1); + + /* check PRNG */ + if ((res = prng_is_valid(wprng)) != CRYPT_OK) return res; + + bytes = (bits+7) >> 3; + mask = 0xff << (8 - bits % 8); + + /* allocate buffer */ + if ((buf = XCALLOC(1, bytes)) == NULL) return CRYPT_MEM; + + /* generate random bytes */ + if (prng_descriptor[wprng].read(buf, bytes, prng) != (unsigned long)bytes) { + res = CRYPT_ERROR_READPRNG; + goto cleanup; + } + /* mask bits */ + buf[0] &= ~mask; + /* load value */ + if ((res = mp_read_unsigned_bin(N, buf, bytes)) != CRYPT_OK) goto cleanup; + + res = CRYPT_OK; + +cleanup: +#ifdef LTC_CLEAN_STACK + zeromem(buf, bytes); +#endif + XFREE(buf); + return res; +} + +/** + Generate a random number N in a range: 1 <= N < limit +*/ +int rand_bn_upto(void *N, void *limit, prng_state *prng, int wprng) +{ + int res, bits; + + LTC_ARGCHK(N != NULL); + LTC_ARGCHK(limit != NULL); + + bits = mp_count_bits(limit); + do { + res = rand_bn_bits(N, bits, prng, wprng); + if (res != CRYPT_OK) return res; + } while (mp_cmp_d(N, 0) != LTC_MP_GT || mp_cmp(N, limit) != LTC_MP_LT); + + return CRYPT_OK; +} +#endif + +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/math/rand_prime.c b/libtomcrypt/src/math/rand_prime.c index f228429..4dd5764 100644 --- a/libtomcrypt/src/math/rand_prime.c +++ b/libtomcrypt/src/math/rand_prime.c @@ -5,15 +5,15 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" +#if defined(LTC_MRSA) || (!defined(LTC_NO_MATH) && !defined(LTC_NO_PRNGS)) + /** @file rand_prime.c Generate a random prime, Tom St Denis -*/ +*/ #define USE_BBS 1 @@ -33,13 +33,13 @@ int rand_prime(void *N, long len, prng_state *prng, int wprng) } /* allow sizes between 2 and 512 bytes for a prime size */ - if (len < 2 || len > 512) { + if (len < 2 || len > 512) { return CRYPT_INVALID_PRIME_SIZE; } - + /* valid PRNG? Better be! */ if ((err = prng_is_valid(wprng)) != CRYPT_OK) { - return err; + return err; } /* allocate buffer to work with */ @@ -58,7 +58,7 @@ int rand_prime(void *N, long len, prng_state *prng, int wprng) /* munge bits */ buf[0] |= 0x80 | 0x40; buf[len-1] |= 0x01 | ((type & USE_BBS) ? 0x02 : 0x00); - + /* load value */ if ((err = mp_read_unsigned_bin(N, buf, len)) != CRYPT_OK) { XFREE(buf); @@ -66,7 +66,7 @@ int rand_prime(void *N, long len, prng_state *prng, int wprng) } /* test */ - if ((err = mp_prime_is_prime(N, 8, &res)) != CRYPT_OK) { + if ((err = mp_prime_is_prime(N, LTC_MILLER_RABIN_REPS, &res)) != CRYPT_OK) { XFREE(buf); return err; } @@ -79,9 +79,10 @@ int rand_prime(void *N, long len, prng_state *prng, int wprng) XFREE(buf); return CRYPT_OK; } - + +#endif /* LTC_NO_MATH */ -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/math/tfm_desc.c b/libtomcrypt/src/math/tfm_desc.c index f568044..2a5a57d 100644 --- a/libtomcrypt/src/math/tfm_desc.c +++ b/libtomcrypt/src/math/tfm_desc.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #define DESC_DEF_ONLY @@ -25,7 +23,7 @@ static const struct { }; /** - Convert a tfm error to a LTC error (Possibly the most powerful function ever! Oh wait... no) + Convert a tfm error to a LTC error (Possibly the most powerful function ever! Oh wait... no) @param err The error to convert @return The equivalent LTC error code or CRYPT_ERROR if none found */ @@ -34,7 +32,7 @@ static int tfm_to_ltc_error(int err) int x; for (x = 0; x < (int)(sizeof(tfm_to_ltc_codes)/sizeof(tfm_to_ltc_codes[0])); x++) { - if (err == tfm_to_ltc_codes[x].tfm_code) { + if (err == tfm_to_ltc_codes[x].tfm_code) { return tfm_to_ltc_codes[x].ltc_code; } } @@ -84,7 +82,7 @@ static int init_copy(void **a, void *b) } /* ---- trivial ---- */ -static int set_int(void *a, unsigned long b) +static int set_int(void *a, ltc_mp_digit b) { LTC_ARGCHK(a != NULL); fp_set(a, b); @@ -99,7 +97,7 @@ static unsigned long get_int(void *a) return A->used > 0 ? A->dp[0] : 0; } -static unsigned long get_digit(void *a, int n) +static ltc_mp_digit get_digit(void *a, int n) { fp_int *A; LTC_ARGCHK(a != NULL); @@ -114,7 +112,7 @@ static int get_digit_count(void *a) A = a; return A->used; } - + static int compare(void *a, void *b) { int ret; @@ -129,7 +127,7 @@ static int compare(void *a, void *b) return 0; } -static int compare_d(void *a, unsigned long b) +static int compare_d(void *a, ltc_mp_digit b) { int ret; LTC_ARGCHK(a != NULL); @@ -213,8 +211,8 @@ static int add(void *a, void *b, void *c) fp_add(a, b, c); return CRYPT_OK; } - -static int addi(void *a, unsigned long b, void *c) + +static int addi(void *a, ltc_mp_digit b, void *c) { LTC_ARGCHK(a != NULL); LTC_ARGCHK(c != NULL); @@ -232,7 +230,7 @@ static int sub(void *a, void *b, void *c) return CRYPT_OK; } -static int subi(void *a, unsigned long b, void *c) +static int subi(void *a, ltc_mp_digit b, void *c) { LTC_ARGCHK(a != NULL); LTC_ARGCHK(c != NULL); @@ -246,11 +244,11 @@ static int mul(void *a, void *b, void *c) LTC_ARGCHK(a != NULL); LTC_ARGCHK(b != NULL); LTC_ARGCHK(c != NULL); - fp_mul(a, b, c); + fp_mul(a, b, c); return CRYPT_OK; } -static int muli(void *a, unsigned long b, void *c) +static int muli(void *a, ltc_mp_digit b, void *c) { LTC_ARGCHK(a != NULL); LTC_ARGCHK(c != NULL); @@ -284,7 +282,7 @@ static int div_2(void *a, void *b) } /* modi */ -static int modi(void *a, unsigned long b, unsigned long *c) +static int modi(void *a, ltc_mp_digit b, ltc_mp_digit *c) { fp_digit tmp; int err; @@ -297,7 +295,7 @@ static int modi(void *a, unsigned long b, unsigned long *c) } *c = tmp; return CRYPT_OK; -} +} /* gcd */ static int gcd(void *a, void *b, void *c) @@ -319,6 +317,24 @@ static int lcm(void *a, void *b, void *c) return CRYPT_OK; } +static int addmod(void *a, void *b, void *c, void *d) +{ + LTC_ARGCHK(a != NULL); + LTC_ARGCHK(b != NULL); + LTC_ARGCHK(c != NULL); + LTC_ARGCHK(d != NULL); + return tfm_to_ltc_error(fp_addmod(a,b,c,d)); +} + +static int submod(void *a, void *b, void *c, void *d) +{ + LTC_ARGCHK(a != NULL); + LTC_ARGCHK(b != NULL); + LTC_ARGCHK(c != NULL); + LTC_ARGCHK(d != NULL); + return tfm_to_ltc_error(fp_submod(a,b,c,d)); +} + static int mulmod(void *a, void *b, void *c, void *d) { LTC_ARGCHK(a != NULL); @@ -393,13 +409,16 @@ static int exptmod(void *a, void *b, void *c, void *d) LTC_ARGCHK(c != NULL); LTC_ARGCHK(d != NULL); return tfm_to_ltc_error(fp_exptmod(a,b,c,d)); -} +} -static int isprime(void *a, int *b) +static int isprime(void *a, int b, int *c) { LTC_ARGCHK(a != NULL); - LTC_ARGCHK(b != NULL); - *b = (fp_isprime(a) == FP_YES) ? LTC_MP_YES : LTC_MP_NO; + LTC_ARGCHK(c != NULL); + if (b == 0) { + b = LTC_MILLER_RABIN_REPS; + } /* if */ + *c = (fp_isprime_ex(a, b) == FP_YES) ? LTC_MP_YES : LTC_MP_NO; return CRYPT_OK; } @@ -437,7 +456,7 @@ static int tfm_ecc_projective_dbl_point(ecc_point *P, ecc_point *R, void *modulu if (fp_cmp(R->z, modulus) != FP_LT) { fp_sub(R->z, modulus, R->z); } - + /* &t2 = X - T1 */ fp_sub(R->x, &t1, &t2); if (fp_cmp_d(&t2, 0) == FP_LT) { @@ -496,7 +515,7 @@ static int tfm_ecc_projective_dbl_point(ecc_point *P, ecc_point *R, void *modulu fp_add(R->x, modulus, R->x); } - /* Y = Y - X */ + /* Y = Y - X */ fp_sub(R->y, R->x, R->y); if (fp_cmp_d(R->y, 0) == FP_LT) { fp_add(R->y, modulus, R->y); @@ -509,7 +528,7 @@ static int tfm_ecc_projective_dbl_point(ecc_point *P, ecc_point *R, void *modulu if (fp_cmp_d(R->y, 0) == FP_LT) { fp_add(R->y, modulus, R->y); } - + return CRYPT_OK; } @@ -519,14 +538,14 @@ static int tfm_ecc_projective_dbl_point(ecc_point *P, ecc_point *R, void *modulu @param Q The point to add @param R [out] The destination of the double @param modulus The modulus of the field the ECC curve is in - @param mp The "b" value from montgomery_setup() + @param Mp The "b" value from montgomery_setup() @return CRYPT_OK on success */ static int tfm_ecc_projective_add_point(ecc_point *P, ecc_point *Q, ecc_point *R, void *modulus, void *Mp) { fp_int t1, t2, x, y, z; - fp_digit mp; - + fp_digit mp; + LTC_ARGCHK(P != NULL); LTC_ARGCHK(Q != NULL); LTC_ARGCHK(R != NULL); @@ -543,7 +562,7 @@ static int tfm_ecc_projective_add_point(ecc_point *P, ecc_point *Q, ecc_point *R /* should we dbl instead? */ fp_sub(modulus, Q->y, &t1); - if ( (fp_cmp(P->x, Q->x) == FP_EQ) && + if ( (fp_cmp(P->x, Q->x) == FP_EQ) && (Q->z != NULL && fp_cmp(P->z, Q->z) == FP_EQ) && (fp_cmp(P->y, Q->y) == FP_EQ || fp_cmp(P->y, &t1) == FP_EQ)) { return tfm_ecc_projective_dbl_point(P, R, modulus, Mp); @@ -636,7 +655,7 @@ static int tfm_ecc_projective_add_point(ecc_point *P, ecc_point *Q, ecc_point *R /* T1 = T1 * X */ fp_mul(&t1, &x, &t1); fp_montgomery_reduce(&t1, modulus, mp); - + /* X = Y*Y */ fp_sqr(&y, &x); fp_montgomery_reduce(&x, modulus, mp); @@ -650,7 +669,7 @@ static int tfm_ecc_projective_add_point(ecc_point *P, ecc_point *Q, ecc_point *R fp_sub(&t2, &x, &t2); if (fp_cmp_d(&t2, 0) == FP_LT) { fp_add(&t2, modulus, &t2); - } + } /* T2 = T2 - X */ fp_sub(&t2, &x, &t2); if (fp_cmp_d(&t2, 0) == FP_LT) { @@ -673,13 +692,20 @@ static int tfm_ecc_projective_add_point(ecc_point *P, ecc_point *Q, ecc_point *R fp_copy(&x, R->x); fp_copy(&y, R->y); fp_copy(&z, R->z); - + return CRYPT_OK; } #endif +static int set_rand(void *a, int size) +{ + LTC_ARGCHK(a != NULL); + fp_rand(a, size); + return CRYPT_OK; +} + const ltc_math_descriptor tfm_desc = { "TomsFastMath", @@ -764,14 +790,18 @@ const ltc_math_descriptor tfm_desc = { &rsa_make_key, &rsa_exptmod, #else - NULL, NULL + NULL, NULL, #endif - + &addmod, + &submod, + + set_rand, + }; #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/misc/adler32.c b/libtomcrypt/src/misc/adler32.c new file mode 100644 index 0000000..8bbf2ac --- /dev/null +++ b/libtomcrypt/src/misc/adler32.c @@ -0,0 +1,131 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + */ +#include "tomcrypt.h" + +/** + @file adler32.c + Adler-32 checksum algorithm + Written and placed in the public domain by Wei Dai + Adapted for libtomcrypt by Steffen Jaeckel +*/ +#ifdef LTC_ADLER32 + +static const unsigned long _adler32_base = 65521; + +void adler32_init(adler32_state *ctx) +{ + LTC_ARGCHKVD(ctx != NULL); + ctx->s[0] = 1; + ctx->s[1] = 0; +} + +void adler32_update(adler32_state *ctx, const unsigned char *input, unsigned long length) +{ + unsigned long s1, s2; + + LTC_ARGCHKVD(ctx != NULL); + LTC_ARGCHKVD(input != NULL); + s1 = ctx->s[0]; + s2 = ctx->s[1]; + + if (length % 8 != 0) { + do { + s1 += *input++; + s2 += s1; + length--; + } while (length % 8 != 0); + + if (s1 >= _adler32_base) + s1 -= _adler32_base; + s2 %= _adler32_base; + } + + while (length > 0) { + s1 += input[0]; + s2 += s1; + s1 += input[1]; + s2 += s1; + s1 += input[2]; + s2 += s1; + s1 += input[3]; + s2 += s1; + s1 += input[4]; + s2 += s1; + s1 += input[5]; + s2 += s1; + s1 += input[6]; + s2 += s1; + s1 += input[7]; + s2 += s1; + + length -= 8; + input += 8; + + if (s1 >= _adler32_base) + s1 -= _adler32_base; + s2 %= _adler32_base; + } + + LTC_ARGCHKVD(s1 < _adler32_base); + LTC_ARGCHKVD(s2 < _adler32_base); + + ctx->s[0] = (unsigned short)s1; + ctx->s[1] = (unsigned short)s2; +} + +void adler32_finish(adler32_state *ctx, void *hash, unsigned long size) +{ + unsigned char* h; + + LTC_ARGCHKVD(ctx != NULL); + LTC_ARGCHKVD(hash != NULL); + + h = hash; + + switch (size) { + default: + h[3] = ctx->s[0] & 0x0ff; + /* FALLTHROUGH */ + case 3: + h[2] = (ctx->s[0] >> 8) & 0x0ff; + /* FALLTHROUGH */ + case 2: + h[1] = ctx->s[1] & 0x0ff; + /* FALLTHROUGH */ + case 1: + h[0] = (ctx->s[1] >> 8) & 0x0ff; + /* FALLTHROUGH */ + case 0: + ; + } +} + +int adler32_test(void) +{ +#ifndef LTC_TEST + return CRYPT_NOP; +#else + const void* in = "libtomcrypt"; + const unsigned char adler32[] = { 0x1b, 0xe8, 0x04, 0xba }; + unsigned char out[4]; + adler32_state ctx; + adler32_init(&ctx); + adler32_update(&ctx, in, strlen(in)); + adler32_finish(&ctx, out, 4); + if (compare_testvector(adler32, 4, out, 4, "adler32", 0)) { + return CRYPT_FAIL_TESTVECTOR; + } + return CRYPT_OK; +#endif +} +#endif + +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/misc/base64/base64_decode.c b/libtomcrypt/src/misc/base64/base64_decode.c index 6fd0ba2..4c58c68 100644 --- a/libtomcrypt/src/misc/base64/base64_decode.c +++ b/libtomcrypt/src/misc/base64/base64_decode.c @@ -5,20 +5,20 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" /** @file base64_decode.c Compliant base64 code donated by Wayne Scott (wscott@bitmover.com) + base64 URL Safe variant (RFC 4648 section 5) by Karel Miko */ -#ifdef LTC_BASE64 +#if defined(LTC_BASE64) || defined (LTC_BASE64_URL) -static const unsigned char map[256] = { +#if defined(LTC_BASE64) +static const unsigned char map_base64[256] = { 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, @@ -41,17 +41,43 @@ static const unsigned char map[256] = { 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255 }; +#endif /* LTC_BASE64 */ -/** - base64 decode a block of memory - @param in The base64 data to decode - @param inlen The length of the base64 data - @param out [out] The destination of the binary decoded data - @param outlen [in/out] The max size and resulting size of the decoded data - @return CRYPT_OK if successful -*/ -int base64_decode(const unsigned char *in, unsigned long inlen, - unsigned char *out, unsigned long *outlen) +static const unsigned char map_base64url[] = { +#if defined(LTC_BASE64_URL) +255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, +255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, +255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, +255, 255, 255, 255, 255, 255, 255, 255, 255, 62, 255, 255, + 52, 53, 54, 55, 56, 57, 58, 59, 60, 61, 255, 255, +255, 254, 255, 255, 255, 0, 1, 2, 3, 4, 5, 6, + 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, + 19, 20, 21, 22, 23, 24, 25, 255, 255, 255, 255, 63, +255, 26, 27, 28, 29, 30, 31, 32, 33, 34, 35, 36, + 37, 38, 39, 40, 41, 42, 43, 44, 45, 46, 47, 48, + 49, 50, 51, 255, 255, 255, 255, 255, 255, 255, 255, 255, +255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, +255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, +255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, +255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, +255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, +255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, +255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, +255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, +255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, +255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, +255, 255, 255, 255 +#endif /* LTC_BASE64_URL */ +}; + +enum { + relaxed = 0, + strict = 1 +}; + +static int _base64_decode_internal(const unsigned char *in, unsigned long inlen, + unsigned char *out, unsigned long *outlen, + const unsigned char *map, int is_strict) { unsigned long t, x, y, z; unsigned char c; @@ -61,44 +87,110 @@ int base64_decode(const unsigned char *in, unsigned long inlen, LTC_ARGCHK(out != NULL); LTC_ARGCHK(outlen != NULL); - g = 3; + g = 0; /* '=' counter */ for (x = y = z = t = 0; x < inlen; x++) { c = map[in[x]&0xFF]; - if (c == 255) continue; - /* the final = symbols are read and used to trim the remaining bytes */ - if (c == 254) { - c = 0; - /* prevent g < 0 which would potentially allow an overflow later */ - if (--g < 0) { - return CRYPT_INVALID_PACKET; - } - } else if (g != 3) { - /* we only allow = to be at the end */ + if (c == 254) { + g++; + continue; + } + else if (is_strict && g > 0) { + /* we only allow '=' to be at the end */ return CRYPT_INVALID_PACKET; } + if (c == 255) { + if (is_strict) + return CRYPT_INVALID_PACKET; + else + continue; + } t = (t<<6)|c; if (++y == 4) { - if (z + g > *outlen) { - return CRYPT_BUFFER_OVERFLOW; - } + if (z + 3 > *outlen) return CRYPT_BUFFER_OVERFLOW; out[z++] = (unsigned char)((t>>16)&255); - if (g > 1) out[z++] = (unsigned char)((t>>8)&255); - if (g > 2) out[z++] = (unsigned char)(t&255); + out[z++] = (unsigned char)((t>>8)&255); + out[z++] = (unsigned char)(t&255); y = t = 0; } } + if (y != 0) { - return CRYPT_INVALID_PACKET; + if (y == 1) return CRYPT_INVALID_PACKET; + if ((y + g) != 4 && is_strict && map != map_base64url) return CRYPT_INVALID_PACKET; + t = t << (6 * (4 - y)); + if (z + y - 1 > *outlen) return CRYPT_BUFFER_OVERFLOW; + if (y >= 2) out[z++] = (unsigned char) ((t >> 16) & 255); + if (y == 3) out[z++] = (unsigned char) ((t >> 8) & 255); } *outlen = z; return CRYPT_OK; } +#if defined(LTC_BASE64) +/** + Relaxed base64 decode a block of memory + @param in The base64 data to decode + @param inlen The length of the base64 data + @param out [out] The destination of the binary decoded data + @param outlen [in/out] The max size and resulting size of the decoded data + @return CRYPT_OK if successful +*/ +int base64_decode(const unsigned char *in, unsigned long inlen, + unsigned char *out, unsigned long *outlen) +{ + return _base64_decode_internal(in, inlen, out, outlen, map_base64, relaxed); +} + +/** + Strict base64 decode a block of memory + @param in The base64 data to decode + @param inlen The length of the base64 data + @param out [out] The destination of the binary decoded data + @param outlen [in/out] The max size and resulting size of the decoded data + @return CRYPT_OK if successful +*/ +int base64_strict_decode(const unsigned char *in, unsigned long inlen, + unsigned char *out, unsigned long *outlen) +{ + return _base64_decode_internal(in, inlen, out, outlen, map_base64, strict); +} +#endif /* LTC_BASE64 */ + +#if defined(LTC_BASE64_URL) +/** + Relaxed base64 (URL Safe, RFC 4648 section 5) decode a block of memory + @param in The base64 data to decode + @param inlen The length of the base64 data + @param out [out] The destination of the binary decoded data + @param outlen [in/out] The max size and resulting size of the decoded data + @return CRYPT_OK if successful +*/ +int base64url_decode(const unsigned char *in, unsigned long inlen, + unsigned char *out, unsigned long *outlen) +{ + return _base64_decode_internal(in, inlen, out, outlen, map_base64url, relaxed); +} + +/** + Strict base64 (URL Safe, RFC 4648 section 5) decode a block of memory + @param in The base64 data to decode + @param inlen The length of the base64 data + @param out [out] The destination of the binary decoded data + @param outlen [in/out] The max size and resulting size of the decoded data + @return CRYPT_OK if successful +*/ +int base64url_strict_decode(const unsigned char *in, unsigned long inlen, + unsigned char *out, unsigned long *outlen) +{ + return _base64_decode_internal(in, inlen, out, outlen, map_base64url, strict); +} +#endif /* LTC_BASE64_URL */ + #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/misc/base64/base64_encode.c b/libtomcrypt/src/misc/base64/base64_encode.c index 58a82df..5c26e60 100644 --- a/libtomcrypt/src/misc/base64/base64_encode.c +++ b/libtomcrypt/src/misc/base64/base64_encode.c @@ -5,32 +5,31 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" /** @file base64_encode.c Compliant base64 encoder donated by Wayne Scott (wscott@bitmover.com) + base64 URL Safe variant (RFC 4648 section 5) by Karel Miko */ -#ifdef LTC_BASE64 +#if defined(LTC_BASE64) || defined (LTC_BASE64_URL) -static const char *codes = +#if defined(LTC_BASE64) +static const char * const codes_base64 = "ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/"; +#endif /* LTC_BASE64 */ -/** - base64 Encode a buffer (NUL terminated) - @param in The input buffer to encode - @param inlen The length of the input buffer - @param out [out] The destination of the base64 encoded data - @param outlen [in/out] The max size and resulting size - @return CRYPT_OK if successful -*/ -int base64_encode(const unsigned char *in, unsigned long inlen, - unsigned char *out, unsigned long *outlen) +#if defined(LTC_BASE64_URL) +static const char * const codes_base64url = +"ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789-_"; +#endif /* LTC_BASE64_URL */ + +static int _base64_encode_internal(const unsigned char *in, unsigned long inlen, + unsigned char *out, unsigned long *outlen, + const char *codes, int pad) { unsigned long i, len2, leven; unsigned char *p; @@ -61,21 +60,65 @@ int base64_encode(const unsigned char *in, unsigned long inlen, *p++ = codes[(a >> 2) & 0x3F]; *p++ = codes[(((a & 3) << 4) + (b >> 4)) & 0x3F]; - *p++ = (i+1 < inlen) ? codes[(((b & 0xf) << 2)) & 0x3F] : '='; - *p++ = '='; + if (pad) { + *p++ = (i+1 < inlen) ? codes[(((b & 0xf) << 2)) & 0x3F] : '='; + *p++ = '='; + } + else { + if (i+1 < inlen) *p++ = codes[(((b & 0xf) << 2)) & 0x3F]; + } } /* append a NULL byte */ *p = '\0'; /* return ok */ - *outlen = p - out; + *outlen = (unsigned long)(p - out); return CRYPT_OK; } +#if defined(LTC_BASE64) +/** + base64 Encode a buffer (NUL terminated) + @param in The input buffer to encode + @param inlen The length of the input buffer + @param out [out] The destination of the base64 encoded data + @param outlen [in/out] The max size and resulting size + @return CRYPT_OK if successful +*/ +int base64_encode(const unsigned char *in, unsigned long inlen, + unsigned char *out, unsigned long *outlen) +{ + return _base64_encode_internal(in, inlen, out, outlen, codes_base64, 1); +} +#endif /* LTC_BASE64 */ + + +#if defined(LTC_BASE64_URL) +/** + base64 (URL Safe, RFC 4648 section 5) Encode a buffer (NUL terminated) + @param in The input buffer to encode + @param inlen The length of the input buffer + @param out [out] The destination of the base64 encoded data + @param outlen [in/out] The max size and resulting size + @return CRYPT_OK if successful +*/ +int base64url_encode(const unsigned char *in, unsigned long inlen, + unsigned char *out, unsigned long *outlen) +{ + return _base64_encode_internal(in, inlen, out, outlen, codes_base64url, 0); +} + +int base64url_strict_encode(const unsigned char *in, unsigned long inlen, + unsigned char *out, unsigned long *outlen) +{ + return _base64_encode_internal(in, inlen, out, outlen, codes_base64url, 1); +} +#endif /* LTC_BASE64_URL */ + #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/misc/burn_stack.c b/libtomcrypt/src/misc/burn_stack.c index 2610c06..afbafee 100644 --- a/libtomcrypt/src/misc/burn_stack.c +++ b/libtomcrypt/src/misc/burn_stack.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" @@ -29,6 +27,6 @@ void burn_stack(unsigned long len) -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/misc/compare_testvector.c b/libtomcrypt/src/misc/compare_testvector.c new file mode 100644 index 0000000..82433c6 --- /dev/null +++ b/libtomcrypt/src/misc/compare_testvector.c @@ -0,0 +1,87 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + */ + +#include "tomcrypt.h" + +/** + @file compare_testvector.c + Function to compare two testvectors and print a (detailed) error-message if required, Steffen Jaeckel +*/ + +#if defined(LTC_TEST) && defined(LTC_TEST_DBG) +static void _print_hex(const char* what, const void* v, const unsigned long l) +{ + const unsigned char* p = v; + unsigned long x, y = 0, z; + fprintf(stderr, "%s contents: \n", what); + for (x = 0; x < l; ) { + fprintf(stderr, "%02X ", p[x]); + if (!(++x % 16) || x == l) { + if((x % 16) != 0) { + z = 16 - (x % 16); + if(z >= 8) + fprintf(stderr, " "); + for (; z != 0; --z) { + fprintf(stderr, " "); + } + } + fprintf(stderr, " | "); + for(; y < x; y++) { + if((y % 8) == 0) + fprintf(stderr, " "); + if(isgraph(p[y])) + fprintf(stderr, "%c", p[y]); + else + fprintf(stderr, "."); + } + fprintf(stderr, "\n"); + } + else if((x % 8) == 0) { + fprintf(stderr, " "); + } + } +} +#endif + +/** + Compare two test-vectors + + @param is The data as it is + @param is_len The length of is + @param should The data as it should + @param should_len The length of should + @param what The type of the data + @param which The iteration count + @return 0 on equality, -1 or 1 on difference +*/ +int compare_testvector(const void* is, const unsigned long is_len, const void* should, const unsigned long should_len, const char* what, int which) +{ + int res = 0; + if(is_len != should_len) + res = is_len > should_len ? -1 : 1; + else + res = XMEMCMP(is, should, is_len); + +#if defined(LTC_TEST) && defined(LTC_TEST_DBG) + if (res != 0) { + fprintf(stderr, "Testvector #%i of %s failed:\n", which, what); + _print_hex("SHOULD", should, should_len); + _print_hex("IS ", is, is_len); + } +#else + LTC_UNUSED_PARAM(which); + LTC_UNUSED_PARAM(what); +#endif + + return res; +} + +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/misc/crc32.c b/libtomcrypt/src/misc/crc32.c new file mode 100644 index 0000000..beb54fc --- /dev/null +++ b/libtomcrypt/src/misc/crc32.c @@ -0,0 +1,202 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + */ +#include "tomcrypt.h" + +/** + @file crc32.c + CRC-32 checksum algorithm + Written and placed in the public domain by Wei Dai + Adapted for libtomcrypt by Steffen Jaeckel +*/ +#ifdef LTC_CRC32 + +static const ulong32 _CRC32_NEGL = 0xffffffffUL; + +#if defined(ENDIAN_LITTLE) +#define CRC32_INDEX(c) (c & 0xff) +#define CRC32_SHIFTED(c) (c >> 8) +#elif defined(ENDIAN_BIG) +#define CRC32_INDEX(c) (c >> 24) +#define CRC32_SHIFTED(c) (c << 8) +#else +#error The existing CRC32 implementation only works properly when the endianness of the target platform is known. +#endif + +/* Table of CRC-32's of all single byte values (made by makecrc.c) */ +static const ulong32 crc32_m_tab[] = +{ +#if defined(ENDIAN_LITTLE) + 0x00000000L, 0x77073096L, 0xee0e612cL, 0x990951baL, 0x076dc419L, + 0x706af48fL, 0xe963a535L, 0x9e6495a3L, 0x0edb8832L, 0x79dcb8a4L, + 0xe0d5e91eL, 0x97d2d988L, 0x09b64c2bL, 0x7eb17cbdL, 0xe7b82d07L, + 0x90bf1d91L, 0x1db71064L, 0x6ab020f2L, 0xf3b97148L, 0x84be41deL, + 0x1adad47dL, 0x6ddde4ebL, 0xf4d4b551L, 0x83d385c7L, 0x136c9856L, + 0x646ba8c0L, 0xfd62f97aL, 0x8a65c9ecL, 0x14015c4fL, 0x63066cd9L, + 0xfa0f3d63L, 0x8d080df5L, 0x3b6e20c8L, 0x4c69105eL, 0xd56041e4L, + 0xa2677172L, 0x3c03e4d1L, 0x4b04d447L, 0xd20d85fdL, 0xa50ab56bL, + 0x35b5a8faL, 0x42b2986cL, 0xdbbbc9d6L, 0xacbcf940L, 0x32d86ce3L, + 0x45df5c75L, 0xdcd60dcfL, 0xabd13d59L, 0x26d930acL, 0x51de003aL, + 0xc8d75180L, 0xbfd06116L, 0x21b4f4b5L, 0x56b3c423L, 0xcfba9599L, + 0xb8bda50fL, 0x2802b89eL, 0x5f058808L, 0xc60cd9b2L, 0xb10be924L, + 0x2f6f7c87L, 0x58684c11L, 0xc1611dabL, 0xb6662d3dL, 0x76dc4190L, + 0x01db7106L, 0x98d220bcL, 0xefd5102aL, 0x71b18589L, 0x06b6b51fL, + 0x9fbfe4a5L, 0xe8b8d433L, 0x7807c9a2L, 0x0f00f934L, 0x9609a88eL, + 0xe10e9818L, 0x7f6a0dbbL, 0x086d3d2dL, 0x91646c97L, 0xe6635c01L, + 0x6b6b51f4L, 0x1c6c6162L, 0x856530d8L, 0xf262004eL, 0x6c0695edL, + 0x1b01a57bL, 0x8208f4c1L, 0xf50fc457L, 0x65b0d9c6L, 0x12b7e950L, + 0x8bbeb8eaL, 0xfcb9887cL, 0x62dd1ddfL, 0x15da2d49L, 0x8cd37cf3L, + 0xfbd44c65L, 0x4db26158L, 0x3ab551ceL, 0xa3bc0074L, 0xd4bb30e2L, + 0x4adfa541L, 0x3dd895d7L, 0xa4d1c46dL, 0xd3d6f4fbL, 0x4369e96aL, + 0x346ed9fcL, 0xad678846L, 0xda60b8d0L, 0x44042d73L, 0x33031de5L, + 0xaa0a4c5fL, 0xdd0d7cc9L, 0x5005713cL, 0x270241aaL, 0xbe0b1010L, + 0xc90c2086L, 0x5768b525L, 0x206f85b3L, 0xb966d409L, 0xce61e49fL, + 0x5edef90eL, 0x29d9c998L, 0xb0d09822L, 0xc7d7a8b4L, 0x59b33d17L, + 0x2eb40d81L, 0xb7bd5c3bL, 0xc0ba6cadL, 0xedb88320L, 0x9abfb3b6L, + 0x03b6e20cL, 0x74b1d29aL, 0xead54739L, 0x9dd277afL, 0x04db2615L, + 0x73dc1683L, 0xe3630b12L, 0x94643b84L, 0x0d6d6a3eL, 0x7a6a5aa8L, + 0xe40ecf0bL, 0x9309ff9dL, 0x0a00ae27L, 0x7d079eb1L, 0xf00f9344L, + 0x8708a3d2L, 0x1e01f268L, 0x6906c2feL, 0xf762575dL, 0x806567cbL, + 0x196c3671L, 0x6e6b06e7L, 0xfed41b76L, 0x89d32be0L, 0x10da7a5aL, + 0x67dd4accL, 0xf9b9df6fL, 0x8ebeeff9L, 0x17b7be43L, 0x60b08ed5L, + 0xd6d6a3e8L, 0xa1d1937eL, 0x38d8c2c4L, 0x4fdff252L, 0xd1bb67f1L, + 0xa6bc5767L, 0x3fb506ddL, 0x48b2364bL, 0xd80d2bdaL, 0xaf0a1b4cL, + 0x36034af6L, 0x41047a60L, 0xdf60efc3L, 0xa867df55L, 0x316e8eefL, + 0x4669be79L, 0xcb61b38cL, 0xbc66831aL, 0x256fd2a0L, 0x5268e236L, + 0xcc0c7795L, 0xbb0b4703L, 0x220216b9L, 0x5505262fL, 0xc5ba3bbeL, + 0xb2bd0b28L, 0x2bb45a92L, 0x5cb36a04L, 0xc2d7ffa7L, 0xb5d0cf31L, + 0x2cd99e8bL, 0x5bdeae1dL, 0x9b64c2b0L, 0xec63f226L, 0x756aa39cL, + 0x026d930aL, 0x9c0906a9L, 0xeb0e363fL, 0x72076785L, 0x05005713L, + 0x95bf4a82L, 0xe2b87a14L, 0x7bb12baeL, 0x0cb61b38L, 0x92d28e9bL, + 0xe5d5be0dL, 0x7cdcefb7L, 0x0bdbdf21L, 0x86d3d2d4L, 0xf1d4e242L, + 0x68ddb3f8L, 0x1fda836eL, 0x81be16cdL, 0xf6b9265bL, 0x6fb077e1L, + 0x18b74777L, 0x88085ae6L, 0xff0f6a70L, 0x66063bcaL, 0x11010b5cL, + 0x8f659effL, 0xf862ae69L, 0x616bffd3L, 0x166ccf45L, 0xa00ae278L, + 0xd70dd2eeL, 0x4e048354L, 0x3903b3c2L, 0xa7672661L, 0xd06016f7L, + 0x4969474dL, 0x3e6e77dbL, 0xaed16a4aL, 0xd9d65adcL, 0x40df0b66L, + 0x37d83bf0L, 0xa9bcae53L, 0xdebb9ec5L, 0x47b2cf7fL, 0x30b5ffe9L, + 0xbdbdf21cL, 0xcabac28aL, 0x53b39330L, 0x24b4a3a6L, 0xbad03605L, + 0xcdd70693L, 0x54de5729L, 0x23d967bfL, 0xb3667a2eL, 0xc4614ab8L, + 0x5d681b02L, 0x2a6f2b94L, 0xb40bbe37L, 0xc30c8ea1L, 0x5a05df1bL, + 0x2d02ef8dL +#else + 0x00000000L, 0x96300777L, 0x2c610eeeL, 0xba510999L, 0x19c46d07L, + 0x8ff46a70L, 0x35a563e9L, 0xa395649eL, 0x3288db0eL, 0xa4b8dc79L, + 0x1ee9d5e0L, 0x88d9d297L, 0x2b4cb609L, 0xbd7cb17eL, 0x072db8e7L, + 0x911dbf90L, 0x6410b71dL, 0xf220b06aL, 0x4871b9f3L, 0xde41be84L, + 0x7dd4da1aL, 0xebe4dd6dL, 0x51b5d4f4L, 0xc785d383L, 0x56986c13L, + 0xc0a86b64L, 0x7af962fdL, 0xecc9658aL, 0x4f5c0114L, 0xd96c0663L, + 0x633d0ffaL, 0xf50d088dL, 0xc8206e3bL, 0x5e10694cL, 0xe44160d5L, + 0x727167a2L, 0xd1e4033cL, 0x47d4044bL, 0xfd850dd2L, 0x6bb50aa5L, + 0xfaa8b535L, 0x6c98b242L, 0xd6c9bbdbL, 0x40f9bcacL, 0xe36cd832L, + 0x755cdf45L, 0xcf0dd6dcL, 0x593dd1abL, 0xac30d926L, 0x3a00de51L, + 0x8051d7c8L, 0x1661d0bfL, 0xb5f4b421L, 0x23c4b356L, 0x9995bacfL, + 0x0fa5bdb8L, 0x9eb80228L, 0x0888055fL, 0xb2d90cc6L, 0x24e90bb1L, + 0x877c6f2fL, 0x114c6858L, 0xab1d61c1L, 0x3d2d66b6L, 0x9041dc76L, + 0x0671db01L, 0xbc20d298L, 0x2a10d5efL, 0x8985b171L, 0x1fb5b606L, + 0xa5e4bf9fL, 0x33d4b8e8L, 0xa2c90778L, 0x34f9000fL, 0x8ea80996L, + 0x18980ee1L, 0xbb0d6a7fL, 0x2d3d6d08L, 0x976c6491L, 0x015c63e6L, + 0xf4516b6bL, 0x62616c1cL, 0xd8306585L, 0x4e0062f2L, 0xed95066cL, + 0x7ba5011bL, 0xc1f40882L, 0x57c40ff5L, 0xc6d9b065L, 0x50e9b712L, + 0xeab8be8bL, 0x7c88b9fcL, 0xdf1ddd62L, 0x492dda15L, 0xf37cd38cL, + 0x654cd4fbL, 0x5861b24dL, 0xce51b53aL, 0x7400bca3L, 0xe230bbd4L, + 0x41a5df4aL, 0xd795d83dL, 0x6dc4d1a4L, 0xfbf4d6d3L, 0x6ae96943L, + 0xfcd96e34L, 0x468867adL, 0xd0b860daL, 0x732d0444L, 0xe51d0333L, + 0x5f4c0aaaL, 0xc97c0dddL, 0x3c710550L, 0xaa410227L, 0x10100bbeL, + 0x86200cc9L, 0x25b56857L, 0xb3856f20L, 0x09d466b9L, 0x9fe461ceL, + 0x0ef9de5eL, 0x98c9d929L, 0x2298d0b0L, 0xb4a8d7c7L, 0x173db359L, + 0x810db42eL, 0x3b5cbdb7L, 0xad6cbac0L, 0x2083b8edL, 0xb6b3bf9aL, + 0x0ce2b603L, 0x9ad2b174L, 0x3947d5eaL, 0xaf77d29dL, 0x1526db04L, + 0x8316dc73L, 0x120b63e3L, 0x843b6494L, 0x3e6a6d0dL, 0xa85a6a7aL, + 0x0bcf0ee4L, 0x9dff0993L, 0x27ae000aL, 0xb19e077dL, 0x44930ff0L, + 0xd2a30887L, 0x68f2011eL, 0xfec20669L, 0x5d5762f7L, 0xcb676580L, + 0x71366c19L, 0xe7066b6eL, 0x761bd4feL, 0xe02bd389L, 0x5a7ada10L, + 0xcc4add67L, 0x6fdfb9f9L, 0xf9efbe8eL, 0x43beb717L, 0xd58eb060L, + 0xe8a3d6d6L, 0x7e93d1a1L, 0xc4c2d838L, 0x52f2df4fL, 0xf167bbd1L, + 0x6757bca6L, 0xdd06b53fL, 0x4b36b248L, 0xda2b0dd8L, 0x4c1b0aafL, + 0xf64a0336L, 0x607a0441L, 0xc3ef60dfL, 0x55df67a8L, 0xef8e6e31L, + 0x79be6946L, 0x8cb361cbL, 0x1a8366bcL, 0xa0d26f25L, 0x36e26852L, + 0x95770cccL, 0x03470bbbL, 0xb9160222L, 0x2f260555L, 0xbe3bbac5L, + 0x280bbdb2L, 0x925ab42bL, 0x046ab35cL, 0xa7ffd7c2L, 0x31cfd0b5L, + 0x8b9ed92cL, 0x1daede5bL, 0xb0c2649bL, 0x26f263ecL, 0x9ca36a75L, + 0x0a936d02L, 0xa906099cL, 0x3f360eebL, 0x85670772L, 0x13570005L, + 0x824abf95L, 0x147ab8e2L, 0xae2bb17bL, 0x381bb60cL, 0x9b8ed292L, + 0x0dbed5e5L, 0xb7efdc7cL, 0x21dfdb0bL, 0xd4d2d386L, 0x42e2d4f1L, + 0xf8b3dd68L, 0x6e83da1fL, 0xcd16be81L, 0x5b26b9f6L, 0xe177b06fL, + 0x7747b718L, 0xe65a0888L, 0x706a0fffL, 0xca3b0666L, 0x5c0b0111L, + 0xff9e658fL, 0x69ae62f8L, 0xd3ff6b61L, 0x45cf6c16L, 0x78e20aa0L, + 0xeed20dd7L, 0x5483044eL, 0xc2b30339L, 0x612667a7L, 0xf71660d0L, + 0x4d476949L, 0xdb776e3eL, 0x4a6ad1aeL, 0xdc5ad6d9L, 0x660bdf40L, + 0xf03bd837L, 0x53aebca9L, 0xc59ebbdeL, 0x7fcfb247L, 0xe9ffb530L, + 0x1cf2bdbdL, 0x8ac2bacaL, 0x3093b353L, 0xa6a3b424L, 0x0536d0baL, + 0x9306d7cdL, 0x2957de54L, 0xbf67d923L, 0x2e7a66b3L, 0xb84a61c4L, + 0x021b685dL, 0x942b6f2aL, 0x37be0bb4L, 0xa18e0cc3L, 0x1bdf055aL, + 0x8def022dL +#endif +}; + +void crc32_init(crc32_state *ctx) +{ + LTC_ARGCHKVD(ctx != NULL); + ctx->crc = _CRC32_NEGL; +} + +void crc32_update(crc32_state *ctx, const unsigned char *input, unsigned long length) +{ + ulong32 crc; + LTC_ARGCHKVD(ctx != NULL); + LTC_ARGCHKVD(input != NULL); + crc = ctx->crc; + + while (length--) + crc = crc32_m_tab[CRC32_INDEX(crc) ^ *input++] ^ CRC32_SHIFTED(crc); + + ctx->crc = crc; +} + +void crc32_finish(crc32_state *ctx, void *hash, unsigned long size) +{ + unsigned long i; + unsigned char* h; + ulong32 crc; + LTC_ARGCHKVD(ctx != NULL); + LTC_ARGCHKVD(hash != NULL); + + h = hash; + crc = ctx->crc; + crc ^= _CRC32_NEGL; + + if (size > 4) size = 4; + for (i = 0; i < size; i++) { + h[i] = ((unsigned char*)&(crc))[size-i-1]; + } +} + +int crc32_test(void) +{ +#ifndef LTC_TEST + return CRYPT_NOP; +#else + const void* in = "libtomcrypt"; + const unsigned char crc32[] = { 0xb3, 0x73, 0x76, 0xef }; + unsigned char out[4]; + crc32_state ctx; + crc32_init(&ctx); + crc32_update(&ctx, in, strlen(in)); + crc32_finish(&ctx, out, 4); + if (compare_testvector(crc32, 4, out, 4, "CRC32", 0)) { + return CRYPT_FAIL_TESTVECTOR; + } + return CRYPT_OK; +#endif +} +#endif + +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/misc/crypt/crypt.c b/libtomcrypt/src/misc/crypt/crypt.c index 054f4b7..83b6c21 100644 --- a/libtomcrypt/src/misc/crypt/crypt.c +++ b/libtomcrypt/src/misc/crypt/crypt.c @@ -5,57 +5,57 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" /** @file crypt.c Build strings, Tom St Denis -*/ +*/ +#define NAME_VALUE(s) #s"="NAME(s) +#define NAME(s) #s -/* +#if 0 /* Dropbear */ const char *crypt_build_settings = - "LibTomCrypt " SCRYPT " (Tom St Denis, tomstdenis@gmail.com)\n" + "LibTomCrypt " SCRYPT " (www.libtom.net)\n" "LibTomCrypt is public domain software.\n" - "Built on " __DATE__ " at " __TIME__ "\n\n\n" - "Endianess: " +#if defined(INCLUDE_BUILD_DATE) + "Built on " __DATE__ " at " __TIME__ "\n" +#endif + "\n\nEndianness: " #if defined(ENDIAN_NEUTRAL) - "neutral\n" -#elif defined(ENDIAN_LITTLE) + "neutral/" +#endif +#if defined(ENDIAN_LITTLE) "little" - #if defined(ENDIAN_32BITWORD) - " (32-bit words)\n" - #else - " (64-bit words)\n" - #endif #elif defined(ENDIAN_BIG) "big" +#endif #if defined(ENDIAN_32BITWORD) " (32-bit words)\n" - #else + #elif defined(ENDIAN_64BITWORD) " (64-bit words)\n" + #else + " (no wordsize defined)\n" #endif -#endif "Clean stack: " #if defined(LTC_CLEAN_STACK) "enabled\n" #else "disabled\n" #endif - "Ciphers built-in:\n" + "\nCiphers built-in:\n" #if defined(LTC_BLOWFISH) " Blowfish\n" #endif #if defined(LTC_RC2) - " LTC_RC2\n" + " RC2\n" #endif #if defined(LTC_RC5) - " LTC_RC5\n" + " RC5\n" #endif #if defined(LTC_RC6) - " LTC_RC6\n" + " RC6\n" #endif #if defined(LTC_SAFERP) " Safer+\n" @@ -67,7 +67,7 @@ const char *crypt_build_settings = " Rijndael\n" #endif #if defined(LTC_XTEA) - " LTC_XTEA\n" + " XTEA\n" #endif #if defined(LTC_TWOFISH) " Twofish " @@ -90,10 +90,10 @@ const char *crypt_build_settings = #endif #endif #if defined(LTC_DES) - " LTC_DES\n" + " DES\n" #endif #if defined(LTC_CAST5) - " LTC_CAST5\n" + " CAST5\n" #endif #if defined(LTC_NOEKEON) " Noekeon\n" @@ -112,57 +112,88 @@ const char *crypt_build_settings = #endif "\n" #if defined(LTC_KSEED) - " LTC_KSEED\n" + " KSEED\n" #endif #if defined(LTC_KASUMI) " KASUMI\n" #endif +#if defined(LTC_MULTI2) + " MULTI2\n" +#endif +#if defined(LTC_CAMELLIA) + " Camellia\n" +#endif + "Stream ciphers built-in:\n" +#if defined(LTC_CHACHA) + " ChaCha\n" +#endif +#if defined(LTC_RC4_STREAM) + " RC4\n" +#endif +#if defined(LTC_SOBER128_STREAM) + " SOBER128\n" +#endif "\nHashes built-in:\n" +#if defined(LTC_SHA3) + " SHA3\n" +#endif #if defined(LTC_SHA512) - " LTC_SHA-512\n" + " SHA-512\n" #endif #if defined(LTC_SHA384) - " LTC_SHA-384\n" + " SHA-384\n" +#endif +#if defined(LTC_SHA512_256) + " SHA-512/256\n" #endif #if defined(LTC_SHA256) - " LTC_SHA-256\n" + " SHA-256\n" +#endif +#if defined(LTC_SHA512_224) + " SHA-512/224\n" #endif #if defined(LTC_SHA224) - " LTC_SHA-224\n" + " SHA-224\n" #endif #if defined(LTC_TIGER) - " LTC_TIGER\n" + " TIGER\n" #endif #if defined(LTC_SHA1) - " LTC_SHA1\n" + " SHA1\n" #endif #if defined(LTC_MD5) - " LTC_MD5\n" + " MD5\n" #endif #if defined(LTC_MD4) - " LTC_MD4\n" + " MD4\n" #endif #if defined(LTC_MD2) - " LTC_MD2\n" + " MD2\n" #endif #if defined(LTC_RIPEMD128) - " LTC_RIPEMD128\n" + " RIPEMD128\n" #endif #if defined(LTC_RIPEMD160) - " LTC_RIPEMD160\n" + " RIPEMD160\n" #endif #if defined(LTC_RIPEMD256) - " LTC_RIPEMD256\n" + " RIPEMD256\n" #endif #if defined(LTC_RIPEMD320) - " LTC_RIPEMD320\n" + " RIPEMD320\n" #endif #if defined(LTC_WHIRLPOOL) - " LTC_WHIRLPOOL\n" + " WHIRLPOOL\n" +#endif +#if defined(LTC_BLAKE2S) + " BLAKE2S\n" +#endif +#if defined(LTC_BLAKE2B) + " BLAKE2B\n" #endif #if defined(LTC_CHC_HASH) - " LTC_CHC_HASH \n" + " CHC_HASH\n" #endif "\nBlock Chaining Modes:\n" @@ -179,97 +210,151 @@ const char *crypt_build_settings = " CBC\n" #endif #if defined(LTC_CTR_MODE) - " CTR " + " CTR\n" #endif -#if defined(LTC_CTR_OLD) - " (CTR_OLD) " -#endif - "\n" -#if defined(LRW_MODE) - " LRW_MODE" -#if defined(LRW_TABLES) - " (LRW_TABLES) " +#if defined(LTC_LRW_MODE) + " LRW" +#if defined(LTC_LRW_TABLES) + " (tables) " #endif "\n" #endif #if defined(LTC_F8_MODE) - " F8 MODE\n" -#endif + " F8\n" +#endif #if defined(LTC_XTS_MODE) - " LTC_XTS_MODE\n" + " XTS\n" #endif "\nMACs:\n" #if defined(LTC_HMAC) - " LTC_HMAC\n" + " HMAC\n" #endif #if defined(LTC_OMAC) - " LTC_OMAC\n" + " OMAC\n" #endif #if defined(LTC_PMAC) " PMAC\n" #endif #if defined(LTC_PELICAN) - " LTC_PELICAN\n" + " PELICAN\n" #endif #if defined(LTC_XCBC) - " XCBC-MAC\n" + " XCBC\n" #endif #if defined(LTC_F9_MODE) - " F9-MAC\n" + " F9\n" +#endif +#if defined(LTC_POLY1305) + " POLY1305\n" +#endif +#if defined(LTC_BLAKE2SMAC) + " BLAKE2S MAC\n" +#endif +#if defined(LTC_BLAKE2BMAC) + " BLAKE2B MAC\n" #endif "\nENC + AUTH modes:\n" #if defined(LTC_EAX_MODE) - " LTC_EAX_MODE\n" + " EAX\n" #endif #if defined(LTC_OCB_MODE) - " LTC_OCB_MODE\n" + " OCB\n" +#endif +#if defined(LTC_OCB3_MODE) + " OCB3\n" #endif #if defined(LTC_CCM_MODE) - " LTC_CCM_MODE\n" + " CCM\n" #endif #if defined(LTC_GCM_MODE) - " LTC_GCM_MODE " -#endif + " GCM" #if defined(LTC_GCM_TABLES) - " (LTC_GCM_TABLES) " + " (tables) " +#endif +#if defined(LTC_GCM_TABLES_SSE2) + " (SSE2) " #endif "\n" +#endif +#if defined(LTC_CHACHA20POLY1305_MODE) + " CHACHA20POLY1305\n" +#endif "\nPRNG:\n" #if defined(LTC_YARROW) - " Yarrow\n" + " Yarrow ("NAME_VALUE(LTC_YARROW_AES)")\n" #endif #if defined(LTC_SPRNG) - " LTC_SPRNG\n" + " SPRNG\n" #endif #if defined(LTC_RC4) - " LTC_RC4\n" + " RC4\n" +#endif +#if defined(LTC_CHACHA20_PRNG) + " ChaCha20\n" #endif #if defined(LTC_FORTUNA) - " Fortuna\n" + " Fortuna (" NAME_VALUE(LTC_FORTUNA_POOLS) ", " NAME_VALUE(LTC_FORTUNA_WD) ")\n" #endif #if defined(LTC_SOBER128) - " LTC_SOBER128\n" + " SOBER128\n" #endif - "\nPK Algs:\n" + "\nPK Crypto:\n" #if defined(LTC_MRSA) - " RSA \n" + " RSA" +#if defined(LTC_RSA_BLINDING) && defined(LTC_RSA_CRT_HARDENING) + " (with blinding and CRT hardening)" +#elif defined(LTC_RSA_BLINDING) + " (with blinding)" +#elif defined(LTC_RSA_CRT_HARDENING) + " (with CRT hardening)" +#endif + "\n" +#endif +#if defined(LTC_MDH) + " DH\n" #endif #if defined(LTC_MECC) - " ECC\n" + " ECC" +#if defined(LTC_ECC_TIMING_RESISTANT) + " (with blinding)" +#endif + "\n" #endif #if defined(LTC_MDSA) " DSA\n" #endif -#if defined(MKAT) +#if defined(LTC_MKAT) " Katja\n" -#endif +#endif +#if defined(LTC_PK_MAX_RETRIES) + " "NAME_VALUE(LTC_PK_MAX_RETRIES)"\n" +#endif + + "\nMPI (Math):\n" +#if defined(LTC_MPI) + " LTC_MPI\n" +#endif +#if defined(LTM_DESC) + " LTM_DESC\n" +#endif +#if defined(TFM_DESC) + " TFM_DESC\n" +#endif +#if defined(GMP_DESC) + " GMP_DESC\n" +#endif +#if defined(LTC_MILLER_RABIN_REPS) + " "NAME_VALUE(LTC_MILLER_RABIN_REPS)"\n" +#endif "\nCompiler:\n" -#if defined(WIN32) +#if defined(_WIN64) + " WIN64 platform detected.\n" +#elif defined(_WIN32) " WIN32 platform detected.\n" #endif #if defined(__CYGWIN__) @@ -281,37 +366,78 @@ const char *crypt_build_settings = #if defined(_MSC_VER) " MSVC compiler detected.\n" #endif -#if defined(__GNUC__) - " GCC compiler detected.\n" -#endif -#if defined(INTEL_CC) - " Intel C Compiler detected.\n" +#if defined(__clang_version__) + " Clang compiler " __clang_version__ ".\n" +#elif defined(INTEL_CC) + " Intel C Compiler " __VERSION__ ".\n" +#elif defined(__GNUC__) /* clang and icc also define __GNUC__ */ + " GCC compiler " __VERSION__ ".\n" #endif + #if defined(__x86_64__) " x86-64 detected.\n" #endif #if defined(LTC_PPC32) - " LTC_PPC32 defined \n" -#endif + " PPC32 detected.\n" +#endif "\nVarious others: " +#if defined(ARGTYPE) + " " NAME_VALUE(ARGTYPE) " " +#endif +#if defined(LTC_ADLER32) + " ADLER32 " +#endif #if defined(LTC_BASE64) - " LTC_BASE64 " + " BASE64 " #endif -#if defined(MPI) - " MPI " +#if defined(LTC_BASE64_URL) + " BASE64-URL-SAFE " #endif -#if defined(TRY_UNRANDOM_FIRST) - " TRY_UNRANDOM_FIRST " +#if defined(LTC_CRC32) + " CRC32 " #endif -#if defined(LTC_TEST) - " LTC_TEST " +#if defined(LTC_DER) + " DER " #endif #if defined(LTC_PKCS_1) - " LTC_PKCS#1 " + " PKCS#1 " #endif #if defined(LTC_PKCS_5) - " LTC_PKCS#5 " + " PKCS#5 " +#endif +#if defined(LTC_HKDF) + " HKDF " +#endif +#if defined(LTC_DEVRANDOM) + " LTC_DEVRANDOM " +#endif +#if defined(LTC_TRY_URANDOM_FIRST) + " LTC_TRY_URANDOM_FIRST " +#endif +#if defined(LTC_RNG_GET_BYTES) + " LTC_RNG_GET_BYTES " +#endif +#if defined(LTC_RNG_MAKE_PRNG) + " LTC_RNG_MAKE_PRNG " +#endif +#if defined(LTC_PRNG_ENABLE_LTC_RNG) + " LTC_PRNG_ENABLE_LTC_RNG " +#endif +#if defined(LTC_HASH_HELPERS) + " LTC_HASH_HELPERS " +#endif +#if defined(LTC_VALGRIND) + " LTC_VALGRIND " +#endif +#if defined(LTC_TEST) + " LTC_TEST " +#endif +#if defined(LTC_TEST_DBG) + " " NAME_VALUE(LTC_TEST_DBG) " " +#endif +#if defined(LTC_TEST_EXT) + " LTC_TEST_EXT " #endif #if defined(LTC_SMALL_CODE) " LTC_SMALL_CODE " @@ -319,8 +445,8 @@ const char *crypt_build_settings = #if defined(LTC_NO_FILE) " LTC_NO_FILE " #endif -#if defined(LTC_DER) - " LTC_DER " +#if defined(LTC_FILE_READ_BUFSIZE) + " " NAME_VALUE(LTC_FILE_READ_BUFSIZE) " " #endif #if defined(LTC_FAST) " LTC_FAST " @@ -334,6 +460,12 @@ const char *crypt_build_settings = #if defined(LTC_NO_ASM) " LTC_NO_ASM " #endif +#if defined(LTC_ROx_ASM) + " LTC_ROx_ASM " +#if defined(LTC_NO_ROLC) + " LTC_NO_ROLC " +#endif +#endif #if defined(LTC_NO_TEST) " LTC_NO_TEST " #endif @@ -343,21 +475,12 @@ const char *crypt_build_settings = #if defined(LTC_PTHREAD) " LTC_PTHREAD " #endif -#if defined(LTM_LTC_DESC) - " LTM_DESC " -#endif -#if defined(TFM_LTC_DESC) - " TFM_DESC " +#if defined(LTC_EASY) + " LTC_EASY " #endif #if defined(LTC_MECC_ACCEL) " LTC_MECC_ACCEL " #endif -#if defined(GMP_LTC_DESC) - " GMP_DESC " -#endif -#if defined(LTC_EASY) - " (easy) " -#endif #if defined(LTC_MECC_FP) " LTC_MECC_FP " #endif @@ -365,11 +488,10 @@ const char *crypt_build_settings = " LTC_ECC_SHAMIR " #endif "\n" - "\n\n\n" ; - */ +#endif /* Dropbear */ -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/misc/crypt/crypt_argchk.c b/libtomcrypt/src/misc/crypt/crypt_argchk.c index 2f2faa7..da7306b 100644 --- a/libtomcrypt/src/misc/crypt/crypt_argchk.c +++ b/libtomcrypt/src/misc/crypt/crypt_argchk.c @@ -5,19 +5,16 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" -#include <signal.h> /** @file crypt_argchk.c Perform argument checking, Tom St Denis -*/ +*/ #if (ARGTYPE == 0) -void crypt_argchk(char *v, char *s, int d) +void crypt_argchk(const char *v, const char *s, int d) { fprintf(stderr, "LTC_ARGCHK '%s' failure on line %d of file %s\n", v, d, s); @@ -25,6 +22,6 @@ void crypt_argchk(char *v, char *s, int d) } #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/misc/crypt/crypt_cipher_descriptor.c b/libtomcrypt/src/misc/crypt/crypt_cipher_descriptor.c index 20aac57..ccc9890 100644 --- a/libtomcrypt/src/misc/crypt/crypt_cipher_descriptor.c +++ b/libtomcrypt/src/misc/crypt/crypt_cipher_descriptor.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" @@ -16,12 +14,12 @@ */ struct ltc_cipher_descriptor cipher_descriptor[TAB_SIZE] = { -{ NULL, 0, 0, 0, 0, 0, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL } +{ NULL, 0, 0, 0, 0, 0, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL } }; LTC_MUTEX_GLOBAL(ltc_cipher_mutex) -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/misc/crypt/crypt_cipher_is_valid.c b/libtomcrypt/src/misc/crypt/crypt_cipher_is_valid.c index 35f1ace..aebc94c 100644 --- a/libtomcrypt/src/misc/crypt/crypt_cipher_is_valid.c +++ b/libtomcrypt/src/misc/crypt/crypt_cipher_is_valid.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" @@ -31,6 +29,6 @@ int cipher_is_valid(int idx) return CRYPT_OK; } -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/misc/crypt/crypt_constants.c b/libtomcrypt/src/misc/crypt/crypt_constants.c new file mode 100644 index 0000000..a7418d5 --- /dev/null +++ b/libtomcrypt/src/misc/crypt/crypt_constants.c @@ -0,0 +1,297 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + */ +#include "tomcrypt.h" + +/** + @file crypt_constants.c + + Make various constants available to dynamic languages + like Python - Larry Bugbee, February 2013 + + LB - Dec 2013 - revised to include compiler define options + LB - Mar 2014 - added endianness and word size +*/ + +typedef struct { + const char *name; + const int value; +} crypt_constant; + +#define _C_STRINGIFY(s) { #s, s } + +static const crypt_constant _crypt_constants[] = { + + _C_STRINGIFY(CRYPT_OK), + _C_STRINGIFY(CRYPT_ERROR), + _C_STRINGIFY(CRYPT_NOP), + _C_STRINGIFY(CRYPT_INVALID_KEYSIZE), + _C_STRINGIFY(CRYPT_INVALID_ROUNDS), + _C_STRINGIFY(CRYPT_FAIL_TESTVECTOR), + _C_STRINGIFY(CRYPT_BUFFER_OVERFLOW), + _C_STRINGIFY(CRYPT_INVALID_PACKET), + _C_STRINGIFY(CRYPT_INVALID_PRNGSIZE), + _C_STRINGIFY(CRYPT_ERROR_READPRNG), + _C_STRINGIFY(CRYPT_INVALID_CIPHER), + _C_STRINGIFY(CRYPT_INVALID_HASH), + _C_STRINGIFY(CRYPT_INVALID_PRNG), + _C_STRINGIFY(CRYPT_MEM), + _C_STRINGIFY(CRYPT_PK_TYPE_MISMATCH), + _C_STRINGIFY(CRYPT_PK_NOT_PRIVATE), + _C_STRINGIFY(CRYPT_INVALID_ARG), + _C_STRINGIFY(CRYPT_FILE_NOTFOUND), + _C_STRINGIFY(CRYPT_PK_INVALID_TYPE), + _C_STRINGIFY(CRYPT_OVERFLOW), + _C_STRINGIFY(CRYPT_UNUSED1), + _C_STRINGIFY(CRYPT_INPUT_TOO_LONG), + _C_STRINGIFY(CRYPT_PK_INVALID_SIZE), + _C_STRINGIFY(CRYPT_INVALID_PRIME_SIZE), + _C_STRINGIFY(CRYPT_PK_INVALID_PADDING), + _C_STRINGIFY(CRYPT_HASH_OVERFLOW), + + _C_STRINGIFY(PK_PUBLIC), + _C_STRINGIFY(PK_PRIVATE), + + _C_STRINGIFY(LTC_ENCRYPT), + _C_STRINGIFY(LTC_DECRYPT), + +#ifdef LTC_PKCS_1 + {"LTC_PKCS_1", 1}, + /* Block types */ + _C_STRINGIFY(LTC_PKCS_1_EMSA), + _C_STRINGIFY(LTC_PKCS_1_EME), + + /* Padding types */ + _C_STRINGIFY(LTC_PKCS_1_V1_5), + _C_STRINGIFY(LTC_PKCS_1_OAEP), + _C_STRINGIFY(LTC_PKCS_1_PSS), + _C_STRINGIFY(LTC_PKCS_1_V1_5_NA1), +#else + {"LTC_PKCS_1", 0}, +#endif + +#ifdef LTC_MRSA + {"LTC_MRSA", 1}, +#else + {"LTC_MRSA", 0}, +#endif + +#ifdef LTC_MKAT + {"LTC_MKAT", 1}, + _C_STRINGIFY(MIN_KAT_SIZE), + _C_STRINGIFY(MAX_KAT_SIZE), +#else + {"LTC_MKAT", 0}, +#endif + +#ifdef LTC_MECC + {"LTC_MECC", 1}, + _C_STRINGIFY(ECC_BUF_SIZE), + _C_STRINGIFY(ECC_MAXSIZE), +#else + {"LTC_MECC", 0}, +#endif + +#ifdef LTC_MDSA + {"LTC_MDSA", 1}, + _C_STRINGIFY(LTC_MDSA_DELTA), + _C_STRINGIFY(LTC_MDSA_MAX_GROUP), +#else + {"LTC_MDSA", 0}, +#endif + +#ifdef LTC_MILLER_RABIN_REPS + _C_STRINGIFY(LTC_MILLER_RABIN_REPS), +#endif + +#ifdef LTC_DER +/* DER handling */ + _C_STRINGIFY(LTC_ASN1_EOL), + _C_STRINGIFY(LTC_ASN1_BOOLEAN), + _C_STRINGIFY(LTC_ASN1_INTEGER), + _C_STRINGIFY(LTC_ASN1_SHORT_INTEGER), + _C_STRINGIFY(LTC_ASN1_BIT_STRING), + _C_STRINGIFY(LTC_ASN1_OCTET_STRING), + _C_STRINGIFY(LTC_ASN1_NULL), + _C_STRINGIFY(LTC_ASN1_OBJECT_IDENTIFIER), + _C_STRINGIFY(LTC_ASN1_IA5_STRING), + _C_STRINGIFY(LTC_ASN1_PRINTABLE_STRING), + _C_STRINGIFY(LTC_ASN1_UTF8_STRING), + _C_STRINGIFY(LTC_ASN1_UTCTIME), + _C_STRINGIFY(LTC_ASN1_CHOICE), + _C_STRINGIFY(LTC_ASN1_SEQUENCE), + _C_STRINGIFY(LTC_ASN1_SET), + _C_STRINGIFY(LTC_ASN1_SETOF), + _C_STRINGIFY(LTC_ASN1_RAW_BIT_STRING), + _C_STRINGIFY(LTC_ASN1_TELETEX_STRING), + _C_STRINGIFY(LTC_ASN1_CONSTRUCTED), + _C_STRINGIFY(LTC_ASN1_CONTEXT_SPECIFIC), + _C_STRINGIFY(LTC_ASN1_GENERALIZEDTIME), +#endif + +#ifdef LTC_CTR_MODE + {"LTC_CTR_MODE", 1}, + _C_STRINGIFY(CTR_COUNTER_LITTLE_ENDIAN), + _C_STRINGIFY(CTR_COUNTER_BIG_ENDIAN), + _C_STRINGIFY(LTC_CTR_RFC3686), +#else + {"LTC_CTR_MODE", 0}, +#endif +#ifdef LTC_GCM_MODE + _C_STRINGIFY(LTC_GCM_MODE_IV), + _C_STRINGIFY(LTC_GCM_MODE_AAD), + _C_STRINGIFY(LTC_GCM_MODE_TEXT), +#endif + + _C_STRINGIFY(LTC_MP_LT), + _C_STRINGIFY(LTC_MP_EQ), + _C_STRINGIFY(LTC_MP_GT), + + _C_STRINGIFY(LTC_MP_NO), + _C_STRINGIFY(LTC_MP_YES), + + _C_STRINGIFY(MAXBLOCKSIZE), + _C_STRINGIFY(TAB_SIZE), + _C_STRINGIFY(ARGTYPE), + +#ifdef LTM_DESC + {"LTM_DESC", 1}, +#else + {"LTM_DESC", 0}, +#endif +#ifdef TFM_DESC + {"TFM_DESC", 1}, +#else + {"TFM_DESC", 0}, +#endif +#ifdef GMP_DESC + {"GMP_DESC", 1}, +#else + {"GMP_DESC", 0}, +#endif + +#ifdef LTC_FAST + {"LTC_FAST", 1}, +#else + {"LTC_FAST", 0}, +#endif + +#ifdef LTC_NO_FILE + {"LTC_NO_FILE", 1}, +#else + {"LTC_NO_FILE", 0}, +#endif + +#ifdef ENDIAN_LITTLE + {"ENDIAN_LITTLE", 1}, +#else + {"ENDIAN_LITTLE", 0}, +#endif + +#ifdef ENDIAN_BIG + {"ENDIAN_BIG", 1}, +#else + {"ENDIAN_BIG", 0}, +#endif + +#ifdef ENDIAN_32BITWORD + {"ENDIAN_32BITWORD", 1}, +#else + {"ENDIAN_32BITWORD", 0}, +#endif + +#ifdef ENDIAN_64BITWORD + {"ENDIAN_64BITWORD", 1}, +#else + {"ENDIAN_64BITWORD", 0}, +#endif + +#ifdef ENDIAN_NEUTRAL + {"ENDIAN_NEUTRAL", 1}, +#else + {"ENDIAN_NEUTRAL", 0}, +#endif +}; + + +/* crypt_get_constant() + * valueout will be the value of the named constant + * return -1 if named item not found + */ +int crypt_get_constant(const char* namein, int *valueout) { + int i; + int _crypt_constants_len = sizeof(_crypt_constants) / sizeof(_crypt_constants[0]); + for (i=0; i<_crypt_constants_len; i++) { + if (XSTRCMP(_crypt_constants[i].name, namein) == 0) { + *valueout = _crypt_constants[i].value; + return 0; + } + } + return 1; +} + +/* crypt_list_all_constants() + * if names_list is NULL, names_list_size will be the minimum + * number of bytes needed to receive the complete names_list + * if names_list is NOT NULL, names_list must be the addr of + * sufficient memory allocated into which the names_list + * is to be written. Also, the value in names_list_size + * sets the upper bound of the number of characters to be + * written. + * a -1 return value signifies insufficient space made available + */ +int crypt_list_all_constants(char *names_list, unsigned int *names_list_size) { + int i; + unsigned int total_len = 0; + char number[32], *ptr; + int number_len; + int count = sizeof(_crypt_constants) / sizeof(_crypt_constants[0]); + + /* calculate amount of memory required for the list */ + for (i=0; i<count; i++) { + total_len += (unsigned int)strlen(_crypt_constants[i].name) + 1; + /* the above +1 is for the commas */ + number_len = snprintf(number, sizeof(number), "%d", _crypt_constants[i].value); + if ((number_len < 0) || + ((unsigned int)number_len >= sizeof(number))) + return -1; + total_len += number_len + 1; + /* this last +1 is for newlines (and ending NULL) */ + } + + if (names_list == NULL) { + *names_list_size = total_len; + } else { + if (total_len > *names_list_size) { + return -1; + } + /* build the names list */ + ptr = names_list; + for (i=0; i<count; i++) { + strcpy(ptr, _crypt_constants[i].name); + ptr += strlen(_crypt_constants[i].name); + strcpy(ptr, ","); + ptr += 1; + + number_len = snprintf(number, sizeof(number), "%d", _crypt_constants[i].value); + strcpy(ptr, number); + ptr += number_len; + strcpy(ptr, "\n"); + ptr += 1; + } + /* to remove the trailing new-line */ + ptr -= 1; + *ptr = 0; + } + return 0; +} + + +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/misc/crypt/crypt_find_cipher.c b/libtomcrypt/src/misc/crypt/crypt_find_cipher.c index 0c563b0..ba908f4 100644 --- a/libtomcrypt/src/misc/crypt/crypt_find_cipher.c +++ b/libtomcrypt/src/misc/crypt/crypt_find_cipher.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" @@ -36,6 +34,6 @@ int find_cipher(const char *name) } -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/misc/crypt/crypt_find_cipher_any.c b/libtomcrypt/src/misc/crypt/crypt_find_cipher_any.c index c528e6e..5cdcdf8 100644 --- a/libtomcrypt/src/misc/crypt/crypt_find_cipher_any.c +++ b/libtomcrypt/src/misc/crypt/crypt_find_cipher_any.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" @@ -16,7 +14,7 @@ */ /** - Find a cipher flexibly. First by name then if not present by block and key size + Find a cipher flexibly. First by name then if not present by block and key size @param name The name of the cipher desired @param blocklen The minimum length of the block cipher desired (octets) @param keylen The minimum length of the key size desired (octets) @@ -26,10 +24,10 @@ int find_cipher_any(const char *name, int blocklen, int keylen) { int x; - LTC_ARGCHK(name != NULL); - - x = find_cipher(name); - if (x != -1) return x; + if(name != NULL) { + x = find_cipher(name); + if (x != -1) return x; + } LTC_MUTEX_LOCK(<c_cipher_mutex); for (x = 0; x < TAB_SIZE; x++) { @@ -45,6 +43,6 @@ int find_cipher_any(const char *name, int blocklen, int keylen) return -1; } -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/misc/crypt/crypt_find_cipher_id.c b/libtomcrypt/src/misc/crypt/crypt_find_cipher_id.c index be4e0fa..34d0049 100644 --- a/libtomcrypt/src/misc/crypt/crypt_find_cipher_id.c +++ b/libtomcrypt/src/misc/crypt/crypt_find_cipher_id.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" @@ -35,6 +33,6 @@ int find_cipher_id(unsigned char ID) return -1; } -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/misc/crypt/crypt_find_hash.c b/libtomcrypt/src/misc/crypt/crypt_find_hash.c index 12ef320..19ee55c 100644 --- a/libtomcrypt/src/misc/crypt/crypt_find_hash.c +++ b/libtomcrypt/src/misc/crypt/crypt_find_hash.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" @@ -35,6 +33,6 @@ int find_hash(const char *name) return -1; } -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/misc/crypt/crypt_find_hash_any.c b/libtomcrypt/src/misc/crypt/crypt_find_hash_any.c index 65ecce7..413809f 100644 --- a/libtomcrypt/src/misc/crypt/crypt_find_hash_any.c +++ b/libtomcrypt/src/misc/crypt/crypt_find_hash_any.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" @@ -16,7 +14,7 @@ */ /** - Find a hash flexibly. First by name then if not present by digest size + Find a hash flexibly. First by name then if not present by digest size @param name The name of the hash desired @param digestlen The minimum length of the digest size (octets) @return >= 0 if found, -1 if not present @@ -44,6 +42,6 @@ return z; } -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/misc/crypt/crypt_find_hash_id.c b/libtomcrypt/src/misc/crypt/crypt_find_hash_id.c index f8e75fc..ea784e8 100644 --- a/libtomcrypt/src/misc/crypt/crypt_find_hash_id.c +++ b/libtomcrypt/src/misc/crypt/crypt_find_hash_id.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" @@ -35,6 +33,6 @@ int find_hash_id(unsigned char ID) return -1; } -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/misc/crypt/crypt_find_hash_oid.c b/libtomcrypt/src/misc/crypt/crypt_find_hash_oid.c index 19aece7..026cc73 100644 --- a/libtomcrypt/src/misc/crypt/crypt_find_hash_oid.c +++ b/libtomcrypt/src/misc/crypt/crypt_find_hash_oid.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" @@ -30,6 +28,6 @@ int find_hash_oid(const unsigned long *ID, unsigned long IDlen) return -1; } -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/misc/crypt/crypt_find_prng.c b/libtomcrypt/src/misc/crypt/crypt_find_prng.c index af3f7b6..a0cad16 100644 --- a/libtomcrypt/src/misc/crypt/crypt_find_prng.c +++ b/libtomcrypt/src/misc/crypt/crypt_find_prng.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" @@ -36,6 +34,6 @@ int find_prng(const char *name) } -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/misc/crypt/crypt_fsa.c b/libtomcrypt/src/misc/crypt/crypt_fsa.c index 3d6d86d..dc2a570 100644 --- a/libtomcrypt/src/misc/crypt/crypt_fsa.c +++ b/libtomcrypt/src/misc/crypt/crypt_fsa.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" #include <stdarg.h> @@ -14,12 +12,11 @@ /** @file crypt_fsa.c LibTomCrypt FULL SPEED AHEAD!, Tom St Denis -*/ +*/ /* format is ltc_mp, cipher_desc, [cipher_desc], NULL, hash_desc, [hash_desc], NULL, prng_desc, [prng_desc], NULL */ int crypt_fsa(void *mp, ...) { - int err; va_list args; void *p; @@ -27,33 +24,33 @@ int crypt_fsa(void *mp, ...) if (mp != NULL) { XMEMCPY(<c_mp, mp, sizeof(ltc_mp)); } - + while ((p = va_arg(args, void*)) != NULL) { - if ((err = register_cipher(p)) != CRYPT_OK) { + if (register_cipher(p) == -1) { va_end(args); - return err; + return CRYPT_INVALID_CIPHER; } } while ((p = va_arg(args, void*)) != NULL) { - if ((err = register_hash(p)) != CRYPT_OK) { + if (register_hash(p) == -1) { va_end(args); - return err; + return CRYPT_INVALID_HASH; } } while ((p = va_arg(args, void*)) != NULL) { - if ((err = register_prng(p)) != CRYPT_OK) { + if (register_prng(p) == -1) { va_end(args); - return err; + return CRYPT_INVALID_PRNG; } } va_end(args); - return CRYPT_OK; + return CRYPT_OK; } -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/misc/crypt/crypt_hash_descriptor.c b/libtomcrypt/src/misc/crypt/crypt_hash_descriptor.c index a0c3c1a..6e1103f 100644 --- a/libtomcrypt/src/misc/crypt/crypt_hash_descriptor.c +++ b/libtomcrypt/src/misc/crypt/crypt_hash_descriptor.c @@ -5,14 +5,12 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" /** @file crypt_hash_descriptor.c - Stores the hash descriptor table, Tom St Denis + Stores the hash descriptor table, Tom St Denis */ struct ltc_hash_descriptor hash_descriptor[TAB_SIZE] = { @@ -22,6 +20,6 @@ struct ltc_hash_descriptor hash_descriptor[TAB_SIZE] = { LTC_MUTEX_GLOBAL(ltc_hash_mutex) -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/misc/crypt/crypt_hash_is_valid.c b/libtomcrypt/src/misc/crypt/crypt_hash_is_valid.c index 011f829..ca75f05 100644 --- a/libtomcrypt/src/misc/crypt/crypt_hash_is_valid.c +++ b/libtomcrypt/src/misc/crypt/crypt_hash_is_valid.c @@ -5,15 +5,13 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" /** @file crypt_hash_is_valid.c Determine if hash is valid, Tom St Denis -*/ +*/ /* Test if a hash index is valid @@ -31,6 +29,6 @@ int hash_is_valid(int idx) return CRYPT_OK; } -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/misc/crypt/crypt_inits.c b/libtomcrypt/src/misc/crypt/crypt_inits.c new file mode 100644 index 0000000..8042f38 --- /dev/null +++ b/libtomcrypt/src/misc/crypt/crypt_inits.c @@ -0,0 +1,43 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + */ +#include "tomcrypt.h" + +/** + @file crypt_inits.c + + Provide math library functions for dynamic languages + like Python - Larry Bugbee, February 2013 +*/ + + +#ifdef LTM_DESC +void init_LTM(void) +{ + ltc_mp = ltm_desc; +} +#endif + +#ifdef TFM_DESC +void init_TFM(void) +{ + ltc_mp = tfm_desc; +} +#endif + +#ifdef GMP_DESC +void init_GMP(void) +{ + ltc_mp = gmp_desc; +} +#endif + + +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/misc/crypt/crypt_ltc_mp_descriptor.c b/libtomcrypt/src/misc/crypt/crypt_ltc_mp_descriptor.c index 8e565d2..0f1407c 100644 --- a/libtomcrypt/src/misc/crypt/crypt_ltc_mp_descriptor.c +++ b/libtomcrypt/src/misc/crypt/crypt_ltc_mp_descriptor.c @@ -5,9 +5,12 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" -ltc_math_descriptor ltc_mp = {0}; +/* Initialize ltc_mp to nulls, to force allocation on all platforms, including macOS. */ +ltc_math_descriptor ltc_mp = { 0 }; + +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/misc/crypt/crypt_prng_descriptor.c b/libtomcrypt/src/misc/crypt/crypt_prng_descriptor.c index 3af9df5..276047c 100644 --- a/libtomcrypt/src/misc/crypt/crypt_prng_descriptor.c +++ b/libtomcrypt/src/misc/crypt/crypt_prng_descriptor.c @@ -5,15 +5,13 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" /** @file crypt_prng_descriptor.c Stores the PRNG descriptors, Tom St Denis -*/ +*/ struct ltc_prng_descriptor prng_descriptor[TAB_SIZE] = { { NULL, 0, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL } }; @@ -21,6 +19,6 @@ struct ltc_prng_descriptor prng_descriptor[TAB_SIZE] = { LTC_MUTEX_GLOBAL(ltc_prng_mutex) -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/misc/crypt/crypt_prng_is_valid.c b/libtomcrypt/src/misc/crypt/crypt_prng_is_valid.c index ccc6e04..9930a06 100644 --- a/libtomcrypt/src/misc/crypt/crypt_prng_is_valid.c +++ b/libtomcrypt/src/misc/crypt/crypt_prng_is_valid.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" @@ -31,6 +29,6 @@ int prng_is_valid(int idx) return CRYPT_OK; } -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/misc/crypt/crypt_prng_rng_descriptor.c b/libtomcrypt/src/misc/crypt/crypt_prng_rng_descriptor.c new file mode 100644 index 0000000..1a79337 --- /dev/null +++ b/libtomcrypt/src/misc/crypt/crypt_prng_rng_descriptor.c @@ -0,0 +1,17 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + */ +#include "tomcrypt.h" + +#ifdef LTC_PRNG_ENABLE_LTC_RNG +unsigned long (*ltc_rng)(unsigned char *out, unsigned long outlen, void (*callback)(void)); +#endif + +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/misc/crypt/crypt_register_all_ciphers.c b/libtomcrypt/src/misc/crypt/crypt_register_all_ciphers.c new file mode 100644 index 0000000..3250a93 --- /dev/null +++ b/libtomcrypt/src/misc/crypt/crypt_register_all_ciphers.c @@ -0,0 +1,100 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + */ + +#include "tomcrypt.h" + +/** + @file crypt_register_all_ciphers.c + + Steffen Jaeckel +*/ + +#define REGISTER_CIPHER(h) do {\ + LTC_ARGCHK(register_cipher(h) != -1); \ +} while(0) + +int register_all_ciphers(void) +{ +#ifdef LTC_RIJNDAEL +#ifdef ENCRYPT_ONLY + /* alternative would be + * register_cipher(&rijndael_enc_desc); + */ + REGISTER_CIPHER(&aes_enc_desc); +#else + /* alternative would be + * register_cipher(&rijndael_desc); + */ + REGISTER_CIPHER(&aes_desc); +#endif +#endif +#ifdef LTC_BLOWFISH + REGISTER_CIPHER(&blowfish_desc); +#endif +#ifdef LTC_XTEA + REGISTER_CIPHER(&xtea_desc); +#endif +#ifdef LTC_RC5 + REGISTER_CIPHER(&rc5_desc); +#endif +#ifdef LTC_RC6 + REGISTER_CIPHER(&rc6_desc); +#endif +#ifdef LTC_SAFERP + REGISTER_CIPHER(&saferp_desc); +#endif +#ifdef LTC_TWOFISH + REGISTER_CIPHER(&twofish_desc); +#endif +#ifdef LTC_SAFER + REGISTER_CIPHER(&safer_k64_desc); + REGISTER_CIPHER(&safer_sk64_desc); + REGISTER_CIPHER(&safer_k128_desc); + REGISTER_CIPHER(&safer_sk128_desc); +#endif +#ifdef LTC_RC2 + REGISTER_CIPHER(&rc2_desc); +#endif +#ifdef LTC_DES + REGISTER_CIPHER(&des_desc); + REGISTER_CIPHER(&des3_desc); +#endif +#ifdef LTC_CAST5 + REGISTER_CIPHER(&cast5_desc); +#endif +#ifdef LTC_NOEKEON + REGISTER_CIPHER(&noekeon_desc); +#endif +#ifdef LTC_SKIPJACK + REGISTER_CIPHER(&skipjack_desc); +#endif +#ifdef LTC_ANUBIS + REGISTER_CIPHER(&anubis_desc); +#endif +#ifdef LTC_KHAZAD + REGISTER_CIPHER(&khazad_desc); +#endif +#ifdef LTC_KSEED + REGISTER_CIPHER(&kseed_desc); +#endif +#ifdef LTC_KASUMI + REGISTER_CIPHER(&kasumi_desc); +#endif +#ifdef LTC_MULTI2 + REGISTER_CIPHER(&multi2_desc); +#endif +#ifdef LTC_CAMELLIA + REGISTER_CIPHER(&camellia_desc); +#endif + return CRYPT_OK; +} + +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/misc/crypt/crypt_register_all_hashes.c b/libtomcrypt/src/misc/crypt/crypt_register_all_hashes.c new file mode 100644 index 0000000..b529389 --- /dev/null +++ b/libtomcrypt/src/misc/crypt/crypt_register_all_hashes.c @@ -0,0 +1,99 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + */ + +#include "tomcrypt.h" + +/** + @file crypt_register_all_hashes.c + + Steffen Jaeckel +*/ + +#define REGISTER_HASH(h) do {\ + LTC_ARGCHK(register_hash(h) != -1); \ +} while(0) + +int register_all_hashes(void) +{ +#ifdef LTC_TIGER + REGISTER_HASH(&tiger_desc); +#endif +#ifdef LTC_MD2 + REGISTER_HASH(&md2_desc); +#endif +#ifdef LTC_MD4 + REGISTER_HASH(&md4_desc); +#endif +#ifdef LTC_MD5 + REGISTER_HASH(&md5_desc); +#endif +#ifdef LTC_SHA1 + REGISTER_HASH(&sha1_desc); +#endif +#ifdef LTC_SHA224 + REGISTER_HASH(&sha224_desc); +#endif +#ifdef LTC_SHA256 + REGISTER_HASH(&sha256_desc); +#endif +#ifdef LTC_SHA384 + REGISTER_HASH(&sha384_desc); +#endif +#ifdef LTC_SHA512 + REGISTER_HASH(&sha512_desc); +#endif +#ifdef LTC_SHA512_224 + REGISTER_HASH(&sha512_224_desc); +#endif +#ifdef LTC_SHA512_256 + REGISTER_HASH(&sha512_256_desc); +#endif +#ifdef LTC_SHA3 + REGISTER_HASH(&sha3_224_desc); + REGISTER_HASH(&sha3_256_desc); + REGISTER_HASH(&sha3_384_desc); + REGISTER_HASH(&sha3_512_desc); +#endif +#ifdef LTC_RIPEMD128 + REGISTER_HASH(&rmd128_desc); +#endif +#ifdef LTC_RIPEMD160 + REGISTER_HASH(&rmd160_desc); +#endif +#ifdef LTC_RIPEMD256 + REGISTER_HASH(&rmd256_desc); +#endif +#ifdef LTC_RIPEMD320 + REGISTER_HASH(&rmd320_desc); +#endif +#ifdef LTC_WHIRLPOOL + REGISTER_HASH(&whirlpool_desc); +#endif +#ifdef LTC_BLAKE2S + REGISTER_HASH(&blake2s_128_desc); + REGISTER_HASH(&blake2s_160_desc); + REGISTER_HASH(&blake2s_224_desc); + REGISTER_HASH(&blake2s_256_desc); +#endif +#ifdef LTC_BLAKE2S + REGISTER_HASH(&blake2b_160_desc); + REGISTER_HASH(&blake2b_256_desc); + REGISTER_HASH(&blake2b_384_desc); + REGISTER_HASH(&blake2b_512_desc); +#endif +#ifdef LTC_CHC_HASH + REGISTER_HASH(&chc_desc); + LTC_ARGCHK(chc_register(find_cipher_any("aes", 8, 16)) == CRYPT_OK); +#endif + return CRYPT_OK; +} + +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/misc/crypt/crypt_register_all_prngs.c b/libtomcrypt/src/misc/crypt/crypt_register_all_prngs.c new file mode 100644 index 0000000..aca8a36 --- /dev/null +++ b/libtomcrypt/src/misc/crypt/crypt_register_all_prngs.c @@ -0,0 +1,48 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + */ + +#include "tomcrypt.h" + +/** + @file crypt_register_all_prngs.c + + Steffen Jaeckel +*/ + +#define REGISTER_PRNG(h) do {\ + LTC_ARGCHK(register_prng(h) != -1); \ +} while(0) + +int register_all_prngs(void) +{ +#ifdef LTC_YARROW + REGISTER_PRNG(&yarrow_desc); +#endif +#ifdef LTC_FORTUNA + REGISTER_PRNG(&fortuna_desc); +#endif +#ifdef LTC_RC4 + REGISTER_PRNG(&rc4_desc); +#endif +#ifdef LTC_CHACHA20_PRNG + REGISTER_PRNG(&chacha20_prng_desc); +#endif +#ifdef LTC_SOBER128 + REGISTER_PRNG(&sober128_desc); +#endif +#ifdef LTC_SPRNG + REGISTER_PRNG(&sprng_desc); +#endif + + return CRYPT_OK; +} + +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/misc/crypt/crypt_register_cipher.c b/libtomcrypt/src/misc/crypt/crypt_register_cipher.c index d7feedf..85178d2 100644 --- a/libtomcrypt/src/misc/crypt/crypt_register_cipher.c +++ b/libtomcrypt/src/misc/crypt/crypt_register_cipher.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" @@ -49,6 +47,6 @@ int register_cipher(const struct ltc_cipher_descriptor *cipher) return -1; } -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/misc/crypt/crypt_register_hash.c b/libtomcrypt/src/misc/crypt/crypt_register_hash.c index 10ccee4..fc7f4e0 100644 --- a/libtomcrypt/src/misc/crypt/crypt_register_hash.c +++ b/libtomcrypt/src/misc/crypt/crypt_register_hash.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" @@ -49,6 +47,6 @@ int register_hash(const struct ltc_hash_descriptor *hash) return -1; } -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/misc/crypt/crypt_register_prng.c b/libtomcrypt/src/misc/crypt/crypt_register_prng.c index 1724df0..9cbd634 100644 --- a/libtomcrypt/src/misc/crypt/crypt_register_prng.c +++ b/libtomcrypt/src/misc/crypt/crypt_register_prng.