diff options
Diffstat (limited to 'libtomcrypt/src')
311 files changed, 51107 insertions, 0 deletions
diff --git a/libtomcrypt/src/ciphers/aes/aes.c b/libtomcrypt/src/ciphers/aes/aes.c new file mode 100644 index 0000000..74798e8 --- /dev/null +++ b/libtomcrypt/src/ciphers/aes/aes.c @@ -0,0 +1,762 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ + +/* AES implementation by Tom St Denis + * + * Derived from the Public Domain source code by + +--- + * rijndael-alg-fst.c + * + * @version 3.0 (December 2000) + * + * Optimised ANSI C code for the Rijndael cipher (now AES) + * + * @author Vincent Rijmen <vincent.rijmen@esat.kuleuven.ac.be> + * @author Antoon Bosselaers <antoon.bosselaers@esat.kuleuven.ac.be> + * @author Paulo Barreto <paulo.barreto@terra.com.br> +--- + */ +/** + @file aes.c + Implementation of AES +*/ + +#include "tomcrypt.h" + +#ifdef RIJNDAEL + +#ifndef ENCRYPT_ONLY + +#define SETUP rijndael_setup +#define ECB_ENC rijndael_ecb_encrypt +#define ECB_DEC rijndael_ecb_decrypt +#define ECB_DONE rijndael_done +#define ECB_TEST rijndael_test +#define ECB_KS rijndael_keysize + +#if 0 +const struct ltc_cipher_descriptor rijndael_desc = +{ + "rijndael", + 6, + 16, 32, 16, 10, + SETUP, ECB_ENC, ECB_DEC, ECB_TEST, ECB_DONE, ECB_KS, + NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL +}; +#endif + +const struct ltc_cipher_descriptor aes_desc = +{ + "aes", + 6, + 16, 32, 16, 10, + SETUP, ECB_ENC, ECB_DEC, ECB_TEST, ECB_DONE, ECB_KS, + NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL +}; + +#else + +#define SETUP rijndael_enc_setup +#define ECB_ENC rijndael_enc_ecb_encrypt +#define ECB_KS rijndael_enc_keysize +#define ECB_DONE rijndael_enc_done + +const struct ltc_cipher_descriptor rijndael_enc_desc = +{ + "rijndael", + 6, + 16, 32, 16, 10, + SETUP, ECB_ENC, NULL, NULL, ECB_DONE, ECB_KS, + NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL +}; + +const struct ltc_cipher_descriptor aes_enc_desc = +{ + "aes", + 6, + 16, 32, 16, 10, + SETUP, ECB_ENC, NULL, NULL, ECB_DONE, ECB_KS, + NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL +}; + +#endif + +#include "aes_tab.c" + +static ulong32 setup_mix(ulong32 temp) +{ + return (Te4_3[byte(temp, 2)]) ^ + (Te4_2[byte(temp, 1)]) ^ + (Te4_1[byte(temp, 0)]) ^ + (Te4_0[byte(temp, 3)]); +} + +#ifndef ENCRYPT_ONLY +#ifdef LTC_SMALL_CODE +static ulong32 setup_mix2(ulong32 temp) +{ + return Td0(255 & Te4[byte(temp, 3)]) ^ + Td1(255 & Te4[byte(temp, 2)]) ^ + Td2(255 & Te4[byte(temp, 1)]) ^ + Td3(255 & Te4[byte(temp, 0)]); +} +#endif +#endif + + /** + Initialize the AES (Rijndael) block cipher + @param key The symmetric key you wish to pass + @param keylen The key length in bytes + @param num_rounds The number of rounds desired (0 for default) + @param skey The key in as scheduled by this function. + @return CRYPT_OK if successful + */ +int SETUP(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey) +{ + int i, j; + ulong32 temp, *rk; +#ifndef ENCRYPT_ONLY + ulong32 *rrk; +#endif + LTC_ARGCHK(key != NULL); + LTC_ARGCHK(skey != NULL); + + if (keylen != 16 && keylen != 24 && keylen != 32) { + return CRYPT_INVALID_KEYSIZE; + } + + if (num_rounds != 0 && num_rounds != (10 + ((keylen/8)-2)*2)) { + return CRYPT_INVALID_ROUNDS; + } + + skey->rijndael.Nr = 10 + ((keylen/8)-2)*2; + + /* setup the forward key */ + i = 0; + rk = skey->rijndael.eK; + LOAD32H(rk[0], key ); + LOAD32H(rk[1], key + 4); + LOAD32H(rk[2], key + 8); + LOAD32H(rk[3], key + 12); + if (keylen == 16) { + j = 44; + for (;;) { + temp = rk[3]; + rk[4] = rk[0] ^ setup_mix(temp) ^ rcon[i]; + rk[5] = rk[1] ^ rk[4]; + rk[6] = rk[2] ^ rk[5]; + rk[7] = rk[3] ^ rk[6]; + if (++i == 10) { + break; + } + rk += 4; + } + } else if (keylen == 24) { + j = 52; + LOAD32H(rk[4], key + 16); + LOAD32H(rk[5], key + 20); + for (;;) { + #ifdef _MSC_VER + temp = skey->rijndael.eK[rk - skey->rijndael.eK + 5]; + #else + temp = rk[5]; + #endif + rk[ 6] = rk[ 0] ^ setup_mix(temp) ^ rcon[i]; + rk[ 7] = rk[ 1] ^ rk[ 6]; + rk[ 8] = rk[ 2] ^ rk[ 7]; + rk[ 9] = rk[ 3] ^ rk[ 8]; + if (++i == 8) { + break; + } + rk[10] = rk[ 4] ^ rk[ 9]; + rk[11] = rk[ 5] ^ rk[10]; + rk += 6; + } + } else if (keylen == 32) { + j = 60; + LOAD32H(rk[4], key + 16); + LOAD32H(rk[5], key + 20); + LOAD32H(rk[6], key + 24); + LOAD32H(rk[7], key + 28); + for (;;) { + #ifdef _MSC_VER + temp = skey->rijndael.eK[rk - skey->rijndael.eK + 7]; + #else + temp = rk[7]; + #endif + rk[ 8] = rk[ 0] ^ setup_mix(temp) ^ rcon[i]; + rk[ 9] = rk[ 1] ^ rk[ 8]; + rk[10] = rk[ 2] ^ rk[ 9]; + rk[11] = rk[ 3] ^ rk[10]; + if (++i == 7) { + break; + } + temp = rk[11]; + rk[12] = rk[ 4] ^ setup_mix(RORc(temp, 8)); + rk[13] = rk[ 5] ^ rk[12]; + rk[14] = rk[ 6] ^ rk[13]; + rk[15] = rk[ 7] ^ rk[14]; + rk += 8; + } + } else { + /* this can't happen */ + return CRYPT_ERROR; + } + +#ifndef ENCRYPT_ONLY + /* setup the inverse key now */ + rk = skey->rijndael.dK; + rrk = skey->rijndael.eK + j - 4; + + /* apply the inverse MixColumn transform to all round keys but the first and the last: */ + /* copy first */ + *rk++ = *rrk++; + *rk++ = *rrk++; + *rk++ = *rrk++; + *rk = *rrk; + rk -= 3; rrk -= 3; + + for (i = 1; i < skey->rijndael.Nr; i++) { + rrk -= 4; + rk += 4; + #ifdef LTC_SMALL_CODE + temp = rrk[0]; + rk[0] = setup_mix2(temp); + temp = rrk[1]; + rk[1] = setup_mix2(temp); + temp = rrk[2]; + rk[2] = setup_mix2(temp); + temp = rrk[3]; + rk[3] = setup_mix2(temp); + #else + temp = rrk[0]; + rk[0] = + Tks0[byte(temp, 3)] ^ + Tks1[byte(temp, 2)] ^ + Tks2[byte(temp, 1)] ^ + Tks3[byte(temp, 0)]; + temp = rrk[1]; + rk[1] = + Tks0[byte(temp, 3)] ^ + Tks1[byte(temp, 2)] ^ + Tks2[byte(temp, 1)] ^ + Tks3[byte(temp, 0)]; + temp = rrk[2]; + rk[2] = + Tks0[byte(temp, 3)] ^ + Tks1[byte(temp, 2)] ^ + Tks2[byte(temp, 1)] ^ + Tks3[byte(temp, 0)]; + temp = rrk[3]; + rk[3] = + Tks0[byte(temp, 3)] ^ + Tks1[byte(temp, 2)] ^ + Tks2[byte(temp, 1)] ^ + Tks3[byte(temp, 0)]; + #endif + + } + + /* copy last */ + rrk -= 4; + rk += 4; + *rk++ = *rrk++; + *rk++ = *rrk++; + *rk++ = *rrk++; + *rk = *rrk; +#endif /* ENCRYPT_ONLY */ + + return CRYPT_OK; +} + +/** + Encrypts a block of text with AES + @param pt The input plaintext (16 bytes) + @param ct The output ciphertext (16 bytes) + @param skey The key as scheduled + @return CRYPT_OK if successful +*/ +#ifdef LTC_CLEAN_STACK +static int _rijndael_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key *skey) +#else +int ECB_ENC(const unsigned char *pt, unsigned char *ct, symmetric_key *skey) +#endif +{ + ulong32 s0, s1, s2, s3, t0, t1, t2, t3, *rk; + int Nr, r; + + LTC_ARGCHK(pt != NULL); + LTC_ARGCHK(ct != NULL); + LTC_ARGCHK(skey != NULL); + + Nr = skey->rijndael.Nr; + rk = skey->rijndael.eK; + + /* + * map byte array block to cipher state + * and add initial round key: + */ + LOAD32H(s0, pt ); s0 ^= rk[0]; + LOAD32H(s1, pt + 4); s1 ^= rk[1]; + LOAD32H(s2, pt + 8); s2 ^= rk[2]; + LOAD32H(s3, pt + 12); s3 ^= rk[3]; + +#ifdef LTC_SMALL_CODE + + for (r = 0; ; r++) { + rk += 4; + t0 = + Te0(byte(s0, 3)) ^ + Te1(byte(s1, 2)) ^ + Te2(byte(s2, 1)) ^ + Te3(byte(s3, 0)) ^ + rk[0]; + t1 = + Te0(byte(s1, 3)) ^ + Te1(byte(s2, 2)) ^ + Te2(byte(s3, 1)) ^ + Te3(byte(s0, 0)) ^ + rk[1]; + t2 = + Te0(byte(s2, 3)) ^ + Te1(byte(s3, 2)) ^ + Te2(byte(s0, 1)) ^ + Te3(byte(s1, 0)) ^ + rk[2]; + t3 = + Te0(byte(s3, 3)) ^ + Te1(byte(s0, 2)) ^ + Te2(byte(s1, 1)) ^ + Te3(byte(s2, 0)) ^ + rk[3]; + if (r == Nr-2) { + break; + } + s0 = t0; s1 = t1; s2 = t2; s3 = t3; + } + rk += 4; + +#else + + /* + * Nr - 1 full rounds: + */ + r = Nr >> 1; + for (;;) { + t0 = + Te0(byte(s0, 3)) ^ + Te1(byte(s1, 2)) ^ + Te2(byte(s2, 1)) ^ + Te3(byte(s3, 0)) ^ + rk[4]; + t1 = + Te0(byte(s1, 3)) ^ + Te1(byte(s2, 2)) ^ + Te2(byte(s3, 1)) ^ + Te3(byte(s0, 0)) ^ + rk[5]; + t2 = + Te0(byte(s2, 3)) ^ + Te1(byte(s3, 2)) ^ + Te2(byte(s0, 1)) ^ + Te3(byte(s1, 0)) ^ + rk[6]; + t3 = + Te0(byte(s3, 3)) ^ + Te1(byte(s0, 2)) ^ + Te2(byte(s1, 1)) ^ + Te3(byte(s2, 0)) ^ + rk[7]; + + rk += 8; + if (--r == 0) { + break; + } + + s0 = + Te0(byte(t0, 3)) ^ + Te1(byte(t1, 2)) ^ + Te2(byte(t2, 1)) ^ + Te3(byte(t3, 0)) ^ + rk[0]; + s1 = + Te0(byte(t1, 3)) ^ + Te1(byte(t2, 2)) ^ + Te2(byte(t3, 1)) ^ + Te3(byte(t0, 0)) ^ + rk[1]; + s2 = + Te0(byte(t2, 3)) ^ + Te1(byte(t3, 2)) ^ + Te2(byte(t0, 1)) ^ + Te3(byte(t1, 0)) ^ + rk[2]; + s3 = + Te0(byte(t3, 3)) ^ + Te1(byte(t0, 2)) ^ + Te2(byte(t1, 1)) ^ + Te3(byte(t2, 0)) ^ + rk[3]; + } + +#endif + + /* + * apply last round and + * map cipher state to byte array block: + */ + s0 = + (Te4_3[byte(t0, 3)]) ^ + (Te4_2[byte(t1, 2)]) ^ + (Te4_1[byte(t2, 1)]) ^ + (Te4_0[byte(t3, 0)]) ^ + rk[0]; + STORE32H(s0, ct); + s1 = + (Te4_3[byte(t1, 3)]) ^ + (Te4_2[byte(t2, 2)]) ^ + (Te4_1[byte(t3, 1)]) ^ + (Te4_0[byte(t0, 0)]) ^ + rk[1]; + STORE32H(s1, ct+4); + s2 = + (Te4_3[byte(t2, 3)]) ^ + (Te4_2[byte(t3, 2)]) ^ + (Te4_1[byte(t0, 1)]) ^ + (Te4_0[byte(t1, 0)]) ^ + rk[2]; + STORE32H(s2, ct+8); + s3 = + (Te4_3[byte(t3, 3)]) ^ + (Te4_2[byte(t0, 2)]) ^ + (Te4_1[byte(t1, 1)]) ^ + (Te4_0[byte(t2, 0)]) ^ + rk[3]; + STORE32H(s3, ct+12); + + return CRYPT_OK; +} + +#ifdef LTC_CLEAN_STACK +int ECB_ENC(const unsigned char *pt, unsigned char *ct, symmetric_key *skey) +{ + int err = _rijndael_ecb_encrypt(pt, ct, skey); + burn_stack(sizeof(unsigned long)*8 + sizeof(unsigned long*) + sizeof(int)*2); + return err; +} +#endif + +#ifndef ENCRYPT_ONLY + +/** + Decrypts a block of text with AES + @param ct The input ciphertext (16 bytes) + @param pt The output plaintext (16 bytes) + @param skey The key as scheduled + @return CRYPT_OK if successful +*/ +#ifdef LTC_CLEAN_STACK +static int _rijndael_ecb_decrypt(const unsigned char *ct, unsigned char *pt, symmetric_key *skey) +#else +int ECB_DEC(const unsigned char *ct, unsigned char *pt, symmetric_key *skey) +#endif +{ + ulong32 s0, s1, s2, s3, t0, t1, t2, t3, *rk; + int Nr, r; + + LTC_ARGCHK(pt != NULL); + LTC_ARGCHK(ct != NULL); + LTC_ARGCHK(skey != NULL); + + Nr = skey->rijndael.Nr; + rk = skey->rijndael.dK; + + /* + * map byte array block to cipher state + * and add initial round key: + */ + LOAD32H(s0, ct ); s0 ^= rk[0]; + LOAD32H(s1, ct + 4); s1 ^= rk[1]; + LOAD32H(s2, ct + 8); s2 ^= rk[2]; + LOAD32H(s3, ct + 12); s3 ^= rk[3]; + +#ifdef LTC_SMALL_CODE + for (r = 0; ; r++) { + rk += 4; + t0 = + Td0(byte(s0, 3)) ^ + Td1(byte(s3, 2)) ^ + Td2(byte(s2, 1)) ^ + Td3(byte(s1, 0)) ^ + rk[0]; + t1 = + Td0(byte(s1, 3)) ^ + Td1(byte(s0, 2)) ^ + Td2(byte(s3, 1)) ^ + Td3(byte(s2, 0)) ^ + rk[1]; + t2 = + Td0(byte(s2, 3)) ^ + Td1(byte(s1, 2)) ^ + Td2(byte(s0, 1)) ^ + Td3(byte(s3, 0)) ^ + rk[2]; + t3 = + Td0(byte(s3, 3)) ^ + Td1(byte(s2, 2)) ^ + Td2(byte(s1, 1)) ^ + Td3(byte(s0, 0)) ^ + rk[3]; + if (r == Nr-2) { + break; + } + s0 = t0; s1 = t1; s2 = t2; s3 = t3; + } + rk += 4; + +#else + + /* + * Nr - 1 full rounds: + */ + r = Nr >> 1; + for (;;) { + + t0 = + Td0(byte(s0, 3)) ^ + Td1(byte(s3, 2)) ^ + Td2(byte(s2, 1)) ^ + Td3(byte(s1, 0)) ^ + rk[4]; + t1 = + Td0(byte(s1, 3)) ^ + Td1(byte(s0, 2)) ^ + Td2(byte(s3, 1)) ^ + Td3(byte(s2, 0)) ^ + rk[5]; + t2 = + Td0(byte(s2, 3)) ^ + Td1(byte(s1, 2)) ^ + Td2(byte(s0, 1)) ^ + Td3(byte(s3, 0)) ^ + rk[6]; + t3 = + Td0(byte(s3, 3)) ^ + Td1(byte(s2, 2)) ^ + Td2(byte(s1, 1)) ^ + Td3(byte(s0, 0)) ^ + rk[7]; + + rk += 8; + if (--r == 0) { + break; + } + + + s0 = + Td0(byte(t0, 3)) ^ + Td1(byte(t3, 2)) ^ + Td2(byte(t2, 1)) ^ + Td3(byte(t1, 0)) ^ + rk[0]; + s1 = + Td0(byte(t1, 3)) ^ + Td1(byte(t0, 2)) ^ + Td2(byte(t3, 1)) ^ + Td3(byte(t2, 0)) ^ + rk[1]; + s2 = + Td0(byte(t2, 3)) ^ + Td1(byte(t1, 2)) ^ + Td2(byte(t0, 1)) ^ + Td3(byte(t3, 0)) ^ + rk[2]; + s3 = + Td0(byte(t3, 3)) ^ + Td1(byte(t2, 2)) ^ + Td2(byte(t1, 1)) ^ + Td3(byte(t0, 0)) ^ + rk[3]; + } +#endif + + /* + * apply last round and + * map cipher state to byte array block: + */ + s0 = + (Td4[byte(t0, 3)] & 0xff000000) ^ + (Td4[byte(t3, 2)] & 0x00ff0000) ^ + (Td4[byte(t2, 1)] & 0x0000ff00) ^ + (Td4[byte(t1, 0)] & 0x000000ff) ^ + rk[0]; + STORE32H(s0, pt); + s1 = + (Td4[byte(t1, 3)] & 0xff000000) ^ + (Td4[byte(t0, 2)] & 0x00ff0000) ^ + (Td4[byte(t3, 1)] & 0x0000ff00) ^ + (Td4[byte(t2, 0)] & 0x000000ff) ^ + rk[1]; + STORE32H(s1, pt+4); + s2 = + (Td4[byte(t2, 3)] & 0xff000000) ^ + (Td4[byte(t1, 2)] & 0x00ff0000) ^ + (Td4[byte(t0, 1)] & 0x0000ff00) ^ + (Td4[byte(t3, 0)] & 0x000000ff) ^ + rk[2]; + STORE32H(s2, pt+8); + s3 = + (Td4[byte(t3, 3)] & 0xff000000) ^ + (Td4[byte(t2, 2)] & 0x00ff0000) ^ + (Td4[byte(t1, 1)] & 0x0000ff00) ^ + (Td4[byte(t0, 0)] & 0x000000ff) ^ + rk[3]; + STORE32H(s3, pt+12); + + return CRYPT_OK; +} + + +#ifdef LTC_CLEAN_STACK +int ECB_DEC(const unsigned char *ct, unsigned char *pt, symmetric_key *skey) +{ + int err = _rijndael_ecb_decrypt(ct, pt, skey); + burn_stack(sizeof(unsigned long)*8 + sizeof(unsigned long*) + sizeof(int)*2); + return err; +} +#endif + +/** + Performs a self-test of the AES block cipher + @return CRYPT_OK if functional, CRYPT_NOP if self-test has been disabled +*/ +int ECB_TEST(void) +{ + #ifndef LTC_TEST + return CRYPT_NOP; + #else + int err; + static const struct { + int keylen; + unsigned char key[32], pt[16], ct[16]; + } tests[] = { + { 16, + { 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07, + 0x08, 0x09, 0x0a, 0x0b, 0x0c, 0x0d, 0x0e, 0x0f }, + { 0x00, 0x11, 0x22, 0x33, 0x44, 0x55, 0x66, 0x77, + 0x88, 0x99, 0xaa, 0xbb, 0xcc, 0xdd, 0xee, 0xff }, + { 0x69, 0xc4, 0xe0, 0xd8, 0x6a, 0x7b, 0x04, 0x30, + 0xd8, 0xcd, 0xb7, 0x80, 0x70, 0xb4, 0xc5, 0x5a } + }, { + 24, + { 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07, + 0x08, 0x09, 0x0a, 0x0b, 0x0c, 0x0d, 0x0e, 0x0f, + 0x10, 0x11, 0x12, 0x13, 0x14, 0x15, 0x16, 0x17 }, + { 0x00, 0x11, 0x22, 0x33, 0x44, 0x55, 0x66, 0x77, + 0x88, 0x99, 0xaa, 0xbb, 0xcc, 0xdd, 0xee, 0xff }, + { 0xdd, 0xa9, 0x7c, 0xa4, 0x86, 0x4c, 0xdf, 0xe0, + 0x6e, 0xaf, 0x70, 0xa0, 0xec, 0x0d, 0x71, 0x91 } + }, { + 32, + { 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07, + 0x08, 0x09, 0x0a, 0x0b, 0x0c, 0x0d, 0x0e, 0x0f, + 0x10, 0x11, 0x12, 0x13, 0x14, 0x15, 0x16, 0x17, + 0x18, 0x19, 0x1a, 0x1b, 0x1c, 0x1d, 0x1e, 0x1f }, + { 0x00, 0x11, 0x22, 0x33, 0x44, 0x55, 0x66, 0x77, + 0x88, 0x99, 0xaa, 0xbb, 0xcc, 0xdd, 0xee, 0xff }, + { 0x8e, 0xa2, 0xb7, 0xca, 0x51, 0x67, 0x45, 0xbf, + 0xea, 0xfc, 0x49, 0x90, 0x4b, 0x49, 0x60, 0x89 } + } + }; + + symmetric_key key; + unsigned char tmp[2][16]; + int i, y; + + for (i = 0; i < (int)(sizeof(tests)/sizeof(tests[0])); i++) { + zeromem(&key, sizeof(key)); + if ((err = rijndael_setup(tests[i].key, tests[i].keylen, 0, &key)) != CRYPT_OK) { + return err; + } + + rijndael_ecb_encrypt(tests[i].pt, tmp[0], &key); + rijndael_ecb_decrypt(tmp[0], tmp[1], &key); + if (XMEMCMP(tmp[0], tests[i].ct, 16) || XMEMCMP(tmp[1], tests[i].pt, 16)) { +#if 0 + printf("\n\nTest %d failed\n", i); + if (XMEMCMP(tmp[0], tests[i].ct, 16)) { + printf("CT: "); + for (i = 0; i < 16; i++) { + printf("%02x ", tmp[0][i]); + } + printf("\n"); + } else { + printf("PT: "); + for (i = 0; i < 16; i++) { + printf("%02x ", tmp[1][i]); + } + printf("\n"); + } +#endif + return CRYPT_FAIL_TESTVECTOR; + } + + /* now see if we can encrypt all zero bytes 1000 times, decrypt and come back where we started */ + for (y = 0; y < 16; y++) tmp[0][y] = 0; + for (y = 0; y < 1000; y++) rijndael_ecb_encrypt(tmp[0], tmp[0], &key); + for (y = 0; y < 1000; y++) rijndael_ecb_decrypt(tmp[0], tmp[0], &key); + for (y = 0; y < 16; y++) if (tmp[0][y] != 0) return CRYPT_FAIL_TESTVECTOR; + } + return CRYPT_OK; + #endif +} + +#endif /* ENCRYPT_ONLY */ + + +/** Terminate the context + @param skey The scheduled key +*/ +void ECB_DONE(symmetric_key *skey) +{ +} + + +/** + Gets suitable key size + @param keysize [in/out] The length of the recommended key (in bytes). This function will store the suitable size back in this variable. + @return CRYPT_OK if the input key size is acceptable. +*/ +int ECB_KS(int *keysize) +{ + LTC_ARGCHK(keysize != NULL); + + if (*keysize < 16) + return CRYPT_INVALID_KEYSIZE; + if (*keysize < 24) { + *keysize = 16; + return CRYPT_OK; + } else if (*keysize < 32) { + *keysize = 24; + return CRYPT_OK; + } else { + *keysize = 32; + return CRYPT_OK; + } +} + +#endif + + +/* $Source: /cvs/libtom/libtomcrypt/src/ciphers/aes/aes.c,v $ */ +/* $Revision: 1.14 $ */ +/* $Date: 2006/11/08 23:01:06 $ */ diff --git a/libtomcrypt/src/ciphers/aes/aes_tab.c b/libtomcrypt/src/ciphers/aes/aes_tab.c new file mode 100644 index 0000000..0ef9731 --- /dev/null +++ b/libtomcrypt/src/ciphers/aes/aes_tab.c @@ -0,0 +1,1028 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +/* The precomputed tables for AES */ +/* +Te0[x] = S [x].[02, 01, 01, 03]; +Te1[x] = S [x].[03, 02, 01, 01]; +Te2[x] = S [x].[01, 03, 02, 01]; +Te3[x] = S [x].[01, 01, 03, 02]; +Te4[x] = S [x].[01, 01, 01, 01]; + +Td0[x] = Si[x].[0e, 09, 0d, 0b]; +Td1[x] = Si[x].[0b, 0e, 09, 0d]; +Td2[x] = Si[x].[0d, 0b, 0e, 09]; +Td3[x] = Si[x].[09, 0d, 0b, 0e]; +Td4[x] = Si[x].[01, 01, 01, 01]; +*/ + +/** + @file aes_tab.c + AES tables +*/ +static const ulong32 TE0[256] = { + 0xc66363a5UL, 0xf87c7c84UL, 0xee777799UL, 0xf67b7b8dUL, + 0xfff2f20dUL, 0xd66b6bbdUL, 0xde6f6fb1UL, 0x91c5c554UL, + 0x60303050UL, 0x02010103UL, 0xce6767a9UL, 0x562b2b7dUL, + 0xe7fefe19UL, 0xb5d7d762UL, 0x4dababe6UL, 0xec76769aUL, + 0x8fcaca45UL, 0x1f82829dUL, 0x89c9c940UL, 0xfa7d7d87UL, + 0xeffafa15UL, 0xb25959ebUL, 0x8e4747c9UL, 0xfbf0f00bUL, + 0x41adadecUL, 0xb3d4d467UL, 0x5fa2a2fdUL, 0x45afafeaUL, + 0x239c9cbfUL, 0x53a4a4f7UL, 0xe4727296UL, 0x9bc0c05bUL, + 0x75b7b7c2UL, 0xe1fdfd1cUL, 0x3d9393aeUL, 0x4c26266aUL, + 0x6c36365aUL, 0x7e3f3f41UL, 0xf5f7f702UL, 0x83cccc4fUL, + 0x6834345cUL, 0x51a5a5f4UL, 0xd1e5e534UL, 0xf9f1f108UL, + 0xe2717193UL, 0xabd8d873UL, 0x62313153UL, 0x2a15153fUL, + 0x0804040cUL, 0x95c7c752UL, 0x46232365UL, 0x9dc3c35eUL, + 0x30181828UL, 0x379696a1UL, 0x0a05050fUL, 0x2f9a9ab5UL, + 0x0e070709UL, 0x24121236UL, 0x1b80809bUL, 0xdfe2e23dUL, + 0xcdebeb26UL, 0x4e272769UL, 0x7fb2b2cdUL, 0xea75759fUL, + 0x1209091bUL, 0x1d83839eUL, 0x582c2c74UL, 0x341a1a2eUL, + 0x361b1b2dUL, 0xdc6e6eb2UL, 0xb45a5aeeUL, 0x5ba0a0fbUL, + 0xa45252f6UL, 0x763b3b4dUL, 0xb7d6d661UL, 0x7db3b3ceUL, + 0x5229297bUL, 0xdde3e33eUL, 0x5e2f2f71UL, 0x13848497UL, + 0xa65353f5UL, 0xb9d1d168UL, 0x00000000UL, 0xc1eded2cUL, + 0x40202060UL, 0xe3fcfc1fUL, 0x79b1b1c8UL, 0xb65b5bedUL, + 0xd46a6abeUL, 0x8dcbcb46UL, 0x67bebed9UL, 0x7239394bUL, + 0x944a4adeUL, 0x984c4cd4UL, 0xb05858e8UL, 0x85cfcf4aUL, + 0xbbd0d06bUL, 0xc5efef2aUL, 0x4faaaae5UL, 0xedfbfb16UL, + 0x864343c5UL, 0x9a4d4dd7UL, 0x66333355UL, 0x11858594UL, + 0x8a4545cfUL, 0xe9f9f910UL, 0x04020206UL, 0xfe7f7f81UL, + 0xa05050f0UL, 0x783c3c44UL, 0x259f9fbaUL, 0x4ba8a8e3UL, + 0xa25151f3UL, 0x5da3a3feUL, 0x804040c0UL, 0x058f8f8aUL, + 0x3f9292adUL, 0x219d9dbcUL, 0x70383848UL, 0xf1f5f504UL, + 0x63bcbcdfUL, 0x77b6b6c1UL, 0xafdada75UL, 0x42212163UL, + 0x20101030UL, 0xe5ffff1aUL, 0xfdf3f30eUL, 0xbfd2d26dUL, + 0x81cdcd4cUL, 0x180c0c14UL, 0x26131335UL, 0xc3ecec2fUL, + 0xbe5f5fe1UL, 0x359797a2UL, 0x884444ccUL, 0x2e171739UL, + 0x93c4c457UL, 0x55a7a7f2UL, 0xfc7e7e82UL, 0x7a3d3d47UL, + 0xc86464acUL, 0xba5d5de7UL, 0x3219192bUL, 0xe6737395UL, + 0xc06060a0UL, 0x19818198UL, 0x9e4f4fd1UL, 0xa3dcdc7fUL, + 0x44222266UL, 0x542a2a7eUL, 0x3b9090abUL, 0x0b888883UL, + 0x8c4646caUL, 0xc7eeee29UL, 0x6bb8b8d3UL, 0x2814143cUL, + 0xa7dede79UL, 0xbc5e5ee2UL, 0x160b0b1dUL, 0xaddbdb76UL, + 0xdbe0e03bUL, 0x64323256UL, 0x743a3a4eUL, 0x140a0a1eUL, + 0x924949dbUL, 0x0c06060aUL, 0x4824246cUL, 0xb85c5ce4UL, + 0x9fc2c25dUL, 0xbdd3d36eUL, 0x43acacefUL, 0xc46262a6UL, + 0x399191a8UL, 0x319595a4UL, 0xd3e4e437UL, 0xf279798bUL, + 0xd5e7e732UL, 0x8bc8c843UL, 0x6e373759UL, 0xda6d6db7UL, + 0x018d8d8cUL, 0xb1d5d564UL, 0x9c4e4ed2UL, 0x49a9a9e0UL, + 0xd86c6cb4UL, 0xac5656faUL, 0xf3f4f407UL, 0xcfeaea25UL, + 0xca6565afUL, 0xf47a7a8eUL, 0x47aeaee9UL, 0x10080818UL, + 0x6fbabad5UL, 0xf0787888UL, 0x4a25256fUL, 0x5c2e2e72UL, + 0x381c1c24UL, 0x57a6a6f1UL, 0x73b4b4c7UL, 0x97c6c651UL, + 0xcbe8e823UL, 0xa1dddd7cUL, 0xe874749cUL, 0x3e1f1f21UL, + 0x964b4bddUL, 0x61bdbddcUL, 0x0d8b8b86UL, 0x0f8a8a85UL, + 0xe0707090UL, 0x7c3e3e42UL, 0x71b5b5c4UL, 0xcc6666aaUL, + 0x904848d8UL, 0x06030305UL, 0xf7f6f601UL, 0x1c0e0e12UL, + 0xc26161a3UL, 0x6a35355fUL, 0xae5757f9UL, 0x69b9b9d0UL, + 0x17868691UL, 0x99c1c158UL, 0x3a1d1d27UL, 0x279e9eb9UL, + 0xd9e1e138UL, 0xebf8f813UL, 0x2b9898b3UL, 0x22111133UL, + 0xd26969bbUL, 0xa9d9d970UL, 0x078e8e89UL, 0x339494a7UL, + 0x2d9b9bb6UL, 0x3c1e1e22UL, 0x15878792UL, 0xc9e9e920UL, + 0x87cece49UL, 0xaa5555ffUL, 0x50282878UL, 0xa5dfdf7aUL, + 0x038c8c8fUL, 0x59a1a1f8UL, 0x09898980UL, 0x1a0d0d17UL, + 0x65bfbfdaUL, 0xd7e6e631UL, 0x844242c6UL, 0xd06868b8UL, + 0x824141c3UL, 0x299999b0UL, 0x5a2d2d77UL, 0x1e0f0f11UL, + 0x7bb0b0cbUL, 0xa85454fcUL, 0x6dbbbbd6UL, 0x2c16163aUL, +}; + +#ifndef PELI_TAB +static const ulong32 Te4[256] = { + 0x63636363UL, 0x7c7c7c7cUL, 0x77777777UL, 0x7b7b7b7bUL, + 0xf2f2f2f2UL, 0x6b6b6b6bUL, 0x6f6f6f6fUL, 0xc5c5c5c5UL, + 0x30303030UL, 0x01010101UL, 0x67676767UL, 0x2b2b2b2bUL, + 0xfefefefeUL, 0xd7d7d7d7UL, 0xababababUL, 0x76767676UL, + 0xcacacacaUL, 0x82828282UL, 0xc9c9c9c9UL, 0x7d7d7d7dUL, + 0xfafafafaUL, 0x59595959UL, 0x47474747UL, 0xf0f0f0f0UL, + 0xadadadadUL, 0xd4d4d4d4UL, 0xa2a2a2a2UL, 0xafafafafUL, + 0x9c9c9c9cUL, 0xa4a4a4a4UL, 0x72727272UL, 0xc0c0c0c0UL, + 0xb7b7b7b7UL, 0xfdfdfdfdUL, 0x93939393UL, 0x26262626UL, + 0x36363636UL, 0x3f3f3f3fUL, 0xf7f7f7f7UL, 0xccccccccUL, + 0x34343434UL, 0xa5a5a5a5UL, 0xe5e5e5e5UL, 0xf1f1f1f1UL, + 0x71717171UL, 0xd8d8d8d8UL, 0x31313131UL, 0x15151515UL, + 0x04040404UL, 0xc7c7c7c7UL, 0x23232323UL, 0xc3c3c3c3UL, + 0x18181818UL, 0x96969696UL, 0x05050505UL, 0x9a9a9a9aUL, + 0x07070707UL, 0x12121212UL, 0x80808080UL, 0xe2e2e2e2UL, + 0xebebebebUL, 0x27272727UL, 0xb2b2b2b2UL, 0x75757575UL, + 0x09090909UL, 0x83838383UL, 0x2c2c2c2cUL, 0x1a1a1a1aUL, + 0x1b1b1b1bUL, 0x6e6e6e6eUL, 0x5a5a5a5aUL, 0xa0a0a0a0UL, + 0x52525252UL, 0x3b3b3b3bUL, 0xd6d6d6d6UL, 0xb3b3b3b3UL, + 0x29292929UL, 0xe3e3e3e3UL, 0x2f2f2f2fUL, 0x84848484UL, + 0x53535353UL, 0xd1d1d1d1UL, 0x00000000UL, 0xededededUL, + 0x20202020UL, 0xfcfcfcfcUL, 0xb1b1b1b1UL, 0x5b5b5b5bUL, + 0x6a6a6a6aUL, 0xcbcbcbcbUL, 0xbebebebeUL, 0x39393939UL, + 0x4a4a4a4aUL, 0x4c4c4c4cUL, 0x58585858UL, 0xcfcfcfcfUL, + 0xd0d0d0d0UL, 0xefefefefUL, 0xaaaaaaaaUL, 0xfbfbfbfbUL, + 0x43434343UL, 0x4d4d4d4dUL, 0x33333333UL, 0x85858585UL, + 0x45454545UL, 0xf9f9f9f9UL, 0x02020202UL, 0x7f7f7f7fUL, + 0x50505050UL, 0x3c3c3c3cUL, 0x9f9f9f9fUL, 0xa8a8a8a8UL, + 0x51515151UL, 0xa3a3a3a3UL, 0x40404040UL, 0x8f8f8f8fUL, + 0x92929292UL, 0x9d9d9d9dUL, 0x38383838UL, 0xf5f5f5f5UL, + 0xbcbcbcbcUL, 0xb6b6b6b6UL, 0xdadadadaUL, 0x21212121UL, + 0x10101010UL, 0xffffffffUL, 0xf3f3f3f3UL, 0xd2d2d2d2UL, + 0xcdcdcdcdUL, 0x0c0c0c0cUL, 0x13131313UL, 0xececececUL, + 0x5f5f5f5fUL, 0x97979797UL, 0x44444444UL, 0x17171717UL, + 0xc4c4c4c4UL, 0xa7a7a7a7UL, 0x7e7e7e7eUL, 0x3d3d3d3dUL, + 0x64646464UL, 0x5d5d5d5dUL, 0x19191919UL, 0x73737373UL, + 0x60606060UL, 0x81818181UL, 0x4f4f4f4fUL, 0xdcdcdcdcUL, + 0x22222222UL, 0x2a2a2a2aUL, 0x90909090UL, 0x88888888UL, + 0x46464646UL, 0xeeeeeeeeUL, 0xb8b8b8b8UL, 0x14141414UL, + 0xdedededeUL, 0x5e5e5e5eUL, 0x0b0b0b0bUL, 0xdbdbdbdbUL, + 0xe0e0e0e0UL, 0x32323232UL, 0x3a3a3a3aUL, 0x0a0a0a0aUL, + 0x49494949UL, 0x06060606UL, 0x24242424UL, 0x5c5c5c5cUL, + 0xc2c2c2c2UL, 0xd3d3d3d3UL, 0xacacacacUL, 0x62626262UL, + 0x91919191UL, 0x95959595UL, 0xe4e4e4e4UL, 0x79797979UL, + 0xe7e7e7e7UL, 0xc8c8c8c8UL, 0x37373737UL, 0x6d6d6d6dUL, + 0x8d8d8d8dUL, 0xd5d5d5d5UL, 0x4e4e4e4eUL, 0xa9a9a9a9UL, + 0x6c6c6c6cUL, 0x56565656UL, 0xf4f4f4f4UL, 0xeaeaeaeaUL, + 0x65656565UL, 0x7a7a7a7aUL, 0xaeaeaeaeUL, 0x08080808UL, + 0xbabababaUL, 0x78787878UL, 0x25252525UL, 0x2e2e2e2eUL, + 0x1c1c1c1cUL, 0xa6a6a6a6UL, 0xb4b4b4b4UL, 0xc6c6c6c6UL, + 0xe8e8e8e8UL, 0xddddddddUL, 0x74747474UL, 0x1f1f1f1fUL, + 0x4b4b4b4bUL, 0xbdbdbdbdUL, 0x8b8b8b8bUL, 0x8a8a8a8aUL, + 0x70707070UL, 0x3e3e3e3eUL, 0xb5b5b5b5UL, 0x66666666UL, + 0x48484848UL, 0x03030303UL, 0xf6f6f6f6UL, 0x0e0e0e0eUL, + 0x61616161UL, 0x35353535UL, 0x57575757UL, 0xb9b9b9b9UL, + 0x86868686UL, 0xc1c1c1c1UL, 0x1d1d1d1dUL, 0x9e9e9e9eUL, + 0xe1e1e1e1UL, 0xf8f8f8f8UL, 0x98989898UL, 0x11111111UL, + 0x69696969UL, 0xd9d9d9d9UL, 0x8e8e8e8eUL, 0x94949494UL, + 0x9b9b9b9bUL, 0x1e1e1e1eUL, 0x87878787UL, 0xe9e9e9e9UL, + 0xcecececeUL, 0x55555555UL, 0x28282828UL, 0xdfdfdfdfUL, + 0x8c8c8c8cUL, 0xa1a1a1a1UL, 0x89898989UL, 0x0d0d0d0dUL, + 0xbfbfbfbfUL, 0xe6e6e6e6UL, 0x42424242UL, 0x68686868UL, + 0x41414141UL, 0x99999999UL, 0x2d2d2d2dUL, 0x0f0f0f0fUL, + 0xb0b0b0b0UL, 0x54545454UL, 0xbbbbbbbbUL, 0x16161616UL, +}; +#endif + +#ifndef ENCRYPT_ONLY + +static const ulong32 TD0[256] = { + 0x51f4a750UL, 0x7e416553UL, 0x1a17a4c3UL, 0x3a275e96UL, + 0x3bab6bcbUL, 0x1f9d45f1UL, 0xacfa58abUL, 0x4be30393UL, + 0x2030fa55UL, 0xad766df6UL, 0x88cc7691UL, 0xf5024c25UL, + 0x4fe5d7fcUL, 0xc52acbd7UL, 0x26354480UL, 0xb562a38fUL, + 0xdeb15a49UL, 0x25ba1b67UL, 0x45ea0e98UL, 0x5dfec0e1UL, + 0xc32f7502UL, 0x814cf012UL, 0x8d4697a3UL, 0x6bd3f9c6UL, + 0x038f5fe7UL, 0x15929c95UL, 0xbf6d7aebUL, 0x955259daUL, + 0xd4be832dUL, 0x587421d3UL, 0x49e06929UL, 0x8ec9c844UL, + 0x75c2896aUL, 0xf48e7978UL, 0x99583e6bUL, 0x27b971ddUL, + 0xbee14fb6UL, 0xf088ad17UL, 0xc920ac66UL, 0x7dce3ab4UL, + 0x63df4a18UL, 0xe51a3182UL, 0x97513360UL, 0x62537f45UL, + 0xb16477e0UL, 0xbb6bae84UL, 0xfe81a01cUL, 0xf9082b94UL, + 0x70486858UL, 0x8f45fd19UL, 0x94de6c87UL, 0x527bf8b7UL, + 0xab73d323UL, 0x724b02e2UL, 0xe31f8f57UL, 0x6655ab2aUL, + 0xb2eb2807UL, 0x2fb5c203UL, 0x86c57b9aUL, 0xd33708a5UL, + 0x302887f2UL, 0x23bfa5b2UL, 0x02036abaUL, 0xed16825cUL, + 0x8acf1c2bUL, 0xa779b492UL, 0xf307f2f0UL, 0x4e69e2a1UL, + 0x65daf4cdUL, 0x0605bed5UL, 0xd134621fUL, 0xc4a6fe8aUL, + 0x342e539dUL, 0xa2f355a0UL, 0x058ae132UL, 0xa4f6eb75UL, + 0x0b83ec39UL, 0x4060efaaUL, 0x5e719f06UL, 0xbd6e1051UL, + 0x3e218af9UL, 0x96dd063dUL, 0xdd3e05aeUL, 0x4de6bd46UL, + 0x91548db5UL, 0x71c45d05UL, 0x0406d46fUL, 0x605015ffUL, + 0x1998fb24UL, 0xd6bde997UL, 0x894043ccUL, 0x67d99e77UL, + 0xb0e842bdUL, 0x07898b88UL, 0xe7195b38UL, 0x79c8eedbUL, + 0xa17c0a47UL, 0x7c420fe9UL, 0xf8841ec9UL, 0x00000000UL, + 0x09808683UL, 0x322bed48UL, 0x1e1170acUL, 0x6c5a724eUL, + 0xfd0efffbUL, 0x0f853856UL, 0x3daed51eUL, 0x362d3927UL, + 0x0a0fd964UL, 0x685ca621UL, 0x9b5b54d1UL, 0x24362e3aUL, + 0x0c0a67b1UL, 0x9357e70fUL, 0xb4ee96d2UL, 0x1b9b919eUL, + 0x80c0c54fUL, 0x61dc20a2UL, 0x5a774b69UL, 0x1c121a16UL, + 0xe293ba0aUL, 0xc0a02ae5UL, 0x3c22e043UL, 0x121b171dUL, + 0x0e090d0bUL, 0xf28bc7adUL, 0x2db6a8b9UL, 0x141ea9c8UL, + 0x57f11985UL, 0xaf75074cUL, 0xee99ddbbUL, 0xa37f60fdUL, + 0xf701269fUL, 0x5c72f5bcUL, 0x44663bc5UL, 0x5bfb7e34UL, + 0x8b432976UL, 0xcb23c6dcUL, 0xb6edfc68UL, 0xb8e4f163UL, + 0xd731dccaUL, 0x42638510UL, 0x13972240UL, 0x84c61120UL, + 0x854a247dUL, 0xd2bb3df8UL, 0xaef93211UL, 0xc729a16dUL, + 0x1d9e2f4bUL, 0xdcb230f3UL, 0x0d8652ecUL, 0x77c1e3d0UL, + 0x2bb3166cUL, 0xa970b999UL, 0x119448faUL, 0x47e96422UL, + 0xa8fc8cc4UL, 0xa0f03f1aUL, 0x567d2cd8UL, 0x223390efUL, + 0x87494ec7UL, 0xd938d1c1UL, 0x8ccaa2feUL, 0x98d40b36UL, + 0xa6f581cfUL, 0xa57ade28UL, 0xdab78e26UL, 0x3fadbfa4UL, + 0x2c3a9de4UL, 0x5078920dUL, 0x6a5fcc9bUL, 0x547e4662UL, + 0xf68d13c2UL, 0x90d8b8e8UL, 0x2e39f75eUL, 0x82c3aff5UL, + 0x9f5d80beUL, 0x69d0937cUL, 0x6fd52da9UL, 0xcf2512b3UL, + 0xc8ac993bUL, 0x10187da7UL, 0xe89c636eUL, 0xdb3bbb7bUL, + 0xcd267809UL, 0x6e5918f4UL, 0xec9ab701UL, 0x834f9aa8UL, + 0xe6956e65UL, 0xaaffe67eUL, 0x21bccf08UL, 0xef15e8e6UL, + 0xbae79bd9UL, 0x4a6f36ceUL, 0xea9f09d4UL, 0x29b07cd6UL, + 0x31a4b2afUL, 0x2a3f2331UL, 0xc6a59430UL, 0x35a266c0UL, + 0x744ebc37UL, 0xfc82caa6UL, 0xe090d0b0UL, 0x33a7d815UL, + 0xf104984aUL, 0x41ecdaf7UL, 0x7fcd500eUL, 0x1791f62fUL, + 0x764dd68dUL, 0x43efb04dUL, 0xccaa4d54UL, 0xe49604dfUL, + 0x9ed1b5e3UL, 0x4c6a881bUL, 0xc12c1fb8UL, 0x4665517fUL, + 0x9d5eea04UL, 0x018c355dUL, 0xfa877473UL, 0xfb0b412eUL, + 0xb3671d5aUL, 0x92dbd252UL, 0xe9105633UL, 0x6dd64713UL, + 0x9ad7618cUL, 0x37a10c7aUL, 0x59f8148eUL, 0xeb133c89UL, + 0xcea927eeUL, 0xb761c935UL, 0xe11ce5edUL, 0x7a47b13cUL, + 0x9cd2df59UL, 0x55f2733fUL, 0x1814ce79UL, 0x73c737bfUL, + 0x53f7cdeaUL, 0x5ffdaa5bUL, 0xdf3d6f14UL, 0x7844db86UL, + 0xcaaff381UL, 0xb968c43eUL, 0x3824342cUL, 0xc2a3405fUL, + 0x161dc372UL, 0xbce2250cUL, 0x283c498bUL, 0xff0d9541UL, + 0x39a80171UL, 0x080cb3deUL, 0xd8b4e49cUL, 0x6456c190UL, + 0x7bcb8461UL, 0xd532b670UL, 0x486c5c74UL, 0xd0b85742UL, +}; + +static const ulong32 Td4[256] = { + 0x52525252UL, 0x09090909UL, 0x6a6a6a6aUL, 0xd5d5d5d5UL, + 0x30303030UL, 0x36363636UL, 0xa5a5a5a5UL, 0x38383838UL, + 0xbfbfbfbfUL, 0x40404040UL, 0xa3a3a3a3UL, 0x9e9e9e9eUL, + 0x81818181UL, 0xf3f3f3f3UL, 0xd7d7d7d7UL, 0xfbfbfbfbUL, + 0x7c7c7c7cUL, 0xe3e3e3e3UL, 0x39393939UL, 0x82828282UL, + 0x9b9b9b9bUL, 0x2f2f2f2fUL, 0xffffffffUL, 0x87878787UL, + 0x34343434UL, 0x8e8e8e8eUL, 0x43434343UL, 0x44444444UL, + 0xc4c4c4c4UL, 0xdedededeUL, 0xe9e9e9e9UL, 0xcbcbcbcbUL, + 0x54545454UL, 0x7b7b7b7bUL, 0x94949494UL, 0x32323232UL, + 0xa6a6a6a6UL, 0xc2c2c2c2UL, 0x23232323UL, 0x3d3d3d3dUL, + 0xeeeeeeeeUL, 0x4c4c4c4cUL, 0x95959595UL, 0x0b0b0b0bUL, + 0x42424242UL, 0xfafafafaUL, 0xc3c3c3c3UL, 0x4e4e4e4eUL, + 0x08080808UL, 0x2e2e2e2eUL, 0xa1a1a1a1UL, 0x66666666UL, + 0x28282828UL, 0xd9d9d9d9UL, 0x24242424UL, 0xb2b2b2b2UL, + 0x76767676UL, 0x5b5b5b5bUL, 0xa2a2a2a2UL, 0x49494949UL, + 0x6d6d6d6dUL, 0x8b8b8b8bUL, 0xd1d1d1d1UL, 0x25252525UL, + 0x72727272UL, 0xf8f8f8f8UL, 0xf6f6f6f6UL, 0x64646464UL, + 0x86868686UL, 0x68686868UL, 0x98989898UL, 0x16161616UL, + 0xd4d4d4d4UL, 0xa4a4a4a4UL, 0x5c5c5c5cUL, 0xccccccccUL, + 0x5d5d5d5dUL, 0x65656565UL, 0xb6b6b6b6UL, 0x92929292UL, + 0x6c6c6c6cUL, 0x70707070UL, 0x48484848UL, 0x50505050UL, + 0xfdfdfdfdUL, 0xededededUL, 0xb9b9b9b9UL, 0xdadadadaUL, + 0x5e5e5e5eUL, 0x15151515UL, 0x46464646UL, 0x57575757UL, + 0xa7a7a7a7UL, 0x8d8d8d8dUL, 0x9d9d9d9dUL, 0x84848484UL, + 0x90909090UL, 0xd8d8d8d8UL, 0xababababUL, 0x00000000UL, + 0x8c8c8c8cUL, 0xbcbcbcbcUL, 0xd3d3d3d3UL, 0x0a0a0a0aUL, + 0xf7f7f7f7UL, 0xe4e4e4e4UL, 0x58585858UL, 0x05050505UL, + 0xb8b8b8b8UL, 0xb3b3b3b3UL, 0x45454545UL, 0x06060606UL, + 0xd0d0d0d0UL, 0x2c2c2c2cUL, 0x1e1e1e1eUL, 0x8f8f8f8fUL, + 0xcacacacaUL, 0x3f3f3f3fUL, 0x0f0f0f0fUL, 0x02020202UL, + 0xc1c1c1c1UL, 0xafafafafUL, 0xbdbdbdbdUL, 0x03030303UL, + 0x01010101UL, 0x13131313UL, 0x8a8a8a8aUL, 0x6b6b6b6bUL, + 0x3a3a3a3aUL, 0x91919191UL, 0x11111111UL, 0x41414141UL, + 0x4f4f4f4fUL, 0x67676767UL, 0xdcdcdcdcUL, 0xeaeaeaeaUL, + 0x97979797UL, 0xf2f2f2f2UL, 0xcfcfcfcfUL, 0xcecececeUL, + 0xf0f0f0f0UL, 0xb4b4b4b4UL, 0xe6e6e6e6UL, 0x73737373UL, + 0x96969696UL, 0xacacacacUL, 0x74747474UL, 0x22222222UL, + 0xe7e7e7e7UL, 0xadadadadUL, 0x35353535UL, 0x85858585UL, + 0xe2e2e2e2UL, 0xf9f9f9f9UL, 0x37373737UL, 0xe8e8e8e8UL, + 0x1c1c1c1cUL, 0x75757575UL, 0xdfdfdfdfUL, 0x6e6e6e6eUL, + 0x47474747UL, 0xf1f1f1f1UL, 0x1a1a1a1aUL, 0x71717171UL, + 0x1d1d1d1dUL, 0x29292929UL, 0xc5c5c5c5UL, 0x89898989UL, + 0x6f6f6f6fUL, 0xb7b7b7b7UL, 0x62626262UL, 0x0e0e0e0eUL, + 0xaaaaaaaaUL, 0x18181818UL, 0xbebebebeUL, 0x1b1b1b1bUL, + 0xfcfcfcfcUL, 0x56565656UL, 0x3e3e3e3eUL, 0x4b4b4b4bUL, + 0xc6c6c6c6UL, 0xd2d2d2d2UL, 0x79797979UL, 0x20202020UL, + 0x9a9a9a9aUL, 0xdbdbdbdbUL, 0xc0c0c0c0UL, 0xfefefefeUL, + 0x78787878UL, 0xcdcdcdcdUL, 0x5a5a5a5aUL, 0xf4f4f4f4UL, + 0x1f1f1f1fUL, 0xddddddddUL, 0xa8a8a8a8UL, 0x33333333UL, + 0x88888888UL, 0x07070707UL, 0xc7c7c7c7UL, 0x31313131UL, + 0xb1b1b1b1UL, 0x12121212UL, 0x10101010UL, 0x59595959UL, + 0x27272727UL, 0x80808080UL, 0xececececUL, 0x5f5f5f5fUL, + 0x60606060UL, 0x51515151UL, 0x7f7f7f7fUL, 0xa9a9a9a9UL, + 0x19191919UL, 0xb5b5b5b5UL, 0x4a4a4a4aUL, 0x0d0d0d0dUL, + 0x2d2d2d2dUL, 0xe5e5e5e5UL, 0x7a7a7a7aUL, 0x9f9f9f9fUL, + 0x93939393UL, 0xc9c9c9c9UL, 0x9c9c9c9cUL, 0xefefefefUL, + 0xa0a0a0a0UL, 0xe0e0e0e0UL, 0x3b3b3b3bUL, 0x4d4d4d4dUL, + 0xaeaeaeaeUL, 0x2a2a2a2aUL, 0xf5f5f5f5UL, 0xb0b0b0b0UL, + 0xc8c8c8c8UL, 0xebebebebUL, 0xbbbbbbbbUL, 0x3c3c3c3cUL, + 0x83838383UL, 0x53535353UL, 0x99999999UL, 0x61616161UL, + 0x17171717UL, 0x2b2b2b2bUL, 0x04040404UL, 0x7e7e7e7eUL, + 0xbabababaUL, 0x77777777UL, 0xd6d6d6d6UL, 0x26262626UL, + 0xe1e1e1e1UL, 0x69696969UL, 0x14141414UL, 0x63636363UL, + 0x55555555UL, 0x21212121UL, 0x0c0c0c0cUL, 0x7d7d7d7dUL, +}; + +#endif /* ENCRYPT_ONLY */ + +#ifdef LTC_SMALL_CODE + +#define Te0(x) TE0[x] +#define Te1(x) RORc(TE0[x], 8) +#define Te2(x) RORc(TE0[x], 16) +#define Te3(x) RORc(TE0[x], 24) + +#define Td0(x) TD0[x] +#define Td1(x) RORc(TD0[x], 8) +#define Td2(x) RORc(TD0[x], 16) +#define Td3(x) RORc(TD0[x], 24) + +#define Te4_0 0x000000FF & Te4 +#define Te4_1 0x0000FF00 & Te4 +#define Te4_2 0x00FF0000 & Te4 +#define Te4_3 0xFF000000 & Te4 + +#else + +#define Te0(x) TE0[x] +#define Te1(x) TE1[x] +#define Te2(x) TE2[x] +#define Te3(x) TE3[x] + +#define Td0(x) TD0[x] +#define Td1(x) TD1[x] +#define Td2(x) TD2[x] +#define Td3(x) TD3[x] + +static const ulong32 TE1[256] = { + 0xa5c66363UL, 0x84f87c7cUL, 0x99ee7777UL, 0x8df67b7bUL, + 0x0dfff2f2UL, 0xbdd66b6bUL, 0xb1de6f6fUL, 0x5491c5c5UL, + 0x50603030UL, 0x03020101UL, 0xa9ce6767UL, 0x7d562b2bUL, + 0x19e7fefeUL, 0x62b5d7d7UL, 0xe64dababUL, 0x9aec7676UL, + 0x458fcacaUL, 0x9d1f8282UL, 0x4089c9c9UL, 0x87fa7d7dUL, + 0x15effafaUL, 0xebb25959UL, 0xc98e4747UL, 0x0bfbf0f0UL, + 0xec41adadUL, 0x67b3d4d4UL, 0xfd5fa2a2UL, 0xea45afafUL, + 0xbf239c9cUL, 0xf753a4a4UL, 0x96e47272UL, 0x5b9bc0c0UL, + 0xc275b7b7UL, 0x1ce1fdfdUL, 0xae3d9393UL, 0x6a4c2626UL, + 0x5a6c3636UL, 0x417e3f3fUL, 0x02f5f7f7UL, 0x4f83ccccUL, + 0x5c683434UL, 0xf451a5a5UL, 0x34d1e5e5UL, 0x08f9f1f1UL, + 0x93e27171UL, 0x73abd8d8UL, 0x53623131UL, 0x3f2a1515UL, + 0x0c080404UL, 0x5295c7c7UL, 0x65462323UL, 0x5e9dc3c3UL, + 0x28301818UL, 0xa1379696UL, 0x0f0a0505UL, 0xb52f9a9aUL, + 0x090e0707UL, 0x36241212UL, 0x9b1b8080UL, 0x3ddfe2e2UL, + 0x26cdebebUL, 0x694e2727UL, 0xcd7fb2b2UL, 0x9fea7575UL, + 0x1b120909UL, 0x9e1d8383UL, 0x74582c2cUL, 0x2e341a1aUL, + 0x2d361b1bUL, 0xb2dc6e6eUL, 0xeeb45a5aUL, 0xfb5ba0a0UL, + 0xf6a45252UL, 0x4d763b3bUL, 0x61b7d6d6UL, 0xce7db3b3UL, + 0x7b522929UL, 0x3edde3e3UL, 0x715e2f2fUL, 0x97138484UL, + 0xf5a65353UL, 0x68b9d1d1UL, 0x00000000UL, 0x2cc1ededUL, + 0x60402020UL, 0x1fe3fcfcUL, 0xc879b1b1UL, 0xedb65b5bUL, + 0xbed46a6aUL, 0x468dcbcbUL, 0xd967bebeUL, 0x4b723939UL, + 0xde944a4aUL, 0xd4984c4cUL, 0xe8b05858UL, 0x4a85cfcfUL, + 0x6bbbd0d0UL, 0x2ac5efefUL, 0xe54faaaaUL, 0x16edfbfbUL, + 0xc5864343UL, 0xd79a4d4dUL, 0x55663333UL, 0x94118585UL, + 0xcf8a4545UL, 0x10e9f9f9UL, 0x06040202UL, 0x81fe7f7fUL, + 0xf0a05050UL, 0x44783c3cUL, 0xba259f9fUL, 0xe34ba8a8UL, + 0xf3a25151UL, 0xfe5da3a3UL, 0xc0804040UL, 0x8a058f8fUL, + 0xad3f9292UL, 0xbc219d9dUL, 0x48703838UL, 0x04f1f5f5UL, + 0xdf63bcbcUL, 0xc177b6b6UL, 0x75afdadaUL, 0x63422121UL, + 0x30201010UL, 0x1ae5ffffUL, 0x0efdf3f3UL, 0x6dbfd2d2UL, + 0x4c81cdcdUL, 0x14180c0cUL, 0x35261313UL, 0x2fc3ececUL, + 0xe1be5f5fUL, 0xa2359797UL, 0xcc884444UL, 0x392e1717UL, + 0x5793c4c4UL, 0xf255a7a7UL, 0x82fc7e7eUL, 0x477a3d3dUL, + 0xacc86464UL, 0xe7ba5d5dUL, 0x2b321919UL, 0x95e67373UL, + 0xa0c06060UL, 0x98198181UL, 0xd19e4f4fUL, 0x7fa3dcdcUL, + 0x66442222UL, 0x7e542a2aUL, 0xab3b9090UL, 0x830b8888UL, + 0xca8c4646UL, 0x29c7eeeeUL, 0xd36bb8b8UL, 0x3c281414UL, + 0x79a7dedeUL, 0xe2bc5e5eUL, 0x1d160b0bUL, 0x76addbdbUL, + 0x3bdbe0e0UL, 0x56643232UL, 0x4e743a3aUL, 0x1e140a0aUL, + 0xdb924949UL, 0x0a0c0606UL, 0x6c482424UL, 0xe4b85c5cUL, + 0x5d9fc2c2UL, 0x6ebdd3d3UL, 0xef43acacUL, 0xa6c46262UL, + 0xa8399191UL, 0xa4319595UL, 0x37d3e4e4UL, 0x8bf27979UL, + 0x32d5e7e7UL, 0x438bc8c8UL, 0x596e3737UL, 0xb7da6d6dUL, + 0x8c018d8dUL, 0x64b1d5d5UL, 0xd29c4e4eUL, 0xe049a9a9UL, + 0xb4d86c6cUL, 0xfaac5656UL, 0x07f3f4f4UL, 0x25cfeaeaUL, + 0xafca6565UL, 0x8ef47a7aUL, 0xe947aeaeUL, 0x18100808UL, + 0xd56fbabaUL, 0x88f07878UL, 0x6f4a2525UL, 0x725c2e2eUL, + 0x24381c1cUL, 0xf157a6a6UL, 0xc773b4b4UL, 0x5197c6c6UL, + 0x23cbe8e8UL, 0x7ca1ddddUL, 0x9ce87474UL, 0x213e1f1fUL, + 0xdd964b4bUL, 0xdc61bdbdUL, 0x860d8b8bUL, 0x850f8a8aUL, + 0x90e07070UL, 0x427c3e3eUL, 0xc471b5b5UL, 0xaacc6666UL, + 0xd8904848UL, 0x05060303UL, 0x01f7f6f6UL, 0x121c0e0eUL, + 0xa3c26161UL, 0x5f6a3535UL, 0xf9ae5757UL, 0xd069b9b9UL, + 0x91178686UL, 0x5899c1c1UL, 0x273a1d1dUL, 0xb9279e9eUL, + 0x38d9e1e1UL, 0x13ebf8f8UL, 0xb32b9898UL, 0x33221111UL, + 0xbbd26969UL, 0x70a9d9d9UL, 0x89078e8eUL, 0xa7339494UL, + 0xb62d9b9bUL, 0x223c1e1eUL, 0x92158787UL, 0x20c9e9e9UL, + 0x4987ceceUL, 0xffaa5555UL, 0x78502828UL, 0x7aa5dfdfUL, + 0x8f038c8cUL, 0xf859a1a1UL, 0x80098989UL, 0x171a0d0dUL, + 0xda65bfbfUL, 0x31d7e6e6UL, 0xc6844242UL, 0xb8d06868UL, + 0xc3824141UL, 0xb0299999UL, 0x775a2d2dUL, 0x111e0f0fUL, + 0xcb7bb0b0UL, 0xfca85454UL, 0xd66dbbbbUL, 0x3a2c1616UL, +}; +static const ulong32 TE2[256] = { + 0x63a5c663UL, 0x7c84f87cUL, 0x7799ee77UL, 0x7b8df67bUL, + 0xf20dfff2UL, 0x6bbdd66bUL, 0x6fb1de6fUL, 0xc55491c5UL, + 0x30506030UL, 0x01030201UL, 0x67a9ce67UL, 0x2b7d562bUL, + 0xfe19e7feUL, 0xd762b5d7UL, 0xabe64dabUL, 0x769aec76UL, + 0xca458fcaUL, 0x829d1f82UL, 0xc94089c9UL, 0x7d87fa7dUL, + 0xfa15effaUL, 0x59ebb259UL, 0x47c98e47UL, 0xf00bfbf0UL, + 0xadec41adUL, 0xd467b3d4UL, 0xa2fd5fa2UL, 0xafea45afUL, + 0x9cbf239cUL, 0xa4f753a4UL, 0x7296e472UL, 0xc05b9bc0UL, + 0xb7c275b7UL, 0xfd1ce1fdUL, 0x93ae3d93UL, 0x266a4c26UL, + 0x365a6c36UL, 0x3f417e3fUL, 0xf702f5f7UL, 0xcc4f83ccUL, + 0x345c6834UL, 0xa5f451a5UL, 0xe534d1e5UL, 0xf108f9f1UL, + 0x7193e271UL, 0xd873abd8UL, 0x31536231UL, 0x153f2a15UL, + 0x040c0804UL, 0xc75295c7UL, 0x23654623UL, 0xc35e9dc3UL, + 0x18283018UL, 0x96a13796UL, 0x050f0a05UL, 0x9ab52f9aUL, + 0x07090e07UL, 0x12362412UL, 0x809b1b80UL, 0xe23ddfe2UL, + 0xeb26cdebUL, 0x27694e27UL, 0xb2cd7fb2UL, 0x759fea75UL, + 0x091b1209UL, 0x839e1d83UL, 0x2c74582cUL, 0x1a2e341aUL, + 0x1b2d361bUL, 0x6eb2dc6eUL, 0x5aeeb45aUL, 0xa0fb5ba0UL, + 0x52f6a452UL, 0x3b4d763bUL, 0xd661b7d6UL, 0xb3ce7db3UL, + 0x297b5229UL, 0xe33edde3UL, 0x2f715e2fUL, 0x84971384UL, + 0x53f5a653UL, 0xd168b9d1UL, 0x00000000UL, 0xed2cc1edUL, + 0x20604020UL, 0xfc1fe3fcUL, 0xb1c879b1UL, 0x5bedb65bUL, + 0x6abed46aUL, 0xcb468dcbUL, 0xbed967beUL, 0x394b7239UL, + 0x4ade944aUL, 0x4cd4984cUL, 0x58e8b058UL, 0xcf4a85cfUL, + 0xd06bbbd0UL, 0xef2ac5efUL, 0xaae54faaUL, 0xfb16edfbUL, + 0x43c58643UL, 0x4dd79a4dUL, 0x33556633UL, 0x85941185UL, + 0x45cf8a45UL, 0xf910e9f9UL, 0x02060402UL, 0x7f81fe7fUL, + 0x50f0a050UL, 0x3c44783cUL, 0x9fba259fUL, 0xa8e34ba8UL, + 0x51f3a251UL, 0xa3fe5da3UL, 0x40c08040UL, 0x8f8a058fUL, + 0x92ad3f92UL, 0x9dbc219dUL, 0x38487038UL, 0xf504f1f5UL, + 0xbcdf63bcUL, 0xb6c177b6UL, 0xda75afdaUL, 0x21634221UL, + 0x10302010UL, 0xff1ae5ffUL, 0xf30efdf3UL, 0xd26dbfd2UL, + 0xcd4c81cdUL, 0x0c14180cUL, 0x13352613UL, 0xec2fc3ecUL, + 0x5fe1be5fUL, 0x97a23597UL, 0x44cc8844UL, 0x17392e17UL, + 0xc45793c4UL, 0xa7f255a7UL, 0x7e82fc7eUL, 0x3d477a3dUL, + 0x64acc864UL, 0x5de7ba5dUL, 0x192b3219UL, 0x7395e673UL, + 0x60a0c060UL, 0x81981981UL, 0x4fd19e4fUL, 0xdc7fa3dcUL, + 0x22664422UL, 0x2a7e542aUL, 0x90ab3b90UL, 0x88830b88UL, + 0x46ca8c46UL, 0xee29c7eeUL, 0xb8d36bb8UL, 0x143c2814UL, + 0xde79a7deUL, 0x5ee2bc5eUL, 0x0b1d160bUL, 0xdb76addbUL, + 0xe03bdbe0UL, 0x32566432UL, 0x3a4e743aUL, 0x0a1e140aUL, + 0x49db9249UL, 0x060a0c06UL, 0x246c4824UL, 0x5ce4b85cUL, + 0xc25d9fc2UL, 0xd36ebdd3UL, 0xacef43acUL, 0x62a6c462UL, + 0x91a83991UL, 0x95a43195UL, 0xe437d3e4UL, 0x798bf279UL, + 0xe732d5e7UL, 0xc8438bc8UL, 0x37596e37UL, 0x6db7da6dUL, + 0x8d8c018dUL, 0xd564b1d5UL, 0x4ed29c4eUL, 0xa9e049a9UL, + 0x6cb4d86cUL, 0x56faac56UL, 0xf407f3f4UL, 0xea25cfeaUL, + 0x65afca65UL, 0x7a8ef47aUL, 0xaee947aeUL, 0x08181008UL, + 0xbad56fbaUL, 0x7888f078UL, 0x256f4a25UL, 0x2e725c2eUL, + 0x1c24381cUL, 0xa6f157a6UL, 0xb4c773b4UL, 0xc65197c6UL, + 0xe823cbe8UL, 0xdd7ca1ddUL, 0x749ce874UL, 0x1f213e1fUL, + 0x4bdd964bUL, 0xbddc61bdUL, 0x8b860d8bUL, 0x8a850f8aUL, + 0x7090e070UL, 0x3e427c3eUL, 0xb5c471b5UL, 0x66aacc66UL, + 0x48d89048UL, 0x03050603UL, 0xf601f7f6UL, 0x0e121c0eUL, + 0x61a3c261UL, 0x355f6a35UL, 0x57f9ae57UL, 0xb9d069b9UL, + 0x86911786UL, 0xc15899c1UL, 0x1d273a1dUL, 0x9eb9279eUL, + 0xe138d9e1UL, 0xf813ebf8UL, 0x98b32b98UL, 0x11332211UL, + 0x69bbd269UL, 0xd970a9d9UL, 0x8e89078eUL, 0x94a73394UL, + 0x9bb62d9bUL, 0x1e223c1eUL, 0x87921587UL, 0xe920c9e9UL, + 0xce4987ceUL, 0x55ffaa55UL, 0x28785028UL, 0xdf7aa5dfUL, + 0x8c8f038cUL, 0xa1f859a1UL, 