summaryrefslogtreecommitdiffhomepage
path: root/modules/base
diff options
context:
space:
mode:
authorJo-Philipp Wich <jow@openwrt.org>2014-06-11 13:29:05 +0000
committerJo-Philipp Wich <jow@openwrt.org>2014-06-11 13:29:05 +0000
commit7043c30e0e55bbbfacdddf97619b6bae96d20ddb (patch)
treeece3254350b3ba01ba3135caed2364cc7ca7804c /modules/base
parentbbb44cf245c11bc0c1d59e836007c9e8c3bfa209 (diff)
build: introduce luci-base
Merges libs/core, libs/ipkg, libs/web, libs/sys, libs/sgi-cgi, libs/sgi-uhttpd, modules/admin-core, themes/base and protcols/core into modules/base and renames luci-lib-core to luci-base.
Diffstat (limited to 'modules/base')
-rw-r--r--modules/base/Makefile45
-rwxr-xr-xmodules/base/htdocs/cgi-bin/luci5
-rw-r--r--modules/base/htdocs/luci-static/resources/cbi.js1339
-rw-r--r--modules/base/htdocs/luci-static/resources/cbi/add.gifbin0 -> 378 bytes
-rw-r--r--modules/base/htdocs/luci-static/resources/cbi/apply.gifbin0 -> 268 bytes
-rw-r--r--modules/base/htdocs/luci-static/resources/cbi/arrow.gifbin0 -> 135 bytes
-rw-r--r--modules/base/htdocs/luci-static/resources/cbi/down.gifbin0 -> 131 bytes
-rw-r--r--modules/base/htdocs/luci-static/resources/cbi/download.gifbin0 -> 189 bytes
-rw-r--r--modules/base/htdocs/luci-static/resources/cbi/edit.gifbin0 -> 280 bytes
-rw-r--r--modules/base/htdocs/luci-static/resources/cbi/fieldadd.gifbin0 -> 379 bytes
-rw-r--r--modules/base/htdocs/luci-static/resources/cbi/file.gifbin0 -> 371 bytes
-rw-r--r--modules/base/htdocs/luci-static/resources/cbi/find.gifbin0 -> 273 bytes
-rw-r--r--modules/base/htdocs/luci-static/resources/cbi/folder.gifbin0 -> 698 bytes
-rw-r--r--modules/base/htdocs/luci-static/resources/cbi/help.gifbin0 -> 266 bytes
-rw-r--r--modules/base/htdocs/luci-static/resources/cbi/key.gifbin0 -> 230 bytes
-rw-r--r--modules/base/htdocs/luci-static/resources/cbi/link.gifbin0 -> 279 bytes
-rw-r--r--modules/base/htdocs/luci-static/resources/cbi/reload.gifbin0 -> 248 bytes
-rw-r--r--modules/base/htdocs/luci-static/resources/cbi/remove.gifbin0 -> 385 bytes
-rw-r--r--modules/base/htdocs/luci-static/resources/cbi/reset.gifbin0 -> 258 bytes
-rw-r--r--modules/base/htdocs/luci-static/resources/cbi/save.gifbin0 -> 263 bytes
-rw-r--r--modules/base/htdocs/luci-static/resources/cbi/up.gifbin0 -> 130 bytes
-rw-r--r--modules/base/htdocs/luci-static/resources/cbi/user.gifbin0 -> 246 bytes
-rw-r--r--modules/base/htdocs/luci-static/resources/icons/bridge.pngbin0 -> 838 bytes
-rw-r--r--modules/base/htdocs/luci-static/resources/icons/bridge_disabled.pngbin0 -> 517 bytes
-rw-r--r--modules/base/htdocs/luci-static/resources/icons/encryption.pngbin0 -> 1224 bytes
-rw-r--r--modules/base/htdocs/luci-static/resources/icons/encryption_disabled.pngbin0 -> 1197 bytes
-rw-r--r--modules/base/htdocs/luci-static/resources/icons/ethernet.pngbin0 -> 814 bytes
-rw-r--r--modules/base/htdocs/luci-static/resources/icons/ethernet_disabled.pngbin0 -> 508 bytes
-rw-r--r--modules/base/htdocs/luci-static/resources/icons/loading.gifbin0 -> 1787 bytes
-rw-r--r--modules/base/htdocs/luci-static/resources/icons/port_down.pngbin0 -> 982 bytes
-rw-r--r--modules/base/htdocs/luci-static/resources/icons/port_up.pngbin0 -> 1401 bytes
-rw-r--r--modules/base/htdocs/luci-static/resources/icons/signal-0-25.pngbin0 -> 495 bytes
-rw-r--r--modules/base/htdocs/luci-static/resources/icons/signal-0.pngbin0 -> 478 bytes
-rw-r--r--modules/base/htdocs/luci-static/resources/icons/signal-25-50.pngbin0 -> 501 bytes
-rw-r--r--modules/base/htdocs/luci-static/resources/icons/signal-50-75.pngbin0 -> 500 bytes
-rw-r--r--modules/base/htdocs/luci-static/resources/icons/signal-75-100.pngbin0 -> 485 bytes
-rw-r--r--modules/base/htdocs/luci-static/resources/icons/signal-none.pngbin0 -> 681 bytes
-rw-r--r--modules/base/htdocs/luci-static/resources/icons/switch.pngbin0 -> 794 bytes
-rw-r--r--modules/base/htdocs/luci-static/resources/icons/switch_disabled.pngbin0 -> 505 bytes
-rw-r--r--modules/base/htdocs/luci-static/resources/icons/tunnel.pngbin0 -> 533 bytes
-rw-r--r--modules/base/htdocs/luci-static/resources/icons/tunnel_disabled.pngbin0 -> 546 bytes
-rw-r--r--modules/base/htdocs/luci-static/resources/icons/vlan.pngbin0 -> 794 bytes
-rw-r--r--modules/base/htdocs/luci-static/resources/icons/vlan_disabled.pngbin0 -> 505 bytes
-rw-r--r--modules/base/htdocs/luci-static/resources/icons/wifi.pngbin0 -> 1037 bytes
-rw-r--r--modules/base/htdocs/luci-static/resources/icons/wifi_big.pngbin0 -> 2865 bytes
-rw-r--r--modules/base/htdocs/luci-static/resources/icons/wifi_big_disabled.pngbin0 -> 2853 bytes
-rw-r--r--modules/base/htdocs/luci-static/resources/icons/wifi_disabled.pngbin0 -> 980 bytes
-rw-r--r--modules/base/htdocs/luci-static/resources/xhr.js241
-rw-r--r--modules/base/luasrc/ccache.lua87
-rw-r--r--modules/base/luasrc/controller/admin/servicectl.lua60
-rw-r--r--modules/base/luasrc/debug.lua37
-rw-r--r--modules/base/luasrc/fs.lua244
-rw-r--r--modules/base/luasrc/init.lua39
-rw-r--r--modules/base/luasrc/ip.lua673
-rw-r--r--modules/base/luasrc/ltn12.lua391
-rw-r--r--modules/base/luasrc/luasrc/cacheloader.lua23
-rw-r--r--modules/base/luasrc/luasrc/cbi.lua1850
-rw-r--r--modules/base/luasrc/luasrc/cbi/datatypes.lua345
-rw-r--r--modules/base/luasrc/luasrc/config.lua42
-rw-r--r--modules/base/luasrc/luasrc/dispatcher.lua959
-rw-r--r--modules/base/luasrc/luasrc/http.lua344
-rw-r--r--modules/base/luasrc/luasrc/http/protocol.lua688
-rw-r--r--modules/base/luasrc/luasrc/http/protocol/conditionals.lua153
-rw-r--r--modules/base/luasrc/luasrc/http/protocol/date.lua115
-rw-r--r--modules/base/luasrc/luasrc/http/protocol/mime.lua99
-rw-r--r--modules/base/luasrc/luasrc/i18n.lua104
-rw-r--r--modules/base/luasrc/luasrc/sauth.lua127
-rw-r--r--modules/base/luasrc/luasrc/template.lua107
-rw-r--r--modules/base/luasrc/luasrc/view/cbi/apply_xhr.htm43
-rw-r--r--modules/base/luasrc/luasrc/view/cbi/browser.htm7
-rw-r--r--modules/base/luasrc/luasrc/view/cbi/button.htm7
-rw-r--r--modules/base/luasrc/luasrc/view/cbi/cell_valuefooter.htm20
-rw-r--r--modules/base/luasrc/luasrc/view/cbi/cell_valueheader.htm2
-rw-r--r--modules/base/luasrc/luasrc/view/cbi/compound.htm1
-rw-r--r--modules/base/luasrc/luasrc/view/cbi/delegator.htm24
-rw-r--r--modules/base/luasrc/luasrc/view/cbi/dvalue.htm13
-rw-r--r--modules/base/luasrc/luasrc/view/cbi/dynlist.htm26
-rw-r--r--modules/base/luasrc/luasrc/view/cbi/filebrowser.htm108
-rw-r--r--modules/base/luasrc/luasrc/view/cbi/firewall_zoneforwards.htm59
-rw-r--r--modules/base/luasrc/luasrc/view/cbi/firewall_zonelist.htm89
-rw-r--r--modules/base/luasrc/luasrc/view/cbi/footer.htm26
-rw-r--r--modules/base/luasrc/luasrc/view/cbi/full_valuefooter.htm59
-rw-r--r--modules/base/luasrc/luasrc/view/cbi/full_valueheader.htm9
-rw-r--r--modules/base/luasrc/luasrc/view/cbi/fvalue.htm9
-rw-r--r--modules/base/luasrc/luasrc/view/cbi/header.htm7
-rw-r--r--modules/base/luasrc/luasrc/view/cbi/lvalue.htm18
-rw-r--r--modules/base/luasrc/luasrc/view/cbi/map.htm13
-rw-r--r--modules/base/luasrc/luasrc/view/cbi/mvalue.htm19
-rw-r--r--modules/base/luasrc/luasrc/view/cbi/network_ifacelist.htm81
-rw-r--r--modules/base/luasrc/luasrc/view/cbi/network_netinfo.htm27
-rw-r--r--modules/base/luasrc/luasrc/view/cbi/network_netlist.htm81
-rw-r--r--modules/base/luasrc/luasrc/view/cbi/nsection.htm31
-rw-r--r--modules/base/luasrc/luasrc/view/cbi/nullsection.htm38
-rw-r--r--modules/base/luasrc/luasrc/view/cbi/simpleform.htm57
-rw-r--r--modules/base/luasrc/luasrc/view/cbi/tabcontainer.htm7
-rw-r--r--modules/base/luasrc/luasrc/view/cbi/tabmenu.htm13
-rw-r--r--modules/base/luasrc/luasrc/view/cbi/tblsection.htm146
-rw-r--r--modules/base/luasrc/luasrc/view/cbi/tsection.htm48
-rw-r--r--modules/base/luasrc/luasrc/view/cbi/tvalue.htm5
-rw-r--r--modules/base/luasrc/luasrc/view/cbi/ucisection.htm75
-rw-r--r--modules/base/luasrc/luasrc/view/cbi/upload.htm14
-rw-r--r--modules/base/luasrc/luasrc/view/cbi/value.htm35
-rw-r--r--modules/base/luasrc/luasrc/view/cbi/valuefooter.htm1
-rw-r--r--modules/base/luasrc/luasrc/view/cbi/valueheader.htm1
-rw-r--r--modules/base/luasrc/model/cbi/admin_network/proto_dhcp.lua76
-rw-r--r--modules/base/luasrc/model/cbi/admin_network/proto_none.lua13
-rw-r--r--modules/base/luasrc/model/cbi/admin_network/proto_static.lua90
-rw-r--r--modules/base/luasrc/model/firewall.lua582
-rw-r--r--modules/base/luasrc/model/ipkg.lua239
-rw-r--r--modules/base/luasrc/model/network.lua1584
-rw-r--r--modules/base/luasrc/model/uci.lua404
-rw-r--r--modules/base/luasrc/sgi/cgi.lua95
-rw-r--r--modules/base/luasrc/sgi/uhttpd.lua105
-rw-r--r--modules/base/luasrc/store.lua16
-rw-r--r--modules/base/luasrc/sys.lua961
-rw-r--r--modules/base/luasrc/sys/iptparser.lua373
-rw-r--r--modules/base/luasrc/sys/zoneinfo.lua28
-rw-r--r--modules/base/luasrc/sys/zoneinfo/tzdata.lua420
-rw-r--r--modules/base/luasrc/sys/zoneinfo/tzoffset.lua162
-rw-r--r--modules/base/luasrc/tools/proto.lua46
-rw-r--r--modules/base/luasrc/tools/status.lua216
-rw-r--r--modules/base/luasrc/tools/webadmin.lua173
-rw-r--r--modules/base/luasrc/util.lua791
-rw-r--r--modules/base/luasrc/version.lua12
-rw-r--r--modules/base/luasrc/view/error404.htm19
-rw-r--r--modules/base/luasrc/view/error500.htm19
-rw-r--r--modules/base/luasrc/view/footer.htm15
-rw-r--r--modules/base/luasrc/view/header.htm21
-rw-r--r--modules/base/luasrc/view/indexer.htm15
-rw-r--r--modules/base/luasrc/view/sysauth.htm80
-rw-r--r--modules/base/root/etc/config/ucitrack53
-rw-r--r--modules/base/root/root/etc/config/luci24
-rw-r--r--modules/base/root/root/lib/uci/upload/.gitignore0
-rwxr-xr-xmodules/base/root/sbin/luci-reload45
-rw-r--r--modules/base/root/www/index.html10
-rw-r--r--modules/base/src/po2lmo.c247
-rw-r--r--modules/base/src/template_lmo.c328
-rw-r--r--modules/base/src/template_lmo.h92
-rw-r--r--modules/base/src/template_lualib.c163
-rw-r--r--modules/base/src/template_lualib.h30
-rw-r--r--modules/base/src/template_parser.c386
-rw-r--r--modules/base/src/template_parser.h79
-rw-r--r--modules/base/src/template_utils.c494
-rw-r--r--modules/base/src/template_utils.h49
-rw-r--r--modules/base/standalone.mk56
145 files changed, 17947 insertions, 0 deletions
diff --git a/modules/base/Makefile b/modules/base/Makefile
new file mode 100644
index 000000000..ad16ec737
--- /dev/null
+++ b/modules/base/Makefile
@@ -0,0 +1,45 @@
+ifneq (,$(wildcard ../../build/config.mk))
+include ../../build/config.mk
+include ../../build/module.mk
+include ../../build/gccconfig.mk
+else
+include standalone.mk
+endif
+
+TPL_LDFLAGS =
+TPL_CFLAGS =
+TPL_SO = parser.so
+TPL_PO2LMO = po2lmo
+TPL_PO2LMO_OBJ = src/po2lmo.o
+TPL_LMO_OBJ = src/template_lmo.o
+TPL_COMMON_OBJ = src/template_parser.o src/template_utils.o
+TPL_LUALIB_OBJ = src/template_lualib.o
+
+%.o: %.c
+ $(COMPILE) $(TPL_CFLAGS) $(LUA_CFLAGS) $(FPIC) -c -o $@ $<
+
+compile: build-clean $(TPL_COMMON_OBJ) $(TPL_LUALIB_OBJ) $(TPL_LMO_OBJ) $(TPL_PO2LMO_OBJ)
+ $(LINK) $(SHLIB_FLAGS) $(TPL_LDFLAGS) -o src/$(TPL_SO) \
+ $(TPL_COMMON_OBJ) $(TPL_LMO_OBJ) $(TPL_LUALIB_OBJ)
+ $(LINK) -o src/$(TPL_PO2LMO) \
+ $(TPL_LMO_OBJ) $(TPL_PO2LMO_OBJ)
+ mkdir -p dist$(LUCI_LIBRARYDIR)/template
+ cp src/$(TPL_SO) dist$(LUCI_LIBRARYDIR)/template/$(TPL_SO)
+
+install: build
+ cp -pR dist$(LUA_LIBRARYDIR)/* $(LUA_LIBRARYDIR)
+
+clean: build-clean
+
+build-clean:
+ rm -f src/*.o src/$(TPL_SO)
+
+host-compile: build-clean host-clean $(TPL_LMO_OBJ) $(TPL_PO2LMO_OBJ)
+ $(LINK) -o src/$(TPL_PO2LMO) $(TPL_LMO_OBJ) $(TPL_PO2LMO_OBJ)
+
+host-install: host-compile
+ cp src/$(TPL_PO2LMO) ../../build/$(TPL_PO2LMO)
+
+host-clean:
+ rm -f src/$(TPL_PO2LMO)
+ rm -f ../../build/$(TPL_PO2LMO)
diff --git a/modules/base/htdocs/cgi-bin/luci b/modules/base/htdocs/cgi-bin/luci
new file mode 100755
index 000000000..529d1d0bc
--- /dev/null
+++ b/modules/base/htdocs/cgi-bin/luci
@@ -0,0 +1,5 @@
+#!/usr/bin/lua
+require "luci.cacheloader"
+require "luci.sgi.cgi"
+luci.dispatcher.indexcache = "/tmp/luci-indexcache"
+luci.sgi.cgi.run() \ No newline at end of file
diff --git a/modules/base/htdocs/luci-static/resources/cbi.js b/modules/base/htdocs/luci-static/resources/cbi.js
new file mode 100644
index 000000000..02814a542
--- /dev/null
+++ b/modules/base/htdocs/luci-static/resources/cbi.js
@@ -0,0 +1,1339 @@
+/*
+ LuCI - Lua Configuration Interface
+
+ Copyright 2008 Steven Barth <steven@midlink.org>
+ Copyright 2008-2012 Jo-Philipp Wich <xm@subsignal.org>
+
+ Licensed under the Apache License, Version 2.0 (the "License");
+ you may not use this file except in compliance with the License.
+ You may obtain a copy of the License at
+
+ http://www.apache.org/licenses/LICENSE-2.0
+*/
+
+var cbi_d = [];
+var cbi_t = [];
+var cbi_c = [];
+
+var cbi_validators = {
+
+ 'integer': function()
+ {
+ return (this.match(/^-?[0-9]+$/) != null);
+ },
+
+ 'uinteger': function()
+ {
+ return (cbi_validators.integer.apply(this) && (this >= 0));
+ },
+
+ 'float': function()
+ {
+ return !isNaN(parseFloat(this));
+ },
+
+ 'ufloat': function()
+ {
+ return (cbi_validators['float'].apply(this) && (this >= 0));
+ },
+
+ 'ipaddr': function()
+ {
+ return cbi_validators.ip4addr.apply(this) ||
+ cbi_validators.ip6addr.apply(this);
+ },
+
+ 'ip4addr': function()
+ {
+ if (this.match(/^(\d{1,3})\.(\d{1,3})\.(\d{1,3})\.(\d{1,3})(\/(\S+))?$/))
+ {
+ return (RegExp.$1 >= 0) && (RegExp.$1 <= 255) &&
+ (RegExp.$2 >= 0) && (RegExp.$2 <= 255) &&
+ (RegExp.$3 >= 0) && (RegExp.$3 <= 255) &&
+ (RegExp.$4 >= 0) && (RegExp.$4 <= 255) &&
+ ((RegExp.$6.indexOf('.') < 0)
+ ? ((RegExp.$6 >= 0) && (RegExp.$6 <= 32))
+ : (cbi_validators.ip4addr.apply(RegExp.$6)))
+ ;
+ }
+
+ return false;
+ },
+
+ 'ip6addr': function()
+ {
+ if( this.match(/^([a-fA-F0-9:.]+)(\/(\d+))?$/) )
+ {
+ if( !RegExp.$2 || ((RegExp.$3 >= 0) && (RegExp.$3 <= 128)) )
+ {
+ var addr = RegExp.$1;
+
+ if( addr == '::' )
+ {
+ return true;
+ }
+
+ if( addr.indexOf('.') > 0 )
+ {
+ var off = addr.lastIndexOf(':');
+
+ if( !(off && cbi_validators.ip4addr.apply(addr.substr(off+1))) )
+ return false;
+
+ addr = addr.substr(0, off) + ':0:0';
+ }
+
+ if( addr.indexOf('::') >= 0 )
+ {
+ var colons = 0;
+ var fill = '0';
+
+ for( var i = 1; i < (addr.length-1); i++ )
+ if( addr.charAt(i) == ':' )
+ colons++;
+
+ if( colons > 7 )
+ return false;
+
+ for( var i = 0; i < (7 - colons); i++ )
+ fill += ':0';
+
+ if (addr.match(/^(.*?)::(.*?)$/))
+ addr = (RegExp.$1 ? RegExp.$1 + ':' : '') + fill +
+ (RegExp.$2 ? ':' + RegExp.$2 : '');
+ }
+
+ return (addr.match(/^(?:[a-fA-F0-9]{1,4}:){7}[a-fA-F0-9]{1,4}$/) != null);
+ }
+ }
+
+ return false;
+ },
+
+ 'port': function()
+ {
+ return cbi_validators.integer.apply(this) &&
+ (this >= 0) && (this <= 65535);
+ },
+
+ 'portrange': function()
+ {
+ if (this.match(/^(\d+)-(\d+)$/))
+ {
+ var p1 = RegExp.$1;
+ var p2 = RegExp.$2;
+
+ return cbi_validators.port.apply(p1) &&
+ cbi_validators.port.apply(p2) &&
+ (parseInt(p1) <= parseInt(p2))
+ ;
+ }
+ else
+ {
+ return cbi_validators.port.apply(this);
+ }
+ },
+
+ 'macaddr': function()
+ {
+ return (this.match(/^([a-fA-F0-9]{2}:){5}[a-fA-F0-9]{2}$/) != null);
+ },
+
+ 'host': function()
+ {
+ return cbi_validators.hostname.apply(this) ||
+ cbi_validators.ipaddr.apply(this);
+ },
+
+ 'hostname': function()
+ {
+ if (this.length <= 253)
+ return (this.match(/^[a-zA-Z0-9]+$/) != null ||
+ (this.match(/^[a-zA-Z0-9_][a-zA-Z0-9_\-.]*[a-zA-Z0-9]$/) &&
+ this.match(/[^0-9.]/)));
+
+ return false;
+ },
+
+ 'network': function()
+ {
+ return cbi_validators.uciname.apply(this) ||
+ cbi_validators.host.apply(this);
+ },
+
+ 'wpakey': function()
+ {
+ var v = this;
+
+ if( v.length == 64 )
+ return (v.match(/^[a-fA-F0-9]{64}$/) != null);
+ else
+ return (v.length >= 8) && (v.length <= 63);
+ },
+
+ 'wepkey': function()
+ {
+ var v = this;
+
+ if ( v.substr(0,2) == 's:' )
+ v = v.substr(2);
+
+ if( (v.length == 10) || (v.length == 26) )
+ return (v.match(/^[a-fA-F0-9]{10,26}$/) != null);
+ else
+ return (v.length == 5) || (v.length == 13);
+ },
+
+ 'uciname': function()
+ {
+ return (this.match(/^[a-zA-Z0-9_]+$/) != null);
+ },
+
+ 'range': function(min, max)
+ {
+ var val = parseFloat(this);
+ if (!isNaN(min) && !isNaN(max) && !isNaN(val))
+ return ((val >= min) && (val <= max));
+
+ return false;
+ },
+
+ 'min': function(min)
+ {
+ var val = parseFloat(this);
+ if (!isNaN(min) && !isNaN(val))
+ return (val >= min);
+
+ return false;
+ },
+
+ 'max': function(max)
+ {
+ var val = parseFloat(this);
+ if (!isNaN(max) && !isNaN(val))
+ return (val <= max);
+
+ return false;
+ },
+
+ 'rangelength': function(min, max)
+ {
+ var val = '' + this;
+ if (!isNaN(min) && !isNaN(max))
+ return ((val.length >= min) && (val.length <= max));
+
+ return false;
+ },
+
+ 'minlength': function(min)
+ {
+ var val = '' + this;
+ if (!isNaN(min))
+ return (val.length >= min);
+
+ return false;
+ },
+
+ 'maxlength': function(max)
+ {
+ var val = '' + this;
+ if (!isNaN(max))
+ return (val.length <= max);
+
+ return false;
+ },
+
+ 'or': function()
+ {
+ for (var i = 0; i < arguments.length; i += 2)
+ {
+ if (typeof arguments[i] != 'function')
+ {
+ if (arguments[i] == this)
+ return true;
+ i--;
+ }
+ else if (arguments[i].apply(this, arguments[i+1]))
+ {
+ return true;
+ }
+ }
+ return false;
+ },
+
+ 'and': function()
+ {
+ for (var i = 0; i < arguments.length; i += 2)
+ {
+ if (typeof arguments[i] != 'function')
+ {
+ if (arguments[i] != this)
+ return false;
+ i--;
+ }
+ else if (!arguments[i].apply(this, arguments[i+1]))
+ {
+ return false;
+ }
+ }
+ return true;
+ },
+
+ 'neg': function()
+ {
+ return cbi_validators.or.apply(
+ this.replace(/^[ \t]*![ \t]*/, ''), arguments);
+ },
+
+ 'list': function(subvalidator, subargs)
+ {
+ if (typeof subvalidator != 'function')
+ return false;
+
+ var tokens = this.match(/[^ \t]+/g);
+ for (var i = 0; i < tokens.length; i++)
+ if (!subvalidator.apply(tokens[i], subargs))
+ return false;
+
+ return true;
+ },
+ 'phonedigit': function()
+ {
+ return (this.match(/^[0-9\*#!\.]+$/) != null);
+ }
+};
+
+
+function cbi_d_add(field, dep, next) {
+ var obj = document.getElementById(field);
+ if (obj) {
+ var entry
+ for (var i=0; i<cbi_d.length; i++) {
+ if (cbi_d[i].id == field) {
+ entry = cbi_d[i];
+ break;
+ }
+ }
+ if (!entry) {
+ entry = {
+ "node": obj,
+ "id": field,
+ "parent": obj.parentNode.id,
+ "next": next,
+ "deps": []
+ };
+ cbi_d.unshift(entry);
+ }
+ entry.deps.push(dep)
+ }
+}
+
+function cbi_d_checkvalue(target, ref) {
+ var t = document.getElementById(target);
+ var value;
+
+ if (!t) {
+ var tl = document.getElementsByName(target);
+
+ if( tl.length > 0 && (tl[0].type == 'radio' || tl[0].type == 'checkbox'))
+ for( var i = 0; i < tl.length; i++ )
+ if( tl[i].checked ) {
+ value = tl[i].value;
+ break;
+ }
+
+ value = value ? value : "";
+ } else if (!t.value) {
+ value = "";
+ } else {
+ value = t.value;
+
+ if (t.type == "checkbox") {
+ value = t.checked ? value : "";
+ }
+ }
+
+ return (value == ref)
+}
+
+function cbi_d_check(deps) {
+ var reverse;
+ var def = false;
+ for (var i=0; i<deps.length; i++) {
+ var istat = true;
+ reverse = false;
+ for (var j in deps[i]) {
+ if (j == "!reverse") {
+ reverse = true;
+ } else if (j == "!default") {
+ def = true;
+ istat = false;
+ } else {
+ istat = (istat && cbi_d_checkvalue(j, deps[i][j]))
+ }
+ }
+ if (istat) {
+ return !reverse;
+ }
+ }
+ return def;
+}
+
+function cbi_d_update() {
+ var state = false;
+ for (var i=0; i<cbi_d.length; i++) {
+ var entry = cbi_d[i];
+ var next = document.getElementById(entry.next)
+ var node = document.getElementById(entry.id)
+ var parent = document.getElementById(entry.parent)
+
+ if (node && node.parentNode && !cbi_d_check(entry.deps)) {
+ node.parentNode.removeChild(node);
+ state = true;
+ if( entry.parent )
+ cbi_c[entry.parent]--;
+ } else if ((!node || !node.parentNode) && cbi_d_check(entry.deps)) {
+ if (!next) {
+ parent.appendChild(entry.node);
+ } else {
+ next.parentNode.insertBefore(entry.node, next);
+ }
+ state = true;
+ if( entry.parent )
+ cbi_c[entry.parent]++;
+ }
+ }
+
+ if (entry && entry.parent) {
+ if (!cbi_t_update())
+ cbi_tag_last(parent);
+ }
+
+ if (state) {
+ cbi_d_update();
+ }
+}
+
+function cbi_bind(obj, type, callback, mode) {
+ if (!obj.addEventListener) {
+ obj.attachEvent('on' + type,
+ function(){
+ var e = window.event;
+
+ if (!e.target && e.srcElement)
+ e.target = e.srcElement;
+
+ return !!callback(e);
+ }
+ );
+ } else {
+ obj.addEventListener(type, callback, !!mode);
+ }
+ return obj;
+}
+
+function cbi_combobox(id, values, def, man) {
+ var selid = "cbi.combobox." + id;
+ if (document.getElementById(selid)) {
+ return
+ }
+
+ var obj = document.getElementById(id)
+ var sel = document.createElement("select");
+ sel.id = selid;
+ sel.className = obj.className.replace(/cbi-input-text/, 'cbi-input-select');
+
+ if (obj.nextSibling) {
+ obj.parentNode.insertBefore(sel, obj.nextSibling);
+ } else {
+ obj.parentNode.appendChild(sel);
+ }
+
+ var dt = obj.getAttribute('cbi_datatype');
+ var op = obj.getAttribute('cbi_optional');
+
+ if (dt)
+ cbi_validate_field(sel, op == 'true', dt);
+
+ if (!values[obj.value]) {
+ if (obj.value == "") {
+ var optdef = document.createElement("option");
+ optdef.value = "";
+ optdef.appendChild(document.createTextNode(def));
+ sel.appendChild(optdef);
+ } else {
+ var opt = document.createElement("option");
+ opt.value = obj.value;
+ opt.selected = "selected";
+ opt.appendChild(document.createTextNode(obj.value));
+ sel.appendChild(opt);
+ }
+ }
+
+ for (var i in values) {
+ var opt = document.createElement("option");
+ opt.value = i;
+
+ if (obj.value == i) {
+ opt.selected = "selected";
+ }
+
+ opt.appendChild(document.createTextNode(values[i]));
+ sel.appendChild(opt);
+ }
+
+ var optman = document.createElement("option");
+ optman.value = "";
+ optman.appendChild(document.createTextNode(man));
+ sel.appendChild(optman);
+
+ obj.style.display = "none";
+
+ cbi_bind(sel, "change", function() {
+ if (sel.selectedIndex == sel.options.length - 1) {
+ obj.style.display = "inline";
+ sel.parentNode.removeChild(sel);
+ obj.focus();
+ } else {
+ obj.value = sel.options[sel.selectedIndex].value;
+ }
+
+ try {
+ cbi_d_update();
+ } catch (e) {
+ //Do nothing
+ }
+ })
+
+ // Retrigger validation in select
+ sel.focus();
+ sel.blur();
+}
+
+function cbi_combobox_init(id, values, def, man) {
+ var obj = document.getElementById(id);
+ cbi_bind(obj, "blur", function() {
+ cbi_combobox(id, values, def, man)
+ });
+ cbi_combobox(id, values, def, man);
+}
+
+function cbi_filebrowser(id, url, defpath) {
+ var field = document.getElementById(id);
+ var browser = window.open(
+ url + ( field.value || defpath || '' ) + '?field=' + id,
+ "luci_filebrowser", "width=300,height=400,left=100,top=200,scrollbars=yes"
+ );
+
+ browser.focus();
+}
+
+function cbi_browser_init(id, respath, url, defpath)
+{
+ function cbi_browser_btnclick(e) {
+ cbi_filebrowser(id, url, defpath);
+ return false;
+ }
+
+ var field = document.getElementById(id);
+
+ var btn = document.createElement('img');
+ btn.className = 'cbi-image-button';
+ btn.src = respath + '/cbi/folder.gif';
+ field.parentNode.insertBefore(btn, field.nextSibling);
+
+ cbi_bind(btn, 'click', cbi_browser_btnclick);
+}
+
+function cbi_dynlist_init(name, respath, datatype, optional, choices)
+{
+ var input0 = document.getElementsByName(name)[0];
+ var prefix = input0.name;
+ var parent = input0.parentNode;
+ var holder = input0.placeholder;
+
+ var values;
+
+ function cbi_dynlist_redraw(focus, add, del)
+ {
+ values = [ ];
+
+ while (parent.firstChild)
+ {
+ var n = parent.firstChild;
+ var i = parseInt(n.index);
+
+ if (i != del)
+ {
+ if (n.nodeName.toLowerCase() == 'input')
+ values.push(n.value || '');
+ else if (n.nodeName.toLowerCase() == 'select')
+ values[values.length-1] = n.options[n.selectedIndex].value;
+ }
+
+ parent.removeChild(n);
+ }
+
+ if (add >= 0)
+ {
+ focus = add+1;
+ values.splice(focus, 0, '');
+ }
+ else if (values.length == 0)
+ {
+ focus = 0;
+ values.push('');
+ }
+
+ for (var i = 0; i < values.length; i++)
+ {
+ var t = document.createElement('input');
+ t.id = prefix + '.' + (i+1);
+ t.name = prefix;
+ t.value = values[i];
+ t.type = 'text';
+ t.index = i;
+ t.className = 'cbi-input-text';
+
+ if (i == 0 && holder)
+ {
+ t.placeholder = holder;
+ }
+
+ var b = document.createElement('img');
+ b.src = respath + ((i+1) < values.length ? '/cbi/remove.gif' : '/cbi/add.gif');
+ b.className = 'cbi-image-button';
+
+ parent.appendChild(t);
+ parent.appendChild(b);
+ parent.appendChild(document.createElement('br'));
+
+ if (datatype)
+ {
+ cbi_validate_field(t.id, ((i+1) == values.length) || optional, datatype);
+ }
+
+ if (choices)
+ {
+ cbi_combobox_init(t.id, choices[0], '', choices[1]);
+ t.nextSibling.index = i;
+
+ cbi_bind(t.nextSibling, 'keydown', cbi_dynlist_keydown);
+ cbi_bind(t.nextSibling, 'keypress', cbi_dynlist_keypress);
+
+ if (i == focus || -i == focus)
+ t.nextSibling.focus();
+ }
+ else
+ {
+ cbi_bind(t, 'keydown', cbi_dynlist_keydown);
+ cbi_bind(t, 'keypress', cbi_dynlist_keypress);
+
+ if (i == focus)
+ {
+ t.focus();
+ }
+ else if (-i == focus)
+ {
+ t.focus();
+
+ /* force cursor to end */
+ var v = t.value;
+ t.value = ' '
+ t.value = v;
+ }
+ }
+
+ cbi_bind(b, 'click', cbi_dynlist_btnclick);
+ }
+ }
+
+ function cbi_dynlist_keypress(ev)
+ {
+ ev = ev ? ev : window.event;
+
+ var se = ev.target ? ev.target : ev.srcElement;
+
+ if (se.nodeType == 3)
+ se = se.parentNode;
+
+ switch (ev.keyCode)
+ {
+ /* backspace, delete */
+ case 8:
+ case 46:
+ if (se.value.length == 0)
+ {
+ if (ev.preventDefault)
+ ev.preventDefault();
+
+ return false;
+ }
+
+ return true;
+
+ /* enter, arrow up, arrow down */
+ case 13:
+ case 38:
+ case 40:
+ if (ev.preventDefault)
+ ev.preventDefault();
+
+ return false;
+ }
+
+ return true;
+ }
+
+ function cbi_dynlist_keydown(ev)
+ {
+ ev = ev ? ev : window.event;
+
+ var se = ev.target ? ev.target : ev.srcElement;
+
+ if (se.nodeType == 3)
+ se = se.parentNode;
+
+ var prev = se.previousSibling;
+ while (prev && prev.name != name)
+ prev = prev.previousSibling;
+
+ var next = se.nextSibling;
+ while (next && next.name != name)
+ next = next.nextSibling;
+
+ /* advance one further in combobox case */
+ if (next && next.nextSibling.name == name)
+ next = next.nextSibling;
+
+ switch (ev.keyCode)
+ {
+ /* backspace, delete */
+ case 8:
+ case 46:
+ var del = (se.nodeName.toLowerCase() == 'select')
+ ? true : (se.value.length == 0);
+
+ if (del)
+ {
+ if (ev.preventDefault)
+ ev.preventDefault();
+
+ var focus = se.index;
+ if (ev.keyCode == 8)
+ focus = -focus+1;
+
+ cbi_dynlist_redraw(focus, -1, se.index);
+
+ return false;
+ }
+
+ break;
+
+ /* enter */
+ case 13:
+ cbi_dynlist_redraw(-1, se.index, -1);
+ break;
+
+ /* arrow up */
+ case 38:
+ if (prev)
+ prev.focus();
+
+ break;
+
+ /* arrow down */
+ case 40:
+ if (next)
+ next.focus();
+
+ break;
+ }
+
+ return true;
+ }
+
+ function cbi_dynlist_btnclick(ev)
+ {
+ ev = ev ? ev : window.event;
+
+ var se = ev.target ? ev.target : ev.srcElement;
+
+ if (se.src.indexOf('remove') > -1)
+ {
+ se.previousSibling.value = '';
+
+ cbi_dynlist_keydown({
+ target: se.previousSibling,
+ keyCode: 8
+ });
+ }
+ else
+ {
+ cbi_dynlist_keydown({
+ target: se.previousSibling,
+ keyCode: 13
+ });
+ }
+
+ return false;
+ }
+
+ cbi_dynlist_redraw(NaN, -1, -1);
+}
+
+//Hijacks the CBI form to send via XHR (requires Prototype)
+function cbi_hijack_forms(layer, win, fail, load) {
+ var forms = layer.getElementsByTagName('form');
+ for (var i=0; i<forms.length; i++) {
+ $(forms[i]).observe('submit', function(event) {
+ // Prevent the form from also submitting the regular way
+ event.stop();
+
+ // Submit via XHR
+ event.element().request({
+ onSuccess: win,
+ onFailure: fail
+ });
+
+ if (load) {
+ load();
+ }
+ });
+ }
+}
+
+
+function cbi_t_add(section, tab) {
+ var t = document.getElementById('tab.' + section + '.' + tab);
+ var c = document.getElementById('container.' + section + '.' + tab);
+
+ if( t && c ) {
+ cbi_t[section] = (cbi_t[section] || [ ]);
+ cbi_t[section][tab] = { 'tab': t, 'container': c, 'cid': c.id };
+ }
+}
+
+function cbi_t_switch(section, tab) {
+ if( cbi_t[section] && cbi_t[section][tab] ) {
+ var o = cbi_t[section][tab];
+ var h = document.getElementById('tab.' + section);
+ for( var tid in cbi_t[section] ) {
+ var o2 = cbi_t[section][tid];
+ if( o.tab.id != o2.tab.id ) {
+ o2.tab.className = o2.tab.className.replace(/(^| )cbi-tab( |$)/, " cbi-tab-disabled ");
+ o2.container.style.display = 'none';
+ }
+ else {
+ if(h) h.value = tab;
+ o2.tab.className = o2.tab.className.replace(/(^| )cbi-tab-disabled( |$)/, " cbi-tab ");
+ o2.container.style.display = 'block';
+ }
+ }
+ }
+ return false
+}
+
+function cbi_t_update() {
+ var hl_tabs = [ ];
+ var updated = false;
+
+ for( var sid in cbi_t )
+ for( var tid in cbi_t[sid] )
+ {
+ if( cbi_c[cbi_t[sid][tid].cid] == 0 ) {
+ cbi_t[sid][tid].tab.style.display = 'none';
+ }
+ else if( cbi_t[sid][tid].tab && cbi_t[sid][tid].tab.style.display == 'none' ) {
+ cbi_t[sid][tid].tab.style.display = '';
+
+ var t = cbi_t[sid][tid].tab;
+ t.className += ' cbi-tab-highlighted';
+ hl_tabs.push(t);
+ }
+
+ cbi_tag_last(cbi_t[sid][tid].container);
+ updated = true;
+ }
+
+ if( hl_tabs.length > 0 )
+ window.setTimeout(function() {
+ for( var i = 0; i < hl_tabs.length; i++ )
+ hl_tabs[i].className = hl_tabs[i].className.replace(/ cbi-tab-highlighted/g, '');
+ }, 750);
+
+ return updated;
+}
+
+
+function cbi_validate_form(form, errmsg)
+{
+ /* if triggered by a section removal or addition, don't validate */
+ if( form.cbi_state == 'add-section' || form.cbi_state == 'del-section' )
+ return true;
+
+ if( form.cbi_validators )
+ {
+ for( var i = 0; i < form.cbi_validators.length; i++ )
+ {
+ var validator = form.cbi_validators[i];
+ if( !validator() && errmsg )
+ {
+ alert(errmsg);
+ return false;
+ }
+ }
+ }
+
+ return true;
+}
+
+function cbi_validate_reset(form)
+{
+ window.setTimeout(
+ function() { cbi_validate_form(form, null) }, 100
+ );
+
+ return true;
+}
+
+function cbi_validate_compile(code)
+{
+ var pos = 0;
+ var esc = false;
+ var depth = 0;
+ var stack = [ ];
+
+ code += ',';
+
+ for (var i = 0; i < code.length; i++)
+ {
+ if (esc)
+ {
+ esc = false;
+ continue;
+ }
+
+ switch (code.charCodeAt(i))
+ {
+ case 92:
+ esc = true;
+ break;
+
+ case 40:
+ case 44:
+ if (depth <= 0)
+ {
+ if (pos < i)
+ {
+ var label = code.substring(pos, i);
+ label = label.replace(/\\(.)/g, '$1');
+ label = label.replace(/^[ \t]+/g, '');
+ label = label.replace(/[ \t]+$/g, '');
+
+ if (label && !isNaN(label))
+ {
+ stack.push(parseFloat(label));
+ }
+ else if (label.match(/^(['"]).*\1$/))
+ {
+ stack.push(label.replace(/^(['"])(.*)\1$/, '$2'));
+ }
+ else if (typeof cbi_validators[label] == 'function')
+ {
+ stack.push(cbi_validators[label]);
+ stack.push(null);
+ }
+ else
+ {
+ throw "Syntax error, unhandled token '"+label+"'";
+ }
+ }
+ pos = i+1;
+ }
+ depth += (code.charCodeAt(i) == 40);
+ break;
+
+ case 41:
+ if (--depth <= 0)
+ {
+ if (typeof stack[stack.length-2] != 'function')
+ throw "Syntax error, argument list follows non-function";
+
+ stack[stack.length-1] =
+ arguments.callee(code.substring(pos, i));
+
+ pos = i+1;
+ }
+ break;
+ }
+ }
+
+ return stack;
+}
+
+function cbi_validate_field(cbid, optional, type)
+{
+ var field = (typeof cbid == "string") ? document.getElementById(cbid) : cbid;
+ var vstack; try { vstack = cbi_validate_compile(type); } catch(e) { };
+
+ if (field && vstack && typeof vstack[0] == "function")
+ {
+ var validator = function()
+ {
+ // is not detached
+ if( field.form )
+ {
+ field.className = field.className.replace(/ cbi-input-invalid/g, '');
+
+ // validate value
+ var value = (field.options && field.options.selectedIndex > -1)
+ ? field.options[field.options.selectedIndex].value : field.value;
+
+ if (!(((value.length == 0) && optional) || vstack[0].apply(value, vstack[1])))
+ {
+ // invalid
+ field.className += ' cbi-input-invalid';
+ return false;
+ }
+ }
+
+ return true;
+ };
+
+ if( ! field.form.cbi_validators )
+ field.form.cbi_validators = [ ];
+
+ field.form.cbi_validators.push(validator);
+
+ cbi_bind(field, "blur", validator);
+ cbi_bind(field, "keyup", validator);
+
+ if (field.nodeName == 'SELECT')
+ {
+ cbi_bind(field, "change", validator);
+ cbi_bind(field, "click", validator);
+ }
+
+ field.setAttribute("cbi_validate", validator);
+ field.setAttribute("cbi_datatype", type);
+ field.setAttribute("cbi_optional", (!!optional).toString());
+
+ validator();
+
+ var fcbox = document.getElementById('cbi.combobox.' + field.id);
+ if (fcbox)
+ cbi_validate_field(fcbox, optional, type);
+ }
+}
+
+function cbi_row_swap(elem, up, store)
+{
+ var tr = elem.parentNode;
+ while (tr && tr.nodeName.toLowerCase() != 'tr')
+ tr = tr.parentNode;
+
+ if (!tr)
+ return false;
+
+ var table = tr.parentNode;
+ while (table && table.nodeName.toLowerCase() != 'table')
+ table = table.parentNode;
+
+ if (!table)
+ return false;
+
+ var s = up ? 3 : 2;
+ var e = up ? table.rows.length : table.rows.length - 1;
+
+ for (var idx = s; idx < e; idx++)
+ {
+ if (table.rows[idx] == tr)
+ {
+ if (up)
+ tr.parentNode.insertBefore(table.rows[idx], table.rows[idx-1]);
+ else
+ tr.parentNode.insertBefore(table.rows[idx+1], table.rows[idx]);
+
+ break;
+ }
+ }
+
+ var ids = [ ];
+ for (idx = 2; idx < table.rows.length; idx++)
+ {
+ table.rows[idx].className = table.rows[idx].className.replace(
+ /cbi-rowstyle-[12]/, 'cbi-rowstyle-' + (1 + (idx % 2))
+ );
+
+ if (table.rows[idx].id && table.rows[idx].id.match(/-([^\-]+)$/) )
+ ids.push(RegExp.$1);
+ }
+
+ var input = document.getElementById(store);
+ if (input)
+ input.value = ids.join(' ');
+
+ return false;
+}
+
+function cbi_tag_last(container)
+{
+ var last;
+
+ for (var i = 0; i < container.childNodes.length; i++)
+ {
+ var c = container.childNodes[i];
+ if (c.nodeType == 1 && c.nodeName.toLowerCase() == 'div')
+ {
+ c.className = c.className.replace(/ cbi-value-last$/, '');
+ last = c;
+ }
+ }
+
+ if (last)
+ {
+ last.className += ' cbi-value-last';
+ }
+}
+
+String.prototype.serialize = function()
+{
+ var o = this;
+ switch(typeof(o))
+ {
+ case 'object':
+ // null
+ if( o == null )
+ {
+ return 'null';
+ }
+
+ // array
+ else if( o.length )
+ {
+ var i, s = '';
+
+ for( var i = 0; i < o.length; i++ )
+ s += (s ? ', ' : '') + String.serialize(o[i]);
+
+ return '[ ' + s + ' ]';
+ }
+
+ // object
+ else
+ {
+ var k, s = '';
+
+ for( k in o )
+ s += (s ? ', ' : '') + k + ': ' + String.serialize(o[k]);
+
+ return '{ ' + s + ' }';
+ }
+
+ break;
+
+ case 'string':
+ // complex string
+ if( o.match(/[^a-zA-Z0-9_,.: -]/) )
+ return 'decodeURIComponent("' + encodeURIComponent(o) + '")';
+
+ // simple string
+ else
+ return '"' + o + '"';
+
+ break;
+
+ default:
+ return o.toString();
+ }
+}
+
+String.prototype.format = function()
+{
+ if (!RegExp)
+ return;
+
+ var html_esc = [/&/g, '&#38;', /"/g, '&#34;', /'/g, '&#39;', /</g, '&#60;', />/g, '&#62;'];
+ var quot_esc = [/"/g, '&#34;', /'/g, '&#39;'];
+
+ function esc(s, r) {
+ for( var i = 0; i < r.length; i += 2 )
+ s = s.replace(r[i], r[i+1]);
+ return s;
+ }
+
+ var str = this;
+ var out = '';
+ var re = /^(([^%]*)%('.|0|\x20)?(-)?(\d+)?(\.\d+)?(%|b|c|d|u|f|o|s|x|X|q|h|j|t|m))/;
+ var a = b = [], numSubstitutions = 0, numMatches = 0;
+
+ while( a = re.exec(str) )
+ {
+ var m = a[1];
+ var leftpart = a[2], pPad = a[3], pJustify = a[4], pMinLength = a[5];
+ var pPrecision = a[6], pType = a[7];
+
+ numMatches++;
+
+ if (pType == '%')
+ {
+ subst = '%';
+ }
+ else
+ {
+ if (numSubstitutions < arguments.length)
+ {
+ var param = arguments[numSubstitutions++];
+
+ var pad = '';
+ if (pPad && pPad.substr(0,1) == "'")
+ pad = leftpart.substr(1,1);
+ else if (pPad)
+ pad = pPad;
+
+ var justifyRight = true;
+ if (pJustify && pJustify === "-")
+ justifyRight = false;
+
+ var minLength = -1;
+ if (pMinLength)
+ minLength = parseInt(pMinLength);
+
+ var precision = -1;
+ if (pPrecision && pType == 'f')
+ precision = parseInt(pPrecision.substring(1));
+
+ var subst = param;
+
+ switch(pType)
+ {
+ case 'b':
+ subst = (parseInt(param) || 0).toString(2);
+ break;
+
+ case 'c':
+ subst = String.fromCharCode(parseInt(param) || 0);
+ break;
+
+ case 'd':
+ subst = (parseInt(param) || 0);
+ break;
+
+ case 'u':
+ subst = Math.abs(parseInt(param) || 0);
+ break;
+
+ case 'f':
+ subst = (precision > -1)
+ ? ((parseFloat(param) || 0.0)).toFixed(precision)
+ : (parseFloat(param) || 0.0);
+ break;
+
+ case 'o':
+ subst = (parseInt(param) || 0).toString(8);
+ break;
+
+ case 's':
+ subst = param;
+ break;
+
+ case 'x':
+ subst = ('' + (parseInt(param) || 0).toString(16)).toLowerCase();
+ break;
+
+ case 'X':
+ subst = ('' + (parseInt(param) || 0).toString(16)).toUpperCase();
+ break;
+
+ case 'h':
+ subst = esc(param, html_esc);
+ break;
+
+ case 'q':
+ subst = esc(param, quot_esc);
+ break;
+
+ case 'j':
+ subst = String.serialize(param);
+ break;
+
+ case 't':
+ var td = 0;
+ var th = 0;
+ var tm = 0;
+ var ts = (param || 0);
+
+ if (ts > 60) {
+ tm = Math.floor(ts / 60);
+ ts = (ts % 60);
+ }
+
+ if (tm > 60) {
+ th = Math.floor(tm / 60);
+ tm = (tm % 60);
+ }
+
+ if (th > 24) {
+ td = Math.floor(th / 24);
+ th = (th % 24);
+ }
+
+ subst = (td > 0)
+ ? String.format('%dd %dh %dm %ds', td, th, tm, ts)
+ : String.format('%dh %dm %ds', th, tm, ts);
+
+ break;
+
+ case 'm':
+ var mf = pMinLength ? parseInt(pMinLength) : 1000;
+ var pr = pPrecision ? Math.floor(10*parseFloat('0'+pPrecision)) : 2;
+
+ var i = 0;
+ var val = parseFloat(param || 0);
+ var units = [ '', 'K', 'M', 'G', 'T', 'P', 'E' ];
+
+ for (i = 0; (i < units.length) && (val > mf); i++)
+ val /= mf;
+
+ subst = val.toFixed(pr) + ' ' + units[i];
+ break;
+ }
+ }
+ }
+
+ out += leftpart + subst;
+ str = str.substr(m.length);
+ }
+
+ return out + str;
+}
+
+String.prototype.nobr = function()
+{
+ return this.replace(/[\s\n]+/g, '&#160;');
+}
+
+String.serialize = function()
+{
+ var a = [ ];
+ for (var i = 1; i < arguments.length; i++)
+ a.push(arguments[i]);
+ return ''.serialize.apply(arguments[0], a);
+}
+
+String.format = function()
+{
+ var a = [ ];
+ for (var i = 1; i < arguments.length; i++)
+ a.push(arguments[i]);
+ return ''.format.apply(arguments[0], a);
+}
+
+String.nobr = function()
+{
+ var a = [ ];
+ for (var i = 1; i < arguments.length; i++)
+ a.push(arguments[i]);
+ return ''.nobr.apply(arguments[0], a);
+}
diff --git a/modules/base/htdocs/luci-static/resources/cbi/add.gif b/modules/base/htdocs/luci-static/resources/cbi/add.gif
new file mode 100644
index 000000000..0888abf85
--- /dev/null
+++ b/modules/base/htdocs/luci-static/resources/cbi/add.gif
Binary files differ
diff --git a/modules/base/htdocs/luci-static/resources/cbi/apply.gif b/modules/base/htdocs/luci-static/resources/cbi/apply.gif
new file mode 100644
index 000000000..82ae7ed82
--- /dev/null
+++ b/modules/base/htdocs/luci-static/resources/cbi/apply.gif
Binary files differ
diff --git a/modules/base/htdocs/luci-static/resources/cbi/arrow.gif b/modules/base/htdocs/luci-static/resources/cbi/arrow.gif
new file mode 100644
index 000000000..10d797e9b
--- /dev/null
+++ b/modules/base/htdocs/luci-static/resources/cbi/arrow.gif
Binary files differ
diff --git a/modules/base/htdocs/luci-static/resources/cbi/down.gif b/modules/base/htdocs/luci-static/resources/cbi/down.gif
new file mode 100644
index 000000000..f0bb6a4ea
--- /dev/null
+++ b/modules/base/htdocs/luci-static/resources/cbi/down.gif
Binary files differ
diff --git a/modules/base/htdocs/luci-static/resources/cbi/download.gif b/modules/base/htdocs/luci-static/resources/cbi/download.gif
new file mode 100644
index 000000000..f99a5383b
--- /dev/null
+++ b/modules/base/htdocs/luci-static/resources/cbi/download.gif
Binary files differ
diff --git a/modules/base/htdocs/luci-static/resources/cbi/edit.gif b/modules/base/htdocs/luci-static/resources/cbi/edit.gif
new file mode 100644
index 000000000..7b02b6e72
--- /dev/null
+++ b/modules/base/htdocs/luci-static/resources/cbi/edit.gif
Binary files differ
diff --git a/modules/base/htdocs/luci-static/resources/cbi/fieldadd.gif b/modules/base/htdocs/luci-static/resources/cbi/fieldadd.gif
new file mode 100644
index 000000000..431ff64d1
--- /dev/null
+++ b/modules/base/htdocs/luci-static/resources/cbi/fieldadd.gif
Binary files differ
diff --git a/modules/base/htdocs/luci-static/resources/cbi/file.gif b/modules/base/htdocs/luci-static/resources/cbi/file.gif
new file mode 100644
index 000000000..3b1217dd6
--- /dev/null
+++ b/modules/base/htdocs/luci-static/resources/cbi/file.gif
Binary files differ
diff --git a/modules/base/htdocs/luci-static/resources/cbi/find.gif b/modules/base/htdocs/luci-static/resources/cbi/find.gif
new file mode 100644
index 000000000..9ae5e3489
--- /dev/null
+++ b/modules/base/htdocs/luci-static/resources/cbi/find.gif
Binary files differ
diff --git a/modules/base/htdocs/luci-static/resources/cbi/folder.gif b/modules/base/htdocs/luci-static/resources/cbi/folder.gif
new file mode 100644
index 000000000..22b583bb5
--- /dev/null
+++ b/modules/base/htdocs/luci-static/resources/cbi/folder.gif
Binary files differ
diff --git a/modules/base/htdocs/luci-static/resources/cbi/help.gif b/modules/base/htdocs/luci-static/resources/cbi/help.gif
new file mode 100644
index 000000000..9dfa0e196
--- /dev/null
+++ b/modules/base/htdocs/luci-static/resources/cbi/help.gif
Binary files differ
diff --git a/modules/base/htdocs/luci-static/resources/cbi/key.gif b/modules/base/htdocs/luci-static/resources/cbi/key.gif
new file mode 100644
index 000000000..e3853e5af
--- /dev/null
+++ b/modules/base/htdocs/luci-static/resources/cbi/key.gif
Binary files differ
diff --git a/modules/base/htdocs/luci-static/resources/cbi/link.gif b/modules/base/htdocs/luci-static/resources/cbi/link.gif
new file mode 100644
index 000000000..f0bb78da6
--- /dev/null
+++ b/modules/base/htdocs/luci-static/resources/cbi/link.gif
Binary files differ
diff --git a/modules/base/htdocs/luci-static/resources/cbi/reload.gif b/modules/base/htdocs/luci-static/resources/cbi/reload.gif
new file mode 100644
index 000000000..8268958a1
--- /dev/null
+++ b/modules/base/htdocs/luci-static/resources/cbi/reload.gif
Binary files differ
diff --git a/modules/base/htdocs/luci-static/resources/cbi/remove.gif b/modules/base/htdocs/luci-static/resources/cbi/remove.gif
new file mode 100644
index 000000000..bf43a0a0b
--- /dev/null
+++ b/modules/base/htdocs/luci-static/resources/cbi/remove.gif
Binary files differ
diff --git a/modules/base/htdocs/luci-static/resources/cbi/reset.gif b/modules/base/htdocs/luci-static/resources/cbi/reset.gif
new file mode 100644
index 000000000..c941c1902
--- /dev/null
+++ b/modules/base/htdocs/luci-static/resources/cbi/reset.gif
Binary files differ
diff --git a/modules/base/htdocs/luci-static/resources/cbi/save.gif b/modules/base/htdocs/luci-static/resources/cbi/save.gif
new file mode 100644
index 000000000..35e949963
--- /dev/null
+++ b/modules/base/htdocs/luci-static/resources/cbi/save.gif
Binary files differ
diff --git a/modules/base/htdocs/luci-static/resources/cbi/up.gif b/modules/base/htdocs/luci-static/resources/cbi/up.gif
new file mode 100644
index 000000000..e8234178e
--- /dev/null
+++ b/modules/base/htdocs/luci-static/resources/cbi/up.gif
Binary files differ
diff --git a/modules/base/htdocs/luci-static/resources/cbi/user.gif b/modules/base/htdocs/luci-static/resources/cbi/user.gif
new file mode 100644
index 000000000..dcb5c2a89
--- /dev/null
+++ b/modules/base/htdocs/luci-static/resources/cbi/user.gif
Binary files differ
diff --git a/modules/base/htdocs/luci-static/resources/icons/bridge.png b/modules/base/htdocs/luci-static/resources/icons/bridge.png
new file mode 100644
index 000000000..4c163bf69
--- /dev/null
+++ b/modules/base/htdocs/luci-static/resources/icons/bridge.png
Binary files differ
diff --git a/modules/base/htdocs/luci-static/resources/icons/bridge_disabled.png b/modules/base/htdocs/luci-static/resources/icons/bridge_disabled.png
new file mode 100644
index 000000000..0f367c536
--- /dev/null
+++ b/modules/base/htdocs/luci-static/resources/icons/bridge_disabled.png
Binary files differ
diff --git a/modules/base/htdocs/luci-static/resources/icons/encryption.png b/modules/base/htdocs/luci-static/resources/icons/encryption.png
new file mode 100644
index 000000000..41d2ba9ac
--- /dev/null
+++ b/modules/base/htdocs/luci-static/resources/icons/encryption.png
Binary files differ
diff --git a/modules/base/htdocs/luci-static/resources/icons/encryption_disabled.png b/modules/base/htdocs/luci-static/resources/icons/encryption_disabled.png
new file mode 100644
index 000000000..f2e05a425
--- /dev/null
+++ b/modules/base/htdocs/luci-static/resources/icons/encryption_disabled.png
Binary files differ
diff --git a/modules/base/htdocs/luci-static/resources/icons/ethernet.png b/modules/base/htdocs/luci-static/resources/icons/ethernet.png
new file mode 100644
index 000000000..a02538124
--- /dev/null
+++ b/modules/base/htdocs/luci-static/resources/icons/ethernet.png
Binary files differ
diff --git a/modules/base/htdocs/luci-static/resources/icons/ethernet_disabled.png b/modules/base/htdocs/luci-static/resources/icons/ethernet_disabled.png
new file mode 100644
index 000000000..2bb02e455
--- /dev/null
+++ b/modules/base/htdocs/luci-static/resources/icons/ethernet_disabled.png
Binary files differ
diff --git a/modules/base/htdocs/luci-static/resources/icons/loading.gif b/modules/base/htdocs/luci-static/resources/icons/loading.gif
new file mode 100644
index 000000000..5bb90fd6a
--- /dev/null
+++ b/modules/base/htdocs/luci-static/resources/icons/loading.gif
Binary files differ
diff --git a/modules/base/htdocs/luci-static/resources/icons/port_down.png b/modules/base/htdocs/luci-static/resources/icons/port_down.png
new file mode 100644
index 000000000..25ea17232
--- /dev/null
+++ b/modules/base/htdocs/luci-static/resources/icons/port_down.png
Binary files differ
diff --git a/modules/base/htdocs/luci-static/resources/icons/port_up.png b/modules/base/htdocs/luci-static/resources/icons/port_up.png
new file mode 100644
index 000000000..e06303791
--- /dev/null
+++ b/modules/base/htdocs/luci-static/resources/icons/port_up.png
Binary files differ
diff --git a/modules/base/htdocs/luci-static/resources/icons/signal-0-25.png b/modules/base/htdocs/luci-static/resources/icons/signal-0-25.png
new file mode 100644
index 000000000..2e5dff466
--- /dev/null
+++ b/modules/base/htdocs/luci-static/resources/icons/signal-0-25.png
Binary files differ
diff --git a/modules/base/htdocs/luci-static/resources/icons/signal-0.png b/modules/base/htdocs/luci-static/resources/icons/signal-0.png
new file mode 100644
index 000000000..114583a67
--- /dev/null
+++ b/modules/base/htdocs/luci-static/resources/icons/signal-0.png
Binary files differ
diff --git a/modules/base/htdocs/luci-static/resources/icons/signal-25-50.png b/modules/base/htdocs/luci-static/resources/icons/signal-25-50.png
new file mode 100644
index 000000000..ee8cc4f1c
--- /dev/null
+++ b/modules/base/htdocs/luci-static/resources/icons/signal-25-50.png
Binary files differ
diff --git a/modules/base/htdocs/luci-static/resources/icons/signal-50-75.png b/modules/base/htdocs/luci-static/resources/icons/signal-50-75.png
new file mode 100644
index 000000000..26bcbf715
--- /dev/null
+++ b/modules/base/htdocs/luci-static/resources/icons/signal-50-75.png
Binary files differ
diff --git a/modules/base/htdocs/luci-static/resources/icons/signal-75-100.png b/modules/base/htdocs/luci-static/resources/icons/signal-75-100.png
new file mode 100644
index 000000000..5cffaa1b8
--- /dev/null
+++ b/modules/base/htdocs/luci-static/resources/icons/signal-75-100.png
Binary files differ
diff --git a/modules/base/htdocs/luci-static/resources/icons/signal-none.png b/modules/base/htdocs/luci-static/resources/icons/signal-none.png
new file mode 100644
index 000000000..b77585c0f
--- /dev/null
+++ b/modules/base/htdocs/luci-static/resources/icons/signal-none.png
Binary files differ
diff --git a/modules/base/htdocs/luci-static/resources/icons/switch.png b/modules/base/htdocs/luci-static/resources/icons/switch.png
new file mode 100644
index 000000000..5c99ba568
--- /dev/null
+++ b/modules/base/htdocs/luci-static/resources/icons/switch.png
Binary files differ
diff --git a/modules/base/htdocs/luci-static/resources/icons/switch_disabled.png b/modules/base/htdocs/luci-static/resources/icons/switch_disabled.png
new file mode 100644
index 000000000..b8c84c8dc
--- /dev/null
+++ b/modules/base/htdocs/luci-static/resources/icons/switch_disabled.png
Binary files differ
diff --git a/modules/base/htdocs/luci-static/resources/icons/tunnel.png b/modules/base/htdocs/luci-static/resources/icons/tunnel.png
new file mode 100644
index 000000000..c5a09dd68
--- /dev/null
+++ b/modules/base/htdocs/luci-static/resources/icons/tunnel.png
Binary files differ
diff --git a/modules/base/htdocs/luci-static/resources/icons/tunnel_disabled.png b/modules/base/htdocs/luci-static/resources/icons/tunnel_disabled.png
new file mode 100644
index 000000000..ad9856cfe
--- /dev/null
+++ b/modules/base/htdocs/luci-static/resources/icons/tunnel_disabled.png
Binary files differ
diff --git a/modules/base/htdocs/luci-static/resources/icons/vlan.png b/modules/base/htdocs/luci-static/resources/icons/vlan.png
new file mode 100644
index 000000000..5c99ba568
--- /dev/null
+++ b/modules/base/htdocs/luci-static/resources/icons/vlan.png
Binary files differ
diff --git a/modules/base/htdocs/luci-static/resources/icons/vlan_disabled.png b/modules/base/htdocs/luci-static/resources/icons/vlan_disabled.png
new file mode 100644
index 000000000..b8c84c8dc
--- /dev/null
+++ b/modules/base/htdocs/luci-static/resources/icons/vlan_disabled.png
Binary files differ
diff --git a/modules/base/htdocs/luci-static/resources/icons/wifi.png b/modules/base/htdocs/luci-static/resources/icons/wifi.png
new file mode 100644
index 000000000..528ce2b4e
--- /dev/null
+++ b/modules/base/htdocs/luci-static/resources/icons/wifi.png
Binary files differ
diff --git a/modules/base/htdocs/luci-static/resources/icons/wifi_big.png b/modules/base/htdocs/luci-static/resources/icons/wifi_big.png
new file mode 100644
index 000000000..d73a5e740
--- /dev/null
+++ b/modules/base/htdocs/luci-static/resources/icons/wifi_big.png
Binary files differ
diff --git a/modules/base/htdocs/luci-static/resources/icons/wifi_big_disabled.png b/modules/base/htdocs/luci-static/resources/icons/wifi_big_disabled.png
new file mode 100644
index 000000000..af93b37b7
--- /dev/null
+++ b/modules/base/htdocs/luci-static/resources/icons/wifi_big_disabled.png
Binary files differ
diff --git a/modules/base/htdocs/luci-static/resources/icons/wifi_disabled.png b/modules/base/htdocs/luci-static/resources/icons/wifi_disabled.png
new file mode 100644
index 000000000..338a34f78
--- /dev/null
+++ b/modules/base/htdocs/luci-static/resources/icons/wifi_disabled.png
Binary files differ
diff --git a/modules/base/htdocs/luci-static/resources/xhr.js b/modules/base/htdocs/luci-static/resources/xhr.js
new file mode 100644
index 000000000..701c12ac1
--- /dev/null
+++ b/modules/base/htdocs/luci-static/resources/xhr.js
@@ -0,0 +1,241 @@
+/*
+ * xhr.js - XMLHttpRequest helper class
+ * (c) 2008-2010 Jo-Philipp Wich
+ */
+
+XHR = function()
+{
+ this.reinit = function()
+ {
+ if (window.XMLHttpRequest) {
+ this._xmlHttp = new XMLHttpRequest();
+ }
+ else if (window.ActiveXObject) {
+ this._xmlHttp = new ActiveXObject("Microsoft.XMLHTTP");
+ }
+ else {
+ alert("xhr.js: XMLHttpRequest is not supported by this browser!");
+ }
+ }
+
+ this.busy = function() {
+ if (!this._xmlHttp)
+ return false;
+
+ switch (this._xmlHttp.readyState)
+ {
+ case 1:
+ case 2:
+ case 3:
+ return true;
+
+ default:
+ return false;
+ }
+ }
+
+ this.abort = function() {
+ if (this.busy())
+ this._xmlHttp.abort();
+ }
+
+ this.get = function(url,data,callback)
+ {
+ this.reinit();
+
+ var xhr = this._xmlHttp;
+ var code = this._encode(data);
+
+ url = location.protocol + '//' + location.host + url;
+
+ if (code)
+ if (url.substr(url.length-1,1) == '&')
+ url += code;
+ else
+ url += '?' + code;
+
+ xhr.open('GET', url, true);
+
+ xhr.onreadystatechange = function()
+ {
+ if (xhr.readyState == 4) {
+ var json = null;
+ if (xhr.getResponseHeader("Content-Type") == "application/json") {
+ try {
+ json = eval('(' + xhr.responseText + ')');
+ }
+ catch(e) {
+ json = null;
+ }
+ }
+
+ callback(xhr, json);
+ }
+ }
+
+ xhr.send(null);
+ }
+
+ this.post = function(url,data,callback)
+ {
+ this.reinit();
+
+ var xhr = this._xmlHttp;
+ var code = this._encode(data);
+
+ xhr.onreadystatechange = function()
+ {
+ if (xhr.readyState == 4)
+ callback(xhr);
+ }
+
+ xhr.open('POST', url, true);
+ xhr.setRequestHeader('Content-type', 'application/x-www-form-urlencoded');
+ xhr.setRequestHeader('Content-length', code.length);
+ xhr.setRequestHeader('Connection', 'close');
+ xhr.send(code);
+ }
+
+ this.cancel = function()
+ {
+ this._xmlHttp.onreadystatechange = function(){};
+ this._xmlHttp.abort();
+ }
+
+ this.send_form = function(form,callback,extra_values)
+ {
+ var code = '';
+
+ for (var i = 0; i < form.elements.length; i++)
+ {
+ var e = form.elements[i];
+
+ if (e.options)
+ {
+ code += (code ? '&' : '') +
+ form.elements[i].name + '=' + encodeURIComponent(
+ e.options[e.selectedIndex].value
+ );
+ }
+ else if (e.length)
+ {
+ for (var j = 0; j < e.length; j++)
+ if (e[j].name) {
+ code += (code ? '&' : '') +
+ e[j].name + '=' + encodeURIComponent(e[j].value);
+ }
+ }
+ else
+ {
+ code += (code ? '&' : '') +
+ e.name + '=' + encodeURIComponent(e.value);
+ }
+ }
+
+ if (typeof extra_values == 'object')
+ for (var key in extra_values)
+ code += (code ? '&' : '') +
+ key + '=' + encodeURIComponent(extra_values[key]);
+
+ return(
+ (form.method == 'get')
+ ? this.get(form.getAttribute('action'), code, callback)
+ : this.post(form.getAttribute('action'), code, callback)
+ );
+ }
+
+ this._encode = function(obj)
+ {
+ obj = obj ? obj : { };
+ obj['_'] = Math.random();
+
+ if (typeof obj == 'object')
+ {
+ var code = '';
+ var self = this;
+
+ for (var k in obj)
+ code += (code ? '&' : '') +
+ k + '=' + encodeURIComponent(obj[k]);
+
+ return code;
+ }
+
+ return obj;
+ }
+}
+
+XHR.get = function(url, data, callback)
+{
+ (new XHR()).get(url, data, callback);
+}
+
+XHR.poll = function(interval, url, data, callback)
+{
+ if (isNaN(interval) || interval < 1)
+ interval = 5;
+
+ if (!XHR._q)
+ {
+ XHR._t = 0;
+ XHR._q = [ ];
+ XHR._r = function() {
+ for (var i = 0, e = XHR._q[0]; i < XHR._q.length; e = XHR._q[++i])
+ {
+ if (!(XHR._t % e.interval) && !e.xhr.busy())
+ e.xhr.get(e.url, e.data, e.callback);
+ }
+
+ XHR._t++;
+ };
+ }
+
+ XHR._q.push({
+ interval: interval,
+ callback: callback,
+ url: url,
+ data: data,
+ xhr: new XHR()
+ });
+
+ XHR.run();
+}
+
+XHR.halt = function()
+{
+ if (XHR._i)
+ {
+ /* show & set poll indicator */
+ try {
+ document.getElementById('xhr_poll_status').style.display = '';
+ document.getElementById('xhr_poll_status_on').style.display = 'none';
+ document.getElementById('xhr_poll_status_off').style.display = '';
+ } catch(e) { }
+
+ window.clearInterval(XHR._i);
+ XHR._i = null;
+ }
+}
+
+XHR.run = function()
+{
+ if (XHR._r && !XHR._i)
+ {
+ /* show & set poll indicator */
+ try {
+ document.getElementById('xhr_poll_status').style.display = '';
+ document.getElementById('xhr_poll_status_on').style.display = '';
+ document.getElementById('xhr_poll_status_off').style.display = 'none';
+ } catch(e) { }
+
+ /* kick first round manually to prevent one second lag when setting up
+ * the poll interval */
+ XHR._r();
+ XHR._i = window.setInterval(XHR._r, 1000);
+ }
+}
+
+XHR.running = function()
+{
+ return !!(XHR._r && XHR._i);
+}
diff --git a/modules/base/luasrc/ccache.lua b/modules/base/luasrc/ccache.lua
new file mode 100644
index 000000000..56ccbc3ef
--- /dev/null
+++ b/modules/base/luasrc/ccache.lua
@@ -0,0 +1,87 @@
+--[[
+LuCI - Lua Configuration Interface
+
+Copyright 2008 Steven Barth <steven@midlink.org>
+Copyright 2008 Jo-Philipp Wich <xm@leipzig.freifunk.net>
+
+Licensed under the Apache License, Version 2.0 (the "License");
+you may not use this file except in compliance with the License.
+You may obtain a copy of the License at
+
+http://www.apache.org/licenses/LICENSE-2.0
+
+$Id$
+]]--
+
+local io = require "io"
+local fs = require "nixio.fs"
+local util = require "luci.util"
+local nixio = require "nixio"
+local debug = require "debug"
+local string = require "string"
+local package = require "package"
+
+local type, loadfile = type, loadfile
+
+
+module "luci.ccache"
+
+function cache_ondemand(...)
