summaryrefslogtreecommitdiffhomepage
path: root/libtomcrypt/src/hashes/sha2
diff options
context:
space:
mode:
Diffstat (limited to 'libtomcrypt/src/hashes/sha2')
-rw-r--r--libtomcrypt/src/hashes/sha2/sha224.c124
-rw-r--r--libtomcrypt/src/hashes/sha2/sha256.c339
-rw-r--r--libtomcrypt/src/hashes/sha2/sha384.c134
-rw-r--r--libtomcrypt/src/hashes/sha2/sha512.c318
4 files changed, 915 insertions, 0 deletions
diff --git a/libtomcrypt/src/hashes/sha2/sha224.c b/libtomcrypt/src/hashes/sha2/sha224.c
new file mode 100644
index 0000000..bff2fdf
--- /dev/null
+++ b/libtomcrypt/src/hashes/sha2/sha224.c
@@ -0,0 +1,124 @@
+/* LibTomCrypt, modular cryptographic library -- Tom St Denis
+ *
+ * LibTomCrypt is a library that provides various cryptographic
+ * algorithms in a highly modular and flexible manner.
+ *
+ * The library is free for all purposes without any express
+ * guarantee it works.
+ *
+ * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.org
+ */
+/**
+ @param sha224.c
+ SHA-224 new NIST standard based off of SHA-256 truncated to 224 bits (Tom St Denis)
+*/
+
+const struct ltc_hash_descriptor sha224_desc =
+{
+ "sha224",
+ 10,
+ 28,
+ 64,
+
+ /* OID */
+ { 2, 16, 840, 1, 101, 3, 4, 2, 4, },
+ 9,
+
+ &sha224_init,
+ &sha256_process,
+ &sha224_done,
+ &sha224_test
+};
+
+/* init the sha256 er... sha224 state ;-) */
+/**
+ Initialize the hash state
+ @param md The hash state you wish to initialize
+ @return CRYPT_OK if successful
+*/
+int sha224_init(hash_state * md)
+{
+ LTC_ARGCHK(md != NULL);
+
+ md->sha256.curlen = 0;
+ md->sha256.length = 0;
+ md->sha256.state[0] = 0xc1059ed8UL;
+ md->sha256.state[1] = 0x367cd507UL;
+ md->sha256.state[2] = 0x3070dd17UL;
+ md->sha256.state[3] = 0xf70e5939UL;
+ md->sha256.state[4] = 0xffc00b31UL;
+ md->sha256.state[5] = 0x68581511UL;
+ md->sha256.state[6] = 0x64f98fa7UL;
+ md->sha256.state[7] = 0xbefa4fa4UL;
+ return CRYPT_OK;
+}
+
+/**
+ Terminate the hash to get the digest
+ @param md The hash state
+ @param out [out] The destination of the hash (28 bytes)
+ @return CRYPT_OK if successful
+*/
+int sha224_done(hash_state * md, unsigned char *out)
+{
+ unsigned char buf[32];
+ int err;
+
+ LTC_ARGCHK(md != NULL);
+ LTC_ARGCHK(out != NULL);
+
+ err = sha256_done(md, buf);
+ XMEMCPY(out, buf, 28);
+#ifdef LTC_CLEAN_STACK
+ zeromem(buf, sizeof(buf));
+#endif
+ return err;
+}
+
+/**
+ Self-test the hash
+ @return CRYPT_OK if successful, CRYPT_NOP if self-tests have been disabled
+*/
+int sha224_test(void)
+{
+ #ifndef LTC_TEST
+ return CRYPT_NOP;
+ #else
+ static const struct {
+ char *msg;
+ unsigned char hash[28];
+ } tests[] = {
+ { "abc",
+ { 0x23, 0x09, 0x7d, 0x22, 0x34, 0x05, 0xd8,
+ 0x22, 0x86, 0x42, 0xa4, 0x77, 0xbd, 0xa2,
+ 0x55, 0xb3, 0x2a, 0xad, 0xbc, 0xe4, 0xbd,
+ 0xa0, 0xb3, 0xf7, 0xe3, 0x6c, 0x9d, 0xa7 }
+ },
+ { "abcdbcdecdefdefgefghfghighijhijkijkljklmklmnlmnomnopnopq",
+ { 0x75, 0x38, 0x8b, 0x16, 0x51, 0x27, 0x76,
+ 0xcc, 0x5d, 0xba, 0x5d, 0xa1, 0xfd, 0x89,
+ 0x01, 0x50, 0xb0, 0xc6, 0x45, 0x5c, 0xb4,
+ 0xf5, 0x8b, 0x19, 0x52, 0x52, 0x25, 0x25 }
+ },
+ };
+
+ int i;
+ unsigned char tmp[28];
+ hash_state md;
+
+ for (i = 0; i < (int)(sizeof(tests) / sizeof(tests[0])); i++) {
+ sha224_init(&md);
+ sha224_process(&md, (unsigned char*)tests[i].msg, (unsigned long)strlen(tests[i].msg));
+ sha224_done(&md, tmp);
+ if (memcmp(tmp, tests[i].hash, 28) != 0) {
+ return CRYPT_FAIL_TESTVECTOR;
+ }
+ }
+ return CRYPT_OK;
+ #endif
+}
+
+
+/* $Source: /cvs/libtom/libtomcrypt/src/hashes/sha2/sha224.c,v $ */
+/* $Revision: 1.5 $ */
+/* $Date: 2005/05/23 02:42:07 $ */
diff --git a/libtomcrypt/src/hashes/sha2/sha256.c b/libtomcrypt/src/hashes/sha2/sha256.c
new file mode 100644
index 0000000..c48c0f6
--- /dev/null
+++ b/libtomcrypt/src/hashes/sha2/sha256.c
@@ -0,0 +1,339 @@
+/* LibTomCrypt, modular cryptographic library -- Tom St Denis
+ *
+ * LibTomCrypt is a library that provides various cryptographic
+ * algorithms in a highly modular and flexible manner.