0x89800989UL, 0x0d171a0dUL, + 0xbfda65bfUL, 0xe631d7e6UL, 0x42c68442UL, 0x68b8d068UL, + 0x41c38241UL, 0x99b02999UL, 0x2d775a2dUL, 0x0f111e0fUL, + 0xb0cb7bb0UL, 0x54fca854UL, 0xbbd66dbbUL, 0x163a2c16UL, +}; +static const ulong32 TE3[256] = { + + 0x6363a5c6UL, 0x7c7c84f8UL, 0x777799eeUL, 0x7b7b8df6UL, + 0xf2f20dffUL, 0x6b6bbdd6UL, 0x6f6fb1deUL, 0xc5c55491UL, + 0x30305060UL, 0x01010302UL, 0x6767a9ceUL, 0x2b2b7d56UL, + 0xfefe19e7UL, 0xd7d762b5UL, 0xababe64dUL, 0x76769aecUL, + 0xcaca458fUL, 0x82829d1fUL, 0xc9c94089UL, 0x7d7d87faUL, + 0xfafa15efUL, 0x5959ebb2UL, 0x4747c98eUL, 0xf0f00bfbUL, + 0xadadec41UL, 0xd4d467b3UL, 0xa2a2fd5fUL, 0xafafea45UL, + 0x9c9cbf23UL, 0xa4a4f753UL, 0x727296e4UL, 0xc0c05b9bUL, + 0xb7b7c275UL, 0xfdfd1ce1UL, 0x9393ae3dUL, 0x26266a4cUL, + 0x36365a6cUL, 0x3f3f417eUL, 0xf7f702f5UL, 0xcccc4f83UL, + 0x34345c68UL, 0xa5a5f451UL, 0xe5e534d1UL, 0xf1f108f9UL, + 0x717193e2UL, 0xd8d873abUL, 0x31315362UL, 0x15153f2aUL, + 0x04040c08UL, 0xc7c75295UL, 0x23236546UL, 0xc3c35e9dUL, + 0x18182830UL, 0x9696a137UL, 0x05050f0aUL, 0x9a9ab52fUL, + 0x0707090eUL, 0x12123624UL, 0x80809b1bUL, 0xe2e23ddfUL, + 0xebeb26cdUL, 0x2727694eUL, 0xb2b2cd7fUL, 0x75759feaUL, + 0x09091b12UL, 0x83839e1dUL, 0x2c2c7458UL, 0x1a1a2e34UL, + 0x1b1b2d36UL, 0x6e6eb2dcUL, 0x5a5aeeb4UL, 0xa0a0fb5bUL, + 0x5252f6a4UL, 0x3b3b4d76UL, 0xd6d661b7UL, 0xb3b3ce7dUL, + 0x29297b52UL, 0xe3e33eddUL, 0x2f2f715eUL, 0x84849713UL, + 0x5353f5a6UL, 0xd1d168b9UL, 0x00000000UL, 0xeded2cc1UL, + 0x20206040UL, 0xfcfc1fe3UL, 0xb1b1c879UL, 0x5b5bedb6UL, + 0x6a6abed4UL, 0xcbcb468dUL, 0xbebed967UL, 0x39394b72UL, + 0x4a4ade94UL, 0x4c4cd498UL, 0x5858e8b0UL, 0xcfcf4a85UL, + 0xd0d06bbbUL, 0xefef2ac5UL, 0xaaaae54fUL, 0xfbfb16edUL, + 0x4343c586UL, 0x4d4dd79aUL, 0x33335566UL, 0x85859411UL, + 0x4545cf8aUL, 0xf9f910e9UL, 0x02020604UL, 0x7f7f81feUL, + 0x5050f0a0UL, 0x3c3c4478UL, 0x9f9fba25UL, 0xa8a8e34bUL, + 0x5151f3a2UL, 0xa3a3fe5dUL, 0x4040c080UL, 0x8f8f8a05UL, + 0x9292ad3fUL, 0x9d9dbc21UL, 0x38384870UL, 0xf5f504f1UL, + 0xbcbcdf63UL, 0xb6b6c177UL, 0xdada75afUL, 0x21216342UL, + 0x10103020UL, 0xffff1ae5UL, 0xf3f30efdUL, 0xd2d26dbfUL, + 0xcdcd4c81UL, 0x0c0c1418UL, 0x13133526UL, 0xecec2fc3UL, + 0x5f5fe1beUL, 0x9797a235UL, 0x4444cc88UL, 0x1717392eUL, + 0xc4c45793UL, 0xa7a7f255UL, 0x7e7e82fcUL, 0x3d3d477aUL, + 0x6464acc8UL, 0x5d5de7baUL, 0x19192b32UL, 0x737395e6UL, + 0x6060a0c0UL, 0x81819819UL, 0x4f4fd19eUL, 0xdcdc7fa3UL, + 0x22226644UL, 0x2a2a7e54UL, 0x9090ab3bUL, 0x8888830bUL, + 0x4646ca8cUL, 0xeeee29c7UL, 0xb8b8d36bUL, 0x14143c28UL, + 0xdede79a7UL, 0x5e5ee2bcUL, 0x0b0b1d16UL, 0xdbdb76adUL, + 0xe0e03bdbUL, 0x32325664UL, 0x3a3a4e74UL, 0x0a0a1e14UL, + 0x4949db92UL, 0x06060a0cUL, 0x24246c48UL, 0x5c5ce4b8UL, + 0xc2c25d9fUL, 0xd3d36ebdUL, 0xacacef43UL, 0x6262a6c4UL, + 0x9191a839UL, 0x9595a431UL, 0xe4e437d3UL, 0x79798bf2UL, + 0xe7e732d5UL, 0xc8c8438bUL, 0x3737596eUL, 0x6d6db7daUL, + 0x8d8d8c01UL, 0xd5d564b1UL, 0x4e4ed29cUL, 0xa9a9e049UL, + 0x6c6cb4d8UL, 0x5656faacUL, 0xf4f407f3UL, 0xeaea25cfUL, + 0x6565afcaUL, 0x7a7a8ef4UL, 0xaeaee947UL, 0x08081810UL, + 0xbabad56fUL, 0x787888f0UL, 0x25256f4aUL, 0x2e2e725cUL, + 0x1c1c2438UL, 0xa6a6f157UL, 0xb4b4c773UL, 0xc6c65197UL, + 0xe8e823cbUL, 0xdddd7ca1UL, 0x74749ce8UL, 0x1f1f213eUL, + 0x4b4bdd96UL, 0xbdbddc61UL, 0x8b8b860dUL, 0x8a8a850fUL, + 0x707090e0UL, 0x3e3e427cUL, 0xb5b5c471UL, 0x6666aaccUL, + 0x4848d890UL, 0x03030506UL, 0xf6f601f7UL, 0x0e0e121cUL, + 0x6161a3c2UL, 0x35355f6aUL, 0x5757f9aeUL, 0xb9b9d069UL, + 0x86869117UL, 0xc1c15899UL, 0x1d1d273aUL, 0x9e9eb927UL, + 0xe1e138d9UL, 0xf8f813ebUL, 0x9898b32bUL, 0x11113322UL, + 0x6969bbd2UL, 0xd9d970a9UL, 0x8e8e8907UL, 0x9494a733UL, + 0x9b9bb62dUL, 0x1e1e223cUL, 0x87879215UL, 0xe9e920c9UL, + 0xcece4987UL, 0x5555ffaaUL, 0x28287850UL, 0xdfdf7aa5UL, + 0x8c8c8f03UL, 0xa1a1f859UL, 0x89898009UL, 0x0d0d171aUL, + 0xbfbfda65UL, 0xe6e631d7UL, 0x4242c684UL, 0x6868b8d0UL, + 0x4141c382UL, 0x9999b029UL, 0x2d2d775aUL, 0x0f0f111eUL, + 0xb0b0cb7bUL, 0x5454fca8UL, 0xbbbbd66dUL, 0x16163a2cUL, +}; + +#ifndef PELI_TAB +static const ulong32 Te4_0[] = { +0x00000063UL, 0x0000007cUL, 0x00000077UL, 0x0000007bUL, 0x000000f2UL, 0x0000006bUL, 0x0000006fUL, 0x000000c5UL, +0x00000030UL, 0x00000001UL, 0x00000067UL, 0x0000002bUL, 0x000000feUL, 0x000000d7UL, 0x000000abUL, 0x00000076UL, +0x000000caUL, 0x00000082UL, 0x000000c9UL, 0x0000007dUL, 0x000000faUL, 0x00000059UL, 0x00000047UL, 0x000000f0UL, +0x000000adUL, 0x000000d4UL, 0x000000a2UL, 0x000000afUL, 0x0000009cUL, 0x000000a4UL, 0x00000072UL, 0x000000c0UL, +0x000000b7UL, 0x000000fdUL, 0x00000093UL, 0x00000026UL, 0x00000036UL, 0x0000003fUL, 0x000000f7UL, 0x000000ccUL, +0x00000034UL, 0x000000a5UL, 0x000000e5UL, 0x000000f1UL, 0x00000071UL, 0x000000d8UL, 0x00000031UL, 0x00000015UL, +0x00000004UL, 0x000000c7UL, 0x00000023UL, 0x000000c3UL, 0x00000018UL, 0x00000096UL, 0x00000005UL, 0x0000009aUL, +0x00000007UL, 0x00000012UL, 0x00000080UL, 0x000000e2UL, 0x000000ebUL, 0x00000027UL, 0x000000b2UL, 0x00000075UL, +0x00000009UL, 0x00000083UL, 0x0000002cUL, 0x0000001aUL, 0x0000001bUL, 0x0000006eUL, 0x0000005aUL, 0x000000a0UL, +0x00000052UL, 0x0000003bUL, 0x000000d6UL, 0x000000b3UL, 0x00000029UL, 0x000000e3UL, 0x0000002fUL, 0x00000084UL, +0x00000053UL, 0x000000d1UL, 0x00000000UL, 0x000000edUL, 0x00000020UL, 0x000000fcUL, 0x000000b1UL, 0x0000005bUL, +0x0000006aUL, 0x000000cbUL, 0x000000beUL, 0x00000039UL, 0x0000004aUL, 0x0000004cUL, 0x00000058UL, 0x000000cfUL, +0x000000d0UL, 0x000000efUL, 0x000000aaUL, 0x000000fbUL, 0x00000043UL, 0x0000004dUL, 0x00000033UL, 0x00000085UL, +0x00000045UL, 0x000000f9UL, 0x00000002UL, 0x0000007fUL, 0x00000050UL, 0x0000003cUL, 0x0000009fUL, 0x000000a8UL, +0x00000051UL, 0x000000a3UL, 0x00000040UL, 0x0000008fUL, 0x00000092UL, 0x0000009dUL, 0x00000038UL, 0x000000f5UL, +0x000000bcUL, 0x000000b6UL, 0x000000daUL, 0x00000021UL, 0x00000010UL, 0x000000ffUL, 0x000000f3UL, 0x000000d2UL, +0x000000cdUL, 0x0000000cUL, 0x00000013UL, 0x000000ecUL, 0x0000005fUL, 0x00000097UL, 0x00000044UL, 0x00000017UL, +0x000000c4UL, 0x000000a7UL, 0x0000007eUL, 0x0000003dUL, 0x00000064UL, 0x0000005dUL, 0x00000019UL, 0x00000073UL, +0x00000060UL, 0x00000081UL, 0x0000004fUL, 0x000000dcUL, 0x00000022UL, 0x0000002aUL, 0x00000090UL, 0x00000088UL, +0x00000046UL, 0x000000eeUL, 0x000000b8UL, 0x00000014UL, 0x000000deUL, 0x0000005eUL, 0x0000000bUL, 0x000000dbUL, +0x000000e0UL, 0x00000032UL, 0x0000003aUL, 0x0000000aUL, 0x00000049UL, 0x00000006UL, 0x00000024UL, 0x0000005cUL, +0x000000c2UL, 0x000000d3UL, 0x000000acUL, 0x00000062UL, 0x00000091UL, 0x00000095UL, 0x000000e4UL, 0x00000079UL, +0x000000e7UL, 0x000000c8UL, 0x00000037UL, 0x0000006dUL, 0x0000008dUL, 0x000000d5UL, 0x0000004eUL, 0x000000a9UL, +0x0000006cUL, 0x00000056UL, 0x000000f4UL, 0x000000eaUL, 0x00000065UL, 0x0000007aUL, 0x000000aeUL, 0x00000008UL, +0x000000baUL, 0x00000078UL, 0x00000025UL, 0x0000002eUL, 0x0000001cUL, 0x000000a6UL, 0x000000b4UL, 0x000000c6UL, +0x000000e8UL, 0x000000ddUL, 0x00000074UL, 0x0000001fUL, 0x0000004bUL, 0x000000bdUL, 0x0000008bUL, 0x0000008aUL, +0x00000070UL, 0x0000003eUL, 0x000000b5UL, 0x00000066UL, 0x00000048UL, 0x00000003UL, 0x000000f6UL, 0x0000000eUL, +0x00000061UL, 0x00000035UL, 0x00000057UL, 0x000000b9UL, 0x00000086UL, 0x000000c1UL, 0x0000001dUL, 0x0000009eUL, +0x000000e1UL, 0x000000f8UL, 0x00000098UL, 0x00000011UL, 0x00000069UL, 0x000000d9UL, 0x0000008eUL, 0x00000094UL, +0x0000009bUL, 0x0000001eUL, 0x00000087UL, 0x000000e9UL, 0x000000ceUL, 0x00000055UL, 0x00000028UL, 0x000000dfUL, +0x0000008cUL, 0x000000a1UL, 0x00000089UL, 0x0000000dUL, 0x000000bfUL, 0x000000e6UL, 0x00000042UL, 0x00000068UL, +0x00000041UL, 0x00000099UL, 0x0000002dUL, 0x0000000fUL, 0x000000b0UL, 0x00000054UL, 0x000000bbUL, 0x00000016UL +}; + +static const ulong32 Te4_1[] = { +0x00006300UL, 0x00007c00UL, 0x00007700UL, 0x00007b00UL, 0x0000f200UL, 0x00006b00UL, 0x00006f00UL, 0x0000c500UL, +0x00003000UL, 0x00000100UL, 0x00006700UL, 0x00002b00UL, 0x0000fe00UL, 0x0000d700UL, 0x0000ab00UL, 0x00007600UL, +0x0000ca00UL, 0x00008200UL, 0x0000c900UL, 0x00007d00UL, 0x0000fa00UL, 0x00005900UL, 0x00004700UL, 0x0000f000UL, +0x0000ad00UL, 0x0000d400UL, 0x0000a200UL, 0x0000af00UL, 0x00009c00UL, 0x0000a400UL, 0x00007200UL, 0x0000c000UL, +0x0000b700UL, 0x0000fd00UL, 0x00009300UL, 0x00002600UL, 0x00003600UL, 0x00003f00UL, 0x0000f700UL, 0x0000cc00UL, +0x00003400UL, 0x0000a500UL, 0x0000e500UL, 0x0000f100UL, 0x00007100UL, 0x0000d800UL, 0x00003100UL, 0x00001500UL, +0x00000400UL, 0x0000c700UL, 0x00002300UL, 0x0000c300UL, 0x00001800UL, 0x00009600UL, 0x00000500UL, 0x00009a00UL, +0x00000700UL, 0x00001200UL, 0x00008000UL, 0x0000e200UL, 0x0000eb00UL, 0x00002700UL, 0x0000b200UL, 0x00007500UL, +0x00000900UL, 0x00008300UL, 0x00002c00UL, 0x00001a00UL, 0x00001b00UL, 0x00006e00UL, 0x00005a00UL, 0x0000a000UL, +0x00005200UL, 0x00003b00UL, 0x0000d600UL, 0x0000b300UL, 0x00002900UL, 0x0000e300UL, 0x00002f00UL, 0x00008400UL, +0x00005300UL, 0x0000d100UL, 0x00000000UL, 0x0000ed00UL, 0x00002000UL, 0x0000fc00UL, 0x0000b100UL, 0x00005b00UL, +0x00006a00UL, 0x0000cb00UL, 0x0000be00UL, 0x00003900UL, 0x00004a00UL, 0x00004c00UL, 0x00005800UL, 0x0000cf00UL, +0x0000d000UL, 0x0000ef00UL, 0x0000aa00UL, 0x0000fb00UL, 0x00004300UL, 0x00004d00UL, 0x00003300UL, 0x00008500UL, +0x00004500UL, 0x0000f900UL, 0x00000200UL, 0x00007f00UL, 0x00005000UL, 0x00003c00UL, 0x00009f00UL, 0x0000a800UL, +0x00005100UL, 0x0000a300UL, 0x00004000UL, 0x00008f00UL, 0x00009200UL, 0x00009d00UL, 0x00003800UL, 0x0000f500UL, +0x0000bc00UL, 0x0000b600UL, 0x0000da00UL, 0x00002100UL, 0x00001000UL, 0x0000ff00UL, 0x0000f300UL, 0x0000d200UL, +0x0000cd00UL, 0x00000c00UL, 0x00001300UL, 0x0000ec00UL, 0x00005f00UL, 0x00009700UL, 0x00004400UL, 0x00001700UL, +0x0000c400UL, 0x0000a700UL, 0x00007e00UL, 0x00003d00UL, 0x00006400UL, 0x00005d00UL, 0x00001900UL, 0x00007300UL, +0x00006000UL, 0x00008100UL, 0x00004f00UL, 0x0000dc00UL, 0x00002200UL, 0x00002a00UL, 0x00009000UL, 0x00008800UL, +0x00004600UL, 0x0000ee00UL, 0x0000b800UL, 0x00001400UL, 0x0000de00UL, 0x00005e00UL, 0x00000b00UL, 0x0000db00UL, +0x0000e000UL, 0x00003200UL, 0x00003a00UL, 0x00000a00UL, 0x00004900UL, 0x00000600UL, 0x00002400UL, 0x00005c00UL, +0x0000c200UL, 0x0000d300UL, 0x0000ac00UL, 0x00006200UL, 0x00009100UL, 0x00009500UL, 0x0000e400UL, 0x00007900UL, +0x0000e700UL, 0x0000c800UL, 0x00003700UL, 0x00006d00UL, 0x00008d00UL, 0x0000d500UL, 0x00004e00UL, 0x0000a900UL, +0x00006c00UL, 0x00005600UL, 0x0000f400UL, 0x0000ea00UL, 0x00006500UL, 0x00007a00UL, 0x0000ae00UL, 0x00000800UL, +0x0000ba00UL, 0x00007800UL, 0x00002500UL, 0x00002e00UL, 0x00001c00UL, 0x0000a600UL, 0x0000b400UL, 0x0000c600UL, +0x0000e800UL, 0x0000dd00UL, 0x00007400UL, 0x00001f00UL, 0x00004b00UL, 0x0000bd00UL, 0x00008b00UL, 0x00008a00UL, +0x00007000UL, 0x00003e00UL, 0x0000b500UL, 0x00006600UL, 0x00004800UL, 0x00000300UL, 0x0000f600UL, 0x00000e00UL, +0x00006100UL, 0x00003500UL, 0x00005700UL, 0x0000b900UL, 0x00008600UL, 0x0000c100UL, 0x00001d00UL, 0x00009e00UL, +0x0000e100UL, 0x0000f800UL, 0x00009800UL, 0x00001100UL, 0x00006900UL, 0x0000d900UL, 0x00008e00UL, 0x00009400UL, +0x00009b00UL, 0x00001e00UL, 0x00008700UL, 0x0000e900UL, 0x0000ce00UL, 0x00005500UL, 0x00002800UL, 0x0000df00UL, +0x00008c00UL, 0x0000a100UL, 0x00008900UL, 0x00000d00UL, 0x0000bf00UL, 0x0000e600UL, 0x00004200UL, 0x00006800UL, +0x00004100UL, 0x00009900UL, 0x00002d00UL, 0x00000f00UL, 0x0000b000UL, 0x00005400UL, 0x0000bb00UL, 0x00001600UL +}; + +static const ulong32 Te4_2[] = { +0x00630000UL, 0x007c0000UL, 0x00770000UL, 0x007b0000UL, 0x00f20000UL, 0x006b0000UL, 0x006f0000UL, 0x00c50000UL, +0x00300000UL, 0x00010000UL, 0x00670000UL, 0x002b0000UL, 0x00fe0000UL, 0x00d70000UL, 0x00ab0000UL, 0x00760000UL, +0x00ca0000UL, 0x00820000UL, 0x00c90000UL, 0x007d0000UL, 0x00fa0000UL, 0x00590000UL, 0x00470000UL, 0x00f00000UL, +0x00ad0000UL, 0x00d40000UL, 0x00a20000UL, 0x00af0000UL, 0x009c0000UL, 0x00a40000UL, 0x00720000UL, 0x00c00000UL, +0x00b70000UL, 0x00fd0000UL, 0x00930000UL, 0x00260000UL, 0x00360000UL, 0x003f0000UL, 0x00f70000UL, 0x00cc0000UL, +0x00340000UL, 0x00a50000UL, 0x00e50000UL, 0x00f10000UL, 0x00710000UL, 0x00d80000UL, 0x00310000UL, 0x00150000UL, +0x00040000UL, 0x00c70000UL, 0x00230000UL, 0x00c30000UL, 0x00180000UL, 0x00960000UL, 0x00050000UL, 0x009a0000UL, +0x00070000UL, 0x00120000UL, 0x00800000UL, 0x00e20000UL, 0x00eb0000UL, 0x00270000UL, 0x00b20000UL, 0x00750000UL, +0x00090000UL, 0x00830000UL, 0x002c0000UL, 0x001a0000UL, 0x001b0000UL, 0x006e0000UL, 0x005a0000UL, 0x00a00000UL, +0x00520000UL, 0x003b0000UL, 0x00d60000UL, 0x00b30000UL, 0x00290000UL, 0x00e30000UL, 0x002f0000UL, 0x00840000UL, +0x00530000UL, 0x00d10000UL, 0x00000000UL, 0x00ed0000UL, 0x00200000UL, 0x00fc0000UL, 0x00b10000UL, 0x005b0000UL, +0x006a0000UL, 0x00cb0000UL, 0x00be0000UL, 0x00390000UL, 0x004a0000UL, 0x004c0000UL, 0x00580000UL, 0x00cf0000UL, +0x00d00000UL, 0x00ef0000UL, 0x00aa0000UL, 0x00fb0000UL, 0x00430000UL, 0x004d0000UL, 0x00330000UL, 0x00850000UL, +0x00450000UL, 0x00f90000UL, 0x00020000UL, 0x007f0000UL, 0x00500000UL, 0x003c0000UL, 0x009f0000UL, 0x00a80000UL, +0x00510000UL, 0x00a30000UL, 0x00400000UL, 0x008f0000UL, 0x00920000UL, 0x009d0000UL, 0x00380000UL, 0x00f50000UL, +0x00bc0000UL, 0x00b60000UL, 0x00da0000UL, 0x00210000UL, 0x00100000UL, 0x00ff0000UL, 0x00f30000UL, 0x00d20000UL, +0x00cd0000UL, 0x000c0000UL, 0x00130000UL, 0x00ec0000UL, 0x005f0000UL, 0x00970000UL, 0x00440000UL, 0x00170000UL, +0x00c40000UL, 0x00a70000UL, 0x007e0000UL, 0x003d0000UL, 0x00640000UL, 0x005d0000UL, 0x00190000UL, 0x00730000UL, +0x00600000UL, 0x00810000UL, 0x004f0000UL, 0x00dc0000UL, 0x00220000UL, 0x002a0000UL, 0x00900000UL, 0x00880000UL, +0x00460000UL, 0x00ee0000UL, 0x00b80000UL, 0x00140000UL, 0x00de0000UL, 0x005e0000UL, 0x000b0000UL, 0x00db0000UL, +0x00e00000UL, 0x00320000UL, 0x003a0000UL, 0x000a0000UL, 0x00490000UL, 0x00060000UL, 0x00240000UL, 0x005c0000UL, +0x00c20000UL, 0x00d30000UL, 0x00ac0000UL, 0x00620000UL, 0x00910000UL, 0x00950000UL, 0x00e40000UL, 0x00790000UL, +0x00e70000UL, 0x00c80000UL, 0x00370000UL, 0x006d0000UL, 0x008d0000UL, 0x00d50000UL, 0x004e0000UL, 0x00a90000UL, +0x006c0000UL, 0x00560000UL, 0x00f40000UL, 0x00ea0000UL, 0x00650000UL, 0x007a0000UL, 0x00ae0000UL, 0x00080000UL, +0x00ba0000UL, 0x00780000UL, 0x00250000UL, 0x002e0000UL, 0x001c0000UL, 0x00a60000UL, 0x00b40000UL, 0x00c60000UL, +0x00e80000UL, 0x00dd0000UL, 0x00740000UL, 0x001f0000UL, 0x004b0000UL, 0x00bd0000UL, 0x008b0000UL, 0x008a0000UL, +0x00700000UL, 0x003e0000UL, 0x00b50000UL, 0x00660000UL, 0x00480000UL, 0x00030000UL, 0x00f60000UL, 0x000e0000UL, +0x00610000UL, 0x00350000UL, 0x00570000UL, 0x00b90000UL, 0x00860000UL, 0x00c10000UL, 0x001d0000UL, 0x009e0000UL, +0x00e10000UL, 0x00f80000UL, 0x00980000UL, 0x00110000UL, 0x00690000UL, 0x00d90000UL, 0x008e0000UL, 0x00940000UL, +0x009b0000UL, 0x001e0000UL, 0x00870000UL, 0x00e90000UL, 0x00ce0000UL, 0x00550000UL, 0x00280000UL, 0x00df0000UL, +0x008c0000UL, 0x00a10000UL, 0x00890000UL, 0x000d0000UL, 0x00bf0000UL, 0x00e60000UL, 0x00420000UL, 0x00680000UL, +0x00410000UL, 0x00990000UL, 0x002d0000UL, 0x000f0000UL, 0x00b00000UL, 0x00540000UL, 0x00bb0000UL, 0x00160000UL +}; + +static const ulong32 Te4_3[] = { +0x63000000UL, 0x7c000000UL, 0x77000000UL, 0x7b000000UL, 0xf2000000UL, 0x6b000000UL, 0x6f000000UL, 0xc5000000UL, +0x30000000UL, 0x01000000UL, 0x67000000UL, 0x2b000000UL, 0xfe000000UL, 0xd7000000UL, 0xab000000UL, 0x76000000UL, +0xca000000UL, 0x82000000UL, 0xc9000000UL, 0x7d000000UL, 0xfa000000UL, 0x59000000UL, 0x47000000UL, 0xf0000000UL, +0xad000000UL, 0xd4000000UL, 0xa2000000UL, 0xaf000000UL, 0x9c000000UL, 0xa4000000UL, 0x72000000UL, 0xc0000000UL, +0xb7000000UL, 0xfd000000UL, 0x93000000UL, 0x26000000UL, 0x36000000UL, 0x3f000000UL, 0xf7000000UL, 0xcc000000UL, +0x34000000UL, 0xa5000000UL, 0xe5000000UL, 0xf1000000UL, 0x71000000UL, 0xd8000000UL, 0x31000000UL, 0x15000000UL, +0x04000000UL, 0xc7000000UL, 0x23000000UL, 0xc3000000UL, 0x18000000UL, 0x96000000UL, 0x05000000UL, 0x9a000000UL, +0x07000000UL, 0x12000000UL, 0x80000000UL, 0xe2000000UL, 0xeb000000UL, 0x27000000UL, 0xb2000000UL, 0x75000000UL, +0x09000000UL, 0x83000000UL, 0x2c000000UL, 0x1a000000UL, 0x1b000000UL, 0x6e000000UL, 0x5a000000UL, 0xa0000000UL, +0x52000000UL, 0x3b000000UL, 0xd6000000UL, 0xb3000000UL, 0x29000000UL, 0xe3000000UL, 0x2f000000UL, 0x84000000UL, +0x53000000UL, 0xd1000000UL, 0x00000000UL, 0xed000000UL, 0x20000000UL, 0xfc000000UL, 0xb1000000UL, 0x5b000000UL, +0x6a000000UL, 0xcb000000UL, 0xbe000000UL, 0x39000000UL, 0x4a000000UL, 0x4c000000UL, 0x58000000UL, 0xcf000000UL, +0xd0000000UL, 0xef000000UL, 0xaa000000UL, 0xfb000000UL, 0x43000000UL, 0x4d000000UL, 0x33000000UL, 0x85000000UL, +0x45000000UL, 0xf9000000UL, 0x02000000UL, 0x7f000000UL, 0x50000000UL, 0x3c000000UL, 0x9f000000UL, 0xa8000000UL, +0x51000000UL, 0xa3000000UL, 0x40000000UL, 0x8f000000UL, 0x92000000UL, 0x9d000000UL, 0x38000000UL, 0xf5000000UL, +0xbc000000UL, 0xb6000000UL, 0xda000000UL, 0x21000000UL, 0x10000000UL, 0xff000000UL, 0xf3000000UL, 0xd2000000UL, +0xcd000000UL, 0x0c000000UL, 0x13000000UL, 0xec000000UL, 0x5f000000UL, 0x97000000UL, 0x44000000UL, 0x17000000UL, +0xc4000000UL, 0xa7000000UL, 0x7e000000UL, 0x3d000000UL, 0x64000000UL, 0x5d000000UL, 0x19000000UL, 0x73000000UL, +0x60000000UL, 0x81000000UL, 0x4f000000UL, 0xdc000000UL, 0x22000000UL, 0x2a000000UL, 0x90000000UL, 0x88000000UL, +0x46000000UL, 0xee000000UL, 0xb8000000UL, 0x14000000UL, 0xde000000UL, 0x5e000000UL, 0x0b000000UL, 0xdb000000UL, +0xe0000000UL, 0x32000000UL, 0x3a000000UL, 0x0a000000UL, 0x49000000UL, 0x06000000UL, 0x24000000UL, 0x5c000000UL, +0xc2000000UL, 0xd3000000UL, 0xac000000UL, 0x62000000UL, 0x91000000UL, 0x95000000UL, 0xe4000000UL, 0x79000000UL, +0xe7000000UL, 0xc8000000UL, 0x37000000UL, 0x6d000000UL, 0x8d000000UL, 0xd5000000UL, 0x4e000000UL, 0xa9000000UL, +0x6c000000UL, 0x56000000UL, 0xf4000000UL, 0xea000000UL, 0x65000000UL, 0x7a000000UL, 0xae000000UL, 0x08000000UL, +0xba000000UL, 0x78000000UL, 0x25000000UL, 0x2e000000UL, 0x1c000000UL, 0xa6000000UL, 0xb4000000UL, 0xc6000000UL, +0xe8000000UL, 0xdd000000UL, 0x74000000UL, 0x1f000000UL, 0x4b000000UL, 0xbd000000UL, 0x8b000000UL, 0x8a000000UL, +0x70000000UL, 0x3e000000UL, 0xb5000000UL, 0x66000000UL, 0x48000000UL, 0x03000000UL, 0xf6000000UL, 0x0e000000UL, +0x61000000UL, 0x35000000UL, 0x57000000UL, 0xb9000000UL, 0x86000000UL, 0xc1000000UL, 0x1d000000UL, 0x9e000000UL, +0xe1000000UL, 0xf8000000UL, 0x98000000UL, 0x11000000UL, 0x69000000UL, 0xd9000000UL, 0x8e000000UL, 0x94000000UL, +0x9b000000UL, 0x1e000000UL, 0x87000000UL, 0xe9000000UL, 0xce000000UL, 0x55000000UL, 0x28000000UL, 0xdf000000UL, +0x8c000000UL, 0xa1000000UL, 0x89000000UL, 0x0d000000UL, 0xbf000000UL, 0xe6000000UL, 0x42000000UL, 0x68000000UL, +0x41000000UL, 0x99000000UL, 0x2d000000UL, 0x0f000000UL, 0xb0000000UL, 0x54000000UL, 0xbb000000UL, 0x16000000UL +}; +#endif /* pelimac */ + +#ifndef ENCRYPT_ONLY + +static const ulong32 TD1[256] = { + 0x5051f4a7UL, 0x537e4165UL, 0xc31a17a4UL, 0x963a275eUL, + 0xcb3bab6bUL, 0xf11f9d45UL, 0xabacfa58UL, 0x934be303UL, + 0x552030faUL, 0xf6ad766dUL, 0x9188cc76UL, 0x25f5024cUL, + 0xfc4fe5d7UL, 0xd7c52acbUL, 0x80263544UL, 0x8fb562a3UL, + 0x49deb15aUL, 0x6725ba1bUL, 0x9845ea0eUL, 0xe15dfec0UL, + 0x02c32f75UL, 0x12814cf0UL, 0xa38d4697UL, 0xc66bd3f9UL, + 0xe7038f5fUL, 0x9515929cUL, 0xebbf6d7aUL, 0xda955259UL, + 0x2dd4be83UL, 0xd3587421UL, 0x2949e069UL, 0x448ec9c8UL, + 0x6a75c289UL, 0x78f48e79UL, 0x6b99583eUL, 0xdd27b971UL, + 0xb6bee14fUL, 0x17f088adUL, 0x66c920acUL, 0xb47dce3aUL, + 0x1863df4aUL, 0x82e51a31UL, 0x60975133UL, 0x4562537fUL, + 0xe0b16477UL, 0x84bb6baeUL, 0x1cfe81a0UL, 0x94f9082bUL, + 0x58704868UL, 0x198f45fdUL, 0x8794de6cUL, 0xb7527bf8UL, + 0x23ab73d3UL, 0xe2724b02UL, 0x57e31f8fUL, 0x2a6655abUL, + 0x07b2eb28UL, 0x032fb5c2UL, 0x9a86c57bUL, 0xa5d33708UL, + 0xf2302887UL, 0xb223bfa5UL, 0xba02036aUL, 0x5ced1682UL, + 0x2b8acf1cUL, 0x92a779b4UL, 0xf0f307f2UL, 0xa14e69e2UL, + 0xcd65daf4UL, 0xd50605beUL, 0x1fd13462UL, 0x8ac4a6feUL, + 0x9d342e53UL, 0xa0a2f355UL, 0x32058ae1UL, 0x75a4f6ebUL, + 0x390b83ecUL, 0xaa4060efUL, 0x065e719fUL, 0x51bd6e10UL, + 0xf93e218aUL, 0x3d96dd06UL, 0xaedd3e05UL, 0x464de6bdUL, + 0xb591548dUL, 0x0571c45dUL, 0x6f0406d4UL, 0xff605015UL, + 0x241998fbUL, 0x97d6bde9UL, 0xcc894043UL, 0x7767d99eUL, + 0xbdb0e842UL, 0x8807898bUL, 0x38e7195bUL, 0xdb79c8eeUL, + 0x47a17c0aUL, 0xe97c420fUL, 0xc9f8841eUL, 0x00000000UL, + 0x83098086UL, 0x48322bedUL, 0xac1e1170UL, 0x4e6c5a72UL, + 0xfbfd0effUL, 0x560f8538UL, 0x1e3daed5UL, 0x27362d39UL, + 0x640a0fd9UL, 0x21685ca6UL, 0xd19b5b54UL, 0x3a24362eUL, + 0xb10c0a67UL, 0x0f9357e7UL, 0xd2b4ee96UL, 0x9e1b9b91UL, + 0x4f80c0c5UL, 0xa261dc20UL, 0x695a774bUL, 0x161c121aUL, + 0x0ae293baUL, 0xe5c0a02aUL, 0x433c22e0UL, 0x1d121b17UL, + 0x0b0e090dUL, 0xadf28bc7UL, 0xb92db6a8UL, 0xc8141ea9UL, + 0x8557f119UL, 0x4caf7507UL, 0xbbee99ddUL, 0xfda37f60UL, + 0x9ff70126UL, 0xbc5c72f5UL, 0xc544663bUL, 0x345bfb7eUL, + 0x768b4329UL, 0xdccb23c6UL, 0x68b6edfcUL, 0x63b8e4f1UL, + 0xcad731dcUL, 0x10426385UL, 0x40139722UL, 0x2084c611UL, + 0x7d854a24UL, 0xf8d2bb3dUL, 0x11aef932UL, 0x6dc729a1UL, + 0x4b1d9e2fUL, 0xf3dcb230UL, 0xec0d8652UL, 0xd077c1e3UL, + 0x6c2bb316UL, 0x99a970b9UL, 0xfa119448UL, 0x2247e964UL, + 0xc4a8fc8cUL, 0x1aa0f03fUL, 0xd8567d2cUL, 0xef223390UL, + 0xc787494eUL, 0xc1d938d1UL, 0xfe8ccaa2UL, 0x3698d40bUL, + 0xcfa6f581UL, 0x28a57adeUL, 0x26dab78eUL, 0xa43fadbfUL, + 0xe42c3a9dUL, 0x0d507892UL, 0x9b6a5fccUL, 0x62547e46UL, + 0xc2f68d13UL, 0xe890d8b8UL, 0x5e2e39f7UL, 0xf582c3afUL, + 0xbe9f5d80UL, 0x7c69d093UL, 0xa96fd52dUL, 0xb3cf2512UL, + 0x3bc8ac99UL, 0xa710187dUL, 0x6ee89c63UL, 0x7bdb3bbbUL, + 0x09cd2678UL, 0xf46e5918UL, 0x01ec9ab7UL, 0xa8834f9aUL, + 0x65e6956eUL, 0x7eaaffe6UL, 0x0821bccfUL, 0xe6ef15e8UL, + 0xd9bae79bUL, 0xce4a6f36UL, 0xd4ea9f09UL, 0xd629b07cUL, + 0xaf31a4b2UL, 0x312a3f23UL, 0x30c6a594UL, 0xc035a266UL, + 0x37744ebcUL, 0xa6fc82caUL, 0xb0e090d0UL, 0x1533a7d8UL, + 0x4af10498UL, 0xf741ecdaUL, 0x0e7fcd50UL, 0x2f1791f6UL, + 0x8d764dd6UL, 0x4d43efb0UL, 0x54ccaa4dUL, 0xdfe49604UL, + 0xe39ed1b5UL, 0x1b4c6a88UL, 0xb8c12c1fUL, 0x7f466551UL, + 0x049d5eeaUL, 0x5d018c35UL, 0x73fa8774UL, 0x2efb0b41UL, + 0x5ab3671dUL, 0x5292dbd2UL, 0x33e91056UL, 0x136dd647UL, + 0x8c9ad761UL, 0x7a37a10cUL, 0x8e59f814UL, 0x89eb133cUL, + 0xeecea927UL, 0x35b761c9UL, 0xede11ce5UL, 0x3c7a47b1UL, + 0x599cd2dfUL, 0x3f55f273UL, 0x791814ceUL, 0xbf73c737UL, + 0xea53f7cdUL, 0x5b5ffdaaUL, 0x14df3d6fUL, 0x867844dbUL, + 0x81caaff3UL, 0x3eb968c4UL, 0x2c382434UL, 0x5fc2a340UL, + 0x72161dc3UL, 0x0cbce225UL, 0x8b283c49UL, 0x41ff0d95UL, + 0x7139a801UL, 0xde080cb3UL, 0x9cd8b4e4UL, 0x906456c1UL, + 0x617bcb84UL, 0x70d532b6UL, 0x74486c5cUL, 0x42d0b857UL, +}; +static const ulong32 TD2[256] = { + 0xa75051f4UL, 0x65537e41UL, 0xa4c31a17UL, 0x5e963a27UL, + 0x6bcb3babUL, 0x45f11f9dUL, 0x58abacfaUL, 0x03934be3UL, + 0xfa552030UL, 0x6df6ad76UL, 0x769188ccUL, 0x4c25f502UL, + 0xd7fc4fe5UL, 0xcbd7c52aUL, 0x44802635UL, 0xa38fb562UL, + 0x5a49deb1UL, 0x1b6725baUL, 0x0e9845eaUL, 0xc0e15dfeUL, + 0x7502c32fUL, 0xf012814cUL, 0x97a38d46UL, 0xf9c66bd3UL, + 0x5fe7038fUL, 0x9c951592UL, 0x7aebbf6dUL, 0x59da9552UL, + 0x832dd4beUL, 0x21d35874UL, 0x692949e0UL, 0xc8448ec9UL, + 0x896a75c2UL, 0x7978f48eUL, 0x3e6b9958UL, 0x71dd27b9UL, + 0x4fb6bee1UL, 0xad17f088UL, 0xac66c920UL, 0x3ab47dceUL, + 0x4a1863dfUL, 0x3182e51aUL, 0x33609751UL, 0x7f456253UL, + 0x77e0b164UL, 0xae84bb6bUL, 0xa01cfe81UL, 0x2b94f908UL, + 0x68587048UL, 0xfd198f45UL, 0x6c8794deUL, 0xf8b7527bUL, + 0xd323ab73UL, 0x02e2724bUL, 0x8f57e31fUL, 0xab2a6655UL, + 0x2807b2ebUL, 0xc2032fb5UL, 0x7b9a86c5UL, 0x08a5d337UL, + 0x87f23028UL, 0xa5b223bfUL, 0x6aba0203UL, 0x825ced16UL, + 0x1c2b8acfUL, 0xb492a779UL, 0xf2f0f307UL, 0xe2a14e69UL, + 0xf4cd65daUL, 0xbed50605UL, 0x621fd134UL, 0xfe8ac4a6UL, + 0x539d342eUL, 0x55a0a2f3UL, 0xe132058aUL, 0xeb75a4f6UL, + 0xec390b83UL, 0xefaa4060UL, 0x9f065e71UL, 0x1051bd6eUL, + 0x8af93e21UL, 0x063d96ddUL, 0x05aedd3eUL, 0xbd464de6UL, + 0x8db59154UL, 0x5d0571c4UL, 0xd46f0406UL, 0x15ff6050UL, + 0xfb241998UL, 0xe997d6bdUL, 0x43cc8940UL, 0x9e7767d9UL, + 0x42bdb0e8UL, 0x8b880789UL, 0x5b38e719UL, 0xeedb79c8UL, + 0x0a47a17cUL, 0x0fe97c42UL, 0x1ec9f884UL, 0x00000000UL, + 0x86830980UL, 0xed48322bUL, 0x70ac1e11UL, 0x724e6c5aUL, + 0xfffbfd0eUL, 0x38560f85UL, 0xd51e3daeUL, 0x3927362dUL, + 0xd9640a0fUL, 0xa621685cUL, 0x54d19b5bUL, 0x2e3a2436UL, + 0x67b10c0aUL, 0xe70f9357UL, 0x96d2b4eeUL, 0x919e1b9bUL, + 0xc54f80c0UL, 0x20a261dcUL, 0x4b695a77UL, 0x1a161c12UL, + 0xba0ae293UL, 0x2ae5c0a0UL, 0xe0433c22UL, 0x171d121bUL, + 0x0d0b0e09UL, 0xc7adf28bUL, 0xa8b92db6UL, 0xa9c8141eUL, + 0x198557f1UL, 0x074caf75UL, 0xddbbee99UL, 0x60fda37fUL, + 0x269ff701UL, 0xf5bc5c72UL, 0x3bc54466UL, 0x7e345bfbUL, + 0x29768b43UL, 0xc6dccb23UL, 0xfc68b6edUL, 0xf163b8e4UL, + 0xdccad731UL, 0x85104263UL, 0x22401397UL, 0x112084c6UL, + 0x247d854aUL, 0x3df8d2bbUL, 0x3211aef9UL, 0xa16dc729UL, + 0x2f4b1d9eUL, 0x30f3dcb2UL, 0x52ec0d86UL, 0xe3d077c1UL, + 0x166c2bb3UL, 0xb999a970UL, 0x48fa1194UL, 0x642247e9UL, + 0x8cc4a8fcUL, 0x3f1aa0f0UL, 0x2cd8567dUL, 0x90ef2233UL, + 0x4ec78749UL, 0xd1c1d938UL, 0xa2fe8ccaUL, 0x0b3698d4UL, + 0x81cfa6f5UL, 0xde28a57aUL, 0x8e26dab7UL, 0xbfa43fadUL, + 0x9de42c3aUL, 0x920d5078UL, 0xcc9b6a5fUL, 0x4662547eUL, + 0x13c2f68dUL, 0xb8e890d8UL, 0xf75e2e39UL, 0xaff582c3UL, + 0x80be9f5dUL, 0x937c69d0UL, 0x2da96fd5UL, 0x12b3cf25UL, + 0x993bc8acUL, 0x7da71018UL, 0x636ee89cUL, 0xbb7bdb3bUL, + 0x7809cd26UL, 0x18f46e59UL, 0xb701ec9aUL, 0x9aa8834fUL, + 0x6e65e695UL, 0xe67eaaffUL, 0xcf0821bcUL, 0xe8e6ef15UL, + 0x9bd9bae7UL, 0x36ce4a6fUL, 0x09d4ea9fUL, 0x7cd629b0UL, + 0xb2af31a4UL, 0x23312a3fUL, 0x9430c6a5UL, 0x66c035a2UL, + 0xbc37744eUL, 0xcaa6fc82UL, 0xd0b0e090UL, 0xd81533a7UL, + 0x984af104UL, 0xdaf741ecUL, 0x500e7fcdUL, 0xf62f1791UL, + 0xd68d764dUL, 0xb04d43efUL, 0x4d54ccaaUL, 0x04dfe496UL, + 0xb5e39ed1UL, 0x881b4c6aUL, 0x1fb8c12cUL, 0x517f4665UL, + 0xea049d5eUL, 0x355d018cUL, 0x7473fa87UL, 0x412efb0bUL, + 0x1d5ab367UL, 0xd25292dbUL, 0x5633e910UL, 0x47136dd6UL, + 0x618c9ad7UL, 0x0c7a37a1UL, 0x148e59f8UL, 0x3c89eb13UL, + 0x27eecea9UL, 0xc935b761UL, 0xe5ede11cUL, 0xb13c7a47UL, + 0xdf599cd2UL, 0x733f55f2UL, 0xce791814UL, 0x37bf73c7UL, + 0xcdea53f7UL, 0xaa5b5ffdUL, 0x6f14df3dUL, 0xdb867844UL, + 0xf381caafUL, 0xc43eb968UL, 0x342c3824UL, 0x405fc2a3UL, + 0xc372161dUL, 0x250cbce2UL, 0x498b283cUL, 0x9541ff0dUL, + 0x017139a8UL, 0xb3de080cUL, 0xe49cd8b4UL, 0xc1906456UL, + 0x84617bcbUL, 0xb670d532UL, 0x5c74486cUL, 0x5742d0b8UL, +}; +static const ulong32 TD3[256] = { + 0xf4a75051UL, 0x4165537eUL, 0x17a4c31aUL, 0x275e963aUL, + 0xab6bcb3bUL, 0x9d45f11fUL, 0xfa58abacUL, 0xe303934bUL, + 0x30fa5520UL, 0x766df6adUL, 0xcc769188UL, 0x024c25f5UL, + 0xe5d7fc4fUL, 0x2acbd7c5UL, 0x35448026UL, 0x62a38fb5UL, + 0xb15a49deUL, 0xba1b6725UL, 0xea0e9845UL, 0xfec0e15dUL, + 0x2f7502c3UL, 0x4cf01281UL, 0x4697a38dUL, 0xd3f9c66bUL, + 0x8f5fe703UL, 0x929c9515UL, 0x6d7aebbfUL, 0x5259da95UL, + 0xbe832dd4UL, 0x7421d358UL, 0xe0692949UL, 0xc9c8448eUL, + 0xc2896a75UL, 0x8e7978f4UL, 0x583e6b99UL, 0xb971dd27UL, + 0xe14fb6beUL, 0x88ad17f0UL, 0x20ac66c9UL, 0xce3ab47dUL, + 0xdf4a1863UL, 0x1a3182e5UL, 0x51336097UL, 0x537f4562UL, + 0x6477e0b1UL, 0x6bae84bbUL, 0x81a01cfeUL, 0x082b94f9UL, + 0x48685870UL, 0x45fd198fUL, 0xde6c8794UL, 0x7bf8b752UL, + 0x73d323abUL, 0x4b02e272UL, 0x1f8f57e3UL, 0x55ab2a66UL, + 0xeb2807b2UL, 0xb5c2032fUL, 0xc57b9a86UL, 0x3708a5d3UL, + 0x2887f230UL, 0xbfa5b223UL, 0x036aba02UL, 0x16825cedUL, + 0xcf1c2b8aUL, 0x79b492a7UL, 0x07f2f0f3UL, 0x69e2a14eUL, + 0xdaf4cd65UL, 0x05bed506UL, 0x34621fd1UL, 0xa6fe8ac4UL, + 0x2e539d34UL, 0xf355a0a2UL, 0x8ae13205UL, 0xf6eb75a4UL, + 0x83ec390bUL, 0x60efaa40UL, 0x719f065eUL, 0x6e1051bdUL, + 0x218af93eUL, 0xdd063d96UL, 0x3e05aeddUL, 0xe6bd464dUL, + 0x548db591UL, 0xc45d0571UL, 0x06d46f04UL, 0x5015ff60UL, + 0x98fb2419UL, 0xbde997d6UL, 0x4043cc89UL, 0xd99e7767UL, + 0xe842bdb0UL, 0x898b8807UL, 0x195b38e7UL, 0xc8eedb79UL, + 0x7c0a47a1UL, 0x420fe97cUL, 0x841ec9f8UL, 0x00000000UL, + 0x80868309UL, 0x2bed4832UL, 0x1170ac1eUL, 0x5a724e6cUL, + 0x0efffbfdUL, 0x8538560fUL, 0xaed51e3dUL, 0x2d392736UL, + 0x0fd9640aUL, 0x5ca62168UL, 0x5b54d19bUL, 0x362e3a24UL, + 0x0a67b10cUL, 0x57e70f93UL, 0xee96d2b4UL, 0x9b919e1bUL, + 0xc0c54f80UL, 0xdc20a261UL, 0x774b695aUL, 0x121a161cUL, + 0x93ba0ae2UL, 0xa02ae5c0UL, 0x22e0433cUL, 0x1b171d12UL, + 0x090d0b0eUL, 0x8bc7adf2UL, 0xb6a8b92dUL, 0x1ea9c814UL, + 0xf1198557UL, 0x75074cafUL, 0x99ddbbeeUL, 0x7f60fda3UL, + 0x01269ff7UL, 0x72f5bc5cUL, 0x663bc544UL, 0xfb7e345bUL, + 0x4329768bUL, 0x23c6dccbUL, 0xedfc68b6UL, 0xe4f163b8UL, + 0x31dccad7UL, 0x63851042UL, 0x97224013UL, 0xc6112084UL, + 0x4a247d85UL, 0xbb3df8d2UL, 0xf93211aeUL, 0x29a16dc7UL, + 0x9e2f4b1dUL, 0xb230f3dcUL, 0x8652ec0dUL, 0xc1e3d077UL, + 0xb3166c2bUL, 0x70b999a9UL, 0x9448fa11UL, 0xe9642247UL, + 0xfc8cc4a8UL, 0xf03f1aa0UL, 0x7d2cd856UL, 0x3390ef22UL, + 0x494ec787UL, 0x38d1c1d9UL, 0xcaa2fe8cUL, 0xd40b3698UL, + 0xf581cfa6UL, 0x7ade28a5UL, 0xb78e26daUL, 0xadbfa43fUL, + 0x3a9de42cUL, 0x78920d50UL, 0x5fcc9b6aUL, 0x7e466254UL, + 0x8d13c2f6UL, 0xd8b8e890UL, 0x39f75e2eUL, 0xc3aff582UL, + 0x5d80be9fUL, 0xd0937c69UL, 0xd52da96fUL, 0x2512b3cfUL, + 0xac993bc8UL, 0x187da710UL, 0x9c636ee8UL, 0x3bbb7bdbUL, + 0x267809cdUL, 0x5918f46eUL, 0x9ab701ecUL, 0x4f9aa883UL, + 0x956e65e6UL, 0xffe67eaaUL, 0xbccf0821UL, 0x15e8e6efUL, + 0xe79bd9baUL, 0x6f36ce4aUL, 0x9f09d4eaUL, 0xb07cd629UL, + 0xa4b2af31UL, 0x3f23312aUL, 0xa59430c6UL, 0xa266c035UL, + 0x4ebc3774UL, 0x82caa6fcUL, 0x90d0b0e0UL, 0xa7d81533UL, + 0x04984af1UL, 0xecdaf741UL, 0xcd500e7fUL, 0x91f62f17UL, + 0x4dd68d76UL, 0xefb04d43UL, 0xaa4d54ccUL, 0x9604dfe4UL, + 0xd1b5e39eUL, 0x6a881b4cUL, 0x2c1fb8c1UL, 0x65517f46UL, + 0x5eea049dUL, 0x8c355d01UL, 0x877473faUL, 0x0b412efbUL, + 0x671d5ab3UL, 0xdbd25292UL, 0x105633e9UL, 0xd647136dUL, + 0xd7618c9aUL, 0xa10c7a37UL, 0xf8148e59UL, 0x133c89ebUL, + 0xa927eeceUL, 0x61c935b7UL, 0x1ce5ede1UL, 0x47b13c7aUL, + 0xd2df599cUL, 0xf2733f55UL, 0x14ce7918UL, 0xc737bf73UL, + 0xf7cdea53UL, 0xfdaa5b5fUL, 0x3d6f14dfUL, 0x44db8678UL, + 0xaff381caUL, 0x68c43eb9UL, 0x24342c38UL, 0xa3405fc2UL, + 0x1dc37216UL, 0xe2250cbcUL, 0x3c498b28UL, 0x0d9541ffUL, + 0xa8017139UL, 0x0cb3de08UL, 0xb4e49cd8UL, 0x56c19064UL, + 0xcb84617bUL, 0x32b670d5UL, 0x6c5c7448UL, 0xb85742d0UL, +}; + +static const ulong32 Tks0[] = { +0x00000000UL, 0x0e090d0bUL, 0x1c121a16UL, 0x121b171dUL, 0x3824342cUL, 0x362d3927UL, 0x24362e3aUL, 0x2a3f2331UL, +0x70486858UL, 0x7e416553UL, 0x6c5a724eUL, 0x62537f45UL, 0x486c5c74UL, 0x4665517fUL, 0x547e4662UL, 0x5a774b69UL, +0xe090d0b0UL, 0xee99ddbbUL, 0xfc82caa6UL, 0xf28bc7adUL, 0xd8b4e49cUL, 0xd6bde997UL, 0xc4a6fe8aUL, 0xcaaff381UL, +0x90d8b8e8UL, 0x9ed1b5e3UL, 0x8ccaa2feUL, 0x82c3aff5UL, 0xa8fc8cc4UL, 0xa6f581cfUL, 0xb4ee96d2UL, 0xbae79bd9UL, +0xdb3bbb7bUL, 0xd532b670UL, 0xc729a16dUL, 0xc920ac66UL, 0xe31f8f57UL, 0xed16825cUL, 0xff0d9541UL, 0xf104984aUL, +0xab73d323UL, 0xa57ade28UL, 0xb761c935UL, 0xb968c43eUL, 0x9357e70fUL, 0x9d5eea04UL, 0x8f45fd19UL, 0x814cf012UL, +0x3bab6bcbUL, 0x35a266c0UL, 0x27b971ddUL, 0x29b07cd6UL, 0x038f5fe7UL, 0x0d8652ecUL, 0x1f9d45f1UL, 0x119448faUL, +0x4be30393UL, 0x45ea0e98UL, 0x57f11985UL, 0x59f8148eUL, 0x73c737bfUL, 0x7dce3ab4UL, 0x6fd52da9UL, 0x61dc20a2UL, +0xad766df6UL, 0xa37f60fdUL, 0xb16477e0UL, 0xbf6d7aebUL, 0x955259daUL, 0x9b5b54d1UL, 0x894043ccUL, 0x87494ec7UL, +0xdd3e05aeUL, 0xd33708a5UL, 0xc12c1fb8UL, 0xcf2512b3UL, 0xe51a3182UL, 0xeb133c89UL, 0xf9082b94UL, 0xf701269fUL, +0x4de6bd46UL, 0x43efb04dUL, 0x51f4a750UL, 0x5ffdaa5bUL, 0x75c2896aUL, 0x7bcb8461UL, 0x69d0937cUL, 0x67d99e77UL, +0x3daed51eUL, 0x33a7d815UL, 0x21bccf08UL, 0x2fb5c203UL, 0x058ae132UL, 0x0b83ec39UL, 0x1998fb24UL, 0x1791f62fUL, +0x764dd68dUL, 0x7844db86UL, 0x6a5fcc9bUL, 0x6456c190UL, 0x4e69e2a1UL, 0x4060efaaUL, 0x527bf8b7UL, 0x5c72f5bcUL, +0x0605bed5UL, 0x080cb3deUL, 0x1a17a4c3UL, 0x141ea9c8UL, 0x3e218af9UL, 0x302887f2UL, 0x223390efUL, 0x2c3a9de4UL, +0x96dd063dUL, 0x98d40b36UL, 0x8acf1c2bUL, 0x84c61120UL, 0xaef93211UL, 0xa0f03f1aUL, 0xb2eb2807UL, 0xbce2250cUL, +0xe6956e65UL, 0xe89c636eUL, 0xfa877473UL, 0xf48e7978UL, 0xdeb15a49UL, 0xd0b85742UL, 0xc2a3405fUL, 0xccaa4d54UL, +0x41ecdaf7UL, 0x4fe5d7fcUL, 0x5dfec0e1UL, 0x53f7cdeaUL, 0x79c8eedbUL, 0x77c1e3d0UL, 0x65daf4cdUL, 0x6bd3f9c6UL, +0x31a4b2afUL, 0x3fadbfa4UL, 0x2db6a8b9UL, 0x23bfa5b2UL, 0x09808683UL, 0x07898b88UL, 0x15929c95UL, 0x1b9b919eUL, +0xa17c0a47UL, 0xaf75074cUL, 0xbd6e1051UL, 0xb3671d5aUL, 0x99583e6bUL, 0x97513360UL, 0x854a247dUL, 0x8b432976UL, +0xd134621fUL, 0xdf3d6f14UL, 0xcd267809UL, 0xc32f7502UL, 0xe9105633UL, 0xe7195b38UL, 0xf5024c25UL, 0xfb0b412eUL, +0x9ad7618cUL, 0x94de6c87UL, 0x86c57b9aUL, 0x88cc7691UL, 0xa2f355a0UL, 0xacfa58abUL, 0xbee14fb6UL, 0xb0e842bdUL, +0xea9f09d4UL, 0xe49604dfUL, 0xf68d13c2UL, 0xf8841ec9UL, 0xd2bb3df8UL, 0xdcb230f3UL, 0xcea927eeUL, 0xc0a02ae5UL, +0x7a47b13cUL, 0x744ebc37UL, 0x6655ab2aUL, 0x685ca621UL, 0x42638510UL, 0x4c6a881bUL, 0x5e719f06UL, 0x5078920dUL, +0x0a0fd964UL, 0x0406d46fUL, 0x161dc372UL, 0x1814ce79UL, 0x322bed48UL, 0x3c22e043UL, 0x2e39f75eUL, 0x2030fa55UL, +0xec9ab701UL, 0xe293ba0aUL, 0xf088ad17UL, 0xfe81a01cUL, 0xd4be832dUL, 0xdab78e26UL, 0xc8ac993bUL, 0xc6a59430UL, +0x9cd2df59UL, 0x92dbd252UL, 0x80c0c54fUL, 0x8ec9c844UL, 0xa4f6eb75UL, 0xaaffe67eUL, 0xb8e4f163UL, 0xb6edfc68UL, +0x0c0a67b1UL, 0x02036abaUL, 0x10187da7UL, 0x1e1170acUL, 0x342e539dUL, 0x3a275e96UL, 0x283c498bUL, 0x26354480UL, +0x7c420fe9UL, 0x724b02e2UL, 0x605015ffUL, 0x6e5918f4UL, 0x44663bc5UL, 0x4a6f36ceUL, 0x587421d3UL, 0x567d2cd8UL, +0x37a10c7aUL, 0x39a80171UL, 0x2bb3166cUL, 0x25ba1b67UL, 0x0f853856UL, 0x018c355dUL, 0x13972240UL, 0x1d9e2f4bUL, +0x47e96422UL, 0x49e06929UL, 0x5bfb7e34UL, 0x55f2733fUL, 0x7fcd500eUL, 0x71c45d05UL, 0x63df4a18UL, 0x6dd64713UL, +0xd731dccaUL, 0xd938d1c1UL, 0xcb23c6dcUL, 0xc52acbd7UL, 0xef15e8e6UL, 0xe11ce5edUL, 0xf307f2f0UL, 0xfd0efffbUL, +0xa779b492UL, 0xa970b999UL, 0xbb6bae84UL, 0xb562a38fUL, 0x9f5d80beUL, 0x91548db5UL, 0x834f9aa8UL, 0x8d4697a3UL +}; + +static const ulong32 Tks1[] = { +0x00000000UL, 0x0b0e090dUL, 0x161c121aUL, 0x1d121b17UL, 0x2c382434UL, 0x27362d39UL, 0x3a24362eUL, 0x312a3f23UL, +0x58704868UL, 0x537e4165UL, 0x4e6c5a72UL, 0x4562537fUL, 0x74486c5cUL, 0x7f466551UL, 0x62547e46UL, 0x695a774bUL, +0xb0e090d0UL, 0xbbee99ddUL, 0xa6fc82caUL, 0xadf28bc7UL, 0x9cd8b4e4UL, 0x97d6bde9UL, 0x8ac4a6feUL, 0x81caaff3UL, +0xe890d8b8UL, 0xe39ed1b5UL, 0xfe8ccaa2UL, 0xf582c3afUL, 0xc4a8fc8cUL, 0xcfa6f581UL, 0xd2b4ee96UL, 0xd9bae79bUL, +0x7bdb3bbbUL, 0x70d532b6UL, 0x6dc729a1UL, 0x66c920acUL, 0x57e31f8fUL, 0x5ced1682UL, 0x41ff0d95UL, 0x4af10498UL, +0x23ab73d3UL, 0x28a57adeUL, 0x35b761c9UL, 0x3eb968c4UL, 0x0f9357e7UL, 0x049d5eeaUL, 0x198f45fdUL, 0x12814cf0UL, +0xcb3bab6bUL, 0xc035a266UL, 0xdd27b971UL, 0xd629b07cUL, 0xe7038f5fUL, 0xec0d8652UL, 0xf11f9d45UL, 0xfa119448UL, +0x934be303UL, 0x9845ea0eUL, 0x8557f119UL, 0x8e59f814UL, 0xbf73c737UL, 0xb47dce3aUL, 0xa96fd52dUL, 0xa261dc20UL, +0xf6ad766dUL, 0xfda37f60UL, 0xe0b16477UL, 0xebbf6d7aUL, 0xda955259UL, 0xd19b5b54UL, 0xcc894043UL, 0xc787494eUL, +0xaedd3e05UL, 0xa5d33708UL, 0xb8c12c1fUL, 0xb3cf2512UL, 0x82e51a31UL, 0x89eb133cUL, 0x94f9082bUL, 0x9ff70126UL, +0x464de6bdUL, 0x4d43efb0UL, 0x5051f4a7UL, 0x5b5ffdaaUL, 0x6a75c289UL, 0x617bcb84UL, 0x7c69d093UL, 0x7767d99eUL, +0x1e3daed5UL, 0x1533a7d8UL, 0x0821bccfUL, 0x032fb5c2UL, 0x32058ae1UL, 0x390b83ecUL, 0x241998fbUL, 0x2f1791f6UL, +0x8d764dd6UL, 0x867844dbUL, 0x9b6a5fccUL, 0x906456c1UL, 0xa14e69e2UL, 0xaa4060efUL, 0xb7527bf8UL, 0xbc5c72f5UL, +0xd50605beUL, 0xde080cb3UL, 0xc31a17a4UL, 0xc8141ea9UL, 0xf93e218aUL, 0xf2302887UL, 0xef223390UL, 0xe42c3a9dUL, +0x3d96dd06UL, 0x3698d40bUL, 0x2b8acf1cUL, 0x2084c611UL, 0x11aef932UL, 0x1aa0f03fUL, 0x07b2eb28UL, 0x0cbce225UL, +0x65e6956eUL, 0x6ee89c63UL, 0x73fa8774UL, 0x78f48e79UL, 0x49deb15aUL, 0x42d0b857UL, 0x5fc2a340UL, 0x54ccaa4dUL, +0xf741ecdaUL, 0xfc4fe5d7UL, 0xe15dfec0UL, 0xea53f7cdUL, 0xdb79c8eeUL, 0xd077c1e3UL, 0xcd65daf4UL, 0xc66bd3f9UL, +0xaf31a4b2UL, 0xa43fadbfUL, 0xb92db6a8UL, 0xb223bfa5UL, 0x83098086UL, 0x8807898bUL, 0x9515929cUL, 0x9e1b9b91UL, +0x47a17c0aUL, 0x4caf7507UL, 0x51bd6e10UL, 0x5ab3671dUL, 0x6b99583eUL, 0x60975133UL, 0x7d854a24UL, 0x768b4329UL, +0x1fd13462UL, 0x14df3d6fUL, 0x09cd2678UL, 0x02c32f75UL, 0x33e91056UL, 0x38e7195bUL, 0x25f5024cUL, 0x2efb0b41UL, +0x8c9ad761UL, 0x8794de6cUL, 0x9a86c57bUL, 0x9188cc76UL, 0xa0a2f355UL, 0xabacfa58UL, 0xb6bee14fUL, 0xbdb0e842UL, +0xd4ea9f09UL, 0xdfe49604UL, 0xc2f68d13UL, 0xc9f8841eUL, 0xf8d2bb3dUL, 0xf3dcb230UL, 0xeecea927UL, 0xe5c0a02aUL, +0x3c7a47b1UL, 0x37744ebcUL, 0x2a6655abUL, 0x21685ca6UL, 0x10426385UL, 0x1b4c6a88UL, 0x065e719fUL, 0x0d507892UL, +0x640a0fd9UL, 0x6f0406d4UL, 0x72161dc3UL, 0x791814ceUL, 0x48322bedUL, 0x433c22e0UL, 0x5e2e39f7UL, 0x552030faUL, +0x01ec9ab7UL, 0x0ae293baUL, 0x17f088adUL, 0x1cfe81a0UL, 0x2dd4be83UL, 0x26dab78eUL, 0x3bc8ac99UL, 0x30c6a594UL, +0x599cd2dfUL, 0x5292dbd2UL, 0x4f80c0c5UL, 0x448ec9c8UL, 0x75a4f6ebUL, 0x7eaaffe6UL, 0x63b8e4f1UL, 0x68b6edfcUL, +0xb10c0a67UL, 0xba02036aUL, 0xa710187dUL, 0xac1e1170UL, 0x9d342e53UL, 0x963a275eUL, 0x8b283c49UL, 0x80263544UL, +0xe97c420fUL, 0xe2724b02UL, 0xff605015UL, 0xf46e5918UL, 0xc544663bUL, 0xce4a6f36UL, 0xd3587421UL, 0xd8567d2cUL, +0x7a37a10cUL, 0x7139a801UL, 0x6c2bb316UL, 0x6725ba1bUL, 0x560f8538UL, 0x5d018c35UL, 0x40139722UL, 0x4b1d9e2fUL, +0x2247e964UL, 0x2949e069UL, 0x345bfb7eUL, 0x3f55f273UL, 0x0e7fcd50UL, 0x0571c45dUL, 0x1863df4aUL, 0x136dd647UL, +0xcad731dcUL, 0xc1d938d1UL, 0xdccb23c6UL, 0xd7c52acbUL, 0xe6ef15e8UL, 0xede11ce5UL, 0xf0f307f2UL, 0xfbfd0effUL, +0x92a779b4UL, 0x99a970b9UL, 0x84bb6baeUL, 0x8fb562a3UL, 0xbe9f5d80UL, 0xb591548dUL, 0xa8834f9aUL, 0xa38d4697UL +}; + +static const ulong32 Tks2[] = { +0x00000000UL, 0x0d0b0e09UL, 0x1a161c12UL, 0x171d121bUL, 0x342c3824UL, 0x3927362dUL, 0x2e3a2436UL, 0x23312a3fUL, +0x68587048UL, 0x65537e41UL, 0x724e6c5aUL, 0x7f456253UL, 0x5c74486cUL, 0x517f4665UL, 0x4662547eUL, 0x4b695a77UL, +0xd0b0e090UL, 0xddbbee99UL, 0xcaa6fc82UL, 0xc7adf28bUL, 0xe49cd8b4UL, 0xe997d6bdUL, 0xfe8ac4a6UL, 0xf381caafUL, +0xb8e890d8UL, 0xb5e39ed1UL, 0xa2fe8ccaUL, 0xaff582c3UL, 0x8cc4a8fcUL, 0x81cfa6f5UL, 0x96d2b4eeUL, 0x9bd9bae7UL, +0xbb7bdb3bUL, 0xb670d532UL, 0xa16dc729UL, 0xac66c920UL, 0x8f57e31fUL, 0x825ced16UL, 0x9541ff0dUL, 0x984af104UL, +0xd323ab73UL, 0xde28a57aUL, 0xc935b761UL, 0xc43eb968UL, 0xe70f9357UL, 0xea049d5eUL, 0xfd198f45UL, 0xf012814cUL, +0x6bcb3babUL, 0x66c035a2UL, 0x71dd27b9UL, 0x7cd629b0UL, 0x5fe7038fUL, 0x52ec0d86UL, 0x45f11f9dUL, 0x48fa1194UL, +0x03934be3UL, 0x0e9845eaUL, 0x198557f1UL, 0x148e59f8UL, 0x37bf73c7UL, 0x3ab47dceUL, 0x2da96fd5UL, 0x20a261dcUL, +0x6df6ad76UL, 0x60fda37fUL, 0x77e0b164UL, 0x7aebbf6dUL, 0x59da9552UL, 0x54d19b5bUL, 0x43cc8940UL, 0x4ec78749UL, +0x05aedd3eUL, 0x08a5d337UL, 0x1fb8c12cUL, 0x12b3cf25UL, 0x3182e51aUL, 0x3c89eb13UL, 0x2b94f908UL, 0x269ff701UL, +0xbd464de6UL, 0xb04d43efUL, 0xa75051f4UL, 0xaa5b5ffdUL, 0x896a75c2UL, 0x84617bcbUL, 0x937c69d0UL, 0x9e7767d9UL, +0xd51e3daeUL, 0xd81533a7UL, 0xcf0821bcUL, 0xc2032fb5UL, 0xe132058aUL, 0xec390b83UL, 0xfb241998UL, 0xf62f1791UL, +0xd68d764dUL, 0xdb867844UL, 0xcc9b6a5fUL, 0xc1906456UL, 0xe2a14e69UL, 0xefaa4060UL, 0xf8b7527bUL, 0xf5bc5c72UL, +0xbed50605UL, 0xb3de080cUL, 0xa4c31a17UL, 0xa9c8141eUL, 0x8af93e21UL, 0x87f23028UL, 0x90ef2233UL, 0x9de42c3aUL, +0x063d96ddUL, 0x0b3698d4UL, 0x1c2b8acfUL, 0x112084c6UL, 0x3211aef9UL, 0x3f1aa0f0UL, 0x2807b2ebUL, 0x250cbce2UL, +0x6e65e695UL, 0x636ee89cUL, 0x7473fa87UL, 0x7978f48eUL, 0x5a49deb1UL, 0x5742d0b8UL, 0x405fc2a3UL, 0x4d54ccaaUL, +0xdaf741ecUL, 0xd7fc4fe5UL, 0xc0e15dfeUL, 0xcdea53f7UL, 0xeedb79c8UL, 0xe3d077c1UL, 0xf4cd65daUL, 0xf9c66bd3UL, +0xb2af31a4UL, 0xbfa43fadUL, 0xa8b92db6UL, 0xa5b223bfUL, 0x86830980UL, 0x8b880789UL, 0x9c951592UL, 0x919e1b9bUL, +0x0a47a17cUL, 0x074caf75UL, 0x1051bd6eUL, 0x1d5ab367UL, 0x3e6b9958UL, 0x33609751UL, 0x247d854aUL, 0x29768b43UL, +0x621fd134UL, 0x6f14df3dUL, 0x7809cd26UL, 0x7502c32fUL, 0x5633e910UL, 0x5b38e719UL, 0x4c25f502UL, 0x412efb0bUL, +0x618c9ad7UL, 0x6c8794deUL, 0x7b9a86c5UL, 0x769188ccUL, 0x55a0a2f3UL, 0x58abacfaUL, 0x4fb6bee1UL, 0x42bdb0e8UL, +0x09d4ea9fUL, 0x04dfe496UL, 0x13c2f68dUL, 0x1ec9f884UL, 0x3df8d2bbUL, 0x30f3dcb2UL, 0x27eecea9UL, 0x2ae5c0a0UL, +0xb13c7a47UL, 0xbc37744eUL, 0xab2a6655UL, 0xa621685cUL, 0x85104263UL, 0x881b4c6aUL, 0x9f065e71UL, 0x920d5078UL, +0xd9640a0fUL, 