+ if debug.getinfo(1, 'S').source ~= "=?" then
+ cache_enable(...)
+ end
+end
+
+function cache_enable(cachepath, mode)
+ cachepath = cachepath or "/tmp/luci-modulecache"
+ mode = mode or "r--r--r--"
+
+ local loader = package.loaders[2]
+ local uid = nixio.getuid()
+
+ if not fs.stat(cachepath) then
+ fs.mkdir(cachepath)
+ end
+
+ local function _encode_filename(name)
+ local encoded = ""
+ for i=1, #name do
+ encoded = encoded .. ("%2X" % string.byte(name, i))
+ end
+ return encoded
+ end
+
+ local function _load_sane(file)
+ local stat = fs.stat(file)
+ if stat and stat.uid == uid and stat.modestr == mode then
+ return loadfile(file)
+ end
+ end
+
+ local function _write_sane(file, func)
+ if nixio.getuid() == uid then
+ local fp = io.open(file, "w")
+ if fp then
+ fp:write(util.get_bytecode(func))
+ fp:close()
+ fs.chmod(file, mode)
+ end
+ end
+ end
+
+ package.loaders[2] = function(mod)
+ local encoded = cachepath .. "/" .. _encode_filename(mod)
+ local modcons = _load_sane(encoded)
+
+ if modcons then
+ return modcons
+ end
+
+ -- No cachefile
+ modcons = loader(mod)
+ if type(modcons) == "function" then
+ _write_sane(encoded, modcons)
+ end
+ return modcons
+ end
+end
diff --git a/modules/base/luasrc/controller/admin/servicectl.lua b/modules/base/luasrc/controller/admin/servicectl.lua
new file mode 100644
index 000000000..753d2c77f
--- /dev/null
+++ b/modules/base/luasrc/controller/admin/servicectl.lua
@@ -0,0 +1,60 @@
+--[[
+LuCI - Lua Configuration Interface
+
+Copyright 2010 Jo-Philipp Wich <xm@subsignal.org>
+
+Licensed under the Apache License, Version 2.0 (the "License");
+you may not use this file except in compliance with the License.
+You may obtain a copy of the License at
+
+ http://www.apache.org/licenses/LICENSE-2.0
+
+$Id$
+]]--
+
+module("luci.controller.admin.servicectl", package.seeall)
+
+function index()
+ entry({"servicectl"}, alias("servicectl", "status")).sysauth = "root"
+ entry({"servicectl", "status"}, call("action_status")).leaf = true
+ entry({"servicectl", "restart"}, call("action_restart")).leaf = true
+end
+
+function action_status()
+ local data = nixio.fs.readfile("/var/run/luci-reload-status")
+ if data then
+ luci.http.write("/etc/config/")
+ luci.http.write(data)
+ else
+ luci.http.write("finish")
+ end
+end
+
+function action_restart(args)
+ local uci = require "luci.model.uci".cursor()
+ if args then
+ local service
+ local services = { }
+
+ for service in args:gmatch("[%w_-]+") do
+ services[#services+1] = service
+ end
+
+ local command = uci:apply(services, true)
+ if nixio.fork() == 0 then
+ local i = nixio.open("/dev/null", "r")
+ local o = nixio.open("/dev/null", "w")
+
+ nixio.dup(i, nixio.stdin)
+ nixio.dup(o, nixio.stdout)
+
+ i:close()
+ o:close()
+
+ nixio.exec("/bin/sh", unpack(command))
+ else
+ luci.http.write("OK")
+ os.exit(0)
+ end
+ end
+end
diff --git a/modules/base/luasrc/debug.lua b/modules/base/luasrc/debug.lua
new file mode 100644
index 000000000..8ff1bb698
--- /dev/null
+++ b/modules/base/luasrc/debug.lua
@@ -0,0 +1,37 @@
+local debug = require "debug"
+local io = require "io"
+local collectgarbage, floor = collectgarbage, math.floor
+
+module "luci.debug"
+__file__ = debug.getinfo(1, 'S').source:sub(2)
+
+-- Enables the memory tracer with given flags and returns a function to disable the tracer again
+function trap_memtrace(flags, dest)
+ flags = flags or "clr"
+ local tracefile = io.open(dest or "/tmp/memtrace", "w")
+ local peak = 0
+
+ local function trap(what, line)
+ local info = debug.getinfo(2, "Sn")
+ local size = floor(collectgarbage("count"))
+ if size > peak then
+ peak = size
+ end
+ if tracefile then
+ tracefile:write(
+ "[", what, "] ", info.source, ":", (line or "?"), "\t",
+ (info.namewhat or ""), "\t",
+ (info.name or ""), "\t",
+ size, " (", peak, ")\n"
+ )
+ end
+ end
+
+ debug.sethook(trap, flags)
+
+ return function()
+ debug.sethook()
+ tracefile:close()
+ end
+end
+
diff --git a/modules/base/luasrc/fs.lua b/modules/base/luasrc/fs.lua
new file mode 100644
index 000000000..a81ff675d
--- /dev/null
+++ b/modules/base/luasrc/fs.lua
@@ -0,0 +1,244 @@
+--[[
+LuCI - Filesystem tools
+
+Description:
+A module offering often needed filesystem manipulation functions
+
+FileId:
+$Id$
+
+License:
+Copyright 2008 Steven Barth <steven@midlink.org>
+
+Licensed under the Apache License, Version 2.0 (the "License");
+you may not use this file except in compliance with the License.
+You may obtain a copy of the License at
+
+ http://www.apache.org/licenses/LICENSE-2.0
+
+Unless required by applicable law or agreed to in writing, software
+distributed under the License is distributed on an "AS IS" BASIS,
+WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+See the License for the specific language governing permissions and
+limitations under the License.
+
+]]--
+
+local io = require "io"
+local os = require "os"
+local ltn12 = require "luci.ltn12"
+local fs = require "nixio.fs"
+local nutil = require "nixio.util"
+
+local type = type
+
+--- LuCI filesystem library.
+module "luci.fs"
+
+--- Test for file access permission on given path.
+-- @class function
+-- @name access
+-- @param str String value containing the path
+-- @return Number containing the return code, 0 on sucess or nil on error
+-- @return String containing the error description (if any)
+-- @return Number containing the os specific errno (if any)
+access = fs.access
+
+--- Evaluate given shell glob pattern and return a table containing all matching
+-- file and directory entries.
+-- @class function
+-- @name glob
+-- @param filename String containing the path of the file to read
+-- @return Table containing file and directory entries or nil if no matches
+-- @return String containing the error description (if no matches)
+-- @return Number containing the os specific errno (if no matches)
+function glob(...)
+ local iter, code, msg = fs.glob(...)
+ if iter then
+ return nutil.consume(iter)
+ else
+ return nil, code, msg
+ end
+end
+
+--- Checks wheather the given path exists and points to a regular file.
+-- @param filename String containing the path of the file to test
+-- @return Boolean indicating wheather given path points to regular file
+function isfile(filename)
+ return fs.stat(filename, "type") == "reg"
+end
+
+--- Checks wheather the given path exists and points to a directory.
+-- @param dirname String containing the path of the directory to test
+-- @return Boolean indicating wheather given path points to directory
+function isdirectory(dirname)
+ return fs.stat(dirname, "type") == "dir"
+end
+
+--- Read the whole content of the given file into memory.
+-- @param filename String containing the path of the file to read
+-- @return String containing the file contents or nil on error
+-- @return String containing the error message on error
+readfile = fs.readfile
+
+--- Write the contents of given string to given file.
+-- @param filename String containing the path of the file to read
+-- @param data String containing the data to write
+-- @return Boolean containing true on success or nil on error
+-- @return String containing the error message on error
+writefile = fs.writefile
+
+--- Copies a file.
+-- @param source Source file
+-- @param dest Destination
+-- @return Boolean containing true on success or nil on error
+copy = fs.datacopy
+
+--- Renames a file.
+-- @param source Source file
+-- @param dest Destination
+-- @return Boolean containing true on success or nil on error
+rename = fs.move
+
+--- Get the last modification time of given file path in Unix epoch format.
+-- @param path String containing the path of the file or directory to read
+-- @return Number containing the epoch time or nil on error
+-- @return String containing the error description (if any)
+-- @return Number containing the os specific errno (if any)
+function mtime(path)
+ return fs.stat(path, "mtime")
+end
+
+--- Set the last modification time of given file path in Unix epoch format.
+-- @param path String containing the path of the file or directory to read
+-- @param mtime Last modification timestamp
+-- @param atime Last accessed timestamp
+-- @return 0 in case of success nil on error
+-- @return String containing the error description (if any)
+-- @return Number containing the os specific errno (if any)
+function utime(path, mtime, atime)
+ return fs.utimes(path, atime, mtime)
+end
+
+--- Return the last element - usually the filename - from the given path with
+-- the directory component stripped.
+-- @class function
+-- @name basename
+-- @param path String containing the path to strip
+-- @return String containing the base name of given path
+-- @see dirname
+basename = fs.basename
+
+--- Return the directory component of the given path with the last element
+-- stripped of.
+-- @class function
+-- @name dirname
+-- @param path String containing the path to strip
+-- @return String containing the directory component of given path
+-- @see basename
+dirname = fs.dirname
+
+--- Return a table containing all entries of the specified directory.
+-- @class function
+-- @name dir
+-- @param path String containing the path of the directory to scan
+-- @return Table containing file and directory entries or nil on error
+-- @return String containing the error description on error
+-- @return Number containing the os specific errno on error
+function dir(...)
+ local iter, code, msg = fs.dir(...)
+ if iter then
+ local t = nutil.consume(iter)
+ t[#t+1] = "."
+ t[#t+1] = ".."
+ return t
+ else
+ return nil, code, msg
+ end
+end
+
+--- Create a new directory, recursively on demand.
+-- @param path String with the name or path of the directory to create
+-- @param recursive Create multiple directory levels (optional, default is true)
+-- @return Number with the return code, 0 on sucess or nil on error
+-- @return String containing the error description on error
+-- @return Number containing the os specific errno on error
+function mkdir(path, recursive)
+ return recursive and fs.mkdirr(path) or fs.mkdir(path)
+end
+
+--- Remove the given empty directory.
+-- @class function
+-- @name rmdir
+-- @param path String containing the path of the directory to remove
+-- @return Number with the return code, 0 on sucess or nil on error
+-- @return String containing the error description on error
+-- @return Number containing the os specific errno on error
+rmdir = fs.rmdir
+
+local stat_tr = {
+ reg = "regular",
+ dir = "directory",
+ lnk = "link",
+ chr = "character device",
+ blk = "block device",
+ fifo = "fifo",
+ sock = "socket"
+}
+--- Get information about given file or directory.
+-- @class function
+-- @name stat
+-- @param path String containing the path of the directory to query
+-- @return Table containing file or directory properties or nil on error
+-- @return String containing the error description on error
+-- @return Number containing the os specific errno on error
+function stat(path, key)
+ local data, code, msg = fs.stat(path)
+ if data then
+ data.mode = data.modestr
+ data.type = stat_tr[data.type] or "?"
+ end
+ return key and data and data[key] or data, code, msg
+end
+
+--- Set permissions on given file or directory.
+-- @class function
+-- @name chmod
+-- @param path String containing the path of the directory
+-- @param perm String containing the permissions to set ([ugoa][+-][rwx])
+-- @return Number with the return code, 0 on sucess or nil on error
+-- @return String containing the error description on error
+-- @return Number containing the os specific errno on error
+chmod = fs.chmod
+
+--- Create a hard- or symlink from given file (or directory) to specified target
+-- file (or directory) path.
+-- @class function
+-- @name link
+-- @param path1 String containing the source path to link
+-- @param path2 String containing the destination path for the link
+-- @param symlink Boolean indicating wheather to create a symlink (optional)
+-- @return Number with the return code, 0 on sucess or nil on error
+-- @return String containing the error description on error
+-- @return Number containing the os specific errno on error
+function link(src, dest, sym)
+ return sym and fs.symlink(src, dest) or fs.link(src, dest)
+end
+
+--- Remove the given file.
+-- @class function
+-- @name unlink
+-- @param path String containing the path of the file to remove
+-- @return Number with the return code, 0 on sucess or nil on error
+-- @return String containing the error description on error
+-- @return Number containing the os specific errno on error
+unlink = fs.unlink
+
+--- Retrieve target of given symlink.
+-- @class function
+-- @name readlink
+-- @param path String containing the path of the symlink to read
+-- @return String containing the link target or nil on error
+-- @return String containing the error description on error
+-- @return Number containing the os specific errno on error
+readlink = fs.readlink
diff --git a/modules/base/luasrc/init.lua b/modules/base/luasrc/init.lua
new file mode 100644
index 000000000..4d66e8673
--- /dev/null
+++ b/modules/base/luasrc/init.lua
@@ -0,0 +1,39 @@
+--[[
+LuCI - Lua Configuration Interface
+
+Description:
+Main class
+
+FileId:
+$Id$
+
+License:
+Copyright 2008 Steven Barth <steven@midlink.org>
+
+Licensed under the Apache License, Version 2.0 (the "License");
+you may not use this file except in compliance with the License.
+You may obtain a copy of the License at
+
+ http://www.apache.org/licenses/LICENSE-2.0
+
+Unless required by applicable law or agreed to in writing, software
+distributed under the License is distributed on an "AS IS" BASIS,
+WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+See the License for the specific language governing permissions and
+limitations under the License.
+
+]]--
+
+local require = require
+
+-- Make sure that bitlib is loaded
+if not _G.bit then
+ _G.bit = require "bit"
+end
+
+module "luci"
+
+local v = require "luci.version"
+
+__version__ = v.luciversion or "trunk"
+__appname__ = v.luciname or "LuCI"
diff --git a/modules/base/luasrc/ip.lua b/modules/base/luasrc/ip.lua
new file mode 100644
index 000000000..60ca09013
--- /dev/null
+++ b/modules/base/luasrc/ip.lua
@@ -0,0 +1,673 @@
+--[[
+
+LuCI ip calculation libarary
+(c) 2008 Jo-Philipp Wich <xm@leipzig.freifunk.net>
+(c) 2008 Steven Barth <steven@midlink.org>
+
+Licensed under the Apache License, Version 2.0 (the "License");
+you may not use this file except in compliance with the License.
+You may obtain a copy of the License at
+
+ http://www.apache.org/licenses/LICENSE-2.0
+
+$Id$
+
+]]--
+
+--- LuCI IP calculation library.
+module( "luci.ip", package.seeall )
+
+require "nixio"
+local bit = nixio.bit
+local util = require "luci.util"
+
+--- Boolean; true if system is little endian
+LITTLE_ENDIAN = not util.bigendian()
+
+--- Boolean; true if system is big endian
+BIG_ENDIAN = not LITTLE_ENDIAN
+
+--- Specifier for IPv4 address family
+FAMILY_INET4 = 0x04
+
+--- Specifier for IPv6 address family
+FAMILY_INET6 = 0x06
+
+
+local function __bless(x)
+ return setmetatable( x, {
+ __index = luci.ip.cidr,
+ __add = luci.ip.cidr.add,
+ __sub = luci.ip.cidr.sub,
+ __lt = luci.ip.cidr.lower,
+ __eq = luci.ip.cidr.equal,
+ __le =
+ function(...)
+ return luci.ip.cidr.equal(...) or luci.ip.cidr.lower(...)
+ end
+ } )
+end
+
+local function __array16( x, family )
+ local list
+
+ if type(x) == "number" then
+ list = { bit.rshift(x, 16), bit.band(x, 0xFFFF) }
+
+ elseif type(x) == "string" then
+ if x:find(":") then x = IPv6(x) else x = IPv4(x) end
+ if x then
+ assert( x[1] == family, "Can't mix IPv4 and IPv6 addresses" )
+ list = { unpack(x[2]) }
+ end
+
+ elseif type(x) == "table" and type(x[2]) == "table" then
+ assert( x[1] == family, "Can't mix IPv4 and IPv6 addresses" )
+ list = { unpack(x[2]) }
+
+ elseif type(x) == "table" then
+ list = { unpack(x) }
+ end
+
+ assert( list, "Invalid operand" )
+
+ return list
+end
+
+local function __mask16(bits)
+ return bit.lshift( bit.rshift( 0xFFFF, 16 - bits % 16 ), 16 - bits % 16 )
+end
+
+local function __not16(bits)
+ return bit.band( bit.bnot( __mask16(bits) ), 0xFFFF )
+end
+
+local function __maxlen(family)
+ return ( family == FAMILY_INET4 ) and 32 or 128
+end
+
+local function __sublen(family)
+ return ( family == FAMILY_INET4 ) and 30 or 127
+end
+
+
+--- Convert given short value to network byte order on little endian hosts
+-- @param x Unsigned integer value between 0x0000 and 0xFFFF
+-- @return Byte-swapped value
+-- @see htonl
+-- @see ntohs
+function htons(x)
+ if LITTLE_ENDIAN then
+ return bit.bor(
+ bit.rshift( x, 8 ),
+ bit.band( bit.lshift( x, 8 ), 0xFF00 )
+ )
+ else
+ return x
+ end
+end
+
+--- Convert given long value to network byte order on little endian hosts
+-- @param x Unsigned integer value between 0x00000000 and 0xFFFFFFFF
+-- @return Byte-swapped value
+-- @see htons
+-- @see ntohl
+function htonl(x)
+ if LITTLE_ENDIAN then
+ return bit.bor(
+ bit.lshift( htons( bit.band( x, 0xFFFF ) ), 16 ),
+ htons( bit.rshift( x, 16 ) )
+ )
+ else
+ return x
+ end
+end
+
+--- Convert given short value to host byte order on little endian hosts
+-- @class function
+-- @name ntohs
+-- @param x Unsigned integer value between 0x0000 and 0xFFFF
+-- @return Byte-swapped value
+-- @see htonl
+-- @see ntohs
+ntohs = htons
+
+--- Convert given short value to host byte order on little endian hosts
+-- @class function
+-- @name ntohl
+-- @param x Unsigned integer value between 0x00000000 and 0xFFFFFFFF
+-- @return Byte-swapped value
+-- @see htons
+-- @see ntohl
+ntohl = htonl
+
+
+--- Parse given IPv4 address in dotted quad or CIDR notation. If an optional
+-- netmask is given as second argument and the IP address is encoded in CIDR
+-- notation then the netmask parameter takes precedence. If neither a CIDR
+-- encoded prefix nor a netmask parameter is given, then a prefix length of
+-- 32 bit is assumed.
+-- @param address IPv4 address in dotted quad or CIDR notation
+-- @param netmask IPv4 netmask in dotted quad notation (optional)
+-- @return luci.ip.cidr instance or nil if given address was invalid
+-- @see IPv6
+-- @see Hex
+function IPv4(address, netmask)
+ address = address or "0.0.0.0/0"
+
+ local obj = __bless({ FAMILY_INET4 })
+
+ local data = {}
+ local prefix = address:match("/(.+)")
+ address = address:gsub("/.+","")
+ address = address:gsub("^%[(.*)%]$", "%1"):upper():gsub("^::FFFF:", "")
+
+ if netmask then
+ prefix = obj:prefix(netmask)
+ elseif prefix then
+ prefix = tonumber(prefix)
+ if not prefix or prefix < 0 or prefix > 32 then return nil end
+ else
+ prefix = 32
+ end
+
+ local b1, b2, b3, b4 = address:match("^(%d+)%.(%d+)%.(%d+)%.(%d+)$")
+
+ b1 = tonumber(b1)
+ b2 = tonumber(b2)
+ b3 = tonumber(b3)
+ b4 = tonumber(b4)
+
+ if b1 and b1 <= 255 and
+ b2 and b2 <= 255 and
+ b3 and b3 <= 255 and
+ b4 and b4 <= 255 and
+ prefix
+ then
+ table.insert(obj, { b1 * 256 + b2, b3 * 256 + b4 })
+ table.insert(obj, prefix)
+ return obj
+ end
+end
+
+--- Parse given IPv6 address in full, compressed, mixed or CIDR notation.
+-- If an optional netmask is given as second argument and the IP address is
+-- encoded in CIDR notation then the netmask parameter takes precedence.
+-- If neither a CIDR encoded prefix nor a netmask parameter is given, then a
+-- prefix length of 128 bit is assumed.
+-- @param address IPv6 address in full/compressed/mixed or CIDR notation
+-- @param netmask IPv6 netmask in full/compressed/mixed notation (optional)
+-- @return luci.ip.cidr instance or nil if given address was invalid
+-- @see IPv4
+-- @see Hex
+function IPv6(address, netmask)
+ address = address or "::/0"
+
+ local obj = __bless({ FAMILY_INET6 })
+
+ local data = {}
+ local prefix = address:match("/(.+)")
+ address = address:gsub("/.+","")
+ address = address:gsub("^%[(.*)%]$", "%1")
+
+ if netmask then
+ prefix = obj:prefix(netmask)
+ elseif prefix then
+ prefix = tonumber(prefix)
+ if not prefix or prefix < 0 or prefix > 128 then return nil end
+ else
+ prefix = 128
+ end
+
+ local borderl = address:sub(1, 1) == ":" and 2 or 1
+ local borderh, zeroh, chunk, block, i
+
+ if #address > 45 then return nil end
+
+ repeat
+ borderh = address:find(":", borderl, true)
+ if not borderh then break end
+
+ block = tonumber(address:sub(borderl, borderh - 1), 16)
+ if block and block <= 0xFFFF then
+ data[#data+1] = block
+ else
+ if zeroh or borderh - borderl > 1 then return nil end
+ zeroh = #data + 1
+ end
+
+ borderl = borderh + 1
+ until #data == 7
+
+ chunk = address:sub(borderl)
+ if #chunk > 0 and #chunk <= 4 then
+ block = tonumber(chunk, 16)
+ if not block or block > 0xFFFF then return nil end
+
+ data[#data+1] = block
+ elseif #chunk > 4 then
+ if #data == 7 or #chunk > 15 then return nil end
+ borderl = 1
+ for i=1, 4 do
+ borderh = chunk:find(".", borderl, true)
+ if not borderh and i < 4 then return nil end
+ borderh = borderh and borderh - 1
+
+ block = tonumber(chunk:sub(borderl, borderh))
+ if not block or block > 255 then return nil end
+
+ if i == 1 or i == 3 then
+ data[#data+1] = block * 256
+ else
+ data[#data] = data[#data] + block
+ end
+
+ borderl = borderh and borderh + 2
+ end
+ end
+
+ if zeroh then
+ if #data == 8 then return nil end
+ while #data < 8 do
+ table.insert(data, zeroh, 0)
+ end
+ end
+
+ if #data == 8 and prefix then
+ table.insert(obj, data)
+ table.insert(obj, prefix)
+ return obj
+ end
+end
+
+--- Transform given hex-encoded value to luci.ip.cidr instance of specified
+-- address family.
+-- @param hex String containing hex encoded value
+-- @param prefix Prefix length of CIDR instance (optional, default is 32/128)
+-- @param family Address family, either luci.ip.FAMILY_INET4 or FAMILY_INET6
+-- @param swap Bool indicating whether to swap byteorder on low endian host
+-- @return luci.ip.cidr instance or nil if given value was invalid
+-- @see IPv4
+-- @see IPv6
+function Hex( hex, prefix, family, swap )
+ family = ( family ~= nil ) and family or FAMILY_INET4
+ swap = ( swap == nil ) and true or swap
+ prefix = prefix or __maxlen(family)
+
+ local len = __maxlen(family)
+ local tmp = ""
+ local data = { }
+ local i
+
+ for i = 1, (len/4) - #hex do tmp = tmp .. '0' end
+
+ if swap and LITTLE_ENDIAN then
+ for i = #hex, 1, -2 do tmp = tmp .. hex:sub( i - 1, i ) end
+ else
+ tmp = tmp .. hex
+ end
+
+ hex = tmp
+
+ for i = 1, ( len / 4 ), 4 do
+ local n = tonumber( hex:sub( i, i+3 ), 16 )
+ if n then
+ data[#data+1] = n
+ else
+ return nil
+ end
+ end
+
+ return __bless({ family, data, prefix })
+end
+
+
+--- LuCI IP Library / CIDR instances
+-- @class module
+-- @cstyle instance
+-- @name luci.ip.cidr
+cidr = util.class()
+
+--- Test whether the instance is a IPv4 address.
+-- @return Boolean indicating a IPv4 address type
+-- @see cidr.is6
+function cidr.is4( self )
+ return self[1] == FAMILY_INET4
+end
+
+--- Test whether this instance is an IPv4 RFC1918 private address
+-- @return Boolean indicating whether this instance is an RFC1918 address
+function cidr.is4rfc1918( self )
+ if self[1] == FAMILY_INET4 then
+ return ((self[2][1] >= 0x0A00) and (self[2][1] <= 0x0AFF)) or
+ ((self[2][1] >= 0xAC10) and (self[2][1] <= 0xAC1F)) or
+ (self[2][1] == 0xC0A8)
+ end
+ return false
+end
+
+--- Test whether this instance is an IPv4 link-local address (Zeroconf)
+-- @return Boolean indicating whether this instance is IPv4 link-local
+function cidr.is4linklocal( self )
+ if self[1] == FAMILY_INET4 then
+ return (self[2][1] == 0xA9FE)
+ end
+ return false
+end
+
+--- Test whether the instance is a IPv6 address.
+-- @return Boolean indicating a IPv6 address type
+-- @see cidr.is4
+function cidr.is6( self )
+ return self[1] == FAMILY_INET6
+end
+
+--- Test whether this instance is an IPv6 link-local address
+-- @return Boolean indicating whether this instance is IPv6 link-local
+function cidr.is6linklocal( self )
+ if self[1] == FAMILY_INET6 then
+ return (self[2][1] >= 0xFE80) and (self[2][1] <= 0xFEBF)
+ end
+ return false
+end
+
+--- Return a corresponding string representation of the instance.
+-- If the prefix length is lower then the maximum possible prefix length for the
+-- corresponding address type then the address is returned in CIDR notation,
+-- otherwise the prefix will be left out.
+function cidr.string( self )
+ local str
+ if self:is4() then
+ str = string.format(
+ "%d.%d.%d.%d",
+ bit.rshift(self[2][1], 8), bit.band(self[2][1], 0xFF),
+ bit.rshift(self[2][2], 8), bit.band(self[2][2], 0xFF)
+ )
+ if self[3] < 32 then
+ str = str .. "/" .. self[3]
+ end
+ elseif self:is6() then
+ str = string.format( "%X:%X:%X:%X:%X:%X:%X:%X", unpack(self[2]) )
+ if self[3] < 128 then
+ str = str .. "/" .. self[3]
+ end
+ end
+ return str
+end
+
+--- Test whether the value of the instance is lower then the given address.
+-- This function will throw an exception if the given address has a different
+-- family than this instance.
+-- @param addr A luci.ip.cidr instance to compare against
+-- @return Boolean indicating whether this instance is lower
+-- @see cidr.higher
+-- @see cidr.equal
+function cidr.lower( self, addr )
+ assert( self[1] == addr[1], "Can't compare IPv4 and IPv6 addresses" )
+ local i
+ for i = 1, #self[2] do
+ if self[2][i] ~= addr[2][i] then
+ return self[2][i] < addr[2][i]
+ end
+ end
+ return false
+end
+
+--- Test whether the value of the instance is higher then the given address.
+-- This function will throw an exception if the given address has a different
+-- family than this instance.
+-- @param addr A luci.ip.cidr instance to compare against
+-- @return Boolean indicating whether this instance is higher
+-- @see cidr.lower
+-- @see cidr.equal
+function cidr.higher( self, addr )
+ assert( self[1] == addr[1], "Can't compare IPv4 and IPv6 addresses" )
+ local i
+ for i = 1, #self[2] do
+ if self[2][i] ~= addr[2][i] then
+ return self[2][i] > addr[2][i]
+ end
+ end
+ return false
+end
+
+--- Test whether the value of the instance is equal to the given address.
+-- This function will throw an exception if the given address is a different
+-- family than this instance.
+-- @param addr A luci.ip.cidr instance to compare against
+-- @return Boolean indicating whether this instance is equal
+-- @see cidr.lower
+-- @see cidr.higher
+function cidr.equal( self, addr )
+ assert( self[1] == addr[1], "Can't compare IPv4 and IPv6 addresses" )
+ local i
+ for i = 1, #self[2] do
+ if self[2][i] ~= addr[2][i] then
+ return false
+ end
+ end
+ return true
+end
+
+--- Return the prefix length of this CIDR instance.
+-- @param mask Override instance prefix with given netmask (optional)
+-- @return Prefix length in bit
+function cidr.prefix( self, mask )
+ local prefix = self[3]
+
+ if mask then
+ prefix = 0
+
+ local stop = false
+ local obj = type(mask) ~= "table"
+ and ( self:is4() and IPv4(mask) or IPv6(mask) ) or mask
+
+ if not obj then return nil end
+
+ local _, word
+ for _, word in ipairs(obj[2]) do
+ if word == 0xFFFF then
+ prefix = prefix + 16
+ else
+ local bitmask = bit.lshift(1, 15)
+ while bit.band(word, bitmask) == bitmask do
+ prefix = prefix + 1
+ bitmask = bit.lshift(1, 15 - (prefix % 16))
+ end
+
+ break
+ end
+ end
+ end
+
+ return prefix
+end
+
+--- Return a corresponding CIDR representing the network address of this
+-- instance.
+-- @param bits Override prefix length of this instance (optional)
+-- @return CIDR instance containing the network address
+-- @see cidr.host
+-- @see cidr.broadcast
+-- @see cidr.mask
+function cidr.network( self, bits )
+ local data = { }
+ bits = bits or self[3]
+
+ local i
+ for i = 1, math.floor( bits / 16 ) do
+ data[#data+1] = self[2][i]
+ end
+
+ if #data < #self[2] then
+ data[#data+1] = bit.band( self[2][1+#data], __mask16(bits) )
+
+ for i = #data + 1, #self[2] do
+ data[#data+1] = 0
+ end
+ end
+
+ return __bless({ self[1], data, __maxlen(self[1]) })
+end
+
+--- Return a corresponding CIDR representing the host address of this
+-- instance. This is intended to extract the host address from larger subnet.
+-- @return CIDR instance containing the network address
+-- @see cidr.network
+-- @see cidr.broadcast
+-- @see cidr.mask
+function cidr.host( self )
+ return __bless({ self[1], self[2], __maxlen(self[1]) })
+end
+
+--- Return a corresponding CIDR representing the netmask of this instance.
+-- @param bits Override prefix length of this instance (optional)
+-- @return CIDR instance containing the netmask
+-- @see cidr.network
+-- @see cidr.host
+-- @see cidr.broadcast
+function cidr.mask( self, bits )
+ local data = { }
+ bits = bits or self[3]
+
+ for i = 1, math.floor( bits / 16 ) do
+ data[#data+1] = 0xFFFF
+ end
+
+ if #data < #self[2] then
+ data[#data+1] = __mask16(bits)
+
+ for i = #data + 1, #self[2] do
+ data[#data+1] = 0
+ end
+ end
+
+ return __bless({ self[1], data, __maxlen(self[1]) })
+end
+
+--- Return CIDR containing the broadcast address of this instance.
+-- @return CIDR instance containing the netmask, always nil for IPv6
+-- @see cidr.network
+-- @see cidr.host
+-- @see cidr.mask
+function cidr.broadcast( self )
+ -- IPv6 has no broadcast addresses (XXX: assert() instead?)
+ if self[1] == FAMILY_INET4 then
+ local data = { unpack(self[2]) }
+ local offset = math.floor( self[3] / 16 ) + 1
+
+ if offset <= #data then
+ data[offset] = bit.bor( data[offset], __not16(self[3]) )
+ for i = offset + 1, #data do data[i] = 0xFFFF end
+
+ return __bless({ self[1], data, __maxlen(self[1]) })
+ end
+ end
+end
+
+--- Test whether this instance fully contains the given CIDR instance.
+-- @param addr CIDR instance to test against
+-- @return Boolean indicating whether this instance contains the given CIDR
+function cidr.contains( self, addr )
+ assert( self[1] == addr[1], "Can't compare IPv4 and IPv6 addresses" )
+
+ if self:prefix() <= addr:prefix() then
+ return self:network() == addr:network(self:prefix())
+ end
+
+ return false
+end
+
+--- Add specified amount of hosts to this instance.
+-- @param amount Number of hosts to add to this instance
+-- @param inplace Boolen indicating whether to alter values inplace (optional)
+-- @return CIDR representing the new address or nil on overflow error
+-- @see cidr.sub
+function cidr.add( self, amount, inplace )
+ local pos
+ local data = { unpack(self[2]) }
+ local shorts = __array16( amount, self[1] )
+
+ for pos = #data, 1, -1 do
+ local add = ( #shorts > 0 ) and table.remove( shorts, #shorts ) or 0
+ if ( data[pos] + add ) > 0xFFFF then
+ data[pos] = ( data[pos] + add ) % 0xFFFF
+ if pos > 1 then
+ data[pos-1] = data[pos-1] + ( add - data[pos] )
+ else
+ return nil
+ end
+ else
+ data[pos] = data[pos] + add
+ end
+ end
+
+ if inplace then
+ self[2] = data
+ return self
+ else
+ return __bless({ self[1], data, self[3] })
+ end
+end
+
+--- Substract specified amount of hosts from this instance.
+-- @param amount Number of hosts to substract from this instance
+-- @param inplace Boolen indicating whether to alter values inplace (optional)
+-- @return CIDR representing the new address or nil on underflow error
+-- @see cidr.add
+function cidr.sub( self, amount, inplace )
+ local pos
+ local data = { unpack(self[2]) }
+ local shorts = __array16( amount, self[1] )
+
+ for pos = #data, 1, -1 do
+ local sub = ( #shorts > 0 ) and table.remove( shorts, #shorts ) or 0
+ if ( data[pos] - sub ) < 0 then
+ data[pos] = ( sub - data[pos] ) % 0xFFFF
+ if pos > 1 then
+ data[pos-1] = data[pos-1] - ( sub + data[pos] )
+ else
+ return nil
+ end
+ else
+ data[pos] = data[pos] - sub
+ end
+ end
+
+ if inplace then
+ self[2] = data
+ return self
+ else
+ return __bless({ self[1], data, self[3] })
+ end
+end
+
+--- Return CIDR containing the lowest available host address within this subnet.
+-- @return CIDR containing the host address, nil if subnet is too small
+-- @see cidr.maxhost
+function cidr.minhost( self )
+ if self[3] <= __sublen(self[1]) then
+ -- 1st is Network Address in IPv4 and Subnet-Router Anycast Adresse in IPv6
+ return self:network():add(1, true)
+ end
+end
+
+--- Return CIDR containing the highest available host address within the subnet.
+-- @return CIDR containing the host address, nil if subnet is too small
+-- @see cidr.minhost
+function cidr.maxhost( self )
+ if self[3] <= __sublen(self[1]) then
+ local i
+ local data = { unpack(self[2]) }
+ local offset = math.floor( self[3] / 16 ) + 1
+
+ data[offset] = bit.bor( data[offset], __not16(self[3]) )
+ for i = offset + 1, #data do data[i] = 0xFFFF end
+ data = __bless({ self[1], data, __maxlen(self[1]) })
+
+ -- Last address in reserved for Broadcast Address in IPv4
+ if data[1] == FAMILY_INET4 then data:sub(1, true) end
+
+ return data
+ end
+end
diff --git a/modules/base/luasrc/ltn12.lua b/modules/base/luasrc/ltn12.lua
new file mode 100644
index 000000000..9371290c6
--- /dev/null
+++ b/modules/base/luasrc/ltn12.lua
@@ -0,0 +1,391 @@
+--[[
+LuaSocket 2.0.2 license
+Copyright � 2004-2007 Diego Nehab
+
+Permission is hereby granted, free of charge, to any person obtaining a
+copy of this software and associated documentation files (the "Software"),
+to deal in the Software without restriction, including without limitation
+the rights to use, copy, modify, merge, publish, distribute, sublicense,
+and/or sell copies of the Software, and to permit persons to whom the
+Software is furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in
+all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING
+FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER
+DEALINGS IN THE SOFTWARE.
+]]--
+--[[
+ Changes made by LuCI project:
+ * Renamed to luci.ltn12 to avoid collisions with luasocket
+ * Added inline documentation
+]]--
+-----------------------------------------------------------------------------
+-- LTN12 - Filters, sources, sinks and pumps.
+-- LuaSocket toolkit.
+-- Author: Diego Nehab
+-- RCS ID: $Id$
+-----------------------------------------------------------------------------
+
+-----------------------------------------------------------------------------
+-- Declare module
+-----------------------------------------------------------------------------
+local string = require("string")
+local table = require("table")
+local base = _G
+
+--- Diego Nehab's LTN12 - Filters, sources, sinks and pumps.
+-- See http://lua-users.org/wiki/FiltersSourcesAndSinks for design concepts
+module("luci.ltn12")
+
+filter = {}
+source = {}
+sink = {}
+pump = {}
+
+-- 2048 seems to be better in windows...
+BLOCKSIZE = 2048
+_VERSION = "LTN12 1.0.1"
+
+-----------------------------------------------------------------------------
+-- Filter stuff
+-----------------------------------------------------------------------------
+
+--- LTN12 Filter constructors
+-- @class module
+-- @name luci.ltn12.filter
+
+--- Return a high level filter that cycles a low-level filter
+-- by passing it each chunk and updating a context between calls.
+-- @param low Low-level filter
+-- @param ctx Context
+-- @param extra Extra argument passed to the low-level filter
+-- @return LTN12 filter
+function filter.cycle(low, ctx, extra)
+ base.assert(low)
+ return function(chunk)
+ local ret
+ ret, ctx = low(ctx, chunk, extra)
+ return ret
+ end
+end
+
+--- Chain a bunch of filters together.
+-- (thanks to Wim Couwenberg)
+-- @param ... filters to be chained
+-- @return LTN12 filter
+function filter.chain(...)
+ local n = table.getn(arg)
+ local top, index = 1, 1
+ local retry = ""
+ return function(chunk)
+ retry = chunk and retry
+ while true do
+ if index == top then
+ chunk = arg[index](chunk)
+ if chunk == "" or top == n then return chunk
+ elseif chunk then index = index + 1
+ else
+ top = top+1
+ index = top
+ end
+ else
+ chunk = arg[index](chunk or "")
+ if chunk == "" then
+ index = index - 1
+ chunk = retry
+ elseif chunk then
+ if index == n then return chunk
+ else index = index + 1 end
+ else base.error("filter returned inappropriate nil") end
+ end
+ end
+ end
+end
+
+-----------------------------------------------------------------------------
+-- Source stuff
+-----------------------------------------------------------------------------
+
+--- LTN12 Source constructors
+-- @class module
+-- @name luci.ltn12.source
+
+-- create an empty source
+local function empty()
+ return nil
+end
+
+--- Create an empty source.
+-- @return LTN12 source
+function source.empty()
+ return empty
+end
+
+--- Return a source that just outputs an error.
+-- @param err Error object
+-- @return LTN12 source
+function source.error(err)
+ return function()
+ return nil, err
+ end
+end
+
+--- Create a file source.
+-- @param handle File handle ready for reading
+-- @param io_err IO error object
+-- @return LTN12 source
+function source.file(handle, io_err)
+ if handle then
+ return function()
+ local chunk = handle:read(BLOCKSIZE)
+ if not chunk then handle:close() end
+ return chunk
+ end
+ else return source.error(io_err or "unable to open file") end
+end
+
+--- Turn a fancy source into a simple source.
+-- @param src fancy source
+-- @return LTN12 source
+function source.simplify(src)
+ base.assert(src)
+ return function()
+ local chunk, err_or_new = src()
+ src = err_or_new or src
+ if not chunk then return nil, err_or_new
+ else return chunk end
+ end
+end
+
+--- Create a string source.
+-- @param s Data
+-- @return LTN12 source
+function source.string(s)
+ if s then
+ local i = 1
+ return function()
+ local chunk = string.sub(s, i, i+BLOCKSIZE-1)
+ i = i + BLOCKSIZE
+ if chunk ~= "" then return chunk
+ else return nil end
+ end
+ else return source.empty() end
+end
+
+--- Creates rewindable source.
+-- @param src LTN12 source to be made rewindable
+-- @return LTN12 source
+function source.rewind(src)
+ base.assert(src)
+ local t = {}
+ return function(chunk)
+ if not chunk then
+ chunk = table.remove(t)
+ if not chunk then return src()
+ else return chunk end
+ else
+ t[#t+1] = chunk
+ end
+ end
+end
+
+--- Chain a source and a filter together.
+-- @param src LTN12 source
+-- @param f LTN12 filter
+-- @return LTN12 source
+function source.chain(src, f)
+ base.assert(src and f)
+ local last_in, last_out = "", ""
+ local state = "feeding"
+ local err
+ return function()
+ if not last_out then
+ base.error('source is empty!', 2)
+ end
+ while true do
+ if state == "feeding" then
+ last_in, err = src()
+ if err then return nil, err end
+ last_out = f(last_in)
+ if not last_out then
+ if last_in then
+ base.error('filter returned inappropriate nil')
+ else
+ return nil
+ end
+ elseif last_out ~= "" then
+ state = "eating"
+ if last_in then last_in = "" end
+ return last_out
+ end
+ else
+ last_out = f(last_in)
+ if last_out == "" then
+ if last_in == "" then
+ state = "feeding"
+ else
+ base.error('filter returned ""')
+ end
+ elseif not last_out then
+ if last_in then
+ base.error('filter returned inappropriate nil')
+ else
+ return nil
+ end
+ else
+ return last_out
+ end
+ end
+ end
+ end
+end
+
+--- Create a source that produces contents of several sources.
+-- Sources will be used one after the other, as if they were concatenated
+-- (thanks to Wim Couwenberg)
+-- @param ... LTN12 sources
+-- @return LTN12 source
+function source.cat(...)
+ local src = table.remove(arg, 1)
+ return function()
+ while src do
+ local chunk, err = src()
+ if chunk then return chunk end
+ if err then return nil, err end
+ src = table.remove(arg, 1)
+ end
+ end
+end
+
+-----------------------------------------------------------------------------
+-- Sink stuff
+-----------------------------------------------------------------------------
+
+--- LTN12 sink constructors
+-- @class module
+-- @name luci.ltn12.sink
+
+--- Create a sink that stores into a table.
+-- @param t output table to store into
+-- @return LTN12 sink
+function sink.table(t)
+ t = t or {}
+ local f = function(chunk, err)
+ if chunk then t[#t+1] = chunk end
+ return 1
+ end
+ return f, t
+end
+
+--- Turn a fancy sink into a simple sink.
+-- @param snk fancy sink
+-- @return LTN12 sink
+function sink.simplify(snk)
+ base.assert(snk)
+ return function(chunk, err)
+ local ret, err_or_new = snk(chunk, err)
+ if not ret then return nil, err_or_new end
+ snk = err_or_new or snk
+ return 1
+ end
+end
+
+--- Create a file sink.
+-- @param handle file handle to write to
+-- @param io_err IO error
+-- @return LTN12 sink
+function sink.file(handle, io_err)
+ if handle then
+ return function(chunk, err)
+ if not chunk then
+ handle:close()
+ return 1
+ else return handle:write(chunk) end
+ end
+ else return sink.error(io_err or "unable to open file") end
+end
+
+-- creates a sink that discards data
+local function null()
+ return 1
+end
+
+--- Create a sink that discards data.
+-- @return LTN12 sink
+function sink.null()
+ return null
+end
+
+--- Create a sink that just returns an error.
+-- @param err Error object
+-- @return LTN12 sink
+function sink.error(err)
+ return function()
+ return nil, err
+ end
+end
+
+--- Chain a sink with a filter.
+-- @param f LTN12 filter
+-- @param snk LTN12 sink
+-- @return LTN12 sink
+function sink.chain(f, snk)
+ base.assert(f and snk)
+ return function(chunk, err)
+ if chunk ~= "" then
+ local filtered = f(chunk)
+ local done = chunk and ""
+ while true do
+ local ret, snkerr = snk(filtered, err)
+ if not ret then return nil, snkerr end
+ if filtered == done then return 1 end
+ filtered = f(done)
+ end
+ else return 1 end
+ end
+end
+
+-----------------------------------------------------------------------------
+-- Pump stuff
+-----------------------------------------------------------------------------
+
+--- LTN12 pump functions
+-- @class module
+-- @name luci.ltn12.pump
+
+--- Pump one chunk from the source to the sink.
+-- @param src LTN12 source
+-- @param snk LTN12 sink
+-- @return Chunk of data or nil if an error occured
+-- @return Error object
+function pump.step(src, snk)
+ local chunk, src_err = src()
+ local ret, snk_err = snk(chunk, src_err)
+ if chunk and ret then return 1
+ else return nil, src_err or snk_err end
+end
+
+--- Pump all data from a source to a sink, using a step function.
+-- @param src LTN12 source
+-- @param snk LTN12 sink
+-- @param step step function (optional)
+-- @return 1 if the operation succeeded otherwise nil
+-- @return Error object
+function pump.all(src, snk, step)
+ base.assert(src and snk)
+ step = step or pump.step
+ while true do
+ local ret, err = step(src, snk)
+ if not ret then
+ if err then return nil, err
+ else return 1 end
+ end
+ end
+end
+
diff --git a/modules/base/luasrc/luasrc/cacheloader.lua b/modules/base/luasrc/luasrc/cacheloader.lua
new file mode 100644
index 000000000..942c4b7b4
--- /dev/null
+++ b/modules/base/luasrc/luasrc/cacheloader.lua
@@ -0,0 +1,23 @@
+--[[
+LuCI - Lua Configuration Interface
+
+Copyright 2008 Steven Barth <steven@midlink.org>
+Copyright 2008 Jo-Philipp Wich <xm@leipzig.freifunk.net>
+
+Licensed under the Apache License, Version 2.0 (the "License");
+you may not use this file except in compliance with the License.
+You may obtain a copy of the License at
+
+http://www.apache.org/licenses/LICENSE-2.0
+
+$Id$
+]]--
+
+local config = require "luci.config"
+local ccache = require "luci.ccache"
+
+module "luci.cacheloader"
+
+if config.ccache and config.ccache.enable == "1" then
+ ccache.cache_ondemand()
+end \ No newline at end of file
diff --git a/modules/base/luasrc/luasrc/cbi.lua b/modules/base/luasrc/luasrc/cbi.lua
new file mode 100644
index 000000000..ae570b155
--- /dev/null
+++ b/modules/base/luasrc/luasrc/cbi.lua
@@ -0,0 +1,1850 @@
+--[[
+LuCI - Configuration Bind Interface
+
+Description:
+Offers an interface for binding configuration values to certain
+data types. Supports value and range validation and basic dependencies.
+
+FileId:
+$Id$
+
+License:
+Copyright 2008 Steven Barth <steven@midlink.org>
+
+Licensed under the Apache License, Version 2.0 (the "License");
+you may not use this file except in compliance with the License.
+You may obtain a copy of the License at
+
+ http://www.apache.org/licenses/LICENSE-2.0
+
+Unless required by applicable law or agreed to in writing, software
+distributed under the License is distributed on an "AS IS" BASIS,
+WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+See the License for the specific language governing permissions and
+limitations under the License.
+
+]]--
+module("luci.cbi", package.seeall)
+
+require("luci.template")
+local util = require("luci.util")
+require("luci.http")
+
+
+--local event = require "luci.sys.event"
+local fs = require("nixio.fs")
+local uci = require("luci.model.uci")
+local datatypes = require("luci.cbi.datatypes")
+local class = util.class
+local instanceof = util.instanceof
+
+FORM_NODATA = 0
+FORM_PROCEED = 0
+FORM_VALID = 1
+FORM_DONE = 1
+FORM_INVALID = -1
+FORM_CHANGED = 2
+FORM_SKIP = 4
+
+AUTO = true
+
+CREATE_PREFIX = "cbi.cts."
+REMOVE_PREFIX = "cbi.rts."
+RESORT_PREFIX = "cbi.sts."
+FEXIST_PREFIX = "cbi.cbe."
+
+-- Loads a CBI map from given file, creating an environment and returns it
+function load(cbimap, ...)
+ local fs = require "nixio.fs"
+ local i18n = require "luci.i18n"
+ require("luci.config")
+ require("luci.util")
+
+ local upldir = "/lib/uci/upload/"
+ local cbidir = luci.util.libpath() .. "/model/cbi/"
+ local func, err
+
+ if fs.access(cbidir..cbimap..".lua") then
+ func, err = loadfile(cbidir..cbimap..".lua")
+ elseif fs.access(cbimap) then
+ func, err = loadfile(cbimap)
+ else
+ func, err = nil, "Model '" .. cbimap .. "' not found!"
+ end
+
+ assert(func, err)
+
+ local env = {
+ translate=i18n.translate,
+ translatef=i18n.translatef,
+ arg={...}
+ }
+
+ setfenv(func, setmetatable(env, {__index =
+ function(tbl, key)
+ return rawget(tbl, key) or _M[key] or _G[key]
+ end}))
+
+ local maps = { func() }
+ local uploads = { }
+ local has_upload = false
+
+ for i, map in ipairs(maps) do
+ if not instanceof(map, Node) then
+ error("CBI map returns no valid map object!")
+ return nil
+ else
+ map:prepare()
+ if map.upload_fields then
+ has_upload = true
+ for _, field in ipairs(map.upload_fields) do
+ uploads[
+ field.config .. '.' ..
+ (field.section.sectiontype or '1') .. '.' ..
+ field.option
+ ] = true
+ end
+ end
+ end
+ end
+
+ if has_upload then
+ local uci = luci.model.uci.cursor()
+ local prm = luci.http.context.request.message.params
+ local fd, cbid
+
+ luci.http.setfilehandler(
+ function( field, chunk, eof )
+ if not field then return end
+ if field.name and not cbid then
+ local c, s, o = field.name:gmatch(
+ "cbid%.([^%.]+)%.([^%.]+)%.([^%.]+)"
+ )()
+
+ if c and s and o then
+ local t = uci:get( c, s ) or s
+ if uploads[c.."."..t.."."..o] then
+ local path = upldir .. field.name
+ fd = io.open(path, "w")
+ if fd then
+ cbid = field.name
+ prm[cbid] = path
+ end
+ end
+ end
+ end
+
+ if field.name == cbid and fd then
+ fd:write(chunk)
+ end
+
+ if eof and fd then
+ fd:close()
+ fd = nil
+ cbid = nil
+ end
+ end
+ )
+ end
+
+ return maps
+end
+
+--
+-- Compile a datatype specification into a parse tree for evaluation later on
+--
+local cdt_cache = { }
+
+function compile_datatype(code)
+ local i
+ local pos = 0
+ local esc = false
+ local depth = 0
+ local stack = { }
+
+ for i = 1, #code+1 do
+ local byte = code:byte(i) or 44
+ if esc then
+ esc = false
+ elseif byte == 92 then
+ esc = true
+ elseif byte == 40 or byte == 44 then
+ if depth <= 0 then
+ if pos < i then
+ local label = code:sub(pos, i-1)
+ :gsub("\\(.)", "%1")
+ :gsub("^%s+", "")
+ :gsub("%s+$", "")
+
+ if #label > 0 and tonumber(label) then
+ stack[#stack+1] = tonumber(label)
+ elseif label:match("^'.*'$") or label:match('^".*"$') then
+ stack[#stack+1] = label:gsub("[\"'](.*)[\"']", "%1")
+ elseif type(datatypes[label]) == "function" then
+ stack[#stack+1] = datatypes[label]
+ stack[#stack+1] = { }
+ else
+ error("Datatype error, bad token %q" % label)
+ end
+ end
+ pos = i + 1
+ end
+ depth = depth + (byte == 40 and 1 or 0)
+ elseif byte == 41 then
+ depth = depth - 1
+ if depth <= 0 then
+ if type(stack[#stack-1]) ~= "function" then
+ error("Datatype error, argument list follows non-function")
+ end
+ stack[#stack] = compile_datatype(code:sub(pos, i-1))
+ pos = i + 1
+ end
+ end
+ end
+
+ return stack
+end
+
+function verify_datatype(dt, value)
+ if dt and #dt > 0 then
+ if not cdt_cache[dt] then
+ local c = compile_datatype(dt)
+ if c and type(c[1]) == "function" then
+ cdt_cache[dt] = c
+ else
+ error("Datatype error, not a function expression")
+ end
+ end
+ if cdt_cache[dt] then
+ return cdt_cache[dt][1](value, unpack(cdt_cache[dt][2]))
+ end
+ end
+ return true
+end
+
+
+-- Node pseudo abstract class
+Node = class()
+
+function Node.__init__(self, title, description)
+ self.children = {}
+ self.title = title or ""
+ self.description = description or ""
+ self.template = "cbi/node"
+end
+
+-- hook helper
+function Node._run_hook(self, hook)
+ if type(self[hook]) == "function" then
+ return self[hook](self)
+ end
+end
+
+function Node._run_hooks(self, ...)
+ local f
+ local r = false
+ for _, f in ipairs(arg) do
+ if type(self[f]) == "function" then
+ self[f](self)
+ r = true
+ end
+ end
+ return r
+end
+
+-- Prepare nodes
+function Node.prepare(self, ...)
+ for k, child in ipairs(self.children) do
+ child:prepare(...)
+ end
+end
+
+-- Append child nodes
+function Node.append(self, obj)
+ table.insert(self.children, obj)
+end
+
+-- Parse this node and its children
+function Node.parse(self, ...)
+ for k, child in ipairs(self.children) do
+ child:parse(...)
+ end
+end
+
+-- Render this node
+function Node.render(self, scope)
+ scope = scope or {}
+ scope.self = self
+
+ luci.template.render(self.template, scope)
+end
+
+-- Render the children
+function Node.render_children(self, ...)
+ local k, node
+ for k, node in ipairs(self.children) do
+ node.last_child = (k == #self.children)
+ node:render(...)
+ end
+end
+
+
+--[[
+A simple template element
+]]--
+Template = class(Node)
+
+function Template.__init__(self, template)
+ Node.__init__(self)
+ self.template = template
+end
+
+function Template.render(self)
+ luci.template.render(self.template, {self=self})
+end
+
+function Template.parse(self, readinput)
+ self.readinput = (readinput ~= false)
+ return Map.formvalue(self, "cbi.submit") and FORM_DONE or FORM_NODATA
+end
+
+
+--[[
+Map - A map describing a configuration file
+]]--
+Map = class(Node)
+
+function Map.__init__(self, config, ...)
+ Node.__init__(self, ...)
+
+ self.config = config
+ self.parsechain = {self.config}
+ self.template = "cbi/map"
+ self.apply_on_parse = nil
+ self.readinput = true
+ self.proceed = false
+ self.flow = {}
+
+ self.uci = uci.cursor()
+ self.save = true
+
+ self.changed = false
+
+ if not self.uci:load(self.config) then
+ error("Unable to read UCI data: " .. self.config)
+ end
+end
+
+function Map.formvalue(self, key)
+ return self.readinput and luci.http.formvalue(key)
+end
+
+function Map.formvaluetable(self, key)
+ return self.readinput and luci.http.formvaluetable(key) or {}
+end
+
+function Map.get_scheme(self, sectiontype, option)
+ if not option then
+ return self.scheme and self.scheme.sections[sectiontype]
+ else
+ return self.scheme and self.scheme.variables[sectiontype]
+ and self.scheme.variables[sectiontype][option]
+ end
+end
+
+function Map.submitstate(self)
+ return self:formvalue("cbi.submit")
+end
+
+-- Chain foreign config
+function Map.chain(self, config)
+ table.insert(self.parsechain, config)
+end
+
+function Map.state_handler(self, state)
+ return state
+end
+
+-- Use optimized UCI writing
+function Map.parse(self, readinput, ...)
+ self.readinput = (readinput ~= false)
+ self:_run_hooks("on_parse")
+
+ if self:formvalue("cbi.skip") then
+ self.state = FORM_SKIP
+ return self:state_handler(self.state)
+ end
+
+ Node.parse(self, ...)
+
+ if self.save then
+ self:_run_hooks("on_save", "on_before_save")
+ for i, config in ipairs(self.parsechain) do
+ self.uci:save(config)
+ end
+ self:_run_hooks("on_after_save")
+ if self:submitstate() and ((not self.proceed and self.flow.autoapply) or luci.http.formvalue("cbi.apply")) then
+ self:_run_hooks("on_before_commit")
+ for i, config in ipairs(self.parsechain) do
+ self.uci:commit(config)
+
+ -- Refresh data because commit changes section names
+ self.uci:load(config)
+ end
+ self:_run_hooks("on_commit", "on_after_commit", "on_before_apply")
+ if self.apply_on_parse then
+ self.uci:apply(self.parsechain)
+ self:_run_hooks("on_apply", "on_after_apply")
+ else
+ -- This is evaluated by the dispatcher and delegated to the
+ -- template which in turn fires XHR to perform the actual
+ -- apply actions.
+ self.apply_needed = true
+ end
+
+ -- Reparse sections
+ Node.parse(self, true)
+
+ end
+ for i, config in ipairs(self.parsechain) do
+ self.uci:unload(config)
+ end
+ if type(self.commit_handler) == "function" then
+ self:commit_handler(self:submitstate())
+ end
+ end
+
+ if self:submitstate() then
+ if not self.save then
+ self.state = FORM_INVALID
+ elseif self.proceed then
+ self.state = FORM_PROCEED
+ else
+ self.state = self.changed and FORM_CHANGED or FORM_VALID
+ end
+ else
+ self.state = FORM_NODATA
+ end
+
+ return self:state_handler(self.state)
+end
+
+function Map.render(self, ...)
+ self:_run_hooks("on_init")
+ Node.render(self, ...)
+end
+
+-- Creates a child section
+function Map.section(self, class, ...)
+ if instanceof(class, AbstractSection) then
+ local obj = class(self, ...)
+ self:append(obj)
+ return obj
+ else
+ error("class must be a descendent of AbstractSection")
+ end
+end
+
+-- UCI add
+function Map.add(self, sectiontype)
+ return self.uci:add(self.config, sectiontype)
+end
+
+-- UCI set
+function Map.set(self, section, option, value)
+ if type(value) ~= "table" or #value > 0 then
+ if option then
+ return self.uci:set(self.config, section, option, value)
+ else
+ return self.uci:set(self.config, section, value)
+ end
+ else
+ return Map.del(self, section, option)
+ end
+end
+
+-- UCI del
+function Map.del(self, section, option)
+ if option then
+ return self.uci:delete(self.config, section, option)
+ else
+ return self.uci:delete(self.config, section)
+ end
+end
+
+-- UCI get
+function Map.get(self, section, option)
+ if not section then
+ return self.uci:get_all(self.config)
+ elseif option then
+ return self.uci:get(self.config, section, option)
+ else
+ return self.uci:get_all(self.config, section)
+ end
+end
+
+--[[
+Compound - Container
+]]--
+Compound = class(Node)
+
+function Compound.__init__(self, ...)
+ Node.__init__(self)
+ self.template = "cbi/compound"
+ self.children = {...}
+end
+
+function Compound.populate_delegator(self, delegator)
+ for _, v in ipairs(self.children) do
+ v.delegator = delegator
+ end
+end
+
+function Compound.parse(self, ...)
+ local cstate, state = 0
+
+ for k, child in ipairs(self.children) do
+ cstate = child:parse(...)
+ state = (not state or cstate < state) and cstate or state
+ end
+
+ return state
+end
+
+
+--[[
+Delegator - Node controller
+]]--
+Delegator = class(Node)
+function Delegator.__init__(self, ...)
+ Node.__init__(self, ...)
+ self.nodes = {}
+ self.defaultpath = {}
+ self.pageaction = false
+ self.readinput = true
+ self.allow_reset = false
+ self.allow_cancel = false
+ self.allow_back = false
+ self.allow_finish = false
+ self.template = "cbi/delegator"
+end
+
+function Delegator.set(self, name, node)
+ assert(not self.nodes[name], "Duplicate entry")
+
+ self.nodes[name] = node
+end
+
+function Delegator.add(self, name, node)
+ node = self:set(name, node)
+ self.defaultpath[#self.defaultpath+1] = name
+end
+
+function Delegator.insert_after(self, name, after)
+ local n = #self.chain + 1
+ for k, v in ipairs(self.chain) do
+ if v == after then
+ n = k + 1
+ break
+ end
+ end
+ table.insert(self.chain, n, name)
+end
+
+function Delegator.set_route(self, ...)
+ local n, chain, route = 0, self.chain, {...}
+ for i = 1, #chain do
+ if chain[i] == self.current then
+ n = i
+ break
+ end
+ end
+ for i = 1, #route do
+ n = n + 1
+ chain[n] = route[i]
+ end
+ for i = n + 1, #chain do
+ chain[i] = nil
+ end
+end
+
+function Delegator.get(self, name)
+ local node = self.nodes[name]
+
+ if type(node) == "string" then
+ node = load(node, name)
+ end
+
+ if type(node) == "table" and getmetatable(node) == nil then
+ node = Compound(unpack(node))
+ end
+
+ return node
+end
+
+function Delegator.parse(self, ...)
+ if self.allow_cancel and Map.formvalue(self, "cbi.cancel") then
+ if self:_run_hooks("on_cancel") then
+ return FORM_DONE
+ end
+ end
+
+ if not Map.formvalue(self, "cbi.delg.current") then
+ self:_run_hooks("on_init")
+ end
+
+ local newcurrent
+ self.chain = self.chain or self:get_chain()
+ self.current = self.current or self:get_active()
+ self.active = self.active or self:get(self.current)
+ assert(self.active, "Invalid state")
+
+ local stat = FORM_DONE
+ if type(self.active) ~= "function" then
+ self.active:populate_delegator(self)
+ stat = self.active:parse()
+ else
+ self:active()
+ end
+
+ if stat > FORM_PROCEED then
+ if Map.formvalue(self, "cbi.delg.back") then
+ newcurrent = self:get_prev(self.current)
+ else
+ newcurrent = self:get_next(self.current)
+ end
+ elseif stat < FORM_PROCEED then
+ return stat
+ end
+
+
+ if not Map.formvalue(self, "cbi.submit") then
+ return FORM_NODATA
+ elseif stat > FORM_PROCEED
+ and (not newcurrent or not self:get(newcurrent)) then
+ return self:_run_hook("on_done") or FORM_DONE
+ else
+ self.current = newcurrent or self.current
+ self.active = self:get(self.current)
+ if type(self.active) ~= "function" then
+ self.active:populate_delegator(self)
+ local stat = self.active:parse(false)
+ if stat == FORM_SKIP then
+ return self:parse(...)
+ else
+ return FORM_PROCEED
+ end
+ else
+ return self:parse(...)
+ end
+ end
+end
+
+function Delegator.get_next(self, state)
+ for k, v in ipairs(self.chain) do
+ if v == state then
+ return self.chain[k+1]
+ end
+ end
+end
+
+function Delegator.get_prev(self, state)
+ for k, v in ipairs(self.chain) do
+ if v == state then
+ return self.chain[k-1]
+ end
+ end
+end
+
+function Delegator.get_chain(self)
+ local x = Map.formvalue(self, "cbi.delg.path") or self.defaultpath
+ return type(x) == "table" and x or {x}
+end
+
+function Delegator.get_active(self)
+ return Map.formvalue(self, "cbi.delg.current") or self.chain[1]
+end
+
+--[[
+Page - A simple node
+]]--
+
+Page = class(Node)
+Page.__init__ = Node.__init__
+Page.parse = function() end
+
+
+--[[
+SimpleForm - A Simple non-UCI form
+]]--
+SimpleForm = class(Node)
+
+function SimpleForm.__init__(self, config, title, description, data)
+ Node.__init__(self, title, description)
+ self.config = config
+ self.data = data or {}
+ self.template = "cbi/simpleform"
+ self.dorender = true
+ self.pageaction = false
+ self.readinput = true
+end
+
+SimpleForm.formvalue = Map.formvalue
+SimpleForm.formvaluetable = Map.formvaluetable
+
+function SimpleForm.parse(self, readinput, ...)
+ self.readinput = (readinput ~= false)
+
+ if self:formvalue("cbi.skip") then
+ return FORM_SKIP
+ end
+
+ if self:formvalue("cbi.cancel") and self:_run_hooks("on_cancel") then
+ return FORM_DONE
+ end
+
+ if self:submitstate() then
+ Node.parse(self, 1, ...)
+ end
+
+ local valid = true
+ for k, j in ipairs(self.children) do
+ for i, v in ipairs(j.children) do
+ valid = valid
+ and (not v.tag_missing or not v.tag_missing[1])
+ and (not v.tag_invalid or not v.tag_invalid[1])
+ and (not v.error)
+ end
+ end
+
+ local state =
+ not self:submitstate() and FORM_NODATA
+ or valid and FORM_VALID
+ or FORM_INVALID
+
+ self.dorender = not self.handle
+ if self.handle then
+ local nrender, nstate = self:handle(state, self.data)
+ self.dorender = self.dorender or (nrender ~= false)
+ state = nstate or state
+ end
+ return state
+end
+
+function SimpleForm.render(self, ...)
+ if self.dorender then
+ Node.render(self, ...)
+ end
+end
+
+function SimpleForm.submitstate(self)
+ return self:formvalue("cbi.submit")
+end
+
+function SimpleForm.section(self, class, ...)
+ if instanceof(class, AbstractSection) then
+ local obj = class(self, ...)
+ self:append(obj)
+ return obj
+ else
+ error("class must be a descendent of AbstractSection")
+ end
+end
+
+-- Creates a child field
+function SimpleForm.field(self, class, ...)
+ local section
+ for k, v in ipairs(self.children) do
+ if instanceof(v, SimpleSection) then
+ section = v
+ break
+ end
+ end
+ if not section then
+ section = self:section(SimpleSection)
+ end
+
+ if instanceof(class, AbstractValue) then
+ local obj = class(self, section, ...)
+ obj.track_missing = true
+ section:append(obj)
+ return obj
+ else
+ error("class must be a descendent of AbstractValue")
+ end
+end
+
+function SimpleForm.set(self, section, option, value)
+ self.data[option] = value
+end
+
+
+function SimpleForm.del(self, section, option)
+ self.data[option] = nil
+end
+
+
+function SimpleForm.get(self, section, option)
+ return self.data[option]
+end
+
+
+function SimpleForm.get_scheme()
+ return nil
+end
+
+
+Form = class(SimpleForm)
+
+function Form.__init__(self, ...)
+ SimpleForm.__init__(self, ...)
+ self.embedded = true
+end
+
+
+--[[
+AbstractSection
+]]--
+AbstractSection = class(Node)
+
+function AbstractSection.__init__(self, map, sectiontype, ...)
+ Node.__init__(self, ...)
+ self.sectiontype = sectiontype
+ self.map = map
+ self.config = map.config
+ self.optionals = {}
+ self.defaults = {}
+ self.fields = {}
+ self.tag_error = {}
+ self.tag_invalid = {}
+ self.tag_deperror = {}
+ self.changed = false
+
+ self.optional = true
+ self.addremove = false
+ self.dynamic = false
+end
+
+-- Define a tab for the section
+function AbstractSection.tab(self, tab, title, desc)
+ self.tabs = self.tabs or { }
+ self.tab_names = self.tab_names or { }
+
+ self.tab_names[#self.tab_names+1] = tab
+ self.tabs[tab] = {
+ title = title,
+ description = desc,
+ childs = { }
+ }
+end
+
+-- Check whether the section has tabs
+function AbstractSection.has_tabs(self)
+ return (self.tabs ~= nil) and (next(self.tabs) ~= nil)
+end
+
+-- Appends a new option
+function AbstractSection.option(self, class, option, ...)
+ if instanceof(class, AbstractValue) then
+ local obj = class(self.map, self, option, ...)
+ self:append(obj)
+ self.fields[option] = obj
+ return obj
+ elseif class == true then
+ error("No valid class was given and autodetection failed.")
+ else
+ error("class must be a descendant of AbstractValue")
+ end
+end
+
+-- Appends a new tabbed option
+function AbstractSection.taboption(self, tab, ...)
+
+ assert(tab and self.tabs and self.tabs[tab],
+ "Cannot assign option to not existing tab %q" % tostring(tab))
+
+ local l = self.tabs[tab].childs
+ local o = AbstractSection.option(self, ...)
+
+ if o then l[#l+1] = o end
+
+ return o
+end
+
+-- Render a single tab
+function AbstractSection.render_tab(self, tab, ...)
+
+ assert(tab and self.tabs and self.tabs[tab],
+ "Cannot render not existing tab %q" % tostring(tab))
+
+ local k, node
+ for k, node in ipairs(self.tabs[tab].childs) do
+ node.last_child = (k == #self.tabs[tab].childs)
+ node:render(...)
+ end
+end
+
+-- Parse optional options
+function AbstractSection.parse_optionals(self, section)
+ if not self.optional then
+ return
+ end
+
+ self.optionals[section] = {}
+
+ local field = self.map:formvalue("cbi.opt."..self.config.."."..section)
+ for k,v in ipairs(self.children) do
+ if v.optional and not v:cfgvalue(section) and not self:has_tabs() then
+ if field == v.option then
+ field = nil
+ self.map.proceed = true
+ else
+ table.insert(self.optionals[section], v)
+ end
+ end
+ end
+
+ if field and #field > 0 and self.dynamic then
+ self:add_dynamic(field)
+ end
+end
+
+-- Add a dynamic option
+function AbstractSection.add_dynamic(self, field, optional)
+ local o = self:option(Value, field, field)
+ o.optional = optional
+end
+
+-- Parse all dynamic options
+function AbstractSection.parse_dynamic(self, section)
+ if not self.dynamic then
+ return
+ end
+
+ local arr = luci.util.clone(self:cfgvalue(section))
+ local form = self.map:formvaluetable("cbid."..self.config.."."..section)
+ for k, v in pairs(form) do
+ arr[k] = v
+ end
+
+ for key,val in pairs(arr) do
+ local create = true
+
+ for i,c in ipairs(self.children) do
+ if c.option == key then
+ create = false
+ end
+ end
+
+ if create and key:sub(1, 1) ~= "." then
+ self.map.proceed = true
+ self:add_dynamic(key, true)
+ end
+ end
+end
+
+-- Returns the section's UCI table
+function AbstractSection.cfgvalue(self, section)
+ return self.map:get(section)
+end
+
+-- Push events
+function AbstractSection.push_events(self)
+ --luci.util.append(self.map.events, self.events)
+ self.map.changed = true
+end
+
+-- Removes the section
+function AbstractSection.remove(self, section)
+ self.map.proceed = true
+ return self.map:del(section)
+end
+
+-- Creates the section
+function AbstractSection.create(self, section)
+ local stat
+
+ if section then
+ stat = section:match("^[%w_]+$") and self.map:set(section, nil, self.sectiontype)
+ else
+ section = self.map:add(self.sectiontype)
+ stat = section
+ end
+
+ if stat then
+ for k,v in pairs(self.children) do
+ if v.default then
+ self.map:set(section, v.option, v.default)
+ end
+ end
+
+ for k,v in pairs(self.defaults) do
+ self.map:set(section, k, v)
+ end
+ end
+
+ self.map.proceed = true
+
+ return stat
+end
+
+
+SimpleSection = class(AbstractSection)
+
+function SimpleSection.__init__(self, form, ...)
+ AbstractSection.__init__(self, form, nil, ...)
+ self.template = "cbi/nullsection"
+end
+
+
+Table = class(AbstractSection)
+
+function Table.__init__(self, form, data, ...)
+ local datasource = {}
+ local tself = self
+ datasource.config = "table"
+ self.data = data or {}
+
+ datasource.formvalue = Map.formvalue
+ datasource.formvaluetable = Map.formvaluetable
+ datasource.readinput = true
+
+ function datasource.get(self, section, option)
+ return tself.data[section] and tself.data[section][option]
+ end
+
+ function datasource.submitstate(self)
+ return Map.formvalue(self, "cbi.submit")
+ end
+
+ function datasource.del(...)
+ return true
+ end
+
+ function datasource.get_scheme()
+ return nil
+ end
+
+ AbstractSection.__init__(self, datasource, "table", ...)
+ self.template = "cbi/tblsection"
+ self.rowcolors = true
+ self.anonymous = true
+end
+
+function Table.parse(self, readinput)
+ self.map.readinput = (readinput ~= false)
+ for i, k in ipairs(self:cfgsections()) do
+ if self.map:submitstate() then
+ Node.parse(self, k)
+ end
+ end
+end
+
+function Table.cfgsections(self)
+ local sections = {}
+
+ for i, v in luci.util.kspairs(self.data) do
+ table.insert(sections, i)
+ end
+
+ return sections
+end
+
+function Table.update(self, data)
+ self.data = data
+end
+
+
+
+--[[
+NamedSection - A fixed configuration section defined by its name
+]]--
+NamedSection = class(AbstractSection)
+
+function NamedSection.__init__(self, map, section, stype, ...)
+ AbstractSection.__init__(self, map, stype, ...)