+ *
+ * The library is free for all purposes without any express
+ * guarantee it works.
+ *
+ * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.org
+ */
+#include "tomcrypt.h"
+
+/**
+ @file sha256.c
+ SHA256 by Tom St Denis
+*/
+
+#ifdef SHA256
+
+const struct ltc_hash_descriptor sha256_desc =
+{
+ "sha256",
+ 0,
+ 32,
+ 64,
+
+ /* OID */
+ { 2, 16, 840, 1, 101, 3, 4, 2, 1, },
+ 9,
+
+ &sha256_init,
+ &sha256_process,
+ &sha256_done,
+ &sha256_test
+};
+
+#ifdef LTC_SMALL_CODE
+/* the K array */
+static const unsigned long K[64] = {
+ 0x428a2f98UL, 0x71374491UL, 0xb5c0fbcfUL, 0xe9b5dba5UL, 0x3956c25bUL,
+ 0x59f111f1UL, 0x923f82a4UL, 0xab1c5ed5UL, 0xd807aa98UL, 0x12835b01UL,
+ 0x243185beUL, 0x550c7dc3UL, 0x72be5d74UL, 0x80deb1feUL, 0x9bdc06a7UL,
+ 0xc19bf174UL, 0xe49b69c1UL, 0xefbe4786UL, 0x0fc19dc6UL, 0x240ca1ccUL,
+ 0x2de92c6fUL, 0x4a7484aaUL, 0x5cb0a9dcUL, 0x76f988daUL, 0x983e5152UL,
+ 0xa831c66dUL, 0xb00327c8UL, 0xbf597fc7UL, 0xc6e00bf3UL, 0xd5a79147UL,
+ 0x06ca6351UL, 0x14292967UL, 0x27b70a85UL, 0x2e1b2138UL, 0x4d2c6dfcUL,
+ 0x53380d13UL, 0x650a7354UL, 0x766a0abbUL, 0x81c2c92eUL, 0x92722c85UL,
+ 0xa2bfe8a1UL, 0xa81a664bUL, 0xc24b8b70UL, 0xc76c51a3UL, 0xd192e819UL,
+ 0xd6990624UL, 0xf40e3585UL, 0x106aa070UL, 0x19a4c116UL, 0x1e376c08UL,
+ 0x2748774cUL, 0x34b0bcb5UL, 0x391c0cb3UL, 0x4ed8aa4aUL, 0x5b9cca4fUL,
+ 0x682e6ff3UL, 0x748f82eeUL, 0x78a5636fUL, 0x84c87814UL, 0x8cc70208UL,
+ 0x90befffaUL, 0xa4506cebUL, 0xbef9a3f7UL, 0xc67178f2UL
+};
+#endif
+
+/* Various logical functions */
+#define Ch(x,y,z) (z ^ (x & (y ^ z)))
+#define Maj(x,y,z) (((x | y) & z) | (x & y))
+#define S(x, n) RORc((x),(n))
+#define R(x, n) (((x)&0xFFFFFFFFUL)>>(n))
+#define Sigma0(x) (S(x, 2) ^ S(x, 13) ^ S(x, 22))
+#define Sigma1(x) (S(x, 6) ^ S(x, 11) ^ S(x, 25))
+#define Gamma0(x) (S(x, 7) ^ S(x, 18) ^ R(x, 3))
+#define Gamma1(x) (S(x, 17) ^ S(x, 19) ^ R(x, 10))
+
+/* compress 512-bits */
+#ifdef LTC_CLEAN_STACK
+static int _sha256_compress(hash_state * md, unsigned char *buf)
+#else
+static int sha256_compress(hash_state * md, unsigned char *buf)
+#endif
+{
+ ulong32 S[8], W[64], t0, t1;
+#ifdef LTC_SMALL_CODE
+ ulong32 t;
+#endif
+ int i;
+
+ /* copy state into S */
+ for (i = 0; i < 8; i++) {
+ S[i] = md->sha256.state[i];
+ }
+
+ /* copy the state into 512-bits into W[0..15] */
+ for (i = 0; i < 16; i++) {
+ LOAD32H(W[i], buf + (4*i));
+ }
+
+ /* fill W[16..63] */
+ for (i = 16; i < 64; i++) {
+ W[i] = Gamma1(W[i - 2]) + W[i - 7] + Gamma0(W[i - 15]) + W[i - 16];
+ }
+
+ /* Compress */
+#ifdef LTC_SMALL_CODE
+#define RND(a,b,c,d,e,f,g,h,i) \
+ t0 = h + Sigma1(e) + Ch(e, f, g) + K[i] + W[i]; \
+ t1 = Sigma0(a) + Maj(a, b, c); \
+ d += t0; \
+ h = t0 + t1;
+
+ for (i = 0; i < 64; ++i) {
+ RND(S[0],S[1],S[2],S[3],S[4],S[5],S[6],S[7],i);
+ t = S[7]; S[7] = S[6]; S[6] = S[5]; S[5] = S[4];
+ S[4] = S[3]; S[3] = S[2]; S[2] = S[1]; S[1] = S[0]; S[0] = t;
+ }
+#else
+#define RND(a,b,c,d,e,f,g,h,i,ki) \
+ t0 = h + Sigma1(e) + Ch(e, f, g) + ki + W[i]; \