0xd46f0406UL, 0xc372161dUL, 0xce791814UL, 0xed48322bUL, 0xe0433c22UL, 0xf75e2e39UL, 0xfa552030UL, +0xb701ec9aUL, 0xba0ae293UL, 0xad17f088UL, 0xa01cfe81UL, 0x832dd4beUL, 0x8e26dab7UL, 0x993bc8acUL, 0x9430c6a5UL, +0xdf599cd2UL, 0xd25292dbUL, 0xc54f80c0UL, 0xc8448ec9UL, 0xeb75a4f6UL, 0xe67eaaffUL, 0xf163b8e4UL, 0xfc68b6edUL, +0x67b10c0aUL, 0x6aba0203UL, 0x7da71018UL, 0x70ac1e11UL, 0x539d342eUL, 0x5e963a27UL, 0x498b283cUL, 0x44802635UL, +0x0fe97c42UL, 0x02e2724bUL, 0x15ff6050UL, 0x18f46e59UL, 0x3bc54466UL, 0x36ce4a6fUL, 0x21d35874UL, 0x2cd8567dUL, +0x0c7a37a1UL, 0x017139a8UL, 0x166c2bb3UL, 0x1b6725baUL, 0x38560f85UL, 0x355d018cUL, 0x22401397UL, 0x2f4b1d9eUL, +0x642247e9UL, 0x692949e0UL, 0x7e345bfbUL, 0x733f55f2UL, 0x500e7fcdUL, 0x5d0571c4UL, 0x4a1863dfUL, 0x47136dd6UL, +0xdccad731UL, 0xd1c1d938UL, 0xc6dccb23UL, 0xcbd7c52aUL, 0xe8e6ef15UL, 0xe5ede11cUL, 0xf2f0f307UL, 0xfffbfd0eUL, +0xb492a779UL, 0xb999a970UL, 0xae84bb6bUL, 0xa38fb562UL, 0x80be9f5dUL, 0x8db59154UL, 0x9aa8834fUL, 0x97a38d46UL +}; + +static const ulong32 Tks3[] = { +0x00000000UL, 0x090d0b0eUL, 0x121a161cUL, 0x1b171d12UL, 0x24342c38UL, 0x2d392736UL, 0x362e3a24UL, 0x3f23312aUL, +0x48685870UL, 0x4165537eUL, 0x5a724e6cUL, 0x537f4562UL, 0x6c5c7448UL, 0x65517f46UL, 0x7e466254UL, 0x774b695aUL, +0x90d0b0e0UL, 0x99ddbbeeUL, 0x82caa6fcUL, 0x8bc7adf2UL, 0xb4e49cd8UL, 0xbde997d6UL, 0xa6fe8ac4UL, 0xaff381caUL, +0xd8b8e890UL, 0xd1b5e39eUL, 0xcaa2fe8cUL, 0xc3aff582UL, 0xfc8cc4a8UL, 0xf581cfa6UL, 0xee96d2b4UL, 0xe79bd9baUL, +0x3bbb7bdbUL, 0x32b670d5UL, 0x29a16dc7UL, 0x20ac66c9UL, 0x1f8f57e3UL, 0x16825cedUL, 0x0d9541ffUL, 0x04984af1UL, +0x73d323abUL, 0x7ade28a5UL, 0x61c935b7UL, 0x68c43eb9UL, 0x57e70f93UL, 0x5eea049dUL, 0x45fd198fUL, 0x4cf01281UL, +0xab6bcb3bUL, 0xa266c035UL, 0xb971dd27UL, 0xb07cd629UL, 0x8f5fe703UL, 0x8652ec0dUL, 0x9d45f11fUL, 0x9448fa11UL, +0xe303934bUL, 0xea0e9845UL, 0xf1198557UL, 0xf8148e59UL, 0xc737bf73UL, 0xce3ab47dUL, 0xd52da96fUL, 0xdc20a261UL, +0x766df6adUL, 0x7f60fda3UL, 0x6477e0b1UL, 0x6d7aebbfUL, 0x5259da95UL, 0x5b54d19bUL, 0x4043cc89UL, 0x494ec787UL, +0x3e05aeddUL, 0x3708a5d3UL, 0x2c1fb8c1UL, 0x2512b3cfUL, 0x1a3182e5UL, 0x133c89ebUL, 0x082b94f9UL, 0x01269ff7UL, +0xe6bd464dUL, 0xefb04d43UL, 0xf4a75051UL, 0xfdaa5b5fUL, 0xc2896a75UL, 0xcb84617bUL, 0xd0937c69UL, 0xd99e7767UL, +0xaed51e3dUL, 0xa7d81533UL, 0xbccf0821UL, 0xb5c2032fUL, 0x8ae13205UL, 0x83ec390bUL, 0x98fb2419UL, 0x91f62f17UL, +0x4dd68d76UL, 0x44db8678UL, 0x5fcc9b6aUL, 0x56c19064UL, 0x69e2a14eUL, 0x60efaa40UL, 0x7bf8b752UL, 0x72f5bc5cUL, +0x05bed506UL, 0x0cb3de08UL, 0x17a4c31aUL, 0x1ea9c814UL, 0x218af93eUL, 0x2887f230UL, 0x3390ef22UL, 0x3a9de42cUL, +0xdd063d96UL, 0xd40b3698UL, 0xcf1c2b8aUL, 0xc6112084UL, 0xf93211aeUL, 0xf03f1aa0UL, 0xeb2807b2UL, 0xe2250cbcUL, +0x956e65e6UL, 0x9c636ee8UL, 0x877473faUL, 0x8e7978f4UL, 0xb15a49deUL, 0xb85742d0UL, 0xa3405fc2UL, 0xaa4d54ccUL, +0xecdaf741UL, 0xe5d7fc4fUL, 0xfec0e15dUL, 0xf7cdea53UL, 0xc8eedb79UL, 0xc1e3d077UL, 0xdaf4cd65UL, 0xd3f9c66bUL, +0xa4b2af31UL, 0xadbfa43fUL, 0xb6a8b92dUL, 0xbfa5b223UL, 0x80868309UL, 0x898b8807UL, 0x929c9515UL, 0x9b919e1bUL, +0x7c0a47a1UL, 0x75074cafUL, 0x6e1051bdUL, 0x671d5ab3UL, 0x583e6b99UL, 0x51336097UL, 0x4a247d85UL, 0x4329768bUL, +0x34621fd1UL, 0x3d6f14dfUL, 0x267809cdUL, 0x2f7502c3UL, 0x105633e9UL, 0x195b38e7UL, 0x024c25f5UL, 0x0b412efbUL, +0xd7618c9aUL, 0xde6c8794UL, 0xc57b9a86UL, 0xcc769188UL, 0xf355a0a2UL, 0xfa58abacUL, 0xe14fb6beUL, 0xe842bdb0UL, +0x9f09d4eaUL, 0x9604dfe4UL, 0x8d13c2f6UL, 0x841ec9f8UL, 0xbb3df8d2UL, 0xb230f3dcUL, 0xa927eeceUL, 0xa02ae5c0UL, +0x47b13c7aUL, 0x4ebc3774UL, 0x55ab2a66UL, 0x5ca62168UL, 0x63851042UL, 0x6a881b4cUL, 0x719f065eUL, 0x78920d50UL, +0x0fd9640aUL, 0x06d46f04UL, 0x1dc37216UL, 0x14ce7918UL, 0x2bed4832UL, 0x22e0433cUL, 0x39f75e2eUL, 0x30fa5520UL, +0x9ab701ecUL, 0x93ba0ae2UL, 0x88ad17f0UL, 0x81a01cfeUL, 0xbe832dd4UL, 0xb78e26daUL, 0xac993bc8UL, 0xa59430c6UL, +0xd2df599cUL, 0xdbd25292UL, 0xc0c54f80UL, 0xc9c8448eUL, 0xf6eb75a4UL, 0xffe67eaaUL, 0xe4f163b8UL, 0xedfc68b6UL, +0x0a67b10cUL, 0x036aba02UL, 0x187da710UL, 0x1170ac1eUL, 0x2e539d34UL, 0x275e963aUL, 0x3c498b28UL, 0x35448026UL, +0x420fe97cUL, 0x4b02e272UL, 0x5015ff60UL, 0x5918f46eUL, 0x663bc544UL, 0x6f36ce4aUL, 0x7421d358UL, 0x7d2cd856UL, +0xa10c7a37UL, 0xa8017139UL, 0xb3166c2bUL, 0xba1b6725UL, 0x8538560fUL, 0x8c355d01UL, 0x97224013UL, 0x9e2f4b1dUL, +0xe9642247UL, 0xe0692949UL, 0xfb7e345bUL, 0xf2733f55UL, 0xcd500e7fUL, 0xc45d0571UL, 0xdf4a1863UL, 0xd647136dUL, +0x31dccad7UL, 0x38d1c1d9UL, 0x23c6dccbUL, 0x2acbd7c5UL, 0x15e8e6efUL, 0x1ce5ede1UL, 0x07f2f0f3UL, 0x0efffbfdUL, +0x79b492a7UL, 0x70b999a9UL, 0x6bae84bbUL, 0x62a38fb5UL, 0x5d80be9fUL, 0x548db591UL, 0x4f9aa883UL, 0x4697a38dUL +}; + +#endif /* ENCRYPT_ONLY */ + +#endif /* SMALL CODE */ + +static const ulong32 rcon[] = { + 0x01000000UL, 0x02000000UL, 0x04000000UL, 0x08000000UL, + 0x10000000UL, 0x20000000UL, 0x40000000UL, 0x80000000UL, + 0x1B000000UL, 0x36000000UL, /* for 128-bit blocks, Rijndael never uses more than 10 rcon values */ +}; + +/* $Source: /cvs/libtom/libtomcrypt/src/ciphers/aes/aes_tab.c,v $ */ +/* $Revision: 1.5 $ */ +/* $Date: 2006/04/02 13:19:09 $ */ diff --git a/libtomcrypt/src/ciphers/anubis.c b/libtomcrypt/src/ciphers/anubis.c new file mode 100644 index 0000000..9a0722c --- /dev/null +++ b/libtomcrypt/src/ciphers/anubis.c @@ -0,0 +1,1558 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ + +/** + @file anubis.c + Anubis implementation derived from public domain source + Authors: Paulo S.L.M. Barreto and Vincent Rijmen. +*/ + +#include "tomcrypt.h" + +#ifdef ANUBIS + +const struct ltc_cipher_descriptor anubis_desc = { + "anubis", + 19, + 16, 40, 16, 12, + &anubis_setup, + &anubis_ecb_encrypt, + &anubis_ecb_decrypt, + &anubis_test, + &anubis_done, + &anubis_keysize, + NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL +}; + +#define MIN_N 4 +#define MAX_N 10 +#define MIN_ROUNDS (8 + MIN_N) +#define MAX_ROUNDS (8 + MAX_N) +#define MIN_KEYSIZEB (4*MIN_N) +#define MAX_KEYSIZEB (4*MAX_N) +#define BLOCKSIZE 128 +#define BLOCKSIZEB (BLOCKSIZE/8) + + +/* + * Though Anubis is endianness-neutral, the encryption tables are listed + * in BIG-ENDIAN format, which is adopted throughout this implementation + * (but little-endian notation would be equally suitable if consistently + * employed). + */ +#if defined(ANUBIS_TWEAK) + +static const ulong32 T0[256] = { + 0xba69d2bbU, 0x54a84de5U, 0x2f5ebce2U, 0x74e8cd25U, + 0x53a651f7U, 0xd3bb6bd0U, 0xd2b96fd6U, 0x4d9a29b3U, + 0x50a05dfdU, 0xac458acfU, 0x8d070e09U, 0xbf63c6a5U, + 0x70e0dd3dU, 0x52a455f1U, 0x9a29527bU, 0x4c982db5U, + 0xeac98f46U, 0xd5b773c4U, 0x97336655U, 0xd1bf63dcU, + 0x3366ccaaU, 0x51a259fbU, 0x5bb671c7U, 0xa651a2f3U, + 0xdea15ffeU, 0x48903dadU, 0xa84d9ad7U, 0x992f5e71U, + 0xdbab4be0U, 0x3264c8acU, 0xb773e695U, 0xfce5d732U, + 0xe3dbab70U, 0x9e214263U, 0x913f7e41U, 0x9b2b567dU, + 0xe2d9af76U, 0xbb6bd6bdU, 0x4182199bU, 0x6edca579U, + 0xa557aef9U, 0xcb8b0b80U, 0x6bd6b167U, 0x95376e59U, + 0xa15fbee1U, 0xf3fbeb10U, 0xb17ffe81U, 0x0204080cU, + 0xcc851792U, 0xc49537a2U, 0x1d3a744eU, 0x14285078U, + 0xc39b2bb0U, 0x63c69157U, 0xdaa94fe6U, 0x5dba69d3U, + 0x5fbe61dfU, 0xdca557f2U, 0x7dfae913U, 0xcd871394U, + 0x7ffee11fU, 0x5ab475c1U, 0x6cd8ad75U, 0x5cb86dd5U, + 0xf7f3fb08U, 0x264c98d4U, 0xffe3db38U, 0xedc79354U, + 0xe8cd874aU, 0x9d274e69U, 0x6fdea17fU, 0x8e010203U, + 0x19326456U, 0xa05dbae7U, 0xf0fde71aU, 0x890f1e11U, + 0x0f1e3c22U, 0x070e1c12U, 0xaf4386c5U, 0xfbebcb20U, + 0x08102030U, 0x152a547eU, 0x0d1a342eU, 0x04081018U, + 0x01020406U, 0x64c88d45U, 0xdfa35bf8U, 0x76ecc529U, + 0x79f2f90bU, 0xdda753f4U, 0x3d7af48eU, 0x162c5874U, + 0x3f7efc82U, 0x376edcb2U, 0x6ddaa973U, 0x3870e090U, + 0xb96fdeb1U, 0x73e6d137U, 0xe9cf834cU, 0x356ad4beU, + 0x55aa49e3U, 0x71e2d93bU, 0x7bf6f107U, 0x8c050a0fU, + 0x72e4d531U, 0x880d1a17U, 0xf6f1ff0eU, 0x2a54a8fcU, + 0x3e7cf884U, 0x5ebc65d9U, 0x274e9cd2U, 0x468c0589U, + 0x0c183028U, 0x65ca8943U, 0x68d0bd6dU, 0x61c2995bU, + 0x03060c0aU, 0xc19f23bcU, 0x57ae41efU, 0xd6b17fceU, + 0xd9af43ecU, 0x58b07dcdU, 0xd8ad47eaU, 0x66cc8549U, + 0xd7b37bc8U, 0x3a74e89cU, 0xc88d078aU, 0x3c78f088U, + 0xfae9cf26U, 0x96316253U, 0xa753a6f5U, 0x982d5a77U, + 0xecc59752U, 0xb86ddab7U, 0xc7933ba8U, 0xae4182c3U, + 0x69d2b96bU, 0x4b9631a7U, 0xab4b96ddU, 0xa94f9ed1U, + 0x67ce814fU, 0x0a14283cU, 0x478e018fU, 0xf2f9ef16U, + 0xb577ee99U, 0x224488ccU, 0xe5d7b364U, 0xeec19f5eU, + 0xbe61c2a3U, 0x2b56acfaU, 0x811f3e21U, 0x1224486cU, + 0x831b362dU, 0x1b366c5aU, 0x0e1c3824U, 0x23468ccaU, + 0xf5f7f304U, 0x458a0983U, 0x214284c6U, 0xce811f9eU, + 0x499239abU, 0x2c58b0e8U, 0xf9efc32cU, 0xe6d1bf6eU, + 0xb671e293U, 0x2850a0f0U, 0x172e5c72U, 0x8219322bU, + 0x1a34685cU, 0x8b0b161dU, 0xfee1df3eU, 0x8a09121bU, + 0x09122436U, 0xc98f038cU, 0x87132635U, 0x4e9c25b9U, + 0xe1dfa37cU, 0x2e5cb8e4U, 0xe4d5b762U, 0xe0dda77aU, + 0xebcb8b40U, 0x903d7a47U, 0xa455aaffU, 0x1e3c7844U, + 0x85172e39U, 0x60c09d5dU, 0x00000000U, 0x254a94deU, + 0xf4f5f702U, 0xf1ffe31cU, 0x94356a5fU, 0x0b162c3aU, + 0xe7d3bb68U, 0x75eac923U, 0xefc39b58U, 0x3468d0b8U, + 0x3162c4a6U, 0xd4b577c2U, 0xd0bd67daU, 0x86112233U, + 0x7efce519U, 0xad478ec9U, 0xfde7d334U, 0x2952a4f6U, + 0x3060c0a0U, 0x3b76ec9aU, 0x9f234665U, 0xf8edc72aU, + 0xc6913faeU, 0x13264c6aU, 0x060c1814U, 0x050a141eU, + 0xc59733a4U, 0x11224466U, 0x77eec12fU, 0x7cf8ed15U, + 0x7af4f501U, 0x78f0fd0dU, 0x366cd8b4U, 0x1c387048U, + 0x3972e496U, 0x59b279cbU, 0x18306050U, 0x56ac45e9U, + 0xb37bf68dU, 0xb07dfa87U, 0x244890d8U, 0x204080c0U, + 0xb279f28bU, 0x9239724bU, 0xa35bb6edU, 0xc09d27baU, + 0x44880d85U, 0x62c49551U, 0x10204060U, 0xb475ea9fU, + 0x84152a3fU, 0x43861197U, 0x933b764dU, 0xc2992fb6U, + 0x4a9435a1U, 0xbd67cea9U, 0x8f030605U, 0x2d5ab4eeU, + 0xbc65caafU, 0x9c254a6fU, 0x6ad4b561U, 0x40801d9dU, + 0xcf831b98U, 0xa259b2ebU, 0x801d3a27U, 0x4f9e21bfU, + 0x1f3e7c42U, 0xca890f86U, 0xaa4992dbU, 0x42841591U, +}; + +static const ulong32 T1[256] = { + 0x69babbd2U, 0xa854e54dU, 0x5e2fe2bcU, 0xe87425cdU, + 0xa653f751U, 0xbbd3d06bU, 0xb9d2d66fU, 0x9a4db329U, + 0xa050fd5dU, 0x45accf8aU, 0x078d090eU, 0x63bfa5c6U, + 0xe0703dddU, 0xa452f155U, 0x299a7b52U, 0x984cb52dU, + 0xc9ea468fU, 0xb7d5c473U, 0x33975566U, 0xbfd1dc63U, + 0x6633aaccU, 0xa251fb59U, 0xb65bc771U, 0x51a6f3a2U, + 0xa1defe5fU, 0x9048ad3dU, 0x4da8d79aU, 0x2f99715eU, + 0xabdbe04bU, 0x6432acc8U, 0x73b795e6U, 0xe5fc32d7U, + 0xdbe370abU, 0x219e6342U, 0x3f91417eU, 0x2b9b7d56U, + 0xd9e276afU, 0x6bbbbdd6U, 0x82419b19U, 0xdc6e79a5U, + 0x57a5f9aeU, 0x8bcb800bU, 0xd66b67b1U, 0x3795596eU, + 0x5fa1e1beU, 0xfbf310ebU, 0x7fb181feU, 0x04020c08U, + 0x85cc9217U, 0x95c4a237U, 0x3a1d4e74U, 0x28147850U, + 0x9bc3b02bU, 0xc6635791U, 0xa9dae64fU, 0xba5dd369U, + 0xbe5fdf61U, 0xa5dcf257U, 0xfa7d13e9U, 0x87cd9413U, + 0xfe7f1fe1U, 0xb45ac175U, 0xd86c75adU, 0xb85cd56dU, + 0xf3f708fbU, 0x4c26d498U, 0xe3ff38dbU, 0xc7ed5493U, + 0xcde84a87U, 0x279d694eU, 0xde6f7fa1U, 0x018e0302U, + 0x32195664U, 0x5da0e7baU, 0xfdf01ae7U, 0x0f89111eU, + 0x1e0f223cU, 0x0e07121cU, 0x43afc586U, 0xebfb20cbU, + 0x10083020U, 0x2a157e54U, 0x1a0d2e34U, 0x08041810U, + 0x02010604U, 0xc864458dU, 0xa3dff85bU, 0xec7629c5U, + 0xf2790bf9U, 0xa7ddf453U, 0x7a3d8ef4U, 0x2c167458U, + 0x7e3f82fcU, 0x6e37b2dcU, 0xda6d73a9U, 0x703890e0U, + 0x6fb9b1deU, 0xe67337d1U, 0xcfe94c83U, 0x6a35bed4U, + 0xaa55e349U, 0xe2713bd9U, 0xf67b07f1U, 0x058c0f0aU, + 0xe47231d5U, 0x0d88171aU, 0xf1f60effU, 0x542afca8U, + 0x7c3e84f8U, 0xbc5ed965U, 0x4e27d29cU, 0x8c468905U, + 0x180c2830U, 0xca654389U, 0xd0686dbdU, 0xc2615b99U, + 0x06030a0cU, 0x9fc1bc23U, 0xae57ef41U, 0xb1d6ce7fU, + 0xafd9ec43U, 0xb058cd7dU, 0xadd8ea47U, 0xcc664985U, + 0xb3d7c87bU, 0x743a9ce8U, 0x8dc88a07U, 0x783c88f0U, + 0xe9fa26cfU, 0x31965362U, 0x53a7f5a6U, 0x2d98775aU, + 0xc5ec5297U, 0x6db8b7daU, 0x93c7a83bU, 0x41aec382U, + 0xd2696bb9U, 0x964ba731U, 0x4babdd96U, 0x4fa9d19eU, + 0xce674f81U, 0x140a3c28U, 0x8e478f01U, 0xf9f216efU, + 0x77b599eeU, 0x4422cc88U, 0xd7e564b3U, 0xc1ee5e9fU, + 0x61bea3c2U, 0x562bfaacU, 0x1f81213eU, 0x24126c48U, + 0x1b832d36U, 0x361b5a6cU, 0x1c0e2438U, 0x4623ca8cU, + 0xf7f504f3U, 0x8a458309U, 0x4221c684U, 0x81ce9e1fU, + 0x9249ab39U, 0x582ce8b0U, 0xeff92cc3U, 0xd1e66ebfU, + 0x71b693e2U, 0x5028f0a0U, 0x2e17725cU, 0x19822b32U, + 0x341a5c68U, 0x0b8b1d16U, 0xe1fe3edfU, 0x098a1b12U, + 0x12093624U, 0x8fc98c03U, 0x13873526U, 0x9c4eb925U, + 0xdfe17ca3U, 0x5c2ee4b8U, 0xd5e462b7U, 0xdde07aa7U, + 0xcbeb408bU, 0x3d90477aU, 0x55a4ffaaU, 0x3c1e4478U, + 0x1785392eU, 0xc0605d9dU, 0x00000000U, 0x4a25de94U, + 0xf5f402f7U, 0xfff11ce3U, 0x35945f6aU, 0x160b3a2cU, + 0xd3e768bbU, 0xea7523c9U, 0xc3ef589bU, 0x6834b8d0U, + 0x6231a6c4U, 0xb5d4c277U, 0xbdd0da67U, 0x11863322U, + 0xfc7e19e5U, 0x47adc98eU, 0xe7fd34d3U, 0x5229f6a4U, + 0x6030a0c0U, 0x763b9aecU, 0x239f6546U, 0xedf82ac7U, + 0x91c6ae3fU, 0x26136a4cU, 0x0c061418U, 0x0a051e14U, + 0x97c5a433U, 0x22116644U, 0xee772fc1U, 0xf87c15edU, + 0xf47a01f5U, 0xf0780dfdU, 0x6c36b4d8U, 0x381c4870U, + 0x723996e4U, 0xb259cb79U, 0x30185060U, 0xac56e945U, + 0x7bb38df6U, 0x7db087faU, 0x4824d890U, 0x4020c080U, + 0x79b28bf2U, 0x39924b72U, 0x5ba3edb6U, 0x9dc0ba27U, + 0x8844850dU, 0xc4625195U, 0x20106040U, 0x75b49feaU, + 0x15843f2aU, 0x86439711U, 0x3b934d76U, 0x99c2b62fU, + 0x944aa135U, 0x67bda9ceU, 0x038f0506U, 0x5a2deeb4U, + 0x65bcafcaU, 0x259c6f4aU, 0xd46a61b5U, 0x80409d1dU, + 0x83cf981bU, 0x59a2ebb2U, 0x1d80273aU, 0x9e4fbf21U, + 0x3e1f427cU, 0x89ca860fU, 0x49aadb92U, 0x84429115U, +}; + +static const ulong32 T2[256] = { + 0xd2bbba69U, 0x4de554a8U, 0xbce22f5eU, 0xcd2574e8U, + 0x51f753a6U, 0x6bd0d3bbU, 0x6fd6d2b9U, 0x29b34d9aU, + 0x5dfd50a0U, 0x8acfac45U, 0x0e098d07U, 0xc6a5bf63U, + 0xdd3d70e0U, 0x55f152a4U, 0x527b9a29U, 0x2db54c98U, + 0x8f46eac9U, 0x73c4d5b7U, 0x66559733U, 0x63dcd1bfU, + 0xccaa3366U, 0x59fb51a2U, 0x71c75bb6U, 0xa2f3a651U, + 0x5ffedea1U, 0x3dad4890U, 0x9ad7a84dU, 0x5e71992fU, + 0x4be0dbabU, 0xc8ac3264U, 0xe695b773U, 0xd732fce5U, + 0xab70e3dbU, 0x42639e21U, 0x7e41913fU, 0x567d9b2bU, + 0xaf76e2d9U, 0xd6bdbb6bU, 0x199b4182U, 0xa5796edcU, + 0xaef9a557U, 0x0b80cb8bU, 0xb1676bd6U, 0x6e599537U, + 0xbee1a15fU, 0xeb10f3fbU, 0xfe81b17fU, 0x080c0204U, + 0x1792cc85U, 0x37a2c495U, 0x744e1d3aU, 0x50781428U, + 0x2bb0c39bU, 0x915763c6U, 0x4fe6daa9U, 0x69d35dbaU, + 0x61df5fbeU, 0x57f2dca5U, 0xe9137dfaU, 0x1394cd87U, + 0xe11f7ffeU, 0x75c15ab4U, 0xad756cd8U, 0x6dd55cb8U, + 0xfb08f7f3U, 0x98d4264cU, 0xdb38ffe3U, 0x9354edc7U, + 0x874ae8cdU, 0x4e699d27U, 0xa17f6fdeU, 0x02038e01U, + 0x64561932U, 0xbae7a05dU, 0xe71af0fdU, 0x1e11890fU, + 0x3c220f1eU, 0x1c12070eU, 0x86c5af43U, 0xcb20fbebU, + 0x20300810U, 0x547e152aU, 0x342e0d1aU, 0x10180408U, + 0x04060102U, 0x8d4564c8U, 0x5bf8dfa3U, 0xc52976ecU, + 0xf90b79f2U, 0x53f4dda7U, 0xf48e3d7aU, 0x5874162cU, + 0xfc823f7eU, 0xdcb2376eU, 0xa9736ddaU, 0xe0903870U, + 0xdeb1b96fU, 0xd13773e6U, 0x834ce9cfU, 0xd4be356aU, + 0x49e355aaU, 0xd93b71e2U, 0xf1077bf6U, 0x0a0f8c05U, + 0xd53172e4U, 0x1a17880dU, 0xff0ef6f1U, 0xa8fc2a54U, + 0xf8843e7cU, 0x65d95ebcU, 0x9cd2274eU, 0x0589468cU, + 0x30280c18U, 0x894365caU, 0xbd6d68d0U, 0x995b61c2U, + 0x0c0a0306U, 0x23bcc19fU, 0x41ef57aeU, 0x7fced6b1U, + 0x43ecd9afU, 0x7dcd58b0U, 0x47ead8adU, 0x854966ccU, + 0x7bc8d7b3U, 0xe89c3a74U, 0x078ac88dU, 0xf0883c78U, + 0xcf26fae9U, 0x62539631U, 0xa6f5a753U, 0x5a77982dU, + 0x9752ecc5U, 0xdab7b86dU, 0x3ba8c793U, 0x82c3ae41U, + 0xb96b69d2U, 0x31a74b96U, 0x96ddab4bU, 0x9ed1a94fU, + 0x814f67ceU, 0x283c0a14U, 0x018f478eU, 0xef16f2f9U, + 0xee99b577U, 0x88cc2244U, 0xb364e5d7U, 0x9f5eeec1U, + 0xc2a3be61U, 0xacfa2b56U, 0x3e21811fU, 0x486c1224U, + 0x362d831bU, 0x6c5a1b36U, 0x38240e1cU, 0x8cca2346U, + 0xf304f5f7U, 0x0983458aU, 0x84c62142U, 0x1f9ece81U, + 0x39ab4992U, 0xb0e82c58U, 0xc32cf9efU, 0xbf6ee6d1U, + 0xe293b671U, 0xa0f02850U, 0x5c72172eU, 0x322b8219U, + 0x685c1a34U, 0x161d8b0bU, 0xdf3efee1U, 0x121b8a09U, + 0x24360912U, 0x038cc98fU, 0x26358713U, 0x25b94e9cU, + 0xa37ce1dfU, 0xb8e42e5cU, 0xb762e4d5U, 0xa77ae0ddU, + 0x8b40ebcbU, 0x7a47903dU, 0xaaffa455U, 0x78441e3cU, + 0x2e398517U, 0x9d5d60c0U, 0x00000000U, 0x94de254aU, + 0xf702f4f5U, 0xe31cf1ffU, 0x6a5f9435U, 0x2c3a0b16U, + 0xbb68e7d3U, 0xc92375eaU, 0x9b58efc3U, 0xd0b83468U, + 0xc4a63162U, 0x77c2d4b5U, 0x67dad0bdU, 0x22338611U, + 0xe5197efcU, 0x8ec9ad47U, 0xd334fde7U, 0xa4f62952U, + 0xc0a03060U, 0xec9a3b76U, 0x46659f23U, 0xc72af8edU, + 0x3faec691U, 0x4c6a1326U, 0x1814060cU, 0x141e050aU, + 0x33a4c597U, 0x44661122U, 0xc12f77eeU, 0xed157cf8U, + 0xf5017af4U, 0xfd0d78f0U, 0xd8b4366cU, 0x70481c38U, + 0xe4963972U, 0x79cb59b2U, 0x60501830U, 0x45e956acU, + 0xf68db37bU, 0xfa87b07dU, 0x90d82448U, 0x80c02040U, + 0xf28bb279U, 0x724b9239U, 0xb6eda35bU, 0x27bac09dU, + 0x0d854488U, 0x955162c4U, 0x40601020U, 0xea9fb475U, + 0x2a3f8415U, 0x11974386U, 0x764d933bU, 0x2fb6c299U, + 0x35a14a94U, 0xcea9bd67U, 0x06058f03U, 0xb4ee2d5aU, + 0xcaafbc65U, 0x4a6f9c25U, 0xb5616ad4U, 0x1d9d4080U, + 0x1b98cf83U, 0xb2eba259U, 0x3a27801dU, 0x21bf4f9eU, + 0x7c421f3eU, 0x0f86ca89U, 0x92dbaa49U, 0x15914284U, +}; + +static const ulong32 T3[256] = { + 0xbbd269baU, 0xe54da854U, 0xe2bc5e2fU, 0x25cde874U, + 0xf751a653U, 0xd06bbbd3U, 0xd66fb9d2U, 0xb3299a4dU, + 0xfd5da050U, 0xcf8a45acU, 0x090e078dU, 0xa5c663bfU, + 0x3ddde070U, 0xf155a452U, 0x7b52299aU, 0xb52d984cU, + 0x468fc9eaU, 0xc473b7d5U, 0x55663397U, 0xdc63bfd1U, + 0xaacc6633U, 0xfb59a251U, 0xc771b65bU, 0xf3a251a6U, + 0xfe5fa1deU, 0xad3d9048U, 0xd79a4da8U, 0x715e2f99U, + 0xe04babdbU, 0xacc86432U, 0x95e673b7U, 0x32d7e5fcU, + 0x70abdbe3U, 0x6342219eU, 0x417e3f91U, 0x7d562b9bU, + 0x76afd9e2U, 0xbdd66bbbU, 0x9b198241U, 0x79a5dc6eU, + 0xf9ae57a5U, 0x800b8bcbU, 0x67b1d66bU, 0x596e3795U, + 0xe1be5fa1U, 0x10ebfbf3U, 0x81fe7fb1U, 0x0c080402U, + 0x921785ccU, 0xa23795c4U, 0x4e743a1dU, 0x78502814U, + 0xb02b9bc3U, 0x5791c663U, 0xe64fa9daU, 0xd369ba5dU, + 0xdf61be5fU, 0xf257a5dcU, 0x13e9fa7dU, 0x941387cdU, + 0x1fe1fe7fU, 0xc175b45aU, 0x75add86cU, 0xd56db85cU, + 0x08fbf3f7U, 0xd4984c26U, 0x38dbe3ffU, 0x5493c7edU, + 0x4a87cde8U, 0x694e279dU, 0x7fa1de6fU, 0x0302018eU, + 0x56643219U, 0xe7ba5da0U, 0x1ae7fdf0U, 0x111e0f89U, + 0x223c1e0fU, 0x121c0e07U, 0xc58643afU, 0x20cbebfbU, + 0x30201008U, 0x7e542a15U, 0x2e341a0dU, 0x18100804U, + 0x06040201U, 0x458dc864U, 0xf85ba3dfU, 0x29c5ec76U, + 0x0bf9f279U, 0xf453a7ddU, 0x8ef47a3dU, 0x74582c16U, + 0x82fc7e3fU, 0xb2dc6e37U, 0x73a9da6dU, 0x90e07038U, + 0xb1de6fb9U, 0x37d1e673U, 0x4c83cfe9U, 0xbed46a35U, + 0xe349aa55U, 0x3bd9e271U, 0x07f1f67bU, 0x0f0a058cU, + 0x31d5e472U, 0x171a0d88U, 0x0efff1f6U, 0xfca8542aU, + 0x84f87c3eU, 0xd965bc5eU, 0xd29c4e27U, 0x89058c46U, + 0x2830180cU, 0x4389ca65U, 0x6dbdd068U, 0x5b99c261U, + 0x0a0c0603U, 0xbc239fc1U, 0xef41ae57U, 0xce7fb1d6U, + 0xec43afd9U, 0xcd7db058U, 0xea47add8U, 0x4985cc66U, + 0xc87bb3d7U, 0x9ce8743aU, 0x8a078dc8U, 0x88f0783cU, + 0x26cfe9faU, 0x53623196U, 0xf5a653a7U, 0x775a2d98U, + 0x5297c5ecU, 0xb7da6db8U, 0xa83b93c7U, 0xc38241aeU, + 0x6bb9d269U, 0xa731964bU, 0xdd964babU, 0xd19e4fa9U, + 0x4f81ce67U, 0x3c28140aU, 0x8f018e47U, 0x16eff9f2U, + 0x99ee77b5U, 0xcc884422U, 0x64b3d7e5U, 0x5e9fc1eeU, + 0xa3c261beU, 0xfaac562bU, 0x213e1f81U, 0x6c482412U, + 0x2d361b83U, 0x5a6c361bU, 0x24381c0eU, 0xca8c4623U, + 0x04f3f7f5U, 0x83098a45U, 0xc6844221U, 0x9e1f81ceU, + 0xab399249U, 0xe8b0582cU, 0x2cc3eff9U, 0x6ebfd1e6U, + 0x93e271b6U, 0xf0a05028U, 0x725c2e17U, 0x2b321982U, + 0x5c68341aU, 0x1d160b8bU, 0x3edfe1feU, 0x1b12098aU, + 0x36241209U, 0x8c038fc9U, 0x35261387U, 0xb9259c4eU, + 0x7ca3dfe1U, 0xe4b85c2eU, 0x62b7d5e4U, 0x7aa7dde0U, + 0x408bcbebU, 0x477a3d90U, 0xffaa55a4U, 0x44783c1eU, + 0x392e1785U, 0x5d9dc060U, 0x00000000U, 0xde944a25U, + 0x02f7f5f4U, 0x1ce3fff1U, 0x5f6a3594U, 0x3a2c160bU, + 0x68bbd3e7U, 0x23c9ea75U, 0x589bc3efU, 0xb8d06834U, + 0xa6c46231U, 0xc277b5d4U, 0xda67bdd0U, 0x33221186U, + 0x19e5fc7eU, 0xc98e47adU, 0x34d3e7fdU, 0xf6a45229U, + 0xa0c06030U, 0x9aec763bU, 0x6546239fU, 0x2ac7edf8U, + 0xae3f91c6U, 0x6a4c2613U, 0x14180c06U, 0x1e140a05U, + 0xa43397c5U, 0x66442211U, 0x2fc1ee77U, 0x15edf87cU, + 0x01f5f47aU, 0x0dfdf078U, 0xb4d86c36U, 0x4870381cU, + 0x96e47239U, 0xcb79b259U, 0x50603018U, 0xe945ac56U, + 0x8df67bb3U, 0x87fa7db0U, 0xd8904824U, 0xc0804020U, + 0x8bf279b2U, 0x4b723992U, 0xedb65ba3U, 0xba279dc0U, + 0x850d8844U, 0x5195c462U, 0x60402010U, 0x9fea75b4U, + 0x3f2a1584U, 0x97118643U, 0x4d763b93U, 0xb62f99c2U, + 0xa135944aU, 0xa9ce67bdU, 0x0506038fU, 0xeeb45a2dU, + 0xafca65bcU, 0x6f4a259cU, 0x61b5d46aU, 0x9d1d8040U, + 0x981b83cfU, 0xebb259a2U, 0x273a1d80U, 0xbf219e4fU, + 0x427c3e1fU, 0x860f89caU, 0xdb9249aaU, 0x91158442U, +}; + +static const ulong32 T4[256] = { + 0xbabababaU, 0x54545454U, 0x2f2f2f2fU, 0x74747474U, + 0x53535353U, 0xd3d3d3d3U, 0xd2d2d2d2U, 0x4d4d4d4dU, + 0x50505050U, 0xacacacacU, 0x8d8d8d8dU, 0xbfbfbfbfU, + 0x70707070U, 0x52525252U, 0x9a9a9a9aU, 0x4c4c4c4cU, + 0xeaeaeaeaU, 0xd5d5d5d5U, 0x97979797U, 0xd1d1d1d1U, + 0x33333333U, 0x51515151U, 0x5b5b5b5bU, 0xa6a6a6a6U, + 0xdedededeU, 0x48484848U, 0xa8a8a8a8U, 0x99999999U, + 0xdbdbdbdbU, 0x32323232U, 0xb7b7b7b7U, 0xfcfcfcfcU, + 0xe3e3e3e3U, 0x9e9e9e9eU, 0x91919191U, 0x9b9b9b9bU, + 0xe2e2e2e2U, 0xbbbbbbbbU, 0x41414141U, 0x6e6e6e6eU, + 0xa5a5a5a5U, 0xcbcbcbcbU, 0x6b6b6b6bU, 0x95959595U, + 0xa1a1a1a1U, 0xf3f3f3f3U, 0xb1b1b1b1U, 0x02020202U, + 0xccccccccU, 0xc4c4c4c4U, 0x1d1d1d1dU, 0x14141414U, + 0xc3c3c3c3U, 0x63636363U, 0xdadadadaU, 0x5d5d5d5dU, + 0x5f5f5f5fU, 0xdcdcdcdcU, 0x7d7d7d7dU, 0xcdcdcdcdU, + 0x7f7f7f7fU, 0x5a5a5a5aU, 0x6c6c6c6cU, 0x5c5c5c5cU, + 0xf7f7f7f7U, 0x26262626U, 0xffffffffU, 0xededededU, + 0xe8e8e8e8U, 0x9d9d9d9dU, 0x6f6f6f6fU, 0x8e8e8e8eU, + 0x19191919U, 0xa0a0a0a0U, 0xf0f0f0f0U, 0x89898989U, + 0x0f0f0f0fU, 0x07070707U, 0xafafafafU, 0xfbfbfbfbU, + 0x08080808U, 0x15151515U, 0x0d0d0d0dU, 0x04040404U, + 0x01010101U, 0x64646464U, 0xdfdfdfdfU, 0x76767676U, + 0x79797979U, 0xddddddddU, 0x3d3d3d3dU, 0x16161616U, + 0x3f3f3f3fU, 0x37373737U, 0x6d6d6d6dU, 0x38383838U, + 0xb9b9b9b9U, 0x73737373U, 0xe9e9e9e9U, 0x35353535U, + 0x55555555U, 0x71717171U, 0x7b7b7b7bU, 0x8c8c8c8cU, + 0x72727272U, 0x88888888U, 0xf6f6f6f6U, 0x2a2a2a2aU, + 0x3e3e3e3eU, 0x5e5e5e5eU, 0x27272727U, 0x46464646U, + 0x0c0c0c0cU, 0x65656565U, 0x68686868U, 0x61616161U, + 0x03030303U, 0xc1c1c1c1U, 0x57575757U, 0xd6d6d6d6U, + 0xd9d9d9d9U, 0x58585858U, 0xd8d8d8d8U, 0x66666666U, + 0xd7d7d7d7U, 0x3a3a3a3aU, 0xc8c8c8c8U, 0x3c3c3c3cU, + 0xfafafafaU, 0x96969696U, 0xa7a7a7a7U, 0x98989898U, + 0xececececU, 0xb8b8b8b8U, 0xc7c7c7c7U, 0xaeaeaeaeU, + 0x69696969U, 0x4b4b4b4bU, 0xababababU, 0xa9a9a9a9U, + 0x67676767U, 0x0a0a0a0aU, 0x47474747U, 0xf2f2f2f2U, + 0xb5b5b5b5U, 0x22222222U, 0xe5e5e5e5U, 0xeeeeeeeeU, + 0xbebebebeU, 0x2b2b2b2bU, 0x81818181U, 0x12121212U, + 0x83838383U, 0x1b1b1b1bU, 0x0e0e0e0eU, 0x23232323U, + 0xf5f5f5f5U, 0x45454545U, 0x21212121U, 0xcecececeU, + 0x49494949U, 0x2c2c2c2cU, 0xf9f9f9f9U, 0xe6e6e6e6U, + 0xb6b6b6b6U, 0x28282828U, 0x17171717U, 0x82828282U, + 0x1a1a1a1aU, 0x8b8b8b8bU, 0xfefefefeU, 0x8a8a8a8aU, + 0x09090909U, 0xc9c9c9c9U, 0x87878787U, 0x4e4e4e4eU, + 0xe1e1e1e1U, 0x2e2e2e2eU, 0xe4e4e4e4U, 0xe0e0e0e0U, + 0xebebebebU, 0x90909090U, 0xa4a4a4a4U, 0x1e1e1e1eU, + 0x85858585U, 0x60606060U, 0x00000000U, 0x25252525U, + 0xf4f4f4f4U, 0xf1f1f1f1U, 0x94949494U, 0x0b0b0b0bU, + 0xe7e7e7e7U, 0x75757575U, 0xefefefefU, 0x34343434U, + 0x31313131U, 0xd4d4d4d4U, 0xd0d0d0d0U, 0x86868686U, + 0x7e7e7e7eU, 0xadadadadU, 0xfdfdfdfdU, 0x29292929U, + 0x30303030U, 0x3b3b3b3bU, 0x9f9f9f9fU, 0xf8f8f8f8U, + 0xc6c6c6c6U, 0x13131313U, 0x06060606U, 0x05050505U, + 0xc5c5c5c5U, 0x11111111U, 0x77777777U, 0x7c7c7c7cU, + 0x7a7a7a7aU, 0x78787878U, 0x36363636U, 0x1c1c1c1cU, + 0x39393939U, 0x59595959U, 0x18181818U, 0x56565656U, + 0xb3b3b3b3U, 0xb0b0b0b0U, 0x24242424U, 0x20202020U, + 0xb2b2b2b2U, 0x92929292U, 0xa3a3a3a3U, 0xc0c0c0c0U, + 0x44444444U, 0x62626262U, 0x10101010U, 0xb4b4b4b4U, + 0x84848484U, 0x43434343U, 0x93939393U, 0xc2c2c2c2U, + 0x4a4a4a4aU, 0xbdbdbdbdU, 0x8f8f8f8fU, 0x2d2d2d2dU, + 0xbcbcbcbcU, 0x9c9c9c9cU, 0x6a6a6a6aU, 0x40404040U, + 0xcfcfcfcfU, 0xa2a2a2a2U, 0x80808080U, 0x4f4f4f4fU, + 0x1f1f1f1fU, 0xcacacacaU, 0xaaaaaaaaU, 0x42424242U, +}; + +static const ulong32 T5[256] = { + 0x00000000U, 0x01020608U, 0x02040c10U, 0x03060a18U, + 0x04081820U, 0x050a1e28U, 0x060c1430U, 0x070e1238U, + 0x08103040U, 0x09123648U, 0x0a143c50U, 0x0b163a58U, + 0x0c182860U, 0x0d1a2e68U, 0x0e1c2470U, 0x0f1e2278U, + 0x10206080U, 0x11226688U, 0x12246c90U, 0x13266a98U, + 0x142878a0U, 0x152a7ea8U, 0x162c74b0U, 0x172e72b8U, + 0x183050c0U, 0x193256c8U, 0x1a345cd0U, 0x1b365ad8U, + 0x1c3848e0U, 0x1d3a4ee8U, 0x1e3c44f0U, 0x1f3e42f8U, + 0x2040c01dU, 0x2142c615U, 0x2244cc0dU, 0x2346ca05U, + 0x2448d83dU, 0x254ade35U, 0x264cd42dU, 0x274ed225U, + 0x2850f05dU, 0x2952f655U, 0x2a54fc4dU, 0x2b56fa45U, + 0x2c58e87dU, 0x2d5aee75U, 0x2e5ce46dU, 0x2f5ee265U, + 0x3060a09dU, 0x3162a695U, 0x3264ac8dU, 0x3366aa85U, + 0x3468b8bdU, 0x356abeb5U, 0x366cb4adU, 0x376eb2a5U, + 0x387090ddU, 0x397296d5U, 0x3a749ccdU, 0x3b769ac5U, + 0x3c7888fdU, 0x3d7a8ef5U, 0x3e7c84edU, 0x3f7e82e5U, + 0x40809d3aU, 0x41829b32U, 0x4284912aU, 0x43869722U, + 0x4488851aU, 0x458a8312U, 0x468c890aU, 0x478e8f02U, + 0x4890ad7aU, 0x4992ab72U, 0x4a94a16aU, 0x4b96a762U, + 0x4c98b55aU, 0x4d9ab352U, 0x4e9cb94aU, 0x4f9ebf42U, + 0x50a0fdbaU, 0x51a2fbb2U, 0x52a4f1aaU, 0x53a6f7a2U, + 0x54a8e59aU, 0x55aae392U, 0x56ace98aU, 0x57aeef82U, + 0x58b0cdfaU, 0x59b2cbf2U, 0x5ab4c1eaU, 0x5bb6c7e2U, + 0x5cb8d5daU, 0x5dbad3d2U, 0x5ebcd9caU, 0x5fbedfc2U, + 0x60c05d27U, 0x61c25b2fU, 0x62c45137U, 0x63c6573fU, + 0x64c84507U, 0x65ca430fU, 0x66cc4917U, 0x67ce4f1fU, + 0x68d06d67U, 0x69d26b6fU, 0x6ad46177U, 0x6bd6677fU, + 0x6cd87547U, 0x6dda734fU, 0x6edc7957U, 0x6fde7f5fU, + 0x70e03da7U, 0x71e23bafU, 0x72e431b7U, 0x73e637bfU, + 0x74e82587U, 0x75ea238fU, 0x76ec2997U, 0x77ee2f9fU, + 0x78f00de7U, 0x79f20befU, 0x7af401f7U, 0x7bf607ffU, + 0x7cf815c7U, 0x7dfa13cfU, 0x7efc19d7U, 0x7ffe1fdfU, + 0x801d2774U, 0x811f217cU, 0x82192b64U, 0x831b2d6cU, + 0x84153f54U, 0x8517395cU, 0x86113344U, 0x8713354cU, + 0x880d1734U, 0x890f113cU, 0x8a091b24U, 0x8b0b1d2cU, + 0x8c050f14U, 0x8d07091cU, 0x8e010304U, 0x8f03050cU, + 0x903d47f4U, 0x913f41fcU, 0x92394be4U, 0x933b4decU, + 0x94355fd4U, 0x953759dcU, 0x963153c4U, 0x973355ccU, + 0x982d77b4U, 0x992f71bcU, 0x9a297ba4U, 0x9b2b7dacU, + 0x9c256f94U, 0x9d27699cU, 0x9e216384U, 0x9f23658cU, + 0xa05de769U, 0xa15fe161U, 0xa259eb79U, 0xa35bed71U, + 0xa455ff49U, 0xa557f941U, 0xa651f359U, 0xa753f551U, + 0xa84dd729U, 0xa94fd121U, 0xaa49db39U, 0xab4bdd31U, + 0xac45cf09U, 0xad47c901U, 0xae41c319U, 0xaf43c511U, + 0xb07d87e9U, 0xb17f81e1U, 0xb2798bf9U, 0xb37b8df1U, + 0xb4759fc9U, 0xb57799c1U, 0xb67193d9U, 0xb77395d1U, + 0xb86db7a9U, 0xb96fb1a1U, 0xba69bbb9U, 0xbb6bbdb1U, + 0xbc65af89U, 0xbd67a981U, 0xbe61a399U, 0xbf63a591U, + 0xc09dba4eU, 0xc19fbc46U, 0xc299b65eU, 0xc39bb056U, + 0xc495a26eU, 0xc597a466U, 0xc691ae7eU, 0xc793a876U, + 0xc88d8a0eU, 0xc98f8c06U, 0xca89861eU, 0xcb8b8016U, + 0xcc85922eU, 0xcd879426U, 0xce819e3eU, 0xcf839836U, + 0xd0bddaceU, 0xd1bfdcc6U, 0xd2b9d6deU, 0xd3bbd0d6U, + 0xd4b5c2eeU, 0xd5b7c4e6U, 0xd6b1cefeU, 0xd7b3c8f6U, + 0xd8adea8eU, 0xd9afec86U, 0xdaa9e69eU, 0xdbabe096U, + 0xdca5f2aeU, 0xdda7f4a6U, 0xdea1febeU, 0xdfa3f8b6U, + 0xe0dd7a53U, 0xe1df7c5bU, 0xe2d97643U, 0xe3db704bU, + 0xe4d56273U, 0xe5d7647bU, 0xe6d16e63U, 0xe7d3686bU, + 0xe8cd4a13U, 0xe9cf4c1bU, 0xeac94603U, 0xebcb400bU, + 0xecc55233U, 0xedc7543bU, 0xeec15e23U, 0xefc3582bU, + 0xf0fd1ad3U, 0xf1ff1cdbU, 0xf2f916c3U, 0xf3fb10cbU, + 0xf4f502f3U, 0xf5f704fbU, 0xf6f10ee3U, 0xf7f308ebU, + 0xf8ed2a93U, 0xf9ef2c9bU, 0xfae92683U, 0xfbeb208bU, + 0xfce532b3U, 0xfde734bbU, 0xfee13ea3U, 0xffe338abU, +}; + +/** + * The round constants. + */ +static const ulong32 rc[] = { + 0xba542f74U, 0x53d3d24dU, 0x50ac8dbfU, 0x70529a4cU, + 0xead597d1U, 0x33515ba6U, 0xde48a899U, 0xdb32b7fcU, + 0xe39e919bU, 0xe2bb416eU, 0xa5cb6b95U, 0xa1f3b102U, + 0xccc41d14U, 0xc363da5dU, 0x5fdc7dcdU, 0x7f5a6c5cU, + 0xf726ffedU, 0xe89d6f8eU, 0x19a0f089U, +}; + + + +#else + + +static const ulong32 T0[256] = { + 0xa753a6f5U, 0xd3bb6bd0U, 0xe6d1bf6eU, 0x71e2d93bU, + 0xd0bd67daU, 0xac458acfU, 0x4d9a29b3U, 0x79f2f90bU, + 0x3a74e89cU, 0xc98f038cU, 0x913f7e41U, 0xfce5d732U, + 0x1e3c7844U, 0x478e018fU, 0x54a84de5U, 0xbd67cea9U, + 0x8c050a0fU, 0xa557aef9U, 0x7af4f501U, 0xfbebcb20U, + 0x63c69157U, 0xb86ddab7U, 0xdda753f4U, 0xd4b577c2U, + 0xe5d7b364U, 0xb37bf68dU, 0xc59733a4U, 0xbe61c2a3U, + 0xa94f9ed1U, 0x880d1a17U, 0x0c183028U, 0xa259b2ebU, + 0x3972e496U, 0xdfa35bf8U, 0x2952a4f6U, 0xdaa94fe6U, + 0x2b56acfaU, 0xa84d9ad7U, 0xcb8b0b80U, 0x4c982db5U, + 0x4b9631a7U, 0x224488ccU, 0xaa4992dbU, 0x244890d8U, + 0x4182199bU, 0x70e0dd3dU, 0xa651a2f3U, 0xf9efc32cU, + 0x5ab475c1U, 0xe2d9af76U, 0xb07dfa87U, 0x366cd8b4U, + 0x7dfae913U, 0xe4d5b762U, 0x3366ccaaU, 0xffe3db38U, + 0x60c09d5dU, 0x204080c0U, 0x08102030U, 0x8b0b161dU, + 0x5ebc65d9U, 0xab4b96ddU, 0x7ffee11fU, 0x78f0fd0dU, + 0x7cf8ed15U, 0x2c58b0e8U, 0x57ae41efU, 0xd2b96fd6U, + 0xdca557f2U, 0x6ddaa973U, 0x7efce519U, 0x0d1a342eU, + 0x53a651f7U, 0x94356a5fU, 0xc39b2bb0U, 0x2850a0f0U, + 0x274e9cd2U, 0x060c1814U, 0x5fbe61dfU, 0xad478ec9U, + 0x67ce814fU, 0x5cb86dd5U, 0x55aa49e3U, 0x48903dadU, + 0x0e1c3824U, 0x52a455f1U, 0xeac98f46U, 0x42841591U, + 0x5bb671c7U, 0x5dba69d3U, 0x3060c0a0U, 0x58b07dcdU, + 0x51a259fbU, 0x59b279cbU, 0x3c78f088U, 0x4e9c25b9U, + 0x3870e090U, 0x8a09121bU, 0x72e4d531U, 0x14285078U, + 0xe7d3bb68U, 0xc6913faeU, 0xdea15ffeU, 0x50a05dfdU, + 0x8e010203U, 0x9239724bU, 0xd1bf63dcU, 0x77eec12fU, + 0x933b764dU, 0x458a0983U, 0x9a29527bU, 0xce811f9eU, + 0x2d5ab4eeU, 0x03060c0aU, 0x62c49551U, 0xb671e293U, + 0xb96fdeb1U, 0xbf63c6a5U, 0x96316253U, 0x6bd6b167U, + 0x3f7efc82U, 0x070e1c12U, 0x1224486cU, 0xae4182c3U, + 0x40801d9dU, 0x3468d0b8U, 0x468c0589U, 0x3e7cf884U, + 0xdbab4be0U, 0xcf831b98U, 0xecc59752U, 0xcc851792U, + 0xc19f23bcU, 0xa15fbee1U, 0xc09d27baU, 0xd6b17fceU, + 0x1d3a744eU, 0xf4f5f702U, 0x61c2995bU, 0x3b76ec9aU, + 0x10204060U, 0xd8ad47eaU, 0x68d0bd6dU, 0xa05dbae7U, + 0xb17ffe81U, 0x0a14283cU, 0x69d2b96bU, 0x6cd8ad75U, + 0x499239abU, 0xfae9cf26U, 0x76ecc529U, 0xc49537a2U, + 0x9e214263U, 0x9b2b567dU, 0x6edca579U, 0x992f5e71U, + 0xc2992fb6U, 0xb773e695U, 0x982d5a77U, 0xbc65caafU, + 0x8f030605U, 0x85172e39U, 0x1f3e7c42U, 0xb475ea9fU, + 0xf8edc72aU, 0x11224466U, 0x2e5cb8e4U, 0x00000000U, + 0x254a94deU, 0x1c387048U, 0x2a54a8fcU, 0x3d7af48eU, + 0x050a141eU, 0x4f9e21bfU, 0x7bf6f107U, 0xb279f28bU, + 0x3264c8acU, 0x903d7a47U, 0xaf4386c5U, 0x19326456U, + 0xa35bb6edU, 0xf7f3fb08U, 0x73e6d137U, 0x9d274e69U, + 0x152a547eU, 0x74e8cd25U, 0xeec19f5eU, 0xca890f86U, + 0x9f234665U, 0x0f1e3c22U, 0x1b366c5aU, 0x75eac923U, + 0x86112233U, 0x84152a3fU, 0x9c254a6fU, 0x4a9435a1U, + 0x97336655U, 0x1a34685cU, 0x65ca8943U, 0xf6f1ff0eU, + 0xedc79354U, 0x09122436U, 0xbb6bd6bdU, 0x264c98d4U, + 0x831b362dU, 0xebcb8b40U, 0x6fdea17fU, 0x811f3e21U, + 0x04081018U, 0x6ad4b561U, 0x43861197U, 0x01020406U, + 0x172e5c72U, 0xe1dfa37cU, 0x87132635U, 0xf5f7f304U, + 0x8d070e09U, 0xe3dbab70U, 0x23468ccaU, 0x801d3a27U, + 0x44880d85U, 0x162c5874U, 0x66cc8549U, 0x214284c6U, + 0xfee1df3eU, 0xd5b773c4U, 0x3162c4a6U, 0xd9af43ecU, + 0x356ad4beU, 0x18306050U, 0x0204080cU, 0x64c88d45U, + 0xf2f9ef16U, 0xf1ffe31cU, 0x56ac45e9U, 0xcd871394U, + 0x8219322bU, 0xc88d078aU, 0xba69d2bbU, 0xf0fde71aU, + 0xefc39b58U, 0xe9cf834cU, 0xe8cd874aU, 0xfde7d334U, + 0x890f1e11U, 0xd7b37bc8U, 0xc7933ba8U, 0xb577ee99U, + 0xa455aaffU, 0x2f5ebce2U, 0x95376e59U, 0x13264c6aU, + 0x0b162c3aU, 0xf3fbeb10U, 0xe0dda77aU, 0x376edcb2U, +}; + +static const ulong32 T1[256] = { + 0x53a7f5a6U, 0xbbd3d06bU, 0xd1e66ebfU, 0xe2713bd9U, + 0xbdd0da67U, 0x45accf8aU, 0x9a4db329U, 0xf2790bf9U, + 0x743a9ce8U, 0x8fc98c03U, 0x3f91417eU, 0xe5fc32d7U, + 0x3c1e4478U, 0x8e478f01U, 0xa854e54dU, 0x67bda9ceU, + 0x058c0f0aU, 0x57a5f9aeU, 0xf47a01f5U, 0xebfb20cbU, + 0xc6635791U, 0x6db8b7daU, 0xa7ddf453U, 0xb5d4c277U, + 0xd7e564b3U, 0x7bb38df6U, 0x97c5a433U, 0x61bea3c2U, + 0x4fa9d19eU, 0x0d88171aU, 0x180c2830U, 0x59a2ebb2U, + 0x723996e4U, 0xa3dff85bU, 0x5229f6a4U, 0xa9dae64fU, + 0x562bfaacU, 0x4da8d79aU, 0x8bcb800bU, 0x984cb52dU, + 0x964ba731U, 0x4422cc88U, 0x49aadb92U, 0x4824d890U, + 0x82419b19U, 0xe0703dddU, 0x51a6f3a2U, 0xeff92cc3U, + 0xb45ac175U, 0xd9e276afU, 0x7db087faU, 0x6c36b4d8U, + 0xfa7d13e9U, 0xd5e462b7U, 0x6633aaccU, 0xe3ff38dbU, + 0xc0605d9dU, 0x4020c080U, 0x10083020U, 0x0b8b1d16U, + 0xbc5ed965U, 0x4babdd96U, 0xfe7f1fe1U, 0xf0780dfdU, + 0xf87c15edU, 0x582ce8b0U, 0xae57ef41U, 0xb9d2d66fU, + 0xa5dcf257U, 0xda6d73a9U, 0xfc7e19e5U, 0x1a0d2e34U, + 0xa653f751U, 0x35945f6aU, 0x9bc3b02bU, 0x5028f0a0U, + 0x4e27d29cU, 0x0c061418U, 0xbe5fdf61U, 0x47adc98eU, + 0xce674f81U, 0xb85cd56dU, 0xaa55e349U, 0x9048ad3dU, + 0x1c0e2438U, 0xa452f155U, 0xc9ea468fU, 0x84429115U, + 0xb65bc771U, 0xba5dd369U, 0x6030a0c0U, 0xb058cd7dU, + 0xa251fb59U, 0xb259cb79U, 0x783c88f0U, 0x9c4eb925U, + 0x703890e0U, 0x098a1b12U, 0xe47231d5U, 0x28147850U, + 0xd3e768bbU, 0x91c6ae3fU, 0xa1defe5fU, 0xa050fd5dU, + 0x018e0302U, 0x39924b72U, 0xbfd1dc63U, 0xee772fc1U, + 0x3b934d76U, 0x8a458309U, 0x299a7b52U, 0x81ce9e1fU, + 0x5a2deeb4U, 0x06030a0cU, 0xc4625195U, 0x71b693e2U, + 0x6fb9b1deU, 0x63bfa5c6U, 0x31965362U, 0xd66b67b1U, + 0x7e3f82fcU, 0x0e07121cU, 0x24126c48U, 0x41aec382U, + 0x80409d1dU, 0x6834b8d0U, 0x8c468905U, 0x7c3e84f8U, + 0xabdbe04bU, 0x83cf981bU, 0xc5ec5297U, 0x85cc9217U, + 0x9fc1bc23U, 0x5fa1e1beU, 0x9dc0ba27U, 0xb1d6ce7fU, + 0x3a1d4e74U, 0xf5f402f7U, 0xc2615b99U, 0x763b9aecU, + 0x20106040U, 0xadd8ea47U, 0xd0686dbdU, 0x5da0e7baU, + 0x7fb181feU, 0x140a3c28U, 0xd2696bb9U, 0xd86c75adU, + 0x9249ab39U, 0xe9fa26cfU, 0xec7629c5U, 0x95c4a237U, + 0x219e6342U, 0x2b9b7d56U, 0xdc6e79a5U, 0x2f99715eU, + 0x99c2b62fU, 0x73b795e6U, 0x2d98775aU, 0x65bcafcaU, + 0x038f0506U, 0x1785392eU, 0x3e1f427cU, 0x75b49feaU, + 0xedf82ac7U, 0x22116644U, 0x5c2ee4b8U, 0x00000000U, + 0x4a25de94U, 0x381c4870U, 0x542afca8U, 0x7a3d8ef4U, + 0x0a051e14U, 0x9e4fbf21U, 0xf67b07f1U, 0x79b28bf2U, + 0x6432acc8U, 0x3d90477aU, 0x43afc586U, 0x32195664U, + 0x5ba3edb6U, 0xf3f708fbU, 0xe67337d1U, 0x279d694eU, + 0x2a157e54U, 0xe87425cdU, 0xc1ee5e9fU, 0x89ca860fU, + 0x239f6546U, 0x1e0f223cU, 0x361b5a6cU, 0xea7523c9U, + 0x11863322U, 0x15843f2aU, 0x259c6f4aU, 0x944aa135U, + 0x33975566U, 0x341a5c68U, 0xca654389U, 0xf1f60effU, + 0xc7ed5493U, 0x12093624U, 0x6bbbbdd6U, 0x4c26d498U, + 0x1b832d36U, 0xcbeb408bU, 0xde6f7fa1U, 0x1f81213eU, + 0x08041810U, 0xd46a61b5U, 0x86439711U, 0x02010604U, + 0x2e17725cU, 0xdfe17ca3U, 0x13873526U, 0xf7f504f3U, + 0x078d090eU, 0xdbe370abU, 0x4623ca8cU, 0x1d80273aU, + 0x8844850dU, 0x2c167458U, 0xcc664985U, 0x4221c684U, + 0xe1fe3edfU, 0xb7d5c473U, 0x6231a6c4U, 0xafd9ec43U, + 0x6a35bed4U, 0x30185060U, 0x04020c08U, 0xc864458dU, + 0xf9f216efU, 0xfff11ce3U, 0xac56e945U, 0x87cd9413U, + 0x19822b32U, 0x8dc88a07U, 0x69babbd2U, 0xfdf01ae7U, + 0xc3ef589bU, 0xcfe94c83U, 0xcde84a87U, 0xe7fd34d3U, + 0x0f89111eU, 0xb3d7c87bU, 0x93c7a83bU, 0x77b599eeU, + 0x55a4ffaaU, 0x5e2fe2bcU, 0x3795596eU, 0x26136a4cU, + 0x160b3a2cU, 0xfbf310ebU, 0xdde07aa7U, 0x6e37b2dcU, +}; + +static const ulong32 T2[256] = { + 0xa6f5a753U, 0x6bd0d3bbU, 0xbf6ee6d1U, 0xd93b71e2U, + 0x67dad0bdU, 0x8acfac45U, 0x29b34d9aU, 0xf90b79f2U, + 0xe89c3a74U, 0x038cc98fU, 0x7e41913fU, 0xd732fce5U, + 0x78441e3cU, 0x018f478eU, 0x4de554a8U, 0xcea9bd67U, + 0x0a0f8c05U, 0xaef9a557U, 0xf5017af4U, 0xcb20fbebU, + 0x915763c6U, 0xdab7b86dU, 0x53f4dda7U, 0x77c2d4b5U, + 0xb364e5d7U, 0xf68db37bU, 0x33a4c597U, 0xc2a3be61U, + 0x9ed1a94fU, 0x1a17880dU, 0x30280c18U, 0xb2eba259U, + 0xe4963972U, 0x5bf8dfa3U, 0xa4f62952U, 0x4fe6daa9U, + 0xacfa2b56U, 0x9ad7a84dU, 0x0b80cb8bU, 0x2db54c98U, + 0x31a74b96U, 0x88cc2244U, 0x92dbaa49U, 0x90d82448U, + 0x199b4182U, 0xdd3d70e0U, 0xa2f3a651U, 0xc32cf9efU, + 0x75c15ab4U, 0xaf76e2d9U, 0xfa87b07dU, 0xd8b4366cU, + 0xe9137dfaU, 0xb762e4d5U, 0xccaa3366U, 0xdb38ffe3U, + 0x9d5d60c0U, 0x80c02040U, 0x20300810U, 0x161d8b0bU, + 0x65d95ebcU, 0x96ddab4bU, 0xe11f7ffeU, 0xfd0d78f0U, + 0xed157cf8U, 0xb0e82c58U, 0x41ef57aeU, 0x6fd6d2b9U, + 0x57f2dca5U, 0xa9736ddaU, 0xe5197efcU, 0x342e0d1aU, + 0x51f753a6U, 0x6a5f9435U, 0x2bb0c39bU, 0xa0f02850U, + 0x9cd2274eU, 0x1814060cU, 0x61df5fbeU, 0x8ec9ad47U, + 0x814f67ceU, 0x6dd55cb8U, 0x49e355aaU, 0x3dad4890U, + 0x38240e1cU, 0x55f152a4U, 0x8f46eac9U, 0x15914284U, + 0x71c75bb6U, 0x69d35dbaU, 0xc0a03060U, 0x7dcd58b0U, + 0x59fb51a2U, 0x79cb59b2U, 0xf0883c78U, 0x25b94e9cU, + 0xe0903870U, 0x121b8a09U, 0xd53172e4U, 0x50781428U, + 0xbb68e7d3U, 0x3faec691U, 0x5ffedea1U, 0x5dfd50a0U, + 0x02038e01U, 0x724b9239U, 0x63dcd1bfU, 0xc12f77eeU, + 0x764d933bU, 0x0983458aU, 0x527b9a29U, 0x1f9ece81U, + 0xb4ee2d5aU, 0x0c0a0306U, 0x955162c4U, 0xe293b671U, + 0xdeb1b96fU, 0xc6a5bf63U, 0x62539631U, 0xb1676bd6U, + 0xfc823f7eU, 0x1c12070eU, 0x486c1224U, 0x82c3ae41U, + 0x1d9d4080U, 0xd0b83468U, 0x0589468cU, 0xf8843e7cU, + 0x4be0dbabU, 0x1b98cf83U, 0x9752ecc5U, 0x1792cc85U, + 0x23bcc19fU, 0xbee1a15fU, 0x27bac09dU, 0x7fced6b1U, + 0x744e1d3aU, 0xf702f4f5U, 0x995b61c2U, 0xec9a3b76U, + 0x40601020U, 0x47ead8adU, 0xbd6d68d0U, 0xbae7a05dU, + 0xfe81b17fU, 0x283c0a14U, 0xb96b69d2U, 0xad756cd8U, + 0x39ab4992U, 0xcf26fae9U, 0xc52976ecU, 0x37a2c495U, + 0x42639e21U, 0x567d9b2bU, 0xa5796edcU, 0x5e71992fU, + 0x2fb6c299U, 0xe695b773U, 0x5a77982dU, 0xcaafbc65U, + 0x06058f03U, 0x2e398517U, 0x7c421f3eU, 0xea9fb475U, + 0xc72af8edU, 0x44661122U, 0xb8e42e5cU, 0x00000000U, + 0x94de254aU, 0x70481c38U, 0xa8fc2a54U, 0xf48e3d7aU, + 0x141e050aU, 0x21bf4f9eU, 0xf1077bf6U, 0xf28bb279U, + 0xc8ac3264U, 0x7a47903dU, 0x86c5af43U, 0x64561932U, + 0xb6eda35bU, 0xfb08f7f3U, 0xd13773e6U, 0x4e699d27U, + 0x547e152aU, 0xcd2574e8U, 0x9f5eeec1U, 0x0f86ca89U, + 0x46659f23U, 0x3c220f1eU, 0x6c5a1b36U, 0xc92375eaU, + 0x22338611U, 0x2a3f8415U, 0x4a6f9c25U, 0x35a14a94U, + 0x66559733U, 0x685c1a34U, 0x894365caU, 0xff0ef6f1U, + 0x9354edc7U, 0x24360912U, 0xd6bdbb6bU, 0x98d4264cU, + 0x362d831bU, 0x8b40ebcbU, 0xa17f6fdeU, 0x3e21811fU, + 0x10180408U, 0xb5616ad4U, 0x11974386U, 0x04060102U, + 0x5c72172eU, 0xa37ce1dfU, 0x26358713U, 0xf304f5f7U, + 0x0e098d07U, 0xab70e3dbU, 0x8cca2346U, 0x3a27801dU, + 0x0d854488U, 0x5874162cU, 0x854966ccU, 0x84c62142U, + 0xdf3efee1U, 0x73c4d5b7U, 0xc4a63162U, 0x43ecd9afU, + 0xd4be356aU, 0x60501830U, 0x080c0204U, 0x8d4564c8U, + 0xef16f2f9U, 0xe31cf1ffU, 0x45e956acU, 0x1394cd87U, + 0x322b8219U, 0x078ac88dU, 0xd2bbba69U, 0xe71af0fdU, + 0x9b58efc3U, 0x834ce9cfU, 0x874ae8cdU, 0xd334fde7U, + 0x1e11890fU, 0x7bc8d7b3U, 0x3ba8c793U, 0xee99b577U, + 0xaaffa455U, 0xbce22f5eU, 0x6e599537U, 0x4c6a1326U, + 0x2c3a0b16U, 0xeb10f3fbU, 0xa77ae0ddU, 0xdcb2376eU, +}; + +static const ulong32 T3[256] = { + 0xf5a653a7U, 0xd06bbbd3U, 0x6ebfd1e6U, 0x3bd9e271U, + 0xda67bdd0U, 0xcf8a45acU, 0xb3299a4dU, 0x0bf9f279U, + 0x9ce8743aU, 0x8c038fc9U, 0x417e3f91U, 0x32d7e5fcU, + 0x44783c1eU, 0x8f018e47U, 0xe54da854U, 0xa9ce67bdU, + 0x0f0a058cU, 0xf9ae57a5U, 0x01f5f47aU, 0x20cbebfbU, + 0x5791c663U, 0xb7da6db8U, 0xf453a7ddU, 0xc277b5d4U, + 0x64b3d7e5U, 0x8df67bb3U, 0xa43397c5U, 0xa3c261beU, + 0xd19e4fa9U, 0x171a0d88U, 0x2830180cU, 0xebb259a2U, + 0x96e47239U, 0xf85ba3dfU, 0xf6a45229U, 0xe64fa9daU, + 0xfaac562bU, 0xd79a4da8U, 0x800b8bcbU, 0xb52d984cU, + 0xa731964bU, 0xcc884422U, 0xdb9249aaU, 0xd8904824U, + 0x9b198241U, 0x3ddde070U, 0xf3a251a6U, 0x2cc3eff9U, + 0xc175b45aU, 0x76afd9e2U, 0x87fa7db0U, 0xb4d86c36U, + 0x13e9fa7dU, 0x62b7d5e4U, 0xaacc6633U, 0x38dbe3ffU, + 0x5d9dc060U, 0xc0804020U, 0x30201008U, 0x1d160b8bU, + 0xd965bc5eU, 0xdd964babU, 0x1fe1fe7fU, 0x0dfdf078U, + 0x15edf87cU, 0xe8b0582cU, 0xef41ae57U, 0xd66fb9d2U, + 0xf257a5dcU, 0x73a9da6dU, 0x19e5fc7eU, 0x2e341a0dU, + 0xf751a653U, 0x5f6a3594U, 0xb02b9bc3U, 0xf0a05028U, + 0xd29c4e27U, 0x14180c06U, 0xdf61be5fU, 0xc98e47adU, + 0x4f81ce67U, 0xd56db85cU, 0xe349aa55U, 0xad3d9048U, + 0x24381c0eU, 0xf155a452U, 0x468fc9eaU, 0x91158442U, + 0xc771b65bU, 0xd369ba5dU, 0xa0c06030U, 0xcd7db058U, + 0xfb59a251U, 0xcb79b259U, 0x88f0783cU, 0xb9259c4eU, + 0x90e07038U, 0x1b12098aU, 0x31d5e472U, 0x78502814U, + 0x68bbd3e7U, 0xae3f91c6U, 0xfe5fa1deU, 0xfd5da050U, + 0x0302018eU, 0x4b723992U, 0xdc63bfd1U, 0x2fc1ee77U, + 0x4d763b93U, 0x83098a45U, 0x7b52299aU, 0x9e1f81ceU, + 0xeeb45a2dU, 0x0a0c0603U, 0x5195c462U, 0x93e271b6U, + 0xb1de6fb9U, 0xa5c663bfU, 0x53623196U, 0x67b1d66bU, + 0x82fc7e3fU, 0x121c0e07U, 0x6c482412U, 0xc38241aeU, + 0x9d1d8040U, 0xb8d06834U, 0x89058c46U, 