+
+ -- Defaults
+ self.addremove = false
+ self.template = "cbi/nsection"
+ self.section = section
+end
+
+function NamedSection.parse(self, novld)
+ local s = self.section
+ local active = self:cfgvalue(s)
+
+ if self.addremove then
+ local path = self.config.."."..s
+ if active then -- Remove the section
+ if self.map:formvalue("cbi.rns."..path) and self:remove(s) then
+ self:push_events()
+ return
+ end
+ else -- Create and apply default values
+ if self.map:formvalue("cbi.cns."..path) then
+ self:create(s)
+ return
+ end
+ end
+ end
+
+ if active then
+ AbstractSection.parse_dynamic(self, s)
+ if self.map:submitstate() then
+ Node.parse(self, s)
+ end
+ AbstractSection.parse_optionals(self, s)
+
+ if self.changed then
+ self:push_events()
+ end
+ end
+end
+
+
+--[[
+TypedSection - A (set of) configuration section(s) defined by the type
+ addremove: Defines whether the user can add/remove sections of this type
+ anonymous: Allow creating anonymous sections
+ validate: a validation function returning nil if the section is invalid
+]]--
+TypedSection = class(AbstractSection)
+
+function TypedSection.__init__(self, map, type, ...)
+ AbstractSection.__init__(self, map, type, ...)
+
+ self.template = "cbi/tsection"
+ self.deps = {}
+ self.anonymous = false
+end
+
+-- Return all matching UCI sections for this TypedSection
+function TypedSection.cfgsections(self)
+ local sections = {}
+ self.map.uci:foreach(self.map.config, self.sectiontype,
+ function (section)
+ if self:checkscope(section[".name"]) then
+ table.insert(sections, section[".name"])
+ end
+ end)
+
+ return sections
+end
+
+-- Limits scope to sections that have certain option => value pairs
+function TypedSection.depends(self, option, value)
+ table.insert(self.deps, {option=option, value=value})
+end
+
+function TypedSection.parse(self, novld)
+ if self.addremove then
+ -- Remove
+ local crval = REMOVE_PREFIX .. self.config
+ local name = self.map:formvaluetable(crval)
+ for k,v in pairs(name) do
+ if k:sub(-2) == ".x" then
+ k = k:sub(1, #k - 2)
+ end
+ if self:cfgvalue(k) and self:checkscope(k) then
+ self:remove(k)
+ end
+ end
+ end
+
+ local co
+ for i, k in ipairs(self:cfgsections()) do
+ AbstractSection.parse_dynamic(self, k)
+ if self.map:submitstate() then
+ Node.parse(self, k, novld)
+ end
+ AbstractSection.parse_optionals(self, k)
+ end
+
+ if self.addremove then
+ -- Create
+ local created
+ local crval = CREATE_PREFIX .. self.config .. "." .. self.sectiontype
+ local origin, name = next(self.map:formvaluetable(crval))
+ if self.anonymous then
+ if name then
+ created = self:create(nil, origin)
+ end
+ else
+ if name then
+ -- Ignore if it already exists
+ if self:cfgvalue(name) then
+ name = nil;
+ end
+
+ name = self:checkscope(name)
+
+ if not name then
+ self.err_invalid = true
+ end
+
+ if name and #name > 0 then
+ created = self:create(name, origin) and name
+ if not created then
+ self.invalid_cts = true
+ end
+ end
+ end
+ end
+
+ if created then
+ AbstractSection.parse_optionals(self, created)
+ end
+ end
+
+ if self.sortable then
+ local stval = RESORT_PREFIX .. self.config .. "." .. self.sectiontype
+ local order = self.map:formvalue(stval)
+ if order and #order > 0 then
+ local sid
+ local num = 0
+ for sid in util.imatch(order) do
+ self.map.uci:reorder(self.config, sid, num)
+ num = num + 1
+ end
+ self.changed = (num > 0)
+ end
+ end
+
+ if created or self.changed then
+ self:push_events()
+ end
+end
+
+-- Verifies scope of sections
+function TypedSection.checkscope(self, section)
+ -- Check if we are not excluded
+ if self.filter and not self:filter(section) then
+ return nil
+ end
+
+ -- Check if at least one dependency is met
+ if #self.deps > 0 and self:cfgvalue(section) then
+ local stat = false
+
+ for k, v in ipairs(self.deps) do
+ if self:cfgvalue(section)[v.option] == v.value then
+ stat = true
+ end
+ end
+
+ if not stat then
+ return nil
+ end
+ end
+
+ return self:validate(section)
+end
+
+
+-- Dummy validate function
+function TypedSection.validate(self, section)
+ return section
+end
+
+
+--[[
+AbstractValue - An abstract Value Type
+ null: Value can be empty
+ valid: A function returning the value if it is valid otherwise nil
+ depends: A table of option => value pairs of which one must be true
+ default: The default value
+ size: The size of the input fields
+ rmempty: Unset value if empty
+ optional: This value is optional (see AbstractSection.optionals)
+]]--
+AbstractValue = class(Node)
+
+function AbstractValue.__init__(self, map, section, option, ...)
+ Node.__init__(self, ...)
+ self.section = section
+ self.option = option
+ self.map = map
+ self.config = map.config
+ self.tag_invalid = {}
+ self.tag_missing = {}
+ self.tag_reqerror = {}
+ self.tag_error = {}
+ self.deps = {}
+ self.subdeps = {}
+ --self.cast = "string"
+
+ self.track_missing = false
+ self.rmempty = true
+ self.default = nil
+ self.size = nil
+ self.optional = false
+end
+
+function AbstractValue.prepare(self)
+ self.cast = self.cast or "string"
+end
+
+-- Add a dependencie to another section field
+function AbstractValue.depends(self, field, value)
+ local deps
+ if type(field) == "string" then
+ deps = {}
+ deps[field] = value
+ else
+ deps = field
+ end
+
+ table.insert(self.deps, {deps=deps, add=""})
+end
+
+-- Generates the unique CBID
+function AbstractValue.cbid(self, section)
+ return "cbid."..self.map.config.."."..section.."."..self.option
+end
+
+-- Return whether this object should be created
+function AbstractValue.formcreated(self, section)
+ local key = "cbi.opt."..self.config.."."..section
+ return (self.map:formvalue(key) == self.option)
+end
+
+-- Returns the formvalue for this object
+function AbstractValue.formvalue(self, section)
+ return self.map:formvalue(self:cbid(section))
+end
+
+function AbstractValue.additional(self, value)
+ self.optional = value
+end
+
+function AbstractValue.mandatory(self, value)
+ self.rmempty = not value
+end
+
+function AbstractValue.add_error(self, section, type, msg)
+ self.error = self.error or { }
+ self.error[section] = msg or type
+
+ self.section.error = self.section.error or { }
+ self.section.error[section] = self.section.error[section] or { }
+ table.insert(self.section.error[section], msg or type)
+
+ if type == "invalid" then
+ self.tag_invalid[section] = true
+ elseif type == "missing" then
+ self.tag_missing[section] = true
+ end
+
+ self.tag_error[section] = true
+ self.map.save = false
+end
+
+function AbstractValue.parse(self, section, novld)
+ local fvalue = self:formvalue(section)
+ local cvalue = self:cfgvalue(section)
+
+ -- If favlue and cvalue are both tables and have the same content
+ -- make them identical
+ if type(fvalue) == "table" and type(cvalue) == "table" then
+ local equal = #fvalue == #cvalue
+ if equal then
+ for i=1, #fvalue do
+ if cvalue[i] ~= fvalue[i] then
+ equal = false
+ end
+ end
+ end
+ if equal then
+ fvalue = cvalue
+ end
+ end
+
+ if fvalue and #fvalue > 0 then -- If we have a form value, write it to UCI
+ local val_err
+ fvalue, val_err = self:validate(fvalue, section)
+ fvalue = self:transform(fvalue)
+
+ if not fvalue and not novld then
+ self:add_error(section, "invalid", val_err)
+ end
+
+ if fvalue and (self.forcewrite or not (fvalue == cvalue)) then
+ if self:write(section, fvalue) then
+ -- Push events
+ self.section.changed = true
+ --luci.util.append(self.map.events, self.events)
+ end
+ end
+ else -- Unset the UCI or error
+ if self.rmempty or self.optional then
+ if self:remove(section) then
+ -- Push events
+ self.section.changed = true
+ --luci.util.append(self.map.events, self.events)
+ end
+ elseif cvalue ~= fvalue and not novld then
+ -- trigger validator with nil value to get custom user error msg.
+ local _, val_err = self:validate(nil, section)
+ self:add_error(section, "missing", val_err)
+ end
+ end
+end
+
+-- Render if this value exists or if it is mandatory
+function AbstractValue.render(self, s, scope)
+ if not self.optional or self.section:has_tabs() or self:cfgvalue(s) or self:formcreated(s) then
+ scope = scope or {}
+ scope.section = s
+ scope.cbid = self:cbid(s)
+ Node.render(self, scope)
+ end
+end
+
+-- Return the UCI value of this object
+function AbstractValue.cfgvalue(self, section)
+ local value
+ if self.tag_error[section] then
+ value = self:formvalue(section)
+ else
+ value = self.map:get(section, self.option)
+ end
+
+ if not value then
+ return nil
+ elseif not self.cast or self.cast == type(value) then
+ return value
+ elseif self.cast == "string" then
+ if type(value) == "table" then
+ return value[1]
+ end
+ elseif self.cast == "table" then
+ return { value }
+ end
+end
+
+-- Validate the form value
+function AbstractValue.validate(self, value)
+ if self.datatype and value then
+ if type(value) == "table" then
+ local v
+ for _, v in ipairs(value) do
+ if v and #v > 0 and not verify_datatype(self.datatype, v) then
+ return nil
+ end
+ end
+ else
+ if not verify_datatype(self.datatype, value) then
+ return nil
+ end
+ end
+ end
+
+ return value
+end
+
+AbstractValue.transform = AbstractValue.validate
+
+
+-- Write to UCI
+function AbstractValue.write(self, section, value)
+ return self.map:set(section, self.option, value)
+end
+
+-- Remove from UCI
+function AbstractValue.remove(self, section)
+ return self.map:del(section, self.option)
+end
+
+
+
+
+--[[
+Value - A one-line value
+ maxlength: The maximum length
+]]--
+Value = class(AbstractValue)
+
+function Value.__init__(self, ...)
+ AbstractValue.__init__(self, ...)
+ self.template = "cbi/value"
+ self.keylist = {}
+ self.vallist = {}
+end
+
+function Value.reset_values(self)
+ self.keylist = {}
+ self.vallist = {}
+end
+
+function Value.value(self, key, val)
+ val = val or key
+ table.insert(self.keylist, tostring(key))
+ table.insert(self.vallist, tostring(val))
+end
+
+
+-- DummyValue - This does nothing except being there
+DummyValue = class(AbstractValue)
+
+function DummyValue.__init__(self, ...)
+ AbstractValue.__init__(self, ...)
+ self.template = "cbi/dvalue"
+ self.value = nil
+end
+
+function DummyValue.cfgvalue(self, section)
+ local value
+ if self.value then
+ if type(self.value) == "function" then
+ value = self:value(section)
+ else
+ value = self.value
+ end
+ else
+ value = AbstractValue.cfgvalue(self, section)
+ end
+ return value
+end
+
+function DummyValue.parse(self)
+
+end
+
+
+--[[
+Flag - A flag being enabled or disabled
+]]--
+Flag = class(AbstractValue)
+
+function Flag.__init__(self, ...)
+ AbstractValue.__init__(self, ...)
+ self.template = "cbi/fvalue"
+
+ self.enabled = "1"
+ self.disabled = "0"
+ self.default = self.disabled
+end
+
+-- A flag can only have two states: set or unset
+function Flag.parse(self, section)
+ local fexists = self.map:formvalue(
+ FEXIST_PREFIX .. self.config .. "." .. section .. "." .. self.option)
+
+ if fexists then
+ local fvalue = self:formvalue(section) and self.enabled or self.disabled
+ if fvalue ~= self.default or (not self.optional and not self.rmempty) then
+ self:write(section, fvalue)
+ else
+ self:remove(section)
+ end
+ else
+ self:remove(section)
+ end
+end
+
+function Flag.cfgvalue(self, section)
+ return AbstractValue.cfgvalue(self, section) or self.default
+end
+
+
+--[[
+ListValue - A one-line value predefined in a list
+ widget: The widget that will be used (select, radio)
+]]--
+ListValue = class(AbstractValue)
+
+function ListValue.__init__(self, ...)
+ AbstractValue.__init__(self, ...)
+ self.template = "cbi/lvalue"
+
+ self.keylist = {}
+ self.vallist = {}
+ self.size = 1
+ self.widget = "select"
+end
+
+function ListValue.reset_values(self)
+ self.keylist = {}
+ self.vallist = {}
+end
+
+function ListValue.value(self, key, val, ...)
+ if luci.util.contains(self.keylist, key) then
+ return
+ end
+
+ val = val or key
+ table.insert(self.keylist, tostring(key))
+ table.insert(self.vallist, tostring(val))
+
+ for i, deps in ipairs({...}) do
+ self.subdeps[#self.subdeps + 1] = {add = "-"..key, deps=deps}
+ end
+end
+
+function ListValue.validate(self, val)
+ if luci.util.contains(self.keylist, val) then
+ return val
+ else
+ return nil
+ end
+end
+
+
+
+--[[
+MultiValue - Multiple delimited values
+ widget: The widget that will be used (select, checkbox)
+ delimiter: The delimiter that will separate the values (default: " ")
+]]--
+MultiValue = class(AbstractValue)
+
+function MultiValue.__init__(self, ...)
+ AbstractValue.__init__(self, ...)
+ self.template = "cbi/mvalue"
+
+ self.keylist = {}
+ self.vallist = {}
+
+ self.widget = "checkbox"
+ self.delimiter = " "
+end
+
+function MultiValue.render(self, ...)
+ if self.widget == "select" and not self.size then
+ self.size = #self.vallist
+ end
+
+ AbstractValue.render(self, ...)
+end
+
+function MultiValue.reset_values(self)
+ self.keylist = {}
+ self.vallist = {}
+end
+
+function MultiValue.value(self, key, val)
+ if luci.util.contains(self.keylist, key) then
+ return
+ end
+
+ val = val or key
+ table.insert(self.keylist, tostring(key))
+ table.insert(self.vallist, tostring(val))
+end
+
+function MultiValue.valuelist(self, section)
+ local val = self:cfgvalue(section)
+
+ if not(type(val) == "string") then
+ return {}
+ end
+
+ return luci.util.split(val, self.delimiter)
+end
+
+function MultiValue.validate(self, val)
+ val = (type(val) == "table") and val or {val}
+
+ local result
+
+ for i, value in ipairs(val) do
+ if luci.util.contains(self.keylist, value) then
+ result = result and (result .. self.delimiter .. value) or value
+ end
+ end
+
+ return result
+end
+
+
+StaticList = class(MultiValue)
+
+function StaticList.__init__(self, ...)
+ MultiValue.__init__(self, ...)
+ self.cast = "table"
+ self.valuelist = self.cfgvalue
+
+ if not self.override_scheme
+ and self.map:get_scheme(self.section.sectiontype, self.option) then
+ local vs = self.map:get_scheme(self.section.sectiontype, self.option)
+ if self.value and vs.values and not self.override_values then
+ for k, v in pairs(vs.values) do
+ self:value(k, v)
+ end
+ end
+ end
+end
+
+function StaticList.validate(self, value)
+ value = (type(value) == "table") and value or {value}
+
+ local valid = {}
+ for i, v in ipairs(value) do
+ if luci.util.contains(self.keylist, v) then
+ table.insert(valid, v)
+ end
+ end
+ return valid
+end
+
+
+DynamicList = class(AbstractValue)
+
+function DynamicList.__init__(self, ...)
+ AbstractValue.__init__(self, ...)
+ self.template = "cbi/dynlist"
+ self.cast = "table"
+ self.keylist = {}
+ self.vallist = {}
+end
+
+function DynamicList.reset_values(self)
+ self.keylist = {}
+ self.vallist = {}
+end
+
+function DynamicList.value(self, key, val)
+ val = val or key
+ table.insert(self.keylist, tostring(key))
+ table.insert(self.vallist, tostring(val))
+end
+
+function DynamicList.write(self, section, value)
+ local t = { }
+
+ if type(value) == "table" then
+ local x
+ for _, x in ipairs(value) do
+ if x and #x > 0 then
+ t[#t+1] = x
+ end
+ end
+ else
+ t = { value }
+ end
+
+ if self.cast == "string" then
+ value = table.concat(t, " ")
+ else
+ value = t
+ end
+
+ return AbstractValue.write(self, section, value)
+end
+
+function DynamicList.cfgvalue(self, section)
+ local value = AbstractValue.cfgvalue(self, section)
+
+ if type(value) == "string" then
+ local x
+ local t = { }
+ for x in value:gmatch("%S+") do
+ if #x > 0 then
+ t[#t+1] = x
+ end
+ end
+ value = t
+ end
+
+ return value
+end
+
+function DynamicList.formvalue(self, section)
+ local value = AbstractValue.formvalue(self, section)
+
+ if type(value) == "string" then
+ if self.cast == "string" then
+ local x
+ local t = { }
+ for x in value:gmatch("%S+") do
+ t[#t+1] = x
+ end
+ value = t
+ else
+ value = { value }
+ end
+ end
+
+ return value
+end
+
+
+--[[
+TextValue - A multi-line value
+ rows: Rows
+]]--
+TextValue = class(AbstractValue)
+
+function TextValue.__init__(self, ...)
+ AbstractValue.__init__(self, ...)
+ self.template = "cbi/tvalue"
+end
+
+--[[
+Button
+]]--
+Button = class(AbstractValue)
+
+function Button.__init__(self, ...)
+ AbstractValue.__init__(self, ...)
+ self.template = "cbi/button"
+ self.inputstyle = nil
+ self.rmempty = true
+end
+
+
+FileUpload = class(AbstractValue)
+
+function FileUpload.__init__(self, ...)
+ AbstractValue.__init__(self, ...)
+ self.template = "cbi/upload"
+ if not self.map.upload_fields then
+ self.map.upload_fields = { self }
+ else
+ self.map.upload_fields[#self.map.upload_fields+1] = self
+ end
+end
+
+function FileUpload.formcreated(self, section)
+ return AbstractValue.formcreated(self, section) or
+ self.map:formvalue("cbi.rlf."..section.."."..self.option) or
+ self.map:formvalue("cbi.rlf."..section.."."..self.option..".x")
+end
+
+function FileUpload.cfgvalue(self, section)
+ local val = AbstractValue.cfgvalue(self, section)
+ if val and fs.access(val) then
+ return val
+ end
+ return nil
+end
+
+function FileUpload.formvalue(self, section)
+ local val = AbstractValue.formvalue(self, section)
+ if val then
+ if not self.map:formvalue("cbi.rlf."..section.."."..self.option) and
+ not self.map:formvalue("cbi.rlf."..section.."."..self.option..".x")
+ then
+ return val
+ end
+ fs.unlink(val)
+ self.value = nil
+ end
+ return nil
+end
+
+function FileUpload.remove(self, section)
+ local val = AbstractValue.formvalue(self, section)
+ if val and fs.access(val) then fs.unlink(val) end
+ return AbstractValue.remove(self, section)
+end
+
+
+FileBrowser = class(AbstractValue)
+
+function FileBrowser.__init__(self, ...)
+ AbstractValue.__init__(self, ...)
+ self.template = "cbi/browser"
+end
diff --git a/modules/base/luasrc/luasrc/cbi/datatypes.lua b/modules/base/luasrc/luasrc/cbi/datatypes.lua
new file mode 100644
index 000000000..c5f4ec0f0
--- /dev/null
+++ b/modules/base/luasrc/luasrc/cbi/datatypes.lua
@@ -0,0 +1,345 @@
+--[[
+
+LuCI - Configuration Bind Interface - Datatype Tests
+(c) 2010 Jo-Philipp Wich <xm@subsignal.org>
+
+Licensed under the Apache License, Version 2.0 (the "License");
+you may not use this file except in compliance with the License.
+You may obtain a copy of the License at
+
+ http://www.apache.org/licenses/LICENSE-2.0
+
+$Id$
+
+]]--
+
+local fs = require "nixio.fs"
+local ip = require "luci.ip"
+local math = require "math"
+local util = require "luci.util"
+local tonumber, tostring, type, unpack, select = tonumber, tostring, type, unpack, select
+
+
+module "luci.cbi.datatypes"
+
+
+_M['or'] = function(v, ...)
+ local i
+ for i = 1, select('#', ...), 2 do
+ local f = select(i, ...)
+ local a = select(i+1, ...)
+ if type(f) ~= "function" then
+ if f == v then
+ return true
+ end
+ i = i - 1
+ elseif f(v, unpack(a)) then
+ return true
+ end
+ end
+ return false
+end
+
+_M['and'] = function(v, ...)
+ local i
+ for i = 1, select('#', ...), 2 do
+ local f = select(i, ...)
+ local a = select(i+1, ...)
+ if type(f) ~= "function" then
+ if f ~= v then
+ return false
+ end
+ i = i - 1
+ elseif not f(v, unpack(a)) then
+ return false
+ end
+ end
+ return true
+end
+
+function neg(v, ...)
+ return _M['or'](v:gsub("^%s*!%s*", ""), ...)
+end
+
+function list(v, subvalidator, subargs)
+ if type(subvalidator) ~= "function" then
+ return false
+ end
+ local token
+ for token in v:gmatch("%S+") do
+ if not subvalidator(token, unpack(subargs)) then
+ return false
+ end
+ end
+ return true
+end
+
+function bool(val)
+ if val == "1" or val == "yes" or val == "on" or val == "true" then
+ return true
+ elseif val == "0" or val == "no" or val == "off" or val == "false" then
+ return true
+ elseif val == "" or val == nil then
+ return true
+ end
+
+ return false
+end
+
+function uinteger(val)
+ local n = tonumber(val)
+ if n ~= nil and math.floor(n) == n and n >= 0 then
+ return true
+ end
+
+ return false
+end
+
+function integer(val)
+ local n = tonumber(val)
+ if n ~= nil and math.floor(n) == n then
+ return true
+ end
+
+ return false
+end
+
+function ufloat(val)
+ local n = tonumber(val)
+ return ( n ~= nil and n >= 0 )
+end
+
+function float(val)
+ return ( tonumber(val) ~= nil )
+end
+
+function ipaddr(val)
+ return ip4addr(val) or ip6addr(val)
+end
+
+function ip4addr(val)
+ if val then
+ return ip.IPv4(val) and true or false
+ end
+
+ return false
+end
+
+function ip4prefix(val)
+ val = tonumber(val)
+ return ( val and val >= 0 and val <= 32 )
+end
+
+function ip6addr(val)
+ if val then
+ return ip.IPv6(val) and true or false
+ end
+
+ return false
+end
+
+function ip6prefix(val)
+ val = tonumber(val)
+ return ( val and val >= 0 and val <= 128 )
+end
+
+function port(val)
+ val = tonumber(val)
+ return ( val and val >= 0 and val <= 65535 )
+end
+
+function portrange(val)
+ local p1, p2 = val:match("^(%d+)%-(%d+)$")
+ if p1 and p2 and port(p1) and port(p2) then
+ return true
+ else
+ return port(val)
+ end
+end
+
+function macaddr(val)
+ if val and val:match(
+ "^[a-fA-F0-9]+:[a-fA-F0-9]+:[a-fA-F0-9]+:" ..
+ "[a-fA-F0-9]+:[a-fA-F0-9]+:[a-fA-F0-9]+$"
+ ) then
+ local parts = util.split( val, ":" )
+
+ for i = 1,6 do
+ parts[i] = tonumber( parts[i], 16 )
+ if parts[i] < 0 or parts[i] > 255 then
+ return false
+ end
+ end
+
+ return true
+ end
+
+ return false
+end
+
+function hostname(val)
+ if val and (#val < 254) and (
+ val:match("^[a-zA-Z_]+$") or
+ (val:match("^[a-zA-Z0-9_][a-zA-Z0-9_%-%.]*[a-zA-Z0-9]$") and
+ val:match("[^0-9%.]"))
+ ) then
+ return true
+ end
+ return false
+end
+
+function host(val)
+ return hostname(val) or ipaddr(val)
+end
+
+function network(val)
+ return uciname(val) or host(val)
+end
+
+function wpakey(val)
+ if #val == 64 then
+ return (val:match("^[a-fA-F0-9]+$") ~= nil)
+ else
+ return (#val >= 8) and (#val <= 63)
+ end
+end
+
+function wepkey(val)
+ if val:sub(1, 2) == "s:" then
+ val = val:sub(3)
+ end
+
+ if (#val == 10) or (#val == 26) then
+ return (val:match("^[a-fA-F0-9]+$") ~= nil)
+ else
+ return (#val == 5) or (#val == 13)
+ end
+end
+
+function string(val)
+ return true -- Everything qualifies as valid string
+end
+
+function directory( val, seen )
+ local s = fs.stat(val)
+ seen = seen or { }
+
+ if s and not seen[s.ino] then
+ seen[s.ino] = true
+ if s.type == "dir" then
+ return true
+ elseif s.type == "lnk" then
+ return directory( fs.readlink(val), seen )
+ end
+ end
+
+ return false
+end
+
+function file( val, seen )
+ local s = fs.stat(val)
+ seen = seen or { }
+
+ if s and not seen[s.ino] then
+ seen[s.ino] = true
+ if s.type == "reg" then
+ return true
+ elseif s.type == "lnk" then
+ return file( fs.readlink(val), seen )
+ end
+ end
+
+ return false
+end
+
+function device( val, seen )
+ local s = fs.stat(val)
+ seen = seen or { }
+
+ if s and not seen[s.ino] then
+ seen[s.ino] = true
+ if s.type == "chr" or s.type == "blk" then
+ return true
+ elseif s.type == "lnk" then
+ return device( fs.readlink(val), seen )
+ end
+ end
+
+ return false
+end
+
+function uciname(val)
+ return (val:match("^[a-zA-Z0-9_]+$") ~= nil)
+end
+
+function range(val, min, max)
+ val = tonumber(val)
+ min = tonumber(min)
+ max = tonumber(max)
+
+ if val ~= nil and min ~= nil and max ~= nil then
+ return ((val >= min) and (val <= max))
+ end
+
+ return false
+end
+
+function min(val, min)
+ val = tonumber(val)
+ min = tonumber(min)
+
+ if val ~= nil and min ~= nil then
+ return (val >= min)
+ end
+
+ return false
+end
+
+function max(val, max)
+ val = tonumber(val)
+ max = tonumber(max)
+
+ if val ~= nil and max ~= nil then
+ return (val <= max)
+ end
+
+ return false
+end
+
+function rangelength(val, min, max)
+ val = tostring(val)
+ min = tonumber(min)
+ max = tonumber(max)
+
+ if val ~= nil and min ~= nil and max ~= nil then
+ return ((#val >= min) and (#val <= max))
+ end
+
+ return false
+end
+
+function minlength(val, min)
+ val = tostring(val)
+ min = tonumber(min)
+
+ if val ~= nil and min ~= nil then
+ return (#val >= min)
+ end
+
+ return false
+end
+
+function maxlength(val, max)
+ val = tostring(val)
+ max = tonumber(max)
+
+ if val ~= nil and max ~= nil then
+ return (#val <= max)
+ end
+
+ return false
+end
+
+function phonedigit(val)
+ return (val:match("^[0-9\*#!%.]+$") ~= nil)
+end
diff --git a/modules/base/luasrc/luasrc/config.lua b/modules/base/luasrc/luasrc/config.lua
new file mode 100644
index 000000000..53db82b32
--- /dev/null
+++ b/modules/base/luasrc/luasrc/config.lua
@@ -0,0 +1,42 @@
+--[[
+LuCI - Configuration
+
+Description:
+Some LuCI configuration values read from uci file "luci"
+
+
+FileId:
+$Id$
+
+License:
+Copyright 2008 Steven Barth <steven@midlink.org>
+
+Licensed under the Apache License, Version 2.0 (the "License");
+you may not use this file except in compliance with the License.
+You may obtain a copy of the License at
+
+ http://www.apache.org/licenses/LICENSE-2.0
+
+Unless required by applicable law or agreed to in writing, software
+distributed under the License is distributed on an "AS IS" BASIS,
+WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+See the License for the specific language governing permissions and
+limitations under the License.
+
+]]--
+
+local util = require "luci.util"
+module("luci.config",
+ function(m)
+ if pcall(require, "luci.model.uci") then
+ local config = util.threadlocal()
+ setmetatable(m, {
+ __index = function(tbl, key)
+ if not config[key] then
+ config[key] = luci.model.uci.cursor():get_all("luci", key)
+ end
+ return config[key]
+ end
+ })
+ end
+ end)
diff --git a/modules/base/luasrc/luasrc/dispatcher.lua b/modules/base/luasrc/luasrc/dispatcher.lua
new file mode 100644
index 000000000..9e5b78d5e
--- /dev/null
+++ b/modules/base/luasrc/luasrc/dispatcher.lua
@@ -0,0 +1,959 @@
+--[[
+LuCI - Dispatcher
+
+Description:
+The request dispatcher and module dispatcher generators
+
+FileId:
+$Id$
+
+License:
+Copyright 2008 Steven Barth <steven@midlink.org>
+
+Licensed under the Apache License, Version 2.0 (the "License");
+you may not use this file except in compliance with the License.
+You may obtain a copy of the License at
+
+ http://www.apache.org/licenses/LICENSE-2.0
+
+Unless required by applicable law or agreed to in writing, software
+distributed under the License is distributed on an "AS IS" BASIS,
+WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+See the License for the specific language governing permissions and
+limitations under the License.
+
+]]--
+
+--- LuCI web dispatcher.
+local fs = require "nixio.fs"
+local sys = require "luci.sys"
+local init = require "luci.init"
+local util = require "luci.util"
+local http = require "luci.http"
+local nixio = require "nixio", require "nixio.util"
+
+module("luci.dispatcher", package.seeall)
+context = util.threadlocal()
+uci = require "luci.model.uci"
+i18n = require "luci.i18n"
+_M.fs = fs
+
+authenticator = {}
+
+-- Index table
+local index = nil
+
+-- Fastindex
+local fi
+
+
+--- Build the URL relative to the server webroot from given virtual path.
+-- @param ... Virtual path
+-- @return Relative URL
+function build_url(...)
+ local path = {...}
+ local url = { http.getenv("SCRIPT_NAME") or "" }
+
+ local k, v
+ for k, v in pairs(context.urltoken) do
+ url[#url+1] = "/;"
+ url[#url+1] = http.urlencode(k)
+ url[#url+1] = "="
+ url[#url+1] = http.urlencode(v)
+ end
+
+ local p
+ for _, p in ipairs(path) do
+ if p:match("^[a-zA-Z0-9_%-%.%%/,;]+$") then
+ url[#url+1] = "/"
+ url[#url+1] = p
+ end
+ end
+
+ return table.concat(url, "")
+end
+
+--- Check whether a dispatch node shall be visible
+-- @param node Dispatch node
+-- @return Boolean indicating whether the node should be visible
+function node_visible(node)
+ if node then
+ return not (
+ (not node.title or #node.title == 0) or
+ (not node.target or node.hidden == true) or
+ (type(node.target) == "table" and node.target.type == "firstchild" and
+ (type(node.nodes) ~= "table" or not next(node.nodes)))
+ )
+ end
+ return false
+end
+
+--- Return a sorted table of visible childs within a given node
+-- @param node Dispatch node
+-- @return Ordered table of child node names
+function node_childs(node)
+ local rv = { }
+ if node then
+ local k, v
+ for k, v in util.spairs(node.nodes,
+ function(a, b)
+ return (node.nodes[a].order or 100)
+ < (node.nodes[b].order or 100)
+ end)
+ do
+ if node_visible(v) then
+ rv[#rv+1] = k
+ end
+ end
+ end
+ return rv
+end
+
+
+--- Send a 404 error code and render the "error404" template if available.
+-- @param message Custom error message (optional)
+-- @return false
+function error404(message)
+ luci.http.status(404, "Not Found")
+ message = message or "Not Found"
+
+ require("luci.template")
+ if not luci.util.copcall(luci.template.render, "error404") then
+ luci.http.prepare_content("text/plain")
+ luci.http.write(message)
+ end
+ return false
+end
+
+--- Send a 500 error code and render the "error500" template if available.
+-- @param message Custom error message (optional)#
+-- @return false
+function error500(message)
+ luci.util.perror(message)
+ if not context.template_header_sent then
+ luci.http.status(500, "Internal Server Error")
+ luci.http.prepare_content("text/plain")
+ luci.http.write(message)
+ else
+ require("luci.template")
+ if not luci.util.copcall(luci.template.render, "error500", {message=message}) then
+ luci.http.prepare_content("text/plain")
+ luci.http.write(message)
+ end
+ end
+ return false
+end
+
+function authenticator.htmlauth(validator, accs, default)
+ local user = luci.http.formvalue("username")
+ local pass = luci.http.formvalue("password")
+
+ if user and validator(user, pass) then
+ return user
+ end
+
+ require("luci.i18n")
+ require("luci.template")
+ context.path = {}
+ luci.template.render("sysauth", {duser=default, fuser=user})
+ return false
+
+end
+
+--- Dispatch an HTTP request.
+-- @param request LuCI HTTP Request object
+function httpdispatch(request, prefix)
+ luci.http.context.request = request
+
+ local r = {}
+ context.request = r
+ context.urltoken = {}
+
+ local pathinfo = http.urldecode(request:getenv("PATH_INFO") or "", true)
+
+ if prefix then
+ for _, node in ipairs(prefix) do
+ r[#r+1] = node
+ end
+ end
+
+ local tokensok = true
+ for node in pathinfo:gmatch("[^/]+") do
+ local tkey, tval
+ if tokensok then
+ tkey, tval = node:match(";(%w+)=([a-fA-F0-9]*)")
+ end
+ if tkey then
+ context.urltoken[tkey] = tval
+ else
+ tokensok = false
+ r[#r+1] = node
+ end
+ end
+
+ local stat, err = util.coxpcall(function()
+ dispatch(context.request)
+ end, error500)
+
+ luci.http.close()
+
+ --context._disable_memtrace()
+end
+
+--- Dispatches a LuCI virtual path.
+-- @param request Virtual path
+function dispatch(request)
+ --context._disable_memtrace = require "luci.debug".trap_memtrace("l")
+ local ctx = context
+ ctx.path = request
+
+ local conf = require "luci.config"
+ assert(conf.main,
+ "/etc/config/luci seems to be corrupt, unable to find section 'main'")
+
+ local lang = conf.main.lang or "auto"
+ if lang == "auto" then
+ local aclang = http.getenv("HTTP_ACCEPT_LANGUAGE") or ""
+ for lpat in aclang:gmatch("[%w-]+") do
+ lpat = lpat and lpat:gsub("-", "_")
+ if conf.languages[lpat] then
+ lang = lpat
+ break
+ end
+ end
+ end
+ require "luci.i18n".setlanguage(lang)
+
+ local c = ctx.tree
+ local stat
+ if not c then
+ c = createtree()
+ end
+
+ local track = {}
+ local args = {}
+ ctx.args = args
+ ctx.requestargs = ctx.requestargs or args
+ local n
+ local token = ctx.urltoken
+ local preq = {}
+ local freq = {}
+
+ for i, s in ipairs(request) do
+ preq[#preq+1] = s
+ freq[#freq+1] = s
+ c = c.nodes[s]
+ n = i
+ if not c then
+ break
+ end
+
+ util.update(track, c)
+
+ if c.leaf then
+ break
+ end
+ end
+
+ if c and c.leaf then
+ for j=n+1, #request do
+ args[#args+1] = request[j]
+ freq[#freq+1] = request[j]
+ end
+ end
+
+ ctx.requestpath = ctx.requestpath or freq
+ ctx.path = preq
+
+ if track.i18n then
+ i18n.loadc(track.i18n)
+ end
+
+ -- Init template engine
+ if (c and c.index) or not track.notemplate then
+ local tpl = require("luci.template")
+ local media = track.mediaurlbase or luci.config.main.mediaurlbase
+ if not pcall(tpl.Template, "themes/%s/header" % fs.basename(media)) then
+ media = nil
+ for name, theme in pairs(luci.config.themes) do
+ if name:sub(1,1) ~= "." and pcall(tpl.Template,
+ "themes/%s/header" % fs.basename(theme)) then
+ media = theme
+ end
+ end
+ assert(media, "No valid theme found")
+ end
+
+ local function _ifattr(cond, key, val)
+ if cond then
+ local env = getfenv(3)
+ local scope = (type(env.self) == "table") and env.self
+ return string.format(
+ ' %s="%s"', tostring(key),
+ luci.util.pcdata(tostring( val
+ or (type(env[key]) ~= "function" and env[key])
+ or (scope and type(scope[key]) ~= "function" and scope[key])
+ or "" ))
+ )
+ else
+ return ''
+ end
+ end
+
+ tpl.context.viewns = setmetatable({
+ write = luci.http.write;
+ include = function(name) tpl.Template(name):render(getfenv(2)) end;
+ translate = i18n.translate;
+ translatef = i18n.translatef;
+ export = function(k, v) if tpl.context.viewns[k] == nil then tpl.context.viewns[k] = v end end;
+ striptags = util.striptags;
+ pcdata = util.pcdata;
+ media = media;
+ theme = fs.basename(media);
+ resource = luci.config.main.resourcebase;
+ ifattr = function(...) return _ifattr(...) end;
+ attr = function(...) return _ifattr(true, ...) end;
+ }, {__index=function(table, key)
+ if key == "controller" then
+ return build_url()
+ elseif key == "REQUEST_URI" then
+ return build_url(unpack(ctx.requestpath))
+ else
+ return rawget(table, key) or _G[key]
+ end
+ end})
+ end
+
+ track.dependent = (track.dependent ~= false)
+ assert(not track.dependent or not track.auto,
+ "Access Violation\nThe page at '" .. table.concat(request, "/") .. "/' " ..
+ "has no parent node so the access to this location has been denied.\n" ..
+ "This is a software bug, please report this message at " ..
+ "http://luci.subsignal.org/trac/newticket"
+ )
+
+ if track.sysauth then
+ local sauth = require "luci.sauth"
+
+ local authen = type(track.sysauth_authenticator) == "function"
+ and track.sysauth_authenticator
+ or authenticator[track.sysauth_authenticator]
+
+ local def = (type(track.sysauth) == "string") and track.sysauth
+ local accs = def and {track.sysauth} or track.sysauth
+ local sess = ctx.authsession
+ local verifytoken = false
+ if not sess then
+ sess = luci.http.getcookie("sysauth")
+ sess = sess and sess:match("^[a-f0-9]*$")
+ verifytoken = true
+ end
+
+ local sdat = sauth.read(sess)
+ local user
+
+ if sdat then
+ if not verifytoken or ctx.urltoken.stok == sdat.token then
+ user = sdat.user
+ end
+ else
+ local eu = http.getenv("HTTP_AUTH_USER")
+ local ep = http.getenv("HTTP_AUTH_PASS")
+ if eu and ep and luci.sys.user.checkpasswd(eu, ep) then
+ authen = function() return eu end
+ end
+ end
+
+ if not util.contains(accs, user) then
+ if authen then
+ ctx.urltoken.stok = nil
+ local user, sess = authen(luci.sys.user.checkpasswd, accs, def)
+ if not user or not util.contains(accs, user) then
+ return
+ else
+ local sid = sess or luci.sys.uniqueid(16)
+ if not sess then
+ local token = luci.sys.uniqueid(16)
+ sauth.reap()
+ sauth.write(sid, {
+ user=user,
+ token=token,
+ secret=luci.sys.uniqueid(16)
+ })
+ ctx.urltoken.stok = token
+ end
+ luci.http.header("Set-Cookie", "sysauth=" .. sid.."; path="..build_url())
+ ctx.authsession = sid
+ ctx.authuser = user
+ end
+ else
+ luci.http.status(403, "Forbidden")
+ return
+ end
+ else
+ ctx.authsession = sess
+ ctx.authuser = user
+ end
+ end
+
+ if track.setgroup then
+ luci.sys.process.setgroup(track.setgroup)
+ end
+
+ if track.setuser then
+ luci.sys.process.setuser(track.setuser)
+ end
+
+ local target = nil
+ if c then
+ if type(c.target) == "function" then
+ target = c.target
+ elseif type(c.target) == "table" then
+ target = c.target.target
+ end
+ end
+
+ if c and (c.index or type(target) == "function") then
+ ctx.dispatched = c
+ ctx.requested = ctx.requested or ctx.dispatched
+ end
+
+ if c and c.index then
+ local tpl = require "luci.template"
+
+ if util.copcall(tpl.render, "indexer", {}) then
+ return true
+ end
+ end
+
+ if type(target) == "function" then
+ util.copcall(function()
+ local oldenv = getfenv(target)
+ local module = require(c.module)
+ local env = setmetatable({}, {__index=
+
+ function(tbl, key)
+ return rawget(tbl, key) or module[key] or oldenv[key]
+ end})
+
+ setfenv(target, env)
+ end)
+
+ local ok, err
+ if type(c.target) == "table" then
+ ok, err = util.copcall(target, c.target, unpack(args))
+ else
+ ok, err = util.copcall(target, unpack(args))
+ end
+ assert(ok,
+ "Failed to execute " .. (type(c.target) == "function" and "function" or c.target.type or "unknown") ..
+ " dispatcher target for entry '/" .. table.concat(request, "/") .. "'.\n" ..
+ "The called action terminated with an exception:\n" .. tostring(err or "(unknown)"))
+ else
+ local root = node()
+ if not root or not root.target then
+ error404("No root node was registered, this usually happens if no module was installed.\n" ..
+ "Install luci-mod-admin-full and retry. " ..
+ "If the module is already installed, try removing the /tmp/luci-indexcache file.")
+ else
+ error404("No page is registered at '/" .. table.concat(request, "/") .. "'.\n" ..
+ "If this url belongs to an extension, make sure it is properly installed.\n" ..
+ "If the extension was recently installed, try removing the /tmp/luci-indexcache file.")
+ end
+ end
+end
+
+--- Generate the dispatching index using the best possible strategy.
+function createindex()
+ local path = luci.util.libpath() .. "/controller/"
+ local suff = { ".lua", ".lua.gz" }
+
+ if luci.util.copcall(require, "luci.fastindex") then
+ createindex_fastindex(path, suff)
+ else
+ createindex_plain(path, suff)
+ end
+end
+
+--- Generate the dispatching index using the fastindex C-indexer.
+-- @param path Controller base directory
+-- @param suffixes Controller file suffixes
+function createindex_fastindex(path, suffixes)
+ index = {}
+
+ if not fi then
+ fi = luci.fastindex.new("index")
+ for _, suffix in ipairs(suffixes) do
+ fi.add(path .. "*" .. suffix)
+ fi.add(path .. "*/*" .. suffix)
+ end
+ end
+ fi.scan()
+
+ for k, v in pairs(fi.indexes) do
+ index[v[2]] = v[1]
+ end
+end
+
+--- Generate the dispatching index using the native file-cache based strategy.
+-- @param path Controller base directory
+-- @param suffixes Controller file suffixes
+function createindex_plain(path, suffixes)
+ local controllers = { }
+ for _, suffix in ipairs(suffixes) do
+ nixio.util.consume((fs.glob(path .. "*" .. suffix)), controllers)
+ nixio.util.consume((fs.glob(path .. "*/*" .. suffix)), controllers)
+ end
+
+ if indexcache then
+ local cachedate = fs.stat(indexcache, "mtime")
+ if cachedate then
+ local realdate = 0
+ for _, obj in ipairs(controllers) do
+ local omtime = fs.stat(obj, "mtime")
+ realdate = (omtime and omtime > realdate) and omtime or realdate
+ end
+
+ if cachedate > realdate then
+ assert(
+ sys.process.info("uid") == fs.stat(indexcache, "uid")
+ and fs.stat(indexcache, "modestr") == "rw-------",
+ "Fatal: Indexcache is not sane!"
+ )
+
+ index = loadfile(indexcache)()
+ return index
+ end
+ end
+ end
+
+ index = {}
+
+ for i,c in ipairs(controllers) do
+ local modname = "luci.controller." .. c:sub(#path+1, #c):gsub("/", ".")
+ for _, suffix in ipairs(suffixes) do
+ modname = modname:gsub(suffix.."$", "")
+ end
+
+ local mod = require(modname)
+ assert(mod ~= true,
+ "Invalid controller file found\n" ..
+ "The file '" .. c .. "' contains an invalid module line.\n" ..
+ "Please verify whether the module name is set to '" .. modname ..
+ "' - It must correspond to the file path!")
+
+ local idx = mod.index
+ assert(type(idx) == "function",
+ "Invalid controller file found\n" ..
+ "The file '" .. c .. "' contains no index() function.\n" ..
+ "Please make sure that the controller contains a valid " ..
+ "index function and verify the spelling!")
+
+ index[modname] = idx
+ end
+
+ if indexcache then
+ local f = nixio.open(indexcache, "w", 600)
+ f:writeall(util.get_bytecode(index))
+ f:close()
+ end
+end
+
+--- Create the dispatching tree from the index.
+-- Build the index before if it does not exist yet.
+function createtree()
+ if not index then
+ createindex()
+ end
+
+ local ctx = context
+ local tree = {nodes={}, inreq=true}
+ local modi = {}
+
+ ctx.treecache = setmetatable({}, {__mode="v"})
+ ctx.tree = tree
+ ctx.modifiers = modi
+
+ -- Load default translation
+ require "luci.i18n".loadc("base")
+
+ local scope = setmetatable({}, {__index = luci.dispatcher})
+
+ for k, v in pairs(index) do
+ scope._NAME = k
+ setfenv(v, scope)
+ v()
+ end
+
+ local function modisort(a,b)
+ return modi[a].order < modi[b].order
+ end
+
+ for _, v in util.spairs(modi, modisort) do
+ scope._NAME = v.module
+ setfenv(v.func, scope)
+ v.func()
+ end
+
+ return tree
+end
+
+--- Register a tree modifier.
+-- @param func Modifier function
+-- @param order Modifier order value (optional)
+function modifier(func, order)
+ context.modifiers[#context.modifiers+1] = {
+ func = func,
+ order = order or 0,
+ module
+ = getfenv(2)._NAME
+ }
+end
+
+--- Clone a node of the dispatching tree to another position.
+-- @param path Virtual path destination
+-- @param clone Virtual path source
+-- @param title Destination node title (optional)
+-- @param order Destination node order value (optional)
+-- @return Dispatching tree node
+function assign(path, clone, title, order)
+ local obj = node(unpack(path))
+ obj.nodes = nil
+ obj.module = nil
+
+ obj.title = title
+ obj.order = order
+
+ setmetatable(obj, {__index = _create_node(clone)})
+
+ return obj
+end
+
+--- Create a new dispatching node and define common parameters.
+-- @param path Virtual path
+-- @param target Target function to call when dispatched.
+-- @param title Destination node title
+-- @param order Destination node order value (optional)
+-- @return Dispatching tree node
+function entry(path, target, title, order)
+ local c = node(unpack(path))
+
+ c.target = target
+ c.title = title
+ c.order = order
+ c.module = getfenv(2)._NAME
+
+ return c
+end
+
+--- Fetch or create a dispatching node without setting the target module or
+-- enabling the node.
+-- @param ... Virtual path
+-- @return Dispatching tree node
+function get(...)
+ return _create_node({...})
+end
+
+--- Fetch or create a new dispatching node.
+-- @param ... Virtual path
+-- @return Dispatching tree node
+function node(...)
+ local c = _create_node({...})
+
+ c.module = getfenv(2)._NAME
+ c.auto = nil
+
+ return c
+end
+
+function _create_node(path)
+ if #path == 0 then
+ return context.tree
+ end
+
+ local name = table.concat(path, ".")
+ local c = context.treecache[name]
+
+ if not c then
+ local last = table.remove(path)
+ local parent = _create_node(path)
+
+ c = {nodes={}, auto=true}
+ -- the node is "in request" if the request path matches
+ -- at least up to the length of the node path
+ if parent.inreq and context.path[#path+1] == last then
+ c.inreq = true
+ end
+ parent.nodes[last] = c
+ context.treecache[name] = c
+ end
+ return c
+end
+
+-- Subdispatchers --
+
+function _firstchild()
+ local path = { unpack(context.path) }
+ local name = table.concat(path, ".")
+ local node = context.treecache[name]
+
+ local lowest
+ if node and node.nodes and next(node.nodes) then
+ local k, v
+ for k, v in pairs(node.nodes) do
+ if not lowest or
+ (v.order or 100) < (node.nodes[lowest].order or 100)
+ then
+ lowest = k
+ end
+ end
+ end
+
+ assert(lowest ~= nil,
+ "The requested node contains no childs, unable to redispatch")
+
+ path[#path+1] = lowest
+ dispatch(path)
+end
+
+--- Alias the first (lowest order) page automatically
+function firstchild()
+ return { type = "firstchild", target = _firstchild }
+end
+
+--- Create a redirect to another dispatching node.
+-- @param ... Virtual path destination
+function alias(...)
+ local req = {...}
+ return function(...)
+ for _, r in ipairs({...}) do
+ req[#req+1] = r
+ end
+
+ dispatch(req)
+ end
+end
+
+--- Rewrite the first x path values of the request.
+-- @param n Number of path values to replace
+-- @param ... Virtual path to replace removed path values with
+function rewrite(n, ...)
+ local req = {...}
+ return function(...)
+ local dispatched = util.clone(context.dispatched)
+
+ for i=1,n do
+ table.remove(dispatched, 1)
+ end
+
+ for i, r in ipairs(req) do
+ table.insert(dispatched, i, r)
+ end
+
+ for _, r in ipairs({...}) do
+ dispatched[#dispatched+1] = r
+ end
+
+ dispatch(dispatched)
+ end
+end
+
+
+local function _call(self, ...)
+ local func = getfenv()[self.name]
+ assert(func ~= nil,
+ 'Cannot resolve function "' .. self.name .. '". Is it misspelled or local?')
+
+ assert(type(func) == "function",
+ 'The symbol "' .. self.name .. '" does not refer to a function but data ' ..
+ 'of type "' .. type(func) .. '".')
+
+ if #self.argv > 0 then
+ return func(unpack(self.argv), ...)
+ else
+ return func(...)
+ end
+end
+
+--- Create a function-call dispatching target.
+-- @param name Target function of local controller
+-- @param ... Additional parameters passed to the function
+function call(name, ...)
+ return {type = "call", argv = {...}, name = name, target = _call}
+end
+
+
+local _template = function(self, ...)
+ require "luci.template".render(self.view)
+end
+
+--- Create a template render dispatching target.
+-- @param name Template to be rendered
+function template(name)
+ return {type = "template", view = name, target = _template}
+end
+
+
+local function _cbi(self, ...)
+ local cbi = require "luci.cbi"
+ local tpl = require "luci.template"
+ local http = require "luci.http"
+
+ local config = self.config or {}
+ local maps = cbi.load(self.model, ...)
+
+ local state = nil
+
+ for i, res in ipairs(maps) do
+ res.flow = config
+ local cstate = res:parse()
+ if cstate and (not state or cstate < state) then
+ state = cstate
+ end
+ end
+
+ local function _resolve_path(path)
+ return type(path) == "table" and build_url(unpack(path)) or path
+ end
+
+ if config.on_valid_to and state and state > 0 and state < 2 then
+ http.redirect(_resolve_path(config.on_valid_to))
+ return
+ end
+
+ if config.on_changed_to and state and state > 1 then
+ http.redirect(_resolve_path(config.on_changed_to))
+ return
+ end
+
+ if config.on_success_to and state and state > 0 then
+ http.redirect(_resolve_path(config.on_success_to))
+ return
+ end
+
+ if config.state_handler then
+ if not config.state_handler(state, maps) then
+ return
+ end
+ end
+
+ http.header("X-CBI-State", state or 0)
+
+ if not config.noheader then
+ tpl.render("cbi/header", {state = state})
+ end
+
+ local redirect
+ local messages
+ local applymap = false
+ local pageaction = true
+ local parsechain = { }
+
+ for i, res in ipairs(maps) do
+ if res.apply_needed and res.parsechain then
+ local c
+ for _, c in ipairs(res.parsechain) do
+ parsechain[#parsechain+1] = c
+ end
+ applymap = true
+ end
+
+ if res.redirect then
+ redirect = redirect or res.redirect
+ end
+
+ if res.pageaction == false then
+ pageaction = false
+ end
+
+ if res.message then
+ messages = messages or { }
+ messages[#messages+1] = res.message
+ end
+ end
+
+ for i, res in ipairs(maps) do
+ res:render({
+ firstmap = (i == 1),
+ applymap = applymap,
+ redirect = redirect,
+ messages = messages,
+ pageaction = pageaction,
+ parsechain = parsechain
+ })
+ end
+
+ if not config.nofooter then
+ tpl.render("cbi/footer", {
+ flow = config,
+ pageaction = pageaction,
+ redirect = redirect,
+ state = state,
+ autoapply = config.autoapply
+ })
+ end
+end
+
+--- Create a CBI model dispatching target.
+-- @param model CBI model to be rendered
+function cbi(model, config)
+ return {type = "cbi", config = config, model = model, target = _cbi}
+end
+
+
+local function _arcombine(self, ...)
+ local argv = {...}
+ local target = #argv > 0 and self.targets[2] or self.targets[1]
+ setfenv(target.target, self.env)
+ target:target(unpack(argv))
+end
+
+--- Create a combined dispatching target for non argv and argv requests.
+-- @param trg1 Overview Target
+-- @param trg2 Detail Target
+function arcombine(trg1, trg2)
+ return {type = "arcombine", env = getfenv(), target = _arcombine, targets = {trg1, trg2}}
+end
+
+
+local function _form(self, ...)
+ local cbi = require "luci.cbi"
+ local tpl = require "luci.template"
+ local http = require "luci.http"
+
+ local maps = luci.cbi.load(self.model, ...)
+ local state = nil
+
+ for i, res in ipairs(maps) do
+ local cstate = res:parse()
+ if cstate and (not state or cstate < state) then
+ state = cstate
+ end
+ end
+
+ http.header("X-CBI-State", state or 0)
+ tpl.render("header")
+ for i, res in ipairs(maps) do
+ res:render()
+ end
+ tpl.render("footer")
+end
+
+--- Create a CBI form model dispatching target.
+-- @param model CBI form model tpo be rendered
+function form(model)
+ return {type = "cbi", model = model, target = _form}
+end
+
+--- Access the luci.i18n translate() api.
+-- @class function
+-- @name translate
+-- @param text Text to translate
+translate = i18n.translate
+
+--- No-op function used to mark translation entries for menu labels.
+-- This function does not actually translate the given argument but
+-- is used by build/i18n-scan.pl to find translatable entries.
+function _(text)
+ return text
+end
diff --git a/modules/base/luasrc/luasrc/http.lua b/modules/base/luasrc/luasrc/http.lua
new file mode 100644
index 000000000..c53307a5a
--- /dev/null
+++ b/modules/base/luasrc/luasrc/http.lua
@@ -0,0 +1,344 @@
+--[[
+LuCI - HTTP-Interaction
+
+Description:
+HTTP-Header manipulator and form variable preprocessor
+
+License:
+Copyright 2008 Steven Barth <steven@midlink.org>
+
+Licensed under the Apache License, Version 2.0 (the "License");
+you may not use this file except in compliance with the License.
+You may obtain a copy of the License at
+
+ http://www.apache.org/licenses/LICENSE-2.0
+
+Unless required by applicable law or agreed to in writing, software
+distributed under the License is distributed on an "AS IS" BASIS,
+WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+See the License for the specific language governing permissions and
+limitations under the License.
+
+]]--
+
+local ltn12 = require "luci.ltn12"
+local protocol = require "luci.http.protocol"
+local util = require "luci.util"
+local string = require "string"
+local coroutine = require "coroutine"
+local table = require "table"
+
+local ipairs, pairs, next, type, tostring, error =
+ ipairs, pairs, next, type, tostring, error
+
+--- LuCI Web Framework high-level HTTP functions.
+module "luci.http"
+
+context = util.threadlocal()
+
+Request = util.class()
+function Request.__init__(self, env, sourcein, sinkerr)
+ self.input = sourcein
+ self.error = sinkerr
+
+
+ -- File handler
+ self.filehandler = function() end
+
+ -- HTTP-Message table
+ self.message = {
+ env = env,
+ headers = {},
+ params = protocol.urldecode_params(env.QUERY_STRING or ""),
+ }
+
+ self.parsed_input = false
+end
+
+function Request.formvalue(self, name, noparse)
+ if not noparse and not self.parsed_input then
+ self:_parse_input()
+ end
+
+ if name then
+ return self.message.params[name]
+ else
+ return self.message.params
+ end
+end
+
+function Request.formvaluetable(self, prefix)
+ local vals = {}
+ prefix = prefix and prefix .. "." or "."
+
+ if not self.parsed_input then
+ self:_parse_input()
+ end
+
+ local void = self.message.params[nil]
+ for k, v in pairs(self.message.params) do
+ if k:find(prefix, 1, true) == 1 then
+ vals[k:sub(#prefix + 1)] = tostring(v)
+ end
+ end
+
+ return vals
+end
+
+function Request.content(self)
+ if not self.parsed_input then
+ self:_parse_input()
+ end
+
+ return self.message.content, self.message.content_length
+end
+
+function Request.getcookie(self, name)
+ local c = string.gsub(";" .. (self:getenv("HTTP_COOKIE") or "") .. ";", "%s*;%s*", ";")
+ local p = ";" .. name .. "=(.-);"
+ local i, j, value = c:find(p)
+ return value and urldecode(value)
+end
+
+function Request.getenv(self, name)
+ if name then
+ return self.message.env[name]
+ else
+ return self.message.env
+ end
+end
+
+function Request.setfilehandler(self, callback)
+ self.filehandler = callback
+end
+
+function Request._parse_input(self)
+ protocol.parse_message_body(
+ self.input,
+ self.message,
+ self.filehandler
+ )
+ self.parsed_input = true
+end
+
+--- Close the HTTP-Connection.
+function close()
+ if not context.eoh then
+ context.eoh = true
+ coroutine.yield(3)
+ end
+
+ if not context.closed then
+ context.closed = true
+ coroutine.yield(5)
+ end
+end
+
+--- Return the request content if the request was of unknown type.
+-- @return HTTP request body
+-- @return HTTP request body length
+function content()
+ return context.request:content()
+end
+
+--- Get a certain HTTP input value or a table of all input values.
+-- @param name Name of the GET or POST variable to fetch
+-- @param noparse Don't parse POST data before getting the value
+-- @return HTTP input value or table of all input value
+function formvalue(name, noparse)
+ return context.request:formvalue(name, noparse)
+end
+
+--- Get a table of all HTTP input values with a certain prefix.
+-- @param prefix Prefix
+-- @return Table of all HTTP input values with given prefix
+function formvaluetable(prefix)
+ return context.request:formvaluetable(prefix)
+end
+
+--- Get the value of a certain HTTP-Cookie.
+-- @param name Cookie Name
+-- @return String containing cookie data
+function getcookie(name)
+ return context.request:getcookie(name)
+end
+
+--- Get the value of a certain HTTP environment variable
+-- or the environment table itself.
+-- @param name Environment variable
+-- @return HTTP environment value or environment table
+function getenv(name)
+ return context.request:getenv(name)
+end
+
+--- Set a handler function for incoming user file uploads.
+-- @param callback Handler function
+function setfilehandler(callback)
+ return context.request:setfilehandler(callback)
+end
+
+--- Send a HTTP-Header.
+-- @param key Header key
+-- @param value Header value
+function header(key, value)
+ if not context.headers then
+ context.headers = {}
+ end
+ context.headers[key:lower()] = value
+ coroutine.yield(2, key, value)
+end
+
+--- Set the mime type of following content data.
+-- @param mime Mimetype of following content
+function prepare_content(mime)
+ if not context.headers or not context.headers["content-type"] then
+ if mime == "application/xhtml+xml" then
+ if not getenv("HTTP_ACCEPT") or
+ not getenv("HTTP_ACCEPT"):find("application/xhtml+xml", nil, true) then
+ mime = "text/html; charset=UTF-8"
+ end
+ header("Vary", "Accept")
+ end
+ header("Content-Type", mime)
+ end
+end
+
+--- Get the RAW HTTP input source
+-- @return HTTP LTN12 source
+function source()
+ return context.request.input
+end
+
+--- Set the HTTP status code and status message.
+-- @param code Status code
+-- @param message Status message
+function status(code, message)
+ code = code or 200
+ message = message or "OK"
+ context.status = code
+ coroutine.yield(1, code, message)
+end
+
+--- Send a chunk of content data to the client.
+-- This function is as a valid LTN12 sink.
+-- If the content chunk is nil this function will automatically invoke close.
+-- @param content Content chunk
+-- @param src_err Error object from source (optional)
+-- @see close
+function write(content, src_err)
+ if not content then
+ if src_err then
+ error(src_err)
+ else
+ close()
+ end
+ return true
+ elseif #content == 0 then
+ return true
+ else
+ if not context.eoh then
+ if not context.status then
+ status()
+ end
+ if not context.headers or not context.headers["content-type"] then
+ header("Content-Type", "text/html; charset=utf-8")
+ end
+ if not context.headers["cache-control"] then
+ header("Cache-Control", "no-cache")
+ header("Expires", "0")
+ end
+
+
+ context.eoh = true
+ coroutine.yield(3)
+ end
+ coroutine.yield(4, content)
+ return true
+ end
+end
+
+--- Splice data from a filedescriptor to the client.
+-- @param fp File descriptor
+-- @param size Bytes to splice (optional)
+function splice(fd, size)
+ coroutine.yield(6, fd, size)
+end
+
+--- Redirects the client to a new URL and closes the connection.
+-- @param url Target URL
+function redirect(url)
+ status(302, "Found")
+ header("Location", url)
+ close()
+end
+
+--- Create a querystring out of a table of key - value pairs.
+-- @param table Query string source table
+-- @return Encoded HTTP query string
+function build_querystring(q)
+ local s = { "?" }
+
+ for k, v in pairs(q) do
+ if #s > 1 then s[#s+1] = "&" end
+
+ s[#s+1] = urldecode(k)
+ s[#s+1] = "="
+ s[#s+1] = urldecode(v)
+ end
+
+ return table.concat(s, "")
+end
+
+--- Return the URL-decoded equivalent of a string.
+-- @param str URL-encoded string
+-- @param no_plus Don't decode + to " "
+-- @return URL-decoded string
+-- @see urlencode
+urldecode = protocol.urldecode
+
+--- Return the URL-encoded equivalent of a string.
+-- @param str Source string
+-- @return URL-encoded string
+-- @see urldecode
+urlencode = protocol.urlencode
+
+--- Send the given data as JSON encoded string.
+-- @param data Data to send
+function write_json(x)
+ if x == nil then
+ write("null")
+ elseif type(x) == "table" then
+ local k, v
+ if type(next(x)) == "number" then
+ write("[ ")
+ for k, v in ipairs(x) do
+ write_json(v)
+ if next(x, k) then
+ write(", ")
+ end
+ end
+ write(" ]")
+ else
+ write("{ ")
+ for k, v in pairs(x) do
+ write("%q: " % k)
+ write_json(v)
+ if next(x, k) then
+ write(", ")
+ end
+ end
+ write(" }")
+ end
+ elseif type(x) == "number" or type(x) == "boolean" then
+ if (x ~= x) then
+ -- NaN is the only value that doesn't equal to itself.
+ write("Number.NaN")
+ else
+ write(tostring(x))
+ end
+ else
+ write('"%s"' % tostring(x):gsub('["%z\1-\31]', function(c)
+ return '\\u%04x' % c:byte(1)
+ end))
+ end
+end
diff --git a/modules/base/luasrc/luasrc/http/protocol.lua b/modules/base/luasrc/luasrc/http/protocol.lua
new file mode 100644
index 000000000..0d41550b2
--- /dev/null
+++ b/modules/base/luasrc/luasrc/http/protocol.lua
@@ -0,0 +1,688 @@
+--[[
+
+HTTP protocol implementation for LuCI
+(c) 2008 Freifunk Leipzig / Jo-Philipp Wich <xm@leipzig.freifunk.net>
+
+Licensed under the Apache License, Version 2.0 (the "License");
+you may not use this file except in compliance with the License.
+You may obtain a copy of the License at
+
+ http://www.apache.org/licenses/LICENSE-2.0
+
+$Id$
+
+]]--
+
+--- LuCI http protocol class.
+-- This class contains several functions useful for http message- and content
+-- decoding and to retrive form data from raw http messages.
+module("luci.http.protocol", package.seeall)
+
+local ltn12 = require("luci.ltn12")
+
+HTTP_MAX_CONTENT = 1024*8 -- 8 kB maximum content size
+
+--- Decode an urlencoded string - optionally without decoding
+-- the "+" sign to " " - and return the decoded string.
+-- @param str Input string in x-www-urlencoded format
+-- @param no_plus Don't decode "+" signs to spaces
+-- @return The decoded string
+-- @see urlencode
+function urldecode( str, no_plus )
+
+ local function __chrdec( hex )
+ return string.char( tonumber( hex, 16 ) )
+ end
+
+ if type(str) == "string" then
+ if not no_plus then
+ str = str:gsub( "+", " " )
+ end
+
+ str = str:gsub( "%%([a-fA-F0-9][a-fA-F0-9])", __chrdec )
+ end
+
+ return str
+end
+
+--- Extract and split urlencoded data pairs, separated bei either "&" or ";"
+-- from given url or string. Returns a table with urldecoded values.
+-- Simple parameters are stored as string values associated with the parameter
+-- name within the table. Parameters with multiple values are stored as array
+-- containing the corresponding values.
+-- @param url The url or string which contains x-www-urlencoded form data
+-- @param tbl Use the given table for storing values (optional)
+-- @return Table containing the urldecoded parameters
+-- @see urlencode_params
+function urldecode_params( url, tbl )
+
+ local params = tbl or { }
+
+ if url:find("?") then
+ url = url:gsub( "^.+%?([^?]+)", "%1" )
+ end
+
+ for pair in url:gmatch( "[^&;]+" ) do
+
+ -- find key and value
+ local key = urldecode( pair:match("^([^=]+)") )
+ local val = urldecode( pair:match("^[^=]+=(.+)$") )
+
+ -- store
+ if type(key) == "string" and key:len() > 0 then
+ if type(val) ~= "string" then val = "" end
+
+ if not params[key] then
+ params[key] = val
+ elseif type(params[key]) ~= "table" then
+ params[key] = { params[key], val }
+ else
+ table.insert( params[key], val )
+ end
+ end
+ end
+
+ return params
+end
+
+--- Encode given string to x-www-urlencoded format.
+-- @param str String to encode
+-- @return String containing the encoded data
+-- @see urldecode
+function urlencode( str )
+
+ local function __chrenc( chr )
+ return string.format(
+ "%%%02x", string.byte( chr )
+ )
+ end
+
+ if type(str) == "string" then
+ str = str:gsub(
+ "([^a-zA-Z0-9$_%-%.%+!*'(),])",
+ __chrenc
+ )
+ end
+
+ return str
+end
+
+--- Encode each key-value-pair in given table to x-www-urlencoded format,
+-- separated by "&". Tables are encoded as parameters with multiple values by
+-- repeating the parameter name with each value.
+-- @param tbl Table with the values
+-- @return String containing encoded values
+-- @see urldecode_params
+function urlencode_params( tbl )
+ local enc = ""
+
+ for k, v in pairs(tbl) do
+ if type(v) == "table" then
+ for i, v2 in ipairs(v) do
+ enc = enc .. ( #enc > 0 and "&" or "" ) ..
+ urlencode(k) .. "=" .. urlencode(v2)
+ end
+ else
+ enc = enc .. ( #enc > 0 and "&" or "" ) ..
+ urlencode(k) .. "=" .. urlencode(v)
+ end
+ end
+
+ return enc
+end
+
+-- (Internal function)
+-- Initialize given parameter and coerce string into table when the parameter
+-- already exists.
+-- @param tbl Table where parameter should be created
+-- @param key Parameter name
+-- @return Always nil
+local function __initval( tbl, key )
+ if tbl[key] == nil then
+ tbl[key] = ""
+ elseif type(tbl[key]) == "string" then
+ tbl[key] = { tbl[key], "" }
+ else
+ table.insert( tbl[key], "" )
+ end
+end
+
+-- (Internal function)
+-- Append given data to given parameter, either by extending the string value
+-- or by appending it to the last string in the parameter's value table.
+-- @param tbl Table containing the previously initialized parameter value
+-- @param key Parameter name
+-- @param chunk String containing the data to append
+-- @return Always nil
+-- @see __initval
+local function __appendval( tbl, key, chunk )
+ if type(tbl[key]) == "table" then
+ tbl[key][#tbl[key]] = tbl[key][#tbl[key]] .. chunk
+ else
+ tbl[key] = tbl[key] .. chunk
+ end
+end
+
+-- (Internal function)
+-- Finish the value of given parameter, either by transforming the string value
+-- or - in the case of multi value parameters - the last element in the
+-- associated values table.
+-- @param tbl Table containing the previously initialized parameter value
+-- @param key Parameter name
+-- @param handler Function which transforms the parameter value
+-- @return Always nil
+-- @see __initval
+-- @see __appendval
+local function __finishval( tbl, key, handler )
+ if handler then
+ if type(tbl[key]) == "table" then
+ tbl[key][#tbl[key]] = handler( tbl[key][#tbl[key]] )
+ else
+ tbl[key] = handler( tbl[key] )
+ end
+ end
+end
+
+
+-- Table of our process states
+local process_states = { }
+
+-- Extract "magic", the first line of a http message.
+-- Extracts the message type ("get", "post" or "response"), the requested uri
+-- or the status code if the line descripes a http response.
+process_states['magic'] = function( msg, chunk, err )
+
+ if chunk ~= nil then
+ -- ignore empty lines before request
+ if #chunk == 0 then
+ return true, nil
+ end
+
+ -- Is it a request?
+ local method, uri, http_ver = chunk:match("^([A-Z]+) ([^ ]+) HTTP/([01]%.[019])$")
+
+ -- Yup, it is
+ if method then
+
+ msg.type = "request"
+ msg.request_method = method:lower()
+ msg.request_uri = uri
+ msg.http_version = tonumber( http_ver )
+ msg.headers = { }
+
+ -- We're done, next state is header parsing
+ return true, function( chunk )
+ return process_states['headers']( msg, chunk )
+ end
+
+ -- Is it a response?
+ else
+
+ local http_ver, code, message = chunk:match("^HTTP/([01]%.[019]) ([0-9]+) ([^\r\n]+)$")
+
+ -- Is a response
+ if code then
+
+ msg.type = "response"
+ msg.status_code = code
+ msg.status_message = message
+ msg.http_version = tonumber( http_ver )
+ msg.headers = { }
+
+ -- We're done, next state is header parsing
+ return true, function( chunk )
+ return process_states['headers']( msg, chunk )
+ end
+ end
+ end
+ end
+
+ -- Can't handle it
+ return nil, "Invalid HTTP message magic"
+end
+
+
+-- Extract headers from given string.
+process_states['headers'] = function( msg, chunk )
+
+ if chunk ~= nil then
+
+ -- Look for a valid header format
+ local hdr, val = chunk:match( "^([A-Za-z][A-Za-z0-9%-_]+): +(.+)$" )
+
+ if type(hdr) == "string" and hdr:len() > 0 and
+ type(val) == "string" and val:len() > 0
+ then
+ msg.headers[hdr] = val
+
+ -- Valid header line, proceed
+ return true, nil
+
+ elseif #chunk == 0 then
+ -- Empty line, we won't accept data anymore
+ return false, nil
+ else
+ -- Junk data
+ return nil, "Invalid HTTP header received"
+ end
+ else
+ return nil, "Unexpected EOF"
+ end
+end
+
+
+--- Creates a ltn12 source from the given socket. The source will return it's
+-- data line by line with the trailing \r\n stripped of.
+-- @param sock Readable network socket
+-- @return Ltn12 source function
+function header_source( sock )
+ return ltn12.source.simplify( function()
+
+ local chunk, err, part = sock:receive("*l")
+
+ -- Line too long
+ if chunk == nil then
+ if err ~= "timeout" then
+ return nil, part
+ and "Line exceeds maximum allowed length"
+ or "Unexpected EOF"
+ else
+ return nil, err
+ end
+
+ -- Line ok
+ elseif chunk ~= nil then
+
+ -- Strip trailing CR
+ chunk = chunk:gsub("\r$","")
+
+ return chunk, nil
+ end
+ end )
+end
+
+--- Decode a mime encoded http message body with multipart/form-data
+-- Content-Type. Stores all extracted data associated with its parameter name
+-- in the params table withing the given message object. Multiple parameter
+-- values are stored as tables, ordinary ones as strings.