+ t1 = Sigma0(a) + Maj(a, b, c); \
+ d += t0; \
+ h = t0 + t1;
+
+ RND(S[0],S[1],S[2],S[3],S[4],S[5],S[6],S[7],0,0x428a2f98);
+ RND(S[7],S[0],S[1],S[2],S[3],S[4],S[5],S[6],1,0x71374491);
+ RND(S[6],S[7],S[0],S[1],S[2],S[3],S[4],S[5],2,0xb5c0fbcf);
+ RND(S[5],S[6],S[7],S[0],S[1],S[2],S[3],S[4],3,0xe9b5dba5);
+ RND(S[4],S[5],S[6],S[7],S[0],S[1],S[2],S[3],4,0x3956c25b);
+ RND(S[3],S[4],S[5],S[6],S[7],S[0],S[1],S[2],5,0x59f111f1);
+ RND(S[2],S[3],S[4],S[5],S[6],S[7],S[0],S[1],6,0x923f82a4);
+ RND(S[1],S[2],S[3],S[4],S[5],S[6],S[7],S[0],7,0xab1c5ed5);
+ RND(S[0],S[1],S[2],S[3],S[4],S[5],S[6],S[7],8,0xd807aa98);
+ RND(S[7],S[0],S[1],S[2],S[3],S[4],S[5],S[6],9,0x12835b01);
+ RND(S[6],S[7],S[0],S[1],S[2],S[3],S[4],S[5],10,0x243185be);
+ RND(S[5],S[6],S[7],S[0],S[1],S[2],S[3],S[4],11,0x550c7dc3);
+ RND(S[4],S[5],S[6],S[7],S[0],S[1],S[2],S[3],12,0x72be5d74);
+ RND(S[3],S[4],S[5],S[6],S[7],S[0],S[1],S[2],13,0x80deb1fe);
+ RND(S[2],S[3],S[4],S[5],S[6],S[7],S[0],S[1],14,0x9bdc06a7);
+ RND(S[1],S[2],S[3],S[4],S[5],S[6],S[7],S[0],15,0xc19bf174);
+ RND(S[0],S[1],S[2],S[3],S[4],S[5],S[6],S[7],16,0xe49b69c1);
+ RND(S[7],S[0],S[1],S[2],S[3],S[4],S[5],S[6],17,0xefbe4786);
+ RND(S[6],S[7],S[0],S[1],S[2],S[3],S[4],S[5],18,0x0fc19dc6);
+ RND(S[5],S[6],S[7],S[0],S[1],S[2],S[3],S[4],19,0x240ca1cc);
+ RND(S[4],S[5],S[6],S[7],S[0],S[1],S[2],S[3],20,0x2de92c6f);
+ RND(S[3],S[4],S[5],S[6],S[7],S[0],S[1],S[2],21,0x4a7484aa);
+ RND(S[2],S[3],S[4],S[5],S[6],S[7],S[0],S[1],22,0x5cb0a9dc);
+ RND(S[1],S[2],S[3],S[4],S[5],S[6],S[7],S[0],23,0x76f988da);
+ RND(S[0],S[1],S[2],S[3],S[4],S[5],S[6],S[7],24,0x983e5152);
+ RND(S[7],S[0],S[1],S[2],S[3],S[4],S[5],S[6],25,0xa831c66d);
+ RND(S[6],S[7],S[0],S[1],S[2],S[3],S[4],S[5],26,0xb00327c8);
+ RND(S[5],S[6],S[7],S[0],S[1],S[2],S[3],S[4],27,0xbf597fc7);
+ RND(S[4],S[5],S[6],S[7],S[0],S[1],S[2],S[3],28,0xc6e00bf3);
+ RND(S[3],S[4],S[5],S[6],S[7],S[0],S[1],S[2],29,0xd5a79147);
+ RND(S[2],S[3],S[4],S[5],S[6],S[7],S[0],S[1],30,0x06ca6351);
+ RND(S[1],S[2],S[3],S[4],S[5],S[6],S[7],S[0],31,0x14292967);
+ RND(S[0],S[1],S[2],S[3],S[4],S[5],S[6],S[7],32,0x27b70a85);
+ RND(S[7],S[0],S[1],S[2],S[3],S[4],S[5],S[6],33,0x2e1b2138);
+ RND(S[6],S[7],S[0],S[1],S[2],S[3],S[4],S[5],34,0x4d2c6dfc);
+ RND(S[5],S[6],S[7],S[0],S[1],S[2],S[3],S[4],35,0x53380d13);
+ RND(S[4],S[5],S[6],S[7],S[0],S[1],S[2],S[3],36,0x650a7354);
+ RND(S[3],S[4],S[5],S[6],S[7],S[0],S[1],S[2],37,0x766a0abb);
+ RND(S[2],S[3],S[4],S[5],S[6],S[7],S[0],S[1],38,0x81c2c92e);
+ RND(S[1],S[2],S[3],S[4],S[5],S[6],S[7],S[0],39,0x92722c85);
+ RND(S[0],S[1],S[2],S[3],S[4],S[5],S[6],S[7],40,0xa2bfe8a1);
+ RND(S[7],S[0],S[1],S[2],S[3],S[4],S[5],S[6],41,0xa81a664b);
+ RND(S[6],S[7],S[0],S[1],S[2],S[3],S[4],S[5],42,0xc24b8b70);
+ RND(S[5],S[6],S[7],S[0],S[1],S[2],S[3],S[4],43,0xc76c51a3);
+ RND(S[4],S[5],S[6],S[7],S[0],S[1],S[2],S[3],44,0xd192e819);
+ RND(S[3],S[4],S[5],S[6],S[7],S[0],S[1],S[2],45,0xd6990624);
+ RND(S[2],S[3],S[4],S[5],S[6],S[7],S[0],S[1],46,0xf40e3585);