0x84f87c3eU, + 0xe04babdbU, 0x981b83cfU, 0x5297c5ecU, 0x921785ccU, + 0xbc239fc1U, 0xe1be5fa1U, 0xba279dc0U, 0xce7fb1d6U, + 0x4e743a1dU, 0x02f7f5f4U, 0x5b99c261U, 0x9aec763bU, + 0x60402010U, 0xea47add8U, 0x6dbdd068U, 0xe7ba5da0U, + 0x81fe7fb1U, 0x3c28140aU, 0x6bb9d269U, 0x75add86cU, + 0xab399249U, 0x26cfe9faU, 0x29c5ec76U, 0xa23795c4U, + 0x6342219eU, 0x7d562b9bU, 0x79a5dc6eU, 0x715e2f99U, + 0xb62f99c2U, 0x95e673b7U, 0x775a2d98U, 0xafca65bcU, + 0x0506038fU, 0x392e1785U, 0x427c3e1fU, 0x9fea75b4U, + 0x2ac7edf8U, 0x66442211U, 0xe4b85c2eU, 0x00000000U, + 0xde944a25U, 0x4870381cU, 0xfca8542aU, 0x8ef47a3dU, + 0x1e140a05U, 0xbf219e4fU, 0x07f1f67bU, 0x8bf279b2U, + 0xacc86432U, 0x477a3d90U, 0xc58643afU, 0x56643219U, + 0xedb65ba3U, 0x08fbf3f7U, 0x37d1e673U, 0x694e279dU, + 0x7e542a15U, 0x25cde874U, 0x5e9fc1eeU, 0x860f89caU, + 0x6546239fU, 0x223c1e0fU, 0x5a6c361bU, 0x23c9ea75U, + 0x33221186U, 0x3f2a1584U, 0x6f4a259cU, 0xa135944aU, + 0x55663397U, 0x5c68341aU, 0x4389ca65U, 0x0efff1f6U, + 0x5493c7edU, 0x36241209U, 0xbdd66bbbU, 0xd4984c26U, + 0x2d361b83U, 0x408bcbebU, 0x7fa1de6fU, 0x213e1f81U, + 0x18100804U, 0x61b5d46aU, 0x97118643U, 0x06040201U, + 0x725c2e17U, 0x7ca3dfe1U, 0x35261387U, 0x04f3f7f5U, + 0x090e078dU, 0x70abdbe3U, 0xca8c4623U, 0x273a1d80U, + 0x850d8844U, 0x74582c16U, 0x4985cc66U, 0xc6844221U, + 0x3edfe1feU, 0xc473b7d5U, 0xa6c46231U, 0xec43afd9U, + 0xbed46a35U, 0x50603018U, 0x0c080402U, 0x458dc864U, + 0x16eff9f2U, 0x1ce3fff1U, 0xe945ac56U, 0x941387cdU, + 0x2b321982U, 0x8a078dc8U, 0xbbd269baU, 0x1ae7fdf0U, + 0x589bc3efU, 0x4c83cfe9U, 0x4a87cde8U, 0x34d3e7fdU, + 0x111e0f89U, 0xc87bb3d7U, 0xa83b93c7U, 0x99ee77b5U, + 0xffaa55a4U, 0xe2bc5e2fU, 0x596e3795U, 0x6a4c2613U, + 0x3a2c160bU, 0x10ebfbf3U, 0x7aa7dde0U, 0xb2dc6e37U, +}; + +static const ulong32 T4[256] = { + 0xa7a7a7a7U, 0xd3d3d3d3U, 0xe6e6e6e6U, 0x71717171U, + 0xd0d0d0d0U, 0xacacacacU, 0x4d4d4d4dU, 0x79797979U, + 0x3a3a3a3aU, 0xc9c9c9c9U, 0x91919191U, 0xfcfcfcfcU, + 0x1e1e1e1eU, 0x47474747U, 0x54545454U, 0xbdbdbdbdU, + 0x8c8c8c8cU, 0xa5a5a5a5U, 0x7a7a7a7aU, 0xfbfbfbfbU, + 0x63636363U, 0xb8b8b8b8U, 0xddddddddU, 0xd4d4d4d4U, + 0xe5e5e5e5U, 0xb3b3b3b3U, 0xc5c5c5c5U, 0xbebebebeU, + 0xa9a9a9a9U, 0x88888888U, 0x0c0c0c0cU, 0xa2a2a2a2U, + 0x39393939U, 0xdfdfdfdfU, 0x29292929U, 0xdadadadaU, + 0x2b2b2b2bU, 0xa8a8a8a8U, 0xcbcbcbcbU, 0x4c4c4c4cU, + 0x4b4b4b4bU, 0x22222222U, 0xaaaaaaaaU, 0x24242424U, + 0x41414141U, 0x70707070U, 0xa6a6a6a6U, 0xf9f9f9f9U, + 0x5a5a5a5aU, 0xe2e2e2e2U, 0xb0b0b0b0U, 0x36363636U, + 0x7d7d7d7dU, 0xe4e4e4e4U, 0x33333333U, 0xffffffffU, + 0x60606060U, 0x20202020U, 0x08080808U, 0x8b8b8b8bU, + 0x5e5e5e5eU, 0xababababU, 0x7f7f7f7fU, 0x78787878U, + 0x7c7c7c7cU, 0x2c2c2c2cU, 0x57575757U, 0xd2d2d2d2U, + 0xdcdcdcdcU, 0x6d6d6d6dU, 0x7e7e7e7eU, 0x0d0d0d0dU, + 0x53535353U, 0x94949494U, 0xc3c3c3c3U, 0x28282828U, + 0x27272727U, 0x06060606U, 0x5f5f5f5fU, 0xadadadadU, + 0x67676767U, 0x5c5c5c5cU, 0x55555555U, 0x48484848U, + 0x0e0e0e0eU, 0x52525252U, 0xeaeaeaeaU, 0x42424242U, + 0x5b5b5b5bU, 0x5d5d5d5dU, 0x30303030U, 0x58585858U, + 0x51515151U, 0x59595959U, 0x3c3c3c3cU, 0x4e4e4e4eU, + 0x38383838U, 0x8a8a8a8aU, 0x72727272U, 0x14141414U, + 0xe7e7e7e7U, 0xc6c6c6c6U, 0xdedededeU, 0x50505050U, + 0x8e8e8e8eU, 0x92929292U, 0xd1d1d1d1U, 0x77777777U, + 0x93939393U, 0x45454545U, 0x9a9a9a9aU, 0xcecececeU, + 0x2d2d2d2dU, 0x03030303U, 0x62626262U, 0xb6b6b6b6U, + 0xb9b9b9b9U, 0xbfbfbfbfU, 0x96969696U, 0x6b6b6b6bU, + 0x3f3f3f3fU, 0x07070707U, 0x12121212U, 0xaeaeaeaeU, + 0x40404040U, 0x34343434U, 0x46464646U, 0x3e3e3e3eU, + 0xdbdbdbdbU, 0xcfcfcfcfU, 0xececececU, 0xccccccccU, + 0xc1c1c1c1U, 0xa1a1a1a1U, 0xc0c0c0c0U, 0xd6d6d6d6U, + 0x1d1d1d1dU, 0xf4f4f4f4U, 0x61616161U, 0x3b3b3b3bU, + 0x10101010U, 0xd8d8d8d8U, 0x68686868U, 0xa0a0a0a0U, + 0xb1b1b1b1U, 0x0a0a0a0aU, 0x69696969U, 0x6c6c6c6cU, + 0x49494949U, 0xfafafafaU, 0x76767676U, 0xc4c4c4c4U, + 0x9e9e9e9eU, 0x9b9b9b9bU, 0x6e6e6e6eU, 0x99999999U, + 0xc2c2c2c2U, 0xb7b7b7b7U, 0x98989898U, 0xbcbcbcbcU, + 0x8f8f8f8fU, 0x85858585U, 0x1f1f1f1fU, 0xb4b4b4b4U, + 0xf8f8f8f8U, 0x11111111U, 0x2e2e2e2eU, 0x00000000U, + 0x25252525U, 0x1c1c1c1cU, 0x2a2a2a2aU, 0x3d3d3d3dU, + 0x05050505U, 0x4f4f4f4fU, 0x7b7b7b7bU, 0xb2b2b2b2U, + 0x32323232U, 0x90909090U, 0xafafafafU, 0x19191919U, + 0xa3a3a3a3U, 0xf7f7f7f7U, 0x73737373U, 0x9d9d9d9dU, + 0x15151515U, 0x74747474U, 0xeeeeeeeeU, 0xcacacacaU, + 0x9f9f9f9fU, 0x0f0f0f0fU, 0x1b1b1b1bU, 0x75757575U, + 0x86868686U, 0x84848484U, 0x9c9c9c9cU, 0x4a4a4a4aU, + 0x97979797U, 0x1a1a1a1aU, 0x65656565U, 0xf6f6f6f6U, + 0xededededU, 0x09090909U, 0xbbbbbbbbU, 0x26262626U, + 0x83838383U, 0xebebebebU, 0x6f6f6f6fU, 0x81818181U, + 0x04040404U, 0x6a6a6a6aU, 0x43434343U, 0x01010101U, + 0x17171717U, 0xe1e1e1e1U, 0x87878787U, 0xf5f5f5f5U, + 0x8d8d8d8dU, 0xe3e3e3e3U, 0x23232323U, 0x80808080U, + 0x44444444U, 0x16161616U, 0x66666666U, 0x21212121U, + 0xfefefefeU, 0xd5d5d5d5U, 0x31313131U, 0xd9d9d9d9U, + 0x35353535U, 0x18181818U, 0x02020202U, 0x64646464U, + 0xf2f2f2f2U, 0xf1f1f1f1U, 0x56565656U, 0xcdcdcdcdU, + 0x82828282U, 0xc8c8c8c8U, 0xbabababaU, 0xf0f0f0f0U, + 0xefefefefU, 0xe9e9e9e9U, 0xe8e8e8e8U, 0xfdfdfdfdU, + 0x89898989U, 0xd7d7d7d7U, 0xc7c7c7c7U, 0xb5b5b5b5U, + 0xa4a4a4a4U, 0x2f2f2f2fU, 0x95959595U, 0x13131313U, + 0x0b0b0b0bU, 0xf3f3f3f3U, 0xe0e0e0e0U, 0x37373737U, +}; + +static const ulong32 T5[256] = { + 0x00000000U, 0x01020608U, 0x02040c10U, 0x03060a18U, + 0x04081820U, 0x050a1e28U, 0x060c1430U, 0x070e1238U, + 0x08103040U, 0x09123648U, 0x0a143c50U, 0x0b163a58U, + 0x0c182860U, 0x0d1a2e68U, 0x0e1c2470U, 0x0f1e2278U, + 0x10206080U, 0x11226688U, 0x12246c90U, 0x13266a98U, + 0x142878a0U, 0x152a7ea8U, 0x162c74b0U, 0x172e72b8U, + 0x183050c0U, 0x193256c8U, 0x1a345cd0U, 0x1b365ad8U, + 0x1c3848e0U, 0x1d3a4ee8U, 0x1e3c44f0U, 0x1f3e42f8U, + 0x2040c01dU, 0x2142c615U, 0x2244cc0dU, 0x2346ca05U, + 0x2448d83dU, 0x254ade35U, 0x264cd42dU, 0x274ed225U, + 0x2850f05dU, 0x2952f655U, 0x2a54fc4dU, 0x2b56fa45U, + 0x2c58e87dU, 0x2d5aee75U, 0x2e5ce46dU, 0x2f5ee265U, + 0x3060a09dU, 0x3162a695U, 0x3264ac8dU, 0x3366aa85U, + 0x3468b8bdU, 0x356abeb5U, 0x366cb4adU, 0x376eb2a5U, + 0x387090ddU, 0x397296d5U, 0x3a749ccdU, 0x3b769ac5U, + 0x3c7888fdU, 0x3d7a8ef5U, 0x3e7c84edU, 0x3f7e82e5U, + 0x40809d3aU, 0x41829b32U, 0x4284912aU, 0x43869722U, + 0x4488851aU, 0x458a8312U, 0x468c890aU, 0x478e8f02U, + 0x4890ad7aU, 0x4992ab72U, 0x4a94a16aU, 0x4b96a762U, + 0x4c98b55aU, 0x4d9ab352U, 0x4e9cb94aU, 0x4f9ebf42U, + 0x50a0fdbaU, 0x51a2fbb2U, 0x52a4f1aaU, 0x53a6f7a2U, + 0x54a8e59aU, 0x55aae392U, 0x56ace98aU, 0x57aeef82U, + 0x58b0cdfaU, 0x59b2cbf2U, 0x5ab4c1eaU, 0x5bb6c7e2U, + 0x5cb8d5daU, 0x5dbad3d2U, 0x5ebcd9caU, 0x5fbedfc2U, + 0x60c05d27U, 0x61c25b2fU, 0x62c45137U, 0x63c6573fU, + 0x64c84507U, 0x65ca430fU, 0x66cc4917U, 0x67ce4f1fU, + 0x68d06d67U, 0x69d26b6fU, 0x6ad46177U, 0x6bd6677fU, + 0x6cd87547U, 0x6dda734fU, 0x6edc7957U, 0x6fde7f5fU, + 0x70e03da7U, 0x71e23bafU, 0x72e431b7U, 0x73e637bfU, + 0x74e82587U, 0x75ea238fU, 0x76ec2997U, 0x77ee2f9fU, + 0x78f00de7U, 0x79f20befU, 0x7af401f7U, 0x7bf607ffU, + 0x7cf815c7U, 0x7dfa13cfU, 0x7efc19d7U, 0x7ffe1fdfU, + 0x801d2774U, 0x811f217cU, 0x82192b64U, 0x831b2d6cU, + 0x84153f54U, 0x8517395cU, 0x86113344U, 0x8713354cU, + 0x880d1734U, 0x890f113cU, 0x8a091b24U, 0x8b0b1d2cU, + 0x8c050f14U, 0x8d07091cU, 0x8e010304U, 0x8f03050cU, + 0x903d47f4U, 0x913f41fcU, 0x92394be4U, 0x933b4decU, + 0x94355fd4U, 0x953759dcU, 0x963153c4U, 0x973355ccU, + 0x982d77b4U, 0x992f71bcU, 0x9a297ba4U, 0x9b2b7dacU, + 0x9c256f94U, 0x9d27699cU, 0x9e216384U, 0x9f23658cU, + 0xa05de769U, 0xa15fe161U, 0xa259eb79U, 0xa35bed71U, + 0xa455ff49U, 0xa557f941U, 0xa651f359U, 0xa753f551U, + 0xa84dd729U, 0xa94fd121U, 0xaa49db39U, 0xab4bdd31U, + 0xac45cf09U, 0xad47c901U, 0xae41c319U, 0xaf43c511U, + 0xb07d87e9U, 0xb17f81e1U, 0xb2798bf9U, 0xb37b8df1U, + 0xb4759fc9U, 0xb57799c1U, 0xb67193d9U, 0xb77395d1U, + 0xb86db7a9U, 0xb96fb1a1U, 0xba69bbb9U, 0xbb6bbdb1U, + 0xbc65af89U, 0xbd67a981U, 0xbe61a399U, 0xbf63a591U, + 0xc09dba4eU, 0xc19fbc46U, 0xc299b65eU, 0xc39bb056U, + 0xc495a26eU, 0xc597a466U, 0xc691ae7eU, 0xc793a876U, + 0xc88d8a0eU, 0xc98f8c06U, 0xca89861eU, 0xcb8b8016U, + 0xcc85922eU, 0xcd879426U, 0xce819e3eU, 0xcf839836U, + 0xd0bddaceU, 0xd1bfdcc6U, 0xd2b9d6deU, 0xd3bbd0d6U, + 0xd4b5c2eeU, 0xd5b7c4e6U, 0xd6b1cefeU, 0xd7b3c8f6U, + 0xd8adea8eU, 0xd9afec86U, 0xdaa9e69eU, 0xdbabe096U, + 0xdca5f2aeU, 0xdda7f4a6U, 0xdea1febeU, 0xdfa3f8b6U, + 0xe0dd7a53U, 0xe1df7c5bU, 0xe2d97643U, 0xe3db704bU, + 0xe4d56273U, 0xe5d7647bU, 0xe6d16e63U, 0xe7d3686bU, + 0xe8cd4a13U, 0xe9cf4c1bU, 0xeac94603U, 0xebcb400bU, + 0xecc55233U, 0xedc7543bU, 0xeec15e23U, 0xefc3582bU, + 0xf0fd1ad3U, 0xf1ff1cdbU, 0xf2f916c3U, 0xf3fb10cbU, + 0xf4f502f3U, 0xf5f704fbU, 0xf6f10ee3U, 0xf7f308ebU, + 0xf8ed2a93U, 0xf9ef2c9bU, 0xfae92683U, 0xfbeb208bU, + 0xfce532b3U, 0xfde734bbU, 0xfee13ea3U, 0xffe338abU, +}; + +/** + * The round constants. + */ +static const ulong32 rc[] = { + 0xa7d3e671U, 0xd0ac4d79U, 0x3ac991fcU, 0x1e4754bdU, + 0x8ca57afbU, 0x63b8ddd4U, 0xe5b3c5beU, 0xa9880ca2U, + 0x39df29daU, 0x2ba8cb4cU, 0x4b22aa24U, 0x4170a6f9U, + 0x5ae2b036U, 0x7de433ffU, 0x6020088bU, 0x5eab7f78U, + 0x7c2c57d2U, 0xdc6d7e0dU, 0x5394c328U, +}; + +#endif + + /** + Initialize the Anubis block cipher + @param key The symmetric key you wish to pass + @param keylen The key length in bytes + @param num_rounds The number of rounds desired (0 for default) + @param skey The key in as scheduled by this function. + @return CRYPT_OK if successful + */ +#ifdef LTC_CLEAN_STACK +static int _anubis_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey) +#else +int anubis_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey) +#endif +{ + int N, R, i, pos, r; + ulong32 kappa[MAX_N]; + ulong32 inter[MAX_N]; + ulong32 v, K0, K1, K2, K3; + + LTC_ARGCHK(key != NULL); + LTC_ARGCHK(skey != NULL); + + /* Valid sizes (in bytes) are 16, 20, 24, 28, 32, 36, and 40. */ + if ((keylen & 3) || (keylen < 16) || (keylen > 40)) { + return CRYPT_INVALID_KEYSIZE; + } + skey->anubis.keyBits = keylen*8; + + /* + * determine the N length parameter: + * (N.B. it is assumed that the key length is valid!) + */ + N = skey->anubis.keyBits >> 5; + + /* + * determine number of rounds from key size: + */ + skey->anubis.R = R = 8 + N; + + if (num_rounds != 0 && num_rounds != skey->anubis.R) { + return CRYPT_INVALID_ROUNDS; + } + + /* + * map cipher key to initial key state (mu): + */ + for (i = 0, pos = 0; i < N; i++, pos += 4) { + kappa[i] = + (key[pos ] << 24) ^ + (key[pos + 1] << 16) ^ + (key[pos + 2] << 8) ^ + (key[pos + 3] ); + } + + /* + * generate R + 1 round keys: + */ + for (r = 0; r <= R; r++) { + /* + * generate r-th round key K^r: + */ + K0 = T4[(kappa[N - 1] >> 24) & 0xff]; + K1 = T4[(kappa[N - 1] >> 16) & 0xff]; + K2 = T4[(kappa[N - 1] >> 8) & 0xff]; + K3 = T4[(kappa[N - 1] ) & 0xff]; + for (i = N - 2; i >= 0; i--) { + K0 = T4[(kappa[i] >> 24) & 0xff] ^ + (T5[(K0 >> 24) & 0xff] & 0xff000000U) ^ + (T5[(K0 >> 16) & 0xff] & 0x00ff0000U) ^ + (T5[(K0 >> 8) & 0xff] & 0x0000ff00U) ^ + (T5[(K0 ) & 0xff] & 0x000000ffU); + K1 = T4[(kappa[i] >> 16) & 0xff] ^ + (T5[(K1 >> 24) & 0xff] & 0xff000000U) ^ + (T5[(K1 >> 16) & 0xff] & 0x00ff0000U) ^ + (T5[(K1 >> 8) & 0xff] & 0x0000ff00U) ^ + (T5[(K1 ) & 0xff] & 0x000000ffU); + K2 = T4[(kappa[i] >> 8) & 0xff] ^ + (T5[(K2 >> 24) & 0xff] & 0xff000000U) ^ + (T5[(K2 >> 16) & 0xff] & 0x00ff0000U) ^ + (T5[(K2 >> 8) & 0xff] & 0x0000ff00U) ^ + (T5[(K2 ) & 0xff] & 0x000000ffU); + K3 = T4[(kappa[i] ) & 0xff] ^ + (T5[(K3 >> 24) & 0xff] & 0xff000000U) ^ + (T5[(K3 >> 16) & 0xff] & 0x00ff0000U) ^ + (T5[(K3 >> 8) & 0xff] & 0x0000ff00U) ^ + (T5[(K3 ) & 0xff] & 0x000000ffU); + } + /* + -- this is the code to use with the large U tables: + K0 = K1 = K2 = K3 = 0; + for (i = 0; i < N; i++) { + K0 ^= U[i][(kappa[i] >> 24) & 0xff]; + K1 ^= U[i][(kappa[i] >> 16) & 0xff]; + K2 ^= U[i][(kappa[i] >> 8) & 0xff]; + K3 ^= U[i][(kappa[i] ) & 0xff]; + } + */ + skey->anubis.roundKeyEnc[r][0] = K0; + skey->anubis.roundKeyEnc[r][1] = K1; + skey->anubis.roundKeyEnc[r][2] = K2; + skey->anubis.roundKeyEnc[r][3] = K3; + + /* + * compute kappa^{r+1} from kappa^r: + */ + if (r == R) { + break; + } + for (i = 0; i < N; i++) { + int j = i; + inter[i] = T0[(kappa[j--] >> 24) & 0xff]; if (j < 0) j = N - 1; + inter[i] ^= T1[(kappa[j--] >> 16) & 0xff]; if (j < 0) j = N - 1; + inter[i] ^= T2[(kappa[j--] >> 8) & 0xff]; if (j < 0) j = N - 1; + inter[i] ^= T3[(kappa[j ] ) & 0xff]; + } + kappa[0] = inter[0] ^ rc[r]; + for (i = 1; i < N; i++) { + kappa[i] = inter[i]; + } + } + + /* + * generate inverse key schedule: K'^0 = K^R, K'^R = K^0, K'^r = theta(K^{R-r}): + */ + for (i = 0; i < 4; i++) { + skey->anubis.roundKeyDec[0][i] = skey->anubis.roundKeyEnc[R][i]; + skey->anubis.roundKeyDec[R][i] = skey->anubis.roundKeyEnc[0][i]; + } + for (r = 1; r < R; r++) { + for (i = 0; i < 4; i++) { + v = skey->anubis.roundKeyEnc[R - r][i]; + skey->anubis.roundKeyDec[r][i] = + T0[T4[(v >> 24) & 0xff] & 0xff] ^ + T1[T4[(v >> 16) & 0xff] & 0xff] ^ + T2[T4[(v >> 8) & 0xff] & 0xff] ^ + T3[T4[(v ) & 0xff] & 0xff]; + } + } + + return CRYPT_OK; +} + +#ifdef LTC_CLEAN_STACK +int anubis_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey) +{ + int err; + err = _anubis_setup(key, keylen, num_rounds, skey); + burn_stack(sizeof(int) * 5 + sizeof(ulong32) * (MAX_N + MAX_N + 5)); + return err; +} +#endif + + +static void anubis_crypt(const unsigned char *plaintext, unsigned char *ciphertext, + ulong32 roundKey[18 + 1][4], int R) { + int i, pos, r; + ulong32 state[4]; + ulong32 inter[4]; + + /* + * map plaintext block to cipher state (mu) + * and add initial round key (sigma[K^0]): + */ + for (i = 0, pos = 0; i < 4; i++, pos += 4) { + state[i] = + (plaintext[pos ] << 24) ^ + (plaintext[pos + 1] << 16) ^ + (plaintext[pos + 2] << 8) ^ + (plaintext[pos + 3] ) ^ + roundKey[0][i]; + } + + /* + * R - 1 full rounds: + */ + for (r = 1; r < R; r++) { + inter[0] = + T0[(state[0] >> 24) & 0xff] ^ + T1[(state[1] >> 24) & 0xff] ^ + T2[(state[2] >> 24) & 0xff] ^ + T3[(state[3] >> 24) & 0xff] ^ + roundKey[r][0]; + inter[1] = + T0[(state[0] >> 16) & 0xff] ^ + T1[(state[1] >> 16) & 0xff] ^ + T2[(state[2] >> 16) & 0xff] ^ + T3[(state[3] >> 16) & 0xff] ^ + roundKey[r][1]; + inter[2] = + T0[(state[0] >> 8) & 0xff] ^ + T1[(state[1] >> 8) & 0xff] ^ + T2[(state[2] >> 8) & 0xff] ^ + T3[(state[3] >> 8) & 0xff] ^ + roundKey[r][2]; + inter[3] = + T0[(state[0] ) & 0xff] ^ + T1[(state[1] ) & 0xff] ^ + T2[(state[2] ) & 0xff] ^ + T3[(state[3] ) & 0xff] ^ + roundKey[r][3]; + state[0] = inter[0]; + state[1] = inter[1]; + state[2] = inter[2]; + state[3] = inter[3]; + } + + /* + * last round: + */ + inter[0] = + (T0[(state[0] >> 24) & 0xff] & 0xff000000U) ^ + (T1[(state[1] >> 24) & 0xff] & 0x00ff0000U) ^ + (T2[(state[2] >> 24) & 0xff] & 0x0000ff00U) ^ + (T3[(state[3] >> 24) & 0xff] & 0x000000ffU) ^ + roundKey[R][0]; + inter[1] = + (T0[(state[0] >> 16) & 0xff] & 0xff000000U) ^ + (T1[(state[1] >> 16) & 0xff] & 0x00ff0000U) ^ + (T2[(state[2] >> 16) & 0xff] & 0x0000ff00U) ^ + (T3[(state[3] >> 16) & 0xff] & 0x000000ffU) ^ + roundKey[R][1]; + inter[2] = + (T0[(state[0] >> 8) & 0xff] & 0xff000000U) ^ + (T1[(state[1] >> 8) & 0xff] & 0x00ff0000U) ^ + (T2[(state[2] >> 8) & 0xff] & 0x0000ff00U) ^ + (T3[(state[3] >> 8) & 0xff] & 0x000000ffU) ^ + roundKey[R][2]; + inter[3] = + (T0[(state[0] ) & 0xff] & 0xff000000U) ^ + (T1[(state[1] ) & 0xff] & 0x00ff0000U) ^ + (T2[(state[2] ) & 0xff] & 0x0000ff00U) ^ + (T3[(state[3] ) & 0xff] & 0x000000ffU) ^ + roundKey[R][3]; + + /* + * map cipher state to ciphertext block (mu^{-1}): + */ + for (i = 0, pos = 0; i < 4; i++, pos += 4) { + ulong32 w = inter[i]; + ciphertext[pos ] = (unsigned char)(w >> 24); + ciphertext[pos + 1] = (unsigned char)(w >> 16); + ciphertext[pos + 2] = (unsigned char)(w >> 8); + ciphertext[pos + 3] = (unsigned char)(w ); + } +} + +/** + Encrypts a block of text with Anubis + @param pt The input plaintext (16 bytes) + @param ct The output ciphertext (16 bytes) + @param skey The key as scheduled + @return CRYPT_OK if successful +*/ +int anubis_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key *skey) +{ + LTC_ARGCHK(pt != NULL); + LTC_ARGCHK(ct != NULL); + LTC_ARGCHK(skey != NULL); + anubis_crypt(pt, ct, skey->anubis.roundKeyEnc, skey->anubis.R); + return CRYPT_OK; +} + +/** + Decrypts a block of text with Anubis + @param ct The input ciphertext (16 bytes) + @param pt The output plaintext (16 bytes) + @param skey The key as scheduled + @return CRYPT_OK if successful +*/ +int anubis_ecb_decrypt(const unsigned char *ct, unsigned char *pt, symmetric_key *skey) +{ + LTC_ARGCHK(pt != NULL); + LTC_ARGCHK(ct != NULL); + LTC_ARGCHK(skey != NULL); + anubis_crypt(ct, pt, skey->anubis.roundKeyDec, skey->anubis.R); + return CRYPT_OK; +} + +/** + Performs a self-test of the Anubis block cipher + @return CRYPT_OK if functional, CRYPT_NOP if self-test has been disabled +*/ +int anubis_test(void) +{ +#if !defined(LTC_TEST) + return CRYPT_NOP; +#else + static const struct test { + int keylen; + unsigned char pt[16], ct[16], key[40]; + } tests[] = { +#ifndef ANUBIS_TWEAK + /**** ORIGINAL ANUBIS ****/ + /* 128 bit keys */ +{ + 16, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0xF0, 0x68, 0x60, 0xFC, 0x67, 0x30, 0xE8, 0x18, + 0xF1, 0x32, 0xC7, 0x8A, 0xF4, 0x13, 0x2A, 0xFE }, + { 0x80, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 } +}, { + 16, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0xA8, 0x66, 0x84, 0x80, 0x07, 0x74, 0x5C, 0x89, + 0xFC, 0x5E, 0xB5, 0xBA, 0xD4, 0xFE, 0x32, 0x6D }, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x01 } +}, + + /* 160-bit keys */ +{ + 20, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0xBD, 0x5E, 0x32, 0xBE, 0x51, 0x67, 0xA8, 0xE2, + 0x72, 0xD7, 0x95, 0x0F, 0x83, 0xC6, 0x8C, 0x31 }, + { 0x80, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00 } +}, { + 20, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0x4C, 0x1F, 0x86, 0x2E, 0x11, 0xEB, 0xCE, 0xEB, + 0xFE, 0xB9, 0x73, 0xC9, 0xDF, 0xEF, 0x7A, 0xDB }, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x01 } +}, + + /* 192-bit keys */ +{ + 24, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0x17, 0xAC, 0x57, 0x44, 0x9D, 0x59, 0x61, 0x66, + 0xD0, 0xC7, 0x9E, 0x04, 0x7C, 0xC7, 0x58, 0xF0 }, + { 0x80, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 } +}, { + 24, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0x71, 0x52, 0xB4, 0xEB, 0x1D, 0xAA, 0x36, 0xFD, + 0x57, 0x14, 0x5F, 0x57, 0x04, 0x9F, 0x70, 0x74 }, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x01 } +}, + + /* 224-bit keys */ +{ + 28, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0xA2, 0xF0, 0xA6, 0xB9, 0x17, 0x93, 0x2A, 0x3B, + 0xEF, 0x08, 0xE8, 0x7A, 0x58, 0xD6, 0xF8, 0x53 }, + { 0x80, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00 } +}, { + 28, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0xF0, 0xCA, 0xFC, 0x78, 0x8B, 0x4B, 0x4E, 0x53, + 0x8B, 0xC4, 0x32, 0x6A, 0xF5, 0xB9, 0x1B, 0x5F }, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x01 } +}, + + /* 256-bit keys */ +{ + 32, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0xE0, 0x86, 0xAC, 0x45, 0x6B, 0x3C, 0xE5, 0x13, + 0xED, 0xF5, 0xDF, 0xDD, 0xD6, 0x3B, 0x71, 0x93 }, + { 0x80, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 } +}, { + 32, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0x50, 0x01, 0xB9, 0xF5, 0x21, 0xC1, 0xC1, 0x29, + 0x00, 0xD5, 0xEC, 0x98, 0x2B, 0x9E, 0xE8, 0x21 }, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x01 } +}, + + /* 288-bit keys */ +{ + 36, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0xE8, 0xF4, 0xAF, 0x2B, 0x21, 0xA0, 0x87, 0x9B, + 0x41, 0x95, 0xB9, 0x71, 0x75, 0x79, 0x04, 0x7C }, + { 0x80, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00 } +}, { + 36, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0xE6, 0xA6, 0xA5, 0xBC, 0x8B, 0x63, 0x6F, 0xE2, + 0xBD, 0xA7, 0xA7, 0x53, 0xAB, 0x40, 0x22, 0xE0 }, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x01 } +}, + + /* 320-bit keys */ +{ + 40, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0x17, 0x04, 0xD7, 0x2C, 0xC6, 0x85, 0x76, 0x02, + 0x4B, 0xCC, 0x39, 0x80, 0xD8, 0x22, 0xEA, 0xA4 }, + { 0x80, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 } +}, { + 40, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0x7A, 0x41, 0xE6, 0x7D, 0x4F, 0xD8, 0x64, 0xF0, + 0x44, 0xA8, 0x3C, 0x73, 0x81, 0x7E, 0x53, 0xD8 }, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x01 } +} +#else + /**** Tweaked ANUBIS ****/ + /* 128 bit keys */ +{ + 16, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0xB8, 0x35, 0xBD, 0xC3, 0x34, 0x82, 0x9D, 0x83, + 0x71, 0xBF, 0xA3, 0x71, 0xE4, 0xB3, 0xC4, 0xFD }, + { 0x80, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 } +}, { + 16, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0xE6, 0x14, 0x1E, 0xAF, 0xEB, 0xE0, 0x59, 0x3C, + 0x48, 0xE1, 0xCD, 0xF2, 0x1B, 0xBA, 0xA1, 0x89 }, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x01 } +}, + + /* 160-bit keys */ +{ + 20, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0x97, 0x59, 0x79, 0x4B, 0x5C, 0xA0, 0x70, 0x73, + 0x24, 0xEF, 0xB3, 0x58, 0x67, 0xCA, 0xD4, 0xB3 }, + { 0x80, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00 } +}, { + 20, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0xB8, 0x0D, 0xFB, 0x9B, 0xE4, 0xA1, 0x58, 0x87, + 0xB3, 0x76, 0xD5, 0x02, 0x18, 0x95, 0xC1, 0x2E }, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x01 } +}, + + /* 192-bit keys */ +{ + 24, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0x7D, 0x62, 0x3B, 0x52, 0xC7, 0x4C, 0x64, 0xD8, + 0xEB, 0xC7, 0x2D, 0x57, 0x97, 0x85, 0x43, 0x8F }, + { 0x80, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 } +}, { + 24, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0xB1, 0x0A, 0x59, 0xDD, 0x5D, 0x5D, 0x8D, 0x67, + 0xEC, 0xEE, 0x4A, 0xC4, 0xBE, 0x4F, 0xA8, 0x4F }, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x01 } +}, + + /* 224-bit keys */ +{ + 28, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0x68, 0x9E, 0x05, 0x94, 0x6A, 0x94, 0x43, 0x8F, + 0xE7, 0x8E, 0x37, 0x3D, 0x24, 0x97, 0x92, 0xF5 }, + { 0x80, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00 } +}, { + 28, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0xDD, 0xB7, 0xB0, 0xB4, 0xE9, 0xB4, 0x9B, 0x9C, + 0x38, 0x20, 0x25, 0x0B, 0x47, 0xC2, 0x1F, 0x89 }, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x01 } +}, + + /* 256-bit keys */ +{ + 32, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0x96, 0x00, 0xF0, 0x76, 0x91, 0x69, 0x29, 0x87, + 0xF5, 0xE5, 0x97, 0xDB, 0xDB, 0xAF, 0x1B, 0x0A }, + { 0x80, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 } +}, { + 32, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0x69, 0x9C, 0xAF, 0xDD, 0x94, 0xC7, 0xBC, 0x60, + 0x44, 0xFE, 0x02, 0x05, 0x8A, 0x6E, 0xEF, 0xBD }, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x01 } +}, + + /* 288-bit keys */ +{ + 36, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0x0F, 0xC7, 0xA2, 0xC0, 0x11, 0x17, 0xAC, 0x43, + 0x52, 0x5E, 0xDF, 0x6C, 0xF3, 0x96, 0x33, 0x6C }, + { 0x80, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00 } +}, { + 36, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0xAD, 0x08, 0x4F, 0xED, 0x55, 0xA6, 0x94, 0x3E, + 0x7E, 0x5E, 0xED, 0x05, 0xA1, 0x9D, 0x41, 0xB4 }, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x01 } +}, + + /* 320-bit keys */ +{ + 40, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0xFE, 0xE2, 0x0E, 0x2A, 0x9D, 0xC5, 0x83, 0xBA, + 0xA3, 0xA6, 0xD6, 0xA6, 0xF2, 0xE8, 0x06, 0xA5 }, + { 0x80, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 } +}, { + 40, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0x86, 0x3D, 0xCC, 0x4A, 0x60, 0x34, 0x9C, 0x28, + 0xA7, 0xDA, 0xA4, 0x3B, 0x0A, 0xD7, 0xFD, 0xC7 }, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x01 } +} +#endif +}; + int x, y; + unsigned char buf[2][16]; + symmetric_key skey; + + for (x = 0; x < (int)(sizeof(tests)/sizeof(tests[0])); x++) { + anubis_setup(tests[x].key, tests[x].keylen, 0, &skey); + anubis_ecb_encrypt(tests[x].pt, buf[0], &skey); + anubis_ecb_decrypt(buf[0], buf[1], &skey); + if (XMEMCMP(buf[0], tests[x].ct, 16) || XMEMCMP(buf[1], tests[x].pt, 16)) { + return CRYPT_FAIL_TESTVECTOR; + } + + for (y = 0; y < 1000; y++) anubis_ecb_encrypt(buf[0], buf[0], &skey); + for (y = 0; y < 1000; y++) anubis_ecb_decrypt(buf[0], buf[0], &skey); + if (XMEMCMP(buf[0], tests[x].ct, 16)) { + return CRYPT_FAIL_TESTVECTOR; + } + + } + return CRYPT_OK; +#endif +} + +/** Terminate the context + @param skey The scheduled key +*/ +void anubis_done(symmetric_key *skey) +{ +} + +/** + Gets suitable key size + @param keysize [in/out] The length of the recommended key (in bytes). This function will store the suitable size back in this variable. + @return CRYPT_OK if the input key size is acceptable. +*/ +int anubis_keysize(int *keysize) +{ + LTC_ARGCHK(keysize != NULL); + if (*keysize >= 40) { + *keysize = 40; + } else if (*keysize >= 36) { + *keysize = 36; + } else if (*keysize >= 32) { + *keysize = 32; + } else if (*keysize >= 28) { + *keysize = 28; + } else if (*keysize >= 24) { + *keysize = 24; + } else if (*keysize >= 20) { + *keysize = 20; + } else if (*keysize >= 16) { + *keysize = 16; + } else { + return CRYPT_INVALID_KEYSIZE; + } + return CRYPT_OK; +} + +#endif + + +/* $Source: /cvs/libtom/libtomcrypt/src/ciphers/anubis.c,v $ */ +/* $Revision: 1.15 $ */ +/* $Date: 2006/11/15 12:41:28 $ */ diff --git a/libtomcrypt/src/ciphers/blowfish.c b/libtomcrypt/src/ciphers/blowfish.c new file mode 100644 index 0000000..ae8945f --- /dev/null +++ b/libtomcrypt/src/ciphers/blowfish.c @@ -0,0 +1,594 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +/** + @file blowfish.c + Implementation of the Blowfish block cipher, Tom St Denis +*/ +#include "tomcrypt.h" + +#ifdef BLOWFISH + +const struct ltc_cipher_descriptor blowfish_desc = +{ + "blowfish", + 0, + 8, 56, 8, 16, + &blowfish_setup, + &blowfish_ecb_encrypt, + &blowfish_ecb_decrypt, + &blowfish_test, + &blowfish_done, + &blowfish_keysize, + NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL +}; + +static const ulong32 ORIG_P[16 + 2] = { + 0x243F6A88UL, 0x85A308D3UL, 0x13198A2EUL, 0x03707344UL, + 0xA4093822UL, 0x299F31D0UL, 0x082EFA98UL, 0xEC4E6C89UL, + 0x452821E6UL, 0x38D01377UL, 0xBE5466CFUL, 0x34E90C6CUL, + 0xC0AC29B7UL, 0xC97C50DDUL, 0x3F84D5B5UL, 0xB5470917UL, + 0x9216D5D9UL, 0x8979FB1BUL +}; + +static const ulong32 ORIG_S[4][256] = { + { 0xD1310BA6UL, 0x98DFB5ACUL, 0x2FFD72DBUL, 0xD01ADFB7UL, + 0xB8E1AFEDUL, 0x6A267E96UL, 0xBA7C9045UL, 0xF12C7F99UL, + 0x24A19947UL, 0xB3916CF7UL, 0x0801F2E2UL, 0x858EFC16UL, + 0x636920D8UL, 0x71574E69UL, 0xA458FEA3UL, 0xF4933D7EUL, + 0x0D95748FUL, 0x728EB658UL, 0x718BCD58UL, 0x82154AEEUL, + 0x7B54A41DUL, 0xC25A59B5UL, 0x9C30D539UL, 0x2AF26013UL, + 0xC5D1B023UL, 0x286085F0UL, 0xCA417918UL, 0xB8DB38EFUL, + 0x8E79DCB0UL, 0x603A180EUL, 0x6C9E0E8BUL, 0xB01E8A3EUL, + 0xD71577C1UL, 0xBD314B27UL, 0x78AF2FDAUL, 0x55605C60UL, + 0xE65525F3UL, 0xAA55AB94UL, 0x57489862UL, 0x63E81440UL, + 0x55CA396AUL, 0x2AAB10B6UL, 0xB4CC5C34UL, 0x1141E8CEUL, + 0xA15486AFUL, 0x7C72E993UL, 0xB3EE1411UL, 0x636FBC2AUL, + 0x2BA9C55DUL, 0x741831F6UL, 0xCE5C3E16UL, 0x9B87931EUL, + 0xAFD6BA33UL, 0x6C24CF5CUL, 0x7A325381UL, 0x28958677UL, + 0x3B8F4898UL, 0x6B4BB9AFUL, 0xC4BFE81BUL, 0x66282193UL, + 0x61D809CCUL, 0xFB21A991UL, 0x487CAC60UL, 0x5DEC8032UL, + 0xEF845D5DUL, 0xE98575B1UL, 0xDC262302UL, 0xEB651B88UL, + 0x23893E81UL, 0xD396ACC5UL, 0x0F6D6FF3UL, 0x83F44239UL, + 0x2E0B4482UL, 0xA4842004UL, 0x69C8F04AUL, 0x9E1F9B5EUL, + 0x21C66842UL, 0xF6E96C9AUL, 0x670C9C61UL, 0xABD388F0UL, + 0x6A51A0D2UL, 0xD8542F68UL, 0x960FA728UL, 0xAB5133A3UL, + 0x6EEF0B6CUL, 0x137A3BE4UL, 0xBA3BF050UL, 0x7EFB2A98UL, + 0xA1F1651DUL, 0x39AF0176UL, 0x66CA593EUL, 0x82430E88UL, + 0x8CEE8619UL, 0x456F9FB4UL, 0x7D84A5C3UL, 0x3B8B5EBEUL, + 0xE06F75D8UL, 0x85C12073UL, 0x401A449FUL, 0x56C16AA6UL, + 0x4ED3AA62UL, 0x363F7706UL, 0x1BFEDF72UL, 0x429B023DUL, + 0x37D0D724UL, 0xD00A1248UL, 0xDB0FEAD3UL, 0x49F1C09BUL, + 0x075372C9UL, 0x80991B7BUL, 0x25D479D8UL, 0xF6E8DEF7UL, + 0xE3FE501AUL, 0xB6794C3BUL, 0x976CE0BDUL, 0x04C006BAUL, + 0xC1A94FB6UL, 0x409F60C4UL, 0x5E5C9EC2UL, 0x196A2463UL, + 0x68FB6FAFUL, 0x3E6C53B5UL, 0x1339B2EBUL, 0x3B52EC6FUL, + 0x6DFC511FUL, 0x9B30952CUL, 0xCC814544UL, 0xAF5EBD09UL, + 0xBEE3D004UL, 0xDE334AFDUL, 0x660F2807UL, 0x192E4BB3UL, + 0xC0CBA857UL, 0x45C8740FUL, 0xD20B5F39UL, 0xB9D3FBDBUL, + 0x5579C0BDUL, 0x1A60320AUL, 0xD6A100C6UL, 0x402C7279UL, + 0x679F25FEUL, 0xFB1FA3CCUL, 0x8EA5E9F8UL, 0xDB3222F8UL, + 0x3C7516DFUL, 0xFD616B15UL, 0x2F501EC8UL, 0xAD0552ABUL, + 0x323DB5FAUL, 0xFD238760UL, 0x53317B48UL, 0x3E00DF82UL, + 0x9E5C57BBUL, 0xCA6F8CA0UL, 0x1A87562EUL, 0xDF1769DBUL, + 0xD542A8F6UL, 0x287EFFC3UL, 0xAC6732C6UL, 0x8C4F5573UL, + 0x695B27B0UL, 0xBBCA58C8UL, 0xE1FFA35DUL, 0xB8F011A0UL, + 0x10FA3D98UL, 0xFD2183B8UL, 0x4AFCB56CUL, 0x2DD1D35BUL, + 0x9A53E479UL, 0xB6F84565UL, 0xD28E49BCUL, 0x4BFB9790UL, + 0xE1DDF2DAUL, 0xA4CB7E33UL, 0x62FB1341UL, 0xCEE4C6E8UL, + 0xEF20CADAUL, 0x36774C01UL, 0xD07E9EFEUL, 0x2BF11FB4UL, + 0x95DBDA4DUL, 0xAE909198UL, 0xEAAD8E71UL, 0x6B93D5A0UL, + 0xD08ED1D0UL, 0xAFC725E0UL, 0x8E3C5B2FUL, 0x8E7594B7UL, + 0x8FF6E2FBUL, 0xF2122B64UL, 0x8888B812UL, 0x900DF01CUL, + 0x4FAD5EA0UL, 0x688FC31CUL, 0xD1CFF191UL, 0xB3A8C1ADUL, + 0x2F2F2218UL, 0xBE0E1777UL, 0xEA752DFEUL, 0x8B021FA1UL, + 0xE5A0CC0FUL, 0xB56F74E8UL, 0x18ACF3D6UL, 0xCE89E299UL, + 0xB4A84FE0UL, 0xFD13E0B7UL, 0x7CC43B81UL, 0xD2ADA8D9UL, + 0x165FA266UL, 0x80957705UL, 0x93CC7314UL, 0x211A1477UL, + 0xE6AD2065UL, 0x77B5FA86UL, 0xC75442F5UL, 0xFB9D35CFUL, + 0xEBCDAF0CUL, 0x7B3E89A0UL, 0xD6411BD3UL, 0xAE1E7E49UL, + 0x00250E2DUL, 0x2071B35EUL, 0x226800BBUL, 0x57B8E0AFUL, + 0x2464369BUL, 0xF009B91EUL, 0x5563911DUL, 0x59DFA6AAUL, + 0x78C14389UL, 0xD95A537FUL, 0x207D5BA2UL, 0x02E5B9C5UL, + 0x83260376UL, 0x6295CFA9UL, 0x11C81968UL, 0x4E734A41UL, + 0xB3472DCAUL, 0x7B14A94AUL, 0x1B510052UL, 0x9A532915UL, + 0xD60F573FUL, 0xBC9BC6E4UL, 0x2B60A476UL, 0x81E67400UL, + 0x08BA6FB5UL, 0x571BE91FUL, 0xF296EC6BUL, 0x2A0DD915UL, + 0xB6636521UL, 0xE7B9F9B6UL, 0xFF34052EUL, 0xC5855664UL, + 0x53B02D5DUL, 0xA99F8FA1UL, 0x08BA4799UL, 0x6E85076AUL }, + { 0x4B7A70E9UL, 0xB5B32944UL, 0xDB75092EUL, 0xC4192623UL, + 0xAD6EA6B0UL, 0x49A7DF7DUL, 0x9CEE60B8UL, 0x8FEDB266UL, + 0xECAA8C71UL, 0x699A17FFUL, 0x5664526CUL, 0xC2B19EE1UL, + 0x193602A5UL, 0x75094C29UL, 0xA0591340UL, 0xE4183A3EUL, + 0x3F54989AUL, 0x5B429D65UL, 0x6B8FE4D6UL, 0x99F73FD6UL, + 0xA1D29C07UL, 0xEFE830F5UL, 0x4D2D38E6UL, 0xF0255DC1UL, + 0x4CDD2086UL, 0x8470EB26UL, 0x6382E9C6UL, 0x021ECC5EUL, + 0x09686B3FUL, 0x3EBAEFC9UL, 0x3C971814UL, 0x6B6A70A1UL, + 0x687F3584UL, 0x52A0E286UL, 0xB79C5305UL, 0xAA500737UL, + 0x3E07841CUL, 0x7FDEAE5CUL, 0x8E7D44ECUL, 0x5716F2B8UL, + 0xB03ADA37UL, 0xF0500C0DUL, 0xF01C1F04UL, 0x0200B3FFUL, + 0xAE0CF51AUL, 0x3CB574B2UL, 0x25837A58UL, 0xDC0921BDUL, + 0xD19113F9UL, 0x7CA92FF6UL, 0x94324773UL, 0x22F54701UL, + 0x3AE5E581UL, 0x37C2DADCUL, 0xC8B57634UL, 0x9AF3DDA7UL, + 0xA9446146UL, 0x0FD0030EUL, 0xECC8C73EUL, 0xA4751E41UL, + 0xE238CD99UL, 0x3BEA0E2FUL, 0x3280BBA1UL, 0x183EB331UL, + 0x4E548B38UL, 0x4F6DB908UL, 0x6F420D03UL, 0xF60A04BFUL, + 0x2CB81290UL, 0x24977C79UL, 0x5679B072UL, 0xBCAF89AFUL, + 0xDE9A771FUL, 0xD9930810UL, 0xB38BAE12UL, 0xDCCF3F2EUL, + 0x5512721FUL, 0x2E6B7124UL, 0x501ADDE6UL, 0x9F84CD87UL, + 0x7A584718UL, 0x7408DA17UL, 0xBC9F9ABCUL, 0xE94B7D8CUL, + 0xEC7AEC3AUL, 0xDB851DFAUL, 0x63094366UL, 0xC464C3D2UL, + 0xEF1C1847UL, 0x3215D908UL, 0xDD433B37UL, 0x24C2BA16UL, + 0x12A14D43UL, 0x2A65C451UL, 0x50940002UL, 0x133AE4DDUL, + 0x71DFF89EUL, 0x10314E55UL, 0x81AC77D6UL, 0x5F11199BUL, + 0x043556F1UL, 0xD7A3C76BUL, 0x3C11183BUL, 0x5924A509UL, + 0xF28FE6EDUL, 0x97F1FBFAUL, 0x9EBABF2CUL, 0x1E153C6EUL, + 0x86E34570UL, 0xEAE96FB1UL, 0x860E5E0AUL, 0x5A3E2AB3UL, + 0x771FE71CUL, 0x4E3D06FAUL, 0x2965DCB9UL, 0x99E71D0FUL, + 0x803E89D6UL, 0x5266C825UL, 0x2E4CC978UL, 0x9C10B36AUL, + 0xC6150EBAUL, 0x94E2EA78UL, 0xA5FC3C53UL, 0x1E0A2DF4UL, + 0xF2F74EA7UL, 0x361D2B3DUL, 0x1939260FUL, 0x19C27960UL, + 0x5223A708UL, 0xF71312B6UL, 0xEBADFE6EUL, 0xEAC31F66UL, + 0xE3BC4595UL, 0xA67BC883UL, 0xB17F37D1UL, 0x018CFF28UL, + 0xC332DDEFUL, 0xBE6C5AA5UL, 0x65582185UL, 0x68AB9802UL, + 0xEECEA50FUL, 0xDB2F953BUL, 0x2AEF7DADUL, 0x5B6E2F84UL, + 0x1521B628UL, 0x29076170UL, 0xECDD4775UL, 0x619F1510UL, + 0x13CCA830UL, 0xEB61BD96UL, 0x0334FE1EUL, 0xAA0363CFUL, + 0xB5735C90UL, 0x4C70A239UL, 0xD59E9E0BUL, 0xCBAADE14UL, + 0xEECC86BCUL, 0x60622CA7UL, 0x9CAB5CABUL, 0xB2F3846EUL, + 0x648B1EAFUL, 0x19BDF0CAUL, 0xA02369B9UL, 0x655ABB50UL, + 0x40685A32UL, 0x3C2AB4B3UL, 0x319EE9D5UL, 0xC021B8F7UL, + 0x9B540B19UL, 0x875FA099UL, 0x95F7997EUL, 0x623D7DA8UL, + 0xF837889AUL, 0x97E32D77UL, 0x11ED935FUL, 0x16681281UL, + 0x0E358829UL, 0xC7E61FD6UL, 0x96DEDFA1UL, 0x7858BA99UL, + 0x57F584A5UL, 0x1B227263UL, 0x9B83C3FFUL, 0x1AC24696UL, + 0xCDB30AEBUL, 0x532E3054UL, 0x8FD948E4UL, 0x6DBC3128UL, + 0x58EBF2EFUL, 0x34C6FFEAUL, 0xFE28ED61UL, 0xEE7C3C73UL, + 0x5D4A14D9UL, 0xE864B7E3UL, 0x42105D14UL, 0x203E13E0UL, + 0x45EEE2B6UL, 0xA3AAABEAUL, 0xDB6C4F15UL, 0xFACB4FD0UL, + 0xC742F442UL, 0xEF6ABBB5UL, 0x654F3B1DUL, 0x41CD2105UL, + 0xD81E799EUL, 0x86854DC7UL, 0xE44B476AUL, 0x3D816250UL, + 0xCF62A1F2UL, 0x5B8D2646UL, 0xFC8883A0UL, 0xC1C7B6A3UL, + 0x7F1524C3UL, 0x69CB7492UL, 0x47848A0BUL, 0x5692B285UL, + 0x095BBF00UL, 0xAD19489DUL, 0x1462B174UL, 0x23820E00UL, + 0x58428D2AUL, 0x0C55F5EAUL, 0x1DADF43EUL, 0x233F7061UL, + 0x3372F092UL, 0x8D937E41UL, 0xD65FECF1UL, 0x6C223BDBUL, + 0x7CDE3759UL, 0xCBEE7460UL, 0x4085F2A7UL, 0xCE77326EUL, + 0xA6078084UL, 0x19F8509EUL, 0xE8EFD855UL, 0x61D99735UL, + 0xA969A7AAUL, 0xC50C06C2UL, 0x5A04ABFCUL, 0x800BCADCUL, + 0x9E447A2EUL, 0xC3453484UL, 0xFDD56705UL, 0x0E1E9EC9UL, + 0xDB73DBD3UL, 0x105588CDUL, 0x675FDA79UL, 0xE3674340UL, + 0xC5C43465UL, 0x713E38D8UL, 0x3D28F89EUL, 0xF16DFF20UL, + 0x153E21E7UL, 0x8FB03D4AUL, 0xE6E39F2BUL, 0xDB83ADF7UL }, + { 0xE93D5A68UL, 0x948140F7UL, 0xF64C261CUL, 0x94692934UL, + 0x411520F7UL, 0x7602D4F7UL, 0xBCF46B2EUL, 0xD4A20068UL, + 0xD4082471UL, 0x3320F46AUL, 0x43B7D4B7UL, 0x500061AFUL, + 0x1E39F62EUL, 0x97244546UL, 0x14214F74UL, 0xBF8B8840UL, + 0x4D95FC1DUL, 0x96B591AFUL, 0x70F4DDD3UL, 0x66A02F45UL, + 0xBFBC09ECUL, 0x03BD9785UL, 0x7FAC6DD0UL, 0x31CB8504UL, + 0x96EB27B3UL, 0x55FD3941UL, 0xDA2547E6UL, 0xABCA0A9AUL, + 0x28507825UL, 0x530429F4UL, 0x0A2C86DAUL, 0xE9B66DFBUL, + 0x68DC1462UL, 0xD7486900UL, 0x680EC0A4UL, 0x27A18DEEUL, + 0x4F3FFEA2UL, 0xE887AD8CUL, 0xB58CE006UL, 0x7AF4D6B6UL, + 0xAACE1E7CUL, 0xD3375FECUL, 0xCE78A399UL, 0x406B2A42UL, + 0x20FE9E35UL, 0xD9F385B9UL, 0xEE39D7ABUL, 0x3B124E8BUL, + 0x1DC9FAF7UL, 0x4B6D1856UL, 0x26A36631UL, 0xEAE397B2UL, + 0x3A6EFA74UL, 0xDD5B4332UL, 0x6841E7F7UL, 0xCA7820FBUL, + 0xFB0AF54EUL, 0xD8FEB397UL, 0x454056ACUL, 0xBA489527UL, + 0x55533A3AUL, 0x20838D87UL, 0xFE6BA9B7UL, 0xD096954BUL, + 0x55A867BCUL, 0xA1159A58UL, 0xCCA92963UL, 0x99E1DB33UL, + 0xA62A4A56UL, 0x3F3125F9UL, 0x5EF47E1CUL, 0x9029317CUL, + 0xFDF8E802UL, 0x04272F70UL, 0x80BB155CUL, 0x05282CE3UL, + 0x95C11548UL, 0xE4C66D22UL, 0x48C1133FUL, 0xC70F86DCUL, + 0x07F9C9EEUL, 0x41041F0FUL, 0x404779A4UL, 0x5D886E17UL, + 0x325F51EBUL, 0xD59BC0D1UL, 0xF2BCC18FUL, 0x41113564UL, + 0x257B7834UL, 0x602A9C60UL, 0xDFF8E8A3UL, 0x1F636C1BUL, + 0x0E12B4C2UL, 0x02E1329EUL, 0xAF664FD1UL, 0xCAD18115UL, + 0x6B2395E0UL, 0x333E92E1UL, 0x3B240B62UL, 0xEEBEB922UL, + 0x85B2A20EUL, 0xE6BA0D99UL, 0xDE720C8CUL, 0x2DA2F728UL, + 0xD0127845UL, 0x95B794FDUL, 0x647D0862UL, 0xE7CCF5F0UL, + 0x5449A36FUL, 0x877D48FAUL, 0xC39DFD27UL, 0xF33E8D1EUL, + 0x0A476341UL, 0x992EFF74UL, 0x3A6F6EABUL, 0xF4F8FD37UL, + 0xA812DC60UL, 0xA1EBDDF8UL, 0x991BE14CUL, 0xDB6E6B0DUL, + 0xC67B5510UL, 0x6D672C37UL, 0x2765D43BUL, 0xDCD0E804UL, + 0xF1290DC7UL, 0xCC00FFA3UL, 0xB5390F92UL, 0x690FED0BUL, + 0x667B9FFBUL, 0xCEDB7D9CUL, 0xA091CF0BUL, 0xD9155EA3UL, + 0xBB132F88UL, 0x515BAD24UL, 0x7B9479BFUL, 0x763BD6EBUL, + 0x37392EB3UL, 0xCC115979UL, 0x8026E297UL, 0xF42E312DUL, + 0x6842ADA7UL, 0xC66A2B3BUL, 0x12754CCCUL, 0x782EF11CUL, + 0x6A124237UL, 0xB79251E7UL, 0x06A1BBE6UL, 0x4BFB6350UL, + 0x1A6B1018UL, 0x11CAEDFAUL, 0x3D25BDD8UL, 0xE2E1C3C9UL, + 0x44421659UL, 0x0A121386UL, 0xD90CEC6EUL, 0xD5ABEA2AUL, + 0x64AF674EUL, 0xDA86A85FUL, 0xBEBFE988UL, 0x64E4C3FEUL, + 0x9DBC8057UL, 0xF0F7C086UL, 0x60787BF8UL, 0x6003604DUL, + 0xD1FD8346UL, 0xF6381FB0UL, 0x7745AE04UL, 0xD736FCCCUL, + 0x83426B33UL, 0xF01EAB71UL, 0xB0804187UL, 0x3C005E5FUL, + 0x77A057BEUL, 0xBDE8AE24UL, 0x55464299UL, 0xBF582E61UL, + 0x4E58F48FUL, 0xF2DDFDA2UL, 0xF474EF38UL, 0x8789BDC2UL, + 0x5366F9C3UL, 0xC8B38E74UL, 0xB475F255UL, 0x46FCD9B9UL, + 0x7AEB2661UL, 0x8B1DDF84UL, 0x846A0E79UL, 0x915F95E2UL, + 0x466E598EUL, 0x20B45770UL, 0x8CD55591UL, 0xC902DE4CUL, + 0xB90BACE1UL, 0xBB8205D0UL, 0x11A86248UL, 0x7574A99EUL, + 0xB77F19B6UL, 0xE0A9DC09UL, 0x662D09A1UL, 0xC4324633UL, + 0xE85A1F02UL, 0x09F0BE8CUL, 0x4A99A025UL, 0x1D6EFE10UL, + 0x1AB93D1DUL, 0x0BA5A4DFUL, 0xA186F20FUL, 0x2868F169UL, + 0xDCB7DA83UL, 0x573906FEUL, 0xA1E2CE9BUL, 0x4FCD7F52UL, + 0x50115E01UL, 0xA70683FAUL, 0xA002B5C4UL, 0x0DE6D027UL, + 0x9AF88C27UL, 0x773F8641UL, 0xC3604C06UL, 0x61A806B5UL, + 0xF0177A28UL, 0xC0F586E0UL, 0x006058AAUL, 0x30DC7D62UL, + 0x11E69ED7UL, 0x2338EA63UL, 0x53C2DD94UL, 0xC2C21634UL, + 0xBBCBEE56UL, 0x90BCB6DEUL, 0xEBFC7DA1UL, 0xCE591D76UL, + 0x6F05E409UL, 0x4B7C0188UL, 0x39720A3DUL, 0x7C927C24UL, + 0x86E3725FUL, 0x724D9DB9UL, 0x1AC15BB4UL, 0xD39EB8FCUL, + 0xED545578UL, 0x08FCA5B5UL, 0xD83D7CD3UL, 0x4DAD0FC4UL, + 0x1E50EF5EUL, 0xB161E6F8UL, 0xA28514D9UL, 0x6C51133CUL, + 0x6FD5C7E7UL, 0x56E14EC4UL, 0x362ABFCEUL, 0xDDC6C837UL, + 0xD79A3234UL, 0x92638212UL, 0x670EFA8EUL, 0x406000E0UL }, + { 0x3A39CE37UL, 0xD3FAF5CFUL, 0xABC27737UL, 0x5AC52D1BUL, + 0x5CB0679EUL, 0x4FA33742UL, 0xD3822740UL, 0x99BC9BBEUL, + 0xD5118E9DUL, 0xBF0F7315UL, 0xD62D1C7EUL, 0xC700C47BUL, + 0xB78C1B6BUL, 0x21A19045UL, 0xB26EB1BEUL, 0x6A366EB4UL, + 0x5748AB2FUL, 0xBC946E79UL, 0xC6A376D2UL, 0x6549C2C8UL, + 0x530FF8EEUL, 0x468DDE7DUL, 0xD5730A1DUL, 0x4CD04DC6UL, + 0x2939BBDBUL, 0xA9BA4650UL, 0xAC9526E8UL, 0xBE5EE304UL, + 0xA1FAD5F0UL, 0x6A2D519AUL, 0x63EF8CE2UL, 0x9A86EE22UL, + 0xC089C2B8UL, 0x43242EF6UL, 0xA51E03AAUL, 0x9CF2D0A4UL, + 0x83C061BAUL, 0x9BE96A4DUL, 0x8FE51550UL, 0xBA645BD6UL, + 0x2826A2F9UL, 0xA73A3AE1UL, 0x4BA99586UL, 0xEF5562E9UL, + 0xC72FEFD3UL, 0xF752F7DAUL, 0x3F046F69UL, 0x77FA0A59UL, + 0x80E4A915UL, 0x87B08601UL, 0x9B09E6ADUL, 0x3B3EE593UL, + 0xE990FD5AUL, 0x9E34D797UL, 0x2CF0B7D9UL, 0x022B8B51UL, + 0x96D5AC3AUL, 0x017DA67DUL, 0xD1CF3ED6UL, 0x7C7D2D28UL, + 0x1F9F25CFUL, 0xADF2B89BUL, 0x5AD6B472UL, 0x5A88F54CUL, + 0xE029AC71UL, 0xE019A5E6UL, 0x47B0ACFDUL, 0xED93FA9BUL, + 0xE8D3C48DUL, 0x283B57CCUL, 0xF8D56629UL, 0x79132E28UL, + 0x785F0191UL, 0xED756055UL, 0xF7960E44UL, 0xE3D35E8CUL, + 0x15056DD4UL, 0x88F46DBAUL, 0x03A16125UL, 0x0564F0BDUL, + 0xC3EB9E15UL, 0x3C9057A2UL, 0x97271AECUL, 0xA93A072AUL, + 0x1B3F6D9BUL, 0x1E6321F5UL, 0xF59C66FBUL, 0x26DCF319UL, + 0x7533D928UL, 0xB155FDF5UL, 0x03563482UL, 0x8ABA3CBBUL, + 0x28517711UL, 0xC20AD9F8UL, 0xABCC5167UL, 0xCCAD925FUL, + 0x4DE81751UL, 0x3830DC8EUL, 0x379D5862UL, 0x9320F991UL, + 0xEA7A90C2UL, 0xFB3E7BCEUL, 0x5121CE64UL, 0x774FBE32UL, + 0xA8B6E37EUL, 0xC3293D46UL, 0x48DE5369UL, 0x6413E680UL, + 0xA2AE0810UL, 0xDD6DB224UL, 0x69852DFDUL, 0x09072166UL, + 0xB39A460AUL, 0x6445C0DDUL, 0x586CDECFUL, 0x1C20C8AEUL, + 0x5BBEF7DDUL, 0x1B588D40UL, 0xCCD2017FUL, 0x6BB4E3BBUL, + 0xDDA26A7EUL, 0x3A59FF45UL, 0x3E350A44UL, 0xBCB4CDD5UL, + 0x72EACEA8UL, 0xFA6484BBUL, 0x8D6612AEUL, 0xBF3C6F47UL, + 0xD29BE463UL, 0x542F5D9EUL, 0xAEC2771BUL, 0xF64E6370UL, + 0x740E0D8DUL, 0xE75B1357UL, 0xF8721671UL, 0xAF537D5DUL, + 0x4040CB08UL, 0x4EB4E2CCUL, 0x34D2466AUL, 0x0115AF84UL, + 0xE1B00428UL, 0x95983A1DUL, 0x06B89FB4UL, 0xCE6EA048UL, + 0x6F3F3B82UL, 0x3520AB82UL, 0x011A1D4BUL, 0x277227F8UL, + 0x611560B1UL, 0xE7933FDCUL, 0xBB3A792BUL, 0x344525BDUL, + 0xA08839E1UL, 0x51CE794BUL, 0x2F32C9B7UL, 0xA01FBAC9UL, + 0xE01CC87EUL, 0xBCC7D1F6UL, 0xCF0111C3UL, 0xA1E8AAC7UL, + 0x1A908749UL, 0xD44FBD9AUL, 0xD0DADECBUL, 0xD50ADA38UL, + 