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" @@ -14,7 +12,7 @@ @file crypt_register_prng.c Register a PRNG, Tom St Denis */ - + /** Register a PRNG with the descriptor table @param prng The PRNG you wish to register @@ -49,6 +47,6 @@ int register_prng(const struct ltc_prng_descriptor *prng) return -1; } -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/misc/crypt/crypt_sizes.c b/libtomcrypt/src/misc/crypt/crypt_sizes.c new file mode 100644 index 0000000..79b3bd4 --- /dev/null +++ b/libtomcrypt/src/misc/crypt/crypt_sizes.c @@ -0,0 +1,356 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + */ +#include "tomcrypt.h" + +/** + @file crypt_sizes.c + + Make various struct sizes available to dynamic languages + like Python - Larry Bugbee, February 2013 + + LB - Dec 2013 - revised to include compiler define options +*/ + + +typedef struct { + const char *name; + const unsigned int size; +} crypt_size; + +#define _SZ_STRINGIFY_S(s) { #s, sizeof(struct s) } +#define _SZ_STRINGIFY_T(s) { #s, sizeof(s) } + +static const crypt_size _crypt_sizes[] = { + /* hash state sizes */ + _SZ_STRINGIFY_S(ltc_hash_descriptor), + _SZ_STRINGIFY_T(hash_state), +#ifdef LTC_CHC_HASH + _SZ_STRINGIFY_S(chc_state), +#endif +#ifdef LTC_WHIRLPOOL + _SZ_STRINGIFY_S(whirlpool_state), +#endif +#ifdef LTC_SHA3 + _SZ_STRINGIFY_S(sha3_state), +#endif +#ifdef LTC_SHA512 + _SZ_STRINGIFY_S(sha512_state), +#endif +#ifdef LTC_SHA256 + _SZ_STRINGIFY_S(sha256_state), +#endif +#ifdef LTC_SHA1 + _SZ_STRINGIFY_S(sha1_state), +#endif +#ifdef LTC_MD5 + _SZ_STRINGIFY_S(md5_state), +#endif +#ifdef LTC_MD4 + _SZ_STRINGIFY_S(md4_state), +#endif +#ifdef LTC_MD2 + _SZ_STRINGIFY_S(md2_state), +#endif +#ifdef LTC_TIGER + _SZ_STRINGIFY_S(tiger_state), +#endif +#ifdef LTC_RIPEMD128 + _SZ_STRINGIFY_S(rmd128_state), +#endif +#ifdef LTC_RIPEMD160 + _SZ_STRINGIFY_S(rmd160_state), +#endif +#ifdef LTC_RIPEMD256 + _SZ_STRINGIFY_S(rmd256_state), +#endif +#ifdef LTC_RIPEMD320 + _SZ_STRINGIFY_S(rmd320_state), +#endif +#ifdef LTC_BLAKE2S + _SZ_STRINGIFY_S(blake2s_state), +#endif +#ifdef LTC_BLAKE2B + _SZ_STRINGIFY_S(blake2b_state), +#endif + + /* block cipher key sizes */ + _SZ_STRINGIFY_S(ltc_cipher_descriptor), + _SZ_STRINGIFY_T(symmetric_key), +#ifdef LTC_ANUBIS + _SZ_STRINGIFY_S(anubis_key), +#endif +#ifdef LTC_CAMELLIA + _SZ_STRINGIFY_S(camellia_key), +#endif +#ifdef LTC_BLOWFISH + _SZ_STRINGIFY_S(blowfish_key), +#endif +#ifdef LTC_CAST5 + _SZ_STRINGIFY_S(cast5_key), +#endif +#ifdef LTC_DES + _SZ_STRINGIFY_S(des_key), + _SZ_STRINGIFY_S(des3_key), +#endif +#ifdef LTC_KASUMI + _SZ_STRINGIFY_S(kasumi_key), +#endif +#ifdef LTC_KHAZAD + _SZ_STRINGIFY_S(khazad_key), +#endif +#ifdef LTC_KSEED + _SZ_STRINGIFY_S(kseed_key), +#endif +#ifdef LTC_MULTI2 + _SZ_STRINGIFY_S(multi2_key), +#endif +#ifdef LTC_NOEKEON + _SZ_STRINGIFY_S(noekeon_key), +#endif +#ifdef LTC_RC2 + _SZ_STRINGIFY_S(rc2_key), +#endif +#ifdef LTC_RC5 + _SZ_STRINGIFY_S(rc5_key), +#endif +#ifdef LTC_RC6 + _SZ_STRINGIFY_S(rc6_key), +#endif +#ifdef LTC_SKIPJACK + _SZ_STRINGIFY_S(skipjack_key), +#endif +#ifdef LTC_XTEA + _SZ_STRINGIFY_S(xtea_key), +#endif +#ifdef LTC_RIJNDAEL + _SZ_STRINGIFY_S(rijndael_key), +#endif +#ifdef LTC_SAFER + _SZ_STRINGIFY_S(safer_key), +#endif +#ifdef LTC_SAFERP + _SZ_STRINGIFY_S(saferp_key), +#endif +#ifdef LTC_TWOFISH + _SZ_STRINGIFY_S(twofish_key), +#endif + + /* mode sizes */ +#ifdef LTC_ECB_MODE + _SZ_STRINGIFY_T(symmetric_ECB), +#endif +#ifdef LTC_CFB_MODE + _SZ_STRINGIFY_T(symmetric_CFB), +#endif +#ifdef LTC_OFB_MODE + _SZ_STRINGIFY_T(symmetric_OFB), +#endif +#ifdef LTC_CBC_MODE + _SZ_STRINGIFY_T(symmetric_CBC), +#endif +#ifdef LTC_CTR_MODE + _SZ_STRINGIFY_T(symmetric_CTR), +#endif +#ifdef LTC_LRW_MODE + _SZ_STRINGIFY_T(symmetric_LRW), +#endif +#ifdef LTC_F8_MODE + _SZ_STRINGIFY_T(symmetric_F8), +#endif +#ifdef LTC_XTS_MODE + _SZ_STRINGIFY_T(symmetric_xts), +#endif + + /* stream cipher sizes */ +#ifdef LTC_CHACHA + _SZ_STRINGIFY_T(chacha_state), +#endif +#ifdef LTC_RC4_STREAM + _SZ_STRINGIFY_T(rc4_state), +#endif +#ifdef LTC_SOBER128_STREAM + _SZ_STRINGIFY_T(sober128_state), +#endif + + /* MAC sizes -- no states for ccm, lrw */ +#ifdef LTC_HMAC + _SZ_STRINGIFY_T(hmac_state), +#endif +#ifdef LTC_OMAC + _SZ_STRINGIFY_T(omac_state), +#endif +#ifdef LTC_PMAC + _SZ_STRINGIFY_T(pmac_state), +#endif +#ifdef LTC_POLY1305 + _SZ_STRINGIFY_T(poly1305_state), +#endif +#ifdef LTC_EAX_MODE + _SZ_STRINGIFY_T(eax_state), +#endif +#ifdef LTC_OCB_MODE + _SZ_STRINGIFY_T(ocb_state), +#endif +#ifdef LTC_OCB3_MODE + _SZ_STRINGIFY_T(ocb3_state), +#endif +#ifdef LTC_CCM_MODE + _SZ_STRINGIFY_T(ccm_state), +#endif +#ifdef LTC_GCM_MODE + _SZ_STRINGIFY_T(gcm_state), +#endif +#ifdef LTC_PELICAN + _SZ_STRINGIFY_T(pelican_state), +#endif +#ifdef LTC_XCBC + _SZ_STRINGIFY_T(xcbc_state), +#endif +#ifdef LTC_F9_MODE + _SZ_STRINGIFY_T(f9_state), +#endif +#ifdef LTC_CHACHA20POLY1305_MODE + _SZ_STRINGIFY_T(chacha20poly1305_state), +#endif + + /* asymmetric keys */ +#ifdef LTC_MRSA + _SZ_STRINGIFY_T(rsa_key), +#endif +#ifdef LTC_MDSA + _SZ_STRINGIFY_T(dsa_key), +#endif +#ifdef LTC_MDH + _SZ_STRINGIFY_T(dh_key), +#endif +#ifdef LTC_MECC + _SZ_STRINGIFY_T(ltc_ecc_set_type), + _SZ_STRINGIFY_T(ecc_point), + _SZ_STRINGIFY_T(ecc_key), +#endif +#ifdef LTC_MKAT + _SZ_STRINGIFY_T(katja_key), +#endif + + /* DER handling */ +#ifdef LTC_DER + _SZ_STRINGIFY_T(ltc_asn1_list), /* a list entry */ + _SZ_STRINGIFY_T(ltc_utctime), + _SZ_STRINGIFY_T(ltc_generalizedtime), +#endif + + /* prng state sizes */ + _SZ_STRINGIFY_S(ltc_prng_descriptor), + _SZ_STRINGIFY_T(prng_state), +#ifdef LTC_FORTUNA + _SZ_STRINGIFY_S(fortuna_prng), +#endif +#ifdef LTC_CHACHA20_PRNG + _SZ_STRINGIFY_S(chacha20_prng), +#endif +#ifdef LTC_RC4 + _SZ_STRINGIFY_S(rc4_prng), +#endif +#ifdef LTC_SOBER128 + _SZ_STRINGIFY_S(sober128_prng), +#endif +#ifdef LTC_YARROW + _SZ_STRINGIFY_S(yarrow_prng), +#endif + /* sprng has no state as it uses other potentially available sources */ + /* like /dev/random. See Developers Guide for more info. */ + +#ifdef LTC_ADLER32 + _SZ_STRINGIFY_T(adler32_state), +#endif +#ifdef LTC_CRC32 + _SZ_STRINGIFY_T(crc32_state), +#endif + + _SZ_STRINGIFY_T(ltc_mp_digit), + _SZ_STRINGIFY_T(ltc_math_descriptor) + +}; + +/* crypt_get_size() + * sizeout will be the size (bytes) of the named struct or union + * return -1 if named item not found + */ +int crypt_get_size(const char* namein, unsigned int *sizeout) { + int i; + int count = sizeof(_crypt_sizes) / sizeof(_crypt_sizes[0]); + for (i=0; i<count; i++) { + if (XSTRCMP(_crypt_sizes[i].name, namein) == 0) { + *sizeout = _crypt_sizes[i].size; + return 0; + } + } + return -1; +} + +/* crypt_list_all_sizes() + * if names_list is NULL, names_list_size will be the minimum + * size needed to receive the complete names_list + * if names_list is NOT NULL, names_list must be the addr with + * sufficient memory allocated into which the names_list + * is to be written. Also, the value in names_list_size + * sets the upper bound of the number of characters to be + * written. + * a -1 return value signifies insufficient space made available + */ +int crypt_list_all_sizes(char *names_list, unsigned int *names_list_size) { + int i; + unsigned int total_len = 0; + char number[32], *ptr; + int number_len; + int count = sizeof(_crypt_sizes) / sizeof(_crypt_sizes[0]); + + /* calculate amount of memory required for the list */ + for (i=0; i<count; i++) { + total_len += (unsigned int)strlen(_crypt_sizes[i].name) + 1; + /* the above +1 is for the commas */ + number_len = snprintf(number, sizeof(number), "%u", _crypt_sizes[i].size); + if ((number_len < 0) || + ((unsigned int)number_len >= sizeof(number))) + return -1; + total_len += (unsigned int)strlen(number) + 1; + /* this last +1 is for newlines (and ending NULL) */ + } + + if (names_list == NULL) { + *names_list_size = total_len; + } else { + if (total_len > *names_list_size) { + return -1; + } + /* build the names list */ + ptr = names_list; + for (i=0; i<count; i++) { + strcpy(ptr, _crypt_sizes[i].name); + ptr += strlen(_crypt_sizes[i].name); + strcpy(ptr, ","); + ptr += 1; + + number_len = snprintf(number, sizeof(number), "%u", _crypt_sizes[i].size); + strcpy(ptr, number); + ptr += number_len; + strcpy(ptr, "\n"); + ptr += 1; + } + /* to remove the trailing new-line */ + ptr -= 1; + *ptr = 0; + } + return 0; +} + + +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/misc/crypt/crypt_unregister_cipher.c b/libtomcrypt/src/misc/crypt/crypt_unregister_cipher.c index b75785f..b57c736 100644 --- a/libtomcrypt/src/misc/crypt/crypt_unregister_cipher.c +++ b/libtomcrypt/src/misc/crypt/crypt_unregister_cipher.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" @@ -40,6 +38,6 @@ int unregister_cipher(const struct ltc_cipher_descriptor *cipher) return CRYPT_ERROR; } -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/misc/crypt/crypt_unregister_hash.c b/libtomcrypt/src/misc/crypt/crypt_unregister_hash.c index ac95d2d..dbbff33 100644 --- a/libtomcrypt/src/misc/crypt/crypt_unregister_hash.c +++ b/libtomcrypt/src/misc/crypt/crypt_unregister_hash.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" @@ -39,6 +37,6 @@ int unregister_hash(const struct ltc_hash_descriptor *hash) return CRYPT_ERROR; } -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/misc/crypt/crypt_unregister_prng.c b/libtomcrypt/src/misc/crypt/crypt_unregister_prng.c index bb34501..f7606ef 100644 --- a/libtomcrypt/src/misc/crypt/crypt_unregister_prng.c +++ b/libtomcrypt/src/misc/crypt/crypt_unregister_prng.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" @@ -25,11 +23,11 @@ int unregister_prng(const struct ltc_prng_descriptor *prng) int x; LTC_ARGCHK(prng != NULL); - + /* is it already registered? */ LTC_MUTEX_LOCK(<c_prng_mutex); for (x = 0; x < TAB_SIZE; x++) { - if (XMEMCMP(&prng_descriptor[x], prng, sizeof(struct ltc_prng_descriptor)) != 0) { + if (XMEMCMP(&prng_descriptor[x], prng, sizeof(struct ltc_prng_descriptor)) == 0) { prng_descriptor[x].name = NULL; LTC_MUTEX_UNLOCK(<c_prng_mutex); return CRYPT_OK; @@ -39,6 +37,6 @@ int unregister_prng(const struct ltc_prng_descriptor *prng) return CRYPT_ERROR; } -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/misc/error_to_string.c b/libtomcrypt/src/misc/error_to_string.c index 034cd18..707f835 100644 --- a/libtomcrypt/src/misc/error_to_string.c +++ b/libtomcrypt/src/misc/error_to_string.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" @@ -16,13 +14,13 @@ Convert error codes to ASCII strings, Tom St Denis */ -static const char *err_2_str[] = +static const char * const err_2_str[] = { "CRYPT_OK", "CRYPT_ERROR", "Non-fatal 'no-operation' requested.", - "Invalid keysize for block cipher.", + "Invalid key size.", "Invalid number of rounds for block cipher.", "Algorithm failed test vectors.", @@ -45,13 +43,20 @@ static const char *err_2_str[] = "File Not Found", "Invalid PK type.", - "Invalid PK system.", - "Duplicate PK key found on keyring.", - "Key not found in keyring.", + + "An overflow of a value was detected/prevented.", + + "UNUSED1.", + + "The input was longer than expected.", + "Invalid sized parameter.", "Invalid size for prime.", + "Invalid padding.", + + "Hash applied to too many bits.", }; /** @@ -65,10 +70,10 @@ const char *error_to_string(int err) return "Invalid error code."; } else { return err_2_str[err]; - } + } } -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/misc/hkdf/hkdf.c b/libtomcrypt/src/misc/hkdf/hkdf.c new file mode 100644 index 0000000..0db4ed9 --- /dev/null +++ b/libtomcrypt/src/misc/hkdf/hkdf.c @@ -0,0 +1,143 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + */ + +#include <assert.h> +#include <stdio.h> +#include <stdlib.h> + +#include "tomcrypt.h" + +#ifdef LTC_HKDF + +/* This is mostly just a wrapper around hmac_memory */ +int hkdf_extract(int hash_idx, const unsigned char *salt, unsigned long saltlen, + const unsigned char *in, unsigned long inlen, + unsigned char *out, unsigned long *outlen) +{ + /* libtomcrypt chokes on a zero length HMAC key, so we need to check for + that. HMAC specifies that keys shorter than the hash's blocksize are + 0 padded to the block size. HKDF specifies that a NULL salt is to be + substituted with a salt comprised of hashLen 0 bytes. HMAC's padding + means that in either case the HMAC is actually using a blocksize long + zero filled key. Unless blocksize < hashLen (which wouldn't make any + sense), we can use a single 0 byte as the HMAC key and still generate + valid results for HKDF. */ + if (salt == NULL || saltlen == 0) { + return hmac_memory(hash_idx, (const unsigned char *)"", 1, in, inlen, out, outlen); + } else { + return hmac_memory(hash_idx, salt, saltlen, in, inlen, out, outlen); + } +} + +int hkdf_expand(int hash_idx, const unsigned char *info, unsigned long infolen, + const unsigned char *in, unsigned long inlen, + unsigned char *out, unsigned long outlen) +{ + unsigned long hashsize; + int err; + unsigned char N; + unsigned long Noutlen, outoff; + + unsigned char *T, *dat; + unsigned long Tlen, datlen; + + /* make sure hash descriptor is valid */ + if ((err = hash_is_valid(hash_idx)) != CRYPT_OK) { + return err; + } + + hashsize = hash_descriptor[hash_idx].hashsize; + + /* RFC5869 parameter restrictions */ + if (inlen < hashsize || outlen > hashsize * 255) + return CRYPT_INVALID_ARG; + if (info == NULL && infolen != 0) + return CRYPT_INVALID_ARG; + LTC_ARGCHK(out != NULL); + + Tlen = hashsize + infolen + 1; + T = XMALLOC(Tlen); /* Replace with static buffer? */ + if (T == NULL) { + return CRYPT_MEM; + } + if (info != NULL) { + XMEMCPY(T + hashsize, info, infolen); + } + + /* HMAC data T(1) doesn't include a previous hash value */ + dat = T + hashsize; + datlen = Tlen - hashsize; + + N = 0; + outoff = 0; /* offset in out to write to */ + while (1) { /* an exit condition breaks mid-loop */ + Noutlen = MIN(hashsize, outlen - outoff); + T[Tlen - 1] = ++N; + if ((err = hmac_memory(hash_idx, in, inlen, dat, datlen, + out + outoff, &Noutlen)) != CRYPT_OK) { + zeromem(T, Tlen); + XFREE(T); + return err; + } + outoff += Noutlen; + + if (outoff >= outlen) /* loop exit condition */ + break; + + /* All subsequent HMAC data T(N) DOES include the previous hash value */ + XMEMCPY(T, out + hashsize * (N-1), hashsize); + if (N == 1) { + dat = T; + datlen = Tlen; + } + } + zeromem(T, Tlen); + XFREE(T); + return CRYPT_OK; +} + +/* all in one step */ +int hkdf(int hash_idx, const unsigned char *salt, unsigned long saltlen, + const unsigned char *info, unsigned long infolen, + const unsigned char *in, unsigned long inlen, + unsigned char *out, unsigned long outlen) +{ + unsigned long hashsize; + int err; + unsigned char *extracted; + + /* make sure hash descriptor is valid */ + if ((err = hash_is_valid(hash_idx)) != CRYPT_OK) { + return err; + } + + hashsize = hash_descriptor[hash_idx].hashsize; + + extracted = XMALLOC(hashsize); /* replace with static buffer? */ + if (extracted == NULL) { + return CRYPT_MEM; + } + if ((err = hkdf_extract(hash_idx, salt, saltlen, in, inlen, extracted, &hashsize)) != 0) { + zeromem(extracted, hashsize); + XFREE(extracted); + return err; + } + err = hkdf_expand(hash_idx, info, infolen, extracted, hashsize, out, outlen); + zeromem(extracted, hashsize); + XFREE(extracted); + return err; +} +#endif /* LTC_HKDF */ + + +/* vim: set ts=2 sw=2 et ai si: */ + +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/misc/hkdf/hkdf_test.c b/libtomcrypt/src/misc/hkdf/hkdf_test.c new file mode 100644 index 0000000..0c58255 --- /dev/null +++ b/libtomcrypt/src/misc/hkdf/hkdf_test.c @@ -0,0 +1,294 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + */ +#include "tomcrypt.h" + +/** + @file hkdf_test.c + LTC_HKDF support, self-test, Steffen Jaeckel +*/ + +#ifdef LTC_HKDF + +/* + TEST CASES SOURCE: + +Internet Engineering Task Force (IETF) H. Krawczyk +Request for Comments: 5869 IBM Research +Category: Informational P. Eronen +ISSN: 2070-1721 Nokia + May 2010 +Appendix A. Test Vectors +*/ + +/** + LTC_HKDF self-test + @return CRYPT_OK if successful, CRYPT_NOP if tests have been disabled. +*/ +int hkdf_test(void) +{ + #ifndef LTC_TEST + return CRYPT_NOP; + #else + unsigned char OKM[82]; + int i; + + static const struct hkdf_test_case { + int num; + const char* Hash; + unsigned char IKM[80]; + unsigned long IKM_l; + unsigned char salt[80]; + unsigned long salt_l; + unsigned char info[80]; + unsigned long info_l; + unsigned char PRK[32]; + unsigned long PRK_l; + unsigned char OKM[82]; + unsigned long OKM_l; + } cases[] = { +#ifdef LTC_SHA256 + /* + Basic test case with SHA-256 + + Hash = SHA-256 + IKM = 0x0b0b0b0b0b0b0b0b0b0b0b0b0b0b0b0b0b0b0b0b0b0b (22 octets) + salt = 0x000102030405060708090a0b0c (13 octets) + info = 0xf0f1f2f3f4f5f6f7f8f9 (10 octets) + L = 42 + + PRK = 0x077709362c2e32df0ddc3f0dc47bba63 + 90b6c73bb50f9c3122ec844ad7c2b3e5 (32 octets) + OKM = 0x3cb25f25faacd57a90434f64d0362f2a + 2d2d0a90cf1a5a4c5db02d56ecc4c5bf + 34007208d5b887185865 (42 octets) + */ + {1, "sha256", + {0x0b, 0x0b, 0x0b, 0x0b, 0x0b, 0x0b, 0x0b, 0x0b, + 0x0b, 0x0b, 0x0b, 0x0b, 0x0b, 0x0b, 0x0b, 0x0b, + 0x0b, 0x0b, 0x0b, 0x0b, 0x0b, 0x0b}, 22, + {0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07, + 0x08, 0x09, 0x0a, 0x0b, 0x0c}, 13, + {0xf0, 0xf1, 0xf2, 0xf3, 0xf4, 0xf5, 0xf6, 0xf7, + 0xf8, 0xf9}, 10, + {0x07, 0x77, 0x09, 0x36, 0x2c, 0x2e, 0x32, 0xdf, + 0x0d, 0xdc, 0x3f, 0x0d, 0xc4, 0x7b, 0xba, 0x63, + 0x90, 0xb6, 0xc7, 0x3b, 0xb5, 0x0f, 0x9c, 0x31, + 0x22, 0xec, 0x84, 0x4a, 0xd7, 0xc2, 0xb3, 0xe5}, 32, + {0x3c, 0xb2, 0x5f, 0x25, 0xfa, 0xac, 0xd5, 0x7a, + 0x90, 0x43, 0x4f, 0x64, 0xd0, 0x36, 0x2f, 0x2a, + 0x2d, 0x2d, 0x0a, 0x90, 0xcf, 0x1a, 0x5a, 0x4c, + 0x5d, 0xb0, 0x2d, 0x56, 0xec, 0xc4, 0xc5, 0xbf, + 0x34, 0x00, 0x72, 0x08, 0xd5, 0xb8, 0x87, 0x18, + 0x58, 0x65}, 42}, +#ifdef LTC_TEST_EXT + /* Test with SHA-256 and longer inputs/outputs */ + {2, "sha256", + {0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07, + 0x08, 0x09, 0x0a, 0x0b, 0x0c, 0x0d, 0x0e, 0x0f, + 0x10, 0x11, 0x12, 0x13, 0x14, 0x15, 0x16, 0x17, + 0x18, 0x19, 0x1a, 0x1b, 0x1c, 0x1d, 0x1e, 0x1f, + 0x20, 0x21, 0x22, 0x23, 0x24, 0x25, 0x26, 0x27, + 0x28, 0x29, 0x2a, 0x2b, 0x2c, 0x2d, 0x2e, 0x2f, + 0x30, 0x31, 0x32, 0x33, 0x34, 0x35, 0x36, 0x37, + 0x38, 0x39, 0x3a, 0x3b, 0x3c, 0x3d, 0x3e, 0x3f, + 0x40, 0x41, 0x42, 0x43, 0x44, 0x45, 0x46, 0x47, + 0x48, 0x49, 0x4a, 0x4b, 0x4c, 0x4d, 0x4e, 0x4f}, 80, + {0x60, 0x61, 0x62, 0x63, 0x64, 0x65, 0x66, 0x67, + 0x68, 0x69, 0x6a, 0x6b, 0x6c, 0x6d, 0x6e, 0x6f, + 0x70, 0x71, 0x72, 0x73, 0x74, 0x75, 0x76, 0x77, + 0x78, 0x79, 0x7a, 0x7b, 0x7c, 0x7d, 0x7e, 0x7f, + 0x80, 0x81, 0x82, 0x83, 0x84, 0x85, 0x86, 0x87, + 0x88, 0x89, 0x8a, 0x8b, 0x8c, 0x8d, 0x8e, 0x8f, + 0x90, 0x91, 0x92, 0x93, 0x94, 0x95, 0x96, 0x97, + 0x98, 0x99, 0x9a, 0x9b, 0x9c, 0x9d, 0x9e, 0x9f, + 0xa0, 0xa1, 0xa2, 0xa3, 0xa4, 0xa5, 0xa6, 0xa7, + 0xa8, 0xa9, 0xaa, 0xab, 0xac, 0xad, 0xae, 0xaf}, 80, + {0xb0, 0xb1, 0xb2, 0xb3, 0xb4, 0xb5, 0xb6, 0xb7, + 0xb8, 0xb9, 0xba, 0xbb, 0xbc, 0xbd, 0xbe, 0xbf, + 0xc0, 0xc1, 0xc2, 0xc3, 0xc4, 0xc5, 0xc6, 0xc7, + 0xc8, 0xc9, 0xca, 0xcb, 0xcc, 0xcd, 0xce, 0xcf, + 0xd0, 0xd1, 0xd2, 0xd3, 0xd4, 0xd5, 0xd6, 0xd7, + 0xd8, 0xd9, 0xda, 0xdb, 0xdc, 0xdd, 0xde, 0xdf, + 0xe0, 0xe1, 0xe2, 0xe3, 0xe4, 0xe5, 0xe6, 0xe7, + 0xe8, 0xe9, 0xea, 0xeb, 0xec, 0xed, 0xee, 0xef, + 0xf0, 0xf1, 0xf2, 0xf3, 0xf4, 0xf5, 0xf6, 0xf7, + 0xf8, 0xf9, 0xfa, 0xfb, 0xfc, 0xfd, 0xfe, 0xff}, 80, + {0x06, 0xa6, 0xb8, 0x8c, 0x58, 0x53, 0x36, 0x1a, + 0x06, 0x10, 0x4c, 0x9c, 0xeb, 0x35, 0xb4, 0x5c, + 0xef, 0x76, 0x00, 0x14, 0x90, 0x46, 0x71, 0x01, + 0x4a, 0x19, 0x3f, 0x40, 0xc1, 0x5f, 0xc2, 0x44}, 32, + {0xb1, 0x1e, 0x39, 0x8d, 0xc8, 0x03, 0x27, 0xa1, + 0xc8, 0xe7, 0xf7, 0x8c, 0x59, 0x6a, 0x49, 0x34, + 0x4f, 0x01, 0x2e, 0xda, 0x2d, 0x4e, 0xfa, 0xd8, + 0xa0, 0x50, 0xcc, 0x4c, 0x19, 0xaf, 0xa9, 0x7c, + 0x59, 0x04, 0x5a, 0x99, 0xca, 0xc7, 0x82, 0x72, + 0x71, 0xcb, 0x41, 0xc6, 0x5e, 0x59, 0x0e, 0x09, + 0xda, 0x32, 0x75, 0x60, 0x0c, 0x2f, 0x09, 0xb8, + 0x36, 0x77, 0x93, 0xa9, 0xac, 0xa3, 0xdb, 0x71, + 0xcc, 0x30, 0xc5, 0x81, 0x79, 0xec, 0x3e, 0x87, + 0xc1, 0x4c, 0x01, 0xd5, 0xc1, 0xf3, 0x43, 0x4f, + 0x1d, 0x87}, 82}, + /* Test with SHA-256 and zero length salt/info */ + {3, "sha256", + {0x0b, 0x0b, 0x0b, 0x0b, 0x0b, 0x0b, 0x0b, 0x0b, + 0x0b, 0x0b, 0x0b, 0x0b, 0x0b, 0x0b, 0x0b, 0x0b, + 0x0b, 0x0b, 0x0b, 0x0b, 0x0b, 0x0b}, 22, + {0}, 0, + {0}, 0, + {0x19, 0xef, 0x24, 0xa3, 0x2c, 0x71, 0x7b, 0x16, + 0x7f, 0x33, 0xa9, 0x1d, 0x6f, 0x64, 0x8b, 0xdf, + 0x96, 0x59, 0x67, 0x76, 0xaf, 0xdb, 0x63, 0x77, + 0xac, 0x43, 0x4c, 0x1c, 0x29, 0x3c, 0xcb, 0x04}, 32, + {0x8d, 0xa4, 0xe7, 0x75, 0xa5, 0x63, 0xc1, 0x8f, + 0x71, 0x5f, 0x80, 0x2a, 0x06, 0x3c, 0x5a, 0x31, + 0xb8, 0xa1, 0x1f, 0x5c, 0x5e, 0xe1, 0x87, 0x9e, + 0xc3, 0x45, 0x4e, 0x5f, 0x3c, 0x73, 0x8d, 0x2d, + 0x9d, 0x20, 0x13, 0x95, 0xfa, 0xa4, 0xb6, 0x1a, + 0x96, 0xc8}, 42}, +#endif /* LTC_TEST_EXT */ +#endif /* LTC_SHA256 */ +#ifdef LTC_SHA1 + /* Basic test case with SHA-1 */ + {4, "sha1", + {0x0b, 0x0b, 0x0b, 0x0b, 0x0b, 0x0b, 0x0b, 0x0b, + 0x0b, 0x0b, 0x0b}, 11, + {0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07, + 0x08, 0x09, 0x0a, 0x0b, 0x0c}, 13, + {0xf0, 0xf1, 0xf2, 0xf3, 0xf4, 0xf5, 0xf6, 0xf7, + 0xf8, 0xf9}, 10, + {0x9b, 0x6c, 0x18, 0xc4, 0x32, 0xa7, 0xbf, 0x8f, + 0x0e, 0x71, 0xc8, 0xeb, 0x88, 0xf4, 0xb3, 0x0b, + 0xaa, 0x2b, 0xa2, 0x43}, 20, + {0x08, 0x5a, 0x01, 0xea, 0x1b, 0x10, 0xf3, 0x69, + 0x33, 0x06, 0x8b, 0x56, 0xef, 0xa5, 0xad, 0x81, + 0xa4, 0xf1, 0x4b, 0x82, 0x2f, 0x5b, 0x09, 0x15, + 0x68, 0xa9, 0xcd, 0xd4, 0xf1, 0x55, 0xfd, 0xa2, + 0xc2, 0x2e, 0x42, 0x24, 0x78, 0xd3, 0x05, 0xf3, + 0xf8, 0x96}, 42}, +#ifdef LTC_TEST_EXT + /* Test with SHA-1 and longer inputs/outputs */ + {5, "sha1", + {0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07, + 0x08, 0x09, 0x0a, 0x0b, 0x0c, 0x0d, 0x0e, 0x0f, + 0x10, 0x11, 0x12, 0x13, 0x14, 0x15, 0x16, 0x17, + 0x18, 0x19, 0x1a, 0x1b, 0x1c, 0x1d, 0x1e, 0x1f, + 0x20, 0x21, 0x22, 0x23, 0x24, 0x25, 0x26, 0x27, + 0x28, 0x29, 0x2a, 0x2b, 0x2c, 0x2d, 0x2e, 0x2f, + 0x30, 0x31, 0x32, 0x33, 0x34, 0x35, 0x36, 0x37, + 0x38, 0x39, 0x3a, 0x3b, 0x3c, 0x3d, 0x3e, 0x3f, + 0x40, 0x41, 0x42, 0x43, 0x44, 0x45, 0x46, 0x47, + 0x48, 0x49, 0x4a, 0x4b, 0x4c, 0x4d, 0x4e, 0x4f}, 80, + {0x60, 0x61, 0x62, 0x63, 0x64, 0x65, 0x66, 0x67, + 0x68, 0x69, 0x6a, 0x6b, 0x6c, 0x6d, 0x6e, 0x6f, + 0x70, 0x71, 0x72, 0x73, 0x74, 0x75, 0x76, 0x77, + 0x78, 0x79, 0x7a, 0x7b, 0x7c, 0x7d, 0x7e, 0x7f, + 0x80, 0x81, 0x82, 0x83, 0x84, 0x85, 0x86, 0x87, + 0x88, 0x89, 0x8a, 0x8b, 0x8c, 0x8d, 0x8e, 0x8f, + 0x90, 0x91, 0x92, 0x93, 0x94, 0x95, 0x96, 0x97, + 0x98, 0x99, 0x9a, 0x9b, 0x9c, 0x9d, 0x9e, 0x9f, + 0xa0, 0xa1, 0xa2, 0xa3, 0xa4, 0xa5, 0xa6, 0xa7, + 0xa8, 0xa9, 0xaa, 0xab, 0xac, 0xad, 0xae, 0xaf}, 80, + {0xb0, 0xb1, 0xb2, 0xb3, 0xb4, 0xb5, 0xb6, 0xb7, + 0xb8, 0xb9, 0xba, 0xbb, 0xbc, 0xbd, 0xbe, 0xbf, + 0xc0, 0xc1, 0xc2, 0xc3, 0xc4, 0xc5, 0xc6, 0xc7, + 0xc8, 0xc9, 0xca, 0xcb, 0xcc, 0xcd, 0xce, 0xcf, + 0xd0, 0xd1, 0xd2, 0xd3, 0xd4, 0xd5, 0xd6, 0xd7, + 0xd8, 0xd9, 0xda, 0xdb, 0xdc, 0xdd, 0xde, 0xdf, + 0xe0, 0xe1, 0xe2, 0xe3, 0xe4, 0xe5, 0xe6, 0xe7, + 0xe8, 0xe9, 0xea, 0xeb, 0xec, 0xed, 0xee, 0xef, + 0xf0, 0xf1, 0xf2, 0xf3, 0xf4, 0xf5, 0xf6, 0xf7, + 0xf8, 0xf9, 0xfa, 0xfb, 0xfc, 0xfd, 0xfe, 0xff}, 80, + {0x8a, 0xda, 0xe0, 0x9a, 0x2a, 0x30, 0x70, 0x59, + 0x47, 0x8d, 0x30, 0x9b, 0x26, 0xc4, 0x11, 0x5a, + 0x22, 0x4c, 0xfa, 0xf6}, 20, + {0x0b, 0xd7, 0x70, 0xa7, 0x4d, 0x11, 0x60, 0xf7, + 0xc9, 0xf1, 0x2c, 0xd5, 0x91, 0x2a, 0x06, 0xeb, + 0xff, 0x6a, 0xdc, 0xae, 0x89, 0x9d, 0x92, 0x19, + 0x1f, 0xe4, 0x30, 0x56, 0x73, 0xba, 0x2f, 0xfe, + 0x8f, 0xa3, 0xf1, 0xa4, 0xe5, 0xad, 0x79, 0xf3, + 0xf3, 0x34, 0xb3, 0xb2, 0x02, 0xb2, 0x17, 0x3c, + 0x48, 0x6e, 0xa3, 0x7c, 0xe3, 0xd3, 0x97, 0xed, + 0x03, 0x4c, 0x7f, 0x9d, 0xfe, 0xb1, 0x5c, 0x5e, + 0x92, 0x73, 0x36, 0xd0, 0x44, 0x1f, 0x4c, 0x43, + 0x00, 0xe2, 0xcf, 0xf0, 0xd0, 0x90, 0x0b, 0x52, + 0xd3, 0xb4}, 82}, + /* Test with SHA-1 and zero-length salt/info */ + {6, "sha1", + {0x0b, 0x0b, 0x0b, 0x0b, 0x0b, 0x0b, 0x0b, 0x0b, + 0x0b, 0x0b, 0x0b, 0x0b, 0x0b, 0x0b, 0x0b, 0x0b, + 0x0b, 0x0b, 0x0b, 0x0b, 0x0b, 0x0b}, 22, + {0}, 0, + {0}, 0, + {0xda, 0x8c, 0x8a, 0x73, 0xc7, 0xfa, 0x77, 0x28, + 0x8e, 0xc6, 0xf5, 0xe7, 0xc2, 0x97, 0x78, 0x6a, + 0xa0, 0xd3, 0x2d, 0x01}, 20, + {0x0a, 0xc1, 0xaf, 0x70, 0x02, 0xb3, 0xd7, 0x61, + 0xd1, 0xe5, 0x52, 0x98, 0xda, 0x9d, 0x05, 0x06, + 0xb9, 0xae, 0x52, 0x05, 0x72, 0x20, 0xa3, 0x06, + 0xe0, 0x7b, 0x6b, 0x87, 0xe8, 0xdf, 0x21, 0xd0, + 0xea, 0x00, 0x03, 0x3d, 0xe0, 0x39, 0x84, 0xd3, + 0x49, 0x18}, 42}, + /* Test with SHA-1, salt not provided (defaults to HashLen zero octets), + zero-length info */ + {7, "sha1", + {0x0c, 0x0c, 0x0c, 0x0c, 0x0c, 0x0c, 0x0c, 0x0c, + 0x0c, 0x0c, 0x0c, 0x0c, 0x0c, 0x0c, 0x0c, 0x0c, + 0x0c, 0x0c, 0x0c, 0x0c, 0x0c, 0x0c}, 22, + {0}, 0, /* pass a null pointer */ + {0}, 0, + {0x2a, 0xdc, 0xca, 0xda, 0x18, 0x77, 0x9e, 0x7c, + 0x20, 0x77, 0xad, 0x2e, 0xb1, 0x9d, 0x3f, 0x3e, + 0x73, 0x13, 0x85, 0xdd}, 20, + {0x2c, 0x91, 0x11, 0x72, 0x04, 0xd7, 0x45, 0xf3, + 0x50, 0x0d, 0x63, 0x6a, 0x62, 0xf6, 0x4f, 0x0a, + 0xb3, 0xba, 0xe5, 0x48, 0xaa, 0x53, 0xd4, 0x23, + 0xb0, 0xd1, 0xf2, 0x7e, 0xbb, 0xa6, 0xf5, 0xe5, + 0x67, 0x3a, 0x08, 0x1d, 0x70, 0xcc, 0xe7, 0xac, + 0xfc, 0x48}, 42}, +#endif /* LTC_TEST_EXT */ +#endif /* LTC_SHA1 */ + }; + + int err; + int tested=0,failed=0; + for(i=0; i < (int)(sizeof(cases) / sizeof(cases[0])); i++) { + int hash = find_hash(cases[i].Hash); + if (hash == -1) continue; + ++tested; + if((err = hkdf(hash, cases[i].salt, cases[i].salt_l, + cases[i].info, cases[i].info_l, + cases[i].IKM, cases[i].IKM_l, + OKM, cases[i].OKM_l)) != CRYPT_OK) { +#if defined(LTC_TEST_DBG) && (LTC_TEST_DBG > 1) + printf("LTC_HKDF-%s test #%d, %s\n", cases[i].Hash, i, error_to_string(err)); +#endif + return err; + } + + if(compare_testvector(OKM, cases[i].OKM_l, cases[i].OKM, (size_t)cases[i].OKM_l, "HKDF", cases[i].num)) { + failed++; + } + } + + if (failed != 0) { + return CRYPT_FAIL_TESTVECTOR; + } else if (tested == 0) { + return CRYPT_NOP; + } else { + return CRYPT_OK; + } + #endif +} + +#endif + + +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/misc/mem_neq.c b/libtomcrypt/src/misc/mem_neq.c new file mode 100644 index 0000000..fbd0cce --- /dev/null +++ b/libtomcrypt/src/misc/mem_neq.c @@ -0,0 +1,63 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + */ +#include "tomcrypt.h" + +/** + @file mem_neq.c + Compare two blocks of memory for inequality in constant time. + Steffen Jaeckel +*/ + +/** + Compare two blocks of memory for inequality in constant time. + + The usage is similar to that of standard memcmp, but you can only test + if the memory is equal or not - you can not determine by how much the + first different byte differs. + + This function shall be used to compare results of cryptographic + operations where inequality means most likely usage of a wrong key. + The execution time has therefore to be constant as otherwise + timing attacks could be possible. + + @param a The first memory region + @param b The second memory region + @param len The length of the area to compare (octets) + + @return 0 when a and b are equal for len bytes, 1 they are not equal. +*/ +int mem_neq(const void *a, const void *b, size_t len) +{ + unsigned char ret = 0; + const unsigned char* pa; + const unsigned char* pb; + + LTC_ARGCHK(a != NULL); + LTC_ARGCHK(b != NULL); + + pa = a; + pb = b; + + while (len-- > 0) { + ret |= *pa ^ *pb; + ++pa; + ++pb; + } + + ret |= ret >> 4; + ret |= ret >> 2; + ret |= ret >> 1; + ret &= 1; + + return ret; +} + +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/misc/pk_get_oid.c b/libtomcrypt/src/misc/pk_get_oid.c new file mode 100644 index 0000000..4f75c5e --- /dev/null +++ b/libtomcrypt/src/misc/pk_get_oid.c @@ -0,0 +1,44 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + */ +#include "tomcrypt.h" + +#ifdef LTC_DER +static const oid_st rsa_oid = { + { 1, 2, 840, 113549, 1, 1, 1 }, + 7, +}; + +static const oid_st dsa_oid = { + { 1, 2, 840, 10040, 4, 1 }, + 6, +}; + +/* + Returns the OID of the public key algorithm. + @return CRYPT_OK if valid +*/ +int pk_get_oid(int pk, oid_st *st) +{ + switch (pk) { + case PKA_RSA: + XMEMCPY(st, &rsa_oid, sizeof(*st)); + break; + case PKA_DSA: + XMEMCPY(st, &dsa_oid, sizeof(*st)); + break; + default: + return CRYPT_INVALID_ARG; + } + return CRYPT_OK; +} +#endif + +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/misc/pkcs5/pkcs_5_1.c b/libtomcrypt/src/misc/pkcs5/pkcs_5_1.c index 519e7aa..10325de 100644 --- a/libtomcrypt/src/misc/pkcs5/pkcs_5_1.c +++ b/libtomcrypt/src/misc/pkcs5/pkcs_5_1.c @@ -5,36 +5,51 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ -#include <tomcrypt.h> +#include "tomcrypt.h" -/** +/** @file pkcs_5_1.c - LTC_PKCS #5, Algorithm #1, Tom St Denis + PKCS #5, Algorithm #1, Tom St Denis */ #ifdef LTC_PKCS_5 /** - Execute LTC_PKCS #5 v1 + Execute PKCS #5 v1 in strict or OpenSSL EVP_BytesToKey()-compat mode. + + PKCS#5 v1 specifies that the output key length can be no larger than + the hash output length. OpenSSL unilaterally extended that by repeating + the hash process on a block-by-block basis for as long as needed to make + bigger keys. If you want to be compatible with KDF for e.g. "openssl enc", + you'll want that. + + If you want strict PKCS behavior, turn openssl_compat off. Or (more + likely), use one of the convenience functions below. + @param password The password (or key) @param password_len The length of the password (octet) @param salt The salt (or nonce) which is 8 octets long - @param iteration_count The LTC_PKCS #5 v1 iteration count + @param iteration_count The PKCS #5 v1 iteration count @param hash_idx The index of the hash desired @param out [out] The destination for this algorithm @param outlen [in/out] The max size and resulting size of the algorithm output + @param openssl_compat [in] Whether or not to grow the key to the buffer size ala OpenSSL @return CRYPT_OK if successful */ -int pkcs_5_alg1(const unsigned char *password, unsigned long password_len, - const unsigned char *salt, - int iteration_count, int hash_idx, - unsigned char *out, unsigned long *outlen) +static int _pkcs_5_alg1_common(const unsigned char *password, + unsigned long password_len, + const unsigned char *salt, + int iteration_count, int hash_idx, + unsigned char *out, unsigned long *outlen, + int openssl_compat) { int err; unsigned long x; hash_state *md; unsigned char *buf; + /* Storage vars in case we need to support > hashsize (OpenSSL compat) */ + unsigned long block = 0, iter; + /* How many bytes to put in the outbut buffer (convenience calc) */ + unsigned long outidx = 0, nb = 0; LTC_ARGCHK(password != NULL); LTC_ARGCHK(salt != NULL); @@ -53,42 +68,64 @@ int pkcs_5_alg1(const unsigned char *password, unsigned long password_len, if (md != NULL) { XFREE(md); } - if (buf != NULL) { + if (buf != NULL) { XFREE(buf); } return CRYPT_MEM; - } - - /* hash initial password + salt */ - if ((err = hash_descriptor[hash_idx].init(md)) != CRYPT_OK) { - goto LBL_ERR; - } - if ((err = hash_descriptor[hash_idx].process(md, password, password_len)) != CRYPT_OK) { - goto LBL_ERR; - } - if ((err = hash_descriptor[hash_idx].process(md, salt, 8)) != CRYPT_OK) { - goto LBL_ERR; - } - if ((err = hash_descriptor[hash_idx].done(md, buf)) != CRYPT_OK) { - goto LBL_ERR; } - while (--iteration_count) { - /* code goes here. */ - x = MAXBLOCKSIZE; - if ((err = hash_memory(hash_idx, buf, hash_descriptor[hash_idx].hashsize, buf, &x)) != CRYPT_OK) { - goto LBL_ERR; + while(block * hash_descriptor[hash_idx].hashsize < *outlen) { + + /* hash initial (maybe previous hash) + password + salt */ + if ((err = hash_descriptor[hash_idx].init(md)) != CRYPT_OK) { + goto LBL_ERR; } - } + /* in OpenSSL mode, we first hash the previous result for blocks 2-n */ + if (openssl_compat && block) { + if ((err = hash_descriptor[hash_idx].process(md, buf, hash_descriptor[hash_idx].hashsize)) != CRYPT_OK) { + goto LBL_ERR; + } + } + if ((err = hash_descriptor[hash_idx].process(md, password, password_len)) != CRYPT_OK) { + goto LBL_ERR; + } + if ((err = hash_descriptor[hash_idx].process(md, salt, 8)) != CRYPT_OK) { + goto LBL_ERR; + } + if ((err = hash_descriptor[hash_idx].done(md, buf)) != CRYPT_OK) { + goto LBL_ERR; + } + + iter = iteration_count; + while (--iter) { + /* code goes here. */ + x = MAXBLOCKSIZE; + if ((err = hash_memory(hash_idx, buf, hash_descriptor[hash_idx].hashsize, buf, &x)) != CRYPT_OK) { + goto LBL_ERR; + } + } + + /* limit the size of the copy to however many bytes we have left in + the output buffer (and how many bytes we have to copy) */ + outidx = block*hash_descriptor[hash_idx].hashsize; + nb = hash_descriptor[hash_idx].hashsize; + if(outidx+nb > *outlen) + nb = *outlen - outidx; + if(nb > 0) + XMEMCPY(out+outidx, buf, nb); - /* copy upto outlen bytes */ - for (x = 0; x < hash_descriptor[hash_idx].hashsize && x < *outlen; x++) { - out[x] = buf[x]; + block++; + if (!openssl_compat) + break; } - *outlen = x; + /* In strict mode, we always return the hashsize, in compat we filled it + as much as was requested, so we leave it alone. */ + if(!openssl_compat) + *outlen = hash_descriptor[hash_idx].hashsize; + err = CRYPT_OK; LBL_ERR: -#ifdef LTC_CLEAN_STACK +#ifdef LTC_CLEAN_STACK zeromem(buf, MAXBLOCKSIZE); zeromem(md, sizeof(hash_state)); #endif @@ -99,8 +136,52 @@ LBL_ERR: return err; } +/** + Execute PKCS #5 v1 - Strict mode (no OpenSSL-compatible extension) + @param password The password (or key) + @param password_len The length of the password (octet) + @param salt The salt (or nonce) which is 8 octets long + @param iteration_count The PKCS #5 v1 iteration count + @param hash_idx The index of the hash desired + @param out [out] The destination for this algorithm + @param outlen [in/out] The max size and resulting size of the algorithm output + @return CRYPT_OK if successful +*/ +int pkcs_5_alg1(const unsigned char *password, unsigned long password_len, + const unsigned char *salt, + int iteration_count, int hash_idx, + unsigned char *out, unsigned long *outlen) +{ + return _pkcs_5_alg1_common(password, password_len, salt, iteration_count, + hash_idx, out, outlen, 0); +} + +/** + Execute PKCS #5 v1 - OpenSSL-extension-compatible mode + + Use this one if you need to derive keys as "openssl enc" does by default. + OpenSSL (for better or worse), uses MD5 as the hash and iteration_count=1. + @param password The password (or key) + @param password_len The length of the password (octet) + @param salt The salt (or nonce) which is 8 octets long + @param iteration_count The PKCS #5 v1 iteration count + @param hash_idx The index of the hash desired + @param out [out] The destination for this algorithm + @param outlen [in/out] The max size and resulting size of the algorithm output + @return CRYPT_OK if successful +*/ +int pkcs_5_alg1_openssl(const unsigned char *password, + unsigned long password_len, + const unsigned char *salt, + int iteration_count, int hash_idx, + unsigned char *out, unsigned long *outlen) +{ + return _pkcs_5_alg1_common(password, password_len, salt, iteration_count, + hash_idx, out, outlen, 1); +} + #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/misc/pkcs5/pkcs_5_2.c b/libtomcrypt/src/misc/pkcs5/pkcs_5_2.c index 0d76d62..2265bcb 100644 --- a/libtomcrypt/src/misc/pkcs5/pkcs_5_2.c +++ b/libtomcrypt/src/misc/pkcs5/pkcs_5_2.c @@ -5,30 +5,28 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ -#include <tomcrypt.h> +#include "tomcrypt.h" -/** +/** @file pkcs_5_2.c - LTC_PKCS #5, Algorithm #2, Tom St Denis + PKCS #5, Algorithm #2, Tom St Denis */ #ifdef LTC_PKCS_5 /** - Execute LTC_PKCS #5 v2 + Execute PKCS #5 v2 @param password The input password (or key) @param password_len The length of the password (octets) @param salt The salt (or nonce) @param salt_len The length of the salt (octets) - @param iteration_count # of iterations desired for LTC_PKCS #5 v2 [read specs for more] + @param iteration_count # of iterations desired for PKCS #5 v2 [read specs for more] @param hash_idx The index of the hash desired @param out [out] The destination for this algorithm @param outlen [in/out] The max size and resulting size of the algorithm output @return CRYPT_OK if successful */ -int pkcs_5_alg2(const unsigned char *password, unsigned long password_len, +int pkcs_5_alg2(const unsigned char *password, unsigned long password_len, const unsigned char *salt, unsigned long salt_len, int iteration_count, int hash_idx, unsigned char *out, unsigned long *outlen) @@ -69,13 +67,13 @@ int pkcs_5_alg2(const unsigned char *password, unsigned long password_len, while (left != 0) { /* process block number blkno */ zeromem(buf[0], MAXBLOCKSIZE*2); - + /* store current block number and increment for next pass */ STORE32H(blkno, buf[1]); ++blkno; /* get PRF(P, S||int(blkno)) */ - if ((err = hmac_init(hmac, hash_idx, password, password_len)) != CRYPT_OK) { + if ((err = hmac_init(hmac, hash_idx, password, password_len)) != CRYPT_OK) { goto LBL_ERR; } if ((err = hmac_process(hmac, salt, salt_len)) != CRYPT_OK) { @@ -124,6 +122,6 @@ LBL_ERR: #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/misc/pkcs5/pkcs_5_test.c b/libtomcrypt/src/misc/pkcs5/pkcs_5_test.c new file mode 100644 index 0000000..f6e413b --- /dev/null +++ b/libtomcrypt/src/misc/pkcs5/pkcs_5_test.c @@ -0,0 +1,231 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + */ +#include "tomcrypt.h" + +/** + @file hkdf_test.c + PKCS #5 support, self-test, Steffen Jaeckel +*/ + +#ifdef LTC_PKCS_5 + +/* + TEST CASES SOURCE: + +Internet Engineering Task Force (IETF) S. Josefsson +Request for Comments: 6070 SJD AB +Category: Informational January 2011 +ISSN: 2070-1721 +*/ + +/** + PKCS #5 self-test + @return CRYPT_OK if successful, CRYPT_NOP if tests have been disabled. +*/ +int pkcs_5_test (void) +{ + #ifndef LTC_TEST + return CRYPT_NOP; + #else + + typedef struct { + const char* P; + unsigned long P_len; + const char* S; + unsigned long S_len; + int c; + unsigned long dkLen; + unsigned char DK[40]; + } case_item; + + static const case_item cases_5_2[] = { + { + "password", + 8, + "salt", + 4, + 1, + 20, + { 0x0c, 0x60, 0xc8, 0x0f, 0x96, 0x1f, 0x0e, 0x71, + 0xf3, 0xa9, 0xb5, 0x24, 0xaf, 0x60, 0x12, 0x06, + 0x2f, 0xe0, 0x37, 0xa6 } + }, + { + "password", + 8, + "salt", + 4, + 2, + 20, + { 0xea, 0x6c, 0x01, 0x4d, 0xc7, 0x2d, 0x6f, 0x8c, + 0xcd, 0x1e, 0xd9, 0x2a, 0xce, 0x1d, 0x41, 0xf0, + 0xd8, 0xde, 0x89, 0x57 } + }, +#ifdef LTC_TEST_EXT + { + "password", + 8, + "salt", + 4, + 4096, + 20, + { 0x4b, 0x00, 0x79, 0x01, 0xb7, 0x65, 0x48, 0x9a, + 0xbe, 0xad, 0x49, 0xd9, 0x26, 0xf7, 0x21, 0xd0, + 0x65, 0xa4, 0x29, 0xc1 } + }, + { + "password", + 8, + "salt", + 4, + 16777216, + 20, + { 0xee, 0xfe, 0x3d, 0x61, 0xcd, 0x4d, 0xa4, 0xe4, + 0xe9, 0x94, 0x5b, 0x3d, 0x6b, 0xa2, 0x15, 0x8c, + 0x26, 0x34, 0xe9, 0x84 } + }, + { + "passwordPASSWORDpassword", + 25, + "saltSALTsaltSALTsaltSALTsaltSALTsalt", + 36, + 4096, + 25, + { 0x3d, 0x2e, 0xec, 0x4f, 0xe4, 0x1c, 0x84, 0x9b, + 0x80, 0xc8, 0xd8, 0x36, 0x62, 0xc0, 0xe4, 0x4a, + 0x8b, 0x29, 0x1a, 0x96, 0x4c, 0xf2, 0xf0, 0x70, + 0x38 } + }, + { + "pass\0word", + 9, + "sa\0lt", + 5, + 4096, + 16, + { 0x56, 0xfa, 0x6a, 0xa7, 0x55, 0x48, 0x09, 0x9d, + 0xcc, 0x37, 0xd7, 0xf0, 0x34, 0x25, 0xe0, 0xc3 } + }, +#endif /* LTC_TEST_EXT */ + }; + + static const case_item cases_5_1[] = { + { + "password", + 8, + "saltsalt", /* must be 8 octects */ + 8, /* ignored by alg1 */ + 1, + 20, + { 0xca, 0xb8, 0x6d, 0xd6, 0x26, 0x17, 0x10, 0x89, 0x1e, 0x8c, + 0xb5, 0x6e, 0xe3, 0x62, 0x56, 0x91, 0xa7, 0x5d, 0xf3, 0x44 } + }, + }; + + static const case_item cases_5_1o[] = { + { + "password", + 8, + "saltsalt", /* must be 8 octects */ + 8, /* ignored by alg1_openssl */ + 1, + 20, + { 0xca, 0xb8, 0x6d, 0xd6, 0x26, 0x17, 0x10, 0x89, 0x1e, 0x8c, + 0xb5, 0x6e, 0xe3, 0x62, 0x56, 0x91, 0xa7, 0x5d, 0xf3, 0x44 } + + }, + { + "password", + 8, + "saltsalt", /* must be 8 octects */ + 8, /* ignored by alg1_openssl */ + 1, + 30, + { 0xca, 0xb8, 0x6d, 0xd6, 0x26, 0x17, 0x10, 0x89, 0x1e, 0x8c, + 0xb5, 0x6e, 0xe3, 0x62, 0x56, 0x91, 0xa7, 0x5d, 0xf3, 0x44, + 0xf0, 0xbf, 0xf4, 0xc1, 0x2c, 0xf3, 0x59, 0x6f, 0xc0, 0x0b } + + } + }; + + unsigned char DK[40]; + unsigned long dkLen; + int i, err; + int tested=0, failed=0; + int hash = find_hash("sha1"); + if (hash == -1) + { +#ifdef LTC_TEST_DBG + printf("PKCS#5 test failed: 'sha1' hash not found\n"); +#endif + return CRYPT_ERROR; + } + + /* testing alg 2 */ + for(i=0; i < (int)(sizeof(cases_5_2) / sizeof(cases_5_2[0])); i++) { + ++tested; + dkLen = cases_5_2[i].dkLen; + if((err = pkcs_5_alg2((unsigned char*)cases_5_2[i].P, cases_5_2[i].P_len, + (unsigned char*)cases_5_2[i].S, cases_5_2[i].S_len, + cases_5_2[i].c, hash, + DK, &dkLen)) != CRYPT_OK) { +#ifdef LTC_TEST_DBG + printf("\npkcs_5_alg2() #%d: Failed/1 (%s)\n", i, error_to_string(err)); +#endif + ++failed; + } + else if (compare_testvector(DK, dkLen, cases_5_2[i].DK, cases_5_2[i].dkLen, "PKCS#5_2", i)) { + ++failed; + } + } + + /* testing alg 1 */ + for(i=0; i < (int)(sizeof(cases_5_1) / sizeof(case_item)); i++, tested++) { + dkLen = cases_5_1[i].dkLen; + if((err = pkcs_5_alg1((unsigned char*)cases_5_1[i].P, cases_5_1[i].P_len, + (unsigned char*)cases_5_1[i].S, + cases_5_1[i].c, hash, + DK, &dkLen)) != CRYPT_OK) { +#ifdef LTC_TEST_DBG + printf("\npkcs_5_alg1() #%d: Failed/1 (%s)\n", i, error_to_string(err)); +#endif + ++failed; + } + else if (compare_testvector(DK, dkLen, cases_5_1[i].DK, cases_5_1[i].dkLen, "PKCS#5_1", i)) { + ++failed; + } + } + + /* testing alg 1_openssl */ + for(i = 0; i < (int)(sizeof(cases_5_1o) / sizeof(cases_5_1o[0])); i++, tested++) { + dkLen = cases_5_1o[i].dkLen; + if ((err = pkcs_5_alg1_openssl((unsigned char*)cases_5_1o[i].P, cases_5_1o[i].P_len, + (unsigned char*)cases_5_1o[i].S, + cases_5_1o[i].c, hash, + DK, &dkLen)) != CRYPT_OK) { +#ifdef LTC_TEST_DBG + printf("\npkcs_5_alg1_openssl() #%d: Failed/1 (%s)\n", i, error_to_string(err)); +#endif + ++failed; + } + else if (compare_testvector(DK, dkLen, cases_5_1o[i].DK, cases_5_1o[i].dkLen, "PKCS#5_1o", i)) { + ++failed; + } + } + + return (failed != 0) ? CRYPT_FAIL_TESTVECTOR : CRYPT_OK; + #endif +} + +#endif + + +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/misc/zeromem.c b/libtomcrypt/src/misc/zeromem.c index 2ddead8..99b02f8 100644 --- a/libtomcrypt/src/misc/zeromem.c +++ b/libtomcrypt/src/misc/zeromem.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" #include "dbhelpers.h" @@ -21,11 +19,11 @@ @param out The destination of the area to zero @param outlen The length of the area to zero (octets) */ -void zeromem(void *out, size_t outlen) +void zeromem(volatile void *out, size_t outlen) { - m_burn(out, outlen); + m_burn((void*)out, outlen); } -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/modes/cbc/cbc_decrypt.c b/libtomcrypt/src/modes/cbc/cbc_decrypt.c index 3751f14..e9f2785 100644 --- a/libtomcrypt/src/modes/cbc/cbc_decrypt.c +++ b/libtomcrypt/src/modes/cbc/cbc_decrypt.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" @@ -34,7 +32,7 @@ int cbc_decrypt(const unsigned char *ct, unsigned char *pt, unsigned long len, s LTC_FAST_TYPE tmpy; #else unsigned char tmpy; -#endif +#endif LTC_ARGCHK(pt != NULL); LTC_ARGCHK(ct != NULL); @@ -43,21 +41,21 @@ int cbc_decrypt(const unsigned char *ct, unsigned char *pt, unsigned long len, s if ((err = cipher_is_valid(cbc->cipher)) != CRYPT_OK) { return err; } - + /* is blocklen valid? */ - if (cbc->blocklen < 1 || cbc->blocklen > (int)sizeof(cbc->IV)) { + if (cbc->blocklen < 1 || cbc->blocklen > (int)sizeof(cbc->IV) || cbc->blocklen > (int)sizeof(tmp)) { return CRYPT_INVALID_ARG; - } + } if (len % cbc->blocklen) { return CRYPT_INVALID_ARG; } #ifdef LTC_FAST - if (cbc->blocklen % sizeof(LTC_FAST_TYPE)) { + if (cbc->blocklen % sizeof(LTC_FAST_TYPE)) { return CRYPT_INVALID_ARG; } #endif - + if (cipher_descriptor[cbc->cipher].accel_cbc_decrypt != NULL) { return cipher_descriptor[cbc->cipher].accel_cbc_decrypt(ct, pt, len / cbc->blocklen, cbc->IV, &cbc->key); } else { @@ -69,19 +67,19 @@ int cbc_decrypt(const unsigned char *ct, unsigned char *pt, unsigned long len, s /* xor IV against plaintext */ #if defined(LTC_FAST) - for (x = 0; x < cbc->blocklen; x += sizeof(LTC_FAST_TYPE)) { - tmpy = *((LTC_FAST_TYPE*)((unsigned char *)cbc->IV + x)) ^ *((LTC_FAST_TYPE*)((unsigned char *)tmp + x)); - *((LTC_FAST_TYPE*)((unsigned char *)cbc->IV + x)) = *((LTC_FAST_TYPE*)((unsigned char *)ct + x)); - *((LTC_FAST_TYPE*)((unsigned char *)pt + x)) = tmpy; - } - #else - for (x = 0; x < cbc->blocklen; x++) { - tmpy = tmp[x] ^ cbc->IV[x]; - cbc->IV[x] = ct[x]; - pt[x] = tmpy; - } + for (x = 0; x < cbc->blocklen; x += sizeof(LTC_FAST_TYPE)) { + tmpy = *(LTC_FAST_TYPE_PTR_CAST((unsigned char *)cbc->IV + x)) ^ *(LTC_FAST_TYPE_PTR_CAST((unsigned char *)tmp + x)); + *(LTC_FAST_TYPE_PTR_CAST((unsigned char *)cbc->IV + x)) = *(LTC_FAST_TYPE_PTR_CAST((unsigned char *)ct + x)); + *(LTC_FAST_TYPE_PTR_CAST((unsigned char *)pt + x)) = tmpy; + } + #else + for (x = 0; x < cbc->blocklen; x++) { + tmpy = tmp[x] ^ cbc->IV[x]; + cbc->IV[x] = ct[x]; + pt[x] = tmpy; + } #endif - + ct += cbc->blocklen; pt += cbc->blocklen; len -= cbc->blocklen; @@ -92,6 +90,6 @@ int cbc_decrypt(const unsigned char *ct, unsigned char *pt, unsigned long len, s #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/modes/cbc/cbc_done.c b/libtomcrypt/src/modes/cbc/cbc_done.c index 75b9742..2f1293d 100644 --- a/libtomcrypt/src/modes/cbc/cbc_done.c +++ b/libtomcrypt/src/modes/cbc/cbc_done.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" @@ -33,10 +31,10 @@ int cbc_done(symmetric_CBC *cbc) return CRYPT_OK; } - + #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/modes/cbc/cbc_encrypt.c b/libtomcrypt/src/modes/cbc/cbc_encrypt.c index 1f28204..00d85fc 100644 --- a/libtomcrypt/src/modes/cbc/cbc_encrypt.c +++ b/libtomcrypt/src/modes/cbc/cbc_encrypt.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" @@ -37,17 +35,17 @@ int cbc_encrypt(const unsigned char *pt, unsigned char *ct, unsigned long len, s if ((err = cipher_is_valid(cbc->cipher)) != CRYPT_OK) { return err; } - + /* is blocklen valid? */ if (cbc->blocklen < 1 || cbc->blocklen > (int)sizeof(cbc->IV)) { return CRYPT_INVALID_ARG; - } + } if (len % cbc->blocklen) { return CRYPT_INVALID_ARG; } #ifdef LTC_FAST - if (cbc->blocklen % sizeof(LTC_FAST_TYPE)) { + if (cbc->blocklen % sizeof(LTC_FAST_TYPE)) { return CRYPT_INVALID_ARG; } #endif @@ -58,13 +56,13 @@ int cbc_encrypt(const unsigned char *pt, unsigned char *ct, unsigned long len, s while (len) { /* xor IV against plaintext */ #if defined(LTC_FAST) - for (x = 0; x < cbc->blocklen; x += sizeof(LTC_FAST_TYPE)) { - *((LTC_FAST_TYPE*)((unsigned char *)cbc->IV + x)) ^= *((LTC_FAST_TYPE*)((unsigned char *)pt + x)); - } - #else - for (x = 0; x < cbc->blocklen; x++) { - cbc->IV[x] ^= pt[x]; - } + for (x = 0; x < cbc->blocklen; x += sizeof(LTC_FAST_TYPE)) { + *(LTC_FAST_TYPE_PTR_CAST((unsigned char *)cbc->IV + x)) ^= *(LTC_FAST_TYPE_PTR_CAST((unsigned char *)pt + x)); + } + #else + for (x = 0; x < cbc->blocklen; x++) { + cbc->IV[x] ^= pt[x]; + } #endif /* encrypt */ @@ -72,27 +70,27 @@ int cbc_encrypt(const unsigned char *pt, unsigned char *ct, unsigned long len, s return err; } - /* store IV [ciphertext] for a future block */ + /* store IV [ciphertext] for a future block */ #if defined(LTC_FAST) - for (x = 0; x < cbc->blocklen; x += sizeof(LTC_FAST_TYPE)) { - *((LTC_FAST_TYPE*)((unsigned char *)cbc->IV + x)) = *((LTC_FAST_TYPE*)((unsigned char *)ct + x)); - } - #else - for (x = 0; x < cbc->blocklen; x++) { - cbc->IV[x] = ct[x]; - } + for (x = 0; x < cbc->blocklen; x += sizeof(LTC_FAST_TYPE)) { + *(LTC_FAST_TYPE_PTR_CAST((unsigned char *)cbc->IV + x)) = *(LTC_FAST_TYPE_PTR_CAST((unsigned char *)ct + x)); + } + #else + for (x = 0; x < cbc->blocklen; x++) { + cbc->IV[x] = ct[x]; + } #endif - - ct += cbc->blocklen; - pt += cbc->blocklen; - len -= cbc->blocklen; - } + + ct += cbc->blocklen; + pt += cbc->blocklen; + len -= cbc->blocklen; + } } return CRYPT_OK; } #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/modes/cbc/cbc_getiv.c b/libtomcrypt/src/modes/cbc/cbc_getiv.c index 6587743..fbf6834 100644 --- a/libtomcrypt/src/modes/cbc/cbc_getiv.c +++ b/libtomcrypt/src/modes/cbc/cbc_getiv.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" @@ -18,9 +16,9 @@ #ifdef LTC_CBC_MODE /** - Get the current initial vector - @param IV [out] The destination of the initial vector - @param len [in/out] The max size and resulting size of the initial vector + Get the current initialization vector + @param IV [out] The destination of the initialization vector + @param len [in/out] The max size and resulting size of the initialization vector @param cbc The CBC state @return CRYPT_OK if successful */ @@ -41,6 +39,6 @@ int cbc_getiv(unsigned char *IV, unsigned long *len, symmetric_CBC *cbc) #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/modes/cbc/cbc_setiv.c b/libtomcrypt/src/modes/cbc/cbc_setiv.c index cd2e32e..255d641 100644 --- a/libtomcrypt/src/modes/cbc/cbc_setiv.c +++ b/libtomcrypt/src/modes/cbc/cbc_setiv.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" @@ -19,8 +17,8 @@ #ifdef LTC_CBC_MODE /** - Set an initial vector - @param IV The initial vector + Set an initialization vector + @param IV The initialization vector @param len The length of the vector (in octets) @param cbc The CBC state @return CRYPT_OK if successful @@ -36,9 +34,9 @@ int cbc_setiv(const unsigned char *IV, unsigned long len, symmetric_CBC *cbc) return CRYPT_OK; } -#endif +#endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/modes/cbc/cbc_start.c b/libtomcrypt/src/modes/cbc/cbc_start.c index 832e77a..6c5c52c 100644 --- a/libtomcrypt/src/modes/cbc/cbc_start.c +++ b/libtomcrypt/src/modes/cbc/cbc_start.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" @@ -20,18 +18,18 @@ /** Initialize a CBC context @param cipher The index of the cipher desired - @param IV The initial vector - @param key The secret key + @param IV The initialization vector + @param key The secret key @param keylen The length of the secret key (octets) @param num_rounds Number of rounds in the cipher desired (0 for default) @param cbc The CBC state to initialize @return CRYPT_OK if successful */ -int cbc_start(int cipher, const unsigned char *IV, const unsigned char *key, +int cbc_start(int cipher, const unsigned char *IV, const unsigned char *key, int keylen, int num_rounds, symmetric_CBC *cbc) { int x, err; - + LTC_ARGCHK(IV != NULL); LTC_ARGCHK(key != NULL); LTC_ARGCHK(cbc != NULL); @@ -57,6 +55,6 @@ int cbc_start(int cipher, const unsigned char *IV, const unsigned char *key, #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/modes/cfb/cfb_decrypt.c b/libtomcrypt/src/modes/cfb/cfb_decrypt.c index 13ac5a6..9749a0b 100644 --- a/libtomcrypt/src/modes/cfb/cfb_decrypt.c +++ b/libtomcrypt/src/modes/cfb/cfb_decrypt.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" @@ -52,7 +50,7 @@ int cfb_decrypt(const unsigned char *ct, unsigned char *pt, unsigned long len, s } cfb->pad[cfb->padlen] = *ct; *pt = *ct ^ cfb->IV[cfb->padlen]; - ++pt; + ++pt; ++ct; ++(cfb->padlen); } @@ -62,6 +60,6 @@ int cfb_decrypt(const unsigned char *ct, unsigned char *pt, unsigned long len, s #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/modes/cfb/cfb_done.c b/libtomcrypt/src/modes/cfb/cfb_done.c index 1ee9a98..24576c8 100644 --- a/libtomcrypt/src/modes/cfb/cfb_done.c +++ b/libtomcrypt/src/modes/cfb/cfb_done.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" @@ -33,10 +31,10 @@ int cfb_done(symmetric_CFB *cfb) return CRYPT_OK; } - + #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/modes/cfb/cfb_encrypt.c b/libtomcrypt/src/modes/cfb/cfb_encrypt.c index 8ac5f5c..4503e5b 100644 --- a/libtomcrypt/src/modes/cfb/cfb_encrypt.c +++ b/libtomcrypt/src/modes/cfb/cfb_encrypt.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" @@ -51,7 +49,7 @@ int cfb_encrypt(const unsigned char *pt, unsigned char *ct, unsigned long len, s cfb->padlen = 0; } cfb->pad[cfb->padlen] = (*ct = *pt ^ cfb->IV[cfb->padlen]); - ++pt; + ++pt; ++ct; ++(cfb->padlen); } @@ -60,6 +58,6 @@ int cfb_encrypt(const unsigned char *pt, unsigned char *ct, unsigned long len, s #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/modes/cfb/cfb_getiv.c b/libtomcrypt/src/modes/cfb/cfb_getiv.c index b6786e1..b972c72 100644 --- a/libtomcrypt/src/modes/cfb/cfb_getiv.c +++ b/libtomcrypt/src/modes/cfb/cfb_getiv.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" @@ -18,9 +16,9 @@ #ifdef LTC_CFB_MODE /** - Get the current initial vector - @param IV [out] The destination of the initial vector - @param len [in/out] The max size and resulting size of the initial vector + Get the current initialization vector + @param IV [out] The destination of the initialization vector + @param len [in/out] The max size and resulting size of the initialization vector @param cfb The CFB state @return CRYPT_OK if successful */ @@ -41,6 +39,6 @@ int cfb_getiv(unsigned char *IV, unsigned long *len, symmetric_CFB *cfb) #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/modes/cfb/cfb_setiv.c b/libtomcrypt/src/modes/cfb/cfb_setiv.c index 0fc8757..4495bf5 100644 --- a/libtomcrypt/src/modes/cfb/cfb_setiv.c +++ b/libtomcrypt/src/modes/cfb/cfb_setiv.c @@ -5,21 +5,19 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" /** @file cfb_setiv.c CFB implementation, set IV, Tom St Denis -*/ +*/ #ifdef LTC_CFB_MODE /** - Set an initial vector - @param IV The initial vector + Set an initialization vector + @param IV The initialization vector @param len The length of the vector (in octets) @param cfb The CFB state @return CRYPT_OK if successful @@ -27,26 +25,26 @@ int cfb_setiv(const unsigned char *IV, unsigned long len, symmetric_CFB *cfb) { int err; - + LTC_ARGCHK(IV != NULL); LTC_ARGCHK(cfb != NULL); if ((err = cipher_is_valid(cfb->cipher)) != CRYPT_OK) { return err; } - + if (len != (unsigned long)cfb->blocklen) { return CRYPT_INVALID_ARG; } - + /* force next block */ cfb->padlen = 0; return cipher_descriptor[cfb->cipher].ecb_encrypt(IV, cfb->IV, &cfb->key); } -#endif +#endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/modes/cfb/cfb_start.c b/libtomcrypt/src/modes/cfb/cfb_start.c index a8e5b8b..e49b119 100644 --- a/libtomcrypt/src/modes/cfb/cfb_start.c +++ b/libtomcrypt/src/modes/cfb/cfb_start.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" @@ -21,14 +19,14 @@ /** Initialize a CFB context @param cipher The index of the cipher desired - @param IV The initial vector - @param key The secret key + @param IV The initialization vector + @param key The secret key @param keylen The length of the secret key (octets) @param num_rounds Number of rounds in the cipher desired (0 for default) @param cfb The CFB state to initialize @return CRYPT_OK if successful */ -int cfb_start(int cipher, const unsigned char *IV, const unsigned char *key, +int cfb_start(int cipher, const unsigned char *IV, const unsigned char *key, int keylen, int num_rounds, symmetric_CFB *cfb) { int x, err; @@ -40,7 +38,7 @@ int cfb_start(int cipher, const unsigned char *IV, const unsigned char *key, if ((err = cipher_is_valid(cipher)) != CRYPT_OK) { return err; } - + /* copy data */ cfb->cipher = cipher; @@ -60,6 +58,6 @@ int cfb_start(int cipher, const unsigned char *IV, const unsigned char *key, #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/modes/ctr/ctr_decrypt.c b/libtomcrypt/src/modes/ctr/ctr_decrypt.c index 9537249..5008089 100644 --- a/libtomcrypt/src/modes/ctr/ctr_decrypt.c +++ b/libtomcrypt/src/modes/ctr/ctr_decrypt.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" @@ -37,6 +35,6 @@ int ctr_decrypt(const unsigned char *ct, unsigned char *pt, unsigned long len, s #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/modes/ctr/ctr_done.c b/libtomcrypt/src/modes/ctr/ctr_done.c index 26391fd..3de13c2 100644 --- a/libtomcrypt/src/modes/ctr/ctr_done.c +++ b/libtomcrypt/src/modes/ctr/ctr_done.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" @@ -33,10 +31,10 @@ int ctr_done(symmetric_CTR *ctr) return CRYPT_OK; } - + #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/modes/ctr/ctr_encrypt.c b/libtomcrypt/src/modes/ctr/ctr_encrypt.c index 0b08359..7319cf5 100644 --- a/libtomcrypt/src/modes/ctr/ctr_encrypt.c +++ b/libtomcrypt/src/modes/ctr/ctr_encrypt.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" @@ -37,7 +35,7 @@ int ctr_encrypt(const unsigned char *pt, unsigned char *ct, unsigned long len, s if ((err = cipher_is_valid(ctr->cipher)) != CRYPT_OK) { return err; } - + /* is blocklen/padlen valid? */ if (ctr->blocklen < 1 || ctr->blocklen > (int)sizeof(ctr->ctr) || ctr->padlen < 0 || ctr->padlen > (int)sizeof(ctr->pad)) { @@ -49,12 +47,14 @@ int ctr_encrypt(const unsigned char *pt, unsigned char *ct, unsigned long len, s return CRYPT_INVALID_ARG; } #endif - + /* handle acceleration only if pad is empty, accelerator is present and length is >= a block size */ if ((ctr->padlen == ctr->blocklen) && cipher_descriptor[ctr->cipher].accel_ctr_encrypt != NULL && (len >= (unsigned long)ctr->blocklen)) { if ((err = cipher_descriptor[ctr->cipher].accel_ctr_encrypt(pt, ct, len/ctr->blocklen, ctr->ctr, ctr->mode, &ctr->key)) != CRYPT_OK) { return err; } + pt += (len / ctr->blocklen) * ctr->blocklen; + ct += (len / ctr->blocklen) * ctr->blocklen; len %= ctr->blocklen; } @@ -89,8 +89,8 @@ int ctr_encrypt(const unsigned char *pt, unsigned char *ct, unsigned long len, s #ifdef LTC_FAST if (ctr->padlen == 0 && len >= (unsigned long)ctr->blocklen) { for (x = 0; x < ctr->blocklen; x += sizeof(LTC_FAST_TYPE)) { - *((LTC_FAST_TYPE*)((unsigned char *)ct + x)) = *((LTC_FAST_TYPE*)((unsigned char *)pt + x)) ^ - *((LTC_FAST_TYPE*)((unsigned char *)ctr->pad + x)); + *(LTC_FAST_TYPE_PTR_CAST((unsigned char *)ct + x)) = *(LTC_FAST_TYPE_PTR_CAST((unsigned char *)pt + x)) ^ + *(LTC_FAST_TYPE_PTR_CAST((unsigned char *)ctr->pad + x)); } pt += ctr->blocklen; ct += ctr->blocklen; @@ -98,7 +98,7 @@ int ctr_encrypt(const unsigned char *pt, unsigned char *ct, unsigned long len, s ctr->padlen = ctr->blocklen; continue; } -#endif +#endif *ct++ = *pt++ ^ ctr->pad[ctr->padlen++]; --len; } @@ -107,6 +107,6 @@ int ctr_encrypt(const unsigned char *pt, unsigned char *ct, unsigned long len, s #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/modes/ctr/ctr_getiv.c b/libtomcrypt/src/modes/ctr/ctr_getiv.c index 6242323..cbf92db 100644 --- a/libtomcrypt/src/modes/ctr/ctr_getiv.c +++ b/libtomcrypt/src/modes/ctr/ctr_getiv.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" @@ -18,9 +16,9 @@ #ifdef LTC_CTR_MODE /** - Get the current initial vector - @param IV [out] The destination of the initial vector - @param len [in/out] The max size and resulting size of the initial vector + Get the current initialization vector + @param IV [out] The destination of the initialization vector + @param len [in/out] The max size and resulting size of the initialization vector @param ctr The CTR state @return CRYPT_OK if successful */ @@ -41,6 +39,6 @@ int ctr_getiv(unsigned char *IV, unsigned long *len, symmetric_CTR *ctr) #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/modes/ctr/ctr_setiv.c b/libtomcrypt/src/modes/ctr/ctr_setiv.c index 56a3c97..64d73a1 100644 --- a/libtomcrypt/src/modes/ctr/ctr_setiv.c +++ b/libtomcrypt/src/modes/ctr/ctr_setiv.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" @@ -14,12 +12,12 @@ @file ctr_setiv.c CTR implementation, set IV, Tom St Denis */ - + #ifdef LTC_CTR_MODE /** - Set an initial vector - @param IV The initial vector + Set an initialization vector + @param IV The initialization vector @param len The length of the vector (in octets) @param ctr The CTR state @return CRYPT_OK if successful @@ -27,7 +25,7 @@ int ctr_setiv(const unsigned char *IV, unsigned long len, symmetric_CTR *ctr) { int err; - + LTC_ARGCHK(IV != NULL); LTC_ARGCHK(ctr != NULL); @@ -35,22 +33,22 @@ int ctr_setiv(const unsigned char *IV, unsigned long len, symmetric_CTR *ctr) if ((err = cipher_is_valid(ctr->cipher)) != CRYPT_OK) { return err; } - + if (len != (unsigned long)ctr->blocklen) { return CRYPT_INVALID_ARG; } /* set IV */ XMEMCPY(ctr->ctr, IV, len); - + /* force next block */ ctr->padlen = 0; return cipher_descriptor[ctr->cipher].ecb_encrypt(IV, ctr->pad, &ctr->key); } -#endif +#endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/modes/ctr/ctr_start.c b/libtomcrypt/src/modes/ctr/ctr_start.c index b27bed0..039fdd6 100644 --- a/libtomcrypt/src/modes/ctr/ctr_start.c +++ b/libtomcrypt/src/modes/ctr/ctr_start.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" @@ -21,17 +19,17 @@ /** Initialize a CTR context @param cipher The index of the cipher desired - @param IV The initial vector - @param key The secret key + @param IV The initialization vector + @param key The secret key @param keylen The length of the secret key (octets) @param num_rounds Number of rounds in the cipher desired (0 for default) @param ctr_mode The counter mode (CTR_COUNTER_LITTLE_ENDIAN or CTR_COUNTER_BIG_ENDIAN) @param ctr The CTR state to initialize @return CRYPT_OK if successful */ -int ctr_start( int cipher, - const unsigned char *IV, - const unsigned char *key, int keylen, +int ctr_start( int cipher, + const unsigned char *IV, + const unsigned char *key, int keylen, int num_rounds, int ctr_mode, symmetric_CTR *ctr) { @@ -91,11 +89,11 @@ int ctr_start( int cipher, } } - return cipher_descriptor[ctr->cipher].ecb_encrypt(ctr->ctr, ctr->pad, &ctr->key); + return cipher_descriptor[ctr->cipher].ecb_encrypt(ctr->ctr, ctr->pad, &ctr->key); } #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/modes/ctr/ctr_test.c b/libtomcrypt/src/modes/ctr/ctr_test.c index 9962afd..878d425 100644 --- a/libtomcrypt/src/modes/ctr/ctr_test.c +++ b/libtomcrypt/src/modes/ctr/ctr_test.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" @@ -52,7 +50,7 @@ int ctr_test(void) unsigned char buf[64]; symmetric_CTR ctr; - /* AES can be under rijndael or aes... try to find it */ + /* AES can be under rijndael or aes... try to find it */ if ((idx = find_cipher("aes")) == -1) { if ((idx = find_cipher("rijndael")) == -1) { return CRYPT_NOP; @@ -67,7 +65,7 @@ int ctr_test(void) return err; } ctr_done(&ctr); - if (XMEMCMP(buf, tests[x].ct, tests[x].msglen)) { + if (compare_testvector(buf, tests[x].msglen, tests[x].ct, tests[x].msglen, "CTR", x)) { return CRYPT_FAIL_TESTVECTOR; } } @@ -77,9 +75,9 @@ int ctr_test(void) #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/modes/ecb/ecb_decrypt.c b/libtomcrypt/src/modes/ecb/ecb_decrypt.c index 84842c2..213b253 100644 --- a/libtomcrypt/src/modes/ecb/ecb_decrypt.c +++ b/libtomcrypt/src/modes/ecb/ecb_decrypt.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" @@ -56,6 +54,6 @@ int ecb_decrypt(const unsigned char *ct, unsigned char *pt, unsigned long len, s #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/modes/ecb/ecb_done.c b/libtomcrypt/src/modes/ecb/ecb_done.c index 961ec97..6df7eec 100644 --- a/libtomcrypt/src/modes/ecb/ecb_done.c +++ b/libtomcrypt/src/modes/ecb/ecb_done.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" @@ -33,10 +31,10 @@ int ecb_done(symmetric_ECB *ecb) return CRYPT_OK; } - + #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/modes/ecb/ecb_encrypt.c b/libtomcrypt/src/modes/ecb/ecb_encrypt.c index 801e0fd..5d4661f 100644 --- a/libtomcrypt/src/modes/ecb/ecb_encrypt.c +++ b/libtomcrypt/src/modes/ecb/ecb_encrypt.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" @@ -56,6 +54,6 @@ int ecb_encrypt(const unsigned char *pt, unsigned char *ct, unsigned long len, s #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/modes/ecb/ecb_start.c b/libtomcrypt/src/modes/ecb/ecb_start.c index cec583a..ecd301b 100644 --- a/libtomcrypt/src/modes/ecb/ecb_start.c +++ b/libtomcrypt/src/modes/ecb/ecb_start.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" @@ -21,7 +19,7 @@ /** Initialize a ECB context @param cipher The index of the cipher desired - @param key The secret key + @param key The secret key @param keylen The length of the secret key (octets) @param num_rounds Number of rounds in the cipher desired (0 for default) @param ecb The ECB state to initialize @@ -43,6 +41,6 @@ int ecb_start(int cipher, const unsigned char *key, int keylen, int num_rounds, #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/modes/f8/f8_decrypt.c b/libtomcrypt/src/modes/f8/f8_decrypt.c index 9c4525d..9c92952 100644 --- a/libtomcrypt/src/modes/f8/f8_decrypt.c +++ b/libtomcrypt/src/modes/f8/f8_decrypt.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" @@ -36,8 +34,8 @@ int f8_decrypt(const unsigned char *ct, unsigned char *pt, unsigned long len, sy #endif - -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ + +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/modes/f8/f8_done.c b/libtomcrypt/src/modes/f8/f8_done.c index 867d603..3f0af66 100644 --- a/libtomcrypt/src/modes/f8/f8_done.c +++ b/libtomcrypt/src/modes/f8/f8_done.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" @@ -33,10 +31,10 @@ int f8_done(symmetric_F8 *f8) return CRYPT_OK; } - + #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/modes/f8/f8_encrypt.c b/libtomcrypt/src/modes/f8/f8_encrypt.c index d1a96df..058f25a 100644 --- a/libtomcrypt/src/modes/f8/f8_encrypt.c +++ b/libtomcrypt/src/modes/f8/f8_encrypt.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" @@ -35,13 +33,13 @@ int f8_encrypt(const unsigned char *pt, unsigned char *ct, unsigned long len, sy if ((err = cipher_is_valid(f8->cipher)) != CRYPT_OK) { return err; } - + /* is blocklen/padlen valid? */ if (f8->blocklen < 0 || f8->blocklen > (int)sizeof(f8->IV) || f8->padlen < 0 || f8->padlen > (int)sizeof(f8->IV)) { return CRYPT_INVALID_ARG; } - + zeromem(buf, sizeof(buf)); /* make sure the pad is empty */ @@ -64,8 +62,8 @@ int f8_encrypt(const unsigned char *pt, unsigned char *ct, unsigned long len, sy STORE32H(f8->blockcnt, (buf+(f8->blocklen-4))); ++(f8->blockcnt); for (x = 0; x < f8->blocklen; x += sizeof(LTC_FAST_TYPE)) { - *((LTC_FAST_TYPE*)(&ct[x])) = *((LTC_FAST_TYPE*)(&pt[x])) ^ *((LTC_FAST_TYPE*)(&f8->IV[x])); - *((LTC_FAST_TYPE*)(&f8->IV[x])) ^= *((LTC_FAST_TYPE*)(&f8->MIV[x])) ^ *((LTC_FAST_TYPE*)(&buf[x])); + *(LTC_FAST_TYPE_PTR_CAST(&ct[x])) = *(LTC_FAST_TYPE_PTR_CAST(&pt[x])) ^ *(LTC_FAST_TYPE_PTR_CAST(&f8->IV[x])); + *(LTC_FAST_TYPE_PTR_CAST(&f8->IV[x])) ^= *(LTC_FAST_TYPE_PTR_CAST(&f8->MIV[x])) ^ *(LTC_FAST_TYPE_PTR_CAST(&buf[x])); } if ((err = cipher_descriptor[f8->cipher].ecb_encrypt(f8->IV, f8->IV, &f8->key)) != CRYPT_OK) { return err; @@ -75,7 +73,7 @@ int f8_encrypt(const unsigned char *pt, unsigned char *ct, unsigned long len, sy ct += x; } } -#endif +#endif while (len > 0) { if (f8->padlen == f8->blocklen) { @@ -98,6 +96,6 @@ int f8_encrypt(const unsigned char *pt, unsigned char *ct, unsigned long len, sy #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/modes/f8/f8_getiv.c b/libtomcrypt/src/modes/f8/f8_getiv.c index ff7cb91..a5885c9 100644 --- a/libtomcrypt/src/modes/f8/f8_getiv.c +++ b/libtomcrypt/src/modes/f8/f8_getiv.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" @@ -18,9 +16,9 @@ #ifdef LTC_F8_MODE /** - Get the current initial vector - @param IV [out] The destination of the initial vector - @param len [in/out] The max size and resulting size of the initial vector + Get the current initialization vector + @param IV [out] The destination of the initialization vector + @param len [in/out] The max size and resulting size of the initialization vector @param f8 The F8 state @return CRYPT_OK if successful */ @@ -41,6 +39,6 @@ int f8_getiv(unsigned char *IV, unsigned long *len, symmetric_F8 *f8) #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/modes/f8/f8_setiv.c b/libtomcrypt/src/modes/f8/f8_setiv.c index d1cafcf..8f45a3f 100644 --- a/libtomcrypt/src/modes/f8/f8_setiv.c +++ b/libtomcrypt/src/modes/f8/f8_setiv.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" @@ -18,8 +16,8 @@ #ifdef LTC_F8_MODE /** - Set an initial vector - @param IV The initial vector + Set an initialization vector + @param IV The initialization vector @param len The length of the vector (in octets) @param f8 The F8 state @return CRYPT_OK if successful @@ -44,9 +42,9 @@ int f8_setiv(const unsigned char *IV, unsigned long len, symmetric_F8 *f8) return cipher_descriptor[f8->cipher].ecb_encrypt(IV, f8->IV, &f8->key); } -#endif +#endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/modes/f8/f8_start.c b/libtomcrypt/src/modes/f8/f8_start.c index 4cd58de..6801702 100644 --- a/libtomcrypt/src/modes/f8/f8_start.c +++ b/libtomcrypt/src/modes/f8/f8_start.