+-- If an optional file callback function is given then it is feeded with the
+-- file contents chunk by chunk and only the extracted file name is stored
+-- within the params table. The callback function will be called subsequently
+-- with three arguments:
+-- o Table containing decoded (name, file) and raw (headers) mime header data
+-- o String value containing a chunk of the file data
+-- o Boolean which indicates wheather the current chunk is the last one (eof)
+-- @param src Ltn12 source function
+-- @param msg HTTP message object
+-- @param filecb File callback function (optional)
+-- @return Value indicating successful operation (not nil means "ok")
+-- @return String containing the error if unsuccessful
+-- @see parse_message_header
+function mimedecode_message_body( src, msg, filecb )
+
+ if msg and msg.env.CONTENT_TYPE then
+ msg.mime_boundary = msg.env.CONTENT_TYPE:match("^multipart/form%-data; boundary=(.+)$")
+ end
+
+ if not msg.mime_boundary then
+ return nil, "Invalid Content-Type found"
+ end
+
+
+ local tlen = 0
+ local inhdr = false
+ local field = nil
+ local store = nil
+ local lchunk = nil
+
+ local function parse_headers( chunk, field )
+
+ local stat
+ repeat
+ chunk, stat = chunk:gsub(
+ "^([A-Z][A-Za-z0-9%-_]+): +([^\r\n]+)\r\n",
+ function(k,v)
+ field.headers[k] = v
+ return ""
+ end
+ )
+ until stat == 0
+
+ chunk, stat = chunk:gsub("^\r\n","")
+
+ -- End of headers
+ if stat > 0 then
+ if field.headers["Content-Disposition"] then
+ if field.headers["Content-Disposition"]:match("^form%-data; ") then
+ field.name = field.headers["Content-Disposition"]:match('name="(.-)"')
+ field.file = field.headers["Content-Disposition"]:match('filename="(.+)"$')
+ end
+ end
+
+ if not field.headers["Content-Type"] then
+ field.headers["Content-Type"] = "text/plain"
+ end
+
+ if field.name and field.file and filecb then
+ __initval( msg.params, field.name )
+ __appendval( msg.params, field.name, field.file )
+
+ store = filecb
+ elseif field.name then
+ __initval( msg.params, field.name )
+
+ store = function( hdr, buf, eof )
+ __appendval( msg.params, field.name, buf )
+ end
+ else
+ store = nil
+ end
+
+ return chunk, true
+ end
+
+ return chunk, false
+ end
+
+ local function snk( chunk )
+
+ tlen = tlen + ( chunk and #chunk or 0 )
+
+ if msg.env.CONTENT_LENGTH and tlen > tonumber(msg.env.CONTENT_LENGTH) + 2 then
+ return nil, "Message body size exceeds Content-Length"
+ end
+
+ if chunk and not lchunk then
+ lchunk = "\r\n" .. chunk
+
+ elseif lchunk then
+ local data = lchunk .. ( chunk or "" )
+ local spos, epos, found
+
+ repeat
+ spos, epos = data:find( "\r\n--" .. msg.mime_boundary .. "\r\n", 1, true )
+
+ if not spos then
+ spos, epos = data:find( "\r\n--" .. msg.mime_boundary .. "--\r\n", 1, true )
+ end
+
+
+ if spos then
+ local predata = data:sub( 1, spos - 1 )
+
+ if inhdr then
+ predata, eof = parse_headers( predata, field )
+
+ if not eof then
+ return nil, "Invalid MIME section header"
+ elseif not field.name then
+ return nil, "Invalid Content-Disposition header"
+ end
+ end
+
+ if store then
+ store( field, predata, true )
+ end
+
+
+ field = { headers = { } }
+ found = found or true
+
+ data, eof = parse_headers( data:sub( epos + 1, #data ), field )
+ inhdr = not eof
+ end
+ until not spos
+
+ if found then
+ -- We found at least some boundary. Save
+ -- the unparsed remaining data for the
+ -- next chunk.
+ lchunk, data = data, nil
+ else
+ -- There was a complete chunk without a boundary. Parse it as headers or
+ -- append it as data, depending on our current state.
+ if inhdr then
+ lchunk, eof = parse_headers( data, field )
+ inhdr = not eof
+ else
+ -- We're inside data, so append the data. Note that we only append
+ -- lchunk, not all of data, since there is a chance that chunk
+ -- contains half a boundary. Assuming that each chunk is at least the
+ -- boundary in size, this should prevent problems
+ store( field, lchunk, false )
+ lchunk, chunk = chunk, nil
+ end
+ end
+ end
+
+ return true
+ end
+
+ return ltn12.pump.all( src, snk )
+end
+
+--- Decode an urlencoded http message body with application/x-www-urlencoded
+-- Content-Type. Stores all extracted data associated with its parameter name
+-- in the params table withing the given message object. Multiple parameter
+-- values are stored as tables, ordinary ones as strings.
+-- @param src Ltn12 source function
+-- @param msg HTTP message object
+-- @return Value indicating successful operation (not nil means "ok")
+-- @return String containing the error if unsuccessful
+-- @see parse_message_header
+function urldecode_message_body( src, msg )
+
+ local tlen = 0
+ local lchunk = nil
+
+ local function snk( chunk )
+
+ tlen = tlen + ( chunk and #chunk or 0 )
+
+ if msg.env.CONTENT_LENGTH and tlen > tonumber(msg.env.CONTENT_LENGTH) + 2 then
+ return nil, "Message body size exceeds Content-Length"
+ elseif tlen > HTTP_MAX_CONTENT then
+ return nil, "Message body size exceeds maximum allowed length"
+ end
+
+ if not lchunk and chunk then
+ lchunk = chunk
+
+ elseif lchunk then
+ local data = lchunk .. ( chunk or "&" )
+ local spos, epos
+
+ repeat
+ spos, epos = data:find("^.-[;&]")
+
+ if spos then
+ local pair = data:sub( spos, epos - 1 )
+ local key = pair:match("^(.-)=")
+ local val = pair:match("=([^%s]*)%s*$")
+
+ if key and #key > 0 then
+ __initval( msg.params, key )
+ __appendval( msg.params, key, val )
+ __finishval( msg.params, key, urldecode )
+ end
+
+ data = data:sub( epos + 1, #data )
+ end
+ until not spos
+
+ lchunk = data
+ end
+
+ return true
+ end
+
+ return ltn12.pump.all( src, snk )
+end
+
+--- Try to extract an http message header including information like protocol
+-- version, message headers and resulting CGI environment variables from the
+-- given ltn12 source.
+-- @param src Ltn12 source function
+-- @return HTTP message object
+-- @see parse_message_body
+function parse_message_header( src )
+
+ local ok = true
+ local msg = { }
+
+ local sink = ltn12.sink.simplify(
+ function( chunk )
+ return process_states['magic']( msg, chunk )
+ end
+ )
+
+ -- Pump input data...
+ while ok do
+
+ -- get data
+ ok, err = ltn12.pump.step( src, sink )
+
+ -- error
+ if not ok and err then
+ return nil, err
+
+ -- eof
+ elseif not ok then
+
+ -- Process get parameters
+ if ( msg.request_method == "get" or msg.request_method == "post" ) and
+ msg.request_uri:match("?")
+ then
+ msg.params = urldecode_params( msg.request_uri )
+ else
+ msg.params = { }
+ end
+
+ -- Populate common environment variables
+ msg.env = {
+ CONTENT_LENGTH = msg.headers['Content-Length'];
+ CONTENT_TYPE = msg.headers['Content-Type'] or msg.headers['Content-type'];
+ REQUEST_METHOD = msg.request_method:upper();
+ REQUEST_URI = msg.request_uri;
+ SCRIPT_NAME = msg.request_uri:gsub("?.+$","");
+ SCRIPT_FILENAME = ""; -- XXX implement me
+ SERVER_PROTOCOL = "HTTP/" .. string.format("%.1f", msg.http_version);
+ QUERY_STRING = msg.request_uri:match("?")
+ and msg.request_uri:gsub("^.+?","") or ""
+ }
+
+ -- Populate HTTP_* environment variables
+ for i, hdr in ipairs( {
+ 'Accept',
+ 'Accept-Charset',
+ 'Accept-Encoding',
+ 'Accept-Language',
+ 'Connection',
+ 'Cookie',
+ 'Host',
+ 'Referer',
+ 'User-Agent',
+ } ) do
+ local var = 'HTTP_' .. hdr:upper():gsub("%-","_")
+ local val = msg.headers[hdr]
+
+ msg.env[var] = val
+ end
+ end
+ end
+
+ return msg
+end
+
+--- Try to extract and decode a http message body from the given ltn12 source.
+-- This function will examine the Content-Type within the given message object
+-- to select the appropriate content decoder.
+-- Currently the application/x-www-urlencoded and application/form-data
+-- mime types are supported. If the encountered content encoding can't be
+-- handled then the whole message body will be stored unaltered as "content"
+-- property within the given message object.
+-- @param src Ltn12 source function
+-- @param msg HTTP message object
+-- @param filecb File data callback (optional, see mimedecode_message_body())
+-- @return Value indicating successful operation (not nil means "ok")
+-- @return String containing the error if unsuccessful
+-- @see parse_message_header
+function parse_message_body( src, msg, filecb )
+ -- Is it multipart/mime ?
+ if msg.env.REQUEST_METHOD == "POST" and msg.env.CONTENT_TYPE and
+ msg.env.CONTENT_TYPE:match("^multipart/form%-data")
+ then
+
+ return mimedecode_message_body( src, msg, filecb )
+
+ -- Is it application/x-www-form-urlencoded ?
+ elseif msg.env.REQUEST_METHOD == "POST" and msg.env.CONTENT_TYPE and
+ msg.env.CONTENT_TYPE:match("^application/x%-www%-form%-urlencoded")
+ then
+ return urldecode_message_body( src, msg, filecb )
+
+
+ -- Unhandled encoding
+ -- If a file callback is given then feed it chunk by chunk, else
+ -- store whole buffer in message.content
+ else
+
+ local sink
+
+ -- If we have a file callback then feed it
+ if type(filecb) == "function" then
+ sink = filecb
+
+ -- ... else append to .content
+ else
+ msg.content = ""
+ msg.content_length = 0
+
+ sink = function( chunk, err )
+ if chunk then
+ if ( msg.content_length + #chunk ) <= HTTP_MAX_CONTENT then
+ msg.content = msg.content .. chunk
+ msg.content_length = msg.content_length + #chunk
+ return true
+ else
+ return nil, "POST data exceeds maximum allowed length"
+ end
+ end
+ return true
+ end
+ end
+
+ -- Pump data...
+ while true do
+ local ok, err = ltn12.pump.step( src, sink )
+
+ if not ok and err then
+ return nil, err
+ elseif not err then
+ return true
+ end
+ end
+
+ return true
+ end
+end
+
+--- Table containing human readable messages for several http status codes.
+-- @class table
+statusmsg = {
+ [200] = "OK",
+ [206] = "Partial Content",
+ [301] = "Moved Permanently",
+ [302] = "Found",
+ [304] = "Not Modified",
+ [400] = "Bad Request",
+ [403] = "Forbidden",
+ [404] = "Not Found",
+ [405] = "Method Not Allowed",
+ [408] = "Request Time-out",
+ [411] = "Length Required",
+ [412] = "Precondition Failed",
+ [416] = "Requested range not satisfiable",
+ [500] = "Internal Server Error",
+ [503] = "Server Unavailable",
+}
diff --git a/modules/base/luasrc/luasrc/http/protocol/conditionals.lua b/modules/base/luasrc/luasrc/http/protocol/conditionals.lua
new file mode 100644
index 000000000..75e1f7b37
--- /dev/null
+++ b/modules/base/luasrc/luasrc/http/protocol/conditionals.lua
@@ -0,0 +1,153 @@
+--[[
+
+HTTP protocol implementation for LuCI - RFC2616 / 14.19, 14.24 - 14.28
+(c) 2008 Freifunk Leipzig / Jo-Philipp Wich <xm@leipzig.freifunk.net>
+
+Licensed under the Apache License, Version 2.0 (the "License");
+you may not use this file except in compliance with the License.
+You may obtain a copy of the License at
+
+ http://www.apache.org/licenses/LICENSE-2.0
+
+$Id$
+
+]]--
+
+--- LuCI http protocol implementation - HTTP/1.1 bits.
+-- This class provides basic ETag handling and implements most of the
+-- conditional HTTP/1.1 headers specified in RFC2616 Sct. 14.24 - 14.28 .
+module("luci.http.protocol.conditionals", package.seeall)
+
+local date = require("luci.http.protocol.date")
+
+
+--- Implement 14.19 / ETag.
+-- @param stat A file.stat structure
+-- @return String containing the generated tag suitable for ETag headers
+function mk_etag( stat )
+ if stat ~= nil then
+ return string.format( '"%x-%x-%x"', stat.ino, stat.size, stat.mtime )
+ end
+end
+
+--- 14.24 / If-Match
+-- Test whether the given message object contains an "If-Match" header and
+-- compare it against the given stat object.
+-- @param req HTTP request message object
+-- @param stat A file.stat object
+-- @return Boolean indicating whether the precondition is ok
+-- @return Alternative status code if the precondition failed
+function if_match( req, stat )
+ local h = req.headers
+ local etag = mk_etag( stat )
+
+ -- Check for matching resource
+ if type(h['If-Match']) == "string" then
+ for ent in h['If-Match']:gmatch("([^, ]+)") do
+ if ( ent == '*' or ent == etag ) and stat ~= nil then
+ return true
+ end
+ end
+
+ return false, 412
+ end
+
+ return true
+end
+
+--- 14.25 / If-Modified-Since
+-- Test whether the given message object contains an "If-Modified-Since" header
+-- and compare it against the given stat object.
+-- @param req HTTP request message object
+-- @param stat A file.stat object
+-- @return Boolean indicating whether the precondition is ok
+-- @return Alternative status code if the precondition failed
+-- @return Table containing extra HTTP headers if the precondition failed
+function if_modified_since( req, stat )
+ local h = req.headers
+
+ -- Compare mtimes
+ if type(h['If-Modified-Since']) == "string" then
+ local since = date.to_unix( h['If-Modified-Since'] )
+
+ if stat == nil or since < stat.mtime then
+ return true
+ end
+
+ return false, 304, {
+ ["ETag"] = mk_etag( stat );
+ ["Date"] = date.to_http( os.time() );
+ ["Last-Modified"] = date.to_http( stat.mtime )
+ }
+ end
+
+ return true
+end
+
+--- 14.26 / If-None-Match
+-- Test whether the given message object contains an "If-None-Match" header and
+-- compare it against the given stat object.
+-- @param req HTTP request message object
+-- @param stat A file.stat object
+-- @return Boolean indicating whether the precondition is ok
+-- @return Alternative status code if the precondition failed
+-- @return Table containing extra HTTP headers if the precondition failed
+function if_none_match( req, stat )
+ local h = req.headers
+ local etag = mk_etag( stat )
+ local method = req.env and req.env.REQUEST_METHOD or "GET"
+
+ -- Check for matching resource
+ if type(h['If-None-Match']) == "string" then
+ for ent in h['If-None-Match']:gmatch("([^, ]+)") do
+ if ( ent == '*' or ent == etag ) and stat ~= nil then
+ if method == "GET" or method == "HEAD" then
+ return false, 304, {
+ ["ETag"] = etag;
+ ["Date"] = date.to_http( os.time() );
+ ["Last-Modified"] = date.to_http( stat.mtime )
+ }
+ else
+ return false, 412
+ end
+ end
+ end
+ end
+
+ return true
+end
+
+--- 14.27 / If-Range
+-- The If-Range header is currently not implemented due to the lack of general
+-- byte range stuff in luci.http.protocol . This function will always return
+-- false, 412 to indicate a failed precondition.
+-- @param req HTTP request message object
+-- @param stat A file.stat object
+-- @return Boolean indicating whether the precondition is ok
+-- @return Alternative status code if the precondition failed
+function if_range( req, stat )
+ -- Sorry, no subranges (yet)
+ return false, 412
+end
+
+--- 14.28 / If-Unmodified-Since
+-- Test whether the given message object contains an "If-Unmodified-Since"
+-- header and compare it against the given stat object.
+-- @param req HTTP request message object
+-- @param stat A file.stat object
+-- @return Boolean indicating whether the precondition is ok
+-- @return Alternative status code if the precondition failed
+function if_unmodified_since( req, stat )
+ local h = req.headers
+
+ -- Compare mtimes
+ if type(h['If-Unmodified-Since']) == "string" then
+ local since = date.to_unix( h['If-Unmodified-Since'] )
+
+ if stat ~= nil and since <= stat.mtime then
+ return false, 412
+ end
+ end
+
+ return true
+end
diff --git a/modules/base/luasrc/luasrc/http/protocol/date.lua b/modules/base/luasrc/luasrc/http/protocol/date.lua
new file mode 100644
index 000000000..83d11e2c2
--- /dev/null
+++ b/modules/base/luasrc/luasrc/http/protocol/date.lua
@@ -0,0 +1,115 @@
+--[[
+
+HTTP protocol implementation for LuCI - date handling
+(c) 2008 Freifunk Leipzig / Jo-Philipp Wich <xm@leipzig.freifunk.net>
+
+Licensed under the Apache License, Version 2.0 (the "License");
+you may not use this file except in compliance with the License.
+You may obtain a copy of the License at
+
+ http://www.apache.org/licenses/LICENSE-2.0
+
+$Id$
+
+]]--
+
+--- LuCI http protocol implementation - date helper class.
+-- This class contains functions to parse, compare and format http dates.
+module("luci.http.protocol.date", package.seeall)
+
+require("luci.sys.zoneinfo")
+
+
+MONTHS = {
+ "Jan", "Feb", "Mar", "Apr", "May", "Jun", "Jul", "Aug",
+ "Sep", "Oct", "Nov", "Dec"
+}
+
+--- Return the time offset in seconds between the UTC and given time zone.
+-- @param tz Symbolic or numeric timezone specifier
+-- @return Time offset to UTC in seconds
+function tz_offset(tz)
+
+ if type(tz) == "string" then
+
+ -- check for a numeric identifier
+ local s, v = tz:match("([%+%-])([0-9]+)")
+ if s == '+' then s = 1 else s = -1 end
+ if v then v = tonumber(v) end
+
+ if s and v then
+ return s * 60 * ( math.floor( v / 100 ) * 60 + ( v % 100 ) )
+
+ -- lookup symbolic tz
+ elseif luci.sys.zoneinfo.OFFSET[tz:lower()] then
+ return luci.sys.zoneinfo.OFFSET[tz:lower()]
+ end
+
+ end
+
+ -- bad luck
+ return 0
+end
+
+--- Parse given HTTP date string and convert it to unix epoch time.
+-- @param data String containing the date
+-- @return Unix epoch time
+function to_unix(date)
+
+ local wd, day, mon, yr, hr, min, sec, tz = date:match(
+ "([A-Z][a-z][a-z]), ([0-9]+) " ..
+ "([A-Z][a-z][a-z]) ([0-9]+) " ..
+ "([0-9]+):([0-9]+):([0-9]+) " ..
+ "([A-Z0-9%+%-]+)"
+ )
+
+ if day and mon and yr and hr and min and sec then
+ -- find month
+ local month = 1
+ for i = 1, 12 do
+ if MONTHS[i] == mon then
+ month = i
+ break
+ end
+ end
+
+ -- convert to epoch time
+ return tz_offset(tz) + os.time( {
+ year = yr,
+ month = month,
+ day = day,
+ hour = hr,
+ min = min,
+ sec = sec
+ } )
+ end
+
+ return 0
+end
+
+--- Convert the given unix epoch time to valid HTTP date string.
+-- @param time Unix epoch time
+-- @return String containing the formatted date
+function to_http(time)
+ return os.date( "%a, %d %b %Y %H:%M:%S GMT", time )
+end
+
+--- Compare two dates which can either be unix epoch times or HTTP date strings.
+-- @param d1 The first date or epoch time to compare
+-- @param d2 The first date or epoch time to compare
+-- @return -1 - if d1 is lower then d2
+-- @return 0 - if both dates are equal
+-- @return 1 - if d1 is higher then d2
+function compare(d1, d2)
+
+ if d1:match("[^0-9]") then d1 = to_unix(d1) end
+ if d2:match("[^0-9]") then d2 = to_unix(d2) end
+
+ if d1 == d2 then
+ return 0
+ elseif d1 < d2 then
+ return -1
+ else
+ return 1
+ end
+end
diff --git a/modules/base/luasrc/luasrc/http/protocol/mime.lua b/modules/base/luasrc/luasrc/http/protocol/mime.lua
new file mode 100644
index 000000000..c87816066
--- /dev/null
+++ b/modules/base/luasrc/luasrc/http/protocol/mime.lua
@@ -0,0 +1,99 @@
+--[[
+
+HTTP protocol implementation for LuCI - mime handling
+(c) 2008 Freifunk Leipzig / Jo-Philipp Wich <xm@leipzig.freifunk.net>
+
+Licensed under the Apache License, Version 2.0 (the "License");
+you may not use this file except in compliance with the License.
+You may obtain a copy of the License at
+
+ http://www.apache.org/licenses/LICENSE-2.0
+
+$Id$
+
+]]--
+
+--- LuCI http protocol implementation - mime helper class.
+-- This class provides functions to guess mime types from file extensions and
+-- vice versa.
+module("luci.http.protocol.mime", package.seeall)
+
+require("luci.util")
+
+--- MIME mapping table containg extension - mimetype relations.
+-- @class table
+MIME_TYPES = {
+ ["txt"] = "text/plain";
+ ["js"] = "text/javascript";
+ ["css"] = "text/css";
+ ["htm"] = "text/html";
+ ["html"] = "text/html";
+ ["patch"] = "text/x-patch";
+ ["c"] = "text/x-csrc";
+ ["h"] = "text/x-chdr";
+ ["o"] = "text/x-object";
+ ["ko"] = "text/x-object";
+
+ ["bmp"] = "image/bmp";
+ ["gif"] = "image/gif";
+ ["png"] = "image/png";
+ ["jpg"] = "image/jpeg";
+ ["jpeg"] = "image/jpeg";
+ ["svg"] = "image/svg+xml";
+
+ ["zip"] = "application/zip";
+ ["pdf"] = "application/pdf";
+ ["xml"] = "application/xml";
+ ["xsl"] = "application/xml";
+ ["doc"] = "application/msword";
+ ["ppt"] = "application/vnd.ms-powerpoint";
+ ["xls"] = "application/vnd.ms-excel";
+ ["odt"] = "application/vnd.oasis.opendocument.text";
+ ["odp"] = "application/vnd.oasis.opendocument.presentation";
+ ["pl"] = "application/x-perl";
+ ["sh"] = "application/x-shellscript";
+ ["php"] = "application/x-php";
+ ["deb"] = "application/x-deb";
+ ["iso"] = "application/x-cd-image";
+ ["tgz"] = "application/x-compressed-tar";
+
+ ["mp3"] = "audio/mpeg";
+ ["ogg"] = "audio/x-vorbis+ogg";
+ ["wav"] = "audio/x-wav";
+
+ ["mpg"] = "video/mpeg";
+ ["mpeg"] = "video/mpeg";
+ ["avi"] = "video/x-msvideo";
+}
+
+--- Extract extension from a filename and return corresponding mime-type or
+-- "application/octet-stream" if the extension is unknown.
+-- @param filename The filename for which the mime type is guessed
+-- @return String containign the determined mime type
+function to_mime(filename)
+ if type(filename) == "string" then
+ local ext = filename:match("[^%.]+$")
+
+ if ext and MIME_TYPES[ext:lower()] then
+ return MIME_TYPES[ext:lower()]
+ end
+ end
+
+ return "application/octet-stream"
+end
+
+--- Return corresponding extension for a given mime type or nil if the
+-- given mime-type is unknown.
+-- @param mimetype The mimetype to retrieve the extension from
+-- @return String with the extension or nil for unknown type
+function to_ext(mimetype)
+ if type(mimetype) == "string" then
+ for ext, type in luci.util.kspairs( MIME_TYPES ) do
+ if type == mimetype then
+ return ext
+ end
+ end
+ end
+
+ return nil
+end
diff --git a/modules/base/luasrc/luasrc/i18n.lua b/modules/base/luasrc/luasrc/i18n.lua
new file mode 100644
index 000000000..545a8aed9
--- /dev/null
+++ b/modules/base/luasrc/luasrc/i18n.lua
@@ -0,0 +1,104 @@
+--[[
+LuCI - Internationalisation
+
+Description:
+A very minimalistic but yet effective internationalisation module
+
+FileId:
+$Id$
+
+License:
+Copyright 2008 Steven Barth <steven@midlink.org>
+
+Licensed under the Apache License, Version 2.0 (the "License");
+you may not use this file except in compliance with the License.
+You may obtain a copy of the License at
+
+ http://www.apache.org/licenses/LICENSE-2.0
+
+Unless required by applicable law or agreed to in writing, software
+distributed under the License is distributed on an "AS IS" BASIS,
+WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+See the License for the specific language governing permissions and
+limitations under the License.
+
+]]--
+
+--- LuCI translation library.
+module("luci.i18n", package.seeall)
+require("luci.util")
+
+local tparser = require "luci.template.parser"
+
+table = {}
+i18ndir = luci.util.libpath() .. "/i18n/"
+loaded = {}
+context = luci.util.threadlocal()
+default = "en"
+
+--- Clear the translation table.
+function clear()
+end
+
+--- Load a translation and copy its data into the translation table.
+-- @param file Language file
+-- @param lang Two-letter language code
+-- @param force Force reload even if already loaded (optional)
+-- @return Success status
+function load(file, lang, force)
+end
+
+--- Load a translation file using the default translation language.
+-- Alternatively load the translation of the fallback language.
+-- @param file Language file
+-- @param force Force reload even if already loaded (optional)
+function loadc(file, force)
+end
+
+--- Set the context default translation language.
+-- @param lang Two-letter language code
+function setlanguage(lang)
+ context.lang = lang:gsub("_", "-")
+ context.parent = (context.lang:match("^([a-z][a-z])_"))
+ if not tparser.load_catalog(context.lang, i18ndir) then
+ if context.parent then
+ tparser.load_catalog(context.parent, i18ndir)
+ return context.parent
+ end
+ end
+ return context.lang
+end
+
+--- Return the translated value for a specific translation key.
+-- @param key Default translation text
+-- @return Translated string
+function translate(key)
+ return tparser.translate(key) or key
+end
+
+--- Return the translated value for a specific translation key and use it as sprintf pattern.
+-- @param key Default translation text
+-- @param ... Format parameters
+-- @return Translated and formatted string
+function translatef(key, ...)
+ return tostring(translate(key)):format(...)
+end
+
+--- Return the translated value for a specific translation key
+-- and ensure that the returned value is a Lua string value.
+-- This is the same as calling <code>tostring(translate(...))</code>
+-- @param key Default translation text
+-- @return Translated string
+function string(key)
+ return tostring(translate(key))
+end
+
+--- Return the translated value for a specific translation key and use it as sprintf pattern.
+-- Ensure that the returned value is a Lua string value.
+-- This is the same as calling <code>tostring(translatef(...))</code>
+-- @param key Default translation text
+-- @param ... Format parameters
+-- @return Translated and formatted string
+function stringf(key, ...)
+ return tostring(translate(key)):format(...)
+end
diff --git a/modules/base/luasrc/luasrc/sauth.lua b/modules/base/luasrc/luasrc/sauth.lua
new file mode 100644
index 000000000..32f172dcd
--- /dev/null
+++ b/modules/base/luasrc/luasrc/sauth.lua
@@ -0,0 +1,127 @@
+--[[
+
+Session authentication
+(c) 2008 Steven Barth <steven@midlink.org>
+
+Licensed under the Apache License, Version 2.0 (the "License");
+you may not use this file except in compliance with the License.
+You may obtain a copy of the License at
+
+ http://www.apache.org/licenses/LICENSE-2.0
+
+$Id$
+
+]]--
+
+--- LuCI session library.
+module("luci.sauth", package.seeall)
+require("luci.util")
+require("luci.sys")
+require("luci.config")
+local nixio = require "nixio", require "nixio.util"
+local fs = require "nixio.fs"
+
+
+luci.config.sauth = luci.config.sauth or {}
+sessionpath = luci.config.sauth.sessionpath
+sessiontime = tonumber(luci.config.sauth.sessiontime) or 15 * 60
+
+--- Prepare session storage by creating the session directory.
+function prepare()
+ fs.mkdir(sessionpath, 700)
+ if not sane() then
+ error("Security Exception: Session path is not sane!")
+ end
+end
+
+local function _read(id)
+ local blob = fs.readfile(sessionpath .. "/" .. id)
+ return blob
+end
+
+local function _write(id, data)
+ local f = nixio.open(sessionpath .. "/" .. id, "w", 600)
+ f:writeall(data)
+ f:close()
+end
+
+local function _checkid(id)
+ return not not (id and #id == 32 and id:match("^[a-fA-F0-9]+$"))
+end
+
+--- Write session data to a session file.
+-- @param id Session identifier
+-- @param data Session data table
+function write(id, data)
+ if not sane() then
+ prepare()
+ end
+
+ assert(_checkid(id), "Security Exception: Session ID is invalid!")
+ assert(type(data) == "table", "Security Exception: Session data invalid!")
+
+ data.atime = luci.sys.uptime()
+
+ _write(id, luci.util.get_bytecode(data))
+end
+
+--- Read a session and return its content.
+-- @param id Session identifier
+-- @return Session data table or nil if the given id is not found
+function read(id)
+ if not id or #id == 0 then
+ return nil
+ end
+
+ assert(_checkid(id), "Security Exception: Session ID is invalid!")
+
+ if not sane(sessionpath .. "/" .. id) then
+ return nil
+ end
+
+ local blob = _read(id)
+ local func = loadstring(blob)
+ setfenv(func, {})
+
+ local sess = func()
+ assert(type(sess) == "table", "Session data invalid!")
+
+ if sess.atime and sess.atime + sessiontime < luci.sys.uptime() then
+ kill(id)
+ return nil
+ end
+
+ -- refresh atime in session
+ write(id, sess)
+
+ return sess
+end
+
+--- Check whether Session environment is sane.
+-- @return Boolean status
+function sane(file)
+ return luci.sys.process.info("uid")
+ == fs.stat(file or sessionpath, "uid")
+ and fs.stat(file or sessionpath, "modestr")
+ == (file and "rw-------" or "rwx------")
+end
+
+--- Kills a session
+-- @param id Session identifier
+function kill(id)
+ assert(_checkid(id), "Security Exception: Session ID is invalid!")
+ fs.unlink(sessionpath .. "/" .. id)
+end
+
+--- Remove all expired session data files
+function reap()
+ if sane() then
+ local id
+ for id in nixio.fs.dir(sessionpath) do
+ if _checkid(id) then
+ -- reading the session will kill it if it is expired
+ read(id)
+ end
+ end
+ end
+end
diff --git a/modules/base/luasrc/luasrc/template.lua b/modules/base/luasrc/luasrc/template.lua
new file mode 100644
index 000000000..72127d1df
--- /dev/null
+++ b/modules/base/luasrc/luasrc/template.lua
@@ -0,0 +1,107 @@
+--[[
+LuCI - Template Parser
+
+Description:
+A template parser supporting includes, translations, Lua code blocks
+and more. It can be used either as a compiler or as an interpreter.
+
+FileId: $Id$
+
+License:
+Copyright 2008 Steven Barth <steven@midlink.org>
+
+Licensed under the Apache License, Version 2.0 (the "License");
+you may not use this file except in compliance with the License.
+You may obtain a copy of the License at
+
+ http://www.apache.org/licenses/LICENSE-2.0
+
+Unless required by applicable law or agreed to in writing, software
+distributed under the License is distributed on an "AS IS" BASIS,
+WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+See the License for the specific language governing permissions and
+limitations under the License.
+
+]]--
+
+local util = require "luci.util"
+local config = require "luci.config"
+local tparser = require "luci.template.parser"
+
+local tostring, pairs, loadstring = tostring, pairs, loadstring
+local setmetatable, loadfile = setmetatable, loadfile
+local getfenv, setfenv, rawget = getfenv, setfenv, rawget
+local assert, type, error = assert, type, error
+
+--- LuCI template library.
+module "luci.template"
+
+config.template = config.template or {}
+viewdir = config.template.viewdir or util.libpath() .. "/view"
+
+
+-- Define the namespace for template modules
+context = util.threadlocal()
+
+--- Render a certain template.
+-- @param name Template name
+-- @param scope Scope to assign to template (optional)
+function render(name, scope)
+ return Template(name):render(scope or getfenv(2))
+end
+
+
+-- Template class
+Template = util.class()
+
+-- Shared template cache to store templates in to avoid unnecessary reloading
+Template.cache = setmetatable({}, {__mode = "v"})
+
+
+-- Constructor - Reads and compiles the template on-demand
+function Template.__init__(self, name)
+
+ self.template = self.cache[name]
+ self.name = name
+
+ -- Create a new namespace for this template
+ self.viewns = context.viewns
+
+ -- If we have a cached template, skip compiling and loading
+ if not self.template then
+
+ -- Compile template
+ local err
+ local sourcefile = viewdir .. "/" .. name .. ".htm"
+
+ self.template, _, err = tparser.parse(sourcefile)
+
+ -- If we have no valid template throw error, otherwise cache the template
+ if not self.template then
+ error("Failed to load template '" .. name .. "'.\n" ..
+ "Error while parsing template '" .. sourcefile .. "':\n" ..
+ (err or "Unknown syntax error"))
+ else
+ self.cache[name] = self.template
+ end
+ end
+end
+
+
+-- Renders a template
+function Template.render(self, scope)
+ scope = scope or getfenv(2)
+
+ -- Put our predefined objects in the scope of the template
+ setfenv(self.template, setmetatable({}, {__index =
+ function(tbl, key)
+ return rawget(tbl, key) or self.viewns[key] or scope[key]
+ end}))
+
+ -- Now finally render the thing
+ local stat, err = util.copcall(self.template)
+ if not stat then
+ error("Failed to execute template '" .. self.name .. "'.\n" ..
+ "A runtime error occured: " .. tostring(err or "(nil)"))
+ end
+end
diff --git a/modules/base/luasrc/luasrc/view/cbi/apply_xhr.htm b/modules/base/luasrc/luasrc/view/cbi/apply_xhr.htm
new file mode 100644
index 000000000..1814c9393
--- /dev/null
+++ b/modules/base/luasrc/luasrc/view/cbi/apply_xhr.htm
@@ -0,0 +1,43 @@
+<% export("cbi_apply_xhr", function(id, configs, redirect) -%>
+<fieldset class="cbi-section" id="cbi-apply-<%=id%>">
+ <legend><%:Applying changes%></legend>
+ <script type="text/javascript">//<![CDATA[
+ var apply_xhr = new XHR();
+
+ apply_xhr.get('<%=luci.dispatcher.build_url("servicectl", "restart", table.concat(configs, ","))%>', null,
+ function() {
+ var checkfinish = function() {
+ apply_xhr.get('<%=luci.dispatcher.build_url("servicectl", "status")%>', null,
+ function(x) {
+ if( x.responseText == 'finish' )
+ {
+ var e = document.getElementById('cbi-apply-<%=id%>-status');
+ if( e )
+ {
+ e.innerHTML = '<%:Configuration applied.%>';
+ window.setTimeout(function() {
+ e.parentNode.style.display = 'none';
+ <% if redirect then %>location.href='<%=redirect%>';<% end %>
+ }, 1000);
+ }
+ }
+ else
+ {
+ var e = document.getElementById('cbi-apply-<%=id%>-status');
+ if( e && x.responseText ) e.innerHTML = x.responseText;
+
+ window.setTimeout(checkfinish, 1000);
+ }
+ }
+ );
+ }
+
+ window.setTimeout(checkfinish, 1000);
+ }
+ );
+ //]]></script>
+
+ <img src="<%=resource%>/icons/loading.gif" alt="<%:Loading%>" style="vertical-align:middle" />
+ <span id="cbi-apply-<%=id%>-status"><%:Waiting for changes to be applied...%></span>
+</fieldset>
+<%- end) %>
diff --git a/modules/base/luasrc/luasrc/view/cbi/browser.htm b/modules/base/luasrc/luasrc/view/cbi/browser.htm
new file mode 100644
index 000000000..e4a4077d5
--- /dev/null
+++ b/modules/base/luasrc/luasrc/view/cbi/browser.htm
@@ -0,0 +1,7 @@
+<% local v = self:cfgvalue(section) -%>
+<%+cbi/valueheader%>
+ <input class="cbi-input-text" type="text"<%= attr("value", v) .. attr("name", cbid) .. attr("id", cbid) %> />
+ <script type="text/javascript">
+cbi_browser_init('<%=cbid%>', '<%=resource%>', '<%=luci.dispatcher.build_url("admin", "filebrowser")%>'<%=self.default_path and ", '"..self.default_path.."'"%>);
+ </script>
+<%+cbi/valuefooter%>
diff --git a/modules/base/luasrc/luasrc/view/cbi/button.htm b/modules/base/luasrc/luasrc/view/cbi/button.htm
new file mode 100644
index 000000000..30f8ddfda
--- /dev/null
+++ b/modules/base/luasrc/luasrc/view/cbi/button.htm
@@ -0,0 +1,7 @@
+<%+cbi/valueheader%>
+ <% if self:cfgvalue(section) ~= false then %>
+ <input class="cbi-button cbi-input-<%=self.inputstyle or "button" %>" type="submit"<%= attr("name", cbid) .. attr("id", cbid) .. attr("value", self.inputtitle or self.title)%> />
+ <% else %>
+ -
+ <% end %>
+<%+cbi/valuefooter%>
diff --git a/modules/base/luasrc/luasrc/view/cbi/cell_valuefooter.htm b/modules/base/luasrc/luasrc/view/cbi/cell_valuefooter.htm
new file mode 100644
index 000000000..220ebd42b
--- /dev/null
+++ b/modules/base/luasrc/luasrc/view/cbi/cell_valuefooter.htm
@@ -0,0 +1,20 @@
+</div>
+<div id="cbip-<%=self.config.."-"..section.."-"..self.option%>"></div>
+</td>
+
+<% if #self.deps > 0 then -%>
+ <script type="text/javascript">
+ <% for j, d in ipairs(self.deps) do -%>
+ cbi_d_add("cbi-<%=self.config.."-"..section.."-"..self.option..d.add%>", {
+ <%-
+ for k,v in pairs(d.deps) do
+ -%>
+ <%-=string.format('"cbid.%s.%s.%s"', self.config, section, k) .. ":" .. string.format("%q", v)-%>
+ <%-if next(d.deps, k) then-%>,<%-end-%>
+ <%-
+ end
+ -%>
+ }, "cbip-<%=self.config.."-"..section.."-"..self.option%>");
+ <%- end %>
+ </script>
+<%- end %>
diff --git a/modules/base/luasrc/luasrc/view/cbi/cell_valueheader.htm b/modules/base/luasrc/luasrc/view/cbi/cell_valueheader.htm
new file mode 100644
index 000000000..9e2e145dd
--- /dev/null
+++ b/modules/base/luasrc/luasrc/view/cbi/cell_valueheader.htm
@@ -0,0 +1,2 @@
+<td class="cbi-value-field<% if self.error and self.error[section] then %> cbi-value-error<% end %>">
+<div id="cbi-<%=self.config.."-"..section.."-"..self.option%>">
diff --git a/modules/base/luasrc/luasrc/view/cbi/compound.htm b/modules/base/luasrc/luasrc/view/cbi/compound.htm
new file mode 100644
index 000000000..12d02bb1d
--- /dev/null
+++ b/modules/base/luasrc/luasrc/view/cbi/compound.htm
@@ -0,0 +1 @@
+<%- self:render_children() %>
diff --git a/modules/base/luasrc/luasrc/view/cbi/delegator.htm b/modules/base/luasrc/luasrc/view/cbi/delegator.htm
new file mode 100644
index 000000000..4fd19265d
--- /dev/null
+++ b/modules/base/luasrc/luasrc/view/cbi/delegator.htm
@@ -0,0 +1,24 @@
+<%- self.active:render() %>
+ <div class="cbi-page-actions">
+ <input type="hidden" name="cbi.delg.current" value="<%=self.current%>" />
+<% for _, x in ipairs(self.chain) do %>
+ <input type="hidden" name="cbi.delg.path" value="<%=x%>" />
+<% end %>
+<% if not self.disallow_pageactions then %>
+<% if self.allow_finish and not self:get_next(self.current) then %>
+ <input class="cbi-button cbi-button-finish" type="submit" value="<%:Finish%>" />
+<% elseif self:get_next(self.current) then %>
+ <input class="cbi-button cbi-button-next" type="submit" value="<%:Next »%>" />
+<% end %>
+<% if self.allow_cancel then %>
+ <input class="cbi-button cbi-button-cancel" type="submit" name="cbi.cancel" value="<%:Cancel%>" />
+<% end %>
+<% if self.allow_reset then %>
+ <input class="cbi-button cbi-button-reset" type="reset" value="<%:Reset%>" />
+<% end %>
+<% if self.allow_back and self:get_prev(self.current) then %>
+ <input class="cbi-button cbi-button-back" type="submit" name="cbi.delg.back" value="<%:« Back%>" />
+<% end %>
+<% end %>
+ <script type="text/javascript">cbi_d_update();</script>
+ </div>
diff --git a/modules/base/luasrc/luasrc/view/cbi/dvalue.htm b/modules/base/luasrc/luasrc/view/cbi/dvalue.htm
new file mode 100644
index 000000000..78e6f323d
--- /dev/null
+++ b/modules/base/luasrc/luasrc/view/cbi/dvalue.htm
@@ -0,0 +1,13 @@
+<%+cbi/valueheader%>
+<% if self.href then %><a href="<%=self.href%>"><% end -%>
+ <%
+ local val = self:cfgvalue(section) or self.default or ""
+ if not self.rawhtml then
+ write(pcdata(val))
+ else
+ write(val)
+ end
+ %>
+<%- if self.href then %></a><%end%>
+<input type="hidden" id="<%=cbid%>" value="<%=pcdata(self:cfgvalue(section) or self.default or "")%>" />
+<%+cbi/valuefooter%>
diff --git a/modules/base/luasrc/luasrc/view/cbi/dynlist.htm b/modules/base/luasrc/luasrc/view/cbi/dynlist.htm
new file mode 100644
index 000000000..fd626a4ec
--- /dev/null
+++ b/modules/base/luasrc/luasrc/view/cbi/dynlist.htm
@@ -0,0 +1,26 @@
+<%+cbi/valueheader%>
+<div>
+<%
+ local vals = self:cfgvalue(section) or {}
+ for i=1, #vals + 1 do
+ local val = vals[i]
+ if (val and #val > 0) or (i == 1) then
+%>
+ <input class="cbi-input-text" value="<%=pcdata(val)%>" onchange="cbi_d_update(this.id)" type="text"<%=
+ attr("id", cbid .. "." .. i) .. attr("name", cbid) .. ifattr(self.size, "size") ..
+ ifattr(i == 1 and self.placeholder, "placeholder", self.placeholder)
+ %> /><br />
+<% end end %>
+</div>
+<script type="text/javascript">
+cbi_dynlist_init(
+ '<%=cbid%>', '<%=resource%>', '<%=self.datatype%>',
+ <%=tostring(self.optional or self.rmempty)%>
+ <%- if #self.keylist > 0 then -%>, [{
+ <%- for i, k in ipairs(self.keylist) do -%>
+ <%-=string.format("%q", k) .. ":" .. string.format("%q", self.vallist[i])-%>
+ <%-if i<#self.keylist then-%>,<%-end-%>
+ <%- end -%>
+ }, '<%: -- custom -- %>']<% end -%>);
+</script>
+<%+cbi/valuefooter%>
diff --git a/modules/base/luasrc/luasrc/view/cbi/filebrowser.htm b/modules/base/luasrc/luasrc/view/cbi/filebrowser.htm
new file mode 100644
index 000000000..a79beebba
--- /dev/null
+++ b/modules/base/luasrc/luasrc/view/cbi/filebrowser.htm
@@ -0,0 +1,108 @@
+<?xml version="1.0" encoding="UTF-8"?>
+<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Strict//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-strict.dtd">
+<html xmlns="http://www.w3.org/1999/xhtml" xml:lang="en" lang="en">
+<head>
+ <title>Filebrowser - LuCI</title>
+ <style type="text/css">
+ #path, #listing {
+ font-size: 85%;
+ }
+
+ ul {
+ padding-left: 0;
+ list-style-type: none;
+ }
+
+ li img {
+ vertical-align: bottom;
+ margin-right: 0.2em;
+ }
+ </style>
+
+ <script type="text/javascript">
+ function callback(path) {
+ if( window.opener ) {
+ var input = window.opener.document.getElementById('<%=luci.http.formvalue('field')%>');
+ if( input ) {
+ input.value = path;
+ window.close();
+ }
+ }
+ }
+ </script>
+</head>
+<body>
+ <%
+ require("nixio.fs")
+ require("nixio.util")
+ require("luci.http")
+ require("luci.dispatcher")
+
+ local field = luci.http.formvalue('field')
+ local request = luci.dispatcher.context.args
+ local path = { '' }
+
+ for i = 1, #request do
+ if request[i] ~= '..' and #request[i] > 0 then
+ path[#path+1] = request[i]
+ end
+ end
+
+ local filepath = table.concat( path, '/' )
+ local filestat = nixio.fs.stat( filepath )
+ local baseurl = luci.dispatcher.build_url('admin', 'filebrowser')
+
+ if filestat and filestat.type == "reg" then
+ table.remove( path, #path )
+ filepath = table.concat( path, '/' ) .. '/'
+ elseif not ( filestat and filestat.type == "dir" ) then
+ path = { '' }
+ filepath = '/'
+ else
+ filepath = filepath .. '/'
+ end
+
+ local entries = nixio.util.consume((nixio.fs.dir(filepath)))
+ -%>
+ <div id="path">
+ Location:
+ <% for i, dir in ipairs(path) do %>
+ <% if i == 1 then %>
+ <a href="<%=baseurl%>?field=<%=field%>">(root)</a>
+ <% elseif next(path, i) then %>
+ <% baseurl = baseurl .. '/' .. dir %>
+ / <a href="<%=baseurl%>?field=<%=field%>"><%=dir%></a>
+ <% else %>
+ <% baseurl = baseurl .. '/' .. dir %>
+ / <%=dir%>
+ <% end %>
+ <% end %>
+ </div>
+
+ <hr />
+
+ <div id="listing">
+ <ul>
+ <% for _, e in luci.util.vspairs(entries) do
+ local stat = nixio.fs.stat(filepath..e)
+ if stat and stat.type == 'dir' then
+ -%>
+ <li class="dir">
+ <img src="<%=resource%>/cbi/folder.gif" alt="<%:Directory%>" />
+ <a href="<%=baseurl%>/<%=e%>?field=<%=field%>"><%=e%>/</a>
+ </li>
+ <% end end -%>
+
+ <% for _, e in luci.util.vspairs(entries) do
+ local stat = nixio.fs.stat(filepath..e)
+ if stat and stat.type ~= 'dir' then
+ -%>
+ <li class="file">
+ <img src="<%=resource%>/cbi/file.gif" alt="<%:File%>" />
+ <a href="#" onclick="callback('<%=filepath..e%>')"><%=e%></a>
+ </li>
+ <% end end -%>
+ </ul>
+ </div>
+</body>
+</html>
diff --git a/modules/base/luasrc/luasrc/view/cbi/firewall_zoneforwards.htm b/modules/base/luasrc/luasrc/view/cbi/firewall_zoneforwards.htm
new file mode 100644
index 000000000..2a433b569
--- /dev/null
+++ b/modules/base/luasrc/luasrc/view/cbi/firewall_zoneforwards.htm
@@ -0,0 +1,59 @@
+<%+cbi/valueheader%>
+
+<%-
+ local utl = require "luci.util"
+ local fwm = require "luci.model.firewall".init()
+ local nwm = require "luci.model.network".init()
+
+ local zone, fwd, fz
+ local value = self:formvalue(section)
+ if not value or value == "-" then
+ value = self:cfgvalue(section) or self.default
+ end
+
+ local def = fwm:get_defaults()
+ local zone = fwm:get_zone(value)
+ local empty = true
+-%>
+
+<% if zone then %>
+<div style="white-space:nowrap">
+ <label class="zonebadge" style="background-color:<%=zone:get_color()%>">
+ <strong><%=zone:name()%>:</strong>
+ <%-
+ local zempty = true
+ for _, net in ipairs(zone:get_networks()) do
+ net = nwm:get_network(net)
+ if net then
+ zempty = false
+ -%>
+ <span class="ifacebadge<% if net:name() == self.network then %> ifacebadge-active<% end %>"><%=net:name()%>:
+ <%
+ local nempty = true
+ for _, iface in ipairs(net:is_bridge() and net:get_interfaces() or { net:get_interface() }) do
+ nempty = false
+ %>
+ <img<%=attr("title", iface:get_i18n())%> style="width:16px; height:16px; vertical-align:middle" src="<%=resource%>/icons/<%=iface:type()%><%=iface:is_up() and "" or "_disabled"%>.png" />
+ <% end %>
+ <% if nempty then %><em><%:(empty)%></em><% end %>
+ </span>
+ <%- end end -%>
+ <%- if zempty then %><em><%:(empty)%></em><% end -%>
+ </label>
+ &#160;&#8658;&#160;
+ <% for _, fwd in ipairs(zone:get_forwardings_by("src")) do
+ fz = fwd:dest_zone()
+ empty = false %>
+ <label class="zonebadge" style="background-color:<%=fz:get_color()%>">
+ <strong><%=fz:name()%></strong>
+ </label>&#160;
+ <% end %>
+ <% if empty then %>
+ <label class="zonebadge zonebadge-empty">
+ <strong><%=zone:forward():upper()%></strong>
+ </label>
+ <% end %>
+</div>
+<% end %>
+
+<%+cbi/valuefooter%>
diff --git a/modules/base/luasrc/luasrc/view/cbi/firewall_zonelist.htm b/modules/base/luasrc/luasrc/view/cbi/firewall_zonelist.htm
new file mode 100644
index 000000000..7973437f4
--- /dev/null
+++ b/modules/base/luasrc/luasrc/view/cbi/firewall_zonelist.htm
@@ -0,0 +1,89 @@
+<%+cbi/valueheader%>
+
+<%-
+ local utl = require "luci.util"
+ local fwm = require "luci.model.firewall".init()
+ local nwm = require "luci.model.network".init()
+
+ local zone, net, iface
+ local zones = fwm:get_zones()
+ local value = self:formvalue(section)
+ if not value or value == "-" then
+ value = self:cfgvalue(section) or self.default
+ end
+
+ local selected = false
+ local checked = { }
+
+ for value in utl.imatch(value) do
+ checked[value] = true
+ end
+
+ if not next(checked) then
+ checked[""] = true
+ end
+-%>
+
+<ul style="margin:0; list-style-type:none; text-align:left">
+ <% if self.allowlocal then %>
+ <li style="padding:0.5em">
+ <input class="cbi-input-radio" onclick="cbi_d_update(this.id)" onchange="cbi_d_update(this.id)"<%=attr("type", self.widget or "radio") .. attr("id", cbid .. "_empty") .. attr("name", cbid) .. attr("value", "") .. ifattr(checked[""], "checked", "checked")%> /> &#160;
+ <label<%=attr("for", cbid .. "_empty")%> style="background-color:<%=fwm.zone.get_color()%>" class="zonebadge">
+ <strong><%:Device%></strong>
+ <% if self.allowany and self.allowlocal then %>(<%:input%>)<% end %>
+ </label>
+ </li>
+ <% end %>
+ <% if self.allowany then %>
+ <li style="padding:0.5em">
+ <input class="cbi-input-radio" onclick="cbi_d_update(this.id)" onchange="cbi_d_update(this.id)"<%=attr("type", self.widget or "radio") .. attr("id", cbid .. "_any") .. attr("name", cbid) .. attr("value", "*") .. ifattr(checked["*"], "checked", "checked")%> /> &#160;
+ <label<%=attr("for", cbid .. "_any")%> style="background-color:<%=fwm.zone.get_color()%>" class="zonebadge">
+ <strong><%:Any zone%></strong>
+ <% if self.allowany and self.allowlocal then %>(<%:forward%>)<% end %>
+ </label>
+ </li>
+ <% end %>
+ <%
+ for _, zone in utl.spairs(zones, function(a,b) return (zones[a]:name() < zones[b]:name()) end) do
+ if zone:name() ~= self.exclude then
+ selected = selected or (value == zone:name())
+ %>
+ <li style="padding:0.5em">
+ <input class="cbi-input-radio" onclick="cbi_d_update(this.id)" onchange="cbi_d_update(this.id)"<%=attr("type", self.widget or "radio") .. attr("id", cbid .. "." .. zone:name()) .. attr("name", cbid) .. attr("value", zone:name()) .. ifattr(checked[zone:name()], "checked", "checked")%> /> &#160;
+ <label<%=attr("for", cbid .. "." .. zone:name())%> style="background-color:<%=zone:get_color()%>" class="zonebadge">
+ <strong><%=zone:name()%>:</strong>
+ <%
+ local zempty = true
+ for _, net in ipairs(zone:get_networks()) do
+ net = nwm:get_network(net)
+ if net then
+ zempty = false
+ %>
+ <span class="ifacebadge<% if net:name() == self.network then %> ifacebadge-active<% end %>"><%=net:name()%>:
+ <%
+ local nempty = true
+ for _, iface in ipairs(net:is_bridge() and net:get_interfaces() or { net:get_interface() }) do
+ nempty = false
+ %>
+ <img<%=attr("title", iface:get_i18n())%> style="width:16px; height:16px; vertical-align:middle" src="<%=resource%>/icons/<%=iface:type()%><%=iface:is_up() and "" or "_disabled"%>.png" />
+ <% end %>
+ <% if nempty then %><em><%:(empty)%></em><% end %>
+ </span>
+ <% end end %>
+ <% if zempty then %><em><%:(empty)%></em><% end %>
+ </label>
+ </li>
+ <% end end %>
+
+ <% if self.widget ~= "checkbox" and not self.nocreate then %>
+ <li style="padding:0.5em">
+ <input class="cbi-input-radio" onclick="cbi_d_update(this.id)" onchange="cbi_d_update(this.id)" type="radio"<%=attr("id", cbid .. "_new") .. attr("name", cbid) .. attr("value", "-") .. ifattr(not selected, "checked", "checked")%> /> &#160;
+ <div onclick="document.getElementById('<%=cbid%>_new').checked=true" class="zonebadge" style="background-color:<%=fwm.zone.get_color()%>">
+ <em><%:unspecified -or- create:%>&#160;</em>
+ <input type="text"<%=attr("name", cbid .. ".newzone") .. ifattr(not selected, "value", luci.http.formvalue(cbid .. ".newzone") or self.default)%> onfocus="document.getElementById('<%=cbid%>_new').checked=true" />
+ </div>
+ </li>
+ <% end %>
+</ul>
+
+<%+cbi/valuefooter%>
diff --git a/modules/base/luasrc/luasrc/view/cbi/footer.htm b/modules/base/luasrc/luasrc/view/cbi/footer.htm
new file mode 100644
index 000000000..2c34028e5
--- /dev/null
+++ b/modules/base/luasrc/luasrc/view/cbi/footer.htm
@@ -0,0 +1,26 @@
+ <%- if pageaction then -%>
+ <div class="cbi-page-actions">
+ <% if redirect then %>
+ <div style="float:left">
+ <input class="cbi-button cbi-button-link" type="button" value="<%:Back to Overview%>" onclick="location.href='<%=pcdata(redirect)%>'" />
+ </div>
+ <% end %>
+
+ <% if flow.skip then %>
+ <input class="cbi-button cbi-button-skip" type="submit" name="cbi.skip" value="<%:Skip%>" />
+ <% end %>
+ <% if not autoapply and not flow.hideapplybtn then %>
+ <input class="cbi-button cbi-button-apply" type="submit" name="cbi.apply" value="<%:Save & Apply%>" />
+ <% end %>
+ <% if not flow.hidesavebtn then %>
+ <input class="cbi-button cbi-button-save" type="submit" value="<%:Save%>" />
+ <% end %>
+ <% if not flow.hideresetbtn then %>
+ <input class="cbi-button cbi-button-reset" type="reset" value="<%:Reset%>" />
+ <% end %>
+
+ <script type="text/javascript">cbi_d_update();</script>
+ </div>
+ <%- end -%>
+</form>
+<%+footer%>
diff --git a/modules/base/luasrc/luasrc/view/cbi/full_valuefooter.htm b/modules/base/luasrc/luasrc/view/cbi/full_valuefooter.htm
new file mode 100644
index 000000000..4876fbcc9
--- /dev/null
+++ b/modules/base/luasrc/luasrc/view/cbi/full_valuefooter.htm
@@ -0,0 +1,59 @@
+ <% if self.description and #self.description > 0 then -%>
+ <% if not luci.util.instanceof(self, luci.cbi.DynamicList) and (not luci.util.instanceof(self, luci.cbi.Flag) or self.orientation == "horizontal") then -%>
+ <br />
+ <%- end %>
+ <div class="cbi-value-description">
+ <span class="cbi-value-helpicon"><img src="<%=resource%>/cbi/help.gif" alt="<%:help%>" /></span>
+ <%=self.description%>
+ </div>
+ <%- end %>
+ <%- if self.title and #self.title > 0 then -%>
+ </div>
+ <%- end -%>
+</div>
+
+
+<% if #self.deps > 0 or #self.subdeps > 0 then -%>
+ <script type="text/javascript" id="cbip-<%=self.config.."-"..section.."-"..self.option%>">
+ <% for j, d in ipairs(self.subdeps) do -%>
+ cbi_d_add("cbi-<%=self.config.."-"..section.."-"..self.option..d.add%>", {
+ <%-
+ for k,v in pairs(d.deps) do
+ local depk
+ if k:find("!", 1, true) then
+ depk = string.format('"%s"', k)
+ elseif k:find(".", 1, true) then
+ depk = string.format('"cbid.%s"', k)
+ else
+ depk = string.format('"cbid.%s.%s.%s"', self.config, section, k)
+ end
+ -%>
+ <%-= depk .. ":" .. string.format("%q", v)-%>
+ <%-if next(d.deps, k) then-%>,<%-end-%>
+ <%-
+ end
+ -%>
+ }, "cbip-<%=self.config.."-"..section.."-"..self.option..d.add%>");
+ <%- end %>
+ <% for j, d in ipairs(self.deps) do -%>
+ cbi_d_add("cbi-<%=self.config.."-"..section.."-"..self.option..d.add%>", {
+ <%-
+ for k,v in pairs(d.deps) do
+ local depk
+ if k:find("!", 1, true) then
+ depk = string.format('"%s"', k)
+ elseif k:find(".", 1, true) then
+ depk = string.format('"cbid.%s"', k)
+ else
+ depk = string.format('"cbid.%s.%s.%s"', self.config, section, k)
+ end
+ -%>
+ <%-= depk .. ":" .. string.format("%q", v)-%>
+ <%-if next(d.deps, k) then-%>,<%-end-%>
+ <%-
+ end
+ -%>
+ }, "cbip-<%=self.config.."-"..section.."-"..self.option..d.add%>");
+ <%- end %>
+ </script>
+<%- end %>
diff --git a/modules/base/luasrc/luasrc/view/cbi/full_valueheader.htm b/modules/base/luasrc/luasrc/view/cbi/full_valueheader.htm
new file mode 100644
index 000000000..aaf085473
--- /dev/null
+++ b/modules/base/luasrc/luasrc/view/cbi/full_valueheader.htm
@@ -0,0 +1,9 @@
+<div class="cbi-value<% if self.error and self.error[section] then %> cbi-value-error<% end %><% if self.last_child then %> cbi-value-last<% end %>" id="cbi-<%=self.config.."-"..section.."-"..self.option%>">
+ <%- if self.title and #self.title > 0 then -%>
+ <label class="cbi-value-title"<%= attr("for", cbid) %>>
+ <%- if self.titleref then -%><a title="<%=self.titledesc or translate('Go to relevant configuration page')%>" class="cbi-title-ref" href="<%=self.titleref%>"><%- end -%>
+ <%-=self.title-%>
+ <%- if self.titleref then -%></a><%- end -%>
+ </label>
+ <div class="cbi-value-field">
+ <%- end -%>
diff --git a/modules/base/luasrc/luasrc/view/cbi/fvalue.htm b/modules/base/luasrc/luasrc/view/cbi/fvalue.htm
new file mode 100644
index 000000000..a1e0808e8
--- /dev/null
+++ b/modules/base/luasrc/luasrc/view/cbi/fvalue.htm
@@ -0,0 +1,9 @@
+<%+cbi/valueheader%>
+ <input type="hidden" value="1"<%=
+ attr("name", "cbi.cbe." .. self.config .. "." .. section .. "." .. self.option)
+ %> />
+ <input class="cbi-input-checkbox" onclick="cbi_d_update(this.id)" onchange="cbi_d_update(this.id)" type="checkbox"<%=
+ attr("id", cbid) .. attr("name", cbid) .. attr("value", self.enabled or 1) ..
+ ifattr((self:cfgvalue(section) or self.default) == self.enabled, "checked", "checked")
+ %> />
+<%+cbi/valuefooter%>
diff --git a/modules/base/luasrc/luasrc/view/cbi/header.htm b/modules/base/luasrc/luasrc/view/cbi/header.htm
new file mode 100644
index 000000000..2bddaba61
--- /dev/null
+++ b/modules/base/luasrc/luasrc/view/cbi/header.htm
@@ -0,0 +1,7 @@
+<%+header%>
+<form method="post" name="cbi" action="<%=REQUEST_URI%>" enctype="multipart/form-data" onreset="return cbi_validate_reset(this)" onsubmit="return cbi_validate_form(this, '<%:Some fields are invalid, cannot save values!%>')">
+ <div>
+ <script type="text/javascript" src="<%=resource%>/cbi.js"></script>
+ <input type="hidden" name="cbi.submit" value="1" />
+ <input type="submit" value="<%:Save%>" class="hidden" />
+ </div>
diff --git a/modules/base/luasrc/luasrc/view/cbi/lvalue.htm b/modules/base/luasrc/luasrc/view/cbi/lvalue.htm
new file mode 100644
index 000000000..8cc086db4
--- /dev/null
+++ b/modules/base/luasrc/luasrc/view/cbi/lvalue.htm
@@ -0,0 +1,18 @@
+<%+cbi/valueheader%>
+<% if self.widget == "select" then %>
+ <select class="cbi-input-select" onchange="cbi_d_update(this.id)"<%= attr("id", cbid) .. attr("name", cbid) .. ifattr(self.size, "size") %>>
+ <% for i, key in pairs(self.keylist) do -%>
+ <option id="cbi-<%=self.config.."-"..section.."-"..self.option.."-"..key%>"<%= attr("value", key) .. ifattr(tostring(self:cfgvalue(section) or self.default) == key, "selected", "selected") %>><%=striptags(self.vallist[i])%></option>
+ <%- end %>
+ </select>
+<% elseif self.widget == "radio" then
+ local c = 0
+ for i, key in pairs(self.keylist) do
+ c = c + 1
+%>
+ <input class="cbi-input-radio" onclick="cbi_d_update(this.id)" onchange="cbi_d_update(this.id)" type="radio"<%= attr("id", cbid..c) .. attr("name", cbid) .. attr("value", key) .. ifattr((self:cfgvalue(section) or self.default) == key, "checked", "checked") %> />
+ <label<%= attr("for", cbid..c) %>><%=self.vallist[i]%></label>
+<% if c == self.size then c = 0 %><% if self.orientation == "horizontal" then %>&#160;<% else %><br /><% end %>
+<% end end %>
+<% end %>
+<%+cbi/valuefooter%>
diff --git a/modules/base/luasrc/luasrc/view/cbi/map.htm b/modules/base/luasrc/luasrc/view/cbi/map.htm
new file mode 100644
index 000000000..053220d18
--- /dev/null
+++ b/modules/base/luasrc/luasrc/view/cbi/map.htm
@@ -0,0 +1,13 @@
+<%- if firstmap and messages then local msg; for _, msg in ipairs(messages) do -%>
+ <div class="errorbox"><%=pcdata(msg)%></div>
+<%- end end -%>
+
+<%-+cbi/apply_xhr-%>
+
+<div class="cbi-map" id="cbi-<%=self.config%>">
+ <% if self.title and #self.title > 0 then %><h2><a id="content" name="content"><%=self.title%></a></h2><% end %>
+ <% if self.description and #self.description > 0 then %><div class="cbi-map-descr"><%=self.description%></div><% end %>
+ <%- if firstmap and applymap then cbi_apply_xhr(self.config, parsechain, redirect) end -%>
+ <%- self:render_children() %>
+ <br />
+</div>
diff --git a/modules/base/luasrc/luasrc/view/cbi/mvalue.htm b/modules/base/luasrc/luasrc/view/cbi/mvalue.htm
new file mode 100644
index 000000000..6a0b3881d
--- /dev/null
+++ b/modules/base/luasrc/luasrc/view/cbi/mvalue.htm
@@ -0,0 +1,19 @@
+<% local v = self:valuelist(section) or {} -%>
+<%+cbi/valueheader%>
+<% if self.widget == "select" then %>
+ <select class="cbi-input-select" multiple="multiple" onclick="cbi_d_update(this.id)" onchange="cbi_d_update(this.id)"<%= attr("name", cbid) .. ifattr(self.size, "size") %>>
+ <% for i, key in pairs(self.keylist) do -%>
+ <option<%= attr("value", key) .. ifattr(luci.util.contains(v, key), "selected", "selected") %>><%=striptags(self.vallist[i])%></option>
+ <%- end %>
+ </select>
+<% elseif self.widget == "checkbox" then
+ local c = 0;
+ for i, key in pairs(self.keylist) do
+ c = c + 1
+%>
+ <input class="cbi-input-checkbox" type="checkbox" onclick="cbi_d_update(this.id)" onchange="cbi_d_update(this.id)"<%= attr("id", cbid..c) .. attr("name", cbid) .. attr("value", key) .. ifattr(luci.util.contains(v, key), "checked", "checked") %> />
+ <label<%= attr("for", cbid..c) %>><%=self.vallist[i]%></label><br />
+<% if c == self.size then c = 0 %><br />
+<% end end %>
+<% end %>
+<%+cbi/valuefooter%>
diff --git a/modules/base/luasrc/luasrc/view/cbi/network_ifacelist.htm b/modules/base/luasrc/luasrc/view/cbi/network_ifacelist.htm
new file mode 100644
index 000000000..643d849a5
--- /dev/null
+++ b/modules/base/luasrc/luasrc/view/cbi/network_ifacelist.htm
@@ -0,0 +1,81 @@
+<%+cbi/valueheader%>
+
+<%-
+ local utl = require "luci.util"
+ local net = require "luci.model.network".init()
+ local cbeid = luci.cbi.FEXIST_PREFIX .. self.config .. "." .. section .. "." .. self.option
+
+ local iface
+ local ifaces = net:get_interfaces()
+ local value
+
+ if self.map:formvalue(cbeid) == "1" then
+ value = self:formvalue(section) or self.default or ""
+ else
+ value = self:cfgvalue(section) or self.default
+ end
+
+ local checked = { }
+
+ if value then
+ for value in utl.imatch(value) do
+ checked[value] = true
+ end
+ else
+ local n = self.network and net:get_network(self.network)
+ if n then
+ local i
+ for _, i in ipairs(n:get_interfaces() or { n:get_interface() }) do
+ checked[i:name()] = true
+ end
+ end
+ end
+-%>
+
+<input type="hidden" name="<%=cbeid%>" value="1" />
+<ul style="margin:0; list-style-type:none">
+ <% for _, iface in ipairs(ifaces) do
+ local link = iface:adminlink()
+ if (not self.nobridges or not iface:is_bridge()) and
+ (not self.noinactive or iface:is_up()) and
+ iface:name() ~= self.exclude
+ then %>
+ <li>
+ <input class="cbi-input-<%=self.widget or "radio"%>" onclick="cbi_d_update(this.id)" onchange="cbi_d_update(this.id)"<%=
+ attr("type", self.widget or "radio") ..
+ attr("id", cbid .. "." .. iface:name()) ..
+ attr("name", cbid) .. attr("value", iface:name()) ..
+ ifattr(checked[iface:name()], "checked", "checked")
+ %> /> &#160;
+ <label<%=attr("for", cbid .. "." .. iface:name())%>>
+ <% if link then -%><a href="<%=link%>"><% end -%>
+ <img<%=attr("title", iface:get_i18n())%> style="width:16px; height:16px; vertical-align:middle" src="<%=resource%>/icons/<%=iface:type()%><%=iface:is_up() and "" or "_disabled"%>.png" />
+ <% if link then -%></a><% end -%>
+ <%=pcdata(iface:get_i18n())%>
+ <% local ns = iface:get_networks(); if #ns > 0 then %>(
+ <%- local i, n; for i, n in ipairs(ns) do -%>
+ <%-= (i>1) and ', ' -%>
+ <a href="<%=n:adminlink()%>"><%=n:name()%></a>
+ <%- end -%>
+ )<% end %>
+ </label>
+ </li>
+ <% end end %>
+ <% if not self.nocreate then %>
+ <li>
+ <input class="cbi-input-<%=self.widget or "radio"%>" onclick="cbi_d_update(this.id)" onchange="cbi_d_update(this.id)"<%=
+ attr("type", self.widget or "radio") ..
+ attr("id", cbid .. "_custom") ..
+ attr("name", cbid) ..
+ attr("value", " ")
+ %> /> &#160;
+ <label<%=attr("for", cbid .. "_custom")%>>
+ <img title="<%:Custom Interface%>" style="width:16px; height:16px; vertical-align:middle" src="<%=resource%>/icons/ethernet_disabled.png" />
+ <%:Custom Interface%>:
+ </label>
+ <input type="text" style="width:50px" onfocus="document.getElementById('<%=cbid%>_custom').checked=true" onblur="var x=document.getElementById('<%=cbid%>_custom'); x.value=this.value; x.checked=true" />
+ </li>
+ <% end %>
+</ul>
+
+<%+cbi/valuefooter%>
diff --git a/modules/base/luasrc/luasrc/view/cbi/network_netinfo.htm b/modules/base/luasrc/luasrc/view/cbi/network_netinfo.htm
new file mode 100644
index 000000000..4fd84112a
--- /dev/null
+++ b/modules/base/luasrc/luasrc/view/cbi/network_netinfo.htm
@@ -0,0 +1,27 @@
+<%+cbi/valueheader%>
+
+<%-
+ local value = self:formvalue(section)
+ if not value or value == "-" then
+ value = self:cfgvalue(section) or self.default
+ end
+
+ local nwm = require "luci.model.network".init()
+ local net = nwm:get_network(value)
+-%>
+
+<% if net then %>
+<span class="ifacebadge"><%=net:name()%>:
+ <%
+ local empty = true
+ for _, iface in ipairs(net:get_interfaces() or { net:get_interface() }) do
+ if not iface:is_bridge() then
+ empty = false
+ %>
+ <img<%=attr("title", iface:get_i18n())%> style="width:16px; height:16px; vertical-align:middle" src="<%=resource%>/icons/<%=iface:type()%><%=iface:is_up() and "" or "_disabled"%>.png" />
+ <% end end %>
+ <% if empty then %><em><%:(no interfaces attached)%></em><% end %>
+</span>
+<% end %>
+
+<%+cbi/valuefooter%>
diff --git a/modules/base/luasrc/luasrc/view/cbi/network_netlist.htm b/modules/base/luasrc/luasrc/view/cbi/network_netlist.htm
new file mode 100644
index 000000000..7e23d149a
--- /dev/null
+++ b/modules/base/luasrc/luasrc/view/cbi/network_netlist.htm
@@ -0,0 +1,81 @@
+<%+cbi/valueheader%>
+
+<%-
+ local utl = require "luci.util"
+ local nwm = require "luci.model.network".init()
+
+ local net, iface
+ local networks = nwm:get_networks()
+ local value = self:formvalue(section)
+
+ self.cast = nil
+
+ if not value or value == "-" then
+ value = self:cfgvalue(section) or self.default
+ end
+
+ local checked = { }
+ for value in utl.imatch(value) do
+ checked[value] = true
+ end
+-%>
+
+<ul style="margin:0; list-style-type:none; text-align:left">
+ <% for _, net in ipairs(networks) do
+ if (net:name() ~= "loopback") and
+ (net:name() ~= self.exclude) and
+ (not self.novirtual or not net:is_virtual())
+ then %>
+ <li style="padding:0.25em 0">
+ <input class="cbi-input-<%=self.widget or "radio"%>" onclick="cbi_d_update(this.id)" onchange="cbi_d_update(this.id)"<%=
+ attr("type", self.widget or "radio") ..
+ attr("id", cbid .. "." .. net:name()) ..
+ attr("name", cbid) .. attr("value", net:name()) ..