+ RND(S[1],S[2],S[3],S[4],S[5],S[6],S[7],S[0],47,0x106aa070);
+ RND(S[0],S[1],S[2],S[3],S[4],S[5],S[6],S[7],48,0x19a4c116);
+ RND(S[7],S[0],S[1],S[2],S[3],S[4],S[5],S[6],49,0x1e376c08);
+ RND(S[6],S[7],S[0],S[1],S[2],S[3],S[4],S[5],50,0x2748774c);
+ RND(S[5],S[6],S[7],S[0],S[1],S[2],S[3],S[4],51,0x34b0bcb5);
+ RND(S[4],S[5],S[6],S[7],S[0],S[1],S[2],S[3],52,0x391c0cb3);
+ RND(S[3],S[4],S[5],S[6],S[7],S[0],S[1],S[2],53,0x4ed8aa4a);
+ RND(S[2],S[3],S[4],S[5],S[6],S[7],S[0],S[1],54,0x5b9cca4f);
+ RND(S[1],S[2],S[3],S[4],S[5],S[6],S[7],S[0],55,0x682e6ff3);
+ RND(S[0],S[1],S[2],S[3],S[4],S[5],S[6],S[7],56,0x748f82ee);
+ RND(S[7],S[0],S[1],S[2],S[3],S[4],S[5],S[6],57,0x78a5636f);
+ RND(S[6],S[7],S[0],S[1],S[2],S[3],S[4],S[5],58,0x84c87814);
+ RND(S[5],S[6],S[7],S[0],S[1],S[2],S[3],S[4],59,0x8cc70208);
+ RND(S[4],S[5],S[6],S[7],S[0],S[1],S[2],S[3],60,0x90befffa);
+ RND(S[3],S[4],S[5],S[6],S[7],S[0],S[1],S[2],61,0xa4506ceb);
+ RND(S[2],S[3],S[4],S[5],S[6],S[7],S[0],S[1],62,0xbef9a3f7);
+ RND(S[1],S[2],S[3],S[4],S[5],S[6],S[7],S[0],63,0xc67178f2);
+
+#undef RND
+
+#endif
+
+ /* feedback */
+ for (i = 0; i < 8; i++) {
+ md->sha256.state[i] = md->sha256.state[i] + S[i];
+ }
+ return CRYPT_OK;
+}
+
+#ifdef LTC_CLEAN_STACK
+static int sha256_compress(hash_state * md, unsigned char *buf)
+{
+ int err;
+ err = _sha256_compress(md, buf);
+ burn_stack(sizeof(ulong32) * 74);
+ return err;
+}
+#endif
+
+/**
+ Initialize the hash state
+ @param md The hash state you wish to initialize
+ @return CRYPT_OK if successful
+*/
+int sha256_init(hash_state * md)
+{
+ LTC_ARGCHK(md != NULL);
+
+ md->sha256.curlen = 0;
+ md->sha256.length = 0;
+ md->sha256.state[0] = 0x6A09E667UL;
+ md->sha256.state[1] = 0xBB67AE85UL;
+ md->sha256.state[2] = 0x3C6EF372UL;
+ md->sha256.state[3] = 0xA54FF53AUL;
+ md->sha256.state[4] = 0x510E527FUL;
+ md->sha256.state[5] = 0x9B05688CUL;
+ md->sha256.state[6] = 0x1F83D9ABUL;
+ md->sha256.state[7] = 0x5BE0CD19UL;
+ return CRYPT_OK;
+}
+
+/**
+ Process a block of memory though the hash
+ @param md The hash state
+ @param in The data to hash
+ @param inlen The length of the data (octets)
+ @return CRYPT_OK if successful
+*/
+HASH_PROCESS(sha256_process, sha256_compress, sha256, 64)
+
+/**
+ Terminate the hash to get the digest
+ @param md The hash state
+ @param out [out] The destination of the hash (32 bytes)
+ @return CRYPT_OK if successful
+*/
+int sha256_done(hash_state * md, unsigned char *out)
+{
+ int i;
+
+ LTC_ARGCHK(md != NULL);
+ LTC_ARGCHK(out != NULL);
+
+ if (md->sha256.curlen >= sizeof(md->sha256.buf)) {
+ return CRYPT_INVALID_ARG;
+ }
+
+
+ /* increase the length of the message */
+ md->sha256.length += md->sha256.curlen * 8;
+
+ /* append the '1' bit */
+ md->sha256.buf[md->sha256.curlen++] = (unsigned char)0x80;
+
+ /* if the length is currently above 56 bytes we append zeros
+ * then compress. Then we can fall back to padding zeros and length
+ * encoding like normal.