0x0339C32AUL, 0xC6913667UL, 0x8DF9317CUL, 0xE0B12B4FUL, + 0xF79E59B7UL, 0x43F5BB3AUL, 0xF2D519FFUL, 0x27D9459CUL, + 0xBF97222CUL, 0x15E6FC2AUL, 0x0F91FC71UL, 0x9B941525UL, + 0xFAE59361UL, 0xCEB69CEBUL, 0xC2A86459UL, 0x12BAA8D1UL, + 0xB6C1075EUL, 0xE3056A0CUL, 0x10D25065UL, 0xCB03A442UL, + 0xE0EC6E0EUL, 0x1698DB3BUL, 0x4C98A0BEUL, 0x3278E964UL, + 0x9F1F9532UL, 0xE0D392DFUL, 0xD3A0342BUL, 0x8971F21EUL, + 0x1B0A7441UL, 0x4BA3348CUL, 0xC5BE7120UL, 0xC37632D8UL, + 0xDF359F8DUL, 0x9B992F2EUL, 0xE60B6F47UL, 0x0FE3F11DUL, + 0xE54CDA54UL, 0x1EDAD891UL, 0xCE6279CFUL, 0xCD3E7E6FUL, + 0x1618B166UL, 0xFD2C1D05UL, 0x848FD2C5UL, 0xF6FB2299UL, + 0xF523F357UL, 0xA6327623UL, 0x93A83531UL, 0x56CCCD02UL, + 0xACF08162UL, 0x5A75EBB5UL, 0x6E163697UL, 0x88D273CCUL, + 0xDE966292UL, 0x81B949D0UL, 0x4C50901BUL, 0x71C65614UL, + 0xE6C6C7BDUL, 0x327A140AUL, 0x45E1D006UL, 0xC3F27B9AUL, + 0xC9AA53FDUL, 0x62A80F00UL, 0xBB25BFE2UL, 0x35BDD2F6UL, + 0x71126905UL, 0xB2040222UL, 0xB6CBCF7CUL, 0xCD769C2BUL, + 0x53113EC0UL, 0x1640E3D3UL, 0x38ABBD60UL, 0x2547ADF0UL, + 0xBA38209CUL, 0xF746CE76UL, 0x77AFA1C5UL, 0x20756060UL, + 0x85CBFE4EUL, 0x8AE88DD8UL, 0x7AAAF9B0UL, 0x4CF9AA7EUL, + 0x1948C25CUL, 0x02FB8A8CUL, 0x01C36AE4UL, 0xD6EBE1F9UL, + 0x90D4F869UL, 0xA65CDEA0UL, 0x3F09252DUL, 0xC208E69FUL, + 0xB74E6132UL, 0xCE77E25BUL, 0x578FDFE3UL, 0x3AC372E6UL } +}; + + /** + Initialize the Blowfish block cipher + @param key The symmetric key you wish to pass + @param keylen The key length in bytes + @param num_rounds The number of rounds desired (0 for default) + @param skey The key in as scheduled by this function. + @return CRYPT_OK if successful + */ +int blowfish_setup(const unsigned char *key, int keylen, int num_rounds, + symmetric_key *skey) +{ + ulong32 x, y, z, A; + unsigned char B[8]; + + LTC_ARGCHK(key != NULL); + LTC_ARGCHK(skey != NULL); + + /* check key length */ + if (keylen < 8 || keylen > 56) { + return CRYPT_INVALID_KEYSIZE; + } + + /* check rounds */ + if (num_rounds != 0 && num_rounds != 16) { + return CRYPT_INVALID_ROUNDS; + } + + /* load in key bytes (Supplied by David Hopwood) */ + for (x = y = 0; x < 18; x++) { + A = 0; + for (z = 0; z < 4; z++) { + A = (A << 8) | ((ulong32)key[y++] & 255); + if (y == (ulong32)keylen) { + y = 0; + } + } + skey->blowfish.K[x] = ORIG_P[x] ^ A; + } + + /* copy sboxes */ + for (x = 0; x < 4; x++) { + for (y = 0; y < 256; y++) { + skey->blowfish.S[x][y] = ORIG_S[x][y]; + } + } + + /* encrypt K array */ + for (x = 0; x < 8; x++) { + B[x] = 0; + } + + for (x = 0; x < 18; x += 2) { + /* encrypt it */ + blowfish_ecb_encrypt(B, B, skey); + /* copy it */ + LOAD32H(skey->blowfish.K[x], &B[0]); + LOAD32H(skey->blowfish.K[x+1], &B[4]); + } + + /* encrypt S array */ + for (x = 0; x < 4; x++) { + for (y = 0; y < 256; y += 2) { + /* encrypt it */ + blowfish_ecb_encrypt(B, B, skey); + /* copy it */ + LOAD32H(skey->blowfish.S[x][y], &B[0]); + LOAD32H(skey->blowfish.S[x][y+1], &B[4]); + } + } + +#ifdef LTC_CLEAN_STACK + zeromem(B, sizeof(B)); +#endif + + return CRYPT_OK; +} + +#ifndef __GNUC__ +#define F(x) ((S1[byte(x,3)] + S2[byte(x,2)]) ^ S3[byte(x,1)]) + S4[byte(x,0)] +#else +#define F(x) ((skey->blowfish.S[0][byte(x,3)] + skey->blowfish.S[1][byte(x,2)]) ^ skey->blowfish.S[2][byte(x,1)]) + skey->blowfish.S[3][byte(x,0)] +#endif + +/** + Encrypts a block of text with Blowfish + @param pt The input plaintext (8 bytes) + @param ct The output ciphertext (8 bytes) + @param skey The key as scheduled + @return CRYPT_OK if successful +*/ +#ifdef LTC_CLEAN_STACK +static int _blowfish_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key *skey) +#else +int blowfish_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key *skey) +#endif +{ + ulong32 L, R; + int r; +#ifndef __GNUC__ + ulong32 *S1, *S2, *S3, *S4; +#endif + + LTC_ARGCHK(pt != NULL); + LTC_ARGCHK(ct != NULL); + LTC_ARGCHK(skey != NULL); + +#ifndef __GNUC__ + S1 = skey->blowfish.S[0]; + S2 = skey->blowfish.S[1]; + S3 = skey->blowfish.S[2]; + S4 = skey->blowfish.S[3]; +#endif + + /* load it */ + LOAD32H(L, &pt[0]); + LOAD32H(R, &pt[4]); + + /* do 16 rounds */ + for (r = 0; r < 16; ) { + L ^= skey->blowfish.K[r++]; R ^= F(L); + R ^= skey->blowfish.K[r++]; L ^= F(R); + L ^= skey->blowfish.K[r++]; R ^= F(L); + R ^= skey->blowfish.K[r++]; L ^= F(R); + } + + /* last keying */ + R ^= skey->blowfish.K[17]; + L ^= skey->blowfish.K[16]; + + /* store */ + STORE32H(R, &ct[0]); + STORE32H(L, &ct[4]); + + return CRYPT_OK; +} + +#ifdef LTC_CLEAN_STACK +int blowfish_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key *skey) +{ + int err = _blowfish_ecb_encrypt(pt, ct, skey); + burn_stack(sizeof(ulong32) * 2 + sizeof(int)); + return err; +} +#endif + +/** + Decrypts a block of text with Blowfish + @param ct The input ciphertext (8 bytes) + @param pt The output plaintext (8 bytes) + @param skey The key as scheduled + @return CRYPT_OK if successful +*/ +#ifdef LTC_CLEAN_STACK +static int _blowfish_ecb_decrypt(const unsigned char *ct, unsigned char *pt, symmetric_key *skey) +#else +int blowfish_ecb_decrypt(const unsigned char *ct, unsigned char *pt, symmetric_key *skey) +#endif +{ + ulong32 L, R; + int r; +#ifndef __GNUC__ + ulong32 *S1, *S2, *S3, *S4; +#endif + + LTC_ARGCHK(pt != NULL); + LTC_ARGCHK(ct != NULL); + LTC_ARGCHK(skey != NULL); + +#ifndef __GNUC__ + S1 = skey->blowfish.S[0]; + S2 = skey->blowfish.S[1]; + S3 = skey->blowfish.S[2]; + S4 = skey->blowfish.S[3]; +#endif + + /* load it */ + LOAD32H(R, &ct[0]); + LOAD32H(L, &ct[4]); + + /* undo last keying */ + R ^= skey->blowfish.K[17]; + L ^= skey->blowfish.K[16]; + + /* do 16 rounds */ + for (r = 15; r > 0; ) { + L ^= F(R); R ^= skey->blowfish.K[r--]; + R ^= F(L); L ^= skey->blowfish.K[r--]; + L ^= F(R); R ^= skey->blowfish.K[r--]; + R ^= F(L); L ^= skey->blowfish.K[r--]; + } + + /* store */ + STORE32H(L, &pt[0]); + STORE32H(R, &pt[4]); + return CRYPT_OK; +} + +#ifdef LTC_CLEAN_STACK +int blowfish_ecb_decrypt(const unsigned char *ct, unsigned char *pt, symmetric_key *skey) +{ + int err = _blowfish_ecb_decrypt(ct, pt, skey); + burn_stack(sizeof(ulong32) * 2 + sizeof(int)); + return err; +} +#endif + + +/** + Performs a self-test of the Blowfish block cipher + @return CRYPT_OK if functional, CRYPT_NOP if self-test has been disabled +*/ +int blowfish_test(void) +{ + #ifndef LTC_TEST + return CRYPT_NOP; + #else + int err; + symmetric_key key; + static const struct { + unsigned char key[8], pt[8], ct[8]; + } tests[] = { + { + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00}, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00}, + { 0x4E, 0xF9, 0x97, 0x45, 0x61, 0x98, 0xDD, 0x78} + }, + { + { 0xFF, 0xFF, 0xFF, 0xFF, 0xFF, 0xFF, 0xFF, 0xFF}, + { 0xFF, 0xFF, 0xFF, 0xFF, 0xFF, 0xFF, 0xFF, 0xFF}, + { 0x51, 0x86, 0x6F, 0xD5, 0xB8, 0x5E, 0xCB, 0x8A} + }, + { + { 0x30, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00}, + { 0x10, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x01}, + { 0x7D, 0x85, 0x6F, 0x9A, 0x61, 0x30, 0x63, 0xF2} + } + }; + unsigned char tmp[2][8]; + int x, y; + + for (x = 0; x < (int)(sizeof(tests) / sizeof(tests[0])); x++) { + /* setup key */ + if ((err = blowfish_setup(tests[x].key, 8, 16, &key)) != CRYPT_OK) { + return err; + } + + /* encrypt and decrypt */ + blowfish_ecb_encrypt(tests[x].pt, tmp[0], &key); + blowfish_ecb_decrypt(tmp[0], tmp[1], &key); + + /* compare */ + if ((XMEMCMP(tmp[0], tests[x].ct, 8) != 0) || (XMEMCMP(tmp[1], tests[x].pt, 8) != 0)) { + return CRYPT_FAIL_TESTVECTOR; + } + + /* now see if we can encrypt all zero bytes 1000 times, decrypt and come back where we started */ + for (y = 0; y < 8; y++) tmp[0][y] = 0; + for (y = 0; y < 1000; y++) blowfish_ecb_encrypt(tmp[0], tmp[0], &key); + for (y = 0; y < 1000; y++) blowfish_ecb_decrypt(tmp[0], tmp[0], &key); + for (y = 0; y < 8; y++) if (tmp[0][y] != 0) return CRYPT_FAIL_TESTVECTOR; + } + return CRYPT_OK; + #endif +} + +/** Terminate the context + @param skey The scheduled key +*/ +void blowfish_done(symmetric_key *skey) +{ +} + +/** + Gets suitable key size + @param keysize [in/out] The length of the recommended key (in bytes). This function will store the suitable size back in this variable. + @return CRYPT_OK if the input key size is acceptable. +*/ +int blowfish_keysize(int *keysize) +{ + LTC_ARGCHK(keysize != NULL); + + if (*keysize < 8) { + return CRYPT_INVALID_KEYSIZE; + } else if (*keysize > 56) { + *keysize = 56; + } + return CRYPT_OK; +} + +#endif + + +/* $Source: /cvs/libtom/libtomcrypt/src/ciphers/blowfish.c,v $ */ +/* $Revision: 1.12 $ */ +/* $Date: 2006/11/08 23:01:06 $ */ diff --git a/libtomcrypt/src/ciphers/cast5.c b/libtomcrypt/src/ciphers/cast5.c new file mode 100644 index 0000000..eba39da --- /dev/null +++ b/libtomcrypt/src/ciphers/cast5.c @@ -0,0 +1,720 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ + + /** + @file cast5.c + Implementation of CAST5 (RFC 2144) by Tom St Denis + */ +#include "tomcrypt.h" + +#ifdef CAST5 + +const struct ltc_cipher_descriptor cast5_desc = { + "cast5", + 15, + 5, 16, 8, 16, + &cast5_setup, + &cast5_ecb_encrypt, + &cast5_ecb_decrypt, + &cast5_test, + &cast5_done, + &cast5_keysize, + NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL +}; + +static const ulong32 S1[256] = { +0x30fb40d4UL, 0x9fa0ff0bUL, 0x6beccd2fUL, 0x3f258c7aUL, 0x1e213f2fUL, 0x9c004dd3UL, +0x6003e540UL, 0xcf9fc949UL, 0xbfd4af27UL, 0x88bbbdb5UL, 0xe2034090UL, 0x98d09675UL, +0x6e63a0e0UL, 0x15c361d2UL, 0xc2e7661dUL, 0x22d4ff8eUL, 0x28683b6fUL, 0xc07fd059UL, +0xff2379c8UL, 0x775f50e2UL, 0x43c340d3UL, 0xdf2f8656UL, 0x887ca41aUL, 0xa2d2bd2dUL, +0xa1c9e0d6UL, 0x346c4819UL, 0x61b76d87UL, 0x22540f2fUL, 0x2abe32e1UL, 0xaa54166bUL, +0x22568e3aUL, 0xa2d341d0UL, 0x66db40c8UL, 0xa784392fUL, 0x004dff2fUL, 0x2db9d2deUL, +0x97943facUL, 0x4a97c1d8UL, 0x527644b7UL, 0xb5f437a7UL, 0xb82cbaefUL, 0xd751d159UL, +0x6ff7f0edUL, 0x5a097a1fUL, 0x827b68d0UL, 0x90ecf52eUL, 0x22b0c054UL, 0xbc8e5935UL, +0x4b6d2f7fUL, 0x50bb64a2UL, 0xd2664910UL, 0xbee5812dUL, 0xb7332290UL, 0xe93b159fUL, +0xb48ee411UL, 0x4bff345dUL, 0xfd45c240UL, 0xad31973fUL, 0xc4f6d02eUL, 0x55fc8165UL, +0xd5b1caadUL, 0xa1ac2daeUL, 0xa2d4b76dUL, 0xc19b0c50UL, 0x882240f2UL, 0x0c6e4f38UL, +0xa4e4bfd7UL, 0x4f5ba272UL, 0x564c1d2fUL, 0xc59c5319UL, 0xb949e354UL, 0xb04669feUL, +0xb1b6ab8aUL, 0xc71358ddUL, 0x6385c545UL, 0x110f935dUL, 0x57538ad5UL, 0x6a390493UL, +0xe63d37e0UL, 0x2a54f6b3UL, 0x3a787d5fUL, 0x6276a0b5UL, 0x19a6fcdfUL, 0x7a42206aUL, +0x29f9d4d5UL, 0xf61b1891UL, 0xbb72275eUL, 0xaa508167UL, 0x38901091UL, 0xc6b505ebUL, +0x84c7cb8cUL, 0x2ad75a0fUL, 0x874a1427UL, 0xa2d1936bUL, 0x2ad286afUL, 0xaa56d291UL, +0xd7894360UL, 0x425c750dUL, 0x93b39e26UL, 0x187184c9UL, 0x6c00b32dUL, 0x73e2bb14UL, +0xa0bebc3cUL, 0x54623779UL, 0x64459eabUL, 0x3f328b82UL, 0x7718cf82UL, 0x59a2cea6UL, +0x04ee002eUL, 0x89fe78e6UL, 0x3fab0950UL, 0x325ff6c2UL, 0x81383f05UL, 0x6963c5c8UL, +0x76cb5ad6UL, 0xd49974c9UL, 0xca180dcfUL, 0x380782d5UL, 0xc7fa5cf6UL, 0x8ac31511UL, +0x35e79e13UL, 0x47da91d0UL, 0xf40f9086UL, 0xa7e2419eUL, 0x31366241UL, 0x051ef495UL, +0xaa573b04UL, 0x4a805d8dUL, 0x548300d0UL, 0x00322a3cUL, 0xbf64cddfUL, 0xba57a68eUL, +0x75c6372bUL, 0x50afd341UL, 0xa7c13275UL, 0x915a0bf5UL, 0x6b54bfabUL, 0x2b0b1426UL, +0xab4cc9d7UL, 0x449ccd82UL, 0xf7fbf265UL, 0xab85c5f3UL, 0x1b55db94UL, 0xaad4e324UL, +0xcfa4bd3fUL, 0x2deaa3e2UL, 0x9e204d02UL, 0xc8bd25acUL, 0xeadf55b3UL, 0xd5bd9e98UL, +0xe31231b2UL, 0x2ad5ad6cUL, 0x954329deUL, 0xadbe4528UL, 0xd8710f69UL, 0xaa51c90fUL, +0xaa786bf6UL, 0x22513f1eUL, 0xaa51a79bUL, 0x2ad344ccUL, 0x7b5a41f0UL, 0xd37cfbadUL, +0x1b069505UL, 0x41ece491UL, 0xb4c332e6UL, 0x032268d4UL, 0xc9600accUL, 0xce387e6dUL, +0xbf6bb16cUL, 0x6a70fb78UL, 0x0d03d9c9UL, 0xd4df39deUL, 0xe01063daUL, 0x4736f464UL, +0x5ad328d8UL, 0xb347cc96UL, 0x75bb0fc3UL, 0x98511bfbUL, 0x4ffbcc35UL, 0xb58bcf6aUL, +0xe11f0abcUL, 0xbfc5fe4aUL, 0xa70aec10UL, 0xac39570aUL, 0x3f04442fUL, 0x6188b153UL, +0xe0397a2eUL, 0x5727cb79UL, 0x9ceb418fUL, 0x1cacd68dUL, 0x2ad37c96UL, 0x0175cb9dUL, +0xc69dff09UL, 0xc75b65f0UL, 0xd9db40d8UL, 0xec0e7779UL, 0x4744ead4UL, 0xb11c3274UL, +0xdd24cb9eUL, 0x7e1c54bdUL, 0xf01144f9UL, 0xd2240eb1UL, 0x9675b3fdUL, 0xa3ac3755UL, +0xd47c27afUL, 0x51c85f4dUL, 0x56907596UL, 0xa5bb15e6UL, 0x580304f0UL, 0xca042cf1UL, +0x011a37eaUL, 0x8dbfaadbUL, 0x35ba3e4aUL, 0x3526ffa0UL, 0xc37b4d09UL, 0xbc306ed9UL, +0x98a52666UL, 0x5648f725UL, 0xff5e569dUL, 0x0ced63d0UL, 0x7c63b2cfUL, 0x700b45e1UL, +0xd5ea50f1UL, 0x85a92872UL, 0xaf1fbda7UL, 0xd4234870UL, 0xa7870bf3UL, 0x2d3b4d79UL, +0x42e04198UL, 0x0cd0ede7UL, 0x26470db8UL, 0xf881814cUL, 0x474d6ad7UL, 0x7c0c5e5cUL, +0xd1231959UL, 0x381b7298UL, 0xf5d2f4dbUL, 0xab838653UL, 0x6e2f1e23UL, 0x83719c9eUL, +0xbd91e046UL, 0x9a56456eUL, 0xdc39200cUL, 0x20c8c571UL, 0x962bda1cUL, 0xe1e696ffUL, +0xb141ab08UL, 0x7cca89b9UL, 0x1a69e783UL, 0x02cc4843UL, 0xa2f7c579UL, 0x429ef47dUL, +0x427b169cUL, 0x5ac9f049UL, 0xdd8f0f00UL, 0x5c8165bfUL}; + +static const ulong32 S2[256] = { +0x1f201094UL, 0xef0ba75bUL, 0x69e3cf7eUL, 0x393f4380UL, 0xfe61cf7aUL, 0xeec5207aUL, +0x55889c94UL, 0x72fc0651UL, 0xada7ef79UL, 0x4e1d7235UL, 0xd55a63ceUL, 0xde0436baUL, +0x99c430efUL, 0x5f0c0794UL, 0x18dcdb7dUL, 0xa1d6eff3UL, 0xa0b52f7bUL, 0x59e83605UL, +0xee15b094UL, 0xe9ffd909UL, 0xdc440086UL, 0xef944459UL, 0xba83ccb3UL, 0xe0c3cdfbUL, +0xd1da4181UL, 0x3b092ab1UL, 0xf997f1c1UL, 0xa5e6cf7bUL, 0x01420ddbUL, 0xe4e7ef5bUL, +0x25a1ff41UL, 0xe180f806UL, 0x1fc41080UL, 0x179bee7aUL, 0xd37ac6a9UL, 0xfe5830a4UL, +0x98de8b7fUL, 0x77e83f4eUL, 0x79929269UL, 0x24fa9f7bUL, 0xe113c85bUL, 0xacc40083UL, +0xd7503525UL, 0xf7ea615fUL, 0x62143154UL, 0x0d554b63UL, 0x5d681121UL, 0xc866c359UL, +0x3d63cf73UL, 0xcee234c0UL, 0xd4d87e87UL, 0x5c672b21UL, 0x071f6181UL, 0x39f7627fUL, +0x361e3084UL, 0xe4eb573bUL, 0x602f64a4UL, 0xd63acd9cUL, 0x1bbc4635UL, 0x9e81032dUL, +0x2701f50cUL, 0x99847ab4UL, 0xa0e3df79UL, 0xba6cf38cUL, 0x10843094UL, 0x2537a95eUL, +0xf46f6ffeUL, 0xa1ff3b1fUL, 0x208cfb6aUL, 0x8f458c74UL, 0xd9e0a227UL, 0x4ec73a34UL, +0xfc884f69UL, 0x3e4de8dfUL, 0xef0e0088UL, 0x3559648dUL, 0x8a45388cUL, 0x1d804366UL, +0x721d9bfdUL, 0xa58684bbUL, 0xe8256333UL, 0x844e8212UL, 0x128d8098UL, 0xfed33fb4UL, +0xce280ae1UL, 0x27e19ba5UL, 0xd5a6c252UL, 0xe49754bdUL, 0xc5d655ddUL, 0xeb667064UL, +0x77840b4dUL, 0xa1b6a801UL, 0x84db26a9UL, 0xe0b56714UL, 0x21f043b7UL, 0xe5d05860UL, +0x54f03084UL, 0x066ff472UL, 0xa31aa153UL, 0xdadc4755UL, 0xb5625dbfUL, 0x68561be6UL, +0x83ca6b94UL, 0x2d6ed23bUL, 0xeccf01dbUL, 0xa6d3d0baUL, 0xb6803d5cUL, 0xaf77a709UL, +0x33b4a34cUL, 0x397bc8d6UL, 0x5ee22b95UL, 0x5f0e5304UL, 0x81ed6f61UL, 0x20e74364UL, +0xb45e1378UL, 0xde18639bUL, 0x881ca122UL, 0xb96726d1UL, 0x8049a7e8UL, 0x22b7da7bUL, +0x5e552d25UL, 0x5272d237UL, 0x79d2951cUL, 0xc60d894cUL, 0x488cb402UL, 0x1ba4fe5bUL, +0xa4b09f6bUL, 0x1ca815cfUL, 0xa20c3005UL, 0x8871df63UL, 0xb9de2fcbUL, 0x0cc6c9e9UL, +0x0beeff53UL, 0xe3214517UL, 0xb4542835UL, 0x9f63293cUL, 0xee41e729UL, 0x6e1d2d7cUL, +0x50045286UL, 0x1e6685f3UL, 0xf33401c6UL, 0x30a22c95UL, 0x31a70850UL, 0x60930f13UL, +0x73f98417UL, 0xa1269859UL, 0xec645c44UL, 0x52c877a9UL, 0xcdff33a6UL, 0xa02b1741UL, +0x7cbad9a2UL, 0x2180036fUL, 0x50d99c08UL, 0xcb3f4861UL, 0xc26bd765UL, 0x64a3f6abUL, +0x80342676UL, 0x25a75e7bUL, 0xe4e6d1fcUL, 0x20c710e6UL, 0xcdf0b680UL, 0x17844d3bUL, +0x31eef84dUL, 0x7e0824e4UL, 0x2ccb49ebUL, 0x846a3baeUL, 0x8ff77888UL, 0xee5d60f6UL, +0x7af75673UL, 0x2fdd5cdbUL, 0xa11631c1UL, 0x30f66f43UL, 0xb3faec54UL, 0x157fd7faUL, +0xef8579ccUL, 0xd152de58UL, 0xdb2ffd5eUL, 0x8f32ce19UL, 0x306af97aUL, 0x02f03ef8UL, +0x99319ad5UL, 0xc242fa0fUL, 0xa7e3ebb0UL, 0xc68e4906UL, 0xb8da230cUL, 0x80823028UL, +0xdcdef3c8UL, 0xd35fb171UL, 0x088a1bc8UL, 0xbec0c560UL, 0x61a3c9e8UL, 0xbca8f54dUL, +0xc72feffaUL, 0x22822e99UL, 0x82c570b4UL, 0xd8d94e89UL, 0x8b1c34bcUL, 0x301e16e6UL, +0x273be979UL, 0xb0ffeaa6UL, 0x61d9b8c6UL, 0x00b24869UL, 0xb7ffce3fUL, 0x08dc283bUL, +0x43daf65aUL, 0xf7e19798UL, 0x7619b72fUL, 0x8f1c9ba4UL, 0xdc8637a0UL, 0x16a7d3b1UL, +0x9fc393b7UL, 0xa7136eebUL, 0xc6bcc63eUL, 0x1a513742UL, 0xef6828bcUL, 0x520365d6UL, +0x2d6a77abUL, 0x3527ed4bUL, 0x821fd216UL, 0x095c6e2eUL, 0xdb92f2fbUL, 0x5eea29cbUL, +0x145892f5UL, 0x91584f7fUL, 0x5483697bUL, 0x2667a8ccUL, 0x85196048UL, 0x8c4baceaUL, +0x833860d4UL, 0x0d23e0f9UL, 0x6c387e8aUL, 0x0ae6d249UL, 0xb284600cUL, 0xd835731dUL, +0xdcb1c647UL, 0xac4c56eaUL, 0x3ebd81b3UL, 0x230eabb0UL, 0x6438bc87UL, 0xf0b5b1faUL, +0x8f5ea2b3UL, 0xfc184642UL, 0x0a036b7aUL, 0x4fb089bdUL, 0x649da589UL, 0xa345415eUL, +0x5c038323UL, 0x3e5d3bb9UL, 0x43d79572UL, 0x7e6dd07cUL, 0x06dfdf1eUL, 0x6c6cc4efUL, +0x7160a539UL, 0x73bfbe70UL, 0x83877605UL, 0x4523ecf1UL}; + +static const ulong32 S3[256] = { +0x8defc240UL, 0x25fa5d9fUL, 0xeb903dbfUL, 0xe810c907UL, 0x47607fffUL, 0x369fe44bUL, +0x8c1fc644UL, 0xaececa90UL, 0xbeb1f9bfUL, 0xeefbcaeaUL, 0xe8cf1950UL, 0x51df07aeUL, +0x920e8806UL, 0xf0ad0548UL, 0xe13c8d83UL, 0x927010d5UL, 0x11107d9fUL, 0x07647db9UL, +0xb2e3e4d4UL, 0x3d4f285eUL, 0xb9afa820UL, 0xfade82e0UL, 0xa067268bUL, 0x8272792eUL, +0x553fb2c0UL, 0x489ae22bUL, 0xd4ef9794UL, 0x125e3fbcUL, 0x21fffceeUL, 0x825b1bfdUL, +0x9255c5edUL, 0x1257a240UL, 0x4e1a8302UL, 0xbae07fffUL, 0x528246e7UL, 0x8e57140eUL, +0x3373f7bfUL, 0x8c9f8188UL, 0xa6fc4ee8UL, 0xc982b5a5UL, 0xa8c01db7UL, 0x579fc264UL, +0x67094f31UL, 0xf2bd3f5fUL, 0x40fff7c1UL, 0x1fb78dfcUL, 0x8e6bd2c1UL, 0x437be59bUL, +0x99b03dbfUL, 0xb5dbc64bUL, 0x638dc0e6UL, 0x55819d99UL, 0xa197c81cUL, 0x4a012d6eUL, +0xc5884a28UL, 0xccc36f71UL, 0xb843c213UL, 0x6c0743f1UL, 0x8309893cUL, 0x0feddd5fUL, +0x2f7fe850UL, 0xd7c07f7eUL, 0x02507fbfUL, 0x5afb9a04UL, 0xa747d2d0UL, 0x1651192eUL, +0xaf70bf3eUL, 0x58c31380UL, 0x5f98302eUL, 0x727cc3c4UL, 0x0a0fb402UL, 0x0f7fef82UL, +0x8c96fdadUL, 0x5d2c2aaeUL, 0x8ee99a49UL, 0x50da88b8UL, 0x8427f4a0UL, 0x1eac5790UL, +0x796fb449UL, 0x8252dc15UL, 0xefbd7d9bUL, 0xa672597dUL, 0xada840d8UL, 0x45f54504UL, +0xfa5d7403UL, 0xe83ec305UL, 0x4f91751aUL, 0x925669c2UL, 0x23efe941UL, 0xa903f12eUL, +0x60270df2UL, 0x0276e4b6UL, 0x94fd6574UL, 0x927985b2UL, 0x8276dbcbUL, 0x02778176UL, +0xf8af918dUL, 0x4e48f79eUL, 0x8f616ddfUL, 0xe29d840eUL, 0x842f7d83UL, 0x340ce5c8UL, +0x96bbb682UL, 0x93b4b148UL, 0xef303cabUL, 0x984faf28UL, 0x779faf9bUL, 0x92dc560dUL, +0x224d1e20UL, 0x8437aa88UL, 0x7d29dc96UL, 0x2756d3dcUL, 0x8b907ceeUL, 0xb51fd240UL, +0xe7c07ce3UL, 0xe566b4a1UL, 0xc3e9615eUL, 0x3cf8209dUL, 0x6094d1e3UL, 0xcd9ca341UL, +0x5c76460eUL, 0x00ea983bUL, 0xd4d67881UL, 0xfd47572cUL, 0xf76cedd9UL, 0xbda8229cUL, +0x127dadaaUL, 0x438a074eUL, 0x1f97c090UL, 0x081bdb8aUL, 0x93a07ebeUL, 0xb938ca15UL, +0x97b03cffUL, 0x3dc2c0f8UL, 0x8d1ab2ecUL, 0x64380e51UL, 0x68cc7bfbUL, 0xd90f2788UL, +0x12490181UL, 0x5de5ffd4UL, 0xdd7ef86aUL, 0x76a2e214UL, 0xb9a40368UL, 0x925d958fUL, +0x4b39fffaUL, 0xba39aee9UL, 0xa4ffd30bUL, 0xfaf7933bUL, 0x6d498623UL, 0x193cbcfaUL, +0x27627545UL, 0x825cf47aUL, 0x61bd8ba0UL, 0xd11e42d1UL, 0xcead04f4UL, 0x127ea392UL, +0x10428db7UL, 0x8272a972UL, 0x9270c4a8UL, 0x127de50bUL, 0x285ba1c8UL, 0x3c62f44fUL, +0x35c0eaa5UL, 0xe805d231UL, 0x428929fbUL, 0xb4fcdf82UL, 0x4fb66a53UL, 0x0e7dc15bUL, +0x1f081fabUL, 0x108618aeUL, 0xfcfd086dUL, 0xf9ff2889UL, 0x694bcc11UL, 0x236a5caeUL, +0x12deca4dUL, 0x2c3f8cc5UL, 0xd2d02dfeUL, 0xf8ef5896UL, 0xe4cf52daUL, 0x95155b67UL, +0x494a488cUL, 0xb9b6a80cUL, 0x5c8f82bcUL, 0x89d36b45UL, 0x3a609437UL, 0xec00c9a9UL, +0x44715253UL, 0x0a874b49UL, 0xd773bc40UL, 0x7c34671cUL, 0x02717ef6UL, 0x4feb5536UL, +0xa2d02fffUL, 0xd2bf60c4UL, 0xd43f03c0UL, 0x50b4ef6dUL, 0x07478cd1UL, 0x006e1888UL, +0xa2e53f55UL, 0xb9e6d4bcUL, 0xa2048016UL, 0x97573833UL, 0xd7207d67UL, 0xde0f8f3dUL, +0x72f87b33UL, 0xabcc4f33UL, 0x7688c55dUL, 0x7b00a6b0UL, 0x947b0001UL, 0x570075d2UL, +0xf9bb88f8UL, 0x8942019eUL, 0x4264a5ffUL, 0x856302e0UL, 0x72dbd92bUL, 0xee971b69UL, +0x6ea22fdeUL, 0x5f08ae2bUL, 0xaf7a616dUL, 0xe5c98767UL, 0xcf1febd2UL, 0x61efc8c2UL, +0xf1ac2571UL, 0xcc8239c2UL, 0x67214cb8UL, 0xb1e583d1UL, 0xb7dc3e62UL, 0x7f10bdceUL, +0xf90a5c38UL, 0x0ff0443dUL, 0x606e6dc6UL, 0x60543a49UL, 0x5727c148UL, 0x2be98a1dUL, +0x8ab41738UL, 0x20e1be24UL, 0xaf96da0fUL, 0x68458425UL, 0x99833be5UL, 0x600d457dUL, +0x282f9350UL, 0x8334b362UL, 0xd91d1120UL, 0x2b6d8da0UL, 0x642b1e31UL, 0x9c305a00UL, +0x52bce688UL, 0x1b03588aUL, 0xf7baefd5UL, 0x4142ed9cUL, 0xa4315c11UL, 0x83323ec5UL, +0xdfef4636UL, 0xa133c501UL, 0xe9d3531cUL, 0xee353783UL}; + +static const ulong32 S4[256] = { +0x9db30420UL, 0x1fb6e9deUL, 0xa7be7befUL, 0xd273a298UL, 0x4a4f7bdbUL, 0x64ad8c57UL, +0x85510443UL, 0xfa020ed1UL, 0x7e287affUL, 0xe60fb663UL, 0x095f35a1UL, 0x79ebf120UL, +0xfd059d43UL, 0x6497b7b1UL, 0xf3641f63UL, 0x241e4adfUL, 0x28147f5fUL, 0x4fa2b8cdUL, +0xc9430040UL, 0x0cc32220UL, 0xfdd30b30UL, 0xc0a5374fUL, 0x1d2d00d9UL, 0x24147b15UL, +0xee4d111aUL, 0x0fca5167UL, 0x71ff904cUL, 0x2d195ffeUL, 0x1a05645fUL, 0x0c13fefeUL, +0x081b08caUL, 0x05170121UL, 0x80530100UL, 0xe83e5efeUL, 0xac9af4f8UL, 0x7fe72701UL, +0xd2b8ee5fUL, 0x06df4261UL, 0xbb9e9b8aUL, 0x7293ea25UL, 0xce84ffdfUL, 0xf5718801UL, +0x3dd64b04UL, 0xa26f263bUL, 0x7ed48400UL, 0x547eebe6UL, 0x446d4ca0UL, 0x6cf3d6f5UL, +0x2649abdfUL, 0xaea0c7f5UL, 0x36338cc1UL, 0x503f7e93UL, 0xd3772061UL, 0x11b638e1UL, +0x72500e03UL, 0xf80eb2bbUL, 0xabe0502eUL, 0xec8d77deUL, 0x57971e81UL, 0xe14f6746UL, +0xc9335400UL, 0x6920318fUL, 0x081dbb99UL, 0xffc304a5UL, 0x4d351805UL, 0x7f3d5ce3UL, +0xa6c866c6UL, 0x5d5bcca9UL, 0xdaec6feaUL, 0x9f926f91UL, 0x9f46222fUL, 0x3991467dUL, +0xa5bf6d8eUL, 0x1143c44fUL, 0x43958302UL, 0xd0214eebUL, 0x022083b8UL, 0x3fb6180cUL, +0x18f8931eUL, 0x281658e6UL, 0x26486e3eUL, 0x8bd78a70UL, 0x7477e4c1UL, 0xb506e07cUL, +0xf32d0a25UL, 0x79098b02UL, 0xe4eabb81UL, 0x28123b23UL, 0x69dead38UL, 0x1574ca16UL, +0xdf871b62UL, 0x211c40b7UL, 0xa51a9ef9UL, 0x0014377bUL, 0x041e8ac8UL, 0x09114003UL, +0xbd59e4d2UL, 0xe3d156d5UL, 0x4fe876d5UL, 0x2f91a340UL, 0x557be8deUL, 0x00eae4a7UL, +0x0ce5c2ecUL, 0x4db4bba6UL, 0xe756bdffUL, 0xdd3369acUL, 0xec17b035UL, 0x06572327UL, +0x99afc8b0UL, 0x56c8c391UL, 0x6b65811cUL, 0x5e146119UL, 0x6e85cb75UL, 0xbe07c002UL, +0xc2325577UL, 0x893ff4ecUL, 0x5bbfc92dUL, 0xd0ec3b25UL, 0xb7801ab7UL, 0x8d6d3b24UL, +0x20c763efUL, 0xc366a5fcUL, 0x9c382880UL, 0x0ace3205UL, 0xaac9548aUL, 0xeca1d7c7UL, +0x041afa32UL, 0x1d16625aUL, 0x6701902cUL, 0x9b757a54UL, 0x31d477f7UL, 0x9126b031UL, +0x36cc6fdbUL, 0xc70b8b46UL, 0xd9e66a48UL, 0x56e55a79UL, 0x026a4cebUL, 0x52437effUL, +0x2f8f76b4UL, 0x0df980a5UL, 0x8674cde3UL, 0xedda04ebUL, 0x17a9be04UL, 0x2c18f4dfUL, +0xb7747f9dUL, 0xab2af7b4UL, 0xefc34d20UL, 0x2e096b7cUL, 0x1741a254UL, 0xe5b6a035UL, +0x213d42f6UL, 0x2c1c7c26UL, 0x61c2f50fUL, 0x6552daf9UL, 0xd2c231f8UL, 0x25130f69UL, +0xd8167fa2UL, 0x0418f2c8UL, 0x001a96a6UL, 0x0d1526abUL, 0x63315c21UL, 0x5e0a72ecUL, +0x49bafefdUL, 0x187908d9UL, 0x8d0dbd86UL, 0x311170a7UL, 0x3e9b640cUL, 0xcc3e10d7UL, +0xd5cad3b6UL, 0x0caec388UL, 0xf73001e1UL, 0x6c728affUL, 0x71eae2a1UL, 0x1f9af36eUL, +0xcfcbd12fUL, 0xc1de8417UL, 0xac07be6bUL, 0xcb44a1d8UL, 0x8b9b0f56UL, 0x013988c3UL, +0xb1c52fcaUL, 0xb4be31cdUL, 0xd8782806UL, 0x12a3a4e2UL, 0x6f7de532UL, 0x58fd7eb6UL, +0xd01ee900UL, 0x24adffc2UL, 0xf4990fc5UL, 0x9711aac5UL, 0x001d7b95UL, 0x82e5e7d2UL, +0x109873f6UL, 0x00613096UL, 0xc32d9521UL, 0xada121ffUL, 0x29908415UL, 0x7fbb977fUL, +0xaf9eb3dbUL, 0x29c9ed2aUL, 0x5ce2a465UL, 0xa730f32cUL, 0xd0aa3fe8UL, 0x8a5cc091UL, +0xd49e2ce7UL, 0x0ce454a9UL, 0xd60acd86UL, 0x015f1919UL, 0x77079103UL, 0xdea03af6UL, +0x78a8565eUL, 0xdee356dfUL, 0x21f05cbeUL, 0x8b75e387UL, 0xb3c50651UL, 0xb8a5c3efUL, +0xd8eeb6d2UL, 0xe523be77UL, 0xc2154529UL, 0x2f69efdfUL, 0xafe67afbUL, 0xf470c4b2UL, +0xf3e0eb5bUL, 0xd6cc9876UL, 0x39e4460cUL, 0x1fda8538UL, 0x1987832fUL, 0xca007367UL, +0xa99144f8UL, 0x296b299eUL, 0x492fc295UL, 0x9266beabUL, 0xb5676e69UL, 0x9bd3dddaUL, +0xdf7e052fUL, 0xdb25701cUL, 0x1b5e51eeUL, 0xf65324e6UL, 0x6afce36cUL, 0x0316cc04UL, +0x8644213eUL, 0xb7dc59d0UL, 0x7965291fUL, 0xccd6fd43UL, 0x41823979UL, 0x932bcdf6UL, +0xb657c34dUL, 0x4edfd282UL, 0x7ae5290cUL, 0x3cb9536bUL, 0x851e20feUL, 0x9833557eUL, +0x13ecf0b0UL, 0xd3ffb372UL, 0x3f85c5c1UL, 0x0aef7ed2UL}; + +static const ulong32 S5[256] = { +0x7ec90c04UL, 0x2c6e74b9UL, 0x9b0e66dfUL, 0xa6337911UL, 0xb86a7fffUL, 0x1dd358f5UL, +0x44dd9d44UL, 0x1731167fUL, 0x08fbf1faUL, 0xe7f511ccUL, 0xd2051b00UL, 0x735aba00UL, +0x2ab722d8UL, 0x386381cbUL, 0xacf6243aUL, 0x69befd7aUL, 0xe6a2e77fUL, 0xf0c720cdUL, +0xc4494816UL, 0xccf5c180UL, 0x38851640UL, 0x15b0a848UL, 0xe68b18cbUL, 0x4caadeffUL, +0x5f480a01UL, 0x0412b2aaUL, 0x259814fcUL, 0x41d0efe2UL, 0x4e40b48dUL, 0x248eb6fbUL, +0x8dba1cfeUL, 0x41a99b02UL, 0x1a550a04UL, 0xba8f65cbUL, 0x7251f4e7UL, 0x95a51725UL, +0xc106ecd7UL, 0x97a5980aUL, 0xc539b9aaUL, 0x4d79fe6aUL, 0xf2f3f763UL, 0x68af8040UL, +0xed0c9e56UL, 0x11b4958bUL, 0xe1eb5a88UL, 0x8709e6b0UL, 0xd7e07156UL, 0x4e29fea7UL, +0x6366e52dUL, 0x02d1c000UL, 0xc4ac8e05UL, 0x9377f571UL, 0x0c05372aUL, 0x578535f2UL, +0x2261be02UL, 0xd642a0c9UL, 0xdf13a280UL, 0x74b55bd2UL, 0x682199c0UL, 0xd421e5ecUL, +0x53fb3ce8UL, 0xc8adedb3UL, 0x28a87fc9UL, 0x3d959981UL, 0x5c1ff900UL, 0xfe38d399UL, +0x0c4eff0bUL, 0x062407eaUL, 0xaa2f4fb1UL, 0x4fb96976UL, 0x90c79505UL, 0xb0a8a774UL, +0xef55a1ffUL, 0xe59ca2c2UL, 0xa6b62d27UL, 0xe66a4263UL, 0xdf65001fUL, 0x0ec50966UL, +0xdfdd55bcUL, 0x29de0655UL, 0x911e739aUL, 0x17af8975UL, 0x32c7911cUL, 0x89f89468UL, +0x0d01e980UL, 0x524755f4UL, 0x03b63cc9UL, 0x0cc844b2UL, 0xbcf3f0aaUL, 0x87ac36e9UL, +0xe53a7426UL, 0x01b3d82bUL, 0x1a9e7449UL, 0x64ee2d7eUL, 0xcddbb1daUL, 0x01c94910UL, +0xb868bf80UL, 0x0d26f3fdUL, 0x9342ede7UL, 0x04a5c284UL, 0x636737b6UL, 0x50f5b616UL, +0xf24766e3UL, 0x8eca36c1UL, 0x136e05dbUL, 0xfef18391UL, 0xfb887a37UL, 0xd6e7f7d4UL, +0xc7fb7dc9UL, 0x3063fcdfUL, 0xb6f589deUL, 0xec2941daUL, 0x26e46695UL, 0xb7566419UL, +0xf654efc5UL, 0xd08d58b7UL, 0x48925401UL, 0xc1bacb7fUL, 0xe5ff550fUL, 0xb6083049UL, +0x5bb5d0e8UL, 0x87d72e5aUL, 0xab6a6ee1UL, 0x223a66ceUL, 0xc62bf3cdUL, 0x9e0885f9UL, +0x68cb3e47UL, 0x086c010fUL, 0xa21de820UL, 0xd18b69deUL, 0xf3f65777UL, 0xfa02c3f6UL, +0x407edac3UL, 0xcbb3d550UL, 0x1793084dUL, 0xb0d70ebaUL, 0x0ab378d5UL, 0xd951fb0cUL, +0xded7da56UL, 0x4124bbe4UL, 0x94ca0b56UL, 0x0f5755d1UL, 0xe0e1e56eUL, 0x6184b5beUL, +0x580a249fUL, 0x94f74bc0UL, 0xe327888eUL, 0x9f7b5561UL, 0xc3dc0280UL, 0x05687715UL, +0x646c6bd7UL, 0x44904db3UL, 0x66b4f0a3UL, 0xc0f1648aUL, 0x697ed5afUL, 0x49e92ff6UL, +0x309e374fUL, 0x2cb6356aUL, 0x85808573UL, 0x4991f840UL, 0x76f0ae02UL, 0x083be84dUL, +0x28421c9aUL, 0x44489406UL, 0x736e4cb8UL, 0xc1092910UL, 0x8bc95fc6UL, 0x7d869cf4UL, +0x134f616fUL, 0x2e77118dUL, 0xb31b2be1UL, 0xaa90b472UL, 0x3ca5d717UL, 0x7d161bbaUL, +0x9cad9010UL, 0xaf462ba2UL, 0x9fe459d2UL, 0x45d34559UL, 0xd9f2da13UL, 0xdbc65487UL, +0xf3e4f94eUL, 0x176d486fUL, 0x097c13eaUL, 0x631da5c7UL, 0x445f7382UL, 0x175683f4UL, +0xcdc66a97UL, 0x70be0288UL, 0xb3cdcf72UL, 0x6e5dd2f3UL, 0x20936079UL, 0x459b80a5UL, +0xbe60e2dbUL, 0xa9c23101UL, 0xeba5315cUL, 0x224e42f2UL, 0x1c5c1572UL, 0xf6721b2cUL, +0x1ad2fff3UL, 0x8c25404eUL, 0x324ed72fUL, 0x4067b7fdUL, 0x0523138eUL, 0x5ca3bc78UL, +0xdc0fd66eUL, 0x75922283UL, 0x784d6b17UL, 0x58ebb16eUL, 0x44094f85UL, 0x3f481d87UL, +0xfcfeae7bUL, 0x77b5ff76UL, 0x8c2302bfUL, 0xaaf47556UL, 0x5f46b02aUL, 0x2b092801UL, +0x3d38f5f7UL, 0x0ca81f36UL, 0x52af4a8aUL, 0x66d5e7c0UL, 0xdf3b0874UL, 0x95055110UL, +0x1b5ad7a8UL, 0xf61ed5adUL, 0x6cf6e479UL, 0x20758184UL, 0xd0cefa65UL, 0x88f7be58UL, +0x4a046826UL, 0x0ff6f8f3UL, 0xa09c7f70UL, 0x5346aba0UL, 0x5ce96c28UL, 0xe176eda3UL, +0x6bac307fUL, 0x376829d2UL, 0x85360fa9UL, 0x17e3fe2aUL, 0x24b79767UL, 0xf5a96b20UL, +0xd6cd2595UL, 0x68ff1ebfUL, 0x7555442cUL, 0xf19f06beUL, 0xf9e0659aUL, 0xeeb9491dUL, +0x34010718UL, 0xbb30cab8UL, 0xe822fe15UL, 0x88570983UL, 0x750e6249UL, 0xda627e55UL, +0x5e76ffa8UL, 0xb1534546UL, 0x6d47de08UL, 0xefe9e7d4UL}; + +static const ulong32 S6[256] = { +0xf6fa8f9dUL, 0x2cac6ce1UL, 0x4ca34867UL, 0xe2337f7cUL, 0x95db08e7UL, 0x016843b4UL, +0xeced5cbcUL, 0x325553acUL, 0xbf9f0960UL, 0xdfa1e2edUL, 0x83f0579dUL, 0x63ed86b9UL, +0x1ab6a6b8UL, 0xde5ebe39UL, 0xf38ff732UL, 0x8989b138UL, 0x33f14961UL, 0xc01937bdUL, +0xf506c6daUL, 0xe4625e7eUL, 0xa308ea99UL, 0x4e23e33cUL, 0x79cbd7ccUL, 0x48a14367UL, +0xa3149619UL, 0xfec94bd5UL, 0xa114174aUL, 0xeaa01866UL, 0xa084db2dUL, 0x09a8486fUL, +0xa888614aUL, 0x2900af98UL, 0x01665991UL, 0xe1992863UL, 0xc8f30c60UL, 0x2e78ef3cUL, +0xd0d51932UL, 0xcf0fec14UL, 0xf7ca07d2UL, 0xd0a82072UL, 0xfd41197eUL, 0x9305a6b0UL, +0xe86be3daUL, 0x74bed3cdUL, 0x372da53cUL, 0x4c7f4448UL, 0xdab5d440UL, 0x6dba0ec3UL, +0x083919a7UL, 0x9fbaeed9UL, 0x49dbcfb0UL, 0x4e670c53UL, 0x5c3d9c01UL, 0x64bdb941UL, +0x2c0e636aUL, 0xba7dd9cdUL, 0xea6f7388UL, 0xe70bc762UL, 0x35f29adbUL, 0x5c4cdd8dUL, +0xf0d48d8cUL, 0xb88153e2UL, 0x08a19866UL, 0x1ae2eac8UL, 0x284caf89UL, 0xaa928223UL, +0x9334be53UL, 0x3b3a21bfUL, 0x16434be3UL, 0x9aea3906UL, 0xefe8c36eUL, 0xf890cdd9UL, +0x80226daeUL, 0xc340a4a3UL, 0xdf7e9c09UL, 0xa694a807UL, 0x5b7c5eccUL, 0x221db3a6UL, +0x9a69a02fUL, 0x68818a54UL, 0xceb2296fUL, 0x53c0843aUL, 0xfe893655UL, 0x25bfe68aUL, +0xb4628abcUL, 0xcf222ebfUL, 0x25ac6f48UL, 0xa9a99387UL, 0x53bddb65UL, 0xe76ffbe7UL, +0xe967fd78UL, 0x0ba93563UL, 0x8e342bc1UL, 0xe8a11be9UL, 0x4980740dUL, 0xc8087dfcUL, +0x8de4bf99UL, 0xa11101a0UL, 0x7fd37975UL, 0xda5a26c0UL, 0xe81f994fUL, 0x9528cd89UL, +0xfd339fedUL, 0xb87834bfUL, 0x5f04456dUL, 0x22258698UL, 0xc9c4c83bUL, 0x2dc156beUL, +0x4f628daaUL, 0x57f55ec5UL, 0xe2220abeUL, 0xd2916ebfUL, 0x4ec75b95UL, 0x24f2c3c0UL, +0x42d15d99UL, 0xcd0d7fa0UL, 0x7b6e27ffUL, 0xa8dc8af0UL, 0x7345c106UL, 0xf41e232fUL, +0x35162386UL, 0xe6ea8926UL, 0x3333b094UL, 0x157ec6f2UL, 0x372b74afUL, 0x692573e4UL, +0xe9a9d848UL, 0xf3160289UL, 0x3a62ef1dUL, 0xa787e238UL, 0xf3a5f676UL, 0x74364853UL, +0x20951063UL, 0x4576698dUL, 0xb6fad407UL, 0x592af950UL, 0x36f73523UL, 0x4cfb6e87UL, +0x7da4cec0UL, 0x6c152daaUL, 0xcb0396a8UL, 0xc50dfe5dUL, 0xfcd707abUL, 0x0921c42fUL, +0x89dff0bbUL, 0x5fe2be78UL, 0x448f4f33UL, 0x754613c9UL, 0x2b05d08dUL, 0x48b9d585UL, +0xdc049441UL, 0xc8098f9bUL, 0x7dede786UL, 0xc39a3373UL, 0x42410005UL, 0x6a091751UL, +0x0ef3c8a6UL, 0x890072d6UL, 0x28207682UL, 0xa9a9f7beUL, 0xbf32679dUL, 0xd45b5b75UL, +0xb353fd00UL, 0xcbb0e358UL, 0x830f220aUL, 0x1f8fb214UL, 0xd372cf08UL, 0xcc3c4a13UL, +0x8cf63166UL, 0x061c87beUL, 0x88c98f88UL, 0x6062e397UL, 0x47cf8e7aUL, 0xb6c85283UL, +0x3cc2acfbUL, 0x3fc06976UL, 0x4e8f0252UL, 0x64d8314dUL, 0xda3870e3UL, 0x1e665459UL, +0xc10908f0UL, 0x513021a5UL, 0x6c5b68b7UL, 0x822f8aa0UL, 0x3007cd3eUL, 0x74719eefUL, +0xdc872681UL, 0x073340d4UL, 0x7e432fd9UL, 0x0c5ec241UL, 0x8809286cUL, 0xf592d891UL, +0x08a930f6UL, 0x957ef305UL, 0xb7fbffbdUL, 0xc266e96fUL, 0x6fe4ac98UL, 0xb173ecc0UL, +0xbc60b42aUL, 0x953498daUL, 0xfba1ae12UL, 0x2d4bd736UL, 0x0f25faabUL, 0xa4f3fcebUL, +0xe2969123UL, 0x257f0c3dUL, 0x9348af49UL, 0x361400bcUL, 0xe8816f4aUL, 0x3814f200UL, +0xa3f94043UL, 0x9c7a54c2UL, 0xbc704f57UL, 0xda41e7f9UL, 0xc25ad33aUL, 0x54f4a084UL, +0xb17f5505UL, 0x59357cbeUL, 0xedbd15c8UL, 0x7f97c5abUL, 0xba5ac7b5UL, 0xb6f6deafUL, +0x3a479c3aUL, 0x5302da25UL, 0x653d7e6aUL, 0x54268d49UL, 0x51a477eaUL, 0x5017d55bUL, +0xd7d25d88UL, 0x44136c76UL, 0x0404a8c8UL, 0xb8e5a121UL, 0xb81a928aUL, 0x60ed5869UL, +0x97c55b96UL, 0xeaec991bUL, 0x29935913UL, 0x01fdb7f1UL, 0x088e8dfaUL, 0x9ab6f6f5UL, +0x3b4cbf9fUL, 0x4a5de3abUL, 0xe6051d35UL, 0xa0e1d855UL, 0xd36b4cf1UL, 0xf544edebUL, +0xb0e93524UL, 0xbebb8fbdUL, 0xa2d762cfUL, 0x49c92f54UL, 0x38b5f331UL, 0x7128a454UL, +0x48392905UL, 0xa65b1db8UL, 0x851c97bdUL, 0xd675cf2fUL}; + +static const ulong32 S7[256] = { +0x85e04019UL, 0x332bf567UL, 0x662dbfffUL, 0xcfc65693UL, 0x2a8d7f6fUL, 0xab9bc912UL, +0xde6008a1UL, 0x2028da1fUL, 0x0227bce7UL, 0x4d642916UL, 0x18fac300UL, 0x50f18b82UL, +0x2cb2cb11UL, 0xb232e75cUL, 0x4b3695f2UL, 0xb28707deUL, 0xa05fbcf6UL, 0xcd4181e9UL, +0xe150210cUL, 0xe24ef1bdUL, 0xb168c381UL, 0xfde4e789UL, 0x5c79b0d8UL, 0x1e8bfd43UL, +0x4d495001UL, 0x38be4341UL, 0x913cee1dUL, 0x92a79c3fUL, 0x089766beUL, 0xbaeeadf4UL, +0x1286becfUL, 0xb6eacb19UL, 0x2660c200UL, 0x7565bde4UL, 0x64241f7aUL, 0x8248dca9UL, +0xc3b3ad66UL, 0x28136086UL, 0x0bd8dfa8UL, 0x356d1cf2UL, 0x107789beUL, 0xb3b2e9ceUL, +0x0502aa8fUL, 0x0bc0351eUL, 0x166bf52aUL, 0xeb12ff82UL, 0xe3486911UL, 0xd34d7516UL, +0x4e7b3affUL, 0x5f43671bUL, 0x9cf6e037UL, 0x4981ac83UL, 0x334266ceUL, 0x8c9341b7UL, +0xd0d854c0UL, 0xcb3a6c88UL, 0x47bc2829UL, 0x4725ba37UL, 0xa66ad22bUL, 0x7ad61f1eUL, +0x0c5cbafaUL, 0x4437f107UL, 0xb6e79962UL, 0x42d2d816UL, 0x0a961288UL, 0xe1a5c06eUL, +0x13749e67UL, 0x72fc081aUL, 0xb1d139f7UL, 0xf9583745UL, 0xcf19df58UL, 0xbec3f756UL, +0xc06eba30UL, 0x07211b24UL, 0x45c28829UL, 0xc95e317fUL, 0xbc8ec511UL, 0x38bc46e9UL, +0xc6e6fa14UL, 0xbae8584aUL, 0xad4ebc46UL, 0x468f508bUL, 0x7829435fUL, 0xf124183bUL, +0x821dba9fUL, 0xaff60ff4UL, 0xea2c4e6dUL, 0x16e39264UL, 0x92544a8bUL, 0x009b4fc3UL, +0xaba68cedUL, 0x9ac96f78UL, 0x06a5b79aUL, 0xb2856e6eUL, 0x1aec3ca9UL, 0xbe838688UL, +0x0e0804e9UL, 0x55f1be56UL, 0xe7e5363bUL, 0xb3a1f25dUL, 0xf7debb85UL, 0x61fe033cUL, +0x16746233UL, 0x3c034c28UL, 0xda6d0c74UL, 0x79aac56cUL, 0x3ce4e1adUL, 0x51f0c802UL, +0x98f8f35aUL, 0x1626a49fUL, 0xeed82b29UL, 0x1d382fe3UL, 0x0c4fb99aUL, 0xbb325778UL, +0x3ec6d97bUL, 0x6e77a6a9UL, 0xcb658b5cUL, 0xd45230c7UL, 0x2bd1408bUL, 0x60c03eb7UL, +0xb9068d78UL, 0xa33754f4UL, 0xf430c87dUL, 0xc8a71302UL, 0xb96d8c32UL, 0xebd4e7beUL, +0xbe8b9d2dUL, 0x7979fb06UL, 0xe7225308UL, 0x8b75cf77UL, 0x11ef8da4UL, 0xe083c858UL, +0x8d6b786fUL, 0x5a6317a6UL, 0xfa5cf7a0UL, 0x5dda0033UL, 0xf28ebfb0UL, 0xf5b9c310UL, +0xa0eac280UL, 0x08b9767aUL, 0xa3d9d2b0UL, 0x79d34217UL, 0x021a718dUL, 0x9ac6336aUL, +0x2711fd60UL, 0x438050e3UL, 0x069908a8UL, 0x3d7fedc4UL, 0x826d2befUL, 0x4eeb8476UL, +0x488dcf25UL, 0x36c9d566UL, 0x28e74e41UL, 0xc2610acaUL, 0x3d49a9cfUL, 0xbae3b9dfUL, +0xb65f8de6UL, 0x92aeaf64UL, 0x3ac7d5e6UL, 0x9ea80509UL, 0xf22b017dUL, 0xa4173f70UL, +0xdd1e16c3UL, 0x15e0d7f9UL, 0x50b1b887UL, 0x2b9f4fd5UL, 0x625aba82UL, 0x6a017962UL, +0x2ec01b9cUL, 0x15488aa9UL, 0xd716e740UL, 0x40055a2cUL, 0x93d29a22UL, 0xe32dbf9aUL, +0x058745b9UL, 0x3453dc1eUL, 0xd699296eUL, 0x496cff6fUL, 0x1c9f4986UL, 0xdfe2ed07UL, +0xb87242d1UL, 0x19de7eaeUL, 0x053e561aUL, 0x15ad6f8cUL, 0x66626c1cUL, 0x7154c24cUL, +0xea082b2aUL, 0x93eb2939UL, 0x17dcb0f0UL, 0x58d4f2aeUL, 0x9ea294fbUL, 0x52cf564cUL, +0x9883fe66UL, 0x2ec40581UL, 0x763953c3UL, 0x01d6692eUL, 0xd3a0c108UL, 0xa1e7160eUL, +0xe4f2dfa6UL, 0x693ed285UL, 0x74904698UL, 0x4c2b0eddUL, 0x4f757656UL, 0x5d393378UL, +0xa132234fUL, 0x3d321c5dUL, 0xc3f5e194UL, 0x4b269301UL, 0xc79f022fUL, 0x3c997e7eUL, +0x5e4f9504UL, 0x3ffafbbdUL, 0x76f7ad0eUL, 0x296693f4UL, 0x3d1fce6fUL, 0xc61e45beUL, +0xd3b5ab34UL, 0xf72bf9b7UL, 0x1b0434c0UL, 0x4e72b567UL, 0x5592a33dUL, 0xb5229301UL, +0xcfd2a87fUL, 0x60aeb767UL, 0x1814386bUL, 0x30bcc33dUL, 0x38a0c07dUL, 0xfd1606f2UL, +0xc363519bUL, 0x589dd390UL, 0x5479f8e6UL, 0x1cb8d647UL, 0x97fd61a9UL, 0xea7759f4UL, +0x2d57539dUL, 0x569a58cfUL, 0xe84e63adUL, 0x462e1b78UL, 0x6580f87eUL, 0xf3817914UL, +0x91da55f4UL, 0x40a230f3UL, 0xd1988f35UL, 0xb6e318d2UL, 0x3ffa50bcUL, 0x3d40f021UL, +0xc3c0bdaeUL, 0x4958c24cUL, 0x518f36b2UL, 0x84b1d370UL, 0x0fedce83UL, 0x878ddadaUL, +0xf2a279c7UL, 0x94e01be8UL, 0x90716f4bUL, 0x954b8aa3UL}; + +static const ulong32 S8[256] = { +0xe216300dUL, 0xbbddfffcUL, 0xa7ebdabdUL, 0x35648095UL, 0x7789f8b7UL, 0xe6c1121bUL, +0x0e241600UL, 0x052ce8b5UL, 0x11a9cfb0UL, 0xe5952f11UL, 0xece7990aUL, 0x9386d174UL, +0x2a42931cUL, 0x76e38111UL, 0xb12def3aUL, 0x37ddddfcUL, 0xde9adeb1UL, 0x0a0cc32cUL, +0xbe197029UL, 0x84a00940UL, 0xbb243a0fUL, 0xb4d137cfUL, 0xb44e79f0UL, 0x049eedfdUL, +0x0b15a15dUL, 0x480d3168UL, 0x8bbbde5aUL, 0x669ded42UL, 0xc7ece831UL, 0x3f8f95e7UL, +0x72df191bUL, 0x7580330dUL, 0x94074251UL, 0x5c7dcdfaUL, 0xabbe6d63UL, 0xaa402164UL, +0xb301d40aUL, 0x02e7d1caUL, 0x53571daeUL, 0x7a3182a2UL, 0x12a8ddecUL, 0xfdaa335dUL, +0x176f43e8UL, 0x71fb46d4UL, 0x38129022UL, 0xce949ad4UL, 0xb84769adUL, 0x965bd862UL, +0x82f3d055UL, 0x66fb9767UL, 0x15b80b4eUL, 0x1d5b47a0UL, 0x4cfde06fUL, 0xc28ec4b8UL, +0x57e8726eUL, 0x647a78fcUL, 0x99865d44UL, 0x608bd593UL, 0x6c200e03UL, 0x39dc5ff6UL, +0x5d0b00a3UL, 0xae63aff2UL, 0x7e8bd632UL, 0x70108c0cUL, 0xbbd35049UL, 0x2998df04UL, +0x980cf42aUL, 0x9b6df491UL, 0x9e7edd53UL, 0x06918548UL, 0x58cb7e07UL, 0x3b74ef2eUL, +0x522fffb1UL, 0xd24708ccUL, 0x1c7e27cdUL, 0xa4eb215bUL, 0x3cf1d2e2UL, 0x19b47a38UL, +0x424f7618UL, 0x35856039UL, 0x9d17dee7UL, 0x27eb35e6UL, 0xc9aff67bUL, 0x36baf5b8UL, +0x09c467cdUL, 0xc18910b1UL, 0xe11dbf7bUL, 0x06cd1af8UL, 0x7170c608UL, 0x2d5e3354UL, +0xd4de495aUL, 0x64c6d006UL, 0xbcc0c62cUL, 0x3dd00db3UL, 0x708f8f34UL, 0x77d51b42UL, +0x264f620fUL, 0x24b8d2bfUL, 0x15c1b79eUL, 0x46a52564UL, 0xf8d7e54eUL, 0x3e378160UL, +0x7895cda5UL, 0x859c15a5UL, 0xe6459788UL, 0xc37bc75fUL, 0xdb07ba0cUL, 0x0676a3abUL, +0x7f229b1eUL, 0x31842e7bUL, 0x24259fd7UL, 0xf8bef472UL, 0x835ffcb8UL, 0x6df4c1f2UL, +0x96f5b195UL, 0xfd0af0fcUL, 0xb0fe134cUL, 0xe2506d3dUL, 0x4f9b12eaUL, 0xf215f225UL, +0xa223736fUL, 0x9fb4c428UL, 0x25d04979UL, 0x34c713f8UL, 0xc4618187UL, 0xea7a6e98UL, +0x7cd16efcUL, 0x1436876cUL, 0xf1544107UL, 0xbedeee14UL, 0x56e9af27UL, 0xa04aa441UL, +0x3cf7c899UL, 0x92ecbae6UL, 0xdd67016dUL, 0x151682ebUL, 0xa842eedfUL, 0xfdba60b4UL, +0xf1907b75UL, 0x20e3030fUL, 0x24d8c29eUL, 0xe139673bUL, 0xefa63fb8UL, 0x71873054UL, +0xb6f2cf3bUL, 0x9f326442UL, 0xcb15a4ccUL, 0xb01a4504UL, 0xf1e47d8dUL, 0x844a1be5UL, +0xbae7dfdcUL, 0x42cbda70UL, 0xcd7dae0aUL, 0x57e85b7aUL, 0xd53f5af6UL, 0x20cf4d8cUL, +0xcea4d428UL, 0x79d130a4UL, 0x3486ebfbUL, 0x33d3cddcUL, 0x77853b53UL, 0x37effcb5UL, +0xc5068778UL, 0xe580b3e6UL, 0x4e68b8f4UL, 0xc5c8b37eUL, 0x0d809ea2UL, 0x398feb7cUL, +0x132a4f94UL, 0x43b7950eUL, 0x2fee7d1cUL, 0x223613bdUL, 0xdd06caa2UL, 0x37df932bUL, +0xc4248289UL, 0xacf3ebc3UL, 0x5715f6b7UL, 0xef3478ddUL, 0xf267616fUL, 0xc148cbe4UL, +0x9052815eUL, 0x5e410fabUL, 0xb48a2465UL, 0x2eda7fa4UL, 0xe87b40e4UL, 0xe98ea084UL, +0x5889e9e1UL, 0xefd390fcUL, 0xdd07d35bUL, 0xdb485694UL, 0x38d7e5b2UL, 0x57720101UL, +0x730edebcUL, 0x5b643113UL, 0x94917e4fUL, 0x503c2fbaUL, 0x646f1282UL, 0x7523d24aUL, +0xe0779695UL, 0xf9c17a8fUL, 0x7a5b2121UL, 0xd187b896UL, 0x29263a4dUL, 0xba510cdfUL, +0x81f47c9fUL, 0xad1163edUL, 0xea7b5965UL, 0x1a00726eUL, 0x11403092UL, 0x00da6d77UL, +0x4a0cdd61UL, 0xad1f4603UL, 0x605bdfb0UL, 0x9eedc364UL, 0x22ebe6a8UL, 0xcee7d28aUL, +0xa0e736a0UL, 0x5564a6b9UL, 0x10853209UL, 0xc7eb8f37UL, 0x2de705caUL, 0x8951570fUL, +0xdf09822bUL, 0xbd691a6cUL, 0xaa12e4f2UL, 0x87451c0fUL, 0xe0f6a27aUL, 0x3ada4819UL, +0x4cf1764fUL, 0x0d771c2bUL, 0x67cdb156UL, 0x350d8384UL, 0x5938fa0fUL, 0x42399ef3UL, +0x36997b07UL, 0x0e84093dUL, 0x4aa93e61UL, 0x8360d87bUL, 0x1fa98b0cUL, 0x1149382cUL, +0xe97625a5UL, 0x0614d1b7UL, 0x0e25244bUL, 0x0c768347UL, 0x589e8d82UL, 0x0d2059d1UL, +0xa466bb1eUL, 0xf8da0a82UL, 0x04f19130UL, 0xba6e4ec0UL, 0x99265164UL, 0x1ee7230dUL, +0x50b2ad80UL, 0xeaee6801UL, 0x8db2a283UL, 0xea8bf59eUL}; + +/* returns the i'th byte of a variable */ +#ifdef _MSC_VER + #define GB(x, i) ((unsigned char)((x[(15-i)>>2])>>(unsigned)(8*((15-i)&3)))) +#else + #define GB(x, i) (((x[(15-i)>>2])>>(unsigned)(8*((15-i)&3)))&255) +#endif + + /** + Initialize the CAST5 block cipher + @param key The symmetric key you wish to pass + @param keylen The key length in bytes + @param num_rounds The number of rounds desired (0 for default) + @param skey The key in as scheduled by this function. + @return CRYPT_OK if successful + */ +#ifdef LTC_CLEAN_STACK +static int _cast5_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey) +#else +int cast5_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey) +#endif +{ + ulong32 x[4], z[4]; + unsigned char buf[16]; + int y, i; + + LTC_ARGCHK(key != NULL); + LTC_ARGCHK(skey != NULL); + + if (num_rounds != 12 && num_rounds != 16 && num_rounds != 0) { + return CRYPT_INVALID_ROUNDS; + } + + if (num_rounds == 12 && keylen > 10) { + return CRYPT_INVALID_ROUNDS; + } + + if (keylen < 5 || keylen > 16) { + return CRYPT_INVALID_KEYSIZE; + } + + /* extend the key as required */ + zeromem(buf, sizeof(buf)); + XMEMCPY(buf, key, (size_t)keylen); + + /* load and start the awful looking network */ + for (y = 0; y < 4; y++) { + LOAD32H(x[3-y],buf+4*y); + } + + for (i = y = 0; y < 2; y++) { + z[3] = x[3] ^ S5[GB(x, 0xD)] ^ S6[GB(x, 0xF)] ^ S7[GB(x, 