+ ifattr(checked[net:name()], "checked", "checked")
+ %> /> &#160;
+ <label<%=attr("for", cbid .. "." .. net:name())%>>
+ <span class="ifacebadge"><%=net:name()%>:
+ <%
+ local empty = true
+ for _, iface in ipairs(net:is_bridge() and net:get_interfaces() or { net:get_interface() }) do
+ if not iface:is_bridge() then
+ empty = false
+ %>
+ <img<%=attr("title", iface:get_i18n())%> style="width:16px; height:16px; vertical-align:middle" src="<%=resource%>/icons/<%=iface:type()%><%=iface:is_up() and "" or "_disabled"%>.png" />
+ <% end end %>
+ <% if empty then %><em><%:(no interfaces attached)%></em><% end %>
+ </span>
+ </label>
+ </li>
+ <% end end %>
+
+ <% if not self.nocreate then %>
+ <li style="padding:0.25em 0">
+ <input class="cbi-input-<%=self.widget or "radio"%>" onclick="cbi_d_update(this.id)" onchange="cbi_d_update(this.id)"<%=attr("type", self.widget or "radio") .. attr("id", cbid .. "_new") .. attr("name", cbid) .. attr("value", "-") .. ifattr(not value and self.widget ~= "checkbox", "checked", "checked")%> /> &#160;
+ <div style="padding:0.5em; display:inline">
+ <label<%=attr("for", cbid .. "_new")%>><em>
+ <%- if self.widget == "checkbox" then -%>
+ <%:create:%>
+ <%- else -%>
+ <%:unspecified -or- create:%>
+ <%- end -%>&#160;</em></label>
+ <input style="width:6em" type="text"<%=attr("name", cbid .. ".newnet")%> onfocus="document.getElementById('<%=cbid%>_new').checked=true" />
+ </div>
+ </li>
+ <% elseif self.widget ~= "checkbox" and self.unspecified then %>
+ <li style="padding:0.25em 0">
+ <input class="cbi-input-<%=self.widget or "radio"%>" onclick="cbi_d_update(this.id)" onchange="cbi_d_update(this.id)"<%=
+ attr("type", self.widget or "radio") ..
+ attr("id", cbid .. "_uns") ..
+ attr("name", cbid) ..
+ attr("value", "") ..
+ ifattr(not value or #value == 0, "checked", "checked")
+ %> /> &#160;
+ <div style="padding:0.5em; display:inline">
+ <label<%=attr("for", cbid .. "_uns")%>><em><%:unspecified%></em></label>
+ </div>
+ </li>
+ <% end %>
+</ul>
+
+<%+cbi/valuefooter%>
diff --git a/modules/base/luasrc/luasrc/view/cbi/nsection.htm b/modules/base/luasrc/luasrc/view/cbi/nsection.htm
new file mode 100644
index 000000000..95e765882
--- /dev/null
+++ b/modules/base/luasrc/luasrc/view/cbi/nsection.htm
@@ -0,0 +1,31 @@
+<% if self:cfgvalue(self.section) then section = self.section %>
+ <fieldset class="cbi-section" id="cbi-<%=self.config%>-<%=section%>">
+ <% if self.title and #self.title > 0 then -%>
+ <legend><%=self.title%></legend>
+ <%- end %>
+ <% if self.description and #self.description > 0 then -%>
+ <div class="cbi-section-descr"><%=self.description%></div>
+ <%- end %>
+ <% if self.addremove then -%>
+ <div class="cbi-section-remove right">
+ <input type="submit" name="cbi.rns.<%=self.config%>.<%=section%>" value="<%:Delete%>" />
+ </div>
+ <%- end %>
+ <%+cbi/tabmenu%>
+ <div class="cbi-section-node<% if self.tabs then %> cbi-section-node-tabbed<% end %>" id="cbi-<%=self.config%>-<%=section%>">
+ <%+cbi/ucisection%>
+ </div>
+ <br />
+ </fieldset>
+<% elseif self.addremove then %>
+ <% if self.template_addremove then include(self.template_addremove) else -%>
+ <fieldset class="cbi-section" id="cbi-<%=self.config%>-<%=self.section%>">
+ <% if self.title and #self.title > 0 then -%>
+ <legend><%=self.title%></legend>
+ <%- end %>
+ <div class="cbi-section-descr"><%=self.description%></div>
+ <input type="submit" class="cbi-button-add" name="cbi.cns.<%=self.config%>.<%=self.section%>" value="<%:Add%>" />
+ </fieldset>
+ <%- end %>
+<% end %>
+<!-- /nsection -->
diff --git a/modules/base/luasrc/luasrc/view/cbi/nullsection.htm b/modules/base/luasrc/luasrc/view/cbi/nullsection.htm
new file mode 100644
index 000000000..bd4895095
--- /dev/null
+++ b/modules/base/luasrc/luasrc/view/cbi/nullsection.htm
@@ -0,0 +1,38 @@
+<fieldset class="cbi-section">
+ <% if self.title and #self.title > 0 then -%>
+ <legend><%=self.title%></legend>
+ <%- end %>
+ <% if self.description and #self.description > 0 then -%>
+ <div class="cbi-section-descr"><%=self.description%></div>
+ <%- end %>
+ <div class="cbi-section-node" id="cbi-<%=self.config%>-<%=tostring(self):sub(8)%>">
+ <div>
+ <% self:render_children(1, scope or {}) %>
+ </div>
+ <% if self.error and self.error[1] then -%>
+ <div class="cbi-section-error">
+ <ul><% for _, e in ipairs(self.error[1]) do -%>
+ <li>
+ <%- if e == "invalid" then -%>
+ <%:One or more fields contain invalid values!%>
+ <%- elseif e == "missing" then -%>
+ <%:One or more required fields have no value!%>
+ <%- else -%>
+ <%=pcdata(e)%>
+ <%- end -%>
+ </li>
+ <%- end %></ul>
+ </div>
+ <%- end %>
+ </div>
+ <br />
+</fieldset>
+<%-
+ if type(self.hidden) == "table" then
+ for k, v in pairs(self.hidden) do
+-%>
+ <input type="hidden" id="<%=k%>" name="<%=k%>" value="<%=pcdata(v)%>" />
+<%-
+ end
+ end
+%>
diff --git a/modules/base/luasrc/luasrc/view/cbi/simpleform.htm b/modules/base/luasrc/luasrc/view/cbi/simpleform.htm
new file mode 100644
index 000000000..5216cd50f
--- /dev/null
+++ b/modules/base/luasrc/luasrc/view/cbi/simpleform.htm
@@ -0,0 +1,57 @@
+<% if not self.embedded then %>
+<form method="post" enctype="multipart/form-data" action="<%=REQUEST_URI%>">
+ <div>
+ <script type="text/javascript" src="<%=resource%>/cbi.js"></script>
+ <input type="hidden" name="cbi.submit" value="1" />
+ </div>
+<% end %>
+ <div class="cbi-map" id="cbi-<%=self.config%>">
+ <% if self.title and #self.title > 0 then %><h2><a id="content" name="content"><%=self.title%></a></h2><% end %>
+ <% if self.description and #self.description > 0 then %><div class="cbi-map-descr"><%=self.description%></div><% end %>
+ <% self:render_children() %>
+ <br />
+ </div>
+<%- if self.message then %>
+ <div><%=self.message%></div>
+<%- end %>
+<%- if self.errmessage then %>
+ <div class="error"><%=self.errmessage%></div>
+<%- end %>
+<% if not self.embedded then %>
+ <div class="cbi-page-actions">
+<%-
+ if type(self.hidden) == "table" then
+ for k, v in pairs(self.hidden) do
+-%>
+ <input type="hidden" id="<%=k%>" name="<%=k%>" value="<%=pcdata(v)%>" />
+<%-
+ end
+ end
+%>
+<% if redirect then %>
+ <div style="float:left">
+ <input class="cbi-button cbi-button-link" type="button" value="<%:Back to Overview%>" onclick="location.href='<%=pcdata(redirect)%>'" />
+ </div>
+<% end %>
+<%- if self.flow and self.flow.skip then %>
+ <input class="cbi-button cbi-button-skip" type="submit" name="cbi.skip" value="<%:Skip%>" />
+<% end %>
+<%- if self.submit ~= false then %>
+ <input class="cbi-button cbi-button-save" type="submit" value="
+ <%- if not self.submit then -%><%-:Submit-%><%-else-%><%=self.submit%><%end-%>
+ " />
+<% end %>
+<%- if self.reset ~= false then %>
+ <input class="cbi-button cbi-button-reset" type="reset" value="
+ <%- if not self.reset then -%><%-:Reset-%><%-else-%><%=self.reset%><%end-%>
+ " />
+<% end %>
+<%- if self.cancel ~= false and self.on_cancel then %>
+ <input class="cbi-button cbi-button-reset" type="submit" name="cbi.cancel" value="
+ <%- if not self.cancel then -%><%-:Cancel-%><%-else-%><%=self.cancel%><%end-%>
+ " />
+<% end %>
+ <script type="text/javascript">cbi_d_update();</script>
+ </div>
+</form>
+<% end %>
diff --git a/modules/base/luasrc/luasrc/view/cbi/tabcontainer.htm b/modules/base/luasrc/luasrc/view/cbi/tabcontainer.htm
new file mode 100644
index 000000000..38c435d6a
--- /dev/null
+++ b/modules/base/luasrc/luasrc/view/cbi/tabcontainer.htm
@@ -0,0 +1,7 @@
+<% for tab, data in pairs(self.tabs) do %>
+ <div class="cbi-tabcontainer" id="container.<%=self.config%>.<%=section%>.<%=tab%>"<% if tab ~= self.selected_tab then %> style="display:none"<% end %>>
+ <% if data.description then %><div class="cbi-tab-descr"><%=data.description%></div><% end %>
+ <% self:render_tab(tab, section, scope or {}) %>
+ </div>
+ <script type="text/javascript">cbi_t_add('<%=self.config%>.<%=section%>', '<%=tab%>')</script>
+<% end %>
diff --git a/modules/base/luasrc/luasrc/view/cbi/tabmenu.htm b/modules/base/luasrc/luasrc/view/cbi/tabmenu.htm
new file mode 100644
index 000000000..b96ac9ce4
--- /dev/null
+++ b/modules/base/luasrc/luasrc/view/cbi/tabmenu.htm
@@ -0,0 +1,13 @@
+<%- if self.tabs then %>
+ <ul class="cbi-tabmenu">
+ <%- self.selected_tab = luci.http.formvalue("tab." .. self.config .. "." .. section) %>
+ <%- for _, tab in ipairs(self.tab_names) do if #self.tabs[tab].childs > 0 then %>
+ <script type="text/javascript">cbi_c['container.<%=self.config%>.<%=section%>.<%=tab%>'] = <%=#self.tabs[tab].childs%>;</script>
+ <%- if not self.selected_tab then self.selected_tab = tab end %>
+ <li id="tab.<%=self.config%>.<%=section%>.<%=tab%>" class="cbi-tab<%=(tab == self.selected_tab) and '' or '-disabled'%>">
+ <a onclick="this.blur(); return cbi_t_switch('<%=self.config%>.<%=section%>', '<%=tab%>')" href="<%=REQUEST_URI%>?tab.<%=self.config%>.<%=section%>=<%=tab%>"><%=self.tabs[tab].title%></a>
+ <% if tab == self.selected_tab then %><input type="hidden" id="tab.<%=self.config%>.<%=section%>" name="tab.<%=self.config%>.<%=section%>" value="<%=tab%>" /><% end %>
+ </li>
+ <% end end -%>
+ </ul>
+<% end -%>
diff --git a/modules/base/luasrc/luasrc/view/cbi/tblsection.htm b/modules/base/luasrc/luasrc/view/cbi/tblsection.htm
new file mode 100644
index 000000000..d92879116
--- /dev/null
+++ b/modules/base/luasrc/luasrc/view/cbi/tblsection.htm
@@ -0,0 +1,146 @@
+<%-
+local rowcnt = 1
+function rowstyle()
+ rowcnt = rowcnt + 1
+ return (rowcnt % 2) + 1
+end
+
+function width(o)
+ if o.width then
+ if type(o.width) == 'number' then
+ return ' style="width:%dpx"' % o.width
+ end
+ return ' style="width:%s"' % o.width
+ end
+ return ''
+end
+-%>
+
+<!-- tblsection -->
+<fieldset class="cbi-section" id="cbi-<%=self.config%>-<%=self.sectiontype%>">
+ <% if self.title and #self.title > 0 then -%>
+ <legend><%=self.title%></legend>
+ <%- end %>
+ <%- if self.sortable then -%>
+ <input type="hidden" id="cbi.sts.<%=self.config%>.<%=self.sectiontype%>" name="cbi.sts.<%=self.config%>.<%=self.sectiontype%>" value="" />
+ <%- end -%>
+ <div class="cbi-section-descr"><%=self.description%></div>
+ <div class="cbi-section-node">
+ <%- local count = 0 -%>
+ <table class="cbi-section-table">
+ <tr class="cbi-section-table-titles">
+ <%- if not self.anonymous then -%>
+ <%- if self.sectionhead then -%>
+ <th class="cbi-section-table-cell"><%=self.sectionhead%></th>
+ <%- else -%>
+ <th>&#160;</th>
+ <%- end -%>
+ <%- end -%>
+ <%- for i, k in pairs(self.children) do if not k.optional then -%>
+ <th class="cbi-section-table-cell"<%=width(k)%>>
+ <%- if k.titleref then -%><a title="<%=self.titledesc or translate('Go to relevant configuration page')%>" class="cbi-title-ref" href="<%=k.titleref%>"><%- end -%>
+ <%-=k.title-%>
+ <%- if k.titleref then -%></a><%- end -%>
+ </th>
+ <%- count = count + 1; end; end; if self.sortable then -%>
+ <th class="cbi-section-table-cell"><%:Sort%></th>
+ <%- end; if self.extedit or self.addremove then -%>
+ <th class="cbi-section-table-cell">&#160;</th>
+ <%- count = count + 1; end -%>
+ </tr>
+ <tr class="cbi-section-table-descr">
+ <%- if not self.anonymous then -%>
+ <%- if self.sectiondesc then -%>
+ <th class="cbi-section-table-cell"><%=self.sectiondesc%></th>
+ <%- else -%>
+ <th></th>
+ <%- end -%>
+ <%- end -%>
+ <%- for i, k in pairs(self.children) do if not k.optional then -%>
+ <th class="cbi-section-table-cell"<%=width(k)%>><%=k.description%></th>
+ <%- end; end; if self.sortable then -%>
+ <th class="cbi-section-table-cell"></th>
+ <%- end; if self.extedit or self.addremove then -%>
+ <th class="cbi-section-table-cell"></th>
+ <%- end -%>
+ </tr>
+ <%- local isempty = true
+ for i, k in ipairs(self:cfgsections()) do
+ section = k
+ isempty = false
+ scope = { valueheader = "cbi/cell_valueheader", valuefooter = "cbi/cell_valuefooter" }
+ -%>
+ <tr class="cbi-section-table-row<% if self.extedit or self.rowcolors then %> cbi-rowstyle-<%=rowstyle()%><% end %>" id="cbi-<%=self.config%>-<%=section%>">
+ <% if not self.anonymous then -%>
+ <th><h3><%=(type(self.sectiontitle) == "function") and self:sectiontitle(section) or k%></h3></th>
+ <%- end %>
+
+
+ <%-
+ for k, node in ipairs(self.children) do
+ if not node.optional then
+ node:render(section, scope or {})
+ end
+ end
+ -%>
+
+ <%- if self.sortable then -%>
+ <td class="cbi-section-table-cell">
+ <input class="cbi-button cbi-button-up" type="button" value="" onclick="return cbi_row_swap(this, true, 'cbi.sts.<%=self.config%>.<%=self.sectiontype%>')" alt="<%:Move up%>" title="<%:Move up%>" />
+ <input class="cbi-button cbi-button-down" type="button" value="" onclick="return cbi_row_swap(this, false, 'cbi.sts.<%=self.config%>.<%=self.sectiontype%>')" alt="<%:Move down%>" title="<%:Move down%>" />
+ </td>
+ <%- end -%>
+
+ <%- if self.extedit or self.addremove then -%>
+ <td class="cbi-section-table-cell">
+ <%- if self.extedit then -%>
+ <input class="cbi-button cbi-button-edit" type="button" value="<%:Edit%>"
+ <%- if type(self.extedit) == "string" then
+ %> onclick="location.href='<%=self.extedit:format(section)%>'"
+ <%- elseif type(self.extedit) == "function" then
+ %> onclick="location.href='<%=self:extedit(section)%>'"
+ <%- end
+ %> alt="<%:Edit%>" title="<%:Edit%>" />
+ <%- end; if self.addremove then %>
+ <input class="cbi-button cbi-button-remove" type="submit" value="<%:Delete%>" onclick="this.form.cbi_state='del-section'; return true" name="cbi.rts.<%=self.config%>.<%=k%>" alt="<%:Delete%>" title="<%:Delete%>" />
+ <%- end -%>
+ </td>
+ <%- end -%>
+ </tr>
+ <%- end -%>
+
+ <%- if isempty then -%>
+ <tr class="cbi-section-table-row">
+ <td colspan="<%=count%>"><em><br /><%:This section contains no values yet%></em></td>
+ </tr>
+ <%- end -%>
+ </table>
+
+ <% if self.error then %>
+ <div class="cbi-section-error">
+ <ul><% for _, c in pairs(self.error) do for _, e in ipairs(c) do -%>
+ <li><%=pcdata(e):gsub("\n","<br />")%></li>
+ <%- end end %></ul>
+ </div>
+ <% end %>
+
+ <%- if self.addremove then -%>
+ <% if self.template_addremove then include(self.template_addremove) else -%>
+ <div class="cbi-section-create cbi-tblsection-create">
+ <% if self.anonymous then %>
+ <input class="cbi-button cbi-button-add" type="submit" value="<%:Add%>" name="cbi.cts.<%=self.config%>.<%=self.sectiontype%>.<%=section%>" title="<%:Add%>" />
+ <% else %>
+ <% if self.invalid_cts then -%><div class="cbi-section-error"><% end %>
+ <input type="text" class="cbi-section-create-name" id="cbi.cts.<%=self.config%>.<%=self.sectiontype%>.<%=section%>" name="cbi.cts.<%=self.config%>.<%=self.sectiontype%>.<%=section%>" />
+ <script type="text/javascript">cbi_validate_field('cbi.cts.<%=self.config%>.<%=self.sectiontype%>.<%=section%>', true, 'uciname');</script>
+ <input class="cbi-button cbi-button-add" type="submit" onclick="this.form.cbi_state='add-section'; return true" value="<%:Add%>" title="<%:Add%>" />
+ <% if self.invalid_cts then -%>
+ <br /><%:Invalid%></div>
+ <%- end %>
+ <% end %>
+ </div>
+ <%- end %>
+ <%- end -%>
+ </div>
+</fieldset>
+<!-- /tblsection -->
diff --git a/modules/base/luasrc/luasrc/view/cbi/tsection.htm b/modules/base/luasrc/luasrc/view/cbi/tsection.htm
new file mode 100644
index 000000000..087548bf2
--- /dev/null
+++ b/modules/base/luasrc/luasrc/view/cbi/tsection.htm
@@ -0,0 +1,48 @@
+<fieldset class="cbi-section" id="cbi-<%=self.config%>-<%=self.sectiontype%>">
+ <% if self.title and #self.title > 0 then -%>
+ <legend><%=self.title%></legend>
+ <%- end %>
+ <div class="cbi-section-descr"><%=self.description%></div>
+ <% local isempty = true for i, k in ipairs(self:cfgsections()) do -%>
+ <% if self.addremove then -%>
+ <div class="cbi-section-remove right">
+ <input type="submit" name="cbi.rts.<%=self.config%>.<%=k%>" onclick="this.form.cbi_state='del-section'; return true" value="<%:Delete%>" class="cbi-button" />
+ </div>
+ <%- end %>
+
+ <%- section = k; isempty = false -%>
+
+ <% if not self.anonymous then -%>
+ <h3><%=section:upper()%></h3>
+ <%- end %>
+
+ <%+cbi/tabmenu%>
+
+ <fieldset class="cbi-section-node<% if self.tabs then %> cbi-section-node-tabbed<% end %>" id="cbi-<%=self.config%>-<%=section%>">
+ <%+cbi/ucisection%>
+ </fieldset>
+ <br />
+ <%- end %>
+
+ <% if isempty then -%>
+ <em><%:This section contains no values yet%><br /><br /></em>
+ <%- end %>
+
+ <% if self.addremove then -%>
+ <% if self.template_addremove then include(self.template_addremove) else -%>
+ <div class="cbi-section-create">
+ <% if self.anonymous then -%>
+ <input type="submit" class="cbi-button cbi-button-add" name="cbi.cts.<%=self.config%>.<%=self.sectiontype%>.<%=section%>" value="<%:Add%>" />
+ <%- else -%>
+ <% if self.invalid_cts then -%><div class="cbi-section-error"><% end %>
+ <input type="text" class="cbi-section-create-name" id="cbi.cts.<%=self.config%>.<%=self.sectiontype%>.<%=section%>" name="cbi.cts.<%=self.config%>.<%=self.sectiontype%>.<%=section%>" />
+ <script type="text/javascript">cbi_validate_field('cbi.cts.<%=self.config%>.<%=self.sectiontype%>.<%=section%>', true, 'uciname');</script>
+ <input type="submit" class="cbi-button cbi-button-add" onclick="this.form.cbi_state='add-section'; return true" value="<%:Add%>" />
+ <% if self.invalid_cts then -%>
+ <br /><%:Invalid%></div>
+ <%- end %>
+ <%- end %>
+ </div>
+ <%- end %>
+ <%- end %>
+</fieldset>
diff --git a/modules/base/luasrc/luasrc/view/cbi/tvalue.htm b/modules/base/luasrc/luasrc/view/cbi/tvalue.htm
new file mode 100644
index 000000000..fcf7a6c94
--- /dev/null
+++ b/modules/base/luasrc/luasrc/view/cbi/tvalue.htm
@@ -0,0 +1,5 @@
+<%+cbi/valueheader%>
+ <textarea class="cbi-input-textarea" <% if not self.size then %> style="width: 100%"<% else %> cols="<%=self.size%>"<% end %> onchange="cbi_d_update(this.id)"<%= attr("name", cbid) .. attr("id", cbid) .. ifattr(self.rows, "rows") .. ifattr(self.wrap, "wrap") %>>
+ <%-=pcdata(self:cfgvalue(section))-%>
+ </textarea>
+<%+cbi/valuefooter%>
diff --git a/modules/base/luasrc/luasrc/view/cbi/ucisection.htm b/modules/base/luasrc/luasrc/view/cbi/ucisection.htm
new file mode 100644
index 000000000..3b69f12f2
--- /dev/null
+++ b/modules/base/luasrc/luasrc/view/cbi/ucisection.htm
@@ -0,0 +1,75 @@
+<%-
+ if type(self.hidden) == "table" then
+ for k, v in pairs(self.hidden) do
+-%>
+ <input type="hidden" id="<%=k%>" name="<%=k%>" value="<%=pcdata(v)%>" />
+<%-
+ end
+ end
+%>
+
+<% if self.tabs then %>
+ <%+cbi/tabcontainer%>
+<% else %>
+ <% self:render_children(section, scope or {}) %>
+<% end %>
+
+<% if self.error and self.error[section] then -%>
+ <div class="cbi-section-error">
+ <ul><% for _, e in ipairs(self.error[section]) do -%>
+ <li>
+ <%- if e == "invalid" then -%>
+ <%:One or more fields contain invalid values!%>
+ <%- elseif e == "missing" then -%>
+ <%:One or more required fields have no value!%>
+ <%- else -%>
+ <%=pcdata(e)%>
+ <%- end -%>
+ </li>
+ <%- end %></ul>
+ </div>
+<%- end %>
+
+<% if self.optionals[section] and #self.optionals[section] > 0 or self.dynamic then %>
+ <div class="cbi-optionals">
+ <% if self.dynamic then %>
+ <input type="text" id="cbi.opt.<%=self.config%>.<%=section%>" name="cbi.opt.<%=self.config%>.<%=section%>" />
+ <% if self.optionals[section] and #self.optionals[section] > 0 then %>
+ <script type="text/javascript">
+ cbi_combobox_init('cbi.opt.<%=self.config%>.<%=section%>', {
+ <%-
+ for i, val in pairs(self.optionals[section]) do
+ -%>
+ <%-=string.format("%q", val.option) .. ":" .. string.format("%q", striptags(val.title))-%>
+ <%-if next(self.optionals[section], i) then-%>,<%-end-%>
+ <%-
+ end
+ -%>
+ }, '', '<%-: -- custom -- -%>');
+ </script>
+ <% end %>
+ <% else %>
+ <select id="cbi.opt.<%=self.config%>.<%=section%>" name="cbi.opt.<%=self.config%>.<%=section%>">
+ <option><%: -- Additional Field -- %></option>
+ <% for key, val in pairs(self.optionals[section]) do -%>
+ <option id="cbi-<%=self.config.."-"..section.."-"..val.option%>" value="<%=val.option%>"><%=striptags(val.title)%></option>
+ <%- end %>
+ </select>
+ <script type="text/javascript"><% for key, val in pairs(self.optionals[section]) do %>
+ <% if #val.deps > 0 then %><% for j, d in ipairs(val.deps) do -%>
+ cbi_d_add("cbi-<%=self.config.."-"..section.."-"..val.option..d.add%>", {
+ <%-
+ for k,v in pairs(d.deps) do
+ -%>
+ <%-=string.format('"cbid.%s.%s.%s"', self.config, section, k) .. ":" .. string.format("%q", v)-%>
+ <%-if next(d.deps, k) then-%>,<%-end-%>
+ <%-
+ end
+ -%>
+ });
+ <%- end %><% end %>
+ <% end %></script>
+ <% end %>
+ <input type="submit" class="cbi-button cbi-button-fieldadd" value="<%:Add%>" />
+ </div>
+<% end %>
diff --git a/modules/base/luasrc/luasrc/view/cbi/upload.htm b/modules/base/luasrc/luasrc/view/cbi/upload.htm
new file mode 100644
index 000000000..777093411
--- /dev/null
+++ b/modules/base/luasrc/luasrc/view/cbi/upload.htm
@@ -0,0 +1,14 @@
+<%
+ local t = require("luci.tools.webadmin")
+ local v = self:cfgvalue(section)
+ local s = v and nixio.fs.stat(v)
+-%>
+<%+cbi/valueheader%>
+ <% if s then %>
+ <%:Uploaded File%> (<%=t.byte_format(s.size)%>)
+ <input type="hidden"<%= attr("value", v) .. attr("name", cbid) .. attr("id", cbid) %> />
+ <input class="cbi-button cbi-input-image" type="image" value="<%:Replace entry%>" name="cbi.rlf.<%=section .. "." .. self.option%>" alt="<%:Replace entry%>" title="<%:Replace entry%>" src="<%=resource%>/cbi/reload.gif" />
+ <% else %>
+ <input class="cbi-input-file" type="file"<%= attr("name", cbid) .. attr("id", cbid) %> />
+ <% end %>
+<%+cbi/valuefooter%>
diff --git a/modules/base/luasrc/luasrc/view/cbi/value.htm b/modules/base/luasrc/luasrc/view/cbi/value.htm
new file mode 100644
index 000000000..d1a7bea5c
--- /dev/null
+++ b/modules/base/luasrc/luasrc/view/cbi/value.htm
@@ -0,0 +1,35 @@
+<%+cbi/valueheader%>
+ <input type="<%=self.password and 'password" class="cbi-input-password' or 'text" class="cbi-input-text' %>" onchange="cbi_d_update(this.id)"<%=
+ attr("name", cbid) .. attr("id", cbid) .. attr("value", self:cfgvalue(section) or self.default) ..
+ ifattr(self.size, "size") .. ifattr(self.placeholder, "placeholder")
+ %> />
+ <% if self.password then %><img src="<%=resource%>/cbi/reload.gif" style="vertical-align:middle" title="<%:Reveal/hide password%>" onclick="var e = document.getElementById('<%=cbid%>'); e.type = (e.type=='password') ? 'text' : 'password';" /><% end %>
+ <% if #self.keylist > 0 or self.datatype then -%>
+ <script type="text/javascript">//<![CDATA[
+ <% if #self.keylist > 0 then -%>
+ cbi_combobox_init('<%=cbid%>', {
+ <%-
+ for i, k in ipairs(self.keylist) do
+ -%>
+ <%-=string.format("%q", k) .. ":" .. string.format("%q", self.vallist[i])-%>
+ <%-if i<#self.keylist then-%>,<%-end-%>
+ <%-
+ end
+ -%>
+ }, '<%- if not self.rmempty and not self.optional then -%>
+ <%-: -- Please choose -- -%>
+ <%- elseif self.placeholder then -%>
+ <%-= pcdata(self.placeholder) -%>
+ <%- end -%>', '
+ <%- if self.combobox_manual then -%>
+ <%-=self.combobox_manual-%>
+ <%- else -%>
+ <%-: -- custom -- -%>
+ <%- end -%>');
+ <%- end %>
+ <% if self.datatype then -%>
+ cbi_validate_field('<%=cbid%>', <%=tostring((self.optional or self.rmempty) == true)%>, '<%=self.datatype:gsub("'", "\\'")%>');
+ <%- end %>
+ //]]></script>
+ <% end -%>
+<%+cbi/valuefooter%>
diff --git a/modules/base/luasrc/luasrc/view/cbi/valuefooter.htm b/modules/base/luasrc/luasrc/view/cbi/valuefooter.htm
new file mode 100644
index 000000000..805312e45
--- /dev/null
+++ b/modules/base/luasrc/luasrc/view/cbi/valuefooter.htm
@@ -0,0 +1 @@
+<% include( valuefooter or "cbi/full_valuefooter" ) %>
diff --git a/modules/base/luasrc/luasrc/view/cbi/valueheader.htm b/modules/base/luasrc/luasrc/view/cbi/valueheader.htm
new file mode 100644
index 000000000..761a54aed
--- /dev/null
+++ b/modules/base/luasrc/luasrc/view/cbi/valueheader.htm
@@ -0,0 +1 @@
+<% include( valueheader or "cbi/full_valueheader" ) %>
diff --git a/modules/base/luasrc/model/cbi/admin_network/proto_dhcp.lua b/modules/base/luasrc/model/cbi/admin_network/proto_dhcp.lua
new file mode 100644
index 000000000..fe3fec6fa
--- /dev/null
+++ b/modules/base/luasrc/model/cbi/admin_network/proto_dhcp.lua
@@ -0,0 +1,76 @@
+--[[
+LuCI - Lua Configuration Interface
+
+Copyright 2011-2012 Jo-Philipp Wich <xm@subsignal.org>
+
+Licensed under the Apache License, Version 2.0 (the "License");
+you may not use this file except in compliance with the License.
+You may obtain a copy of the License at
+
+ http://www.apache.org/licenses/LICENSE-2.0
+]]--
+
+local map, section, net = ...
+local ifc = net:get_interface()
+
+local hostname, accept_ra, send_rs
+local bcast, defaultroute, peerdns, dns, metric, clientid, vendorclass
+
+
+hostname = section:taboption("general", Value, "hostname",
+ translate("Hostname to send when requesting DHCP"))
+
+hostname.placeholder = luci.sys.hostname()
+hostname.datatype = "hostname"
+
+
+bcast = section:taboption("advanced", Flag, "broadcast",
+ translate("Use broadcast flag"),
+ translate("Required for certain ISPs, e.g. Charter with DOCSIS 3"))
+
+bcast.default = bcast.disabled
+
+
+defaultroute = section:taboption("advanced", Flag, "defaultroute",
+ translate("Use default gateway"),
+ translate("If unchecked, no default route is configured"))
+
+defaultroute.default = defaultroute.enabled
+
+
+peerdns = section:taboption("advanced", Flag, "peerdns",
+ translate("Use DNS servers advertised by peer"),
+ translate("If unchecked, the advertised DNS server addresses are ignored"))
+
+peerdns.default = peerdns.enabled
+
+
+dns = section:taboption("advanced", DynamicList, "dns",
+ translate("Use custom DNS servers"))
+
+dns:depends("peerdns", "")
+dns.datatype = "ipaddr"
+dns.cast = "string"
+
+
+metric = section:taboption("advanced", Value, "metric",
+ translate("Use gateway metric"))
+
+metric.placeholder = "0"
+metric.datatype = "uinteger"
+
+
+clientid = section:taboption("advanced", Value, "clientid",
+ translate("Client ID to send when requesting DHCP"))
+
+
+vendorclass = section:taboption("advanced", Value, "vendorid",
+ translate("Vendor Class to send when requesting DHCP"))
+
+
+luci.tools.proto.opt_macaddr(section, ifc, translate("Override MAC address"))
+
+
+mtu = section:taboption("advanced", Value, "mtu", translate("Override MTU"))
+mtu.placeholder = "1500"
+mtu.datatype = "max(9200)"
diff --git a/modules/base/luasrc/model/cbi/admin_network/proto_none.lua b/modules/base/luasrc/model/cbi/admin_network/proto_none.lua
new file mode 100644
index 000000000..0e34b67de
--- /dev/null
+++ b/modules/base/luasrc/model/cbi/admin_network/proto_none.lua
@@ -0,0 +1,13 @@
+--[[
+LuCI - Lua Configuration Interface
+
+Copyright 2011 Jo-Philipp Wich <xm@subsignal.org>
+
+Licensed under the Apache License, Version 2.0 (the "License");
+you may not use this file except in compliance with the License.
+You may obtain a copy of the License at
+
+ http://www.apache.org/licenses/LICENSE-2.0
+]]--
+
+local map, section, net = ...
diff --git a/modules/base/luasrc/model/cbi/admin_network/proto_static.lua b/modules/base/luasrc/model/cbi/admin_network/proto_static.lua
new file mode 100644
index 000000000..338c0b7d8
--- /dev/null
+++ b/modules/base/luasrc/model/cbi/admin_network/proto_static.lua
@@ -0,0 +1,90 @@
+--[[
+LuCI - Lua Configuration Interface
+
+Copyright 2011 Jo-Philipp Wich <xm@subsignal.org>
+
+Licensed under the Apache License, Version 2.0 (the "License");
+you may not use this file except in compliance with the License.
+You may obtain a copy of the License at
+
+ http://www.apache.org/licenses/LICENSE-2.0
+]]--
+
+local map, section, net = ...
+local ifc = net:get_interface()
+
+local ipaddr, netmask, gateway, broadcast, dns, accept_ra, send_rs, ip6addr, ip6gw
+local mtu, metric
+
+
+ipaddr = section:taboption("general", Value, "ipaddr", translate("IPv4 address"))
+ipaddr.datatype = "ip4addr"
+
+
+netmask = section:taboption("general", Value, "netmask",
+ translate("IPv4 netmask"))
+
+netmask.datatype = "ip4addr"
+netmask:value("255.255.255.0")
+netmask:value("255.255.0.0")
+netmask:value("255.0.0.0")
+
+
+gateway = section:taboption("general", Value, "gateway", translate("IPv4 gateway"))
+gateway.datatype = "ip4addr"
+
+
+broadcast = section:taboption("general", Value, "broadcast", translate("IPv4 broadcast"))
+broadcast.datatype = "ip4addr"
+
+
+dns = section:taboption("general", DynamicList, "dns",
+ translate("Use custom DNS servers"))
+
+dns.datatype = "ipaddr"
+dns.cast = "string"
+
+
+if luci.model.network:has_ipv6() then
+
+ local ip6assign = section:taboption("general", Value, "ip6assign", translate("IPv6 assignment length"),
+ translate("Assign a part of given length of every public IPv6-prefix to this interface"))
+ ip6assign:value("", translate("disabled"))
+ ip6assign:value("64")
+ ip6assign.datatype = "max(64)"
+
+ local ip6hint = section:taboption("general", Value, "ip6hint", translate("IPv6 assignment hint"),
+ translate("Assign prefix parts using this hexadecimal subprefix ID for this interface."))
+ for i=33,64 do ip6hint:depends("ip6assign", i) end
+
+ ip6addr = section:taboption("general", Value, "ip6addr", translate("IPv6 address"))
+ ip6addr.datatype = "ip6addr"
+ ip6addr:depends("ip6assign", "")
+
+
+ ip6gw = section:taboption("general", Value, "ip6gw", translate("IPv6 gateway"))
+ ip6gw.datatype = "ip6addr"
+ ip6gw:depends("ip6assign", "")
+
+
+ local ip6prefix = s:taboption("general", Value, "ip6prefix", translate("IPv6 routed prefix"),
+ translate("Public prefix routed to this device for distribution to clients."))
+ ip6prefix.datatype = "ip6addr"
+ ip6prefix:depends("ip6assign", "")
+
+end
+
+
+luci.tools.proto.opt_macaddr(section, ifc, translate("Override MAC address"))
+
+
+mtu = section:taboption("advanced", Value, "mtu", translate("Override MTU"))
+mtu.placeholder = "1500"
+mtu.datatype = "max(9200)"
+
+
+metric = section:taboption("advanced", Value, "metric",
+ translate("Use gateway metric"))
+
+metric.placeholder = "0"
+metric.datatype = "uinteger"
diff --git a/modules/base/luasrc/model/firewall.lua b/modules/base/luasrc/model/firewall.lua
new file mode 100644
index 000000000..a9f6fdb7f
--- /dev/null
+++ b/modules/base/luasrc/model/firewall.lua
@@ -0,0 +1,582 @@
+--[[
+LuCI - Firewall model
+
+Copyright 2009 Jo-Philipp Wich <xm@subsignal.org>
+
+Licensed under the Apache License, Version 2.0 (the "License");
+you may not use this file except in compliance with the License.
+You may obtain a copy of the License at
+
+ http://www.apache.org/licenses/LICENSE-2.0
+
+Unless required by applicable law or agreed to in writing, software
+distributed under the License is distributed on an "AS IS" BASIS,
+WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+See the License for the specific language governing permissions and
+limitations under the License.
+
+]]--
+
+local type, pairs, ipairs, table, luci, math
+ = type, pairs, ipairs, table, luci, math
+
+local tpl = require "luci.template.parser"
+local utl = require "luci.util"
+local uci = require "luci.model.uci"
+
+module "luci.model.firewall"
+
+
+local uci_r, uci_s
+
+function _valid_id(x)
+ return (x and #x > 0 and x:match("^[a-zA-Z0-9_]+$"))
+end
+
+function _get(c, s, o)
+ return uci_r:get(c, s, o)
+end
+
+function _set(c, s, o, v)
+ if v ~= nil then
+ if type(v) == "boolean" then v = v and "1" or "0" end
+ return uci_r:set(c, s, o, v)
+ else
+ return uci_r:delete(c, s, o)
+ end
+end
+
+
+function init(cursor)
+ uci_r = cursor or uci_r or uci.cursor()
+ uci_s = uci_r:substate()
+
+ return _M
+end
+
+function save(self, ...)
+ uci_r:save(...)
+ uci_r:load(...)
+end
+
+function commit(self, ...)
+ uci_r:commit(...)
+ uci_r:load(...)
+end
+
+function get_defaults()
+ return defaults()
+end
+
+function new_zone(self)
+ local name = "newzone"
+ local count = 1
+
+ while self:get_zone(name) do
+ count = count + 1
+ name = "newzone%d" % count
+ end
+
+ return self:add_zone(name)
+end
+
+function add_zone(self, n)
+ if _valid_id(n) and not self:get_zone(n) then
+ local d = defaults()
+ local z = uci_r:section("firewall", "zone", nil, {
+ name = n,
+ network = " ",
+ input = d:input() or "DROP",
+ forward = d:forward() or "DROP",
+ output = d:output() or "DROP"
+ })
+
+ return z and zone(z)
+ end
+end
+
+function get_zone(self, n)
+ if uci_r:get("firewall", n) == "zone" then
+ return zone(n)
+ else
+ local z
+ uci_r:foreach("firewall", "zone",
+ function(s)
+ if n and s.name == n then
+ z = s['.name']
+ return false
+ end
+ end)
+ return z and zone(z)
+ end
+end
+
+function get_zones(self)
+ local zones = { }
+ local znl = { }
+
+ uci_r:foreach("firewall", "zone",
+ function(s)
+ if s.name then
+ znl[s.name] = zone(s['.name'])
+ end
+ end)
+
+ local z
+ for z in utl.kspairs(znl) do
+ zones[#zones+1] = znl[z]
+ end
+
+ return zones
+end
+
+function get_zone_by_network(self, net)
+ local z
+
+ uci_r:foreach("firewall", "zone",
+ function(s)
+ if s.name and net then
+ local n
+ for n in utl.imatch(s.network or s.name) do
+ if n == net then
+ z = s['.name']
+ return false
+ end
+ end
+ end
+ end)
+
+ return z and zone(z)
+end
+
+function del_zone(self, n)
+ local r = false
+
+ if uci_r:get("firewall", n) == "zone" then
+ local z = uci_r:get("firewall", n, "name")
+ r = uci_r:delete("firewall", n)
+ n = z
+ else
+ uci_r:foreach("firewall", "zone",
+ function(s)
+ if n and s.name == n then
+ r = uci_r:delete("firewall", s['.name'])
+ return false
+ end
+ end)
+ end
+
+ if r then
+ uci_r:foreach("firewall", "rule",
+ function(s)
+ if s.src == n or s.dest == n then
+ uci_r:delete("firewall", s['.name'])
+ end
+ end)
+
+ uci_r:foreach("firewall", "redirect",
+ function(s)
+ if s.src == n or s.dest == n then
+ uci_r:delete("firewall", s['.name'])
+ end
+ end)
+
+ uci_r:foreach("firewall", "forwarding",
+ function(s)
+ if s.src == n or s.dest == n then
+ uci_r:delete("firewall", s['.name'])
+ end
+ end)
+ end
+
+ return r
+end
+
+function rename_zone(self, old, new)
+ local r = false
+
+ if _valid_id(new) and not self:get_zone(new) then
+ uci_r:foreach("firewall", "zone",
+ function(s)
+ if old and s.name == old then
+ if not s.network then
+ uci_r:set("firewall", s['.name'], "network", old)
+ end
+ uci_r:set("firewall", s['.name'], "name", new)
+ r = true
+ return false
+ end
+ end)
+
+ if r then
+ uci_r:foreach("firewall", "rule",
+ function(s)
+ if s.src == old then
+ uci_r:set("firewall", s['.name'], "src", new)
+ end
+ if s.dest == old then
+ uci_r:set("firewall", s['.name'], "dest", new)
+ end
+ end)
+
+ uci_r:foreach("firewall", "redirect",
+ function(s)
+ if s.src == old then
+ uci_r:set("firewall", s['.name'], "src", new)
+ end
+ if s.dest == old then
+ uci_r:set("firewall", s['.name'], "dest", new)
+ end
+ end)
+
+ uci_r:foreach("firewall", "forwarding",
+ function(s)
+ if s.src == old then
+ uci_r:set("firewall", s['.name'], "src", new)
+ end
+ if s.dest == old then
+ uci_r:set("firewall", s['.name'], "dest", new)
+ end
+ end)
+ end
+ end
+
+ return r
+end
+
+function del_network(self, net)
+ local z
+ if net then
+ for _, z in ipairs(self:get_zones()) do
+ z:del_network(net)
+ end
+ end
+end
+
+
+defaults = utl.class()
+function defaults.__init__(self)
+ uci_r:foreach("firewall", "defaults",
+ function(s)
+ self.sid = s['.name']
+ return false
+ end)
+
+ self.sid = self.sid or uci_r:section("firewall", "defaults", nil, { })
+end
+
+function defaults.get(self, opt)
+ return _get("firewall", self.sid, opt)
+end
+
+function defaults.set(self, opt, val)
+ return _set("firewall", self.sid, opt, val)
+end
+
+function defaults.syn_flood(self)
+ return (self:get("syn_flood") == "1")
+end
+
+function defaults.drop_invalid(self)
+ return (self:get("drop_invalid") == "1")
+end
+
+function defaults.input(self)
+ return self:get("input") or "DROP"
+end
+
+function defaults.forward(self)
+ return self:get("forward") or "DROP"
+end
+
+function defaults.output(self)
+ return self:get("output") or "DROP"
+end
+
+
+zone = utl.class()
+function zone.__init__(self, z)
+ if uci_r:get("firewall", z) == "zone" then
+ self.sid = z
+ self.data = uci_r:get_all("firewall", z)
+ else
+ uci_r:foreach("firewall", "zone",
+ function(s)
+ if s.name == z then
+ self.sid = s['.name']
+ self.data = s
+ return false
+ end
+ end)
+ end
+end
+
+function zone.get(self, opt)
+ return _get("firewall", self.sid, opt)
+end
+
+function zone.set(self, opt, val)
+ return _set("firewall", self.sid, opt, val)
+end
+
+function zone.masq(self)
+ return (self:get("masq") == "1")
+end
+
+function zone.name(self)
+ return self:get("name")
+end
+
+function zone.network(self)
+ return self:get("network")
+end
+
+function zone.input(self)
+ return self:get("input") or defaults():input() or "DROP"
+end
+
+function zone.forward(self)
+ return self:get("forward") or defaults():forward() or "DROP"
+end
+
+function zone.output(self)
+ return self:get("output") or defaults():output() or "DROP"
+end
+
+function zone.add_network(self, net)
+ if uci_r:get("network", net) == "interface" then
+ local nets = { }
+
+ local n
+ for n in utl.imatch(self:get("network") or self:get("name")) do
+ if n ~= net then
+ nets[#nets+1] = n
+ end
+ end
+
+ nets[#nets+1] = net
+
+ _M:del_network(net)
+ self:set("network", table.concat(nets, " "))
+ end
+end
+
+function zone.del_network(self, net)
+ local nets = { }
+
+ local n
+ for n in utl.imatch(self:get("network") or self:get("name")) do
+ if n ~= net then
+ nets[#nets+1] = n
+ end
+ end
+
+ if #nets > 0 then
+ self:set("network", table.concat(nets, " "))
+ else
+ self:set("network", " ")
+ end
+end
+
+function zone.get_networks(self)
+ local nets = { }
+
+ local n
+ for n in utl.imatch(self:get("network") or self:get("name")) do
+ nets[#nets+1] = n
+ end
+
+ return nets
+end
+
+function zone.clear_networks(self)
+ self:set("network", " ")
+end
+
+function zone.get_forwardings_by(self, what)
+ local name = self:name()
+ local forwards = { }
+
+ uci_r:foreach("firewall", "forwarding",
+ function(s)
+ if s.src and s.dest and s[what] == name then
+ forwards[#forwards+1] = forwarding(s['.name'])
+ end
+ end)
+
+ return forwards
+end
+
+function zone.add_forwarding_to(self, dest)
+ local exist, forward
+
+ for _, forward in ipairs(self:get_forwardings_by('src')) do
+ if forward:dest() == dest then
+ exist = true
+ break
+ end
+ end
+
+ if not exist and dest ~= self:name() and _valid_id(dest) then
+ local s = uci_r:section("firewall", "forwarding", nil, {
+ src = self:name(),
+ dest = dest
+ })
+
+ return s and forwarding(s)
+ end
+end
+
+function zone.add_forwarding_from(self, src)
+ local exist, forward
+
+ for _, forward in ipairs(self:get_forwardings_by('dest')) do
+ if forward:src() == src then
+ exist = true
+ break
+ end
+ end
+
+ if not exist and src ~= self:name() and _valid_id(src) then
+ local s = uci_r:section("firewall", "forwarding", nil, {
+ src = src,
+ dest = self:name()
+ })
+
+ return s and forwarding(s)
+ end
+end
+
+function zone.del_forwardings_by(self, what)
+ local name = self:name()
+
+ uci_r:delete_all("firewall", "forwarding",
+ function(s)
+ return (s.src and s.dest and s[what] == name)
+ end)
+end
+
+function zone.add_redirect(self, options)
+ options = options or { }
+ options.src = self:name()
+
+ local s = uci_r:section("firewall", "redirect", nil, options)
+ return s and redirect(s)
+end
+
+function zone.add_rule(self, options)
+ options = options or { }
+ options.src = self:name()
+
+ local s = uci_r:section("firewall", "rule", nil, options)
+ return s and rule(s)
+end
+
+function zone.get_color(self)
+ if self and self:name() == "lan" then
+ return "#90f090"
+ elseif self and self:name() == "wan" then
+ return "#f09090"
+ elseif self then
+ math.randomseed(tpl.hash(self:name()))
+
+ local r = math.random(128)
+ local g = math.random(128)
+ local min = 0
+ local max = 128
+
+ if ( r + g ) < 128 then
+ min = 128 - r - g
+ else
+ max = 255 - r - g
+ end
+
+ local b = min + math.floor( math.random() * ( max - min ) )
+
+ return "#%02x%02x%02x" % { 0xFF - r, 0xFF - g, 0xFF - b }
+ else
+ return "#eeeeee"
+ end
+end
+
+
+forwarding = utl.class()
+function forwarding.__init__(self, f)
+ self.sid = f
+end
+
+function forwarding.src(self)
+ return uci_r:get("firewall", self.sid, "src")
+end
+
+function forwarding.dest(self)
+ return uci_r:get("firewall", self.sid, "dest")
+end
+
+function forwarding.src_zone(self)
+ return zone(self:src())
+end
+
+function forwarding.dest_zone(self)
+ return zone(self:dest())
+end
+
+
+rule = utl.class()
+function rule.__init__(self, f)
+ self.sid = f
+end
+
+function rule.get(self, opt)
+ return _get("firewall", self.sid, opt)
+end
+
+function rule.set(self, opt, val)
+ return _set("firewall", self.sid, opt, val)
+end
+
+function rule.src(self)
+ return uci_r:get("firewall", self.sid, "src")
+end
+
+function rule.dest(self)
+ return uci_r:get("firewall", self.sid, "dest")
+end
+
+function rule.src_zone(self)
+ return zone(self:src())
+end
+
+function rule.dest_zone(self)
+ return zone(self:dest())
+end
+
+
+redirect = utl.class()
+function redirect.__init__(self, f)
+ self.sid = f
+end
+
+function redirect.get(self, opt)
+ return _get("firewall", self.sid, opt)
+end
+
+function redirect.set(self, opt, val)
+ return _set("firewall", self.sid, opt, val)
+end
+
+function redirect.src(self)
+ return uci_r:get("firewall", self.sid, "src")
+end
+
+function redirect.dest(self)
+ return uci_r:get("firewall", self.sid, "dest")
+end
+
+function redirect.src_zone(self)
+ return zone(self:src())
+end
+
+function redirect.dest_zone(self)
+ return zone(self:dest())
+end
diff --git a/modules/base/luasrc/model/ipkg.lua b/modules/base/luasrc/model/ipkg.lua
new file mode 100644
index 000000000..c927e7116
--- /dev/null
+++ b/modules/base/luasrc/model/ipkg.lua
@@ -0,0 +1,239 @@
+--[[
+LuCI - Lua Configuration Interface
+
+(c) 2008-2011 Jo-Philipp Wich <xm@subsignal.org>
+(c) 2008 Steven Barth <steven@midlink.org>
+
+Licensed under the Apache License, Version 2.0 (the "License");
+you may not use this file except in compliance with the License.
+You may obtain a copy of the License at
+
+http://www.apache.org/licenses/LICENSE-2.0
+
+]]--
+
+local os = require "os"
+local io = require "io"
+local fs = require "nixio.fs"
+local util = require "luci.util"
+
+local type = type
+local pairs = pairs
+local error = error
+local table = table
+
+local ipkg = "opkg --force-removal-of-dependent-packages --force-overwrite --nocase"
+local icfg = "/etc/opkg.conf"
+
+--- LuCI OPKG call abstraction library
+module "luci.model.ipkg"
+
+
+-- Internal action function
+local function _action(cmd, ...)
+ local pkg = ""
+ for k, v in pairs({...}) do
+ pkg = pkg .. " '" .. v:gsub("'", "") .. "'"
+ end
+
+ local c = "%s %s %s >/tmp/opkg.stdout 2>/tmp/opkg.stderr" %{ ipkg, cmd, pkg }
+ local r = os.execute(c)
+ local e = fs.readfile("/tmp/opkg.stderr")
+ local o = fs.readfile("/tmp/opkg.stdout")
+
+ fs.unlink("/tmp/opkg.stderr")
+ fs.unlink("/tmp/opkg.stdout")
+
+ return r, o or "", e or ""
+end
+
+-- Internal parser function
+local function _parselist(rawdata)
+ if type(rawdata) ~= "function" then
+ error("OPKG: Invalid rawdata given")
+ end
+
+ local data = {}
+ local c = {}
+ local l = nil
+
+ for line in rawdata do
+ if line:sub(1, 1) ~= " " then
+ local key, val = line:match("(.-): ?(.*)%s*")
+
+ if key and val then
+ if key == "Package" then
+ c = {Package = val}
+ data[val] = c
+ elseif key == "Status" then
+ c.Status = {}
+ for j in val:gmatch("([^ ]+)") do
+ c.Status[j] = true
+ end
+ else
+ c[key] = val
+ end
+ l = key
+ end
+ else
+ -- Multi-line field
+ c[l] = c[l] .. "\n" .. line
+ end
+ end
+
+ return data
+end
+
+-- Internal lookup function
+local function _lookup(act, pkg)
+ local cmd = ipkg .. " " .. act
+ if pkg then
+ cmd = cmd .. " '" .. pkg:gsub("'", "") .. "'"
+ end
+
+ -- OPKG sometimes kills the whole machine because it sucks
+ -- Therefore we have to use a sucky approach too and use
+ -- tmpfiles instead of directly reading the output
+ local tmpfile = os.tmpname()
+ os.execute(cmd .. (" >%s 2>/dev/null" % tmpfile))
+
+ local data = _parselist(io.lines(tmpfile))
+ os.remove(tmpfile)
+ return data
+end
+
+
+--- Return information about installed and available packages.
+-- @param pkg Limit output to a (set of) packages
+-- @return Table containing package information
+function info(pkg)
+ return _lookup("info", pkg)
+end
+
+--- Return the package status of one or more packages.
+-- @param pkg Limit output to a (set of) packages
+-- @return Table containing package status information
+function status(pkg)
+ return _lookup("status", pkg)
+end
+
+--- Install one or more packages.
+-- @param ... List of packages to install
+-- @return Boolean indicating the status of the action
+-- @return OPKG return code, STDOUT and STDERR
+function install(...)
+ return _action("install", ...)
+end
+
+--- Determine whether a given package is installed.
+-- @param pkg Package
+-- @return Boolean
+function installed(pkg)
+ local p = status(pkg)[pkg]
+ return (p and p.Status and p.Status.installed)
+end
+
+--- Remove one or more packages.
+-- @param ... List of packages to install
+-- @return Boolean indicating the status of the action
+-- @return OPKG return code, STDOUT and STDERR
+function remove(...)
+ return _action("remove", ...)
+end
+
+--- Update package lists.
+-- @return Boolean indicating the status of the action
+-- @return OPKG return code, STDOUT and STDERR
+function update()
+ return _action("update")
+end
+
+--- Upgrades all installed packages.
+-- @return Boolean indicating the status of the action
+-- @return OPKG return code, STDOUT and STDERR
+function upgrade()
+ return _action("upgrade")
+end
+
+-- List helper
+function _list(action, pat, cb)
+ local fd = io.popen(ipkg .. " " .. action ..
+ (pat and (" '%s'" % pat:gsub("'", "")) or ""))
+
+ if fd then
+ local name, version, desc
+ while true do
+ local line = fd:read("*l")
+ if not line then break end
+
+ name, version, desc = line:match("^(.-) %- (.-) %- (.+)")
+
+ if not name then
+ name, version = line:match("^(.-) %- (.+)")
+ desc = ""
+ end
+
+ cb(name, version, desc)
+
+ name = nil
+ version = nil
+ desc = nil
+ end
+
+ fd:close()
+ end
+end
+
+--- List all packages known to opkg.
+-- @param pat Only find packages matching this pattern, nil lists all packages
+-- @param cb Callback function invoked for each package, receives name, version and description as arguments
+-- @return nothing
+function list_all(pat, cb)
+ _list("list", pat, cb)
+end
+
+--- List installed packages.
+-- @param pat Only find packages matching this pattern, nil lists all packages
+-- @param cb Callback function invoked for each package, receives name, version and description as arguments
+-- @return nothing
+function list_installed(pat, cb)
+ _list("list_installed", pat, cb)
+end
+
+--- Find packages that match the given pattern.
+-- @param pat Find packages whose names or descriptions match this pattern, nil results in zero results
+-- @param cb Callback function invoked for each patckage, receives name, version and description as arguments
+-- @return nothing
+function find(pat, cb)
+ _list("find", pat, cb)
+end
+
+
+--- Determines the overlay root used by opkg.
+-- @return String containing the directory path of the overlay root.
+function overlay_root()
+ local od = "/"
+ local fd = io.open(icfg, "r")
+
+ if fd then
+ local ln
+
+ repeat
+ ln = fd:read("*l")
+ if ln and ln:match("^%s*option%s+overlay_root%s+") then
+ od = ln:match("^%s*option%s+overlay_root%s+(%S+)")
+
+ local s = fs.stat(od)
+ if not s or s.type ~= "dir" then
+ od = "/"
+ end
+
+ break
+ end
+ until not ln
+
+ fd:close()
+ end
+
+ return od
+end
diff --git a/modules/base/luasrc/model/network.lua b/modules/base/luasrc/model/network.lua
new file mode 100644
index 000000000..a409621f8
--- /dev/null
+++ b/modules/base/luasrc/model/network.lua
@@ -0,0 +1,1584 @@
+--[[
+LuCI - Network model
+
+Copyright 2009-2010 Jo-Philipp Wich <xm@subsignal.org>
+
+Licensed under the Apache License, Version 2.0 (the "License");
+you may not use this file except in compliance with the License.
+You may obtain a copy of the License at
+
+ http://www.apache.org/licenses/LICENSE-2.0
+
+Unless required by applicable law or agreed to in writing, software
+distributed under the License is distributed on an "AS IS" BASIS,
+WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+See the License for the specific language governing permissions and
+limitations under the License.
+
+]]--
+
+local type, next, pairs, ipairs, loadfile, table
+ = type, next, pairs, ipairs, loadfile, table
+
+local tonumber, tostring, math = tonumber, tostring, math
+
+local require = require
+
+local bus = require "ubus"
+local nxo = require "nixio"
+local nfs = require "nixio.fs"
+local ipc = require "luci.ip"
+local sys = require "luci.sys"
+local utl = require "luci.util"
+local dsp = require "luci.dispatcher"
+local uci = require "luci.model.uci"
+local lng = require "luci.i18n"
+
+module "luci.model.network"
+
+
+IFACE_PATTERNS_VIRTUAL = { }
+IFACE_PATTERNS_IGNORE = { "^wmaster%d", "^wifi%d", "^hwsim%d", "^imq%d", "^ifb%d", "^mon%.wlan%d", "^sit%d", "^gre%d", "^lo$" }
+IFACE_PATTERNS_WIRELESS = { "^wlan%d", "^wl%d", "^ath%d", "^%w+%.network%d" }
+
+
+protocol = utl.class()
+
+local _protocols = { }
+
+local _interfaces, _bridge, _switch, _tunnel
+local _ubus, _ubusnetcache, _ubusdevcache, _ubuswificache
+local _uci_real, _uci_state
+
+function _filter(c, s, o, r)
+ local val = _uci_real:get(c, s, o)
+ if val then
+ local l = { }
+ if type(val) == "string" then
+ for val in val:gmatch("%S+") do
+ if val ~= r then
+ l[#l+1] = val
+ end
+ end
+ if #l > 0 then
+ _uci_real:set(c, s, o, table.concat(l, " "))
+ else
+ _uci_real:delete(c, s, o)
+ end
+ elseif type(val) == "table" then
+ for _, val in ipairs(val) do
+ if val ~= r then
+ l[#l+1] = val
+ end
+ end
+ if #l > 0 then
+ _uci_real:set(c, s, o, l)
+ else
+ _uci_real:delete(c, s, o)
+ end
+ end
+ end
+end
+
+function _append(c, s, o, a)
+ local val = _uci_real:get(c, s, o) or ""
+ if type(val) == "string" then
+ local l = { }
+ for val in val:gmatch("%S+") do
+ if val ~= a then
+ l[#l+1] = val
+ end
+ end
+ l[#l+1] = a
+ _uci_real:set(c, s, o, table.concat(l, " "))
+ elseif type(val) == "table" then
+ local l = { }
+ for _, val in ipairs(val) do
+ if val ~= a then
+ l[#l+1] = val
+ end
+ end
+ l[#l+1] = a
+ _uci_real:set(c, s, o, l)
+ end
+end
+
+function _stror(s1, s2)
+ if not s1 or #s1 == 0 then
+ return s2 and #s2 > 0 and s2
+ else
+ return s1
+ end
+end
+
+function _get(c, s, o)
+ return _uci_real:get(c, s, o)
+end
+
+function _set(c, s, o, v)
+ if v ~= nil then
+ if type(v) == "boolean" then v = v and "1" or "0" end
+ return _uci_real:set(c, s, o, v)
+ else
+ return _uci_real:delete(c, s, o)
+ end
+end
+
+function _wifi_iface(x)
+ local _, p
+ for _, p in ipairs(IFACE_PATTERNS_WIRELESS) do
+ if x:match(p) then
+ return true
+ end
+ end
+ return false
+end
+
+function _wifi_state(key, val, field)
+ if not next(_ubuswificache) then
+ _ubuswificache = _ubus:call("network.wireless", "status", {}) or {}
+ end
+
+ local radio, radiostate
+ for radio, radiostate in pairs(_ubuswificache) do
+ local ifc, ifcstate
+ for ifc, ifcstate in pairs(radiostate.interfaces) do
+ if ifcstate[key] == val then
+ return ifcstate[field]
+ end
+ end
+ end
+end
+
+function _wifi_lookup(ifn)
+ -- got a radio#.network# pseudo iface, locate the corresponding section
+ local radio, ifnidx = ifn:match("^(%w+)%.network(%d+)$")
+ if radio and ifnidx then
+ local sid = nil
+ local num = 0
+
+ ifnidx = tonumber(ifnidx)
+ _uci_real:foreach("wireless", "wifi-iface",
+ function(s)
+ if s.device == radio then
+ num = num + 1
+ if num == ifnidx then
+ sid = s['.name']
+ return false
+ end
+ end
+ end)
+
+ return sid
+
+ -- looks like wifi, try to locate the section via state vars
+ elseif _wifi_iface(ifn) then
+ local sid = _wifi_state("ifname", ifn, "section")
+ if not sid then
+ _uci_state:foreach("wireless", "wifi-iface",
+ function(s)
+ if s.ifname == ifn then
+ sid = s['.name']
+ return false
+ end
+ end)
+ end
+
+ return sid
+ end
+end
+
+function _iface_virtual(x)
+ local _, p
+ for _, p in ipairs(IFACE_PATTERNS_VIRTUAL) do
+ if x:match(p) then
+ return true
+ end
+ end
+ return false
+end
+
+function _iface_ignore(x)
+ local _, p
+ for _, p in ipairs(IFACE_PATTERNS_IGNORE) do
+ if x:match(p) then
+ return true
+ end
+ end
+ return _iface_virtual(x)
+end
+
+
+function init(cursor)
+ _uci_real = cursor or _uci_real or uci.cursor()
+ _uci_state = _uci_real:substate()
+
+ _interfaces = { }
+ _bridge = { }
+ _switch = { }
+ _tunnel = { }
+
+ _ubus = bus.connect()
+ _ubusnetcache = { }
+ _ubusdevcache = { }
+ _ubuswificache = { }
+
+ -- read interface information
+ local n, i
+ for n, i in ipairs(nxo.getifaddrs()) do
+ local name = i.name:match("[^:]+")
+ local prnt = name:match("^([^%.]+)%.")
+
+ if _iface_virtual(name) then
+ _tunnel[name] = true
+ end
+
+ if _tunnel[name] or not _iface_ignore(name) then
+ _interfaces[name] = _interfaces[name] or {
+ idx = i.ifindex or n,
+ name = name,
+ rawname = i.name,
+ flags = { },
+ ipaddrs = { },
+ ip6addrs = { }
+ }
+
+ if prnt then
+ _switch[name] = true
+ _switch[prnt] = true
+ end
+
+ if i.family == "packet" then
+ _interfaces[name].flags = i.flags
+ _interfaces[name].stats = i.data
+ _interfaces[name].macaddr = i.addr
+ elseif i.family == "inet" then
+ _interfaces[name].ipaddrs[#_interfaces[name].ipaddrs+1] = ipc.IPv4(i.addr, i.netmask)
+ elseif i.family == "inet6" then
+ _interfaces[name].ip6addrs[#_interfaces[name].ip6addrs+1] = ipc.IPv6(i.addr, i.netmask)
+ end
+ end
+ end
+
+ -- read bridge informaton
+ local b, l
+ for l in utl.execi("brctl show") do
+ if not l:match("STP") then
+ local r = utl.split(l, "%s+", nil, true)
+ if #r == 4 then
+ b = {
+ name = r[1],
+ id = r[2],
+ stp = r[3] == "yes",
+ ifnames = { _interfaces[r[4]] }
+ }
+ if b.ifnames[1] then
+ b.ifnames[1].bridge = b
+ end
+ _bridge[r[1]] = b
+ elseif b then
+ b.ifnames[#b.ifnames+1] = _interfaces[r[2]]
+ b.ifnames[#b.ifnames].bridge = b
+ end
+ end
+ end
+
+ return _M
+end
+
+function save(self, ...)
+ _uci_real:save(...)
+ _uci_real:load(...)
+end
+
+function commit(self, ...)
+ _uci_real:commit(...)
+ _uci_real:load(...)