+ */
+ if (md->sha256.curlen > 56) {
+ while (md->sha256.curlen < 64) {
+ md->sha256.buf[md->sha256.curlen++] = (unsigned char)0;
+ }
+ sha256_compress(md, md->sha256.buf);
+ md->sha256.curlen = 0;
+ }
+
+ /* pad upto 56 bytes of zeroes */
+ while (md->sha256.curlen < 56) {
+ md->sha256.buf[md->sha256.curlen++] = (unsigned char)0;
+ }
+
+ /* store length */
+ STORE64H(md->sha256.length, md->sha256.buf+56);
+ sha256_compress(md, md->sha256.buf);
+
+ /* copy output */
+ for (i = 0; i < 8; i++) {
+ STORE32H(md->sha256.state[i], out+(4*i));
+ }
+#ifdef LTC_CLEAN_STACK
+ zeromem(md, sizeof(hash_state));
+#endif
+ return CRYPT_OK;
+}
+
+/**
+ Self-test the hash
+ @return CRYPT_OK if successful, CRYPT_NOP if self-tests have been disabled
+*/
+int sha256_test(void)
+{
+ #ifndef LTC_TEST
+ return CRYPT_NOP;
+ #else
+ static const struct {
+ char *msg;
+ unsigned char hash[32];
+ } tests[] = {
+ { "abc",
+ { 0xba, 0x78, 0x16, 0xbf, 0x8f, 0x01, 0xcf, 0xea,
+ 0x41, 0x41, 0x40, 0xde, 0x5d, 0xae, 0x22, 0x23,
+ 0xb0, 0x03, 0x61, 0xa3, 0x96, 0x17, 0x7a, 0x9c,
+ 0xb4, 0x10, 0xff, 0x61, 0xf2, 0x00, 0x15, 0xad }
+ },
+ { "abcdbcdecdefdefgefghfghighijhijkijkljklmklmnlmnomnopnopq",
+ { 0x24, 0x8d, 0x6a, 0x61, 0xd2, 0x06, 0x38, 0xb8,
+ 0xe5, 0xc0, 0x26, 0x93, 0x0c, 0x3e, 0x60, 0x39,
+ 0xa3, 0x3c, 0xe4, 0x59, 0x64, 0xff, 0x21, 0x67,
+ 0xf6, 0xec, 0xed, 0xd4, 0x19, 0xdb, 0x06, 0xc1 }
+ },
+ };
+
+ int i;
+ unsigned char tmp[32];
+ hash_state md;
+
+ for (i = 0; i < (int)(sizeof(tests) / sizeof(tests[0])); i++) {
+ sha256_init(&md);
+ sha256_process(&md, (unsigned char*)tests[i].msg, (unsigned long)strlen(tests[i].msg));
+ sha256_done(&md, tmp);
+ if (memcmp(tmp, tests[i].hash, 32) != 0) {
+ return CRYPT_FAIL_TESTVECTOR;
+ }
+ }
+ return CRYPT_OK;
+ #endif
+}
+
+#ifdef SHA224
+#include "sha224.c"
+#endif
+
+#endif
+
+
+
+/* $Source: /cvs/libtom/libtomcrypt/src/hashes/sha2/sha256.c,v $ */
+/* $Revision: 1.5 $ */
+/* $Date: 2005/05/23 02:42:07 $ */
diff --git a/libtomcrypt/src/hashes/sha2/sha384.c b/libtomcrypt/src/hashes/sha2/sha384.c
new file mode 100644
index 0000000..43f8fb6
--- /dev/null
+++ b/libtomcrypt/src/hashes/sha2/sha384.c
@@ -0,0 +1,134 @@
+/* LibTomCrypt, modular cryptographic library -- Tom St Denis
+ *
+ * LibTomCrypt is a library that provides various cryptographic
+ * algorithms in a highly modular and flexible manner.
+ *
+ * The library is free for all purposes without any express
+ * guarantee it works.
+ *
+ * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.org
+ */
+/**
+ @param sha384.c
+ SHA384 hash included in sha512.c, Tom St Denis
+*/
+
+const struct ltc_hash_descriptor sha384_desc =
+{
+ "sha384",
+ 4,
+ 48,
+ 128,
+
+ /* OID */
+ { 2, 16, 840, 1, 101, 3, 4, 2, 2, },
+ 9,
+
+ &sha384_init,
+ &sha512_process,
+ &sha384_done,
+ &sha384_test
+};
+
+/**
+ Initialize the hash state
+ @param md The hash state you wish to initialize
+ @return CRYPT_OK if successful
+*/
+int sha384_init(hash_state * md)
+{
+ LTC_ARGCHK(md != NULL);
+
+ md->sha512.curlen = 0;
+ md->sha512.length = 0;
+ md->sha512.state[0] = CONST64(0xcbbb9d5dc1059ed8);
+ md->sha512.state[1] = CONST64(0x629a292a367cd507);
+ md->sha512.state[2] = CONST64(0x9159015a3070dd17);
+ md->sha512.state[3] = CONST64(0x152fecd8f70e5939);
+ md->sha512.state[4] = CONST64(0x67332667ffc00b31);
+ md->sha512.state[5] = CONST64(0x8eb44a8768581511);
+ md->sha512.state[6] = CONST64(0xdb0c2e0d64f98fa7);
+ md->sha512.state[7] = CONST64(0x47b5481dbefa4fa4);
+ return CRYPT_OK;
+}
+
+/**
+ Terminate the hash to get the digest
+ @param md The hash state
+ @param out [out] The destination of the hash (48 bytes)
+ @return CRYPT_OK if successful
+*/
+int sha384_done(hash_state * md, unsigned char *out)
+{
+ unsigned char buf[64];
+
+ LTC_ARGCHK(md != NULL);
+ LTC_ARGCHK(out != NULL);
+
+ if (md->sha512.curlen >= sizeof(md->sha512.buf)) {
+ return CRYPT_INVALID_ARG;
+ }
+
+ sha512_done(md, buf);
+ XMEMCPY(out, buf, 48);
+#ifdef LTC_CLEAN_STACK
+ zeromem(buf, sizeof(buf));
+#endif
+ return CRYPT_OK;
+}
+
+/**
+ Self-test the hash
+ @return CRYPT_OK if successful, CRYPT_NOP if self-tests have been disabled
+*/
+int sha384_test(void)
+{
+ #ifndef LTC_TEST
+ return CRYPT_NOP;
+ #else
+ static const struct {
+ char *msg;
+ unsigned char hash[48];