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" @@ -21,8 +19,8 @@ /** Initialize an F8 context @param cipher The index of the cipher desired - @param IV The initial vector - @param key The secret key + @param IV The initialization vector + @param key The secret key @param keylen The length of the secret key (octets) @param salt_key The salting key for the IV @param skeylen The length of the salting key (octets) @@ -30,8 +28,8 @@ @param f8 The F8 state to initialize @return CRYPT_OK if successful */ -int f8_start( int cipher, const unsigned char *IV, - const unsigned char *key, int keylen, +int f8_start( int cipher, const unsigned char *IV, + const unsigned char *key, int keylen, const unsigned char *salt_key, int skeylen, int num_rounds, symmetric_F8 *f8) { @@ -58,7 +56,7 @@ int f8_start( int cipher, const unsigned char *IV, f8->cipher = cipher; f8->blocklen = cipher_descriptor[cipher].block_length; f8->padlen = f8->blocklen; - + /* now get key ^ salt_key [extend salt_ket with 0x55 as required to match length] */ zeromem(tkey, sizeof(tkey)); for (x = 0; x < keylen && x < (int)sizeof(tkey); x++) { @@ -66,16 +64,16 @@ int f8_start( int cipher, const unsigned char *IV, } for (x = 0; x < skeylen && x < (int)sizeof(tkey); x++) { tkey[x] ^= salt_key[x]; - } + } for (; x < keylen && x < (int)sizeof(tkey); x++) { tkey[x] ^= 0x55; } - + /* now encrypt with tkey[0..keylen-1] the IV and use that as the IV */ if ((err = cipher_descriptor[cipher].setup(tkey, keylen, num_rounds, &f8->key)) != CRYPT_OK) { return err; } - + /* encrypt IV */ if ((err = cipher_descriptor[f8->cipher].ecb_encrypt(IV, f8->MIV, &f8->key)) != CRYPT_OK) { cipher_descriptor[f8->cipher].done(&f8->key); @@ -83,16 +81,16 @@ int f8_start( int cipher, const unsigned char *IV, } zeromem(tkey, sizeof(tkey)); zeromem(f8->IV, sizeof(f8->IV)); - + /* terminate this cipher */ cipher_descriptor[f8->cipher].done(&f8->key); - + /* init the cipher */ return cipher_descriptor[cipher].setup(key, keylen, num_rounds, &f8->key); } #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/modes/f8/f8_test_mode.c b/libtomcrypt/src/modes/f8/f8_test_mode.c index 5cc391b..778cd35 100644 --- a/libtomcrypt/src/modes/f8/f8_test_mode.c +++ b/libtomcrypt/src/modes/f8/f8_test_mode.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" @@ -23,36 +21,36 @@ int f8_test_mode(void) #ifndef LTC_TEST return CRYPT_NOP; #else - static const unsigned char key[16] = { 0x23, 0x48, 0x29, 0x00, 0x84, 0x67, 0xbe, 0x18, + static const unsigned char key[16] = { 0x23, 0x48, 0x29, 0x00, 0x84, 0x67, 0xbe, 0x18, 0x6c, 0x3d, 0xe1, 0x4a, 0xae, 0x72, 0xd6, 0x2c }; static const unsigned char salt[4] = { 0x32, 0xf2, 0x87, 0x0d }; - static const unsigned char IV[16] = { 0x00, 0x6e, 0x5c, 0xba, 0x50, 0x68, 0x1d, 0xe5, + static const unsigned char IV[16] = { 0x00, 0x6e, 0x5c, 0xba, 0x50, 0x68, 0x1d, 0xe5, 0x5c, 0x62, 0x15, 0x99, 0xd4, 0x62, 0x56, 0x4a }; - static const unsigned char pt[39] = { 0x70, 0x73, 0x65, 0x75, 0x64, 0x6f, 0x72, 0x61, + static const unsigned char pt[39] = { 0x70, 0x73, 0x65, 0x75, 0x64, 0x6f, 0x72, 0x61, 0x6e, 0x64, 0x6f, 0x6d, 0x6e, 0x65, 0x73, 0x73, - 0x20, 0x69, 0x73, 0x20, 0x74, 0x68, 0x65, 0x20, + 0x20, 0x69, 0x73, 0x20, 0x74, 0x68, 0x65, 0x20, 0x6e, 0x65, 0x78, 0x74, 0x20, 0x62, 0x65, 0x73, 0x74, 0x20, 0x74, 0x68, 0x69, 0x6e, 0x67 }; - static const unsigned char ct[39] = { 0x01, 0x9c, 0xe7, 0xa2, 0x6e, 0x78, 0x54, 0x01, + static const unsigned char ct[39] = { 0x01, 0x9c, 0xe7, 0xa2, 0x6e, 0x78, 0x54, 0x01, 0x4a, 0x63, 0x66, 0xaa, 0x95, 0xd4, 0xee, 0xfd, - 0x1a, 0xd4, 0x17, 0x2a, 0x14, 0xf9, 0xfa, 0xf4, + 0x1a, 0xd4, 0x17, 0x2a, 0x14, 0xf9, 0xfa, 0xf4, 0x55, 0xb7, 0xf1, 0xd4, 0xb6, 0x2b, 0xd0, 0x8f, 0x56, 0x2c, 0x0e, 0xef, 0x7c, 0x48, 0x02 }; unsigned char buf[39]; symmetric_F8 f8; int err, idx; - + idx = find_cipher("aes"); if (idx == -1) { idx = find_cipher("rijndael"); if (idx == -1) return CRYPT_NOP; - } - + } + /* initialize the context */ if ((err = f8_start(idx, IV, key, sizeof(key), salt, sizeof(salt), 0, &f8)) != CRYPT_OK) { return err; } - + /* encrypt block */ if ((err = f8_encrypt(pt, buf, sizeof(pt), &f8)) != CRYPT_OK) { f8_done(&f8); @@ -61,16 +59,16 @@ int f8_test_mode(void) f8_done(&f8); /* compare */ - if (XMEMCMP(buf, ct, sizeof(ct))) { + if (compare_testvector(buf, sizeof(ct), ct, sizeof(ct), "f8", 0)) { return CRYPT_FAIL_TESTVECTOR; - } - + } + return CRYPT_OK; -#endif -} +#endif +} #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/modes/lrw/lrw_decrypt.c b/libtomcrypt/src/modes/lrw/lrw_decrypt.c index e2858c0..bfedb64 100644 --- a/libtomcrypt/src/modes/lrw/lrw_decrypt.c +++ b/libtomcrypt/src/modes/lrw/lrw_decrypt.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" @@ -46,6 +44,6 @@ int lrw_decrypt(const unsigned char *ct, unsigned char *pt, unsigned long len, s #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/modes/lrw/lrw_done.c b/libtomcrypt/src/modes/lrw/lrw_done.c index e123d28..0088f62 100644 --- a/libtomcrypt/src/modes/lrw/lrw_done.c +++ b/libtomcrypt/src/modes/lrw/lrw_done.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" @@ -22,12 +20,12 @@ @param lrw The state to terminate @return CRYPT_OK if successful */ -int lrw_done(symmetric_LRW *lrw) +int lrw_done(symmetric_LRW *lrw) { int err; LTC_ARGCHK(lrw != NULL); - + if ((err = cipher_is_valid(lrw->cipher)) != CRYPT_OK) { return err; } @@ -37,6 +35,6 @@ int lrw_done(symmetric_LRW *lrw) } #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/modes/lrw/lrw_encrypt.c b/libtomcrypt/src/modes/lrw/lrw_encrypt.c index d84cbdd..0738648 100644 --- a/libtomcrypt/src/modes/lrw/lrw_encrypt.c +++ b/libtomcrypt/src/modes/lrw/lrw_encrypt.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" @@ -16,7 +14,7 @@ */ #ifdef LTC_LRW_MODE - + /** LRW encrypt blocks @param pt The plaintext @@ -45,6 +43,6 @@ int lrw_encrypt(const unsigned char *pt, unsigned char *ct, unsigned long len, s #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/modes/lrw/lrw_getiv.c b/libtomcrypt/src/modes/lrw/lrw_getiv.c index 575e322..6dcd96d 100644 --- a/libtomcrypt/src/modes/lrw/lrw_getiv.c +++ b/libtomcrypt/src/modes/lrw/lrw_getiv.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" @@ -40,6 +38,6 @@ int lrw_getiv(unsigned char *IV, unsigned long *len, symmetric_LRW *lrw) } #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/modes/lrw/lrw_process.c b/libtomcrypt/src/modes/lrw/lrw_process.c index 25661e7..0896bc6 100644 --- a/libtomcrypt/src/modes/lrw/lrw_process.c +++ b/libtomcrypt/src/modes/lrw/lrw_process.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" @@ -30,7 +28,7 @@ int lrw_process(const unsigned char *pt, unsigned char *ct, unsigned long len, i { unsigned char prod[16]; int x, err; -#ifdef LRW_TABLES +#ifdef LTC_LRW_TABLES int y; #endif @@ -49,18 +47,18 @@ int lrw_process(const unsigned char *pt, unsigned char *ct, unsigned long len, i /* increment IV */ for (x = 15; x >= 0; x--) { lrw->IV[x] = (lrw->IV[x] + 1) & 255; - if (lrw->IV[x]) { + if (lrw->IV[x]) { break; } } /* update pad */ -#ifdef LRW_TABLES +#ifdef LTC_LRW_TABLES /* for each byte changed we undo it's affect on the pad then add the new product */ for (; x < 16; x++) { #ifdef LTC_FAST for (y = 0; y < 16; y += sizeof(LTC_FAST_TYPE)) { - *((LTC_FAST_TYPE *)(lrw->pad + y)) ^= *((LTC_FAST_TYPE *)(&lrw->PC[x][lrw->IV[x]][y])) ^ *((LTC_FAST_TYPE *)(&lrw->PC[x][(lrw->IV[x]-1)&255][y])); + *(LTC_FAST_TYPE_PTR_CAST(lrw->pad + y)) ^= *(LTC_FAST_TYPE_PTR_CAST(&lrw->PC[x][lrw->IV[x]][y])) ^ *(LTC_FAST_TYPE_PTR_CAST(&lrw->PC[x][(lrw->IV[x]-1)&255][y])); } #else for (y = 0; y < 16; y++) { @@ -75,7 +73,7 @@ int lrw_process(const unsigned char *pt, unsigned char *ct, unsigned long len, i /* xor prod */ #ifdef LTC_FAST for (x = 0; x < 16; x += sizeof(LTC_FAST_TYPE)) { - *((LTC_FAST_TYPE *)(ct + x)) = *((LTC_FAST_TYPE *)(pt + x)) ^ *((LTC_FAST_TYPE *)(prod + x)); + *(LTC_FAST_TYPE_PTR_CAST(ct + x)) = *(LTC_FAST_TYPE_PTR_CAST(pt + x)) ^ *(LTC_FAST_TYPE_PTR_CAST(prod + x)); } #else for (x = 0; x < 16; x++) { @@ -92,19 +90,19 @@ int lrw_process(const unsigned char *pt, unsigned char *ct, unsigned long len, i if ((err = cipher_descriptor[lrw->cipher].ecb_decrypt(ct, ct, &lrw->key)) != CRYPT_OK) { return err; } - } + } /* xor prod */ #ifdef LTC_FAST for (x = 0; x < 16; x += sizeof(LTC_FAST_TYPE)) { - *((LTC_FAST_TYPE *)(ct + x)) = *((LTC_FAST_TYPE *)(ct + x)) ^ *((LTC_FAST_TYPE *)(prod + x)); + *(LTC_FAST_TYPE_PTR_CAST(ct + x)) = *(LTC_FAST_TYPE_PTR_CAST(ct + x)) ^ *(LTC_FAST_TYPE_PTR_CAST(prod + x)); } #else for (x = 0; x < 16; x++) { ct[x] = ct[x] ^ prod[x]; } #endif - + /* move to next */ pt += 16; ct += 16; @@ -113,8 +111,8 @@ int lrw_process(const unsigned char *pt, unsigned char *ct, unsigned long len, i return CRYPT_OK; } - + #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/modes/lrw/lrw_setiv.c b/libtomcrypt/src/modes/lrw/lrw_setiv.c index 2ff9a80..5c04157 100644 --- a/libtomcrypt/src/modes/lrw/lrw_setiv.c +++ b/libtomcrypt/src/modes/lrw/lrw_setiv.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" @@ -27,7 +25,7 @@ int lrw_setiv(const unsigned char *IV, unsigned long len, symmetric_LRW *lrw) { int err; -#ifdef LRW_TABLES +#ifdef LTC_LRW_TABLES unsigned char T[16]; int x, y; #endif @@ -51,12 +49,12 @@ int lrw_setiv(const unsigned char *IV, unsigned long len, symmetric_LRW *lrw) return CRYPT_OK; } -#ifdef LRW_TABLES +#ifdef LTC_LRW_TABLES XMEMCPY(T, &lrw->PC[0][IV[0]][0], 16); for (x = 1; x < 16; x++) { #ifdef LTC_FAST for (y = 0; y < 16; y += sizeof(LTC_FAST_TYPE)) { - *((LTC_FAST_TYPE *)(T + y)) ^= *((LTC_FAST_TYPE *)(&lrw->PC[x][IV[x]][y])); + *(LTC_FAST_TYPE_PTR_CAST(T + y)) ^= *(LTC_FAST_TYPE_PTR_CAST(&lrw->PC[x][IV[x]][y])); } #else for (y = 0; y < 16; y++) { @@ -65,8 +63,8 @@ int lrw_setiv(const unsigned char *IV, unsigned long len, symmetric_LRW *lrw) #endif } XMEMCPY(lrw->pad, T, 16); -#else - gcm_gf_mult(lrw->tweak, IV, lrw->pad); +#else + gcm_gf_mult(lrw->tweak, IV, lrw->pad); #endif return CRYPT_OK; @@ -74,6 +72,6 @@ int lrw_setiv(const unsigned char *IV, unsigned long len, symmetric_LRW *lrw) #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/modes/lrw/lrw_start.c b/libtomcrypt/src/modes/lrw/lrw_start.c index f378789..e13d3bd 100644 --- a/libtomcrypt/src/modes/lrw/lrw_start.c +++ b/libtomcrypt/src/modes/lrw/lrw_start.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" @@ -19,9 +17,9 @@ /** Initialize the LRW context - @param cipher The cipher desired, must be a 128-bit block cipher + @param cipher The cipher desired, must be a 128-bit block cipher @param IV The index value, must be 128-bits - @param key The cipher key + @param key The cipher key @param keylen The length of the cipher key in octets @param tweak The tweak value (second key), must be 128-bits @param num_rounds The number of rounds for the cipher (0 == default) @@ -32,19 +30,19 @@ int lrw_start( int cipher, const unsigned char *IV, const unsigned char *key, int keylen, const unsigned char *tweak, - int num_rounds, + int num_rounds, symmetric_LRW *lrw) { int err; -#ifdef LRW_TABLES +#ifdef LTC_LRW_TABLES unsigned char B[16]; int x, y, z, t; #endif - LTC_ARGCHK(IV != NULL); - LTC_ARGCHK(key != NULL); - LTC_ARGCHK(tweak != NULL); - LTC_ARGCHK(lrw != NULL); + LTC_ARGCHK(IV != NULL); + LTC_ARGCHK(key != NULL); + LTC_ARGCHK(tweak != NULL); + LTC_ARGCHK(lrw != NULL); #ifdef LTC_FAST if (16 % sizeof(LTC_FAST_TYPE)) { @@ -69,7 +67,7 @@ int lrw_start( int cipher, /* copy the IV and tweak */ XMEMCPY(lrw->tweak, tweak, 16); -#ifdef LRW_TABLES +#ifdef LTC_LRW_TABLES /* setup tables */ /* generate the first table as it has no shifting (from which we make the other tables) */ zeromem(B, 16); @@ -88,8 +86,8 @@ int lrw_start( int cipher, } lrw->PC[x][y][0] = gcm_shift_table[t<<1]; lrw->PC[x][y][1] ^= gcm_shift_table[(t<<1)+1]; - } - } + } + } #endif /* generate first pad */ @@ -98,6 +96,6 @@ int lrw_start( int cipher, #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/modes/lrw/lrw_test.c b/libtomcrypt/src/modes/lrw/lrw_test.c index 63e014a..7762d47 100644 --- a/libtomcrypt/src/modes/lrw/lrw_test.c +++ b/libtomcrypt/src/modes/lrw/lrw_test.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" @@ -88,7 +86,7 @@ int lrw_test(void) } /* check pad against expected tweak */ - if (XMEMCMP(tests[x].expected_tweak, lrw.pad, 16)) { + if (compare_testvector(tests[x].expected_tweak, 16, lrw.pad, 16, "LRW Tweak", x)) { lrw_done(&lrw); return CRYPT_FAIL_TESTVECTOR; } @@ -99,13 +97,13 @@ int lrw_test(void) return err; } - if (XMEMCMP(buf[0], tests[x].C, 16)) { + if (compare_testvector(buf[0], 16, tests[x].C, 16, "LRW Encrypt", x)) { lrw_done(&lrw); return CRYPT_FAIL_TESTVECTOR; } /* process block */ - if ((err = lrw_setiv(tests[x].IV, 16, &lrw)) != CRYPT_OK) { + if ((err = lrw_setiv(tests[x].IV, 16, &lrw)) != CRYPT_OK) { lrw_done(&lrw); return err; } @@ -115,15 +113,15 @@ int lrw_test(void) return err; } - if (XMEMCMP(buf[1], tests[x].P, 16)) { + if (compare_testvector(buf[1], 16, tests[x].P, 16, "LRW Decrypt", x)) { lrw_done(&lrw); return CRYPT_FAIL_TESTVECTOR; } if ((err = lrw_done(&lrw)) != CRYPT_OK) { return err; } - } - return CRYPT_OK; + } + return CRYPT_OK; #endif } @@ -131,6 +129,6 @@ int lrw_test(void) -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/modes/ofb/ofb_decrypt.c b/libtomcrypt/src/modes/ofb/ofb_decrypt.c index 2c8780e..f402802 100644 --- a/libtomcrypt/src/modes/ofb/ofb_decrypt.c +++ b/libtomcrypt/src/modes/ofb/ofb_decrypt.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" @@ -36,8 +34,8 @@ int ofb_decrypt(const unsigned char *ct, unsigned char *pt, unsigned long len, s #endif - -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ + +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/modes/ofb/ofb_done.c b/libtomcrypt/src/modes/ofb/ofb_done.c index 10506b3..9caddbe 100644 --- a/libtomcrypt/src/modes/ofb/ofb_done.c +++ b/libtomcrypt/src/modes/ofb/ofb_done.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" @@ -33,10 +31,10 @@ int ofb_done(symmetric_OFB *ofb) return CRYPT_OK; } - + #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/modes/ofb/ofb_encrypt.c b/libtomcrypt/src/modes/ofb/ofb_encrypt.c index 8c97a4d..415842d 100644 --- a/libtomcrypt/src/modes/ofb/ofb_encrypt.c +++ b/libtomcrypt/src/modes/ofb/ofb_encrypt.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" @@ -34,13 +32,13 @@ int ofb_encrypt(const unsigned char *pt, unsigned char *ct, unsigned long len, s if ((err = cipher_is_valid(ofb->cipher)) != CRYPT_OK) { return err; } - + /* is blocklen/padlen valid? */ if (ofb->blocklen < 0 || ofb->blocklen > (int)sizeof(ofb->IV) || ofb->padlen < 0 || ofb->padlen > (int)sizeof(ofb->IV)) { return CRYPT_INVALID_ARG; } - + while (len-- > 0) { if (ofb->padlen == ofb->blocklen) { if ((err = cipher_descriptor[ofb->cipher].ecb_encrypt(ofb->IV, ofb->IV, &ofb->key)) != CRYPT_OK) { @@ -55,6 +53,6 @@ int ofb_encrypt(const unsigned char *pt, unsigned char *ct, unsigned long len, s #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/modes/ofb/ofb_getiv.c b/libtomcrypt/src/modes/ofb/ofb_getiv.c index c009e33..e6bc0ed 100644 --- a/libtomcrypt/src/modes/ofb/ofb_getiv.c +++ b/libtomcrypt/src/modes/ofb/ofb_getiv.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" @@ -18,9 +16,9 @@ #ifdef LTC_OFB_MODE /** - Get the current initial vector - @param IV [out] The destination of the initial vector - @param len [in/out] The max size and resulting size of the initial vector + Get the current initialization vector + @param IV [out] The destination of the initialization vector + @param len [in/out] The max size and resulting size of the initialization vector @param ofb The OFB state @return CRYPT_OK if successful */ @@ -41,6 +39,6 @@ int ofb_getiv(unsigned char *IV, unsigned long *len, symmetric_OFB *ofb) #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/modes/ofb/ofb_setiv.c b/libtomcrypt/src/modes/ofb/ofb_setiv.c index 826caa9..005dbc7 100644 --- a/libtomcrypt/src/modes/ofb/ofb_setiv.c +++ b/libtomcrypt/src/modes/ofb/ofb_setiv.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" @@ -18,8 +16,8 @@ #ifdef LTC_OFB_MODE /** - Set an initial vector - @param IV The initial vector + Set an initialization vector + @param IV The initialization vector @param len The length of the vector (in octets) @param ofb The OFB state @return CRYPT_OK if successful @@ -44,9 +42,9 @@ int ofb_setiv(const unsigned char *IV, unsigned long len, symmetric_OFB *ofb) return cipher_descriptor[ofb->cipher].ecb_encrypt(IV, ofb->IV, &ofb->key); } -#endif +#endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/modes/ofb/ofb_start.c b/libtomcrypt/src/modes/ofb/ofb_start.c index cf87545..fe7a764 100644 --- a/libtomcrypt/src/modes/ofb/ofb_start.c +++ b/libtomcrypt/src/modes/ofb/ofb_start.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" @@ -21,14 +19,14 @@ /** Initialize a OFB context @param cipher The index of the cipher desired - @param IV The initial vector - @param key The secret key + @param IV The initialization vector + @param key The secret key @param keylen The length of the secret key (octets) @param num_rounds Number of rounds in the cipher desired (0 for default) @param ofb The OFB state to initialize @return CRYPT_OK if successful */ -int ofb_start(int cipher, const unsigned char *IV, const unsigned char *key, +int ofb_start(int cipher, const unsigned char *IV, const unsigned char *key, int keylen, int num_rounds, symmetric_OFB *ofb) { int x, err; @@ -55,6 +53,6 @@ int ofb_start(int cipher, const unsigned char *IV, const unsigned char *key, #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/modes/xts/xts_decrypt.c b/libtomcrypt/src/modes/xts/xts_decrypt.c index 3e46c53..4580991 100644 --- a/libtomcrypt/src/modes/xts/xts_decrypt.c +++ b/libtomcrypt/src/modes/xts/xts_decrypt.c @@ -5,18 +5,16 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" -/** - Source donated by Elliptic Semiconductor Inc (www.ellipticsemi.com) to the LibTom Projects -*/ +/** + Source donated by Elliptic Semiconductor Inc (www.ellipticsemi.com) to the LibTom Projects + */ #ifdef LTC_XTS_MODE -static int tweak_uncrypt(const unsigned char *C, unsigned char *P, unsigned char *T, symmetric_xts *xts) +static int _tweak_uncrypt(const unsigned char *C, unsigned char *P, unsigned char *T, symmetric_xts *xts) { unsigned long x; int err; @@ -24,23 +22,23 @@ static int tweak_uncrypt(const unsigned char *C, unsigned char *P, unsigned char /* tweak encrypt block i */ #ifdef LTC_FAST for (x = 0; x < 16; x += sizeof(LTC_FAST_TYPE)) { - *((LTC_FAST_TYPE*)&P[x]) = *((LTC_FAST_TYPE*)&C[x]) ^ *((LTC_FAST_TYPE*)&T[x]); + *(LTC_FAST_TYPE_PTR_CAST(&P[x])) = *(LTC_FAST_TYPE_PTR_CAST(&C[x])) ^ *(LTC_FAST_TYPE_PTR_CAST(&T[x])); } #else for (x = 0; x < 16; x++) { - P[x] = C[x] ^ T[x]; + P[x] = C[x] ^ T[x]; } #endif - - err = cipher_descriptor[xts->cipher].ecb_decrypt(P, P, &xts->key1); + + err = cipher_descriptor[xts->cipher].ecb_decrypt(P, P, &xts->key1); #ifdef LTC_FAST for (x = 0; x < 16; x += sizeof(LTC_FAST_TYPE)) { - *((LTC_FAST_TYPE*)&P[x]) ^= *((LTC_FAST_TYPE*)&T[x]); + *(LTC_FAST_TYPE_PTR_CAST(&P[x])) ^= *(LTC_FAST_TYPE_PTR_CAST(&T[x])); } #else for (x = 0; x < 16; x++) { - P[x] = P[x] ^ T[x]; + P[x] = P[x] ^ T[x]; } #endif @@ -48,30 +46,28 @@ static int tweak_uncrypt(const unsigned char *C, unsigned char *P, unsigned char xts_mult_x(T); return err; -} +} /** XTS Decryption - @param ct [in] Ciphertext - @param ptlen Length of plaintext (and ciphertext) - @param pt [out] Plaintext - @param tweak [in] The 128--bit encryption tweak (e.g. sector number) - @param xts The XTS structure - Returns CRYPT_OK upon success -*/int xts_decrypt( - const unsigned char *ct, unsigned long ptlen, - unsigned char *pt, - const unsigned char *tweak, - symmetric_xts *xts) + @param ct [in] Ciphertext + @param ptlen Length of plaintext (and ciphertext) + @param pt [out] Plaintext + @param tweak [in] The 128--bit encryption tweak (e.g. sector number) + @param xts The XTS structure + Returns CRYPT_OK upon success + */ +int xts_decrypt(const unsigned char *ct, unsigned long ptlen, unsigned char *pt, unsigned char *tweak, + symmetric_xts *xts) { unsigned char PP[16], CC[16], T[16]; unsigned long i, m, mo, lim; - int err; + int err; /* check inputs */ - LTC_ARGCHK(pt != NULL); - LTC_ARGCHK(ct != NULL); + LTC_ARGCHK(pt != NULL); + LTC_ARGCHK(ct != NULL); LTC_ARGCHK(tweak != NULL); - LTC_ARGCHK(xts != NULL); + LTC_ARGCHK(xts != NULL); /* check if valid */ if ((err = cipher_is_valid(xts->cipher)) != CRYPT_OK) { @@ -79,7 +75,7 @@ static int tweak_uncrypt(const unsigned char *C, unsigned char *P, unsigned char } /* get number of blocks */ - m = ptlen >> 4; + m = ptlen >> 4; mo = ptlen & 15; /* must have at least one full block */ @@ -87,55 +83,74 @@ static int tweak_uncrypt(const unsigned char *C, unsigned char *P, unsigned char return CRYPT_INVALID_ARG; } - /* encrypt the tweak */ - if ((err = cipher_descriptor[xts->cipher].ecb_encrypt(tweak, T, &xts->key2)) != CRYPT_OK) { - return err; - } - - /* for i = 0 to m-2 do */ if (mo == 0) { lim = m; } else { lim = m - 1; } - for (i = 0; i < lim; i++) { - err = tweak_uncrypt(ct, pt, T, xts); - ct += 16; - pt += 16; + if (cipher_descriptor[xts->cipher].accel_xts_decrypt && lim > 0) { + + /* use accelerated decryption for whole blocks */ + if ((err = cipher_descriptor[xts->cipher].accel_xts_decrypt(ct, pt, lim, tweak, &xts->key1, &xts->key2)) != + CRYPT_OK) { + return err; + } + ct += lim * 16; + pt += lim * 16; + + /* tweak is encrypted on output */ + XMEMCPY(T, tweak, sizeof(T)); + } else { + /* encrypt the tweak */ + if ((err = cipher_descriptor[xts->cipher].ecb_encrypt(tweak, T, &xts->key2)) != CRYPT_OK) { + return err; + } + + for (i = 0; i < lim; i++) { + if ((err = _tweak_uncrypt(ct, pt, T, xts)) != CRYPT_OK) { + return err; + } + ct += 16; + pt += 16; + } } - + /* if ptlen not divide 16 then */ if (mo > 0) { XMEMCPY(CC, T, 16); xts_mult_x(CC); /* PP = tweak decrypt block m-1 */ - if ((err = tweak_uncrypt(ct, PP, CC, xts)) != CRYPT_OK) { + if ((err = _tweak_uncrypt(ct, PP, CC, xts)) != CRYPT_OK) { return err; } /* Pm = first ptlen % 16 bytes of PP */ for (i = 0; i < mo; i++) { - CC[i] = ct[16+i]; - pt[16+i] = PP[i]; + CC[i] = ct[16 + i]; + pt[16 + i] = PP[i]; } for (; i < 16; i++) { - CC[i] = PP[i]; + CC[i] = PP[i]; } /* Pm-1 = Tweak uncrypt CC */ - if ((err = tweak_uncrypt(CC, pt, T, xts)) != CRYPT_OK) { + if ((err = _tweak_uncrypt(CC, pt, T, xts)) != CRYPT_OK) { return err; } } + /* Decrypt the tweak back */ + if ((err = cipher_descriptor[xts->cipher].ecb_decrypt(T, tweak, &xts->key2)) != CRYPT_OK) { + return err; + } + return CRYPT_OK; } #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ - +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/modes/xts/xts_done.c b/libtomcrypt/src/modes/xts/xts_done.c index 7c04277..558c043 100644 --- a/libtomcrypt/src/modes/xts/xts_done.c +++ b/libtomcrypt/src/modes/xts/xts_done.c @@ -5,19 +5,17 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" -/** +/** Source donated by Elliptic Semiconductor Inc (www.ellipticsemi.com) to the LibTom Projects */ #ifdef LTC_XTS_MODE -/** Terminate XTS state - @param XTS The state to terminate +/** Terminate XTS state + @param xts The state to terminate */ void xts_done(symmetric_xts *xts) { @@ -28,7 +26,6 @@ void xts_done(symmetric_xts *xts) #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ - +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/modes/xts/xts_encrypt.c b/libtomcrypt/src/modes/xts/xts_encrypt.c index ab53d3c..787c302 100644 --- a/libtomcrypt/src/modes/xts/xts_encrypt.c +++ b/libtomcrypt/src/modes/xts/xts_encrypt.c @@ -5,18 +5,16 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" -/** - Source donated by Elliptic Semiconductor Inc (www.ellipticsemi.com) to the LibTom Projects -*/ +/** + Source donated by Elliptic Semiconductor Inc (www.ellipticsemi.com) to the LibTom Projects + */ #ifdef LTC_XTS_MODE -static int tweak_crypt(const unsigned char *P, unsigned char *C, unsigned char *T, symmetric_xts *xts) +static int _tweak_crypt(const unsigned char *P, unsigned char *C, unsigned char *T, symmetric_xts *xts) { unsigned long x; int err; @@ -24,25 +22,25 @@ static int tweak_crypt(const unsigned char *P, unsigned char *C, unsigned char * /* tweak encrypt block i */ #ifdef LTC_FAST for (x = 0; x < 16; x += sizeof(LTC_FAST_TYPE)) { - *((LTC_FAST_TYPE*)&C[x]) = *((LTC_FAST_TYPE*)&P[x]) ^ *((LTC_FAST_TYPE*)&T[x]); + *(LTC_FAST_TYPE_PTR_CAST(&C[x])) = *(LTC_FAST_TYPE_PTR_CAST(&P[x])) ^ *(LTC_FAST_TYPE_PTR_CAST(&T[x])); } #else for (x = 0; x < 16; x++) { C[x] = P[x] ^ T[x]; } #endif - + if ((err = cipher_descriptor[xts->cipher].ecb_encrypt(C, C, &xts->key1)) != CRYPT_OK) { return err; } #ifdef LTC_FAST for (x = 0; x < 16; x += sizeof(LTC_FAST_TYPE)) { - *((LTC_FAST_TYPE*)&C[x]) ^= *((LTC_FAST_TYPE*)&T[x]); + *(LTC_FAST_TYPE_PTR_CAST(&C[x])) ^= *(LTC_FAST_TYPE_PTR_CAST(&T[x])); } #else for (x = 0; x < 16; x++) { - C[x] = C[x] ^ T[x]; + C[x] = C[x] ^ T[x]; } #endif @@ -50,31 +48,28 @@ static int tweak_crypt(const unsigned char *P, unsigned char *C, unsigned char * xts_mult_x(T); return CRYPT_OK; -} +} /** XTS Encryption - @param pt [in] Plaintext - @param ptlen Length of plaintext (and ciphertext) - @param ct [out] Ciphertext - @param tweak [in] The 128--bit encryption tweak (e.g. sector number) - @param xts The XTS structure - Returns CRYPT_OK upon success -*/ -int xts_encrypt( - const unsigned char *pt, unsigned long ptlen, - unsigned char *ct, - const unsigned char *tweak, - symmetric_xts *xts) + @param pt [in] Plaintext + @param ptlen Length of plaintext (and ciphertext) + @param ct [out] Ciphertext + @param tweak [in] The 128--bit encryption tweak (e.g. sector number) + @param xts The XTS structure + Returns CRYPT_OK upon success + */ +int xts_encrypt(const unsigned char *pt, unsigned long ptlen, unsigned char *ct, unsigned char *tweak, + symmetric_xts *xts) { unsigned char PP[16], CC[16], T[16]; unsigned long i, m, mo, lim; - int err; + int err; /* check inputs */ - LTC_ARGCHK(pt != NULL); - LTC_ARGCHK(ct != NULL); + LTC_ARGCHK(pt != NULL); + LTC_ARGCHK(ct != NULL); LTC_ARGCHK(tweak != NULL); - LTC_ARGCHK(xts != NULL); + LTC_ARGCHK(xts != NULL); /* check if valid */ if ((err = cipher_is_valid(xts->cipher)) != CRYPT_OK) { @@ -82,61 +77,81 @@ int xts_encrypt( } /* get number of blocks */ - m = ptlen >> 4; + m = ptlen >> 4; mo = ptlen & 15; - /* must have at least one full block */ + /* must have at least one full block */ if (m == 0) { return CRYPT_INVALID_ARG; } - /* encrypt the tweak */ - if ((err = cipher_descriptor[xts->cipher].ecb_encrypt(tweak, T, &xts->key2)) != CRYPT_OK) { - return err; - } - - /* for i = 0 to m-2 do */ if (mo == 0) { lim = m; } else { lim = m - 1; } - for (i = 0; i < lim; i++) { - err = tweak_crypt(pt, ct, T, xts); - ct += 16; - pt += 16; + if (cipher_descriptor[xts->cipher].accel_xts_encrypt && lim > 0) { + + /* use accelerated encryption for whole blocks */ + if ((err = cipher_descriptor[xts->cipher].accel_xts_encrypt(pt, ct, lim, tweak, &xts->key1, &xts->key2)) != + CRYPT_OK) { + return err; + } + ct += lim * 16; + pt += lim * 16; + + /* tweak is encrypted on output */ + XMEMCPY(T, tweak, sizeof(T)); + } else { + + /* encrypt the tweak */ + if ((err = cipher_descriptor[xts->cipher].ecb_encrypt(tweak, T, &xts->key2)) != CRYPT_OK) { + return err; + } + + for (i = 0; i < lim; i++) { + if ((err = _tweak_crypt(pt, ct, T, xts)) != CRYPT_OK) { + return err; + } + ct += 16; + pt += 16; + } } - + /* if ptlen not divide 16 then */ if (mo > 0) { /* CC = tweak encrypt block m-1 */ - if ((err = tweak_crypt(pt, CC, T, xts)) != CRYPT_OK) { + if ((err = _tweak_crypt(pt, CC, T, xts)) != CRYPT_OK) { return err; } /* Cm = first ptlen % 16 bytes of CC */ for (i = 0; i < mo; i++) { - PP[i] = pt[16+i]; - ct[16+i] = CC[i]; + PP[i] = pt[16 + i]; + ct[16 + i] = CC[i]; } for (; i < 16; i++) { - PP[i] = CC[i]; + PP[i] = CC[i]; } /* Cm-1 = Tweak encrypt PP */ - if ((err = tweak_crypt(PP, ct, T, xts)) != CRYPT_OK) { + if ((err = _tweak_crypt(PP, ct, T, xts)) != CRYPT_OK) { return err; } } + /* Decrypt the tweak back */ + if ((err = cipher_descriptor[xts->cipher].ecb_decrypt(T, tweak, &xts->key2)) != CRYPT_OK) { + return err; + } + return err; } #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ - +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/modes/xts/xts_init.c b/libtomcrypt/src/modes/xts/xts_init.c index f38c01e..be0ac6a 100644 --- a/libtomcrypt/src/modes/xts/xts_init.c +++ b/libtomcrypt/src/modes/xts/xts_init.c @@ -5,18 +5,15 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" -/** +/** Source donated by Elliptic Semiconductor Inc (www.ellipticsemi.com) to the LibTom Projects */ #ifdef LTC_XTS_MODE - /** Start XTS mode @param cipher The index of the cipher to use @param key1 The encrypt key @@ -26,19 +23,15 @@ @param xts [out] XTS structure Returns CRYPT_OK upon success. */ -int xts_start( int cipher, - const unsigned char *key1, - const unsigned char *key2, - unsigned long keylen, - int num_rounds, - symmetric_xts *xts) +int xts_start(int cipher, const unsigned char *key1, const unsigned char *key2, unsigned long keylen, int num_rounds, + symmetric_xts *xts) { int err; /* check inputs */ - LTC_ARGCHK(key1 != NULL); - LTC_ARGCHK(key2 != NULL); - LTC_ARGCHK(xts != NULL); + LTC_ARGCHK(key1 != NULL); + LTC_ARGCHK(key2 != NULL); + LTC_ARGCHK(xts != NULL); /* check if valid */ if ((err = cipher_is_valid(cipher)) != CRYPT_OK) { @@ -63,7 +56,6 @@ int xts_start( int cipher, #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ - +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/modes/xts/xts_mult_x.c b/libtomcrypt/src/modes/xts/xts_mult_x.c index e5b7c11..3fad22b 100644 --- a/libtomcrypt/src/modes/xts/xts_mult_x.c +++ b/libtomcrypt/src/modes/xts/xts_mult_x.c @@ -5,38 +5,35 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" -/** +/** Source donated by Elliptic Semiconductor Inc (www.ellipticsemi.com) to the LibTom Projects */ #ifdef LTC_XTS_MODE -/** multiply by x +/** multiply by x @param I The value to multiply by x (LFSR shift) */ void xts_mult_x(unsigned char *I) { - int x; - unsigned char t, tt; + int x; + unsigned char t, tt; - for (x = t = 0; x < 16; x++) { - tt = I[x] >> 7; - I[x] = ((I[x] << 1) | t) & 0xFF; - t = tt; - } - if (tt) { - I[0] ^= 0x87; - } + for (x = t = 0; x < 16; x++) { + tt = I[x] >> 7; + I[x] = ((I[x] << 1) | t) & 0xFF; + t = tt; + } + if (tt) { + I[0] ^= 0x87; + } } #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ - +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/modes/xts/xts_test.c b/libtomcrypt/src/modes/xts/xts_test.c index b91e0f4..347fb4b 100644 --- a/libtomcrypt/src/modes/xts/xts_test.c +++ b/libtomcrypt/src/modes/xts/xts_test.c @@ -5,15 +5,70 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" #ifdef LTC_XTS_MODE -/** +#ifndef LTC_NO_TEST +static int _xts_test_accel_xts_encrypt(const unsigned char *pt, unsigned char *ct, unsigned long blocks, + unsigned char *tweak, symmetric_key *skey1, symmetric_key *skey2) +{ + int ret; + symmetric_xts xts; + int (*orig)(const unsigned char *, unsigned char *, + unsigned long , unsigned char *, symmetric_key *, + symmetric_key *); + + /* AES can be under rijndael or aes... try to find it */ + if ((xts.cipher = find_cipher("aes")) == -1) { + if ((xts.cipher = find_cipher("rijndael")) == -1) { + return CRYPT_NOP; + } + } + orig = cipher_descriptor[xts.cipher].accel_xts_encrypt; + cipher_descriptor[xts.cipher].accel_xts_encrypt = NULL; + + XMEMCPY(&xts.key1, skey1, sizeof(symmetric_key)); + XMEMCPY(&xts.key2, skey2, sizeof(symmetric_key)); + + ret = xts_encrypt(pt, blocks << 4, ct, tweak, &xts); + cipher_descriptor[xts.cipher].accel_xts_encrypt = orig; + + return ret; +} + +static int _xts_test_accel_xts_decrypt(const unsigned char *ct, unsigned char *pt, unsigned long blocks, + unsigned char *tweak, symmetric_key *skey1, symmetric_key *skey2) +{ + int ret; + symmetric_xts xts; + int (*orig)(const unsigned char *, unsigned char *, + unsigned long , unsigned char *, symmetric_key *, + symmetric_key *); + + /* AES can be under rijndael or aes... try to find it */ + if ((xts.cipher = find_cipher("aes")) == -1) { + if ((xts.cipher = find_cipher("rijndael")) == -1) { + return CRYPT_NOP; + } + } + orig = cipher_descriptor[xts.cipher].accel_xts_decrypt; + cipher_descriptor[xts.cipher].accel_xts_decrypt = NULL; + + XMEMCPY(&xts.key1, skey1, sizeof(symmetric_key)); + XMEMCPY(&xts.key2, skey2, sizeof(symmetric_key)); + + ret = xts_decrypt(ct, blocks << 4, pt, tweak, &xts); + cipher_descriptor[xts.cipher].accel_xts_decrypt = orig; + + return ret; +} +#endif + +/** Source donated by Elliptic Semiconductor Inc (www.ellipticsemi.com) to the LibTom Projects + Returns CRYPT_OK upon success. */ int xts_test(void) @@ -21,7 +76,8 @@ int xts_test(void) #ifdef LTC_NO_TEST return CRYPT_NOP; #else - static const struct { + static const struct + { int keylen; unsigned char key1[32]; unsigned char key2[32]; @@ -142,50 +198,102 @@ int xts_test(void) }, }; - unsigned char OUT[512], T[16]; - ulong64 seq; + unsigned char OUT[512], Torg[16], T[16]; + ulong64 seq; symmetric_xts xts; - int i, err, idx; + int i, j, k, err, idx; + unsigned long len; - /* AES can be under rijndael or aes... try to find it */ + /* AES can be under rijndael or aes... try to find it */ if ((idx = find_cipher("aes")) == -1) { if ((idx = find_cipher("rijndael")) == -1) { return CRYPT_NOP; } } + for (k = 0; k < 4; ++k) { + cipher_descriptor[idx].accel_xts_encrypt = NULL; + cipher_descriptor[idx].accel_xts_decrypt = NULL; + if (k & 0x1) { + cipher_descriptor[idx].accel_xts_encrypt = _xts_test_accel_xts_encrypt; + } + if (k & 0x2) { + cipher_descriptor[idx].accel_xts_decrypt = _xts_test_accel_xts_decrypt; + } + for (j = 0; j < 2; j++) { + for (i = 0; i < (int)(sizeof(tests) / sizeof(tests[0])); i++) { + /* skip the cases where + * the length is smaller than 2*blocklen + * or the length is not a multiple of 32 + */ + if ((j == 1) && ((tests[i].PTLEN < 32) || (tests[i].PTLEN % 32))) { + continue; + } + if ((k > 0) && (j == 1)) { + continue; + } + len = tests[i].PTLEN / 2; + + err = xts_start(idx, tests[i].key1, tests[i].key2, tests[i].keylen / 2, 0, &xts); + if (err != CRYPT_OK) { + return err; + } + + seq = tests[i].seqnum; + STORE64L(seq, Torg); + XMEMSET(Torg + 8, 0, 8); + + XMEMCPY(T, Torg, sizeof(T)); + if (j == 0) { + err = xts_encrypt(tests[i].PTX, tests[i].PTLEN, OUT, T, &xts); + if (err != CRYPT_OK) { + xts_done(&xts); + return err; + } + } else { + err = xts_encrypt(tests[i].PTX, len, OUT, T, &xts); + if (err != CRYPT_OK) { + xts_done(&xts); + return err; + } + err = xts_encrypt(&tests[i].PTX[len], len, &OUT[len], T, &xts); + if (err != CRYPT_OK) { + xts_done(&xts); + return err; + } + } - for (i = 0; i < (int)(sizeof(tests)/sizeof(tests[0])); i++) { - err = xts_start(idx, tests[i].key1, tests[i].key2, tests[i].keylen/2, 0, &xts); - if (err != CRYPT_OK) { - return err; - } - - seq = tests[i].seqnum; - STORE64L(seq,T); - XMEMSET(T+8, 0, 8); - - err = xts_encrypt(tests[i].PTX, tests[i].PTLEN, OUT, T, &xts); - if (err != CRYPT_OK) { - xts_done(&xts); - return err; - } - - if (XMEMCMP(OUT, tests[i].CTX, tests[i].PTLEN)) { - xts_done(&xts); - return CRYPT_FAIL_TESTVECTOR; - } - - err = xts_decrypt(tests[i].CTX, tests[i].PTLEN, OUT, T, &xts); - if (err != CRYPT_OK) { - xts_done(&xts); - return err; - } - - if (XMEMCMP(OUT, tests[i].PTX, tests[i].PTLEN)) { - xts_done(&xts); - return CRYPT_FAIL_TESTVECTOR; - } - xts_done(&xts); + if (compare_testvector(OUT, tests[i].PTLEN, tests[i].CTX, tests[i].PTLEN, "XTS encrypt", i)) { + xts_done(&xts); + return CRYPT_FAIL_TESTVECTOR; + } + + XMEMCPY(T, Torg, sizeof(T)); + if (j == 0) { + err = xts_decrypt(tests[i].CTX, tests[i].PTLEN, OUT, T, &xts); + if (err != CRYPT_OK) { + xts_done(&xts); + return err; + } + } else { + err = xts_decrypt(tests[i].CTX, len, OUT, T, &xts); + if (err != CRYPT_OK) { + xts_done(&xts); + return err; + } + err = xts_decrypt(&tests[i].CTX[len], len, &OUT[len], T, &xts); + if (err != CRYPT_OK) { + xts_done(&xts); + return err; + } + } + + if (compare_testvector(OUT, tests[i].PTLEN, tests[i].PTX, tests[i].PTLEN, "XTS decrypt", i)) { + xts_done(&xts); + return CRYPT_FAIL_TESTVECTOR; + } + xts_done(&xts); + } + } } return CRYPT_OK; #endif @@ -193,7 +301,6 @@ int xts_test(void) #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ - +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/pk/asn1/der/bit/der_decode_bit_string.c b/libtomcrypt/src/pk/asn1/der/bit/der_decode_bit_string.c index bace8c8..5203fcf 100644 --- a/libtomcrypt/src/pk/asn1/der/bit/der_decode_bit_string.c +++ b/libtomcrypt/src/pk/asn1/der/bit/der_decode_bit_string.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" @@ -45,8 +43,8 @@ int der_decode_bit_string(const unsigned char *in, unsigned long inlen, return CRYPT_INVALID_PACKET; } - /* offset in the data */ - x = 1; + /* offset in the data */ + x = 1; /* get the length of the data */ if (in[x] & 0x80) { @@ -67,7 +65,7 @@ int der_decode_bit_string(const unsigned char *in, unsigned long inlen, /* short format */ dlen = in[x++] & 0x7F; } - + /* is the data len too long or too short? */ if ((dlen == 0) || (dlen + x > inlen)) { return CRYPT_INVALID_PACKET; @@ -97,6 +95,6 @@ int der_decode_bit_string(const unsigned char *in, unsigned long inlen, #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/pk/asn1/der/bit/der_decode_raw_bit_string.c b/libtomcrypt/src/pk/asn1/der/bit/der_decode_raw_bit_string.c new file mode 100644 index 0000000..223899b --- /dev/null +++ b/libtomcrypt/src/pk/asn1/der/bit/der_decode_raw_bit_string.c @@ -0,0 +1,107 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + */ +#include "tomcrypt.h" + +/** + @file der_decode_bit_string.c + ASN.1 DER, encode a BIT STRING, Tom St Denis +*/ + + +#ifdef LTC_DER + +#define SETBIT(v, n) (v=((unsigned char)(v) | (1U << (unsigned char)(n)))) +#define CLRBIT(v, n) (v=((unsigned char)(v) & ~(1U << (unsigned char)(n)))) + +/** + Store a BIT STRING + @param in The DER encoded BIT STRING + @param inlen The size of the DER BIT STRING + @param out [out] The array of bits stored (8 per char) + @param outlen [in/out] The number of bits stored + @return CRYPT_OK if successful +*/ +int der_decode_raw_bit_string(const unsigned char *in, unsigned long inlen, + unsigned char *out, unsigned long *outlen) +{ + unsigned long dlen, blen, x, y; + + LTC_ARGCHK(in != NULL); + LTC_ARGCHK(out != NULL); + LTC_ARGCHK(outlen != NULL); + + /* packet must be at least 4 bytes */ + if (inlen < 4) { + return CRYPT_INVALID_ARG; + } + + /* check for 0x03 */ + if ((in[0]&0x1F) != 0x03) { + return CRYPT_INVALID_PACKET; + } + + /* offset in the data */ + x = 1; + + /* get the length of the data */ + if (in[x] & 0x80) { + /* long format get number of length bytes */ + y = in[x++] & 0x7F; + + /* invalid if 0 or > 2 */ + if (y == 0 || y > 2) { + return CRYPT_INVALID_PACKET; + } + + /* read the data len */ + dlen = 0; + while (y--) { + dlen = (dlen << 8) | (unsigned long)in[x++]; + } + } else { + /* short format */ + dlen = in[x++] & 0x7F; + } + + /* is the data len too long or too short? */ + if ((dlen == 0) || (dlen + x > inlen)) { + return CRYPT_INVALID_PACKET; + } + + /* get padding count */ + blen = ((dlen - 1) << 3) - (in[x++] & 7); + + /* too many bits? */ + if (blen > *outlen) { + *outlen = blen; + return CRYPT_BUFFER_OVERFLOW; + } + + /* decode/store the bits */ + for (y = 0; y < blen; y++) { + if (in[x] & (1 << (7 - (y & 7)))) { + SETBIT(out[y/8], 7-(y%8)); + } else { + CLRBIT(out[y/8], 7-(y%8)); + } + if ((y & 7) == 7) { + ++x; + } + } + + /* we done */ + *outlen = blen; + return CRYPT_OK; +} + +#endif + +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/pk/asn1/der/bit/der_encode_bit_string.c b/libtomcrypt/src/pk/asn1/der/bit/der_encode_bit_string.c index e64bd1f..c552184 100644 --- a/libtomcrypt/src/pk/asn1/der/bit/der_encode_bit_string.c +++ b/libtomcrypt/src/pk/asn1/der/bit/der_encode_bit_string.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" @@ -84,6 +82,6 @@ int der_encode_bit_string(const unsigned char *in, unsigned long inlen, #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/pk/asn1/der/bit/der_encode_raw_bit_string.c b/libtomcrypt/src/pk/asn1/der/bit/der_encode_raw_bit_string.c new file mode 100644 index 0000000..298c4e3 --- /dev/null +++ b/libtomcrypt/src/pk/asn1/der/bit/der_encode_raw_bit_string.c @@ -0,0 +1,90 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + */ +#include "tomcrypt.h" + +/** + @file der_encode_bit_string.c + ASN.1 DER, encode a BIT STRING, Tom St Denis +*/ + + +#ifdef LTC_DER + +#define getbit(n, k) (((n) & ( 1 << (k) )) >> (k)) + +/** + Store a BIT STRING + @param in The array of bits to store (8 per char) + @param inlen The number of bits to store + @param out [out] The destination for the DER encoded BIT STRING + @param outlen [in/out] The max size and resulting size of the DER BIT STRING + @return CRYPT_OK if successful +*/ +int der_encode_raw_bit_string(const unsigned char *in, unsigned long inlen, + unsigned char *out, unsigned long *outlen) +{ + unsigned long len, x, y; + unsigned char buf; + int err; + + LTC_ARGCHK(in != NULL); + LTC_ARGCHK(out != NULL); + LTC_ARGCHK(outlen != NULL); + + /* avoid overflows */ + if ((err = der_length_bit_string(inlen, &len)) != CRYPT_OK) { + return err; + } + + if (len > *outlen) { + *outlen = len; + return CRYPT_BUFFER_OVERFLOW; + } + + /* store header (include bit padding count in length) */ + x = 0; + y = (inlen >> 3) + ((inlen&7) ? 1 : 0) + 1; + + out[x++] = 0x03; + if (y < 128) { + out[x++] = (unsigned char)y; + } else if (y < 256) { + out[x++] = 0x81; + out[x++] = (unsigned char)y; + } else if (y < 65536) { + out[x++] = 0x82; + out[x++] = (unsigned char)((y>>8)&255); + out[x++] = (unsigned char)(y&255); + } + + /* store number of zero padding bits */ + out[x++] = (unsigned char)((8 - inlen) & 7); + + /* store the bits in big endian format */ + for (y = buf = 0; y < inlen; y++) { + buf |= (getbit(in[y/8],7-y%8)?1:0) << (7 - (y & 7)); + if ((y & 7) == 7) { + out[x++] = buf; + buf = 0; + } + } + /* store last byte */ + if (inlen & 7) { + out[x++] = buf; + } + + *outlen = x; + return CRYPT_OK; +} + +#endif + +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/pk/asn1/der/bit/der_length_bit_string.c b/libtomcrypt/src/pk/asn1/der/bit/der_length_bit_string.c index 3ec5f58..b9c99fb 100644 --- a/libtomcrypt/src/pk/asn1/der/bit/der_length_bit_string.c +++ b/libtomcrypt/src/pk/asn1/der/bit/der_length_bit_string.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" @@ -17,7 +15,7 @@ #ifdef LTC_DER /** - Gets length of DER encoding of BIT STRING + Gets length of DER encoding of BIT STRING @param nbits The number of bits in the string to encode @param outlen [out] The length of the DER encoding for the given string @return CRYPT_OK if successful @@ -29,7 +27,7 @@ int der_length_bit_string(unsigned long nbits, unsigned long *outlen) /* get the number of the bytes */ nbytes = (nbits >> 3) + ((nbits & 7) ? 1 : 0) + 1; - + if (nbytes < 128) { /* 03 LL PP DD DD DD ... */ *outlen = 2 + nbytes; @@ -49,6 +47,6 @@ int der_length_bit_string(unsigned long nbits, unsigned long *outlen) #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/pk/asn1/der/boolean/der_decode_boolean.c b/libtomcrypt/src/pk/asn1/der/boolean/der_decode_boolean.c index e7c5699..da60ca9 100644 --- a/libtomcrypt/src/pk/asn1/der/boolean/der_decode_boolean.c +++ b/libtomcrypt/src/pk/asn1/der/boolean/der_decode_boolean.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" @@ -30,18 +28,18 @@ int der_decode_boolean(const unsigned char *in, unsigned long inlen, { LTC_ARGCHK(in != NULL); LTC_ARGCHK(out != NULL); - - if (inlen != 3 || in[0] != 0x01 || in[1] != 0x01 || (in[2] != 0x00 && in[2] != 0xFF)) { + + if (inlen < 3 || in[0] != 0x01 || in[1] != 0x01 || (in[2] != 0x00 && in[2] != 0xFF)) { return CRYPT_INVALID_ARG; } - + *out = (in[2]==0xFF) ? 1 : 0; - + return CRYPT_OK; } #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/pk/asn1/der/boolean/der_encode_boolean.c b/libtomcrypt/src/pk/asn1/der/boolean/der_encode_boolean.c index b40fae6..c5cacdd 100644 --- a/libtomcrypt/src/pk/asn1/der/boolean/der_encode_boolean.c +++ b/libtomcrypt/src/pk/asn1/der/boolean/der_encode_boolean.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" @@ -25,27 +23,27 @@ @param outlen [in/out] The max size and resulting size of the DER BOOLEAN @return CRYPT_OK if successful */ -int der_encode_boolean(int in, +int der_encode_boolean(int in, unsigned char *out, unsigned long *outlen) { LTC_ARGCHK(outlen != NULL); LTC_ARGCHK(out != NULL); - + if (*outlen < 3) { *outlen = 3; return CRYPT_BUFFER_OVERFLOW; } - + *outlen = 3; out[0] = 0x01; out[1] = 0x01; out[2] = in ? 0xFF : 0x00; - + return CRYPT_OK; } #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/pk/asn1/der/boolean/der_length_boolean.c b/libtomcrypt/src/pk/asn1/der/boolean/der_length_boolean.c index 5437031..a1a3a7b 100644 --- a/libtomcrypt/src/pk/asn1/der/boolean/der_length_boolean.c +++ b/libtomcrypt/src/pk/asn1/der/boolean/der_length_boolean.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" @@ -17,7 +15,7 @@ #ifdef LTC_DER /** - Gets length of DER encoding of a BOOLEAN + Gets length of DER encoding of a BOOLEAN @param outlen [out] The length of the DER encoding @return CRYPT_OK if successful */ @@ -30,6 +28,6 @@ int der_length_boolean(unsigned long *outlen) #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/pk/asn1/der/choice/der_decode_choice.c b/libtomcrypt/src/pk/asn1/der/choice/der_decode_choice.c index 1220b37..0bfd3bb 100644 --- a/libtomcrypt/src/pk/asn1/der/choice/der_decode_choice.c +++ b/libtomcrypt/src/pk/asn1/der/choice/der_decode_choice.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" @@ -51,6 +49,16 @@ int der_decode_choice(const unsigned char *in, unsigned long *inlen, data = list[x].data; switch (list[x].type) { + case LTC_ASN1_BOOLEAN: + if (der_decode_boolean(in, *inlen, data) == CRYPT_OK) { + if (der_length_boolean(&z) == CRYPT_OK) { + list[x].used = 1; + *inlen = z; + return CRYPT_OK; + } + } + break; + case LTC_ASN1_INTEGER: if (der_decode_integer(in, *inlen, data) == CRYPT_OK) { if (der_length_integer(data, &z) == CRYPT_OK) { @@ -82,6 +90,17 @@ int der_decode_choice(const unsigned char *in, unsigned long *inlen, } break; + case LTC_ASN1_RAW_BIT_STRING: + if (der_decode_raw_bit_string(in, *inlen, data, &size) == CRYPT_OK) { + if (der_length_bit_string(size, &z) == CRYPT_OK) { + list[x].used = 1; + list[x].size = size; + *inlen = z; + return CRYPT_OK; + } + } + break; + case LTC_ASN1_OCTET_STRING: if (der_decode_octet_string(in, *inlen, data, &size) == CRYPT_OK) { if (der_length_octet_string(size, &z) == CRYPT_OK) { @@ -100,7 +119,7 @@ int der_decode_choice(const unsigned char *in, unsigned long *inlen, return CRYPT_OK; } break; - + case LTC_ASN1_OBJECT_IDENTIFIER: if (der_decode_object_identifier(in, *inlen, data, &size) == CRYPT_OK) { if (der_length_object_identifier(data, size, &z) == CRYPT_OK) { @@ -112,6 +131,17 @@ int der_decode_choice(const unsigned char *in, unsigned long *inlen, } break; + case LTC_ASN1_TELETEX_STRING: + if (der_decode_teletex_string(in, *inlen, data, &size) == CRYPT_OK) { + if (der_length_teletex_string(data, size, &z) == CRYPT_OK) { + list[x].used = 1; + list[x].size = size; + *inlen = z; + return CRYPT_OK; + } + } + break; + case LTC_ASN1_IA5_STRING: if (der_decode_ia5_string(in, *inlen, data, &size) == CRYPT_OK) { if (der_length_ia5_string(data, size, &z) == CRYPT_OK) { @@ -123,7 +153,6 @@ int der_decode_choice(const unsigned char *in, unsigned long *inlen, } break; - case LTC_ASN1_PRINTABLE_STRING: if (der_decode_printable_string(in, *inlen, data, &size) == CRYPT_OK) { if (der_length_printable_string(data, size, &z) == CRYPT_OK) { @@ -155,6 +184,15 @@ int der_decode_choice(const unsigned char *in, unsigned long *inlen, } break; + case LTC_ASN1_GENERALIZEDTIME: + z = *inlen; + if (der_decode_generalizedtime(in, &z, data) == CRYPT_OK) { + list[x].used = 1; + *inlen = z; + return CRYPT_OK; + } + break; + case LTC_ASN1_SET: case LTC_ASN1_SETOF: case LTC_ASN1_SEQUENCE: @@ -167,7 +205,10 @@ int der_decode_choice(const unsigned char *in, unsigned long *inlen, } break; - default: + case LTC_ASN1_CHOICE: + case LTC_ASN1_CONSTRUCTED: + case LTC_ASN1_CONTEXT_SPECIFIC: + case LTC_ASN1_EOL: return CRYPT_INVALID_ARG; } } @@ -177,6 +218,6 @@ int der_decode_choice(const unsigned char *in, unsigned long *inlen, #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/pk/asn1/der/generalizedtime/der_decode_generalizedtime.c b/libtomcrypt/src/pk/asn1/der/generalizedtime/der_decode_generalizedtime.c new file mode 100644 index 0000000..016a4c2 --- /dev/null +++ b/libtomcrypt/src/pk/asn1/der/generalizedtime/der_decode_generalizedtime.c @@ -0,0 +1,144 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + */ +#include "tomcrypt.h" + +/** + @file der_decode_generalizedtime.c + ASN.1 DER, decode a GeneralizedTime, Steffen Jaeckel + Based on der_decode_utctime.c +*/ + +#ifdef LTC_DER + +static int _char_to_int(unsigned char x) +{ + switch (x) { + case '0': return 0; + case '1': return 1; + case '2': return 2; + case '3': return 3; + case '4': return 4; + case '5': return 5; + case '6': return 6; + case '7': return 7; + case '8': return 8; + case '9': return 9; + default: return 100; + } +} + +#define DECODE_V(y, max) do {\ + y = _char_to_int(buf[x])*10 + _char_to_int(buf[x+1]); \ + if (y >= max) return CRYPT_INVALID_PACKET; \ + x += 2; \ +} while(0) + +#define DECODE_V4(y, max) do {\ + y = _char_to_int(buf[x])*1000 + _char_to_int(buf[x+1])*100 + _char_to_int(buf[x+2])*10 + _char_to_int(buf[x+3]); \ + if (y >= max) return CRYPT_INVALID_PACKET; \ + x += 4; \ +} while(0) + +/** + Decodes a Generalized time structure in DER format (reads all 6 valid encoding formats) + @param in Input buffer + @param inlen Length of input buffer in octets + @param out [out] Destination of Generalized time structure + @return CRYPT_OK if successful +*/ +int der_decode_generalizedtime(const unsigned char *in, unsigned long *inlen, + ltc_generalizedtime *out) +{ + unsigned char buf[32]; + unsigned long x; + int y; + + LTC_ARGCHK(in != NULL); + LTC_ARGCHK(inlen != NULL); + LTC_ARGCHK(out != NULL); + + /* check header */ + if (*inlen < 2UL || (in[1] >= sizeof(buf)) || ((in[1] + 2UL) > *inlen)) { + return CRYPT_INVALID_PACKET; + } + + /* decode the string */ + for (x = 0; x < in[1]; x++) { + y = der_ia5_value_decode(in[x+2]); + if (y == -1) { + return CRYPT_INVALID_PACKET; + } + if (!((y >= '0' && y <= '9') + || y == 'Z' || y == '.' + || y == '+' || y == '-')) { + return CRYPT_INVALID_PACKET; + } + buf[x] = y; + } + *inlen = 2 + x; + + if (x < 15) { + return CRYPT_INVALID_PACKET; + } + + /* possible encodings are +YYYYMMDDhhmmssZ +YYYYMMDDhhmmss+hh'mm' +YYYYMMDDhhmmss-hh'mm' +YYYYMMDDhhmmss.fsZ +YYYYMMDDhhmmss.fs+hh'mm' +YYYYMMDDhhmmss.fs-hh'mm' + + So let's do a trivial decode upto [including] ss + */ + + x = 0; + DECODE_V4(out->YYYY, 10000); + DECODE_V(out->MM, 13); + DECODE_V(out->DD, 32); + DECODE_V(out->hh, 24); + DECODE_V(out->mm, 60); + DECODE_V(out->ss, 60); + + /* clear fractional seconds info */ + out->fs = 0; + + /* now is it Z or . */ + if (buf[x] == 'Z') { + return CRYPT_OK; + } else if (buf[x] == '.') { + x++; + while (buf[x] >= '0' && buf[x] <= '9') { + unsigned fs = out->fs; + if (x >= sizeof(buf)) return CRYPT_INVALID_PACKET; + out->fs *= 10; + out->fs += _char_to_int(buf[x]); + if (fs > out->fs) return CRYPT_OVERFLOW; + x++; + } + } + + /* now is it Z, +, - */ + if (buf[x] == 'Z') { + return CRYPT_OK; + } else if (buf[x] == '+' || buf[x] == '-') { + out->off_dir = (buf[x++] == '+') ? 0 : 1; + DECODE_V(out->off_hh, 24); + DECODE_V(out->off_mm, 60); + return CRYPT_OK; + } else { + return CRYPT_INVALID_PACKET; + } +} + +#endif + +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/pk/asn1/der/generalizedtime/der_encode_generalizedtime.c b/libtomcrypt/src/pk/asn1/der/generalizedtime/der_encode_generalizedtime.c new file mode 100644 index 0000000..ddc472a --- /dev/null +++ b/libtomcrypt/src/pk/asn1/der/generalizedtime/der_encode_generalizedtime.c @@ -0,0 +1,108 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + */ +#include "tomcrypt.h" + +/** + @file der_encode_utctime.c + ASN.1 DER, encode a GeneralizedTime, Steffen Jaeckel + Based on der_encode_utctime.c +*/ + +#ifdef LTC_DER + +static const char * const baseten = "0123456789"; + +#define STORE_V(y) do {\ + out[x++] = der_ia5_char_encode(baseten[(y/10) % 10]); \ + out[x++] = der_ia5_char_encode(baseten[y % 10]); \ +} while(0) + +#define STORE_V4(y) do {\ + out[x++] = der_ia5_char_encode(baseten[(y/1000) % 10]); \ + out[x++] = der_ia5_char_encode(baseten[(y/100) % 10]); \ + out[x++] = der_ia5_char_encode(baseten[(y/10) % 10]); \ + out[x++] = der_ia5_char_encode(baseten[y % 10]); \ +} while(0) + +/** + Encodes a Generalized time structure in DER format + @param gtime The GeneralizedTime structure to encode + @param out The destination of the DER encoding of the GeneralizedTime structure + @param outlen [in/out] The length of the DER encoding + @return CRYPT_OK if successful +*/ +int der_encode_generalizedtime(ltc_generalizedtime *gtime, + unsigned char *out, unsigned long *outlen) +{ + unsigned long x, tmplen; + int err; + + LTC_ARGCHK(gtime != NULL); + LTC_ARGCHK(out != NULL); + LTC_ARGCHK(outlen != NULL); + + if ((err = der_length_generalizedtime(gtime, &tmplen)) != CRYPT_OK) { + return err; + } + if (tmplen > *outlen) { + *outlen = tmplen; + return CRYPT_BUFFER_OVERFLOW; + } + + /* store header */ + out[0] = 0x18; + + /* store values */ + x = 2; + STORE_V4(gtime->YYYY); + STORE_V(gtime->MM); + STORE_V(gtime->DD); + STORE_V(gtime->hh); + STORE_V(gtime->mm); + STORE_V(gtime->ss); + + if (gtime->fs) { + unsigned long divisor; + unsigned fs = gtime->fs; + unsigned len = 0; + out[x++] = der_ia5_char_encode('.'); + divisor = 1; + do { + fs /= 10; + divisor *= 10; + len++; + } while(fs != 0); + while (len-- > 1) { + divisor /= 10; + out[x++] = der_ia5_char_encode(baseten[(gtime->fs/divisor) % 10]); + } + out[x++] = der_ia5_char_encode(baseten[gtime->fs % 10]); + } + + if (gtime->off_mm || gtime->off_hh) { + out[x++] = der_ia5_char_encode(gtime->off_dir ? '-' : '+'); + STORE_V(gtime->off_hh); + STORE_V(gtime->off_mm); + } else { + out[x++] = der_ia5_char_encode('Z'); + } + + /* store length */ + out[1] = (unsigned char)(x - 2); + + /* all good let's return */ + *outlen = x; + return CRYPT_OK; +} + +#endif + +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/pk/asn1/der/generalizedtime/der_length_generalizedtime.c b/libtomcrypt/src/pk/asn1/der/generalizedtime/der_length_generalizedtime.c new file mode 100644 index 0000000..def6270 --- /dev/null +++ b/libtomcrypt/src/pk/asn1/der/generalizedtime/der_length_generalizedtime.c @@ -0,0 +1,58 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + */ +#include "tomcrypt.h" + +/** + @file der_length_utctime.c + ASN.1 DER, get length of GeneralizedTime, Steffen Jaeckel + Based on der_length_utctime.c +*/ + +#ifdef LTC_DER + +/** + Gets length of DER encoding of GeneralizedTime + @param gtime The GeneralizedTime structure to get the size of + @param outlen [out] The length of the DER encoding + @return CRYPT_OK if successful +*/ +int der_length_generalizedtime(ltc_generalizedtime *gtime, unsigned long *outlen) +{ + LTC_ARGCHK(outlen != NULL); + LTC_ARGCHK(gtime != NULL); + + if (gtime->fs == 0) { + /* we encode as YYYYMMDDhhmmssZ */ + *outlen = 2 + 14 + 1; + } else { + unsigned long len = 2 + 14 + 1; + unsigned fs = gtime->fs; + do { + fs /= 10; + len++; + } while(fs != 0); + if (gtime->off_hh == 0 && gtime->off_mm == 0) { + /* we encode as YYYYMMDDhhmmss.fsZ */ + len += 1; + } + else { + /* we encode as YYYYMMDDhhmmss.fs{+|-}hh'mm' */ + len += 5; + } + *outlen = len; + } + + return CRYPT_OK; +} + +#endif + +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/pk/asn1/der/ia5/der_decode_ia5_string.c b/libtomcrypt/src/pk/asn1/der/ia5/der_decode_ia5_string.c index 1880ada..c347251 100644 --- a/libtomcrypt/src/pk/asn1/der/ia5/der_decode_ia5_string.c +++ b/libtomcrypt/src/pk/asn1/der/ia5/der_decode_ia5_string.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" @@ -88,9 +86,9 @@ int der_decode_ia5_string(const unsigned char *in, unsigned long inlen, return CRYPT_OK; } - + #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/pk/asn1/der/ia5/der_encode_ia5_string.c b/libtomcrypt/src/pk/asn1/der/ia5/der_encode_ia5_string.c index 6009dbc..18b926e 100644 --- a/libtomcrypt/src/pk/asn1/der/ia5/der_encode_ia5_string.c +++ b/libtomcrypt/src/pk/asn1/der/ia5/der_encode_ia5_string.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" @@ -37,7 +35,7 @@ int der_encode_ia5_string(const unsigned char *in, unsigned long inlen, /* get the size */ if ((err = der_length_ia5_string(in, inlen, &len)) != CRYPT_OK) { - return err; + return err; } /* too big? */ @@ -80,6 +78,6 @@ int der_encode_ia5_string(const unsigned char *in, unsigned long inlen, #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/pk/asn1/der/ia5/der_length_ia5_string.c b/libtomcrypt/src/pk/asn1/der/ia5/der_length_ia5_string.c index f10c1b8..5f1a78d 100644 --- a/libtomcrypt/src/pk/asn1/der/ia5/der_length_ia5_string.c +++ b/libtomcrypt/src/pk/asn1/der/ia5/der_length_ia5_string.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" @@ -21,106 +19,106 @@ static const struct { int code, value; } ia5_table[] = { { '\0', 0 }, -{ '\a', 7 }, -{ '\b', 8 }, -{ '\t', 9 }, -{ '\n', 10 }, -{ '\f', 12 }, -{ '\r', 13 }, -{ ' ', 32 }, -{ '!', 33 }, -{ '"', 34 }, -{ '#', 35 }, -{ '$', 36 }, -{ '%', 37 }, -{ '&', 38 }, -{ '\'', 39 }, -{ '(', 40 }, -{ ')', 41 }, -{ '*', 42 }, -{ '+', 43 }, -{ ',', 44 }, -{ '-', 45 }, -{ '.', 46 }, -{ '/', 47 }, -{ '0', 48 }, -{ '1', 49 }, -{ '2', 50 }, -{ '3', 51 }, -{ '4', 52 }, -{ '5', 53 }, -{ '6', 54 }, -{ '7', 55 }, -{ '8', 56 }, -{ '9', 57 }, -{ ':', 58 }, -{ ';', 59 }, -{ '<', 60 }, -{ '=', 61 }, -{ '>', 62 }, -{ '?', 63 }, -{ '@', 64 }, -{ 'A', 65 }, -{ 'B', 66 }, -{ 'C', 67 }, -{ 'D', 68 }, -{ 'E', 69 }, -{ 'F', 70 }, -{ 'G', 71 }, -{ 'H', 72 }, -{ 'I', 73 }, -{ 'J', 74 }, -{ 'K', 75 }, -{ 'L', 76 }, -{ 'M', 77 }, -{ 'N', 78 }, -{ 'O', 79 }, -{ 'P', 80 }, -{ 'Q', 81 }, -{ 'R', 82 }, -{ 'S', 83 }, -{ 'T', 84 }, -{ 'U', 85 }, -{ 'V', 86 }, -{ 'W', 87 }, -{ 'X', 88 }, -{ 'Y', 89 }, -{ 'Z', 90 }, -{ '[', 91 }, -{ '\\', 92 }, -{ ']', 93 }, -{ '^', 94 }, -{ '_', 95 }, -{ '`', 96 }, -{ 'a', 97 }, -{ 'b', 98 }, -{ 'c', 99 }, -{ 'd', 100 }, -{ 'e', 101 }, -{ 'f', 102 }, -{ 'g', 103 }, -{ 'h', 104 }, -{ 'i', 105 }, -{ 'j', 106 }, -{ 'k', 107 }, -{ 'l', 108 }, -{ 'm', 109 }, -{ 'n', 110 }, -{ 'o', 111 }, -{ 'p', 112 }, -{ 'q', 113 }, -{ 'r', 114 }, -{ 's', 115 }, -{ 't', 116 }, -{ 'u', 117 }, -{ 'v', 118 }, -{ 'w', 119 }, -{ 'x', 120 }, -{ 'y', 121 }, -{ 'z', 122 }, -{ '{', 123 }, -{ '|', 124 }, -{ '}', 125 }, +{ '\a', 7 }, +{ '\b', 8 }, +{ '\t', 9 }, +{ '\n', 10 }, +{ '\f', 12 }, +{ '\r', 13 }, +{ ' ', 32 }, +{ '!', 33 }, +{ '"', 34 }, +{ '#', 35 }, +{ '$', 36 }, +{ '%', 37 }, +{ '&', 38 }, +{ '\'', 39 }, +{ '(', 40 }, +{ ')', 41 }, +{ '*', 42 }, +{ '+', 43 }, +{ ',', 44 }, +{ '-', 45 }, +{ '.', 46 }, +{ '/', 47 }, +{ '0', 48 }, +{ '1', 49 }, +{ '2', 50 }, +{ '3', 51 }, +{ '4', 52 }, +{ '5', 53 }, +{ '6', 54 }, +{ '7', 55 }, +{ '8', 56 }, +{ '9', 57 }, +{ ':', 58 }, +{ ';', 59 }, +{ '<', 60 }, +{ '=', 61 }, +{ '>', 62 }, +{ '?', 63 }, +{ '@', 64 }, +{ 'A', 65 }, +{ 'B', 66 }, +{ 'C', 67 }, +{ 'D', 68 }, +{ 'E', 69 }, +{ 'F', 70 }, +{ 'G', 71 }, +{ 'H', 72 }, +{ 'I', 73 }, +{ 'J', 74 }, +{ 'K', 75 }, +{ 'L', 76 }, +{ 'M', 77 }, +{ 'N', 78 }, +{ 'O', 79 }, +{ 'P', 80 }, +{ 'Q', 81 }, +{ 'R', 82 }, +{ 'S', 83 }, +{ 'T', 84 }, +{ 'U', 85 }, +{ 'V', 86 }, +{ 'W', 87 }, +{ 'X', 88 }, +{ 'Y', 89 }, +{ 'Z', 90 }, +{ '[', 91 }, +{ '\\', 92 }, +{ ']', 93 }, +{ '^', 94 }, +{ '_', 95 }, +{ '`', 96 }, +{ 'a', 97 }, +{ 'b', 98 }, +{ 'c', 99 }, +{ 'd', 100 }, +{ 'e', 101 }, +{ 'f', 102 }, +{ 'g', 103 }, +{ 'h', 104 }, +{ 'i', 105 }, +{ 'j', 106 }, +{ 'k', 107 }, +{ 'l', 108 }, +{ 'm', 109 }, +{ 'n', 110 }, +{ 'o', 111 }, +{ 'p', 112 }, +{ 'q', 113 }, +{ 'r', 114 }, +{ 's', 115 }, +{ 't', 116 }, +{ 'u', 117 }, +{ 'v', 118 }, +{ 'w', 119 }, +{ 'x', 120 }, +{ 'y', 121 }, +{ 'z', 122 }, +{ '{', 123 }, +{ '|', 124 }, +{ '}', 125 }, { '~', 126 } }; @@ -145,10 +143,10 @@ int der_ia5_value_decode(int v) } return -1; } - + /** - Gets length of DER encoding of IA5 STRING - @param octets The values you want to encode + Gets length of DER encoding of IA5 STRING + @param octets The values you want to encode @param noctets The number of octets in the string to encode @param outlen [out] The length of the DER encoding for the given string @return CRYPT_OK if successful @@ -189,6 +187,6 @@ int der_length_ia5_string(const unsigned char *octets, unsigned long noctets, un #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/pk/asn1/der/integer/der_decode_integer.c b/libtomcrypt/src/pk/asn1/der/integer/der_decode_integer.c index 0ed8ad7..88cf93f 100644 --- a/libtomcrypt/src/pk/asn1/der/integer/der_decode_integer.c +++ b/libtomcrypt/src/pk/asn1/der/integer/der_decode_integer.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" @@ -54,7 +52,7 @@ int der_decode_integer(const unsigned char *in, unsigned long inlen, void *num) if (x + z > inlen) { return CRYPT_INVALID_PACKET; } - + /* no so read it */ if ((err = mp_read_unsigned_bin(num, (unsigned char *)in + x, z)) != CRYPT_OK) { return err; @@ -62,7 +60,7 @@ int der_decode_integer(const unsigned char *in, unsigned long inlen, void *num) } else { /* long form */ z &= 0x7F; - + /* will number of length bytes overflow? (or > 4) */ if (((x + z) > inlen) || (z > 4) || (z == 0)) { return CRYPT_INVALID_PACKET; @@ -97,7 +95,7 @@ int der_decode_integer(const unsigned char *in, unsigned long inlen, void *num) return CRYPT_MEM; } mp_clear(tmp); - } + } return CRYPT_OK; @@ -105,6 +103,6 @@ int der_decode_integer(const unsigned char *in, unsigned long inlen, void *num) #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/pk/asn1/der/integer/der_encode_integer.c b/libtomcrypt/src/pk/asn1/der/integer/der_encode_integer.c index e80bb3c..a8bada5 100644 --- a/libtomcrypt/src/pk/asn1/der/integer/der_encode_integer.c +++ b/libtomcrypt/src/pk/asn1/der/integer/der_encode_integer.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" @@ -27,7 +25,7 @@ @return CRYPT_OK if successful */ int der_encode_integer(void *num, unsigned char *out, unsigned long *outlen) -{ +{ unsigned long tmplen, y; int err, leading_zero; @@ -97,7 +95,7 @@ int der_encode_integer(void *num, unsigned char *out, unsigned long *outlen) } } else if (mp_iszero(num) != LTC_MP_YES) { void *tmp; - + /* negative */ if (mp_init(&tmp) != CRYPT_OK) { return CRYPT_MEM; @@ -119,12 +117,12 @@ int der_encode_integer(void *num, unsigned char *out, unsigned long *outlen) } /* we good */ - *outlen = tmplen; + *outlen = tmplen; return CRYPT_OK; } #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/pk/asn1/der/integer/der_length_integer.c b/libtomcrypt/src/pk/asn1/der/integer/der_length_integer.c index 9d49683..753ef0e 100644 --- a/libtomcrypt/src/pk/asn1/der/integer/der_length_integer.c +++ b/libtomcrypt/src/pk/asn1/der/integer/der_length_integer.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" @@ -18,8 +16,8 @@ #ifdef LTC_DER /** - Gets length of DER encoding of num - @param num The int to get the size of + Gets length of DER encoding of num + @param num The int to get the size of @param outlen [out] The length of the DER encoding for the given integer @return CRYPT_OK if successful */ @@ -46,7 +44,6 @@ int der_length_integer(void *num, unsigned long *outlen) } else { /* it's negative */ /* find power of 2 that is a multiple of eight and greater than count bits */ - leading_zero = 0; z = mp_count_bits(num); z = z + (8 - (z & 7)); if (((mp_cnt_lsb(num)+1)==mp_count_bits(num)) && ((mp_count_bits(num)&7)==0)) --z; @@ -71,12 +68,12 @@ int der_length_integer(void *num, unsigned long *outlen) ++len; /* return length */ - *outlen = len; + *outlen = len; return CRYPT_OK; } #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/pk/asn1/der/object_identifier/der_decode_object_identifier.c b/libtomcrypt/src/pk/asn1/der/object_identifier/der_decode_object_identifier.c index 406acdc..75bc127 100644 --- a/libtomcrypt/src/pk/asn1/der/object_identifier/der_decode_object_identifier.c +++ b/libtomcrypt/src/pk/asn1/der/object_identifier/der_decode_object_identifier.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" @@ -28,6 +26,7 @@ int der_decode_object_identifier(const unsigned char *in, unsigned long inle unsigned long *words, unsigned long *outlen) { unsigned long x, y, t, len; + int err; LTC_ARGCHK(in != NULL); LTC_ARGCHK(words != NULL); @@ -40,6 +39,7 @@ int der_decode_object_identifier(const unsigned char *in, unsigned long inle /* must be room for at least two words */ if (*outlen < 2) { + *outlen = 2; return CRYPT_BUFFER_OVERFLOW; } @@ -48,19 +48,19 @@ int der_decode_object_identifier(const unsigned char *in, unsigned long inle if ((in[x++] & 0x1F) != 0x06) { return CRYPT_INVALID_PACKET; } - + /* get the length */ if (in[x] < 128) { - len = in[x++]; + len = in[x++]; } else { - if (in[x] < 0x81 || in[x] > 0x82) { - return CRYPT_INVALID_PACKET; - } - y = in[x++] & 0x7F; - len = 0; - while (y--) { - len = (len << 8) | (unsigned long)in[x++]; - } + if (in[x] < 0x81 || in[x] > 0x82) { + return CRYPT_INVALID_PACKET; + } + y = in[x++] & 0x7F; + len = 0; + while (y--) { + len = (len << 8) | (unsigned long)in[x++]; + } } if (len < 1 || (len + x) > inlen) { @@ -71,29 +71,36 @@ int der_decode_object_identifier(const unsigned char *in, unsigned long inle y = 0; t = 0; while (len--) { - t = (t << 7) | (in[x] & 0x7F); - if (!(in[x++] & 0x80)) { - /* store t */ - if (y >= *outlen) { - return CRYPT_BUFFER_OVERFLOW; - } - if (y == 0) { - words[0] = t / 40; - words[1] = t % 40; - y = 2; - } else { - words[y++] = t; + t = (t << 7) | (in[x] & 0x7F); + if (!(in[x++] & 0x80)) { + /* store t */ + if (y >= *outlen) { + y++; + } else { + if (y == 0) { + words[0] = t / 40; + words[1] = t % 40; + y = 2; + } else { + words[y++] = t; + } + } + t = 0; } - t = 0; - } } - + + if (y > *outlen) { + err = CRYPT_BUFFER_OVERFLOW; + } else { + err = CRYPT_OK; + } + *outlen = y; - return CRYPT_OK; + return err; } #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/pk/asn1/der/object_identifier/der_encode_object_identifier.c b/libtomcrypt/src/pk/asn1/der/object_identifier/der_encode_object_identifier.c index f018ba9..b1ce62c 100644 --- a/libtomcrypt/src/pk/asn1/der/object_identifier/der_encode_object_identifier.c +++ b/libtomcrypt/src/pk/asn1/der/object_identifier/der_encode_object_identifier.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" @@ -55,7 +53,7 @@ int der_encode_object_identifier(unsigned long *words, unsigned long nwords, } /* store header + length */ - x = 0; + x = 0; out[x++] = 0x06; if (z < 128) { out[x++] = (unsigned char)z; @@ -71,33 +69,33 @@ int der_encode_object_identifier(unsigned long *words, unsigned long nwords, } /* store first byte */ - wordbuf = words[0] * 40 + words[1]; - for (i = 1; i < nwords; i++) { - /* store 7 bit words in little endian */ - t = wordbuf & 0xFFFFFFFF; - if (t) { - y = x; - mask = 0; - while (t) { - out[x++] = (unsigned char)((t & 0x7F) | mask); - t >>= 7; - mask |= 0x80; /* upper bit is set on all but the last byte */ - } - /* now swap bytes y...x-1 */ - z = x - 1; - while (y < z) { - t = out[y]; out[y] = out[z]; out[z] = (unsigned char)t; - ++y; - --z; - } - } else { - /* zero word */ - out[x++] = 0x00; - } - - if (i < nwords - 1) { - wordbuf = words[i + 1]; - } + wordbuf = words[0] * 40 + words[1]; + for (i = 1; i < nwords; i++) { + /* store 7 bit words in little endian */ + t = wordbuf & 0xFFFFFFFF; + if (t) { + y = x; + mask = 0; + while (t) { + out[x++] = (unsigned char)((t & 0x7F) | mask); + t >>= 7; + mask |= 0x80; /* upper bit is set on all but the last byte */ + } + /* now swap bytes y...x-1 */ + z = x - 1; + while (y < z) { + t = out[y]; out[y] = out[z]; out[z] = (unsigned char)t; + ++y; + --z; + } + } else { + /* zero word */ + out[x++] = 0x00; + } + + if (i < nwords - 1) { + wordbuf = words[i + 1]; + } } *outlen = x; @@ -106,6 +104,6 @@ int der_encode_object_identifier(unsigned long *words, unsigned long nwords, #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/pk/asn1/der/object_identifier/der_length_object_identifier.c b/libtomcrypt/src/pk/asn1/der/object_identifier/der_length_object_identifier.c index ccb1e6d..ac08915 100644 --- a/libtomcrypt/src/pk/asn1/der/object_identifier/der_length_object_identifier.c +++ b/libtomcrypt/src/pk/asn1/der/object_identifier/der_length_object_identifier.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" @@ -32,14 +30,14 @@ unsigned long der_object_identifier_bits(unsigned long x) /** Gets length of DER encoding of Object Identifier - @param nwords The number of OID words + @param nwords The number of OID words @param words The actual OID words to get the size of @param outlen [out] The length of the DER encoding for the given string @return CRYPT_OK if successful */ int der_length_object_identifier(unsigned long *words, unsigned long nwords, unsigned long *outlen) { - unsigned long y, z, t, wordbuf; + unsigned long y, z, t, wordbuf; LTC_ARGCHK(words != NULL); LTC_ARGCHK(outlen != NULL); @@ -84,6 +82,6 @@ int der_length_object_identifier(unsigned long *words, unsigned long nwords, uns #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/pk/asn1/der/octet/der_decode_octet_string.c b/libtomcrypt/src/pk/asn1/der/octet/der_decode_octet_string.c index 952d739..02859dc 100644 --- a/libtomcrypt/src/pk/asn1/der/octet/der_decode_octet_string.c +++ b/libtomcrypt/src/pk/asn1/der/octet/der_decode_octet_string.