0xC)] ^ S8[GB(x, 0xE)] ^ S7[GB(x, 0x8)]; + z[2] = x[1] ^ S5[GB(z, 0x0)] ^ S6[GB(z, 0x2)] ^ S7[GB(z, 0x1)] ^ S8[GB(z, 0x3)] ^ S8[GB(x, 0xA)]; + z[1] = x[0] ^ S5[GB(z, 0x7)] ^ S6[GB(z, 0x6)] ^ S7[GB(z, 0x5)] ^ S8[GB(z, 0x4)] ^ S5[GB(x, 0x9)]; + z[0] = x[2] ^ S5[GB(z, 0xA)] ^ S6[GB(z, 0x9)] ^ S7[GB(z, 0xb)] ^ S8[GB(z, 0x8)] ^ S6[GB(x, 0xB)]; + skey->cast5.K[i++] = S5[GB(z, 0x8)] ^ S6[GB(z, 0x9)] ^ S7[GB(z, 0x7)] ^ S8[GB(z, 0x6)] ^ S5[GB(z, 0x2)]; + skey->cast5.K[i++] = S5[GB(z, 0xA)] ^ S6[GB(z, 0xB)] ^ S7[GB(z, 0x5)] ^ S8[GB(z, 0x4)] ^ S6[GB(z, 0x6)]; + skey->cast5.K[i++] = S5[GB(z, 0xC)] ^ S6[GB(z, 0xd)] ^ S7[GB(z, 0x3)] ^ S8[GB(z, 0x2)] ^ S7[GB(z, 0x9)]; + skey->cast5.K[i++] = S5[GB(z, 0xE)] ^ S6[GB(z, 0xF)] ^ S7[GB(z, 0x1)] ^ S8[GB(z, 0x0)] ^ S8[GB(z, 0xc)]; + + x[3] = z[1] ^ S5[GB(z, 0x5)] ^ S6[GB(z, 0x7)] ^ S7[GB(z, 0x4)] ^ S8[GB(z, 0x6)] ^ S7[GB(z, 0x0)]; + x[2] = z[3] ^ S5[GB(x, 0x0)] ^ S6[GB(x, 0x2)] ^ S7[GB(x, 0x1)] ^ S8[GB(x, 0x3)] ^ S8[GB(z, 0x2)]; + x[1] = z[2] ^ S5[GB(x, 0x7)] ^ S6[GB(x, 0x6)] ^ S7[GB(x, 0x5)] ^ S8[GB(x, 0x4)] ^ S5[GB(z, 0x1)]; + x[0] = z[0] ^ S5[GB(x, 0xA)] ^ S6[GB(x, 0x9)] ^ S7[GB(x, 0xb)] ^ S8[GB(x, 0x8)] ^ S6[GB(z, 0x3)]; + skey->cast5.K[i++] = S5[GB(x, 0x3)] ^ S6[GB(x, 0x2)] ^ S7[GB(x, 0xc)] ^ S8[GB(x, 0xd)] ^ S5[GB(x, 0x8)]; + skey->cast5.K[i++] = S5[GB(x, 0x1)] ^ S6[GB(x, 0x0)] ^ S7[GB(x, 0xe)] ^ S8[GB(x, 0xf)] ^ S6[GB(x, 0xd)]; + skey->cast5.K[i++] = S5[GB(x, 0x7)] ^ S6[GB(x, 0x6)] ^ S7[GB(x, 0x8)] ^ S8[GB(x, 0x9)] ^ S7[GB(x, 0x3)]; + skey->cast5.K[i++] = S5[GB(x, 0x5)] ^ S6[GB(x, 0x4)] ^ S7[GB(x, 0xa)] ^ S8[GB(x, 0xb)] ^ S8[GB(x, 0x7)]; + + /* second half */ + z[3] = x[3] ^ S5[GB(x, 0xD)] ^ S6[GB(x, 0xF)] ^ S7[GB(x, 0xC)] ^ S8[GB(x, 0xE)] ^ S7[GB(x, 0x8)]; + z[2] = x[1] ^ S5[GB(z, 0x0)] ^ S6[GB(z, 0x2)] ^ S7[GB(z, 0x1)] ^ S8[GB(z, 0x3)] ^ S8[GB(x, 0xA)]; + z[1] = x[0] ^ S5[GB(z, 0x7)] ^ S6[GB(z, 0x6)] ^ S7[GB(z, 0x5)] ^ S8[GB(z, 0x4)] ^ S5[GB(x, 0x9)]; + z[0] = x[2] ^ S5[GB(z, 0xA)] ^ S6[GB(z, 0x9)] ^ S7[GB(z, 0xb)] ^ S8[GB(z, 0x8)] ^ S6[GB(x, 0xB)]; + skey->cast5.K[i++] = S5[GB(z, 0x3)] ^ S6[GB(z, 0x2)] ^ S7[GB(z, 0xc)] ^ S8[GB(z, 0xd)] ^ S5[GB(z, 0x9)]; + skey->cast5.K[i++] = S5[GB(z, 0x1)] ^ S6[GB(z, 0x0)] ^ S7[GB(z, 0xe)] ^ S8[GB(z, 0xf)] ^ S6[GB(z, 0xc)]; + skey->cast5.K[i++] = S5[GB(z, 0x7)] ^ S6[GB(z, 0x6)] ^ S7[GB(z, 0x8)] ^ S8[GB(z, 0x9)] ^ S7[GB(z, 0x2)]; + skey->cast5.K[i++] = S5[GB(z, 0x5)] ^ S6[GB(z, 0x4)] ^ S7[GB(z, 0xa)] ^ S8[GB(z, 0xb)] ^ S8[GB(z, 0x6)]; + + x[3] = z[1] ^ S5[GB(z, 0x5)] ^ S6[GB(z, 0x7)] ^ S7[GB(z, 0x4)] ^ S8[GB(z, 0x6)] ^ S7[GB(z, 0x0)]; + x[2] = z[3] ^ S5[GB(x, 0x0)] ^ S6[GB(x, 0x2)] ^ S7[GB(x, 0x1)] ^ S8[GB(x, 0x3)] ^ S8[GB(z, 0x2)]; + x[1] = z[2] ^ S5[GB(x, 0x7)] ^ S6[GB(x, 0x6)] ^ S7[GB(x, 0x5)] ^ S8[GB(x, 0x4)] ^ S5[GB(z, 0x1)]; + x[0] = z[0] ^ S5[GB(x, 0xA)] ^ S6[GB(x, 0x9)] ^ S7[GB(x, 0xb)] ^ S8[GB(x, 0x8)] ^ S6[GB(z, 0x3)]; + skey->cast5.K[i++] = S5[GB(x, 0x8)] ^ S6[GB(x, 0x9)] ^ S7[GB(x, 0x7)] ^ S8[GB(x, 0x6)] ^ S5[GB(x, 0x3)]; + skey->cast5.K[i++] = S5[GB(x, 0xa)] ^ S6[GB(x, 0xb)] ^ S7[GB(x, 0x5)] ^ S8[GB(x, 0x4)] ^ S6[GB(x, 0x7)]; + skey->cast5.K[i++] = S5[GB(x, 0xc)] ^ S6[GB(x, 0xd)] ^ S7[GB(x, 0x3)] ^ S8[GB(x, 0x2)] ^ S7[GB(x, 0x8)]; + skey->cast5.K[i++] = S5[GB(x, 0xe)] ^ S6[GB(x, 0xf)] ^ S7[GB(x, 0x1)] ^ S8[GB(x, 0x0)] ^ S8[GB(x, 0xd)]; + } + + skey->cast5.keylen = keylen; + +#ifdef LTC_CLEAN_STACK + zeromem(buf, sizeof(buf)); + zeromem(x, sizeof(x)); + zeromem(z, sizeof(z)); +#endif + + return CRYPT_OK; +} + +#ifdef LTC_CLEAN_STACK +int cast5_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey) +{ + int z; + z = _cast5_setup(key, keylen, num_rounds, skey); + burn_stack(sizeof(ulong32)*8 + 16 + sizeof(int)*2); + return z; +} +#endif + +#ifdef _MSC_VER + #define INLINE __inline +#else + #define INLINE +#endif + +INLINE static ulong32 FI(ulong32 R, ulong32 Km, ulong32 Kr) +{ + ulong32 I; + I = (Km + R); + I = ROL(I, Kr); + return ((S1[byte(I, 3)] ^ S2[byte(I,2)]) - S3[byte(I,1)]) + S4[byte(I,0)]; +} + +INLINE static ulong32 FII(ulong32 R, ulong32 Km, ulong32 Kr) +{ + ulong32 I; + I = (Km ^ R); + I = ROL(I, Kr); + return ((S1[byte(I, 3)] - S2[byte(I,2)]) + S3[byte(I,1)]) ^ S4[byte(I,0)]; +} + +INLINE static ulong32 FIII(ulong32 R, ulong32 Km, ulong32 Kr) +{ + ulong32 I; + I = (Km - R); + I = ROL(I, Kr); + return ((S1[byte(I, 3)] + S2[byte(I,2)]) ^ S3[byte(I,1)]) - S4[byte(I,0)]; +} + +/** + Encrypts a block of text with CAST5 + @param pt The input plaintext (8 bytes) + @param ct The output ciphertext (8 bytes) + @param skey The key as scheduled +*/ +#ifdef LTC_CLEAN_STACK +static int _cast5_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key *skey) +#else +int cast5_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key *skey) +#endif +{ + ulong32 R, L; + + LTC_ARGCHK(pt != NULL); + LTC_ARGCHK(ct != NULL); + LTC_ARGCHK(skey != NULL); + + LOAD32H(L,&pt[0]); + LOAD32H(R,&pt[4]); + L ^= FI(R, skey->cast5.K[0], skey->cast5.K[16]); + R ^= FII(L, skey->cast5.K[1], skey->cast5.K[17]); + L ^= FIII(R, skey->cast5.K[2], skey->cast5.K[18]); + R ^= FI(L, skey->cast5.K[3], skey->cast5.K[19]); + L ^= FII(R, skey->cast5.K[4], skey->cast5.K[20]); + R ^= FIII(L, skey->cast5.K[5], skey->cast5.K[21]); + L ^= FI(R, skey->cast5.K[6], skey->cast5.K[22]); + R ^= FII(L, skey->cast5.K[7], skey->cast5.K[23]); + L ^= FIII(R, skey->cast5.K[8], skey->cast5.K[24]); + R ^= FI(L, skey->cast5.K[9], skey->cast5.K[25]); + L ^= FII(R, skey->cast5.K[10], skey->cast5.K[26]); + R ^= FIII(L, skey->cast5.K[11], skey->cast5.K[27]); + if (skey->cast5.keylen > 10) { + L ^= FI(R, skey->cast5.K[12], skey->cast5.K[28]); + R ^= FII(L, skey->cast5.K[13], skey->cast5.K[29]); + L ^= FIII(R, skey->cast5.K[14], skey->cast5.K[30]); + R ^= FI(L, skey->cast5.K[15], skey->cast5.K[31]); + } + STORE32H(R,&ct[0]); + STORE32H(L,&ct[4]); + return CRYPT_OK; +} + + +#ifdef LTC_CLEAN_STACK +int cast5_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key *skey) +{ + int err =_cast5_ecb_encrypt(pt,ct,skey); + burn_stack(sizeof(ulong32)*3); + return err; +} +#endif + +/** + Decrypts a block of text with CAST5 + @param ct The input ciphertext (8 bytes) + @param pt The output plaintext (8 bytes) + @param skey The key as scheduled +*/ +#ifdef LTC_CLEAN_STACK +static int _cast5_ecb_decrypt(const unsigned char *ct, unsigned char *pt, symmetric_key *skey) +#else +int cast5_ecb_decrypt(const unsigned char *ct, unsigned char *pt, symmetric_key *skey) +#endif +{ + ulong32 R, L; + + LTC_ARGCHK(pt != NULL); + LTC_ARGCHK(ct != NULL); + LTC_ARGCHK(skey != NULL); + + LOAD32H(R,&ct[0]); + LOAD32H(L,&ct[4]); + if (skey->cast5.keylen > 10) { + R ^= FI(L, skey->cast5.K[15], skey->cast5.K[31]); + L ^= FIII(R, skey->cast5.K[14], skey->cast5.K[30]); + R ^= FII(L, skey->cast5.K[13], skey->cast5.K[29]); + L ^= FI(R, skey->cast5.K[12], skey->cast5.K[28]); + } + R ^= FIII(L, skey->cast5.K[11], skey->cast5.K[27]); + L ^= FII(R, skey->cast5.K[10], skey->cast5.K[26]); + R ^= FI(L, skey->cast5.K[9], skey->cast5.K[25]); + L ^= FIII(R, skey->cast5.K[8], skey->cast5.K[24]); + R ^= FII(L, skey->cast5.K[7], skey->cast5.K[23]); + L ^= FI(R, skey->cast5.K[6], skey->cast5.K[22]); + R ^= FIII(L, skey->cast5.K[5], skey->cast5.K[21]); + L ^= FII(R, skey->cast5.K[4], skey->cast5.K[20]); + R ^= FI(L, skey->cast5.K[3], skey->cast5.K[19]); + L ^= FIII(R, skey->cast5.K[2], skey->cast5.K[18]); + R ^= FII(L, skey->cast5.K[1], skey->cast5.K[17]); + L ^= FI(R, skey->cast5.K[0], skey->cast5.K[16]); + STORE32H(L,&pt[0]); + STORE32H(R,&pt[4]); + + return CRYPT_OK; +} + +#ifdef LTC_CLEAN_STACK +int cast5_ecb_decrypt(const unsigned char *ct, unsigned char *pt, symmetric_key *skey) +{ + int err = _cast5_ecb_decrypt(ct,pt,skey); + burn_stack(sizeof(ulong32)*3); + return err; +} +#endif + +/** + Performs a self-test of the CAST5 block cipher + @return CRYPT_OK if functional, CRYPT_NOP if self-test has been disabled +*/ +int cast5_test(void) +{ + #ifndef LTC_TEST + return CRYPT_NOP; + #else + static const struct { + int keylen; + unsigned char key[16]; + unsigned char pt[8]; + unsigned char ct[8]; + } tests[] = { + { 16, + {0x01, 0x23, 0x45, 0x67, 0x12, 0x34, 0x56, 0x78, 0x23, 0x45, 0x67, 0x89, 0x34, 0x56, 0x78, 0x9A}, + {0x01, 0x23, 0x45, 0x67, 0x89, 0xAB, 0xCD, 0xEF}, + {0x23, 0x8B, 0x4F, 0xE5, 0x84, 0x7E, 0x44, 0xB2} + }, + { 10, + {0x01, 0x23, 0x45, 0x67, 0x12, 0x34, 0x56, 0x78, 0x23, 0x45, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00}, + {0x01, 0x23, 0x45, 0x67, 0x89, 0xAB, 0xCD, 0xEF}, + {0xEB, 0x6A, 0x71, 0x1A, 0x2C, 0x02, 0x27, 0x1B}, + }, + { 5, + {0x01, 0x23, 0x45, 0x67, 0x12, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00}, + {0x01, 0x23, 0x45, 0x67, 0x89, 0xAB, 0xCD, 0xEF}, + {0x7A, 0xC8, 0x16, 0xD1, 0x6E, 0x9B, 0x30, 0x2E} + } + }; + int i, y, err; + symmetric_key key; + unsigned char tmp[2][8]; + + for (i = 0; i < (int)(sizeof(tests) / sizeof(tests[0])); i++) { + if ((err = cast5_setup(tests[i].key, tests[i].keylen, 0, &key)) != CRYPT_OK) { + return err; + } + cast5_ecb_encrypt(tests[i].pt, tmp[0], &key); + cast5_ecb_decrypt(tmp[0], tmp[1], &key); + if ((XMEMCMP(tmp[0], tests[i].ct, 8) != 0) || (XMEMCMP(tmp[1], tests[i].pt, 8) != 0)) { + return CRYPT_FAIL_TESTVECTOR; + } + /* now see if we can encrypt all zero bytes 1000 times, decrypt and come back where we started */ + for (y = 0; y < 8; y++) tmp[0][y] = 0; + for (y = 0; y < 1000; y++) cast5_ecb_encrypt(tmp[0], tmp[0], &key); + for (y = 0; y < 1000; y++) cast5_ecb_decrypt(tmp[0], tmp[0], &key); + for (y = 0; y < 8; y++) if (tmp[0][y] != 0) return CRYPT_FAIL_TESTVECTOR; + + } + return CRYPT_OK; + #endif +} + +/** Terminate the context + @param skey The scheduled key +*/ +void cast5_done(symmetric_key *skey) +{ +} + +/** + Gets suitable key size + @param keysize [in/out] The length of the recommended key (in bytes). This function will store the suitable size back in this variable. + @return CRYPT_OK if the input key size is acceptable. +*/ +int cast5_keysize(int *keysize) +{ + LTC_ARGCHK(keysize != NULL); + if (*keysize < 5) { + return CRYPT_INVALID_KEYSIZE; + } else if (*keysize > 16) { + *keysize = 16; + } + return CRYPT_OK; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/ciphers/cast5.c,v $ */ +/* $Revision: 1.12 $ */ +/* $Date: 2006/11/08 23:01:06 $ */ diff --git a/libtomcrypt/src/ciphers/des.c b/libtomcrypt/src/ciphers/des.c new file mode 100644 index 0000000..e505b14 --- /dev/null +++ b/libtomcrypt/src/ciphers/des.c @@ -0,0 +1,1914 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file des.c + DES code submitted by Dobes Vandermeer +*/ + +#ifdef DES + +#define EN0 0 +#define DE1 1 + +#if 0 +const struct ltc_cipher_descriptor des_desc = +{ + "des", + 13, + 8, 8, 8, 16, + &des_setup, + &des_ecb_encrypt, + &des_ecb_decrypt, + &des_test, + &des_done, + &des_keysize, + NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL +}; +#endif + +const struct ltc_cipher_descriptor des3_desc = +{ + "3des", + 14, + 24, 24, 8, 16, + &des3_setup, + &des3_ecb_encrypt, + &des3_ecb_decrypt, + &des3_test, + &des3_done, + &des3_keysize, + NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL +}; + +static const ulong32 bytebit[8] = +{ + 0200, 0100, 040, 020, 010, 04, 02, 01 +}; + +static const ulong32 bigbyte[24] = +{ + 0x800000UL, 0x400000UL, 0x200000UL, 0x100000UL, + 0x80000UL, 0x40000UL, 0x20000UL, 0x10000UL, + 0x8000UL, 0x4000UL, 0x2000UL, 0x1000UL, + 0x800UL, 0x400UL, 0x200UL, 0x100UL, + 0x80UL, 0x40UL, 0x20UL, 0x10UL, + 0x8UL, 0x4UL, 0x2UL, 0x1L +}; + +/* Use the key schedule specific in the standard (ANSI X3.92-1981) */ + +static const unsigned char pc1[56] = { + 56, 48, 40, 32, 24, 16, 8, 0, 57, 49, 41, 33, 25, 17, + 9, 1, 58, 50, 42, 34, 26, 18, 10, 2, 59, 51, 43, 35, + 62, 54, 46, 38, 30, 22, 14, 6, 61, 53, 45, 37, 29, 21, + 13, 5, 60, 52, 44, 36, 28, 20, 12, 4, 27, 19, 11, 3 +}; + +static const unsigned char totrot[16] = { + 1, 2, 4, 6, + 8, 10, 12, 14, + 15, 17, 19, 21, + 23, 25, 27, 28 +}; + +static const unsigned char pc2[48] = { + 13, 16, 10, 23, 0, 4, 2, 27, 14, 5, 20, 9, + 22, 18, 11, 3, 25, 7, 15, 6, 26, 19, 12, 1, + 40, 51, 30, 36, 46, 54, 29, 39, 50, 44, 32, 47, + 43, 48, 38, 55, 33, 52, 45, 41, 49, 35, 28, 31 +}; + + +static const ulong32 SP1[64] = +{ + 0x01010400UL, 0x00000000UL, 0x00010000UL, 0x01010404UL, + 0x01010004UL, 0x00010404UL, 0x00000004UL, 0x00010000UL, + 0x00000400UL, 0x01010400UL, 0x01010404UL, 0x00000400UL, + 0x01000404UL, 0x01010004UL, 0x01000000UL, 0x00000004UL, + 0x00000404UL, 0x01000400UL, 0x01000400UL, 0x00010400UL, + 0x00010400UL, 0x01010000UL, 0x01010000UL, 0x01000404UL, + 0x00010004UL, 0x01000004UL, 0x01000004UL, 0x00010004UL, + 0x00000000UL, 0x00000404UL, 0x00010404UL, 0x01000000UL, + 0x00010000UL, 0x01010404UL, 0x00000004UL, 0x01010000UL, + 0x01010400UL, 0x01000000UL, 0x01000000UL, 0x00000400UL, + 0x01010004UL, 0x00010000UL, 0x00010400UL, 0x01000004UL, + 0x00000400UL, 0x00000004UL, 0x01000404UL, 0x00010404UL, + 0x01010404UL, 0x00010004UL, 0x01010000UL, 0x01000404UL, + 0x01000004UL, 0x00000404UL, 0x00010404UL, 0x01010400UL, + 0x00000404UL, 0x01000400UL, 0x01000400UL, 0x00000000UL, + 0x00010004UL, 0x00010400UL, 0x00000000UL, 0x01010004UL +}; + +static const ulong32 SP2[64] = +{ + 0x80108020UL, 0x80008000UL, 0x00008000UL, 0x00108020UL, + 0x00100000UL, 0x00000020UL, 0x80100020UL, 0x80008020UL, + 0x80000020UL, 0x80108020UL, 0x80108000UL, 0x80000000UL, + 0x80008000UL, 0x00100000UL, 0x00000020UL, 0x80100020UL, + 0x00108000UL, 0x00100020UL, 0x80008020UL, 0x00000000UL, + 0x80000000UL, 0x00008000UL, 0x00108020UL, 0x80100000UL, + 0x00100020UL, 0x80000020UL, 0x00000000UL, 0x00108000UL, + 0x00008020UL, 0x80108000UL, 0x80100000UL, 0x00008020UL, + 0x00000000UL, 0x00108020UL, 0x80100020UL, 0x00100000UL, + 0x80008020UL, 0x80100000UL, 0x80108000UL, 0x00008000UL, + 0x80100000UL, 0x80008000UL, 0x00000020UL, 0x80108020UL, + 0x00108020UL, 0x00000020UL, 0x00008000UL, 0x80000000UL, + 0x00008020UL, 0x80108000UL, 0x00100000UL, 0x80000020UL, + 0x00100020UL, 0x80008020UL, 0x80000020UL, 0x00100020UL, + 0x00108000UL, 0x00000000UL, 0x80008000UL, 0x00008020UL, + 0x80000000UL, 0x80100020UL, 0x80108020UL, 0x00108000UL +}; + +static const ulong32 SP3[64] = +{ + 0x00000208UL, 0x08020200UL, 0x00000000UL, 0x08020008UL, + 0x08000200UL, 0x00000000UL, 0x00020208UL, 0x08000200UL, + 0x00020008UL, 0x08000008UL, 0x08000008UL, 0x00020000UL, + 0x08020208UL, 0x00020008UL, 0x08020000UL, 0x00000208UL, + 0x08000000UL, 0x00000008UL, 0x08020200UL, 0x00000200UL, + 0x00020200UL, 0x08020000UL, 0x08020008UL, 0x00020208UL, + 0x08000208UL, 0x00020200UL, 0x00020000UL, 0x08000208UL, + 0x00000008UL, 0x08020208UL, 0x00000200UL, 0x08000000UL, + 0x08020200UL, 0x08000000UL, 0x00020008UL, 0x00000208UL, + 0x00020000UL, 0x08020200UL, 0x08000200UL, 0x00000000UL, + 0x00000200UL, 0x00020008UL, 0x08020208UL, 0x08000200UL, + 0x08000008UL, 0x00000200UL, 0x00000000UL, 0x08020008UL, + 0x08000208UL, 0x00020000UL, 0x08000000UL, 0x08020208UL, + 0x00000008UL, 0x00020208UL, 0x00020200UL, 0x08000008UL, + 0x08020000UL, 0x08000208UL, 0x00000208UL, 0x08020000UL, + 0x00020208UL, 0x00000008UL, 0x08020008UL, 0x00020200UL +}; + +static const ulong32 SP4[64] = +{ + 0x00802001UL, 0x00002081UL, 0x00002081UL, 0x00000080UL, + 0x00802080UL, 0x00800081UL, 0x00800001UL, 0x00002001UL, + 0x00000000UL, 0x00802000UL, 0x00802000UL, 0x00802081UL, + 0x00000081UL, 0x00000000UL, 0x00800080UL, 0x00800001UL, + 0x00000001UL, 0x00002000UL, 0x00800000UL, 0x00802001UL, + 0x00000080UL, 0x00800000UL, 0x00002001UL, 0x00002080UL, + 0x00800081UL, 0x00000001UL, 0x00002080UL, 0x00800080UL, + 0x00002000UL, 0x00802080UL, 0x00802081UL, 0x00000081UL, + 0x00800080UL, 0x00800001UL, 0x00802000UL, 0x00802081UL, + 0x00000081UL, 0x00000000UL, 0x00000000UL, 0x00802000UL, + 0x00002080UL, 0x00800080UL, 0x00800081UL, 0x00000001UL, + 0x00802001UL, 0x00002081UL, 0x00002081UL, 0x00000080UL, + 0x00802081UL, 0x00000081UL, 0x00000001UL, 0x00002000UL, + 0x00800001UL, 0x00002001UL, 0x00802080UL, 0x00800081UL, + 0x00002001UL, 0x00002080UL, 0x00800000UL, 0x00802001UL, + 0x00000080UL, 0x00800000UL, 0x00002000UL, 0x00802080UL +}; + +static const ulong32 SP5[64] = +{ + 0x00000100UL, 0x02080100UL, 0x02080000UL, 0x42000100UL, + 0x00080000UL, 0x00000100UL, 0x40000000UL, 0x02080000UL, + 0x40080100UL, 0x00080000UL, 0x02000100UL, 0x40080100UL, + 0x42000100UL, 0x42080000UL, 0x00080100UL, 0x40000000UL, + 0x02000000UL, 0x40080000UL, 0x40080000UL, 0x00000000UL, + 0x40000100UL, 0x42080100UL, 0x42080100UL, 0x02000100UL, + 0x42080000UL, 0x40000100UL, 0x00000000UL, 0x42000000UL, + 0x02080100UL, 0x02000000UL, 0x42000000UL, 0x00080100UL, + 0x00080000UL, 0x42000100UL, 0x00000100UL, 0x02000000UL, + 0x40000000UL, 0x02080000UL, 0x42000100UL, 0x40080100UL, + 0x02000100UL, 0x40000000UL, 0x42080000UL, 0x02080100UL, + 0x40080100UL, 0x00000100UL, 0x02000000UL, 0x42080000UL, + 0x42080100UL, 0x00080100UL, 0x42000000UL, 0x42080100UL, + 0x02080000UL, 0x00000000UL, 0x40080000UL, 0x42000000UL, + 0x00080100UL, 0x02000100UL, 0x40000100UL, 0x00080000UL, + 0x00000000UL, 0x40080000UL, 0x02080100UL, 0x40000100UL +}; + +static const ulong32 SP6[64] = +{ + 0x20000010UL, 0x20400000UL, 0x00004000UL, 0x20404010UL, + 0x20400000UL, 0x00000010UL, 0x20404010UL, 0x00400000UL, + 0x20004000UL, 0x00404010UL, 0x00400000UL, 0x20000010UL, + 0x00400010UL, 0x20004000UL, 0x20000000UL, 0x00004010UL, + 0x00000000UL, 0x00400010UL, 0x20004010UL, 0x00004000UL, + 0x00404000UL, 0x20004010UL, 0x00000010UL, 0x20400010UL, + 0x20400010UL, 0x00000000UL, 0x00404010UL, 0x20404000UL, + 0x00004010UL, 0x00404000UL, 0x20404000UL, 0x20000000UL, + 0x20004000UL, 0x00000010UL, 0x20400010UL, 0x00404000UL, + 0x20404010UL, 0x00400000UL, 0x00004010UL, 0x20000010UL, + 0x00400000UL, 0x20004000UL, 0x20000000UL, 0x00004010UL, + 0x20000010UL, 0x20404010UL, 0x00404000UL, 0x20400000UL, + 0x00404010UL, 0x20404000UL, 0x00000000UL, 0x20400010UL, + 0x00000010UL, 0x00004000UL, 0x20400000UL, 0x00404010UL, + 0x00004000UL, 0x00400010UL, 0x20004010UL, 0x00000000UL, + 0x20404000UL, 0x20000000UL, 0x00400010UL, 0x20004010UL +}; + +static const ulong32 SP7[64] = +{ + 0x00200000UL, 0x04200002UL, 0x04000802UL, 0x00000000UL, + 0x00000800UL, 0x04000802UL, 0x00200802UL, 0x04200800UL, + 0x04200802UL, 0x00200000UL, 0x00000000UL, 0x04000002UL, + 0x00000002UL, 0x04000000UL, 0x04200002UL, 0x00000802UL, + 0x04000800UL, 0x00200802UL, 0x00200002UL, 0x04000800UL, + 0x04000002UL, 0x04200000UL, 0x04200800UL, 0x00200002UL, + 0x04200000UL, 0x00000800UL, 0x00000802UL, 0x04200802UL, + 0x00200800UL, 0x00000002UL, 0x04000000UL, 0x00200800UL, + 0x04000000UL, 0x00200800UL, 0x00200000UL, 0x04000802UL, + 0x04000802UL, 0x04200002UL, 0x04200002UL, 0x00000002UL, + 0x00200002UL, 0x04000000UL, 0x04000800UL, 0x00200000UL, + 0x04200800UL, 0x00000802UL, 0x00200802UL, 0x04200800UL, + 0x00000802UL, 0x04000002UL, 0x04200802UL, 0x04200000UL, + 0x00200800UL, 0x00000000UL, 0x00000002UL, 0x04200802UL, + 0x00000000UL, 0x00200802UL, 0x04200000UL, 0x00000800UL, + 0x04000002UL, 0x04000800UL, 0x00000800UL, 0x00200002UL +}; + +static const ulong32 SP8[64] = +{ + 0x10001040UL, 0x00001000UL, 0x00040000UL, 0x10041040UL, + 0x10000000UL, 0x10001040UL, 0x00000040UL, 0x10000000UL, + 0x00040040UL, 0x10040000UL, 0x10041040UL, 0x00041000UL, + 0x10041000UL, 0x00041040UL, 0x00001000UL, 0x00000040UL, + 0x10040000UL, 0x10000040UL, 0x10001000UL, 0x00001040UL, + 0x00041000UL, 0x00040040UL, 0x10040040UL, 0x10041000UL, + 0x00001040UL, 0x00000000UL, 0x00000000UL, 0x10040040UL, + 0x10000040UL, 0x10001000UL, 0x00041040UL, 0x00040000UL, + 0x00041040UL, 0x00040000UL, 0x10041000UL, 0x00001000UL, + 0x00000040UL, 0x10040040UL, 0x00001000UL, 0x00041040UL, + 0x10001000UL, 0x00000040UL, 0x10000040UL, 0x10040000UL, + 0x10040040UL, 0x10000000UL, 0x00040000UL, 0x10001040UL, + 0x00000000UL, 0x10041040UL, 0x00040040UL, 0x10000040UL, + 0x10040000UL, 0x10001000UL, 0x10001040UL, 0x00000000UL, + 0x10041040UL, 0x00041000UL, 0x00041000UL, 0x00001040UL, + 0x00001040UL, 0x00040040UL, 0x10000000UL, 0x10041000UL +}; + +#ifndef LTC_SMALL_CODE + +static const ulong64 des_ip[8][256] = { + +{ CONST64(0x0000000000000000), CONST64(0x0000001000000000), CONST64(0x0000000000000010), CONST64(0x0000001000000010), + CONST64(0x0000100000000000), CONST64(0x0000101000000000), CONST64(0x0000100000000010), CONST64(0x0000101000000010), + CONST64(0x0000000000001000), CONST64(0x0000001000001000), CONST64(0x0000000000001010), CONST64(0x0000001000001010), + CONST64(0x0000100000001000), CONST64(0x0000101000001000), CONST64(0x0000100000001010), CONST64(0x0000101000001010), + CONST64(0x0010000000000000), CONST64(0x0010001000000000), CONST64(0x0010000000000010), CONST64(0x0010001000000010), + CONST64(0x0010100000000000), CONST64(0x0010101000000000), CONST64(0x0010100000000010), CONST64(0x0010101000000010), + CONST64(0x0010000000001000), CONST64(0x0010001000001000), CONST64(0x0010000000001010), CONST64(0x0010001000001010), + CONST64(0x0010100000001000), CONST64(0x0010101000001000), CONST64(0x0010100000001010), CONST64(0x0010101000001010), + CONST64(0x0000000000100000), CONST64(0x0000001000100000), CONST64(0x0000000000100010), CONST64(0x0000001000100010), + CONST64(0x0000100000100000), CONST64(0x0000101000100000), CONST64(0x0000100000100010), CONST64(0x0000101000100010), + CONST64(0x0000000000101000), CONST64(0x0000001000101000), CONST64(0x0000000000101010), CONST64(0x0000001000101010), + CONST64(0x0000100000101000), CONST64(0x0000101000101000), CONST64(0x0000100000101010), CONST64(0x0000101000101010), + CONST64(0x0010000000100000), CONST64(0x0010001000100000), CONST64(0x0010000000100010), CONST64(0x0010001000100010), + CONST64(0x0010100000100000), CONST64(0x0010101000100000), CONST64(0x0010100000100010), CONST64(0x0010101000100010), + CONST64(0x0010000000101000), CONST64(0x0010001000101000), CONST64(0x0010000000101010), CONST64(0x0010001000101010), + CONST64(0x0010100000101000), CONST64(0x0010101000101000), CONST64(0x0010100000101010), CONST64(0x0010101000101010), + CONST64(0x1000000000000000), CONST64(0x1000001000000000), CONST64(0x1000000000000010), CONST64(0x1000001000000010), + CONST64(0x1000100000000000), CONST64(0x1000101000000000), CONST64(0x1000100000000010), CONST64(0x1000101000000010), + CONST64(0x1000000000001000), CONST64(0x1000001000001000), CONST64(0x1000000000001010), CONST64(0x1000001000001010), + CONST64(0x1000100000001000), CONST64(0x1000101000001000), CONST64(0x1000100000001010), CONST64(0x1000101000001010), + CONST64(0x1010000000000000), CONST64(0x1010001000000000), CONST64(0x1010000000000010), CONST64(0x1010001000000010), + CONST64(0x1010100000000000), CONST64(0x1010101000000000), CONST64(0x1010100000000010), CONST64(0x1010101000000010), + CONST64(0x1010000000001000), CONST64(0x1010001000001000), CONST64(0x1010000000001010), CONST64(0x1010001000001010), + CONST64(0x1010100000001000), CONST64(0x1010101000001000), CONST64(0x1010100000001010), CONST64(0x1010101000001010), + CONST64(0x1000000000100000), CONST64(0x1000001000100000), CONST64(0x1000000000100010), CONST64(0x1000001000100010), + CONST64(0x1000100000100000), CONST64(0x1000101000100000), CONST64(0x1000100000100010), CONST64(0x1000101000100010), + CONST64(0x1000000000101000), CONST64(0x1000001000101000), CONST64(0x1000000000101010), CONST64(0x1000001000101010), + CONST64(0x1000100000101000), CONST64(0x1000101000101000), CONST64(0x1000100000101010), CONST64(0x1000101000101010), + CONST64(0x1010000000100000), CONST64(0x1010001000100000), CONST64(0x1010000000100010), CONST64(0x1010001000100010), + CONST64(0x1010100000100000), CONST64(0x1010101000100000), CONST64(0x1010100000100010), CONST64(0x1010101000100010), + CONST64(0x1010000000101000), CONST64(0x1010001000101000), CONST64(0x1010000000101010), CONST64(0x1010001000101010), + CONST64(0x1010100000101000), CONST64(0x1010101000101000), CONST64(0x1010100000101010), CONST64(0x1010101000101010), + CONST64(0x0000000010000000), CONST64(0x0000001010000000), CONST64(0x0000000010000010), CONST64(0x0000001010000010), + CONST64(0x0000100010000000), CONST64(0x0000101010000000), CONST64(0x0000100010000010), CONST64(0x0000101010000010), + CONST64(0x0000000010001000), CONST64(0x0000001010001000), CONST64(0x0000000010001010), CONST64(0x0000001010001010), + CONST64(0x0000100010001000), CONST64(0x0000101010001000), CONST64(0x0000100010001010), CONST64(0x0000101010001010), + CONST64(0x0010000010000000), CONST64(0x0010001010000000), CONST64(0x0010000010000010), CONST64(0x0010001010000010), + CONST64(0x0010100010000000), CONST64(0x0010101010000000), CONST64(0x0010100010000010), CONST64(0x0010101010000010), + CONST64(0x0010000010001000), CONST64(0x0010001010001000), CONST64(0x0010000010001010), CONST64(0x0010001010001010), + CONST64(0x0010100010001000), CONST64(0x0010101010001000), CONST64(0x0010100010001010), CONST64(0x0010101010001010), + CONST64(0x0000000010100000), CONST64(0x0000001010100000), CONST64(0x0000000010100010), CONST64(0x0000001010100010), + CONST64(0x0000100010100000), CONST64(0x0000101010100000), CONST64(0x0000100010100010), CONST64(0x0000101010100010), + CONST64(0x0000000010101000), CONST64(0x0000001010101000), CONST64(0x0000000010101010), CONST64(0x0000001010101010), + CONST64(0x0000100010101000), CONST64(0x0000101010101000), CONST64(0x0000100010101010), CONST64(0x0000101010101010), + CONST64(0x0010000010100000), CONST64(0x0010001010100000), CONST64(0x0010000010100010), CONST64(0x0010001010100010), + CONST64(0x0010100010100000), CONST64(0x0010101010100000), CONST64(0x0010100010100010), CONST64(0x0010101010100010), + CONST64(0x0010000010101000), CONST64(0x0010001010101000), CONST64(0x0010000010101010), CONST64(0x0010001010101010), + CONST64(0x0010100010101000), CONST64(0x0010101010101000), CONST64(0x0010100010101010), CONST64(0x0010101010101010), + CONST64(0x1000000010000000), CONST64(0x1000001010000000), CONST64(0x1000000010000010), CONST64(0x1000001010000010), + CONST64(0x1000100010000000), CONST64(0x1000101010000000), CONST64(0x1000100010000010), CONST64(0x1000101010000010), + CONST64(0x1000000010001000), CONST64(0x1000001010001000), CONST64(0x1000000010001010), CONST64(0x1000001010001010), + CONST64(0x1000100010001000), CONST64(0x1000101010001000), CONST64(0x1000100010001010), CONST64(0x1000101010001010), + CONST64(0x1010000010000000), CONST64(0x1010001010000000), CONST64(0x1010000010000010), CONST64(0x1010001010000010), + CONST64(0x1010100010000000), CONST64(0x1010101010000000), CONST64(0x1010100010000010), CONST64(0x1010101010000010), + CONST64(0x1010000010001000), CONST64(0x1010001010001000), CONST64(0x1010000010001010), CONST64(0x1010001010001010), + CONST64(0x1010100010001000), CONST64(0x1010101010001000), CONST64(0x1010100010001010), CONST64(0x1010101010001010), + CONST64(0x1000000010100000), CONST64(0x1000001010100000), CONST64(0x1000000010100010), CONST64(0x1000001010100010), + CONST64(0x1000100010100000), CONST64(0x1000101010100000), CONST64(0x1000100010100010), CONST64(0x1000101010100010), + CONST64(0x1000000010101000), CONST64(0x1000001010101000), CONST64(0x1000000010101010), CONST64(0x1000001010101010), + CONST64(0x1000100010101000), CONST64(0x1000101010101000), CONST64(0x1000100010101010), CONST64(0x1000101010101010), + CONST64(0x1010000010100000), CONST64(0x1010001010100000), CONST64(0x1010000010100010), CONST64(0x1010001010100010), + CONST64(0x1010100010100000), CONST64(0x1010101010100000), CONST64(0x1010100010100010), CONST64(0x1010101010100010), + CONST64(0x1010000010101000), CONST64(0x1010001010101000), CONST64(0x1010000010101010), CONST64(0x1010001010101010), + CONST64(0x1010100010101000), CONST64(0x1010101010101000), CONST64(0x1010100010101010), CONST64(0x1010101010101010) + }, +{ CONST64(0x0000000000000000), CONST64(0x0000000800000000), CONST64(0x0000000000000008), CONST64(0x0000000800000008), + CONST64(0x0000080000000000), CONST64(0x0000080800000000), CONST64(0x0000080000000008), CONST64(0x0000080800000008), + CONST64(0x0000000000000800), CONST64(0x0000000800000800), CONST64(0x0000000000000808), CONST64(0x0000000800000808), + CONST64(0x0000080000000800), CONST64(0x0000080800000800), CONST64(0x0000080000000808), CONST64(0x0000080800000808), + CONST64(0x0008000000000000), CONST64(0x0008000800000000), CONST64(0x0008000000000008), CONST64(0x0008000800000008), + CONST64(0x0008080000000000), CONST64(0x0008080800000000), CONST64(0x0008080000000008), CONST64(0x0008080800000008), + CONST64(0x0008000000000800), CONST64(0x0008000800000800), CONST64(0x0008000000000808), CONST64(0x0008000800000808), + CONST64(0x0008080000000800), CONST64(0x0008080800000800), CONST64(0x0008080000000808), CONST64(0x0008080800000808), + CONST64(0x0000000000080000), CONST64(0x0000000800080000), CONST64(0x0000000000080008), CONST64(0x0000000800080008), + CONST64(0x0000080000080000), CONST64(0x0000080800080000), CONST64(0x0000080000080008), CONST64(0x0000080800080008), + CONST64(0x0000000000080800), CONST64(0x0000000800080800), CONST64(0x0000000000080808), CONST64(0x0000000800080808), + CONST64(0x0000080000080800), CONST64(0x0000080800080800), CONST64(0x0000080000080808), CONST64(0x0000080800080808), + CONST64(0x0008000000080000), CONST64(0x0008000800080000), CONST64(0x0008000000080008), CONST64(0x0008000800080008), + CONST64(0x0008080000080000), CONST64(0x0008080800080000), CONST64(0x0008080000080008), CONST64(0x0008080800080008), + CONST64(0x0008000000080800), CONST64(0x0008000800080800), CONST64(0x0008000000080808), CONST64(0x0008000800080808), + CONST64(0x0008080000080800), CONST64(0x0008080800080800), CONST64(0x0008080000080808), CONST64(0x0008080800080808), + CONST64(0x0800000000000000), CONST64(0x0800000800000000), CONST64(0x0800000000000008), CONST64(0x0800000800000008), + CONST64(0x0800080000000000), CONST64(0x0800080800000000), CONST64(0x0800080000000008), CONST64(0x0800080800000008), + CONST64(0x0800000000000800), CONST64(0x0800000800000800), CONST64(0x0800000000000808), CONST64(0x0800000800000808), + CONST64(0x0800080000000800), CONST64(0x0800080800000800), CONST64(0x0800080000000808), CONST64(0x0800080800000808), + CONST64(0x0808000000000000), CONST64(0x0808000800000000), CONST64(0x0808000000000008), CONST64(0x0808000800000008), + CONST64(0x0808080000000000), CONST64(0x0808080800000000), CONST64(0x0808080000000008), CONST64(0x0808080800000008), + CONST64(0x0808000000000800), CONST64(0x0808000800000800), CONST64(0x0808000000000808), CONST64(0x0808000800000808), + CONST64(0x0808080000000800), CONST64(0x0808080800000800), CONST64(0x0808080000000808), CONST64(0x0808080800000808), + CONST64(0x0800000000080000), CONST64(0x0800000800080000), CONST64(0x0800000000080008), CONST64(0x0800000800080008), + CONST64(0x0800080000080000), CONST64(0x0800080800080000), CONST64(0x0800080000080008), CONST64(0x0800080800080008), + CONST64(0x0800000000080800), CONST64(0x0800000800080800), CONST64(0x0800000000080808), CONST64(0x0800000800080808), + CONST64(0x0800080000080800), CONST64(0x0800080800080800), CONST64(0x0800080000080808), CONST64(0x0800080800080808), + CONST64(0x0808000000080000), CONST64(0x0808000800080000), CONST64(0x0808000000080008), CONST64(0x0808000800080008), + CONST64(0x0808080000080000), CONST64(0x0808080800080000), CONST64(0x0808080000080008), CONST64(0x0808080800080008), + CONST64(0x0808000000080800), CONST64(0x0808000800080800), CONST64(0x0808000000080808), CONST64(0x0808000800080808), + CONST64(0x0808080000080800), CONST64(0x0808080800080800), CONST64(0x0808080000080808), CONST64(0x0808080800080808), + CONST64(0x0000000008000000), CONST64(0x0000000808000000), CONST64(0x0000000008000008), CONST64(0x0000000808000008), + CONST64(0x0000080008000000), CONST64(0x0000080808000000), CONST64(0x0000080008000008), CONST64(0x0000080808000008), + CONST64(0x0000000008000800), CONST64(0x0000000808000800), CONST64(0x0000000008000808), CONST64(0x0000000808000808), + CONST64(0x0000080008000800), CONST64(0x0000080808000800), CONST64(0x0000080008000808), CONST64(0x0000080808000808), + CONST64(0x0008000008000000), CONST64(0x0008000808000000), CONST64(0x0008000008000008), CONST64(0x0008000808000008), + CONST64(0x0008080008000000), CONST64(0x0008080808000000), CONST64(0x0008080008000008), CONST64(0x0008080808000008), + CONST64(0x0008000008000800), CONST64(0x0008000808000800), CONST64(0x0008000008000808), CONST64(0x0008000808000808), + CONST64(0x0008080008000800), CONST64(0x0008080808000800), CONST64(0x0008080008000808), CONST64(0x0008080808000808), + CONST64(0x0000000008080000), CONST64(0x0000000808080000), CONST64(0x0000000008080008), CONST64(0x0000000808080008), + CONST64(0x0000080008080000), CONST64(0x0000080808080000), CONST64(0x0000080008080008), CONST64(0x0000080808080008), + CONST64(0x0000000008080800), CONST64(0x0000000808080800), CONST64(0x0000000008080808), CONST64(0x0000000808080808), + CONST64(0x0000080008080800), CONST64(0x0000080808080800), CONST64(0x0000080008080808), CONST64(0x0000080808080808), + CONST64(0x0008000008080000), CONST64(0x0008000808080000), CONST64(0x0008000008080008), CONST64(0x0008000808080008), + CONST64(0x0008080008080000), CONST64(0x0008080808080000), CONST64(0x0008080008080008), CONST64(0x0008080808080008), + CONST64(0x0008000008080800), CONST64(0x0008000808080800), CONST64(0x0008000008080808), CONST64(0x0008000808080808), + CONST64(0x0008080008080800), CONST64(0x0008080808080800), CONST64(0x0008080008080808), CONST64(0x0008080808080808), + CONST64(0x0800000008000000), CONST64(0x0800000808000000), CONST64(0x0800000008000008), CONST64(0x0800000808000008), + CONST64(0x0800080008000000), CONST64(0x0800080808000000), CONST64(0x0800080008000008), CONST64(0x0800080808000008), + CONST64(0x0800000008000800), CONST64(0x0800000808000800), CONST64(0x0800000008000808), CONST64(0x0800000808000808), + CONST64(0x0800080008000800), CONST64(0x0800080808000800), CONST64(0x0800080008000808), CONST64(0x0800080808000808), + CONST64(0x0808000008000000), CONST64(0x0808000808000000), CONST64(0x0808000008000008), CONST64(0x0808000808000008), + CONST64(0x0808080008000000), CONST64(0x0808080808000000), CONST64(0x0808080008000008), CONST64(0x0808080808000008), + CONST64(0x0808000008000800), CONST64(0x0808000808000800), CONST64(0x0808000008000808), CONST64(0x0808000808000808), + CONST64(0x0808080008000800), CONST64(0x0808080808000800), CONST64(0x0808080008000808), CONST64(0x0808080808000808), + CONST64(0x0800000008080000), CONST64(0x0800000808080000), CONST64(0x0800000008080008), CONST64(0x0800000808080008), + CONST64(0x0800080008080000), CONST64(0x0800080808080000), CONST64(0x0800080008080008), CONST64(0x0800080808080008), + CONST64(0x0800000008080800), CONST64(0x0800000808080800), CONST64(0x0800000008080808), CONST64(0x0800000808080808), + CONST64(0x0800080008080800), CONST64(0x0800080808080800), CONST64(0x0800080008080808), CONST64(0x0800080808080808), + CONST64(0x0808000008080000), CONST64(0x0808000808080000), CONST64(0x0808000008080008), CONST64(0x0808000808080008), + CONST64(0x0808080008080000), CONST64(0x0808080808080000), CONST64(0x0808080008080008), CONST64(0x0808080808080008), + CONST64(0x0808000008080800), CONST64(0x0808000808080800), CONST64(0x0808000008080808), CONST64(0x0808000808080808), + CONST64(0x0808080008080800), CONST64(0x0808080808080800), CONST64(0x0808080008080808), CONST64(0x0808080808080808) + }, +{ CONST64(0x0000000000000000), CONST64(0x0000000400000000), CONST64(0x0000000000000004), CONST64(0x0000000400000004), + CONST64(0x0000040000000000), CONST64(0x0000040400000000), CONST64(0x0000040000000004), CONST64(0x0000040400000004), + CONST64(0x0000000000000400), CONST64(0x0000000400000400), CONST64(0x0000000000000404), CONST64(0x0000000400000404), + CONST64(0x0000040000000400), CONST64(0x0000040400000400), CONST64(0x0000040000000404), CONST64(0x0000040400000404), + CONST64(0x0004000000000000), CONST64(0x0004000400000000), CONST64(0x0004000000000004), CONST64(0x0004000400000004), + CONST64(0x0004040000000000), CONST64(0x0004040400000000), CONST64(0x0004040000000004), CONST64(0x0004040400000004), + CONST64(0x0004000000000400), CONST64(0x0004000400000400), CONST64(0x0004000000000404), CONST64(0x0004000400000404), + CONST64(0x0004040000000400), CONST64(0x0004040400000400), CONST64(0x0004040000000404), CONST64(0x0004040400000404), + CONST64(0x0000000000040000), CONST64(0x0000000400040000), CONST64(0x0000000000040004), CONST64(0x0000000400040004), + CONST64(0x0000040000040000), CONST64(0x0000040400040000), CONST64(0x0000040000040004), CONST64(0x0000040400040004), + CONST64(0x0000000000040400), CONST64(0x0000000400040400), CONST64(0x0000000000040404), CONST64(0x0000000400040404), + CONST64(0x0000040000040400), CONST64(0x0000040400040400), CONST64(0x0000040000040404), CONST64(0x0000040400040404), + CONST64(0x0004000000040000), CONST64(0x0004000400040000), CONST64(0x0004000000040004), CONST64(0x0004000400040004), + CONST64(0x0004040000040000), CONST64(0x0004040400040000), CONST64(0x0004040000040004), CONST64(0x0004040400040004), + CONST64(0x0004000000040400), CONST64(0x0004000400040400), CONST64(0x0004000000040404), CONST64(0x0004000400040404), + CONST64(0x0004040000040400), CONST64(0x0004040400040400), CONST64(0x0004040000040404), CONST64(0x0004040400040404), + CONST64(0x0400000000000000), CONST64(0x0400000400000000), CONST64(0x0400000000000004), CONST64(0x0400000400000004), + CONST64(0x0400040000000000), CONST64(0x0400040400000000), CONST64(0x0400040000000004), CONST64(0x0400040400000004), + CONST64(0x0400000000000400), CONST64(0x0400000400000400), CONST64(0x0400000000000404), CONST64(0x0400000400000404), + CONST64(0x0400040000000400), CONST64(0x0400040400000400), CONST64(0x0400040000000404), CONST64(0x0400040400000404), + CONST64(0x0404000000000000), CONST64(0x0404000400000000), CONST64(0x0404000000000004), CONST64(0x0404000400000004), + CONST64(0x0404040000000000), CONST64(0x0404040400000000), CONST64(0x0404040000000004), CONST64(0x0404040400000004), + CONST64(0x0404000000000400), CONST64(0x0404000400000400), CONST64(0x0404000000000404), CONST64(0x0404000400000404), + CONST64(0x0404040000000400), CONST64(0x0404040400000400), CONST64(0x0404040000000404), CONST64(0x0404040400000404), + CONST64(0x0400000000040000), CONST64(0x0400000400040000), CONST64(0x0400000000040004), CONST64(0x0400000400040004), + CONST64(0x0400040000040000), CONST64(0x0400040400040000), CONST64(0x0400040000040004), CONST64(0x0400040400040004), + CONST64(0x0400000000040400), CONST64(0x0400000400040400), CONST64(0x0400000000040404), CONST64(0x0400000400040404), + CONST64(0x0400040000040400), CONST64(0x0400040400040400), CONST64(0x0400040000040404), CONST64(0x0400040400040404), + CONST64(0x0404000000040000), CONST64(0x0404000400040000), CONST64(0x0404000000040004), CONST64(0x0404000400040004), + CONST64(0x0404040000040000), CONST64(0x0404040400040000), CONST64(0x0404040000040004), CONST64(0x0404040400040004), + CONST64(0x0404000000040400), CONST64(0x0404000400040400), CONST64(0x0404000000040404), CONST64(0x0404000400040404), + CONST64(0x0404040000040400), CONST64(0x0404040400040400), CONST64(0x0404040000040404), CONST64(0x0404040400040404), + CONST64(0x0000000004000000), CONST64(0x0000000404000000), CONST64(0x0000000004000004), CONST64(0x0000000404000004), + CONST64(0x0000040004000000), CONST64(0x0000040404000000), CONST64(0x0000040004000004), CONST64(0x0000040404000004), + CONST64(0x0000000004000400), CONST64(0x0000000404000400), CONST64(0x0000000004000404), CONST64(0x0000000404000404), + CONST64(0x0000040004000400), CONST64(0x0000040404000400), CONST64(0x0000040004000404), CONST64(0x0000040404000404), + CONST64(0x0004000004000000), CONST64(0x0004000404000000), CONST64(0x0004000004000004), CONST64(0x0004000404000004), + CONST64(0x0004040004000000), CONST64(0x0004040404000000), CONST64(0x0004040004000004), CONST64(0x0004040404000004), + CONST64(0x0004000004000400), CONST64(0x0004000404000400), CONST64(0x0004000004000404), CONST64(0x0004000404000404), + CONST64(0x0004040004000400), CONST64(0x0004040404000400), CONST64(0x0004040004000404), CONST64(0x0004040404000404), + CONST64(0x0000000004040000), CONST64(0x0000000404040000), CONST64(0x0000000004040004), CONST64(0x0000000404040004), + CONST64(0x0000040004040000), CONST64(0x0000040404040000), CONST64(0x0000040004040004), CONST64(0x0000040404040004), + CONST64(0x0000000004040400), CONST64(0x0000000404040400), CONST64(0x0000000004040404), CONST64(0x0000000404040404), + CONST64(0x0000040004040400), CONST64(0x0000040404040400), CONST64(0x0000040004040404), CONST64(0x0000040404040404), + CONST64(0x0004000004040000), CONST64(0x0004000404040000), CONST64(0x0004000004040004), CONST64(0x0004000404040004), + CONST64(0x0004040004040000), CONST64(0x0004040404040000), CONST64(0x0004040004040004), CONST64(0x0004040404040004), + CONST64(0x0004000004040400), CONST64(0x0004000404040400), CONST64(0x0004000004040404), CONST64(0x0004000404040404), + CONST64(0x0004040004040400), CONST64(0x0004040404040400), CONST64(0x0004040004040404), CONST64(0x0004040404040404), + CONST64(0x0400000004000000), CONST64(0x0400000404000000), CONST64(0x0400000004000004), CONST64(0x0400000404000004), + CONST64(0x0400040004000000), CONST64(0x0400040404000000), CONST64(0x0400040004000004), CONST64(0x0400040404000004), + CONST64(0x0400000004000400), CONST64(0x0400000404000400), CONST64(0x0400000004000404), CONST64(0x0400000404000404), + CONST64(0x0400040004000400), CONST64(0x0400040404000400), CONST64(0x0400040004000404), CONST64(0x0400040404000404), + CONST64(0x0404000004000000), CONST64(0x0404000404000000), CONST64(0x0404000004000004), CONST64(0x0404000404000004), + CONST64(0x0404040004000000), CONST64(0x0404040404000000), CONST64(0x0404040004000004), CONST64(0x0404040404000004), + CONST64(0x0404000004000400), CONST64(0x0404000404000400), CONST64(0x0404000004000404), CONST64(0x0404000404000404), + CONST64(0x0404040004000400), CONST64(0x0404040404000400), CONST64(0x0404040004000404), CONST64(0x0404040404000404), + CONST64(0x0400000004040000), CONST64(0x0400000404040000), CONST64(0x0400000004040004), CONST64(0x0400000404040004), + CONST64(0x0400040004040000), CONST64(0x0400040404040000), CONST64(0x0400040004040004), CONST64(0x0400040404040004), + CONST64(0x0400000004040400), CONST64(0x0400000404040400), CONST64(0x0400000004040404), CONST64(0x0400000404040404), + CONST64(0x0400040004040400), CONST64(0x0400040404040400), CONST64(0x0400040004040404), CONST64(0x0400040404040404), + CONST64(0x0404000004040000), CONST64(0x0404000404040000), CONST64(0x0404000004040004), CONST64(0x0404000404040004), + CONST64(0x0404040004040000), CONST64(0x0404040404040000), CONST64(0x0404040004040004), CONST64(0x0404040404040004), + CONST64(0x0404000004040400), CONST64(0x0404000404040400), CONST64(0x0404000004040404), CONST64(0x0404000404040404), + CONST64(0x0404040004040400), CONST64(0x0404040404040400), CONST64(0x0404040004040404), CONST64(0x0404040404040404) + }, +{ CONST64(0x0000000000000000), CONST64(0x0000000200000000), CONST64(0x0000000000000002), CONST64(0x0000000200000002), + CONST64(0x0000020000000000), CONST64(0x0000020200000000), CONST64(0x0000020000000002), CONST64(0x0000020200000002), + CONST64(0x0000000000000200), CONST64(0x0000000200000200), CONST64(0x0000000000000202), CONST64(0x0000000200000202), + CONST64(0x0000020000000200), CONST64(0x0000020200000200), CONST64(0x0000020000000202), CONST64(0x0000020200000202), + CONST64(0x0002000000000000), CONST64(0x0002000200000000), CONST64(0x0002000000000002), CONST64(0x0002000200000002), + CONST64(0x0002020000000000), CONST64(0x0002020200000000), CONST64(0x0002020000000002), CONST64(0x0002020200000002), + CONST64(0x0002000000000200), CONST64(0x0002000200000200), CONST64(0x0002000000000202), CONST64(0x0002000200000202), + CONST64(0x0002020000000200), CONST64(0x0002020200000200), CONST64(0x0002020000000202), CONST64(0x0002020200000202), + CONST64(0x0000000000020000), CONST64(0x0000000200020000), CONST64(0x0000000000020002), CONST64(0x0000000200020002), + CONST64(0x0000020000020000), CONST64(0x0000020200020000), CONST64(0x0000020000020002), CONST64(0x0000020200020002), + CONST64(0x0000000000020200), CONST64(0x0000000200020200), CONST64(0x0000000000020202), CONST64(0x0000000200020202), + CONST64(0x0000020000020200), CONST64(0x0000020200020200), CONST64(0x0000020000020202), CONST64(0x0000020200020202), + CONST64(0x0002000000020000), CONST64(0x0002000200020000), CONST64(0x0002000000020002), CONST64(0x0002000200020002), + CONST64(0x0002020000020000), CONST64(0x0002020200020000), CONST64(0x0002020000020002), CONST64(0x0002020200020002), + CONST64(0x0002000000020200), CONST64(0x0002000200020200), CONST64(0x0002000000020202), CONST64(0x0002000200020202), + CONST64(0x0002020000020200), CONST64(0x0002020200020200), CONST64(0x0002020000020202), CONST64(0x0002020200020202), + CONST64(0x0200000000000000), CONST64(0x0200000200000000), CONST64(0x0200000000000002), CONST64(0x0200000200000002), + CONST64(0x0200020000000000), CONST64(0x0200020200000000), CONST64(0x0200020000000002), CONST64(0x0200020200000002), + CONST64(0x0200000000000200), CONST64(0x0200000200000200), CONST64(0x0200000000000202), CONST64(0x0200000200000202), + CONST64(0x0200020000000200), CONST64(0x0200020200000200), CONST64(0x0200020000000202), CONST64(0x0200020200000202), + CONST64(0x0202000000000000), CONST64(0x0202000200000000), CONST64(0x0202000000000002), CONST64(0x0202000200000002), + CONST64(0x0202020000000000), CONST64(0x0202020200000000), CONST64(0x0202020000000002), CONST64(0x0202020200000002), + CONST64(0x0202000000000200), CONST64(0x0202000200000200), CONST64(0x0202000000000202), CONST64(0x0202000200000202), + CONST64(0x0202020000000200), CONST64(0x0202020200000200), CONST64(0x0202020000000202), CONST64(0x0202020200000202), + CONST64(0x0200000000020000), CONST64(0x0200000200020000), CONST64(0x0200000000020002), CONST64(0x0200000200020002), + CONST64(0x0200020000020000), CONST64(0x0200020200020000), CONST64(0x0200020000020002), CONST64(0x0200020200020002), + CONST64(0x0200000000020200), CONST64(0x0200000200020200), CONST64(0x0200000000020202), CONST64(0x0200000200020202), + CONST64(0x0200020000020200), CONST64(0x0200020200020200), CONST64(0x0200020000020202), CONST64(0x0200020200020202), + CONST64(0x0202000000020000), CONST64(0x0202000200020000), CONST64(0x0202000000020002), CONST64(0x0202000200020002), + CONST64(0x0202020000020000), CONST64(0x0202020200020000), CONST64(0x0202020000020002), CONST64(0x0202020200020002), + CONST64(0x0202000000020200), CONST64(0x0202000200020200), CONST64(0x0202000000020202), CONST64(0x0202000200020202), + CONST64(0x0202020000020200), CONST64(0x0202020200020200), CONST64(0x0202020000020202), CONST64(0x0202020200020202), + CONST64(0x0000000002000000), CONST64(0x0000000202000000), CONST64(0x0000000002000002), CONST64(0x0000000202000002), + CONST64(0x0000020002000000), CONST64(0x0000020202000000), CONST64(0x0000020002000002), CONST64(0x0000020202000002), + CONST64(0x0000000002000200), CONST64(0x0000000202000200), CONST64(0x0000000002000202), CONST64(0x0000000202000202), + CONST64(0x0000020002000200), CONST64(0x0000020202000200), CONST64(0x0000020002000202), CONST64(0x0000020202000202), + CONST64(0x0002000002000000), CONST64(0x0002000202000000), CONST64(0x0002000002000002), CONST64(0x0002000202000002), + CONST64(0x0002020002000000), CONST64(0x0002020202000000), CONST64(0x0002020002000002), CONST64(0x0002020202000002), + CONST64(0x0002000002000200), CONST64(0x0002000202000200), CONST64(0x0002000002000202), CONST64(0x0002000202000202), + CONST64(0x0002020002000200), CONST64(0x0002020202000200), CONST64(0x0002020002000202), CONST64(0x0002020202000202), + CONST64(0x0000000002020000), CONST64(0x0000000202020000), CONST64(0x0000000002020002), CONST64(0x0000000202020002), + CONST64(0x0000020002020000), CONST64(0x0000020202020000), CONST64(0x0000020002020002), CONST64(0x0000020202020002), + CONST64(0x0000000002020200), CONST64(0x0000000202020200), CONST64(0x0000000002020202), CONST64(0x0000000202020202), + CONST64(0x0000020002020200), CONST64(0x0000020202020200), CONST64(0x0000020002020202), CONST64(0x0000020202020202), + CONST64(0x0002000002020000), CONST64(0x0002000202020000), CONST64(0x0002000002020002), CONST64(0x0002000202020002), + CONST64(0x0002020002020000), CONST64(0x0002020202020000), CONST64(0x0002020002020002), CONST64(0x0002020202020002), + CONST64(0x0002000002020200), CONST64(0x0002000202020200), CONST64(0x0002000002020202), CONST64(0x0002000202020202), + CONST64(0x0002020002020200), CONST64(0x0002020202020200), CONST64(0x0002020002020202), CONST64(0x0002020202020202), + CONST64(0x0200000002000000), CONST64(0x0200000202000000), CONST64(0x0200000002000002), CONST64(0x0200000202000002), + CONST64(0x0200020002000000), CONST64(0x0200020202000000), CONST64(0x0200020002000002), CONST64(0x0200020202000002), + CONST64(0x0200000002000200), CONST64(0x0200000202000200), CONST64(0x0200000002000202), CONST64(0x0200000202000202), + CONST64(0x0200020002000200), CONST64(0x0200020202000200), CONST64(0x0200020002000202), CONST64(0x0200020202000202), + CONST64(0x0202000002000000), CONST64(0x0202000202000000), CONST64(0x0202000002000002), CONST64(0x0202000202000002), + CONST64(0x0202020002000000), CONST64(0x0202020202000000), CONST64(0x0202020002000002), CONST64(0x0202020202000002), + CONST64(0x0202000002000200), CONST64(0x0202000202000200), CONST64(0x0202000002000202), CONST64(0x0202000202000202), + CONST64(0x0202020002000200), CONST64(0x0202020202000200), CONST64(0x0202020002000202), CONST64(0x0202020202000202), + CONST64(0x0200000002020000), CONST64(0x0200000202020000), CONST64(0x0200000002020002), CONST64(0x0200000202020002), + CONST64(0x0200020002020000), CONST64(0x0200020202020000), CONST64(0x0200020002020002), CONST64(0x0200020202020002), + CONST64(0x0200000002020200), CONST64(0x0200000202020200), CONST64(0x0200000002020202), CONST64(0x0200000202020202), + CONST64(0x0200020002020200), CONST64(0x0200020202020200), CONST64(0x0200020002020202), CONST64(0x0200020202020202), + CONST64(0x0202000002020000), CONST64(0x0202000202020000), CONST64(0x0202000002020002), CONST64(0x0202000202020002), + CONST64(0x0202020002020000), CONST64(0x0202020202020000), CONST64(0x0202020002020002), CONST64(0x0202020202020002), + CONST64(0x0202000002020200), CONST64(0x0202000202020200), CONST64(0x0202000002020202), CONST64(0x0202000202020202), + CONST64(0x0202020002020200), CONST64(0x0202020202020200), CONST64(0x0202020002020202), CONST64(0x0202020202020202) + }, +{ CONST64(0x0000000000000000), CONST64(0x0000010000000000), CONST64(0x0000000000000100), CONST64(0x0000010000000100), + CONST64(0x0001000000000000), CONST64(0x0001010000000000), CONST64(0x0001000000000100), CONST64(0x0001010000000100), + CONST64(0x0000000000010000), CONST64(0x0000010000010000), CONST64(0x0000000000010100), CONST64(0x0000010000010100), + CONST64(0x0001000000010000), CONST64(0x0001010000010000), CONST64(0x0001000000010100), CONST64(0x0001010000010100), + CONST64(0x0100000000000000), CONST64(0x0100010000000000), CONST64(0x0100000000000100), CONST64(0x0100010000000100), + CONST64(0x0101000000000000), CONST64(0x0101010000000000), CONST64(0x0101000000000100), CONST64(0x0101010000000100), + CONST64(0x0100000000010000), CONST64(0x0100010000010000), CONST64(0x0100000000010100), CONST64(0x0100010000010100), + CONST64(0x0101000000010000), CONST64(0x0101010000010000), CONST64(0x0101000000010100), CONST64(0x0101010000010100), + CONST64(0x0000000001000000), CONST64(0x0000010001000000), CONST64(0x0000000001000100), CONST64(0x0000010001000100), + CONST64(0x0001000001000000), CONST64(0x0001010001000000), CONST64(0x0001000001000100), CONST64(0x0001010001000100), + CONST64(0x0000000001010000), CONST64(0x0000010001010000), CONST64(0x0000000001010100), CONST64(0x0000010001010100), + CONST64(0x0001000001010000), CONST64(0x0001010001010000), CONST64(0x0001000001010100), CONST64(0x0001010001010100), + CONST64(0x0100000001000000), CONST64(0x0100010001000000), CONST64(0x0100000001000100), CONST64(0x0100010001000100), + CONST64(0x0101000001000000), CONST64(0x0101010001000000), CONST64(0x0101000001000100), CONST64(0x0101010001000100), + CONST64(0x0100000001010000), CONST64(0x0100010001010000), CONST64(0x0100000001010100), CONST64(0x0100010001010100), + CONST64(0x0101000001010000), CONST64(0x0101010001010000), CONST64(0x0101000001010100), CONST64(0x0101010001010100), + CONST64(0x0000000100000000), CONST64(0x0000010100000000), CONST64(0x0000000100000100), CONST64(0x0000010100000100), + CONST64(0x0001000100000000), CONST64(0x0001010100000000), CONST64(0x0001000100000100), CONST64(0x0001010100000100), + CONST64(0x0000000100010000), CONST64(0x0000010100010000), CONST64(0x0000000100010100), CONST64(0x0000010100010100), + CONST64(0x0001000100010000), CONST64(0x0001010100010000), CONST64(0x0001000100010100), CONST64(0x0001010100010100), + CONST64(0x0100000100000000), CONST64(0x0100010100000000), CONST64(0x0100000100000100), CONST64(0x0100010100000100), + CONST64(0x0101000100000000), CONST64(0x0101010100000000), CONST64(0x0101000100000100), CONST64(0x0101010100000100), + CONST64(0x0100000100010000), CONST64(0x0100010100010000), CONST64(0x0100000100010100), CONST64(0x0100010100010100), + CONST64(0x0101000100010000), CONST64(0x0101010100010000), CONST64(0x0101000100010100), CONST64(0x0101010100010100), + CONST64(0x0000000101000000), CONST64(0x0000010101000000), CONST64(0x0000000101000100), CONST64(0x0000010101000100), + CONST64(0x0001000101000000), CONST64(0x0001010101000000), CONST64(0x0001000101000100), CONST64(0x0001010101000100), + CONST64(0x0000000101010000), CONST64(0x0000010101010000), CONST64(0x0000000101010100), CONST64(0x0000010101010100), + CONST64(0x0001000101010000), CONST64(0x0001010101010000), CONST64(0x0001000101010100), CONST64(0x0001010101010100), + CONST64(0x0100000101000000), CONST64(0x0100010101000000), CONST64(0x0100000101000100), CONST64(0x0100010101000100), + CONST64(0x0101000101000000), CONST64(0x0101010101000000), CONST64(0x0101000101000100), CONST64(0x0101010101000100), + CONST64(0x0100000101010000), CONST64(0x0100010101010000), CONST64(0x0100000101010100), CONST64(0x0100010101010100), + CONST64(0x0101000101010000), CONST64(0x0101010101010000), CONST64(0x0101000101010100), CONST64(0x0101010101010100), + CONST64(0x0000000000000001), CONST64(0x0000010000000001), CONST64(0x0000000000000101), CONST64(0x0000010000000101), + CONST64(0x0001000000000001), CONST64(0x0001010000000001), CONST64(0x0001000000000101), CONST64(0x0001010000000101), + CONST64(0x0000000000010001), CONST64(0x0000010000010001), CONST64(0x0000000000010101), CONST64(0x0000010000010101), + CONST64(0x0001000000010001), CONST64(0x0001010000010001), CONST64(0x0001000000010101), CONST64(0x0001010000010101), + CONST64(0x0100000000000001), CONST64(0x0100010000000001), CONST64(0x0100000000000101), CONST64(0x0100010000000101), + CONST64(0x0101000000000001), CONST64(0x0101010000000001), CONST64(0x0101000000000101), CONST64(0x0101010000000101), + CONST64(0x0100000000010001), CONST64(0x0100010000010001), CONST64(0x0100000000010101), CONST64(0x0100010000010101), + CONST64(0x0101000000010001), CONST64(0x0101010000010001), CONST64(0x0101000000010101), CONST64(0x0101010000010101), + CONST64(0x0000000001000001), CONST64(0x0000010001000001), CONST64(0x0000000001000101), CONST64(0x0000010001000101), + CONST64(0x0001000001000001), CONST64(0x0001010001000001), CONST64(0x0001000001000101), CONST64(0x0001010001000101), + CONST64(0x0000000001010001), CONST64(0x0000010001010001), CONST64(0x0000000001010101), CONST64(0x0000010001010101), + CONST64(0x0001000001010001), CONST64(0x0001010001010001), CONST64(0x0001000001010101), CONST64(0x0001010001010101), + CONST64(0x0100000001000001), CONST64(0x0100010001000001), CONST64(0x0100000001000101), CONST64(0x0100010001000101), + CONST64(0x0101000001000001), CONST64(0x0101010001000001), CONST64(0x0101000001000101), CONST64(0x0101010001000101), + CONST64(0x0100000001010001), CONST64(0x0100010001010001), CONST64(0x0100000001010101), CONST64(0x0100010001010101), + CONST64(0x0101000001010001), CONST64(0x0101010001010001), CONST64(0x0101000001010101), CONST64(0x0101010001010101), + CONST64(0x0000000100000001), CONST64(0x0000010100000001), CONST64(0x0000000100000101), CONST64(0x0000010100000101), + CONST64(0x0001000100000001), CONST64(0x0001010100000001), CONST64(0x0001000100000101), CONST64(0x0001010100000101), + CONST64(0x0000000100010001), CONST64(0x0000010100010001), CONST64(0x0000000100010101), CONST64(0x0000010100010101), + CONST64(0x0001000100010001), CONST64(0x0001010100010001), CONST64(0x0001000100010101), CONST64(0x0001010100010101), + CONST64(0x0100000100000001), CONST64(0x0100010100000001), CONST64(0x0100000100000101), CONST64(0x0100010100000101), + CONST64(0x0101000100000001), CONST64(0x0101010100000001), CONST64(0x0101000100000101), CONST64(0x0101010100000101), + CONST64(0x0100000100010001), CONST64(0x0100010100010001), CONST64(0x0100000100010101), CONST64(0x0100010100010101), + CONST64(0x0101000100010001), CONST64(0x0101010100010001), CONST64(0x0101000100010101), CONST64(0x0101010100010101), + CONST64(0x0000000101000001), CONST64(0x0000010101000001), CONST64(0x0000000101000101), CONST64(0x0000010101000101), + CONST64(0x0001000101000001), CONST64(0x0001010101000001), CONST64(0x0001000101000101), CONST64(0x0001010101000101), + CONST64(0x0000000101010001), CONST64(0x0000010101010001), CONST64(0x0000000101010101), CONST64(0x0000010101010101), + CONST64(0x0001000101010001), CONST64(0x0001010101010001), CONST64(0x0001000101010101), CONST64(0x0001010101010101), + CONST64(0x0100000101000001), CONST64(0x0100010101000001), CONST64(0x0100000101000101), CONST64(0x0100010101000101), + CONST64(0x0101000101000001), CONST64(0x0101010101000001), CONST64(0x0101000101000101), CONST64(0x0101010101000101), + CONST64(0x0100000101010001), CONST64(0x0100010101010001), CONST64(0x0100000101010101), CONST64(0x0100010101010101), + CONST64(0x0101000101010001), CONST64(0x0101010101010001), CONST64(0x0101000101010101), CONST64(0x0101010101010101) + }, +{ CONST64(0x0000000000000000), CONST64(0x0000008000000000), CONST64(0x0000000000000080), CONST64(0x0000008000000080), + CONST64(0x0000800000000000), CONST64(0x0000808000000000), CONST64(0x0000800000000080), CONST64(0x0000808000000080), + CONST64(0x0000000000008000), CONST64(0x0000008000008000), CONST64(0x0000000000008080), CONST64(0x0000008000008080), + CONST64(0x0000800000008000), CONST64(0x0000808000008000), CONST64(0x0000800000008080), CONST64(0x0000808000008080), + CONST64(0x0080000000000000), CONST64(0x0080008000000000), CONST64(0x0080000000000080), CONST64(0x0080008000000080), + CONST64(0x0080800000000000), CONST64(0x0080808000000000), CONST64(0x0080800000000080), CONST64(0x0080808000000080), + CONST64(0x0080000000008000), CONST64(0x0080008000008000), CONST64(0x0080000000008080), CONST64(0x0080008000008080), + CONST64(0x0080800000008000), CONST64(0x0080808000008000), CONST64(0x0080800000008080), CONST64(0x0080808000008080), + CONST64(0x0000000000800000), CONST64(0x0000008000800000), CONST64(0x0000000000800080), CONST64(0x0000008000800080), + CONST64(0x0000800000800000), CONST64(0x0000808000800000), CONST64(0x0000800000800080), CONST64(0x0000808000800080), + CONST64(0x0000000000808000), CONST64(0x0000008000808000), CONST64(0x0000000000808080), CONST64(0x0000008000808080), + CONST64(0x0000800000808000), CONST64(0x0000808000808000), CONST64(0x0000800000808080), CONST64(0x0000808000808080), + CONST64(0x0080000000800000), CONST64(0x0080008000800000), CONST64(0x0080000000800080), CONST64(0x0080008000800080), + CONST64(0x0080800000800000), CONST64(0x0080808000800000), CONST64(0x0080800000800080), CONST64(0x0080808000800080), + CONST64(0x0080000000808000), CONST64(0x0080008000808000), CONST64(0x0080000000808080), CONST64(0x0080008000808080), + CONST64(0x0080800000808000), CONST64(0x0080808000808000), CONST64(0x0080800000808080), CONST64(0x0080808000808080), + CONST64(0x8000000000000000), CONST64(0x8000008000000000), CONST64(0x8000000000000080), CONST64(0x8000008000000080), + CONST64(0x8000800000000000), CONST64(0x8000808000000000), CONST64(0x8000800000000080), CONST64(0x8000808000000080), + CONST64(0x8000000000008000), CONST64(0x8000008000008000), CONST64(0x8000000000008080), CONST64(0x8000008000008080), + CONST64(0x8000800000008000), CONST64(0x8000808000008000), CONST64(0x8000800000008080), CONST64(0x8000808000008080), + CONST64(0x8080000000000000), CONST64(0x8080008000000000), CONST64(0x8080000000000080), CONST64(0x8080008000000080), + CONST64(0x8080800000000000), CONST64(0x8080808000000000), CONST64(0x8080800000000080), CONST64(0x8080808000000080), + CONST64(0x8080000000008000), CONST64(0x8080008000008000), CONST64(0x8080000000008080), CONST64(0x8080008000008080), + CONST64(0x8080800000008000), CONST64(0x8080808000008000), CONST64(0x8080800000008080), CONST64(0x8080808000008080), + CONST64(0x8000000000800000), CONST64(0x8000008000800000), CONST64(0x8000000000800080), CONST64(0x8000008000800080), + CONST64(0x8000800000800000), CONST64(0x8000808000800000), CONST64(0x8000800000800080), CONST64(0x8000808000800080), + CONST64(0x8000000000808000), CONST64(0x8000008000808000), CONST64(0x8000000000808080), CONST64(0x8000008000808080), + CONST64(0x8000800000808000), CONST64(0x8000808000808000), CONST64(0x8000800000808080), CONST64(0x8000808000808080), + CONST64(0x8080000000800000), CONST64(0x8080008000800000), CONST64(0x8080000000800080), CONST64(0x8080008000800080), + CONST64(0x8080800000800000), CONST64(0x8080808000800000), CONST64(0x8080800000800080), CONST64(0x8080808000800080), + CONST64(0x8080000000808000), CONST64(0x8080008000808000), CONST64(0x8080000000808080), CONST64(0x8080008000808080), + CONST64(0x8080800000808000), CONST64(0x8080808000808000), CONST64(0x8080800000808080), CONST64(0x8080808000808080), + CONST64(0x0000000080000000), CONST64(0x0000008080000000), CONST64(0x0000000080000080), CONST64(0x0000008080000080), + CONST64(0x0000800080000000), CONST64(0x0000808080000000), CONST64(0x0000800080000080), CONST64(0x0000808080000080), + CONST64(0x0000000080008000), CONST64(0x0000008080008000), CONST64(0x0000000080008080), CONST64(0x0000008080008080), + CONST64(0x0000800080008000), CONST64(0x0000808080008000), CONST64(0x0000800080008080), CONST64(0x0000808080008080), + CONST64(0x0080000080000000), CONST64(0x0080008080000000), CONST64(0x0080000080000080), CONST64(0x0080008080000080), + CONST64(0x0080800080000000), CONST64(0x0080808080000000), CONST64(0x0080800080000080), CONST64(0x0080808080000080), + CONST64(0x0080000080008000), CONST64(0x0080008080008000), CONST64(0x0080000080008080), CONST64(0x0080008080008080), + CONST64(0x0080800080008000), CONST64(0x0080808080008000), CONST64(0x0080800080008080), CONST64(0x0080808080008080), + CONST64(0x0000000080800000), CONST64(0x0000008080800000), CONST64(0x0000000080800080), CONST64(0x0000008080800080), + CONST64(0x0000800080800000), CONST64(0x0000808080800000), CONST64(0x0000800080800080), CONST64(0x0000808080800080), + CONST64(0x0000000080808000), CONST64(0x0000008080808000), CONST64(0x0000000080808080), CONST64(0x0000008080808080), + CONST64(0x0000800080808000), CONST64(0x0000808080808000), CONST64(0x0000800080808080), CONST64(0x0000808080808080), + CONST64(0x0080000080800000), CONST64(0x0080008080800000), CONST64(0x0080000080800080), CONST64(0x0080008080800080), + CONST64(0x0080800080800000), CONST64(0x0080808080800000), CONST64(0x0080800080800080), CONST64(0x0080808080800080), + CONST64(0x0080000080808000), CONST64(0x0080008080808000), CONST64(0x0080000080808080), CONST64(0x0080008080808080), + CONST64(0x0080800080808000), CONST64(0x0080808080808000), CONST64(0x0080800080808080), CONST64(0x0080808080808080), + CONST64(0x8000000080000000), CONST64(0x8000008080000000), CONST64(0x8000000080000080), CONST64(0x8000008080000080), + CONST64(0x8000800080000000), CONST64(0x8000808080000000), CONST64(0x8000800080000080), CONST64(0x8000808080000080), + CONST64(0x8000000080008000), CONST64(0x8000008080008000), CONST64(0x8000000080008080), CONST64(0x8000008080008080), + CONST64(0x8000800080008000), CONST64(0x8000808080008000), CONST64(0x8000800080008080), CONST64(0x8000808080008080), + CONST64(0x8080000080000000), CONST64(0x8080008080000000), CONST64(0x8080000080000080), CONST64(0x8080008080000080), + CONST64(0x8080800080000000), CONST64(0x8080808080000000), CONST64(0x8080800080000080), CONST64(0x8080808080000080), + CONST64(0x8080000080008000), CONST64(0x8080008080008000), CONST64(0x8080000080008080), CONST64(0x8080008080008080), + CONST64(0x8080800080008000), CONST64(0x8080808080008000), CONST64(0x8080800080008080), CONST64(0x8080808080008080), + CONST64(0x8000000080800000), CONST64(0x8000008080800000), CONST64(0x8000000080800080), CONST64(0x8000008080800080), + CONST64(0x8000800080800000), CONST64(0x8000808080800000), CONST64(0x8000800080800080), CONST64(0x8000808080800080), + CONST64(0x8000000080808000), CONST64(0x8000008080808000), CONST64(0x8000000080808080), CONST64(0x8000008080808080), + CONST64(0x8000800080808000), CONST64(0x8000808080808000), CONST64(0x8000800080808080), CONST64(0x8000808080808080), + CONST64(0x8080000080800000), CONST64(0x8080008080800000), CONST64(0x8080000080800080), CONST64(0x8080008080800080), + CONST64(0x8080800080800000), CONST64(0x8080808080800000), CONST64(0x8080800080800080), CONST64(0x8080808080800080), + CONST64(0x8080000080808000), CONST64(0x8080008080808000), CONST64(0x8080000080808080), CONST64(0x8080008080808080), + CONST64(0x8080800080808000), CONST64(0x8080808080808000), CONST64(0x8080800080808080), CONST64(0x8080808080808080) + }, +{ CONST64(0x0000000000000000), CONST64(0x0000004000000000), CONST64(0x0000000000000040), CONST64(0x0000004000000040), + CONST64(0x0000400000000000), CONST64(0x0000404000000000), CONST64(0x0000400000000040), CONST64(0x0000404000000040), + CONST64(0x0000000000004000), CONST64(0x0000004000004000), CONST64(0x0000000000004040), CONST64(0x0000004000004040), + CONST64(0x0000400000004000), CONST64(0x0000404000004000), CONST64(0x0000400000004040), CONST64(0x0000404000004040), + CONST64(0x0040000000000000), CONST64(0x0040004000000000), CONST64(0x0040000000000040), CONST64(0x0040004000000040), + CONST64(0x0040400000000000), CONST64(0x0040404000000000), CONST64(0x0040400000000040), CONST64(0x0040404000000040), + CONST64(0x0040000000004000), CONST64(0x0040004000004000), CONST64(0x0040000000004040), CONST64(0x0040004000004040), + CONST64(0x0040400000004000), CONST64(0x0040404000004000), CONST64(0x0040400000004040), CONST64(0x0040404000004040), + CONST64(0x0000000000400000), CONST64(0x0000004000400000), CONST64(0x0000000000400040), CONST64(0x0000004000400040), + CONST64(0x0000400000400000), CONST64(0x0000404000400000), CONST64(0x0000400000400040), CONST64(0x0000404000400040), + CONST64(0x0000000000404000), CONST64(0x0000004000404000), CONST64(0x0000000000404040), CONST64(0x0000004000404040), + CONST64(0x0000400000404000), CONST64(0x0000404000404000), CONST64(0x0000400000404040), CONST64(0x0000404000404040), + CONST64(0x0040000000400000), CONST64(0x0040004000400000), CONST64(0x0040000000400040), CONST64(0x0040004000400040), + CONST64(0x0040400000400000), CONST64(0x0040404000400000), CONST64(0x0040400000400040), CONST64(0x0040404000400040), + CONST64(0x0040000000404000), CONST64(0x0040004000404000), CONST64(0x0040000000404040), CONST64(0x0040004000404040), + CONST64(0x0040400000404000), CONST64(0x0040404000404000), CONST64(0x0040400000404040), CONST64(0x0040404000404040), + CONST64(0x4000000000000000), CONST64(0x4000004000000000), CONST64(0x4000000000000040), CONST64(0x4000004000000040), + CONST64(0x4000400000000000), CONST64(0x4000404000000000), CONST64(0x4000400000000040), CONST64(0x4000404000000040), + CONST64(0x4000000000004000), CONST64(0x4000004000004000), CONST64(0x4000000000004040), CONST64(0x4000004000004040), + CONST64(0x4000400000004000), CONST64(0x4000404000004000), CONST64(0x4000400000004040), CONST64(0x4000404000004040), + CONST64(0x4040000000000000), CONST64(0x4040004000000000), CONST64(0x4040000000000040), CONST64(0x4040004000000040), + CONST64(0x4040400000000000), CONST64(0x4040404000000000), CONST64(0x4040400000000040), CONST64(0x4040404000000040), + CONST64(0x4040000000004000), CONST64(0x4040004000004000), CONST64(0x4040000000004040), CONST64(0x4040004000004040), + CONST64(0x4040400000004000), CONST64(0x4040404000004000), CONST64(0x4040400000004040), CONST64(0x4040404000004040), + CONST64(0x4000000000400000), CONST64(0x4000004000400000), CONST64(0x4000000000400040), CONST64(0x4000004000400040), + CONST64(0x4000400000400000), CONST64(0x4000404000400000), CONST64(0x4000400000400040), CONST64(0x4000404000400040), + CONST64(0x4000000000404000), CONST64(0x4000004000404000), CONST64(0x4000000000404040), CONST64(0x4000004000404040), + CONST64(0x4000400000404000), CONST64(0x4000404000404000), CONST64(0x4000400000404040), CONST64(0x4000404000404040), + CONST64(0x4040000000400000), CONST64(0x4040004000400000), CONST64(0x4040000000400040), CONST64(0x4040004000400040), + CONST64(0x4040400000400000), CONST64(0x4040404000400000), CONST64(0x4040400000400040), CONST64(0x4040404000400040), + CONST64(0x4040000000404000), CONST64(0x4040004000404000), CONST64(0x4040000000404040), CONST64(0x4040004000404040), + CONST64(0x4040400000404000), CONST64(0x4040404000404000), CONST64(0x4040400000404040), CONST64(0x4040404000404040), + CONST64(0x0000000040000000), CONST64(0x0000004040000000), CONST64(0x0000000040000040), CONST64(0x0000004040000040), + CONST64(0x0000400040000000), CONST64(0x0000404040000000), CONST64(0x0000400040000040), CONST64(0x0000404040000040), + CONST64(0x0000000040004000), CONST64(0x0000004040004000), CONST64(0x0000000040004040), CONST64(0x0000004040004040), + CONST64(0x0000400040004000), CONST64(0x0000404040004000), CONST64(0x0000400040004040), CONST64(0x0000404040004040), + CONST64(0x0040000040000000), CONST64(0x0040004040000000), CONST64(0x0040000040000040), CONST64(0x0040004040000040), + CONST64(0x0040400040000000), CONST64(0x0040404040000000), CONST64(0x0040400040000040), CONST64(0x0040404040000040), + CONST64(0x0040000040004000), CONST64(0x0040004040004000), CONST64(0x0040000040004040), CONST64(0x0040004040004040), + CONST64(0x0040400040004000), CONST64(0x0040404040004000), CONST64(0x0040400040004040), CONST64(0x0040404040004040), + CONST64(0x0000000040400000), CONST64(0x0000004040400000), CONST64(0x0000000040400040), CONST64(0x0000004040400040), + CONST64(0x0000400040400000), CONST64(0x0000404040400000), CONST64(0x0000400040400040), CONST64(0x0000404040400040), + CONST64(0x0000000040404000), CONST64(0x0000004040404000), CONST64(0x0000000040404040), CONST64(0x0000004040404040), + CONST64(0x0000400040404000), CONST64(0x0000404040404000), CONST64(0x0000400040404040), CONST64(0x0000404040404040), + CONST64(0x0040000040400000), CONST64(0x0040004040400000), CONST64(0x0040000040400040), CONST64(0x0040004040400040), + CONST64(0x0040400040400000), CONST64(0x0040404040400000), CONST64(0x0040400040400040), CONST64(0x0040404040400040), + CONST64(0x0040000040404000), CONST64(0x0040004040404000), CONST64(0x0040000040404040), CONST64(0x0040004040404040), + CONST64(0x0040400040404000), CONST64(0x0040404040404000), CONST64(0x0040400040404040), CONST64(0x0040404040404040), + CONST64(0x4000000040000000), CONST64(0x4000004040000000), CONST64(0x4000000040000040), CONST64(0x4000004040000040), + CONST64(0x4000400040000000), CONST64(0x4000404040000000), CONST64(0x4000400040000040), CONST64(0x4000404040000040), + CONST64(0x4000000040004000), CONST64(0x4000004040004000), CONST64(0x4000000040004040), CONST64(0x4000004040004040), + CONST64(0x4000400040004000), CONST64(0x4000404040004000), CONST64(0x4000400040004040), CONST64(0x4000404040004040), + CONST64(0x4040000040000000), CONST64(0x4040004040000000), CONST64(0x4040000040000040), CONST64(0x4040004040000040), + CONST64(0x4040400040000000), CONST64(0x4040404040000000), CONST64(0x4040400040000040), CONST64(0x4040404040000040), + CONST64(0x4040000040004000), CONST64(0x4040004040004000), CONST64(0x4040000040004040), CONST64(0x4040004040004040), + CONST64(0x4040400040004000), CONST64(0x4040404040004000), CONST64(0x4040400040004040), CONST64(0x4040404040004040), + CONST64(0x4000000040400000), CONST64(0x4000004040400000), CONST64(0x4000000040400040), CONST64(0x4000004040400040), + CONST64(0x4000400040400000), CONST64(0x4000404040400000), CONST64(0x4000400040400040), CONST64(0x4000404040400040), + CONST64(0x4000000040404000), CONST64(0x4000004040404000), CONST64(0x4000000040404040), CONST64(0x4000004040404040), + CONST64(0x4000400040404000), CONST64(0x4000404040404000), CONST64(0x4000400040404040), CONST64(0x4000404040404040), + CONST64(0x4040000040400000), CONST64(0x4040004040400000), CONST64(0x4040000040400040), CONST64(0x4040004040400040), + CONST64(0x4040400040400000), CONST64(0x4040404040400000), CONST64(0x4040400040400040), CONST64(0x4040404040400040), + CONST64(0x4040000040404000), CONST64(0x4040004040404000), CONST64(0x4040000040404040), CONST64(0x4040004040404040), + CONST64(0x4040400040404000), CONST64(0x4040404040404000), CONST64(0x4040400040404040), CONST64(0x4040404040404040) + }, +{ CONST64(0x0000000000000000), CONST64(0x0000002000000000), CONST64(0x0000000000000020), CONST64(0x0000002000000020), + CONST64(0x0000200000000000), CONST64(0x0000202000000000), CONST64(0x0000200000000020), CONST64(0x0000202000000020), + CONST64(0x0000000000002000), CONST64(0x0000002000002000), CONST64(0x0000000000002020), CONST64(0x0000002000002020), + CONST64(0x0000200000002000), CONST64(0x0000202000002000), CONST64(0x0000200000002020), CONST64(0x0000202000002020), + CONST64(0x0020000000000000), CONST64(0x0020002000000000), CONST64(0x0020000000000020), CONST64(0x0020002000000020), + CONST64(0x0020200000000000), CONST64(0x0020202000000000), CONST64(0x0020200000000020), CONST64(0x0020202000000020), + CONST64(0x0020000000002000), CONST64(0x0020002000002000), CONST64(0x0020000000002020), CONST64(0x0020002000002020), + CONST64(0x0020200000002000), CONST64(0x0020202000002000), CONST64(0x0020200000002020), CONST64(0x0020202000002020), + CONST64(0x0000000000200000), CONST64(0x0000002000200000), CONST64(0x0000000000200020), CONST64(0x0000002000200020), + CONST64(0x0000200000200000), CONST64(0x0000202000200000), CONST64(0x0000200000200020), CONST64(0x0000202000200020), + CONST64(0x0000000000202000), CONST64(0x0000002000202000), CONST64(0x0000000000202020), CONST64(0x0000002000202020), + CONST64(0x0000200000202000), CONST64(0x0000202000202000), CONST64(0x0000200000202020), CONST64(0x0000202000202020), + CONST64(0x0020000000200000), CONST64(0x0020002000200000), CONST64(0x0020000000200020), CONST64(0x0020002000200020), + CONST64(0x0020200000200000), CONST64(0x0020202000200000), CONST64(0x0020200000200020), CONST64(0x0020202000200020), + CONST64(0x0020000000202000), CONST64(0x0020002000202000), CONST64(0x0020000000202020), CONST64(0x0020002000202020), + CONST64(0x0020200000202000), CONST64(0x0020202000202000), CONST64(0x0020200000202020), CONST64(0x0020202000202020), + CONST64(0x2000000000000000), CONST64(0x2000002000000000), CONST64(0x2000000000000020), CONST64(0x2000002000000020), + CONST64(0x2000200000000000), CONST64(0x2000202000000000), CONST64(0x2000200000000020), CONST64(0x2000202000000020), + CONST64(0x2000000000002000), CONST64(0x2000002000002000), CONST64(0x2000000000002020), CONST64(0x2000002000002020), + CONST64(0x2000200000002000), CONST64(0x2000202000002000), CONST64(0x2000200000002020), CONST64(0x2000202000002020), + CONST64(0x2020000000000000), CONST64(0x2020002000000000), CONST64(0x2020000000000020), CONST64(0x2020002000000020), + CONST64(0x2020200000000000), CONST64(0x2020202000000000), CONST64(0x2020200000000020), CONST64(0x2020202000000020), + CONST64(0x2020000000002000), CONST64(0x2020002000002000), CONST64(0x2020000000002020), CONST64(0x2020002000002020), + CONST64(0x2020200000002000), CONST64(0x2020202000002000), CONST64(0x2020200000002020), CONST64(0x2020202000002020), + CONST64(0x2000000000200000), CONST64(0x2000002000200000), CONST64(0x2000000000200020), CONST64(0x2000002000200020), + CONST64(0x2000200000200000), CONST64(0x2000202000200000), CONST64(0x2000200000200020), CONST64(0x2000202000200020), + CONST64(0x2000000000202000), CONST64(0x2000002000202000), CONST64(0x2000000000202020), CONST64(0x2000002000202020), + CONST64(0x2000200000202000), CONST64(0x2000202000202000), CONST64(0x2000200000202020), CONST64(0x2000202000202020), + CONST64(0x2020000000200000), CONST64(0x2020002000200000), CONST64(0x2020000000200020), CONST64(0x2020002000200020), + CONST64(0x2020200000200000), CONST64(0x2020202000200000), CONST64(0x2020200000200020), CONST64(0x2020202000200020), + CONST64(0x2020000000202000), CONST64(0x2020002000202000), CONST64(0x2020000000202020), CONST64(0x2020002000202020), + CONST64(0x2020200000202000), CONST64(0x2020202000202000), CONST64(0x2020200000202020), CONST64(0x2020202000202020), + CONST64(0x0000000020000000), CONST64(0x0000002020000000), CONST64(0x0000000020000020), CONST64(0x0000002020000020), + CONST64(0x0000200020000000), CONST64(0x0000202020000000), CONST64(0x0000200020000020), CONST64(0x0000202020000020), + CONST64(0x0000000020002000), CONST64(0x0000002020002000), CONST64(0x0000000020002020), CONST64(0x0000002020002020), + CONST64(0x0000200020002000), CONST64(0x0000202020002000), CONST64(0x0000200020002020), CONST64(0x0000202020002020), + CONST64(0x0020000020000000), CONST64(0x0020002020000000), CONST64(0x0020000020000020), CONST64(0x0020002020000020), + CONST64(0x0020200020000000), CONST64(0x0020202020000000), CONST64(0x0020200020000020), CONST64(0x0020202020000020), + CONST64(0x0020000020002000), CONST64(0x0020002020002000), CONST64(0x0020000020002020), CONST64(0x0020002020002020), + CONST64(0x0020200020002000), CONST64(0x0020202020002000), CONST64(0x0020200020002020), CONST64(0x0020202020002020), + CONST64(0x0000000020200000), CONST64(0x0000002020200000), CONST64(0x0000000020200020), CONST64(0x0000002020200020), + CONST64(0x0000200020200000), CONST64(0x0000202020200000), CONST64(0x0000200020200020), CONST64(0x0000202020200020), + CONST64(0x0000000020202000), CONST64(0x0000002020202000), CONST64(0x0000000020202020), CONST64(0x0000002020202020), + CONST64(0x0000200020202000), CONST64(0x0000202020202000), CONST64(0x0000200020202020), CONST64(0x0000202020202020), + CONST64(0x0020000020200000), CONST64(0x0020002020200000), CONST64(0x0020000020200020), CONST64(0x0020002020200020), + CONST64(0x0020200020200000), CONST64(0x0020202020200000), CONST64(0x0020200020200020), CONST64(0x0020202020200020), + CONST64(0x0020000020202000), CONST64(0x0020002020202000), CONST64(0x0020000020202020), CONST64(0x0020002020202020), + CONST64(0x0020200020202000), CONST64(0x0020202020202000), CONST64(0x0020200020202020), CONST64(0x0020202020202020), + CONST64(0x2000000020000000), CONST64(0x2000002020000000), CONST64(0x2000000020000020), CONST64(0x2000002020000020), + CONST64(0x2000200020000000), CONST64(0x2000202020000000), CONST64(0x2000200020000020), CONST64(0x2000202020000020), + CONST64(0x2000000020002000), CONST64(0x2000002020002000), CONST64(0x2000000020002020), CONST64(0x2000002020002020), + CONST64(0x2000200020002000), CONST64(0x2000202020002000), CONST64(0x2000200020002020), CONST64(0x2000202020002020), + CONST64(0x2020000020000000), CONST64(0x2020002020000000), CONST64(0x2020000020000020), CONST64(0x2020002020000020), + CONST64(0x2020200020000000), CONST64(0x2020202020000000), CONST64(0x2020200020000020), CONST64(0x2020202020000020), + CONST64(0x2020000020002000), CONST64(0x2020002020002000), CONST64(0x2020000020002020), CONST64(0x2020002020002020), + CONST64(0x2020200020002000), CONST64(0x2020202020002000), CONST64(0x2020200020002020), CONST64(0x2020202020002020), + CONST64(0x2000000020200000), CONST64(0x2000002020200000), CONST64(0x2000000020200020), CONST64(0x2000002020200020), + CONST64(0x2000200020200000), CONST64(0x2000202020200000), CONST64(0x2000200020200020), CONST64(0x2000202020200020), + CONST64(0x2000000020202000), CONST64(0x2000002020202000), CONST64(0x2000000020202020), CONST64(0x2000002020202020), + CONST64(0x2000200020202000), CONST64(0x2000202020202000), CONST64(0x2000200020202020), CONST64(0x2000202020202020), + CONST64(0x2020000020200000), CONST64(0x2020002020200000), CONST64(0x2020000020200020), CONST64(0x2020002020200020), + CONST64(0x2020200020200000), CONST64(0x2020202020200000), CONST64(0x2020200020200020), CONST64(0x2020202020200020), + CONST64(0x2020000020202000), CONST64(0x2020002020202000), CONST64(0x2020000020202020), CONST64(0x2020002020202020), + CONST64(0x2020200020202000), CONST64(0x2020202020202000), CONST64(0x2020200020202020), CONST64(0x2020202020202020) + }}; + +static