+end
+
+function ifnameof(self, x)
+ if utl.instanceof(x, interface) then
+ return x:name()
+ elseif utl.instanceof(x, protocol) then
+ return x:ifname()
+ elseif type(x) == "string" then
+ return x:match("^[^:]+")
+ end
+end
+
+function get_protocol(self, protoname, netname)
+ local v = _protocols[protoname]
+ if v then
+ return v(netname or "__dummy__")
+ end
+end
+
+function get_protocols(self)
+ local p = { }
+ local _, v
+ for _, v in ipairs(_protocols) do
+ p[#p+1] = v("__dummy__")
+ end
+ return p
+end
+
+function register_protocol(self, protoname)
+ local proto = utl.class(protocol)
+
+ function proto.__init__(self, name)
+ self.sid = name
+ end
+
+ function proto.proto(self)
+ return protoname
+ end
+
+ _protocols[#_protocols+1] = proto
+ _protocols[protoname] = proto
+
+ return proto
+end
+
+function register_pattern_virtual(self, pat)
+ IFACE_PATTERNS_VIRTUAL[#IFACE_PATTERNS_VIRTUAL+1] = pat
+end
+
+
+function has_ipv6(self)
+ return nfs.access("/proc/net/ipv6_route")
+end
+
+function add_network(self, n, options)
+ local oldnet = self:get_network(n)
+ if n and #n > 0 and n:match("^[a-zA-Z0-9_]+$") and not oldnet then
+ if _uci_real:section("network", "interface", n, options) then
+ return network(n)
+ end
+ elseif oldnet and oldnet:is_empty() then
+ if options then
+ local k, v
+ for k, v in pairs(options) do
+ oldnet:set(k, v)
+ end
+ end
+ return oldnet
+ end
+end
+
+function get_network(self, n)
+ if n and _uci_real:get("network", n) == "interface" then
+ return network(n)
+ end
+end
+
+function get_networks(self)
+ local nets = { }
+ local nls = { }
+
+ _uci_real:foreach("network", "interface",
+ function(s)
+ nls[s['.name']] = network(s['.name'])
+ end)
+
+ local n
+ for n in utl.kspairs(nls) do
+ nets[#nets+1] = nls[n]
+ end
+
+ return nets
+end
+
+function del_network(self, n)
+ local r = _uci_real:delete("network", n)
+ if r then
+ _uci_real:delete_all("network", "alias",
+ function(s) return (s.interface == n) end)
+
+ _uci_real:delete_all("network", "route",
+ function(s) return (s.interface == n) end)
+
+ _uci_real:delete_all("network", "route6",
+ function(s) return (s.interface == n) end)
+
+ _uci_real:foreach("wireless", "wifi-iface",
+ function(s)
+ local net
+ local rest = { }
+ for net in utl.imatch(s.network) do
+ if net ~= n then
+ rest[#rest+1] = net
+ end
+ end
+ if #rest > 0 then
+ _uci_real:set("wireless", s['.name'], "network",
+ table.concat(rest, " "))
+ else
+ _uci_real:delete("wireless", s['.name'], "network")
+ end
+ end)
+ end
+ return r
+end
+
+function rename_network(self, old, new)
+ local r
+ if new and #new > 0 and new:match("^[a-zA-Z0-9_]+$") and not self:get_network(new) then
+ r = _uci_real:section("network", "interface", new, _uci_real:get_all("network", old))
+
+ if r then
+ _uci_real:foreach("network", "alias",
+ function(s)
+ if s.interface == old then
+ _uci_real:set("network", s['.name'], "interface", new)
+ end
+ end)
+
+ _uci_real:foreach("network", "route",
+ function(s)
+ if s.interface == old then
+ _uci_real:set("network", s['.name'], "interface", new)
+ end
+ end)
+
+ _uci_real:foreach("network", "route6",
+ function(s)
+ if s.interface == old then
+ _uci_real:set("network", s['.name'], "interface", new)
+ end
+ end)
+
+ _uci_real:foreach("wireless", "wifi-iface",
+ function(s)
+ local net
+ local list = { }
+ for net in utl.imatch(s.network) do
+ if net == old then
+ list[#list+1] = new
+ else
+ list[#list+1] = net
+ end
+ end
+ if #list > 0 then
+ _uci_real:set("wireless", s['.name'], "network",
+ table.concat(list, " "))
+ end
+ end)
+
+ _uci_real:delete("network", old)
+ end
+ end
+ return r or false
+end
+
+function get_interface(self, i)
+ if _interfaces[i] or _wifi_iface(i) then
+ return interface(i)
+ else
+ local ifc
+ local num = { }
+ _uci_real:foreach("wireless", "wifi-iface",
+ function(s)
+ if s.device then
+ num[s.device] = num[s.device] and num[s.device] + 1 or 1
+ if s['.name'] == i then
+ ifc = interface(
+ "%s.network%d" %{s.device, num[s.device] })
+ return false
+ end
+ end
+ end)
+ return ifc
+ end
+end
+
+function get_interfaces(self)
+ local iface
+ local ifaces = { }
+ local seen = { }
+ local nfs = { }
+ local baseof = { }
+
+ -- find normal interfaces
+ _uci_real:foreach("network", "interface",
+ function(s)
+ for iface in utl.imatch(s.ifname) do
+ if not _iface_ignore(iface) and not _wifi_iface(iface) then
+ seen[iface] = true
+ nfs[iface] = interface(iface)
+ end
+ end
+ end)
+
+ for iface in utl.kspairs(_interfaces) do
+ if not (seen[iface] or _iface_ignore(iface) or _wifi_iface(iface)) then
+ nfs[iface] = interface(iface)
+ end
+ end
+
+ -- find vlan interfaces
+ _uci_real:foreach("network", "switch_vlan",
+ function(s)
+ if not s.device then
+ return
+ end
+
+ local base = baseof[s.device]
+ if not base then
+ if not s.device:match("^eth%d") then
+ local l
+ for l in utl.execi("swconfig dev %q help 2>/dev/null" % s.device) do
+ if not base then
+ base = l:match("^%w+: (%w+)")
+ end
+ end
+ if not base or not base:match("^eth%d") then
+ base = "eth0"
+ end
+ else
+ base = s.device
+ end
+ baseof[s.device] = base
+ end
+
+ local vid = tonumber(s.vid or s.vlan)
+ if vid ~= nil and vid >= 0 and vid <= 4095 then
+ local iface = "%s.%d" %{ base, vid }
+ if not seen[iface] then
+ seen[iface] = true
+ nfs[iface] = interface(iface)
+ end
+ end
+ end)
+
+ for iface in utl.kspairs(nfs) do
+ ifaces[#ifaces+1] = nfs[iface]
+ end
+
+ -- find wifi interfaces
+ local num = { }
+ local wfs = { }
+ _uci_real:foreach("wireless", "wifi-iface",
+ function(s)
+ if s.device then
+ num[s.device] = num[s.device] and num[s.device] + 1 or 1
+ local i = "%s.network%d" %{ s.device, num[s.device] }
+ wfs[i] = interface(i)
+ end
+ end)
+
+ for iface in utl.kspairs(wfs) do
+ ifaces[#ifaces+1] = wfs[iface]
+ end
+
+ return ifaces
+end
+
+function ignore_interface(self, x)
+ return _iface_ignore(x)
+end
+
+function get_wifidev(self, dev)
+ if _uci_real:get("wireless", dev) == "wifi-device" then
+ return wifidev(dev)
+ end
+end
+
+function get_wifidevs(self)
+ local devs = { }
+ local wfd = { }
+
+ _uci_real:foreach("wireless", "wifi-device",
+ function(s) wfd[#wfd+1] = s['.name'] end)
+
+ local dev
+ for _, dev in utl.vspairs(wfd) do
+ devs[#devs+1] = wifidev(dev)
+ end
+
+ return devs
+end
+
+function get_wifinet(self, net)
+ local wnet = _wifi_lookup(net)
+ if wnet then
+ return wifinet(wnet)
+ end
+end
+
+function add_wifinet(self, net, options)
+ if type(options) == "table" and options.device and
+ _uci_real:get("wireless", options.device) == "wifi-device"
+ then
+ local wnet = _uci_real:section("wireless", "wifi-iface", nil, options)
+ return wifinet(wnet)
+ end
+end
+
+function del_wifinet(self, net)
+ local wnet = _wifi_lookup(net)
+ if wnet then
+ _uci_real:delete("wireless", wnet)
+ return true
+ end
+ return false
+end
+
+function get_status_by_route(self, addr, mask)
+ local _, object
+ for _, object in ipairs(_ubus:objects()) do
+ local net = object:match("^network%.interface%.(.+)")
+ if net then
+ local s = _ubus:call(object, "status", {})
+ if s and s.route then
+ local rt
+ for _, rt in ipairs(s.route) do
+ if not rt.table and rt.target == addr and rt.mask == mask then
+ return net, s
+ end
+ end
+ end
+ end
+ end
+end
+
+function get_status_by_address(self, addr)
+ local _, object
+ for _, object in ipairs(_ubus:objects()) do
+ local net = object:match("^network%.interface%.(.+)")
+ if net then
+ local s = _ubus:call(object, "status", {})
+ if s and s['ipv4-address'] then
+ local a
+ for _, a in ipairs(s['ipv4-address']) do
+ if a.address == addr then
+ return net, s
+ end
+ end
+ end
+ if s and s['ipv6-address'] then
+ local a
+ for _, a in ipairs(s['ipv6-address']) do
+ if a.address == addr then
+ return net, s
+ end
+ end
+ end
+ end
+ end
+end
+
+function get_wannet(self)
+ local net = self:get_status_by_route("0.0.0.0", 0)
+ return net and network(net)
+end
+
+function get_wandev(self)
+ local _, stat = self:get_status_by_route("0.0.0.0", 0)
+ return stat and interface(stat.l3_device or stat.device)
+end
+
+function get_wan6net(self)
+ local net = self:get_status_by_route("::", 0)
+ return net and network(net)
+end
+
+function get_wan6dev(self)
+ local _, stat = self:get_status_by_route("::", 0)
+ return stat and interface(stat.l3_device or stat.device)
+end
+
+
+function network(name, proto)
+ if name then
+ local p = proto or _uci_real:get("network", name, "proto")
+ local c = p and _protocols[p] or protocol
+ return c(name)
+ end
+end
+
+function protocol.__init__(self, name)
+ self.sid = name
+end
+
+function protocol._get(self, opt)
+ local v = _uci_real:get("network", self.sid, opt)
+ if type(v) == "table" then
+ return table.concat(v, " ")
+ end
+ return v or ""
+end
+
+function protocol._ubus(self, field)
+ if not _ubusnetcache[self.sid] then
+ _ubusnetcache[self.sid] = _ubus:call("network.interface.%s" % self.sid,
+ "status", { })
+ end
+ if _ubusnetcache[self.sid] and field then
+ return _ubusnetcache[self.sid][field]
+ end
+ return _ubusnetcache[self.sid]
+end
+
+function protocol.get(self, opt)
+ return _get("network", self.sid, opt)
+end
+
+function protocol.set(self, opt, val)
+ return _set("network", self.sid, opt, val)
+end
+
+function protocol.ifname(self)
+ local ifname
+ if self:is_floating() then
+ ifname = self:_ubus("l3_device")
+ else
+ ifname = self:_ubus("device")
+ end
+ if not ifname then
+ local num = { }
+ _uci_real:foreach("wireless", "wifi-iface",
+ function(s)
+ if s.device then
+ num[s.device] = num[s.device]
+ and num[s.device] + 1 or 1
+
+ local net
+ for net in utl.imatch(s.network) do
+ if net == self.sid then
+ ifname = "%s.network%d" %{ s.device, num[s.device] }
+ return false
+ end
+ end
+ end
+ end)
+ end
+ return ifname
+end
+
+function protocol.proto(self)
+ return "none"
+end
+
+function protocol.get_i18n(self)
+ local p = self:proto()
+ if p == "none" then
+ return lng.translate("Unmanaged")
+ elseif p == "static" then
+ return lng.translate("Static address")
+ elseif p == "dhcp" then
+ return lng.translate("DHCP client")
+ else
+ return lng.translate("Unknown")
+ end
+end
+
+function protocol.type(self)
+ return self:_get("type")
+end
+
+function protocol.name(self)
+ return self.sid
+end
+
+function protocol.uptime(self)
+ return self:_ubus("uptime") or 0
+end
+
+function protocol.expires(self)
+ local a = tonumber(_uci_state:get("network", self.sid, "lease_acquired"))
+ local l = tonumber(_uci_state:get("network", self.sid, "lease_lifetime"))
+ if a and l then
+ l = l - (nxo.sysinfo().uptime - a)
+ return l > 0 and l or 0
+ end
+ return -1
+end
+
+function protocol.metric(self)
+ return tonumber(_uci_state:get("network", self.sid, "metric")) or 0
+end
+
+function protocol.ipaddr(self)
+ local addrs = self:_ubus("ipv4-address")
+ return addrs and #addrs > 0 and addrs[1].address
+end
+
+function protocol.netmask(self)
+ local addrs = self:_ubus("ipv4-address")
+ return addrs and #addrs > 0 and
+ ipc.IPv4("0.0.0.0/%d" % addrs[1].mask):mask():string()
+end
+
+function protocol.gwaddr(self)
+ local _, route
+ for _, route in ipairs(self:_ubus("route") or { }) do
+ if route.target == "0.0.0.0" and route.mask == 0 then
+ return route.nexthop
+ end
+ end
+end
+
+function protocol.dnsaddrs(self)
+ local dns = { }
+ local _, addr
+ for _, addr in ipairs(self:_ubus("dns-server") or { }) do
+ if not addr:match(":") then
+ dns[#dns+1] = addr
+ end
+ end
+ return dns
+end
+
+function protocol.ip6addr(self)
+ local addrs = self:_ubus("ipv6-address")
+ if addrs and #addrs > 0 then
+ return "%s/%d" %{ addrs[1].address, addrs[1].mask }
+ else
+ addrs = self:_ubus("ipv6-prefix-assignment")
+ if addrs and #addrs > 0 then
+ return "%s/%d" %{ addrs[1].address, addrs[1].mask }
+ end
+ end
+end
+
+function protocol.gw6addr(self)
+ local _, route
+ for _, route in ipairs(self:_ubus("route") or { }) do
+ if route.target == "::" and route.mask == 0 then
+ return ipc.IPv6(route.nexthop):string()
+ end
+ end
+end
+
+function protocol.dns6addrs(self)
+ local dns = { }
+ local _, addr
+ for _, addr in ipairs(self:_ubus("dns-server") or { }) do
+ if addr:match(":") then
+ dns[#dns+1] = addr
+ end
+ end
+ return dns
+end
+
+function protocol.is_bridge(self)
+ return (not self:is_virtual() and self:type() == "bridge")
+end
+
+function protocol.opkg_package(self)
+ return nil
+end
+
+function protocol.is_installed(self)
+ return true
+end
+
+function protocol.is_virtual(self)
+ return false
+end
+
+function protocol.is_floating(self)
+ return false
+end
+
+function protocol.is_empty(self)
+ if self:is_floating() then
+ return false
+ else
+ local rv = true
+
+ if (self:_get("ifname") or ""):match("%S+") then
+ rv = false
+ end
+
+ _uci_real:foreach("wireless", "wifi-iface",
+ function(s)
+ local n
+ for n in utl.imatch(s.network) do
+ if n == self.sid then
+ rv = false
+ return false
+ end
+ end
+ end)
+
+ return rv
+ end
+end
+
+function protocol.add_interface(self, ifname)
+ ifname = _M:ifnameof(ifname)
+ if ifname and not self:is_floating() then
+ -- if its a wifi interface, change its network option
+ local wif = _wifi_lookup(ifname)
+ if wif then
+ _append("wireless", wif, "network", self.sid)
+
+ -- add iface to our iface list
+ else
+ _append("network", self.sid, "ifname", ifname)
+ end
+ end
+end
+
+function protocol.del_interface(self, ifname)
+ ifname = _M:ifnameof(ifname)
+ if ifname and not self:is_floating() then
+ -- if its a wireless interface, clear its network option
+ local wif = _wifi_lookup(ifname)
+ if wif then _filter("wireless", wif, "network", self.sid) end
+
+ -- remove the interface
+ _filter("network", self.sid, "ifname", ifname)
+ end
+end
+
+function protocol.get_interface(self)
+ if self:is_virtual() then
+ _tunnel[self:proto() .. "-" .. self.sid] = true
+ return interface(self:proto() .. "-" .. self.sid, self)
+ elseif self:is_bridge() then
+ _bridge["br-" .. self.sid] = true
+ return interface("br-" .. self.sid, self)
+ else
+ local ifn = nil
+ local num = { }
+ for ifn in utl.imatch(_uci_real:get("network", self.sid, "ifname")) do
+ ifn = ifn:match("^[^:/]+")
+ return ifn and interface(ifn, self)
+ end
+ ifn = nil
+ _uci_real:foreach("wireless", "wifi-iface",
+ function(s)
+ if s.device then
+ num[s.device] = num[s.device] and num[s.device] + 1 or 1
+
+ local net
+ for net in utl.imatch(s.network) do
+ if net == self.sid then
+ ifn = "%s.network%d" %{ s.device, num[s.device] }
+ return false
+ end
+ end
+ end
+ end)
+ return ifn and interface(ifn, self)
+ end
+end
+
+function protocol.get_interfaces(self)
+ if self:is_bridge() or (self:is_virtual() and not self:is_floating()) then
+ local ifaces = { }
+
+ local ifn
+ local nfs = { }
+ for ifn in utl.imatch(self:get("ifname")) do
+ ifn = ifn:match("^[^:/]+")
+ nfs[ifn] = interface(ifn, self)
+ end
+
+ for ifn in utl.kspairs(nfs) do
+ ifaces[#ifaces+1] = nfs[ifn]
+ end
+
+ local num = { }
+ local wfs = { }
+ _uci_real:foreach("wireless", "wifi-iface",
+ function(s)
+ if s.device then
+ num[s.device] = num[s.device] and num[s.device] + 1 or 1
+
+ local net
+ for net in utl.imatch(s.network) do
+ if net == self.sid then
+ ifn = "%s.network%d" %{ s.device, num[s.device] }
+ wfs[ifn] = interface(ifn, self)
+ end
+ end
+ end
+ end)
+
+ for ifn in utl.kspairs(wfs) do
+ ifaces[#ifaces+1] = wfs[ifn]
+ end
+
+ return ifaces
+ end
+end
+
+function protocol.contains_interface(self, ifname)
+ ifname = _M:ifnameof(ifname)
+ if not ifname then
+ return false
+ elseif self:is_virtual() and self:proto() .. "-" .. self.sid == ifname then
+ return true
+ elseif self:is_bridge() and "br-" .. self.sid == ifname then
+ return true
+ else
+ local ifn
+ for ifn in utl.imatch(self:get("ifname")) do
+ ifn = ifn:match("[^:]+")
+ if ifn == ifname then
+ return true
+ end
+ end
+
+ local wif = _wifi_lookup(ifname)
+ if wif then
+ local n
+ for n in utl.imatch(_uci_real:get("wireless", wif, "network")) do
+ if n == self.sid then
+ return true
+ end
+ end
+ end
+ end
+
+ return false
+end
+
+function protocol.adminlink(self)
+ return dsp.build_url("admin", "network", "network", self.sid)
+end
+
+
+interface = utl.class()
+
+function interface.__init__(self, ifname, network)
+ local wif = _wifi_lookup(ifname)
+ if wif then
+ self.wif = wifinet(wif)
+ self.ifname = _wifi_state("section", wif, "ifname")
+ end
+
+ self.ifname = self.ifname or ifname
+ self.dev = _interfaces[self.ifname]
+ self.network = network
+end
+
+function interface._ubus(self, field)
+ if not _ubusdevcache[self.ifname] then
+ _ubusdevcache[self.ifname] = _ubus:call("network.device", "status",
+ { name = self.ifname })
+ end
+ if _ubusdevcache[self.ifname] and field then
+ return _ubusdevcache[self.ifname][field]
+ end
+ return _ubusdevcache[self.ifname]
+end
+
+function interface.name(self)
+ return self.wif and self.wif:ifname() or self.ifname
+end
+
+function interface.mac(self)
+ return (self:_ubus("macaddr") or "00:00:00:00:00:00"):upper()
+end
+
+function interface.ipaddrs(self)
+ return self.dev and self.dev.ipaddrs or { }
+end
+
+function interface.ip6addrs(self)
+ return self.dev and self.dev.ip6addrs or { }
+end
+
+function interface.type(self)
+ if self.wif or _wifi_iface(self.ifname) then
+ return "wifi"
+ elseif _bridge[self.ifname] then
+ return "bridge"
+ elseif _tunnel[self.ifname] then
+ return "tunnel"
+ elseif self.ifname:match("%.") then
+ return "vlan"
+ elseif _switch[self.ifname] then
+ return "switch"
+ else
+ return "ethernet"
+ end
+end
+
+function interface.shortname(self)
+ if self.wif then
+ return "%s %q" %{
+ self.wif:active_mode(),
+ self.wif:active_ssid() or self.wif:active_bssid()
+ }
+ else
+ return self.ifname
+ end
+end
+
+function interface.get_i18n(self)
+ if self.wif then
+ return "%s: %s %q" %{
+ lng.translate("Wireless Network"),
+ self.wif:active_mode(),
+ self.wif:active_ssid() or self.wif:active_bssid()
+ }
+ else
+ return "%s: %q" %{ self:get_type_i18n(), self:name() }
+ end
+end
+
+function interface.get_type_i18n(self)
+ local x = self:type()
+ if x == "wifi" then
+ return lng.translate("Wireless Adapter")
+ elseif x == "bridge" then
+ return lng.translate("Bridge")
+ elseif x == "switch" then
+ return lng.translate("Ethernet Switch")
+ elseif x == "vlan" then
+ return lng.translate("VLAN Interface")
+ elseif x == "tunnel" then
+ return lng.translate("Tunnel Interface")
+ else
+ return lng.translate("Ethernet Adapter")
+ end
+end
+
+function interface.adminlink(self)
+ if self.wif then
+ return self.wif:adminlink()
+ end
+end
+
+function interface.ports(self)
+ local members = self:_ubus("bridge-members")
+ if members then
+ local _, iface
+ local ifaces = { }
+ for _, iface in ipairs(members) do
+ ifaces[#ifaces+1] = interface(iface)
+ end
+ end
+end
+
+function interface.bridge_id(self)
+ if self.br then
+ return self.br.id
+ else
+ return nil
+ end
+end
+
+function interface.bridge_stp(self)
+ if self.br then
+ return self.br.stp
+ else
+ return false
+ end
+end
+
+function interface.is_up(self)
+ return self:_ubus("up") or false
+end
+
+function interface.is_bridge(self)
+ return (self:type() == "bridge")
+end
+
+function interface.is_bridgeport(self)
+ return self.dev and self.dev.bridge and true or false
+end
+
+function interface.tx_bytes(self)
+ local stat = self:_ubus("statistics")
+ return stat and stat.tx_bytes or 0
+end
+
+function interface.rx_bytes(self)
+ local stat = self:_ubus("statistics")
+ return stat and stat.rx_bytes or 0
+end
+
+function interface.tx_packets(self)
+ local stat = self:_ubus("statistics")
+ return stat and stat.tx_packets or 0
+end
+
+function interface.rx_packets(self)
+ local stat = self:_ubus("statistics")
+ return stat and stat.rx_packets or 0
+end
+
+function interface.get_network(self)
+ return self:get_networks()[1]
+end
+
+function interface.get_networks(self)
+ if not self.networks then
+ local nets = { }
+ local _, net
+ for _, net in ipairs(_M:get_networks()) do
+ if net:contains_interface(self.ifname) or
+ net:ifname() == self.ifname
+ then
+ nets[#nets+1] = net
+ end
+ end
+ table.sort(nets, function(a, b) return a.sid < b.sid end)
+ self.networks = nets
+ return nets
+ else
+ return self.networks
+ end
+end
+
+function interface.get_wifinet(self)
+ return self.wif
+end
+
+
+wifidev = utl.class()
+
+function wifidev.__init__(self, dev)
+ self.sid = dev
+ self.iwinfo = dev and sys.wifi.getiwinfo(dev) or { }
+end
+
+function wifidev.get(self, opt)
+ return _get("wireless", self.sid, opt)
+end
+
+function wifidev.set(self, opt, val)
+ return _set("wireless", self.sid, opt, val)
+end
+
+function wifidev.name(self)
+ return self.sid
+end
+
+function wifidev.hwmodes(self)
+ local l = self.iwinfo.hwmodelist
+ if l and next(l) then
+ return l
+ else
+ return { b = true, g = true }
+ end
+end
+
+function wifidev.get_i18n(self)
+ local t = "Generic"
+ if self.iwinfo.type == "wl" then
+ t = "Broadcom"
+ elseif self.iwinfo.type == "madwifi" then
+ t = "Atheros"
+ end
+
+ local m = ""
+ local l = self:hwmodes()
+ if l.a then m = m .. "a" end
+ if l.b then m = m .. "b" end
+ if l.g then m = m .. "g" end
+ if l.n then m = m .. "n" end
+
+ return "%s 802.11%s Wireless Controller (%s)" %{ t, m, self:name() }
+end
+
+function wifidev.is_up(self)
+ if _ubuswificache[self.sid] then
+ return (_ubuswificache[self.sid].up == true)
+ end
+
+ local up = false
+ _uci_state:foreach("wireless", "wifi-iface",
+ function(s)
+ if s.device == self.sid then
+ if s.up == "1" then
+ up = true
+ return false
+ end
+ end
+ end)
+
+ return up
+end
+
+function wifidev.get_wifinet(self, net)
+ if _uci_real:get("wireless", net) == "wifi-iface" then
+ return wifinet(net)
+ else
+ local wnet = _wifi_lookup(net)
+ if wnet then
+ return wifinet(wnet)
+ end
+ end
+end
+
+function wifidev.get_wifinets(self)
+ local nets = { }
+
+ _uci_real:foreach("wireless", "wifi-iface",
+ function(s)
+ if s.device == self.sid then
+ nets[#nets+1] = wifinet(s['.name'])
+ end
+ end)
+
+ return nets
+end
+
+function wifidev.add_wifinet(self, options)
+ options = options or { }
+ options.device = self.sid
+
+ local wnet = _uci_real:section("wireless", "wifi-iface", nil, options)
+ if wnet then
+ return wifinet(wnet, options)
+ end
+end
+
+function wifidev.del_wifinet(self, net)
+ if utl.instanceof(net, wifinet) then
+ net = net.sid
+ elseif _uci_real:get("wireless", net) ~= "wifi-iface" then
+ net = _wifi_lookup(net)
+ end
+
+ if net and _uci_real:get("wireless", net, "device") == self.sid then
+ _uci_real:delete("wireless", net)
+ return true
+ end
+
+ return false
+end
+
+
+wifinet = utl.class()
+
+function wifinet.__init__(self, net, data)
+ self.sid = net
+
+ local num = { }
+ local netid
+ _uci_real:foreach("wireless", "wifi-iface",
+ function(s)
+ if s.device then
+ num[s.device] = num[s.device] and num[s.device] + 1 or 1
+ if s['.name'] == self.sid then
+ netid = "%s.network%d" %{ s.device, num[s.device] }
+ return false
+ end
+ end
+ end)
+
+ local dev = _wifi_state("section", self.sid, "ifname") or netid
+
+ self.netid = netid
+ self.wdev = dev
+ self.iwinfo = dev and sys.wifi.getiwinfo(dev) or { }
+ self.iwdata = data or _uci_state:get_all("wireless", self.sid) or
+ _uci_real:get_all("wireless", self.sid) or { }
+end
+
+function wifinet.get(self, opt)
+ return _get("wireless", self.sid, opt)
+end
+
+function wifinet.set(self, opt, val)
+ return _set("wireless", self.sid, opt, val)
+end
+
+function wifinet.mode(self)
+ return _uci_state:get("wireless", self.sid, "mode") or "ap"
+end
+
+function wifinet.ssid(self)
+ return _uci_state:get("wireless", self.sid, "ssid")
+end
+
+function wifinet.bssid(self)
+ return _uci_state:get("wireless", self.sid, "bssid")
+end
+
+function wifinet.network(self)
+ return _uci_state:get("wifinet", self.sid, "network")
+end
+
+function wifinet.id(self)
+ return self.netid
+end
+
+function wifinet.name(self)
+ return self.sid
+end
+
+function wifinet.ifname(self)
+ local ifname = self.iwinfo.ifname
+ if not ifname or ifname:match("^wifi%d") or ifname:match("^radio%d") then
+ ifname = self.wdev
+ end
+ return ifname
+end
+
+function wifinet.get_device(self)
+ if self.iwdata.device then
+ return wifidev(self.iwdata.device)
+ end
+end
+
+function wifinet.is_up(self)
+ local ifc = self:get_interface()
+ return (ifc and ifc:is_up() or false)
+end
+
+function wifinet.active_mode(self)
+ local m = _stror(self.iwinfo.mode, self.iwdata.mode) or "ap"
+
+ if m == "ap" then m = "Master"
+ elseif m == "sta" then m = "Client"
+ elseif m == "adhoc" then m = "Ad-Hoc"
+ elseif m == "mesh" then m = "Mesh"
+ elseif m == "monitor" then m = "Monitor"
+ end
+
+ return m
+end
+
+function wifinet.active_mode_i18n(self)
+ return lng.translate(self:active_mode())
+end
+
+function wifinet.active_ssid(self)
+ return _stror(self.iwinfo.ssid, self.iwdata.ssid)
+end
+
+function wifinet.active_bssid(self)
+ return _stror(self.iwinfo.bssid, self.iwdata.bssid) or "00:00:00:00:00:00"
+end
+
+function wifinet.active_encryption(self)
+ local enc = self.iwinfo and self.iwinfo.encryption
+ return enc and enc.description or "-"
+end
+
+function wifinet.assoclist(self)
+ return self.iwinfo.assoclist or { }
+end
+
+function wifinet.frequency(self)
+ local freq = self.iwinfo.frequency
+ if freq and freq > 0 then
+ return "%.03f" % (freq / 1000)
+ end
+end
+
+function wifinet.bitrate(self)
+ local rate = self.iwinfo.bitrate
+ if rate and rate > 0 then
+ return (rate / 1000)
+ end
+end
+
+function wifinet.channel(self)
+ return self.iwinfo.channel or
+ tonumber(_uci_state:get("wireless", self.iwdata.device, "channel"))
+end
+
+function wifinet.signal(self)
+ return self.iwinfo.signal or 0
+end
+
+function wifinet.noise(self)
+ return self.iwinfo.noise or 0
+end
+
+function wifinet.country(self)
+ return self.iwinfo.country or "00"
+end
+
+function wifinet.txpower(self)
+ local pwr = (self.iwinfo.txpower or 0)
+ return pwr + self:txpower_offset()
+end
+
+function wifinet.txpower_offset(self)
+ return self.iwinfo.txpower_offset or 0
+end
+
+function wifinet.signal_level(self, s, n)
+ if self:active_bssid() ~= "00:00:00:00:00:00" then
+ local signal = s or self:signal()
+ local noise = n or self:noise()
+
+ if signal < 0 and noise < 0 then
+ local snr = -1 * (noise - signal)
+ return math.floor(snr / 5)
+ else
+ return 0
+ end
+ else
+ return -1
+ end
+end
+
+function wifinet.signal_percent(self)
+ local qc = self.iwinfo.quality or 0
+ local qm = self.iwinfo.quality_max or 0
+
+ if qc > 0 and qm > 0 then
+ return math.floor((100 / qm) * qc)
+ else
+ return 0
+ end
+end
+
+function wifinet.shortname(self)
+ return "%s %q" %{
+ lng.translate(self:active_mode()),
+ self:active_ssid() or self:active_bssid()
+ }
+end
+
+function wifinet.get_i18n(self)
+ return "%s: %s %q (%s)" %{
+ lng.translate("Wireless Network"),
+ lng.translate(self:active_mode()),
+ self:active_ssid() or self:active_bssid(),
+ self:ifname()
+ }
+end
+
+function wifinet.adminlink(self)
+ return dsp.build_url("admin", "network", "wireless", self.netid)
+end
+
+function wifinet.get_network(self)
+ return self:get_networks()[1]
+end
+
+function wifinet.get_networks(self)
+ local nets = { }
+ local net
+ for net in utl.imatch(tostring(self.iwdata.network)) do
+ if _uci_real:get("network", net) == "interface" then
+ nets[#nets+1] = network(net)
+ end
+ end
+ table.sort(nets, function(a, b) return a.sid < b.sid end)
+ return nets
+end
+
+function wifinet.get_interface(self)
+ return interface(self:ifname())
+end
+
+
+-- setup base protocols
+_M:register_protocol("static")
+_M:register_protocol("dhcp")
+_M:register_protocol("none")
+
+-- load protocol extensions
+local exts = nfs.dir(utl.libpath() .. "/model/network")
+if exts then
+ local ext
+ for ext in exts do
+ if ext:match("%.lua$") then
+ require("luci.model.network." .. ext:gsub("%.lua$", ""))
+ end
+ end
+end
diff --git a/modules/base/luasrc/model/uci.lua b/modules/base/luasrc/model/uci.lua
new file mode 100644
index 000000000..a39456304
--- /dev/null
+++ b/modules/base/luasrc/model/uci.lua
@@ -0,0 +1,404 @@
+--[[
+LuCI - UCI model
+
+Description:
+Generalized UCI model
+
+FileId:
+$Id$
+
+License:
+Copyright 2008 Steven Barth <steven@midlink.org>
+
+Licensed under the Apache License, Version 2.0 (the "License");
+you may not use this file except in compliance with the License.
+You may obtain a copy of the License at
+
+ http://www.apache.org/licenses/LICENSE-2.0
+
+Unless required by applicable law or agreed to in writing, software
+distributed under the License is distributed on an "AS IS" BASIS,
+WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+See the License for the specific language governing permissions and
+limitations under the License.
+
+]]--
+local os = require "os"
+local uci = require "uci"
+local util = require "luci.util"
+local table = require "table"
+
+
+local setmetatable, rawget, rawset = setmetatable, rawget, rawset
+local require, getmetatable = require, getmetatable
+local error, pairs, ipairs = error, pairs, ipairs
+local type, tostring, tonumber, unpack = type, tostring, tonumber, unpack
+
+--- LuCI UCI model library.
+-- The typical workflow for UCI is: Get a cursor instance from the
+-- cursor factory, modify data (via Cursor.add, Cursor.delete, etc.),
+-- save the changes to the staging area via Cursor.save and finally
+-- Cursor.commit the data to the actual config files.
+-- LuCI then needs to Cursor.apply the changes so deamons etc. are
+-- reloaded.
+-- @cstyle instance
+module "luci.model.uci"
+
+--- Create a new UCI-Cursor.
+-- @class function
+-- @name cursor
+-- @return UCI-Cursor
+cursor = uci.cursor
+
+APIVERSION = uci.APIVERSION
+
+--- Create a new Cursor initialized to the state directory.
+-- @return UCI cursor
+function cursor_state()
+ return cursor(nil, "/var/state")
+end
+
+
+inst = cursor()
+inst_state = cursor_state()
+
+local Cursor = getmetatable(inst)
+
+--- Applies UCI configuration changes
+-- @param configlist List of UCI configurations
+-- @param command Don't apply only return the command
+function Cursor.apply(self, configlist, command)
+ configlist = self:_affected(configlist)
+ if command then
+ return { "/sbin/luci-reload", unpack(configlist) }
+ else
+ return os.execute("/sbin/luci-reload %s >/dev/null 2>&1"
+ % table.concat(configlist, " "))
+ end
+end
+
+
+--- Delete all sections of a given type that match certain criteria.
+-- @param config UCI config
+-- @param type UCI section type
+-- @param comparator Function that will be called for each section and
+-- returns a boolean whether to delete the current section (optional)
+function Cursor.delete_all(self, config, stype, comparator)
+ local del = {}
+
+ if type(comparator) == "table" then
+ local tbl = comparator
+ comparator = function(section)
+ for k, v in pairs(tbl) do
+ if section[k] ~= v then
+ return false
+ end
+ end
+ return true
+ end
+ end
+
+ local function helper (section)
+
+ if not comparator or comparator(section) then
+ del[#del+1] = section[".name"]
+ end
+ end
+
+ self:foreach(config, stype, helper)
+
+ for i, j in ipairs(del) do
+ self:delete(config, j)
+ end
+end
+
+--- Create a new section and initialize it with data.
+-- @param config UCI config
+-- @param type UCI section type
+-- @param name UCI section name (optional)
+-- @param values Table of key - value pairs to initialize the section with
+-- @return Name of created section
+function Cursor.section(self, config, type, name, values)
+ local stat = true
+ if name then
+ stat = self:set(config, name, type)
+ else
+ name = self:add(config, type)
+ stat = name and true
+ end
+
+ if stat and values then
+ stat = self:tset(config, name, values)
+ end
+
+ return stat and name
+end
+
+--- Updated the data of a section using data from a table.
+-- @param config UCI config
+-- @param section UCI section name (optional)
+-- @param values Table of key - value pairs to update the section with
+function Cursor.tset(self, config, section, values)
+ local stat = true
+ for k, v in pairs(values) do
+ if k:sub(1, 1) ~= "." then
+ stat = stat and self:set(config, section, k, v)
+ end
+ end
+ return stat
+end
+
+--- Get a boolean option and return it's value as true or false.
+-- @param config UCI config
+-- @param section UCI section name
+-- @param option UCI option
+-- @return Boolean
+function Cursor.get_bool(self, ...)
+ local val = self:get(...)
+ return ( val == "1" or val == "true" or val == "yes" or val == "on" )
+end
+
+--- Get an option or list and return values as table.
+-- @param config UCI config
+-- @param section UCI section name
+-- @param option UCI option
+-- @return UCI value
+function Cursor.get_list(self, config, section, option)
+ if config and section and option then
+ local val = self:get(config, section, option)
+ return ( type(val) == "table" and val or { val } )
+ end
+ return nil
+end
+
+--- Get the given option from the first section with the given type.
+-- @param config UCI config
+-- @param type UCI section type
+-- @param option UCI option (optional)
+-- @param default Default value (optional)
+-- @return UCI value
+function Cursor.get_first(self, conf, stype, opt, def)
+ local rv = def
+
+ self:foreach(conf, stype,
+ function(s)
+ local val = not opt and s['.name'] or s[opt]
+
+ if type(def) == "number" then
+ val = tonumber(val)
+ elseif type(def) == "boolean" then
+ val = (val == "1" or val == "true" or
+ val == "yes" or val == "on")
+ end
+
+ if val ~= nil then
+ rv = val
+ return false
+ end
+ end)
+
+ return rv
+end
+
+--- Set given values as list.
+-- @param config UCI config
+-- @param section UCI section name
+-- @param option UCI option
+-- @param value UCI value
+-- @return Boolean whether operation succeeded
+function Cursor.set_list(self, config, section, option, value)
+ if config and section and option then
+ return self:set(
+ config, section, option,
+ ( type(value) == "table" and value or { value } )
+ )
+ end
+ return false
+end
+
+-- Return a list of initscripts affected by configuration changes.
+function Cursor._affected(self, configlist)
+ configlist = type(configlist) == "table" and configlist or {configlist}
+
+ local c = cursor()
+ c:load("ucitrack")
+
+ -- Resolve dependencies
+ local reloadlist = {}
+
+ local function _resolve_deps(name)
+ local reload = {name}
+ local deps = {}
+
+ c:foreach("ucitrack", name,
+ function(section)
+ if section.affects then
+ for i, aff in ipairs(section.affects) do
+ deps[#deps+1] = aff
+ end
+ end
+ end)
+
+ for i, dep in ipairs(deps) do
+ for j, add in ipairs(_resolve_deps(dep)) do
+ reload[#reload+1] = add
+ end
+ end
+
+ return reload
+ end
+
+ -- Collect initscripts
+ for j, config in ipairs(configlist) do
+ for i, e in ipairs(_resolve_deps(config)) do
+ if not util.contains(reloadlist, e) then
+ reloadlist[#reloadlist+1] = e
+ end
+ end
+ end
+
+ return reloadlist
+end
+
+--- Create a sub-state of this cursor. The sub-state is tied to the parent
+-- curser, means it the parent unloads or loads configs, the sub state will
+-- do so as well.
+-- @return UCI state cursor tied to the parent cursor
+function Cursor.substate(self)
+ Cursor._substates = Cursor._substates or { }
+ Cursor._substates[self] = Cursor._substates[self] or cursor_state()
+ return Cursor._substates[self]
+end
+
+local _load = Cursor.load
+function Cursor.load(self, ...)
+ if Cursor._substates and Cursor._substates[self] then
+ _load(Cursor._substates[self], ...)
+ end
+ return _load(self, ...)
+end
+
+local _unload = Cursor.unload
+function Cursor.unload(self, ...)
+ if Cursor._substates and Cursor._substates[self] then
+ _unload(Cursor._substates[self], ...)
+ end
+ return _unload(self, ...)
+end
+
+
+--- Add an anonymous section.
+-- @class function
+-- @name Cursor.add
+-- @param config UCI config
+-- @param type UCI section type
+-- @return Name of created section
+
+--- Get a table of saved but uncommitted changes.
+-- @class function
+-- @name Cursor.changes
+-- @param config UCI config
+-- @return Table of changes
+-- @see Cursor.save
+
+--- Commit saved changes.
+-- @class function
+-- @name Cursor.commit
+-- @param config UCI config
+-- @return Boolean whether operation succeeded
+-- @see Cursor.revert
+-- @see Cursor.save
+
+--- Deletes a section or an option.
+-- @class function
+-- @name Cursor.delete
+-- @param config UCI config
+-- @param section UCI section name
+-- @param option UCI option (optional)
+-- @return Boolean whether operation succeeded
+
+--- Call a function for every section of a certain type.
+-- @class function
+-- @name Cursor.foreach
+-- @param config UCI config
+-- @param type UCI section type
+-- @param callback Function to be called
+-- @return Boolean whether operation succeeded
+
+--- Get a section type or an option
+-- @class function
+-- @name Cursor.get
+-- @param config UCI config
+-- @param section UCI section name
+-- @param option UCI option (optional)
+-- @return UCI value
+
+--- Get all sections of a config or all values of a section.
+-- @class function
+-- @name Cursor.get_all
+-- @param config UCI config
+-- @param section UCI section name (optional)
+-- @return Table of UCI sections or table of UCI values
+
+--- Manually load a config.
+-- @class function
+-- @name Cursor.load
+-- @param config UCI config
+-- @return Boolean whether operation succeeded
+-- @see Cursor.save
+-- @see Cursor.unload
+
+--- Revert saved but uncommitted changes.
+-- @class function
+-- @name Cursor.revert
+-- @param config UCI config
+-- @return Boolean whether operation succeeded
+-- @see Cursor.commit
+-- @see Cursor.save
+
+--- Saves changes made to a config to make them committable.
+-- @class function
+-- @name Cursor.save
+-- @param config UCI config
+-- @return Boolean whether operation succeeded
+-- @see Cursor.load
+-- @see Cursor.unload
+
+--- Set a value or create a named section.
+-- @class function
+-- @name Cursor.set
+-- @param config UCI config
+-- @param section UCI section name
+-- @param option UCI option or UCI section type
+-- @param value UCI value or nil if you want to create a section
+-- @return Boolean whether operation succeeded
+
+--- Get the configuration directory.
+-- @class function
+-- @name Cursor.get_confdir
+-- @return Configuration directory
+
+--- Get the directory for uncomitted changes.
+-- @class function
+-- @name Cursor.get_savedir
+-- @return Save directory
+
+--- Set the configuration directory.
+-- @class function
+-- @name Cursor.set_confdir
+-- @param directory UCI configuration directory
+-- @return Boolean whether operation succeeded
+
+--- Set the directory for uncommited changes.
+-- @class function
+-- @name Cursor.set_savedir
+-- @param directory UCI changes directory
+-- @return Boolean whether operation succeeded
+
+--- Discard changes made to a config.
+-- @class function
+-- @name Cursor.unload
+-- @param config UCI config
+-- @return Boolean whether operation succeeded
+-- @see Cursor.load
+-- @see Cursor.save
diff --git a/modules/base/luasrc/sgi/cgi.lua b/modules/base/luasrc/sgi/cgi.lua
new file mode 100644
index 000000000..04ae9aa59
--- /dev/null
+++ b/modules/base/luasrc/sgi/cgi.lua
@@ -0,0 +1,95 @@
+--[[
+LuCI - SGI-Module for CGI
+
+Description:
+Server Gateway Interface for CGI
+
+FileId:
+$Id$
+
+License:
+Copyright 2008 Steven Barth <steven@midlink.org>
+
+Licensed under the Apache License, Version 2.0 (the "License");
+you may not use this file except in compliance with the License.
+You may obtain a copy of the License at
+
+ http://www.apache.org/licenses/LICENSE-2.0
+
+Unless required by applicable law or agreed to in writing, software
+distributed under the License is distributed on an "AS IS" BASIS,
+WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+See the License for the specific language governing permissions and
+limitations under the License.
+
+]]--
+exectime = os.clock()
+module("luci.sgi.cgi", package.seeall)
+local ltn12 = require("luci.ltn12")
+require("nixio.util")
+require("luci.http")
+require("luci.sys")
+require("luci.dispatcher")
+
+-- Limited source to avoid endless blocking
+local function limitsource(handle, limit)
+ limit = limit or 0
+ local BLOCKSIZE = ltn12.BLOCKSIZE
+
+ return function()
+ if limit < 1 then
+ handle:close()
+ return nil
+ else
+ local read = (limit > BLOCKSIZE) and BLOCKSIZE or limit
+ limit = limit - read
+
+ local chunk = handle:read(read)
+ if not chunk then handle:close() end
+ return chunk
+ end
+ end
+end
+
+function run()
+ local r = luci.http.Request(
+ luci.sys.getenv(),
+ limitsource(io.stdin, tonumber(luci.sys.getenv("CONTENT_LENGTH"))),
+ ltn12.sink.file(io.stderr)
+ )
+
+ local x = coroutine.create(luci.dispatcher.httpdispatch)
+ local hcache = ""
+ local active = true
+
+ while coroutine.status(x) ~= "dead" do
+ local res, id, data1, data2 = coroutine.resume(x, r)
+
+ if not res then
+ print("Status: 500 Internal Server Error")
+ print("Content-Type: text/plain\n")
+ print(id)
+ break;
+ end
+
+ if active then
+ if id == 1 then
+ io.write("Status: " .. tostring(data1) .. " " .. data2 .. "\r\n")
+ elseif id == 2 then
+ hcache = hcache .. data1 .. ": " .. data2 .. "\r\n"
+ elseif id == 3 then
+ io.write(hcache)
+ io.write("\r\n")
+ elseif id == 4 then
+ io.write(tostring(data1 or ""))
+ elseif id == 5 then
+ io.flush()
+ io.close()
+ active = false
+ elseif id == 6 then
+ data1:copyz(nixio.stdout, data2)
+ data1:close()
+ end
+ end
+ end
+end
diff --git a/modules/base/luasrc/sgi/uhttpd.lua b/modules/base/luasrc/sgi/uhttpd.lua
new file mode 100644
index 000000000..db8780f7e
--- /dev/null
+++ b/modules/base/luasrc/sgi/uhttpd.lua
@@ -0,0 +1,105 @@
+--[[
+LuCI - Server Gateway Interface for the uHTTPd server
+
+Copyright 2010 Jo-Philipp Wich <xm@subsignal.org>
+
+Licensed under the Apache License, Version 2.0 (the "License");
+you may not use this file except in compliance with the License.
+You may obtain a copy of the License at
+
+ http://www.apache.org/licenses/LICENSE-2.0
+
+Unless required by applicable law or agreed to in writing, software
+distributed under the License is distributed on an "AS IS" BASIS,
+WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+See the License for the specific language governing permissions and
+limitations under the License.
+
+]]--
+
+require "nixio.util"
+require "luci.http"
+require "luci.sys"
+require "luci.dispatcher"
+require "luci.ltn12"
+
+function handle_request(env)
+ exectime = os.clock()
+ local renv = {
+ CONTENT_LENGTH = env.CONTENT_LENGTH,
+ CONTENT_TYPE = env.CONTENT_TYPE,
+ REQUEST_METHOD = env.REQUEST_METHOD,
+ REQUEST_URI = env.REQUEST_URI,
+ PATH_INFO = env.PATH_INFO,
+ SCRIPT_NAME = env.SCRIPT_NAME:gsub("/+$", ""),
+ SCRIPT_FILENAME = env.SCRIPT_NAME,
+ SERVER_PROTOCOL = env.SERVER_PROTOCOL,
+ QUERY_STRING = env.QUERY_STRING
+ }
+
+ local k, v
+ for k, v in pairs(env.headers) do
+ k = k:upper():gsub("%-", "_")
+ renv["HTTP_" .. k] = v
+ end
+
+ local len = tonumber(env.CONTENT_LENGTH) or 0
+ local function recv()
+ if len > 0 then
+ local rlen, rbuf = uhttpd.recv(4096)
+ if rlen >= 0 then
+ len = len - rlen
+ return rbuf
+ end
+ end
+ return nil
+ end
+
+ local send = uhttpd.send
+
+ local req = luci.http.Request(
+ renv, recv, luci.ltn12.sink.file(io.stderr)
+ )
+
+
+ local x = coroutine.create(luci.dispatcher.httpdispatch)
+ local hcache = { }
+ local active = true
+
+ while coroutine.status(x) ~= "dead" do
+ local res, id, data1, data2 = coroutine.resume(x, req)
+
+ if not res then
+ send("Status: 500 Internal Server Error\r\n")
+ send("Content-Type: text/plain\r\n\r\n")
+ send(tostring(id))
+ break
+ end
+
+ if active then
+ if id == 1 then
+ send("Status: ")
+ send(tostring(data1))
+ send(" ")
+ send(tostring(data2))
+ send("\r\n")
+ elseif id == 2 then
+ hcache[data1] = data2
+ elseif id == 3 then
+ for k, v in pairs(hcache) do
+ send(tostring(k))
+ send(": ")
+ send(tostring(v))
+ send("\r\n")
+ end
+ send("\r\n")
+ elseif id == 4 then
+ send(tostring(data1 or ""))
+ elseif id == 5 then
+ active = false
+ elseif id == 6 then
+ data1:copyz(nixio.stdout, data2)
+ end
+ end
+ end
+end
diff --git a/modules/base/luasrc/store.lua b/modules/base/luasrc/store.lua
new file mode 100644
index 000000000..c33ef07e1
--- /dev/null
+++ b/modules/base/luasrc/store.lua
@@ -0,0 +1,16 @@
+--[[
+
+LuCI - Lua Development Framework
+(c) 2009 Steven Barth <steven@midlink.org>
+(c) 2009 Jo-Philipp Wich <xm@leipzig.freifunk.net>
+
+Licensed under the Apache License, Version 2.0 (the "License");
+you may not use this file except in compliance with the License.
+You may obtain a copy of the License at
+
+ http://www.apache.org/licenses/LICENSE-2.0
+
+]]--
+
+local util = require "luci.util"
+module("luci.store", util.threadlocal) \ No newline at end of file
diff --git a/modules/base/luasrc/sys.lua b/modules/base/luasrc/sys.lua
new file mode 100644
index 000000000..df6280dda
--- /dev/null
+++ b/modules/base/luasrc/sys.lua
@@ -0,0 +1,961 @@
+--[[
+LuCI - System library
+
+Description:
+Utilities for interaction with the Linux system
+
+FileId:
+$Id$
+
+License:
+Copyright 2008 Steven Barth <steven@midlink.org>
+
+Licensed under the Apache License, Version 2.0 (the "License");
+you may not use this file except in compliance with the License.
+You may obtain a copy of the License at
+
+ http://www.apache.org/licenses/LICENSE-2.0
+
+Unless required by applicable law or agreed to in writing, software
+distributed under the License is distributed on an "AS IS" BASIS,
+WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+See the License for the specific language governing permissions and
+limitations under the License.
+
+]]--
+
+
+local io = require "io"
+local os = require "os"
+local table = require "table"
+local nixio = require "nixio"
+local fs = require "nixio.fs"
+local uci = require "luci.model.uci"
+
+local luci = {}
+luci.util = require "luci.util"
+luci.ip = require "luci.ip"
+
+local tonumber, ipairs, pairs, pcall, type, next, setmetatable, require, select =
+ tonumber, ipairs, pairs, pcall, type, next, setmetatable, require, select
+
+
+--- LuCI Linux and POSIX system utilities.
+module "luci.sys"
+
+--- Execute a given shell command and return the error code
+-- @class function
+-- @name call
+-- @param ... Command to call
+-- @return Error code of the command
+function call(...)
+ return os.execute(...) / 256
+end
+
+--- Execute a given shell command and capture its standard output
+-- @class function
+-- @name exec
+-- @param command Command to call
+-- @return String containg the return the output of the command
+exec = luci.util.exec
+
+--- Retrieve information about currently mounted file systems.
+-- @return Table containing mount information
+function mounts()
+ local data = {}
+ local k = {"fs", "blocks", "used", "available", "percent", "mountpoint"}
+ local ps = luci.util.execi("df")
+
+ if not ps then
+ return
+ else
+ ps()
+ end
+
+ for line in ps do
+ local row = {}
+
+ local j = 1
+ for value in line:gmatch("[^%s]+") do
+ row[k[j]] = value
+ j = j + 1
+ end
+
+ if row[k[1]] then
+
+ -- this is a rather ugly workaround to cope with wrapped lines in
+ -- the df output:
+ --
+ -- /dev/scsi/host0/bus0/target0/lun0/part3
+ -- 114382024 93566472 15005244 86% /mnt/usb
+ --
+
+ if not row[k[2]] then
+ j = 2
+ line = ps()
+ for value in line:gmatch("[^%s]+") do
+ row[k[j]] = value
+ j = j + 1
+ end
+ end
+
+ table.insert(data, row)
+ end
+ end
+
+ return data
+end
+
+--- Retrieve environment variables. If no variable is given then a table
+-- containing the whole environment is returned otherwise this function returns
+-- the corresponding string value for the given name or nil if no such variable
+-- exists.
+-- @class function
+-- @name getenv
+-- @param var Name of the environment variable to retrieve (optional)
+-- @return String containg the value of the specified variable
+-- @return Table containing all variables if no variable name is given
+getenv = nixio.getenv
+
+--- Get or set the current hostname.
+-- @param String containing a new hostname to set (optional)
+-- @return String containing the system hostname
+function hostname(newname)
+ if type(newname) == "string" and #newname > 0 then
+ fs.writefile( "/proc/sys/kernel/hostname", newname )
+ return newname
+ else
+ return nixio.uname().nodename
+ end
+end
+
+--- Returns the contents of a documented referred by an URL.
+-- @param url The URL to retrieve
+-- @param stream Return a stream instead of a buffer
+-- @param target Directly write to target file name
+-- @return String containing the contents of given the URL
+function httpget(url, stream, target)
+ if not target then
+ local source = stream and io.popen or luci.util.exec
+ return source("wget -qO- '"..url:gsub("'", "").."'")
+ else
+ return os.execute("wget -qO '%s' '%s'" %
+ {target:gsub("'", ""), url:gsub("'", "")})
+ end
+end
+
+--- Returns the system load average values.
+-- @return String containing the average load value 1 minute ago
+-- @return String containing the average load value 5 minutes ago
+-- @return String containing the average load value 15 minutes ago
+function loadavg()
+ local info = nixio.sysinfo()
+ return info.loads[1], info.loads[2], info.loads[3]
+end
+
+--- Initiate a system reboot.
+-- @return Return value of os.execute()
+function reboot()
+ return os.execute("reboot >/dev/null 2>&1")
+end
+
+--- Returns the system type, cpu name and installed physical memory.
+-- @return String containing the system or platform identifier
+-- @return String containing hardware model information
+-- @return String containing the total memory amount in kB
+-- @return String containing the memory used for caching in kB
+-- @return String containing the memory used for buffering in kB
+-- @return String containing the free memory amount in kB
+-- @return String containing the cpu bogomips (number)
+function sysinfo()
+ local cpuinfo = fs.readfile("/proc/cpuinfo")
+ local meminfo = fs.readfile("/proc/meminfo")
+
+ local memtotal = tonumber(meminfo:match("MemTotal:%s*(%d+)"))
+ local memcached = tonumber(meminfo:match("\nCached:%s*(%d+)"))
+ local memfree = tonumber(meminfo:match("MemFree:%s*(%d+)"))
+ local membuffers = tonumber(meminfo:match("Buffers:%s*(%d+)"))
+ local bogomips = tonumber(cpuinfo:match("[Bb]ogo[Mm][Ii][Pp][Ss].-: ([^\n]+)")) or 0
+ local swaptotal = tonumber(meminfo:match("SwapTotal:%s*(%d+)"))
+ local swapcached = tonumber(meminfo:match("SwapCached:%s*(%d+)"))
+ local swapfree = tonumber(meminfo:match("SwapFree:%s*(%d+)"))
+
+ local system =
+ cpuinfo:match("system type\t+: ([^\n]+)") or
+ cpuinfo:match("Processor\t+: ([^\n]+)") or
+ cpuinfo:match("model name\t+: ([^\n]+)")
+
+ local model =
+ luci.util.pcdata(fs.readfile("/tmp/sysinfo/model")) or
+ cpuinfo:match("machine\t+: ([^\n]+)") or
+ cpuinfo:match("Hardware\t+: ([^\n]+)") or
+ luci.util.pcdata(fs.readfile("/proc/diag/model")) or
+ nixio.uname().machine or
+ system
+
+ return system, model, memtotal, memcached, membuffers, memfree, bogomips, swaptotal, swapcached, swapfree
+end
+
+--- Retrieves the output of the "logread" command.
+-- @return String containing the current log buffer
+function syslog()
+ return luci.util.exec("logread")
+end
+
+--- Retrieves the output of the "dmesg" command.
+-- @return String containing the current log buffer
+function dmesg()
+ return luci.util.exec("dmesg")
+end
+
+--- Generates a random id with specified length.
+-- @param bytes Number of bytes for the unique id
+-- @return String containing hex encoded id
+function uniqueid(bytes)
+ local rand = fs.readfile("/dev/urandom", bytes)
+ return rand and nixio.bin.hexlify(rand)
+end
+
+--- Returns the current system uptime stats.
+-- @return String containing total uptime in seconds
+function uptime()
+ return nixio.sysinfo().uptime
+end
+
+
+--- LuCI system utilities / network related functions.
+-- @class module
+-- @name luci.sys.net
+net = {}
+
+--- Returns the current arp-table entries as two-dimensional table.
+-- @return Table of table containing the current arp entries.
+-- The following fields are defined for arp entry objects:
+-- { "IP address", "HW address", "HW type", "Flags", "Mask", "Device" }
+function net.arptable(callback)
+ local arp = (not callback) and {} or nil
+ local e, r, v
+ if fs.access("/proc/net/arp") then
+ for e in io.lines("/proc/net/arp") do
+ local r = { }, v
+ for v in e:gmatch("%S+") do
+ r[#r+1] = v
+ end
+
+ if r[1] ~= "IP" then
+ local x = {
+ ["IP address"] = r[1],
+ ["HW type"] = r[2],
+ ["Flags"] = r[3],
+ ["HW address"] = r[4],
+ ["Mask"] = r[5],
+ ["Device"] = r[6]
+ }
+
+ if callback then
+ callback(x)
+ else
+ arp = arp or { }
+ arp[#arp+1] = x
+ end
+ end
+ end
+ end
+ return arp
+end
+
+local function _nethints(what, callback)
+ local _, k, e, mac, ip, name
+ local cur = uci.cursor()
+ local ifn = { }
+ local hosts = { }
+
+ local function _add(i, ...)
+ local k = select(i, ...)
+ if k then
+ if not hosts[k] then hosts[k] = { } end
+ hosts[k][1] = select(1, ...) or hosts[k][1]
+ hosts[k][2] = select(2, ...) or hosts[k][2]
+ hosts[k][3] = select(3, ...) or hosts[k][3]
+ hosts[k][4] = select(4, ...) or hosts[k][4]
+ end
+ end
+
+ if fs.access("/proc/net/arp") then
+ for e in io.lines("/proc/net/arp") do
+ ip, mac = e:match("^([%d%.]+)%s+%S+%s+%S+%s+([a-fA-F0-9:]+)%s+")
+ if ip and mac then
+ _add(what, mac:upper(), ip, nil, nil)
+ end
+ end
+ end
+
+ if fs.access("/etc/ethers") then
+ for e in io.lines("/etc/ethers") do
+ mac, ip = e:match("^([a-f0-9]%S+) (%S+)")
+ if mac and ip then
+ _add(what, mac:upper(), ip, nil, nil)
+ end
+ end
+ end
+
+ if fs.access("/var/dhcp.leases") then
+ for e in io.lines("/var/dhcp.leases") do
+ mac, ip, name = e:match("^%d+ (%S+) (%S+) (%S+)")
+ if mac and ip then
+ _add(what, mac:upper(), ip, nil, name ~= "*" and name)
+ end
+ end
+ end
+
+ cur:foreach("dhcp", "host",
+ function(s)
+ for mac in luci.util.imatch(s.mac) do
+ _add(what, mac:upper(), s.ip, nil, s.name)
+ end
+ end)
+
+ for _, e in ipairs(nixio.getifaddrs()) do
+ if e.name ~= "lo" then
+ ifn[e.name] = ifn[e.name] or { }
+ if e.family == "packet" and e.addr and #e.addr == 17 then
+ ifn[e.name][1] = e.addr:upper()
+ elseif e.family == "inet" then
+ ifn[e.name][2] = e.addr
+ elseif e.family == "inet6" then
+ ifn[e.name][3] = e.addr
+ end
+ end
+ end
+
+ for _, e in pairs(ifn) do
+ if e[what] and (e[2] or e[3]) then
+ _add(what, e[1], e[2], e[3], e[4])
+ end
+ end
+
+ for _, e in luci.util.kspairs(hosts) do
+ callback(e[1], e[2], e[3], e[4])
+ end
+end
+
+--- Returns a two-dimensional table of mac address hints.
+-- @return Table of table containing known hosts from various sources.
+-- Each entry contains the values in the following order:
+-- [ "mac", "name" ]
+function net.mac_hints(callback)
+ if callback then
+ _nethints(1, function(mac, v4, v6, name)
+ name = name or nixio.getnameinfo(v4 or v6, nil, 100) or v4
+ if name and name ~= mac then
+ callback(mac, name or nixio.getnameinfo(v4 or v6, nil, 100) or v4)
+ end
+ end)
+ else
+ local rv = { }
+ _nethints(1, function(mac, v4, v6, name)
+ name = name or nixio.getnameinfo(v4 or v6, nil, 100) or v4
+ if name and name ~= mac then
+ rv[#rv+1] = { mac, name or nixio.getnameinfo(v4 or v6, nil, 100) or v4 }
+ end
+ end)
+ return rv
+ end
+end
+
+--- Returns a two-dimensional table of IPv4 address hints.
+-- @return Table of table containing known hosts from various sources.
+-- Each entry contains the values in the following order:
+-- [ "ip", "name" ]
+function net.ipv4_hints(callback)
+ if callback then
+ _nethints(2, function(mac, v4, v6, name)
+ name = name or nixio.getnameinfo(v4, nil, 100) or mac
+ if name and name ~= v4 then
+ callback(v4, name)
+ end
+ end)
+ else
+ local rv = { }
+ _nethints(2, function(mac, v4, v6, name)
+ name = name or nixio.getnameinfo(v4, nil, 100) or mac
+ if name and name ~= v4 then
+ rv[#rv+1] = { v4, name }
+ end
+ end)
+ return rv
+ end
+end
+
+--- Returns a two-dimensional table of IPv6 address hints.
+-- @return Table of table containing known hosts from various sources.
+-- Each entry contains the values in the following order:
+-- [ "ip", "name" ]
+function net.ipv6_hints(callback)
+ if callback then
+ _nethints(3, function(mac, v4, v6, name)
+ name = name or nixio.getnameinfo(v6, nil, 100) or mac
+ if name and name ~= v6 then
+ callback(v6, name)
+ end
+ end)
+ else
+ local rv = { }
+ _nethints(3, function(mac, v4, v6, name)
+ name = name or nixio.getnameinfo(v6, nil, 100) or mac
+ if name and name ~= v6 then
+ rv[#rv+1] = { v6, name }
+ end
+ end)
+ return rv
+ end
+end
+
+--- Returns conntrack information
+-- @return Table with the currently tracked IP connections
+function net.conntrack(callback)
+ local connt = {}
+ if fs.access("/proc/net/nf_conntrack", "r") then
+ for line in io.lines("/proc/net/nf_conntrack") do
+ line = line:match "^(.-( [^ =]+=).-)%2"
+ local entry, flags = _parse_mixed_record(line, " +")
+ if flags[6] ~= "TIME_WAIT" then
+ entry.layer3 = flags[1]
+ entry.layer4 = flags[3]
+ for i=1, #entry do
+ entry[i] = nil
+ end
+
+ if callback then
+ callback(entry)
+ else
+ connt[#connt+1] = entry
+ end
+ end
+ end
+ elseif fs.access("/proc/net/ip_conntrack", "r") then
+ for line in io.lines("/proc/net/ip_conntrack") do
+ line = line:match "^(.-( [^ =]+=).-)%2"
+ local entry, flags = _parse_mixed_record(line, " +")
+ if flags[4] ~= "TIME_WAIT" then
+ entry.layer3 = "ipv4"
+ entry.layer4 = flags[1]
+ for i=1, #entry do
+ entry[i] = nil
+ end
+
+ if callback then
+ callback(entry)
+ else
+ connt[#connt+1] = entry
+ end
+ end
+ end
+ else
+ return nil
+ end
+ return connt
+end
+
+--- Determine the current IPv4 default route. If multiple default routes exist,
+-- return the one with the lowest metric.
+-- @return Table with the properties of the current default route.
+-- The following fields are defined:
+-- { "dest", "gateway", "metric", "refcount", "usecount", "irtt",
+-- "flags", "device" }
+function net.defaultroute()
+ local route
+
+ net.routes(function(rt)
+ if rt.dest:prefix() == 0 and (not route or route.metric > rt.metric) then
+ route = rt
+ end
+ end)
+
+ return route
+end
+
+--- Determine the current IPv6 default route. If multiple default routes exist,
+-- return the one with the lowest metric.
+-- @return Table with the properties of the current default route.
+-- The following fields are defined:
+-- { "source", "dest", "nexthop", "metric", "refcount", "usecount",
+-- "flags", "device" }
+function net.defaultroute6()
+ local route
+
+ net.routes6(function(rt)
+ if rt.dest:prefix() == 0 and rt.device ~= "lo" and
+ (not route or route.metric > rt.metric)
+ then
+ route = rt
+ end
+ end)
+
+ if not route then
+ local global_unicast = luci.ip.IPv6("2000::/3")
+ net.routes6(function(rt)
+ if rt.dest:equal(global_unicast) and
+ (not route or route.metric > rt.metric)
+ then
+ route = rt
+ end
+ end)
+ end
+
+ return route
+end
+
+--- Determine the names of available network interfaces.
+-- @return Table containing all current interface names
+function net.devices()
+ local devs = {}
+ for k, v in ipairs(nixio.getifaddrs()) do
+ if v.family == "packet" then
+ devs[#devs+1] = v.name
+ end
+ end
+ return devs
+end
+
+
+--- Return information about available network interfaces.
+-- @return Table containing all current interface names and their information
+function net.deviceinfo()
+ local devs = {}
+ for k, v in ipairs(nixio.getifaddrs()) do
+ if v.family == "packet" then
+ local d = v.data
+ d[1] = d.rx_bytes
+ d[2] = d.rx_packets
+ d[3] = d.rx_errors
+ d[4] = d.rx_dropped
+ d[5] = 0
+ d[6] = 0
+ d[7] = 0
+ d[8] = d.multicast
+ d[9] = d.tx_bytes
+ d[10] = d.tx_packets
+ d[11] = d.tx_errors
+ d[12] = d.tx_dropped
+ d[13] = 0
+ d[14] = d.collisions
+ d[15] = 0
+ d[16] = 0
+ devs[v.name] = d
+ end
+ end
+ return devs
+end
+
+
+-- Determine the MAC address belonging to the given IP address.
+-- @param ip IPv4 address
+-- @return String containing the MAC address or nil if it cannot be found
+function net.ip4mac(ip)
+ local mac = nil
+ net.arptable(function(e)
+ if e["IP address"] == ip then
+ mac = e["HW address"]
+ end
+ end)
+ return mac
+end
+
+--- Returns the current kernel routing table entries.
+-- @return Table of tables with properties of the corresponding routes.
+-- The following fields are defined for route entry tables:
+-- { "dest", "gateway", "metric", "refcount", "usecount", "irtt",
+-- "flags", "device" }
+function net.routes(callback)
+ local routes = { }
+
+ for line in io.lines("/proc/net/route") do
+
+ local dev, dst_ip, gateway, flags, refcnt, usecnt, metric,
+ dst_mask, mtu, win, irtt = line:match(
+ "([^%s]+)\t([A-F0-9]+)\t([A-F0-9]+)\t([A-F0-9]+)\t" ..
+ "(%d+)\t(%d+)\t(%d+)\t([A-F0-9]+)\t(%d+)\t(%d+)\t(%d+)"
+ )
+
+ if dev then
+ gateway = luci.ip.Hex( gateway, 32, luci.ip.FAMILY_INET4 )
+ dst_mask = luci.ip.Hex( dst_mask, 32, luci.ip.FAMILY_INET4 )
+ dst_ip = luci.ip.Hex(
+ dst_ip, dst_mask:prefix(dst_mask), luci.ip.FAMILY_INET4
+ )
+
+ local rt = {
+ dest = dst_ip,
+ gateway = gateway,
+ metric = tonumber(metric),
+ refcount = tonumber(refcnt),
+ usecount = tonumber(usecnt),
+ mtu = tonumber(mtu),
+ window = tonumber(window),
+ irtt = tonumber(irtt),
+ flags = tonumber(flags, 16),
+ device = dev
+ }
+
+ if callback then
+ callback(rt)
+ else
+ routes[#routes+1] = rt
+ end
+ end
+ end
+
+ return routes
+end
+
+--- Returns the current ipv6 kernel routing table entries.
+-- @return Table of tables with properties of the corresponding routes.
+-- The following fields are defined for route entry tables:
+-- { "source", "dest", "nexthop", "metric", "refcount", "usecount",
+-- "flags", "device" }
+function net.routes6(callback)
+ if fs.access("/proc/net/ipv6_route", "r") then
+ local routes = { }
+
+ for line in io.lines("/proc/net/ipv6_route") do
+
+ local dst_ip, dst_prefix, src_ip, src_prefix, nexthop,
+ metric, refcnt, usecnt, flags, dev = line:match(
+ "([a-f0-9]+) ([a-f0-9]+) " ..
+ "([a-f0-9]+) ([a-f0-9]+) " ..
+ "([a-f0-9]+) ([a-f0-9]+) " ..
+ "([a-f0-9]+) ([a-f0-9]+) " ..
+ "([a-f0-9]+) +([^%s]+)"
+ )
+
+ if dst_ip and dst_prefix and
+ src_ip and src_prefix and
+ nexthop and metric and
+ refcnt and usecnt and
+ flags and dev
+ then
+ src_ip = luci.ip.Hex(
+ src_ip, tonumber(src_prefix, 16), luci.ip.FAMILY_INET6, false
+ )
+
+ dst_ip = luci.ip.Hex(
+ dst_ip, tonumber(dst_prefix, 16), luci.ip.FAMILY_INET6, false
+ )
+
+ nexthop = luci.ip.Hex( nexthop, 128, luci.ip.FAMILY_INET6, false )
+
+ local rt = {
+ source = src_ip,
+ dest = dst_ip,
+ nexthop = nexthop,
+ metric = tonumber(metric, 16),
+ refcount = tonumber(refcnt, 16),
+ usecount = tonumber(usecnt, 16),
+ flags = tonumber(flags, 16),
+ device = dev,
+
+ -- lua number is too small for storing the metric
+ -- add a metric_raw field with the original content
+ metric_raw = metric
+ }
+
+ if callback then
+ callback(rt)
+ else
+ routes[#routes+1] = rt
+ end
+ end
+ end
+
+ return routes
+ end
+end
+
+--- Tests whether the given host responds to ping probes.
+-- @param host String containing a hostname or IPv4 address
+-- @return Number containing 0 on success and >= 1 on error
+function net.pingtest(host)
+ return os.execute("ping -c1 '"..host:gsub("'", '').."' >/dev/null 2>&1")
+end
+
+
+--- LuCI system utilities / process related functions.
+-- @class module
+-- @name luci.sys.process
+process = {}
+
+--- Get the current process id.
+-- @class function
+-- @name process.info
+-- @return Number containing the current pid
+function process.info(key)
+ local s = {uid = nixio.getuid(), gid = nixio.getgid()}
+ return not key and s or s[key]
+end
+
+--- Retrieve information about currently running processes.
+-- @return Table containing process information
+function process.list()
+ local data = {}
+ local k
+ local ps = luci.util.execi("/bin/busybox top -bn1")
+
+ if not ps then
+ return
+ end
+
+ for line in ps do
+ local pid, ppid, user, stat, vsz, mem, cpu, cmd = line:match(
+ "^ *(%d+) +(%d+) +(%S.-%S) +([RSDZTW][W ][<N ]) +(%d+) +(%d+%%) +(%d+%%) +(.+)"
+ )
+
+ local idx = tonumber(pid)
+ if idx then
+ data[idx] = {
+ ['PID'] = pid,
+ ['PPID'] = ppid,
+ ['USER'] = user,
+ ['STAT'] = stat,
+ ['VSZ'] = vsz,
+ ['%MEM'] = mem,
+ ['%CPU'] = cpu,
+ ['COMMAND'] = cmd
+ }
+ end
+ end
+
+ return data
+end
+
+--- Set the gid of a process identified by given pid.
+-- @param gid Number containing the Unix group id
+-- @return Boolean indicating successful operation
+-- @return String containing the error message if failed
+-- @return Number containing the error code if failed
+function process.setgroup(gid)
+ return nixio.setgid(gid)
+end
+
+--- Set the uid of a process identified by given pid.
+-- @param uid Number containing the Unix user id
+-- @return Boolean indicating successful operation
+-- @return String containing the error message if failed
+-- @return Number containing the error code if failed
+function process.setuser(uid)
+ return nixio.setuid(uid)
+end
+
+--- Send a signal to a process identified by given pid.
+-- @class function
+-- @name process.signal
+-- @param pid Number containing the process id
+-- @param sig Signal to send (default: 15 [SIGTERM])
+-- @return Boolean indicating successful operation
+-- @return Number containing the error code if failed
+process.signal = nixio.kill
+
+
+--- LuCI system utilities / user related functions.
+-- @class module
+-- @name luci.sys.user
+user = {}
+
+--- Retrieve user informations for given uid.
+-- @class function
+-- @name getuser
+-- @param uid Number containing the Unix user id
+-- @return Table containing the following fields:
+-- { "uid", "gid", "name", "passwd", "dir", "shell", "gecos" }
+user.getuser = nixio.getpw
+
+--- Retrieve the current user password hash.
+-- @param username String containing the username to retrieve the password for
+-- @return String containing the hash or nil if no password is set.
+-- @return Password database entry
+function user.getpasswd(username)
+ local pwe = nixio.getsp and nixio.getsp(username) or nixio.getpw(username)
+ local pwh = pwe and (pwe.pwdp or pwe.passwd)
+ if not pwh or #pwh < 1 or pwh == "!" or pwh == "x" then
+ return nil, pwe
+ else
+ return pwh, pwe
+ end
+end
+
+--- Test whether given string matches the password of a given system user.
+-- @param username String containing the Unix user name
+-- @param pass String containing the password to compare
+-- @return Boolean indicating wheather the passwords are equal
+function user.checkpasswd(username, pass)
+ local pwh, pwe = user.getpasswd(username)
+ if pwe then
+ return (pwh == nil or nixio.crypt(pass, pwh) == pwh)
+ end
+ return false
+end
+
+--- Change the password of given user.
+-- @param username String containing the Unix user name
+-- @param password String containing the password to compare
+-- @return Number containing 0 on success and >= 1 on error
+function user.setpasswd(username, password)
+ if password then
+ password = password:gsub("'", [['"'"']])
+ end
+
+ if username then
+ username = username:gsub("'", [['"'"']])
+ end
+
+ return os.execute(
+ "(echo '" .. password .. "'; sleep 1; echo '" .. password .. "') | " ..
+ "passwd '" .. username .. "' >/dev/null 2>&1"
+ )
+end
+
+
+--- LuCI system utilities / wifi related functions.
+-- @class module
+-- @name luci.sys.wifi
+wifi = {}
+
+--- Get wireless information for given interface.
+-- @param ifname String containing the interface name
+-- @return A wrapped iwinfo object instance
+function wifi.getiwinfo(ifname)
+ local stat, iwinfo = pcall(require, "iwinfo")
+
+ if ifname then
+ local c = 0
+ local u = uci.cursor_state()
+ local d, n = ifname:match("^(%w+)%.network(%d+)")
+ if d and n then
+ ifname = d
+ n = tonumber(n)
+ u:foreach("wireless", "wifi-iface",
+ function(s)
+ if s.device == d then
+ c = c + 1
+ if c == n then
+ ifname = s.ifname or s.device
+ return false
+ end
+ end
+ end)
+ elseif u:get("wireless", ifname) == "wifi-device" then
+ u:foreach("wireless", "wifi-iface",
+ function(s)
+ if s.device == ifname and s.ifname then
+ ifname = s.ifname
+ return false
+ end
+ end)
+ end
+
+ local t = stat and iwinfo.type(ifname)
+ local x = t and iwinfo[t] or { }
+ return setmetatable({}, {
+ __index = function(t, k)
+ if k == "ifname" then
+ return ifname
+ elseif x[k] then
+ return x[k](ifname)
+ end
+ end
+ })
+ end
+end
+
+
+--- LuCI system utilities / init related functions.
+-- @class module
+-- @name luci.sys.init
+init = {}
+init.dir = "/etc/init.d/"
+
+--- Get the names of all installed init scripts
+-- @return Table containing the names of all inistalled init scripts
+function init.names()
+ local names = { }
+ for name in fs.glob(init.dir.."*") do
+ names[#names+1] = fs.basename(name)
+ end
+ return names
+end
+
+--- Get the index of he given init script
+-- @param name Name of the init script
+-- @return Numeric index value
+function init.index(name)
+ if fs.access(init.dir..name) then
+ return call("env -i sh -c 'source %s%s enabled; exit ${START:-255}' >/dev/null"
+ %{ init.dir, name })
+ end
+end
+
+local function init_action(action, name)
+ if fs.access(init.dir..name) then
+ return call("env -i %s%s %s >/dev/null" %{ init.dir, name, action })
+ end
+end
+
+--- Test whether the given init script is enabled
+-- @param name Name of the init script
+-- @return Boolean indicating whether init is enabled
+function init.enabled(name)
+ return (init_action("enabled", name) == 0)
+end
+
+--- Enable the given init script
+-- @param name Name of the init script
+-- @return Boolean indicating success
+function init.enable(name)
+ return (init_action("enable", name) == 1)
+end
+
+--- Disable the given init script
+-- @param name Name of the init script
+-- @return Boolean indicating success
+function init.disable(name)
+ return (init_action("disable", name) == 0)
+end
+
+--- Start the given init script
+-- @param name Name of the init script
+-- @return Boolean indicating success
+function init.start(name)
+ return (init_action("start", name) == 0)
+end
+
+--- Stop the given init script
+-- @param name Name of the init script
+-- @return Boolean indicating success
+function init.stop(name)
+ return (init_action("stop", name) == 0)
+end
+
+
+-- Internal functions
+
+function _parse_mixed_record(cnt, delimiter)
+ delimiter = delimiter or " "
+ local data = {}
+ local flags = {}
+
+ for i, l in pairs(luci.util.split(luci.util.trim(cnt), "\n")) do
+ for j, f in pairs(luci.util.split(luci.util.trim(l), delimiter, nil, true)) do
+ local k, x, v = f:match('([^%s][^:=]*) *([:=]*) *"*([^\n"]*)"*')
+
+ if k then
+ if x == "" then
+ table.insert(flags, k)
+ else
+ data[k] = v
+ end
+ end
+ end
+ end
+
+ return data, flags
+end
diff --git a/modules/base/luasrc/sys/iptparser.lua b/modules/base/luasrc/sys/iptparser.lua
new file mode 100644
index 000000000..d82363309
--- /dev/null
+++ b/modules/base/luasrc/sys/iptparser.lua
@@ -0,0 +1,373 @@
+--[[
+
+Iptables parser and query library
+(c) 2008-2009 Jo-Philipp Wich <xm@leipzig.freifunk.net>
+(c) 2008-2009 Steven Barth <steven@midlink.org>
+
+Licensed under the Apache License, Version 2.0 (the "License");
+you may not use this file except in compliance with the License.
+You may obtain a copy of the License at
+
+ http://www.apache.org/licenses/LICENSE-2.0
+
+$Id$
+
+]]--
+
+local luci = {}
+luci.util = require "luci.util"
+luci.sys = require "luci.sys"
+luci.ip = require "luci.ip"
+
+local tonumber, ipairs, table = tonumber, ipairs, table
+
+--- LuCI iptables parser and query library
+-- @cstyle instance
+module("luci.sys.iptparser")
+
+--- Create a new iptables parser object.