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" @@ -83,9 +81,9 @@ int der_decode_octet_string(const unsigned char *in, unsigned long inlen, return CRYPT_OK; } - + #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/pk/asn1/der/octet/der_encode_octet_string.c b/libtomcrypt/src/pk/asn1/der/octet/der_encode_octet_string.c index 9a16c3b..9c9d1a6 100644 --- a/libtomcrypt/src/pk/asn1/der/octet/der_encode_octet_string.c +++ b/libtomcrypt/src/pk/asn1/der/octet/der_encode_octet_string.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" @@ -38,7 +36,7 @@ int der_encode_octet_string(const unsigned char *in, unsigned long inlen, /* get the size */ if ((err = der_length_octet_string(inlen, &len)) != CRYPT_OK) { - return err; + return err; } /* too big? */ @@ -81,6 +79,6 @@ int der_encode_octet_string(const unsigned char *in, unsigned long inlen, #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/pk/asn1/der/octet/der_length_octet_string.c b/libtomcrypt/src/pk/asn1/der/octet/der_length_octet_string.c index 07da058..10c9e89 100644 --- a/libtomcrypt/src/pk/asn1/der/octet/der_length_octet_string.c +++ b/libtomcrypt/src/pk/asn1/der/octet/der_length_octet_string.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" @@ -17,7 +15,7 @@ #ifdef LTC_DER /** - Gets length of DER encoding of OCTET STRING + Gets length of DER encoding of OCTET STRING @param noctets The number of octets in the string to encode @param outlen [out] The length of the DER encoding for the given string @return CRYPT_OK if successful @@ -48,6 +46,6 @@ int der_length_octet_string(unsigned long noctets, unsigned long *outlen) #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/pk/asn1/der/printable_string/der_decode_printable_string.c b/libtomcrypt/src/pk/asn1/der/printable_string/der_decode_printable_string.c index 56bf376..6947429 100644 --- a/libtomcrypt/src/pk/asn1/der/printable_string/der_decode_printable_string.c +++ b/libtomcrypt/src/pk/asn1/der/printable_string/der_decode_printable_string.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" @@ -88,9 +86,9 @@ int der_decode_printable_string(const unsigned char *in, unsigned long inlen, return CRYPT_OK; } - + #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/pk/asn1/der/printable_string/der_encode_printable_string.c b/libtomcrypt/src/pk/asn1/der/printable_string/der_encode_printable_string.c index 7d7cfd2..ee54e48 100644 --- a/libtomcrypt/src/pk/asn1/der/printable_string/der_encode_printable_string.c +++ b/libtomcrypt/src/pk/asn1/der/printable_string/der_encode_printable_string.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" @@ -37,7 +35,7 @@ int der_encode_printable_string(const unsigned char *in, unsigned long inlen, /* get the size */ if ((err = der_length_printable_string(in, inlen, &len)) != CRYPT_OK) { - return err; + return err; } /* too big? */ @@ -80,6 +78,6 @@ int der_encode_printable_string(const unsigned char *in, unsigned long inlen, #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/pk/asn1/der/printable_string/der_length_printable_string.c b/libtomcrypt/src/pk/asn1/der/printable_string/der_length_printable_string.c index 9f78f20..40f0beb 100644 --- a/libtomcrypt/src/pk/asn1/der/printable_string/der_length_printable_string.c +++ b/libtomcrypt/src/pk/asn1/der/printable_string/der_length_printable_string.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" @@ -20,80 +18,80 @@ static const struct { int code, value; } printable_table[] = { -{ ' ', 32 }, -{ '\'', 39 }, -{ '(', 40 }, -{ ')', 41 }, -{ '+', 43 }, -{ ',', 44 }, -{ '-', 45 }, -{ '.', 46 }, -{ '/', 47 }, -{ '0', 48 }, -{ '1', 49 }, -{ '2', 50 }, -{ '3', 51 }, -{ '4', 52 }, -{ '5', 53 }, -{ '6', 54 }, -{ '7', 55 }, -{ '8', 56 }, -{ '9', 57 }, -{ ':', 58 }, -{ '=', 61 }, -{ '?', 63 }, -{ 'A', 65 }, -{ 'B', 66 }, -{ 'C', 67 }, -{ 'D', 68 }, -{ 'E', 69 }, -{ 'F', 70 }, -{ 'G', 71 }, -{ 'H', 72 }, -{ 'I', 73 }, -{ 'J', 74 }, -{ 'K', 75 }, -{ 'L', 76 }, -{ 'M', 77 }, -{ 'N', 78 }, -{ 'O', 79 }, -{ 'P', 80 }, -{ 'Q', 81 }, -{ 'R', 82 }, -{ 'S', 83 }, -{ 'T', 84 }, -{ 'U', 85 }, -{ 'V', 86 }, -{ 'W', 87 }, -{ 'X', 88 }, -{ 'Y', 89 }, -{ 'Z', 90 }, -{ 'a', 97 }, -{ 'b', 98 }, -{ 'c', 99 }, -{ 'd', 100 }, -{ 'e', 101 }, -{ 'f', 102 }, -{ 'g', 103 }, -{ 'h', 104 }, -{ 'i', 105 }, -{ 'j', 106 }, -{ 'k', 107 }, -{ 'l', 108 }, -{ 'm', 109 }, -{ 'n', 110 }, -{ 'o', 111 }, -{ 'p', 112 }, -{ 'q', 113 }, -{ 'r', 114 }, -{ 's', 115 }, -{ 't', 116 }, -{ 'u', 117 }, -{ 'v', 118 }, -{ 'w', 119 }, -{ 'x', 120 }, -{ 'y', 121 }, -{ 'z', 122 }, +{ ' ', 32 }, +{ '\'', 39 }, +{ '(', 40 }, +{ ')', 41 }, +{ '+', 43 }, +{ ',', 44 }, +{ '-', 45 }, +{ '.', 46 }, +{ '/', 47 }, +{ '0', 48 }, +{ '1', 49 }, +{ '2', 50 }, +{ '3', 51 }, +{ '4', 52 }, +{ '5', 53 }, +{ '6', 54 }, +{ '7', 55 }, +{ '8', 56 }, +{ '9', 57 }, +{ ':', 58 }, +{ '=', 61 }, +{ '?', 63 }, +{ 'A', 65 }, +{ 'B', 66 }, +{ 'C', 67 }, +{ 'D', 68 }, +{ 'E', 69 }, +{ 'F', 70 }, +{ 'G', 71 }, +{ 'H', 72 }, +{ 'I', 73 }, +{ 'J', 74 }, +{ 'K', 75 }, +{ 'L', 76 }, +{ 'M', 77 }, +{ 'N', 78 }, +{ 'O', 79 }, +{ 'P', 80 }, +{ 'Q', 81 }, +{ 'R', 82 }, +{ 'S', 83 }, +{ 'T', 84 }, +{ 'U', 85 }, +{ 'V', 86 }, +{ 'W', 87 }, +{ 'X', 88 }, +{ 'Y', 89 }, +{ 'Z', 90 }, +{ 'a', 97 }, +{ 'b', 98 }, +{ 'c', 99 }, +{ 'd', 100 }, +{ 'e', 101 }, +{ 'f', 102 }, +{ 'g', 103 }, +{ 'h', 104 }, +{ 'i', 105 }, +{ 'j', 106 }, +{ 'k', 107 }, +{ 'l', 108 }, +{ 'm', 109 }, +{ 'n', 110 }, +{ 'o', 111 }, +{ 'p', 112 }, +{ 'q', 113 }, +{ 'r', 114 }, +{ 's', 115 }, +{ 't', 116 }, +{ 'u', 117 }, +{ 'v', 118 }, +{ 'w', 119 }, +{ 'x', 120 }, +{ 'y', 121 }, +{ 'z', 122 }, }; int der_printable_char_encode(int c) @@ -117,10 +115,10 @@ int der_printable_value_decode(int v) } return -1; } - + /** - Gets length of DER encoding of Printable STRING - @param octets The values you want to encode + Gets length of DER encoding of Printable STRING + @param octets The values you want to encode @param noctets The number of octets in the string to encode @param outlen [out] The length of the DER encoding for the given string @return CRYPT_OK if successful @@ -161,6 +159,6 @@ int der_length_printable_string(const unsigned char *octets, unsigned long nocte #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/pk/asn1/der/sequence/der_decode_sequence_ex.c b/libtomcrypt/src/pk/asn1/der/sequence/der_decode_sequence_ex.c index 5042b18..b820c68 100644 --- a/libtomcrypt/src/pk/asn1/der/sequence/der_decode_sequence_ex.c +++ b/libtomcrypt/src/pk/asn1/der/sequence/der_decode_sequence_ex.c @@ -5,11 +5,8 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" -#include <stdarg.h> /** @@ -31,13 +28,14 @@ int der_decode_sequence_ex(const unsigned char *in, unsigned long inlen, ltc_asn1_list *list, unsigned long outlen, int ordered) { - int err, type; - unsigned long size, x, y, z, i, blksize; + int err, i; + ltc_asn1_type type; + unsigned long size, x, y, z, blksize; void *data; LTC_ARGCHK(in != NULL); LTC_ARGCHK(list != NULL); - + /* get blk size */ if (inlen < 2) { return CRYPT_INVALID_PACKET; @@ -50,9 +48,12 @@ int der_decode_sequence_ex(const unsigned char *in, unsigned long inlen, } ++x; + /* check if the msb is set, which signals that the + * 7 lsb bits represent the number of bytes of the length + */ if (in[x] < 128) { blksize = in[x++]; - } else if (in[x] & 0x80) { + } else { if (in[x] < 0x81 || in[x] > 0x83) { return CRYPT_INVALID_PACKET; } @@ -68,28 +69,28 @@ int der_decode_sequence_ex(const unsigned char *in, unsigned long inlen, while (y--) { blksize = (blksize << 8) | (unsigned long)in[x++]; } - } + } - /* would this blksize overflow? */ - if (x + blksize > inlen) { - return CRYPT_INVALID_PACKET; - } + /* would this blksize overflow? */ + if (x + blksize > inlen) { + return CRYPT_INVALID_PACKET; + } /* mark all as unused */ - for (i = 0; i < outlen; i++) { + for (i = 0; i < (int)outlen; i++) { list[i].used = 0; - } + } - /* ok read data */ + /* ok read data */ inlen = blksize; - for (i = 0; i < outlen; i++) { + for (i = 0; i < (int)outlen; i++) { z = 0; type = list[i].type; size = list[i].size; data = list[i].data; if (!ordered && list[i].used == 1) { continue; } - if (type == LTC_ASN1_EOL) { + if (type == LTC_ASN1_EOL) { break; } @@ -97,13 +98,14 @@ int der_decode_sequence_ex(const unsigned char *in, unsigned long inlen, case LTC_ASN1_BOOLEAN: z = inlen; if ((err = der_decode_boolean(in + x, z, ((int *)data))) != CRYPT_OK) { + if (!ordered) { continue; } goto LBL_ERR; } if ((err = der_length_boolean(&z)) != CRYPT_OK) { goto LBL_ERR; - } - break; - + } + break; + case LTC_ASN1_INTEGER: z = inlen; if ((err = der_decode_integer(in + x, z, data)) != CRYPT_OK) { @@ -124,7 +126,7 @@ int der_decode_sequence_ex(const unsigned char *in, unsigned long inlen, if ((err = der_length_short_integer(((unsigned long*)data)[0], &z)) != CRYPT_OK) { goto LBL_ERR; } - + break; case LTC_ASN1_BIT_STRING: @@ -139,6 +141,18 @@ int der_decode_sequence_ex(const unsigned char *in, unsigned long inlen, } break; + case LTC_ASN1_RAW_BIT_STRING: + z = inlen; + if ((err = der_decode_raw_bit_string(in + x, z, data, &size)) != CRYPT_OK) { + if (!ordered) { continue; } + goto LBL_ERR; + } + list[i].size = size; + if ((err = der_length_bit_string(size, &z)) != CRYPT_OK) { + goto LBL_ERR; + } + break; + case LTC_ASN1_OCTET_STRING: z = inlen; if ((err = der_decode_octet_string(in + x, z, data, &size)) != CRYPT_OK) { @@ -159,7 +173,7 @@ int der_decode_sequence_ex(const unsigned char *in, unsigned long inlen, } z = 2; break; - + case LTC_ASN1_OBJECT_IDENTIFIER: z = inlen; if ((err = der_decode_object_identifier(in + x, z, data, &size)) != CRYPT_OK) { @@ -172,6 +186,18 @@ int der_decode_sequence_ex(const unsigned char *in, unsigned long inlen, } break; + case LTC_ASN1_TELETEX_STRING: + z = inlen; + if ((err = der_decode_teletex_string(in + x, z, data, &size)) != CRYPT_OK) { + if (!ordered) { continue; } + goto LBL_ERR; + } + list[i].size = size; + if ((err = der_length_teletex_string(data, size, &z)) != CRYPT_OK) { + goto LBL_ERR; + } + break; + case LTC_ASN1_IA5_STRING: z = inlen; if ((err = der_decode_ia5_string(in + x, z, data, &size)) != CRYPT_OK) { @@ -217,6 +243,14 @@ int der_decode_sequence_ex(const unsigned char *in, unsigned long inlen, } break; + case LTC_ASN1_GENERALIZEDTIME: + z = inlen; + if ((err = der_decode_generalizedtime(in + x, &z, data)) != CRYPT_OK) { + if (!ordered) { continue; } + goto LBL_ERR; + } + break; + case LTC_ASN1_SET: z = inlen; if ((err = der_decode_set(in + x, z, data, size)) != CRYPT_OK) { @@ -227,7 +261,7 @@ int der_decode_sequence_ex(const unsigned char *in, unsigned long inlen, goto LBL_ERR; } break; - + case LTC_ASN1_SETOF: case LTC_ASN1_SEQUENCE: /* detect if we have the right type */ @@ -255,33 +289,40 @@ int der_decode_sequence_ex(const unsigned char *in, unsigned long inlen, } break; - default: + case LTC_ASN1_CONSTRUCTED: + case LTC_ASN1_CONTEXT_SPECIFIC: + case LTC_ASN1_EOL: err = CRYPT_INVALID_ARG; goto LBL_ERR; } x += z; inlen -= z; list[i].used = 1; - if (!ordered) { + if (!ordered) { /* restart the decoder */ i = -1; - } + } } - - for (i = 0; i < outlen; i++) { + + for (i = 0; i < (int)outlen; i++) { if (list[i].used == 0) { err = CRYPT_INVALID_PACKET; goto LBL_ERR; } - } - err = CRYPT_OK; + } + + if (inlen == 0) { + err = CRYPT_OK; + } else { + err = CRYPT_INPUT_TOO_LONG; + } LBL_ERR: return err; -} - +} + #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/pk/asn1/der/sequence/der_decode_sequence_flexi.c b/libtomcrypt/src/pk/asn1/der/sequence/der_decode_sequence_flexi.c index 4fd3aaa..142ef95 100644 --- a/libtomcrypt/src/pk/asn1/der/sequence/der_decode_sequence_flexi.c +++ b/libtomcrypt/src/pk/asn1/der/sequence/der_decode_sequence_flexi.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" @@ -17,102 +15,129 @@ #ifdef LTC_DER -static unsigned long fetch_length(const unsigned char *in, unsigned long inlen) +static unsigned long _fetch_length(const unsigned char *in, unsigned long inlen, unsigned long *data_offset) { - unsigned long x, y, z; + unsigned long x, z; - y = 0; + *data_offset = 0; /* skip type and read len */ if (inlen < 2) { return 0xFFFFFFFF; } - ++in; ++y; - + ++in; ++(*data_offset); + /* read len */ - x = *in++; ++y; - + x = *in++; ++(*data_offset); + /* <128 means literal */ if (x < 128) { - return x+y; + return x+*data_offset; } x &= 0x7F; /* the lower 7 bits are the length of the length */ inlen -= 2; - + /* len means len of len! */ if (x == 0 || x > 4 || x > inlen) { return 0xFFFFFFFF; } - - y += x; + + *data_offset += x; z = 0; - while (x--) { + while (x--) { z = (z<<8) | ((unsigned long)*in); ++in; } - return z+y; + return z+*data_offset; } -/** +static int _new_element(ltc_asn1_list **l) +{ + /* alloc new link */ + if (*l == NULL) { + *l = XCALLOC(1, sizeof(ltc_asn1_list)); + if (*l == NULL) { + return CRYPT_MEM; + } + } else { + (*l)->next = XCALLOC(1, sizeof(ltc_asn1_list)); + if ((*l)->next == NULL) { + return CRYPT_MEM; + } + (*l)->next->prev = *l; + *l = (*l)->next; + } + return CRYPT_OK; +} + +/** ASN.1 DER Flexi(ble) decoder will decode arbitrary DER packets and create a linked list of the decoded elements. @param in The input buffer - @param inlen [in/out] The length of the input buffer and on output the amount of decoded data + @param inlen [in/out] The length of the input buffer and on output the amount of decoded data @param out [out] A pointer to the linked list @return CRYPT_OK on success. -*/ +*/ int der_decode_sequence_flexi(const unsigned char *in, unsigned long *inlen, ltc_asn1_list **out) { ltc_asn1_list *l; - unsigned long err, type, len, totlen, x, y; + unsigned long err, type, len, totlen, data_offset; void *realloc_tmp; - + LTC_ARGCHK(in != NULL); LTC_ARGCHK(inlen != NULL); LTC_ARGCHK(out != NULL); l = NULL; totlen = 0; - + + if (*inlen == 0) { + /* alloc new link */ + if ((err = _new_element(&l)) != CRYPT_OK) { + goto error; + } + } + /* scan the input and and get lengths and what not */ - while (*inlen) { + while (*inlen) { /* read the type byte */ type = *in; /* fetch length */ - len = fetch_length(in, *inlen); + len = _fetch_length(in, *inlen, &data_offset); if (len > *inlen) { err = CRYPT_INVALID_PACKET; goto error; } /* alloc new link */ - if (l == NULL) { - l = XCALLOC(1, sizeof(*l)); - if (l == NULL) { - err = CRYPT_MEM; - goto error; - } - } else { - l->next = XCALLOC(1, sizeof(*l)); - if (l->next == NULL) { - err = CRYPT_MEM; - goto error; - } - l->next->prev = l; - l = l->next; + if ((err = _new_element(&l)) != CRYPT_OK) { + goto error; + } + + if ((type & 0x20) && (type != 0x30) && (type != 0x31)) { + /* constructed, use the 'used' field to store the original identifier */ + l->used = type; + /* treat constructed elements like SETs */ + type = 0x20; + } + else if ((type & 0xC0) == 0x80) { + /* context-specific, use the 'used' field to store the original identifier */ + l->used = type; + /* context-specific elements are treated as opaque data */ + type = 0x80; } - /* now switch on type */ + /* now switch on type */ switch (type) { case 0x01: /* BOOLEAN */ l->type = LTC_ASN1_BOOLEAN; l->size = 1; l->data = XCALLOC(1, sizeof(int)); - + if ((err = der_decode_boolean(in, *inlen, l->data)) != CRYPT_OK) { goto error; } - + if ((err = der_length_boolean(&len)) != CRYPT_OK) { goto error; } @@ -125,12 +150,12 @@ int der_decode_sequence_flexi(const unsigned char *in, unsigned long *inlen, ltc if ((err = mp_init(&l->data)) != CRYPT_OK) { goto error; } - + /* decode field */ if ((err = der_decode_integer(in, *inlen, l->data)) != CRYPT_OK) { goto error; } - + /* calc length of object */ if ((err = der_length_integer(l->data, &len)) != CRYPT_OK) { goto error; @@ -146,11 +171,11 @@ int der_decode_sequence_flexi(const unsigned char *in, unsigned long *inlen, ltc err = CRYPT_MEM; goto error; } - + if ((err = der_decode_bit_string(in, *inlen, l->data, &l->size)) != CRYPT_OK) { goto error; } - + if ((err = der_length_bit_string(l->size, &len)) != CRYPT_OK) { goto error; } @@ -166,34 +191,34 @@ int der_decode_sequence_flexi(const unsigned char *in, unsigned long *inlen, ltc err = CRYPT_MEM; goto error; } - + if ((err = der_decode_octet_string(in, *inlen, l->data, &l->size)) != CRYPT_OK) { goto error; } - + if ((err = der_length_octet_string(l->size, &len)) != CRYPT_OK) { goto error; } break; case 0x05: /* NULL */ - + /* valid NULL is 0x05 0x00 */ if (in[0] != 0x05 || in[1] != 0x00) { err = CRYPT_INVALID_PACKET; goto error; } - + /* simple to store ;-) */ l->type = LTC_ASN1_NULL; l->data = NULL; l->size = 0; len = 2; - + break; - + case 0x06: /* OID */ - + /* init field */ l->type = LTC_ASN1_OBJECT_IDENTIFIER; l->size = len; @@ -202,15 +227,15 @@ int der_decode_sequence_flexi(const unsigned char *in, unsigned long *inlen, ltc err = CRYPT_MEM; goto error; } - + if ((err = der_decode_object_identifier(in, *inlen, l->data, &l->size)) != CRYPT_OK) { goto error; } - + if ((err = der_length_object_identifier(l->data, l->size, &len)) != CRYPT_OK) { goto error; } - + /* resize it to save a bunch of mem */ if ((realloc_tmp = XREALLOC(l->data, l->size * sizeof(unsigned long))) == NULL) { /* out of heap but this is not an error */ @@ -218,9 +243,9 @@ int der_decode_sequence_flexi(const unsigned char *in, unsigned long *inlen, ltc } l->data = realloc_tmp; break; - + case 0x0C: /* UTF8 */ - + /* init field */ l->type = LTC_ASN1_UTF8_STRING; l->size = len; @@ -229,18 +254,18 @@ int der_decode_sequence_flexi(const unsigned char *in, unsigned long *inlen, ltc err = CRYPT_MEM; goto error; } - + if ((err = der_decode_utf8_string(in, *inlen, l->data, &l->size)) != CRYPT_OK) { goto error; } - + if ((err = der_length_utf8_string(l->data, l->size, &len)) != CRYPT_OK) { goto error; } break; case 0x13: /* PRINTABLE */ - + /* init field */ l->type = LTC_ASN1_PRINTABLE_STRING; l->size = len; @@ -249,18 +274,38 @@ int der_decode_sequence_flexi(const unsigned char *in, unsigned long *inlen, ltc err = CRYPT_MEM; goto error; } - + if ((err = der_decode_printable_string(in, *inlen, l->data, &l->size)) != CRYPT_OK) { goto error; } - + if ((err = der_length_printable_string(l->data, l->size, &len)) != CRYPT_OK) { goto error; } break; - + + case 0x14: /* TELETEXT */ + + /* init field */ + l->type = LTC_ASN1_TELETEX_STRING; + l->size = len; + + if ((l->data = XCALLOC(1, l->size)) == NULL) { + err = CRYPT_MEM; + goto error; + } + + if ((err = der_decode_teletex_string(in, *inlen, l->data, &l->size)) != CRYPT_OK) { + goto error; + } + + if ((err = der_length_teletex_string(l->data, l->size, &len)) != CRYPT_OK) { + goto error; + } + break; + case 0x16: /* IA5 */ - + /* init field */ l->type = LTC_ASN1_IA5_STRING; l->size = len; @@ -269,18 +314,18 @@ int der_decode_sequence_flexi(const unsigned char *in, unsigned long *inlen, ltc err = CRYPT_MEM; goto error; } - + if ((err = der_decode_ia5_string(in, *inlen, l->data, &l->size)) != CRYPT_OK) { goto error; } - + if ((err = der_length_ia5_string(l->data, l->size, &len)) != CRYPT_OK) { goto error; } break; - + case 0x17: /* UTC TIME */ - + /* init field */ l->type = LTC_ASN1_UTCTIME; l->size = 1; @@ -289,83 +334,125 @@ int der_decode_sequence_flexi(const unsigned char *in, unsigned long *inlen, ltc err = CRYPT_MEM; goto error; } - + len = *inlen; if ((err = der_decode_utctime(in, &len, l->data)) != CRYPT_OK) { goto error; } - + if ((err = der_length_utctime(l->data, &len)) != CRYPT_OK) { goto error; } break; - + + case 0x18: + l->type = LTC_ASN1_GENERALIZEDTIME; + l->size = len; + + if ((l->data = XCALLOC(1, sizeof(ltc_generalizedtime))) == NULL) { + err = CRYPT_MEM; + goto error; + } + + if ((err = der_decode_generalizedtime(in, &len, l->data)) != CRYPT_OK) { + goto error; + } + + if ((err = der_length_generalizedtime(l->data, &len)) != CRYPT_OK) { + goto error; + } + + break; + + case 0x20: /* Any CONSTRUCTED element that is neither SEQUENCE nor SET */ case 0x30: /* SEQUENCE */ case 0x31: /* SET */ - + /* init field */ - l->type = (type == 0x30) ? LTC_ASN1_SEQUENCE : LTC_ASN1_SET; - - /* we have to decode the SEQUENCE header and get it's length */ - - /* move past type */ - ++in; --(*inlen); - - /* read length byte */ - x = *in++; --(*inlen); - - /* smallest SEQUENCE/SET header */ - y = 2; - - /* now if it's > 127 the next bytes are the length of the length */ - if (x > 128) { - x &= 0x7F; - in += x; - *inlen -= x; - - /* update sequence header len */ - y += x; - } - + if (type == 0x20) { + l->type = LTC_ASN1_CONSTRUCTED; + } + else if (type == 0x30) { + l->type = LTC_ASN1_SEQUENCE; + } + else { + l->type = LTC_ASN1_SET; + } + + if ((l->data = XMALLOC(len)) == NULL) { + err = CRYPT_MEM; + goto error; + } + + XMEMCPY(l->data, in, len); + l->size = len; + + + /* jump to the start of the data */ + in += data_offset; + *inlen -= data_offset; + len = len - data_offset; + /* Sequence elements go as child */ - len = len - y; if ((err = der_decode_sequence_flexi(in, &len, &(l->child))) != CRYPT_OK) { goto error; } - + /* len update */ - totlen += y; - - /* link them up y0 */ - l->child->parent = l; - + totlen += data_offset; + + /* the flexi decoder can also do nothing, so make sure a child has been allocated */ + if (l->child) { + /* link them up y0 */ + l->child->parent = l; + } + + break; + + case 0x80: /* Context-specific */ + l->type = LTC_ASN1_CONTEXT_SPECIFIC; + + if ((l->data = XCALLOC(1, len - data_offset)) == NULL) { + err = CRYPT_MEM; + goto error; + } + + XMEMCPY(l->data, in + data_offset, len - data_offset); + l->size = len - data_offset; + break; + default: /* invalid byte ... this is a soft error */ /* remove link */ - l = l->prev; - XFREE(l->next); - l->next = NULL; + if (l->prev) { + l = l->prev; + XFREE(l->next); + l->next = NULL; + } goto outside; } - + /* advance pointers */ totlen += len; in += len; *inlen -= len; } - -outside: - - /* rewind l please */ - while (l->prev != NULL || l->parent != NULL) { - if (l->parent != NULL) { - l = l->parent; - } else { - l = l->prev; + +outside: + + /* in case we processed anything */ + if (totlen) { + /* rewind l please */ + while (l->prev != NULL || l->parent != NULL) { + if (l->parent != NULL) { + l = l->parent; + } else { + l = l->prev; + } } } - + /* return */ *out = l; *inlen = totlen; @@ -381,6 +468,6 @@ error: #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/pk/asn1/der/sequence/der_decode_sequence_multi.c b/libtomcrypt/src/pk/asn1/der/sequence/der_decode_sequence_multi.c index 4202eb3..1361b76 100644 --- a/libtomcrypt/src/pk/asn1/der/sequence/der_decode_sequence_multi.c +++ b/libtomcrypt/src/pk/asn1/der/sequence/der_decode_sequence_multi.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" #include <stdarg.h> @@ -25,10 +23,11 @@ @param inlen Length of input in octets @remark <...> is of the form <type, size, data> (int, unsigned long, void*) @return CRYPT_OK on success -*/ +*/ int der_decode_sequence_multi(const unsigned char *in, unsigned long inlen, ...) { - int err, type; + int err; + ltc_asn1_type type; unsigned long size, x; void *data; va_list args; @@ -40,11 +39,13 @@ int der_decode_sequence_multi(const unsigned char *in, unsigned long inlen, ...) va_start(args, inlen); x = 0; for (;;) { - type = va_arg(args, int); + type = (ltc_asn1_type)va_arg(args, int); size = va_arg(args, unsigned long); data = va_arg(args, void*); + LTC_UNUSED_PARAM(size); + LTC_UNUSED_PARAM(data); - if (type == LTC_ASN1_EOL) { + if (type == LTC_ASN1_EOL) { break; } @@ -64,10 +65,15 @@ int der_decode_sequence_multi(const unsigned char *in, unsigned long inlen, ...) case LTC_ASN1_SETOF: case LTC_ASN1_SEQUENCE: case LTC_ASN1_CHOICE: - ++x; + case LTC_ASN1_RAW_BIT_STRING: + case LTC_ASN1_TELETEX_STRING: + case LTC_ASN1_GENERALIZEDTIME: + ++x; break; - - default: + + case LTC_ASN1_EOL: + case LTC_ASN1_CONSTRUCTED: + case LTC_ASN1_CONTEXT_SPECIFIC: va_end(args); return CRYPT_INVALID_ARG; } @@ -88,11 +94,11 @@ int der_decode_sequence_multi(const unsigned char *in, unsigned long inlen, ...) va_start(args, inlen); x = 0; for (;;) { - type = va_arg(args, int); + type = (ltc_asn1_type)va_arg(args, int); size = va_arg(args, unsigned long); data = va_arg(args, void*); - if (type == LTC_ASN1_EOL) { + if (type == LTC_ASN1_EOL) { break; } @@ -110,23 +116,23 @@ int der_decode_sequence_multi(const unsigned char *in, unsigned long inlen, ...) case LTC_ASN1_UTCTIME: case LTC_ASN1_SEQUENCE: case LTC_ASN1_SET: - case LTC_ASN1_SETOF: + case LTC_ASN1_SETOF: case LTC_ASN1_CHOICE: - list[x].type = type; - list[x].size = size; - list[x++].data = data; + case LTC_ASN1_RAW_BIT_STRING: + case LTC_ASN1_TELETEX_STRING: + case LTC_ASN1_GENERALIZEDTIME: + LTC_SET_ASN1(list, x++, type, data, size); + break; + /* coverity[dead_error_line] */ + case LTC_ASN1_EOL: + case LTC_ASN1_CONSTRUCTED: + case LTC_ASN1_CONTEXT_SPECIFIC: break; - - default: - va_end(args); - err = CRYPT_INVALID_ARG; - goto LBL_ERR; } } va_end(args); err = der_decode_sequence(in, inlen, list, x); -LBL_ERR: XFREE(list); return err; } @@ -134,6 +140,6 @@ LBL_ERR: #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/pk/asn1/der/sequence/der_decode_subject_public_key_info.c b/libtomcrypt/src/pk/asn1/der/sequence/der_decode_subject_public_key_info.c new file mode 100644 index 0000000..6826181 --- /dev/null +++ b/libtomcrypt/src/pk/asn1/der/sequence/der_decode_subject_public_key_info.c @@ -0,0 +1,112 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + */ +#include "tomcrypt.h" +/** + @file der_decode_subject_public_key_info.c + ASN.1 DER, encode a Subject Public Key structure --nmav +*/ + +#ifdef LTC_DER + +/* AlgorithmIdentifier := SEQUENCE { + * algorithm OBJECT IDENTIFIER, + * parameters ANY DEFINED BY algorithm + * } + * + * SubjectPublicKeyInfo := SEQUENCE { + * algorithm AlgorithmIdentifier, + * subjectPublicKey BIT STRING + * } + */ +/** + Decode a subject public key info + @param in The input buffer + @param inlen The length of the input buffer + @param algorithm One out of the enum #public_key_algorithms + @param public_key The buffer for the public key + @param public_key_len [in/out] The length of the public key buffer and the written length + @param parameters_type The parameters' type out of the enum ltc_asn1_type + @param parameters The parameters to include + @param parameters_len The number of parameters to include + @return CRYPT_OK on success +*/ +int der_decode_subject_public_key_info(const unsigned char *in, unsigned long inlen, + unsigned int algorithm, void* public_key, unsigned long* public_key_len, + unsigned long parameters_type, ltc_asn1_list* parameters, unsigned long parameters_len) +{ + int err; + unsigned long len; + oid_st oid; + unsigned char *tmpbuf; + unsigned long tmpoid[16]; + ltc_asn1_list alg_id[2]; + ltc_asn1_list subject_pubkey[2]; + + LTC_ARGCHK(in != NULL); + LTC_ARGCHK(inlen != 0); + LTC_ARGCHK(public_key_len != NULL); + + err = pk_get_oid(algorithm, &oid); + if (err != CRYPT_OK) { + return err; + } + + /* see if the OpenSSL DER format RSA public key will work */ + tmpbuf = XCALLOC(1, inlen); + if (tmpbuf == NULL) { + err = CRYPT_MEM; + goto LBL_ERR; + } + + /* this includes the internal hash ID and optional params (NULL in this case) */ + LTC_SET_ASN1(alg_id, 0, LTC_ASN1_OBJECT_IDENTIFIER, tmpoid, sizeof(tmpoid)/sizeof(tmpoid[0])); + LTC_SET_ASN1(alg_id, 1, (ltc_asn1_type)parameters_type, parameters, parameters_len); + + /* the actual format of the SSL DER key is odd, it stores a RSAPublicKey + * in a **BIT** string ... so we have to extract it then proceed to convert bit to octet + */ + LTC_SET_ASN1(subject_pubkey, 0, LTC_ASN1_SEQUENCE, alg_id, 2); + LTC_SET_ASN1(subject_pubkey, 1, LTC_ASN1_RAW_BIT_STRING, tmpbuf, inlen*8U); + + err=der_decode_sequence(in, inlen, subject_pubkey, 2UL); + if (err != CRYPT_OK) { + goto LBL_ERR; + } + + if ((alg_id[0].size != oid.OIDlen) || + XMEMCMP(oid.OID, alg_id[0].data, oid.OIDlen * sizeof(oid.OID[0]))) { + /* OID mismatch */ + err = CRYPT_PK_INVALID_TYPE; + goto LBL_ERR; + } + + len = subject_pubkey[1].size/8; + if (*public_key_len > len) { + XMEMCPY(public_key, subject_pubkey[1].data, len); + *public_key_len = len; + } else { + *public_key_len = len; + err = CRYPT_BUFFER_OVERFLOW; + goto LBL_ERR; + } + + err = CRYPT_OK; + +LBL_ERR: + + XFREE(tmpbuf); + + return err; +} + +#endif + +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/pk/asn1/der/sequence/der_encode_sequence_ex.c b/libtomcrypt/src/pk/asn1/der/sequence/der_encode_sequence_ex.c index e92f7c3..2b42ff4 100644 --- a/libtomcrypt/src/pk/asn1/der/sequence/der_encode_sequence_ex.c +++ b/libtomcrypt/src/pk/asn1/der/sequence/der_encode_sequence_ex.c @@ -5,11 +5,8 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" -#include <stdarg.h> /** @@ -23,15 +20,16 @@ Encode a SEQUENCE @param list The list of items to encode @param inlen The number of items in the list - @param out [out] The destination + @param out [out] The destination @param outlen [in/out] The size of the output @param type_of LTC_ASN1_SEQUENCE or LTC_ASN1_SET/LTC_ASN1_SETOF @return CRYPT_OK on success */ int der_encode_sequence_ex(ltc_asn1_list *list, unsigned long inlen, - unsigned char *out, unsigned long *outlen, int type_of) + unsigned char *out, unsigned long *outlen, int type_of) { - int err, type; + int err; + ltc_asn1_type type; unsigned long size, x, y, z, i; void *data; @@ -40,123 +38,8 @@ int der_encode_sequence_ex(ltc_asn1_list *list, unsigned long inlen, LTC_ARGCHK(outlen != NULL); /* get size of output that will be required */ - y = 0; - for (i = 0; i < inlen; i++) { - type = list[i].type; - size = list[i].size; - data = list[i].data; - - if (type == LTC_ASN1_EOL) { - break; - } - - switch (type) { - case LTC_ASN1_BOOLEAN: - if ((err = der_length_boolean(&x)) != CRYPT_OK) { - goto LBL_ERR; - } - y += x; - break; - - case LTC_ASN1_INTEGER: - if ((err = der_length_integer(data, &x)) != CRYPT_OK) { - goto LBL_ERR; - } - y += x; - break; - - case LTC_ASN1_SHORT_INTEGER: - if ((err = der_length_short_integer(*((unsigned long*)data), &x)) != CRYPT_OK) { - goto LBL_ERR; - } - y += x; - break; - - case LTC_ASN1_BIT_STRING: - if ((err = der_length_bit_string(size, &x)) != CRYPT_OK) { - goto LBL_ERR; - } - y += x; - break; - - case LTC_ASN1_OCTET_STRING: - if ((err = der_length_octet_string(size, &x)) != CRYPT_OK) { - goto LBL_ERR; - } - y += x; - break; - - case LTC_ASN1_NULL: - y += 2; - break; - - case LTC_ASN1_OBJECT_IDENTIFIER: - if ((err = der_length_object_identifier(data, size, &x)) != CRYPT_OK) { - goto LBL_ERR; - } - y += x; - break; - - case LTC_ASN1_IA5_STRING: - if ((err = der_length_ia5_string(data, size, &x)) != CRYPT_OK) { - goto LBL_ERR; - } - y += x; - break; - - case LTC_ASN1_PRINTABLE_STRING: - if ((err = der_length_printable_string(data, size, &x)) != CRYPT_OK) { - goto LBL_ERR; - } - y += x; - break; - - case LTC_ASN1_UTF8_STRING: - if ((err = der_length_utf8_string(data, size, &x)) != CRYPT_OK) { - goto LBL_ERR; - } - y += x; - break; - - case LTC_ASN1_UTCTIME: - if ((err = der_length_utctime(data, &x)) != CRYPT_OK) { - goto LBL_ERR; - } - y += x; - break; - - case LTC_ASN1_SET: - case LTC_ASN1_SETOF: - case LTC_ASN1_SEQUENCE: - if ((err = der_length_sequence(data, size, &x)) != CRYPT_OK) { - goto LBL_ERR; - } - y += x; - break; - - default: - err = CRYPT_INVALID_ARG; - goto LBL_ERR; - } - } - - /* calc header size */ - z = y; - if (y < 128) { - y += 2; - } else if (y < 256) { - /* 0x30 0x81 LL */ - y += 3; - } else if (y < 65536UL) { - /* 0x30 0x82 LL LL */ - y += 4; - } else if (y < 16777216UL) { - /* 0x30 0x83 LL LL LL */ - y += 5; - } else { - err = CRYPT_INVALID_ARG; - goto LBL_ERR; - } + y = 0; z = 0; + if ((err = der_length_sequence_ex(list, inlen, &y, &z)) != CRYPT_OK) return CRYPT_INVALID_ARG; /* too big ? */ if (*outlen < y) { @@ -168,7 +51,7 @@ int der_encode_sequence_ex(ltc_asn1_list *list, unsigned long inlen, /* store header */ x = 0; out[x++] = (type_of == LTC_ASN1_SEQUENCE) ? 0x30 : 0x31; - + if (z < 128) { out[x++] = (unsigned char)z; } else if (z < 256) { @@ -192,7 +75,7 @@ int der_encode_sequence_ex(ltc_asn1_list *list, unsigned long inlen, size = list[i].size; data = list[i].data; - if (type == LTC_ASN1_EOL) { + if (type == LTC_ASN1_EOL) { break; } @@ -202,17 +85,13 @@ int der_encode_sequence_ex(ltc_asn1_list *list, unsigned long inlen, if ((err = der_encode_boolean(*((int *)data), out + x, &z)) != CRYPT_OK) { goto LBL_ERR; } - x += z; - *outlen -= z; break; - + case LTC_ASN1_INTEGER: z = *outlen; if ((err = der_encode_integer(data, out + x, &z)) != CRYPT_OK) { goto LBL_ERR; } - x += z; - *outlen -= z; break; case LTC_ASN1_SHORT_INTEGER: @@ -220,8 +99,6 @@ int der_encode_sequence_ex(ltc_asn1_list *list, unsigned long inlen, if ((err = der_encode_short_integer(*((unsigned long*)data), out + x, &z)) != CRYPT_OK) { goto LBL_ERR; } - x += z; - *outlen -= z; break; case LTC_ASN1_BIT_STRING: @@ -229,8 +106,13 @@ int der_encode_sequence_ex(ltc_asn1_list *list, unsigned long inlen, if ((err = der_encode_bit_string(data, size, out + x, &z)) != CRYPT_OK) { goto LBL_ERR; } - x += z; - *outlen -= z; + break; + + case LTC_ASN1_RAW_BIT_STRING: + z = *outlen; + if ((err = der_encode_raw_bit_string(data, size, out + x, &z)) != CRYPT_OK) { + goto LBL_ERR; + } break; case LTC_ASN1_OCTET_STRING: @@ -238,14 +120,12 @@ int der_encode_sequence_ex(ltc_asn1_list *list, unsigned long inlen, if ((err = der_encode_octet_string(data, size, out + x, &z)) != CRYPT_OK) { goto LBL_ERR; } - x += z; - *outlen -= z; break; case LTC_ASN1_NULL: - out[x++] = 0x05; - out[x++] = 0x00; - *outlen -= 2; + out[x] = 0x05; + out[x+1] = 0x00; + z = 2; break; case LTC_ASN1_OBJECT_IDENTIFIER: @@ -253,8 +133,6 @@ int der_encode_sequence_ex(ltc_asn1_list *list, unsigned long inlen, if ((err = der_encode_object_identifier(data, size, out + x, &z)) != CRYPT_OK) { goto LBL_ERR; } - x += z; - *outlen -= z; break; case LTC_ASN1_IA5_STRING: @@ -262,17 +140,13 @@ int der_encode_sequence_ex(ltc_asn1_list *list, unsigned long inlen, if ((err = der_encode_ia5_string(data, size, out + x, &z)) != CRYPT_OK) { goto LBL_ERR; } - x += z; - *outlen -= z; break; - + case LTC_ASN1_PRINTABLE_STRING: z = *outlen; if ((err = der_encode_printable_string(data, size, out + x, &z)) != CRYPT_OK) { goto LBL_ERR; } - x += z; - *outlen -= z; break; case LTC_ASN1_UTF8_STRING: @@ -280,8 +154,6 @@ int der_encode_sequence_ex(ltc_asn1_list *list, unsigned long inlen, if ((err = der_encode_utf8_string(data, size, out + x, &z)) != CRYPT_OK) { goto LBL_ERR; } - x += z; - *outlen -= z; break; case LTC_ASN1_UTCTIME: @@ -289,8 +161,13 @@ int der_encode_sequence_ex(ltc_asn1_list *list, unsigned long inlen, if ((err = der_encode_utctime(data, out + x, &z)) != CRYPT_OK) { goto LBL_ERR; } - x += z; - *outlen -= z; + break; + + case LTC_ASN1_GENERALIZEDTIME: + z = *outlen; + if ((err = der_encode_generalizedtime(data, out + x, &z)) != CRYPT_OK) { + goto LBL_ERR; + } break; case LTC_ASN1_SET: @@ -298,8 +175,6 @@ int der_encode_sequence_ex(ltc_asn1_list *list, unsigned long inlen, if ((err = der_encode_set(data, size, out + x, &z)) != CRYPT_OK) { goto LBL_ERR; } - x += z; - *outlen -= z; break; case LTC_ASN1_SETOF: @@ -307,8 +182,6 @@ int der_encode_sequence_ex(ltc_asn1_list *list, unsigned long inlen, if ((err = der_encode_setof(data, size, out + x, &z)) != CRYPT_OK) { goto LBL_ERR; } - x += z; - *outlen -= z; break; case LTC_ASN1_SEQUENCE: @@ -316,20 +189,29 @@ int der_encode_sequence_ex(ltc_asn1_list *list, unsigned long inlen, if ((err = der_encode_sequence_ex(data, size, out + x, &z, type)) != CRYPT_OK) { goto LBL_ERR; } - x += z; - *outlen -= z; break; - - default: + + case LTC_ASN1_CHOICE: + case LTC_ASN1_CONSTRUCTED: + case LTC_ASN1_CONTEXT_SPECIFIC: + case LTC_ASN1_EOL: + case LTC_ASN1_TELETEX_STRING: err = CRYPT_INVALID_ARG; goto LBL_ERR; } + + x += z; + *outlen -= z; } *outlen = x; - err = CRYPT_OK; + err = CRYPT_OK; LBL_ERR: return err; } #endif + +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/pk/asn1/der/sequence/der_encode_sequence_multi.c b/libtomcrypt/src/pk/asn1/der/sequence/der_encode_sequence_multi.c index 659f029..c1b40c7 100644 --- a/libtomcrypt/src/pk/asn1/der/sequence/der_encode_sequence_multi.c +++ b/libtomcrypt/src/pk/asn1/der/sequence/der_encode_sequence_multi.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" #include <stdarg.h> @@ -25,10 +23,11 @@ @param outlen [in/out] Length of buffer and resulting length of output @remark <...> is of the form <type, size, data> (int, unsigned long, void*) @return CRYPT_OK on success -*/ +*/ int der_encode_sequence_multi(unsigned char *out, unsigned long *outlen, ...) { - int err, type; + int err; + ltc_asn1_type type; unsigned long size, x; void *data; va_list args; @@ -41,11 +40,13 @@ int der_encode_sequence_multi(unsigned char *out, unsigned long *outlen, ...) va_start(args, outlen); x = 0; for (;;) { - type = va_arg(args, int); + type = (ltc_asn1_type)va_arg(args, int); size = va_arg(args, unsigned long); data = va_arg(args, void*); + LTC_UNUSED_PARAM(size); + LTC_UNUSED_PARAM(data); - if (type == LTC_ASN1_EOL) { + if (type == LTC_ASN1_EOL) { break; } @@ -64,10 +65,16 @@ int der_encode_sequence_multi(unsigned char *out, unsigned long *outlen, ...) case LTC_ASN1_SEQUENCE: case LTC_ASN1_SET: case LTC_ASN1_SETOF: - ++x; + case LTC_ASN1_RAW_BIT_STRING: + case LTC_ASN1_GENERALIZEDTIME: + ++x; break; - - default: + + case LTC_ASN1_CHOICE: + case LTC_ASN1_CONSTRUCTED: + case LTC_ASN1_CONTEXT_SPECIFIC: + case LTC_ASN1_EOL: + case LTC_ASN1_TELETEX_STRING: va_end(args); return CRYPT_INVALID_ARG; } @@ -88,11 +95,11 @@ int der_encode_sequence_multi(unsigned char *out, unsigned long *outlen, ...) va_start(args, outlen); x = 0; for (;;) { - type = va_arg(args, int); + type = (ltc_asn1_type)va_arg(args, int); size = va_arg(args, unsigned long); data = va_arg(args, void*); - if (type == LTC_ASN1_EOL) { + if (type == LTC_ASN1_EOL) { break; } @@ -111,12 +118,16 @@ int der_encode_sequence_multi(unsigned char *out, unsigned long *outlen, ...) case LTC_ASN1_SEQUENCE: case LTC_ASN1_SET: case LTC_ASN1_SETOF: - list[x].type = type; - list[x].size = size; - list[x++].data = data; + case LTC_ASN1_RAW_BIT_STRING: + case LTC_ASN1_GENERALIZEDTIME: + LTC_SET_ASN1(list, x++, type, data, size); break; - - default: + + case LTC_ASN1_CHOICE: + case LTC_ASN1_CONSTRUCTED: + case LTC_ASN1_CONTEXT_SPECIFIC: + case LTC_ASN1_EOL: + case LTC_ASN1_TELETEX_STRING: va_end(args); err = CRYPT_INVALID_ARG; goto LBL_ERR; @@ -124,7 +135,7 @@ int der_encode_sequence_multi(unsigned char *out, unsigned long *outlen, ...) } va_end(args); - err = der_encode_sequence(list, x, out, outlen); + err = der_encode_sequence(list, x, out, outlen); LBL_ERR: XFREE(list); return err; @@ -133,6 +144,6 @@ LBL_ERR: #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/pk/asn1/der/sequence/der_encode_subject_public_key_info.c b/libtomcrypt/src/pk/asn1/der/sequence/der_encode_subject_public_key_info.c new file mode 100644 index 0000000..dcb869a --- /dev/null +++ b/libtomcrypt/src/pk/asn1/der/sequence/der_encode_subject_public_key_info.c @@ -0,0 +1,71 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + */ +#include "tomcrypt.h" + +/** + @file der_encode_subject_public_key_info.c + ASN.1 DER, encode a Subject Public Key structure --nmav +*/ + +#ifdef LTC_DER + +/* AlgorithmIdentifier := SEQUENCE { + * algorithm OBJECT IDENTIFIER, + * parameters ANY DEFINED BY algorithm + * } + * + * SubjectPublicKeyInfo := SEQUENCE { + * algorithm AlgorithmIdentifier, + * subjectPublicKey BIT STRING + * } + */ +/** + Encode a subject public key info + @param out The output buffer + @param outlen [in/out] Length of buffer and resulting length of output + @param algorithm One out of the enum #public_key_algorithms + @param public_key The buffer for the public key + @param public_key_len The length of the public key buffer + @param parameters_type The parameters' type out of the enum ltc_asn1_type + @param parameters The parameters to include + @param parameters_len The number of parameters to include + @return CRYPT_OK on success +*/ +int der_encode_subject_public_key_info(unsigned char *out, unsigned long *outlen, + unsigned int algorithm, void* public_key, unsigned long public_key_len, + unsigned long parameters_type, void* parameters, unsigned long parameters_len) +{ + int err; + ltc_asn1_list alg_id[2]; + oid_st oid; + + LTC_ARGCHK(out != NULL); + LTC_ARGCHK(outlen != NULL); + + err = pk_get_oid(algorithm, &oid); + if (err != CRYPT_OK) { + return err; + } + + LTC_SET_ASN1(alg_id, 0, LTC_ASN1_OBJECT_IDENTIFIER, oid.OID, oid.OIDlen); + LTC_SET_ASN1(alg_id, 1, (ltc_asn1_type)parameters_type, parameters, parameters_len); + + return der_encode_sequence_multi(out, outlen, + LTC_ASN1_SEQUENCE, (unsigned long)sizeof(alg_id)/sizeof(alg_id[0]), alg_id, + LTC_ASN1_RAW_BIT_STRING, public_key_len*8U, public_key, + LTC_ASN1_EOL, 0UL, NULL); + +} + +#endif + +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ + diff --git a/libtomcrypt/src/pk/asn1/der/sequence/der_length_sequence.c b/libtomcrypt/src/pk/asn1/der/sequence/der_length_sequence.c index 7221f99..aed7cc2 100644 --- a/libtomcrypt/src/pk/asn1/der/sequence/der_length_sequence.c +++ b/libtomcrypt/src/pk/asn1/der/sequence/der_length_sequence.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" @@ -18,17 +16,24 @@ #ifdef LTC_DER /** - Get the length of a DER sequence + Get the length of a DER sequence @param list The sequences of items in the SEQUENCE @param inlen The number of items - @param outlen [out] The length required in octets to store it + @param outlen [out] The length required in octets to store it @return CRYPT_OK on success */ int der_length_sequence(ltc_asn1_list *list, unsigned long inlen, - unsigned long *outlen) + unsigned long *outlen) +{ + return der_length_sequence_ex(list, inlen, outlen, NULL); +} + +int der_length_sequence_ex(ltc_asn1_list *list, unsigned long inlen, + unsigned long *outlen, unsigned long *payloadlen) { - int err, type; - unsigned long size, x, y, z, i; + int err; + ltc_asn1_type type; + unsigned long size, x, y, i, z; void *data; LTC_ARGCHK(list != NULL); @@ -41,7 +46,7 @@ int der_length_sequence(ltc_asn1_list *list, unsigned long inlen, size = list[i].size; data = list[i].data; - if (type == LTC_ASN1_EOL) { + if (type == LTC_ASN1_EOL) { break; } @@ -52,7 +57,7 @@ int der_length_sequence(ltc_asn1_list *list, unsigned long inlen, } y += x; break; - + case LTC_ASN1_INTEGER: if ((err = der_length_integer(data, &x)) != CRYPT_OK) { goto LBL_ERR; @@ -68,6 +73,7 @@ int der_length_sequence(ltc_asn1_list *list, unsigned long inlen, break; case LTC_ASN1_BIT_STRING: + case LTC_ASN1_RAW_BIT_STRING: if ((err = der_length_bit_string(size, &x)) != CRYPT_OK) { goto LBL_ERR; } @@ -99,6 +105,13 @@ int der_length_sequence(ltc_asn1_list *list, unsigned long inlen, y += x; break; + case LTC_ASN1_TELETEX_STRING: + if ((err = der_length_teletex_string(data, size, &x)) != CRYPT_OK) { + goto LBL_ERR; + } + y += x; + break; + case LTC_ASN1_PRINTABLE_STRING: if ((err = der_length_printable_string(data, size, &x)) != CRYPT_OK) { goto LBL_ERR; @@ -113,6 +126,13 @@ int der_length_sequence(ltc_asn1_list *list, unsigned long inlen, y += x; break; + case LTC_ASN1_GENERALIZEDTIME: + if ((err = der_length_generalizedtime(data, &x)) != CRYPT_OK) { + goto LBL_ERR; + } + y += x; + break; + case LTC_ASN1_UTF8_STRING: if ((err = der_length_utf8_string(data, size, &x)) != CRYPT_OK) { goto LBL_ERR; @@ -129,8 +149,11 @@ int der_length_sequence(ltc_asn1_list *list, unsigned long inlen, y += x; break; - - default: + + case LTC_ASN1_CHOICE: + case LTC_ASN1_CONSTRUCTED: + case LTC_ASN1_CONTEXT_SPECIFIC: + case LTC_ASN1_EOL: err = CRYPT_INVALID_ARG; goto LBL_ERR; } @@ -155,6 +178,7 @@ int der_length_sequence(ltc_asn1_list *list, unsigned long inlen, } /* store size */ + if (payloadlen) *payloadlen = z; *outlen = y; err = CRYPT_OK; @@ -164,6 +188,6 @@ LBL_ERR: #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/pk/asn1/der/sequence/der_sequence_free.c b/libtomcrypt/src/pk/asn1/der/sequence/der_sequence_free.c index c933f58..3c2a663 100644 --- a/libtomcrypt/src/pk/asn1/der/sequence/der_sequence_free.c +++ b/libtomcrypt/src/pk/asn1/der/sequence/der_sequence_free.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" @@ -20,11 +18,13 @@ /** Free memory allocated by der_decode_sequence_flexi() @param in The list to free -*/ +*/ void der_sequence_free(ltc_asn1_list *in) { ltc_asn1_list *l; - + + if (!in) return; + /* walk to the start of the chain */ while (in->prev != NULL || in->parent != NULL) { if (in->parent != NULL) { @@ -33,7 +33,7 @@ void der_sequence_free(ltc_asn1_list *in) in = in->prev; } } - + /* now walk the list and free stuff */ while (in != NULL) { /* is there a child? */ @@ -42,24 +42,22 @@ void der_sequence_free(ltc_asn1_list *in) in->child->parent = NULL; der_sequence_free(in->child); } - - switch (in->type) { - case LTC_ASN1_SET: - case LTC_ASN1_SETOF: - case LTC_ASN1_SEQUENCE: break; + + switch (in->type) { + case LTC_ASN1_SETOF: break; case LTC_ASN1_INTEGER : if (in->data != NULL) { mp_clear(in->data); } break; default : if (in->data != NULL) { XFREE(in->data); } } - + /* move to next and free current */ l = in->next; - free(in); + XFREE(in); in = l; - } + } } #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/pk/asn1/der/sequence/der_sequence_shrink.c b/libtomcrypt/src/pk/asn1/der/sequence/der_sequence_shrink.c new file mode 100644 index 0000000..9b9e036 --- /dev/null +++ b/libtomcrypt/src/pk/asn1/der/sequence/der_sequence_shrink.c @@ -0,0 +1,50 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + */ +#include "tomcrypt.h" + +/** + @file der_sequence_shrink.c + Free memory allocated for CONSTRUCTED, SET or SEQUENCE elements by der_decode_sequence_flexi(), Steffen Jaeckel +*/ + +#ifdef LTC_DER + +/** + Free memory allocated for CONSTRUCTED, + SET or SEQUENCE elements by der_decode_sequence_flexi() + @param in The list to shrink +*/ +void der_sequence_shrink(ltc_asn1_list *in) +{ + if (!in) return; + + /* now walk the list and free stuff */ + while (in != NULL) { + /* is there a child? */ + if (in->child) { + der_sequence_shrink(in->child); + } + + switch (in->type) { + case LTC_ASN1_CONSTRUCTED: + case LTC_ASN1_SET: + case LTC_ASN1_SEQUENCE : if (in->data != NULL) { XFREE(in->data); in->data = NULL; } break; + default: break; + } + + /* move to next and free current */ + in = in->next; + } +} + +#endif + +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/pk/asn1/der/set/der_encode_set.c b/libtomcrypt/src/pk/asn1/der/set/der_encode_set.c index a2d0128..fef3092 100644 --- a/libtomcrypt/src/pk/asn1/der/set/der_encode_set.c +++ b/libtomcrypt/src/pk/asn1/der/set/der_encode_set.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" @@ -18,35 +16,42 @@ #ifdef LTC_DER /* LTC define to ASN.1 TAG */ -static int ltc_to_asn1(int v) +static int _ltc_to_asn1(ltc_asn1_type v) { switch (v) { case LTC_ASN1_BOOLEAN: return 0x01; case LTC_ASN1_INTEGER: case LTC_ASN1_SHORT_INTEGER: return 0x02; + case LTC_ASN1_RAW_BIT_STRING: case LTC_ASN1_BIT_STRING: return 0x03; case LTC_ASN1_OCTET_STRING: return 0x04; case LTC_ASN1_NULL: return 0x05; case LTC_ASN1_OBJECT_IDENTIFIER: return 0x06; case LTC_ASN1_UTF8_STRING: return 0x0C; case LTC_ASN1_PRINTABLE_STRING: return 0x13; + case LTC_ASN1_TELETEX_STRING: return 0x14; case LTC_ASN1_IA5_STRING: return 0x16; case LTC_ASN1_UTCTIME: return 0x17; + case LTC_ASN1_GENERALIZEDTIME: return 0x18; case LTC_ASN1_SEQUENCE: return 0x30; case LTC_ASN1_SET: case LTC_ASN1_SETOF: return 0x31; - default: return -1; + case LTC_ASN1_CHOICE: + case LTC_ASN1_CONSTRUCTED: + case LTC_ASN1_CONTEXT_SPECIFIC: + case LTC_ASN1_EOL: return -1; } -} - + return -1; +} + -static int qsort_helper(const void *a, const void *b) +static int _qsort_helper(const void *a, const void *b) { ltc_asn1_list *A = (ltc_asn1_list *)a, *B = (ltc_asn1_list *)b; int r; - - r = ltc_to_asn1(A->type) - ltc_to_asn1(B->type); - + + r = _ltc_to_asn1(A->type) - _ltc_to_asn1(B->type); + /* for QSORT the order is UNDEFINED if they are "equal" which means it is NOT DETERMINISTIC. So we force it to be :-) */ if (r == 0) { /* their order in the original list now determines the position */ @@ -54,13 +59,13 @@ static int qsort_helper(const void *a, const void *b) } else { return r; } -} +} /* Encode a SET type @param list The list of items to encode @param inlen The number of items in the list - @param out [out] The destination + @param out [out] The destination @param outlen [in/out] The size of the output @return CRYPT_OK on success */ @@ -70,34 +75,34 @@ int der_encode_set(ltc_asn1_list *list, unsigned long inlen, ltc_asn1_list *copy; unsigned long x; int err; - + /* make copy of list */ copy = XCALLOC(inlen, sizeof(*copy)); if (copy == NULL) { return CRYPT_MEM; - } - + } + /* fill in used member with index so we can fully sort it */ for (x = 0; x < inlen; x++) { copy[x] = list[x]; copy[x].used = x; - } - + } + /* sort it by the "type" field */ - XQSORT(copy, inlen, sizeof(*copy), &qsort_helper); - + XQSORT(copy, inlen, sizeof(*copy), &_qsort_helper); + /* call der_encode_sequence_ex() */ - err = der_encode_sequence_ex(copy, inlen, out, outlen, LTC_ASN1_SET); - + err = der_encode_sequence_ex(copy, inlen, out, outlen, LTC_ASN1_SET); + /* free list */ XFREE(copy); - + return err; -} +} #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/pk/asn1/der/set/der_encode_setof.c b/libtomcrypt/src/pk/asn1/der/set/der_encode_setof.c index 8e87f84..b837cdd 100644 --- a/libtomcrypt/src/pk/asn1/der/set/der_encode_setof.c +++ b/libtomcrypt/src/pk/asn1/der/set/der_encode_setof.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" @@ -22,15 +20,15 @@ struct edge { unsigned long size; }; -static int qsort_helper(const void *a, const void *b) +static int _qsort_helper(const void *a, const void *b) { struct edge *A = (struct edge *)a, *B = (struct edge *)b; int r; unsigned long x; - + /* compare min length */ r = XMEMCMP(A->start, B->start, MIN(A->size, B->size)); - + if (r == 0 && A->size != B->size) { if (A->size > B->size) { for (x = B->size; x < A->size; x++) { @@ -44,28 +42,29 @@ static int qsort_helper(const void *a, const void *b) return -1; } } - } + } } - - return r; + + return r; } /** Encode a SETOF stucture @param list The list of items to encode @param inlen The number of items in the list - @param out [out] The destination + @param out [out] The destination @param outlen [in/out] The size of the output @return CRYPT_OK on success -*/ +*/ int der_encode_setof(ltc_asn1_list *list, unsigned long inlen, unsigned char *out, unsigned long *outlen) { - unsigned long x, y, z, hdrlen; + unsigned long x, y, z; + ptrdiff_t hdrlen; int err; struct edge *edges; unsigned char *ptr, *buf; - + /* check that they're all the same type */ for (x = 1; x < inlen; x++) { if (list[x].type != list[x-1].type) { @@ -77,43 +76,43 @@ int der_encode_setof(ltc_asn1_list *list, unsigned long inlen, buf = XCALLOC(1, *outlen); if (buf == NULL) { return CRYPT_MEM; - } - + } + /* encode list */ if ((err = der_encode_sequence_ex(list, inlen, buf, outlen, LTC_ASN1_SETOF)) != CRYPT_OK) { XFREE(buf); return err; } - + /* allocate edges */ edges = XCALLOC(inlen, sizeof(*edges)); if (edges == NULL) { XFREE(buf); return CRYPT_MEM; - } - + } + /* skip header */ - ptr = buf + 1; + ptr = buf + 1; + + /* now skip length data */ + x = *ptr++; + if (x >= 0x80) { + ptr += (x & 0x7F); + } + + /* get the size of the static header */ + hdrlen = ptr - buf; + - /* now skip length data */ - x = *ptr++; - if (x >= 0x80) { - ptr += (x & 0x7F); - } - - /* get the size of the static header */ - hdrlen = ((unsigned long)ptr) - ((unsigned long)buf); - - /* scan for edges */ x = 0; while (ptr < (buf + *outlen)) { /* store start */ edges[x].start = ptr; - + /* skip type */ z = 1; - + /* parse length */ y = ptr[z++]; if (y < 128) { @@ -125,38 +124,38 @@ int der_encode_setof(ltc_asn1_list *list, unsigned long inlen, edges[x].size = (edges[x].size << 8) | ((unsigned long)ptr[z++]); } } - + /* skip content */ edges[x].size += z; ptr += edges[x].size; ++x; - } - + } + /* sort based on contents (using edges) */ - XQSORT(edges, inlen, sizeof(*edges), &qsort_helper); - + XQSORT(edges, inlen, sizeof(*edges), &_qsort_helper); + /* copy static header */ XMEMCPY(out, buf, hdrlen); - + /* copy+sort using edges+indecies to output from buffer */ - for (y = hdrlen, x = 0; x < inlen; x++) { + for (y = (unsigned long)hdrlen, x = 0; x < inlen; x++) { XMEMCPY(out+y, edges[x].start, edges[x].size); y += edges[x].size; - } - + } + #ifdef LTC_CLEAN_STACK zeromem(buf, *outlen); -#endif - +#endif + /* free buffers */ XFREE(edges); XFREE(buf); - + return CRYPT_OK; } #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/pk/asn1/der/short_integer/der_decode_short_integer.c b/libtomcrypt/src/pk/asn1/der/short_integer/der_decode_short_integer.c index a174740..71debf3 100644 --- a/libtomcrypt/src/pk/asn1/der/short_integer/der_decode_short_integer.c +++ b/libtomcrypt/src/pk/asn1/der/short_integer/der_decode_short_integer.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" @@ -63,6 +61,6 @@ int der_decode_short_integer(const unsigned char *in, unsigned long inlen, unsig #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/pk/asn1/der/short_integer/der_encode_short_integer.c b/libtomcrypt/src/pk/asn1/der/short_integer/der_encode_short_integer.c index 903ceb4..ea413eb 100644 --- a/libtomcrypt/src/pk/asn1/der/short_integer/der_encode_short_integer.c +++ b/libtomcrypt/src/pk/asn1/der/short_integer/der_encode_short_integer.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" @@ -26,10 +24,10 @@ @return CRYPT_OK if successful */ int der_encode_short_integer(unsigned long num, unsigned char *out, unsigned long *outlen) -{ +{ unsigned long len, x, y, z; int err; - + LTC_ARGCHK(out != NULL); LTC_ARGCHK(outlen != NULL); @@ -86,12 +84,12 @@ int der_encode_short_integer(unsigned long num, unsigned char *out, unsigned lon /* we good */ *outlen = x; - + return CRYPT_OK; } #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/pk/asn1/der/short_integer/der_length_short_integer.c b/libtomcrypt/src/pk/asn1/der/short_integer/der_length_short_integer.c index 0b8fdcf..52d0e1a 100644 --- a/libtomcrypt/src/pk/asn1/der/short_integer/der_length_short_integer.c +++ b/libtomcrypt/src/pk/asn1/der/short_integer/der_length_short_integer.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" @@ -18,8 +16,8 @@ #ifdef LTC_DER /** - Gets length of DER encoding of num - @param num The integer to get the size of + Gets length of DER encoding of num + @param num The integer to get the size of @param outlen [out] The length of the DER encoding for the given integer @return CRYPT_OK if successful */ @@ -39,7 +37,7 @@ int der_length_short_integer(unsigned long num, unsigned long *outlen) ++z; y >>= 8; } - + /* handle zero */ if (z == 0) { z = 1; @@ -58,13 +56,13 @@ int der_length_short_integer(unsigned long num, unsigned long *outlen) len += (num&(1UL<<((z<<3) - 1))) ? 1 : 0; /* return length */ - *outlen = len; - + *outlen = len; + return CRYPT_OK; } #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/pk/asn1/der/teletex_string/der_decode_teletex_string.c b/libtomcrypt/src/pk/asn1/der/teletex_string/der_decode_teletex_string.c new file mode 100644 index 0000000..0c7c3c8 --- /dev/null +++ b/libtomcrypt/src/pk/asn1/der/teletex_string/der_decode_teletex_string.c @@ -0,0 +1,93 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + */ +#include "tomcrypt.h" + +/** + @file der_decode_teletex_string.c + ASN.1 DER, encode a teletex STRING +*/ + +#ifdef LTC_DER + +/** + Store a teletex STRING + @param in The DER encoded teletex STRING + @param inlen The size of the DER teletex STRING + @param out [out] The array of octets stored (one per char) + @param outlen [in/out] The number of octets stored + @return CRYPT_OK if successful +*/ +int der_decode_teletex_string(const unsigned char *in, unsigned long inlen, + unsigned char *out, unsigned long *outlen) +{ + unsigned long x, y, len; + int t; + + LTC_ARGCHK(in != NULL); + LTC_ARGCHK(out != NULL); + LTC_ARGCHK(outlen != NULL); + + /* must have header at least */ + if (inlen < 2) { + return CRYPT_INVALID_PACKET; + } + + /* check for 0x14 */ + if ((in[0] & 0x1F) != 0x14) { + return CRYPT_INVALID_PACKET; + } + x = 1; + + /* decode the length */ + if (in[x] & 0x80) { + /* valid # of bytes in length are 1,2,3 */ + y = in[x] & 0x7F; + if ((y == 0) || (y > 3) || ((x + y) > inlen)) { + return CRYPT_INVALID_PACKET; + } + + /* read the length in */ + len = 0; + ++x; + while (y--) { + len = (len << 8) | in[x++]; + } + } else { + len = in[x++] & 0x7F; + } + + /* is it too long? */ + if (len > *outlen) { + *outlen = len; + return CRYPT_BUFFER_OVERFLOW; + } + + if (len + x > inlen) { + return CRYPT_INVALID_PACKET; + } + + /* read the data */ + for (y = 0; y < len; y++) { + t = der_teletex_value_decode(in[x++]); + if (t == -1) { + return CRYPT_INVALID_ARG; + } + out[y] = t; + } + + *outlen = y; + + return CRYPT_OK; +} + +#endif + +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/pk/asn1/der/teletex_string/der_length_teletex_string.c b/libtomcrypt/src/pk/asn1/der/teletex_string/der_length_teletex_string.c new file mode 100644 index 0000000..29fe5b0 --- /dev/null +++ b/libtomcrypt/src/pk/asn1/der/teletex_string/der_length_teletex_string.c @@ -0,0 +1,208 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + */ +#include "tomcrypt.h" + +/** + @file der_length_teletex_string.c + ASN.1 DER, get length of teletex STRING +*/ + +#ifdef LTC_DER + +static const struct { + int code, value; +} teletex_table[] = { +{ '\0', 0 }, +{ '\a', 7 }, +{ '\b', 8 }, +{ '\t', 9 }, +{ '\n', 10 }, +{ '\v', 11 }, +{ '\f', 12 }, +{ '\r', 13 }, +{ ' ', 32 }, +{ '!', 33 }, +{ '"', 34 }, +{ '%', 37 }, +{ '&', 38 }, +{ '\'', 39 }, +{ '(', 40 }, +{ ')', 41 }, +{ '+', 43 }, +{ ',', 44 }, +{ '-', 45 }, +{ '.', 46 }, +{ '/', 47 }, +{ '0', 48 }, +{ '1', 49 }, +{ '2', 50 }, +{ '3', 51 }, +{ '4', 52 }, +{ '5', 53 }, +{ '6', 54 }, +{ '7', 55 }, +{ '8', 56 }, +{ '9', 57 }, +{ ':', 58 }, +{ ';', 59 }, +{ '<', 60 }, +{ '=', 61 }, +{ '>', 62 }, +{ '?', 63 }, +{ '@', 64 }, +{ 'A', 65 }, +{ 'B', 66 }, +{ 'C', 67 }, +{ 'D', 68 }, +{ 'E', 69 }, +{ 'F', 70 }, +{ 'G', 71 }, +{ 'H', 72 }, +{ 'I', 73 }, +{ 'J', 74 }, +{ 'K', 75 }, +{ 'L', 76 }, +{ 'M', 77 }, +{ 'N', 78 }, +{ 'O', 79 }, +{ 'P', 80 }, +{ 'Q', 81 }, +{ 'R', 82 }, +{ 'S', 83 }, +{ 'T', 84 }, +{ 'U', 85 }, +{ 'V', 86 }, +{ 'W', 87 }, +{ 'X', 88 }, +{ 'Y', 89 }, +{ 'Z', 90 }, +{ '[', 91 }, +{ ']', 93 }, +{ '_', 95 }, +{ 'a', 97 }, +{ 'b', 98 }, +{ 'c', 99 }, +{ 'd', 100 }, +{ 'e', 101 }, +{ 'f', 102 }, +{ 'g', 103 }, +{ 'h', 104 }, +{ 'i', 105 }, +{ 'j', 106 }, +{ 'k', 107 }, +{ 'l', 108 }, +{ 'm', 109 }, +{ 'n', 110 }, +{ 'o', 111 }, +{ 'p', 112 }, +{ 'q', 113 }, +{ 'r', 114 }, +{ 's', 115 }, +{ 't', 116 }, +{ 'u', 117 }, +{ 'v', 118 }, +{ 'w', 119 }, +{ 'x', 120 }, +{ 'y', 121 }, +{ 'z', 122 }, +{ '|', 124 }, +{ ' ', 160 }, +{ 0xa1, 161 }, +{ 0xa2, 162 }, +{ 0xa3, 163 }, +{ '$', 164 }, +{ 0xa5, 165 }, +{ '#', 166 }, +{ 0xa7, 167 }, +{ 0xa4, 168 }, +{ 0xab, 171 }, +{ 0xb0, 176 }, +{ 0xb1, 177 }, +{ 0xb2, 178 }, +{ 0xb3, 179 }, +{ 0xd7, 180 }, +{ 0xb5, 181 }, +{ 0xb6, 182 }, +{ 0xb7, 183 }, +{ 0xf7, 184 }, +{ 0xbb, 187 }, +{ 0xbc, 188 }, +{ 0xbd, 189 }, +{ 0xbe, 190 }, +{ 0xbf, 191 }, +}; + +int der_teletex_char_encode(int c) +{ + int x; + for (x = 0; x < (int)(sizeof(teletex_table)/sizeof(teletex_table[0])); x++) { + if (teletex_table[x].code == c) { + return teletex_table[x].value; + } + } + return -1; +} + +int der_teletex_value_decode(int v) +{ + int x; + for (x = 0; x < (int)(sizeof(teletex_table)/sizeof(teletex_table[0])); x++) { + if (teletex_table[x].value == v) { + return teletex_table[x].code; + } + } + return -1; +} + +/** + Gets length of DER encoding of teletex STRING + @param octets The values you want to encode + @param noctets The number of octets in the string to encode + @param outlen [out] The length of the DER encoding for the given string + @return CRYPT_OK if successful +*/ +int der_length_teletex_string(const unsigned char *octets, unsigned long noctets, unsigned long *outlen) +{ + unsigned long x; + + LTC_ARGCHK(outlen != NULL); + LTC_ARGCHK(octets != NULL); + + /* scan string for validity */ + for (x = 0; x < noctets; x++) { + if (der_teletex_char_encode(octets[x]) == -1) { + return CRYPT_INVALID_ARG; + } + } + + if (noctets < 128) { + /* 16 LL DD DD DD ... */ + *outlen = 2 + noctets; + } else if (noctets < 256) { + /* 16 81 LL DD DD DD ... */ + *outlen = 3 + noctets; + } else if (noctets < 65536UL) { + /* 16 82 LL LL DD DD DD ... */ + *outlen = 4 + noctets; + } else if (noctets < 16777216UL) { + /* 16 83 LL LL LL DD DD DD ... */ + *outlen = 5 + noctets; + } else { + return CRYPT_INVALID_ARG; + } + + return CRYPT_OK; +} + +#endif + + +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/pk/asn1/der/utctime/der_decode_utctime.c b/libtomcrypt/src/pk/asn1/der/utctime/der_decode_utctime.c index c86bc75..07fcb80 100644 --- a/libtomcrypt/src/pk/asn1/der/utctime/der_decode_utctime.c +++ b/libtomcrypt/src/pk/asn1/der/utctime/der_decode_utctime.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" @@ -17,7 +15,7 @@ #ifdef LTC_DER -static int char_to_int(unsigned char x) +static int _char_to_int(unsigned char x) { switch (x) { case '0': return 0; @@ -30,12 +28,12 @@ static int char_to_int(unsigned char x) case '7': return 7; case '8': return 8; case '9': return 9; + default: return 100; } - return 100; } #define DECODE_V(y, max) \ - y = char_to_int(buf[x])*10 + char_to_int(buf[x+1]); \ + y = _char_to_int(buf[x])*10 + _char_to_int(buf[x+1]); \ if (y >= max) return CRYPT_INVALID_PACKET; \ x += 2; @@ -49,7 +47,7 @@ static int char_to_int(unsigned char x) int der_decode_utctime(const unsigned char *in, unsigned long *inlen, ltc_utctime *out) { - unsigned char buf[32]; + unsigned char buf[32] = { 0 }; /* initialize as all zeroes */ unsigned long x; int y; @@ -73,7 +71,7 @@ int der_decode_utctime(const unsigned char *in, unsigned long *inlen, *inlen = 2 + x; - /* possible encodings are + /* possible encodings are YYMMDDhhmmZ YYMMDDhhmm+hh'mm' YYMMDDhhmm-hh'mm' @@ -81,7 +79,7 @@ YYMMDDhhmmssZ YYMMDDhhmmss+hh'mm' YYMMDDhhmmss-hh'mm' - So let's do a trivial decode upto [including] mm + So let's do a trivial decode upto [including] mm */ x = 0; @@ -122,6 +120,6 @@ YYMMDDhhmmss-hh'mm' #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/pk/asn1/der/utctime/der_encode_utctime.c b/libtomcrypt/src/pk/asn1/der/utctime/der_encode_utctime.c index f8d0c56..c6c8464 100644 --- a/libtomcrypt/src/pk/asn1/der/utctime/der_encode_utctime.c +++ b/libtomcrypt/src/pk/asn1/der/utctime/der_encode_utctime.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" @@ -17,7 +15,7 @@ #ifdef LTC_DER -static const char *baseten = "0123456789"; +static const char * const baseten = "0123456789"; #define STORE_V(y) \ out[x++] = der_ia5_char_encode(baseten[(y/10) % 10]); \ @@ -30,12 +28,12 @@ static const char *baseten = "0123456789"; @param outlen [in/out] The length of the DER encoding @return CRYPT_OK if successful */ -int der_encode_utctime(ltc_utctime *utctime, +int der_encode_utctime(ltc_utctime *utctime, unsigned char *out, unsigned long *outlen) { unsigned long x, tmplen; int err; - + LTC_ARGCHK(utctime != NULL); LTC_ARGCHK(out != NULL); LTC_ARGCHK(outlen != NULL); @@ -47,7 +45,7 @@ int der_encode_utctime(ltc_utctime *utctime, *outlen = tmplen; return CRYPT_BUFFER_OVERFLOW; } - + /* store header */ out[0] = 0x17; @@ -70,7 +68,7 @@ int der_encode_utctime(ltc_utctime *utctime, /* store length */ out[1] = (unsigned char)(x - 2); - + /* all good let's return */ *outlen = x; return CRYPT_OK; @@ -78,6 +76,6 @@ int der_encode_utctime(ltc_utctime *utctime, #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/pk/asn1/der/utctime/der_length_utctime.c b/libtomcrypt/src/pk/asn1/der/utctime/der_length_utctime.c index e33c4f3..4202083 100644 --- a/libtomcrypt/src/pk/asn1/der/utctime/der_length_utctime.c +++ b/libtomcrypt/src/pk/asn1/der/utctime/der_length_utctime.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" @@ -41,6 +39,6 @@ int der_length_utctime(ltc_utctime *utctime, unsigned long *outlen) #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/pk/asn1/der/utf8/der_decode_utf8_string.c b/libtomcrypt/src/pk/asn1/der/utf8/der_decode_utf8_string.c index d9cbdaf..195a3f5 100644 --- a/libtomcrypt/src/pk/asn1/der/utf8/der_decode_utf8_string.c +++ b/libtomcrypt/src/pk/asn1/der/utf8/der_decode_utf8_string.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" @@ -31,6 +29,7 @@ int der_decode_utf8_string(const unsigned char *in, unsigned long inlen, { wchar_t tmp; unsigned long x, y, z, len; + int err; LTC_ARGCHK(in != NULL); LTC_ARGCHK(out != NULL); @@ -73,10 +72,10 @@ int der_decode_utf8_string(const unsigned char *in, unsigned long inlen, for (y = 0; x < inlen; ) { /* get first byte */ tmp = in[x++]; - + /* count number of bytes */ for (z = 0; (tmp & 0x80) && (z <= 4); z++, tmp = (tmp << 1) & 0xFF); - + if (z > 4 || (x + (z - 1) > inlen)) { return CRYPT_INVALID_PACKET; } @@ -93,19 +92,23 @@ int der_decode_utf8_string(const unsigned char *in, unsigned long inlen, tmp = (tmp << 6) | ((wchar_t)in[x++] & 0x3F); } - if (y > *outlen) { - *outlen = y; - return CRYPT_BUFFER_OVERFLOW; + if (y < *outlen) { + out[y] = tmp; } - out[y++] = tmp; + y++; + } + if (y > *outlen) { + err = CRYPT_BUFFER_OVERFLOW; + } else { + err = CRYPT_OK; } *outlen = y; - return CRYPT_OK; + return err; } - + #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/pk/asn1/der/utf8/der_encode_utf8_string.c b/libtomcrypt/src/pk/asn1/der/utf8/der_encode_utf8_string.c index 847a726..4c2030f 100644 --- a/libtomcrypt/src/pk/asn1/der/utf8/der_encode_utf8_string.c +++ b/libtomcrypt/src/pk/asn1/der/utf8/der_encode_utf8_string.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" @@ -37,9 +35,7 @@ int der_encode_utf8_string(const wchar_t *in, unsigned long inlen, /* get the size */ for (x = len = 0; x < inlen; x++) { - if (in[x] < 0 || in[x] > 0x1FFFF) { - return CRYPT_INVALID_ARG; - } + if (!der_utf8_valid_char(in[x])) return CRYPT_INVALID_ARG; len += der_utf8_charsize(in[x]); } @@ -57,7 +53,7 @@ int der_encode_utf8_string(const wchar_t *in, unsigned long inlen, /* too big? */ if (y > *outlen) { - *outlen = len; + *outlen = y; return CRYPT_BUFFER_OVERFLOW; } @@ -79,6 +75,7 @@ int der_encode_utf8_string(const wchar_t *in, unsigned long inlen, out[x++] = (unsigned char)((len>>8)&255); out[x++] = (unsigned char)(len&255); } else { + /* coverity[dead_error_line] */ return CRYPT_INVALID_ARG; } @@ -88,7 +85,9 @@ int der_encode_utf8_string(const wchar_t *in, unsigned long inlen, case 1: out[x++] = (unsigned char)in[y]; break; case 2: out[x++] = 0xC0 | ((in[y] >> 6) & 0x1F); out[x++] = 0x80 | (in[y] & 0x3F); break; case 3: out[x++] = 0xE0 | ((in[y] >> 12) & 0x0F); out[x++] = 0x80 | ((in[y] >> 6) & 0x3F); out[x++] = 0x80 | (in[y] & 0x3F); break; +#if !defined(LTC_WCHAR_MAX) || LTC_WCHAR_MAX > 0xFFFF case 4: out[x++] = 0xF0 | ((in[y] >> 18) & 0x07); out[x++] = 0x80 | ((in[y] >> 12) & 0x3F); out[x++] = 0x80 | ((in[y] >> 6) & 0x3F); out[x++] = 0x80 | (in[y] & 0x3F); break; +#endif } } @@ -100,6 +99,6 @@ int der_encode_utf8_string(const wchar_t *in, unsigned long inlen, #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/pk/asn1/der/utf8/der_length_utf8_string.c b/libtomcrypt/src/pk/asn1/der/utf8/der_length_utf8_string.c index 3321f94..88f4355 100644 --- a/libtomcrypt/src/pk/asn1/der/utf8/der_length_utf8_string.c +++ b/libtomcrypt/src/pk/asn1/der/utf8/der_length_utf8_string.