+ } tests[] = {
+ { "abc",
+ { 0xcb, 0x00, 0x75, 0x3f, 0x45, 0xa3, 0x5e, 0x8b,
+ 0xb5, 0xa0, 0x3d, 0x69, 0x9a, 0xc6, 0x50, 0x07,
+ 0x27, 0x2c, 0x32, 0xab, 0x0e, 0xde, 0xd1, 0x63,
+ 0x1a, 0x8b, 0x60, 0x5a, 0x43, 0xff, 0x5b, 0xed,
+ 0x80, 0x86, 0x07, 0x2b, 0xa1, 0xe7, 0xcc, 0x23,
+ 0x58, 0xba, 0xec, 0xa1, 0x34, 0xc8, 0x25, 0xa7 }
+ },
+ { "abcdefghbcdefghicdefghijdefghijkefghijklfghijklmghijklmnhijklmnoijklmnopjklmnopqklmnopqrlmnopqrsmnopqrstnopqrstu",
+ { 0x09, 0x33, 0x0c, 0x33, 0xf7, 0x11, 0x47, 0xe8,
+ 0x3d, 0x19, 0x2f, 0xc7, 0x82, 0xcd, 0x1b, 0x47,
+ 0x53, 0x11, 0x1b, 0x17, 0x3b, 0x3b, 0x05, 0xd2,
+ 0x2f, 0xa0, 0x80, 0x86, 0xe3, 0xb0, 0xf7, 0x12,
+ 0xfc, 0xc7, 0xc7, 0x1a, 0x55, 0x7e, 0x2d, 0xb9,
+ 0x66, 0xc3, 0xe9, 0xfa, 0x91, 0x74, 0x60, 0x39 }
+ },
+ };
+
+ int i;
+ unsigned char tmp[48];
+ hash_state md;
+
+ for (i = 0; i < (int)(sizeof(tests) / sizeof(tests[0])); i++) {
+ sha384_init(&md);
+ sha384_process(&md, (unsigned char*)tests[i].msg, (unsigned long)strlen(tests[i].msg));
+ sha384_done(&md, tmp);
+ if (memcmp(tmp, tests[i].hash, 48) != 0) {
+ return CRYPT_FAIL_TESTVECTOR;
+ }
+ }
+ return CRYPT_OK;
+ #endif
+}
+
+
+
+
+
+
+/* $Source: /cvs/libtom/libtomcrypt/src/hashes/sha2/sha384.c,v $ */
+/* $Revision: 1.5 $ */
+/* $Date: 2005/05/23 02:42:07 $ */
diff --git a/libtomcrypt/src/hashes/sha2/sha512.c b/libtomcrypt/src/hashes/sha2/sha512.c
new file mode 100644
index 0000000..7b6805b
--- /dev/null
+++ b/libtomcrypt/src/hashes/sha2/sha512.c
@@ -0,0 +1,318 @@
+/* LibTomCrypt, modular cryptographic library -- Tom St Denis
+ *
+ * LibTomCrypt is a library that provides various cryptographic
+ * algorithms in a highly modular and flexible manner.
+ *
+ * The library is free for all purposes without any express
+ * guarantee it works.
+ *
+ * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.org
+ */
+#include "tomcrypt.h"
+
+/**
+ @param sha512.c
+ SHA512 by Tom St Denis
+*/
+
+#ifdef SHA512
+
+const struct ltc_hash_descriptor sha512_desc =
+{
+ "sha512",
+ 5,
+ 64,
+ 128,
+
+ /* OID */
+ { 2, 16, 840, 1, 101, 3, 4, 2, 3, },
+ 9,
+
+ &sha512_init,
+ &sha512_process,
+ &sha512_done,
+ &sha512_test
+};
+
+/* the K array */
+static const ulong64 K[80] = {
+CONST64(0x428a2f98d728ae22), CONST64(0x7137449123ef65cd),
+CONST64(0xb5c0fbcfec4d3b2f), CONST64(0xe9b5dba58189dbbc),
+CONST64(0x3956c25bf348b538), CONST64(0x59f111f1b605d019),
+CONST64(0x923f82a4af194f9b), CONST64(0xab1c5ed5da6d8118),
+CONST64(0xd807aa98a3030242), CONST64(0x12835b0145706fbe),
+CONST64(0x243185be4ee4b28c), CONST64(0x550c7dc3d5ffb4e2),
+CONST64(0x72be5d74f27b896f), CONST64(0x80deb1fe3b1696b1),
+CONST64(0x9bdc06a725c71235), CONST64(0xc19bf174cf692694),
+CONST64(0xe49b69c19ef14ad2), CONST64(0xefbe4786384f25e3),
+CONST64(0x0fc19dc68b8cd5b5), CONST64(0x240ca1cc77ac9c65),
+CONST64(0x2de92c6f592b0275), CONST64(0x4a7484aa6ea6e483),
+CONST64(0x5cb0a9dcbd41fbd4), CONST64(0x76f988da831153b5),
+CONST64(0x983e5152ee66dfab), CONST64(0xa831c66d2db43210),
+CONST64(0xb00327c898fb213f), CONST64(0xbf597fc7beef0ee4),
+CONST64(0xc6e00bf33da88fc2), CONST64(0xd5a79147930aa725),
+CONST64(0x06ca6351e003826f), CONST64(0x142929670a0e6e70),
+CONST64(0x27b70a8546d22ffc), CONST64(0x2e1b21385c26c926),
+CONST64(0x4d2c6dfc5ac42aed), CONST64(0x53380d139d95b3df),
+CONST64(0x650a73548baf63de), CONST64(0x766a0abb3c77b2a8),
+CONST64(0x81c2c92e47edaee6), CONST64(0x92722c851482353b),
+CONST64(0xa2bfe8a14cf10364), CONST64(0xa81a664bbc423001),
+CONST64(0xc24b8b70d0f89791), CONST64(0xc76c51a30654be30),
+CONST64(0xd192e819d6ef5218), CONST64(0xd69906245565a910),
+CONST64(0xf40e35855771202a), CONST64(0x106aa07032bbd1b8),
+CONST64(0x19a4c116b8d2d0c8), CONST64(0x1e376c085141ab53),
+CONST64(0x2748774cdf8eeb99), CONST64(0x34b0bcb5e19b48a8),
+CONST64(0x391c0cb3c5c95a63), CONST64(0x4ed8aa4ae3418acb),
+CONST64(0x5b9cca4f7763e373), CONST64(0x682e6ff3d6b2b8a3),
+CONST64(0x748f82ee5defb2fc), CONST64(0x78a5636f43172f60),
+CONST64(0x84c87814a1f0ab72), CONST64(0x8cc702081a6439ec),
+CONST64(0x90befffa23631e28), CONST64(0xa4506cebde82bde9),
+CONST64(0xbef9a3f7b2c67915), CONST64(0xc67178f2e372532b),
+CONST64(0xca273eceea26619c), CONST64(0xd186b8c721c0c207),
+CONST64(0xeada7dd6cde0eb1e), CONST64(0xf57d4f7fee6ed178),
+CONST64(0x06f067aa72176fba), CONST64(0x0a637dc5a2c898a6),