+-- @class function
+-- @name IptParser
+-- @param family Number specifying the address family. 4 for IPv4, 6 for IPv6
+-- @return IptParser instance
+IptParser = luci.util.class()
+
+function IptParser.__init__( self, family )
+ self._family = (tonumber(family) == 6) and 6 or 4
+ self._rules = { }
+ self._chains = { }
+
+ if self._family == 4 then
+ self._nulladdr = "0.0.0.0/0"
+ self._tables = { "filter", "nat", "mangle", "raw" }
+ self._command = "iptables -t %s --line-numbers -nxvL"
+ else
+ self._nulladdr = "::/0"
+ self._tables = { "filter", "mangle", "raw" }
+ self._command = "ip6tables -t %s --line-numbers -nxvL"
+ end
+
+ self:_parse_rules()
+end
+
+--- Find all firewall rules that match the given criteria. Expects a table with
+-- search criteria as only argument. If args is nil or an empty table then all
+-- rules will be returned.
+--
+-- The following keys in the args table are recognized:
+-- <ul>
+-- <li> table - Match rules that are located within the given table
+-- <li> chain - Match rules that are located within the given chain
+-- <li> target - Match rules with the given target
+-- <li> protocol - Match rules that match the given protocol, rules with
+-- protocol "all" are always matched
+-- <li> source - Match rules with the given source, rules with source
+-- "0.0.0.0/0" (::/0) are always matched
+-- <li> destination - Match rules with the given destination, rules with
+-- destination "0.0.0.0/0" (::/0) are always matched
+-- <li> inputif - Match rules with the given input interface, rules
+-- with input interface "*" (=all) are always matched
+-- <li> outputif - Match rules with the given output interface, rules
+-- with output interface "*" (=all) are always matched
+-- <li> flags - Match rules that match the given flags, current
+-- supported values are "-f" (--fragment)
+-- and "!f" (! --fragment)
+-- <li> options - Match rules containing all given options
+-- </ul>
+-- The return value is a list of tables representing the matched rules.
+-- Each rule table contains the following fields:
+-- <ul>
+-- <li> index - The index number of the rule
+-- <li> table - The table where the rule is located, can be one
+-- of "filter", "nat" or "mangle"
+-- <li> chain - The chain where the rule is located, e.g. "INPUT"
+-- or "postrouting_wan"
+-- <li> target - The rule target, e.g. "REJECT" or "DROP"
+-- <li> protocol The matching protocols, e.g. "all" or "tcp"
+-- <li> flags - Special rule options ("--", "-f" or "!f")
+-- <li> inputif - Input interface of the rule, e.g. "eth0.0"
+-- or "*" for all interfaces
+-- <li> outputif - Output interface of the rule,e.g. "eth0.0"
+-- or "*" for all interfaces
+-- <li> source - The source ip range, e.g. "0.0.0.0/0" (::/0)
+-- <li> destination - The destination ip range, e.g. "0.0.0.0/0" (::/0)
+-- <li> options - A list of specific options of the rule,
+-- e.g. { "reject-with", "tcp-reset" }
+-- <li> packets - The number of packets matched by the rule
+-- <li> bytes - The number of total bytes matched by the rule
+-- </ul>
+-- Example:
+-- <pre>
+-- ip = luci.sys.iptparser.IptParser()
+-- result = ip.find( {
+-- target="REJECT",
+-- protocol="tcp",
+-- options={ "reject-with", "tcp-reset" }
+-- } )
+-- </pre>
+-- This will match all rules with target "-j REJECT",
+-- protocol "-p tcp" (or "-p all")
+-- and the option "--reject-with tcp-reset".
+-- @params args Table containing the search arguments (optional)
+-- @return Table of matching rule tables
+function IptParser.find( self, args )
+
+ local args = args or { }
+ local rv = { }
+
+ args.source = args.source and self:_parse_addr(args.source)
+ args.destination = args.destination and self:_parse_addr(args.destination)
+
+ for i, rule in ipairs(self._rules) do
+ local match = true
+
+ -- match table
+ if not ( not args.table or args.table:lower() == rule.table ) then
+ match = false
+ end
+
+ -- match chain
+ if not ( match == true and (
+ not args.chain or args.chain == rule.chain
+ ) ) then
+ match = false
+ end
+
+ -- match target
+ if not ( match == true and (
+ not args.target or args.target == rule.target
+ ) ) then
+ match = false
+ end
+
+ -- match protocol
+ if not ( match == true and (
+ not args.protocol or rule.protocol == "all" or
+ args.protocol:lower() == rule.protocol
+ ) ) then
+ match = false
+ end
+
+ -- match source
+ if not ( match == true and (
+ not args.source or rule.source == self._nulladdr or
+ self:_parse_addr(rule.source):contains(args.source)
+ ) ) then
+ match = false
+ end
+
+ -- match destination
+ if not ( match == true and (
+ not args.destination or rule.destination == self._nulladdr or
+ self:_parse_addr(rule.destination):contains(args.destination)
+ ) ) then
+ match = false
+ end
+
+ -- match input interface
+ if not ( match == true and (
+ not args.inputif or rule.inputif == "*" or
+ args.inputif == rule.inputif
+ ) ) then
+ match = false
+ end
+
+ -- match output interface
+ if not ( match == true and (
+ not args.outputif or rule.outputif == "*" or
+ args.outputif == rule.outputif
+ ) ) then
+ match = false
+ end
+
+ -- match flags (the "opt" column)
+ if not ( match == true and (
+ not args.flags or rule.flags == args.flags
+ ) ) then
+ match = false
+ end
+
+ -- match specific options
+ if not ( match == true and (
+ not args.options or
+ self:_match_options( rule.options, args.options )
+ ) ) then
+ match = false
+ end
+
+ -- insert match
+ if match == true then
+ rv[#rv+1] = rule
+ end
+ end
+
+ return rv
+end
+
+
+--- Rebuild the internal lookup table, for example when rules have changed
+-- through external commands.
+-- @return nothing
+function IptParser.resync( self )
+ self._rules = { }
+ self._chain = nil
+ self:_parse_rules()
+end
+
+
+--- Find the names of all tables.
+-- @return Table of table names.
+function IptParser.tables( self )
+ return self._tables
+end
+
+
+--- Find the names of all chains within the given table name.
+-- @param table String containing the table name
+-- @return Table of chain names in the order they occur.
+function IptParser.chains( self, table )
+ local lookup = { }
+ local chains = { }
+ for _, r in ipairs(self:find({table=table})) do
+ if not lookup[r.chain] then
+ lookup[r.chain] = true
+ chains[#chains+1] = r.chain
+ end
+ end
+ return chains
+end
+
+
+--- Return the given firewall chain within the given table name.
+-- @param table String containing the table name
+-- @param chain String containing the chain name
+-- @return Table containing the fields "policy", "packets", "bytes"
+-- and "rules". The "rules" field is a table of rule tables.
+function IptParser.chain( self, table, chain )
+ return self._chains[table:lower()] and self._chains[table:lower()][chain]
+end
+
+
+--- Test whether the given target points to a custom chain.
+-- @param target String containing the target action
+-- @return Boolean indicating whether target is a custom chain.
+function IptParser.is_custom_target( self, target )
+ for _, r in ipairs(self._rules) do
+ if r.chain == target then
+ return true
+ end
+ end
+ return false
+end
+
+
+-- [internal] Parse address according to family.
+function IptParser._parse_addr( self, addr )
+ if self._family == 4 then
+ return luci.ip.IPv4(addr)
+ else
+ return luci.ip.IPv6(addr)
+ end
+end
+
+-- [internal] Parse iptables output from all tables.
+function IptParser._parse_rules( self )
+
+ for i, tbl in ipairs(self._tables) do
+
+ self._chains[tbl] = { }
+
+ for i, rule in ipairs(luci.util.execl(self._command % tbl)) do
+
+ if rule:find( "^Chain " ) == 1 then
+
+ local crefs
+ local cname, cpol, cpkt, cbytes = rule:match(
+ "^Chain ([^%s]*) %(policy (%w+) " ..
+ "(%d+) packets, (%d+) bytes%)"
+ )
+
+ if not cname then
+ cname, crefs = rule:match(
+ "^Chain ([^%s]*) %((%d+) references%)"
+ )
+ end
+
+ self._chain = cname
+ self._chains[tbl][cname] = {
+ policy = cpol,
+ packets = tonumber(cpkt or 0),
+ bytes = tonumber(cbytes or 0),
+ references = tonumber(crefs or 0),
+ rules = { }
+ }
+
+ else
+ if rule:find("%d") == 1 then
+
+ local rule_parts = luci.util.split( rule, "%s+", nil, true )
+ local rule_details = { }
+
+ -- cope with rules that have no target assigned
+ if rule:match("^%d+%s+%d+%s+%d+%s%s") then
+ table.insert(rule_parts, 4, nil)
+ end
+
+ -- ip6tables opt column is usually zero-width
+ if self._family == 6 then
+ table.insert(rule_parts, 6, "--")
+ end
+
+ rule_details["table"] = tbl
+ rule_details["chain"] = self._chain
+ rule_details["index"] = tonumber(rule_parts[1])
+ rule_details["packets"] = tonumber(rule_parts[2])
+ rule_details["bytes"] = tonumber(rule_parts[3])
+ rule_details["target"] = rule_parts[4]
+ rule_details["protocol"] = rule_parts[5]
+ rule_details["flags"] = rule_parts[6]
+ rule_details["inputif"] = rule_parts[7]
+ rule_details["outputif"] = rule_parts[8]
+ rule_details["source"] = rule_parts[9]
+ rule_details["destination"] = rule_parts[10]
+ rule_details["options"] = { }
+
+ for i = 11, #rule_parts do
+ if #rule_parts[i] > 0 then
+ rule_details["options"][i-10] = rule_parts[i]
+ end
+ end
+
+ self._rules[#self._rules+1] = rule_details
+
+ self._chains[tbl][self._chain].rules[
+ #self._chains[tbl][self._chain].rules + 1
+ ] = rule_details
+ end
+ end
+ end
+ end
+
+ self._chain = nil
+end
+
+
+-- [internal] Return true if optlist1 contains all elements of optlist 2.
+-- Return false in all other cases.
+function IptParser._match_options( self, o1, o2 )
+
+ -- construct a hashtable of first options list to speed up lookups
+ local oh = { }
+ for i, opt in ipairs( o1 ) do oh[opt] = true end
+
+ -- iterate over second options list
+ -- each string in o2 must be also present in o1
+ -- if o2 contains a string which is not found in o1 then return false
+ for i, opt in ipairs( o2 ) do
+ if not oh[opt] then
+ return false
+ end
+ end
+
+ return true
+end
diff --git a/modules/base/luasrc/sys/zoneinfo.lua b/modules/base/luasrc/sys/zoneinfo.lua
new file mode 100644
index 000000000..f5a12bfcb
--- /dev/null
+++ b/modules/base/luasrc/sys/zoneinfo.lua
@@ -0,0 +1,28 @@
+--[[
+LuCI - Autogenerated Zoneinfo Module
+
+Licensed under the Apache License, Version 2.0 (the "License");
+you may not use this file except in compliance with the License.
+You may obtain a copy of the License at
+
+ http://www.apache.org/licenses/LICENSE-2.0
+
+]]--
+
+local setmetatable, require, rawget, rawset = setmetatable, require, rawget, rawset
+
+module "luci.sys.zoneinfo"
+
+setmetatable(_M, {
+ __index = function(t, k)
+ if k == "TZ" and not rawget(t, k) then
+ local m = require "luci.sys.zoneinfo.tzdata"
+ rawset(t, k, rawget(m, k))
+ elseif k == "OFFSET" and not rawget(t, k) then
+ local m = require "luci.sys.zoneinfo.tzoffset"
+ rawset(t, k, rawget(m, k))
+ end
+
+ return rawget(t, k)
+ end
+})
diff --git a/modules/base/luasrc/sys/zoneinfo/tzdata.lua b/modules/base/luasrc/sys/zoneinfo/tzdata.lua
new file mode 100644
index 000000000..1a99f6a7e
--- /dev/null
+++ b/modules/base/luasrc/sys/zoneinfo/tzdata.lua
@@ -0,0 +1,420 @@
+--[[
+LuCI - Autogenerated Zoneinfo Module
+
+Licensed under the Apache License, Version 2.0 (the "License");
+you may not use this file except in compliance with the License.
+You may obtain a copy of the License at
+
+ http://www.apache.org/licenses/LICENSE-2.0
+
+]]--
+
+module "luci.sys.zoneinfo.tzdata"
+
+TZ = {
+ { 'Africa/Abidjan', 'GMT0' },
+ { 'Africa/Accra', 'GMT0' },
+ { 'Africa/Addis Ababa', 'EAT-3' },
+ { 'Africa/Algiers', 'CET-1' },
+ { 'Africa/Asmara', 'EAT-3' },
+ { 'Africa/Bamako', 'GMT0' },
+ { 'Africa/Bangui', 'WAT-1' },
+ { 'Africa/Banjul', 'GMT0' },
+ { 'Africa/Bissau', 'GMT0' },
+ { 'Africa/Blantyre', 'CAT-2' },
+ { 'Africa/Brazzaville', 'WAT-1' },
+ { 'Africa/Bujumbura', 'CAT-2' },
+ { 'Africa/Casablanca', 'WET0' },
+ { 'Africa/Ceuta', 'CET-1CEST,M3.5.0,M10.5.0/3' },
+ { 'Africa/Conakry', 'GMT0' },
+ { 'Africa/Dakar', 'GMT0' },
+ { 'Africa/Dar es Salaam', 'EAT-3' },
+ { 'Africa/Djibouti', 'EAT-3' },
+ { 'Africa/Douala', 'WAT-1' },
+ { 'Africa/El Aaiun', 'WET0' },
+ { 'Africa/Freetown', 'GMT0' },
+ { 'Africa/Gaborone', 'CAT-2' },
+ { 'Africa/Harare', 'CAT-2' },
+ { 'Africa/Johannesburg', 'SAST-2' },
+ { 'Africa/Juba', 'EAT-3' },
+ { 'Africa/Kampala', 'EAT-3' },
+ { 'Africa/Khartoum', 'EAT-3' },
+ { 'Africa/Kigali', 'CAT-2' },
+ { 'Africa/Kinshasa', 'WAT-1' },
+ { 'Africa/Lagos', 'WAT-1' },
+ { 'Africa/Libreville', 'WAT-1' },
+ { 'Africa/Lome', 'GMT0' },
+ { 'Africa/Luanda', 'WAT-1' },
+ { 'Africa/Lubumbashi', 'CAT-2' },
+ { 'Africa/Lusaka', 'CAT-2' },
+ { 'Africa/Malabo', 'WAT-1' },
+ { 'Africa/Maputo', 'CAT-2' },
+ { 'Africa/Maseru', 'SAST-2' },
+ { 'Africa/Mbabane', 'SAST-2' },
+ { 'Africa/Mogadishu', 'EAT-3' },
+ { 'Africa/Monrovia', 'GMT0' },
+ { 'Africa/Nairobi', 'EAT-3' },
+ { 'Africa/Ndjamena', 'WAT-1' },
+ { 'Africa/Niamey', 'WAT-1' },
+ { 'Africa/Nouakchott', 'GMT0' },
+ { 'Africa/Ouagadougou', 'GMT0' },
+ { 'Africa/Porto-Novo', 'WAT-1' },
+ { 'Africa/Sao Tome', 'GMT0' },
+ { 'Africa/Tripoli', 'EET-2' },
+ { 'Africa/Tunis', 'CET-1' },
+ { 'Africa/Windhoek', 'WAT-1WAST,M9.1.0,M4.1.0' },
+ { 'America/Adak', 'HAST10HADT,M3.2.0,M11.1.0' },
+ { 'America/Anchorage', 'AKST9AKDT,M3.2.0,M11.1.0' },
+ { 'America/Anguilla', 'AST4' },
+ { 'America/Antigua', 'AST4' },
+ { 'America/Araguaina', 'BRT3' },
+ { 'America/Argentina/Buenos Aires', 'ART3' },
+ { 'America/Argentina/Catamarca', 'ART3' },
+ { 'America/Argentina/Cordoba', 'ART3' },
+ { 'America/Argentina/Jujuy', 'ART3' },
+ { 'America/Argentina/La Rioja', 'ART3' },
+ { 'America/Argentina/Mendoza', 'ART3' },
+ { 'America/Argentina/Rio Gallegos', 'ART3' },
+ { 'America/Argentina/Salta', 'ART3' },
+ { 'America/Argentina/San Juan', 'ART3' },
+ { 'America/Argentina/Tucuman', 'ART3' },
+ { 'America/Argentina/Ushuaia', 'ART3' },
+ { 'America/Aruba', 'AST4' },
+ { 'America/Asuncion', 'PYT4PYST,M10.1.0/0,M4.2.0/0' },
+ { 'America/Atikokan', 'EST5' },
+ { 'America/Bahia', 'BRT3BRST,M10.3.0/0,M2.3.0/0' },
+ { 'America/Bahia Banderas', 'CST6CDT,M4.1.0,M10.5.0' },
+ { 'America/Barbados', 'AST4' },
+ { 'America/Belem', 'BRT3' },
+ { 'America/Belize', 'CST6' },
+ { 'America/Blanc-Sablon', 'AST4' },
+ { 'America/Boa Vista', 'AMT4' },
+ { 'America/Bogota', 'COT5' },
+ { 'America/Boise', 'MST7MDT,M3.2.0,M11.1.0' },
+ { 'America/Cambridge Bay', 'MST7MDT,M3.2.0,M11.1.0' },
+ { 'America/Campo Grande', 'AMT4AMST,M10.3.0/0,M2.3.0/0' },
+ { 'America/Cancun', 'CST6CDT,M4.1.0,M10.5.0' },
+ { 'America/Caracas', 'VET4:30' },
+ { 'America/Cayenne', 'GFT3' },
+ { 'America/Cayman', 'EST5' },
+ { 'America/Chicago', 'CST6CDT,M3.2.0,M11.1.0' },
+ { 'America/Chihuahua', 'MST7MDT,M4.1.0,M10.5.0' },
+ { 'America/Costa Rica', 'CST6' },
+ { 'America/Cuiaba', 'AMT4AMST,M10.3.0/0,M2.3.0/0' },
+ { 'America/Curacao', 'AST4' },
+ { 'America/Danmarkshavn', 'GMT0' },
+ { 'America/Dawson', 'PST8PDT,M3.2.0,M11.1.0' },
+ { 'America/Dawson Creek', 'MST7' },
+ { 'America/Denver', 'MST7MDT,M3.2.0,M11.1.0' },
+ { 'America/Detroit', 'EST5EDT,M3.2.0,M11.1.0' },
+ { 'America/Dominica', 'AST4' },
+ { 'America/Edmonton', 'MST7MDT,M3.2.0,M11.1.0' },
+ { 'America/Eirunepe', 'AMT4' },
+ { 'America/El Salvador', 'CST6' },
+ { 'America/Fortaleza', 'BRT3' },
+ { 'America/Glace Bay', 'AST4ADT,M3.2.0,M11.1.0' },
+ { 'America/Goose Bay', 'AST4ADT,M3.2.0,M11.1.0' },
+ { 'America/Grand Turk', 'EST5EDT,M3.2.0,M11.1.0' },
+ { 'America/Grenada', 'AST4' },
+ { 'America/Guadeloupe', 'AST4' },
+ { 'America/Guatemala', 'CST6' },
+ { 'America/Guayaquil', 'ECT5' },
+ { 'America/Guyana', 'GYT4' },
+ { 'America/Halifax', 'AST4ADT,M3.2.0,M11.1.0' },
+ { 'America/Havana', 'CST5CDT,M3.2.0/0,M10.5.0/1' },
+ { 'America/Hermosillo', 'MST7' },
+ { 'America/Indiana/Indianapolis', 'EST5EDT,M3.2.0,M11.1.0' },
+ { 'America/Indiana/Knox', 'CST6CDT,M3.2.0,M11.1.0' },
+ { 'America/Indiana/Marengo', 'EST5EDT,M3.2.0,M11.1.0' },
+ { 'America/Indiana/Petersburg', 'EST5EDT,M3.2.0,M11.1.0' },
+ { 'America/Indiana/Tell City', 'CST6CDT,M3.2.0,M11.1.0' },
+ { 'America/Indiana/Vevay', 'EST5EDT,M3.2.0,M11.1.0' },
+ { 'America/Indiana/Vincennes', 'EST5EDT,M3.2.0,M11.1.0' },
+ { 'America/Indiana/Winamac', 'EST5EDT,M3.2.0,M11.1.0' },
+ { 'America/Inuvik', 'MST7MDT,M3.2.0,M11.1.0' },
+ { 'America/Iqaluit', 'EST5EDT,M3.2.0,M11.1.0' },
+ { 'America/Jamaica', 'EST5' },
+ { 'America/Juneau', 'AKST9AKDT,M3.2.0,M11.1.0' },
+ { 'America/Kentucky/Louisville', 'EST5EDT,M3.2.0,M11.1.0' },
+ { 'America/Kentucky/Monticello', 'EST5EDT,M3.2.0,M11.1.0' },
+ { 'America/Kralendijk', 'AST4' },
+ { 'America/La Paz', 'BOT4' },
+ { 'America/Lima', 'PET5' },
+ { 'America/Los Angeles', 'PST8PDT,M3.2.0,M11.1.0' },
+ { 'America/Lower Princes', 'AST4' },
+ { 'America/Maceio', 'BRT3' },
+ { 'America/Managua', 'CST6' },
+ { 'America/Manaus', 'AMT4' },
+ { 'America/Marigot', 'AST4' },
+ { 'America/Martinique', 'AST4' },
+ { 'America/Matamoros', 'CST6CDT,M3.2.0,M11.1.0' },
+ { 'America/Mazatlan', 'MST7MDT,M4.1.0,M10.5.0' },
+ { 'America/Menominee', 'CST6CDT,M3.2.0,M11.1.0' },
+ { 'America/Merida', 'CST6CDT,M4.1.0,M10.5.0' },
+ { 'America/Metlakatla', 'MeST8' },
+ { 'America/Mexico City', 'CST6CDT,M4.1.0,M10.5.0' },
+ { 'America/Miquelon', 'PMST3PMDT,M3.2.0,M11.1.0' },
+ { 'America/Moncton', 'AST4ADT,M3.2.0,M11.1.0' },
+ { 'America/Monterrey', 'CST6CDT,M4.1.0,M10.5.0' },
+ { 'America/Montevideo', 'UYT3UYST,M10.1.0,M3.2.0' },
+ { 'America/Montreal', 'EST5EDT,M3.2.0,M11.1.0' },
+ { 'America/Montserrat', 'AST4' },
+ { 'America/Nassau', 'EST5EDT,M3.2.0,M11.1.0' },
+ { 'America/New York', 'EST5EDT,M3.2.0,M11.1.0' },
+ { 'America/Nipigon', 'EST5EDT,M3.2.0,M11.1.0' },
+ { 'America/Nome', 'AKST9AKDT,M3.2.0,M11.1.0' },
+ { 'America/Noronha', 'FNT2' },
+ { 'America/North Dakota/Beulah', 'CST6CDT,M3.2.0,M11.1.0' },
+ { 'America/North Dakota/Center', 'CST6CDT,M3.2.0,M11.1.0' },
+ { 'America/North Dakota/New Salem', 'CST6CDT,M3.2.0,M11.1.0' },
+ { 'America/Ojinaga', 'MST7MDT,M3.2.0,M11.1.0' },
+ { 'America/Panama', 'EST5' },
+ { 'America/Pangnirtung', 'EST5EDT,M3.2.0,M11.1.0' },
+ { 'America/Paramaribo', 'SRT3' },
+ { 'America/Phoenix', 'MST7' },
+ { 'America/Port of Spain', 'AST4' },
+ { 'America/Port-au-Prince', 'EST5' },
+ { 'America/Porto Velho', 'AMT4' },
+ { 'America/Puerto Rico', 'AST4' },
+ { 'America/Rainy River', 'CST6CDT,M3.2.0,M11.1.0' },
+ { 'America/Rankin Inlet', 'CST6CDT,M3.2.0,M11.1.0' },
+ { 'America/Recife', 'BRT3' },
+ { 'America/Regina', 'CST6' },
+ { 'America/Resolute', 'CST6CDT,M3.2.0,M11.1.0' },
+ { 'America/Rio Branco', 'AMT4' },
+ { 'America/Santa Isabel', 'PST8PDT,M4.1.0,M10.5.0' },
+ { 'America/Santarem', 'BRT3' },
+ { 'America/Santo Domingo', 'AST4' },
+ { 'America/Sao Paulo', 'BRT3BRST,M10.3.0/0,M2.3.0/0' },
+ { 'America/Scoresbysund', 'EGT1EGST,M3.5.0/0,M10.5.0/1' },
+ { 'America/Shiprock', 'MST7MDT,M3.2.0,M11.1.0' },
+ { 'America/Sitka', 'AKST9AKDT,M3.2.0,M11.1.0' },
+ { 'America/St Barthelemy', 'AST4' },
+ { 'America/St Johns', 'NST3:30NDT,M3.2.0,M11.1.0' },
+ { 'America/St Kitts', 'AST4' },
+ { 'America/St Lucia', 'AST4' },
+ { 'America/St Thomas', 'AST4' },
+ { 'America/St Vincent', 'AST4' },
+ { 'America/Swift Current', 'CST6' },
+ { 'America/Tegucigalpa', 'CST6' },
+ { 'America/Thule', 'AST4ADT,M3.2.0,M11.1.0' },
+ { 'America/Thunder Bay', 'EST5EDT,M3.2.0,M11.1.0' },
+ { 'America/Tijuana', 'PST8PDT,M3.2.0,M11.1.0' },
+ { 'America/Toronto', 'EST5EDT,M3.2.0,M11.1.0' },
+ { 'America/Tortola', 'AST4' },
+ { 'America/Vancouver', 'PST8PDT,M3.2.0,M11.1.0' },
+ { 'America/Whitehorse', 'PST8PDT,M3.2.0,M11.1.0' },
+ { 'America/Winnipeg', 'CST6CDT,M3.2.0,M11.1.0' },
+ { 'America/Yakutat', 'AKST9AKDT,M3.2.0,M11.1.0' },
+ { 'America/Yellowknife', 'MST7MDT,M3.2.0,M11.1.0' },
+ { 'Antarctica/Casey', 'WST-8' },
+ { 'Antarctica/Davis', 'DAVT-7' },
+ { 'Antarctica/DumontDUrville', 'DDUT-10' },
+ { 'Antarctica/Macquarie', 'MIST-11' },
+ { 'Antarctica/Mawson', 'MAWT-5' },
+ { 'Antarctica/McMurdo', 'NZST-12NZDT,M9.5.0,M4.1.0/3' },
+ { 'Antarctica/Rothera', 'ROTT3' },
+ { 'Antarctica/South Pole', 'NZST-12NZDT,M9.5.0,M4.1.0/3' },
+ { 'Antarctica/Syowa', 'SYOT-3' },
+ { 'Antarctica/Vostok', 'VOST-6' },
+ { 'Arctic/Longyearbyen', 'CET-1CEST,M3.5.0,M10.5.0/3' },
+ { 'Asia/Aden', 'AST-3' },
+ { 'Asia/Almaty', 'ALMT-6' },
+ { 'Asia/Anadyr', 'ANAT-12' },
+ { 'Asia/Aqtau', 'AQTT-5' },
+ { 'Asia/Aqtobe', 'AQTT-5' },
+ { 'Asia/Ashgabat', 'TMT-5' },
+ { 'Asia/Baghdad', 'AST-3' },
+ { 'Asia/Bahrain', 'AST-3' },
+ { 'Asia/Baku', 'AZT-4AZST,M3.5.0/4,M10.5.0/5' },
+ { 'Asia/Bangkok', 'ICT-7' },
+ { 'Asia/Beirut', 'EET-2EEST,M3.5.0/0,M10.5.0/0' },
+ { 'Asia/Bishkek', 'KGT-6' },
+ { 'Asia/Brunei', 'BNT-8' },
+ { 'Asia/Choibalsan', 'CHOT-8' },
+ { 'Asia/Chongqing', 'CST-8' },
+ { 'Asia/Colombo', 'IST-5:30' },
+ { 'Asia/Damascus', 'EET-2EEST,M4.1.5/0,M10.5.5/0' },
+ { 'Asia/Dhaka', 'BDT-6' },
+ { 'Asia/Dili', 'TLT-9' },
+ { 'Asia/Dubai', 'GST-4' },
+ { 'Asia/Dushanbe', 'TJT-5' },
+ { 'Asia/Gaza', 'EET-2' },
+ { 'Asia/Harbin', 'CST-8' },
+ { 'Asia/Hebron', 'EET-2' },
+ { 'Asia/Ho Chi Minh', 'ICT-7' },
+ { 'Asia/Hong Kong', 'HKT-8' },
+ { 'Asia/Hovd', 'HOVT-7' },
+ { 'Asia/Irkutsk', 'IRKT-9' },
+ { 'Asia/Jakarta', 'WIT-7' },
+ { 'Asia/Jayapura', 'EIT-9' },
+ { 'Asia/Kabul', 'AFT-4:30' },
+ { 'Asia/Kamchatka', 'PETT-12' },
+ { 'Asia/Karachi', 'PKT-5' },
+ { 'Asia/Kashgar', 'CST-8' },
+ { 'Asia/Kathmandu', 'NPT-5:45' },
+ { 'Asia/Kolkata', 'IST-5:30' },
+ { 'Asia/Krasnoyarsk', 'KRAT-8' },
+ { 'Asia/Kuala Lumpur', 'MYT-8' },
+ { 'Asia/Kuching', 'MYT-8' },
+ { 'Asia/Kuwait', 'AST-3' },
+ { 'Asia/Macau', 'CST-8' },
+ { 'Asia/Magadan', 'MAGT-12' },
+ { 'Asia/Makassar', 'CIT-8' },
+ { 'Asia/Manila', 'PHT-8' },
+ { 'Asia/Muscat', 'GST-4' },
+ { 'Asia/Nicosia', 'EET-2EEST,M3.5.0/3,M10.5.0/4' },
+ { 'Asia/Novokuznetsk', 'NOVT-7' },
+ { 'Asia/Novosibirsk', 'NOVT-7' },
+ { 'Asia/Omsk', 'OMST-7' },
+ { 'Asia/Oral', 'ORAT-5' },
+ { 'Asia/Phnom Penh', 'ICT-7' },
+ { 'Asia/Pontianak', 'WIT-7' },
+ { 'Asia/Pyongyang', 'KST-9' },
+ { 'Asia/Qatar', 'AST-3' },
+ { 'Asia/Qyzylorda', 'QYZT-6' },
+ { 'Asia/Rangoon', 'MMT-6:30' },
+ { 'Asia/Riyadh', 'AST-3' },
+ { 'Asia/Sakhalin', 'SAKT-11' },
+ { 'Asia/Samarkand', 'UZT-5' },
+ { 'Asia/Seoul', 'KST-9' },
+ { 'Asia/Shanghai', 'CST-8' },
+ { 'Asia/Singapore', 'SGT-8' },
+ { 'Asia/Taipei', 'CST-8' },
+ { 'Asia/Tashkent', 'UZT-5' },
+ { 'Asia/Tbilisi', 'GET-4' },
+ { 'Asia/Thimphu', 'BTT-6' },
+ { 'Asia/Tokyo', 'JST-9' },
+ { 'Asia/Ulaanbaatar', 'ULAT-8' },
+ { 'Asia/Urumqi', 'CST-8' },
+ { 'Asia/Vientiane', 'ICT-7' },
+ { 'Asia/Vladivostok', 'VLAT-11' },
+ { 'Asia/Yakutsk', 'YAKT-10' },
+ { 'Asia/Yekaterinburg', 'YEKT-6' },
+ { 'Asia/Yerevan', 'AMT-4AMST,M3.5.0,M10.5.0/3' },
+ { 'Atlantic/Azores', 'AZOT1AZOST,M3.5.0/0,M10.5.0/1' },
+ { 'Atlantic/Bermuda', 'AST4ADT,M3.2.0,M11.1.0' },
+ { 'Atlantic/Canary', 'WET0WEST,M3.5.0/1,M10.5.0' },
+ { 'Atlantic/Cape Verde', 'CVT1' },
+ { 'Atlantic/Faroe', 'WET0WEST,M3.5.0/1,M10.5.0' },
+ { 'Atlantic/Madeira', 'WET0WEST,M3.5.0/1,M10.5.0' },
+ { 'Atlantic/Reykjavik', 'GMT0' },
+ { 'Atlantic/South Georgia', 'GST2' },
+ { 'Atlantic/St Helena', 'GMT0' },
+ { 'Atlantic/Stanley', 'FKT4FKST,M9.1.0,M4.3.0' },
+ { 'Australia/Adelaide', 'CST-9:30CST,M10.1.0,M4.1.0/3' },
+ { 'Australia/Brisbane', 'EST-10' },
+ { 'Australia/Broken Hill', 'CST-9:30CST,M10.1.0,M4.1.0/3' },
+ { 'Australia/Currie', 'EST-10EST,M10.1.0,M4.1.0/3' },
+ { 'Australia/Darwin', 'CST-9:30' },
+ { 'Australia/Eucla', 'CWST-8:45' },
+ { 'Australia/Hobart', 'EST-10EST,M10.1.0,M4.1.0/3' },
+ { 'Australia/Lindeman', 'EST-10' },
+ { 'Australia/Lord Howe', 'LHST-10:30LHST-11,M10.1.0,M4.1.0' },
+ { 'Australia/Melbourne', 'EST-10EST,M10.1.0,M4.1.0/3' },
+ { 'Australia/Perth', 'WST-8' },
+ { 'Australia/Sydney', 'EST-10EST,M10.1.0,M4.1.0/3' },
+ { 'Europe/Amsterdam', 'CET-1CEST,M3.5.0,M10.5.0/3' },
+ { 'Europe/Andorra', 'CET-1CEST,M3.5.0,M10.5.0/3' },
+ { 'Europe/Athens', 'EET-2EEST,M3.5.0/3,M10.5.0/4' },
+ { 'Europe/Belgrade', 'CET-1CEST,M3.5.0,M10.5.0/3' },
+ { 'Europe/Berlin', 'CET-1CEST,M3.5.0,M10.5.0/3' },
+ { 'Europe/Bratislava', 'CET-1CEST,M3.5.0,M10.5.0/3' },
+ { 'Europe/Brussels', 'CET-1CEST,M3.5.0,M10.5.0/3' },
+ { 'Europe/Bucharest', 'EET-2EEST,M3.5.0/3,M10.5.0/4' },
+ { 'Europe/Budapest', 'CET-1CEST,M3.5.0,M10.5.0/3' },
+ { 'Europe/Chisinau', 'EET-2EEST,M3.5.0/3,M10.5.0/4' },
+ { 'Europe/Copenhagen', 'CET-1CEST,M3.5.0,M10.5.0/3' },
+ { 'Europe/Dublin', 'GMT0IST,M3.5.0/1,M10.5.0' },
+ { 'Europe/Gibraltar', 'CET-1CEST,M3.5.0,M10.5.0/3' },
+ { 'Europe/Guernsey', 'GMT0BST,M3.5.0/1,M10.5.0' },
+ { 'Europe/Helsinki', 'EET-2EEST,M3.5.0/3,M10.5.0/4' },
+ { 'Europe/Isle of Man', 'GMT0BST,M3.5.0/1,M10.5.0' },
+ { 'Europe/Istanbul', 'EET-2EEST,M3.5.0/3,M10.5.0/4' },
+ { 'Europe/Jersey', 'GMT0BST,M3.5.0/1,M10.5.0' },
+ { 'Europe/Kaliningrad', 'FET-3' },
+ { 'Europe/Kiev', 'EET-2EEST,M3.5.0/3,M10.5.0/4' },
+ { 'Europe/Lisbon', 'WET0WEST,M3.5.0/1,M10.5.0' },
+ { 'Europe/Ljubljana', 'CET-1CEST,M3.5.0,M10.5.0/3' },
+ { 'Europe/London', 'GMT0BST,M3.5.0/1,M10.5.0' },
+ { 'Europe/Luxembourg', 'CET-1CEST,M3.5.0,M10.5.0/3' },
+ { 'Europe/Madrid', 'CET-1CEST,M3.5.0,M10.5.0/3' },
+ { 'Europe/Malta', 'CET-1CEST,M3.5.0,M10.5.0/3' },
+ { 'Europe/Mariehamn', 'EET-2EEST,M3.5.0/3,M10.5.0/4' },
+ { 'Europe/Minsk', 'FET-3' },
+ { 'Europe/Monaco', 'CET-1CEST,M3.5.0,M10.5.0/3' },
+ { 'Europe/Moscow', 'MSK-4' },
+ { 'Europe/Oslo', 'CET-1CEST,M3.5.0,M10.5.0/3' },
+ { 'Europe/Paris', 'CET-1CEST,M3.5.0,M10.5.0/3' },
+ { 'Europe/Podgorica', 'CET-1CEST,M3.5.0,M10.5.0/3' },
+ { 'Europe/Prague', 'CET-1CEST,M3.5.0,M10.5.0/3' },
+ { 'Europe/Riga', 'EET-2EEST,M3.5.0/3,M10.5.0/4' },
+ { 'Europe/Rome', 'CET-1CEST,M3.5.0,M10.5.0/3' },
+ { 'Europe/Samara', 'SAMT-4' },
+ { 'Europe/San Marino', 'CET-1CEST,M3.5.0,M10.5.0/3' },
+ { 'Europe/Sarajevo', 'CET-1CEST,M3.5.0,M10.5.0/3' },
+ { 'Europe/Simferopol', 'EET-2EEST,M3.5.0/3,M10.5.0/4' },
+ { 'Europe/Skopje', 'CET-1CEST,M3.5.0,M10.5.0/3' },
+ { 'Europe/Sofia', 'EET-2EEST,M3.5.0/3,M10.5.0/4' },
+ { 'Europe/Stockholm', 'CET-1CEST,M3.5.0,M10.5.0/3' },
+ { 'Europe/Tallinn', 'EET-2EEST,M3.5.0/3,M10.5.0/4' },
+ { 'Europe/Tirane', 'CET-1CEST,M3.5.0,M10.5.0/3' },
+ { 'Europe/Uzhgorod', 'EET-2EEST,M3.5.0/3,M10.5.0/4' },
+ { 'Europe/Vaduz', 'CET-1CEST,M3.5.0,M10.5.0/3' },
+ { 'Europe/Vatican', 'CET-1CEST,M3.5.0,M10.5.0/3' },
+ { 'Europe/Vienna', 'CET-1CEST,M3.5.0,M10.5.0/3' },
+ { 'Europe/Vilnius', 'EET-2EEST,M3.5.0/3,M10.5.0/4' },
+ { 'Europe/Volgograd', 'VOLT-4' },
+ { 'Europe/Warsaw', 'CET-1CEST,M3.5.0,M10.5.0/3' },
+ { 'Europe/Zagreb', 'CET-1CEST,M3.5.0,M10.5.0/3' },
+ { 'Europe/Zaporozhye', 'EET-2EEST,M3.5.0/3,M10.5.0/4' },
+ { 'Europe/Zurich', 'CET-1CEST,M3.5.0,M10.5.0/3' },
+ { 'Indian/Antananarivo', 'EAT-3' },
+ { 'Indian/Chagos', 'IOT-6' },
+ { 'Indian/Christmas', 'CXT-7' },
+ { 'Indian/Cocos', 'CCT-6:30' },
+ { 'Indian/Comoro', 'EAT-3' },
+ { 'Indian/Kerguelen', 'TFT-5' },
+ { 'Indian/Mahe', 'SCT-4' },
+ { 'Indian/Maldives', 'MVT-5' },
+ { 'Indian/Mauritius', 'MUT-4' },
+ { 'Indian/Mayotte', 'EAT-3' },
+ { 'Indian/Reunion', 'RET-4' },
+ { 'Pacific/Apia', 'WST-13' },
+ { 'Pacific/Auckland', 'NZST-12NZDT,M9.5.0,M4.1.0/3' },
+ { 'Pacific/Chatham', 'CHAST-12:45CHADT,M9.5.0/2:45,M4.1.0/3:45' },
+ { 'Pacific/Chuuk', 'CHUT-10' },
+ { 'Pacific/Efate', 'VUT-11' },
+ { 'Pacific/Enderbury', 'PHOT-13' },
+ { 'Pacific/Fakaofo', 'TKT10' },
+ { 'Pacific/Fiji', 'FJT-12' },
+ { 'Pacific/Funafuti', 'TVT-12' },
+ { 'Pacific/Galapagos', 'GALT6' },
+ { 'Pacific/Gambier', 'GAMT9' },
+ { 'Pacific/Guadalcanal', 'SBT-11' },
+ { 'Pacific/Guam', 'ChST-10' },
+ { 'Pacific/Honolulu', 'HST10' },
+ { 'Pacific/Johnston', 'HST10' },
+ { 'Pacific/Kiritimati', 'LINT-14' },
+ { 'Pacific/Kosrae', 'KOST-11' },
+ { 'Pacific/Kwajalein', 'MHT-12' },
+ { 'Pacific/Majuro', 'MHT-12' },
+ { 'Pacific/Marquesas', 'MART9:30' },
+ { 'Pacific/Midway', 'SST11' },
+ { 'Pacific/Nauru', 'NRT-12' },
+ { 'Pacific/Niue', 'NUT11' },
+ { 'Pacific/Norfolk', 'NFT-11:30' },
+ { 'Pacific/Noumea', 'NCT-11' },
+ { 'Pacific/Pago Pago', 'SST11' },
+ { 'Pacific/Palau', 'PWT-9' },
+ { 'Pacific/Pitcairn', 'PST8' },
+ { 'Pacific/Pohnpei', 'PONT-11' },
+ { 'Pacific/Port Moresby', 'PGT-10' },
+ { 'Pacific/Rarotonga', 'CKT10' },
+ { 'Pacific/Saipan', 'ChST-10' },
+ { 'Pacific/Tahiti', 'TAHT10' },
+ { 'Pacific/Tarawa', 'GILT-12' },
+ { 'Pacific/Tongatapu', 'TOT-13' },
+ { 'Pacific/Wake', 'WAKT-12' },
+ { 'Pacific/Wallis', 'WFT-12' },
+}
diff --git a/modules/base/luasrc/sys/zoneinfo/tzoffset.lua b/modules/base/luasrc/sys/zoneinfo/tzoffset.lua
new file mode 100644
index 000000000..bbe75d5a4
--- /dev/null
+++ b/modules/base/luasrc/sys/zoneinfo/tzoffset.lua
@@ -0,0 +1,162 @@
+--[[
+LuCI - Autogenerated Zoneinfo Module
+
+Licensed under the Apache License, Version 2.0 (the "License");
+you may not use this file except in compliance with the License.
+You may obtain a copy of the License at
+
+ http://www.apache.org/licenses/LICENSE-2.0
+
+]]--
+
+module "luci.sys.zoneinfo.tzoffset"
+
+OFFSET = {
+ gmt = 0, -- GMT
+ eat = 10800, -- EAT
+ cet = 3600, -- CET
+ wat = 3600, -- WAT
+ cat = 7200, -- CAT
+ wet = 0, -- WET
+ sast = 7200, -- SAST
+ eet = 7200, -- EET
+ hast = -36000, -- HAST
+ hadt = -32400, -- HADT
+ akst = -32400, -- AKST
+ akdt = -28800, -- AKDT
+ ast = -14400, -- AST
+ brt = -10800, -- BRT
+ art = -10800, -- ART
+ pyt = -14400, -- PYT
+ pyst = -10800, -- PYST
+ est = -18000, -- EST
+ cst = -21600, -- CST
+ cdt = -18000, -- CDT
+ amt = -14400, -- AMT
+ cot = -18000, -- COT
+ mst = -25200, -- MST
+ mdt = -21600, -- MDT
+ vet = -16200, -- VET
+ gft = -10800, -- GFT
+ pst = -28800, -- PST
+ pdt = -25200, -- PDT
+ ect = -18000, -- ECT
+ gyt = -14400, -- GYT
+ bot = -14400, -- BOT
+ pet = -18000, -- PET
+ pmst = -10800, -- PMST
+ pmdt = -7200, -- PMDT
+ uyt = -10800, -- UYT
+ uyst = -7200, -- UYST
+ fnt = -7200, -- FNT
+ srt = -10800, -- SRT
+ egt = -3600, -- EGT
+ egst = 0, -- EGST
+ nst = -12600, -- NST
+ ndt = -9000, -- NDT
+ wst = 28800, -- WST
+ davt = 25200, -- DAVT
+ ddut = 36000, -- DDUT
+ mist = 39600, -- MIST
+ mawt = 18000, -- MAWT
+ nzst = 43200, -- NZST
+ nzdt = 46800, -- NZDT
+ rott = -10800, -- ROTT
+ syot = 10800, -- SYOT
+ vost = 21600, -- VOST
+ almt = 21600, -- ALMT
+ anat = 43200, -- ANAT
+ aqtt = 18000, -- AQTT
+ tmt = 18000, -- TMT
+ azt = 14400, -- AZT
+ azst = 18000, -- AZST
+ ict = 25200, -- ICT
+ kgt = 21600, -- KGT
+ bnt = 28800, -- BNT
+ chot = 28800, -- CHOT
+ ist = 19800, -- IST
+ bdt = 21600, -- BDT
+ tlt = 32400, -- TLT
+ gst = 14400, -- GST
+ tjt = 18000, -- TJT
+ hkt = 28800, -- HKT
+ hovt = 25200, -- HOVT
+ irkt = 32400, -- IRKT
+ wit = 25200, -- WIT
+ eit = 32400, -- EIT
+ aft = 16200, -- AFT
+ pett = 43200, -- PETT
+ pkt = 18000, -- PKT
+ npt = 20700, -- NPT
+ krat = 28800, -- KRAT
+ myt = 28800, -- MYT
+ magt = 43200, -- MAGT
+ cit = 28800, -- CIT
+ pht = 28800, -- PHT
+ novt = 25200, -- NOVT
+ omst = 25200, -- OMST
+ orat = 18000, -- ORAT
+ kst = 32400, -- KST
+ qyzt = 21600, -- QYZT
+ mmt = 23400, -- MMT
+ sakt = 39600, -- SAKT
+ uzt = 18000, -- UZT
+ sgt = 28800, -- SGT
+ get = 14400, -- GET
+ btt = 21600, -- BTT
+ jst = 32400, -- JST
+ ulat = 28800, -- ULAT
+ vlat = 39600, -- VLAT
+ yakt = 36000, -- YAKT
+ yekt = 21600, -- YEKT
+ azot = -3600, -- AZOT
+ azost = 0, -- AZOST
+ cvt = -3600, -- CVT
+ fkt = -14400, -- FKT
+ fkst = -10800, -- FKST
+ cwst = 31500, -- CWST
+ lhst = 37800, -- LHST
+ lhst = 39600, -- LHST
+ fet = 10800, -- FET
+ msk = 14400, -- MSK
+ samt = 14400, -- SAMT
+ volt = 14400, -- VOLT
+ iot = 21600, -- IOT
+ cxt = 25200, -- CXT
+ cct = 23400, -- CCT
+ tft = 18000, -- TFT
+ sct = 14400, -- SCT
+ mvt = 18000, -- MVT
+ mut = 14400, -- MUT
+ ret = 14400, -- RET
+ chast = 45900, -- CHAST
+ chadt = 49500, -- CHADT
+ chut = 36000, -- CHUT
+ vut = 39600, -- VUT
+ phot = 46800, -- PHOT
+ tkt = -36000, -- TKT
+ fjt = 43200, -- FJT
+ tvt = 43200, -- TVT
+ galt = -21600, -- GALT
+ gamt = -32400, -- GAMT
+ sbt = 39600, -- SBT
+ hst = -36000, -- HST
+ lint = 50400, -- LINT
+ kost = 39600, -- KOST
+ mht = 43200, -- MHT
+ mart = -34200, -- MART
+ sst = -39600, -- SST
+ nrt = 43200, -- NRT
+ nut = -39600, -- NUT
+ nft = 41400, -- NFT
+ nct = 39600, -- NCT
+ pwt = 32400, -- PWT
+ pont = 39600, -- PONT
+ pgt = 36000, -- PGT
+ ckt = -36000, -- CKT
+ taht = -36000, -- TAHT
+ gilt = 43200, -- GILT
+ tot = 46800, -- TOT
+ wakt = 43200, -- WAKT
+ wft = 43200, -- WFT
+}
diff --git a/modules/base/luasrc/tools/proto.lua b/modules/base/luasrc/tools/proto.lua
new file mode 100644
index 000000000..4df02696b
--- /dev/null
+++ b/modules/base/luasrc/tools/proto.lua
@@ -0,0 +1,46 @@
+--[[
+LuCI - Lua Configuration Interface
+
+Copyright 2012 Jo-Philipp Wich <xm@subsignal.org>
+
+Licensed under the Apache License, Version 2.0 (the "License");
+you may not use this file except in compliance with the License.
+You may obtain a copy of the License at
+
+ http://www.apache.org/licenses/LICENSE-2.0
+
+]]--
+
+module("luci.tools.proto", package.seeall)
+
+function opt_macaddr(s, ifc, ...)
+ local v = luci.cbi.Value
+ local o = s:taboption("advanced", v, "macaddr", ...)
+
+ o.placeholder = ifc and ifc:mac()
+ o.datatype = "macaddr"
+
+ function o.cfgvalue(self, section)
+ local w = ifc and ifc:get_wifinet()
+ if w then
+ return w:get("macaddr")
+ else
+ return v.cfgvalue(self, section)
+ end
+ end
+
+ function o.write(self, section, value)
+ local w = ifc and ifc:get_wifinet()
+ if w then
+ w:set("macaddr", value)
+ elseif value then
+ v.write(self, section, value)
+ else
+ v.remove(self, section)
+ end
+ end
+
+ function o.remove(self, section)
+ self:write(section, nil)
+ end
+end
diff --git a/modules/base/luasrc/tools/status.lua b/modules/base/luasrc/tools/status.lua
new file mode 100644
index 000000000..27bc925bd
--- /dev/null
+++ b/modules/base/luasrc/tools/status.lua
@@ -0,0 +1,216 @@
+--[[
+LuCI - Lua Configuration Interface
+
+Copyright 2011 Jo-Philipp Wich <xm@subsignal.org>
+
+Licensed under the Apache License, Version 2.0 (the "License");
+you may not use this file except in compliance with the License.
+You may obtain a copy of the License at
+
+ http://www.apache.org/licenses/LICENSE-2.0
+
+]]--
+
+module("luci.tools.status", package.seeall)
+
+local uci = require "luci.model.uci".cursor()
+
+local function dhcp_leases_common(family)
+ local rv = { }
+ local nfs = require "nixio.fs"
+ local leasefile = "/var/dhcp.leases"
+
+ uci:foreach("dhcp", "dnsmasq",
+ function(s)
+ if s.leasefile and nfs.access(s.leasefile) then
+ leasefile = s.leasefile
+ return false
+ end
+ end)
+
+ local fd = io.open(leasefile, "r")
+ if fd then
+ while true do
+ local ln = fd:read("*l")
+ if not ln then
+ break
+ else
+ local ts, mac, ip, name, duid = ln:match("^(%d+) (%S+) (%S+) (%S+) (%S+)")
+ if ts and mac and ip and name and duid then
+ if family == 4 and not ip:match(":") then
+ rv[#rv+1] = {
+ expires = os.difftime(tonumber(ts) or 0, os.time()),
+ macaddr = mac,
+ ipaddr = ip,
+ hostname = (name ~= "*") and name
+ }
+ elseif family == 6 and ip:match(":") then
+ rv[#rv+1] = {
+ expires = os.difftime(tonumber(ts) or 0, os.time()),
+ ip6addr = ip,
+ duid = (duid ~= "*") and duid,
+ hostname = (name ~= "*") and name
+ }
+ end
+ end
+ end
+ end
+ fd:close()
+ end
+
+ local fd = io.open("/tmp/hosts/odhcpd", "r")
+ if fd then
+ while true do
+ local ln = fd:read("*l")
+ if not ln then
+ break
+ else
+ local iface, duid, iaid, name, ts, id, length, ip = ln:match("^# (%S+) (%S+) (%S+) (%S+) (%d+) (%S+) (%S+) (.*)")
+ if ip and iaid ~= "ipv4" and family == 6 then
+ rv[#rv+1] = {
+ expires = os.difftime(tonumber(ts) or 0, os.time()),
+ duid = duid,
+ ip6addr = ip,
+ hostname = (name ~= "-") and name
+ }
+ elseif ip and iaid == "ipv4" and family == 4 then
+ rv[#rv+1] = {
+ expires = os.difftime(tonumber(ts) or 0, os.time()),
+ macaddr = duid,
+ ipaddr = ip,
+ hostname = (name ~= "-") and name
+ }
+ end
+ end
+ end
+ fd:close()
+ end
+
+ return rv
+end
+
+function dhcp_leases()
+ return dhcp_leases_common(4)
+end
+
+function dhcp6_leases()
+ return dhcp_leases_common(6)
+end
+
+function wifi_networks()
+ local rv = { }
+ local ntm = require "luci.model.network".init()
+
+ local dev
+ for _, dev in ipairs(ntm:get_wifidevs()) do
+ local rd = {
+ up = dev:is_up(),
+ device = dev:name(),
+ name = dev:get_i18n(),
+ networks = { }
+ }
+
+ local net
+ for _, net in ipairs(dev:get_wifinets()) do
+ rd.networks[#rd.networks+1] = {
+ name = net:shortname(),
+ link = net:adminlink(),
+ up = net:is_up(),
+ mode = net:active_mode(),
+ ssid = net:active_ssid(),
+ bssid = net:active_bssid(),
+ encryption = net:active_encryption(),
+ frequency = net:frequency(),
+ channel = net:channel(),
+ signal = net:signal(),
+ quality = net:signal_percent(),
+ noise = net:noise(),
+ bitrate = net:bitrate(),
+ ifname = net:ifname(),
+ assoclist = net:assoclist(),
+ country = net:country(),
+ txpower = net:txpower(),
+ txpoweroff = net:txpower_offset()
+ }
+ end
+
+ rv[#rv+1] = rd
+ end
+
+ return rv
+end
+
+function wifi_network(id)
+ local ntm = require "luci.model.network".init()
+ local net = ntm:get_wifinet(id)
+ if net then
+ local dev = net:get_device()
+ if dev then
+ return {
+ id = id,
+ name = net:shortname(),
+ link = net:adminlink(),
+ up = net:is_up(),
+ mode = net:active_mode(),
+ ssid = net:active_ssid(),
+ bssid = net:active_bssid(),
+ encryption = net:active_encryption(),
+ frequency = net:frequency(),
+ channel = net:channel(),
+ signal = net:signal(),
+ quality = net:signal_percent(),
+ noise = net:noise(),
+ bitrate = net:bitrate(),
+ ifname = net:ifname(),
+ assoclist = net:assoclist(),
+ country = net:country(),
+ txpower = net:txpower(),
+ txpoweroff = net:txpower_offset(),
+ device = {
+ up = dev:is_up(),
+ device = dev:name(),
+ name = dev:get_i18n()
+ }
+ }
+ end
+ end
+ return { }
+end
+
+function switch_status(devs)
+ local dev
+ local switches = { }
+ for dev in devs:gmatch("[^%s,]+") do
+ local ports = { }
+ local swc = io.popen("swconfig dev %q show" % dev, "r")
+ if swc then
+ local l
+ repeat
+ l = swc:read("*l")
+ if l then
+ local port, up = l:match("port:(%d+) link:(%w+)")
+ if port then
+ local speed = l:match(" speed:(%d+)")
+ local duplex = l:match(" (%w+)-duplex")
+ local txflow = l:match(" (txflow)")
+ local rxflow = l:match(" (rxflow)")
+ local auto = l:match(" (auto)")
+
+ ports[#ports+1] = {
+ port = tonumber(port) or 0,
+ speed = tonumber(speed) or 0,
+ link = (up == "up"),
+ duplex = (duplex == "full"),
+ rxflow = (not not rxflow),
+ txflow = (not not txflow),
+ auto = (not not auto)
+ }
+ end
+ end
+ until not l
+ swc:close()
+ end
+ switches[dev] = ports
+ end
+ return switches
+end
diff --git a/modules/base/luasrc/tools/webadmin.lua b/modules/base/luasrc/tools/webadmin.lua
new file mode 100644
index 000000000..0e09be980
--- /dev/null
+++ b/modules/base/luasrc/tools/webadmin.lua
@@ -0,0 +1,173 @@
+--[[
+LuCI - Lua Configuration Interface
+
+Copyright 2008 Steven Barth <steven@midlink.org>
+Copyright 2008 Jo-Philipp Wich <xm@leipzig.freifunk.net>
+
+Licensed under the Apache License, Version 2.0 (the "License");
+you may not use this file except in compliance with the License.
+You may obtain a copy of the License at
+
+ http://www.apache.org/licenses/LICENSE-2.0
+
+$Id$
+]]--
+
+module("luci.tools.webadmin", package.seeall)
+local uci = require("luci.model.uci")
+require("luci.sys")
+require("luci.ip")
+
+function byte_format(byte)
+ local suff = {"B", "KB", "MB", "GB", "TB"}
+ for i=1, 5 do
+ if byte > 1024 and i < 5 then
+ byte = byte / 1024
+ else
+ return string.format("%.2f %s", byte, suff[i])
+ end
+ end
+end
+
+function date_format(secs)
+ local suff = {"min", "h", "d"}
+ local mins = 0
+ local hour = 0
+ local days = 0
+
+ secs = math.floor(secs)
+ if secs > 60 then
+ mins = math.floor(secs / 60)
+ secs = secs % 60
+ end
+
+ if mins > 60 then
+ hour = math.floor(mins / 60)
+ mins = mins % 60
+ end
+
+ if hour > 24 then
+ days = math.floor(hour / 24)
+ hour = hour % 24
+ end
+
+ if days > 0 then
+ return string.format("%.0fd %02.0fh %02.0fmin %02.0fs", days, hour, mins, secs)
+ else
+ return string.format("%02.0fh %02.0fmin %02.0fs", hour, mins, secs)
+ end
+end
+
+function network_get_addresses(net)
+ local state = uci.cursor_state()
+ state:load("network")
+ local addr = {}
+ local ipv4 = state:get("network", net, "ipaddr")
+ local mav4 = state:get("network", net, "netmask")
+ local ipv6 = state:get("network", net, "ip6addr")
+
+ if ipv4 and #ipv4 > 0 then
+ if mav4 and #mav4 == 0 then mav4 = nil end
+
+ ipv4 = luci.ip.IPv4(ipv4, mav4)
+
+ if ipv4 then
+ table.insert(addr, ipv4:string())
+ end
+ end
+
+ if ipv6 then
+ table.insert(addr, ipv6)
+ end
+
+ state:foreach("network", "alias",
+ function (section)
+ if section.interface == net then
+ if section.ipaddr and section.netmask then
+ local ipv4 = luci.ip.IPv4(section.ipaddr, section.netmask)
+
+ if ipv4 then
+ table.insert(addr, ipv4:string())
+ end
+ end
+
+ if section.ip6addr then
+ table.insert(addr, section.ip6addr)
+ end
+ end
+ end
+ )
+
+ return addr
+end
+
+function cbi_add_networks(field)
+ uci.cursor():foreach("network", "interface",
+ function (section)
+ if section[".name"] ~= "loopback" then
+ field:value(section[".name"])
+ end
+ end
+ )
+ field.titleref = luci.dispatcher.build_url("admin", "network", "network")
+end
+
+function cbi_add_knownips(field)
+ for i, dataset in ipairs(luci.sys.net.arptable()) do
+ field:value(dataset["IP address"])
+ end
+end
+
+function network_get_zones(net)
+ local state = uci.cursor_state()
+ if not state:load("firewall") then
+ return nil
+ end
+
+ local zones = {}
+
+ state:foreach("firewall", "zone",
+ function (section)
+ local znet = section.network or section.name
+ if luci.util.contains(luci.util.split(znet, " "), net) then
+ table.insert(zones, section.name)
+ end
+ end
+ )
+
+ return zones
+end
+
+function firewall_find_zone(name)
+ local find
+
+ luci.model.uci.cursor():foreach("firewall", "zone",
+ function (section)
+ if section.name == name then
+ find = section[".name"]
+ end
+ end
+ )
+
+ return find
+end
+
+function iface_get_network(iface)
+ local state = uci.cursor_state()
+ state:load("network")
+ local net
+
+ state:foreach("network", "interface",
+ function (section)
+ local ifname = state:get(
+ "network", section[".name"], "ifname"
+ )
+
+ if iface == ifname then
+ net = section[".name"]
+ end
+ end
+ )
+
+ return net
+end
diff --git a/modules/base/luasrc/util.lua b/modules/base/luasrc/util.lua
new file mode 100644
index 000000000..da761e219
--- /dev/null
+++ b/modules/base/luasrc/util.lua
@@ -0,0 +1,791 @@
+--[[
+LuCI - Utility library
+
+Description:
+Several common useful Lua functions
+
+License:
+Copyright 2008 Steven Barth <steven@midlink.org>
+
+Licensed under the Apache License, Version 2.0 (the "License");
+you may not use this file except in compliance with the License.
+You may obtain a copy of the License at
+
+ http://www.apache.org/licenses/LICENSE-2.0
+
+Unless required by applicable law or agreed to in writing, software
+distributed under the License is distributed on an "AS IS" BASIS,
+WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+See the License for the specific language governing permissions and
+limitations under the License.
+
+]]--
+
+local io = require "io"
+local math = require "math"
+local table = require "table"
+local debug = require "debug"
+local ldebug = require "luci.debug"
+local string = require "string"
+local coroutine = require "coroutine"
+local tparser = require "luci.template.parser"
+
+local getmetatable, setmetatable = getmetatable, setmetatable
+local rawget, rawset, unpack = rawget, rawset, unpack
+local tostring, type, assert = tostring, type, assert
+local ipairs, pairs, next, loadstring = ipairs, pairs, next, loadstring
+local require, pcall, xpcall = require, pcall, xpcall
+local collectgarbage, get_memory_limit = collectgarbage, get_memory_limit
+
+--- LuCI utility functions.
+module "luci.util"
+
+--
+-- Pythonic string formatting extension
+--
+getmetatable("").__mod = function(a, b)
+ if not b then
+ return a
+ elseif type(b) == "table" then
+ for k, _ in pairs(b) do if type(b[k]) == "userdata" then b[k] = tostring(b[k]) end end
+ return a:format(unpack(b))
+ else
+ if type(b) == "userdata" then b = tostring(b) end
+ return a:format(b)
+ end
+end
+
+
+--
+-- Class helper routines
+--
+
+-- Instantiates a class
+local function _instantiate(class, ...)
+ local inst = setmetatable({}, {__index = class})
+
+ if inst.__init__ then
+ inst:__init__(...)
+ end
+
+ return inst
+end
+
+--- Create a Class object (Python-style object model).
+-- The class object can be instantiated by calling itself.
+-- Any class functions or shared parameters can be attached to this object.
+-- Attaching a table to the class object makes this table shared between
+-- all instances of this class. For object parameters use the __init__ function.
+-- Classes can inherit member functions and values from a base class.
+-- Class can be instantiated by calling them. All parameters will be passed
+-- to the __init__ function of this class - if such a function exists.
+-- The __init__ function must be used to set any object parameters that are not shared
+-- with other objects of this class. Any return values will be ignored.
+-- @param base The base class to inherit from (optional)
+-- @return A class object
+-- @see instanceof
+-- @see clone
+function class(base)
+ return setmetatable({}, {
+ __call = _instantiate,
+ __index = base
+ })
+end
+
+--- Test whether the given object is an instance of the given class.
+-- @param object Object instance
+-- @param class Class object to test against
+-- @return Boolean indicating whether the object is an instance
+-- @see class
+-- @see clone
+function instanceof(object, class)
+ local meta = getmetatable(object)
+ while meta and meta.__index do
+ if meta.__index == class then
+ return true
+ end
+ meta = getmetatable(meta.__index)
+ end
+ return false
+end
+
+
+--
+-- Scope manipulation routines
+--
+
+local tl_meta = {
+ __mode = "k",
+
+ __index = function(self, key)
+ local t = rawget(self, coxpt[coroutine.running()]
+ or coroutine.running() or 0)
+ return t and t[key]
+ end,
+
+ __newindex = function(self, key, value)
+ local c = coxpt[coroutine.running()] or coroutine.running() or 0
+ if not rawget(self, c) then
+ rawset(self, c, { [key] = value })
+ else
+ rawget(self, c)[key] = value
+ end
+ end
+}
+
+--- Create a new or get an already existing thread local store associated with
+-- the current active coroutine. A thread local store is private a table object
+-- whose values can't be accessed from outside of the running coroutine.
+-- @return Table value representing the corresponding thread local store
+function threadlocal(tbl)
+ return setmetatable(tbl or {}, tl_meta)
+end
+
+
+--
+-- Debugging routines
+--
+
+--- Write given object to stderr.
+-- @param obj Value to write to stderr
+-- @return Boolean indicating whether the write operation was successful
+function perror(obj)
+ return io.stderr:write(tostring(obj) .. "\n")
+end
+
+--- Recursively dumps a table to stdout, useful for testing and debugging.
+-- @param t Table value to dump
+-- @param maxdepth Maximum depth
+-- @return Always nil
+function dumptable(t, maxdepth, i, seen)
+ i = i or 0
+ seen = seen or setmetatable({}, {__mode="k"})
+
+ for k,v in pairs(t) do
+ perror(string.rep("\t", i) .. tostring(k) .. "\t" .. tostring(v))
+ if type(v) == "table" and (not maxdepth or i < maxdepth) then
+ if not seen[v] then
+ seen[v] = true
+ dumptable(v, maxdepth, i+1, seen)
+ else
+ perror(string.rep("\t", i) .. "*** RECURSION ***")
+ end
+ end
+ end
+end
+
+
+--
+-- String and data manipulation routines
+--
+
+--- Create valid XML PCDATA from given string.
+-- @param value String value containing the data to escape
+-- @return String value containing the escaped data
+function pcdata(value)
+ return value and tparser.pcdata(tostring(value))
+end
+
+--- Strip HTML tags from given string.
+-- @param value String containing the HTML text
+-- @return String with HTML tags stripped of
+function striptags(value)
+ return value and tparser.striptags(tostring(value))
+end
+
+--- Splits given string on a defined separator sequence and return a table
+-- containing the resulting substrings. The optional max parameter specifies
+-- the number of bytes to process, regardless of the actual length of the given
+-- string. The optional last parameter, regex, specifies whether the separator
+-- sequence is interpreted as regular expression.
+-- @param str String value containing the data to split up
+-- @param pat String with separator pattern (optional, defaults to "\n")
+-- @param max Maximum times to split (optional)
+-- @param regex Boolean indicating whether to interpret the separator
+-- pattern as regular expression (optional, default is false)
+-- @return Table containing the resulting substrings
+function split(str, pat, max, regex)
+ pat = pat or "\n"
+ max = max or #str
+
+ local t = {}
+ local c = 1
+
+ if #str == 0 then
+ return {""}
+ end
+
+ if #pat == 0 then
+ return nil
+ end
+
+ if max == 0 then
+ return str
+ end
+
+ repeat
+ local s, e = str:find(pat, c, not regex)
+ max = max - 1
+ if s and max < 0 then
+ t[#t+1] = str:sub(c)
+ else
+ t[#t+1] = str:sub(c, s and s - 1)
+ end
+ c = e and e + 1 or #str + 1
+ until not s or max < 0
+
+ return t
+end
+
+--- Remove leading and trailing whitespace from given string value.
+-- @param str String value containing whitespace padded data
+-- @return String value with leading and trailing space removed
+function trim(str)
+ return (str:gsub("^%s*(.-)%s*$", "%1"))
+end
+
+--- Count the occurences of given substring in given string.
+-- @param str String to search in
+-- @param pattern String containing pattern to find
+-- @return Number of found occurences
+function cmatch(str, pat)
+ local count = 0
+ for _ in str:gmatch(pat) do count = count + 1 end
+ return count
+end
+
+--- Return a matching iterator for the given value. The iterator will return
+-- one token per invocation, the tokens are separated by whitespace. If the
+-- input value is a table, it is transformed into a string first. A nil value
+-- will result in a valid interator which aborts with the first invocation.
+-- @param val The value to scan (table, string or nil)
+-- @return Iterator which returns one token per call
+function imatch(v)
+ if type(v) == "table" then
+ local k = nil
+ return function()
+ k = next(v, k)
+ return v[k]
+ end
+
+ elseif type(v) == "number" or type(v) == "boolean" then
+ local x = true
+ return function()
+ if x then
+ x = false
+ return tostring(v)
+ end
+ end
+
+ elseif type(v) == "userdata" or type(v) == "string" then
+ return tostring(v):gmatch("%S+")
+ end
+
+ return function() end
+end
+
+--- Parse certain units from the given string and return the canonical integer
+-- value or 0 if the unit is unknown. Upper- or lower case is irrelevant.
+-- Recognized units are:
+-- o "y" - one year (60*60*24*366)
+-- o "m" - one month (60*60*24*31)
+-- o "w" - one week (60*60*24*7)
+-- o "d" - one day (60*60*24)
+-- o "h" - one hour (60*60)
+-- o "min" - one minute (60)
+-- o "kb" - one kilobyte (1024)
+-- o "mb" - one megabyte (1024*1024)
+-- o "gb" - one gigabyte (1024*1024*1024)
+-- o "kib" - one si kilobyte (1000)
+-- o "mib" - one si megabyte (1000*1000)
+-- o "gib" - one si gigabyte (1000*1000*1000)
+-- @param ustr String containing a numerical value with trailing unit
+-- @return Number containing the canonical value
+function parse_units(ustr)
+
+ local val = 0
+
+ -- unit map
+ local map = {
+ -- date stuff
+ y = 60 * 60 * 24 * 366,
+ m = 60 * 60 * 24 * 31,
+ w = 60 * 60 * 24 * 7,
+ d = 60 * 60 * 24,
+ h = 60 * 60,
+ min = 60,
+
+ -- storage sizes
+ kb = 1024,
+ mb = 1024 * 1024,
+ gb = 1024 * 1024 * 1024,
+
+ -- storage sizes (si)
+ kib = 1000,
+ mib = 1000 * 1000,
+ gib = 1000 * 1000 * 1000
+ }
+
+ -- parse input string
+ for spec in ustr:lower():gmatch("[0-9%.]+[a-zA-Z]*") do
+
+ local num = spec:gsub("[^0-9%.]+$","")
+ local spn = spec:gsub("^[0-9%.]+", "")
+
+ if map[spn] or map[spn:sub(1,1)] then
+ val = val + num * ( map[spn] or map[spn:sub(1,1)] )
+ else
+ val = val + num
+ end
+ end
+
+
+ return val
+end
+
+-- also register functions above in the central string class for convenience
+string.pcdata = pcdata
+string.striptags = striptags
+string.split = split
+string.trim = trim
+string.cmatch = cmatch
+string.parse_units = parse_units
+
+
+--- Appends numerically indexed tables or single objects to a given table.
+-- @param src Target table
+-- @param ... Objects to insert
+-- @return Target table
+function append(src, ...)
+ for i, a in ipairs({...}) do
+ if type(a) == "table" then
+ for j, v in ipairs(a) do
+ src[#src+1] = v
+ end
+ else
+ src[#src+1] = a
+ end
+ end
+ return src
+end
+
+--- Combines two or more numerically indexed tables and single objects into one table.
+-- @param tbl1 Table value to combine
+-- @param tbl2 Table value to combine
+-- @param ... More tables to combine
+-- @return Table value containing all values of given tables
+function combine(...)
+ return append({}, ...)
+end
+
+--- Checks whether the given table contains the given value.
+-- @param table Table value
+-- @param value Value to search within the given table
+-- @return Boolean indicating whether the given value occurs within table
+function contains(table, value)
+ for k, v in pairs(table) do
+ if value == v then
+ return k
+ end
+ end
+ return false
+end
+
+--- Update values in given table with the values from the second given table.
+-- Both table are - in fact - merged together.
+-- @param t Table which should be updated
+-- @param updates Table containing the values to update
+-- @return Always nil
+function update(t, updates)
+ for k, v in pairs(updates) do
+ t[k] = v
+ end
+end
+
+--- Retrieve all keys of given associative table.
+-- @param t Table to extract keys from
+-- @return Sorted table containing the keys
+function keys(t)
+ local keys = { }
+ if t then
+ for k, _ in kspairs(t) do
+ keys[#keys+1] = k
+ end
+ end
+ return keys
+end
+
+--- Clones the given object and return it's copy.
+-- @param object Table value to clone
+-- @param deep Boolean indicating whether to do recursive cloning
+-- @return Cloned table value
+function clone(object, deep)
+ local copy = {}
+
+ for k, v in pairs(object) do
+ if deep and type(v) == "table" then
+ v = clone(v, deep)
+ end
+ copy[k] = v
+ end
+
+ return setmetatable(copy, getmetatable(object))
+end
+
+
+--- Create a dynamic table which automatically creates subtables.
+-- @return Dynamic Table
+function dtable()
+ return setmetatable({}, { __index =
+ function(tbl, key)
+ return rawget(tbl, key)
+ or rawget(rawset(tbl, key, dtable()), key)
+ end
+ })
+end
+
+
+-- Serialize the contents of a table value.