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" @@ -27,15 +25,38 @@ unsigned long der_utf8_charsize(const wchar_t c) return 1; } else if (c <= 0x7FF) { return 2; +#if LTC_WCHAR_MAX == 0xFFFF + } else { + return 3; + } +#else } else if (c <= 0xFFFF) { return 3; } else { return 4; } +#endif +} + +/** + Test whether the given code point is valid character + @param c The UTF-8 character to test + @return 1 - valid, 0 - invalid +*/ +int der_utf8_valid_char(const wchar_t c) +{ + LTC_UNUSED_PARAM(c); +#if !defined(LTC_WCHAR_MAX) || LTC_WCHAR_MAX > 0xFFFF + if (c > 0x10FFFF) return 0; +#endif +#if LTC_WCHAR_MAX != 0xFFFF && LTC_WCHAR_MAX != 0xFFFFFFFF + if (c < 0) return 0; +#endif + return 1; } /** - Gets length of DER encoding of UTF8 STRING + Gets length of DER encoding of UTF8 STRING @param in The characters to measure the length of @param noctets The number of octets in the string to encode @param outlen [out] The length of the DER encoding for the given string @@ -50,9 +71,7 @@ int der_length_utf8_string(const wchar_t *in, unsigned long noctets, unsigned lo len = 0; for (x = 0; x < noctets; x++) { - if (in[x] < 0 || in[x] > 0x10FFFF) { - return CRYPT_INVALID_ARG; - } + if (!der_utf8_valid_char(in[x])) return CRYPT_INVALID_ARG; len += der_utf8_charsize(in[x]); } @@ -78,6 +97,6 @@ int der_length_utf8_string(const wchar_t *in, unsigned long noctets, unsigned lo #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/pk/dh/dh.c b/libtomcrypt/src/pk/dh/dh.c new file mode 100644 index 0000000..763b007 --- /dev/null +++ b/libtomcrypt/src/pk/dh/dh.c @@ -0,0 +1,237 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + */ + +#include "tomcrypt.h" + +#ifdef LTC_MDH + +/* This holds the key settings. ***MUST*** be organized by size from smallest to largest. */ +const ltc_dh_set_type ltc_dh_sets[] = { +#ifdef LTC_DH768 +{ /* 768-bit MODP Group 1 - https://tools.ietf.org/html/rfc7296#appendix-B.1 */ + 96, + "DH-768", + "2", + "FFFFFFFFFFFFFFFFC90FDAA22168C234C4C6628B80DC1CD1" + "29024E088A67CC74020BBEA63B139B22514A08798E3404DD" + "EF9519B3CD3A431B302B0A6DF25F14374FE1356D6D51C245" + "E485B576625E7EC6F44C42E9A63A3620FFFFFFFFFFFFFFFF" +}, +#endif +#ifdef LTC_DH1024 +{ /* 1024-bit MODP Group 2 - https://tools.ietf.org/html/rfc7296#appendix-B.2 */ + 128, + "DH-1024", + "2", + "FFFFFFFFFFFFFFFFC90FDAA22168C234C4C6628B80DC1CD1" + "29024E088A67CC74020BBEA63B139B22514A08798E3404DD" + "EF9519B3CD3A431B302B0A6DF25F14374FE1356D6D51C245" + "E485B576625E7EC6F44C42E9A637ED6B0BFF5CB6F406B7ED" + "EE386BFB5A899FA5AE9F24117C4B1FE649286651ECE65381" + "FFFFFFFFFFFFFFFF" +}, +#endif +#ifdef LTC_DH1536 +{ /* 1536-bit MODP Group 5 - https://tools.ietf.org/html/rfc3526#section-2 */ + 192, + "DH-1536", + "2", + "FFFFFFFFFFFFFFFFC90FDAA22168C234C4C6628B80DC1CD1" + "29024E088A67CC74020BBEA63B139B22514A08798E3404DD" + "EF9519B3CD3A431B302B0A6DF25F14374FE1356D6D51C245" + "E485B576625E7EC6F44C42E9A637ED6B0BFF5CB6F406B7ED" + "EE386BFB5A899FA5AE9F24117C4B1FE649286651ECE45B3D" + "C2007CB8A163BF0598DA48361C55D39A69163FA8FD24CF5F" + "83655D23DCA3AD961C62F356208552BB9ED529077096966D" + "670C354E4ABC9804F1746C08CA237327FFFFFFFFFFFFFFFF" +}, +#endif +#ifdef LTC_DH2048 +{ /* 2048-bit MODP Group 14 - https://tools.ietf.org/html/rfc3526#section-3 */ + 256, + "DH-2048", + "2", + "FFFFFFFFFFFFFFFFC90FDAA22168C234C4C6628B80DC1CD1" + "29024E088A67CC74020BBEA63B139B22514A08798E3404DD" + "EF9519B3CD3A431B302B0A6DF25F14374FE1356D6D51C245" + "E485B576625E7EC6F44C42E9A637ED6B0BFF5CB6F406B7ED" + "EE386BFB5A899FA5AE9F24117C4B1FE649286651ECE45B3D" + "C2007CB8A163BF0598DA48361C55D39A69163FA8FD24CF5F" + "83655D23DCA3AD961C62F356208552BB9ED529077096966D" + "670C354E4ABC9804F1746C08CA18217C32905E462E36CE3B" + "E39E772C180E86039B2783A2EC07A28FB5C55DF06F4C52C9" + "DE2BCBF6955817183995497CEA956AE515D2261898FA0510" + "15728E5A8AACAA68FFFFFFFFFFFFFFFF" +}, +#endif +#ifdef LTC_DH3072 +{ /* 3072-bit MODP Group 15 - https://tools.ietf.org/html/rfc3526#section-4 */ + 384, + "DH-3072", + "2", + "FFFFFFFFFFFFFFFFC90FDAA22168C234C4C6628B80DC1CD1" + "29024E088A67CC74020BBEA63B139B22514A08798E3404DD" + "EF9519B3CD3A431B302B0A6DF25F14374FE1356D6D51C245" + "E485B576625E7EC6F44C42E9A637ED6B0BFF5CB6F406B7ED" + "EE386BFB5A899FA5AE9F24117C4B1FE649286651ECE45B3D" + "C2007CB8A163BF0598DA48361C55D39A69163FA8FD24CF5F" + "83655D23DCA3AD961C62F356208552BB9ED529077096966D" + "670C354E4ABC9804F1746C08CA18217C32905E462E36CE3B" + "E39E772C180E86039B2783A2EC07A28FB5C55DF06F4C52C9" + "DE2BCBF6955817183995497CEA956AE515D2261898FA0510" + "15728E5A8AAAC42DAD33170D04507A33A85521ABDF1CBA64" + "ECFB850458DBEF0A8AEA71575D060C7DB3970F85A6E1E4C7" + "ABF5AE8CDB0933D71E8C94E04A25619DCEE3D2261AD2EE6B" + "F12FFA06D98A0864D87602733EC86A64521F2B18177B200C" + "BBE117577A615D6C770988C0BAD946E208E24FA074E5AB31" + "43DB5BFCE0FD108E4B82D120A93AD2CAFFFFFFFFFFFFFFFF" +}, +#endif +#ifdef LTC_DH4096 +{ /* 4096-bit MODP Group 16 - https://tools.ietf.org/html/rfc3526#section-5 */ + 512, + "DH-4096", + "2", + "FFFFFFFFFFFFFFFFC90FDAA22168C234C4C6628B80DC1CD1" + "29024E088A67CC74020BBEA63B139B22514A08798E3404DD" + "EF9519B3CD3A431B302B0A6DF25F14374FE1356D6D51C245" + "E485B576625E7EC6F44C42E9A637ED6B0BFF5CB6F406B7ED" + "EE386BFB5A899FA5AE9F24117C4B1FE649286651ECE45B3D" + "C2007CB8A163BF0598DA48361C55D39A69163FA8FD24CF5F" + "83655D23DCA3AD961C62F356208552BB9ED529077096966D" + "670C354E4ABC9804F1746C08CA18217C32905E462E36CE3B" + "E39E772C180E86039B2783A2EC07A28FB5C55DF06F4C52C9" + "DE2BCBF6955817183995497CEA956AE515D2261898FA0510" + "15728E5A8AAAC42DAD33170D04507A33A85521ABDF1CBA64" + "ECFB850458DBEF0A8AEA71575D060C7DB3970F85A6E1E4C7" + "ABF5AE8CDB0933D71E8C94E04A25619DCEE3D2261AD2EE6B" + "F12FFA06D98A0864D87602733EC86A64521F2B18177B200C" + "BBE117577A615D6C770988C0BAD946E208E24FA074E5AB31" + "43DB5BFCE0FD108E4B82D120A92108011A723C12A787E6D7" + "88719A10BDBA5B2699C327186AF4E23C1A946834B6150BDA" + "2583E9CA2AD44CE8DBBBC2DB04DE8EF92E8EFC141FBECAA6" + "287C59474E6BC05D99B2964FA090C3A2233BA186515BE7ED" + "1F612970CEE2D7AFB81BDD762170481CD0069127D5B05AA9" + "93B4EA988D8FDDC186FFB7DC90A6C08F4DF435C934063199" + "FFFFFFFFFFFFFFFF" +}, +#endif +#ifdef LTC_DH6144 +{ /* 6144-bit MODP Group 17 - https://tools.ietf.org/html/rfc3526#section-6 */ + 768, + "DH-6144", + "2", + "FFFFFFFFFFFFFFFFC90FDAA22168C234C4C6628B80DC1CD1" + "29024E088A67CC74020BBEA63B139B22514A08798E3404DD" + "EF9519B3CD3A431B302B0A6DF25F14374FE1356D6D51C245" + "E485B576625E7EC6F44C42E9A637ED6B0BFF5CB6F406B7ED" + "EE386BFB5A899FA5AE9F24117C4B1FE649286651ECE45B3D" + "C2007CB8A163BF0598DA48361C55D39A69163FA8FD24CF5F" + "83655D23DCA3AD961C62F356208552BB9ED529077096966D" + "670C354E4ABC9804F1746C08CA18217C32905E462E36CE3B" + "E39E772C180E86039B2783A2EC07A28FB5C55DF06F4C52C9" + "DE2BCBF6955817183995497CEA956AE515D2261898FA0510" + "15728E5A8AAAC42DAD33170D04507A33A85521ABDF1CBA64" + "ECFB850458DBEF0A8AEA71575D060C7DB3970F85A6E1E4C7" + "ABF5AE8CDB0933D71E8C94E04A25619DCEE3D2261AD2EE6B" + "F12FFA06D98A0864D87602733EC86A64521F2B18177B200C" + "BBE117577A615D6C770988C0BAD946E208E24FA074E5AB31" + "43DB5BFCE0FD108E4B82D120A92108011A723C12A787E6D7" + "88719A10BDBA5B2699C327186AF4E23C1A946834B6150BDA" + "2583E9CA2AD44CE8DBBBC2DB04DE8EF92E8EFC141FBECAA6" + "287C59474E6BC05D99B2964FA090C3A2233BA186515BE7ED" + "1F612970CEE2D7AFB81BDD762170481CD0069127D5B05AA9" + "93B4EA988D8FDDC186FFB7DC90A6C08F4DF435C934028492" + "36C3FAB4D27C7026C1D4DCB2602646DEC9751E763DBA37BD" + "F8FF9406AD9E530EE5DB382F413001AEB06A53ED9027D831" + "179727B0865A8918DA3EDBEBCF9B14ED44CE6CBACED4BB1B" + "DB7F1447E6CC254B332051512BD7AF426FB8F401378CD2BF" + "5983CA01C64B92ECF032EA15D1721D03F482D7CE6E74FEF6" + "D55E702F46980C82B5A84031900B1C9E59E7C97FBEC7E8F3" + "23A97A7E36CC88BE0F1D45B7FF585AC54BD407B22B4154AA" + "CC8F6D7EBF48E1D814CC5ED20F8037E0A79715EEF29BE328" + "06A1D58BB7C5DA76F550AA3D8A1FBFF0EB19CCB1A313D55C" + "DA56C9EC2EF29632387FE8D76E3C0468043E8F663F4860EE" + "12BF2D5B0B7474D6E694F91E6DCC4024FFFFFFFFFFFFFFFF" +}, +#endif +#ifdef LTC_DH8192 +{ /* 8192-bit MODP Group 18 - https://tools.ietf.org/html/rfc3526#section-7 */ + 1024, + "DH-8192", + "2", + "FFFFFFFFFFFFFFFFC90FDAA22168C234C4C6628B80DC1CD1" + "29024E088A67CC74020BBEA63B139B22514A08798E3404DD" + "EF9519B3CD3A431B302B0A6DF25F14374FE1356D6D51C245" + "E485B576625E7EC6F44C42E9A637ED6B0BFF5CB6F406B7ED" + "EE386BFB5A899FA5AE9F24117C4B1FE649286651ECE45B3D" + "C2007CB8A163BF0598DA48361C55D39A69163FA8FD24CF5F" + "83655D23DCA3AD961C62F356208552BB9ED529077096966D" + "670C354E4ABC9804F1746C08CA18217C32905E462E36CE3B" + "E39E772C180E86039B2783A2EC07A28FB5C55DF06F4C52C9" + "DE2BCBF6955817183995497CEA956AE515D2261898FA0510" + "15728E5A8AAAC42DAD33170D04507A33A85521ABDF1CBA64" + "ECFB850458DBEF0A8AEA71575D060C7DB3970F85A6E1E4C7" + "ABF5AE8CDB0933D71E8C94E04A25619DCEE3D2261AD2EE6B" + "F12FFA06D98A0864D87602733EC86A64521F2B18177B200C" + "BBE117577A615D6C770988C0BAD946E208E24FA074E5AB31" + "43DB5BFCE0FD108E4B82D120A92108011A723C12A787E6D7" + "88719A10BDBA5B2699C327186AF4E23C1A946834B6150BDA" + "2583E9CA2AD44CE8DBBBC2DB04DE8EF92E8EFC141FBECAA6" + "287C59474E6BC05D99B2964FA090C3A2233BA186515BE7ED" + "1F612970CEE2D7AFB81BDD762170481CD0069127D5B05AA9" + "93B4EA988D8FDDC186FFB7DC90A6C08F4DF435C934028492" + "36C3FAB4D27C7026C1D4DCB2602646DEC9751E763DBA37BD" + "F8FF9406AD9E530EE5DB382F413001AEB06A53ED9027D831" + "179727B0865A8918DA3EDBEBCF9B14ED44CE6CBACED4BB1B" + "DB7F1447E6CC254B332051512BD7AF426FB8F401378CD2BF" + "5983CA01C64B92ECF032EA15D1721D03F482D7CE6E74FEF6" + "D55E702F46980C82B5A84031900B1C9E59E7C97FBEC7E8F3" + "23A97A7E36CC88BE0F1D45B7FF585AC54BD407B22B4154AA" + "CC8F6D7EBF48E1D814CC5ED20F8037E0A79715EEF29BE328" + "06A1D58BB7C5DA76F550AA3D8A1FBFF0EB19CCB1A313D55C" + "DA56C9EC2EF29632387FE8D76E3C0468043E8F663F4860EE" + "12BF2D5B0B7474D6E694F91E6DBE115974A3926F12FEE5E4" + "38777CB6A932DF8CD8BEC4D073B931BA3BC832B68D9DD300" + "741FA7BF8AFC47ED2576F6936BA424663AAB639C5AE4F568" + "3423B4742BF1C978238F16CBE39D652DE3FDB8BEFC848AD9" + "22222E04A4037C0713EB57A81A23F0C73473FC646CEA306B" + "4BCBC8862F8385DDFA9D4B7FA2C087E879683303ED5BDD3A" + "062B3CF5B3A278A66D2A13F83F44F82DDF310EE074AB6A36" + "4597E899A0255DC164F31CC50846851DF9AB48195DED7EA1" + "B1D510BD7EE74D73FAF36BC31ECFA268359046F4EB879F92" + "4009438B481C6CD7889A002ED5EE382BC9190DA6FC026E47" + "9558E4475677E9AA9E3050E2765694DFC81F56E880B96E71" + "60C980DD98EDD3DFFFFFFFFFFFFFFFFF" +}, +#endif +{ + 0, + NULL, + NULL, + NULL +} +}; + +/** + Returns the DH group size (octets) for given key + @param key The DH key to get the size of + @return The group size in octets (0 on error) + */ +int dh_get_groupsize(dh_key *key) +{ + if (key == NULL) return 0; + return mp_unsigned_bin_size(key->prime); +} + +#endif /* LTC_MDH */ + +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/pk/dh/dh_check_pubkey.c b/libtomcrypt/src/pk/dh/dh_check_pubkey.c new file mode 100644 index 0000000..fb4f37b --- /dev/null +++ b/libtomcrypt/src/pk/dh/dh_check_pubkey.c @@ -0,0 +1,65 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + */ + +#include "tomcrypt.h" + +#ifdef LTC_MDH + +/** + Check DH public key (INTERNAL ONLY, not part of public API) + @param key The key you wish to test + @return CRYPT_OK if successful +*/ +int dh_check_pubkey(dh_key *key) +{ + void *p_minus1; + ltc_mp_digit digit; + int i, digit_count, bits_set = 0, err; + + LTC_ARGCHK(key != NULL); + + if ((err = mp_init(&p_minus1)) != CRYPT_OK) { + return err; + } + + /* avoid: y <= 1 OR y >= p-1 */ + if ((err = mp_sub_d(key->prime, 1, p_minus1)) != CRYPT_OK) { + goto error; + } + if (mp_cmp(key->y, p_minus1) != LTC_MP_LT || mp_cmp_d(key->y, 1) != LTC_MP_GT) { + err = CRYPT_INVALID_ARG; + goto error; + } + + /* public key must have more than one bit set */ + digit_count = mp_get_digit_count(key->y); + for (i = 0; i < digit_count && bits_set < 2; i++) { + digit = mp_get_digit(key->y, i); + while (digit > 0) { + if (digit & 1) bits_set++; + digit >>= 1; + } + } + if (bits_set > 1) { + err = CRYPT_OK; + } + else { + err = CRYPT_INVALID_ARG; + } + +error: + mp_clear(p_minus1); + return err; +} + +#endif /* LTC_MDH */ + +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/pk/dh/dh_export.c b/libtomcrypt/src/pk/dh/dh_export.c new file mode 100644 index 0000000..6a02a89 --- /dev/null +++ b/libtomcrypt/src/pk/dh/dh_export.c @@ -0,0 +1,62 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + */ + +#include "tomcrypt.h" + +#ifdef LTC_MDH + +/** + Export a DH key to a binary packet + @param out [out] The destination for the key + @param outlen [in/out] The max size and resulting size of the DH key + @param type Which type of key (PK_PRIVATE or PK_PUBLIC) + @param key The key you wish to export + @return CRYPT_OK if successful +*/ +int dh_export(unsigned char *out, unsigned long *outlen, int type, dh_key *key) +{ + unsigned char flags[1]; + int err; + unsigned long version = 0; + + LTC_ARGCHK(out != NULL); + LTC_ARGCHK(outlen != NULL); + LTC_ARGCHK(key != NULL); + + if (type == PK_PRIVATE) { + /* export x - private key */ + flags[0] = 1; + err = der_encode_sequence_multi(out, outlen, + LTC_ASN1_SHORT_INTEGER, 1UL, &version, + LTC_ASN1_BIT_STRING, 1UL, flags, + LTC_ASN1_INTEGER, 1UL, key->prime, + LTC_ASN1_INTEGER, 1UL, key->base, + LTC_ASN1_INTEGER, 1UL, key->x, + LTC_ASN1_EOL, 0UL, NULL); + } + else { + /* export y - public key */ + flags[0] = 0; + err = der_encode_sequence_multi(out, outlen, + LTC_ASN1_SHORT_INTEGER, 1UL, &version, + LTC_ASN1_BIT_STRING, 1UL, flags, + LTC_ASN1_INTEGER, 1UL, key->prime, + LTC_ASN1_INTEGER, 1UL, key->base, + LTC_ASN1_INTEGER, 1UL, key->y, + LTC_ASN1_EOL, 0UL, NULL); + } + + return err; +} + +#endif /* LTC_MDH */ + +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/pk/dh/dh_export_key.c b/libtomcrypt/src/pk/dh/dh_export_key.c new file mode 100644 index 0000000..d48c011 --- /dev/null +++ b/libtomcrypt/src/pk/dh/dh_export_key.c @@ -0,0 +1,47 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + */ + +#include "tomcrypt.h" + +#ifdef LTC_MDH + +/** + Binary export a DH key to a buffer + @param out [out] The destination for the key + @param outlen [in/out] The max size and resulting size of the DH key + @param type Which type of key (PK_PRIVATE or PK_PUBLIC) + @param key The key you wish to export + @return CRYPT_OK if successful +*/ +int dh_export_key(void *out, unsigned long *outlen, int type, dh_key *key) +{ + unsigned long len; + void *k; + + LTC_ARGCHK(out != NULL); + LTC_ARGCHK(outlen != NULL); + LTC_ARGCHK(key != NULL); + + k = (type == PK_PRIVATE) ? key->x : key->y; + len = mp_unsigned_bin_size(k); + + if (*outlen < len) { + *outlen = len; + return CRYPT_BUFFER_OVERFLOW; + } + *outlen = len; + + return mp_to_unsigned_bin(k, out); +} + +#endif /* LTC_MDH */ + +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/pk/dh/dh_free.c b/libtomcrypt/src/pk/dh/dh_free.c new file mode 100644 index 0000000..b4f58ca --- /dev/null +++ b/libtomcrypt/src/pk/dh/dh_free.c @@ -0,0 +1,28 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + */ + +#include "tomcrypt.h" + +#ifdef LTC_MDH + +/** + Free the allocated ram for a DH key + @param key The key which you wish to free +*/ +void dh_free(dh_key *key) +{ + LTC_ARGCHKVD(key != NULL); + mp_cleanup_multi(&key->prime, &key->base, &key->y, &key->x, NULL); +} + +#endif /* LTC_MDH */ + +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/pk/dh/dh_generate_key.c b/libtomcrypt/src/pk/dh/dh_generate_key.c new file mode 100644 index 0000000..69fb6f9 --- /dev/null +++ b/libtomcrypt/src/pk/dh/dh_generate_key.c @@ -0,0 +1,102 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + */ + +#include "tomcrypt.h" + +#ifdef LTC_MDH + +static int _dh_groupsize_to_keysize(int groupsize) +{ + /* The strength estimates from https://tools.ietf.org/html/rfc3526#section-8 + * We use "Estimate 2" to get an appropriate private key (exponent) size. + */ + if (groupsize <= 0) { + return 0; + } + else if (groupsize <= 192) { + return 30; /* 1536-bit => key size 240-bit */ + } + else if (groupsize <= 256) { + return 40; /* 2048-bit => key size 320-bit */ + } + else if (groupsize <= 384) { + return 52; /* 3072-bit => key size 416-bit */ + } + else if (groupsize <= 512) { + return 60; /* 4096-bit => key size 480-bit */ + } + else if (groupsize <= 768) { + return 67; /* 6144-bit => key size 536-bit */ + } + else if (groupsize <= 1024) { + return 77; /* 8192-bit => key size 616-bit */ + } + else { + return 0; + } +} + +int dh_generate_key(prng_state *prng, int wprng, dh_key *key) +{ + unsigned char *buf; + unsigned long keysize; + int err, max_iterations = LTC_PK_MAX_RETRIES; + + LTC_ARGCHK(key != NULL); + LTC_ARGCHK(ltc_mp.name != NULL); + + /* good prng? */ + if ((err = prng_is_valid(wprng)) != CRYPT_OK) { + return err; + } + + keysize = _dh_groupsize_to_keysize(mp_unsigned_bin_size(key->prime)); + if (keysize == 0) { + err = CRYPT_INVALID_KEYSIZE; + goto freemp; + } + + /* allocate buffer */ + buf = XMALLOC(keysize); + if (buf == NULL) { + err = CRYPT_MEM; + goto freemp; + } + + key->type = PK_PRIVATE; + do { + /* make up random buf */ + if (prng_descriptor[wprng].read(buf, keysize, prng) != keysize) { + err = CRYPT_ERROR_READPRNG; + goto freebuf; + } + /* load the x value - private key */ + if ((err = mp_read_unsigned_bin(key->x, buf, keysize)) != CRYPT_OK) { + goto freebuf; + } + /* compute the y value - public key */ + if ((err = mp_exptmod(key->base, key->x, key->prime, key->y)) != CRYPT_OK) { + goto freebuf; + } + err = dh_check_pubkey(key); + } while (err != CRYPT_OK && max_iterations-- > 0); + +freebuf: + zeromem(buf, keysize); + XFREE(buf); +freemp: + if (err != CRYPT_OK) dh_free(key); + return err; +} + +#endif /* LTC_MDH */ + +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/pk/dh/dh_import.c b/libtomcrypt/src/pk/dh/dh_import.c new file mode 100644 index 0000000..601e5e7 --- /dev/null +++ b/libtomcrypt/src/pk/dh/dh_import.c @@ -0,0 +1,99 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + */ + +#include "tomcrypt.h" + +#ifdef LTC_MDH + +/** + Import a DH key from a binary packet + @param in The packet to read + @param inlen The length of the input packet + @param key [out] Where to import the key to + @return CRYPT_OK if successful, on error all allocated memory is freed automatically +*/ +int dh_import(const unsigned char *in, unsigned long inlen, dh_key *key) +{ + unsigned char flags[1]; + int err; + unsigned long version; + + LTC_ARGCHK(in != NULL); + LTC_ARGCHK(key != NULL); + + /* init */ + if ((err = mp_init_multi(&key->x, &key->y, &key->base, &key->prime, NULL)) != CRYPT_OK) { + return err; + } + + /* find out what type of key it is */ + err = der_decode_sequence_multi(in, inlen, + LTC_ASN1_SHORT_INTEGER, 1UL, &version, + LTC_ASN1_BIT_STRING, 1UL, &flags, + LTC_ASN1_EOL, 0UL, NULL); + if (err != CRYPT_OK && err != CRYPT_INPUT_TOO_LONG) { + goto error; + } + + if (version == 0) { + if (flags[0] == 1) { + key->type = PK_PRIVATE; + if ((err = der_decode_sequence_multi(in, inlen, + LTC_ASN1_SHORT_INTEGER, 1UL, &version, + LTC_ASN1_BIT_STRING, 1UL, flags, + LTC_ASN1_INTEGER, 1UL, key->prime, + LTC_ASN1_INTEGER, 1UL, key->base, + LTC_ASN1_INTEGER, 1UL, key->x, + LTC_ASN1_EOL, 0UL, NULL)) != CRYPT_OK) { + goto error; + } + /* compute public key: y = (base ^ x) mod prime */ + if ((err = mp_exptmod(key->base, key->x, key->prime, key->y)) != CRYPT_OK) { + goto error; + } + } + else if (flags[0] == 0) { + key->type = PK_PUBLIC; + if ((err = der_decode_sequence_multi(in, inlen, + LTC_ASN1_SHORT_INTEGER, 1UL, &version, + LTC_ASN1_BIT_STRING, 1UL, flags, + LTC_ASN1_INTEGER, 1UL, key->prime, + LTC_ASN1_INTEGER, 1UL, key->base, + LTC_ASN1_INTEGER, 1UL, key->y, + LTC_ASN1_EOL, 0UL, NULL)) != CRYPT_OK) { + goto error; + } + } + else { + err = CRYPT_INVALID_PACKET; + goto error; + } + } + else { + err = CRYPT_INVALID_PACKET; + goto error; + } + + /* check public key */ + if ((err = dh_check_pubkey(key)) != CRYPT_OK) { + goto error; + } + + return CRYPT_OK; + +error: + dh_free(key); + return err; +} + +#endif /* LTC_MDH */ + +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/pk/dh/dh_set.c b/libtomcrypt/src/pk/dh/dh_set.c new file mode 100644 index 0000000..8d0af7d --- /dev/null +++ b/libtomcrypt/src/pk/dh/dh_set.c @@ -0,0 +1,124 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + */ + +#include "tomcrypt.h" + +#ifdef LTC_MDH + +/** + Import DH key parts p and g from raw numbers + + @param p DH's p (prime) + @param plen DH's p's length + @param g DH's g (group) + @param glen DH's g's length + @param key [out] the destination for the imported key + @return CRYPT_OK if successful +*/ +int dh_set_pg(const unsigned char *p, unsigned long plen, + const unsigned char *g, unsigned long glen, + dh_key *key) +{ + int err; + + LTC_ARGCHK(key != NULL); + LTC_ARGCHK(p != NULL); + LTC_ARGCHK(g != NULL); + LTC_ARGCHK(ltc_mp.name != NULL); + + if ((err = mp_init_multi(&key->x, &key->y, &key->base, &key->prime, NULL)) != CRYPT_OK) { + return err; + } + + if ((err = mp_read_unsigned_bin(key->base, (unsigned char*)g, glen)) != CRYPT_OK) { goto LBL_ERR; } + if ((err = mp_read_unsigned_bin(key->prime, (unsigned char*)p, plen)) != CRYPT_OK) { goto LBL_ERR; } + + return CRYPT_OK; + +LBL_ERR: + dh_free(key); + return err; +} + +/** + Import DH key parts p and g from built-in DH groups + + @param groupsize The size of the DH group to use + @param key [out] Where the newly created DH key will be stored + @return CRYPT_OK if successful, note: on error all allocated memory will be freed automatically. +*/ +int dh_set_pg_groupsize(int groupsize, dh_key *key) +{ + int err, i; + + LTC_ARGCHK(key != NULL); + LTC_ARGCHK(ltc_mp.name != NULL); + LTC_ARGCHK(groupsize > 0); + + for (i = 0; (groupsize > ltc_dh_sets[i].size) && (ltc_dh_sets[i].size != 0); i++); + if (ltc_dh_sets[i].size == 0) return CRYPT_INVALID_KEYSIZE; + + if ((err = mp_init_multi(&key->x, &key->y, &key->base, &key->prime, NULL)) != CRYPT_OK) { + return err; + } + if ((err = mp_read_radix(key->base, ltc_dh_sets[i].base, 16)) != CRYPT_OK) { goto LBL_ERR; } + if ((err = mp_read_radix(key->prime, ltc_dh_sets[i].prime, 16)) != CRYPT_OK) { goto LBL_ERR; } + + return CRYPT_OK; + +LBL_ERR: + dh_free(key); + return err; +} + +/** + Import DH public or private key part from raw numbers + + NB: The p & g parts must be set beforehand + + @param in The key-part to import, either public or private. + @param inlen The key-part's length + @param type Which type of key (PK_PRIVATE or PK_PUBLIC) + @param key [out] the destination for the imported key + @return CRYPT_OK if successful +*/ +int dh_set_key(const unsigned char *in, unsigned long inlen, int type, dh_key *key) +{ + int err; + + LTC_ARGCHK(key != NULL); + LTC_ARGCHK(ltc_mp.name != NULL); + + if (type == PK_PRIVATE) { + key->type = PK_PRIVATE; + if ((err = mp_read_unsigned_bin(key->x, (unsigned char*)in, inlen)) != CRYPT_OK) { goto LBL_ERR; } + if ((err = mp_exptmod(key->base, key->x, key->prime, key->y)) != CRYPT_OK) { goto LBL_ERR; } + } + else { + key->type = PK_PUBLIC; + if ((err = mp_read_unsigned_bin(key->y, (unsigned char*)in, inlen)) != CRYPT_OK) { goto LBL_ERR; } + } + + /* check public key */ + if ((err = dh_check_pubkey(key)) != CRYPT_OK) { + goto LBL_ERR; + } + + return CRYPT_OK; + +LBL_ERR: + dh_free(key); + return err; +} + +#endif /* LTC_MDH */ + +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/pk/dh/dh_set_pg_dhparam.c b/libtomcrypt/src/pk/dh/dh_set_pg_dhparam.c new file mode 100644 index 0000000..7003011 --- /dev/null +++ b/libtomcrypt/src/pk/dh/dh_set_pg_dhparam.c @@ -0,0 +1,54 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + */ + +#include "tomcrypt.h" + +#ifdef LTC_MDH + +/** + Import DH key parts p and g from dhparam + + dhparam data: openssl dhparam -outform DER -out dhparam.der 2048 + + @param dhparam The DH param DER encoded data + @param dhparamlen The length of dhparam data + @param key [out] Where the newly created DH key will be stored + @return CRYPT_OK if successful, note: on error all allocated memory will be freed automatically. +*/ +int dh_set_pg_dhparam(const unsigned char *dhparam, unsigned long dhparamlen, dh_key *key) +{ + int err; + + LTC_ARGCHK(key != NULL); + LTC_ARGCHK(ltc_mp.name != NULL); + LTC_ARGCHK(dhparam != NULL); + LTC_ARGCHK(dhparamlen > 0); + + if ((err = mp_init_multi(&key->x, &key->y, &key->base, &key->prime, NULL)) != CRYPT_OK) { + return err; + } + if ((err = der_decode_sequence_multi(dhparam, dhparamlen, + LTC_ASN1_INTEGER, 1UL, key->prime, + LTC_ASN1_INTEGER, 1UL, key->base, + LTC_ASN1_EOL, 0UL, NULL)) != CRYPT_OK) { + goto LBL_ERR; + } + + return CRYPT_OK; + +LBL_ERR: + dh_free(key); + return err; +} + +#endif /* LTC_MDH */ + +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/pk/dh/dh_shared_secret.c b/libtomcrypt/src/pk/dh/dh_shared_secret.c new file mode 100644 index 0000000..1eb69fb --- /dev/null +++ b/libtomcrypt/src/pk/dh/dh_shared_secret.c @@ -0,0 +1,80 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + */ + +#include "tomcrypt.h" + +#ifdef LTC_MDH + +/** + Create a DH shared secret. + @param private_key The private DH key in the pair + @param public_key The public DH key in the pair + @param out [out] The destination of the shared data + @param outlen [in/out] The max size and resulting size of the shared data. + @return CRYPT_OK if successful +*/ +int dh_shared_secret(dh_key *private_key, dh_key *public_key, + unsigned char *out, unsigned long *outlen) +{ + void *tmp; + unsigned long x; + int err; + + LTC_ARGCHK(private_key != NULL); + LTC_ARGCHK(public_key != NULL); + LTC_ARGCHK(out != NULL); + LTC_ARGCHK(outlen != NULL); + + /* types valid? */ + if (private_key->type != PK_PRIVATE) { + return CRYPT_PK_NOT_PRIVATE; + } + + /* same DH group? */ + if (mp_cmp(private_key->prime, public_key->prime) != LTC_MP_EQ) { return CRYPT_PK_TYPE_MISMATCH; } + if (mp_cmp(private_key->base, public_key->base) != LTC_MP_EQ) { return CRYPT_PK_TYPE_MISMATCH; } + + /* init big numbers */ + if ((err = mp_init(&tmp)) != CRYPT_OK) { + return err; + } + + /* check public key */ + if ((err = dh_check_pubkey(public_key)) != CRYPT_OK) { + goto error; + } + + /* compute tmp = y^x mod p */ + if ((err = mp_exptmod(public_key->y, private_key->x, private_key->prime, tmp)) != CRYPT_OK) { + goto error; + } + + /* enough space for output? */ + x = (unsigned long)mp_unsigned_bin_size(tmp); + if (*outlen < x) { + *outlen = x; + err = CRYPT_BUFFER_OVERFLOW; + goto error; + } + if ((err = mp_to_unsigned_bin(tmp, out)) != CRYPT_OK) { + goto error; + } + *outlen = x; + err = CRYPT_OK; + +error: + mp_clear(tmp); + return err; +} + +#endif /* LTC_MDH */ + +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/pk/dsa/dsa_decrypt_key.c b/libtomcrypt/src/pk/dsa/dsa_decrypt_key.c index c622c78..ef4e1dd 100644 --- a/libtomcrypt/src/pk/dsa/dsa_decrypt_key.c +++ b/libtomcrypt/src/pk/dsa/dsa_decrypt_key.c @@ -5,15 +5,13 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" /** @file dsa_decrypt_key.c DSA Crypto, Tom St Denis -*/ +*/ #ifdef LTC_MDSA @@ -27,12 +25,13 @@ @return CRYPT_OK if successful */ int dsa_decrypt_key(const unsigned char *in, unsigned long inlen, - unsigned char *out, unsigned long *outlen, + unsigned char *out, unsigned long *outlen, dsa_key *key) { unsigned char *skey, *expt; void *g_pub; - unsigned long x, y, hashOID[32]; + unsigned long x, y; + unsigned long hashOID[32] = { 0 }; int hash, err; ltc_asn1_list decode[3]; @@ -45,21 +44,21 @@ int dsa_decrypt_key(const unsigned char *in, unsigned long inlen, if (key->type != PK_PRIVATE) { return CRYPT_PK_NOT_PRIVATE; } - + /* decode to find out hash */ LTC_SET_ASN1(decode, 0, LTC_ASN1_OBJECT_IDENTIFIER, hashOID, sizeof(hashOID)/sizeof(hashOID[0])); - - if ((err = der_decode_sequence(in, inlen, decode, 1)) != CRYPT_OK) { + err = der_decode_sequence(in, inlen, decode, 1); + if (err != CRYPT_OK && err != CRYPT_INPUT_TOO_LONG) { return err; } - hash = find_hash_oid(hashOID, decode[0].size); + hash = find_hash_oid(hashOID, decode[0].size); if (hash_is_valid(hash) != CRYPT_OK) { return CRYPT_INVALID_PACKET; } /* we now have the hash! */ - + if ((err = mp_init(&g_pub)) != CRYPT_OK) { return err; } @@ -77,7 +76,7 @@ int dsa_decrypt_key(const unsigned char *in, unsigned long inlen, mp_clear(g_pub); return CRYPT_MEM; } - + LTC_SET_ASN1(decode, 1, LTC_ASN1_INTEGER, g_pub, 1UL); LTC_SET_ASN1(decode, 2, LTC_ASN1_OCTET_STRING, skey, MAXBLOCKSIZE); @@ -92,7 +91,8 @@ int dsa_decrypt_key(const unsigned char *in, unsigned long inlen, goto LBL_ERR; } - y = MIN(mp_unsigned_bin_size(key->p) + 1, MAXBLOCKSIZE); + y = mp_unsigned_bin_size(key->p) + 1; + y = MIN(y, MAXBLOCKSIZE); if ((err = hash_memory(hash, expt, x, expt, &y)) != CRYPT_OK) { goto LBL_ERR; } @@ -125,7 +125,7 @@ LBL_ERR: XFREE(expt); XFREE(skey); - + mp_clear(g_pub); return err; @@ -133,7 +133,7 @@ LBL_ERR: #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/pk/dsa/dsa_encrypt_key.c b/libtomcrypt/src/pk/dsa/dsa_encrypt_key.c index a082969..c854367 100644 --- a/libtomcrypt/src/pk/dsa/dsa_encrypt_key.c +++ b/libtomcrypt/src/pk/dsa/dsa_encrypt_key.c @@ -5,15 +5,13 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" /** @file dsa_encrypt_key.c DSA Crypto, Tom St Denis -*/ +*/ #ifdef LTC_MDSA @@ -24,14 +22,14 @@ @param out [out] The destination for the ciphertext @param outlen [in/out] The max size and resulting size of the ciphertext @param prng An active PRNG state - @param wprng The index of the PRNG you wish to use - @param hash The index of the hash you want to use + @param wprng The index of the PRNG you wish to use + @param hash The index of the hash you want to use @param key The DSA key you want to encrypt to @return CRYPT_OK if successful */ int dsa_encrypt_key(const unsigned char *in, unsigned long inlen, - unsigned char *out, unsigned long *outlen, - prng_state *prng, int wprng, int hash, + unsigned char *out, unsigned long *outlen, + prng_state *prng, int wprng, int hash, dsa_key *key) { unsigned char *expt, *skey; @@ -61,7 +59,7 @@ int dsa_encrypt_key(const unsigned char *in, unsigned long inlen, if ((err = mp_init_multi(&g_pub, &g_priv, NULL)) != CRYPT_OK) { return err; } - + expt = XMALLOC(mp_unsigned_bin_size(key->p) + 1); skey = XMALLOC(MAXBLOCKSIZE); if (expt == NULL || skey == NULL) { @@ -74,24 +72,19 @@ int dsa_encrypt_key(const unsigned char *in, unsigned long inlen, mp_clear_multi(g_pub, g_priv, NULL); return CRYPT_MEM; } - - /* make a random x, g^x pair */ - x = mp_unsigned_bin_size(key->q); - if (prng_descriptor[wprng].read(expt, x, prng) != x) { - err = CRYPT_ERROR_READPRNG; - goto LBL_ERR; - } - - /* load x */ - if ((err = mp_read_unsigned_bin(g_priv, expt, x)) != CRYPT_OK) { - goto LBL_ERR; + + /* make a random g_priv, g_pub = g^x pair + private key x should be in range: 1 <= x <= q-1 (see FIPS 186-4 B.1.2) + */ + if ((err = rand_bn_upto(g_priv, key->q, prng, wprng)) != CRYPT_OK) { + goto LBL_ERR; } - + /* compute y */ if ((err = mp_exptmod(key->g, g_priv, key->p, g_pub)) != CRYPT_OK) { goto LBL_ERR; } - + /* make random key */ x = mp_unsigned_bin_size(key->p) + 1; if ((err = dsa_shared_secret(g_priv, key->y, key, expt, &x)) != CRYPT_OK) { @@ -102,7 +95,7 @@ int dsa_encrypt_key(const unsigned char *in, unsigned long inlen, if ((err = hash_memory(hash, expt, x, skey, &y)) != CRYPT_OK) { goto LBL_ERR; } - + /* Encrypt key */ for (x = 0; x < inlen; x++) { skey[x] ^= in[x]; @@ -123,13 +116,13 @@ LBL_ERR: XFREE(skey); XFREE(expt); - + mp_clear_multi(g_pub, g_priv, NULL); return err; } #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/pk/dsa/dsa_export.c b/libtomcrypt/src/pk/dsa/dsa_export.c index e4c4508..1f6bb5a 100644 --- a/libtomcrypt/src/pk/dsa/dsa_export.c +++ b/libtomcrypt/src/pk/dsa/dsa_export.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" @@ -27,12 +25,16 @@ */ int dsa_export(unsigned char *out, unsigned long *outlen, int type, dsa_key *key) { - unsigned char flags[1]; + unsigned long zero=0; + int err, std; LTC_ARGCHK(out != NULL); LTC_ARGCHK(outlen != NULL); LTC_ARGCHK(key != NULL); + std = type & PK_STD; + type &= ~PK_STD; + /* can we store the static header? */ if (type == PK_PRIVATE && key->type != PK_PRIVATE) { return CRYPT_PK_TYPE_MISMATCH; @@ -42,31 +44,73 @@ int dsa_export(unsigned char *out, unsigned long *outlen, int type, dsa_key *key return CRYPT_INVALID_ARG; } - flags[0] = (type != PK_PUBLIC) ? 1 : 0; - if (type == PK_PRIVATE) { - return der_encode_sequence_multi(out, outlen, - LTC_ASN1_BIT_STRING, 1UL, flags, - LTC_ASN1_INTEGER, 1UL, key->g, - LTC_ASN1_INTEGER, 1UL, key->p, - LTC_ASN1_INTEGER, 1UL, key->q, - LTC_ASN1_INTEGER, 1UL, key->y, - LTC_ASN1_INTEGER, 1UL, key->x, - LTC_ASN1_EOL, 0UL, NULL); + if (std) { + return der_encode_sequence_multi(out, outlen, + LTC_ASN1_SHORT_INTEGER, 1UL, &zero, + LTC_ASN1_INTEGER, 1UL, key->p, + LTC_ASN1_INTEGER, 1UL, key->q, + LTC_ASN1_INTEGER, 1UL, key->g, + LTC_ASN1_INTEGER, 1UL, key->y, + LTC_ASN1_INTEGER, 1UL, key->x, + LTC_ASN1_EOL, 0UL, NULL); + } + else { + unsigned char flags[1]; + flags[0] = 1; + return der_encode_sequence_multi(out, outlen, + LTC_ASN1_BIT_STRING, 1UL, flags, + LTC_ASN1_INTEGER, 1UL, key->g, + LTC_ASN1_INTEGER, 1UL, key->p, + LTC_ASN1_INTEGER, 1UL, key->q, + LTC_ASN1_INTEGER, 1UL, key->y, + LTC_ASN1_INTEGER, 1UL, key->x, + LTC_ASN1_EOL, 0UL, NULL); + } } else { - return der_encode_sequence_multi(out, outlen, - LTC_ASN1_BIT_STRING, 1UL, flags, - LTC_ASN1_INTEGER, 1UL, key->g, - LTC_ASN1_INTEGER, 1UL, key->p, - LTC_ASN1_INTEGER, 1UL, key->q, - LTC_ASN1_INTEGER, 1UL, key->y, - LTC_ASN1_EOL, 0UL, NULL); + if (std) { + unsigned long tmplen = (mp_count_bits(key->y) / 8) + 8; + unsigned char* tmp = XMALLOC(tmplen); + ltc_asn1_list int_list[3]; + + if (tmp == NULL) { + return CRYPT_MEM; + } + + err = der_encode_integer(key->y, tmp, &tmplen); + if (err != CRYPT_OK) { + goto error; + } + + LTC_SET_ASN1(int_list, 0, LTC_ASN1_INTEGER, key->p, 1UL); + LTC_SET_ASN1(int_list, 1, LTC_ASN1_INTEGER, key->q, 1UL); + LTC_SET_ASN1(int_list, 2, LTC_ASN1_INTEGER, key->g, 1UL); + + err = der_encode_subject_public_key_info(out, outlen, PKA_DSA, tmp, + tmplen, LTC_ASN1_SEQUENCE, int_list, + sizeof(int_list) / sizeof(int_list[0])); + +error: + XFREE(tmp); + return err; + } + else { + unsigned char flags[1]; + flags[0] = 0; + return der_encode_sequence_multi(out, outlen, + LTC_ASN1_BIT_STRING, 1UL, flags, + LTC_ASN1_INTEGER, 1UL, key->g, + LTC_ASN1_INTEGER, 1UL, key->p, + LTC_ASN1_INTEGER, 1UL, key->q, + LTC_ASN1_INTEGER, 1UL, key->y, + LTC_ASN1_EOL, 0UL, NULL); + } } } #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/pk/dsa/dsa_free.c b/libtomcrypt/src/pk/dsa/dsa_free.c index 5f5ce72..5cac656 100644 --- a/libtomcrypt/src/pk/dsa/dsa_free.c +++ b/libtomcrypt/src/pk/dsa/dsa_free.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" @@ -24,11 +22,12 @@ void dsa_free(dsa_key *key) { LTC_ARGCHKVD(key != NULL); - mp_clear_multi(key->g, key->q, key->p, key->x, key->y, NULL); + mp_cleanup_multi(&key->y, &key->x, &key->q, &key->g, &key->p, NULL); + key->type = key->qord = 0; } #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/pk/dsa/dsa_generate_key.c b/libtomcrypt/src/pk/dsa/dsa_generate_key.c new file mode 100644 index 0000000..18b2df6 --- /dev/null +++ b/libtomcrypt/src/pk/dsa/dsa_generate_key.c @@ -0,0 +1,47 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + */ +#include "tomcrypt.h" + +/** + @file dsa_make_key.c + DSA implementation, generate a DSA key +*/ + +#ifdef LTC_MDSA + +/** + Create a DSA key + @param prng An active PRNG state + @param wprng The index of the PRNG desired + @param key [in/out] Where to store the created key + @return CRYPT_OK if successful. +*/ +int dsa_generate_key(prng_state *prng, int wprng, dsa_key *key) +{ + int err; + + LTC_ARGCHK(key != NULL); + LTC_ARGCHK(ltc_mp.name != NULL); + + /* so now we have our DH structure, generator g, order q, modulus p + Now we need a random exponent [mod q] and it's power g^x mod p + */ + /* private key x should be from range: 1 <= x <= q-1 (see FIPS 186-4 B.1.2) */ + if ((err = rand_bn_upto(key->x, key->q, prng, wprng)) != CRYPT_OK) { return err; } + if ((err = mp_exptmod(key->g, key->x, key->p, key->y)) != CRYPT_OK) { return err; } + key->type = PK_PRIVATE; + + return CRYPT_OK; +} + +#endif + +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/pk/dsa/dsa_generate_pqg.c b/libtomcrypt/src/pk/dsa/dsa_generate_pqg.c new file mode 100644 index 0000000..91c7ef7 --- /dev/null +++ b/libtomcrypt/src/pk/dsa/dsa_generate_pqg.c @@ -0,0 +1,244 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + */ +#include "tomcrypt.h" + +/** + @file dsa_generate_pqg.c + DSA implementation - generate DSA parameters p, q & g +*/ + +#ifdef LTC_MDSA + +/** + Create DSA parameters (INTERNAL ONLY, not part of public API) + @param prng An active PRNG state + @param wprng The index of the PRNG desired + @param group_size Size of the multiplicative group (octets) + @param modulus_size Size of the modulus (octets) + @param p [out] bignum where generated 'p' is stored (must be initialized by caller) + @param q [out] bignum where generated 'q' is stored (must be initialized by caller) + @param g [out] bignum where generated 'g' is stored (must be initialized by caller) + @return CRYPT_OK if successful, upon error this function will free all allocated memory +*/ +static int _dsa_make_params(prng_state *prng, int wprng, int group_size, int modulus_size, void *p, void *q, void *g) +{ + unsigned long L, N, n, outbytes, seedbytes, counter, j, i; + int err, res, mr_tests_q, mr_tests_p, found_p, found_q, hash; + unsigned char *wbuf, *sbuf, digest[MAXBLOCKSIZE]; + void *t2L1, *t2N1, *t2q, *t2seedlen, *U, *W, *X, *c, *h, *e, *seedinc; + + /* check size */ + if (group_size >= LTC_MDSA_MAX_GROUP || group_size < 1 || group_size >= modulus_size) { + return CRYPT_INVALID_ARG; + } + + /* FIPS-186-4 A.1.1.2 Generation of the Probable Primes p and q Using an Approved Hash Function + * + * L = The desired length of the prime p (in bits e.g. L = 1024) + * N = The desired length of the prime q (in bits e.g. N = 160) + * seedlen = The desired bit length of the domain parameter seed; seedlen shallbe equal to or greater than N + * outlen = The bit length of Hash function + * + * 1. Check that the (L, N) + * 2. If (seedlen <N), then return INVALID. + * 3. n = ceil(L / outlen) - 1 + * 4. b = L- 1 - (n * outlen) + * 5. domain_parameter_seed = an arbitrary sequence of seedlen bits + * 6. U = Hash (domain_parameter_seed) mod 2^(N-1) + * 7. q = 2^(N-1) + U + 1 - (U mod 2) + * 8. Test whether or not q is prime as specified in Appendix C.3 + * 9. If qis not a prime, then go to step 5. + * 10. offset = 1 + * 11. For counter = 0 to (4L- 1) do { + * For j=0 to n do { + * Vj = Hash ((domain_parameter_seed+ offset + j) mod 2^seedlen + * } + * W = V0 + (V1 *2^outlen) + ... + (Vn-1 * 2^((n-1) * outlen)) + ((Vn mod 2^b) * 2^(n * outlen)) + * X = W + 2^(L-1) Comment: 0 <= W < 2^(L-1); hence 2^(L-1) <= X < 2^L + * c = X mod 2*q + * p = X - (c - 1) Comment: p ~ 1 (mod 2*q) + * If (p >= 2^(L-1)) { + * Test whether or not p is prime as specified in Appendix C.3. + * If p is determined to be prime, then return VALID and the values of p, qand (optionally) the values of domain_parameter_seed and counter + * } + * offset = offset + n + 1 Comment: Increment offset + * } + */ + + seedbytes = group_size; + L = modulus_size * 8; + N = group_size * 8; + + /* XXX-TODO no Lucas test */ +#ifdef LTC_MPI_HAS_LUCAS_TEST + /* M-R tests (when followed by one Lucas test) according FIPS-186-4 - Appendix C.3 - table C.1 */ + mr_tests_p = (L <= 2048) ? 3 : 2; + if (N <= 160) { mr_tests_q = 19; } + else if (N <= 224) { mr_tests_q = 24; } + else { mr_tests_q = 27; } +#else + /* M-R tests (without Lucas test) according FIPS-186-4 - Appendix C.3 - table C.1 */ + if (L <= 1024) { mr_tests_p = 40; } + else if (L <= 2048) { mr_tests_p = 56; } + else { mr_tests_p = 64; } + + if (N <= 160) { mr_tests_q = 40; } + else if (N <= 224) { mr_tests_q = 56; } + else { mr_tests_q = 64; } +#endif + + if (N <= 256) { + hash = register_hash(&sha256_desc); + } + else if (N <= 384) { + hash = register_hash(&sha384_desc); + } + else if (N <= 512) { + hash = register_hash(&sha512_desc); + } + else { + return CRYPT_INVALID_ARG; /* group_size too big */ + } + + if ((err = hash_is_valid(hash)) != CRYPT_OK) { return err; } + outbytes = hash_descriptor[hash].hashsize; + + n = ((L + outbytes*8 - 1) / (outbytes*8)) - 1; + + if ((wbuf = XMALLOC((n+1)*outbytes)) == NULL) { err = CRYPT_MEM; goto cleanup3; } + if ((sbuf = XMALLOC(seedbytes)) == NULL) { err = CRYPT_MEM; goto cleanup2; } + + err = mp_init_multi(&t2L1, &t2N1, &t2q, &t2seedlen, &U, &W, &X, &c, &h, &e, &seedinc, NULL); + if (err != CRYPT_OK) { goto cleanup1; } + + if ((err = mp_2expt(t2L1, L-1)) != CRYPT_OK) { goto cleanup; } + /* t2L1 = 2^(L-1) */ + if ((err = mp_2expt(t2N1, N-1)) != CRYPT_OK) { goto cleanup; } + /* t2N1 = 2^(N-1) */ + if ((err = mp_2expt(t2seedlen, seedbytes*8)) != CRYPT_OK) { goto cleanup; } + /* t2seedlen = 2^seedlen */ + + for(found_p=0; !found_p;) { + /* q */ + for(found_q=0; !found_q;) { + if (prng_descriptor[wprng].read(sbuf, seedbytes, prng) != seedbytes) { err = CRYPT_ERROR_READPRNG; goto cleanup; } + i = outbytes; + if ((err = hash_memory(hash, sbuf, seedbytes, digest, &i)) != CRYPT_OK) { goto cleanup; } + if ((err = mp_read_unsigned_bin(U, digest, outbytes)) != CRYPT_OK) { goto cleanup; } + if ((err = mp_mod(U, t2N1, U)) != CRYPT_OK) { goto cleanup; } + if ((err = mp_add(t2N1, U, q)) != CRYPT_OK) { goto cleanup; } + if (!mp_isodd(q)) mp_add_d(q, 1, q); + if ((err = mp_prime_is_prime(q, mr_tests_q, &res)) != CRYPT_OK) { goto cleanup; } + if (res == LTC_MP_YES) found_q = 1; + } + + /* p */ + if ((err = mp_read_unsigned_bin(seedinc, sbuf, seedbytes)) != CRYPT_OK) { goto cleanup; } + if ((err = mp_add(q, q, t2q)) != CRYPT_OK) { goto cleanup; } + for(counter=0; counter < 4*L && !found_p; counter++) { + for(j=0; j<=n; j++) { + if ((err = mp_add_d(seedinc, 1, seedinc)) != CRYPT_OK) { goto cleanup; } + if ((err = mp_mod(seedinc, t2seedlen, seedinc)) != CRYPT_OK) { goto cleanup; } + /* seedinc = (seedinc+1) % 2^seed_bitlen */ + if ((i = mp_unsigned_bin_size(seedinc)) > seedbytes) { err = CRYPT_INVALID_ARG; goto cleanup; } + zeromem(sbuf, seedbytes); + if ((err = mp_to_unsigned_bin(seedinc, sbuf + seedbytes-i)) != CRYPT_OK) { goto cleanup; } + i = outbytes; + err = hash_memory(hash, sbuf, seedbytes, wbuf+(n-j)*outbytes, &i); + if (err != CRYPT_OK) { goto cleanup; } + } + if ((err = mp_read_unsigned_bin(W, wbuf, (n+1)*outbytes)) != CRYPT_OK) { goto cleanup; } + if ((err = mp_mod(W, t2L1, W)) != CRYPT_OK) { goto cleanup; } + if ((err = mp_add(W, t2L1, X)) != CRYPT_OK) { goto cleanup; } + if ((err = mp_mod(X, t2q, c)) != CRYPT_OK) { goto cleanup; } + if ((err = mp_sub_d(c, 1, p)) != CRYPT_OK) { goto cleanup; } + if ((err = mp_sub(X, p, p)) != CRYPT_OK) { goto cleanup; } + if (mp_cmp(p, t2L1) != LTC_MP_LT) { + /* p >= 2^(L-1) */ + if ((err = mp_prime_is_prime(p, mr_tests_p, &res)) != CRYPT_OK) { goto cleanup; } + if (res == LTC_MP_YES) { + found_p = 1; + } + } + } + } + + /* FIPS-186-4 A.2.1 Unverifiable Generation of the Generator g + * 1. e = (p - 1)/q + * 2. h = any integer satisfying: 1 < h < (p - 1) + * h could be obtained from a random number generator or from a counter that changes after each use + * 3. g = h^e mod p + * 4. if (g == 1), then go to step 2. + * + */ + + if ((err = mp_sub_d(p, 1, e)) != CRYPT_OK) { goto cleanup; } + if ((err = mp_div(e, q, e, c)) != CRYPT_OK) { goto cleanup; } + /* e = (p - 1)/q */ + i = mp_count_bits(p); + do { + do { + if ((err = rand_bn_bits(h, i, prng, wprng)) != CRYPT_OK) { goto cleanup; } + } while (mp_cmp(h, p) != LTC_MP_LT || mp_cmp_d(h, 2) != LTC_MP_GT); + if ((err = mp_sub_d(h, 1, h)) != CRYPT_OK) { goto cleanup; } + /* h is randon and 1 < h < (p-1) */ + if ((err = mp_exptmod(h, e, p, g)) != CRYPT_OK) { goto cleanup; } + } while (mp_cmp_d(g, 1) == LTC_MP_EQ); + + err = CRYPT_OK; +cleanup: + mp_clear_multi(t2L1, t2N1, t2q, t2seedlen, U, W, X, c, h, e, seedinc, NULL); +cleanup1: + XFREE(sbuf); +cleanup2: + XFREE(wbuf); +cleanup3: + return err; +} + +/** + Generate DSA parameters p, q & g + @param prng An active PRNG state + @param wprng The index of the PRNG desired + @param group_size Size of the multiplicative group (octets) + @param modulus_size Size of the modulus (octets) + @param key [out] Where to store the created key + @return CRYPT_OK if successful. +*/ +int dsa_generate_pqg(prng_state *prng, int wprng, int group_size, int modulus_size, dsa_key *key) +{ + int err; + + LTC_ARGCHK(key != NULL); + LTC_ARGCHK(ltc_mp.name != NULL); + + /* init mp_ints */ + if ((err = mp_init_multi(&key->p, &key->g, &key->q, &key->x, &key->y, NULL)) != CRYPT_OK) { + return err; + } + /* generate params */ + err = _dsa_make_params(prng, wprng, group_size, modulus_size, key->p, key->q, key->g); + if (err != CRYPT_OK) { + goto cleanup; + } + + key->qord = group_size; + + return CRYPT_OK; + +cleanup: + dsa_free(key); + return err; +} + +#endif + +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/pk/dsa/dsa_import.c b/libtomcrypt/src/pk/dsa/dsa_import.c index 47a68ca..e6a7560 100644 --- a/libtomcrypt/src/pk/dsa/dsa_import.c +++ b/libtomcrypt/src/pk/dsa/dsa_import.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" @@ -18,7 +16,7 @@ #ifdef LTC_MDSA /** - Import a DSA key + Import a DSA key @param in The binary packet to import from @param inlen The length of the binary packet @param key [out] Where to store the imported key @@ -26,8 +24,10 @@ */ int dsa_import(const unsigned char *in, unsigned long inlen, dsa_key *key) { + int err, stat; + unsigned long zero = 0; + unsigned char* tmpbuf = NULL; unsigned char flags[1]; - int err; LTC_ARGCHK(in != NULL); LTC_ARGCHK(key != NULL); @@ -38,53 +38,115 @@ int dsa_import(const unsigned char *in, unsigned long inlen, dsa_key *key) return CRYPT_MEM; } + /* try to match the old libtomcrypt format */ + err = der_decode_sequence_multi(in, inlen, LTC_ASN1_BIT_STRING, 1UL, flags, + LTC_ASN1_EOL, 0UL, NULL); + + if (err == CRYPT_OK || err == CRYPT_INPUT_TOO_LONG) { + /* private key */ + if (flags[0] == 1) { + if ((err = der_decode_sequence_multi(in, inlen, + LTC_ASN1_BIT_STRING, 1UL, flags, + LTC_ASN1_INTEGER, 1UL, key->g, + LTC_ASN1_INTEGER, 1UL, key->p, + LTC_ASN1_INTEGER, 1UL, key->q, + LTC_ASN1_INTEGER, 1UL, key->y, + LTC_ASN1_INTEGER, 1UL, key->x, + LTC_ASN1_EOL, 0UL, NULL)) != CRYPT_OK) { + goto LBL_ERR; + } + key->type = PK_PRIVATE; + goto LBL_OK; + } + /* public key */ + else if (flags[0] == 0) { + if ((err = der_decode_sequence_multi(in, inlen, + LTC_ASN1_BIT_STRING, 1UL, flags, + LTC_ASN1_INTEGER, 1UL, key->g, + LTC_ASN1_INTEGER, 1UL, key->p, + LTC_ASN1_INTEGER, 1UL, key->q, + LTC_ASN1_INTEGER, 1UL, key->y, + LTC_ASN1_EOL, 0UL, NULL)) != CRYPT_OK) { + goto LBL_ERR; + } + key->type = PK_PUBLIC; + goto LBL_OK; + } + else { + err = CRYPT_INVALID_PACKET; + goto LBL_ERR; + } + } /* get key type */ if ((err = der_decode_sequence_multi(in, inlen, - LTC_ASN1_BIT_STRING, 1UL, flags, - LTC_ASN1_EOL, 0UL, NULL)) != CRYPT_OK) { - goto error; - } + LTC_ASN1_SHORT_INTEGER, 1UL, &zero, + LTC_ASN1_INTEGER, 1UL, key->p, + LTC_ASN1_INTEGER, 1UL, key->q, + LTC_ASN1_INTEGER, 1UL, key->g, + LTC_ASN1_INTEGER, 1UL, key->y, + LTC_ASN1_INTEGER, 1UL, key->x, + LTC_ASN1_EOL, 0UL, NULL)) == CRYPT_OK) { + + key->type = PK_PRIVATE; + } else { /* public */ + ltc_asn1_list params[3]; + unsigned long tmpbuf_len = inlen; + + LTC_SET_ASN1(params, 0, LTC_ASN1_INTEGER, key->p, 1UL); + LTC_SET_ASN1(params, 1, LTC_ASN1_INTEGER, key->q, 1UL); + LTC_SET_ASN1(params, 2, LTC_ASN1_INTEGER, key->g, 1UL); + + tmpbuf = XCALLOC(1, tmpbuf_len); + if (tmpbuf == NULL) { + err = CRYPT_MEM; + goto LBL_ERR; + } - if (flags[0] == 1) { - if ((err = der_decode_sequence_multi(in, inlen, - LTC_ASN1_BIT_STRING, 1UL, flags, - LTC_ASN1_INTEGER, 1UL, key->g, - LTC_ASN1_INTEGER, 1UL, key->p, - LTC_ASN1_INTEGER, 1UL, key->q, - LTC_ASN1_INTEGER, 1UL, key->y, - LTC_ASN1_INTEGER, 1UL, key->x, - LTC_ASN1_EOL, 0UL, NULL)) != CRYPT_OK) { - goto error; + err = der_decode_subject_public_key_info(in, inlen, PKA_DSA, + tmpbuf, &tmpbuf_len, + LTC_ASN1_SEQUENCE, params, 3); + if (err != CRYPT_OK) { + XFREE(tmpbuf); + goto LBL_ERR; } - key->type = PK_PRIVATE; - } else { - if ((err = der_decode_sequence_multi(in, inlen, - LTC_ASN1_BIT_STRING, 1UL, flags, - LTC_ASN1_INTEGER, 1UL, key->g, - LTC_ASN1_INTEGER, 1UL, key->p, - LTC_ASN1_INTEGER, 1UL, key->q, - LTC_ASN1_INTEGER, 1UL, key->y, - LTC_ASN1_EOL, 0UL, NULL)) != CRYPT_OK) { - goto error; + + if ((err=der_decode_integer(tmpbuf, tmpbuf_len, key->y)) != CRYPT_OK) { + XFREE(tmpbuf); + goto LBL_ERR; } + + XFREE(tmpbuf); key->type = PK_PUBLIC; - } - key->qord = mp_unsigned_bin_size(key->q); + } + +LBL_OK: + key->qord = mp_unsigned_bin_size(key->q); - if (key->qord >= LTC_MDSA_MAX_GROUP || key->qord <= 15 || - (unsigned long)key->qord >= mp_unsigned_bin_size(key->p) || (mp_unsigned_bin_size(key->p) - key->qord) >= LTC_MDSA_DELTA) { + /* quick p, q, g validation, without primality testing */ + if ((err = dsa_int_validate_pqg(key, &stat)) != CRYPT_OK) { + goto LBL_ERR; + } + if (stat == 0) { + err = CRYPT_INVALID_PACKET; + goto LBL_ERR; + } + /* validate x, y */ + if ((err = dsa_int_validate_xy(key, &stat)) != CRYPT_OK) { + goto LBL_ERR; + } + if (stat == 0) { err = CRYPT_INVALID_PACKET; - goto error; + goto LBL_ERR; } return CRYPT_OK; -error: - mp_clear_multi(key->p, key->g, key->q, key->x, key->y, NULL); +LBL_ERR: + dsa_free(key); return err; } #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/pk/dsa/dsa_make_key.c b/libtomcrypt/src/pk/dsa/dsa_make_key.c index 1c16d03..8ac08f8 100644 --- a/libtomcrypt/src/pk/dsa/dsa_make_key.c +++ b/libtomcrypt/src/pk/dsa/dsa_make_key.c @@ -5,133 +5,37 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" /** @file dsa_make_key.c - DSA implementation, generate a DSA key, Tom St Denis + DSA implementation, generate a DSA key */ #ifdef LTC_MDSA /** - Create a DSA key + Old-style creation of a DSA key @param prng An active PRNG state @param wprng The index of the PRNG desired @param group_size Size of the multiplicative group (octets) @param modulus_size Size of the modulus (octets) @param key [out] Where to store the created key - @return CRYPT_OK if successful, upon error this function will free all allocated memory + @return CRYPT_OK if successful. */ int dsa_make_key(prng_state *prng, int wprng, int group_size, int modulus_size, dsa_key *key) { - void *tmp, *tmp2; - int err, res; - unsigned char *buf; - - LTC_ARGCHK(key != NULL); - LTC_ARGCHK(ltc_mp.name != NULL); - - /* check prng */ - if ((err = prng_is_valid(wprng)) != CRYPT_OK) { - return err; - } - - /* check size */ - if (group_size >= LTC_MDSA_MAX_GROUP || group_size <= 15 || - group_size >= modulus_size || (modulus_size - group_size) >= LTC_MDSA_DELTA) { - return CRYPT_INVALID_ARG; - } - - /* allocate ram */ - buf = XMALLOC(LTC_MDSA_DELTA); - if (buf == NULL) { - return CRYPT_MEM; - } - - /* init mp_ints */ - if ((err = mp_init_multi(&tmp, &tmp2, &key->g, &key->q, &key->p, &key->x, &key->y, NULL)) != CRYPT_OK) { - XFREE(buf); - return err; - } - - /* make our prime q */ - if ((err = rand_prime(key->q, group_size, prng, wprng)) != CRYPT_OK) { goto error; } - - /* double q */ - if ((err = mp_add(key->q, key->q, tmp)) != CRYPT_OK) { goto error; } - - /* now make a random string and multply it against q */ - if (prng_descriptor[wprng].read(buf+1, modulus_size - group_size, prng) != (unsigned long)(modulus_size - group_size)) { - err = CRYPT_ERROR_READPRNG; - goto error; - } - - /* force magnitude */ - buf[0] |= 0xC0; + int err; - /* force even */ - buf[modulus_size - group_size - 1] &= ~1; - - if ((err = mp_read_unsigned_bin(tmp2, buf, modulus_size - group_size)) != CRYPT_OK) { goto error; } - if ((err = mp_mul(key->q, tmp2, key->p)) != CRYPT_OK) { goto error; } - if ((err = mp_add_d(key->p, 1, key->p)) != CRYPT_OK) { goto error; } - - /* now loop until p is prime */ - for (;;) { - if ((err = mp_prime_is_prime(key->p, 8, &res)) != CRYPT_OK) { goto error; } - if (res == LTC_MP_YES) break; - - /* add 2q to p and 2 to tmp2 */ - if ((err = mp_add(tmp, key->p, key->p)) != CRYPT_OK) { goto error; } - if ((err = mp_add_d(tmp2, 2, tmp2)) != CRYPT_OK) { goto error; } - } - - /* now p = (q * tmp2) + 1 is prime, find a value g for which g^tmp2 != 1 */ - mp_set(key->g, 1); - - do { - if ((err = mp_add_d(key->g, 1, key->g)) != CRYPT_OK) { goto error; } - if ((err = mp_exptmod(key->g, tmp2, key->p, tmp)) != CRYPT_OK) { goto error; } - } while (mp_cmp_d(tmp, 1) == LTC_MP_EQ); - - /* at this point tmp generates a group of order q mod p */ - mp_exch(tmp, key->g); - - /* so now we have our DH structure, generator g, order q, modulus p - Now we need a random exponent [mod q] and it's power g^x mod p - */ - do { - if (prng_descriptor[wprng].read(buf, group_size, prng) != (unsigned long)group_size) { - err = CRYPT_ERROR_READPRNG; - goto error; - } - if ((err = mp_read_unsigned_bin(key->x, buf, group_size)) != CRYPT_OK) { goto error; } - } while (mp_cmp_d(key->x, 1) != LTC_MP_GT); - if ((err = mp_exptmod(key->g, key->x, key->p, key->y)) != CRYPT_OK) { goto error; } - - key->type = PK_PRIVATE; - key->qord = group_size; - -#ifdef LTC_CLEAN_STACK - zeromem(buf, LTC_MDSA_DELTA); -#endif + if ((err = dsa_generate_pqg(prng, wprng, group_size, modulus_size, key)) != CRYPT_OK) { return err; } + if ((err = dsa_generate_key(prng, wprng, key)) != CRYPT_OK) { return err; } - err = CRYPT_OK; - goto done; -error: - mp_clear_multi(key->g, key->q, key->p, key->x, key->y, NULL); -done: - mp_clear_multi(tmp, tmp2, NULL); - XFREE(buf); - return err; + return CRYPT_OK; } #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/pk/dsa/dsa_set.c b/libtomcrypt/src/pk/dsa/dsa_set.c new file mode 100644 index 0000000..a4d4042 --- /dev/null +++ b/libtomcrypt/src/pk/dsa/dsa_set.c @@ -0,0 +1,112 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + */ +#include "tomcrypt.h" + + +#ifdef LTC_MDSA + +/** + Import DSA's p, q & g from raw numbers + @param p DSA's p in binary representation + @param plen The length of p + @param q DSA's q in binary representation + @param qlen The length of q + @param g DSA's g in binary representation + @param glen The length of g + @param key [out] the destination for the imported key + @return CRYPT_OK if successful. +*/ +int dsa_set_pqg(const unsigned char *p, unsigned long plen, + const unsigned char *q, unsigned long qlen, + const unsigned char *g, unsigned long glen, + dsa_key *key) +{ + int err, stat; + + LTC_ARGCHK(p != NULL); + LTC_ARGCHK(q != NULL); + LTC_ARGCHK(g != NULL); + LTC_ARGCHK(key != NULL); + LTC_ARGCHK(ltc_mp.name != NULL); + + /* init key */ + err = mp_init_multi(&key->p, &key->g, &key->q, &key->x, &key->y, NULL); + if (err != CRYPT_OK) return err; + + if ((err = mp_read_unsigned_bin(key->p, (unsigned char *)p , plen)) != CRYPT_OK) { goto LBL_ERR; } + if ((err = mp_read_unsigned_bin(key->g, (unsigned char *)g , glen)) != CRYPT_OK) { goto LBL_ERR; } + if ((err = mp_read_unsigned_bin(key->q, (unsigned char *)q , qlen)) != CRYPT_OK) { goto LBL_ERR; } + + key->qord = mp_unsigned_bin_size(key->q); + + /* do only a quick validation, without primality testing */ + if ((err = dsa_int_validate_pqg(key, &stat)) != CRYPT_OK) { goto LBL_ERR; } + if (stat == 0) { + err = CRYPT_INVALID_PACKET; + goto LBL_ERR; + } + + return CRYPT_OK; + +LBL_ERR: + dsa_free(key); + return err; +} + +/** + Import DSA public or private key-part from raw numbers + + NB: The p, q & g parts must be set beforehand + + @param in The key-part to import, either public or private. + @param inlen The key-part's length + @param type Which type of key (PK_PRIVATE or PK_PUBLIC) + @param key [out] the destination for the imported key + @return CRYPT_OK if successful. +*/ +int dsa_set_key(const unsigned char *in, unsigned long inlen, int type, dsa_key *key) +{ + int err, stat = 0; + + LTC_ARGCHK(key != NULL); + LTC_ARGCHK(key->x != NULL); + LTC_ARGCHK(key->y != NULL); + LTC_ARGCHK(key->p != NULL); + LTC_ARGCHK(key->g != NULL); + LTC_ARGCHK(key->q != NULL); + LTC_ARGCHK(ltc_mp.name != NULL); + + if (type == PK_PRIVATE) { + key->type = PK_PRIVATE; + if ((err = mp_read_unsigned_bin(key->x, (unsigned char *)in, inlen)) != CRYPT_OK) { goto LBL_ERR; } + if ((err = mp_exptmod(key->g, key->x, key->p, key->y)) != CRYPT_OK) { goto LBL_ERR; } + } + else { + key->type = PK_PUBLIC; + if ((err = mp_read_unsigned_bin(key->y, (unsigned char *)in, inlen)) != CRYPT_OK) { goto LBL_ERR; } + } + + if ((err = dsa_int_validate_xy(key, &stat)) != CRYPT_OK) { goto LBL_ERR; } + if (stat == 0) { + err = CRYPT_INVALID_PACKET; + goto LBL_ERR; + } + + return CRYPT_OK; + +LBL_ERR: + dsa_free(key); + return err; +} + +#endif + +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/pk/dsa/dsa_set_pqg_dsaparam.c b/libtomcrypt/src/pk/dsa/dsa_set_pqg_dsaparam.c new file mode 100644 index 0000000..edbed1c --- /dev/null +++ b/libtomcrypt/src/pk/dsa/dsa_set_pqg_dsaparam.c @@ -0,0 +1,67 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + */ +#include "tomcrypt.h" + + +#ifdef LTC_MDSA + +/** + Import DSA's p, q & g from dsaparam + + dsaparam data: openssl dsaparam -outform DER -out dsaparam.der 2048 + + @param dsaparam The DSA param DER encoded data + @param dsaparamlen The length of dhparam data + @param key [out] the destination for the imported key + @return CRYPT_OK if successful. +*/ +int dsa_set_pqg_dsaparam(const unsigned char *dsaparam, unsigned long dsaparamlen, + dsa_key *key) +{ + int err, stat; + + LTC_ARGCHK(dsaparam != NULL); + LTC_ARGCHK(key != NULL); + LTC_ARGCHK(ltc_mp.name != NULL); + + /* init key */ + err = mp_init_multi(&key->p, &key->g, &key->q, &key->x, &key->y, NULL); + if (err != CRYPT_OK) return err; + + if ((err = der_decode_sequence_multi(dsaparam, dsaparamlen, + LTC_ASN1_INTEGER, 1UL, key->p, + LTC_ASN1_INTEGER, 1UL, key->q, + LTC_ASN1_INTEGER, 1UL, key->g, + LTC_ASN1_EOL, 0UL, NULL)) != CRYPT_OK) { + goto LBL_ERR; + } + + key->qord = mp_unsigned_bin_size(key->q); + + /* quick p, q, g validation, without primality testing */ + if ((err = dsa_int_validate_pqg(key, &stat)) != CRYPT_OK) { + goto LBL_ERR; + } + if (stat == 0) { + err = CRYPT_INVALID_PACKET; + goto LBL_ERR; + } + + return CRYPT_OK; + +LBL_ERR: + dsa_free(key); + return err; +} + +#endif + +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/pk/dsa/dsa_shared_secret.c b/libtomcrypt/src/pk/dsa/dsa_shared_secret.c index 5adaa5f..4c18261 100644 --- a/libtomcrypt/src/pk/dsa/dsa_shared_secret.c +++ b/libtomcrypt/src/pk/dsa/dsa_shared_secret.c @@ -5,22 +5,20 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" /** @file dsa_shared_secret.c DSA Crypto, Tom St Denis -*/ +*/ #ifdef LTC_MDSA /** Create a DSA shared secret between two keys @param private_key The private DSA key (the exponent) - @param base The base of the exponentiation (allows this to be used for both encrypt and decrypt) + @param base The base of the exponentiation (allows this to be used for both encrypt and decrypt) @param public_key The public key @param out [out] Destination of the shared secret @param outlen [in/out] The max size and resulting size of the shared secret @@ -48,7 +46,7 @@ int dsa_shared_secret(void *private_key, void *base, mp_clear(res); return err; } - + x = (unsigned long)mp_unsigned_bin_size(res); if (*outlen < x) { *outlen = x; @@ -66,7 +64,7 @@ done: } #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/pk/dsa/dsa_sign_hash.c b/libtomcrypt/src/pk/dsa/dsa_sign_hash.c index 3fc7e99..fda2ca1 100644 --- a/libtomcrypt/src/pk/dsa/dsa_sign_hash.c +++ b/libtomcrypt/src/pk/dsa/dsa_sign_hash.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" @@ -34,7 +32,7 @@ int dsa_sign_hash_raw(const unsigned char *in, unsigned long inlen, { void *k, *kinv, *tmp; unsigned char *buf; - int err; + int err, qbits; LTC_ARGCHK(in != NULL); LTC_ARGCHK(r != NULL); @@ -61,20 +59,15 @@ int dsa_sign_hash_raw(const unsigned char *in, unsigned long inlen, /* Init our temps */ if ((err = mp_init_multi(&k, &kinv, &tmp, NULL)) != CRYPT_OK) { goto ERRBUF; } + qbits = mp_count_bits(key->q); retry: do { /* gen random k */ - if (prng_descriptor[wprng].read(buf, key->qord, prng) != (unsigned long)key->qord) { - err = CRYPT_ERROR_READPRNG; - goto error; - } - - /* read k */ - if ((err = mp_read_unsigned_bin(k, buf, key->qord)) != CRYPT_OK) { goto error; } + if ((err = rand_bn_bits(k, qbits, prng, wprng)) != CRYPT_OK) { goto error; } - /* k > 1 ? */ - if (mp_cmp_d(k, 1) != LTC_MP_GT) { goto retry; } + /* k should be from range: 1 <= k <= q-1 (see FIPS 186-4 B.2.2) */ + if (mp_cmp_d(k, 0) != LTC_MP_GT || mp_cmp(k, key->q) != LTC_MP_LT) { goto retry; } /* test gcd */ if ((err = mp_gcd(k, key->q, tmp)) != CRYPT_OK) { goto error; } @@ -89,6 +82,9 @@ retry: if (mp_iszero(r) == LTC_MP_YES) { goto retry; } + /* FIPS 186-4 4.6: use leftmost min(bitlen(q), bitlen(hash)) bits of 'hash'*/ + inlen = MIN(inlen, (unsigned long)(key->qord)); + /* now find s = (in + xr)/k mod q */ if ((err = mp_read_unsigned_bin(tmp, (unsigned char *)in, inlen)) != CRYPT_OK) { goto error; } if ((err = mp_mul(key->x, r, s)) != CRYPT_OK) { goto error; } @@ -98,7 +94,7 @@ retry: if (mp_iszero(s) == LTC_MP_YES) { goto retry; } err = CRYPT_OK; -error: +error: mp_clear_multi(k, kinv, tmp, NULL); ERRBUF: #ifdef LTC_CLEAN_STACK @@ -139,9 +135,9 @@ int dsa_sign_hash(const unsigned char *in, unsigned long inlen, goto error; } - err = der_encode_sequence_multi(out, outlen, - LTC_ASN1_INTEGER, 1UL, r, - LTC_ASN1_INTEGER, 1UL, s, + err = der_encode_sequence_multi(out, outlen, + LTC_ASN1_INTEGER, 1UL, r, + LTC_ASN1_INTEGER, 1UL, s, LTC_ASN1_EOL, 0UL, NULL); error: @@ -151,6 +147,6 @@ error: #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/pk/dsa/dsa_verify_hash.c b/libtomcrypt/src/pk/dsa/dsa_verify_hash.c index 59beec2..3d3fab5 100644 --- a/libtomcrypt/src/pk/dsa/dsa_verify_hash.c +++ b/libtomcrypt/src/pk/dsa/dsa_verify_hash.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" @@ -25,11 +23,11 @@ @param hash The hash that was signed @param hashlen The length of the hash that was signed @param stat [out] The result of the signature verification, 1==valid, 0==invalid - @param key The corresponding public DH key + @param key The corresponding public DSA key @return CRYPT_OK if successful (even if the signature is invalid) */ int dsa_verify_hash_raw( void *r, void *s, - const unsigned char *hash, unsigned long hashlen, + const unsigned char *hash, unsigned long hashlen, int *stat, dsa_key *key) { void *w, *v, *u1, *u2; @@ -49,11 +47,14 @@ int dsa_verify_hash_raw( void *r, void *s, } /* neither r or s can be null or >q*/ - if (mp_iszero(r) == LTC_MP_YES || mp_iszero(s) == LTC_MP_YES || mp_cmp(r, key->q) != LTC_MP_LT || mp_cmp(s, key->q) != LTC_MP_LT) { + if (mp_cmp_d(r, 0) != LTC_MP_GT || mp_cmp_d(s, 0) != LTC_MP_GT || mp_cmp(r, key->q) != LTC_MP_LT || mp_cmp(s, key->q) != LTC_MP_LT) { err = CRYPT_INVALID_PACKET; goto error; } - + + /* FIPS 186-4 4.7: use leftmost min(bitlen(q), bitlen(hash)) bits of 'hash' */ + hashlen = MIN(hashlen, (unsigned long)(key->qord)); + /* w = 1/s mod q */ if ((err = mp_invmod(s, key->q, w)) != CRYPT_OK) { goto error; } @@ -62,7 +63,7 @@ int dsa_verify_hash_raw( void *r, void *s, if ((err = mp_mulmod(u1, w, key->q, u1)) != CRYPT_OK) { goto error; } /* u2 = r*w mod q */ - if ((err = mp_mulmod(r, w, key->q, u2)) != CRYPT_OK) { goto error; } + if ((err = mp_mulmod(r, w, key->q, u2)) != CRYPT_OK) { goto error; } /* v = g^u1 * y^u2 mod p mod q */ if ((err = mp_exptmod(key->g, u1, key->p, u1)) != CRYPT_OK) { goto error; } @@ -88,25 +89,35 @@ error: @param hash The hash that was signed @param hashlen The length of the hash that was signed @param stat [out] The result of the signature verification, 1==valid, 0==invalid - @param key The corresponding public DH key + @param key The corresponding public DSA key @return CRYPT_OK if successful (even if the signature is invalid) */ int dsa_verify_hash(const unsigned char *sig, unsigned long siglen, - const unsigned char *hash, unsigned long hashlen, + const unsigned char *hash, unsigned long hashlen, int *stat, dsa_key *key) { int err; void *r, *s; + ltc_asn1_list sig_seq[2]; + unsigned long reallen = 0; + + LTC_ARGCHK(stat != NULL); + *stat = 0; /* must be set before the first return */ if ((err = mp_init_multi(&r, &s, NULL)) != CRYPT_OK) { - return CRYPT_MEM; + return err; + } + + LTC_SET_ASN1(sig_seq, 0, LTC_ASN1_INTEGER, r, 1UL); + LTC_SET_ASN1(sig_seq, 1, LTC_ASN1_INTEGER, s, 1UL); + + err = der_decode_sequence(sig, siglen, sig_seq, 2); + if (err != CRYPT_OK) { + goto LBL_ERR; } - /* decode the sequence */ - if ((err = der_decode_sequence_multi(sig, siglen, - LTC_ASN1_INTEGER, 1UL, r, - LTC_ASN1_INTEGER, 1UL, s, - LTC_ASN1_EOL, 0UL, NULL)) != CRYPT_OK) { + err = der_length_sequence(sig_seq, 2, &reallen); + if (err != CRYPT_OK || reallen != siglen) { goto LBL_ERR; } @@ -121,6 +132,6 @@ LBL_ERR: #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/pk/dsa/dsa_verify_key.c b/libtomcrypt/src/pk/dsa/dsa_verify_key.c index fa839ef..258e6cb 100644 --- a/libtomcrypt/src/pk/dsa/dsa_verify_key.c +++ b/libtomcrypt/src/pk/dsa/dsa_verify_key.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" @@ -18,83 +16,184 @@ #ifdef LTC_MDSA /** - Verify a DSA key for validity - @param key The key to verify + Validate a DSA key + + Yeah, this function should've been called dsa_validate_key() + in the first place and for compat-reasons we keep it + as it was (for now). + + @param key The key to validate @param stat [out] Result of test, 1==valid, 0==invalid @return CRYPT_OK if successful */ int dsa_verify_key(dsa_key *key, int *stat) { - void *tmp, *tmp2; - int res, err; + int err; + + err = dsa_int_validate_primes(key, stat); + if (err != CRYPT_OK || *stat == 0) return err; + + err = dsa_int_validate_pqg(key, stat); + if (err != CRYPT_OK || *stat == 0) return err; + + return dsa_int_validate_xy(key, stat); +} + +/** + Non-complex part (no primality testing) of the validation + of DSA params (p, q, g) + + @param key The key to validate + @param stat [out] Result of test, 1==valid, 0==invalid + @return CRYPT_OK if successful +*/ +int dsa_int_validate_pqg(dsa_key *key, int *stat) +{ + void *tmp1, *tmp2; + int err; LTC_ARGCHK(key != NULL); LTC_ARGCHK(stat != NULL); - - /* default to an invalid key */ *stat = 0; - /* first make sure key->q and key->p are prime */ - if ((err = mp_prime_is_prime(key->q, 8, &res)) != CRYPT_OK) { - return err; - } - if (res == 0) { + /* check q-order */ + if ( key->qord >= LTC_MDSA_MAX_GROUP || key->qord <= 15 || + (unsigned long)key->qord >= mp_unsigned_bin_size(key->p) || + (mp_unsigned_bin_size(key->p) - key->qord) >= LTC_MDSA_DELTA ) { return CRYPT_OK; } - if ((err = mp_prime_is_prime(key->p, 8, &res)) != CRYPT_OK) { - return err; - } - if (res == 0) { + /* FIPS 186-4 chapter 4.1: 1 < g < p */ + if (mp_cmp_d(key->g, 1) != LTC_MP_GT || mp_cmp(key->g, key->p) != LTC_MP_LT) { return CRYPT_OK; } - /* now make sure that g is not -1, 0 or 1 and <p */ - if (mp_cmp_d(key->g, 0) == LTC_MP_EQ || mp_cmp_d(key->g, 1) == LTC_MP_EQ) { - return CRYPT_OK; - } - if ((err = mp_init_multi(&tmp, &tmp2, NULL)) != CRYPT_OK) { return err; } - if ((err = mp_sub_d(key->p, 1, tmp)) != CRYPT_OK) { goto error; } - if (mp_cmp(tmp, key->g) == LTC_MP_EQ || mp_cmp(key->g, key->p) != LTC_MP_LT) { + if ((err = mp_init_multi(&tmp1, &tmp2, NULL)) != CRYPT_OK) { return err; } + + /* FIPS 186-4 chapter 4.1: q is a divisor of (p - 1) */ + if ((err = mp_sub_d(key->p, 1, tmp1)) != CRYPT_OK) { goto error; } + if ((err = mp_div(tmp1, key->q, tmp1, tmp2)) != CRYPT_OK) { goto error; } + if (mp_iszero(tmp2) != LTC_MP_YES) { err = CRYPT_OK; goto error; } - /* 1 < y < p-1 */ - if (!(mp_cmp_d(key->y, 1) == LTC_MP_GT && mp_cmp(key->y, tmp) == LTC_MP_LT)) { + /* FIPS 186-4 chapter 4.1: g is a generator of a subgroup of order q in + * the multiplicative group of GF(p) - so we make sure that g^q mod p = 1 + */ + if ((err = mp_exptmod(key->g, key->q, key->p, tmp1)) != CRYPT_OK) { goto error; } + if (mp_cmp_d(tmp1, 1) != LTC_MP_EQ) { err = CRYPT_OK; goto error; } - /* now we have to make sure that g^q = 1, and that p-1/q gives 0 remainder */ - if ((err = mp_div(tmp, key->q, tmp, tmp2)) != CRYPT_OK) { goto error; } - if (mp_iszero(tmp2) != LTC_MP_YES) { - err = CRYPT_OK; - goto error; + err = CRYPT_OK; + *stat = 1; +error: + mp_clear_multi(tmp2, tmp1, NULL); + return err; +} + +/** + Primality testing of DSA params p and q + + @param key The key to validate + @param stat [out] Result of test, 1==valid, 0==invalid + @return CRYPT_OK if successful +*/ +int dsa_int_validate_primes(dsa_key *key, int *stat) +{ + int err, res; + + *stat = 0; + LTC_ARGCHK(key != NULL); + LTC_ARGCHK(stat != NULL); + + /* key->q prime? */ + if ((err = mp_prime_is_prime(key->q, LTC_MILLER_RABIN_REPS, &res)) != CRYPT_OK) { + return err; + } + if (res == LTC_MP_NO) { + return CRYPT_OK; } - if ((err = mp_exptmod(key->g, key->q, key->p, tmp)) != CRYPT_OK) { goto error; } - if (mp_cmp_d(tmp, 1) != LTC_MP_EQ) { - err = CRYPT_OK; - goto error; + /* key->p prime? */ + if ((err = mp_prime_is_prime(key->p, LTC_MILLER_RABIN_REPS, &res)) != CRYPT_OK) { + return err; } + if (res == LTC_MP_NO) { + return CRYPT_OK; + } + + *stat = 1; + return CRYPT_OK; +} + +/** + Validation of a DSA key (x and y values) - /* now we have to make sure that y^q = 1, this makes sure y \in g^x mod p */ - if ((err = mp_exptmod(key->y, key->q, key->p, tmp)) != CRYPT_OK) { goto error; } - if (mp_cmp_d(tmp, 1) != LTC_MP_EQ) { + @param key The key to validate + @param stat [out] Result of test, 1==valid, 0==invalid + @return CRYPT_OK if successful +*/ +int dsa_int_validate_xy(dsa_key *key, int *stat) +{ + void *tmp; + int err; + + *stat = 0; + LTC_ARGCHK(key != NULL); + LTC_ARGCHK(stat != NULL); + + /* 1 < y < p-1 */ + if ((err = mp_init(&tmp)) != CRYPT_OK) { + return err; + } + if ((err = mp_sub_d(key->p, 1, tmp)) != CRYPT_OK) { + goto error; + } + if (mp_cmp_d(key->y, 1) != LTC_MP_GT || mp_cmp(key->y, tmp) != LTC_MP_LT) { err = CRYPT_OK; goto error; } - /* at this point we are out of tests ;-( */ + if (key->type == PK_PRIVATE) { + /* FIPS 186-4 chapter 4.1: 0 < x < q */ + if (mp_cmp_d(key->x, 0) != LTC_MP_GT || mp_cmp(key->x, key->q) != LTC_MP_LT) { + err = CRYPT_OK; + goto error; + } + /* FIPS 186-4 chapter 4.1: y = g^x mod p */ + if ((err = mp_exptmod(key->g, key->x, key->p, tmp)) != CRYPT_OK) { + goto error; + } + if (mp_cmp(tmp, key->y) != LTC_MP_EQ) { + err = CRYPT_OK; + goto error; + } + } + else { + /* with just a public key we cannot test y = g^x mod p therefore we + * only test that y^q mod p = 1, which makes sure y is in g^x mod p + */ + if ((err = mp_exptmod(key->y, key->q, key->p, tmp)) != CRYPT_OK) { + goto error; + } + if (mp_cmp_d(tmp, 1) != LTC_MP_EQ) { + err = CRYPT_OK; + goto error; + } + } + err = CRYPT_OK; *stat = 1; -error: - mp_clear_multi(tmp, tmp2, NULL); +error: + mp_clear(tmp); return err; } + #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/pk/ecc/ecc.c b/libtomcrypt/src/pk/ecc/ecc.c index 56ed526..18da0b3 100644 --- a/libtomcrypt/src/pk/ecc/ecc.c +++ b/libtomcrypt/src/pk/ecc/ecc.