+CONST64(0x113f9804bef90dae), CONST64(0x1b710b35131c471b),
+CONST64(0x28db77f523047d84), CONST64(0x32caab7b40c72493),
+CONST64(0x3c9ebe0a15c9bebc), CONST64(0x431d67c49c100d4c),
+CONST64(0x4cc5d4becb3e42b6), CONST64(0x597f299cfc657e2a),
+CONST64(0x5fcb6fab3ad6faec), CONST64(0x6c44198c4a475817)
+};
+
+/* Various logical functions */
+#define Ch(x,y,z) (z ^ (x & (y ^ z)))
+#define Maj(x,y,z) (((x | y) & z) | (x & y))
+#define S(x, n) ROR64c(x, n)
+#define R(x, n) (((x)&CONST64(0xFFFFFFFFFFFFFFFF))>>((ulong64)n))
+#define Sigma0(x) (S(x, 28) ^ S(x, 34) ^ S(x, 39))
+#define Sigma1(x) (S(x, 14) ^ S(x, 18) ^ S(x, 41))
+#define Gamma0(x) (S(x, 1) ^ S(x, 8) ^ R(x, 7))
+#define Gamma1(x) (S(x, 19) ^ S(x, 61) ^ R(x, 6))
+
+/* compress 1024-bits */
+#ifdef LTC_CLEAN_STACK
+static int _sha512_compress(hash_state * md, unsigned char *buf)
+#else
+static int sha512_compress(hash_state * md, unsigned char *buf)
+#endif
+{
+ ulong64 S[8], W[80], t0, t1;
+ int i;
+
+ /* copy state into S */
+ for (i = 0; i < 8; i++) {
+ S[i] = md->sha512.state[i];
+ }
+
+ /* copy the state into 1024-bits into W[0..15] */
+ for (i = 0; i < 16; i++) {
+ LOAD64H(W[i], buf + (8*i));
+ }
+
+ /* fill W[16..79] */
+ for (i = 16; i < 80; i++) {
+ W[i] = Gamma1(W[i - 2]) + W[i - 7] + Gamma0(W[i - 15]) + W[i - 16];
+ }
+
+ /* Compress */
+#ifdef LTC_SMALL_CODE
+ for (i = 0; i < 80; i++) {
+ t0 = S[7] + Sigma1(S[4]) + Ch(S[4], S[5], S[6]) + K[i] + W[i];
+ t1 = Sigma0(S[0]) + Maj(S[0], S[1], S[2]);
+ S[7] = S[6];
+ S[6] = S[5];
+ S[5] = S[4];
+ S[4] = S[3] + t0;
+ S[3] = S[2];
+ S[2] = S[1];
+ S[1] = S[0];
+ S[0] = t0 + t1;
+ }
+#else
+#define RND(a,b,c,d,e,f,g,h,i) \
+ t0 = h + Sigma1(e) + Ch(e, f, g) + K[i] + W[i]; \
+ t1 = Sigma0(a) + Maj(a, b, c); \
+ d += t0; \
+ h = t0 + t1;
+
+ for (i = 0; i < 80; i += 8) {
+ RND(S[0],S[1],S[2],S[3],S[4],S[5],S[6],S[7],i+0);
+ RND(S[7],S[0],S[1],S[2],S[3],S[4],S[5],S[6],i+1);
+ RND(S[6],S[7],S[0],S[1],S[2],S[3],S[4],S[5],i+2);
+ RND(S[5],S[6],S[7],S[0],S[1],S[2],S[3],S[4],i+3);
+ RND(S[4],S[5],S[6],S[7],S[0],S[1],S[2],S[3],i+4);
+ RND(S[3],S[4],S[5],S[6],S[7],S[0],S[1],S[2],i+5);
+ RND(S[2],S[3],S[4],S[5],S[6],S[7],S[0],S[1],i+6);
+ RND(S[1],S[2],S[3],S[4],S[5],S[6],S[7],S[0],i+7);
+ }
+#endif
+
+
+ /* feedback */
+ for (i = 0; i < 8; i++) {
+ md->sha512.state[i] = md->sha512.state[i] + S[i];
+ }
+
+ return CRYPT_OK;
+}
+
+/* compress 1024-bits */
+#ifdef LTC_CLEAN_STACK
+static int sha512_compress(hash_state * md, unsigned char *buf)
+{
+ int err;
+ err = _sha512_compress(md, buf);
+ burn_stack(sizeof(ulong64) * 90 + sizeof(int));
+ return err;
+}
+#endif
+
+/**
+ Initialize the hash state
+ @param md The hash state you wish to initialize
+ @return CRYPT_OK if successful
+*/
+int sha512_init(hash_state * md)
+{
+ LTC_ARGCHK(md != NULL);
+ md->sha512.curlen = 0;
+ md->sha512.length = 0;
+ md->sha512.state[0] = CONST64(0x6a09e667f3bcc908);
+ md->sha512.state[1] = CONST64(0xbb67ae8584caa73b);
+ md->sha512.state[2] = CONST64(0x3c6ef372fe94f82b);
+ md->sha512.state[3] = CONST64(0xa54ff53a5f1d36f1);
+ md->sha512.state[4] = CONST64(0x510e527fade682d1);
+ md->sha512.state[5] = CONST64(0x9b05688c2b3e6c1f);
+ md->sha512.state[6] = CONST64(0x1f83d9abfb41bd6b);
+ md->sha512.state[7] = CONST64(0x5be0cd19137e2179);
+ return CRYPT_OK;
+}
+
+/**
+ Process a block of memory though the hash
+ @param md The hash state
+ @param in The data to hash
+ @param inlen The length of the data (octets)
+ @return CRYPT_OK if successful
+*/
+HASH_PROCESS(sha512_process, sha512_compress, sha512, 128)
+
+/**
+ Terminate the hash to get the digest
+ @param md The hash state
+ @param out [out] The destination of the hash (64 bytes)
+ @return CRYPT_OK if successful
+*/
+int sha512_done(hash_state * md, unsigned char *out)
+{
+ int i;
+
+ LTC_ARGCHK(md != NULL);
+ LTC_ARGCHK(out != NULL);
+
+ if (md->sha512.curlen >= sizeof(md->sha512.buf)) {
+ return CRYPT_INVALID_ARG;
+ }
+
+ /* increase the length of the message */
+ md->sha512.length += md->sha512.curlen * CONST64(8);
+
+ /* append the '1' bit */
+ md->sha512.buf[md->sha512.curlen++] = (unsigned char)0x80;
+
+ /* if the length is currently above 112 bytes we append zeros
+ * then compress. Then we can fall back to padding zeros and length
+ * encoding like normal.