+function _serialize_table(t, seen)
+ assert(not seen[t], "Recursion detected.")
+ seen[t] = true
+
+ local data = ""
+ local idata = ""
+ local ilen = 0
+
+ for k, v in pairs(t) do
+ if type(k) ~= "number" or k < 1 or math.floor(k) ~= k or ( k - #t ) > 3 then
+ k = serialize_data(k, seen)
+ v = serialize_data(v, seen)
+ data = data .. ( #data > 0 and ", " or "" ) ..
+ '[' .. k .. '] = ' .. v
+ elseif k > ilen then
+ ilen = k
+ end
+ end
+
+ for i = 1, ilen do
+ local v = serialize_data(t[i], seen)
+ idata = idata .. ( #idata > 0 and ", " or "" ) .. v
+ end
+
+ return idata .. ( #data > 0 and #idata > 0 and ", " or "" ) .. data
+end
+
+--- Recursively serialize given data to lua code, suitable for restoring
+-- with loadstring().
+-- @param val Value containing the data to serialize
+-- @return String value containing the serialized code
+-- @see restore_data
+-- @see get_bytecode
+function serialize_data(val, seen)
+ seen = seen or setmetatable({}, {__mode="k"})
+
+ if val == nil then
+ return "nil"
+ elseif type(val) == "number" then
+ return val
+ elseif type(val) == "string" then
+ return "%q" % val
+ elseif type(val) == "boolean" then
+ return val and "true" or "false"
+ elseif type(val) == "function" then
+ return "loadstring(%q)" % get_bytecode(val)
+ elseif type(val) == "table" then
+ return "{ " .. _serialize_table(val, seen) .. " }"
+ else
+ return '"[unhandled data type:' .. type(val) .. ']"'
+ end
+end
+
+--- Restore data previously serialized with serialize_data().
+-- @param str String containing the data to restore
+-- @return Value containing the restored data structure
+-- @see serialize_data
+-- @see get_bytecode
+function restore_data(str)
+ return loadstring("return " .. str)()
+end
+
+
+--
+-- Byte code manipulation routines
+--
+
+--- Return the current runtime bytecode of the given data. The byte code
+-- will be stripped before it is returned.
+-- @param val Value to return as bytecode
+-- @return String value containing the bytecode of the given data
+function get_bytecode(val)
+ local code
+
+ if type(val) == "function" then
+ code = string.dump(val)
+ else
+ code = string.dump( loadstring( "return " .. serialize_data(val) ) )
+ end
+
+ return code -- and strip_bytecode(code)
+end
+
+--- Strips unnescessary lua bytecode from given string. Information like line
+-- numbers and debugging numbers will be discarded. Original version by
+-- Peter Cawley (http://lua-users.org/lists/lua-l/2008-02/msg01158.html)
+-- @param code String value containing the original lua byte code
+-- @return String value containing the stripped lua byte code
+function strip_bytecode(code)
+ local version, format, endian, int, size, ins, num, lnum = code:byte(5, 12)
+ local subint
+ if endian == 1 then
+ subint = function(code, i, l)
+ local val = 0
+ for n = l, 1, -1 do
+ val = val * 256 + code:byte(i + n - 1)
+ end
+ return val, i + l
+ end
+ else
+ subint = function(code, i, l)
+ local val = 0
+ for n = 1, l, 1 do
+ val = val * 256 + code:byte(i + n - 1)
+ end
+ return val, i + l
+ end
+ end
+
+ local function strip_function(code)
+ local count, offset = subint(code, 1, size)
+ local stripped = { string.rep("\0", size) }
+ local dirty = offset + count
+ offset = offset + count + int * 2 + 4
+ offset = offset + int + subint(code, offset, int) * ins
+ count, offset = subint(code, offset, int)
+ for n = 1, count do
+ local t
+ t, offset = subint(code, offset, 1)
+ if t == 1 then
+ offset = offset + 1
+ elseif t == 4 then
+ offset = offset + size + subint(code, offset, size)
+ elseif t == 3 then
+ offset = offset + num
+ elseif t == 254 or t == 9 then
+ offset = offset + lnum
+ end
+ end
+ count, offset = subint(code, offset, int)
+ stripped[#stripped+1] = code:sub(dirty, offset - 1)
+ for n = 1, count do
+ local proto, off = strip_function(code:sub(offset, -1))
+ stripped[#stripped+1] = proto
+ offset = offset + off - 1
+ end
+ offset = offset + subint(code, offset, int) * int + int
+ count, offset = subint(code, offset, int)
+ for n = 1, count do
+ offset = offset + subint(code, offset, size) + size + int * 2
+ end
+ count, offset = subint(code, offset, int)
+ for n = 1, count do
+ offset = offset + subint(code, offset, size) + size
+ end
+ stripped[#stripped+1] = string.rep("\0", int * 3)
+ return table.concat(stripped), offset
+ end
+
+ return code:sub(1,12) .. strip_function(code:sub(13,-1))
+end
+
+
+--
+-- Sorting iterator functions
+--
+
+function _sortiter( t, f )
+ local keys = { }
+
+ local k, v
+ for k, v in pairs(t) do
+ keys[#keys+1] = k
+ end
+
+ local _pos = 0
+
+ table.sort( keys, f )
+
+ return function()
+ _pos = _pos + 1
+ if _pos <= #keys then
+ return keys[_pos], t[keys[_pos]], _pos
+ end
+ end
+end
+
+--- Return a key, value iterator which returns the values sorted according to
+-- the provided callback function.
+-- @param t The table to iterate
+-- @param f A callback function to decide the order of elements
+-- @return Function value containing the corresponding iterator
+function spairs(t,f)
+ return _sortiter( t, f )
+end
+
+--- Return a key, value iterator for the given table.
+-- The table pairs are sorted by key.
+-- @param t The table to iterate
+-- @return Function value containing the corresponding iterator
+function kspairs(t)
+ return _sortiter( t )
+end
+
+--- Return a key, value iterator for the given table.
+-- The table pairs are sorted by value.
+-- @param t The table to iterate
+-- @return Function value containing the corresponding iterator
+function vspairs(t)
+ return _sortiter( t, function (a,b) return t[a] < t[b] end )
+end
+
+
+--
+-- System utility functions
+--
+
+--- Test whether the current system is operating in big endian mode.
+-- @return Boolean value indicating whether system is big endian
+function bigendian()
+ return string.byte(string.dump(function() end), 7) == 0
+end
+
+--- Execute given commandline and gather stdout.
+-- @param command String containing command to execute
+-- @return String containing the command's stdout
+function exec(command)
+ local pp = io.popen(command)
+ local data = pp:read("*a")
+ pp:close()
+
+ return data
+end
+
+--- Return a line-buffered iterator over the output of given command.
+-- @param command String containing the command to execute
+-- @return Iterator
+function execi(command)
+ local pp = io.popen(command)
+
+ return pp and function()
+ local line = pp:read()
+
+ if not line then
+ pp:close()
+ end
+
+ return line
+ end
+end
+
+-- Deprecated
+function execl(command)
+ local pp = io.popen(command)
+ local line = ""
+ local data = {}
+
+ while true do
+ line = pp:read()
+ if (line == nil) then break end
+ data[#data+1] = line
+ end
+ pp:close()
+
+ return data
+end
+
+--- Returns the absolute path to LuCI base directory.
+-- @return String containing the directory path
+function libpath()
+ return require "nixio.fs".dirname(ldebug.__file__)
+end
+
+
+--
+-- Coroutine safe xpcall and pcall versions modified for Luci
+-- original version:
+-- coxpcall 1.13 - Copyright 2005 - Kepler Project (www.keplerproject.org)
+--
+-- Copyright © 2005 Kepler Project.
+-- Permission is hereby granted, free of charge, to any person obtaining a
+-- copy of this software and associated documentation files (the "Software"),
+-- to deal in the Software without restriction, including without limitation
+-- the rights to use, copy, modify, merge, publish, distribute, sublicense,
+-- and/or sell copies of the Software, and to permit persons to whom the
+-- Software is furnished to do so, subject to the following conditions:
+--
+-- The above copyright notice and this permission notice shall be
+-- included in all copies or substantial portions of the Software.
+--
+-- THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND,
+-- EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES
+-- OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+-- IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM,
+-- DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT,
+-- TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE
+-- OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
+
+local performResume, handleReturnValue
+local oldpcall, oldxpcall = pcall, xpcall
+coxpt = {}
+setmetatable(coxpt, {__mode = "kv"})
+
+-- Identity function for copcall
+local function copcall_id(trace, ...)
+ return ...
+end
+
+--- This is a coroutine-safe drop-in replacement for Lua's "xpcall"-function
+-- @param f Lua function to be called protected
+-- @param err Custom error handler
+-- @param ... Parameters passed to the function
+-- @return A boolean whether the function call succeeded and the return
+-- values of either the function or the error handler
+function coxpcall(f, err, ...)
+ local res, co = oldpcall(coroutine.create, f)
+ if not res then
+ local params = {...}
+ local newf = function() return f(unpack(params)) end
+ co = coroutine.create(newf)
+ end
+ local c = coroutine.running()
+ coxpt[co] = coxpt[c] or c or 0
+
+ return performResume(err, co, ...)
+end
+
+--- This is a coroutine-safe drop-in replacement for Lua's "pcall"-function
+-- @param f Lua function to be called protected
+-- @param ... Parameters passed to the function
+-- @return A boolean whether the function call succeeded and the returns
+-- values of the function or the error object
+function copcall(f, ...)
+ return coxpcall(f, copcall_id, ...)
+end
+
+-- Handle return value of protected call
+function handleReturnValue(err, co, status, ...)
+ if not status then
+ return false, err(debug.traceback(co, (...)), ...)
+ end
+
+ if coroutine.status(co) ~= 'suspended' then
+ return true, ...
+ end
+
+ return performResume(err, co, coroutine.yield(...))
+end
+
+-- Resume execution of protected function call
+function performResume(err, co, ...)
+ return handleReturnValue(err, co, coroutine.resume(co, ...))
+end
diff --git a/modules/base/luasrc/version.lua b/modules/base/luasrc/version.lua
new file mode 100644
index 000000000..9e5cb719c
--- /dev/null
+++ b/modules/base/luasrc/version.lua
@@ -0,0 +1,12 @@
+--[[
+LuCI - Lua Configuration Interface
+Version definition - do not edit this file
+]]--
+
+module "luci.version"
+
+distname = "Host System"
+distversion = "SDK"
+
+luciname = "LuCI"
+luciversion = "SVN"
diff --git a/modules/base/luasrc/view/error404.htm b/modules/base/luasrc/view/error404.htm
new file mode 100644
index 000000000..813604d12
--- /dev/null
+++ b/modules/base/luasrc/view/error404.htm
@@ -0,0 +1,19 @@
+<%#
+LuCI - Lua Configuration Interface
+Copyright 2008 Steven Barth <steven@midlink.org>
+Copyright 2008 Jo-Philipp Wich <xm@leipzig.freifunk.net>
+
+Licensed under the Apache License, Version 2.0 (the "License");
+you may not use this file except in compliance with the License.
+You may obtain a copy of the License at
+
+ http://www.apache.org/licenses/LICENSE-2.0
+
+$Id$
+
+-%>
+<%+header%>
+<h2><a id="content" name="content">404 <%:Not Found%></a></h2>
+<p><%:Sorry, the object you requested was not found.%></p>
+<tt><%:Unable to dispatch%>: <%=luci.http.request.env.PATH_INFO%></tt>
+<%+footer%>
diff --git a/modules/base/luasrc/view/error500.htm b/modules/base/luasrc/view/error500.htm
new file mode 100644
index 000000000..14ba0410a
--- /dev/null
+++ b/modules/base/luasrc/view/error500.htm
@@ -0,0 +1,19 @@
+<%#
+LuCI - Lua Configuration Interface
+Copyright 2008 Steven Barth <steven@midlink.org>
+Copyright 2008 Jo-Philipp Wich <xm@leipzig.freifunk.net>
+
+Licensed under the Apache License, Version 2.0 (the "License");
+you may not use this file except in compliance with the License.
+You may obtain a copy of the License at
+
+ http://www.apache.org/licenses/LICENSE-2.0
+
+$Id$
+
+-%>
+<%+header%>
+<h2><a id="content" name="content">500 <%:Internal Server Error%></a></h2>
+<p><%:Sorry, the server encountered an unexpected error.%></p>
+<pre class="error500"><%=message%></pre>
+<%+footer%>
diff --git a/modules/base/luasrc/view/footer.htm b/modules/base/luasrc/view/footer.htm
new file mode 100644
index 000000000..6c6d21421
--- /dev/null
+++ b/modules/base/luasrc/view/footer.htm
@@ -0,0 +1,15 @@
+<%#
+LuCI - Lua Configuration Interface
+Copyright 2008 Steven Barth <steven@midlink.org>
+Copyright 2008 Jo-Philipp Wich <xm@leipzig.freifunk.net>
+
+Licensed under the Apache License, Version 2.0 (the "License");
+you may not use this file except in compliance with the License.
+You may obtain a copy of the License at
+
+ http://www.apache.org/licenses/LICENSE-2.0
+
+$Id$
+
+-%>
+<% include("themes/" .. theme .. "/footer") %> \ No newline at end of file
diff --git a/modules/base/luasrc/view/header.htm b/modules/base/luasrc/view/header.htm
new file mode 100644
index 000000000..77018b117
--- /dev/null
+++ b/modules/base/luasrc/view/header.htm
@@ -0,0 +1,21 @@
+<%#
+LuCI - Lua Configuration Interface
+Copyright 2008 Steven Barth <steven@midlink.org>
+Copyright 2008 Jo-Philipp Wich <xm@leipzig.freifunk.net>
+
+Licensed under the Apache License, Version 2.0 (the "License");
+you may not use this file except in compliance with the License.
+You may obtain a copy of the License at
+
+ http://www.apache.org/licenses/LICENSE-2.0
+
+$Id$
+
+-%>
+
+<%
+ if not luci.dispatcher.context.template_header_sent then
+ include("themes/" .. theme .. "/header")
+ luci.dispatcher.context.template_header_sent = true
+ end
+%>
diff --git a/modules/base/luasrc/view/indexer.htm b/modules/base/luasrc/view/indexer.htm
new file mode 100644
index 000000000..c62828971
--- /dev/null
+++ b/modules/base/luasrc/view/indexer.htm
@@ -0,0 +1,15 @@
+<%#
+LuCI - Lua Configuration Interface
+Copyright 2008 Steven Barth <steven@midlink.org>
+Copyright 2008 Jo-Philipp Wich <xm@leipzig.freifunk.net>
+
+Licensed under the Apache License, Version 2.0 (the "License");
+you may not use this file except in compliance with the License.
+You may obtain a copy of the License at
+
+ http://www.apache.org/licenses/LICENSE-2.0
+
+$Id$
+
+-%>
+<% include("themes/" .. theme .. "/indexer") %> \ No newline at end of file
diff --git a/modules/base/luasrc/view/sysauth.htm b/modules/base/luasrc/view/sysauth.htm
new file mode 100644
index 000000000..7c39f0da5
--- /dev/null
+++ b/modules/base/luasrc/view/sysauth.htm
@@ -0,0 +1,80 @@
+<%#
+LuCI - Lua Configuration Interface
+Copyright 2008 Steven Barth <steven@midlink.org>
+Copyright 2008-2012 Jo-Philipp Wich <xm@subsignal.org>
+
+Licensed under the Apache License, Version 2.0 (the "License");
+you may not use this file except in compliance with the License.
+You may obtain a copy of the License at
+
+ http://www.apache.org/licenses/LICENSE-2.0
+
+-%>
+
+<%+header%>
+
+<form method="post" action="<%=pcdata(luci.http.getenv("REQUEST_URI"))%>">
+ <div class="cbi-map">
+ <h2><a id="content" name="content"><%:Authorization Required%></a></h2>
+ <div class="cbi-map-descr">
+ <%:Please enter your username and password.%>
+ <%- if fuser then %>
+ <div class="error"><%:Invalid username and/or password! Please try again.%></div>
+ <br />
+ <% end -%>
+ </div>
+ <fieldset class="cbi-section"><fieldset class="cbi-section-node">
+ <div class="cbi-value">
+ <label class="cbi-value-title"><%:Username%></label>
+ <div class="cbi-value-field">
+ <input class="cbi-input-user" type="text" name="username" value="<%=duser%>" />
+ </div>
+ </div>
+ <div class="cbi-value cbi-value-last">
+ <label class="cbi-value-title"><%:Password%></label>
+ <div class="cbi-value-field">
+ <input id="focus_password" class="cbi-input-password" type="password" name="password" />
+ </div>
+ </div>
+ </fieldset></fieldset>
+ </div>
+
+ <div>
+ <input type="submit" value="<%:Login%>" class="cbi-button cbi-button-apply" />
+ <input type="reset" value="<%:Reset%>" class="cbi-button cbi-button-reset" />
+ </div>
+</form>
+<script type="text/javascript">//<![CDATA[
+ var input = document.getElementById('focus_password');
+ if (input)
+ input.focus();
+//]]></script>
+
+<%
+local uci = require "luci.model.uci".cursor()
+local fs = require "nixio.fs"
+local https_key = uci:get("uhttpd", "main", "key")
+local https_port = uci:get("uhttpd", "main", "listen_https")
+if type(https_port) == "table" then
+ https_port = https_port[1]
+end
+
+if https_port and fs.access(https_key) then
+ https_port = https_port:match("(%d+)$")
+%>
+
+<script type="text/javascript">//<![CDATA[
+ if (document.location.protocol != 'https:') {
+ var url = 'https://' + window.location.hostname + ':' + '<%=https_port%>' + window.location.pathname;
+ var img=new Image;
+ img.onload=function(){window.location = url};
+ img.src='https://' + window.location.hostname + ':' + '<%=https_port%>' + '<%=resource%>/cbi/up.gif?' + Math.random();;
+ setTimeout(function(){
+ img.src=''
+ }, 5000);
+ }
+//]]></script>
+
+<% end %>
+
+<%+footer%>
diff --git a/modules/base/root/etc/config/ucitrack b/modules/base/root/etc/config/ucitrack
new file mode 100644
index 000000000..04467f4fd
--- /dev/null
+++ b/modules/base/root/etc/config/ucitrack
@@ -0,0 +1,53 @@
+config network
+ option init network
+ list affects dhcp
+ list affects radvd
+
+config wireless
+ list affects network
+
+config firewall
+ option init firewall
+ list affects luci-splash
+ list affects qos
+ list affects miniupnpd
+
+config olsr
+ option init olsrd
+
+config dhcp
+ option init dnsmasq
+
+config dropbear
+ option init dropbear
+
+config httpd
+ option init httpd
+
+config fstab
+ option init fstab
+
+config qos
+ option init qos
+
+config system
+ option init led
+ list affects luci_statistics
+
+config luci_splash
+ option init luci_splash
+
+config upnpd
+ option init miniupnpd
+
+config ntpclient
+ option init ntpclient
+
+config samba
+ option init samba
+
+config tinyproxy
+ option init tinyproxy
+
+config 6relayd
+ option init 6relayd
diff --git a/modules/base/root/root/etc/config/luci b/modules/base/root/root/etc/config/luci
new file mode 100644
index 000000000..c503a8f1e
--- /dev/null
+++ b/modules/base/root/root/etc/config/luci
@@ -0,0 +1,24 @@
+config core main
+ option lang auto
+ option mediaurlbase /luci-static/openwrt.org
+ option resourcebase /luci-static/resources
+
+config extern flash_keep
+ option uci "/etc/config/"
+ option dropbear "/etc/dropbear/"
+ option openvpn "/etc/openvpn/"
+ option passwd "/etc/passwd"
+ option opkg "/etc/opkg.conf"
+ option firewall "/etc/firewall.user"
+ option uploads "/lib/uci/upload/"
+
+config internal languages
+
+config internal sauth
+ option sessionpath "/tmp/luci-sessions"
+ option sessiontime 3600
+
+config internal ccache
+ option enable 1
+
+config internal themes
diff --git a/modules/base/root/root/lib/uci/upload/.gitignore b/modules/base/root/root/lib/uci/upload/.gitignore
new file mode 100644
index 000000000..e69de29bb
--- /dev/null
+++ b/modules/base/root/root/lib/uci/upload/.gitignore
diff --git a/modules/base/root/sbin/luci-reload b/modules/base/root/sbin/luci-reload
new file mode 100755
index 000000000..cc41da2bb
--- /dev/null
+++ b/modules/base/root/sbin/luci-reload
@@ -0,0 +1,45 @@
+#!/bin/sh
+. /lib/functions.sh
+
+apply_config() {
+ config_get init "$1" init
+ config_get exec "$1" exec
+ config_get test "$1" test
+
+ echo "$2" > "/var/run/luci-reload-status"
+
+ [ -n "$init" ] && reload_init "$2" "$init" "$test"
+ [ -n "$exec" ] && reload_exec "$2" "$exec" "$test"
+}
+
+reload_exec() {
+ local service="$1"
+ local ok="$3"
+ set -- $2
+ local cmd="$1"; shift
+
+ [ -x "$cmd" ] && {
+ echo "Reloading $service... "
+ ( $cmd "$@" ) 2>/dev/null 1>&2
+ [ -n "$ok" -a "$?" != "$ok" ] && echo '!!! Failed to reload' $service '!!!'
+ }
+}
+
+reload_init() {
+ [ -x /etc/init.d/$2 ] && /etc/init.d/$2 enabled && {
+ echo "Reloading $1... "
+ /etc/init.d/$2 reload >/dev/null 2>&1
+ [ -n "$3" -a "$?" != "$3" ] && echo '!!! Failed to reload' $1 '!!!'
+ }
+}
+
+lock "/var/run/luci-reload"
+
+config_load ucitrack
+
+for i in $*; do
+ config_foreach apply_config $i $i
+done
+
+rm -f "/var/run/luci-reload-status"
+lock -u "/var/run/luci-reload"
diff --git a/modules/base/root/www/index.html b/modules/base/root/www/index.html
new file mode 100644
index 000000000..0a7238b55
--- /dev/null
+++ b/modules/base/root/www/index.html
@@ -0,0 +1,10 @@
+<?xml version="1.0" encoding="utf-8"?>
+<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.1//EN" "http://www.w3.org/TR/xhtml11/DTD/xhtml11.dtd">
+<html xmlns="http://www.w3.org/1999/xhtml">
+<head>
+<meta http-equiv="refresh" content="0; URL=/cgi-bin/luci" />
+</head>
+<body style="background-color: black">
+<a style="color: white; text-decoration: none" href="/cgi-bin/luci">LuCI - Lua Configuration Interface</a>
+</body>
+</html>
diff --git a/modules/base/src/po2lmo.c b/modules/base/src/po2lmo.c
new file mode 100644
index 000000000..0da792b68
--- /dev/null
+++ b/modules/base/src/po2lmo.c
@@ -0,0 +1,247 @@
+/*
+ * lmo - Lua Machine Objects - PO to LMO conversion tool
+ *
+ * Copyright (C) 2009-2012 Jo-Philipp Wich <xm@subsignal.org>
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#include "template_lmo.h"
+
+static void die(const char *msg)
+{
+ fprintf(stderr, "Error: %s\n", msg);
+ exit(1);
+}
+
+static void usage(const char *name)
+{
+ fprintf(stderr, "Usage: %s input.po output.lmo\n", name);
+ exit(1);
+}
+
+static void print(const void *ptr, size_t size, size_t nmemb, FILE *stream)
+{
+ if( fwrite(ptr, size, nmemb, stream) == 0 )
+ die("Failed to write stdout");
+}
+
+static int extract_string(const char *src, char *dest, int len)
+{
+ int pos = 0;
+ int esc = 0;
+ int off = -1;
+
+ for( pos = 0; (pos < strlen(src)) && (pos < len); pos++ )
+ {
+ if( (off == -1) && (src[pos] == '"') )
+ {
+ off = pos + 1;
+ }
+ else if( off >= 0 )
+ {
+ if( esc == 1 )
+ {
+ switch (src[pos])
+ {
+ case '"':
+ case '\\':
+ off++;
+ break;
+ }
+ dest[pos-off] = src[pos];
+ esc = 0;
+ }
+ else if( src[pos] == '\\' )
+ {
+ dest[pos-off] = src[pos];
+ esc = 1;
+ }
+ else if( src[pos] != '"' )
+ {
+ dest[pos-off] = src[pos];
+ }
+ else
+ {
+ dest[pos-off] = '\0';
+ break;
+ }
+ }
+ }
+
+ return (off > -1) ? strlen(dest) : -1;
+}
+
+static int cmp_index(const void *a, const void *b)
+{
+ uint32_t x = ((const lmo_entry_t *)a)->key_id;
+ uint32_t y = ((const lmo_entry_t *)b)->key_id;
+
+ if (x < y)
+ return -1;
+ else if (x > y)
+ return 1;
+
+ return 0;
+}
+
+static void print_uint32(uint32_t x, FILE *out)
+{
+ uint32_t y = htonl(x);
+ print(&y, sizeof(uint32_t), 1, out);
+}
+
+static void print_index(void *array, int n, FILE *out)
+{
+ lmo_entry_t *e;
+
+ qsort(array, n, sizeof(*e), cmp_index);
+
+ for (e = array; n > 0; n--, e++)
+ {
+ print_uint32(e->key_id, out);
+ print_uint32(e->val_id, out);
+ print_uint32(e->offset, out);
+ print_uint32(e->length, out);
+ }
+}
+
+int main(int argc, char *argv[])
+{
+ char line[4096];
+ char key[4096];
+ char val[4096];
+ char tmp[4096];
+ int state = 0;
+ int offset = 0;
+ int length = 0;
+ int n_entries = 0;
+ void *array = NULL;
+ lmo_entry_t *entry = NULL;
+ uint32_t key_id, val_id;
+
+ FILE *in;
+ FILE *out;
+
+ if( (argc != 3) || ((in = fopen(argv[1], "r")) == NULL) || ((out = fopen(argv[2], "w")) == NULL) )
+ usage(argv[0]);
+
+ memset(line, 0, sizeof(key));
+ memset(key, 0, sizeof(val));
+ memset(val, 0, sizeof(val));
+
+ while( (NULL != fgets(line, sizeof(line), in)) || (state >= 2 && feof(in)) )
+ {
+ if( state == 0 && strstr(line, "msgid \"") == line )
+ {
+ switch(extract_string(line, key, sizeof(key)))
+ {
+ case -1:
+ die("Syntax error in msgid");
+ case 0:
+ state = 1;
+ break;
+ default:
+ state = 2;
+ }
+ }
+ else if( state == 1 || state == 2 )
+ {
+ if( strstr(line, "msgstr \"") == line || state == 2 )
+ {
+ switch(extract_string(line, val, sizeof(val)))
+ {
+ case -1:
+ state = 4;
+ break;
+ default:
+ state = 3;
+ }
+ }
+ else
+ {
+ switch(extract_string(line, tmp, sizeof(tmp)))
+ {
+ case -1:
+ state = 2;
+ break;
+ default:
+ strcat(key, tmp);
+ }
+ }
+ }
+ else if( state == 3 )
+ {
+ switch(extract_string(line, tmp, sizeof(tmp)))
+ {
+ case -1:
+ state = 4;
+ break;
+ default:
+ strcat(val, tmp);
+ }
+ }
+
+ if( state == 4 )
+ {
+ if( strlen(key) > 0 && strlen(val) > 0 )
+ {
+ key_id = sfh_hash(key, strlen(key));
+ val_id = sfh_hash(val, strlen(val));
+
+ if( key_id != val_id )
+ {
+ n_entries++;
+ array = realloc(array, n_entries * sizeof(lmo_entry_t));
+ entry = (lmo_entry_t *)array + n_entries - 1;
+
+ if (!array)
+ die("Out of memory");
+
+ entry->key_id = key_id;
+ entry->val_id = val_id;
+ entry->offset = offset;
+ entry->length = strlen(val);
+
+ length = strlen(val) + ((4 - (strlen(val) % 4)) % 4);
+
+ print(val, length, 1, out);
+ offset += length;
+ }
+ }
+
+ state = 0;
+ memset(key, 0, sizeof(key));
+ memset(val, 0, sizeof(val));
+ }
+
+ memset(line, 0, sizeof(line));
+ }
+
+ print_index(array, n_entries, out);
+
+ if( offset > 0 )
+ {
+ print_uint32(offset, out);
+ fsync(fileno(out));
+ fclose(out);
+ }
+ else
+ {
+ fclose(out);
+ unlink(argv[2]);
+ }
+
+ fclose(in);
+ return(0);
+}
diff --git a/modules/base/src/template_lmo.c b/modules/base/src/template_lmo.c
new file mode 100644
index 000000000..27205a722
--- /dev/null
+++ b/modules/base/src/template_lmo.c
@@ -0,0 +1,328 @@
+/*
+ * lmo - Lua Machine Objects - Base functions
+ *
+ * Copyright (C) 2009-2010 Jo-Philipp Wich <xm@subsignal.org>
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#include "template_lmo.h"
+
+/*
+ * Hash function from http://www.azillionmonkeys.com/qed/hash.html
+ * Copyright (C) 2004-2008 by Paul Hsieh
+ */
+
+uint32_t sfh_hash(const char *data, int len)
+{
+ uint32_t hash = len, tmp;
+ int rem;
+
+ if (len <= 0 || data == NULL) return 0;
+
+ rem = len & 3;
+ len >>= 2;
+
+ /* Main loop */
+ for (;len > 0; len--) {
+ hash += sfh_get16(data);
+ tmp = (sfh_get16(data+2) << 11) ^ hash;
+ hash = (hash << 16) ^ tmp;
+ data += 2*sizeof(uint16_t);
+ hash += hash >> 11;
+ }
+
+ /* Handle end cases */
+ switch (rem) {
+ case 3: hash += sfh_get16(data);
+ hash ^= hash << 16;
+ hash ^= data[sizeof(uint16_t)] << 18;
+ hash += hash >> 11;
+ break;
+ case 2: hash += sfh_get16(data);
+ hash ^= hash << 11;
+ hash += hash >> 17;
+ break;
+ case 1: hash += *data;
+ hash ^= hash << 10;
+ hash += hash >> 1;
+ }
+
+ /* Force "avalanching" of final 127 bits */
+ hash ^= hash << 3;
+ hash += hash >> 5;
+ hash ^= hash << 4;
+ hash += hash >> 17;
+ hash ^= hash << 25;
+ hash += hash >> 6;
+
+ return hash;
+}
+
+uint32_t lmo_canon_hash(const char *str, int len)
+{
+ char res[4096];
+ char *ptr, prev;
+ int off;
+
+ if (!str || len >= sizeof(res))
+ return 0;
+
+ for (prev = ' ', ptr = res, off = 0; off < len; prev = *str, off++, str++)
+ {
+ if (isspace(*str))
+ {
+ if (!isspace(prev))
+ *ptr++ = ' ';
+ }
+ else
+ {
+ *ptr++ = *str;
+ }
+ }
+
+ if ((ptr > res) && isspace(*(ptr-1)))
+ ptr--;
+
+ return sfh_hash(res, ptr - res);
+}
+
+lmo_archive_t * lmo_open(const char *file)
+{
+ int in = -1;
+ uint32_t idx_offset = 0;
+ struct stat s;
+
+ lmo_archive_t *ar = NULL;
+
+ if (stat(file, &s) == -1)
+ goto err;
+
+ if ((in = open(file, O_RDONLY)) == -1)
+ goto err;
+
+ if ((ar = (lmo_archive_t *)malloc(sizeof(*ar))) != NULL)
+ {
+ memset(ar, 0, sizeof(*ar));
+
+ ar->fd = in;
+ ar->size = s.st_size;
+
+ fcntl(ar->fd, F_SETFD, fcntl(ar->fd, F_GETFD) | FD_CLOEXEC);
+
+ if ((ar->mmap = mmap(NULL, ar->size, PROT_READ, MAP_SHARED, ar->fd, 0)) == MAP_FAILED)
+ goto err;
+
+ idx_offset = ntohl(*((const uint32_t *)
+ (ar->mmap + ar->size - sizeof(uint32_t))));
+
+ if (idx_offset >= ar->size)
+ goto err;
+
+ ar->index = (lmo_entry_t *)(ar->mmap + idx_offset);
+ ar->length = (ar->size - idx_offset - sizeof(uint32_t)) / sizeof(lmo_entry_t);
+ ar->end = ar->mmap + ar->size;
+
+ return ar;
+ }
+
+err:
+ if (in > -1)
+ close(in);
+
+ if (ar != NULL)
+ {
+ if ((ar->mmap != NULL) && (ar->mmap != MAP_FAILED))
+ munmap(ar->mmap, ar->size);
+
+ free(ar);
+ }
+
+ return NULL;
+}
+
+void lmo_close(lmo_archive_t *ar)
+{
+ if (ar != NULL)
+ {
+ if ((ar->mmap != NULL) && (ar->mmap != MAP_FAILED))
+ munmap(ar->mmap, ar->size);
+
+ close(ar->fd);
+ free(ar);
+
+ ar = NULL;
+ }
+}
+
+
+lmo_catalog_t *_lmo_catalogs = NULL;
+lmo_catalog_t *_lmo_active_catalog = NULL;
+
+int lmo_load_catalog(const char *lang, const char *dir)
+{
+ DIR *dh = NULL;
+ char pattern[16];
+ char path[PATH_MAX];
+ struct dirent *de = NULL;
+
+ lmo_archive_t *ar = NULL;
+ lmo_catalog_t *cat = NULL;
+
+ if (!lmo_change_catalog(lang))
+ return 0;
+
+ if (!dir || !(dh = opendir(dir)))
+ goto err;
+
+ if (!(cat = malloc(sizeof(*cat))))
+ goto err;
+
+ memset(cat, 0, sizeof(*cat));
+
+ snprintf(cat->lang, sizeof(cat->lang), "%s", lang);
+ snprintf(pattern, sizeof(pattern), "*.%s.lmo", lang);
+
+ while ((de = readdir(dh)) != NULL)
+ {
+ if (!fnmatch(pattern, de->d_name, 0))
+ {
+ snprintf(path, sizeof(path), "%s/%s", dir, de->d_name);
+ ar = lmo_open(path);
+
+ if (ar)
+ {
+ ar->next = cat->archives;
+ cat->archives = ar;
+ }
+ }
+ }
+
+ closedir(dh);
+
+ cat->next = _lmo_catalogs;
+ _lmo_catalogs = cat;
+
+ if (!_lmo_active_catalog)
+ _lmo_active_catalog = cat;
+
+ return 0;
+
+err:
+ if (dh) closedir(dh);
+ if (cat) free(cat);
+
+ return -1;
+}
+
+int lmo_change_catalog(const char *lang)
+{
+ lmo_catalog_t *cat;
+
+ for (cat = _lmo_catalogs; cat; cat = cat->next)
+ {
+ if (!strncmp(cat->lang, lang, sizeof(cat->lang)))
+ {
+ _lmo_active_catalog = cat;
+ return 0;
+ }
+ }
+
+ return -1;
+}
+
+static lmo_entry_t * lmo_find_entry(lmo_archive_t *ar, uint32_t hash)
+{
+ unsigned int m, l, r;
+ uint32_t k;
+
+ l = 0;
+ r = ar->length - 1;
+
+ while (1)
+ {
+ m = l + ((r - l) / 2);
+
+ if (r < l)
+ break;
+
+ k = ntohl(ar->index[m].key_id);
+
+ if (k == hash)
+ return &ar->index[m];
+
+ if (k > hash)
+ {
+ if (!m)
+ break;
+
+ r = m - 1;
+ }
+ else
+ {
+ l = m + 1;
+ }
+ }
+
+ return NULL;
+}
+
+int lmo_translate(const char *key, int keylen, char **out, int *outlen)
+{
+ uint32_t hash;
+ lmo_entry_t *e;
+ lmo_archive_t *ar;
+
+ if (!key || !_lmo_active_catalog)
+ return -2;
+
+ hash = lmo_canon_hash(key, keylen);
+
+ for (ar = _lmo_active_catalog->archives; ar; ar = ar->next)
+ {
+ if ((e = lmo_find_entry(ar, hash)) != NULL)
+ {
+ *out = ar->mmap + ntohl(e->offset);
+ *outlen = ntohl(e->length);
+ return 0;
+ }
+ }
+
+ return -1;
+}
+
+void lmo_close_catalog(const char *lang)
+{
+ lmo_archive_t *ar, *next;
+ lmo_catalog_t *cat, *prev;
+
+ for (prev = NULL, cat = _lmo_catalogs; cat; prev = cat, cat = cat->next)
+ {
+ if (!strncmp(cat->lang, lang, sizeof(cat->lang)))
+ {
+ if (prev)
+ prev->next = cat->next;
+ else
+ _lmo_catalogs = cat->next;
+
+ for (ar = cat->archives; ar; ar = next)
+ {
+ next = ar->next;
+ lmo_close(ar);
+ }
+
+ free(cat);
+ break;
+ }
+ }
+}
diff --git a/modules/base/src/template_lmo.h b/modules/base/src/template_lmo.h
new file mode 100644
index 000000000..57f59aa56
--- /dev/null
+++ b/modules/base/src/template_lmo.h
@@ -0,0 +1,92 @@
+/*
+ * lmo - Lua Machine Objects - General header
+ *
+ * Copyright (C) 2009-2012 Jo-Philipp Wich <xm@subsignal.org>
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#ifndef _TEMPLATE_LMO_H_
+#define _TEMPLATE_LMO_H_
+
+#include <stdlib.h>
+#include <stdio.h>
+#include <stdint.h>
+#include <string.h>
+#include <fcntl.h>
+#include <sys/stat.h>
+#include <sys/mman.h>
+#include <arpa/inet.h>
+#include <unistd.h>
+#include <errno.h>
+#include <fnmatch.h>
+#include <dirent.h>
+#include <ctype.h>
+#include <limits.h>
+
+#if (defined(__GNUC__) && defined(__i386__))
+#define sfh_get16(d) (*((const uint16_t *) (d)))
+#else
+#define sfh_get16(d) ((((uint32_t)(((const uint8_t *)(d))[1])) << 8)\
+ +(uint32_t)(((const uint8_t *)(d))[0]) )
+#endif
+
+
+struct lmo_entry {
+ uint32_t key_id;
+ uint32_t val_id;
+ uint32_t offset;
+ uint32_t length;
+} __attribute__((packed));
+
+typedef struct lmo_entry lmo_entry_t;
+
+
+struct lmo_archive {
+ int fd;
+ int length;
+ uint32_t size;
+ lmo_entry_t *index;
+ char *mmap;
+ char *end;
+ struct lmo_archive *next;
+};
+
+typedef struct lmo_archive lmo_archive_t;
+
+
+struct lmo_catalog {
+ char lang[6];
+ struct lmo_archive *archives;
+ struct lmo_catalog *next;
+};
+
+typedef struct lmo_catalog lmo_catalog_t;
+
+
+uint32_t sfh_hash(const char *data, int len);
+uint32_t lmo_canon_hash(const char *data, int len);
+
+lmo_archive_t * lmo_open(const char *file);
+void lmo_close(lmo_archive_t *ar);
+
+
+extern lmo_catalog_t *_lmo_catalogs;
+extern lmo_catalog_t *_lmo_active_catalog;
+
+int lmo_load_catalog(const char *lang, const char *dir);
+int lmo_change_catalog(const char *lang);
+int lmo_translate(const char *key, int keylen, char **out, int *outlen);
+void lmo_close_catalog(const char *lang);
+
+#endif
diff --git a/modules/base/src/template_lualib.c b/modules/base/src/template_lualib.c
new file mode 100644
index 000000000..0d4364104
--- /dev/null
+++ b/modules/base/src/template_lualib.c
@@ -0,0 +1,163 @@
+/*
+ * LuCI Template - Lua binding
+ *
+ * Copyright (C) 2009 Jo-Philipp Wich <xm@subsignal.org>
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#include "template_lualib.h"
+
+int template_L_parse(lua_State *L)
+{
+ const char *file = luaL_checkstring(L, 1);
+ struct template_parser *parser = template_open(file);
+ int lua_status, rv;
+
+ if (!parser)
+ {
+ lua_pushnil(L);
+ lua_pushinteger(L, errno);
+ lua_pushstring(L, strerror(errno));
+ return 3;
+ }
+
+ lua_status = lua_load(L, template_reader, parser, file);
+
+ if (lua_status == 0)
+ rv = 1;
+ else
+ rv = template_error(L, parser);
+
+ template_close(parser);
+
+ return rv;
+}
+
+int template_L_utf8(lua_State *L)
+{
+ size_t len = 0;
+ const char *str = luaL_checklstring(L, 1, &len);
+ char *res = utf8(str, len);
+
+ if (res != NULL)
+ {
+ lua_pushstring(L, res);
+ free(res);
+
+ return 1;
+ }
+
+ return 0;
+}
+
+int template_L_pcdata(lua_State *L)
+{
+ size_t len = 0;
+ const char *str = luaL_checklstring(L, 1, &len);
+ char *res = pcdata(str, len);
+
+ if (res != NULL)
+ {
+ lua_pushstring(L, res);
+ free(res);
+
+ return 1;
+ }
+
+ return 0;
+}
+
+int template_L_striptags(lua_State *L)
+{
+ size_t len = 0;
+ const char *str = luaL_checklstring(L, 1, &len);
+ char *res = striptags(str, len);
+
+ if (res != NULL)
+ {
+ lua_pushstring(L, res);
+ free(res);
+
+ return 1;
+ }
+
+ return 0;
+}
+
+static int template_L_load_catalog(lua_State *L) {
+ const char *lang = luaL_optstring(L, 1, "en");
+ const char *dir = luaL_optstring(L, 2, NULL);
+ lua_pushboolean(L, !lmo_load_catalog(lang, dir));
+ return 1;
+}
+
+static int template_L_close_catalog(lua_State *L) {
+ const char *lang = luaL_optstring(L, 1, "en");
+ lmo_close_catalog(lang);
+ return 0;
+}
+
+static int template_L_change_catalog(lua_State *L) {
+ const char *lang = luaL_optstring(L, 1, "en");
+ lua_pushboolean(L, !lmo_change_catalog(lang));
+ return 1;
+}
+
+static int template_L_translate(lua_State *L) {
+ size_t len;
+ char *tr;
+ int trlen;
+ const char *key = luaL_checklstring(L, 1, &len);
+
+ switch (lmo_translate(key, len, &tr, &trlen))
+ {
+ case 0:
+ lua_pushlstring(L, tr, trlen);
+ return 1;
+
+ case -1:
+ return 0;
+ }
+
+ lua_pushnil(L);
+ lua_pushstring(L, "no catalog loaded");
+ return 2;
+}
+
+static int template_L_hash(lua_State *L) {
+ size_t len;
+ const char *key = luaL_checklstring(L, 1, &len);
+ lua_pushinteger(L, sfh_hash(key, len));
+ return 1;
+}
+
+
+/* module table */
+static const luaL_reg R[] = {
+ { "parse", template_L_parse },
+ { "utf8", template_L_utf8 },
+ { "pcdata", template_L_pcdata },
+ { "striptags", template_L_striptags },
+ { "load_catalog", template_L_load_catalog },
+ { "close_catalog", template_L_close_catalog },
+ { "change_catalog", template_L_change_catalog },
+ { "translate", template_L_translate },
+ { "hash", template_L_hash },
+ { NULL, NULL }
+};
+
+LUALIB_API int luaopen_luci_template_parser(lua_State *L) {
+ luaL_register(L, TEMPLATE_LUALIB_META, R);
+ return 1;
+}
diff --git a/modules/base/src/template_lualib.h b/modules/base/src/template_lualib.h
new file mode 100644
index 000000000..1b659be12
--- /dev/null
+++ b/modules/base/src/template_lualib.h
@@ -0,0 +1,30 @@
+/*
+ * LuCI Template - Lua library header
+ *
+ * Copyright (C) 2009 Jo-Philipp Wich <xm@subsignal.org>
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#ifndef _TEMPLATE_LUALIB_H_
+#define _TEMPLATE_LUALIB_H_
+
+#include "template_parser.h"
+#include "template_utils.h"
+#include "template_lmo.h"
+
+#define TEMPLATE_LUALIB_META "template.parser"
+
+LUALIB_API int luaopen_luci_template_parser(lua_State *L);
+
+#endif
diff --git a/modules/base/src/template_parser.c b/modules/base/src/template_parser.c
new file mode 100644
index 000000000..605445131
--- /dev/null
+++ b/modules/base/src/template_parser.c
@@ -0,0 +1,386 @@
+/*
+ * LuCI Template - Parser implementation
+ *
+ * Copyright (C) 2009-2012 Jo-Philipp Wich <xm@subsignal.org>
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#include "template_parser.h"
+#include "template_utils.h"
+#include "template_lmo.h"
+
+
+/* leading and trailing code for different types */
+const char *gen_code[9][2] = {
+ { NULL, NULL },
+ { "write(\"", "\")" },
+ { NULL, NULL },
+ { "write(tostring(", " or \"\"))" },
+ { "include(\"", "\")" },
+ { "write(\"", "\")" },
+ { "write(\"", "\")" },
+ { NULL, " " },
+ { NULL, NULL },
+};
+
+/* Simple strstr() like function that takes len arguments for both haystack and needle. */
+static char *strfind(char *haystack, int hslen, const char *needle, int ndlen)
+{
+ int match = 0;
+ int i, j;
+
+ for( i = 0; i < hslen; i++ )
+ {
+ if( haystack[i] == needle[0] )
+ {
+ match = ((ndlen == 1) || ((i + ndlen) <= hslen));
+
+ for( j = 1; (j < ndlen) && ((i + j) < hslen); j++ )
+ {
+ if( haystack[i+j] != needle[j] )
+ {
+ match = 0;
+ break;
+ }
+ }
+
+ if( match )
+ return &haystack[i];
+ }
+ }
+
+ return NULL;
+}
+
+struct template_parser * template_open(const char *file)
+{
+ struct stat s;
+ static struct template_parser *parser;
+
+ if (!(parser = malloc(sizeof(*parser))))
+ goto err;
+
+ memset(parser, 0, sizeof(*parser));
+ parser->fd = -1;
+ parser->file = file;
+
+ if (stat(file, &s))
+ goto err;
+
+ if ((parser->fd = open(file, O_RDONLY)) < 0)
+ goto err;
+
+ parser->size = s.st_size;
+ parser->mmap = mmap(NULL, parser->size, PROT_READ, MAP_PRIVATE,
+ parser->fd, 0);
+
+ if (parser->mmap != MAP_FAILED)
+ {
+ parser->off = parser->mmap;
+ parser->cur_chunk.type = T_TYPE_INIT;
+ parser->cur_chunk.s = parser->mmap;
+ parser->cur_chunk.e = parser->mmap;
+
+ return parser;
+ }
+
+err:
+ template_close(parser);
+ return NULL;
+}
+
+void template_close(struct template_parser *parser)
+{
+ if (!parser)
+ return;
+
+ if (parser->gc != NULL)
+ free(parser->gc);
+
+ if ((parser->mmap != NULL) && (parser->mmap != MAP_FAILED))
+ munmap(parser->mmap, parser->size);
+
+ if (parser->fd >= 0)
+ close(parser->fd);
+
+ free(parser);
+}
+
+void template_text(struct template_parser *parser, const char *e)
+{
+ const char *s = parser->off;
+
+ if (s < (parser->mmap + parser->size))
+ {
+ if (parser->strip_after)
+ {
+ while ((s <= e) && isspace(*s))
+ s++;
+ }
+
+ parser->cur_chunk.type = T_TYPE_TEXT;
+ }
+ else
+ {
+ parser->cur_chunk.type = T_TYPE_EOF;
+ }
+
+ parser->cur_chunk.line = parser->line;
+ parser->cur_chunk.s = s;
+ parser->cur_chunk.e = e;
+}
+
+void template_code(struct template_parser *parser, const char *e)
+{
+ const char *s = parser->off;
+
+ parser->strip_before = 0;
+ parser->strip_after = 0;
+
+ if (*s == '-')
+ {
+ parser->strip_before = 1;
+ for (s++; (s <= e) && (*s == ' ' || *s == '\t'); s++);
+ }
+
+ if (*(e-1) == '-')
+ {
+ parser->strip_after = 1;
+ for (e--; (e >= s) && (*e == ' ' || *e == '\t'); e--);
+ }
+
+ switch (*s)
+ {
+ /* comment */
+ case '#':
+ s++;
+ parser->cur_chunk.type = T_TYPE_COMMENT;
+ break;
+
+ /* include */
+ case '+':
+ s++;
+ parser->cur_chunk.type = T_TYPE_INCLUDE;
+ break;
+
+ /* translate */
+ case ':':
+ s++;
+ parser->cur_chunk.type = T_TYPE_I18N;
+ break;
+
+ /* translate raw */
+ case '_':
+ s++;
+ parser->cur_chunk.type = T_TYPE_I18N_RAW;
+ break;
+
+ /* expr */
+ case '=':
+ s++;
+ parser->cur_chunk.type = T_TYPE_EXPR;
+ break;
+
+ /* code */
+ default:
+ parser->cur_chunk.type = T_TYPE_CODE;
+ break;
+ }
+
+ parser->cur_chunk.line = parser->line;
+ parser->cur_chunk.s = s;
+ parser->cur_chunk.e = e;
+}
+
+static const char *
+template_format_chunk(struct template_parser *parser, size_t *sz)
+{
+ const char *s, *p;
+ const char *head, *tail;
+ struct template_chunk *c = &parser->prv_chunk;
+ struct template_buffer *buf;
+
+ *sz = 0;
+ s = parser->gc = NULL;
+
+ if (parser->strip_before && c->type == T_TYPE_TEXT)
+ {
+ while ((c->e > c->s) && isspace(*(c->e - 1)))
+ c->e--;
+ }
+
+ /* empty chunk */
+ if (c->s == c->e)
+ {
+ if (c->type == T_TYPE_EOF)
+ {
+ *sz = 0;
+ s = NULL;
+ }
+ else
+ {
+ *sz = 1;
+ s = " ";
+ }
+ }
+
+ /* format chunk */
+ else if ((buf = buf_init(c->e - c->s)) != NULL)
+ {
+ if ((head = gen_code[c->type][0]) != NULL)
+ buf_append(buf, head, strlen(head));
+
+ switch (c->type)
+ {
+ case T_TYPE_TEXT:
+ luastr_escape(buf, c->s, c->e - c->s, 0);
+ break;
+
+ case T_TYPE_EXPR:
+ buf_append(buf, c->s, c->e - c->s);
+ for (p = c->s; p < c->e; p++)
+ parser->line += (*p == '\n');
+ break;
+
+ case T_TYPE_INCLUDE:
+ luastr_escape(buf, c->s, c->e - c->s, 0);
+ break;
+
+ case T_TYPE_I18N:
+ luastr_translate(buf, c->s, c->e - c->s, 1);
+ break;
+
+ case T_TYPE_I18N_RAW:
+ luastr_translate(buf, c->s, c->e - c->s, 0);
+ break;
+
+ case T_TYPE_CODE:
+ buf_append(buf, c->s, c->e - c->s);
+ for (p = c->s; p < c->e; p++)
+ parser->line += (*p == '\n');
+ break;
+ }
+
+ if ((tail = gen_code[c->type][1]) != NULL)
+ buf_append(buf, tail, strlen(tail));
+
+ *sz = buf_length(buf);
+ s = parser->gc = buf_destroy(buf);
+
+ if (!*sz)
+ {
+ *sz = 1;
+ s = " ";
+ }
+ }
+
+ return s;
+}
+
+const char *template_reader(lua_State *L, void *ud, size_t *sz)
+{
+ struct template_parser *parser = ud;
+ int rem = parser->size - (parser->off - parser->mmap);
+ char *tag;
+
+ parser->prv_chunk = parser->cur_chunk;
+
+ /* free previous string */
+ if (parser->gc)
+ {
+ free(parser->gc);
+ parser->gc = NULL;
+ }
+
+ /* before tag */
+ if (!parser->in_expr)
+ {
+ if ((tag = strfind(parser->off, rem, "<%", 2)) != NULL)
+ {
+ template_text(parser, tag);
+ parser->off = tag + 2;
+ parser->in_expr = 1;
+ }
+ else
+ {
+ template_text(parser, parser->mmap + parser->size);
+ parser->off = parser->mmap + parser->size;
+ }
+ }
+
+ /* inside tag */
+ else
+ {
+ if ((tag = strfind(parser->off, rem, "%>", 2)) != NULL)
+ {
+ template_code(parser, tag);
+ parser->off = tag + 2;
+ parser->in_expr = 0;
+ }
+ else
+ {
+ /* unexpected EOF */
+ template_code(parser, parser->mmap + parser->size);
+
+ *sz = 1;
+ return "\033";
+ }
+ }
+
+ return template_format_chunk(parser, sz);
+}
+
+int template_error(lua_State *L, struct template_parser *parser)
+{
+ const char *err = luaL_checkstring(L, -1);
+ const char *off = parser->prv_chunk.s;
+ const char *ptr;
+ char msg[1024];
+ int line = 0;
+ int chunkline = 0;
+
+ if ((ptr = strfind((char *)err, strlen(err), "]:", 2)) != NULL)
+ {
+ chunkline = atoi(ptr + 2) - parser->prv_chunk.line;
+
+ while (*ptr)
+ {
+ if (*ptr++ == ' ')
+ {
+ err = ptr;
+ break;
+ }
+ }
+ }
+
+ if (strfind((char *)err, strlen(err), "'char(27)'", 10) != NULL)
+ {
+ off = parser->mmap + parser->size;
+ err = "'%>' expected before end of file";
+ chunkline = 0;
+ }
+
+ for (ptr = parser->mmap; ptr < off; ptr++)
+ if (*ptr == '\n')
+ line++;
+
+ snprintf(msg, sizeof(msg), "Syntax error in %s:%d: %s",
+ parser->file, line + chunkline, err ? err : "(unknown error)");
+
+ lua_pushnil(L);
+ lua_pushinteger(L, line + chunkline);
+ lua_pushstring(L, msg);
+
+ return 3;
+}
diff --git a/modules/base/src/template_parser.h b/modules/base/src/template_parser.h
new file mode 100644
index 000000000..d1c606272
--- /dev/null
+++ b/modules/base/src/template_parser.h
@@ -0,0 +1,79 @@
+/*
+ * LuCI Template - Parser header
+ *
+ * Copyright (C) 2009 Jo-Philipp Wich <xm@subsignal.org>
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#ifndef _TEMPLATE_PARSER_H_
+#define _TEMPLATE_PARSER_H_
+
+#include <stdlib.h>
+#include <stdio.h>
+#include <stdint.h>
+#include <unistd.h>
+#include <fcntl.h>
+#include <sys/stat.h>
+#include <sys/mman.h>
+#include <string.h>
+#include <ctype.h>
+#include <errno.h>
+
+#include <lua.h>
+#include <lualib.h>
+#include <lauxlib.h>
+
+
+/* code types */
+#define T_TYPE_INIT 0
+#define T_TYPE_TEXT 1
+#define T_TYPE_COMMENT 2
+#define T_TYPE_EXPR 3
+#define T_TYPE_INCLUDE 4
+#define T_TYPE_I18N 5
+#define T_TYPE_I18N_RAW 6
+#define T_TYPE_CODE 7
+#define T_TYPE_EOF 8
+
+
+struct template_chunk {
+ const char *s;
+ const char *e;
+ int type;
+ int line;
+};
+
+/* parser state */
+struct template_parser {
+ int fd;
+ uint32_t size;
+ char *mmap;
+ char *off;
+ char *gc;
+ int line;
+ int in_expr;
+ int strip_before;
+ int strip_after;
+ struct template_chunk prv_chunk;
+ struct template_chunk cur_chunk;
+ const char *file;
+};
+
+struct template_parser * template_open(const char *file);
+void template_close(struct template_parser *parser);
+
+const char *template_reader(lua_State *L, void *ud, size_t *sz);
+int template_error(lua_State *L, struct template_parser *parser);
+
+#endif
diff --git a/modules/base/src/template_utils.c b/modules/base/src/template_utils.c
new file mode 100644
index 000000000..80542bd4f
--- /dev/null
+++ b/modules/base/src/template_utils.c
@@ -0,0 +1,494 @@
+/*
+ * LuCI Template - Utility functions
+ *
+ * Copyright (C) 2010 Jo-Philipp Wich <xm@subsignal.org>
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#include "template_utils.h"
+#include "template_lmo.h"
+
+/* initialize a buffer object */
+struct template_buffer * buf_init(int size)
+{
+ struct template_buffer *buf;
+
+ if (size <= 0)
+ size = 1024;
+
+ buf = (struct template_buffer *)malloc(sizeof(struct template_buffer));
+
+ if (buf != NULL)
+ {
+ buf->fill = 0;
+ buf->size = size;
+ buf->data = malloc(buf->size);
+
+ if (buf->data != NULL)
+ {
+ buf->dptr = buf->data;
+ buf->data[0] = 0;
+
+ return buf;
+ }
+
+ free(buf);
+ }
+
+ return NULL;
+}
+
+/* grow buffer */
+int buf_grow(struct template_buffer *buf, int size)
+{
+ unsigned int off = (buf->dptr - buf->data);
+ char *data;
+
+ if (size <= 0)
+ size = 1024;
+
+ data = realloc(buf->data, buf->size + size);
+
+ if (data != NULL)
+ {
+ buf->data = data;
+ buf->dptr = data + off;
+ buf->size += size;
+
+ return buf->size;
+ }
+
+ return 0;
+}
+
+/* put one char into buffer object */
+int buf_putchar(struct template_buffer *buf, char c)
+{
+ if( ((buf->fill + 1) >= buf->size) && !buf_grow(buf, 0) )
+ return 0;
+
+ *(buf->dptr++) = c;
+ *(buf->dptr) = 0;
+
+ buf->fill++;
+ return 1;
+}
+
+/* append data to buffer */
+int buf_append(struct template_buffer *buf, const char *s, int len)
+{
+ if ((buf->fill + len + 1) >= buf->size)
+ {
+ if (!buf_grow(buf, len + 1))
+ return 0;
+ }
+
+ memcpy(buf->dptr, s, len);
+ buf->fill += len;
+ buf->dptr += len;
+
+ *(buf->dptr) = 0;
+
+ return len;
+}
+
+/* read buffer length */
+int buf_length(struct template_buffer *buf)
+{
+ return buf->fill;
+}
+
+/* destroy buffer object and return pointer to data */
+char * buf_destroy(struct template_buffer *buf)
+{
+ char *data = buf->data;
+
+ free(buf);
+ return data;
+}
+
+
+/* calculate the number of expected continuation chars */
+static inline int mb_num_chars(unsigned char c)
+{
+ if ((c & 0xE0) == 0xC0)
+ return 2;
+ else if ((c & 0xF0) == 0xE0)
+ return 3;
+ else if ((c & 0xF8) == 0xF0)
+ return 4;
+ else if ((c & 0xFC) == 0xF8)
+ return 5;
+ else if ((c & 0xFE) == 0xFC)
+ return 6;
+
+ return 1;
+}
+
+/* test whether the given byte is a valid continuation char */
+static inline int mb_is_cont(unsigned char c)
+{
+ return ((c >= 0x80) && (c <= 0xBF));
+}
+
+/* test whether the byte sequence at the given pointer with the given
+ * length is the shortest possible representation of the code point */
+static inline int mb_is_shortest(unsigned char *s, int n)
+{
+ switch (n)
+ {
+ case 2:
+ /* 1100000x (10xxxxxx) */
+ return !(((*s >> 1) == 0x60) &&
+ ((*(s+1) >> 6) == 0x02));
+
+ case 3:
+ /* 11100000 100xxxxx (10xxxxxx) */
+ return !((*s == 0xE0) &&
+ ((*(s+1) >> 5) == 0x04) &&
+ ((*(s+2) >> 6) == 0x02));
+
+ case 4:
+ /* 11110000 1000xxxx (10xxxxxx 10xxxxxx) */
+ return !((*s == 0xF0) &&
+ ((*(s+1) >> 4) == 0x08) &&
+ ((*(s+2) >> 6) == 0x02) &&
+ ((*(s+3) >> 6) == 0x02));
+
+ case 5:
+ /* 11111000 10000xxx (10xxxxxx 10xxxxxx 10xxxxxx) */
+ return !((*s == 0xF8) &&
+ ((*(s+1) >> 3) == 0x10) &&
+ ((*(s+2) >> 6) == 0x02) &&
+ ((*(s+3) >> 6) == 0x02) &&
+ ((*(s+4) >> 6) == 0x02));
+
+ case 6:
+ /* 11111100 100000xx (10xxxxxx 10xxxxxx 10xxxxxx 10xxxxxx) */
+ return !((*s == 0xF8) &&
+ ((*(s+1) >> 2) == 0x20) &&
+ ((*(s+2) >> 6) == 0x02) &&
+ ((*(s+3) >> 6) == 0x02) &&
+ ((*(s+4) >> 6) == 0x02) &&
+ ((*(s+5) >> 6) == 0x02));
+ }
+
+ return 1;
+}
+
+/* test whether the byte sequence at the given pointer with the given
+ * length is an UTF-16 surrogate */
+static inline int mb_is_surrogate(unsigned char *s, int n)
+{
+ return ((n == 3) && (*s == 0xED) && (*(s+1) >= 0xA0) && (*(s+1) <= 0xBF));
+}
+
+/* test whether the byte sequence at the given pointer with the given
+ * length is an illegal UTF-8 code point */
+static inline int mb_is_illegal(unsigned char *s, int n)
+{
+ return ((n == 3) && (*s == 0xEF) && (*(s+1) == 0xBF) &&
+ (*(s+2) >= 0xBE) && (*(s+2) <= 0xBF));
+}
+
+
+/* scan given source string, validate UTF-8 sequence and store result
+ * in given buffer object */
+static int _validate_utf8(unsigned char **s, int l, struct template_buffer *buf)
+{
+ unsigned char *ptr = *s;
+ unsigned int o = 0, v, n;
+
+ /* ascii byte without null */
+ if ((*(ptr+0) >= 0x01) && (*(ptr+0) <= 0x7F))
+ {
+ if (!buf_putchar(buf, *ptr++))
+ return 0;
+
+ o = 1;
+ }
+
+ /* multi byte sequence */
+ else if ((n = mb_num_chars(*ptr)) > 1)
+ {
+ /* count valid chars */
+ for (v = 1; (v <= n) && ((o+v) < l) && mb_is_cont(*(ptr+v)); v++);
+
+ switch (n)
+ {
+ case 6:
+ case 5:
+ /* five and six byte sequences are always invalid */
+ if (!buf_putchar(buf, '?'))
+ return 0;
+
+ break;
+
+ default:
+ /* if the number of valid continuation bytes matches the
+ * expected number and if the sequence is legal, copy
+ * the bytes to the destination buffer */
+ if ((v == n) && mb_is_shortest(ptr, n) &&
+ !mb_is_surrogate(ptr, n) && !mb_is_illegal(ptr, n))
+ {
+ /* copy sequence */
+ if (!buf_append(buf, (char *)ptr, n))
+ return 0;
+ }
+
+ /* the found sequence is illegal, skip it */
+ else
+ {
+ /* invalid sequence */
+ if (!buf_putchar(buf, '?'))
+ return 0;
+ }
+
+ break;
+ }
+
+ /* advance beyound the last found valid continuation char */
+ o = v;
+ ptr += v;
+ }
+
+ /* invalid byte (0x00) */
+ else
+ {
+ if (!buf_putchar(buf, '?')) /* or 0xEF, 0xBF, 0xBD */
+ return 0;
+
+ o = 1;
+ ptr++;
+ }
+
+ *s = ptr;
+ return o;
+}
+
+/* sanitize given string and replace all invalid UTF-8 sequences with "?" */
+char * utf8(const char *s, unsigned int l)
+{
+ struct template_buffer *buf = buf_init(l);
+ unsigned char *ptr = (unsigned char *)s;
+ unsigned int v, o;
+
+ if (!buf)
+ return NULL;
+
+ for (o = 0; o < l; o++)
+ {
+ /* ascii char */
+ if ((*ptr >= 0x01) && (*ptr <= 0x7F))
+ {
+ if (!buf_putchar(buf, (char)*ptr++))
+ break;
+ }
+
+ /* invalid byte or multi byte sequence */
+ else
+ {
+ if (!(v = _validate_utf8(&ptr, l - o, buf)))
+ break;
+
+ o += (v - 1);
+ }
+ }
+
+ return buf_destroy(buf);
+}
+
+/* Sanitize given string and strip all invalid XML bytes
+ * Validate UTF-8 sequences
+ * Escape XML control chars */
+char * pcdata(const char *s, unsigned int l)
+{
+ struct template_buffer *buf = buf_init(l);
+ unsigned char *ptr = (unsigned char *)s;
+ unsigned int o, v;
+ char esq[8];
+ int esl;
+
+ if (!buf)
+ return NULL;
+
+ for (o = 0; o < l; o++)
+ {
+ /* Invalid XML bytes */
+ if (((*ptr >= 0x00) && (*ptr <= 0x08)) ||
+ ((*ptr >= 0x0B) && (*ptr <= 0x0C)) ||
+ ((*ptr >= 0x0E) && (*ptr <= 0x1F)) ||
+ (*ptr == 0x7F))
+ {
+ ptr++;
+ }
+
+ /* Escapes */
+ else if ((*ptr == 0x26) ||
+ (*ptr == 0x27) ||
+ (*ptr == 0x22) ||
+ (*ptr == 0x3C) ||
+ (*ptr == 0x3E))
+ {
+ esl = snprintf(esq, sizeof(esq), "&#%i;", *ptr);
+
+ if (!buf_append(buf, esq, esl))
+ break;
+
+ ptr++;
+ }
+
+ /* ascii char */
+ else if (*ptr <= 0x7F)
+ {
+ buf_putchar(buf, (char)*ptr++);
+ }
+
+ /* multi byte sequence */
+ else
+ {
+ if (!(v = _validate_utf8(&ptr, l - o, buf)))
+ break;
+
+ o += (v - 1);
+ }
+ }
+
+ return buf_destroy(buf);
+}
+
+char * striptags(const char *s, unsigned int l)
+{
+ struct template_buffer *buf = buf_init(l);
+ unsigned char *ptr = (unsigned char *)s;
+ unsigned char *end = ptr + l;
+ unsigned char *tag;
+ unsigned char prev;
+ char esq[8];
+ int esl;
+
+ for (prev = ' '; ptr < end; ptr++)
+ {
+ if ((*ptr == '<') && ((ptr + 2) < end) &&
+ ((*(ptr + 1) == '/') || isalpha(*(ptr + 1))))
+ {
+ for (tag = ptr; tag < end; tag++)
+ {
+ if (*tag == '>')
+ {
+ if (!isspace(prev))
+ buf_putchar(buf, ' ');
+
+ ptr = tag;
+ prev = ' ';
+ break;
+ }
+ }
+ }
+ else if (isspace(*ptr))
+ {
+ if (!isspace(prev))
+ buf_putchar(buf, *ptr);
+
+ prev = *ptr;
+ }
+ else
+ {
+ switch(*ptr)
+ {
+ case '"':
+ case '\'':
+ case '<':
+ case '>':
+ case '&':
+ esl = snprintf(esq, sizeof(esq), "&#%i;", *ptr);
+ buf_append(buf, esq, esl);
+ break;
+
+ default:
+ buf_putchar(buf, *ptr);
+ break;
+ }
+
+ prev = *ptr;
+ }
+ }
+
+ return buf_destroy(buf);
+}
+
+void luastr_escape(struct template_buffer *out, const char *s, unsigned int l,
+ int escape_xml)
+{
+ int esl;
+ char esq[8];
+ char *ptr;
+
+ for (ptr = (char *)s; ptr < (s + l); ptr++)
+ {
+ switch (*ptr)
+ {
+ case '\\':
+ buf_append(out, "\\\\", 2);
+ break;
+
+ case '"':
+ if (escape_xml)
+ buf_append(out, "&#34;", 5);
+ else
+ buf_append(out, "\\\"", 2);
+ break;
+
+ case '\n':
+ buf_append(out, "\\n", 2);
+ break;
+
+ case '\'':
+ case '&':
+ case '<':
+ case '>':
+ if (escape_xml)
+ {
+ esl = snprintf(esq, sizeof(esq), "&#%i;", *ptr);
+ buf_append(out, esq, esl);
+ break;
+ }
+
+ default:
+ buf_putchar(out, *ptr);
+ }
+ }
+}
+
+void luastr_translate(struct template_buffer *out, const char *s, unsigned int l,
+ int escape_xml)
+{
+ char *tr;
+ int trlen;
+
+ switch (lmo_translate(s, l, &tr, &trlen))
+ {
+ case 0:
+ luastr_escape(out, tr, trlen, escape_xml);
+ break;
+
+ case -1:
+ luastr_escape(out, s, l, escape_xml);
+ break;
+
+ default:
+ /* no catalog loaded */
+ break;
+ }
+}
diff --git a/modules/base/src/template_utils.h b/modules/base/src/template_utils.h
new file mode 100644
index 000000000..c54af757c
--- /dev/null
+++ b/modules/base/src/template_utils.h
@@ -0,0 +1,49 @@
+/*
+ * LuCI Template - Utility header
+ *
+ * Copyright (C) 2010-2012 Jo-Philipp Wich <xm@subsignal.org>
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#ifndef _TEMPLATE_UTILS_H_
+#define _TEMPLATE_UTILS_H_
+
+#include <stdlib.h>
+#include <stdio.h>
+#include <string.h>
+
+
+/* buffer object */
+struct template_buffer {
+ char *data;
+ char *dptr;
+ unsigned int size;
+ unsigned int fill;
+};
+
+struct template_buffer * buf_init(int size);
+int buf_grow(struct template_buffer *buf, int size);
+int buf_putchar(struct template_buffer *buf, char c);
+int buf_append(struct template_buffer *buf, const char *s, int len);
+int buf_length(struct template_buffer *buf);
+char * buf_destroy(struct template_buffer *buf);
+
+char * utf8(const char *s, unsigned int l);
+char * pcdata(const char *s, unsigned int l);
+char * striptags(const char *s, unsigned int l);
+
+void luastr_escape(struct template_buffer *out, const char *s, unsigned int l, int escape_xml);
+void luastr_translate(struct template_buffer *out, const char *s, unsigned int l, int escape_xml);
+
+#endif
diff --git a/modules/base/standalone.mk b/modules/base/standalone.mk
new file mode 100644
index 000000000..66a0e5a2e
--- /dev/null
+++ b/modules/base/standalone.mk
@@ -0,0 +1,56 @@
+LUAC = luac
+LUAC_OPTIONS = -s
+LUA_TARGET ?= source
+
+LUA_MODULEDIR = /usr/local/share/lua/5.1
+LUA_LIBRARYDIR = /usr/local/lib/lua/5.1
+
+OS ?= $(shell uname)
+
+LUA_SHLIBS = $(shell pkg-config --silence-errors --libs lua5.1 || pkg-config --silence-errors --libs lua-5.1 || pkg-config --silence-errors --libs lua)
+LUA_LIBS = $(if $(LUA_SHLIBS),$(LUA_SHLIBS),$(firstword $(wildcard /usr/lib/liblua.a /usr/local/lib/liblua.a /opt/local/lib/liblua.a)))
+LUA_CFLAGS = $(shell pkg-config --silence-errors --cflags lua5.1 || pkg-config --silence-errors --cflags lua-5.1 || pkg-config --silence-errors --cflags lua)
+
+CC = gcc
+AR = ar
+RANLIB = ranlib
+CFLAGS = -O2
+FPIC = -fPIC
+EXTRA_CFLAGS = --std=gnu99
+WFLAGS = -Wall -Werror -pedantic
+CPPFLAGS =
+COMPILE = $(CC) $(CPPFLAGS) $(CFLAGS) $(EXTRA_CFLAGS) $(WFLAGS)
+ifeq ($(OS),Darwin)
+ SHLIB_FLAGS = -bundle -undefined dynamic_lookup
+else
+ SHLIB_FLAGS = -shared
+endif
+LINK = $(CC) $(LDFLAGS)
+
+.PHONY: all build compile luacompile luasource clean luaclean
+
+all: build
+
+build: luabuild gccbuild
+
+luabuild: lua$(LUA_TARGET)
+
+gccbuild: compile
+compile:
+
+clean: luaclean
+
+luasource:
+ mkdir -p dist$(LUA_MODULEDIR)
+ cp -pR root/* dist 2>/dev/null || true
+ cp -pR lua/* dist$(LUA_MODULEDIR) 2>/dev/null || true
+ for i in $$(find dist -name .svn); do rm -rf $$i || true; done
+
+luastrip: luasource
+ for i in $$(find dist -type f -name '*.lua'); do perl -e 'undef $$/; open( F, "< $$ARGV[0]" ) || die $$!; $$src = <F>; close F; $$src =~ s/--\[\[.*?\]\](--)?//gs; $$src =~ s/^\s*--.*?\n//gm; open( F, "> $$ARGV[0]" ) || die $$!; print F $$src; close F' $$i; done
+
+luacompile: luasource
+ for i in $$(find dist -name *.lua -not -name debug.lua); do $(LUAC) $(LUAC_OPTIONS) -o $$i $$i; done
+
+luaclean:
+ rm -rf dist