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /* Implements ECC over Z/pZ for curve y^2 = x^3 - 3x + b @@ -19,13 +17,13 @@ /** @file ecc.c ECC Crypto, Tom St Denis -*/ +*/ #ifdef LTC_MECC /* This holds the key settings. ***MUST*** be organized by size from smallest to largest. */ const ltc_ecc_set_type ltc_ecc_sets[] = { -#ifdef ECC112 +#ifdef LTC_ECC112 { 14, "SECP112R1", @@ -36,7 +34,7 @@ const ltc_ecc_set_type ltc_ecc_sets[] = { "A89CE5AF8724C0A23E0E0FF77500" }, #endif -#ifdef ECC128 +#ifdef LTC_ECC128 { 16, "SECP128R1", @@ -47,7 +45,7 @@ const ltc_ecc_set_type ltc_ecc_sets[] = { "CF5AC8395BAFEB13C02DA292DDED7A83", }, #endif -#ifdef ECC160 +#ifdef LTC_ECC160 { 20, "SECP160R1", @@ -58,7 +56,7 @@ const ltc_ecc_set_type ltc_ecc_sets[] = { "23A628553168947D59DCC912042351377AC5FB32", }, #endif -#ifdef ECC192 +#ifdef LTC_ECC192 { 24, "ECC-192", @@ -69,7 +67,7 @@ const ltc_ecc_set_type ltc_ecc_sets[] = { "7192B95FFC8DA78631011ED6B24CDD573F977A11E794811", }, #endif -#ifdef ECC224 +#ifdef LTC_ECC224 { 28, "ECC-224", @@ -80,7 +78,7 @@ const ltc_ecc_set_type ltc_ecc_sets[] = { "BD376388B5F723FB4C22DFE6CD4375A05A07476444D5819985007E34", }, #endif -#ifdef ECC256 +#ifdef LTC_ECC256 { 32, "ECC-256", @@ -91,7 +89,7 @@ const ltc_ecc_set_type ltc_ecc_sets[] = { "4FE342E2FE1A7F9B8EE7EB4A7C0F9E162BCE33576B315ECECBB6406837BF51F5", }, #endif -#ifdef ECC384 +#ifdef LTC_ECC384 { 48, "ECC-384", @@ -102,7 +100,7 @@ const ltc_ecc_set_type ltc_ecc_sets[] = { "3617DE4A96262C6F5D9E98BF9292DC29F8F41DBD289A147CE9DA3113B5F0B8C00A60B1CE1D7E819D7A431D7C90EA0E5F", }, #endif -#ifdef ECC521 +#ifdef LTC_ECC521 { 66, "ECC-521", @@ -121,7 +119,7 @@ const ltc_ecc_set_type ltc_ecc_sets[] = { #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/pk/ecc/ecc_ansi_x963_export.c b/libtomcrypt/src/pk/ecc/ecc_ansi_x963_export.c index 09dae07..773b683 100644 --- a/libtomcrypt/src/pk/ecc/ecc_ansi_x963_export.c +++ b/libtomcrypt/src/pk/ecc/ecc_ansi_x963_export.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /* Implements ECC over Z/pZ for curve y^2 = x^3 - 3x + b @@ -19,7 +17,7 @@ /** @file ecc_ansi_x963_export.c ECC Crypto, Tom St Denis -*/ +*/ #ifdef LTC_MECC @@ -32,33 +30,40 @@ int ecc_ansi_x963_export(ecc_key *key, unsigned char *out, unsigned long *outlen) { unsigned char buf[ECC_BUF_SIZE]; - unsigned long numlen; + unsigned long numlen, xlen, ylen; LTC_ARGCHK(key != NULL); - LTC_ARGCHK(out != NULL); LTC_ARGCHK(outlen != NULL); if (ltc_ecc_is_valid_idx(key->idx) == 0) { return CRYPT_INVALID_ARG; } numlen = key->dp->size; + xlen = mp_unsigned_bin_size(key->pubkey.x); + ylen = mp_unsigned_bin_size(key->pubkey.y); + + if (xlen > numlen || ylen > numlen || sizeof(buf) < numlen) { + return CRYPT_BUFFER_OVERFLOW; + } if (*outlen < (1 + 2*numlen)) { *outlen = 1 + 2*numlen; return CRYPT_BUFFER_OVERFLOW; } + LTC_ARGCHK(out != NULL); + /* store byte 0x04 */ out[0] = 0x04; /* pad and store x */ zeromem(buf, sizeof(buf)); - mp_to_unsigned_bin(key->pubkey.x, buf + (numlen - mp_unsigned_bin_size(key->pubkey.x))); + mp_to_unsigned_bin(key->pubkey.x, buf + (numlen - xlen)); XMEMCPY(out+1, buf, numlen); /* pad and store y */ zeromem(buf, sizeof(buf)); - mp_to_unsigned_bin(key->pubkey.y, buf + (numlen - mp_unsigned_bin_size(key->pubkey.y))); + mp_to_unsigned_bin(key->pubkey.y, buf + (numlen - ylen)); XMEMCPY(out+1+numlen, buf, numlen); *outlen = 1 + 2*numlen; @@ -67,6 +72,6 @@ int ecc_ansi_x963_export(ecc_key *key, unsigned char *out, unsigned long *outlen #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/pk/ecc/ecc_ansi_x963_import.c b/libtomcrypt/src/pk/ecc/ecc_ansi_x963_import.c index ec34245..ee5a4c9 100644 --- a/libtomcrypt/src/pk/ecc/ecc_ansi_x963_import.c +++ b/libtomcrypt/src/pk/ecc/ecc_ansi_x963_import.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /* Implements ECC over Z/pZ for curve y^2 = x^3 - 3x + b @@ -19,11 +17,11 @@ /** @file ecc_ansi_x963_import.c ECC Crypto, Tom St Denis -*/ +*/ #ifdef LTC_MECC -/** Import an ANSI X9.63 format public key +/** Import an ANSI X9.63 format public key @param in The input data to read @param inlen The length of the input data @param key [out] destination to store imported key \ @@ -36,10 +34,10 @@ int ecc_ansi_x963_import(const unsigned char *in, unsigned long inlen, ecc_key * int ecc_ansi_x963_import_ex(const unsigned char *in, unsigned long inlen, ecc_key *key, ltc_ecc_set_type *dp) { int x, err; - + LTC_ARGCHK(in != NULL); LTC_ARGCHK(key != NULL); - + /* must be odd */ if ((inlen & 1) == 0) { return CRYPT_INVALID_ARG; @@ -99,6 +97,6 @@ error: #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/pk/ecc/ecc_decrypt_key.c b/libtomcrypt/src/pk/ecc/ecc_decrypt_key.c index 49df8e8..8f8ad2f 100644 --- a/libtomcrypt/src/pk/ecc/ecc_decrypt_key.c +++ b/libtomcrypt/src/pk/ecc/ecc_decrypt_key.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /* Implements ECC over Z/pZ for curve y^2 = x^3 - 3x + b @@ -19,7 +17,7 @@ /** @file ecc_decrypt_key.c ECC Crypto, Tom St Denis -*/ +*/ #if defined(LTC_MECC) && defined(LTC_DER) @@ -33,11 +31,12 @@ @return CRYPT_OK if successful */ int ecc_decrypt_key(const unsigned char *in, unsigned long inlen, - unsigned char *out, unsigned long *outlen, + unsigned char *out, unsigned long *outlen, ecc_key *key) { unsigned char *ecc_shared, *skey, *pub_expt; - unsigned long x, y, hashOID[32]; + unsigned long x, y; + unsigned long hashOID[32] = { 0 }; int hash, err; ecc_key pubkey; ltc_asn1_list decode[3]; @@ -51,15 +50,15 @@ int ecc_decrypt_key(const unsigned char *in, unsigned long inlen, if (key->type != PK_PRIVATE) { return CRYPT_PK_NOT_PRIVATE; } - + /* decode to find out hash */ LTC_SET_ASN1(decode, 0, LTC_ASN1_OBJECT_IDENTIFIER, hashOID, sizeof(hashOID)/sizeof(hashOID[0])); - - if ((err = der_decode_sequence(in, inlen, decode, 1)) != CRYPT_OK) { + err = der_decode_sequence(in, inlen, decode, 1); + if (err != CRYPT_OK && err != CRYPT_INPUT_TOO_LONG) { return err; } - hash = find_hash_oid(hashOID, decode[0].size); + hash = find_hash_oid(hashOID, decode[0].size); if (hash_is_valid(hash) != CRYPT_OK) { return CRYPT_INVALID_PACKET; } @@ -144,7 +143,7 @@ LBL_ERR: #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/pk/ecc/ecc_encrypt_key.c b/libtomcrypt/src/pk/ecc/ecc_encrypt_key.c index e97e737..6d26efb 100644 --- a/libtomcrypt/src/pk/ecc/ecc_encrypt_key.c +++ b/libtomcrypt/src/pk/ecc/ecc_encrypt_key.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /* Implements ECC over Z/pZ for curve y^2 = x^3 - 3x + b @@ -19,25 +17,25 @@ /** @file ecc_encrypt_key.c ECC Crypto, Tom St Denis -*/ +*/ #if defined(LTC_MECC) && defined(LTC_DER) /** - Encrypt a symmetric key with ECC + Encrypt a symmetric key with ECC @param in The symmetric key you want to encrypt @param inlen The length of the key to encrypt (octets) @param out [out] The destination for the ciphertext @param outlen [in/out] The max size and resulting size of the ciphertext @param prng An active PRNG state - @param wprng The index of the PRNG you wish to use - @param hash The index of the hash you want to use + @param wprng The index of the PRNG you wish to use + @param hash The index of the hash you want to use @param key The ECC key you want to encrypt to @return CRYPT_OK if successful */ int ecc_encrypt_key(const unsigned char *in, unsigned long inlen, - unsigned char *out, unsigned long *outlen, - prng_state *prng, int wprng, int hash, + unsigned char *out, unsigned long *outlen, + prng_state *prng, int wprng, int hash, ecc_key *key) { unsigned char *pub_expt, *ecc_shared, *skey; @@ -90,7 +88,7 @@ int ecc_encrypt_key(const unsigned char *in, unsigned long inlen, ecc_free(&pubkey); goto LBL_ERR; } - + /* make random key */ x = ECC_BUF_SIZE; if ((err = ecc_shared_secret(&pubkey, key, ecc_shared, &x)) != CRYPT_OK) { @@ -102,7 +100,7 @@ int ecc_encrypt_key(const unsigned char *in, unsigned long inlen, if ((err = hash_memory(hash, ecc_shared, x, skey, &y)) != CRYPT_OK) { goto LBL_ERR; } - + /* Encrypt key */ for (x = 0; x < inlen; x++) { skey[x] ^= in[x]; @@ -130,7 +128,7 @@ LBL_ERR: } #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/pk/ecc/ecc_export.c b/libtomcrypt/src/pk/ecc/ecc_export.c index 6a712fd..be137e1 100644 --- a/libtomcrypt/src/pk/ecc/ecc_export.c +++ b/libtomcrypt/src/pk/ecc/ecc_export.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /* Implements ECC over Z/pZ for curve y^2 = x^3 - 3x + b @@ -19,7 +17,7 @@ /** @file ecc_export.c ECC Crypto, Tom St Denis -*/ +*/ #if defined(LTC_MECC) && defined(LTC_DER) @@ -40,7 +38,7 @@ int ecc_export(unsigned char *out, unsigned long *outlen, int type, ecc_key *key LTC_ARGCHK(out != NULL); LTC_ARGCHK(outlen != NULL); LTC_ARGCHK(key != NULL); - + /* type valid? */ if (key->type != PK_PRIVATE && type == PK_PRIVATE) { return CRYPT_PK_TYPE_MISMATCH; @@ -76,7 +74,7 @@ int ecc_export(unsigned char *out, unsigned long *outlen, int type, ecc_key *key } #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/pk/ecc/ecc_free.c b/libtomcrypt/src/pk/ecc/ecc_free.c index c9e5d6c..4a8ca45 100644 --- a/libtomcrypt/src/pk/ecc/ecc_free.c +++ b/libtomcrypt/src/pk/ecc/ecc_free.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /* Implements ECC over Z/pZ for curve y^2 = x^3 - 3x + b @@ -19,7 +17,7 @@ /** @file ecc_free.c ECC Crypto, Tom St Denis -*/ +*/ #ifdef LTC_MECC @@ -34,7 +32,7 @@ void ecc_free(ecc_key *key) } #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/pk/ecc/ecc_get_size.c b/libtomcrypt/src/pk/ecc/ecc_get_size.c index a824aa4..4dc5d22 100644 --- a/libtomcrypt/src/pk/ecc/ecc_get_size.c +++ b/libtomcrypt/src/pk/ecc/ecc_get_size.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /* Implements ECC over Z/pZ for curve y^2 = x^3 - 3x + b @@ -19,13 +17,13 @@ /** @file ecc_get_size.c ECC Crypto, Tom St Denis -*/ +*/ #ifdef LTC_MECC /** Get the size of an ECC key - @param key The key to get the size of + @param key The key to get the size of @return The size (octets) of the key or INT_MAX on error */ int ecc_get_size(ecc_key *key) @@ -38,7 +36,7 @@ int ecc_get_size(ecc_key *key) } #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/pk/ecc/ecc_import.c b/libtomcrypt/src/pk/ecc/ecc_import.c index 9506076..9b61055 100644 --- a/libtomcrypt/src/pk/ecc/ecc_import.c +++ b/libtomcrypt/src/pk/ecc/ecc_import.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /* Implements ECC over Z/pZ for curve y^2 = x^3 - 3x + b @@ -19,34 +17,34 @@ /** @file ecc_import.c ECC Crypto, Tom St Denis -*/ +*/ #if defined(LTC_MECC) && defined(LTC_DER) -static int is_point(ecc_key *key) +static int _is_point(ecc_key *key) { void *prime, *b, *t1, *t2; int err; - + if ((err = mp_init_multi(&prime, &b, &t1, &t2, NULL)) != CRYPT_OK) { return err; } - + /* load prime and b */ if ((err = mp_read_radix(prime, key->dp->prime, 16)) != CRYPT_OK) { goto error; } if ((err = mp_read_radix(b, key->dp->B, 16)) != CRYPT_OK) { goto error; } - + /* compute y^2 */ if ((err = mp_sqr(key->pubkey.y, t1)) != CRYPT_OK) { goto error; } - + /* compute x^3 */ if ((err = mp_sqr(key->pubkey.x, t2)) != CRYPT_OK) { goto error; } if ((err = mp_mod(t2, prime, t2)) != CRYPT_OK) { goto error; } if ((err = mp_mul(key->pubkey.x, t2, t2)) != CRYPT_OK) { goto error; } - + /* compute y^2 - x^3 */ if ((err = mp_sub(t1, t2, t1)) != CRYPT_OK) { goto error; } - + /* compute y^2 - x^3 + 3x */ if ((err = mp_add(t1, key->pubkey.x, t1)) != CRYPT_OK) { goto error; } if ((err = mp_add(t1, key->pubkey.x, t1)) != CRYPT_OK) { goto error; } @@ -58,14 +56,14 @@ static int is_point(ecc_key *key) while (mp_cmp(t1, prime) != LTC_MP_LT) { if ((err = mp_sub(t1, prime, t1)) != CRYPT_OK) { goto error; } } - + /* compare to b */ if (mp_cmp(t1, b) != LTC_MP_EQ) { err = CRYPT_INVALID_PACKET; } else { err = CRYPT_OK; } - + error: mp_clear_multi(prime, b, t1, t2, NULL); return err; @@ -107,9 +105,9 @@ int ecc_import_ex(const unsigned char *in, unsigned long inlen, ecc_key *key, co } /* find out what type of key it is */ - if ((err = der_decode_sequence_multi(in, inlen, - LTC_ASN1_BIT_STRING, 1UL, &flags, - LTC_ASN1_EOL, 0UL, NULL)) != CRYPT_OK) { + err = der_decode_sequence_multi(in, inlen, LTC_ASN1_BIT_STRING, 1UL, flags, + LTC_ASN1_EOL, 0UL, NULL); + if (err != CRYPT_OK && err != CRYPT_INPUT_TOO_LONG) { goto done; } @@ -126,7 +124,7 @@ int ecc_import_ex(const unsigned char *in, unsigned long inlen, ecc_key *key, co LTC_ASN1_EOL, 0UL, NULL)) != CRYPT_OK) { goto done; } - } else { + } else if (flags[0] == 0) { /* public key */ key->type = PK_PUBLIC; if ((err = der_decode_sequence_multi(in, inlen, @@ -138,6 +136,10 @@ int ecc_import_ex(const unsigned char *in, unsigned long inlen, ecc_key *key, co goto done; } } + else { + err = CRYPT_INVALID_PACKET; + goto done; + } if (dp == NULL) { /* find the idx */ @@ -153,9 +155,9 @@ int ecc_import_ex(const unsigned char *in, unsigned long inlen, ecc_key *key, co } /* set z */ if ((err = mp_set(key->pubkey.z, 1)) != CRYPT_OK) { goto done; } - + /* is it a point on the curve? */ - if ((err = is_point(key)) != CRYPT_OK) { + if ((err = _is_point(key)) != CRYPT_OK) { goto done; } @@ -166,7 +168,7 @@ done: return err; } #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/pk/ecc/ecc_make_key.c b/libtomcrypt/src/pk/ecc/ecc_make_key.c index 9bbeb44..113a994 100644 --- a/libtomcrypt/src/pk/ecc/ecc_make_key.c +++ b/libtomcrypt/src/pk/ecc/ecc_make_key.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /* Implements ECC over Z/pZ for curve y^2 = x^3 - 3x + b @@ -19,12 +17,12 @@ /** @file ecc_make_key.c ECC Crypto, Tom St Denis -*/ +*/ #ifdef LTC_MECC /** - Make a new ECC key + Make a new ECC key @param prng An active PRNG state @param wprng The index of the PRNG you wish to use @param keysize The keysize for the new key (in octets from 20 to 65 bytes) @@ -124,7 +122,7 @@ ERR_BUF: } #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/pk/ecc/ecc_shared_secret.c b/libtomcrypt/src/pk/ecc/ecc_shared_secret.c index 5aece5e..d18a205 100644 --- a/libtomcrypt/src/pk/ecc/ecc_shared_secret.c +++ b/libtomcrypt/src/pk/ecc/ecc_shared_secret.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /* Implements ECC over Z/pZ for curve y^2 = x^3 - 3x + b @@ -19,7 +17,7 @@ /** @file ecc_shared_secret.c ECC Crypto, Tom St Denis -*/ +*/ #ifdef LTC_MECC @@ -89,7 +87,7 @@ done: } #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/pk/ecc/ecc_sign_hash.c b/libtomcrypt/src/pk/ecc/ecc_sign_hash.c index 0ef7e2b..d285dac 100644 --- a/libtomcrypt/src/pk/ecc/ecc_sign_hash.c +++ b/libtomcrypt/src/pk/ecc/ecc_sign_hash.c @@ -5,42 +5,26 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ -/* Implements ECC over Z/pZ for curve y^2 = x^3 - 3x + b - * - * All curves taken from NIST recommendation paper of July 1999 - * Available at http://csrc.nist.gov/cryptval/dss.htm - */ #include "tomcrypt.h" +#if defined(LTC_MECC) && defined(LTC_DER) + /** @file ecc_sign_hash.c ECC Crypto, Tom St Denis */ -#if defined(LTC_MECC) && defined(LTC_DER) - -/** - Sign a message digest - @param in The message digest to sign - @param inlen The length of the digest - @param out [out] The destination for the signature - @param outlen [in/out] The max size and resulting size of the signature - @param prng An active PRNG state - @param wprng The index of the PRNG you wish to use - @param key A private ECC key - @return CRYPT_OK if successful -*/ -int ecc_sign_hash(const unsigned char *in, unsigned long inlen, +static int _ecc_sign_hash(const unsigned char *in, unsigned long inlen, unsigned char *out, unsigned long *outlen, - prng_state *prng, int wprng, ecc_key *key) + prng_state *prng, int wprng, ecc_key *key, int sigformat) { ecc_key pubkey; void *r, *s, *e, *p; - int err; + int err, max_iterations = LTC_PK_MAX_RETRIES; + unsigned long pbits, pbytes, i, shift_right; + unsigned char ch, buf[MAXBLOCKSIZE]; LTC_ARGCHK(in != NULL); LTC_ARGCHK(out != NULL); @@ -61,16 +45,33 @@ int ecc_sign_hash(const unsigned char *in, unsigned long inlen, return err; } - /* get the hash and load it as a bignum into 'e' */ /* init the bignums */ if ((err = mp_init_multi(&r, &s, &p, &e, NULL)) != CRYPT_OK) { return err; } if ((err = mp_read_radix(p, (char *)key->dp->order, 16)) != CRYPT_OK) { goto errnokey; } - if ((err = mp_read_unsigned_bin(e, (unsigned char *)in, (int)inlen)) != CRYPT_OK) { goto errnokey; } + + /* get the hash and load it as a bignum into 'e' */ + pbits = mp_count_bits(p); + pbytes = (pbits+7) >> 3; + if (pbits > inlen*8) { + if ((err = mp_read_unsigned_bin(e, (unsigned char *)in, inlen)) != CRYPT_OK) { goto errnokey; } + } + else if (pbits % 8 == 0) { + if ((err = mp_read_unsigned_bin(e, (unsigned char *)in, pbytes)) != CRYPT_OK) { goto errnokey; } + } + else { + shift_right = 8 - pbits % 8; + for (i=0, ch=0; i<pbytes; i++) { + buf[i] = ch; + ch = (in[i] << (8-shift_right)); + buf[i] = buf[i] ^ (in[i] >> shift_right); + } + if ((err = mp_read_unsigned_bin(e, (unsigned char *)buf, pbytes)) != CRYPT_OK) { goto errnokey; } + } /* make up a key and export the public copy */ - for (;;) { + do { if ((err = ecc_make_key_ex(prng, wprng, &pubkey, key->dp)) != CRYPT_OK) { goto errnokey; } @@ -92,13 +93,30 @@ int ecc_sign_hash(const unsigned char *in, unsigned long inlen, break; } } + } while (--max_iterations > 0); + + if (max_iterations == 0) { + goto errnokey; } - /* store as SEQUENCE { r, s -- integer } */ + if (sigformat == 1) { + /* RFC7518 format */ + if (*outlen < 2*pbytes) { err = CRYPT_MEM; goto errnokey; } + zeromem(out, 2*pbytes); + i = mp_unsigned_bin_size(r); + if ((err = mp_to_unsigned_bin(r, out + (pbytes - i))) != CRYPT_OK) { goto errnokey; } + i = mp_unsigned_bin_size(s); + if ((err = mp_to_unsigned_bin(s, out + (2*pbytes - i))) != CRYPT_OK) { goto errnokey; } + *outlen = 2*pbytes; + err = CRYPT_OK; + } + else { + /* store as ASN.1 SEQUENCE { r, s -- integer } */ err = der_encode_sequence_multi(out, outlen, LTC_ASN1_INTEGER, 1UL, r, LTC_ASN1_INTEGER, 1UL, s, LTC_ASN1_EOL, 0UL, NULL); + } goto errnokey; error: ecc_free(&pubkey); @@ -107,8 +125,44 @@ errnokey: return err; } +/** + Sign a message digest + @param in The message digest to sign + @param inlen The length of the digest + @param out [out] The destination for the signature + @param outlen [in/out] The max size and resulting size of the signature + @param prng An active PRNG state + @param wprng The index of the PRNG you wish to use + @param key A private ECC key + @return CRYPT_OK if successful +*/ +int ecc_sign_hash(const unsigned char *in, unsigned long inlen, + unsigned char *out, unsigned long *outlen, + prng_state *prng, int wprng, ecc_key *key) +{ + return _ecc_sign_hash(in, inlen, out, outlen, prng, wprng, key, 0); +} + +/** + Sign a message digest in RFC7518 format + @param in The message digest to sign + @param inlen The length of the digest + @param out [out] The destination for the signature + @param outlen [in/out] The max size and resulting size of the signature + @param prng An active PRNG state + @param wprng The index of the PRNG you wish to use + @param key A private ECC key + @return CRYPT_OK if successful +*/ +int ecc_sign_hash_rfc7518(const unsigned char *in, unsigned long inlen, + unsigned char *out, unsigned long *outlen, + prng_state *prng, int wprng, ecc_key *key) +{ + return _ecc_sign_hash(in, inlen, out, outlen, prng, wprng, key, 1); +} + #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/pk/ecc/ecc_sizes.c b/libtomcrypt/src/pk/ecc/ecc_sizes.c index b02a9f9..7c311fe 100644 --- a/libtomcrypt/src/pk/ecc/ecc_sizes.c +++ b/libtomcrypt/src/pk/ecc/ecc_sizes.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /* Implements ECC over Z/pZ for curve y^2 = x^3 - 3x + b @@ -19,7 +17,7 @@ /** @file ecc_sizes.c ECC Crypto, Tom St Denis -*/ +*/ #ifdef LTC_MECC @@ -42,7 +40,7 @@ void ecc_sizes(int *low, int *high) } #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/pk/ecc/ecc_test.c b/libtomcrypt/src/pk/ecc/ecc_test.c index 873e70b..b6d54d1 100644 --- a/libtomcrypt/src/pk/ecc/ecc_test.c +++ b/libtomcrypt/src/pk/ecc/ecc_test.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /* Implements ECC over Z/pZ for curve y^2 = x^3 - 3x + b @@ -19,7 +17,7 @@ /** @file ecc_test.c ECC Crypto, Tom St Denis -*/ +*/ #ifdef LTC_MECC @@ -89,7 +87,7 @@ done: #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/pk/ecc/ecc_verify_hash.c b/libtomcrypt/src/pk/ecc/ecc_verify_hash.c index c10076b..7aa5f52 100644 --- a/libtomcrypt/src/pk/ecc/ecc_verify_hash.c +++ b/libtomcrypt/src/pk/ecc/ecc_verify_hash.c @@ -5,52 +5,27 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ -/* Implements ECC over Z/pZ for curve y^2 = x^3 - 3x + b - * - * All curves taken from NIST recommendation paper of July 1999 - * Available at http://csrc.nist.gov/cryptval/dss.htm - */ #include "tomcrypt.h" +#if defined(LTC_MECC) && defined(LTC_DER) + /** @file ecc_verify_hash.c ECC Crypto, Tom St Denis */ -#if defined(LTC_MECC) && defined(LTC_DER) - -/* verify - * - * w = s^-1 mod n - * u1 = xw - * u2 = rw - * X = u1*G + u2*Q - * v = X_x1 mod n - * accept if v == r - */ - -/** - Verify an ECC signature - @param sig The signature to verify - @param siglen The length of the signature (octets) - @param hash The hash (message digest) that was signed - @param hashlen The length of the hash (octets) - @param stat Result of signature, 1==valid, 0==invalid - @param key The corresponding public ECC key - @return CRYPT_OK if successful (even if the signature is not valid) -*/ -int ecc_verify_hash(const unsigned char *sig, unsigned long siglen, +static int _ecc_verify_hash(const unsigned char *sig, unsigned long siglen, const unsigned char *hash, unsigned long hashlen, - int *stat, ecc_key *key) + int *stat, ecc_key *key, int sigformat) { ecc_point *mG, *mQ; void *r, *s, *v, *w, *u1, *u2, *e, *p, *m; void *mp; int err; + unsigned long pbits, pbytes, i, shift_right; + unsigned char ch, buf[MAXBLOCKSIZE]; LTC_ARGCHK(sig != NULL); LTC_ARGCHK(hash != NULL); @@ -79,12 +54,22 @@ int ecc_verify_hash(const unsigned char *sig, unsigned long siglen, goto error; } - /* parse header */ + if (sigformat == 1) { + /* RFC7518 format */ + if ((siglen % 2) == 1) { + err = CRYPT_INVALID_PACKET; + goto error; + } + i = siglen / 2; + if ((err = mp_read_unsigned_bin(r, (unsigned char *)sig, i)) != CRYPT_OK) { goto error; } + if ((err = mp_read_unsigned_bin(s, (unsigned char *)sig+i, i)) != CRYPT_OK) { goto error; } + } + else { + /* ASN.1 format */ if ((err = der_decode_sequence_multi(sig, siglen, LTC_ASN1_INTEGER, 1UL, r, LTC_ASN1_INTEGER, 1UL, s, - LTC_ASN1_EOL, 0UL, NULL)) != CRYPT_OK) { - goto error; + LTC_ASN1_EOL, 0UL, NULL)) != CRYPT_OK) { goto error; } } /* get the order */ @@ -99,8 +84,24 @@ int ecc_verify_hash(const unsigned char *sig, unsigned long siglen, goto error; } - /* read hash */ - if ((err = mp_read_unsigned_bin(e, (unsigned char *)hash, (int)hashlen)) != CRYPT_OK) { goto error; } + /* read hash - truncate if needed */ + pbits = mp_count_bits(p); + pbytes = (pbits+7) >> 3; + if (pbits > hashlen*8) { + if ((err = mp_read_unsigned_bin(e, (unsigned char *)hash, hashlen)) != CRYPT_OK) { goto error; } + } + else if (pbits % 8 == 0) { + if ((err = mp_read_unsigned_bin(e, (unsigned char *)hash, pbytes)) != CRYPT_OK) { goto error; } + } + else { + shift_right = 8 - pbits % 8; + for (i=0, ch=0; i<pbytes; i++) { + buf[i] = ch; + ch = (hash[i] << (8-shift_right)); + buf[i] = buf[i] ^ (hash[i] >> shift_right); + } + if ((err = mp_read_unsigned_bin(e, (unsigned char *)buf, pbytes)) != CRYPT_OK) { goto error; } + } /* w = s^-1 mod n */ if ((err = mp_invmod(s, p, w)) != CRYPT_OK) { goto error; } @@ -158,8 +159,42 @@ error: return err; } +/** + Verify an ECC signature + @param sig The signature to verify + @param siglen The length of the signature (octets) + @param hash The hash (message digest) that was signed + @param hashlen The length of the hash (octets) + @param stat Result of signature, 1==valid, 0==invalid + @param key The corresponding public ECC key + @return CRYPT_OK if successful (even if the signature is not valid) +*/ +int ecc_verify_hash(const unsigned char *sig, unsigned long siglen, + const unsigned char *hash, unsigned long hashlen, + int *stat, ecc_key *key) +{ + return _ecc_verify_hash(sig, siglen, hash, hashlen, stat, key, 0); +} + +/** + Verify an ECC signature in RFC7518 format + @param sig The signature to verify + @param siglen The length of the signature (octets) + @param hash The hash (message digest) that was signed + @param hashlen The length of the hash (octets) + @param stat Result of signature, 1==valid, 0==invalid + @param key The corresponding public ECC key + @return CRYPT_OK if successful (even if the signature is not valid) +*/ +int ecc_verify_hash_rfc7518(const unsigned char *sig, unsigned long siglen, + const unsigned char *hash, unsigned long hashlen, + int *stat, ecc_key *key) +{ + return _ecc_verify_hash(sig, siglen, hash, hashlen, stat, key, 1); +} + #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/pk/ecc/ltc_ecc_is_valid_idx.c b/libtomcrypt/src/pk/ecc/ltc_ecc_is_valid_idx.c index 4a02068..057a899 100644 --- a/libtomcrypt/src/pk/ecc/ltc_ecc_is_valid_idx.c +++ b/libtomcrypt/src/pk/ecc/ltc_ecc_is_valid_idx.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /* Implements ECC over Z/pZ for curve y^2 = x^3 - 3x + b @@ -19,14 +17,14 @@ /** @file ltc_ecc_is_valid_idx.c ECC Crypto, Tom St Denis -*/ +*/ #ifdef LTC_MECC /** Returns whether an ECC idx is valid or not @param n The idx number to check @return 1 if valid, 0 if not -*/ +*/ int ltc_ecc_is_valid_idx(int n) { int x; @@ -40,7 +38,7 @@ int ltc_ecc_is_valid_idx(int n) } #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/pk/ecc/ltc_ecc_map.c b/libtomcrypt/src/pk/ecc/ltc_ecc_map.c index 4f3ec09..c745f29 100644 --- a/libtomcrypt/src/pk/ecc/ltc_ecc_map.c +++ b/libtomcrypt/src/pk/ecc/ltc_ecc_map.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /* Implements ECC over Z/pZ for curve y^2 = x^3 - 3x + b @@ -19,7 +17,7 @@ /** @file ltc_ecc_map.c ECC Crypto, Tom St Denis -*/ +*/ #ifdef LTC_MECC @@ -40,7 +38,7 @@ int ltc_ecc_map(ecc_point *P, void *modulus, void *mp) LTC_ARGCHK(mp != NULL); if ((err = mp_init_multi(&t1, &t2, NULL)) != CRYPT_OK) { - return CRYPT_MEM; + return err; } /* first map z back to normal */ @@ -48,7 +46,7 @@ int ltc_ecc_map(ecc_point *P, void *modulus, void *mp) /* get 1/z */ if ((err = mp_invmod(P->z, modulus, t1)) != CRYPT_OK) { goto done; } - + /* get 1/z^2 and 1/z^3 */ if ((err = mp_sqr(t1, t2)) != CRYPT_OK) { goto done; } if ((err = mp_mod(t2, modulus, t2)) != CRYPT_OK) { goto done; } @@ -70,7 +68,7 @@ done: #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/pk/ecc/ltc_ecc_mul2add.c b/libtomcrypt/src/pk/ecc/ltc_ecc_mul2add.c index a6d1aab..cef1844 100644 --- a/libtomcrypt/src/pk/ecc/ltc_ecc_mul2add.c +++ b/libtomcrypt/src/pk/ecc/ltc_ecc_mul2add.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /* Implements ECC over Z/pZ for curve y^2 = x^3 - 3x + b @@ -19,7 +17,7 @@ /** @file ltc_ecc_mul2add.c ECC Crypto, Shamir's Trick, Tom St Denis -*/ +*/ #ifdef LTC_MECC @@ -31,9 +29,9 @@ @param B Second point to multiply @param kB What to multiple B by @param C [out] Destination point (can overlap with A or B - @param modulus Modulus for curve + @param modulus Modulus for curve @return CRYPT_OK on success -*/ +*/ int ltc_ecc_mul2add(ecc_point *A, void *kA, ecc_point *B, void *kB, ecc_point *C, @@ -44,7 +42,7 @@ int ltc_ecc_mul2add(ecc_point *A, void *kA, unsigned char *tA, *tB; int err, first; void *mp, *mu; - + /* argchks */ LTC_ARGCHK(A != NULL); LTC_ARGCHK(B != NULL); @@ -93,16 +91,16 @@ int ltc_ecc_mul2add(ecc_point *A, void *kA, } } - /* init montgomery reduction */ - if ((err = mp_montgomery_setup(modulus, &mp)) != CRYPT_OK) { + /* init montgomery reduction */ + if ((err = mp_montgomery_setup(modulus, &mp)) != CRYPT_OK) { goto ERR_P; - } - if ((err = mp_init(&mu)) != CRYPT_OK) { + } + if ((err = mp_init(&mu)) != CRYPT_OK) { goto ERR_MP; - } - if ((err = mp_montgomery_normalization(mu, modulus)) != CRYPT_OK) { + } + if ((err = mp_montgomery_normalization(mu, modulus)) != CRYPT_OK) { goto ERR_MU; - } + } /* copy ones ... */ if ((err = mp_mulmod(A->x, mu, modulus, precomp[1]->x)) != CRYPT_OK) { goto ERR_MU; } @@ -126,7 +124,7 @@ int ltc_ecc_mul2add(ecc_point *A, void *kA, for (y = 1; y < 4; y++) { if ((err = ltc_mp.ecc_ptadd(precomp[x], precomp[(y<<2)], precomp[x+(y<<2)], modulus, mp)) != CRYPT_OK) { goto ERR_MU; } } - } + } nibble = 3; first = 1; @@ -134,20 +132,21 @@ int ltc_ecc_mul2add(ecc_point *A, void *kA, bitbufB = tB[0]; /* for every byte of the multiplicands */ - for (x = -1;; ) { + for (x = 0;; ) { /* grab a nibble */ if (++nibble == 4) { - ++x; if (x == len) break; + if (x == len) break; bitbufA = tA[x]; bitbufB = tB[x]; nibble = 0; + ++x; } /* extract two bits from both, shift/update */ nA = (bitbufA >> 6) & 0x03; nB = (bitbufB >> 6) & 0x03; - bitbufA = (bitbufA << 2) & 0xFF; - bitbufB = (bitbufB << 2) & 0xFF; + bitbufA = (bitbufA << 2) & 0xFF; + bitbufB = (bitbufB << 2) & 0xFF; /* if both zero, if first, continue */ if ((nA == 0) && (nB == 0) && (first == 1)) { @@ -202,6 +201,6 @@ ERR_T: #endif #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/pk/ecc/ltc_ecc_mulmod.c b/libtomcrypt/src/pk/ecc/ltc_ecc_mulmod.c index 4b11392..5834865 100644 --- a/libtomcrypt/src/pk/ecc/ltc_ecc_mulmod.c +++ b/libtomcrypt/src/pk/ecc/ltc_ecc_mulmod.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /* Implements ECC over Z/pZ for curve y^2 = x^3 - 3x + b @@ -19,7 +17,7 @@ /** @file ltc_ecc_mulmod.c ECC Crypto, Tom St Denis -*/ +*/ #ifdef LTC_MECC #ifndef LTC_ECC_TIMING_RESISTANT @@ -28,7 +26,7 @@ #define WINSIZE 4 /** - Perform a point multiplication + Perform a point multiplication @param k The scalar to multiply by @param G The base point @param R [out] Destination for kG @@ -41,7 +39,7 @@ int ltc_ecc_mulmod(void *k, ecc_point *G, ecc_point *R, void *modulus, int map) ecc_point *tG, *M[8]; int i, j, err; void *mu, *mp; - unsigned long buf; + ltc_mp_digit buf; int first, bitbuf, bitcpy, bitcnt, mode, digidx; LTC_ARGCHK(k != NULL); @@ -62,7 +60,7 @@ int ltc_ecc_mulmod(void *k, ecc_point *G, ecc_point *R, void *modulus, int map) mp_clear(mu); return err; } - + /* alloc ram for window temps */ for (i = 0; i < 8; i++) { M[i] = ltc_ecc_new_point(); @@ -85,14 +83,14 @@ int ltc_ecc_mulmod(void *k, ecc_point *G, ecc_point *R, void *modulus, int map) if ((err = mp_copy(G->x, tG->x)) != CRYPT_OK) { goto done; } if ((err = mp_copy(G->y, tG->y)) != CRYPT_OK) { goto done; } if ((err = mp_copy(G->z, tG->z)) != CRYPT_OK) { goto done; } - } else { + } else { if ((err = mp_mulmod(G->x, mu, modulus, tG->x)) != CRYPT_OK) { goto done; } if ((err = mp_mulmod(G->y, mu, modulus, tG->y)) != CRYPT_OK) { goto done; } if ((err = mp_mulmod(G->z, mu, modulus, tG->z)) != CRYPT_OK) { goto done; } } mp_clear(mu); mu = NULL; - + /* calc the M tab, which holds kG for k==8..15 */ /* M[0] == 8G */ if ((err = ltc_mp.ecc_ptdbl(tG, M[0], modulus, mp)) != CRYPT_OK) { goto done; } @@ -217,6 +215,6 @@ done: #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/pk/ecc/ltc_ecc_mulmod_timing.c b/libtomcrypt/src/pk/ecc/ltc_ecc_mulmod_timing.c index 25dcf0a..ca5c9d9 100644 --- a/libtomcrypt/src/pk/ecc/ltc_ecc_mulmod_timing.c +++ b/libtomcrypt/src/pk/ecc/ltc_ecc_mulmod_timing.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /* Implements ECC over Z/pZ for curve y^2 = x^3 - 3x + b @@ -39,7 +37,7 @@ int ltc_ecc_mulmod(void *k, ecc_point *G, ecc_point *R, void *modulus, int map) ecc_point *tG, *M[3]; int i, j, err; void *mu, *mp; - unsigned long buf; + ltc_mp_digit buf; int bitcnt, mode, digidx; LTC_ARGCHK(k != NULL); @@ -159,7 +157,7 @@ done: #endif #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/pk/ecc/ltc_ecc_points.c b/libtomcrypt/src/pk/ecc/ltc_ecc_points.c index 9be9eff..a63bdb5 100644 --- a/libtomcrypt/src/pk/ecc/ltc_ecc_points.c +++ b/libtomcrypt/src/pk/ecc/ltc_ecc_points.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /* Implements ECC over Z/pZ for curve y^2 = x^3 - 3x + b @@ -19,13 +17,13 @@ /** @file ltc_ecc_points.c ECC Crypto, Tom St Denis -*/ +*/ #ifdef LTC_MECC /** Allocate a new ECC point - @return A newly allocated point or NULL on error + @return A newly allocated point or NULL on error */ ecc_point *ltc_ecc_new_point(void) { @@ -54,7 +52,7 @@ void ltc_ecc_del_point(ecc_point *p) } #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/pk/ecc/ltc_ecc_projective_add_point.c b/libtomcrypt/src/pk/ecc/ltc_ecc_projective_add_point.c index c45a47b..9e22e10 100644 --- a/libtomcrypt/src/pk/ecc/ltc_ecc_projective_add_point.c +++ b/libtomcrypt/src/pk/ecc/ltc_ecc_projective_add_point.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /* Implements ECC over Z/pZ for curve y^2 = x^3 - 3x + b @@ -19,9 +17,9 @@ /** @file ltc_ecc_projective_add_point.c ECC Crypto, Tom St Denis -*/ +*/ -#if defined(LTC_MECC) && (!defined(LTC_MECC_ACCEL) || defined(LTM_LTC_DESC)) +#if defined(LTC_MECC) && (!defined(LTC_MECC_ACCEL) || defined(LTM_DESC)) /** Add two ECC points @@ -46,11 +44,11 @@ int ltc_ecc_projective_add_point(ecc_point *P, ecc_point *Q, ecc_point *R, void if ((err = mp_init_multi(&t1, &t2, &x, &y, &z, NULL)) != CRYPT_OK) { return err; } - + /* should we dbl instead? */ if ((err = mp_sub(modulus, Q->y, t1)) != CRYPT_OK) { goto done; } - if ( (mp_cmp(P->x, Q->x) == LTC_MP_EQ) && + if ( (mp_cmp(P->x, Q->x) == LTC_MP_EQ) && (Q->z != NULL && mp_cmp(P->z, Q->z) == LTC_MP_EQ) && (mp_cmp(P->y, Q->y) == LTC_MP_EQ || mp_cmp(P->y, t1) == LTC_MP_EQ)) { mp_clear_multi(t1, t2, x, y, z, NULL); @@ -144,7 +142,7 @@ int ltc_ecc_projective_add_point(ecc_point *P, ecc_point *Q, ecc_point *R, void /* T1 = T1 * X */ if ((err = mp_mul(t1, x, t1)) != CRYPT_OK) { goto done; } if ((err = mp_montgomery_reduce(t1, modulus, mp)) != CRYPT_OK) { goto done; } - + /* X = Y*Y */ if ((err = mp_sqr(y, x)) != CRYPT_OK) { goto done; } if ((err = mp_montgomery_reduce(x, modulus, mp)) != CRYPT_OK) { goto done; } @@ -158,7 +156,7 @@ int ltc_ecc_projective_add_point(ecc_point *P, ecc_point *Q, ecc_point *R, void if ((err = mp_sub(t2, x, t2)) != CRYPT_OK) { goto done; } if (mp_cmp_d(t2, 0) == LTC_MP_LT) { if ((err = mp_add(t2, modulus, t2)) != CRYPT_OK) { goto done; } - } + } /* T2 = T2 - X */ if ((err = mp_sub(t2, x, t2)) != CRYPT_OK) { goto done; } if (mp_cmp_d(t2, 0) == LTC_MP_LT) { @@ -190,7 +188,7 @@ done: #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/pk/ecc/ltc_ecc_projective_dbl_point.c b/libtomcrypt/src/pk/ecc/ltc_ecc_projective_dbl_point.c index ce31ccc..0c6b996 100644 --- a/libtomcrypt/src/pk/ecc/ltc_ecc_projective_dbl_point.c +++ b/libtomcrypt/src/pk/ecc/ltc_ecc_projective_dbl_point.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ /* Implements ECC over Z/pZ for curve y^2 = x^3 - 3x + b @@ -19,9 +17,9 @@ /** @file ltc_ecc_projective_dbl_point.c ECC Crypto, Tom St Denis -*/ +*/ -#if defined(LTC_MECC) && (!defined(LTC_MECC_ACCEL) || defined(LTM_LTC_DESC)) +#if defined(LTC_MECC) && (!defined(LTC_MECC_ACCEL) || defined(LTM_DESC)) /** Double an ECC point @@ -62,7 +60,7 @@ int ltc_ecc_projective_dbl_point(ecc_point *P, ecc_point *R, void *modulus, void if (mp_cmp(R->z, modulus) != LTC_MP_LT) { if ((err = mp_sub(R->z, modulus, R->z)) != CRYPT_OK) { goto done; } } - + /* T2 = X - T1 */ if ((err = mp_sub(R->x, t1, t2)) != CRYPT_OK) { goto done; } if (mp_cmp_d(t2, 0) == LTC_MP_LT) { @@ -121,7 +119,7 @@ int ltc_ecc_projective_dbl_point(ecc_point *P, ecc_point *R, void *modulus, void if ((err = mp_add(R->x, modulus, R->x)) != CRYPT_OK) { goto done; } } - /* Y = Y - X */ + /* Y = Y - X */ if ((err = mp_sub(R->y, R->x, R->y)) != CRYPT_OK) { goto done; } if (mp_cmp_d(R->y, 0) == LTC_MP_LT) { if ((err = mp_add(R->y, modulus, R->y)) != CRYPT_OK) { goto done; } @@ -134,14 +132,14 @@ int ltc_ecc_projective_dbl_point(ecc_point *P, ecc_point *R, void *modulus, void if (mp_cmp_d(R->y, 0) == LTC_MP_LT) { if ((err = mp_add(R->y, modulus, R->y)) != CRYPT_OK) { goto done; } } - + err = CRYPT_OK; done: mp_clear_multi(t1, t2, NULL); return err; } #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/pk/katja/katja_decrypt_key.c b/libtomcrypt/src/pk/katja/katja_decrypt_key.c index e8819d9..72009b0 100644 --- a/libtomcrypt/src/pk/katja/katja_decrypt_key.c +++ b/libtomcrypt/src/pk/katja/katja_decrypt_key.c @@ -5,20 +5,18 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" /** @file katja_decrypt_key.c - Katja LTC_PKCS #1 OAEP Decryption, Tom St Denis -*/ + Katja PKCS #1 OAEP Decryption, Tom St Denis +*/ -#ifdef MKAT +#ifdef LTC_MKAT /** - (LTC_PKCS #1 v2.0) decrypt then OAEP depad + (PKCS #1 v2.0) decrypt then OAEP depad @param in The ciphertext @param inlen The length of the ciphertext (octets) @param out [out] The plaintext @@ -31,7 +29,7 @@ @return CRYPT_OK if succcessul (even if invalid) */ int katja_decrypt_key(const unsigned char *in, unsigned long inlen, - unsigned char *out, unsigned long *outlen, + unsigned char *out, unsigned long *outlen, const unsigned char *lparam, unsigned long lparamlen, int hash_idx, int *stat, katja_key *key) @@ -39,7 +37,7 @@ int katja_decrypt_key(const unsigned char *in, unsigned long inlen, unsigned long modulus_bitlen, modulus_bytelen, x; int err; unsigned char *tmp; - + LTC_ARGCHK(out != NULL); LTC_ARGCHK(outlen != NULL); LTC_ARGCHK(key != NULL); @@ -52,7 +50,7 @@ int katja_decrypt_key(const unsigned char *in, unsigned long inlen, if ((err = hash_is_valid(hash_idx)) != CRYPT_OK) { return err; } - + /* get modulus len in bits */ modulus_bitlen = mp_count_bits( (key->N)); @@ -100,6 +98,6 @@ int katja_decrypt_key(const unsigned char *in, unsigned long inlen, -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/pk/katja/katja_encrypt_key.c b/libtomcrypt/src/pk/katja/katja_encrypt_key.c index ef59e92..9ed72fb 100644 --- a/libtomcrypt/src/pk/katja/katja_encrypt_key.c +++ b/libtomcrypt/src/pk/katja/katja_encrypt_key.c @@ -5,20 +5,18 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" /** @file katja_encrypt_key.c - Katja LTC_PKCS-style OAEP encryption, Tom St Denis -*/ + Katja PKCS-style OAEP encryption, Tom St Denis +*/ -#ifdef MKAT +#ifdef LTC_MKAT /** - (LTC_PKCS #1 v2.0) OAEP pad then encrypt + (PKCS #1 v2.0) OAEP pad then encrypt @param in The plaintext @param inlen The length of the plaintext (octets) @param out [out] The ciphertext @@ -30,7 +28,7 @@ @param hash_idx The index of the desired hash @param key The Katja key to encrypt to @return CRYPT_OK if successful -*/ +*/ int katja_encrypt_key(const unsigned char *in, unsigned long inlen, unsigned char *out, unsigned long *outlen, const unsigned char *lparam, unsigned long lparamlen, @@ -38,12 +36,12 @@ int katja_encrypt_key(const unsigned char *in, unsigned long inlen, { unsigned long modulus_bitlen, modulus_bytelen, x; int err; - + LTC_ARGCHK(in != NULL); LTC_ARGCHK(out != NULL); LTC_ARGCHK(outlen != NULL); LTC_ARGCHK(key != NULL); - + /* valid prng and hash ? */ if ((err = prng_is_valid(prng_idx)) != CRYPT_OK) { return err; @@ -51,7 +49,7 @@ int katja_encrypt_key(const unsigned char *in, unsigned long inlen, if ((err = hash_is_valid(hash_idx)) != CRYPT_OK) { return err; } - + /* get modulus len in bits */ modulus_bitlen = mp_count_bits((key->N)); @@ -70,11 +68,11 @@ int katja_encrypt_key(const unsigned char *in, unsigned long inlen, /* OAEP pad the key */ x = *outlen; - if ((err = pkcs_1_oaep_encode(in, inlen, lparam, - lparamlen, modulus_bitlen, prng, prng_idx, hash_idx, + if ((err = pkcs_1_oaep_encode(in, inlen, lparam, + lparamlen, modulus_bitlen, prng, prng_idx, hash_idx, out, &x)) != CRYPT_OK) { return err; - } + } /* Katja exptmod the OAEP pad */ return katja_exptmod(out, x, out, outlen, PK_PUBLIC, key); @@ -82,6 +80,6 @@ int katja_encrypt_key(const unsigned char *in, unsigned long inlen, #endif /* LTC_MRSA */ -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/pk/katja/katja_export.c b/libtomcrypt/src/pk/katja/katja_export.c index 5f4d327..0412e65 100644 --- a/libtomcrypt/src/pk/katja/katja_export.c +++ b/libtomcrypt/src/pk/katja/katja_export.c @@ -5,17 +5,15 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" /** @file katja_export.c - Export Katja LTC_PKCS-style keys, Tom St Denis -*/ + Export Katja PKCS-style keys, Tom St Denis +*/ -#ifdef MKAT +#ifdef LTC_MKAT /** This will export either an KatjaPublicKey or KatjaPrivateKey @@ -24,7 +22,7 @@ @param type The type of exported key (PK_PRIVATE or PK_PUBLIC) @param key The Katja key to export @return CRYPT_OK if successful -*/ +*/ int katja_export(unsigned char *out, unsigned long *outlen, int type, katja_key *key) { int err; @@ -41,35 +39,35 @@ int katja_export(unsigned char *out, unsigned long *outlen, int type, katja_key if (type == PK_PRIVATE) { /* private key */ - /* output is + /* output is Version, n, d, p, q, d mod (p-1), d mod (q - 1), 1/q mod p, pq */ - if ((err = der_encode_sequence_multi(out, outlen, - LTC_ASN1_SHORT_INTEGER, 1UL, &zero, - LTC_ASN1_INTEGER, 1UL, key->N, - LTC_ASN1_INTEGER, 1UL, key->d, - LTC_ASN1_INTEGER, 1UL, key->p, - LTC_ASN1_INTEGER, 1UL, key->q, + if ((err = der_encode_sequence_multi(out, outlen, + LTC_ASN1_SHORT_INTEGER, 1UL, &zero, + LTC_ASN1_INTEGER, 1UL, key->N, + LTC_ASN1_INTEGER, 1UL, key->d, + LTC_ASN1_INTEGER, 1UL, key->p, + LTC_ASN1_INTEGER, 1UL, key->q, LTC_ASN1_INTEGER, 1UL, key->dP, - LTC_ASN1_INTEGER, 1UL, key->dQ, - LTC_ASN1_INTEGER, 1UL, key->qP, - LTC_ASN1_INTEGER, 1UL, key->pq, + LTC_ASN1_INTEGER, 1UL, key->dQ, + LTC_ASN1_INTEGER, 1UL, key->qP, + LTC_ASN1_INTEGER, 1UL, key->pq, LTC_ASN1_EOL, 0UL, NULL)) != CRYPT_OK) { return err; } - + /* clear zero and return */ return CRYPT_OK; } else { /* public key */ - return der_encode_sequence_multi(out, outlen, - LTC_ASN1_INTEGER, 1UL, key->N, + return der_encode_sequence_multi(out, outlen, + LTC_ASN1_INTEGER, 1UL, key->N, LTC_ASN1_EOL, 0UL, NULL); } } #endif /* LTC_MRSA */ -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/pk/katja/katja_exptmod.c b/libtomcrypt/src/pk/katja/katja_exptmod.c index 5df8908..afc847f 100644 --- a/libtomcrypt/src/pk/katja/katja_exptmod.c +++ b/libtomcrypt/src/pk/katja/katja_exptmod.c @@ -5,28 +5,26 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" /** @file katja_exptmod.c - Katja LTC_PKCS-style exptmod, Tom St Denis -*/ + Katja PKCS-style exptmod, Tom St Denis +*/ -#ifdef MKAT +#ifdef LTC_MKAT -/** - Compute an RSA modular exponentiation +/** + Compute an RSA modular exponentiation @param in The input data to send into RSA @param inlen The length of the input (octets) - @param out [out] The destination + @param out [out] The destination @param outlen [in/out] The max size and resulting size of the output @param which Which exponent to use, e.g. PK_PRIVATE or PK_PUBLIC - @param key The RSA key to use + @param key The RSA key to use @return CRYPT_OK if successful -*/ +*/ int katja_exptmod(const unsigned char *in, unsigned long inlen, unsigned char *out, unsigned long *outlen, int which, katja_key *key) @@ -39,7 +37,7 @@ int katja_exptmod(const unsigned char *in, unsigned long inlen, LTC_ARGCHK(out != NULL); LTC_ARGCHK(outlen != NULL); LTC_ARGCHK(key != NULL); - + /* is the key of the right type for the operation? */ if (which == PK_PRIVATE && (key->type != PK_PRIVATE)) { return CRYPT_PK_NOT_PRIVATE; @@ -110,6 +108,6 @@ done: #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/pk/katja/katja_free.c b/libtomcrypt/src/pk/katja/katja_free.c index c5a46af..117bbf4 100644 --- a/libtomcrypt/src/pk/katja/katja_free.c +++ b/libtomcrypt/src/pk/katja/katja_free.c @@ -5,17 +5,15 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" /** @file katja_free.c Free an Katja key, Tom St Denis -*/ +*/ -#ifdef MKAT +#ifdef LTC_MKAT /** Free an Katja key from memory @@ -30,6 +28,6 @@ void katja_free(katja_key *key) #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/pk/katja/katja_import.c b/libtomcrypt/src/pk/katja/katja_import.c index 425f498..98357c0 100644 --- a/libtomcrypt/src/pk/katja/katja_import.c +++ b/libtomcrypt/src/pk/katja/katja_import.c @@ -5,20 +5,18 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" /** @file katja_import.c - Import a LTC_PKCS-style Katja key, Tom St Denis -*/ + Import a PKCS-style Katja key, Tom St Denis +*/ -#ifdef MKAT +#ifdef LTC_MKAT /** - Import an KatjaPublicKey or KatjaPrivateKey [two-prime only, only support >= 1024-bit keys, defined in LTC_PKCS #1 v2.1] + Import an KatjaPublicKey or KatjaPrivateKey [two-prime only, only support >= 1024-bit keys, defined in PKCS #1 v2.1] @param in The packet to import from @param inlen It's length (octets) @param key [out] Destination for newly imported key @@ -34,29 +32,29 @@ int katja_import(const unsigned char *in, unsigned long inlen, katja_key *key) LTC_ARGCHK(ltc_mp.name != NULL); /* init key */ - if ((err = mp_init_multi(&zero, &key->d, &key->N, &key->dQ, + if ((err = mp_init_multi(&zero, &key->d, &key->N, &key->dQ, &key->dP, &key->qP, &key->p, &key->q, &key->pq, NULL)) != CRYPT_OK) { return err; } - if ((err = der_decode_sequence_multi(in, inlen, - LTC_ASN1_INTEGER, 1UL, key->N, + if ((err = der_decode_sequence_multi(in, inlen, + LTC_ASN1_INTEGER, 1UL, key->N, LTC_ASN1_EOL, 0UL, NULL)) != CRYPT_OK) { goto LBL_ERR; } if (mp_cmp_d(key->N, 0) == LTC_MP_EQ) { /* it's a private key */ - if ((err = der_decode_sequence_multi(in, inlen, - LTC_ASN1_INTEGER, 1UL, zero, - LTC_ASN1_INTEGER, 1UL, key->N, - LTC_ASN1_INTEGER, 1UL, key->d, - LTC_ASN1_INTEGER, 1UL, key->p, - LTC_ASN1_INTEGER, 1UL, key->q, + if ((err = der_decode_sequence_multi(in, inlen, + LTC_ASN1_INTEGER, 1UL, zero, + LTC_ASN1_INTEGER, 1UL, key->N, + LTC_ASN1_INTEGER, 1UL, key->d, + LTC_ASN1_INTEGER, 1UL, key->p, + LTC_ASN1_INTEGER, 1UL, key->q, LTC_ASN1_INTEGER, 1UL, key->dP, - LTC_ASN1_INTEGER, 1UL, key->dQ, - LTC_ASN1_INTEGER, 1UL, key->qP, - LTC_ASN1_INTEGER, 1UL, key->pq, + LTC_ASN1_INTEGER, 1UL, key->dQ, + LTC_ASN1_INTEGER, 1UL, key->qP, + LTC_ASN1_INTEGER, 1UL, key->pq, LTC_ASN1_EOL, 0UL, NULL)) != CRYPT_OK) { goto LBL_ERR; } @@ -76,6 +74,6 @@ LBL_ERR: #endif /* LTC_MRSA */ -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/pk/katja/katja_make_key.c b/libtomcrypt/src/pk/katja/katja_make_key.c index eec8e98..6f83bcc 100644 --- a/libtomcrypt/src/pk/katja/katja_make_key.c +++ b/libtomcrypt/src/pk/katja/katja_make_key.c @@ -5,19 +5,17 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" /** @file katja_make_key.c Katja key generation, Tom St Denis -*/ +*/ -#ifdef MKAT +#ifdef LTC_MKAT -/** +/** Create a Katja key @param prng An active PRNG state @param wprng The index of the PRNG desired @@ -29,7 +27,7 @@ int katja_make_key(prng_state *prng, int wprng, int size, katja_key *key) { void *p, *q, *tmp1, *tmp2; int err; - + LTC_ARGCHK(key != NULL); LTC_ARGCHK(ltc_mp.name != NULL); @@ -68,7 +66,7 @@ int katja_make_key(prng_state *prng, int wprng, int size, katja_key *key) if ((err = mp_copy( p, key->p)) != CRYPT_OK) { goto error2; } if ((err = mp_copy( q, key->q)) != CRYPT_OK) { goto error2; } if ((err = mp_mul(key->p, key->q, key->pq)) != CRYPT_OK) { goto error2; } /* tmp1 = pq */ - if ((err = mp_mul(key->pq, key->p, key->N)) != CRYPT_OK) { goto error2; } /* N = p^2q */ + if ((err = mp_mul(key->pq, key->p, key->N)) != CRYPT_OK) { goto error2; } /* N = p^2q */ if ((err = mp_sub_d( p, 1, tmp1)) != CRYPT_OK) { goto error2; } /* tmp1 = q-1 */ if ((err = mp_sub_d( q, 1, tmp2)) != CRYPT_OK) { goto error2; } /* tmp2 = p-1 */ if ((err = mp_lcm(tmp1, tmp2, key->d)) != CRYPT_OK) { goto error2; } /* tmp1 = lcd(p-1,q-1) */ @@ -96,6 +94,6 @@ done: #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/pk/pkcs1/pkcs_1_i2osp.c b/libtomcrypt/src/pk/pkcs1/pkcs_1_i2osp.c index 2d9df75..5324c1e 100644 --- a/libtomcrypt/src/pk/pkcs1/pkcs_1_i2osp.c +++ b/libtomcrypt/src/pk/pkcs1/pkcs_1_i2osp.c @@ -5,14 +5,12 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" -/** +/** @file pkcs_1_i2osp.c - Integer to Octet I2OSP, Tom St Denis + Integer to Octet I2OSP, Tom St Denis */ #ifdef LTC_PKCS_1 @@ -22,7 +20,7 @@ */ /** - LTC_PKCS #1 Integer to binary + PKCS #1 Integer to binary @param n The integer to store @param modulus_len The length of the RSA modulus @param out [out] The destination for the integer @@ -46,6 +44,6 @@ int pkcs_1_i2osp(void *n, unsigned long modulus_len, unsigned char *out) #endif /* LTC_PKCS_1 */ -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/pk/pkcs1/pkcs_1_mgf1.c b/libtomcrypt/src/pk/pkcs1/pkcs_1_mgf1.c index af8f7e2..c6283ca 100644 --- a/libtomcrypt/src/pk/pkcs1/pkcs_1_mgf1.c +++ b/libtomcrypt/src/pk/pkcs1/pkcs_1_mgf1.c @@ -5,23 +5,21 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" -/** +/** @file pkcs_1_mgf1.c - The Mask Generation Function (MGF1) for LTC_PKCS #1, Tom St Denis + The Mask Generation Function (MGF1) for PKCS #1, Tom St Denis */ #ifdef LTC_PKCS_1 /** - Perform LTC_PKCS #1 MGF1 (internal) + Perform PKCS #1 MGF1 (internal) + @param hash_idx The index of the hash desired @param seed The seed for MGF1 @param seedlen The length of the seed - @param hash_idx The index of the hash desired @param mask [out] The destination @param masklen The length of the mask desired @return CRYPT_OK if successful @@ -35,12 +33,12 @@ int pkcs_1_mgf1(int hash_idx, int err; hash_state *md; unsigned char *buf; - + LTC_ARGCHK(seed != NULL); LTC_ARGCHK(mask != NULL); /* ensure valid hash */ - if ((err = hash_is_valid(hash_idx)) != CRYPT_OK) { + if ((err = hash_is_valid(hash_idx)) != CRYPT_OK) { return err; } @@ -103,6 +101,6 @@ LBL_ERR: #endif /* LTC_PKCS_1 */ -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/pk/pkcs1/pkcs_1_oaep_decode.c b/libtomcrypt/src/pk/pkcs1/pkcs_1_oaep_decode.c index 9ac9976..27c9245 100644 --- a/libtomcrypt/src/pk/pkcs1/pkcs_1_oaep_decode.c +++ b/libtomcrypt/src/pk/pkcs1/pkcs_1_oaep_decode.c @@ -5,20 +5,18 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" -/** +/** @file pkcs_1_oaep_decode.c - OAEP Padding for LTC_PKCS #1, Tom St Denis + OAEP Padding for PKCS #1, Tom St Denis */ #ifdef LTC_PKCS_1 /** - LTC_PKCS #1 v2.00 OAEP decode + PKCS #1 v2.00 OAEP decode @param msg The encoded data to decode @param msglen The length of the encoded data (octets) @param lparam The session or system data (can be NULL) @@ -28,7 +26,7 @@ @param out [out] Destination of decoding @param outlen [in/out] The max size and resulting size of the decoding @param res [out] Result of decoding, 1==valid, 0==invalid - @return CRYPT_OK if successful (even if invalid) + @return CRYPT_OK if successful */ int pkcs_1_oaep_decode(const unsigned char *msg, unsigned long msglen, const unsigned char *lparam, unsigned long lparamlen, @@ -38,7 +36,7 @@ int pkcs_1_oaep_decode(const unsigned char *msg, unsigned long msglen, { unsigned char *DB, *seed, *mask; unsigned long hLen, x, y, modulus_len; - int err; + int err, ret; LTC_ARGCHK(msg != NULL); LTC_ARGCHK(out != NULL); @@ -47,9 +45,9 @@ int pkcs_1_oaep_decode(const unsigned char *msg, unsigned long msglen, /* default to invalid packet */ *res = 0; - + /* test valid hash */ - if ((err = hash_is_valid(hash_idx)) != CRYPT_OK) { + if ((err = hash_is_valid(hash_idx)) != CRYPT_OK) { return err; } hLen = hash_descriptor[hash_idx].hashsize; @@ -78,17 +76,18 @@ int pkcs_1_oaep_decode(const unsigned char *msg, unsigned long msglen, } /* ok so it's now in the form - - 0x00 || maskedseed || maskedDB - + + 0x00 || maskedseed || maskedDB + 1 || hLen || modulus_len - hLen - 1 - + */ + ret = CRYPT_OK; + /* must have leading 0x00 byte */ if (msg[0] != 0x00) { - err = CRYPT_OK; - goto LBL_ERR; + ret = CRYPT_INVALID_PACKET; } /* now read the masked seed */ @@ -100,7 +99,7 @@ int pkcs_1_oaep_decode(const unsigned char *msg, unsigned long msglen, XMEMCPY(DB, msg + x, modulus_len - hLen - 1); x += modulus_len - hLen - 1; - /* compute MGF1 of maskedDB (hLen) */ + /* compute MGF1 of maskedDB (hLen) */ if ((err = pkcs_1_mgf1(hash_idx, DB, modulus_len - hLen - 1, mask, hLen)) != CRYPT_OK) { goto LBL_ERR; } @@ -117,7 +116,7 @@ int pkcs_1_oaep_decode(const unsigned char *msg, unsigned long msglen, /* xor against DB */ for (y = 0; y < (modulus_len - hLen - 1); y++) { - DB[y] ^= mask[y]; + DB[y] ^= mask[y]; } /* now DB == lhash || PS || 0x01 || M, PS == k - mlen - 2hlen - 2 zeroes */ @@ -136,9 +135,8 @@ int pkcs_1_oaep_decode(const unsigned char *msg, unsigned long msglen, } /* compare the lhash'es */ - if (XMEMCMP(seed, DB, hLen) != 0) { - err = CRYPT_OK; - goto LBL_ERR; + if (XMEM_NEQ(seed, DB, hLen) != 0) { + ret = CRYPT_INVALID_PACKET; } /* now zeroes before a 0x01 */ @@ -146,28 +144,26 @@ int pkcs_1_oaep_decode(const unsigned char *msg, unsigned long msglen, /* step... */ } - /* error out if wasn't 0x01 */ + /* error if wasn't 0x01 */ if (x == (modulus_len - hLen - 1) || DB[x] != 0x01) { - err = CRYPT_INVALID_PACKET; - goto LBL_ERR; + ret = CRYPT_INVALID_PACKET; } /* rest is the message (and skip 0x01) */ if ((modulus_len - hLen - 1 - ++x) > *outlen) { - *outlen = modulus_len - hLen - 1 - x; - err = CRYPT_BUFFER_OVERFLOW; - goto LBL_ERR; + ret = CRYPT_INVALID_PACKET; } - /* copy message */ - *outlen = modulus_len - hLen - 1 - x; - XMEMCPY(out, DB + x, modulus_len - hLen - 1 - x); - x += modulus_len - hLen - 1; + if (ret == CRYPT_OK) { + /* copy message */ + *outlen = modulus_len - hLen - 1 - x; + XMEMCPY(out, DB + x, modulus_len - hLen - 1 - x); - /* valid packet */ - *res = 1; + /* valid packet */ + *res = 1; + } + err = ret; - err = CRYPT_OK; LBL_ERR: #ifdef LTC_CLEAN_STACK zeromem(DB, modulus_len); @@ -184,6 +180,6 @@ LBL_ERR: #endif /* LTC_PKCS_1 */ -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/pk/pkcs1/pkcs_1_oaep_encode.c b/libtomcrypt/src/pk/pkcs1/pkcs_1_oaep_encode.c index 4403477..5042946 100644 --- a/libtomcrypt/src/pk/pkcs1/pkcs_1_oaep_encode.c +++ b/libtomcrypt/src/pk/pkcs1/pkcs_1_oaep_encode.c @@ -5,20 +5,18 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" /** @file pkcs_1_oaep_encode.c - OAEP Padding for LTC_PKCS #1, Tom St Denis + OAEP Padding for PKCS #1, Tom St Denis */ #ifdef LTC_PKCS_1 /** - LTC_PKCS #1 v2.00 OAEP encode + PKCS #1 v2.00 OAEP encode @param msg The data to encode @param msglen The length of the data to encode (octets) @param lparam A session or system parameter (can be NULL) @@ -46,7 +44,7 @@ int pkcs_1_oaep_encode(const unsigned char *msg, unsigned long msglen, LTC_ARGCHK(outlen != NULL); /* test valid hash */ - if ((err = hash_is_valid(hash_idx)) != CRYPT_OK) { + if ((err = hash_is_valid(hash_idx)) != CRYPT_OK) { return err; } @@ -120,10 +118,10 @@ int pkcs_1_oaep_encode(const unsigned char *msg, unsigned long msglen, /* xor against DB */ for (y = 0; y < (modulus_len - hLen - 1); y++) { - DB[y] ^= mask[y]; + DB[y] ^= mask[y]; } - /* compute MGF1 of maskedDB (hLen) */ + /* compute MGF1 of maskedDB (hLen) */ if ((err = pkcs_1_mgf1(hash_idx, DB, modulus_len - hLen - 1, mask, hLen)) != CRYPT_OK) { goto LBL_ERR; } @@ -149,7 +147,7 @@ int pkcs_1_oaep_encode(const unsigned char *msg, unsigned long msglen, x += modulus_len - hLen - 1; *outlen = x; - + err = CRYPT_OK; LBL_ERR: #ifdef LTC_CLEAN_STACK @@ -168,6 +166,6 @@ LBL_ERR: #endif /* LTC_PKCS_1 */ -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/pk/pkcs1/pkcs_1_os2ip.c b/libtomcrypt/src/pk/pkcs1/pkcs_1_os2ip.c index 2df7574..743c70b 100644 --- a/libtomcrypt/src/pk/pkcs1/pkcs_1_os2ip.c +++ b/libtomcrypt/src/pk/pkcs1/pkcs_1_os2ip.c @@ -5,14 +5,12 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" -/** +/** @file pkcs_1_os2ip.c - Octet to Integer OS2IP, Tom St Denis + Octet to Integer OS2IP, Tom St Denis */ #ifdef LTC_PKCS_1 @@ -31,6 +29,6 @@ int pkcs_1_os2ip(void *n, unsigned char *in, unsigned long inlen) #endif /* LTC_PKCS_1 */ -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/pk/pkcs1/pkcs_1_pss_decode.c b/libtomcrypt/src/pk/pkcs1/pkcs_1_pss_decode.c index 222048c..8e112a1 100644 --- a/libtomcrypt/src/pk/pkcs1/pkcs_1_pss_decode.c +++ b/libtomcrypt/src/pk/pkcs1/pkcs_1_pss_decode.c @@ -5,20 +5,18 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" -/** +/** @file pkcs_1_pss_decode.c - LTC_PKCS #1 PSS Signature Padding, Tom St Denis + PKCS #1 PSS Signature Padding, Tom St Denis */ #ifdef LTC_PKCS_1 /** - LTC_PKCS #1 v2.00 PSS decode + PKCS #1 v2.00 PSS decode @param msghash The hash to verify @param msghashlen The length of the hash (octets) @param sig The signature data (encoded data) @@ -51,11 +49,12 @@ int pkcs_1_pss_decode(const unsigned char *msghash, unsigned long msghashlen, } hLen = hash_descriptor[hash_idx].hashsize; + modulus_bitlen--; modulus_len = (modulus_bitlen>>3) + (modulus_bitlen & 7 ? 1 : 0); /* check sizes */ - if ((saltlen > modulus_len) || - (modulus_len < hLen + saltlen + 2) || (siglen != modulus_len)) { + if ((saltlen > modulus_len) || + (modulus_len < hLen + saltlen + 2)) { return CRYPT_PK_INVALID_SIZE; } @@ -93,10 +92,10 @@ int pkcs_1_pss_decode(const unsigned char *msghash, unsigned long msghashlen, /* copy out the hash */ XMEMCPY(hash, sig + x, hLen); - x += hLen; + /* x += hLen; */ /* check the MSB */ - if ((sig[0] & ~(0xFF >> ((modulus_len<<3) - (modulus_bitlen-1)))) != 0) { + if ((sig[0] & ~(0xFF >> ((modulus_len<<3) - (modulus_bitlen)))) != 0) { err = CRYPT_INVALID_PACKET; goto LBL_ERR; } @@ -110,9 +109,9 @@ int pkcs_1_pss_decode(const unsigned char *msghash, unsigned long msghashlen, for (y = 0; y < (modulus_len - hLen - 1); y++) { DB[y] ^= mask[y]; } - + /* now clear the first byte [make sure smaller than modulus] */ - DB[0] &= 0xFF >> ((modulus_len<<3) - (modulus_bitlen-1)); + DB[0] &= 0xFF >> ((modulus_len<<3) - (modulus_bitlen)); /* DB = PS || 0x01 || salt, PS == modulus_len - saltlen - hLen - 2 zero bytes */ @@ -149,17 +148,17 @@ int pkcs_1_pss_decode(const unsigned char *msghash, unsigned long msghashlen, } /* mask == hash means valid signature */ - if (XMEMCMP(mask, hash, hLen) == 0) { + if (XMEM_NEQ(mask, hash, hLen) == 0) { *res = 1; } err = CRYPT_OK; LBL_ERR: #ifdef LTC_CLEAN_STACK - zeromem(DB, modulus_len); - zeromem(mask, modulus_len); - zeromem(salt, modulus_len); - zeromem(hash, modulus_len); + zeromem(DB, modulus_len); + zeromem(mask, modulus_len); + zeromem(salt, modulus_len); + zeromem(hash, modulus_len); #endif XFREE(hash); @@ -172,6 +171,6 @@ LBL_ERR: #endif /* LTC_PKCS_1 */ -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/pk/pkcs1/pkcs_1_pss_encode.c b/libtomcrypt/src/pk/pkcs1/pkcs_1_pss_encode.c index b22a99f..c795114 100644 --- a/libtomcrypt/src/pk/pkcs1/pkcs_1_pss_encode.c +++ b/libtomcrypt/src/pk/pkcs1/pkcs_1_pss_encode.c @@ -5,20 +5,18 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" -/** +/** @file pkcs_1_pss_encode.c - LTC_PKCS #1 PSS Signature Padding, Tom St Denis + PKCS #1 PSS Signature Padding, Tom St Denis */ #ifdef LTC_PKCS_1 /** - LTC_PKCS #1 v2.00 Signature Encoding + PKCS #1 v2.00 Signature Encoding @param msghash The hash to encode @param msghashlen The length of the hash (octets) @param saltlen The length of the salt desired (octets) @@ -31,7 +29,7 @@ @return CRYPT_OK if successful */ int pkcs_1_pss_encode(const unsigned char *msghash, unsigned long msghashlen, - unsigned long saltlen, prng_state *prng, + unsigned long saltlen, prng_state *prng, int prng_idx, int hash_idx, unsigned long modulus_bitlen, unsigned char *out, unsigned long *outlen) @@ -54,6 +52,7 @@ int pkcs_1_pss_encode(const unsigned char *msghash, unsigned long msghashlen, } hLen = hash_descriptor[hash_idx].hashsize; + modulus_bitlen--; modulus_len = (modulus_bitlen>>3) + (modulus_bitlen & 7 ? 1 : 0); /* check sizes */ @@ -115,7 +114,7 @@ int pkcs_1_pss_encode(const unsigned char *msghash, unsigned long msghashlen, x += modulus_len - saltlen - hLen - 2; DB[x++] = 0x01; XMEMCPY(DB + x, salt, saltlen); - x += saltlen; + /* x += saltlen; */ /* generate mask of length modulus_len - hLen - 1 from hash */ if ((err = pkcs_1_mgf1(hash_idx, hash, hLen, mask, modulus_len - hLen - 1)) != CRYPT_OK) { @@ -147,17 +146,17 @@ int pkcs_1_pss_encode(const unsigned char *msghash, unsigned long msghashlen, out[y] = 0xBC; /* now clear the 8*modulus_len - modulus_bitlen most significant bits */ - out[0] &= 0xFF >> ((modulus_len<<3) - (modulus_bitlen-1)); + out[0] &= 0xFF >> ((modulus_len<<3) - modulus_bitlen); /* store output size */ *outlen = modulus_len; err = CRYPT_OK; LBL_ERR: #ifdef LTC_CLEAN_STACK - zeromem(DB, modulus_len); - zeromem(mask, modulus_len); - zeromem(salt, modulus_len); - zeromem(hash, modulus_len); + zeromem(DB, modulus_len); + zeromem(mask, modulus_len); + zeromem(salt, modulus_len); + zeromem(hash, modulus_len); #endif XFREE(hash); @@ -170,6 +169,6 @@ LBL_ERR: #endif /* LTC_PKCS_1 */ -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/pk/pkcs1/pkcs_1_v1_5_decode.c b/libtomcrypt/src/pk/pkcs1/pkcs_1_v1_5_decode.c index 8345601..94e1b2a 100644 --- a/libtomcrypt/src/pk/pkcs1/pkcs_1_v1_5_decode.c +++ b/libtomcrypt/src/pk/pkcs1/pkcs_1_v1_5_decode.c @@ -5,19 +5,17 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" /** @file pkcs_1_v1_5_decode.c * - * LTC_PKCS #1 v1.5 Padding. (Andreas Lange) + * PKCS #1 v1.5 Padding. (Andreas Lange) */ #ifdef LTC_PKCS_1 -/** @brief LTC_PKCS #1 v1.5 decode. +/** @brief PKCS #1 v1.5 decode. * * @param msg The encoded data to decode * @param msglen The length of the encoded data (octets) @@ -27,13 +25,13 @@ * @param outlen [in/out] The max size and resulting size of the decoding * @param is_valid [out] Boolean whether the padding was valid * - * @return CRYPT_OK if successful (even if invalid) + * @return CRYPT_OK if successful */ -int pkcs_1_v1_5_decode(const unsigned char *msg, +int pkcs_1_v1_5_decode(const unsigned char *msg, unsigned long msglen, int block_type, unsigned long modulus_bitlen, - unsigned char *out, + unsigned char *out, unsigned long *outlen, int *is_valid) { @@ -51,26 +49,25 @@ int pkcs_1_v1_5_decode(const unsigned char *msg, return CRYPT_PK_INVALID_SIZE; } + result = CRYPT_OK; + /* separate encoded message */ if ((msg[0] != 0x00) || (msg[1] != (unsigned char)block_type)) { result = CRYPT_INVALID_PACKET; - goto bail; } - if (block_type == LTC_LTC_PKCS_1_EME) { + if (block_type == LTC_PKCS_1_EME) { for (i = 2; i < modulus_len; i++) { /* separator */ if (msg[i] == 0x00) { break; } } ps_len = i++ - 2; - if ((i >= modulus_len) || (ps_len < 8)) { - /* There was no octet with hexadecimal value 0x00 to separate ps from m, - * or the length of ps is less than 8 octets. + if (i >= modulus_len) { + /* There was no octet with hexadecimal value 0x00 to separate ps from m. */ result = CRYPT_INVALID_PACKET; - goto bail; } } else { for (i = 2; i < modulus_len - 1; i++) { @@ -81,30 +78,35 @@ int pkcs_1_v1_5_decode(const unsigned char *msg, if (msg[i] != 0) { /* There was no octet with hexadecimal value 0x00 to separate ps from m. */ result = CRYPT_INVALID_PACKET; - goto bail; } ps_len = i - 2; } + if (ps_len < 8) + { + /* The length of ps is less than 8 octets. + */ + result = CRYPT_INVALID_PACKET; + } + if (*outlen < (msglen - (2 + ps_len + 1))) { - *outlen = msglen - (2 + ps_len + 1); - result = CRYPT_BUFFER_OVERFLOW; - goto bail; + result = CRYPT_INVALID_PACKET; } - *outlen = (msglen - (2 + ps_len + 1)); - XMEMCPY(out, &msg[2 + ps_len + 1], *outlen); + if (result == CRYPT_OK) { + *outlen = (msglen - (2 + ps_len + 1)); + XMEMCPY(out, &msg[2 + ps_len + 1], *outlen); + + /* valid packet */ + *is_valid = 1; + } - /* valid packet */ - *is_valid = 1; - result = CRYPT_OK; -bail: return result; } /* pkcs_1_v1_5_decode */ #endif /* #ifdef LTC_PKCS_1 */ -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/pk/pkcs1/pkcs_1_v1_5_encode.c b/libtomcrypt/src/pk/pkcs1/pkcs_1_v1_5_encode.c index 1c35069..dd92c64 100644 --- a/libtomcrypt/src/pk/pkcs1/pkcs_1_v1_5_encode.c +++ b/libtomcrypt/src/pk/pkcs1/pkcs_1_v1_5_encode.c @@ -5,38 +5,36 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" /*! \file pkcs_1_v1_5_encode.c * - * LTC_PKCS #1 v1.5 Padding (Andreas Lange) + * PKCS #1 v1.5 Padding (Andreas Lange) */ #ifdef LTC_PKCS_1 -/*! \brief LTC_PKCS #1 v1.5 encode. +/*! \brief PKCS #1 v1.5 encode. * * \param msg The data to encode * \param msglen The length of the data to encode (octets) * \param block_type Block type to use in padding (\sa ltc_pkcs_1_v1_5_blocks) * \param modulus_bitlen The bit length of the RSA modulus - * \param prng An active PRNG state (only for LTC_LTC_PKCS_1_EME) - * \param prng_idx The index of the PRNG desired (only for LTC_LTC_PKCS_1_EME) + * \param prng An active PRNG state (only for LTC_PKCS_1_EME) + * \param prng_idx The index of the PRNG desired (only for LTC_PKCS_1_EME) * \param out [out] The destination for the encoded data * \param outlen [in/out] The max size and resulting size of the encoded data * * \return CRYPT_OK if successful */ -int pkcs_1_v1_5_encode(const unsigned char *msg, +int pkcs_1_v1_5_encode(const unsigned char *msg, unsigned long msglen, int block_type, unsigned long modulus_bitlen, - prng_state *prng, + prng_state *prng, int prng_idx, - unsigned char *out, + unsigned char *out, unsigned long *outlen) { unsigned long modulus_len, ps_len, i; @@ -44,12 +42,12 @@ int pkcs_1_v1_5_encode(const unsigned char *msg, int result; /* valid block_type? */ - if ((block_type != LTC_LTC_PKCS_1_EMSA) && - (block_type != LTC_LTC_PKCS_1_EME)) { + if ((block_type != LTC_PKCS_1_EMSA) && + (block_type != LTC_PKCS_1_EME)) { return CRYPT_PK_INVALID_PADDING; } - if (block_type == LTC_LTC_PKCS_1_EME) { /* encryption padding, we need a valid PRNG */ + if (block_type == LTC_PKCS_1_EME) { /* encryption padding, we need a valid PRNG */ if ((result = prng_is_valid(prng_idx)) != CRYPT_OK) { return result; } @@ -72,7 +70,7 @@ int pkcs_1_v1_5_encode(const unsigned char *msg, ps = &out[2]; ps_len = modulus_len - msglen - 3; - if (block_type == LTC_LTC_PKCS_1_EME) { + if (block_type == LTC_PKCS_1_EME) { /* now choose a random ps */ if (prng_descriptor[prng_idx].read(ps, ps_len, prng) != ps_len) { result = CRYPT_ERROR_READPRNG; @@ -106,6 +104,6 @@ bail: #endif /* #ifdef LTC_PKCS_1 */ -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/pk/rsa/rsa_decrypt_key.c b/libtomcrypt/src/pk/rsa/rsa_decrypt_key.c index 31d841f..9e1bced 100644 --- a/libtomcrypt/src/pk/rsa/rsa_decrypt_key.c +++ b/libtomcrypt/src/pk/rsa/rsa_decrypt_key.c @@ -5,20 +5,18 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" /** @file rsa_decrypt_key.c - RSA LTC_PKCS #1 Decryption, Tom St Denis and Andreas Lange + RSA PKCS #1 Decryption, Tom St Denis and Andreas Lange */ #ifdef LTC_MRSA /** - LTC_PKCS #1 decrypt then v1.5 or OAEP depad + PKCS #1 decrypt then v1.5 or OAEP depad @param in The ciphertext @param inlen The length of the ciphertext (octets) @param out [out] The plaintext @@ -26,7 +24,7 @@ @param lparam The system "lparam" value @param lparamlen The length of the lparam value (octets) @param hash_idx The index of the hash desired - @param padding Type of padding (LTC_LTC_PKCS_1_OAEP or LTC_LTC_PKCS_1_V1_5) + @param padding Type of padding (LTC_PKCS_1_OAEP or LTC_PKCS_1_V1_5) @param stat [out] Result of the decryption, 1==valid, 0==invalid @param key The corresponding private RSA key @return CRYPT_OK if succcessul (even if invalid) @@ -51,12 +49,12 @@ int rsa_decrypt_key_ex(const unsigned char *in, unsigned long inlen, /* valid padding? */ - if ((padding != LTC_LTC_PKCS_1_V1_5) && - (padding != LTC_LTC_PKCS_1_OAEP)) { + if ((padding != LTC_PKCS_1_V1_5) && + (padding != LTC_PKCS_1_OAEP)) { return CRYPT_PK_INVALID_PADDING; } - if (padding == LTC_LTC_PKCS_1_OAEP) { + if (padding == LTC_PKCS_1_OAEP) { /* valid hash ? */ if ((err = hash_is_valid(hash_idx)) != CRYPT_OK) { return err; @@ -85,13 +83,13 @@ int rsa_decrypt_key_ex(const unsigned char *in, unsigned long inlen, return err; } - if (padding == LTC_LTC_PKCS_1_OAEP) { + if (padding == LTC_PKCS_1_OAEP) { /* now OAEP decode the packet */ err = pkcs_1_oaep_decode(tmp, x, lparam, lparamlen, modulus_bitlen, hash_idx, out, outlen, stat); } else { - /* now LTC_PKCS #1 v1.5 depad the packet */ - err = pkcs_1_v1_5_decode(tmp, x, LTC_LTC_PKCS_1_EME, modulus_bitlen, out, outlen, stat); + /* now PKCS #1 v1.5 depad the packet */ + err = pkcs_1_v1_5_decode(tmp, x, LTC_PKCS_1_EME, modulus_bitlen, out, outlen, stat); } XFREE(tmp); @@ -100,6 +98,6 @@ int rsa_decrypt_key_ex(const unsigned char *in, unsigned long inlen, #endif /* LTC_MRSA */ -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/pk/rsa/rsa_encrypt_key.c b/libtomcrypt/src/pk/rsa/rsa_encrypt_key.c index edb7e65..ef066d2 100644 --- a/libtomcrypt/src/pk/rsa/rsa_encrypt_key.c +++ b/libtomcrypt/src/pk/rsa/rsa_encrypt_key.c @@ -5,20 +5,18 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" /** @file rsa_encrypt_key.c - RSA LTC_PKCS #1 encryption, Tom St Denis and Andreas Lange + RSA PKCS #1 encryption, Tom St Denis and Andreas Lange */ #ifdef LTC_MRSA /** - (LTC_PKCS #1 v2.0) OAEP pad then encrypt + (PKCS #1 v2.0) OAEP pad then encrypt @param in The plaintext @param inlen The length of the plaintext (octets) @param out [out] The ciphertext @@ -28,7 +26,7 @@ @param prng An active PRNG @param prng_idx The index of the desired prng @param hash_idx The index of the desired hash - @param padding Type of padding (LTC_LTC_PKCS_1_OAEP or LTC_LTC_PKCS_1_V1_5) + @param padding Type of padding (LTC_PKCS_1_OAEP or LTC_PKCS_1_V1_5) @param key The RSA key to encrypt to @return CRYPT_OK if successful */ @@ -46,8 +44,8 @@ int rsa_encrypt_key_ex(const unsigned char *in, unsigned long inlen, LTC_ARGCHK(key != NULL); /* valid padding? */ - if ((padding != LTC_LTC_PKCS_1_V1_5) && - (padding != LTC_LTC_PKCS_1_OAEP)) { + if ((padding != LTC_PKCS_1_V1_5) && + (padding != LTC_PKCS_1_OAEP)) { return CRYPT_PK_INVALID_PADDING; } @@ -56,7 +54,7 @@ int rsa_encrypt_key_ex(const unsigned char *in, unsigned long inlen, return err; } - if (padding == LTC_LTC_PKCS_1_OAEP) { + if (padding == LTC_PKCS_1_OAEP) { /* valid hash? */ if ((err = hash_is_valid(hash_idx)) != CRYPT_OK) { return err; @@ -73,7 +71,7 @@ int rsa_encrypt_key_ex(const unsigned char *in, unsigned long inlen, return CRYPT_BUFFER_OVERFLOW; } - if (padding == LTC_LTC_PKCS_1_OAEP) { + if (padding == LTC_PKCS_1_OAEP) { /* OAEP pad the key */ x = *outlen; if ((err = pkcs_1_oaep_encode(in, inlen, lparam, @@ -82,21 +80,21 @@ int rsa_encrypt_key_ex(const unsigned char *in, unsigned long inlen, return err; } } else { - /* LTC_PKCS #1 v1.5 pad the key */ + /* PKCS #1 v1.5 pad the key */ x = *outlen; - if ((err = pkcs_1_v1_5_encode(in, inlen, LTC_LTC_PKCS_1_EME, + if ((err = pkcs_1_v1_5_encode(in, inlen, LTC_PKCS_1_EME, modulus_bitlen, prng, prng_idx, out, &x)) != CRYPT_OK) { return err; } } - /* rsa exptmod the OAEP or LTC_PKCS #1 v1.5 pad */ + /* rsa exptmod the OAEP or PKCS #1 v1.5 pad */ return ltc_mp.rsa_me(out, x, out, outlen, PK_PUBLIC, key); } #endif /* LTC_MRSA */ -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/pk/rsa/rsa_export.c b/libtomcrypt/src/pk/rsa/rsa_export.c index 40cb066..a9885de 100644 --- a/libtomcrypt/src/pk/rsa/rsa_export.c +++ b/libtomcrypt/src/pk/rsa/rsa_export.c @@ -5,29 +5,28 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" /** @file rsa_export.c - Export RSA LTC_PKCS keys, Tom St Denis -*/ + Export RSA PKCS keys, Tom St Denis +*/ #ifdef LTC_MRSA /** - This will export either an RSAPublicKey or RSAPrivateKey [defined in LTC_PKCS #1 v2.1] + This will export either an RSAPublicKey or RSAPrivateKey [defined in PKCS #1 v2.1] @param out [out] Destination of the packet @param outlen [in/out] The max size and resulting size of the packet @param type The type of exported key (PK_PRIVATE or PK_PUBLIC) @param key The RSA key to export @return CRYPT_OK if successful -*/ +*/ int rsa_export(unsigned char *out, unsigned long *outlen, int type, rsa_key *key) { unsigned long zero=0; + int err; LTC_ARGCHK(out != NULL); LTC_ARGCHK(outlen != NULL); LTC_ARGCHK(key != NULL); @@ -39,31 +38,60 @@ int rsa_export(unsigned char *out, unsigned long *outlen, int type, rsa_key *key if (type == PK_PRIVATE) { /* private key */ - /* output is + /* output is Version, n, e, d, p, q, d mod (p-1), d mod (q - 1), 1/q mod p */ - return der_encode_sequence_multi(out, outlen, - LTC_ASN1_SHORT_INTEGER, 1UL, &zero, - LTC_ASN1_INTEGER, 1UL, key->N, + return der_encode_sequence_multi(out, outlen, + LTC_ASN1_SHORT_INTEGER, 1UL, &zero, + LTC_ASN1_INTEGER, 1UL, key->N, LTC_ASN1_INTEGER, 1UL, key->e, - LTC_ASN1_INTEGER, 1UL, key->d, - LTC_ASN1_INTEGER, 1UL, key->p, - LTC_ASN1_INTEGER, 1UL, key->q, + LTC_ASN1_INTEGER, 1UL, key->d, + LTC_ASN1_INTEGER, 1UL, key->p, + LTC_ASN1_INTEGER, 1UL, key->q, LTC_ASN1_INTEGER, 1UL, key->dP, - LTC_ASN1_INTEGER, 1UL, key->dQ, - LTC_ASN1_INTEGER, 1UL, key->qP, + LTC_ASN1_INTEGER, 1UL, key->dQ, + LTC_ASN1_INTEGER, 1UL, key->qP, LTC_ASN1_EOL, 0UL, NULL); } else { /* public key */ - return der_encode_sequence_multi(out, outlen, - LTC_ASN1_INTEGER, 1UL, key->N, - LTC_ASN1_INTEGER, 1UL, key->e, + unsigned long tmplen, *ptmplen; + unsigned char* tmp = NULL; + + if (type & PK_STD) { + tmplen = (mp_count_bits(key->N)/8)*2+8; + tmp = XMALLOC(tmplen); + ptmplen = &tmplen; + if (tmp == NULL) { + return CRYPT_MEM; + } + } + else { + tmp = out; + ptmplen = outlen; + } + + err = der_encode_sequence_multi(tmp, ptmplen, + LTC_ASN1_INTEGER, 1UL, key->N, + LTC_ASN1_INTEGER, 1UL, key->e, LTC_ASN1_EOL, 0UL, NULL); + + if ((err != CRYPT_OK) || !