+ */
+ if (md->sha512.curlen > 112) {
+ while (md->sha512.curlen < 128) {
+ md->sha512.buf[md->sha512.curlen++] = (unsigned char)0;
+ }
+ sha512_compress(md, md->sha512.buf);
+ md->sha512.curlen = 0;
+ }
+
+ /* pad upto 120 bytes of zeroes
+ * note: that from 112 to 120 is the 64 MSB of the length. We assume that you won't hash
+ * > 2^64 bits of data... :-)
+ */
+ while (md->sha512.curlen < 120) {
+ md->sha512.buf[md->sha512.curlen++] = (unsigned char)0;
+ }
+
+ /* store length */
+ STORE64H(md->sha512.length, md->sha512.buf+120);
+ sha512_compress(md, md->sha512.buf);
+
+ /* copy output */
+ for (i = 0; i < 8; i++) {
+ STORE64H(md->sha512.state[i], out+(8*i));
+ }
+#ifdef LTC_CLEAN_STACK
+ zeromem(md, sizeof(hash_state));
+#endif
+ return CRYPT_OK;
+}
+
+/**
+ Self-test the hash
+ @return CRYPT_OK if successful, CRYPT_NOP if self-tests have been disabled
+*/
+int sha512_test(void)
+{
+ #ifndef LTC_TEST
+ return CRYPT_NOP;
+ #else
+ static const struct {
+ char *msg;
+ unsigned char hash[64];
+ } tests[] = {
+ { "abc",
+ { 0xdd, 0xaf, 0x35, 0xa1, 0x93, 0x61, 0x7a, 0xba,
+ 0xcc, 0x41, 0x73, 0x49, 0xae, 0x20, 0x41, 0x31,
+ 0x12, 0xe6, 0xfa, 0x4e, 0x89, 0xa9, 0x7e, 0xa2,
+ 0x0a, 0x9e, 0xee, 0xe6, 0x4b, 0x55, 0xd3, 0x9a,
+ 0x21, 0x92, 0x99, 0x2a, 0x27, 0x4f, 0xc1, 0xa8,
+ 0x36, 0xba, 0x3c, 0x23, 0xa3, 0xfe, 0xeb, 0xbd,
+ 0x45, 0x4d, 0x44, 0x23, 0x64, 0x3c, 0xe8, 0x0e,
+ 0x2a, 0x9a, 0xc9, 0x4f, 0xa5, 0x4c, 0xa4, 0x9f }
+ },
+ { "abcdefghbcdefghicdefghijdefghijkefghijklfghijklmghijklmnhijklmnoijklmnopjklmnopqklmnopqrlmnopqrsmnopqrstnopqrstu",
+ { 0x8e, 0x95, 0x9b, 0x75, 0xda, 0xe3, 0x13, 0xda,
+ 0x8c, 0xf4, 0xf7, 0x28, 0x14, 0xfc, 0x14, 0x3f,
+ 0x8f, 0x77, 0x79, 0xc6, 0xeb, 0x9f, 0x7f, 0xa1,
+ 0x72, 0x99, 0xae, 0xad, 0xb6, 0x88, 0x90, 0x18,
+ 0x50, 0x1d, 0x28, 0x9e, 0x49, 0x00, 0xf7, 0xe4,
+ 0x33, 0x1b, 0x99, 0xde, 0xc4, 0xb5, 0x43, 0x3a,
+ 0xc7, 0xd3, 0x29, 0xee, 0xb6, 0xdd, 0x26, 0x54,
+ 0x5e, 0x96, 0xe5, 0x5b, 0x87, 0x4b, 0xe9, 0x09 }
+ },
+ };
+
+ int i;
+ unsigned char tmp[64];
+ hash_state md;
+
+ for (i = 0; i < (int)(sizeof(tests) / sizeof(tests[0])); i++) {
+ sha512_init(&md);
+ sha512_process(&md, (unsigned char *)tests[i].msg, (unsigned long)strlen(tests[i].msg));
+ sha512_done(&md, tmp);
+ if (memcmp(tmp, tests[i].hash, 64) != 0) {
+ return CRYPT_FAIL_TESTVECTOR;
+ }
+ }
+ return CRYPT_OK;
+ #endif
+}
+
+#ifdef SHA384
+ #include "sha384.c"
+#endif
+
+#endif
+
+
+
+
+/* $Source: /cvs/libtom/libtomcrypt/src/hashes/sha2/sha512.c,v $ */
+/* $Revision: 1.5 $ */
+/* $Date: 2005/05/23 02:42:07 $ */
generated by cgit v1.2.3 (git 2.39.1) at 2024-12-03 19:07:53 +0000