(type & PK_STD)) { + goto finish; + } + + err = der_encode_subject_public_key_info(out, outlen, + PKA_RSA, tmp, tmplen, LTC_ASN1_NULL, NULL, 0); + +finish: + if (tmp != out) + XFREE(tmp); + return err; + } } #endif /* LTC_MRSA */ -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/pk/rsa/rsa_exptmod.c b/libtomcrypt/src/pk/rsa/rsa_exptmod.c index 101a766..37f62d1 100644 --- a/libtomcrypt/src/pk/rsa/rsa_exptmod.c +++ b/libtomcrypt/src/pk/rsa/rsa_exptmod.c @@ -5,41 +5,43 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" /** @file rsa_exptmod.c - RSA LTC_PKCS exptmod, Tom St Denis -*/ + RSA PKCS exptmod, Tom St Denis + Added RSA blinding --nmav +*/ #ifdef LTC_MRSA -/** - Compute an RSA modular exponentiation +/** + Compute an RSA modular exponentiation @param in The input data to send into RSA @param inlen The length of the input (octets) - @param out [out] The destination + @param out [out] The destination @param outlen [in/out] The max size and resulting size of the output @param which Which exponent to use, e.g. PK_PRIVATE or PK_PUBLIC - @param key The RSA key to use + @param key The RSA key to use @return CRYPT_OK if successful -*/ +*/ int rsa_exptmod(const unsigned char *in, unsigned long inlen, unsigned char *out, unsigned long *outlen, int which, rsa_key *key) { - void *tmp, *tmpa, *tmpb; + void *tmp, *tmpa, *tmpb; + #ifdef LTC_RSA_BLINDING + void *rnd, *rndi /* inverse of rnd */; + #endif unsigned long x; - int err; + int err, has_crt_parameters; LTC_ARGCHK(in != NULL); LTC_ARGCHK(out != NULL); LTC_ARGCHK(outlen != NULL); LTC_ARGCHK(key != NULL); - + /* is the key of the right type for the operation? */ if (which == PK_PRIVATE && (key->type != PK_PRIVATE)) { return CRYPT_PK_NOT_PRIVATE; @@ -51,8 +53,15 @@ int rsa_exptmod(const unsigned char *in, unsigned long inlen, } /* init and copy into tmp */ - if ((err = mp_init_multi(&tmp, &tmpa, &tmpb, NULL)) != CRYPT_OK) { return err; } - if ((err = mp_read_unsigned_bin(tmp, (unsigned char *)in, (int)inlen)) != CRYPT_OK) { goto error; } + if ((err = mp_init_multi(&tmp, &tmpa, &tmpb, +#ifdef LTC_RSA_BLINDING + &rnd, &rndi, +#endif /* LTC_RSA_BLINDING */ + NULL)) != CRYPT_OK) + { return err; } + if ((err = mp_read_unsigned_bin(tmp, (unsigned char *)in, (int)inlen)) != CRYPT_OK) + { goto error; } + /* sanity check on the input */ if (mp_cmp(key->N, tmp) == LTC_MP_LT) { @@ -62,19 +71,75 @@ int rsa_exptmod(const unsigned char *in, unsigned long inlen, /* are we using the private exponent and is the key optimized? */ if (which == PK_PRIVATE) { - /* tmpa = tmp^dP mod p */ - if ((err = mp_exptmod(tmp, key->dP, key->p, tmpa)) != CRYPT_OK) { goto error; } - - /* tmpb = tmp^dQ mod q */ - if ((err = mp_exptmod(tmp, key->dQ, key->q, tmpb)) != CRYPT_OK) { goto error; } - - /* tmp = (tmpa - tmpb) * qInv (mod p) */ - if ((err = mp_sub(tmpa, tmpb, tmp)) != CRYPT_OK) { goto error; } - if ((err = mp_mulmod(tmp, key->qP, key->p, tmp)) != CRYPT_OK) { goto error; } - - /* tmp = tmpb + q * tmp */ - if ((err = mp_mul(tmp, key->q, tmp)) != CRYPT_OK) { goto error; } - if ((err = mp_add(tmp, tmpb, tmp)) != CRYPT_OK) { goto error; } + #ifdef LTC_RSA_BLINDING + /* do blinding */ + err = mp_rand(rnd, mp_get_digit_count(key->N)); + if (err != CRYPT_OK) { + goto error; + } + + /* rndi = 1/rnd mod N */ + err = mp_invmod(rnd, key->N, rndi); + if (err != CRYPT_OK) { + goto error; + } + + /* rnd = rnd^e */ + err = mp_exptmod( rnd, key->e, key->N, rnd); + if (err != CRYPT_OK) { + goto error; + } + + /* tmp = tmp*rnd mod N */ + err = mp_mulmod( tmp, rnd, key->N, tmp); + if (err != CRYPT_OK) { + goto error; + } + #endif /* LTC_RSA_BLINDING */ + + has_crt_parameters = (key->p != NULL) && (mp_get_digit_count(key->p) != 0) && + (key->q != NULL) && (mp_get_digit_count(key->q) != 0) && + (key->dP != NULL) && (mp_get_digit_count(key->dP) != 0) && + (key->dQ != NULL) && (mp_get_digit_count(key->dQ) != 0) && + (key->qP != NULL) && (mp_get_digit_count(key->qP) != 0); + + if (!has_crt_parameters) { + /* + * In case CRT optimization parameters are not provided, + * the private key is directly used to exptmod it + */ + if ((err = mp_exptmod(tmp, key->d, key->N, tmp)) != CRYPT_OK) { goto error; } + } else { + /* tmpa = tmp^dP mod p */ + if ((err = mp_exptmod(tmp, key->dP, key->p, tmpa)) != CRYPT_OK) { goto error; } + + /* tmpb = tmp^dQ mod q */ + if ((err = mp_exptmod(tmp, key->dQ, key->q, tmpb)) != CRYPT_OK) { goto error; } + + /* tmp = (tmpa - tmpb) * qInv (mod p) */ + if ((err = mp_sub(tmpa, tmpb, tmp)) != CRYPT_OK) { goto error; } + if ((err = mp_mulmod(tmp, key->qP, key->p, tmp)) != CRYPT_OK) { goto error; } + + /* tmp = tmpb + q * tmp */ + if ((err = mp_mul(tmp, key->q, tmp)) != CRYPT_OK) { goto error; } + if ((err = mp_add(tmp, tmpb, tmp)) != CRYPT_OK) { goto error; } + } + + #ifdef LTC_RSA_BLINDING + /* unblind */ + err = mp_mulmod( tmp, rndi, key->N, tmp); + if (err != CRYPT_OK) { + goto error; + } + #endif + + #ifdef LTC_RSA_CRT_HARDENING + if (has_crt_parameters) { + if ((err = mp_exptmod(tmp, key->e, key->N, tmpa)) != CRYPT_OK) { goto error; } + if ((err = mp_read_unsigned_bin(tmpb, (unsigned char *)in, (int)inlen)) != CRYPT_OK) { goto error; } + if (mp_cmp(tmpa, tmpb) != LTC_MP_EQ) { err = CRYPT_ERROR; goto error; } + } + #endif } else { /* exptmod it */ if ((err = mp_exptmod(tmp, key->e, key->N, tmp)) != CRYPT_OK) { goto error; } @@ -102,12 +167,16 @@ int rsa_exptmod(const unsigned char *in, unsigned long inlen, /* clean up and return */ err = CRYPT_OK; error: - mp_clear_multi(tmp, tmpa, tmpb, NULL); + mp_clear_multi( +#ifdef LTC_RSA_BLINDING + rndi, rnd, +#endif /* LTC_RSA_BLINDING */ + tmpb, tmpa, tmp, NULL); return err; } #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/pk/rsa/rsa_free.c b/libtomcrypt/src/pk/rsa/rsa_free.c index bb6daef..1e62f09 100644 --- a/libtomcrypt/src/pk/rsa/rsa_free.c +++ b/libtomcrypt/src/pk/rsa/rsa_free.c @@ -5,15 +5,13 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" /** @file rsa_free.c Free an RSA key, Tom St Denis -*/ +*/ #ifdef LTC_MRSA @@ -24,11 +22,11 @@ void rsa_free(rsa_key *key) { LTC_ARGCHKVD(key != NULL); - mp_clear_multi(key->e, key->d, key->N, key->dQ, key->dP, key->qP, key->p, key->q, NULL); + mp_cleanup_multi(&key->q, &key->p, &key->qP, &key->dP, &key->dQ, &key->N, &key->d, &key->e, NULL); } #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/pk/rsa/rsa_get_size.c b/libtomcrypt/src/pk/rsa/rsa_get_size.c new file mode 100644 index 0000000..8c90194 --- /dev/null +++ b/libtomcrypt/src/pk/rsa/rsa_get_size.c @@ -0,0 +1,40 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + */ +#include "tomcrypt.h" + +/** + @file rsa_get_size.c + Retrieve the size of an RSA key, Steffen Jaeckel. +*/ + +#ifdef LTC_MRSA + +/** + Retrieve the size in bytes of an RSA key. + @param key The RSA key + @return The size in bytes of the RSA key or INT_MAX on error. +*/ +int rsa_get_size(rsa_key *key) +{ + int ret = INT_MAX; + LTC_ARGCHK(key != NULL); + + if (key) + { + ret = mp_unsigned_bin_size(key->N); + } /* if */ + + return ret; +} + +#endif + +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/pk/rsa/rsa_import.c b/libtomcrypt/src/pk/rsa/rsa_import.c index 85c676b..84cd6f6 100644 --- a/libtomcrypt/src/pk/rsa/rsa_import.c +++ b/libtomcrypt/src/pk/rsa/rsa_import.c @@ -5,20 +5,18 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" /** @file rsa_import.c - Import a LTC_PKCS RSA key, Tom St Denis -*/ + Import a PKCS RSA key, Tom St Denis +*/ #ifdef LTC_MRSA /** - Import an RSAPublicKey or RSAPrivateKey [two-prime only, only support >= 1024-bit keys, defined in LTC_PKCS #1 v2.1] + Import an RSAPublicKey or RSAPrivateKey [two-prime only, only support >= 1024-bit keys, defined in PKCS #1 v2.1] @param in The packet to import from @param inlen It's length (octets) @param key [out] Destination for newly imported key @@ -28,87 +26,68 @@ int rsa_import(const unsigned char *in, unsigned long inlen, rsa_key *key) { int err; void *zero; - unsigned char *tmpbuf; - unsigned long t, x, y, z, tmpoid[16]; - ltc_asn1_list ssl_pubkey_hashoid[2]; - ltc_asn1_list ssl_pubkey[2]; + unsigned char *tmpbuf=NULL; + unsigned long tmpbuf_len; LTC_ARGCHK(in != NULL); LTC_ARGCHK(key != NULL); LTC_ARGCHK(ltc_mp.name != NULL); /* init key */ - if ((err = mp_init_multi(&key->e, &key->d, &key->N, &key->dQ, + if ((err = mp_init_multi(&key->e, &key->d, &key->N, &key->dQ, &key->dP, &key->qP, &key->p, &key->q, NULL)) != CRYPT_OK) { return err; } /* see if the OpenSSL DER format RSA public key will work */ - tmpbuf = XCALLOC(1, MAX_RSA_SIZE*8); + tmpbuf_len = inlen; + tmpbuf = XCALLOC(1, tmpbuf_len); if (tmpbuf == NULL) { err = CRYPT_MEM; goto LBL_ERR; } - /* this includes the internal hash ID and optional params (NULL in this case) */ - LTC_SET_ASN1(ssl_pubkey_hashoid, 0, LTC_ASN1_OBJECT_IDENTIFIER, tmpoid, sizeof(tmpoid)/sizeof(tmpoid[0])); - LTC_SET_ASN1(ssl_pubkey_hashoid, 1, LTC_ASN1_NULL, NULL, 0); - - /* the actual format of the SSL DER key is odd, it stores a RSAPublicKey in a **BIT** string ... so we have to extract it - then proceed to convert bit to octet - */ - LTC_SET_ASN1(ssl_pubkey, 0, LTC_ASN1_SEQUENCE, &ssl_pubkey_hashoid, 2); - LTC_SET_ASN1(ssl_pubkey, 1, LTC_ASN1_BIT_STRING, tmpbuf, MAX_RSA_SIZE*8); - - if (der_decode_sequence(in, inlen, - ssl_pubkey, 2UL) == CRYPT_OK) { - - /* ok now we have to reassemble the BIT STRING to an OCTET STRING. Thanks OpenSSL... */ - for (t = y = z = x = 0; x < ssl_pubkey[1].size; x++) { - y = (y << 1) | tmpbuf[x]; - if (++z == 8) { - tmpbuf[t++] = (unsigned char)y; - y = 0; - z = 0; - } - } + err = der_decode_subject_public_key_info(in, inlen, + PKA_RSA, tmpbuf, &tmpbuf_len, + LTC_ASN1_NULL, NULL, 0); + + if (err == CRYPT_OK) { /* SubjectPublicKeyInfo format */ /* now it should be SEQUENCE { INTEGER, INTEGER } */ - if ((err = der_decode_sequence_multi(tmpbuf, t, - LTC_ASN1_INTEGER, 1UL, key->N, - LTC_ASN1_INTEGER, 1UL, key->e, + if ((err = der_decode_sequence_multi(tmpbuf, tmpbuf_len, + LTC_ASN1_INTEGER, 1UL, key->N, + LTC_ASN1_INTEGER, 1UL, key->e, LTC_ASN1_EOL, 0UL, NULL)) != CRYPT_OK) { - XFREE(tmpbuf); goto LBL_ERR; } - XFREE(tmpbuf); key->type = PK_PUBLIC; - return CRYPT_OK; + err = CRYPT_OK; + goto LBL_FREE; } - XFREE(tmpbuf); - /* not SSL public key, try to match against LTC_PKCS #1 standards */ - if ((err = der_decode_sequence_multi(in, inlen, - LTC_ASN1_INTEGER, 1UL, key->N, - LTC_ASN1_EOL, 0UL, NULL)) != CRYPT_OK) { + /* not SSL public key, try to match against PKCS #1 standards */ + err = der_decode_sequence_multi(in, inlen, LTC_ASN1_INTEGER, 1UL, key->N, + LTC_ASN1_EOL, 0UL, NULL); + + if (err != CRYPT_OK && err != CRYPT_INPUT_TOO_LONG) { goto LBL_ERR; } if (mp_cmp_d(key->N, 0) == LTC_MP_EQ) { - if ((err = mp_init(&zero)) != CRYPT_OK) { + if ((err = mp_init(&zero)) != CRYPT_OK) { goto LBL_ERR; } /* it's a private key */ - if ((err = der_decode_sequence_multi(in, inlen, - LTC_ASN1_INTEGER, 1UL, zero, - LTC_ASN1_INTEGER, 1UL, key->N, + if ((err = der_decode_sequence_multi(in, inlen, + LTC_ASN1_INTEGER, 1UL, zero, + LTC_ASN1_INTEGER, 1UL, key->N, LTC_ASN1_INTEGER, 1UL, key->e, - LTC_ASN1_INTEGER, 1UL, key->d, - LTC_ASN1_INTEGER, 1UL, key->p, - LTC_ASN1_INTEGER, 1UL, key->q, + LTC_ASN1_INTEGER, 1UL, key->d, + LTC_ASN1_INTEGER, 1UL, key->p, + LTC_ASN1_INTEGER, 1UL, key->q, LTC_ASN1_INTEGER, 1UL, key->dP, - LTC_ASN1_INTEGER, 1UL, key->dQ, - LTC_ASN1_INTEGER, 1UL, key->qP, + LTC_ASN1_INTEGER, 1UL, key->dQ, + LTC_ASN1_INTEGER, 1UL, key->qP, LTC_ASN1_EOL, 0UL, NULL)) != CRYPT_OK) { mp_clear(zero); goto LBL_ERR; @@ -121,23 +100,30 @@ int rsa_import(const unsigned char *in, unsigned long inlen, rsa_key *key) goto LBL_ERR; } else { /* it's a public key and we lack e */ - if ((err = der_decode_sequence_multi(in, inlen, - LTC_ASN1_INTEGER, 1UL, key->N, - LTC_ASN1_INTEGER, 1UL, key->e, + if ((err = der_decode_sequence_multi(in, inlen, + LTC_ASN1_INTEGER, 1UL, key->N, + LTC_ASN1_INTEGER, 1UL, key->e, LTC_ASN1_EOL, 0UL, NULL)) != CRYPT_OK) { goto LBL_ERR; } key->type = PK_PUBLIC; } - return CRYPT_OK; + err = CRYPT_OK; + goto LBL_FREE; + LBL_ERR: mp_clear_multi(key->d, key->e, key->N, key->dQ, key->dP, key->qP, key->p, key->q, NULL); + +LBL_FREE: + if (tmpbuf != NULL) + XFREE(tmpbuf); + return err; } #endif /* LTC_MRSA */ -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/pk/rsa/rsa_import_pkcs8.c b/libtomcrypt/src/pk/rsa/rsa_import_pkcs8.c new file mode 100644 index 0000000..8e15e06 --- /dev/null +++ b/libtomcrypt/src/pk/rsa/rsa_import_pkcs8.c @@ -0,0 +1,153 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + */ +#include "tomcrypt.h" + +/** + @file rsa_import_pkcs8.c + Import a PKCS RSA key +*/ + +#ifdef LTC_MRSA + +/* Public-Key Cryptography Standards (PKCS) #8: + * Private-Key Information Syntax Specification Version 1.2 + * https://tools.ietf.org/html/rfc5208 + * + * PrivateKeyInfo ::= SEQUENCE { + * version Version, + * privateKeyAlgorithm PrivateKeyAlgorithmIdentifier, + * privateKey PrivateKey, + * attributes [0] IMPLICIT Attributes OPTIONAL } + * where: + * - Version ::= INTEGER + * - PrivateKeyAlgorithmIdentifier ::= AlgorithmIdentifier + * - PrivateKey ::= OCTET STRING + * - Attributes ::= SET OF Attribute + * + * EncryptedPrivateKeyInfo ::= SEQUENCE { + * encryptionAlgorithm EncryptionAlgorithmIdentifier, + * encryptedData EncryptedData } + * where: + * - EncryptionAlgorithmIdentifier ::= AlgorithmIdentifier + * - EncryptedData ::= OCTET STRING + */ + +/** + Import an RSAPublicKey or RSAPrivateKey in PKCS#8 format + @param in The packet to import from + @param inlen It's length (octets) + @param passwd The password for decrypting privkey (NOT SUPPORTED YET) + @param passwdlen Password's length (octets) + @param key [out] Destination for newly imported key + @return CRYPT_OK if successful, upon error allocated memory is freed +*/ +int rsa_import_pkcs8(const unsigned char *in, unsigned long inlen, + const void *passwd, unsigned long passwdlen, + rsa_key *key) +{ + int err; + void *zero, *iter; + unsigned char *buf1 = NULL, *buf2 = NULL; + unsigned long buf1len, buf2len; + unsigned long oid[16]; + oid_st rsaoid; + ltc_asn1_list alg_seq[2], top_seq[3]; + ltc_asn1_list alg_seq_e[2], key_seq_e[2], top_seq_e[2]; + unsigned char *decrypted = NULL; + unsigned long decryptedlen; + + LTC_ARGCHK(in != NULL); + LTC_ARGCHK(key != NULL); + LTC_ARGCHK(ltc_mp.name != NULL); + + /* get RSA alg oid */ + err = pk_get_oid(PKA_RSA, &rsaoid); + if (err != CRYPT_OK) { goto LBL_NOFREE; } + + /* alloc buffers */ + buf1len = inlen; /* approx. */ + buf1 = XMALLOC(buf1len); + if (buf1 == NULL) { err = CRYPT_MEM; goto LBL_NOFREE; } + buf2len = inlen; /* approx. */ + buf2 = XMALLOC(buf2len); + if (buf2 == NULL) { err = CRYPT_MEM; goto LBL_FREE1; } + + /* init key */ + err = mp_init_multi(&key->e, &key->d, &key->N, &key->dQ, &key->dP, &key->qP, &key->p, &key->q, &zero, &iter, NULL); + if (err != CRYPT_OK) { goto LBL_FREE2; } + + /* try to decode encrypted priv key */ + LTC_SET_ASN1(key_seq_e, 0, LTC_ASN1_OCTET_STRING, buf1, buf1len); + LTC_SET_ASN1(key_seq_e, 1, LTC_ASN1_INTEGER, iter, 1UL); + LTC_SET_ASN1(alg_seq_e, 0, LTC_ASN1_OBJECT_IDENTIFIER, oid, 16UL); + LTC_SET_ASN1(alg_seq_e, 1, LTC_ASN1_SEQUENCE, key_seq_e, 2UL); + LTC_SET_ASN1(top_seq_e, 0, LTC_ASN1_SEQUENCE, alg_seq_e, 2UL); + LTC_SET_ASN1(top_seq_e, 1, LTC_ASN1_OCTET_STRING, buf2, buf2len); + err=der_decode_sequence(in, inlen, top_seq_e, 2UL); + if (err == CRYPT_OK) { + LTC_UNUSED_PARAM(passwd); + LTC_UNUSED_PARAM(passwdlen); + /* XXX: TODO encrypted pkcs8 not implemented yet */ + /* fprintf(stderr, "decrypt: iter=%ld salt.len=%ld encdata.len=%ld\n", mp_get_int(iter), key_seq_e[0].size, top_seq_e[1].size); */ + err = CRYPT_PK_INVALID_TYPE; + goto LBL_ERR; + } + else { + decrypted = (unsigned char *)in; + decryptedlen = inlen; + } + + /* try to decode unencrypted priv key */ + LTC_SET_ASN1(alg_seq, 0, LTC_ASN1_OBJECT_IDENTIFIER, oid, 16UL); + LTC_SET_ASN1(alg_seq, 1, LTC_ASN1_NULL, NULL, 0UL); + LTC_SET_ASN1(top_seq, 0, LTC_ASN1_INTEGER, zero, 1UL); + LTC_SET_ASN1(top_seq, 1, LTC_ASN1_SEQUENCE, alg_seq, 2UL); + LTC_SET_ASN1(top_seq, 2, LTC_ASN1_OCTET_STRING, buf1, buf1len); + err=der_decode_sequence(decrypted, decryptedlen, top_seq, 3UL); + if (err != CRYPT_OK) { goto LBL_ERR; } + + /* check alg oid */ + if ((alg_seq[0].size != rsaoid.OIDlen) || + XMEMCMP(rsaoid.OID, alg_seq[0].data, rsaoid.OIDlen * sizeof(rsaoid.OID[0]))) { + err = CRYPT_PK_INVALID_TYPE; + goto LBL_ERR; + } + + err = der_decode_sequence_multi(buf1, top_seq[2].size, + LTC_ASN1_INTEGER, 1UL, zero, + LTC_ASN1_INTEGER, 1UL, key->N, + LTC_ASN1_INTEGER, 1UL, key->e, + LTC_ASN1_INTEGER, 1UL, key->d, + LTC_ASN1_INTEGER, 1UL, key->p, + LTC_ASN1_INTEGER, 1UL, key->q, + LTC_ASN1_INTEGER, 1UL, key->dP, + LTC_ASN1_INTEGER, 1UL, key->dQ, + LTC_ASN1_INTEGER, 1UL, key->qP, + LTC_ASN1_EOL, 0UL, NULL); + if (err != CRYPT_OK) { goto LBL_ERR; } + key->type = PK_PRIVATE; + err = CRYPT_OK; + goto LBL_FREE2; + +LBL_ERR: + rsa_free(key); +LBL_FREE2: + mp_clear_multi(iter, zero, NULL); + XFREE(buf2); +LBL_FREE1: + XFREE(buf1); +LBL_NOFREE: + return err; +} + +#endif /* LTC_MRSA */ + +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/pk/rsa/rsa_import_x509.c b/libtomcrypt/src/pk/rsa/rsa_import_x509.c new file mode 100644 index 0000000..0f2d5f1 --- /dev/null +++ b/libtomcrypt/src/pk/rsa/rsa_import_x509.c @@ -0,0 +1,118 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + */ +#include "tomcrypt.h" + +/** + @file rsa_import.c + Import an RSA key from a X.509 certificate, Steffen Jaeckel +*/ + +#ifdef LTC_MRSA + +/** + Import an RSA key from a X.509 certificate + @param in The packet to import from + @param inlen It's length (octets) + @param key [out] Destination for newly imported key + @return CRYPT_OK if successful, upon error allocated memory is freed +*/ +int rsa_import_x509(const unsigned char *in, unsigned long inlen, rsa_key *key) +{ + int err; + unsigned char *tmpbuf; + unsigned long tmpbuf_len, tmp_inlen; + ltc_asn1_list *decoded_list = NULL, *l; + + LTC_ARGCHK(in != NULL); + LTC_ARGCHK(key != NULL); + LTC_ARGCHK(ltc_mp.name != NULL); + + /* init key */ + if ((err = mp_init_multi(&key->e, &key->d, &key->N, &key->dQ, + &key->dP, &key->qP, &key->p, &key->q, NULL)) != CRYPT_OK) { + return err; + } + + tmpbuf_len = inlen; + tmpbuf = XCALLOC(1, tmpbuf_len); + if (tmpbuf == NULL) { + err = CRYPT_MEM; + goto LBL_ERR; + } + + tmp_inlen = inlen; + if ((err = der_decode_sequence_flexi(in, &tmp_inlen, &decoded_list)) == CRYPT_OK) { + l = decoded_list; + /* Move 2 levels up in the tree + SEQUENCE + SEQUENCE + ... + */ + if (l->type == LTC_ASN1_SEQUENCE && l->child) { + l = l->child; + if (l->type == LTC_ASN1_SEQUENCE && l->child) { + l = l->child; + + err = CRYPT_ERROR; + + /* Move forward in the tree until we find this combination + ... + SEQUENCE + SEQUENCE + OBJECT IDENTIFIER 1.2.840.113549.1.1.1 + NULL + BIT STRING + */ + do { + /* The additional check for l->data is there to make sure + * we won't try to decode a list that has been 'shrunk' + */ + if (l->type == LTC_ASN1_SEQUENCE && l->data && l->child && + l->child->type == LTC_ASN1_SEQUENCE && l->child->child && + l->child->child->type == LTC_ASN1_OBJECT_IDENTIFIER && l->child->next && + l->child->next->type == LTC_ASN1_BIT_STRING) { + err = der_decode_subject_public_key_info(l->data, l->size, + PKA_RSA, tmpbuf, &tmpbuf_len, + LTC_ASN1_NULL, NULL, 0); + if (err == CRYPT_OK) { + /* now it should be SEQUENCE { INTEGER, INTEGER } */ + if ((err = der_decode_sequence_multi(tmpbuf, tmpbuf_len, + LTC_ASN1_INTEGER, 1UL, key->N, + LTC_ASN1_INTEGER, 1UL, key->e, + LTC_ASN1_EOL, 0UL, NULL)) != CRYPT_OK) { + goto LBL_ERR; + } + key->type = PK_PUBLIC; + err = CRYPT_OK; + goto LBL_FREE; + } + } + l = l->next; + } while(l); + } + } + } + + +LBL_ERR: + rsa_free(key); + +LBL_FREE: + if (decoded_list) der_free_sequence_flexi(decoded_list); + if (tmpbuf != NULL) XFREE(tmpbuf); + + return err; +} + +#endif /* LTC_MRSA */ + + +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/pk/rsa/rsa_make_key.c b/libtomcrypt/src/pk/rsa/rsa_make_key.c index d62e37e..c5c4c28 100644 --- a/libtomcrypt/src/pk/rsa/rsa_make_key.c +++ b/libtomcrypt/src/pk/rsa/rsa_make_key.c @@ -5,19 +5,17 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" /** @file rsa_make_key.c RSA key generation, Tom St Denis -*/ +*/ #ifdef LTC_MRSA -/** +/** Create an RSA key @param prng An active PRNG state @param wprng The index of the PRNG desired @@ -33,10 +31,7 @@ int rsa_make_key(prng_state *prng, int wprng, int size, long e, rsa_key *key) LTC_ARGCHK(ltc_mp.name != NULL); LTC_ARGCHK(key != NULL); - - if ((size < (MIN_RSA_SIZE/8)) || (size > (MAX_RSA_SIZE/8))) { - return CRYPT_INVALID_KEYSIZE; - } + LTC_ARGCHK(size > 0); if ((e < 3) || ((e & 1) == 0)) { return CRYPT_INVALID_ARG; @@ -51,26 +46,26 @@ int rsa_make_key(prng_state *prng, int wprng, int size, long e, rsa_key *key) } /* make primes p and q (optimization provided by Wayne Scott) */ - if ((err = mp_set_int(tmp3, e)) != CRYPT_OK) { goto errkey; } /* tmp3 = e */ + if ((err = mp_set_int(tmp3, e)) != CRYPT_OK) { goto cleanup; } /* tmp3 = e */ /* make prime "p" */ do { - if ((err = rand_prime( p, size/2, prng, wprng)) != CRYPT_OK) { goto errkey; } - if ((err = mp_sub_d( p, 1, tmp1)) != CRYPT_OK) { goto errkey; } /* tmp1 = p-1 */ - if ((err = mp_gcd( tmp1, tmp3, tmp2)) != CRYPT_OK) { goto errkey; } /* tmp2 = gcd(p-1, e) */ + if ((err = rand_prime( p, size/2, prng, wprng)) != CRYPT_OK) { goto cleanup; } + if ((err = mp_sub_d( p, 1, tmp1)) != CRYPT_OK) { goto cleanup; } /* tmp1 = p-1 */ + if ((err = mp_gcd( tmp1, tmp3, tmp2)) != CRYPT_OK) { goto cleanup; } /* tmp2 = gcd(p-1, e) */ } while (mp_cmp_d( tmp2, 1) != 0); /* while e divides p-1 */ /* make prime "q" */ do { - if ((err = rand_prime( q, size/2, prng, wprng)) != CRYPT_OK) { goto errkey; } - if ((err = mp_sub_d( q, 1, tmp1)) != CRYPT_OK) { goto errkey; } /* tmp1 = q-1 */ - if ((err = mp_gcd( tmp1, tmp3, tmp2)) != CRYPT_OK) { goto errkey; } /* tmp2 = gcd(q-1, e) */ + if ((err = rand_prime( q, size/2, prng, wprng)) != CRYPT_OK) { goto cleanup; } + if ((err = mp_sub_d( q, 1, tmp1)) != CRYPT_OK) { goto cleanup; } /* tmp1 = q-1 */ + if ((err = mp_gcd( tmp1, tmp3, tmp2)) != CRYPT_OK) { goto cleanup; } /* tmp2 = gcd(q-1, e) */ } while (mp_cmp_d( tmp2, 1) != 0); /* while e divides q-1 */ /* tmp1 = lcm(p-1, q-1) */ - if ((err = mp_sub_d( p, 1, tmp2)) != CRYPT_OK) { goto errkey; } /* tmp2 = p-1 */ + if ((err = mp_sub_d( p, 1, tmp2)) != CRYPT_OK) { goto cleanup; } /* tmp2 = p-1 */ /* tmp1 = q-1 (previous do/while loop) */ - if ((err = mp_lcm( tmp1, tmp2, tmp1)) != CRYPT_OK) { goto errkey; } /* tmp1 = lcm(p-1, q-1) */ + if ((err = mp_lcm( tmp1, tmp2, tmp1)) != CRYPT_OK) { goto cleanup; } /* tmp1 = lcm(p-1, q-1) */ /* make key */ if ((err = mp_init_multi(&key->e, &key->d, &key->N, &key->dQ, &key->dP, &key->qP, &key->p, &key->q, NULL)) != CRYPT_OK) { @@ -99,14 +94,14 @@ int rsa_make_key(prng_state *prng, int wprng, int size, long e, rsa_key *key) err = CRYPT_OK; goto cleanup; errkey: - mp_clear_multi(key->d, key->e, key->N, key->dQ, key->dP, key->qP, key->p, key->q, NULL); + rsa_free(key); cleanup: - mp_clear_multi(tmp3, tmp2, tmp1, p, q, NULL); + mp_clear_multi(tmp3, tmp2, tmp1, q, p, NULL); return err; } #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/pk/rsa/rsa_set.c b/libtomcrypt/src/pk/rsa/rsa_set.c new file mode 100644 index 0000000..0d540c4 --- /dev/null +++ b/libtomcrypt/src/pk/rsa/rsa_set.c @@ -0,0 +1,134 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + */ +#include "tomcrypt.h" + + +#ifdef LTC_MRSA + +/** + Import RSA key from raw numbers + + @param N RSA's N + @param Nlen RSA's N's length + @param e RSA's e + @param elen RSA's e's length + @param d RSA's d (only private key, NULL for public key) + @param dlen RSA's d's length + @param key [out] the destination for the imported key + @return CRYPT_OK if successful +*/ +int rsa_set_key(const unsigned char *N, unsigned long Nlen, + const unsigned char *e, unsigned long elen, + const unsigned char *d, unsigned long dlen, + rsa_key *key) +{ + int err; + + LTC_ARGCHK(key != NULL); + LTC_ARGCHK(N != NULL); + LTC_ARGCHK(e != NULL); + LTC_ARGCHK(ltc_mp.name != NULL); + + err = mp_init_multi(&key->e, &key->d, &key->N, &key->dQ, &key->dP, &key->qP, &key->p, &key->q, NULL); + if (err != CRYPT_OK) return err; + + if ((err = mp_read_unsigned_bin(key->N , (unsigned char *)N , Nlen)) != CRYPT_OK) { goto LBL_ERR; } + if ((err = mp_read_unsigned_bin(key->e , (unsigned char *)e , elen)) != CRYPT_OK) { goto LBL_ERR; } + if (d && dlen) { + if ((err = mp_read_unsigned_bin(key->d , (unsigned char *)d , dlen)) != CRYPT_OK) { goto LBL_ERR; } + key->type = PK_PRIVATE; + } + else { + key->type = PK_PUBLIC; + } + return CRYPT_OK; + +LBL_ERR: + rsa_free(key); + return err; +} + +/** + Import factors of an RSA key from raw numbers + + Only for private keys. + + @param p RSA's p + @param plen RSA's p's length + @param q RSA's q + @param qlen RSA's q's length + @param key [out] the destination for the imported key + @return CRYPT_OK if successful +*/ +int rsa_set_factors(const unsigned char *p, unsigned long plen, + const unsigned char *q, unsigned long qlen, + rsa_key *key) +{ + int err; + + LTC_ARGCHK(key != NULL); + LTC_ARGCHK(p != NULL); + LTC_ARGCHK(q != NULL); + LTC_ARGCHK(ltc_mp.name != NULL); + + if (key->type != PK_PRIVATE) return CRYPT_PK_TYPE_MISMATCH; + + if ((err = mp_read_unsigned_bin(key->p , (unsigned char *)p , plen)) != CRYPT_OK) { goto LBL_ERR; } + if ((err = mp_read_unsigned_bin(key->q , (unsigned char *)q , qlen)) != CRYPT_OK) { goto LBL_ERR; } + return CRYPT_OK; + +LBL_ERR: + rsa_free(key); + return err; +} + +/** + Import CRT parameters of an RSA key from raw numbers + + Only for private keys. + + @param dP RSA's dP + @param dPlen RSA's dP's length + @param dQ RSA's dQ + @param dQlen RSA's dQ's length + @param qP RSA's qP + @param qPlen RSA's qP's length + @param key [out] the destination for the imported key + @return CRYPT_OK if successful +*/ +int rsa_set_crt_params(const unsigned char *dP, unsigned long dPlen, + const unsigned char *dQ, unsigned long dQlen, + const unsigned char *qP, unsigned long qPlen, + rsa_key *key) +{ + int err; + + LTC_ARGCHK(key != NULL); + LTC_ARGCHK(dP != NULL); + LTC_ARGCHK(dQ != NULL); + LTC_ARGCHK(qP != NULL); + LTC_ARGCHK(ltc_mp.name != NULL); + + if (key->type != PK_PRIVATE) return CRYPT_PK_TYPE_MISMATCH; + + if ((err = mp_read_unsigned_bin(key->dP, (unsigned char *)dP, dPlen)) != CRYPT_OK) { goto LBL_ERR; } + if ((err = mp_read_unsigned_bin(key->dQ, (unsigned char *)dQ, dQlen)) != CRYPT_OK) { goto LBL_ERR; } + if ((err = mp_read_unsigned_bin(key->qP, (unsigned char *)qP, qPlen)) != CRYPT_OK) { goto LBL_ERR; } + return CRYPT_OK; + +LBL_ERR: + rsa_free(key); + return err; +} + +#endif /* LTC_MRSA */ + +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/pk/rsa/rsa_sign_hash.c b/libtomcrypt/src/pk/rsa/rsa_sign_hash.c index 3b64095..05c7155 100644 --- a/libtomcrypt/src/pk/rsa/rsa_sign_hash.c +++ b/libtomcrypt/src/pk/rsa/rsa_sign_hash.c @@ -5,25 +5,23 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" /** @file rsa_sign_hash.c - RSA LTC_PKCS #1 v1.5 and v2 PSS sign hash, Tom St Denis and Andreas Lange + RSA PKCS #1 v1.5 and v2 PSS sign hash, Tom St Denis and Andreas Lange */ #ifdef LTC_MRSA /** - LTC_PKCS #1 pad then sign + PKCS #1 pad then sign @param in The hash to sign @param inlen The length of the hash to sign (octets) @param out [out] The signature @param outlen [in/out] The max size and resulting size of the signature - @param padding Type of padding (LTC_LTC_PKCS_1_PSS or LTC_LTC_PKCS_1_V1_5) + @param padding Type of padding (LTC_PKCS_1_PSS, LTC_PKCS_1_V1_5 or LTC_PKCS_1_V1_5_NA1) @param prng An active PRNG state @param prng_idx The index of the PRNG desired @param hash_idx The index of the hash desired @@ -47,15 +45,21 @@ int rsa_sign_hash_ex(const unsigned char *in, unsigned long inlen, LTC_ARGCHK(key != NULL); /* valid padding? */ - if ((padding != LTC_LTC_PKCS_1_V1_5) && (padding != LTC_LTC_PKCS_1_PSS)) { + if ((padding != LTC_PKCS_1_V1_5) && + (padding != LTC_PKCS_1_PSS) && + (padding != LTC_PKCS_1_V1_5_NA1)) { return CRYPT_PK_INVALID_PADDING; } - if (padding == LTC_LTC_PKCS_1_PSS) { - /* valid prng and hash ? */ + if (padding == LTC_PKCS_1_PSS) { + /* valid prng ? */ if ((err = prng_is_valid(prng_idx)) != CRYPT_OK) { return err; } + } + + if (padding != LTC_PKCS_1_V1_5_NA1) { + /* valid hash ? */ if ((err = hash_is_valid(hash_idx)) != CRYPT_OK) { return err; } @@ -71,7 +75,7 @@ int rsa_sign_hash_ex(const unsigned char *in, unsigned long inlen, return CRYPT_BUFFER_OVERFLOW; } - if (padding == LTC_LTC_PKCS_1_PSS) { + if (padding == LTC_PKCS_1_PSS) { /* PSS pad the key */ x = *outlen; if ((err = pkcs_1_pss_encode(in, inlen, saltlen, prng, prng_idx, @@ -79,48 +83,56 @@ int rsa_sign_hash_ex(const unsigned char *in, unsigned long inlen, return err; } } else { - /* LTC_PKCS #1 v1.5 pad the hash */ + /* PKCS #1 v1.5 pad the hash */ unsigned char *tmpin; - ltc_asn1_list digestinfo[2], siginfo[2]; - /* not all hashes have OIDs... so sad */ - if (hash_descriptor[hash_idx].OIDlen == 0) { - return CRYPT_INVALID_ARG; - } + if (padding == LTC_PKCS_1_V1_5) { + ltc_asn1_list digestinfo[2], siginfo[2]; + /* not all hashes have OIDs... so sad */ + if (hash_descriptor[hash_idx].OIDlen == 0) { + return CRYPT_INVALID_ARG; + } - /* construct the SEQUENCE - SEQUENCE { - SEQUENCE {hashoid OID - blah NULL - } - hash OCTET STRING + /* construct the SEQUENCE + SEQUENCE { + SEQUENCE {hashoid OID + blah NULL + } + hash OCTET STRING + } + */ + LTC_SET_ASN1(digestinfo, 0, LTC_ASN1_OBJECT_IDENTIFIER, hash_descriptor[hash_idx].OID, hash_descriptor[hash_idx].OIDlen); + LTC_SET_ASN1(digestinfo, 1, LTC_ASN1_NULL, NULL, 0); + LTC_SET_ASN1(siginfo, 0, LTC_ASN1_SEQUENCE, digestinfo, 2); + LTC_SET_ASN1(siginfo, 1, LTC_ASN1_OCTET_STRING, in, inlen); + + /* allocate memory for the encoding */ + y = mp_unsigned_bin_size(key->N); + tmpin = XMALLOC(y); + if (tmpin == NULL) { + return CRYPT_MEM; } - */ - LTC_SET_ASN1(digestinfo, 0, LTC_ASN1_OBJECT_IDENTIFIER, hash_descriptor[hash_idx].OID, hash_descriptor[hash_idx].OIDlen); - LTC_SET_ASN1(digestinfo, 1, LTC_ASN1_NULL, NULL, 0); - LTC_SET_ASN1(siginfo, 0, LTC_ASN1_SEQUENCE, digestinfo, 2); - LTC_SET_ASN1(siginfo, 1, LTC_ASN1_OCTET_STRING, in, inlen); - - /* allocate memory for the encoding */ - y = mp_unsigned_bin_size(key->N); - tmpin = XMALLOC(y); - if (tmpin == NULL) { - return CRYPT_MEM; - } - if ((err = der_encode_sequence(siginfo, 2, tmpin, &y)) != CRYPT_OK) { - XFREE(tmpin); - return err; + if ((err = der_encode_sequence(siginfo, 2, tmpin, &y)) != CRYPT_OK) { + XFREE(tmpin); + return err; + } + } else { + /* set the pointer and data-length to the input values */ + tmpin = (unsigned char *)in; + y = inlen; } x = *outlen; - if ((err = pkcs_1_v1_5_encode(tmpin, y, LTC_LTC_PKCS_1_EMSA, - modulus_bitlen, NULL, 0, - out, &x)) != CRYPT_OK) { + err = pkcs_1_v1_5_encode(tmpin, y, LTC_PKCS_1_EMSA, modulus_bitlen, NULL, 0, out, &x); + + if (padding == LTC_PKCS_1_V1_5) { XFREE(tmpin); + } + + if (err != CRYPT_OK) { return err; } - XFREE(tmpin); } /* RSA encode it */ @@ -129,6 +141,6 @@ int rsa_sign_hash_ex(const unsigned char *in, unsigned long inlen, #endif /* LTC_MRSA */ -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/pk/rsa/rsa_sign_saltlen_get.c b/libtomcrypt/src/pk/rsa/rsa_sign_saltlen_get.c new file mode 100644 index 0000000..b217f94 --- /dev/null +++ b/libtomcrypt/src/pk/rsa/rsa_sign_saltlen_get.c @@ -0,0 +1,47 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + */ +#include "tomcrypt.h" + +/** + @file rsa_sign_saltlen_get.c + Retrieve the maximum size of the salt, Steffen Jaeckel. +*/ + +#ifdef LTC_MRSA + +/** + Retrieve the maximum possible size of the salt when creating a PKCS#1 PSS signature. + @param padding Type of padding (LTC_PKCS_1_PSS only) + @param hash_idx The index of the desired hash + @param key The RSA key + @return The maximum salt length in bytes or INT_MAX on error. +*/ +int rsa_sign_saltlen_get_max_ex(int padding, int hash_idx, rsa_key *key) +{ + int ret = INT_MAX; + LTC_ARGCHK(key != NULL); + + if ((hash_is_valid(hash_idx) == CRYPT_OK) && + (padding == LTC_PKCS_1_PSS)) + { + ret = rsa_get_size(key); + if (ret < INT_MAX) + { + ret -= (hash_descriptor[hash_idx].hashsize + 2); + } /* if */ + } /* if */ + + return ret; +} + +#endif + +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/pk/rsa/rsa_verify_hash.c b/libtomcrypt/src/pk/rsa/rsa_verify_hash.c index fe83690..b584696 100644 --- a/libtomcrypt/src/pk/rsa/rsa_verify_hash.c +++ b/libtomcrypt/src/pk/rsa/rsa_verify_hash.c @@ -5,25 +5,23 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" /** @file rsa_verify_hash.c - RSA LTC_PKCS #1 v1.5 or v2 PSS signature verification, Tom St Denis and Andreas Lange + RSA PKCS #1 v1.5 or v2 PSS signature verification, Tom St Denis and Andreas Lange */ #ifdef LTC_MRSA /** - LTC_PKCS #1 de-sign then v1.5 or PSS depad + PKCS #1 de-sign then v1.5 or PSS depad @param sig The signature data @param siglen The length of the signature data (octets) @param hash The hash of the message that was signed @param hashlen The length of the hash of the message that was signed (octets) - @param padding Type of padding (LTC_LTC_PKCS_1_PSS or LTC_LTC_PKCS_1_V1_5) + @param padding Type of padding (LTC_PKCS_1_PSS, LTC_PKCS_1_V1_5 or LTC_PKCS_1_V1_5_NA1) @param hash_idx The index of the desired hash @param saltlen The length of the salt used during signature @param stat [out] The result of the signature comparison, 1==valid, 0==invalid @@ -50,12 +48,13 @@ int rsa_verify_hash_ex(const unsigned char *sig, unsigned long siglen, /* valid padding? */ - if ((padding != LTC_LTC_PKCS_1_V1_5) && - (padding != LTC_LTC_PKCS_1_PSS)) { + if ((padding != LTC_PKCS_1_V1_5) && + (padding != LTC_PKCS_1_PSS) && + (padding != LTC_PKCS_1_V1_5_NA1)) { return CRYPT_PK_INVALID_PADDING; } - if (padding == LTC_LTC_PKCS_1_PSS) { + if (padding != LTC_PKCS_1_V1_5_NA1) { /* valid hash ? */ if ((err = hash_is_valid(hash_idx)) != CRYPT_OK) { return err; @@ -90,21 +89,21 @@ int rsa_verify_hash_ex(const unsigned char *sig, unsigned long siglen, return CRYPT_INVALID_PACKET; } - if (padding == LTC_LTC_PKCS_1_PSS) { + if (padding == LTC_PKCS_1_PSS) { /* PSS decode and verify it */ - err = pkcs_1_pss_decode(hash, hashlen, tmpbuf, x, saltlen, hash_idx, modulus_bitlen, stat); + + if(modulus_bitlen%8 == 1){ + err = pkcs_1_pss_decode(hash, hashlen, tmpbuf+1, x-1, saltlen, hash_idx, modulus_bitlen, stat); + } + else{ + err = pkcs_1_pss_decode(hash, hashlen, tmpbuf, x, saltlen, hash_idx, modulus_bitlen, stat); + } + } else { - /* LTC_PKCS #1 v1.5 decode it */ + /* PKCS #1 v1.5 decode it */ unsigned char *out; - unsigned long outlen, loid[16]; + unsigned long outlen; int decoded; - ltc_asn1_list digestinfo[2], siginfo[2]; - - /* not all hashes have OIDs... so sad */ - if (hash_descriptor[hash_idx].OIDlen == 0) { - err = CRYPT_INVALID_ARG; - goto bail_2; - } /* allocate temp buffer for decoded hash */ outlen = ((modulus_bitlen >> 3) + (modulus_bitlen & 7 ? 1 : 0)) - 3; @@ -114,36 +113,63 @@ int rsa_verify_hash_ex(const unsigned char *sig, unsigned long siglen, goto bail_2; } - if ((err = pkcs_1_v1_5_decode(tmpbuf, x, LTC_LTC_PKCS_1_EMSA, modulus_bitlen, out, &outlen, &decoded)) != CRYPT_OK) { - XFREE(out); + if ((err = pkcs_1_v1_5_decode(tmpbuf, x, LTC_PKCS_1_EMSA, modulus_bitlen, out, &outlen, &decoded)) != CRYPT_OK) { + XFREE(out); goto bail_2; } - /* now we must decode out[0...outlen-1] using ASN.1, test the OID and then test the hash */ - /* construct the SEQUENCE - SEQUENCE { - SEQUENCE {hashoid OID - blah NULL + if (padding == LTC_PKCS_1_V1_5) { + unsigned long loid[16], reallen; + ltc_asn1_list digestinfo[2], siginfo[2]; + + /* not all hashes have OIDs... so sad */ + if (hash_descriptor[hash_idx].OIDlen == 0) { + err = CRYPT_INVALID_ARG; + goto bail_2; + } + + /* now we must decode out[0...outlen-1] using ASN.1, test the OID and then test the hash */ + /* construct the SEQUENCE + SEQUENCE { + SEQUENCE {hashoid OID + blah NULL + } + hash OCTET STRING + } + */ + LTC_SET_ASN1(digestinfo, 0, LTC_ASN1_OBJECT_IDENTIFIER, loid, sizeof(loid)/sizeof(loid[0])); + LTC_SET_ASN1(digestinfo, 1, LTC_ASN1_NULL, NULL, 0); + LTC_SET_ASN1(siginfo, 0, LTC_ASN1_SEQUENCE, digestinfo, 2); + LTC_SET_ASN1(siginfo, 1, LTC_ASN1_OCTET_STRING, tmpbuf, siglen); + + if ((err = der_decode_sequence(out, outlen, siginfo, 2)) != CRYPT_OK) { + /* fallback to Legacy:missing NULL */ + LTC_SET_ASN1(siginfo, 0, LTC_ASN1_SEQUENCE, digestinfo, 1); + if ((err = der_decode_sequence(out, outlen, siginfo, 2)) != CRYPT_OK) { + XFREE(out); + goto bail_2; } - hash OCTET STRING } - */ - LTC_SET_ASN1(digestinfo, 0, LTC_ASN1_OBJECT_IDENTIFIER, loid, sizeof(loid)/sizeof(loid[0])); - LTC_SET_ASN1(digestinfo, 1, LTC_ASN1_NULL, NULL, 0); - LTC_SET_ASN1(siginfo, 0, LTC_ASN1_SEQUENCE, digestinfo, 2); - LTC_SET_ASN1(siginfo, 1, LTC_ASN1_OCTET_STRING, tmpbuf, siglen); - - if ((err = der_decode_sequence(out, outlen, siginfo, 2)) != CRYPT_OK) { - XFREE(out); - goto bail_2; - } - /* test OID */ - if ((digestinfo[0].size == hash_descriptor[hash_idx].OIDlen) && + if ((err = der_length_sequence(siginfo, 2, &reallen)) != CRYPT_OK) { + XFREE(out); + goto bail_2; + } + + /* test OID */ + if ((reallen == outlen) && + (digestinfo[0].size == hash_descriptor[hash_idx].OIDlen) && (XMEMCMP(digestinfo[0].data, hash_descriptor[hash_idx].OID, sizeof(unsigned long) * hash_descriptor[hash_idx].OIDlen) == 0) && - (siginfo[1].size == hashlen) && + (siginfo[1].size == hashlen) && (XMEMCMP(siginfo[1].data, hash, hashlen) == 0)) { - *stat = 1; + *stat = 1; + } + } else { + /* only check if the hash is equal */ + if ((hashlen == outlen) && + (XMEMCMP(out, hash, hashlen) == 0)) { + *stat = 1; + } } #ifdef LTC_CLEAN_STACK @@ -162,6 +188,6 @@ bail_2: #endif /* LTC_MRSA */ -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/prngs/chacha20.c b/libtomcrypt/src/prngs/chacha20.c new file mode 100644 index 0000000..72a6d63 --- /dev/null +++ b/libtomcrypt/src/prngs/chacha20.c @@ -0,0 +1,247 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + */ + + /* the idea of re-keying loosely follows the approach used in: + * http://bxr.su/OpenBSD/lib/libc/crypt/arc4random.c + */ + +#include "tomcrypt.h" + +#ifdef LTC_CHACHA20_PRNG + +const struct ltc_prng_descriptor chacha20_prng_desc = +{ + "chacha20", + 40, + &chacha20_prng_start, + &chacha20_prng_add_entropy, + &chacha20_prng_ready, + &chacha20_prng_read, + &chacha20_prng_done, + &chacha20_prng_export, + &chacha20_prng_import, + &chacha20_prng_test +}; + +/** + Start the PRNG + @param prng The PRNG state to initialize + @return CRYPT_OK if successful +*/ +int chacha20_prng_start(prng_state *prng) +{ + LTC_ARGCHK(prng != NULL); + prng->ready = 0; + XMEMSET(&prng->chacha.ent, 0, sizeof(prng->chacha.ent)); + prng->chacha.idx = 0; + LTC_MUTEX_INIT(&prng->lock) + return CRYPT_OK; +} + +/** + Add entropy to the PRNG state + @param in The data to add + @param inlen Length of the data to add + @param prng PRNG state to update + @return CRYPT_OK if successful +*/ +int chacha20_prng_add_entropy(const unsigned char *in, unsigned long inlen, prng_state *prng) +{ + unsigned char buf[40]; + unsigned long i; + int err; + + LTC_ARGCHK(prng != NULL); + LTC_ARGCHK(in != NULL); + LTC_ARGCHK(inlen > 0); + + LTC_MUTEX_LOCK(&prng->lock); + if (prng->ready) { + /* chacha20_prng_ready() was already called, do "rekey" operation */ + if ((err = chacha_keystream(&prng->chacha.s, buf, sizeof(buf))) != CRYPT_OK) goto LBL_UNLOCK; + for(i = 0; i < inlen; i++) buf[i % sizeof(buf)] ^= in[i]; + /* key 32 bytes, 20 rounds */ + if ((err = chacha_setup(&prng->chacha.s, buf, 32, 20)) != CRYPT_OK) goto LBL_UNLOCK; + /* iv 8 bytes */ + if ((err = chacha_ivctr64(&prng->chacha.s, buf + 32, 8, 0)) != CRYPT_OK) goto LBL_UNLOCK; + /* clear KEY + IV */ + zeromem(buf, sizeof(buf)); + } + else { + /* chacha20_prng_ready() was not called yet, add entropy to ent buffer */ + while (inlen--) prng->chacha.ent[prng->chacha.idx++ % sizeof(prng->chacha.ent)] ^= *in++; + } + err = CRYPT_OK; +LBL_UNLOCK: + LTC_MUTEX_UNLOCK(&prng->lock); + return err; +} + +/** + Make the PRNG ready to read from + @param prng The PRNG to make active + @return CRYPT_OK if successful +*/ +int chacha20_prng_ready(prng_state *prng) +{ + int err; + + LTC_ARGCHK(prng != NULL); + + LTC_MUTEX_LOCK(&prng->lock); + if (prng->ready) { err = CRYPT_OK; goto LBL_UNLOCK; } + /* key 32 bytes, 20 rounds */ + if ((err = chacha_setup(&prng->chacha.s, prng->chacha.ent, 32, 20)) != CRYPT_OK) goto LBL_UNLOCK; + /* iv 8 bytes */ + if ((err = chacha_ivctr64(&prng->chacha.s, prng->chacha.ent + 32, 8, 0)) != CRYPT_OK) goto LBL_UNLOCK; + XMEMSET(&prng->chacha.ent, 0, sizeof(prng->chacha.ent)); + prng->chacha.idx = 0; + prng->ready = 1; +LBL_UNLOCK: + LTC_MUTEX_UNLOCK(&prng->lock); + return err; +} + +/** + Read from the PRNG + @param out Destination + @param outlen Length of output + @param prng The active PRNG to read from + @return Number of octets read +*/ +unsigned long chacha20_prng_read(unsigned char *out, unsigned long outlen, prng_state *prng) +{ + if (outlen == 0 || prng == NULL || out == NULL) return 0; + LTC_MUTEX_LOCK(&prng->lock); + if (!prng->ready) { outlen = 0; goto LBL_UNLOCK; } + if (chacha_keystream(&prng->chacha.s, out, outlen) != CRYPT_OK) outlen = 0; +LBL_UNLOCK: + LTC_MUTEX_UNLOCK(&prng->lock); + return outlen; +} + +/** + Terminate the PRNG + @param prng The PRNG to terminate + @return CRYPT_OK if successful +*/ +int chacha20_prng_done(prng_state *prng) +{ + int err; + LTC_ARGCHK(prng != NULL); + LTC_MUTEX_LOCK(&prng->lock); + prng->ready = 0; + err = chacha_done(&prng->chacha.s); + LTC_MUTEX_UNLOCK(&prng->lock); + LTC_MUTEX_DESTROY(&prng->lock); + return err; +} + +/** + Export the PRNG state + @param out [out] Destination + @param outlen [in/out] Max size and resulting size of the state + @param prng The PRNG to export + @return CRYPT_OK if successful +*/ +int chacha20_prng_export(unsigned char *out, unsigned long *outlen, prng_state *prng) +{ + unsigned long len = chacha20_prng_desc.export_size; + + LTC_ARGCHK(prng != NULL); + LTC_ARGCHK(out != NULL); + LTC_ARGCHK(outlen != NULL); + + if (*outlen < len) { + *outlen = len; + return CRYPT_BUFFER_OVERFLOW; + } + + if (chacha20_prng_read(out, len, prng) != len) { + return CRYPT_ERROR_READPRNG; + } + + *outlen = len; + return CRYPT_OK; +} + +/** + Import a PRNG state + @param in The PRNG state + @param inlen Size of the state + @param prng The PRNG to import + @return CRYPT_OK if successful +*/ +int chacha20_prng_import(const unsigned char *in, unsigned long inlen, prng_state *prng) +{ + int err; + + LTC_ARGCHK(prng != NULL); + LTC_ARGCHK(in != NULL); + if (inlen < (unsigned long)chacha20_prng_desc.export_size) return CRYPT_INVALID_ARG; + + if ((err = chacha20_prng_start(prng)) != CRYPT_OK) return err; + if ((err = chacha20_prng_add_entropy(in, inlen, prng)) != CRYPT_OK) return err; + return CRYPT_OK; +} + +/** + PRNG self-test + @return CRYPT_OK if successful, CRYPT_NOP if self-testing has been disabled +*/ +int chacha20_prng_test(void) +{ +#ifndef LTC_TEST + return CRYPT_NOP; +#else + prng_state st; + unsigned char en[] = { 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07, 0x08, 0x09, 0x0a, + 0x0b, 0x0c, 0x0d, 0x0e, 0x0f, 0x10, 0x11, 0x12, 0x13, 0x14, + 0x15, 0x16, 0x17, 0x18, 0x19, 0x1a, 0x1b, 0x1c, 0x1d, 0x1e, + 0x1f, 0x20, 0x21, 0x22, 0x23, 0x24, 0x25, 0x26, 0x27, 0x28, + 0x29, 0x2a, 0x2b, 0x2c, 0x2d, 0x2e, 0x2f, 0x30, 0x31, 0x32 }; + unsigned char dmp[300]; + unsigned long dmplen = sizeof(dmp); + unsigned char out[500]; + unsigned char t1[] = { 0x59, 0xB2, 0x26, 0x95, 0x2B, 0x01, 0x8F, 0x05, 0xBE, 0xD8 }; + unsigned char t2[] = { 0x47, 0xC9, 0x0D, 0x03, 0xE4, 0x75, 0x34, 0x27, 0xBD, 0xDE }; + unsigned char t3[] = { 0xBC, 0xFA, 0xEF, 0x59, 0x37, 0x7F, 0x1A, 0x91, 0x1A, 0xA6 }; + int err; + + if ((err = chacha20_prng_start(&st)) != CRYPT_OK) return err; + /* add entropy to uninitialized prng */ + if ((err = chacha20_prng_add_entropy(en, sizeof(en), &st)) != CRYPT_OK) return err; + if ((err = chacha20_prng_ready(&st)) != CRYPT_OK) return err; + if (chacha20_prng_read(out, 10, &st) != 10) return CRYPT_ERROR_READPRNG; /* 10 bytes for testing */ + if (compare_testvector(out, 10, t1, sizeof(t1), "CHACHA-PRNG", 1)) return CRYPT_FAIL_TESTVECTOR; + if (chacha20_prng_read(out, 500, &st) != 500) return CRYPT_ERROR_READPRNG; /* skip 500 bytes */ + /* add entropy to already initialized prng */ + if ((err = chacha20_prng_add_entropy(en, sizeof(en), &st)) != CRYPT_OK) return err; + if (chacha20_prng_read(out, 500, &st) != 500) return CRYPT_ERROR_READPRNG; /* skip 500 bytes */ + if ((err = chacha20_prng_export(dmp, &dmplen, &st)) != CRYPT_OK) return err; + if (chacha20_prng_read(out, 500, &st) != 500) return CRYPT_ERROR_READPRNG; /* skip 500 bytes */ + if (chacha20_prng_read(out, 10, &st) != 10) return CRYPT_ERROR_READPRNG; /* 10 bytes for testing */ + if (compare_testvector(out, 10, t2, sizeof(t2), "CHACHA-PRNG", 2)) return CRYPT_FAIL_TESTVECTOR; + if ((err = chacha20_prng_done(&st)) != CRYPT_OK) return err; + if ((err = chacha20_prng_import(dmp, dmplen, &st)) != CRYPT_OK) return err; + if ((err = chacha20_prng_ready(&st)) != CRYPT_OK) return err; + if (chacha20_prng_read(out, 500, &st) != 500) return CRYPT_ERROR_READPRNG; /* skip 500 bytes */ + if (chacha20_prng_read(out, 10, &st) != 10) return CRYPT_ERROR_READPRNG; /* 10 bytes for testing */ + if (compare_testvector(out, 10, t3, sizeof(t3), "CHACHA-PRNG", 3)) return CRYPT_FAIL_TESTVECTOR; + if ((err = chacha20_prng_done(&st)) != CRYPT_OK) return err; + + return CRYPT_OK; +#endif +} + +#endif + +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/prngs/fortuna.c b/libtomcrypt/src/prngs/fortuna.c index d262a0b..7b1ecb6 100644 --- a/libtomcrypt/src/prngs/fortuna.c +++ b/libtomcrypt/src/prngs/fortuna.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" @@ -14,14 +12,14 @@ @file fortuna.c Fortuna PRNG, Tom St Denis */ - -/* Implementation of Fortuna by Tom St Denis + +/* Implementation of Fortuna by Tom St Denis We deviate slightly here for reasons of simplicity [and to fit in the API]. First all "sources" -in the AddEntropy function are fixed to 0. Second since no reliable timer is provided +in the AddEntropy function are fixed to 0. Second since no reliable timer is provided we reseed automatically when len(pool0) >= 64 or every LTC_FORTUNA_WD calls to the read function */ -#ifdef LTC_FORTUNA +#ifdef LTC_FORTUNA /* requries LTC_SHA256 and AES */ #if !(defined(LTC_RIJNDAEL) && defined(LTC_SHA256)) @@ -38,7 +36,8 @@ we reseed automatically when len(pool0) >= 64 or every LTC_FORTUNA_WD calls to t #endif const struct ltc_prng_descriptor fortuna_desc = { - "fortuna", 1024, + "fortuna", + (32 * LTC_FORTUNA_POOLS), /* default: 1024 */ &fortuna_start, &fortuna_add_entropy, &fortuna_ready, @@ -50,7 +49,7 @@ const struct ltc_prng_descriptor fortuna_desc = { }; /* update the IV */ -static void fortuna_update_iv(prng_state *prng) +static void _fortuna_update_iv(prng_state *prng) { int x; unsigned char *IV; @@ -63,7 +62,7 @@ static void fortuna_update_iv(prng_state *prng) } /* reseed the PRNG */ -static int fortuna_reseed(prng_state *prng) +static int _fortuna_reseed(prng_state *prng) { unsigned char tmp[MAXBLOCKSIZE]; hash_state md; @@ -79,11 +78,11 @@ static int fortuna_reseed(prng_state *prng) } for (x = 0; x < LTC_FORTUNA_POOLS; x++) { - if (x == 0 || ((prng->fortuna.reset_cnt >> (x-1)) & 1) == 0) { + if (x == 0 || ((prng->fortuna.reset_cnt >> (x-1)) & 1) == 0) { /* terminate this hash */ if ((err = sha256_done(&prng->fortuna.pool[x], tmp)) != CRYPT_OK) { sha256_done(&md, tmp); - return err; + return err; } /* add it to the string */ if ((err = sha256_process(&md, tmp, 32)) != CRYPT_OK) { @@ -102,12 +101,12 @@ static int fortuna_reseed(prng_state *prng) /* finish key */ if ((err = sha256_done(&md, prng->fortuna.K)) != CRYPT_OK) { - return err; + return err; } if ((err = rijndael_setup(prng->fortuna.K, 32, 0, &prng->fortuna.skey)) != CRYPT_OK) { return err; } - fortuna_update_iv(prng); + _fortuna_update_iv(prng); /* reset pool len */ prng->fortuna.pool0_len = 0; @@ -126,14 +125,15 @@ static int fortuna_reseed(prng_state *prng) Start the PRNG @param prng [out] The PRNG state to initialize @return CRYPT_OK if successful -*/ +*/ int fortuna_start(prng_state *prng) { int err, x, y; unsigned char tmp[MAXBLOCKSIZE]; LTC_ARGCHK(prng != NULL); - + prng->ready = 0; + /* initialize the pools */ for (x = 0; x < LTC_FORTUNA_POOLS; x++) { if ((err = sha256_init(&prng->fortuna.pool[x])) != CRYPT_OK) { @@ -155,9 +155,9 @@ int fortuna_start(prng_state *prng) return err; } zeromem(prng->fortuna.IV, 16); - - LTC_MUTEX_INIT(&prng->fortuna.prng_lock) - + + LTC_MUTEX_INIT(&prng->lock) + return CRYPT_OK; } @@ -167,33 +167,31 @@ int fortuna_start(prng_state *prng) @param inlen Length of the data to add @param prng PRNG state to update @return CRYPT_OK if successful -*/ +*/ int fortuna_add_entropy(const unsigned char *in, unsigned long inlen, prng_state *prng) { unsigned char tmp[2]; int err; - LTC_ARGCHK(in != NULL); LTC_ARGCHK(prng != NULL); - - LTC_MUTEX_LOCK(&prng->fortuna.prng_lock); + LTC_ARGCHK(in != NULL); + LTC_ARGCHK(inlen > 0); /* ensure inlen <= 32 */ if (inlen > 32) { - LTC_MUTEX_UNLOCK(&prng->fortuna.prng_lock); - return CRYPT_INVALID_ARG; + inlen = 32; } /* add s || length(in) || in to pool[pool_idx] */ tmp[0] = 0; tmp[1] = (unsigned char)inlen; + + LTC_MUTEX_LOCK(&prng->lock); if ((err = sha256_process(&prng->fortuna.pool[prng->fortuna.pool_idx], tmp, 2)) != CRYPT_OK) { - LTC_MUTEX_UNLOCK(&prng->fortuna.prng_lock); - return err; + goto LBL_UNLOCK; } if ((err = sha256_process(&prng->fortuna.pool[prng->fortuna.pool_idx], in, inlen)) != CRYPT_OK) { - LTC_MUTEX_UNLOCK(&prng->fortuna.prng_lock); - return err; + goto LBL_UNLOCK; } if (prng->fortuna.pool_idx == 0) { prng->fortuna.pool0_len += inlen; @@ -201,19 +199,29 @@ int fortuna_add_entropy(const unsigned char *in, unsigned long inlen, prng_state if (++(prng->fortuna.pool_idx) == LTC_FORTUNA_POOLS) { prng->fortuna.pool_idx = 0; } + err = CRYPT_OK; /* success */ - LTC_MUTEX_UNLOCK(&prng->fortuna.prng_lock); - return CRYPT_OK; +LBL_UNLOCK: + LTC_MUTEX_UNLOCK(&prng->lock); + return err; } /** Make the PRNG ready to read from @param prng The PRNG to make active @return CRYPT_OK if successful -*/ +*/ int fortuna_ready(prng_state *prng) { - return fortuna_reseed(prng); + int err; + LTC_ARGCHK(prng != NULL); + + LTC_MUTEX_LOCK(&prng->lock); + err = _fortuna_reseed(prng); + prng->ready = (err == CRYPT_OK) ? 1 : 0; + + LTC_MUTEX_UNLOCK(&prng->lock); + return err; } /** @@ -222,23 +230,24 @@ int fortuna_ready(prng_state *prng) @param outlen Length of output @param prng The active PRNG to read from @return Number of octets read -*/ +*/ unsigned long fortuna_read(unsigned char *out, unsigned long outlen, prng_state *prng) { unsigned char tmp[16]; - int err; - unsigned long tlen; + unsigned long tlen = 0; - LTC_ARGCHK(out != NULL); - LTC_ARGCHK(prng != NULL); + if (outlen == 0 || prng == NULL || out == NULL) return 0; + + LTC_MUTEX_LOCK(&prng->lock); - LTC_MUTEX_LOCK(&prng->fortuna.prng_lock); + if (!prng->ready) { + goto LBL_UNLOCK; + } /* do we have to reseed? */ if (++prng->fortuna.wd == LTC_FORTUNA_WD || prng->fortuna.pool0_len >= 64) { - if ((err = fortuna_reseed(prng)) != CRYPT_OK) { - LTC_MUTEX_UNLOCK(&prng->fortuna.prng_lock); - return 0; + if (_fortuna_reseed(prng) != CRYPT_OK) { + goto LBL_UNLOCK; } } @@ -251,59 +260,66 @@ unsigned long fortuna_read(unsigned char *out, unsigned long outlen, prng_state rijndael_ecb_encrypt(prng->fortuna.IV, out, &prng->fortuna.skey); out += 16; outlen -= 16; - fortuna_update_iv(prng); + _fortuna_update_iv(prng); } /* left over bytes? */ if (outlen > 0) { rijndael_ecb_encrypt(prng->fortuna.IV, tmp, &prng->fortuna.skey); XMEMCPY(out, tmp, outlen); - fortuna_update_iv(prng); + _fortuna_update_iv(prng); } - + /* generate new key */ - rijndael_ecb_encrypt(prng->fortuna.IV, prng->fortuna.K , &prng->fortuna.skey); fortuna_update_iv(prng); - rijndael_ecb_encrypt(prng->fortuna.IV, prng->fortuna.K+16, &prng->fortuna.skey); fortuna_update_iv(prng); - if ((err = rijndael_setup(prng->fortuna.K, 32, 0, &prng->fortuna.skey)) != CRYPT_OK) { - LTC_MUTEX_UNLOCK(&prng->fortuna.prng_lock); - return 0; + rijndael_ecb_encrypt(prng->fortuna.IV, prng->fortuna.K , &prng->fortuna.skey); + _fortuna_update_iv(prng); + + rijndael_ecb_encrypt(prng->fortuna.IV, prng->fortuna.K+16, &prng->fortuna.skey); + _fortuna_update_iv(prng); + + if (rijndael_setup(prng->fortuna.K, 32, 0, &prng->fortuna.skey) != CRYPT_OK) { + tlen = 0; } +LBL_UNLOCK: #ifdef LTC_CLEAN_STACK zeromem(tmp, sizeof(tmp)); #endif - LTC_MUTEX_UNLOCK(&prng->fortuna.prng_lock); + LTC_MUTEX_UNLOCK(&prng->lock); return tlen; -} +} /** Terminate the PRNG @param prng The PRNG to terminate @return CRYPT_OK if successful -*/ +*/ int fortuna_done(prng_state *prng) { int err, x; unsigned char tmp[32]; LTC_ARGCHK(prng != NULL); - LTC_MUTEX_LOCK(&prng->fortuna.prng_lock); + + LTC_MUTEX_LOCK(&prng->lock); + prng->ready = 0; /* terminate all the hashes */ for (x = 0; x < LTC_FORTUNA_POOLS; x++) { if ((err = sha256_done(&(prng->fortuna.pool[x]), tmp)) != CRYPT_OK) { - LTC_MUTEX_UNLOCK(&prng->fortuna.prng_lock); - return err; + goto LBL_UNLOCK; } } /* call cipher done when we invent one ;-) */ + err = CRYPT_OK; /* success */ +LBL_UNLOCK: #ifdef LTC_CLEAN_STACK zeromem(tmp, sizeof(tmp)); #endif - - LTC_MUTEX_UNLOCK(&prng->fortuna.prng_lock); - return CRYPT_OK; + LTC_MUTEX_UNLOCK(&prng->lock); + LTC_MUTEX_DESTROY(&prng->lock); + return err; } /** @@ -312,34 +328,40 @@ int fortuna_done(prng_state *prng) @param outlen [in/out] Max size and resulting size of the state @param prng The PRNG to export @return CRYPT_OK if successful -*/ +*/ int fortuna_export(unsigned char *out, unsigned long *outlen, prng_state *prng) { int x, err; hash_state *md; + unsigned long len = fortuna_desc.export_size; LTC_ARGCHK(out != NULL); LTC_ARGCHK(outlen != NULL); LTC_ARGCHK(prng != NULL); - LTC_MUTEX_LOCK(&prng->fortuna.prng_lock); + LTC_MUTEX_LOCK(&prng->lock); + + if (!prng->ready) { + err = CRYPT_ERROR; + goto LBL_UNLOCK; + } /* we'll write bytes for s&g's */ - if (*outlen < 32*LTC_FORTUNA_POOLS) { - LTC_MUTEX_UNLOCK(&prng->fortuna.prng_lock); - *outlen = 32*LTC_FORTUNA_POOLS; - return CRYPT_BUFFER_OVERFLOW; + if (*outlen < len) { + *outlen = len; + err = CRYPT_BUFFER_OVERFLOW; + goto LBL_UNLOCK; } md = XMALLOC(sizeof(hash_state)); if (md == NULL) { - LTC_MUTEX_UNLOCK(&prng->fortuna.prng_lock); - return CRYPT_MEM; + err = CRYPT_MEM; + goto LBL_UNLOCK; } - /* to emit the state we copy each pool, terminate it then hash it again so - * an attacker who sees the state can't determine the current state of the PRNG - */ + /* to emit the state we copy each pool, terminate it then hash it again so + * an attacker who sees the state can't determine the current state of the PRNG + */ for (x = 0; x < LTC_FORTUNA_POOLS; x++) { /* copy the PRNG */ XMEMCPY(md, &(prng->fortuna.pool[x]), sizeof(*md)); @@ -360,7 +382,7 @@ int fortuna_export(unsigned char *out, unsigned long *outlen, prng_state *prng) goto LBL_ERR; } } - *outlen = 32*LTC_FORTUNA_POOLS; + *outlen = len; err = CRYPT_OK; LBL_ERR: @@ -368,17 +390,18 @@ LBL_ERR: zeromem(md, sizeof(*md)); #endif XFREE(md); - LTC_MUTEX_UNLOCK(&prng->fortuna.prng_lock); +LBL_UNLOCK: + LTC_MUTEX_UNLOCK(&prng->lock); return err; } - + /** Import a PRNG state @param in The PRNG state @param inlen Size of the state @param prng The PRNG to import @return CRYPT_OK if successful -*/ +*/ int fortuna_import(const unsigned char *in, unsigned long inlen, prng_state *prng) { int err, x; @@ -386,7 +409,7 @@ int fortuna_import(const unsigned char *in, unsigned long inlen, prng_state *prn LTC_ARGCHK(in != NULL); LTC_ARGCHK(prng != NULL); - if (inlen != 32*LTC_FORTUNA_POOLS) { + if (inlen < (unsigned long)fortuna_desc.export_size) { return CRYPT_INVALID_ARG; } @@ -398,13 +421,13 @@ int fortuna_import(const unsigned char *in, unsigned long inlen, prng_state *prn return err; } } - return err; + return CRYPT_OK; } /** PRNG self-test @return CRYPT_OK if successful, CRYPT_NOP if self-testing has been disabled -*/ +*/ int fortuna_test(void) { #ifndef LTC_TEST @@ -422,6 +445,6 @@ int fortuna_test(void) #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/prngs/rc4.c b/libtomcrypt/src/prngs/rc4.c index 15c74e3..e2aa921 100644 --- a/libtomcrypt/src/prngs/rc4.c +++ b/libtomcrypt/src/prngs/rc4.c @@ -5,44 +5,45 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" /** - @file rc4.c - LTC_RC4 PRNG, Tom St Denis -*/ + @file prngs/rc4.c + RC4 PRNG, Tom St Denis +*/ #ifdef LTC_RC4 -const struct ltc_prng_descriptor rc4_desc = +const struct ltc_prng_descriptor rc4_desc = { - "rc4", 32, - &rc4_start, - &rc4_add_entropy, - &rc4_ready, - &rc4_read, - &rc4_done, - &rc4_export, - &rc4_import, - &rc4_test + "rc4", + 32, + &rc4_start, + &rc4_add_entropy, + &rc4_ready, + &rc4_read, + &rc4_done, + &rc4_export, + &rc4_import, + &rc4_test }; /** Start the PRNG @param prng [out] The PRNG state to initialize @return CRYPT_OK if successful -*/ +*/ int rc4_start(prng_state *prng) { - LTC_ARGCHK(prng != NULL); - - /* set keysize to zero */ - prng->rc4.x = 0; - - return CRYPT_OK; + LTC_ARGCHK(prng != NULL); + prng->ready = 0; + /* set entropy (key) size to zero */ + prng->rc4.s.x = 0; + /* clear entropy (key) buffer */ + XMEMSET(&prng->rc4.s.buf, 0, sizeof(prng->rc4.s.buf)); + LTC_MUTEX_INIT(&prng->lock) + return CRYPT_OK; } /** @@ -51,68 +52,63 @@ int rc4_start(prng_state *prng) @param inlen Length of the data to add @param prng PRNG state to update @return CRYPT_OK if successful -*/ +*/ int rc4_add_entropy(const unsigned char *in, unsigned long inlen, prng_state *prng) { - LTC_ARGCHK(in != NULL); - LTC_ARGCHK(prng != NULL); - - /* trim as required */ - if (prng->rc4.x + inlen > 256) { - if (prng->rc4.x == 256) { - /* I can't possibly accept another byte, ok maybe a mint wafer... */ - return CRYPT_OK; - } else { - /* only accept part of it */ - inlen = 256 - prng->rc4.x; - } - } - - while (inlen--) { - prng->rc4.buf[prng->rc4.x++] = *in++; - } + unsigned char buf[256]; + unsigned long i; + int err; - return CRYPT_OK; - + LTC_ARGCHK(prng != NULL); + LTC_ARGCHK(in != NULL); + LTC_ARGCHK(inlen > 0); + + LTC_MUTEX_LOCK(&prng->lock); + if (prng->ready) { + /* rc4_ready() was already called, do "rekey" operation */ + if ((err = rc4_stream_keystream(&prng->rc4.s, buf, sizeof(buf))) != CRYPT_OK) goto LBL_UNLOCK; + for(i = 0; i < inlen; i++) buf[i % sizeof(buf)] ^= in[i]; + /* initialize RC4 */ + if ((err = rc4_stream_setup(&prng->rc4.s, buf, sizeof(buf))) != CRYPT_OK) goto LBL_UNLOCK; + /* drop first 3072 bytes - https://en.wikipedia.org/wiki/RC4#Fluhrer.2C_Mantin_and_Shamir_attack */ + for (i = 0; i < 12; i++) rc4_stream_keystream(&prng->rc4.s, buf, sizeof(buf)); + zeromem(buf, sizeof(buf)); + } + else { + /* rc4_ready() was not called yet, add entropy to the buffer */ + while (inlen--) prng->rc4.s.buf[prng->rc4.s.x++ % sizeof(prng->rc4.s.buf)] ^= *in++; + } + err = CRYPT_OK; +LBL_UNLOCK: + LTC_MUTEX_UNLOCK(&prng->lock); + return err; } /** Make the PRNG ready to read from @param prng The PRNG to make active @return CRYPT_OK if successful -*/ +*/ int rc4_ready(prng_state *prng) { - unsigned char key[256], tmp, *s; - int keylen, x, y, j; - - LTC_ARGCHK(prng != NULL); - - /* extract the key */ - s = prng->rc4.buf; - XMEMCPY(key, s, 256); - keylen = prng->rc4.x; + unsigned char buf[256] = { 0 }; + unsigned long len; + int err, i; - /* make LTC_RC4 perm and shuffle */ - for (x = 0; x < 256; x++) { - s[x] = x; - } - - for (j = x = y = 0; x < 256; x++) { - y = (y + prng->rc4.buf[x] + key[j++]) & 255; - if (j == keylen) { - j = 0; - } - tmp = s[x]; s[x] = s[y]; s[y] = tmp; - } - prng->rc4.x = 0; - prng->rc4.y = 0; - -#ifdef LTC_CLEAN_STACK - zeromem(key, sizeof(key)); -#endif + LTC_ARGCHK(prng != NULL); - return CRYPT_OK; + LTC_MUTEX_LOCK(&prng->lock); + if (prng->ready) { err = CRYPT_OK; goto LBL_UNLOCK; } + XMEMCPY(buf, prng->rc4.s.buf, sizeof(buf)); + /* initialize RC4 */ + len = MIN(prng->rc4.s.x, 256); /* TODO: we can perhaps always use all 256 bytes */ + if ((err = rc4_stream_setup(&prng->rc4.s, buf, len)) != CRYPT_OK) goto LBL_UNLOCK; + /* drop first 3072 bytes - https://en.wikipedia.org/wiki/RC4#Fluhrer.2C_Mantin_and_Shamir_attack */ + for (i = 0; i < 12; i++) rc4_stream_keystream(&prng->rc4.s, buf, sizeof(buf)); + prng->ready = 1; +LBL_UNLOCK: + LTC_MUTEX_UNLOCK(&prng->lock); + return err; } /** @@ -121,44 +117,33 @@ int rc4_ready(prng_state *prng) @param outlen Length of output @param prng The active PRNG to read from @return Number of octets read -*/ +*/ unsigned long rc4_read(unsigned char *out, unsigned long outlen, prng_state *prng) { - unsigned char x, y, *s, tmp; - unsigned long n; - - LTC_ARGCHK(out != NULL); - LTC_ARGCHK(prng != NULL); - -#ifdef LTC_VALGRIND - zeromem(out, outlen); -#endif - - n = outlen; - x = prng->rc4.x; - y = prng->rc4.y; - s = prng->rc4.buf; - while (outlen--) { - x = (x + 1) & 255; - y = (y + s[x]) & 255; - tmp = s[x]; s[x] = s[y]; s[y] = tmp; - tmp = (s[x] + s[y]) & 255; - *out++ ^= s[tmp]; - } - prng->rc4.x = x; - prng->rc4.y = y; - return n; + if (outlen == 0 || prng == NULL || out == NULL) return 0; + LTC_MUTEX_LOCK(&prng->lock); + if (!prng->ready) { outlen = 0; goto LBL_UNLOCK; } + if (rc4_stream_keystream(&prng->rc4.s, out, outlen) != CRYPT_OK) outlen = 0; +LBL_UNLOCK: + LTC_MUTEX_UNLOCK(&prng->lock); + return outlen; } /** Terminate the PRNG @param prng The PRNG to terminate @return CRYPT_OK if successful -*/ +*/ int rc4_done(prng_state *prng) { + int err; LTC_ARGCHK(prng != NULL); - return CRYPT_OK; + LTC_MUTEX_LOCK(&prng->lock); + prng->ready = 0; + err = rc4_stream_done(&prng->rc4.s); + LTC_MUTEX_UNLOCK(&prng->lock); + LTC_MUTEX_DESTROY(&prng->lock); + return err; } /** @@ -167,103 +152,99 @@ int rc4_done(prng_state *prng) @param outlen [in/out] Max size and resulting size of the state @param prng The PRNG to export @return CRYPT_OK if successful -*/ +*/ int rc4_export(unsigned char *out, unsigned long *outlen, prng_state *prng) { - LTC_ARGCHK(outlen != NULL); - LTC_ARGCHK(out != NULL); + unsigned long len = rc4_desc.export_size; + LTC_ARGCHK(prng != NULL); + LTC_ARGCHK(out != NULL); + LTC_ARGCHK(outlen != NULL); - if (*outlen < 32) { - *outlen = 32; + if (*outlen < len) { + *outlen = len; return CRYPT_BUFFER_OVERFLOW; } - if (rc4_read(out, 32, prng) != 32) { + if (rc4_read(out, len, prng) != len) { return CRYPT_ERROR_READPRNG; } - *outlen = 32; + *outlen = len; return CRYPT_OK; } - + /** Import a PRNG state @param in The PRNG state @param inlen Size of the state @param prng The PRNG to import @return CRYPT_OK if successful -*/ +*/ int rc4_import(const unsigned char *in, unsigned long inlen, prng_state *prng) { int err; - LTC_ARGCHK(in != NULL); + LTC_ARGCHK(prng != NULL); + LTC_ARGCHK(in != NULL); + if (inlen < (unsigned long)rc4_desc.export_size) return CRYPT_INVALID_ARG; - if (inlen != 32) { - return CRYPT_INVALID_ARG; - } - - if ((err = rc4_start(prng)) != CRYPT_OK) { - return err; - } - return rc4_add_entropy(in, 32, prng); + if ((err = rc4_start(prng)) != CRYPT_OK) return err; + if ((err = rc4_add_entropy(in, inlen, prng)) != CRYPT_OK) return err; + return CRYPT_OK; } /** PRNG self-test @return CRYPT_OK if successful, CRYPT_NOP if self-testing has been disabled -*/ +*/ int rc4_test(void) { -#if !defined(LTC_TEST) || defined(LTC_VALGRIND) +#ifndef LTC_TEST return CRYPT_NOP; #else - static const struct { - unsigned char key[8], pt[8], ct[8]; - } tests[] = { -{ - { 0x01, 0x23, 0x45, 0x67, 0x89, 0xab, 0xcd, 0xef }, - { 0x01, 0x23, 0x45, 0x67, 0x89, 0xab, 0xcd, 0xef }, - { 0x75, 0xb7, 0x87, 0x80, 0x99, 0xe0, 0xc5, 0x96 } -} -}; - prng_state prng; - unsigned char dst[8]; - int err, x; + prng_state st; + unsigned char en[] = { 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07, 0x08, 0x09, 0x0a, + 0x0b, 0x0c, 0x0d, 0x0e, 0x0f, 0x10, 0x11, 0x12, 0x13, 0x14, + 0x15, 0x16, 0x17, 0x18, 0x19, 0x1a, 0x1b, 0x1c, 0x1d, 0x1e, + 0x1f, 0x20, 0x21, 0x22, 0x23, 0x24, 0x25, 0x26, 0x27, 0x28, + 0x29, 0x2a, 0x2b, 0x2c, 0x2d, 0x2e, 0x2f, 0x30, 0x31, 0x32 }; + unsigned char dmp[500]; + unsigned long dmplen = sizeof(dmp); + unsigned char out[1000]; + unsigned char t1[] = { 0xE0, 0x4D, 0x9A, 0xF6, 0xA8, 0x9D, 0x77, 0x53, 0xAE, 0x09 }; + unsigned char t2[] = { 0xEF, 0x80, 0xA2, 0xE6, 0x50, 0x91, 0xF3, 0x17, 0x4A, 0x8A }; + unsigned char t3[] = { 0x4B, 0xD6, 0x5C, 0x67, 0x99, 0x03, 0x56, 0x12, 0x80, 0x48 }; + int err; + + if ((err = rc4_start(&st)) != CRYPT_OK) return err; + /* add entropy to uninitialized prng */ + if ((err = rc4_add_entropy(en, sizeof(en), &st)) != CRYPT_OK) return err; + if ((err = rc4_ready(&st)) != CRYPT_OK) return err; + if (rc4_read(out, 10, &st) != 10) return CRYPT_ERROR_READPRNG; /* 10 bytes for testing */ + if (compare_testvector(out, 10, t1, sizeof(t1), "RC4-PRNG", 1)) return CRYPT_FAIL_TESTVECTOR; + if (rc4_read(out, 500, &st) != 500) return CRYPT_ERROR_READPRNG; /* skip 500 bytes */ + /* add entropy to already initialized prng */ + if ((err = rc4_add_entropy(en, sizeof(en), &st)) != CRYPT_OK) return err; + if (rc4_read(out, 500, &st) != 500) return CRYPT_ERROR_READPRNG; /* skip 500 bytes */ + if ((err = rc4_export(dmp, &dmplen, &st)) != CRYPT_OK) return err; + if (rc4_read(out, 500, &st) != 500) return CRYPT_ERROR_READPRNG; /* skip 500 bytes */ + if (rc4_read(out, 10, &st) != 10) return CRYPT_ERROR_READPRNG; /* 10 bytes for testing */ + if (compare_testvector(out, 10, t2, sizeof(t2), "RC4-PRNG", 2)) return CRYPT_FAIL_TESTVECTOR; + if ((err = rc4_done(&st)) != CRYPT_OK) return err; + if ((err = rc4_import(dmp, dmplen, &st)) != CRYPT_OK) return err; + if ((err = rc4_ready(&st)) != CRYPT_OK) return err; + if (rc4_read(out, 500, &st) != 500) return CRYPT_ERROR_READPRNG; /* skip 500 bytes */ + if (rc4_read(out, 10, &st) != 10) return CRYPT_ERROR_READPRNG; /* 10 bytes for testing */ + if (compare_testvector(out, 10, t3, sizeof(t3), "RC4-PRNG", 3)) return CRYPT_FAIL_TESTVECTOR; + if ((err = rc4_done(&st)) != CRYPT_OK) return err; - for (x = 0; x < (int)(sizeof(tests)/sizeof(tests[0])); x++) { - if ((err = rc4_start(&prng)) != CRYPT_OK) { - return err; - } - if ((err = rc4_add_entropy(tests[x].key, 8, &prng)) != CRYPT_OK) { - return err; - } - if ((err = rc4_ready(&prng)) != CRYPT_OK) { - return err; - } - XMEMCPY(dst, tests[x].pt, 8); - if (rc4_read(dst, 8, &prng) != 8) { - return CRYPT_ERROR_READPRNG; - } - rc4_done(&prng); - if (XMEMCMP(dst, tests[x].ct, 8)) { -#if 0 - int y; - printf("\n\nLTC_RC4 failed, I got:\n"); - for (y = 0; y < 8; y++) printf("%02x ", dst[y]); - printf("\n"); -#endif - return CRYPT_FAIL_TESTVECTOR; - } - } return CRYPT_OK; #endif } #endif - -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/prngs/rng_get_bytes.c b/libtomcrypt/src/prngs/rng_get_bytes.c index b8cc6f5..4e9a063 100644 --- a/libtomcrypt/src/prngs/rng_get_bytes.c +++ b/libtomcrypt/src/prngs/rng_get_bytes.c @@ -5,42 +5,45 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" -/** +#ifdef LTC_RNG_GET_BYTES +/** @file rng_get_bytes.c portable way to get secure random bits to feed a PRNG (Tom St Denis) */ -#ifdef LTC_DEVRANDOM +#if defined(LTC_DEVRANDOM) && !defined(_WIN32) /* on *NIX read /dev/random */ -static unsigned long rng_nix(unsigned char *buf, unsigned long len, +static unsigned long _rng_nix(unsigned char *buf, unsigned long len, void (*callback)(void)) { #ifdef LTC_NO_FILE + LTC_UNUSED_PARAM(callback); + LTC_UNUSED_PARAM(buf); + LTC_UNUSED_PARAM(len); return 0; #else FILE *f; unsigned long x; -#ifdef TRY_URANDOM_FIRST + LTC_UNUSED_PARAM(callback); +#ifdef LTC_TRY_URANDOM_FIRST f = fopen("/dev/urandom", "rb"); if (f == NULL) -#endif /* TRY_URANDOM_FIRST */ +#endif /* LTC_TRY_URANDOM_FIRST */ f = fopen("/dev/random", "rb"); if (f == NULL) { return 0; } - + /* disable buffering */ if (setvbuf(f, NULL, _IONBF, 0) != 0) { fclose(f); return 0; - } - + } + x = (unsigned long)fread(buf, 1, (size_t)len, f); fclose(f); return x; @@ -49,21 +52,16 @@ static unsigned long rng_nix(unsigned char *buf, unsigned long len, #endif /* LTC_DEVRANDOM */ -/* on ANSI C platforms with 100 < CLOCKS_PER_SEC < 10000 */ -#if defined(CLOCKS_PER_SEC) && !defined(WINCE) +#if !defined(_WIN32_WCE) #define ANSI_RNG -static unsigned long rng_ansic(unsigned char *buf, unsigned long len, +static unsigned long _rng_ansic(unsigned char *buf, unsigned long len, void (*callback)(void)) { clock_t t1; int l, acc, bits, a, b; - if (XCLOCKS_PER_SEC < 100 || XCLOCKS_PER_SEC > 10000) { - return 0; - } - l = len; bits = 8; acc = a = b = 0; @@ -76,33 +74,37 @@ static unsigned long rng_ansic(unsigned char *buf, unsigned long len, } while (a == b); acc = (acc << 1) | a; } - *buf++ = acc; + *buf++ = acc; acc = 0; bits = 8; } - acc = bits = a = b = 0; return l; } -#endif +#endif /* Try the Microsoft CSP */ -#if defined(WIN32) || defined(WINCE) -#define _WIN32_WINNT 0x0400 -#ifdef WINCE +#if defined(_WIN32) || defined(_WIN32_WCE) +#ifndef _WIN32_WINNT + #define _WIN32_WINNT 0x0400 +#endif +#ifdef _WIN32_WCE #define UNDER_CE #define ARM #endif + +#define WIN32_LEAN_AND_MEAN #include <windows.h> #include <wincrypt.h> -static unsigned long rng_win32(unsigned char *buf, unsigned long len, +static unsigned long _rng_win32(unsigned char *buf, unsigned long len, void (*callback)(void)) { HCRYPTPROV hProv = 0; - if (!CryptAcquireContext(&hProv, NULL, MS_DEF_PROV, PROV_RSA_FULL, - (CRYPT_VERIFYCONTEXT | CRYPT_MACHINE_KEYSET)) && - !CryptAcquireContext (&hProv, NULL, MS_DEF_PROV, PROV_RSA_FULL, + LTC_UNUSED_PARAM(callback); + if (!CryptAcquireContext(&hProv, NULL, MS_DEF_PROV, PROV_RSA_FULL, + (CRYPT_VERIFYCONTEXT | CRYPT_MACHINE_KEYSET)) && + !CryptAcquireContext (&hProv, NULL, MS_DEF_PROV, PROV_RSA_FULL, CRYPT_VERIFYCONTEXT | CRYPT_MACHINE_KEYSET | CRYPT_NEWKEYSET)) return 0; @@ -123,26 +125,35 @@ static unsigned long rng_win32(unsigned char *buf, unsigned long len, @param outlen Length desired (octets) @param callback Pointer to void function to act as "callback" when RNG is slow. This can be NULL @return Number of octets read -*/ -unsigned long rng_get_bytes(unsigned char *out, unsigned long outlen, +*/ +unsigned long rng_get_bytes(unsigned char *out, unsigned long outlen, void (*callback)(void)) { unsigned long x; LTC_ARGCHK(out != NULL); -#if defined(LTC_DEVRANDOM) - x = rng_nix(out, outlen, callback); if (x != 0) { return x; } +#ifdef LTC_PRNG_ENABLE_LTC_RNG + if (ltc_rng) { + x = ltc_rng(out, outlen, callback); + if (x != 0) { + return x; + } + } #endif -#ifdef WIN32 - x = rng_win32(out, outlen, callback); if (x != 0) { return x; } + +#if defined(_WIN32) || defined(_WIN32_WCE) + x = _rng_win32(out, outlen, callback); if (x != 0) { return x; } +#elif defined(LTC_DEVRANDOM) + x = _rng_nix(out, outlen, callback); if (x != 0) { return x; } #endif #ifdef ANSI_RNG - x = rng_ansic(out, outlen, callback); if (x != 0) { return x; } + x = _rng_ansic(out, outlen, callback); if (x != 0) { return x; } #endif return 0; } +#endif /* #ifdef LTC_RNG_GET_BYTES */ -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/prngs/rng_make_prng.c b/libtomcrypt/src/prngs/rng_make_prng.c index 6ba2cbe..b01c325 100644 --- a/libtomcrypt/src/prngs/rng_make_prng.c +++ b/libtomcrypt/src/prngs/rng_make_prng.c @@ -5,12 +5,11 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" -/** +#ifdef LTC_RNG_MAKE_PRNG +/** @file rng_make_prng.c portable way to get secure random bits to feed a PRNG (Tom St Denis) */ @@ -22,13 +21,13 @@ @param prng [out] PRNG state to initialize @param callback A pointer to a void function for when the RNG is slow, this can be NULL @return CRYPT_OK if successful -*/ -int rng_make_prng(int bits, int wprng, prng_state *prng, +*/ +int rng_make_prng(int bits, int wprng, prng_state *prng, void (*callback)(void)) { unsigned char buf[256]; int err; - + LTC_ARGCHK(prng != NULL); /* check parameter */ @@ -62,8 +61,9 @@ int rng_make_prng(int bits, int wprng, prng_state *prng, #endif return CRYPT_OK; } +#endif /* #ifdef LTC_RNG_MAKE_PRNG */ -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/prngs/sober128.c b/libtomcrypt/src/prngs/sober128.c index 9bc7727..8d95491 100644 --- a/libtomcrypt/src/prngs/sober128.c +++ b/libtomcrypt/src/prngs/sober128.c @@ -5,196 +5,45 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ + #include "tomcrypt.h" /** - @file sober128.c + @file prngs/sober128.c Implementation of SOBER-128 by Tom St Denis. Based on s128fast.c reference code supplied by Greg Rose of QUALCOMM. */ #ifdef LTC_SOBER128 -#include "sober128tab.c" - -const struct ltc_prng_descriptor sober128_desc = -{ - "sober128", 64, - &sober128_start, - &sober128_add_entropy, - &sober128_ready, - &sober128_read, - &sober128_done, - &sober128_export, - &sober128_import, - &sober128_test +const struct ltc_prng_descriptor sober128_desc = +{ + "sober128", + 40, + &sober128_start, + &sober128_add_entropy, + &sober128_ready, + &sober128_read, + &sober128_done, + &sober128_export, + &sober128_import, + &sober128_test }; -/* don't change these... */ -#define N 17 -#define FOLD N /* how many iterations of folding to do */ -#define INITKONST 0x6996c53a /* value of KONST to use during key loading */ -#define KEYP 15 /* where to insert key words */ -#define FOLDP 4 /* where to insert non-linear feedback */ - -#define B(x,i) ((unsigned char)(((x) >> (8*i)) & 0xFF)) - -static ulong32 BYTE2WORD(unsigned char *b) -{ - ulong32 t; - LOAD32L(t, b); - return t; -} - -#define WORD2BYTE(w, b) STORE32L(b, w) - -static void XORWORD(ulong32 w, unsigned char *b) -{ - ulong32 t; - LOAD32L(t, b); - t ^= w; - STORE32L(t, b); -} - -/* give correct offset for the current position of the register, - * where logically R[0] is at position "zero". - */ -#define OFF(zero, i) (((zero)+(i)) % N) - -/* step the LFSR */ -/* After stepping, "zero" moves right one place */ -#define STEP(R,z) \ - R[OFF(z,0)] = R[OFF(z,15)] ^ R[OFF(z,4)] ^ (R[OFF(z,0)] << 8) ^ Multab[(R[OFF(z,0)] >> 24) & 0xFF]; - -static void cycle(ulong32 *R) -{ - ulong32 t; - int i; - - STEP(R,0); - t = R[0]; - for (i = 1; i < N; ++i) { - R[i-1] = R[i]; - } - R[N-1] = t; -} - -/* Return a non-linear function of some parts of the register. - */ -#define NLFUNC(c,z) \ -{ \ - t = c->R[OFF(z,0)] + c->R[OFF(z,16)]; \ - t ^= Sbox[(t >> 24) & 0xFF]; \ - t = RORc(t, 8); \ - t = ((t + c->R[OFF(z,1)]) ^ c->konst) + c->R[OFF(z,6)]; \ - t ^= Sbox[(t >> 24) & 0xFF]; \ - t = t + c->R[OFF(z,13)]; \ -} - -static ulong32 nltap(struct sober128_prng *c) -{ - ulong32 t; - NLFUNC(c, 0); - return t; -} - /** Start the PRNG @param prng [out] The PRNG state to initialize @return CRYPT_OK if successful -*/ +*/ int sober128_start(prng_state *prng) { - int i; - struct sober128_prng *c; - - LTC_ARGCHK(prng != NULL); - - c = &(prng->sober128); - - /* Register initialised to Fibonacci numbers */ - c->R[0] = 1; - c->R[1] = 1; - for (i = 2; i < N; ++i) { - c->R[i] = c->R[i-1] + c->R[i-2]; - } - c->konst = INITKONST; - - /* next add_entropy will be the key */ - c->flag = 1; - c->set = 0; - - return CRYPT_OK; -} - -/* Save the current register state - */ -static void s128_savestate(struct sober128_prng *c) -{ - int i; - for (i = 0; i < N; ++i) { - c->initR[i] = c->R[i]; - } -} - -/* initialise to previously saved register state - */ -static void s128_reloadstate(struct sober128_prng *c) -{ - int i; - - for (i = 0; i < N; ++i) { - c->R[i] = c->initR[i]; - } -} - -/* Initialise "konst" - */ -static void s128_genkonst(struct sober128_prng *c) -{ - ulong32 newkonst; - - do { - cycle(c->R); - newkonst = nltap(c); - } while ((newkonst & 0xFF000000) == 0); - c->konst = newkonst; -} - -/* Load key material into the register - */ -#define ADDKEY(k) \ - c->R[KEYP] += (k); - -#define XORNL(nl) \ - c->R[FOLDP] ^= (nl); - -/* nonlinear diffusion of register for key */ -#define DROUND(z) STEP(c->R,z); NLFUNC(c,(z+1)); c->R[OFF((z+1),FOLDP)] ^= t; -static void s128_diffuse(struct sober128_prng *c) -{ - ulong32 t; - /* relies on FOLD == N == 17! */ - DROUND(0); - DROUND(1); - DROUND(2); - DROUND(3); - DROUND(4); - DROUND(5); - DROUND(6); - DROUND(7); - DROUND(8); - DROUND(9); - DROUND(10); - DROUND(11); - DROUND(12); - DROUND(13); - DROUND(14); - DROUND(15); - DROUND(16); + LTC_ARGCHK(prng != NULL); + prng->ready = 0; + XMEMSET(&prng->sober128.ent, 0, sizeof(prng->sober128.ent)); + prng->sober128.idx = 0; + LTC_MUTEX_INIT(&prng->lock) + return CRYPT_OK; } /** @@ -203,81 +52,63 @@ static void s128_diffuse(struct sober128_prng *c) @param inlen Length of the data to add @param prng PRNG state to update @return CRYPT_OK if successful -*/ +*/ int sober128_add_entropy(const unsigned char *in, unsigned long inlen, prng_state *prng) { - struct sober128_prng *c; - ulong32 i, k; - - LTC_ARGCHK(in != NULL); - LTC_ARGCHK(prng != NULL); - c = &(prng->sober128); - - if (c->flag == 1) { - /* this is the first call to the add_entropy so this input is the key */ - /* inlen must be multiple of 4 bytes */ - if ((inlen & 3) != 0) { - return CRYPT_INVALID_KEYSIZE; - } - - for (i = 0; i < inlen; i += 4) { - k = BYTE2WORD((unsigned char *)&in[i]); - ADDKEY(k); - cycle(c->R); - XORNL(nltap(c)); - } - - /* also fold in the length of the key */ - ADDKEY(inlen); - - /* now diffuse */ - s128_diffuse(c); - - s128_genkonst(c); - s128_savestate(c); - c->nbuf = 0; - c->flag = 0; - c->set = 1; - } else { - /* ok we are adding an IV then... */ - s128_reloadstate(c); - - /* inlen must be multiple of 4 bytes */ - if ((inlen & 3) != 0) { - return CRYPT_INVALID_KEYSIZE; - } - - for (i = 0; i < inlen; i += 4) { - k = BYTE2WORD((unsigned char *)&in[i]); - ADDKEY(k); - cycle(c->R); - XORNL(nltap(c)); - } - - /* also fold in the length of the key */ - ADDKEY(inlen); - - /* now diffuse */ - s128_diffuse(c); - c->nbuf = 0; - } + unsigned char buf[40]; + unsigned long i; + int err; - return CRYPT_OK; + LTC_ARGCHK(prng != NULL); + LTC_ARGCHK(in != NULL); + LTC_ARGCHK(inlen > 0); + + LTC_MUTEX_LOCK(&prng->lock); + if (prng->ready) { + /* sober128_ready() was already called, do "rekey" operation */ + if ((err = sober128_stream_keystream(&prng->sober128.s, buf, sizeof(buf))) != CRYPT_OK) goto LBL_UNLOCK; + for(i = 0; i < inlen; i++) buf[i % sizeof(buf)] ^= in[i]; + /* key 32 bytes, 20 rounds */ + if ((err = sober128_stream_setup(&prng->sober128.s, buf, 32)) != CRYPT_OK) goto LBL_UNLOCK; + /* iv 8 bytes */ + if ((err = sober128_stream_setiv(&prng->sober128.s, buf + 32, 8)) != CRYPT_OK) goto LBL_UNLOCK; + /* clear KEY + IV */ + zeromem(buf, sizeof(buf)); + } + else { + /* sober128_ready() was not called yet, add entropy to ent buffer */ + while (inlen--) prng->sober128.ent[prng->sober128.idx++ % sizeof(prng->sober128.ent)] ^= *in++; + } + err = CRYPT_OK; +LBL_UNLOCK: + LTC_MUTEX_UNLOCK(&prng->lock); + return err; } /** Make the PRNG ready to read from @param prng The PRNG to make active @return CRYPT_OK if successful -*/ +*/ int sober128_ready(prng_state *prng) { - return prng->sober128.set == 1 ? CRYPT_OK : CRYPT_ERROR; -} + int err; -/* XOR pseudo-random bytes into buffer - */ -#define SROUND(z) STEP(c->R,z); NLFUNC(c,(z+1)); XORWORD(t, out+(z*4)); + LTC_ARGCHK(prng != NULL); + + LTC_MUTEX_LOCK(&prng->lock); + if (prng->ready) { err = CRYPT_OK; goto LBL_UNLOCK; } + /* key 32 bytes, 20 rounds */ + if ((err = sober128_stream_setup(&prng->sober128.s, prng->sober128.ent, 32)) != CRYPT_OK) goto LBL_UNLOCK; + /* iv 8 bytes */ + if ((err = sober128_stream_setiv(&prng->sober128.s, prng->sober128.ent + 32, 8)) != CRYPT_OK) goto LBL_UNLOCK; + XMEMSET(&prng->sober128.ent, 0, sizeof(prng->sober128.ent)); + prng->sober128.idx = 0; + prng->ready = 1; +LBL_UNLOCK: + LTC_MUTEX_UNLOCK(&prng->lock); + return err; +} /** Read from the PRNG @@ -285,90 +116,33 @@ int sober128_ready(prng_state *prng) @param outlen Length of output @param prng The active PRNG to read from @return Number of octets read -*/ +*/ unsigned long sober128_read(unsigned char *out, unsigned long outlen, prng_state *prng) { - struct sober128_prng *c; - ulong32 t, tlen; - - LTC_ARGCHK(out != NULL); - LTC_ARGCHK(prng != NULL); - -#ifdef LTC_VALGRIND - zeromem(out, outlen); -#endif - - c = &(prng->sober128); - t = 0; - tlen = outlen; - - /* handle any previously buffered bytes */ - while (c->nbuf != 0 && outlen != 0) { - *out++ ^= c->sbuf & 0xFF; - c->sbuf >>= 8; - c->nbuf -= 8; - --outlen; - } - -#ifndef LTC_SMALL_CODE - /* do lots at a time, if there's enough to do */ - while (outlen >= N*4) { - SROUND(0); - SROUND(1); - SROUND(2); - SROUND(3); - SROUND(4); - SROUND(5); - SROUND(6); - SROUND(7); - SROUND(8); - SROUND(9); - SROUND(10); - SROUND(11); - SROUND(12); - SROUND(13); - SROUND(14); - SROUND(15); - SROUND(16); - out += 4*N; - outlen -= 4*N; - } -#endif - - /* do small or odd size buffers the slow way */ - while (4 <= outlen) { - cycle(c->R); - t = nltap(c); - XORWORD(t, out); - out += 4; - outlen -= 4; - } - - /* handle any trailing bytes */ - if (outlen != 0) { - cycle(c->R); - c->sbuf = nltap(c); - c->nbuf = 32; - while (c->nbuf != 0 && outlen != 0) { - *out++ ^= c->sbuf & 0xFF; - c->sbuf >>= 8; - c->nbuf -= 8; - --outlen; - } - } - - return tlen; + if (outlen == 0 || prng == NULL || out == NULL) return 0; + LTC_MUTEX_LOCK(&prng->lock); + if (!prng->ready) { outlen = 0; goto LBL_UNLOCK; } + if (sober128_stream_keystream(&prng->sober128.s, out, outlen) != CRYPT_OK) outlen = 0; +LBL_UNLOCK: + LTC_MUTEX_UNLOCK(&prng->lock); + return outlen; } /** Terminate the PRNG @param prng The PRNG to terminate @return CRYPT_OK if successful -*/ +*/ int sober128_done(prng_state *prng) { + int err; LTC_ARGCHK(prng != NULL); - return CRYPT_OK; + LTC_MUTEX_LOCK(&prng->lock); + prng->ready = 0; + err = sober128_stream_done(&prng->sober128.s); + LTC_MUTEX_UNLOCK(&prng->lock); + LTC_MUTEX_DESTROY(&prng->lock); + return err; } /** @@ -377,124 +151,99 @@ int sober128_done(prng_state *prng) @param outlen [in/out] Max size and resulting size of the state @param prng The PRNG to export @return CRYPT_OK if successful -*/ +*/ int sober128_export(unsigned char *out, unsigned long *outlen, prng_state *prng) { - LTC_ARGCHK(outlen != NULL); - LTC_ARGCHK(out != NULL); + unsigned long len = sober128_desc.export_size; + LTC_ARGCHK(prng != NULL); + LTC_ARGCHK(out != NULL); + LTC_ARGCHK(outlen != NULL); - if (*outlen < 64) { - *outlen = 64; + if (*outlen < len) { + *outlen = len; return CRYPT_BUFFER_OVERFLOW; } - if (sober128_read(out, 64, prng) != 64) { + if (sober128_read(out, len, prng) != len) { return CRYPT_ERROR_READPRNG; } - *outlen = 64; + *outlen = len; return CRYPT_OK; } - + /** Import a PRNG state @param in The PRNG state @param inlen Size of the state @param prng The PRNG to import @return CRYPT_OK if successful -*/ +*/ int sober128_import(const unsigned char *in, unsigned long inlen, prng_state *prng) { int err; - LTC_ARGCHK(in != NULL); + LTC_ARGCHK(prng != NULL); + LTC_ARGCHK(in != NULL); + if (inlen < (unsigned long)sober128_desc.export_size) return CRYPT_INVALID_ARG; - if (inlen != 64) { - return CRYPT_INVALID_ARG; - } - - if ((err = sober128_start(prng)) != CRYPT_OK) { - return err; - } - if ((err = sober128_add_entropy(in, 64, prng)) != CRYPT_OK) { - return err; - } - return sober128_ready(prng); + if ((err = sober128_start(prng)) != CRYPT_OK) return err; + if ((err = sober128_add_entropy(in, sober128_desc.export_size, prng)) != CRYPT_OK) return err; + return CRYPT_OK; } /** PRNG self-test @return CRYPT_OK if successful, CRYPT_NOP if self-testing has been disabled -*/ +*/ int sober128_test(void) { #ifndef LTC_TEST return CRYPT_NOP; #else - static const struct { - int keylen, ivlen, len; - unsigned char key[16], iv[4], out[20]; - } tests[] = { - -{ - 16, 4, 20, - - /* key */ - { 0x74, 0x65, 0x73, 0x74, 0x20, 0x6b, 0x65, 0x79, - 0x20, 0x31, 0x32, 0x38, 0x62, 0x69, 0x74, 0x73 }, - - /* IV */ - { 0x00, 0x00, 0x00, 0x00 }, - - /* expected output */ - { 0x43, 0x50, 0x0c, 0xcf, 0x89, 0x91, 0x9f, 0x1d, - 0xaa, 0x37, 0x74, 0x95, 0xf4, 0xb4, 0x58, 0xc2, - 0x40, 0x37, 0x8b, 0xbb } -} - -}; - prng_state prng; - unsigned char dst[20]; - int err, x; + prng_state st; + unsigned char en[] = { 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07, 0x08, 0x09, 0x0a, + 0x0b, 0x0c, 0x0d, 0x0e, 0x0f, 0x10, 0x11, 0x12, 0x13, 0x14, + 0x15, 0x16, 0x17, 0x18, 0x19, 0x1a, 0x1b, 0x1c, 0x1d, 0x1e, + 0x1f, 0x20, 0x21, 0x22, 0x23, 0x24, 0x25, 0x26, 0x27, 0x28, + 0x29, 0x2a, 0x2b, 0x2c, 0x2d, 0x2e, 0x2f, 0x30, 0x31, 0x32 }; + unsigned char dmp[300]; + unsigned long dmplen = sizeof(dmp); + unsigned char out[500]; + unsigned char t1[] = { 0x31, 0x82, 0xA7, 0xA5, 0x8B, 0xD7, 0xCB, 0x39, 0x86, 0x1A }; + unsigned char t2[] = { 0x6B, 0x43, 0x9E, 0xBC, 0xE7, 0x62, 0x9B, 0xE6, 0x9B, 0x83 }; + unsigned char t3[] = { 0x4A, 0x0E, 0x6C, 0xC1, 0xCF, 0xB4, 0x73, 0x49, 0x99, 0x05 }; + int err; - for (x = 0; x < (int)(sizeof(tests)/sizeof(tests[0])); x++) { - if ((err = sober128_start(&prng)) != CRYPT_OK) { - return err; - } - if ((err = sober128_add_entropy(tests[x].key, tests[x].keylen, &prng)) != CRYPT_OK) { - return err; - } - /* add IV */ - if ((err = sober128_add_entropy(tests[x].iv, tests[x].ivlen, &prng)) != CRYPT_OK) { - return err; - } + if ((err = sober128_start(&st)) != CRYPT_OK) return err; + /* add entropy to uninitialized prng */ + if ((err = sober128_add_entropy(en, sizeof(en), &st)) != CRYPT_OK) return err; + if ((err = sober128_ready(&st)) != CRYPT_OK) return err; + if (sober128_read(out, 10, &st) != 10) return CRYPT_ERROR_READPRNG; /* 10 bytes for testing */ + if (compare_testvector(out, 10, t1, sizeof(t1), "SOBER128-PRNG", 1)) return CRYPT_FAIL_TESTVECTOR; + if (sober128_read(out, 500, &st) != 500) return CRYPT_ERROR_READPRNG; /* skip 500 bytes */ + /* add entropy to already initialized prng */ + if ((err = sober128_add_entropy(en, sizeof(en), &st)) != CRYPT_OK) return err; + if (sober128_read(out, 500, &st) != 500) return CRYPT_ERROR_READPRNG; /* skip 500 bytes */ + if ((err = sober128_export(dmp, &dmplen, &st)) != CRYPT_OK) return err; + if (sober128_read(out, 500, &st) != 500) return CRYPT_ERROR_READPRNG; /* skip 500 bytes */ + if (sober128_read(out, 10, &st) != 10) return CRYPT_ERROR_READPRNG; /* 10 bytes for testing */ + if (compare_testvector(out, 10, t2, sizeof(t2), "SOBER128-PRNG", 2)) return CRYPT_FAIL_TESTVECTOR; + if ((err = sober128_done(&st)) != CRYPT_OK) return err; + if ((err = sober128_import(dmp, dmplen, &st)) != CRYPT_OK) return err; + if ((err = sober128_ready(&st)) != CRYPT_OK) return err; + if (sober128_read(out, 500, &st) != 500) return CRYPT_ERROR_READPRNG; /* skip 500 bytes */ + if (sober128_read(out, 10, &st) != 10) return CRYPT_ERROR_READPRNG; /* 10 bytes for testing */ + if (compare_testvector(out, 10, t3, sizeof(t3), "SOBER128-PRNG", 3)) return CRYPT_FAIL_TESTVECTOR; + if ((err = sober128_done(&st)) != CRYPT_OK) return err; - /* ready up */ - if ((err = sober128_ready(&prng)) != CRYPT_OK) { - return err; - } - XMEMSET(dst, 0, tests[x].len); - if (sober128_read(dst, tests[x].len, &prng) != (unsigned long)tests[x].len) { - return CRYPT_ERROR_READPRNG; - } - sober128_done(&prng); - if (XMEMCMP(dst, tests[x].out, tests[x].len)) { -#if 0 - printf("\n\nLTC_SOBER128 failed, I got:\n"); - for (y = 0; y < tests[x].len; y++) printf("%02x ", dst[y]); - printf("\n"); -#endif - return CRYPT_FAIL_TESTVECTOR; - } - } return CRYPT_OK; #endif } #endif - -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/prngs/sprng.c b/libtomcrypt/src/prngs/sprng.c index d86b081..b74d8da 100644 --- a/libtomcrypt/src/prngs/sprng.c +++ b/libtomcrypt/src/prngs/sprng.c @@ -5,8 +5,6 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" @@ -14,7 +12,7 @@ @file sprng.c Secure PRNG, Tom St Denis */ - + /* A secure PRNG using the RNG functions. Basically this is a * wrapper that allows you to use a secure RNG as a PRNG * in the various other functions. @@ -39,10 +37,11 @@ const struct ltc_prng_descriptor sprng_desc = Start the PRNG @param prng [out] The PRNG state to initialize @return CRYPT_OK if successful -*/ +*/ int sprng_start(prng_state *prng) { - return CRYPT_OK; + LTC_UNUSED_PARAM(prng); + return CRYPT_OK; } /** @@ -51,9 +50,12 @@ int sprng_start(prng_state *prng) @param inlen Length of the data to add @param prng PRNG state to update @return CRYPT_OK if successful -*/ +*/ int sprng_add_entropy(const unsigned char *in, unsigned long inlen, prng_state *prng) { + LTC_UNUSED_PARAM(in); + LTC_UNUSED_PARAM(inlen); + LTC_UNUSED_PARAM(prng); return CRYPT_OK; } @@ -61,9 +63,10 @@ int sprng_add_entropy(const unsigned char *in, unsigned long inlen, prng_state * Make the PRNG ready to read from @param prng The PRNG to make active @return CRYPT_OK if successful -*/ +*/ int sprng_ready(prng_state *prng) { + LTC_UNUSED_PARAM(prng); return CRYPT_OK; } @@ -73,10 +76,11 @@ int sprng_ready(prng_state *prng) @param outlen Length of output @param prng The active PRNG to read from @return Number of octets read -*/ +*/ unsigned long sprng_read(unsigned char *out, unsigned long outlen, prng_state *prng) { LTC_ARGCHK(out != NULL); + LTC_UNUSED_PARAM(prng); return rng_get_bytes(out, outlen, NULL); } @@ -84,9 +88,10 @@ unsigned long sprng_read(unsigned char *out, unsigned long outlen, prng_state *p Terminate the PRNG @param prng The PRNG to terminate @return CRYPT_OK if successful -*/ +*/ int sprng_done(prng_state *prng) { + LTC_UNUSED_PARAM(prng); return CRYPT_OK; } @@ -96,41 +101,61 @@ int sprng_done(prng_state *prng) @param outlen [in/out] Max size and resulting size of the state @param prng The PRNG to export @return CRYPT_OK if successful -*/ +*/ int sprng_export(unsigned char *out, unsigned long *outlen, prng_state *prng) { LTC_ARGCHK(outlen != NULL); + LTC_UNUSED_PARAM(out); + LTC_UNUSED_PARAM(prng); *outlen = 0; return CRYPT_OK; } - + /** Import a PRNG state @param in The PRNG state @param inlen Size of the state @param prng The PRNG to import @return CRYPT_OK if successful -*/ +*/ int sprng_import(const unsigned char *in, unsigned long inlen, prng_state *prng) { + LTC_UNUSED_PARAM(in); + LTC_UNUSED_PARAM(inlen); + LTC_UNUSED_PARAM(prng); return CRYPT_OK; } /** PRNG self-test @return CRYPT_OK if successful, CRYPT_NOP if self-testing has been disabled -*/ +*/ int sprng_test(void) { +#ifndef LTC_TEST + return CRYPT_NOP; +#else + prng_state st; + unsigned char en[] = { 0x01, 0x02, 0x03, 0x04 }; + unsigned char out[1000]; + int err; + + if ((err = sprng_start(&st)) != CRYPT_OK) return err; + if ((err = sprng_add_entropy(en, sizeof(en), &st)) != CRYPT_OK) return err; + if ((err = sprng_ready(&st)) != CRYPT_OK) return err; + if (sprng_read(out, 500, &st) != 500) return CRYPT_ERROR_READPRNG; /* skip 500 bytes */ + if ((err = sprng_done(&st)) != CRYPT_OK) return err; + return CRYPT_OK; +#endif } #endif - -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ + +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/prngs/yarrow.c b/libtomcrypt/src/prngs/yarrow.c index c94671f..e598834 100644 --- a/libtomcrypt/src/prngs/yarrow.c +++ b/libtomcrypt/src/prngs/yarrow.c @@ -5,15 +5,13 @@ * * The library is free for all purposes without any express * guarantee it works. - * - * Tom St Denis, tomstdenis@gmail.com, http://libtom.org */ #include "tomcrypt.h" /** @file yarrow.c Yarrow PRNG, Tom St Denis -*/ +*/ #ifdef LTC_YARROW @@ -34,12 +32,13 @@ const struct ltc_prng_descriptor yarrow_desc = Start the PRNG @param prng [out] The PRNG state to initialize @return CRYPT_OK if successful -*/ +*/ int yarrow_start(prng_state *prng) { int err; - + LTC_ARGCHK(prng != NULL); + prng->ready = 0; /* these are the default hash/cipher combo used */ #ifdef LTC_RIJNDAEL @@ -64,13 +63,13 @@ int yarrow_start(prng_state *prng) prng->yarrow.cipher = register_cipher(&saferp_desc); #elif defined(LTC_RC2) prng->yarrow.cipher = register_cipher(&rc2_desc); -#elif defined(LTC_NOEKEON) +#elif defined(LTC_NOEKEON) prng->yarrow.cipher = register_cipher(&noekeon_desc); -#elif defined(LTC_ANUBIS) +#elif defined(LTC_ANUBIS) prng->yarrow.cipher = register_cipher(&anubis_desc); -#elif defined(LTC_KSEED) +#elif defined(LTC_KSEED) prng->yarrow.cipher = register_cipher(&kseed_desc); -#elif defined(LTC_KHAZAD) +#elif defined(LTC_KHAZAD) prng->yarrow.cipher = register_cipher(&khazad_desc); #elif defined(LTC_CAST5) prng->yarrow.cipher = register_cipher(&cast5_desc); @@ -120,7 +119,7 @@ int yarrow_start(prng_state *prng) /* zero the memory used */ zeromem(prng->yarrow.pool, sizeof(prng->yarrow.pool)); - LTC_MUTEX_INIT(&prng->yarrow.prng_lock) + LTC_MUTEX_INIT(&prng->lock) return CRYPT_OK; } @@ -131,78 +130,71 @@ int yarrow_start(prng_state *prng) @param inlen Length of the data to add @param prng PRNG state to update @return CRYPT_OK if successful -*/ +*/ int yarrow_add_entropy(const unsigned char *in, unsigned long inlen, prng_state *prng) { hash_state md; int err; - LTC_ARGCHK(in != NULL); LTC_ARGCHK(prng != NULL); - - LTC_MUTEX_LOCK(&prng->yarrow.prng_lock); - + LTC_ARGCHK(in != NULL); + LTC_ARGCHK(inlen > 0); + + LTC_MUTEX_LOCK(&prng->lock); + if ((err = hash_is_valid(prng->yarrow.hash)) != CRYPT_OK) { - LTC_MUTEX_UNLOCK(&prng->yarrow.prng_lock); - return err; + goto LBL_UNLOCK; } /* start the hash */ if ((err = hash_descriptor[prng->yarrow.hash].init(&md)) != CRYPT_OK) { - LTC_MUTEX_UNLOCK(&prng->yarrow.prng_lock); - return err; + goto LBL_UNLOCK; } /* hash the current pool */ - if ((err = hash_descriptor[prng->yarrow.hash].process(&md, prng->yarrow.pool, + if ((err = hash_descriptor[prng->yarrow.hash].process(&md, prng->yarrow.pool, hash_descriptor[prng->yarrow.hash].hashsize)) != CRYPT_OK) { - LTC_MUTEX_UNLOCK(&prng->yarrow.prng_lock); - return err; + goto LBL_UNLOCK; } /* add the new entropy */ if ((err = hash_descriptor[prng->yarrow.hash].process(&md, in, inlen)) != CRYPT_OK) { - LTC_MUTEX_UNLOCK(&prng->yarrow.prng_lock); - return err; + goto LBL_UNLOCK; } /* store result */ - if ((err = hash_descriptor[prng->yarrow.hash].done(&md, prng->yarrow.pool)) != CRYPT_OK) { - LTC_MUTEX_UNLOCK(&prng->yarrow.prng_lock); - return err; - } + err = hash_descriptor[prng->yarrow.hash].done(&md, prng->yarrow.pool); - LTC_MUTEX_UNLOCK(&prng->yarrow.prng_lock); - return CRYPT_OK; +LBL_UNLOCK: + LTC_MUTEX_UNLOCK(&prng->lock); + return err; } /** Make the PRNG ready to read from @param prng The PRNG to make active @return CRYPT_OK if successful -*/ +*/ int yarrow_ready(prng_state *prng) { int ks, err; LTC_ARGCHK(prng != NULL); - LTC_MUTEX_LOCK(&prng->yarrow.prng_lock); + + LTC_MUTEX_LOCK(&prng->lock); if ((err = hash_is_valid(prng->yarrow.hash)) != CRYPT_OK) { - LTC_MUTEX_UNLOCK(&prng->yarrow.prng_lock); - return err; + goto LBL_UNLOCK; } - + if ((err = cipher_is_valid(prng->yarrow.cipher)) != CRYPT_OK) { - LTC_MUTEX_UNLOCK(&prng->yarrow.prng_lock); - return err; + goto LBL_UNLOCK; } /* setup CTR mode using the "pool" as the key */ ks = (int)hash_descriptor[prng->yarrow.hash].hashsize; if ((err = cipher_descriptor[prng->yarrow.cipher].keysize(&ks)) != CRYPT_OK) { - LTC_MUTEX_UNLOCK(&prng->yarrow.prng_lock); - return err; + goto LBL_UNLOCK; } if ((err = ctr_start(prng->yarrow.cipher, /* what cipher to use */ @@ -211,11 +203,13 @@ int yarrow_ready(prng_state *prng) 0, /* number of rounds */ CTR_COUNTER_LITTLE_ENDIAN, /* little endian counter */ &prng->yarrow.ctr)) != CRYPT_OK) { - LTC_MUTEX_UNLOCK(&prng->yarrow.prng_lock); - return err; + goto LBL_UNLOCK; } - LTC_MUTEX_UNLOCK(&prng->yarrow.prng_lock); - return CRYPT_OK; + prng->ready = 1; + +LBL_UNLOCK: + LTC_MUTEX_UNLOCK(&prng->lock); + return err; } /** @@ -224,23 +218,28 @@ int yarrow_ready(prng_state *prng) @param outlen Length of output @param prng The active PRNG to read from @return Number of octets read -*/ +*/ unsigned long yarrow_read(unsigned char *out, unsigned long outlen, prng_state *prng) { - LTC_ARGCHK(out != NULL); - LTC_ARGCHK(prng != NULL); + if (outlen == 0 || prng == NULL || out == NULL) return 0; - LTC_MUTEX_LOCK(&prng->yarrow.prng_lock); + LTC_MUTEX_LOCK(&prng->lock); + + if (!prng->ready) { + outlen = 0; + goto LBL_UNLOCK; + } /* put out in predictable state first */ zeromem(out, outlen); - + /* now randomize it */ if (ctr_encrypt(out, out, outlen, &prng->yarrow.ctr) != CRYPT_OK) { - LTC_MUTEX_UNLOCK(&prng->yarrow.prng_lock); - return 0; + outlen = 0; } - LTC_MUTEX_UNLOCK(&prng->yarrow.prng_lock); + +LBL_UNLOCK: + LTC_MUTEX_UNLOCK(&prng->lock); return outlen; } @@ -248,20 +247,22 @@ unsigned long yarrow_read(unsigned char *out, unsigned long outlen, prng_state * Terminate the PRNG @param prng The PRNG to terminate @return CRYPT_OK if successful -*/ +*/ int yarrow_done(prng_state *prng) { int err; LTC_ARGCHK(prng != NULL); - LTC_MUTEX_LOCK(&prng->yarrow.prng_lock); + LTC_MUTEX_LOCK(&prng->lock); + prng->ready = 0; /* call cipher done when we invent one ;-) */ /* we invented one */ err = ctr_done(&prng->yarrow.ctr); - - LTC_MUTEX_UNLOCK(&prng->yarrow.prng_lock); + + LTC_MUTEX_UNLOCK(&prng->lock); + LTC_MUTEX_DESTROY(&prng->lock); return err; } @@ -271,65 +272,52 @@ int yarrow_done(prng_state *prng) @param outlen [in/out] Max size and resulting size of the state @param prng The PRNG to export @return CRYPT_OK if successful -*/ +*/ int yarrow_export(unsigned char *out, unsigned long *outlen, prng_state *prng) { + unsigned long len = yarrow_desc.export_size; + LTC_ARGCHK(out != NULL); LTC_ARGCHK(outlen != NULL); LTC_ARGCHK(prng != NULL); - LTC_MUTEX_LOCK(&prng->yarrow.prng_lock); - - /* we'll write 64 bytes for s&g's */ - if (*outlen < 64) { - LTC_MUTEX_UNLOCK(&prng->yarrow.prng_lock); - *outlen = 64; + if (*outlen < len) { + *outlen = len; return CRYPT_BUFFER_OVERFLOW; } - if (yarrow_read(out, 64, prng) != 64) { - LTC_MUTEX_UNLOCK(&prng->yarrow.prng_lock); + if (yarrow_read(out, len, prng) != len) { return CRYPT_ERROR_READPRNG; } - *outlen = 64; + *outlen = len; return CRYPT_OK; } - + /** Import a PRNG state @param in The PRNG state @param inlen Size of the state @param prng The PRNG to import @return CRYPT_OK if successful -*/ +*/ int yarrow_import(const unsigned char *in, unsigned long inlen, prng_state *prng) { int err; LTC_ARGCHK(in != NULL); LTC_ARGCHK(prng != NULL); - - LTC_MUTEX_LOCK(&prng->yarrow.prng_lock); + if (inlen < (unsigned long)yarrow_desc.export_size) return CRYPT_INVALID_ARG; - if (inlen != 64) { - LTC_MUTEX_UNLOCK(&prng->yarrow.prng_lock); - return CRYPT_INVALID_ARG; - } - - if ((err = yarrow_start(prng)) != CRYPT_OK) { - LTC_MUTEX_UNLOCK(&prng->yarrow.prng_lock); - return err; - } - err = yarrow_add_entropy(in, 64, prng); - LTC_MUTEX_UNLOCK(&prng->yarrow.prng_lock); - return err; + if ((err = yarrow_start(prng)) != CRYPT_OK) return err; + if ((err = yarrow_add_entropy(in, inlen, prng)) != CRYPT_OK) return err; + return CRYPT_OK; } /** PRNG self-test @return CRYPT_OK if successful, CRYPT_NOP if self-testing has been disabled -*/ +*/ int yarrow_test(void) { #ifndef LTC_TEST @@ -341,13 +329,15 @@ int yarrow_test(void) if ((err = yarrow_start(&prng)) != CRYPT_OK) { return err; } - + /* now let's test the hash/cipher that was chosen */ - if ((err = cipher_descriptor[prng.yarrow.cipher].test()) != CRYPT_OK) { - return err; + if (cipher_descriptor[prng.yarrow.cipher].test && + ((err = cipher_descriptor[prng.yarrow.cipher].test()) != CRYPT_OK)) { + return err; } - if ((err = hash_descriptor[prng.yarrow.hash].test()) != CRYPT_OK) { - return err; + if (hash_descriptor[prng.yarrow.hash].test && + ((err = hash_descriptor[prng.yarrow.hash].test()) != CRYPT_OK)) { + return err; } return CRYPT_OK; @@ -357,6 +347,6 @@ int yarrow_test(void) #endif -/* $Source$ */ -/* $Revision$ */ -/* $Date$ */ +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/stream/chacha/chacha_crypt.c b/libtomcrypt/src/stream/chacha/chacha_crypt.c new file mode 100644 index 0000000..6814058 --- /dev/null +++ b/libtomcrypt/src/stream/chacha/chacha_crypt.c @@ -0,0 +1,101 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + */ + +/* The implementation is based on: + * chacha-ref.c version 20080118 + * Public domain from D. J. Bernstein + */ + +#include "tomcrypt.h" + +#ifdef LTC_CHACHA + +#define QUARTERROUND(a,b,c,d) \ + x[a] += x[b]; x[d] = ROL(x[d] ^ x[a], 16); \ + x[c] += x[d]; x[b] = ROL(x[b] ^ x[c], 12); \ + x[a] += x[b]; x[d] = ROL(x[d] ^ x[a], 8); \ + x[c] += x[d]; x[b] = ROL(x[b] ^ x[c], 7); + +static void _chacha_block(unsigned char *output, const ulong32 *input, int rounds) +{ + ulong32 x[16]; + int i; + XMEMCPY(x, input, sizeof(x)); + for (i = rounds; i > 0; i -= 2) { + QUARTERROUND(0, 4, 8,12) + QUARTERROUND(1, 5, 9,13) + QUARTERROUND(2, 6,10,14) + QUARTERROUND(3, 7,11,15) + QUARTERROUND(0, 5,10,15) + QUARTERROUND(1, 6,11,12) + QUARTERROUND(2, 7, 8,13) + QUARTERROUND(3, 4, 9,14) + } + for (i = 0; i < 16; ++i) { + x[i] += input[i]; + STORE32L(x[i], output + 4 * i); + } +} + +/** + Encrypt (or decrypt) bytes of ciphertext (or plaintext) with ChaCha + @param st The ChaCha state + @param in The plaintext (or ciphertext) + @param inlen The length of the input (octets) + @param out [out] The ciphertext (or plaintext), length inlen + @return CRYPT_OK if successful +*/ +int chacha_crypt(chacha_state *st, const unsigned char *in, unsigned long inlen, unsigned char *out) +{ + unsigned char buf[64]; + unsigned long i, j; + + if (inlen == 0) return CRYPT_OK; /* nothing to do */ + + LTC_ARGCHK(st != NULL); + LTC_ARGCHK(in != NULL); + LTC_ARGCHK(out != NULL); + LTC_ARGCHK(st->ivlen != 0); + + if (st->ksleft > 0) { + j = MIN(st->ksleft, inlen); + for (i = 0; i < j; ++i, st->ksleft--) out[i] = in[i] ^ st->kstream[64 - st->ksleft]; + inlen -= j; + if (inlen == 0) return CRYPT_OK; + out += j; + in += j; + } + for (;;) { + _chacha_block(buf, st->input, st->rounds); + if (st->ivlen == 8) { + /* IV-64bit, increment 64bit counter */ + if (0 == ++st->input[12] && 0 == ++st->input[13]) return CRYPT_OVERFLOW; + } + else { + /* IV-96bit, increment 32bit counter */ + if (0 == ++st->input[12]) return CRYPT_OVERFLOW; + } + if (inlen <= 64) { + for (i = 0; i < inlen; ++i) out[i] = in[i] ^ buf[i]; + st->ksleft = 64 - inlen; + for (i = inlen; i < 64; ++i) st->kstream[i] = buf[i]; + return CRYPT_OK; + } + for (i = 0; i < 64; ++i) out[i] = in[i] ^ buf[i]; + inlen -= 64; + out += 64; + in += 64; + } +} + +#endif + +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/stream/chacha/chacha_done.c b/libtomcrypt/src/stream/chacha/chacha_done.c new file mode 100644 index 0000000..9f0196e --- /dev/null +++ b/libtomcrypt/src/stream/chacha/chacha_done.c @@ -0,0 +1,30 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + */ + +#include "tomcrypt.h" + +#ifdef LTC_CHACHA + +/** + Terminate and clear ChaCha state + @param st The ChaCha state + @return CRYPT_OK on success +*/ +int chacha_done(chacha_state *st) +{ + LTC_ARGCHK(st != NULL); + XMEMSET(st, 0, sizeof(chacha_state)); + return CRYPT_OK; +} + +#endif + +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/stream/chacha/chacha_ivctr32.c b/libtomcrypt/src/stream/chacha/chacha_ivctr32.c new file mode 100644 index 0000000..c9a6dbb --- /dev/null +++ b/libtomcrypt/src/stream/chacha/chacha_ivctr32.c @@ -0,0 +1,47 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + */ + +/* The implementation is based on: + * chacha-ref.c version 20080118 + * Public domain from D. J. Bernstein + */ + +#include "tomcrypt.h" + +#ifdef LTC_CHACHA + +/** + Set IV + counter data to the ChaCha state + @param st The ChaCha20 state + @param iv The IV data to add + @param ivlen The length of the IV (must be 12) + @param counter 32bit (unsigned) initial counter value + @return CRYPT_OK on success + */ +int chacha_ivctr32(chacha_state *st, const unsigned char *iv, unsigned long ivlen, ulong32 counter) +{ + LTC_ARGCHK(st != NULL); + LTC_ARGCHK(iv != NULL); + /* 96bit IV + 32bit counter */ + LTC_ARGCHK(ivlen == 12); + + st->input[12] = counter; + LOAD32L(st->input[13], iv + 0); + LOAD32L(st->input[14], iv + 4); + LOAD32L(st->input[15], iv + 8); + st->ksleft = 0; + st->ivlen = ivlen; + return CRYPT_OK; +} + +#endif + +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/stream/chacha/chacha_ivctr64.c b/libtomcrypt/src/stream/chacha/chacha_ivctr64.c new file mode 100644 index 0000000..643d11f --- /dev/null +++ b/libtomcrypt/src/stream/chacha/chacha_ivctr64.c @@ -0,0 +1,47 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + */ + +/* The implementation is based on: + * chacha-ref.c version 20080118 + * Public domain from D. J. Bernstein + */ + +#include "tomcrypt.h" + +#ifdef LTC_CHACHA + +/** + Set IV + counter data to the ChaCha state + @param st The ChaCha20 state + @param iv The IV data to add + @param ivlen The length of the IV (must be 8) + @param counter 64bit (unsigned) initial counter value + @return CRYPT_OK on success + */ +int chacha_ivctr64(chacha_state *st, const unsigned char *iv, unsigned long ivlen, ulong64 counter) +{ + LTC_ARGCHK(st != NULL); + LTC_ARGCHK(iv != NULL); + /* 64bit IV + 64bit counter */ + LTC_ARGCHK(ivlen == 8); + + st->input[12] = (ulong32)(counter & 0xFFFFFFFF); + st->input[13] = (ulong32)(counter >> 32); + LOAD32L(st->input[14], iv + 0); + LOAD32L(st->input[15], iv + 4); + st->ksleft = 0; + st->ivlen = ivlen; + return CRYPT_OK; +} + +#endif + +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/stream/chacha/chacha_keystream.c b/libtomcrypt/src/stream/chacha/chacha_keystream.c new file mode 100644 index 0000000..25eb63a --- /dev/null +++ b/libtomcrypt/src/stream/chacha/chacha_keystream.c @@ -0,0 +1,38 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + */ + +/* The implementation is based on: + * chacha-ref.c version 20080118 + * Public domain from D. J. Bernstein + */ + +#include "tomcrypt.h" + +#ifdef LTC_CHACHA + +/** + Generate a stream of random bytes via ChaCha + @param st The ChaCha20 state + @param out [out] The output buffer + @param outlen The output length + @return CRYPT_OK on success + */ +int chacha_keystream(chacha_state *st, unsigned char *out, unsigned long outlen) +{ + if (outlen == 0) return CRYPT_OK; /* nothing to do */ + LTC_ARGCHK(out != NULL); + XMEMSET(out, 0, outlen); + return chacha_crypt(st, out, outlen, out); +} + +#endif + +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/stream/chacha/chacha_setup.c b/libtomcrypt/src/stream/chacha/chacha_setup.c new file mode 100644 index 0000000..e34370b --- /dev/null +++ b/libtomcrypt/src/stream/chacha/chacha_setup.c @@ -0,0 +1,67 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + */ + +/* The implementation is based on: + * chacha-ref.c version 20080118 + * Public domain from D. J. Bernstein + */ + +#include "tomcrypt.h" + +#ifdef LTC_CHACHA + +static const char * const sigma = "expand 32-byte k"; +static const char * const tau = "expand 16-byte k"; + +/** + Initialize an ChaCha context (only the key) + @param st [out] The destination of the ChaCha state + @param key The secret key + @param keylen The length of the secret key (octets) + @param rounds Number of rounds (e.g. 20 for ChaCha20) + @return CRYPT_OK if successful +*/ +int chacha_setup(chacha_state *st, const unsigned char *key, unsigned long keylen, int rounds) +{ + const char *constants; + + LTC_ARGCHK(st != NULL); + LTC_ARGCHK(key != NULL); + LTC_ARGCHK(keylen == 32 || keylen == 16); + + if (rounds == 0) rounds = 20; + + LOAD32L(st->input[4], key + 0); + LOAD32L(st->input[5], key + 4); + LOAD32L(st->input[6], key + 8); + LOAD32L(st->input[7], key + 12); + if (keylen == 32) { /* 256bit */ + key += 16; + constants = sigma; + } else { /* 128bit */ + constants = tau; + } + LOAD32L(st->input[8], key + 0); + LOAD32L(st->input[9], key + 4); + LOAD32L(st->input[10], key + 8); + LOAD32L(st->input[11], key + 12); + LOAD32L(st->input[0], constants + 0); + LOAD32L(st->input[1], constants + 4); + LOAD32L(st->input[2], constants + 8); + LOAD32L(st->input[3], constants + 12); + st->rounds = rounds; /* e.g. 20 for chacha20 */ + st->ivlen = 0; /* will be set later by chacha_ivctr(32|64) */ + return CRYPT_OK; +} + +#endif + +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/stream/chacha/chacha_test.c b/libtomcrypt/src/stream/chacha/chacha_test.c new file mode 100644 index 0000000..649ebf9 --- /dev/null +++ b/libtomcrypt/src/stream/chacha/chacha_test.c @@ -0,0 +1,71 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + */ + +/* The implementation is based on: + * chacha-ref.c version 20080118 + * Public domain from D. J. Bernstein + */ + +#include "tomcrypt.h" + +#ifdef LTC_CHACHA + +int chacha_test(void) +{ +#ifndef LTC_TEST + return CRYPT_NOP; +#else + unsigned long len; + unsigned char out[1000]; + /* https://tools.ietf.org/html/rfc7539#section-2.4.2 */ + unsigned char k[] = { 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07, 0x08, 0x09, 0x0a, 0x0b, 0x0c, 0x0d, 0x0e, 0x0f, + 0x10, 0x11, 0x12, 0x13, 0x14, 0x15, 0x16, 0x17, 0x18, 0x19, 0x1a, 0x1b, 0x1c, 0x1d, 0x1e, 0x1f }; + unsigned char n[] = { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x4a, 0x00, 0x00, 0x00, 0x00 }; + unsigned char ct[] = { 0x6E, 0x2E, 0x35, 0x9A, 0x25, 0x68, 0xF9, 0x80, 0x41, 0xBA, 0x07, 0x28, 0xDD, 0x0D, 0x69, 0x81, + 0xE9, 0x7E, 0x7A, 0xEC, 0x1D, 0x43, 0x60, 0xC2, 0x0A, 0x27, 0xAF, 0xCC, 0xFD, 0x9F, 0xAE, 0x0B, + 0xF9, 0x1B, 0x65, 0xC5, 0x52, 0x47, 0x33, 0xAB, 0x8F, 0x59, 0x3D, 0xAB, 0xCD, 0x62, 0xB3, 0x57, + 0x16, 0x39, 0xD6, 0x24, 0xE6, 0x51, 0x52, 0xAB, 0x8F, 0x53, 0x0C, 0x35, 0x9F, 0x08, 0x61, 0xD8, + 0x07, 0xCA, 0x0D, 0xBF, 0x50, 0x0D, 0x6A, 0x61, 0x56, 0xA3, 0x8E, 0x08, 0x8A, 0x22, 0xB6, 0x5E, + 0x52, 0xBC, 0x51, 0x4D, 0x16, 0xCC, 0xF8, 0x06, 0x81, 0x8C, 0xE9, 0x1A, 0xB7, 0x79, 0x37, 0x36, + 0x5A, 0xF9, 0x0B, 0xBF, 0x74, 0xA3, 0x5B, 0xE6, 0xB4, 0x0B, 0x8E, 0xED, 0xF2, 0x78, 0x5E, 0x42, + 0x87, 0x4D }; + char pt[] = "Ladies and Gentlemen of the class of '99: If I could offer you only one tip for the future, sunscreen would be it."; + chacha_state st; + int err; + + len = strlen(pt); + /* crypt piece by piece */ + if ((err = chacha_setup(&st, k, sizeof(k), 20)) != CRYPT_OK) return err; + if ((err = chacha_ivctr32(&st, n, sizeof(n), 1)) != CRYPT_OK) return err; + if ((err = chacha_crypt(&st, (unsigned char*)pt, 35, out)) != CRYPT_OK) return err; + if ((err = chacha_crypt(&st, (unsigned char*)pt + 35, 35, out + 35)) != CRYPT_OK) return err; + if ((err = chacha_crypt(&st, (unsigned char*)pt + 70, 5, out + 70)) != CRYPT_OK) return err; + if ((err = chacha_crypt(&st, (unsigned char*)pt + 75, 5, out + 75)) != CRYPT_OK) return err; + if ((err = chacha_crypt(&st, (unsigned char*)pt + 80, len - 80, out + 80)) != CRYPT_OK) return err; + if (compare_testvector(out, len, ct, sizeof(ct), "CHACHA-TV1", 1)) return CRYPT_FAIL_TESTVECTOR; + /* crypt in one go */ + if ((err = chacha_setup(&st, k, sizeof(k), 20)) != CRYPT_OK) return err; + if ((err = chacha_ivctr32(&st, n, sizeof(n), 1)) != CRYPT_OK) return err; + if ((err = chacha_crypt(&st, (unsigned char*)pt, len, out)) != CRYPT_OK) return err; + if (compare_testvector(out, len, ct, sizeof(ct), "CHACHA-TV2", 1)) return CRYPT_FAIL_TESTVECTOR; + /* crypt in one go - using chacha_ivctr64() */ + if ((err = chacha_setup(&st, k, sizeof(k), 20)) != CRYPT_OK) return err; + if ((err = chacha_ivctr64(&st, n + 4, sizeof(n) - 4, 1)) != CRYPT_OK) return err; + if ((err = chacha_crypt(&st, (unsigned char*)pt, len, out)) != CRYPT_OK) return err; + if (compare_testvector(out, len, ct, sizeof(ct), "CHACHA-TV3", 1)) return CRYPT_FAIL_TESTVECTOR; + + return CRYPT_OK; +#endif +} + +#endif + +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/stream/rc4/rc4_stream.c b/libtomcrypt/src/stream/rc4/rc4_stream.c new file mode 100644 index 0000000..178489d --- /dev/null +++ b/libtomcrypt/src/stream/rc4/rc4_stream.c @@ -0,0 +1,111 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + */ + +#include "tomcrypt.h" + +#ifdef LTC_RC4_STREAM + +/** + Initialize an RC4 context (only the key) + @param st [out] The destination of the RC4 state + @param key The secret key + @param keylen The length of the secret key (8 - 256 bytes) + @return CRYPT_OK if successful +*/ +int rc4_stream_setup(rc4_state *st, const unsigned char *key, unsigned long keylen) +{ + unsigned char tmp, *s; + int x, y; + unsigned long j; + + LTC_ARGCHK(st != NULL); + LTC_ARGCHK(key != NULL); + LTC_ARGCHK(keylen >= 5); /* 40-2048 bits */ + + s = st->buf; + for (x = 0; x < 256; x++) { + s[x] = x; + } + + for (j = x = y = 0; x < 256; x++) { + y = (y + s[x] + key[j++]) & 255; + if (j == keylen) { + j = 0; + } + tmp = s[x]; s[x] = s[y]; s[y] = tmp; + } + st->x = 0; + st->y = 0; + + return CRYPT_OK; +} + +/** + Encrypt (or decrypt) bytes of ciphertext (or plaintext) with RC4 + @param st The RC4 state + @param in The plaintext (or ciphertext) + @param inlen The length of the input (octets) + @param out [out] The ciphertext (or plaintext), length inlen + @return CRYPT_OK if successful +*/ +int rc4_stream_crypt(rc4_state *st, const unsigned char *in, unsigned long inlen, unsigned char *out) +{ + unsigned char x, y, *s, tmp; + + LTC_ARGCHK(st != NULL); + LTC_ARGCHK(in != NULL); + LTC_ARGCHK(out != NULL); + + x = st->x; + y = st->y; + s = st->buf; + while (inlen--) { + x = (x + 1) & 255; + y = (y + s[x]) & 255; + tmp = s[x]; s[x] = s[y]; s[y] = tmp; + tmp = (s[x] + s[y]) & 255; + *out++ = *in++ ^ s[tmp]; + } + st->x = x; + st->y = y; + return CRYPT_OK; +} + +/** + Generate a stream of random bytes via RC4 + @param st The RC420 state + @param out [out] The output buffer + @param outlen The output length + @return CRYPT_OK on success + */ +int rc4_stream_keystream(rc4_state *st, unsigned char *out, unsigned long outlen) +{ + if (outlen == 0) return CRYPT_OK; /* nothing to do */ + LTC_ARGCHK(out != NULL); + XMEMSET(out, 0, outlen); + return rc4_stream_crypt(st, out, outlen, out); +} + +/** + Terminate and clear RC4 state + @param st The RC4 state + @return CRYPT_OK on success +*/ +int rc4_stream_done(rc4_state *st) +{ + LTC_ARGCHK(st != NULL); + XMEMSET(st, 0, sizeof(rc4_state)); + return CRYPT_OK; +} + +#endif + +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/stream/rc4/rc4_test.c b/libtomcrypt/src/stream/rc4/rc4_test.c new file mode 100644 index 0000000..a7e4887 --- /dev/null +++ b/libtomcrypt/src/stream/rc4/rc4_test.c @@ -0,0 +1,39 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + */ + +#include "tomcrypt.h" + +#ifdef LTC_RC4_STREAM + +int rc4_stream_test(void) +{ +#ifndef LTC_TEST + return CRYPT_NOP; +#else + rc4_state st; + int err; + const unsigned char key[] = { 0x01, 0x23, 0x45, 0x67, 0x89, 0xab, 0xcd, 0xef }; + const unsigned char pt[] = { 0x01, 0x23, 0x45, 0x67, 0x89, 0xab, 0xcd, 0xef }; + const unsigned char ct[] = { 0x75, 0xb7, 0x87, 0x80, 0x99, 0xe0, 0xc5, 0x96 }; + unsigned char buf[10]; + + if ((err = rc4_stream_setup(&st, key, sizeof(key))) != CRYPT_OK) return err; + if ((err = rc4_stream_crypt(&st, pt, sizeof(pt), buf)) != CRYPT_OK) return err; + if (compare_testvector(buf, sizeof(ct), ct, sizeof(ct), "RC4", 0)) return CRYPT_FAIL_TESTVECTOR; + if ((err = rc4_stream_done(&st)) != CRYPT_OK) return err; + + return CRYPT_OK; +#endif +} + +#endif + +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/stream/sober128/sober128_stream.c b/libtomcrypt/src/stream/sober128/sober128_stream.c new file mode 100644 index 0000000..5c35eda --- /dev/null +++ b/libtomcrypt/src/stream/sober128/sober128_stream.c @@ -0,0 +1,346 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + */ +#include "tomcrypt.h" + +/** + @file sober128_stream.c + Implementation of SOBER-128 by Tom St Denis. + Based on s128fast.c reference code supplied by Greg Rose of QUALCOMM. +*/ + +#ifdef LTC_SOBER128 + +#define __LTC_SOBER128TAB_C__ +#include "sober128tab.c" + +/* don't change these... */ +#define N 17 +#define FOLD N /* how many iterations of folding to do */ +#define INITKONST 0x6996c53a /* value of KONST to use during key loading */ +#define KEYP 15 /* where to insert key words */ +#define FOLDP 4 /* where to insert non-linear feedback */ + +#define B(x,i) ((unsigned char)(((x) >> (8*i)) & 0xFF)) + +static ulong32 BYTE2WORD(unsigned char *b) +{ + ulong32 t; + LOAD32L(t, b); + return t; +} + +static void XORWORD(ulong32 w, const unsigned char *in, unsigned char *out) +{ + ulong32 t; + LOAD32L(t, in); + t ^= w; + STORE32L(t, out); +} + +/* give correct offset for the current position of the register, + * where logically R[0] is at position "zero". + */ +#define OFF(zero, i) (((zero)+(i)) % N) + +/* step the LFSR */ +/* After stepping, "zero" moves right one place */ +#define STEP(R,z) \ + R[OFF(z,0)] = R[OFF(z,15)] ^ R[OFF(z,4)] ^ (R[OFF(z,0)] << 8) ^ Multab[(R[OFF(z,0)] >> 24) & 0xFF]; + +static void cycle(ulong32 *R) +{ + ulong32 t; + int i; + + STEP(R,0); + t = R[0]; + for (i = 1; i < N; ++i) { + R[i-1] = R[i]; + } + R[N-1] = t; +} + +/* Return a non-linear function of some parts of the register. + */ +#define NLFUNC(c,z) \ +{ \ + t = c->R[OFF(z,0)] + c->R[OFF(z,16)]; \ + t ^= Sbox[(t >> 24) & 0xFF]; \ + t = RORc(t, 8); \ + t = ((t + c->R[OFF(z,1)]) ^ c->konst) + c->R[OFF(z,6)]; \ + t ^= Sbox[(t >> 24) & 0xFF]; \ + t = t + c->R[OFF(z,13)]; \ +} + +static ulong32 nltap(sober128_state *c) +{ + ulong32 t; + NLFUNC(c, 0); + return t; +} + +/* Save the current register state + */ +static void s128_savestate(sober128_state *c) +{ + int i; + for (i = 0; i < N; ++i) { + c->initR[i] = c->R[i]; + } +} + +/* initialise to previously saved register state + */ +static void s128_reloadstate(sober128_state *c) +{ + int i; + + for (i = 0; i < N; ++i) { + c->R[i] = c->initR[i]; + } +} + +/* Initialise "konst" + */ +static void s128_genkonst(sober128_state *c) +{ + ulong32 newkonst; + + do { + cycle(c->R); + newkonst = nltap(c); + } while ((newkonst & 0xFF000000) == 0); + c->konst = newkonst; +} + +/* Load key material into the register + */ +#define ADDKEY(k) \ + c->R[KEYP] += (k); + +#define XORNL(nl) \ + c->R[FOLDP] ^= (nl); + +/* nonlinear diffusion of register for key */ +#define DROUND(z) STEP(c->R,z); NLFUNC(c,(z+1)); c->R[OFF((z+1),FOLDP)] ^= t; +static void s128_diffuse(sober128_state *c) +{ + ulong32 t; + /* relies on FOLD == N == 17! */ + DROUND(0); + DROUND(1); + DROUND(2); + DROUND(3); + DROUND(4); + DROUND(5); + DROUND(6); + DROUND(7); + DROUND(8); + DROUND(9); + DROUND(10); + DROUND(11); + DROUND(12); + DROUND(13); + DROUND(14); + DROUND(15); + DROUND(16); +} + +/** + Initialize an Sober128 context (only the key) + @param c [out] The destination of the Sober128 state + @param key The secret key + @param keylen The length of the secret key (octets) + @return CRYPT_OK if successful +*/ +int sober128_stream_setup(sober128_state *c, const unsigned char *key, unsigned long keylen) +{ + ulong32 i, k; + + LTC_ARGCHK(c != NULL); + LTC_ARGCHK(key != NULL); + LTC_ARGCHK(keylen > 0); + + /* keylen must be multiple of 4 bytes */ + if ((keylen & 3) != 0) { + return CRYPT_INVALID_KEYSIZE; + } + + /* Register initialised to Fibonacci numbers */ + c->R[0] = 1; + c->R[1] = 1; + for (i = 2; i < N; ++i) { + c->R[i] = c->R[i-1] + c->R[i-2]; + } + c->konst = INITKONST; + + for (i = 0; i < keylen; i += 4) { + k = BYTE2WORD((unsigned char *)&key[i]); + ADDKEY(k); + cycle(c->R); + XORNL(nltap(c)); + } + + /* also fold in the length of the key */ + ADDKEY(keylen); + + /* now diffuse */ + s128_diffuse(c); + s128_genkonst(c); + s128_savestate(c); + c->nbuf = 0; + + return CRYPT_OK; +} + +/** + Set IV to the Sober128 state + @param c The Sober12820 state + @param iv The IV data to add + @param ivlen The length of the IV (must be 12) + @return CRYPT_OK on success + */ +int sober128_stream_setiv(sober128_state *c, const unsigned char *iv, unsigned long ivlen) +{ + ulong32 i, k; + + LTC_ARGCHK(c != NULL); + LTC_ARGCHK(iv != NULL); + LTC_ARGCHK(ivlen > 0); + + /* ok we are adding an IV then... */ + s128_reloadstate(c); + + /* ivlen must be multiple of 4 bytes */ + if ((ivlen & 3) != 0) { + return CRYPT_INVALID_KEYSIZE; + } + + for (i = 0; i < ivlen; i += 4) { + k = BYTE2WORD((unsigned char *)&iv[i]); + ADDKEY(k); + cycle(c->R); + XORNL(nltap(c)); + } + + /* also fold in the length of the key */ + ADDKEY(ivlen); + + /* now diffuse */ + s128_diffuse(c); + c->nbuf = 0; + + return CRYPT_OK; +} + +/* XOR pseudo-random bytes into buffer + */ +#define SROUND(z) STEP(c->R,z); NLFUNC(c,(z+1)); XORWORD(t, in+(z*4), out+(z*4)); + +/** + Encrypt (or decrypt) bytes of ciphertext (or plaintext) with Sober128 + @param c The Sober128 state + @param in The plaintext (or ciphertext) + @param inlen The length of the input (octets) + @param out [out] The ciphertext (or plaintext), length inlen + @return CRYPT_OK if successful +*/ +int sober128_stream_crypt(sober128_state *c, const unsigned char *in, unsigned long inlen, unsigned char *out) +{ + ulong32 t; + + if (inlen == 0) return CRYPT_OK; /* nothing to do */ + LTC_ARGCHK(out != NULL); + LTC_ARGCHK(c != NULL); + + /* handle any previously buffered bytes */ + while (c->nbuf != 0 && inlen != 0) { + *out++ = *in++ ^ (unsigned char)(c->sbuf & 0xFF); + c->sbuf >>= 8; + c->nbuf -= 8; + --inlen; + } + +#ifndef LTC_SMALL_CODE + /* do lots at a time, if there's enough to do */ + while (inlen >= N*4) { + SROUND(0); + SROUND(1); + SROUND(2); + SROUND(3); + SROUND(4); + SROUND(5); + SROUND(6); + SROUND(7); + SROUND(8); + SROUND(9); + SROUND(10); + SROUND(11); + SROUND(12); + SROUND(13); + SROUND(14); + SROUND(15); + SROUND(16); + out += 4*N; + in += 4*N; + inlen -= 4*N; + } +#endif + + /* do small or odd size buffers the slow way */ + while (4 <= inlen) { + cycle(c->R); + t = nltap(c); + XORWORD(t, in, out); + out += 4; + in += 4; + inlen -= 4; + } + + /* handle any trailing bytes */ + if (inlen != 0) { + cycle(c->R); + c->sbuf = nltap(c); + c->nbuf = 32; + while (c->nbuf != 0 && inlen != 0) { + *out++ = *in++ ^ (unsigned char)(c->sbuf & 0xFF); + c->sbuf >>= 8; + c->nbuf -= 8; + --inlen; + } + } + + return CRYPT_OK; +} + +int sober128_stream_keystream(sober128_state *c, unsigned char *out, unsigned long outlen) +{ + if (outlen == 0) return CRYPT_OK; /* nothing to do */ + LTC_ARGCHK(out != NULL); + XMEMSET(out, 0, outlen); + return sober128_stream_crypt(c, out, outlen, out); +} + +/** + Terminate and clear Sober128 state + @param c The Sober128 state + @return CRYPT_OK on success +*/ +int sober128_stream_done(sober128_state *c) +{ + LTC_ARGCHK(c != NULL); + XMEMSET(c, 0, sizeof(sober128_state)); + return CRYPT_OK; +} + +#endif + +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/stream/sober128/sober128_test.c b/libtomcrypt/src/stream/sober128/sober128_test.c new file mode 100644 index 0000000..32ea461 --- /dev/null +++ b/libtomcrypt/src/stream/sober128/sober128_test.c @@ -0,0 +1,45 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + */ + +#include "tomcrypt.h" + +#ifdef LTC_SOBER128 + +int sober128_stream_test(void) +{ +#ifndef LTC_TEST + return CRYPT_NOP; +#else + unsigned char key[16] = { 0x74, 0x65, 0x73, 0x74, 0x20, 0x6b, 0x65, 0x79, + 0x20, 0x31, 0x32, 0x38, 0x62, 0x69, 0x74, 0x73 }; + unsigned char iv[4] = { 0x00, 0x00, 0x00, 0x00 }; + unsigned char out[20] = { 0x43, 0x50, 0x0c, 0xcf, 0x89, 0x91, 0x9f, 0x1d, + 0xaa, 0x37, 0x74, 0x95, 0xf4, 0xb4, 0x58, 0xc2, + 0x40, 0x37, 0x8b, 0xbb }; + int err, len = 20; + unsigned char src[20], dst[20]; + sober128_state st; + + XMEMSET(src, 0, len); /* input */ + if ((err = sober128_stream_setup(&st, key, sizeof(key))) != CRYPT_OK) return err; + if ((err = sober128_stream_setiv(&st, iv, sizeof(iv))) != CRYPT_OK) return err; + if ((err = sober128_stream_crypt(&st, src, len, dst)) != CRYPT_OK) return err; + if ((err = sober128_stream_done(&st)) != CRYPT_OK) return err; + if (compare_testvector(dst, len, out, len, "SOBER-128", 0)) { + return CRYPT_FAIL_TESTVECTOR; + } + return CRYPT_OK; +#endif +} + +#endif + +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ diff --git a/libtomcrypt/src/stream/sober128/sober128tab.c b/libtomcrypt/src/stream/sober128/sober128tab.c new file mode 100644 index 0000000..e02ff23 --- /dev/null +++ b/libtomcrypt/src/stream/sober128/sober128tab.c @@ -0,0 +1,176 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + */ + +/** + @file sober128tab.c + SOBER-128 Tables +*/ + +#ifdef __LTC_SOBER128TAB_C__ + +/* $ID$ */ +/* @(#)TuringMultab.h 1.3 (QUALCOMM) 02/09/03 */ +/* Multiplication table for Turing using 0xD02B4367 */ +static const ulong32 Multab[256] = { + 0x00000000, 0xD02B4367, 0xED5686CE, 0x3D7DC5A9, + 0x97AC41D1, 0x478702B6, 0x7AFAC71F, 0xAAD18478, + 0x631582EF, 0xB33EC188, 0x8E430421, 0x5E684746, + 0xF4B9C33E, 0x24928059, 0x19EF45F0, 0xC9C40697, + 0xC62A4993, 0x16010AF4, 0x2B7CCF5D, 0xFB578C3A, + 0x51860842, 0x81AD4B25, 0xBCD08E8C, 0x6CFBCDEB, + 0xA53FCB7C, 0x7514881B, 0x48694DB2, 0x98420ED5, + 0x32938AAD, 0xE2B8C9CA, 0xDFC50C63, 0x0FEE4F04, + 0xC154926B, 0x117FD10C, 0x2C0214A5, 0xFC2957C2, + 0x56F8D3BA, 0x86D390DD, 0xBBAE5574, 0x6B851613, + 0xA2411084, 0x726A53E3, 0x4F17964A, 0x9F3CD52D, + 0x35ED5155, 0xE5C61232, 0xD8BBD79B, 0x089094FC, + 0x077EDBF8, 0xD755989F, 0xEA285D36, 0x3A031E51, + 0x90D29A29, 0x40F9D94E, 0x7D841CE7, 0xADAF5F80, + 0x646B5917, 0xB4401A70, 0x893DDFD9, 0x59169CBE, + 0xF3C718C6, 0x23EC5BA1, 0x1E919E08, 0xCEBADD6F, + 0xCFA869D6, 0x1F832AB1, 0x22FEEF18, 0xF2D5AC7F, + 0x58042807, 0x882F6B60, 0xB552AEC9, 0x6579EDAE, + 0xACBDEB39, 0x7C96A85E, 0x41EB6DF7, 0x91C02E90, + 0x3B11AAE8, 0xEB3AE98F, 0xD6472C26, 0x066C6F41, + 0x09822045, 0xD9A96322, 0xE4D4A68B, 0x34FFE5EC, + 0x9E2E6194, 0x4E0522F3, 0x7378E75A, 0xA353A43D, + 0x6A97A2AA, 0xBABCE1CD, 0x87C12464, 0x57EA6703, + 0xFD3BE37B, 0x2D10A01C, 0x106D65B5, 0xC04626D2, + 0x0EFCFBBD, 0xDED7B8DA, 0xE3AA7D73, 0x33813E14, + 0x9950BA6C, 0x497BF90B, 0x74063CA2, 0xA42D7FC5, + 0x6DE97952, 0xBDC23A35, 0x80BFFF9C, 0x5094BCFB, + 0xFA453883, 0x2A6E7BE4, 0x1713BE4D, 0xC738FD2A, + 0xC8D6B22E, 0x18FDF149, 0x258034E0, 0xF5AB7787, + 0x5F7AF3FF, 0x8F51B098, 0xB22C7531, 0x62073656, + 0xABC330C1, 0x7BE873A6, 0x4695B60F, 0x96BEF568, + 0x3C6F7110, 0xEC443277, 0xD139F7DE, 0x0112B4B9, + 0xD31DD2E1, 0x03369186, 0x3E4B542F, 0xEE601748, + 0x44B19330, 0x949AD057, 0xA9E715FE, 0x79CC5699, + 0xB008500E, 0x60231369, 0x5D5ED6C0, 0x8D7595A7, + 0x27A411DF, 0xF78F52B8, 0xCAF29711, 0x1AD9D476, + 0x15379B72, 0xC51CD815, 0xF8611DBC, 0x284A5EDB, + 0x829BDAA3, 0x52B099C4, 0x6FCD5C6D, 0xBFE61F0A, + 0x7622199D, 0xA6095AFA, 0x9B749F53, 0x4B5FDC34, + 0xE18E584C, 0x31A51B2B, 0x0CD8DE82, 0xDCF39DE5, + 0x1249408A, 0xC26203ED, 0xFF1FC644, 0x2F348523, + 0x85E5015B, 0x55CE423C, 0x68B38795, 0xB898C4F2, + 0x715CC265, 0xA1778102, 0x9C0A44AB, 0x4C2107CC, + 0xE6F083B4, 0x36DBC0D3, 0x0BA6057A, 0xDB8D461D, + 0xD4630919, 0x04484A7E, 0x39358FD7, 0xE91ECCB0, + 0x43CF48C8, 0x93E40BAF, 0xAE99CE06, 0x7EB28D61, + 0xB7768BF6, 0x675DC891, 0x5A200D38, 0x8A0B4E5F, + 0x20DACA27, 0xF0F18940, 0xCD8C4CE9, 0x1DA70F8E, + 0x1CB5BB37, 0xCC9EF850, 0xF1E33DF9, 0x21C87E9E, + 0x8B19FAE6, 0x5B32B981, 0x664F7C28, 0xB6643F4F, + 0x7FA039D8, 0xAF8B7ABF, 0x92F6BF16, 0x42DDFC71, + 0xE80C7809, 0x38273B6E, 0x055AFEC7, 0xD571BDA0, + 0xDA9FF2A4, 0x0AB4B1C3, 0x37C9746A, 0xE7E2370D, + 0x4D33B375, 0x9D18F012, 0xA06535BB, 0x704E76DC, + 0xB98A704B, 0x69A1332C, 0x54DCF685, 0x84F7B5E2, + 0x2E26319A, 0xFE0D72FD, 0xC370B754, 0x135BF433, + 0xDDE1295C, 0x0DCA6A3B, 0x30B7AF92, 0xE09CECF5, + 0x4A4D688D, 0x9A662BEA, 0xA71BEE43, 0x7730AD24, + 0xBEF4ABB3, 0x6EDFE8D4, 0x53A22D7D, 0x83896E1A, + 0x2958EA62, 0xF973A905, 0xC40E6CAC, 0x14252FCB, + 0x1BCB60CF, 0xCBE023A8, 0xF69DE601, 0x26B6A566, + 0x8C67211E, 0x5C4C6279, 0x6131A7D0, 0xB11AE4B7, + 0x78DEE220, 0xA8F5A147, 0x958864EE, 0x45A32789, + 0xEF72A3F1, 0x3F59E096, 0x0224253F, 0xD20F6658, +}; + +/* $ID$ */ +/* Sbox for SOBER-128 */ +/* + * This is really the combination of two SBoxes; the least significant + * 24 bits comes from: + * 8->32 Sbox generated by Millan et. al. at Queensland University of + * Technology. See: E. Dawson, W. Millan, L. Burnett, G. Carter, + * "On the Design of 8*32 S-boxes". Unpublished report, by the + * Information Systems Research Centre, + * Queensland University of Technology, 1999. + * + * The most significant 8 bits are the Skipjack "F table", which can be + * found at http://csrc.nist.gov/CryptoToolkit/skipjack/skipjack.pdf . + * In this optimised table, though, the intent is to XOR the word from + * the table selected by the high byte with the input word. Thus, the + * high byte is actually the Skipjack F-table entry XORED with its + * table index. + */ +static const ulong32 Sbox[256] = { + 0xa3aa1887, 0xd65e435c, 0x0b65c042, 0x800e6ef4, + 0xfc57ee20, 0x4d84fed3, 0xf066c502, 0xf354e8ae, + 0xbb2ee9d9, 0x281f38d4, 0x1f829b5d, 0x735cdf3c, + 0x95864249, 0xbc2e3963, 0xa1f4429f, 0xf6432c35, + 0xf7f40325, 0x3cc0dd70, 0x5f973ded, 0x9902dc5e, + 0xda175b42, 0x590012bf, 0xdc94d78c, 0x39aab26b, + 0x4ac11b9a, 0x8c168146, 0xc3ea8ec5, 0x058ac28f, + 0x52ed5c0f, 0x25b4101c, 0x5a2db082, 0x370929e1, + 0x2a1843de, 0xfe8299fc, 0x202fbc4b, 0x833915dd, + 0x33a803fa, 0xd446b2de, 0x46233342, 0x4fcee7c3, + 0x3ad607ef, 0x9e97ebab, 0x507f859b, 0xe81f2e2f, + 0xc55b71da, 0xd7e2269a, 0x1339c3d1, 0x7ca56b36, + 0xa6c9def2, 0xb5c9fc5f, 0x5927b3a3, 0x89a56ddf, + 0xc625b510, 0x560f85a7, 0xace82e71, 0x2ecb8816, + 0x44951e2a, 0x97f5f6af, 0xdfcbc2b3, 0xce4ff55d, + 0xcb6b6214, 0x2b0b83e3, 0x549ea6f5, 0x9de041af, + 0x792f1f17, 0xf73b99ee, 0x39a65ec0, 0x4c7016c6, + 0x857709a4, 0xd6326e01, 0xc7b280d9, 0x5cfb1418, + 0xa6aff227, 0xfd548203, 0x506b9d96, 0xa117a8c0, + 0x9cd5bf6e, 0xdcee7888, 0x61fcfe64, 0xf7a193cd, + 0x050d0184, 0xe8ae4930, 0x88014f36, 0xd6a87088, + 0x6bad6c2a, 0x1422c678, 0xe9204de7, 0xb7c2e759, + 0x0200248e, 0x013b446b, 0xda0d9fc2, 0x0414a895, + 0x3a6cc3a1, 0x56fef170, 0x86c19155, 0xcf7b8a66, + 0x551b5e69, 0xb4a8623e, 0xa2bdfa35, 0xc4f068cc, + 0x573a6acd, 0x6355e936, 0x03602db9, 0x0edf13c1, + 0x2d0bb16d, 0x6980b83c, 0xfeb23763, 0x3dd8a911, + 0x01b6bc13, 0xf55579d7, 0xf55c2fa8, 0x19f4196e, + 0xe7db5476, 0x8d64a866, 0xc06e16ad, 0xb17fc515, + 0xc46feb3c, 0x8bc8a306, 0xad6799d9, 0x571a9133, + 0x992466dd, 0x92eb5dcd, 0xac118f50, 0x9fafb226, + 0xa1b9cef3, 0x3ab36189, 0x347a19b1, 0x62c73084, + 0xc27ded5c, 0x6c8bc58f, 0x1cdde421, 0xed1e47fb, + 0xcdcc715e, 0xb9c0ff99, 0x4b122f0f, 0xc4d25184, + 0xaf7a5e6c, 0x5bbf18bc, 0x8dd7c6e0, 0x5fb7e420, + 0x521f523f, 0x4ad9b8a2, 0xe9da1a6b, 0x97888c02, + 0x19d1e354, 0x5aba7d79, 0xa2cc7753, 0x8c2d9655, + 0x19829da1, 0x531590a7, 0x19c1c149, 0x3d537f1c, + 0x50779b69, 0xed71f2b7, 0x463c58fa, 0x52dc4418, + 0xc18c8c76, 0xc120d9f0, 0xafa80d4d, 0x3b74c473, + 0xd09410e9, 0x290e4211, 0xc3c8082b, 0x8f6b334a, + 0x3bf68ed2, 0xa843cc1b, 0x8d3c0ff3, 0x20e564a0, + 0xf8f55a4f, 0x2b40f8e7, 0xfea7f15f, 0xcf00fe21, + 0x8a6d37d6, 0xd0d506f1, 0xade00973, 0xefbbde36, + 0x84670fa8, 0xfa31ab9e, 0xaedab618, 0xc01f52f5, + 0x6558eb4f, 0x71b9e343, 0x4b8d77dd, 0x8cb93da6, + 0x740fd52d, 0x425412f8, 0xc5a63360, 0x10e53ad0, + 0x5a700f1c, 0x8324ed0b, 0xe53dc1ec, 0x1a366795, + 0x6d549d15, 0xc5ce46d7, 0xe17abe76, 0x5f48e0a0, + 0xd0f07c02, 0x941249b7, 0xe49ed6ba, 0x37a47f78, + 0xe1cfffbd, 0xb007ca84, 0xbb65f4da, 0xb59f35da, + 0x33d2aa44, 0x417452ac, 0xc0d674a7, 0x2d61a46a, + 0xdc63152a, 0x3e12b7aa, 0x6e615927, 0xa14fb118, + 0xa151758d, 0xba81687b, 0xe152f0b3, 0x764254ed, + 0x34c77271, 0x0a31acab, 0x54f94aec, 0xb9e994cd, + 0x574d9e81, 0x5b623730, 0xce8a21e8, 0x37917f0b, + 0xe8a9b5d6, 0x9697adf8, 0xf3d30431, 0x5dcac921, + 0x76b35d46, 0xaa430a36, 0xc2194022, 0x22bca65e, + 0xdaec70ba, 0xdfaea8cc, 0x777bae8b, 0x242924d5, + 0x1f098a5a, 0x4b396b81, 0x55de2522, 0x435c1cb8, + 0xaeb8fe1d, 0x9db3c697, 0x5b164f83, 0xe0c16376, + 0xa319224c, 0xd0203b35, 0x433ac0fe, 0x1466a19a, + 0x45f0b24f, 0x51fda998, 0xc0d52d71, 0xfa0896a8, + 0xf9e6053f, 0xa4b0d300, 0xd499cbcc, 0xb95e3d40, +}; + +#endif /* __LTC_SOBER128TAB_C__ */ + +/* ref: $Format:%D$ */ +/* git commit: $Format:%H$ */ +/* commit time: $Format:%ai$ */ |