const ulong64 des_fp[8][256] = { + +{ CONST64(0x0000000000000000), CONST64(0x0000008000000000), CONST64(0x0000000002000000), CONST64(0x0000008002000000), + CONST64(0x0000000000020000), CONST64(0x0000008000020000), CONST64(0x0000000002020000), CONST64(0x0000008002020000), + CONST64(0x0000000000000200), CONST64(0x0000008000000200), CONST64(0x0000000002000200), CONST64(0x0000008002000200), + CONST64(0x0000000000020200), CONST64(0x0000008000020200), CONST64(0x0000000002020200), CONST64(0x0000008002020200), + CONST64(0x0000000000000002), CONST64(0x0000008000000002), CONST64(0x0000000002000002), CONST64(0x0000008002000002), + CONST64(0x0000000000020002), CONST64(0x0000008000020002), CONST64(0x0000000002020002), CONST64(0x0000008002020002), + CONST64(0x0000000000000202), CONST64(0x0000008000000202), CONST64(0x0000000002000202), CONST64(0x0000008002000202), + CONST64(0x0000000000020202), CONST64(0x0000008000020202), CONST64(0x0000000002020202), CONST64(0x0000008002020202), + CONST64(0x0200000000000000), CONST64(0x0200008000000000), CONST64(0x0200000002000000), CONST64(0x0200008002000000), + CONST64(0x0200000000020000), CONST64(0x0200008000020000), CONST64(0x0200000002020000), CONST64(0x0200008002020000), + CONST64(0x0200000000000200), CONST64(0x0200008000000200), CONST64(0x0200000002000200), CONST64(0x0200008002000200), + CONST64(0x0200000000020200), CONST64(0x0200008000020200), CONST64(0x0200000002020200), CONST64(0x0200008002020200), + CONST64(0x0200000000000002), CONST64(0x0200008000000002), CONST64(0x0200000002000002), CONST64(0x0200008002000002), + CONST64(0x0200000000020002), CONST64(0x0200008000020002), CONST64(0x0200000002020002), CONST64(0x0200008002020002), + CONST64(0x0200000000000202), CONST64(0x0200008000000202), CONST64(0x0200000002000202), CONST64(0x0200008002000202), + CONST64(0x0200000000020202), CONST64(0x0200008000020202), CONST64(0x0200000002020202), CONST64(0x0200008002020202), + CONST64(0x0002000000000000), CONST64(0x0002008000000000), CONST64(0x0002000002000000), CONST64(0x0002008002000000), + CONST64(0x0002000000020000), CONST64(0x0002008000020000), CONST64(0x0002000002020000), CONST64(0x0002008002020000), + CONST64(0x0002000000000200), CONST64(0x0002008000000200), CONST64(0x0002000002000200), CONST64(0x0002008002000200), + CONST64(0x0002000000020200), CONST64(0x0002008000020200), CONST64(0x0002000002020200), CONST64(0x0002008002020200), + CONST64(0x0002000000000002), CONST64(0x0002008000000002), CONST64(0x0002000002000002), CONST64(0x0002008002000002), + CONST64(0x0002000000020002), CONST64(0x0002008000020002), CONST64(0x0002000002020002), CONST64(0x0002008002020002), + CONST64(0x0002000000000202), CONST64(0x0002008000000202), CONST64(0x0002000002000202), CONST64(0x0002008002000202), + CONST64(0x0002000000020202), CONST64(0x0002008000020202), CONST64(0x0002000002020202), CONST64(0x0002008002020202), + CONST64(0x0202000000000000), CONST64(0x0202008000000000), CONST64(0x0202000002000000), CONST64(0x0202008002000000), + CONST64(0x0202000000020000), CONST64(0x0202008000020000), CONST64(0x0202000002020000), CONST64(0x0202008002020000), + CONST64(0x0202000000000200), CONST64(0x0202008000000200), CONST64(0x0202000002000200), CONST64(0x0202008002000200), + CONST64(0x0202000000020200), CONST64(0x0202008000020200), CONST64(0x0202000002020200), CONST64(0x0202008002020200), + CONST64(0x0202000000000002), CONST64(0x0202008000000002), CONST64(0x0202000002000002), CONST64(0x0202008002000002), + CONST64(0x0202000000020002), CONST64(0x0202008000020002), CONST64(0x0202000002020002), CONST64(0x0202008002020002), + CONST64(0x0202000000000202), CONST64(0x0202008000000202), CONST64(0x0202000002000202), CONST64(0x0202008002000202), + CONST64(0x0202000000020202), CONST64(0x0202008000020202), CONST64(0x0202000002020202), CONST64(0x0202008002020202), + CONST64(0x0000020000000000), CONST64(0x0000028000000000), CONST64(0x0000020002000000), CONST64(0x0000028002000000), + CONST64(0x0000020000020000), CONST64(0x0000028000020000), CONST64(0x0000020002020000), CONST64(0x0000028002020000), + CONST64(0x0000020000000200), CONST64(0x0000028000000200), CONST64(0x0000020002000200), CONST64(0x0000028002000200), + CONST64(0x0000020000020200), CONST64(0x0000028000020200), CONST64(0x0000020002020200), CONST64(0x0000028002020200), + CONST64(0x0000020000000002), CONST64(0x0000028000000002), CONST64(0x0000020002000002), CONST64(0x0000028002000002), + CONST64(0x0000020000020002), CONST64(0x0000028000020002), CONST64(0x0000020002020002), CONST64(0x0000028002020002), + CONST64(0x0000020000000202), CONST64(0x0000028000000202), CONST64(0x0000020002000202), CONST64(0x0000028002000202), + CONST64(0x0000020000020202), CONST64(0x0000028000020202), CONST64(0x0000020002020202), CONST64(0x0000028002020202), + CONST64(0x0200020000000000), CONST64(0x0200028000000000), CONST64(0x0200020002000000), CONST64(0x0200028002000000), + CONST64(0x0200020000020000), CONST64(0x0200028000020000), CONST64(0x0200020002020000), CONST64(0x0200028002020000), + CONST64(0x0200020000000200), CONST64(0x0200028000000200), CONST64(0x0200020002000200), CONST64(0x0200028002000200), + CONST64(0x0200020000020200), CONST64(0x0200028000020200), CONST64(0x0200020002020200), CONST64(0x0200028002020200), + CONST64(0x0200020000000002), CONST64(0x0200028000000002), CONST64(0x0200020002000002), CONST64(0x0200028002000002), + CONST64(0x0200020000020002), CONST64(0x0200028000020002), CONST64(0x0200020002020002), CONST64(0x0200028002020002), + CONST64(0x0200020000000202), CONST64(0x0200028000000202), CONST64(0x0200020002000202), CONST64(0x0200028002000202), + CONST64(0x0200020000020202), CONST64(0x0200028000020202), CONST64(0x0200020002020202), CONST64(0x0200028002020202), + CONST64(0x0002020000000000), CONST64(0x0002028000000000), CONST64(0x0002020002000000), CONST64(0x0002028002000000), + CONST64(0x0002020000020000), CONST64(0x0002028000020000), CONST64(0x0002020002020000), CONST64(0x0002028002020000), + CONST64(0x0002020000000200), CONST64(0x0002028000000200), CONST64(0x0002020002000200), CONST64(0x0002028002000200), + CONST64(0x0002020000020200), CONST64(0x0002028000020200), CONST64(0x0002020002020200), CONST64(0x0002028002020200), + CONST64(0x0002020000000002), CONST64(0x0002028000000002), CONST64(0x0002020002000002), CONST64(0x0002028002000002), + CONST64(0x0002020000020002), CONST64(0x0002028000020002), CONST64(0x0002020002020002), CONST64(0x0002028002020002), + CONST64(0x0002020000000202), CONST64(0x0002028000000202), CONST64(0x0002020002000202), CONST64(0x0002028002000202), + CONST64(0x0002020000020202), CONST64(0x0002028000020202), CONST64(0x0002020002020202), CONST64(0x0002028002020202), + CONST64(0x0202020000000000), CONST64(0x0202028000000000), CONST64(0x0202020002000000), CONST64(0x0202028002000000), + CONST64(0x0202020000020000), CONST64(0x0202028000020000), CONST64(0x0202020002020000), CONST64(0x0202028002020000), + CONST64(0x0202020000000200), CONST64(0x0202028000000200), CONST64(0x0202020002000200), CONST64(0x0202028002000200), + CONST64(0x0202020000020200), CONST64(0x0202028000020200), CONST64(0x0202020002020200), CONST64(0x0202028002020200), + CONST64(0x0202020000000002), CONST64(0x0202028000000002), CONST64(0x0202020002000002), CONST64(0x0202028002000002), + CONST64(0x0202020000020002), CONST64(0x0202028000020002), CONST64(0x0202020002020002), CONST64(0x0202028002020002), + CONST64(0x0202020000000202), CONST64(0x0202028000000202), CONST64(0x0202020002000202), CONST64(0x0202028002000202), + CONST64(0x0202020000020202), CONST64(0x0202028000020202), CONST64(0x0202020002020202), CONST64(0x0202028002020202) + }, +{ CONST64(0x0000000000000000), CONST64(0x0000000200000000), CONST64(0x0000000008000000), CONST64(0x0000000208000000), + CONST64(0x0000000000080000), CONST64(0x0000000200080000), CONST64(0x0000000008080000), CONST64(0x0000000208080000), + CONST64(0x0000000000000800), CONST64(0x0000000200000800), CONST64(0x0000000008000800), CONST64(0x0000000208000800), + CONST64(0x0000000000080800), CONST64(0x0000000200080800), CONST64(0x0000000008080800), CONST64(0x0000000208080800), + CONST64(0x0000000000000008), CONST64(0x0000000200000008), CONST64(0x0000000008000008), CONST64(0x0000000208000008), + CONST64(0x0000000000080008), CONST64(0x0000000200080008), CONST64(0x0000000008080008), CONST64(0x0000000208080008), + CONST64(0x0000000000000808), CONST64(0x0000000200000808), CONST64(0x0000000008000808), CONST64(0x0000000208000808), + CONST64(0x0000000000080808), CONST64(0x0000000200080808), CONST64(0x0000000008080808), CONST64(0x0000000208080808), + CONST64(0x0800000000000000), CONST64(0x0800000200000000), CONST64(0x0800000008000000), CONST64(0x0800000208000000), + CONST64(0x0800000000080000), CONST64(0x0800000200080000), CONST64(0x0800000008080000), CONST64(0x0800000208080000), + CONST64(0x0800000000000800), CONST64(0x0800000200000800), CONST64(0x0800000008000800), CONST64(0x0800000208000800), + CONST64(0x0800000000080800), CONST64(0x0800000200080800), CONST64(0x0800000008080800), CONST64(0x0800000208080800), + CONST64(0x0800000000000008), CONST64(0x0800000200000008), CONST64(0x0800000008000008), CONST64(0x0800000208000008), + CONST64(0x0800000000080008), CONST64(0x0800000200080008), CONST64(0x0800000008080008), CONST64(0x0800000208080008), + CONST64(0x0800000000000808), CONST64(0x0800000200000808), CONST64(0x0800000008000808), CONST64(0x0800000208000808), + CONST64(0x0800000000080808), CONST64(0x0800000200080808), CONST64(0x0800000008080808), CONST64(0x0800000208080808), + CONST64(0x0008000000000000), CONST64(0x0008000200000000), CONST64(0x0008000008000000), CONST64(0x0008000208000000), + CONST64(0x0008000000080000), CONST64(0x0008000200080000), CONST64(0x0008000008080000), CONST64(0x0008000208080000), + CONST64(0x0008000000000800), CONST64(0x0008000200000800), CONST64(0x0008000008000800), CONST64(0x0008000208000800), + CONST64(0x0008000000080800), CONST64(0x0008000200080800), CONST64(0x0008000008080800), CONST64(0x0008000208080800), + CONST64(0x0008000000000008), CONST64(0x0008000200000008), CONST64(0x0008000008000008), CONST64(0x0008000208000008), + CONST64(0x0008000000080008), CONST64(0x0008000200080008), CONST64(0x0008000008080008), CONST64(0x0008000208080008), + CONST64(0x0008000000000808), CONST64(0x0008000200000808), CONST64(0x0008000008000808), CONST64(0x0008000208000808), + CONST64(0x0008000000080808), CONST64(0x0008000200080808), CONST64(0x0008000008080808), CONST64(0x0008000208080808), + CONST64(0x0808000000000000), CONST64(0x0808000200000000), CONST64(0x0808000008000000), CONST64(0x0808000208000000), + CONST64(0x0808000000080000), CONST64(0x0808000200080000), CONST64(0x0808000008080000), CONST64(0x0808000208080000), + CONST64(0x0808000000000800), CONST64(0x0808000200000800), CONST64(0x0808000008000800), CONST64(0x0808000208000800), + CONST64(0x0808000000080800), CONST64(0x0808000200080800), CONST64(0x0808000008080800), CONST64(0x0808000208080800), + CONST64(0x0808000000000008), CONST64(0x0808000200000008), CONST64(0x0808000008000008), CONST64(0x0808000208000008), + CONST64(0x0808000000080008), CONST64(0x0808000200080008), CONST64(0x0808000008080008), CONST64(0x0808000208080008), + CONST64(0x0808000000000808), CONST64(0x0808000200000808), CONST64(0x0808000008000808), CONST64(0x0808000208000808), + CONST64(0x0808000000080808), CONST64(0x0808000200080808), CONST64(0x0808000008080808), CONST64(0x0808000208080808), + CONST64(0x0000080000000000), CONST64(0x0000080200000000), CONST64(0x0000080008000000), CONST64(0x0000080208000000), + CONST64(0x0000080000080000), CONST64(0x0000080200080000), CONST64(0x0000080008080000), CONST64(0x0000080208080000), + CONST64(0x0000080000000800), CONST64(0x0000080200000800), CONST64(0x0000080008000800), CONST64(0x0000080208000800), + CONST64(0x0000080000080800), CONST64(0x0000080200080800), CONST64(0x0000080008080800), CONST64(0x0000080208080800), + CONST64(0x0000080000000008), CONST64(0x0000080200000008), CONST64(0x0000080008000008), CONST64(0x0000080208000008), + CONST64(0x0000080000080008), CONST64(0x0000080200080008), CONST64(0x0000080008080008), CONST64(0x0000080208080008), + CONST64(0x0000080000000808), CONST64(0x0000080200000808), CONST64(0x0000080008000808), CONST64(0x0000080208000808), + CONST64(0x0000080000080808), CONST64(0x0000080200080808), CONST64(0x0000080008080808), CONST64(0x0000080208080808), + CONST64(0x0800080000000000), CONST64(0x0800080200000000), CONST64(0x0800080008000000), CONST64(0x0800080208000000), + CONST64(0x0800080000080000), CONST64(0x0800080200080000), CONST64(0x0800080008080000), CONST64(0x0800080208080000), + CONST64(0x0800080000000800), CONST64(0x0800080200000800), CONST64(0x0800080008000800), CONST64(0x0800080208000800), + CONST64(0x0800080000080800), CONST64(0x0800080200080800), CONST64(0x0800080008080800), CONST64(0x0800080208080800), + CONST64(0x0800080000000008), CONST64(0x0800080200000008), CONST64(0x0800080008000008), CONST64(0x0800080208000008), + CONST64(0x0800080000080008), CONST64(0x0800080200080008), CONST64(0x0800080008080008), CONST64(0x0800080208080008), + CONST64(0x0800080000000808), CONST64(0x0800080200000808), CONST64(0x0800080008000808), CONST64(0x0800080208000808), + CONST64(0x0800080000080808), CONST64(0x0800080200080808), CONST64(0x0800080008080808), CONST64(0x0800080208080808), + CONST64(0x0008080000000000), CONST64(0x0008080200000000), CONST64(0x0008080008000000), CONST64(0x0008080208000000), + CONST64(0x0008080000080000), CONST64(0x0008080200080000), CONST64(0x0008080008080000), CONST64(0x0008080208080000), + CONST64(0x0008080000000800), CONST64(0x0008080200000800), CONST64(0x0008080008000800), CONST64(0x0008080208000800), + CONST64(0x0008080000080800), CONST64(0x0008080200080800), CONST64(0x0008080008080800), CONST64(0x0008080208080800), + CONST64(0x0008080000000008), CONST64(0x0008080200000008), CONST64(0x0008080008000008), CONST64(0x0008080208000008), + CONST64(0x0008080000080008), CONST64(0x0008080200080008), CONST64(0x0008080008080008), CONST64(0x0008080208080008), + CONST64(0x0008080000000808), CONST64(0x0008080200000808), CONST64(0x0008080008000808), CONST64(0x0008080208000808), + CONST64(0x0008080000080808), CONST64(0x0008080200080808), CONST64(0x0008080008080808), CONST64(0x0008080208080808), + CONST64(0x0808080000000000), CONST64(0x0808080200000000), CONST64(0x0808080008000000), CONST64(0x0808080208000000), + CONST64(0x0808080000080000), CONST64(0x0808080200080000), CONST64(0x0808080008080000), CONST64(0x0808080208080000), + CONST64(0x0808080000000800), CONST64(0x0808080200000800), CONST64(0x0808080008000800), CONST64(0x0808080208000800), + CONST64(0x0808080000080800), CONST64(0x0808080200080800), CONST64(0x0808080008080800), CONST64(0x0808080208080800), + CONST64(0x0808080000000008), CONST64(0x0808080200000008), CONST64(0x0808080008000008), CONST64(0x0808080208000008), + CONST64(0x0808080000080008), CONST64(0x0808080200080008), CONST64(0x0808080008080008), CONST64(0x0808080208080008), + CONST64(0x0808080000000808), CONST64(0x0808080200000808), CONST64(0x0808080008000808), CONST64(0x0808080208000808), + CONST64(0x0808080000080808), CONST64(0x0808080200080808), CONST64(0x0808080008080808), CONST64(0x0808080208080808) + }, +{ CONST64(0x0000000000000000), CONST64(0x0000000800000000), CONST64(0x0000000020000000), CONST64(0x0000000820000000), + CONST64(0x0000000000200000), CONST64(0x0000000800200000), CONST64(0x0000000020200000), CONST64(0x0000000820200000), + CONST64(0x0000000000002000), CONST64(0x0000000800002000), CONST64(0x0000000020002000), CONST64(0x0000000820002000), + CONST64(0x0000000000202000), CONST64(0x0000000800202000), CONST64(0x0000000020202000), CONST64(0x0000000820202000), + CONST64(0x0000000000000020), CONST64(0x0000000800000020), CONST64(0x0000000020000020), CONST64(0x0000000820000020), + CONST64(0x0000000000200020), CONST64(0x0000000800200020), CONST64(0x0000000020200020), CONST64(0x0000000820200020), + CONST64(0x0000000000002020), CONST64(0x0000000800002020), CONST64(0x0000000020002020), CONST64(0x0000000820002020), + CONST64(0x0000000000202020), CONST64(0x0000000800202020), CONST64(0x0000000020202020), CONST64(0x0000000820202020), + CONST64(0x2000000000000000), CONST64(0x2000000800000000), CONST64(0x2000000020000000), CONST64(0x2000000820000000), + CONST64(0x2000000000200000), CONST64(0x2000000800200000), CONST64(0x2000000020200000), CONST64(0x2000000820200000), + CONST64(0x2000000000002000), CONST64(0x2000000800002000), CONST64(0x2000000020002000), CONST64(0x2000000820002000), + CONST64(0x2000000000202000), CONST64(0x2000000800202000), CONST64(0x2000000020202000), CONST64(0x2000000820202000), + CONST64(0x2000000000000020), CONST64(0x2000000800000020), CONST64(0x2000000020000020), CONST64(0x2000000820000020), + CONST64(0x2000000000200020), CONST64(0x2000000800200020), CONST64(0x2000000020200020), CONST64(0x2000000820200020), + CONST64(0x2000000000002020), CONST64(0x2000000800002020), CONST64(0x2000000020002020), CONST64(0x2000000820002020), + CONST64(0x2000000000202020), CONST64(0x2000000800202020), CONST64(0x2000000020202020), CONST64(0x2000000820202020), + CONST64(0x0020000000000000), CONST64(0x0020000800000000), CONST64(0x0020000020000000), CONST64(0x0020000820000000), + CONST64(0x0020000000200000), CONST64(0x0020000800200000), CONST64(0x0020000020200000), CONST64(0x0020000820200000), + CONST64(0x0020000000002000), CONST64(0x0020000800002000), CONST64(0x0020000020002000), CONST64(0x0020000820002000), + CONST64(0x0020000000202000), CONST64(0x0020000800202000), CONST64(0x0020000020202000), CONST64(0x0020000820202000), + CONST64(0x0020000000000020), CONST64(0x0020000800000020), CONST64(0x0020000020000020), CONST64(0x0020000820000020), + CONST64(0x0020000000200020), CONST64(0x0020000800200020), CONST64(0x0020000020200020), CONST64(0x0020000820200020), + CONST64(0x0020000000002020), CONST64(0x0020000800002020), CONST64(0x0020000020002020), CONST64(0x0020000820002020), + CONST64(0x0020000000202020), CONST64(0x0020000800202020), CONST64(0x0020000020202020), CONST64(0x0020000820202020), + CONST64(0x2020000000000000), CONST64(0x2020000800000000), CONST64(0x2020000020000000), CONST64(0x2020000820000000), + CONST64(0x2020000000200000), CONST64(0x2020000800200000), CONST64(0x2020000020200000), CONST64(0x2020000820200000), + CONST64(0x2020000000002000), CONST64(0x2020000800002000), CONST64(0x2020000020002000), CONST64(0x2020000820002000), + CONST64(0x2020000000202000), CONST64(0x2020000800202000), CONST64(0x2020000020202000), CONST64(0x2020000820202000), + CONST64(0x2020000000000020), CONST64(0x2020000800000020), CONST64(0x2020000020000020), CONST64(0x2020000820000020), + CONST64(0x2020000000200020), CONST64(0x2020000800200020), CONST64(0x2020000020200020), CONST64(0x2020000820200020), + CONST64(0x2020000000002020), CONST64(0x2020000800002020), CONST64(0x2020000020002020), CONST64(0x2020000820002020), + CONST64(0x2020000000202020), CONST64(0x2020000800202020), CONST64(0x2020000020202020), CONST64(0x2020000820202020), + CONST64(0x0000200000000000), CONST64(0x0000200800000000), CONST64(0x0000200020000000), CONST64(0x0000200820000000), + CONST64(0x0000200000200000), CONST64(0x0000200800200000), CONST64(0x0000200020200000), CONST64(0x0000200820200000), + CONST64(0x0000200000002000), CONST64(0x0000200800002000), CONST64(0x0000200020002000), CONST64(0x0000200820002000), + CONST64(0x0000200000202000), CONST64(0x0000200800202000), CONST64(0x0000200020202000), CONST64(0x0000200820202000), + CONST64(0x0000200000000020), CONST64(0x0000200800000020), CONST64(0x0000200020000020), CONST64(0x0000200820000020), + CONST64(0x0000200000200020), CONST64(0x0000200800200020), CONST64(0x0000200020200020), CONST64(0x0000200820200020), + CONST64(0x0000200000002020), CONST64(0x0000200800002020), CONST64(0x0000200020002020), CONST64(0x0000200820002020), + CONST64(0x0000200000202020), CONST64(0x0000200800202020), CONST64(0x0000200020202020), CONST64(0x0000200820202020), + CONST64(0x2000200000000000), CONST64(0x2000200800000000), CONST64(0x2000200020000000), CONST64(0x2000200820000000), + CONST64(0x2000200000200000), CONST64(0x2000200800200000), CONST64(0x2000200020200000), CONST64(0x2000200820200000), + CONST64(0x2000200000002000), CONST64(0x2000200800002000), CONST64(0x2000200020002000), CONST64(0x2000200820002000), + CONST64(0x2000200000202000), CONST64(0x2000200800202000), CONST64(0x2000200020202000), CONST64(0x2000200820202000), + CONST64(0x2000200000000020), CONST64(0x2000200800000020), CONST64(0x2000200020000020), CONST64(0x2000200820000020), + CONST64(0x2000200000200020), CONST64(0x2000200800200020), CONST64(0x2000200020200020), CONST64(0x2000200820200020), + CONST64(0x2000200000002020), CONST64(0x2000200800002020), CONST64(0x2000200020002020), CONST64(0x2000200820002020), + CONST64(0x2000200000202020), CONST64(0x2000200800202020), CONST64(0x2000200020202020), CONST64(0x2000200820202020), + CONST64(0x0020200000000000), CONST64(0x0020200800000000), CONST64(0x0020200020000000), CONST64(0x0020200820000000), + CONST64(0x0020200000200000), CONST64(0x0020200800200000), CONST64(0x0020200020200000), CONST64(0x0020200820200000), + CONST64(0x0020200000002000), CONST64(0x0020200800002000), CONST64(0x0020200020002000), CONST64(0x0020200820002000), + CONST64(0x0020200000202000), CONST64(0x0020200800202000), CONST64(0x0020200020202000), CONST64(0x0020200820202000), + CONST64(0x0020200000000020), CONST64(0x0020200800000020), CONST64(0x0020200020000020), CONST64(0x0020200820000020), + CONST64(0x0020200000200020), CONST64(0x0020200800200020), CONST64(0x0020200020200020), CONST64(0x0020200820200020), + CONST64(0x0020200000002020), CONST64(0x0020200800002020), CONST64(0x0020200020002020), CONST64(0x0020200820002020), + CONST64(0x0020200000202020), CONST64(0x0020200800202020), CONST64(0x0020200020202020), CONST64(0x0020200820202020), + CONST64(0x2020200000000000), CONST64(0x2020200800000000), CONST64(0x2020200020000000), CONST64(0x2020200820000000), + CONST64(0x2020200000200000), CONST64(0x2020200800200000), CONST64(0x2020200020200000), CONST64(0x2020200820200000), + CONST64(0x2020200000002000), CONST64(0x2020200800002000), CONST64(0x2020200020002000), CONST64(0x2020200820002000), + CONST64(0x2020200000202000), CONST64(0x2020200800202000), CONST64(0x2020200020202000), CONST64(0x2020200820202000), + CONST64(0x2020200000000020), CONST64(0x2020200800000020), CONST64(0x2020200020000020), CONST64(0x2020200820000020), + CONST64(0x2020200000200020), CONST64(0x2020200800200020), CONST64(0x2020200020200020), CONST64(0x2020200820200020), + CONST64(0x2020200000002020), CONST64(0x2020200800002020), CONST64(0x2020200020002020), CONST64(0x2020200820002020), + CONST64(0x2020200000202020), CONST64(0x2020200800202020), CONST64(0x2020200020202020), CONST64(0x2020200820202020) + }, +{ CONST64(0x0000000000000000), CONST64(0x0000002000000000), CONST64(0x0000000080000000), CONST64(0x0000002080000000), + CONST64(0x0000000000800000), CONST64(0x0000002000800000), CONST64(0x0000000080800000), CONST64(0x0000002080800000), + CONST64(0x0000000000008000), CONST64(0x0000002000008000), CONST64(0x0000000080008000), CONST64(0x0000002080008000), + CONST64(0x0000000000808000), CONST64(0x0000002000808000), CONST64(0x0000000080808000), CONST64(0x0000002080808000), + CONST64(0x0000000000000080), CONST64(0x0000002000000080), CONST64(0x0000000080000080), CONST64(0x0000002080000080), + CONST64(0x0000000000800080), CONST64(0x0000002000800080), CONST64(0x0000000080800080), CONST64(0x0000002080800080), + CONST64(0x0000000000008080), CONST64(0x0000002000008080), CONST64(0x0000000080008080), CONST64(0x0000002080008080), + CONST64(0x0000000000808080), CONST64(0x0000002000808080), CONST64(0x0000000080808080), CONST64(0x0000002080808080), + CONST64(0x8000000000000000), CONST64(0x8000002000000000), CONST64(0x8000000080000000), CONST64(0x8000002080000000), + CONST64(0x8000000000800000), CONST64(0x8000002000800000), CONST64(0x8000000080800000), CONST64(0x8000002080800000), + CONST64(0x8000000000008000), CONST64(0x8000002000008000), CONST64(0x8000000080008000), CONST64(0x8000002080008000), + CONST64(0x8000000000808000), CONST64(0x8000002000808000), CONST64(0x8000000080808000), CONST64(0x8000002080808000), + CONST64(0x8000000000000080), CONST64(0x8000002000000080), CONST64(0x8000000080000080), CONST64(0x8000002080000080), + CONST64(0x8000000000800080), CONST64(0x8000002000800080), CONST64(0x8000000080800080), CONST64(0x8000002080800080), + CONST64(0x8000000000008080), CONST64(0x8000002000008080), CONST64(0x8000000080008080), CONST64(0x8000002080008080), + CONST64(0x8000000000808080), CONST64(0x8000002000808080), CONST64(0x8000000080808080), CONST64(0x8000002080808080), + CONST64(0x0080000000000000), CONST64(0x0080002000000000), CONST64(0x0080000080000000), CONST64(0x0080002080000000), + CONST64(0x0080000000800000), CONST64(0x0080002000800000), CONST64(0x0080000080800000), CONST64(0x0080002080800000), + CONST64(0x0080000000008000), CONST64(0x0080002000008000), CONST64(0x0080000080008000), CONST64(0x0080002080008000), + CONST64(0x0080000000808000), CONST64(0x0080002000808000), CONST64(0x0080000080808000), CONST64(0x0080002080808000), + CONST64(0x0080000000000080), CONST64(0x0080002000000080), CONST64(0x0080000080000080), CONST64(0x0080002080000080), + CONST64(0x0080000000800080), CONST64(0x0080002000800080), CONST64(0x0080000080800080), CONST64(0x0080002080800080), + CONST64(0x0080000000008080), CONST64(0x0080002000008080), CONST64(0x0080000080008080), CONST64(0x0080002080008080), + CONST64(0x0080000000808080), CONST64(0x0080002000808080), CONST64(0x0080000080808080), CONST64(0x0080002080808080), + CONST64(0x8080000000000000), CONST64(0x8080002000000000), CONST64(0x8080000080000000), CONST64(0x8080002080000000), + CONST64(0x8080000000800000), CONST64(0x8080002000800000), CONST64(0x8080000080800000), CONST64(0x8080002080800000), + CONST64(0x8080000000008000), CONST64(0x8080002000008000), CONST64(0x8080000080008000), CONST64(0x8080002080008000), + CONST64(0x8080000000808000), CONST64(0x8080002000808000), CONST64(0x8080000080808000), CONST64(0x8080002080808000), + CONST64(0x8080000000000080), CONST64(0x8080002000000080), CONST64(0x8080000080000080), CONST64(0x8080002080000080), + CONST64(0x8080000000800080), CONST64(0x8080002000800080), CONST64(0x8080000080800080), CONST64(0x8080002080800080), + CONST64(0x8080000000008080), CONST64(0x8080002000008080), CONST64(0x8080000080008080), CONST64(0x8080002080008080), + CONST64(0x8080000000808080), CONST64(0x8080002000808080), CONST64(0x8080000080808080), CONST64(0x8080002080808080), + CONST64(0x0000800000000000), CONST64(0x0000802000000000), CONST64(0x0000800080000000), CONST64(0x0000802080000000), + CONST64(0x0000800000800000), CONST64(0x0000802000800000), CONST64(0x0000800080800000), CONST64(0x0000802080800000), + CONST64(0x0000800000008000), CONST64(0x0000802000008000), CONST64(0x0000800080008000), CONST64(0x0000802080008000), + CONST64(0x0000800000808000), CONST64(0x0000802000808000), CONST64(0x0000800080808000), CONST64(0x0000802080808000), + CONST64(0x0000800000000080), CONST64(0x0000802000000080), CONST64(0x0000800080000080), CONST64(0x0000802080000080), + CONST64(0x0000800000800080), CONST64(0x0000802000800080), CONST64(0x0000800080800080), CONST64(0x0000802080800080), + CONST64(0x0000800000008080), CONST64(0x0000802000008080), CONST64(0x0000800080008080), CONST64(0x0000802080008080), + CONST64(0x0000800000808080), CONST64(0x0000802000808080), CONST64(0x0000800080808080), CONST64(0x0000802080808080), + CONST64(0x8000800000000000), CONST64(0x8000802000000000), CONST64(0x8000800080000000), CONST64(0x8000802080000000), + CONST64(0x8000800000800000), CONST64(0x8000802000800000), CONST64(0x8000800080800000), CONST64(0x8000802080800000), + CONST64(0x8000800000008000), CONST64(0x8000802000008000), CONST64(0x8000800080008000), CONST64(0x8000802080008000), + CONST64(0x8000800000808000), CONST64(0x8000802000808000), CONST64(0x8000800080808000), CONST64(0x8000802080808000), + CONST64(0x8000800000000080), CONST64(0x8000802000000080), CONST64(0x8000800080000080), CONST64(0x8000802080000080), + CONST64(0x8000800000800080), CONST64(0x8000802000800080), CONST64(0x8000800080800080), CONST64(0x8000802080800080), + CONST64(0x8000800000008080), CONST64(0x8000802000008080), CONST64(0x8000800080008080), CONST64(0x8000802080008080), + CONST64(0x8000800000808080), CONST64(0x8000802000808080), CONST64(0x8000800080808080), CONST64(0x8000802080808080), + CONST64(0x0080800000000000), CONST64(0x0080802000000000), CONST64(0x0080800080000000), CONST64(0x0080802080000000), + CONST64(0x0080800000800000), CONST64(0x0080802000800000), CONST64(0x0080800080800000), CONST64(0x0080802080800000), + CONST64(0x0080800000008000), CONST64(0x0080802000008000), CONST64(0x0080800080008000), CONST64(0x0080802080008000), + CONST64(0x0080800000808000), CONST64(0x0080802000808000), CONST64(0x0080800080808000), CONST64(0x0080802080808000), + CONST64(0x0080800000000080), CONST64(0x0080802000000080), CONST64(0x0080800080000080), CONST64(0x0080802080000080), + CONST64(0x0080800000800080), CONST64(0x0080802000800080), CONST64(0x0080800080800080), CONST64(0x0080802080800080), + CONST64(0x0080800000008080), CONST64(0x0080802000008080), CONST64(0x0080800080008080), CONST64(0x0080802080008080), + CONST64(0x0080800000808080), CONST64(0x0080802000808080), CONST64(0x0080800080808080), CONST64(0x0080802080808080), + CONST64(0x8080800000000000), CONST64(0x8080802000000000), CONST64(0x8080800080000000), CONST64(0x8080802080000000), + CONST64(0x8080800000800000), CONST64(0x8080802000800000), CONST64(0x8080800080800000), CONST64(0x8080802080800000), + CONST64(0x8080800000008000), CONST64(0x8080802000008000), CONST64(0x8080800080008000), CONST64(0x8080802080008000), + CONST64(0x8080800000808000), CONST64(0x8080802000808000), CONST64(0x8080800080808000), CONST64(0x8080802080808000), + CONST64(0x8080800000000080), CONST64(0x8080802000000080), CONST64(0x8080800080000080), CONST64(0x8080802080000080), + CONST64(0x8080800000800080), CONST64(0x8080802000800080), CONST64(0x8080800080800080), CONST64(0x8080802080800080), + CONST64(0x8080800000008080), CONST64(0x8080802000008080), CONST64(0x8080800080008080), CONST64(0x8080802080008080), + CONST64(0x8080800000808080), CONST64(0x8080802000808080), CONST64(0x8080800080808080), CONST64(0x8080802080808080) + }, +{ CONST64(0x0000000000000000), CONST64(0x0000004000000000), CONST64(0x0000000001000000), CONST64(0x0000004001000000), + CONST64(0x0000000000010000), CONST64(0x0000004000010000), CONST64(0x0000000001010000), CONST64(0x0000004001010000), + CONST64(0x0000000000000100), CONST64(0x0000004000000100), CONST64(0x0000000001000100), CONST64(0x0000004001000100), + CONST64(0x0000000000010100), CONST64(0x0000004000010100), CONST64(0x0000000001010100), CONST64(0x0000004001010100), + CONST64(0x0000000000000001), CONST64(0x0000004000000001), CONST64(0x0000000001000001), CONST64(0x0000004001000001), + CONST64(0x0000000000010001), CONST64(0x0000004000010001), CONST64(0x0000000001010001), CONST64(0x0000004001010001), + CONST64(0x0000000000000101), CONST64(0x0000004000000101), CONST64(0x0000000001000101), CONST64(0x0000004001000101), + CONST64(0x0000000000010101), CONST64(0x0000004000010101), CONST64(0x0000000001010101), CONST64(0x0000004001010101), + CONST64(0x0100000000000000), CONST64(0x0100004000000000), CONST64(0x0100000001000000), CONST64(0x0100004001000000), + CONST64(0x0100000000010000), CONST64(0x0100004000010000), CONST64(0x0100000001010000), CONST64(0x0100004001010000), + CONST64(0x0100000000000100), CONST64(0x0100004000000100), CONST64(0x0100000001000100), CONST64(0x0100004001000100), + CONST64(0x0100000000010100), CONST64(0x0100004000010100), CONST64(0x0100000001010100), CONST64(0x0100004001010100), + CONST64(0x0100000000000001), CONST64(0x0100004000000001), CONST64(0x0100000001000001), CONST64(0x0100004001000001), + CONST64(0x0100000000010001), CONST64(0x0100004000010001), CONST64(0x0100000001010001), CONST64(0x0100004001010001), + CONST64(0x0100000000000101), CONST64(0x0100004000000101), CONST64(0x0100000001000101), CONST64(0x0100004001000101), + CONST64(0x0100000000010101), CONST64(0x0100004000010101), CONST64(0x0100000001010101), CONST64(0x0100004001010101), + CONST64(0x0001000000000000), CONST64(0x0001004000000000), CONST64(0x0001000001000000), CONST64(0x0001004001000000), + CONST64(0x0001000000010000), CONST64(0x0001004000010000), CONST64(0x0001000001010000), CONST64(0x0001004001010000), + CONST64(0x0001000000000100), CONST64(0x0001004000000100), CONST64(0x0001000001000100), CONST64(0x0001004001000100), + CONST64(0x0001000000010100), CONST64(0x0001004000010100), CONST64(0x0001000001010100), CONST64(0x0001004001010100), + CONST64(0x0001000000000001), CONST64(0x0001004000000001), CONST64(0x0001000001000001), CONST64(0x0001004001000001), + CONST64(0x0001000000010001), CONST64(0x0001004000010001), CONST64(0x0001000001010001), CONST64(0x0001004001010001), + CONST64(0x0001000000000101), CONST64(0x0001004000000101), CONST64(0x0001000001000101), CONST64(0x0001004001000101), + CONST64(0x0001000000010101), CONST64(0x0001004000010101), CONST64(0x0001000001010101), CONST64(0x0001004001010101), + CONST64(0x0101000000000000), CONST64(0x0101004000000000), CONST64(0x0101000001000000), CONST64(0x0101004001000000), + CONST64(0x0101000000010000), CONST64(0x0101004000010000), CONST64(0x0101000001010000), CONST64(0x0101004001010000), + CONST64(0x0101000000000100), CONST64(0x0101004000000100), CONST64(0x0101000001000100), CONST64(0x0101004001000100), + CONST64(0x0101000000010100), CONST64(0x0101004000010100), CONST64(0x0101000001010100), CONST64(0x0101004001010100), + CONST64(0x0101000000000001), CONST64(0x0101004000000001), CONST64(0x0101000001000001), CONST64(0x0101004001000001), + CONST64(0x0101000000010001), CONST64(0x0101004000010001), CONST64(0x0101000001010001), CONST64(0x0101004001010001), + CONST64(0x0101000000000101), CONST64(0x0101004000000101), CONST64(0x0101000001000101), CONST64(0x0101004001000101), + CONST64(0x0101000000010101), CONST64(0x0101004000010101), CONST64(0x0101000001010101), CONST64(0x0101004001010101), + CONST64(0x0000010000000000), CONST64(0x0000014000000000), CONST64(0x0000010001000000), CONST64(0x0000014001000000), + CONST64(0x0000010000010000), CONST64(0x0000014000010000), CONST64(0x0000010001010000), CONST64(0x0000014001010000), + CONST64(0x0000010000000100), CONST64(0x0000014000000100), CONST64(0x0000010001000100), CONST64(0x0000014001000100), + CONST64(0x0000010000010100), CONST64(0x0000014000010100), CONST64(0x0000010001010100), CONST64(0x0000014001010100), + CONST64(0x0000010000000001), CONST64(0x0000014000000001), CONST64(0x0000010001000001), CONST64(0x0000014001000001), + CONST64(0x0000010000010001), CONST64(0x0000014000010001), CONST64(0x0000010001010001), CONST64(0x0000014001010001), + CONST64(0x0000010000000101), CONST64(0x0000014000000101), CONST64(0x0000010001000101), CONST64(0x0000014001000101), + CONST64(0x0000010000010101), CONST64(0x0000014000010101), CONST64(0x0000010001010101), CONST64(0x0000014001010101), + CONST64(0x0100010000000000), CONST64(0x0100014000000000), CONST64(0x0100010001000000), CONST64(0x0100014001000000), + CONST64(0x0100010000010000), CONST64(0x0100014000010000), CONST64(0x0100010001010000), CONST64(0x0100014001010000), + CONST64(0x0100010000000100), CONST64(0x0100014000000100), CONST64(0x0100010001000100), CONST64(0x0100014001000100), + CONST64(0x0100010000010100), CONST64(0x0100014000010100), CONST64(0x0100010001010100), CONST64(0x0100014001010100), + CONST64(0x0100010000000001), CONST64(0x0100014000000001), CONST64(0x0100010001000001), CONST64(0x0100014001000001), + CONST64(0x0100010000010001), CONST64(0x0100014000010001), CONST64(0x0100010001010001), CONST64(0x0100014001010001), + CONST64(0x0100010000000101), CONST64(0x0100014000000101), CONST64(0x0100010001000101), CONST64(0x0100014001000101), + CONST64(0x0100010000010101), CONST64(0x0100014000010101), CONST64(0x0100010001010101), CONST64(0x0100014001010101), + CONST64(0x0001010000000000), CONST64(0x0001014000000000), CONST64(0x0001010001000000), CONST64(0x0001014001000000), + CONST64(0x0001010000010000), CONST64(0x0001014000010000), CONST64(0x0001010001010000), CONST64(0x0001014001010000), + CONST64(0x0001010000000100), CONST64(0x0001014000000100), CONST64(0x0001010001000100), CONST64(0x0001014001000100), + CONST64(0x0001010000010100), CONST64(0x0001014000010100), CONST64(0x0001010001010100), CONST64(0x0001014001010100), + CONST64(0x0001010000000001), CONST64(0x0001014000000001), CONST64(0x0001010001000001), CONST64(0x0001014001000001), + CONST64(0x0001010000010001), CONST64(0x0001014000010001), CONST64(0x0001010001010001), CONST64(0x0001014001010001), + CONST64(0x0001010000000101), CONST64(0x0001014000000101), CONST64(0x0001010001000101), CONST64(0x0001014001000101), + CONST64(0x0001010000010101), CONST64(0x0001014000010101), CONST64(0x0001010001010101), CONST64(0x0001014001010101), + CONST64(0x0101010000000000), CONST64(0x0101014000000000), CONST64(0x0101010001000000), CONST64(0x0101014001000000), + CONST64(0x0101010000010000), CONST64(0x0101014000010000), CONST64(0x0101010001010000), CONST64(0x0101014001010000), + CONST64(0x0101010000000100), CONST64(0x0101014000000100), CONST64(0x0101010001000100), CONST64(0x0101014001000100), + CONST64(0x0101010000010100), CONST64(0x0101014000010100), CONST64(0x0101010001010100), CONST64(0x0101014001010100), + CONST64(0x0101010000000001), CONST64(0x0101014000000001), CONST64(0x0101010001000001), CONST64(0x0101014001000001), + CONST64(0x0101010000010001), CONST64(0x0101014000010001), CONST64(0x0101010001010001), CONST64(0x0101014001010001), + CONST64(0x0101010000000101), CONST64(0x0101014000000101), CONST64(0x0101010001000101), CONST64(0x0101014001000101), + CONST64(0x0101010000010101), CONST64(0x0101014000010101), CONST64(0x0101010001010101), CONST64(0x0101014001010101) + }, +{ CONST64(0x0000000000000000), CONST64(0x0000000100000000), CONST64(0x0000000004000000), CONST64(0x0000000104000000), + CONST64(0x0000000000040000), CONST64(0x0000000100040000), CONST64(0x0000000004040000), CONST64(0x0000000104040000), + CONST64(0x0000000000000400), CONST64(0x0000000100000400), CONST64(0x0000000004000400), CONST64(0x0000000104000400), + CONST64(0x0000000000040400), CONST64(0x0000000100040400), CONST64(0x0000000004040400), CONST64(0x0000000104040400), + CONST64(0x0000000000000004), CONST64(0x0000000100000004), CONST64(0x0000000004000004), CONST64(0x0000000104000004), + CONST64(0x0000000000040004), CONST64(0x0000000100040004), CONST64(0x0000000004040004), CONST64(0x0000000104040004), + CONST64(0x0000000000000404), CONST64(0x0000000100000404), CONST64(0x0000000004000404), CONST64(0x0000000104000404), + CONST64(0x0000000000040404), CONST64(0x0000000100040404), CONST64(0x0000000004040404), CONST64(0x0000000104040404), + CONST64(0x0400000000000000), CONST64(0x0400000100000000), CONST64(0x0400000004000000), CONST64(0x0400000104000000), + CONST64(0x0400000000040000), CONST64(0x0400000100040000), CONST64(0x0400000004040000), CONST64(0x0400000104040000), + CONST64(0x0400000000000400), CONST64(0x0400000100000400), CONST64(0x0400000004000400), CONST64(0x0400000104000400), + CONST64(0x0400000000040400), CONST64(0x0400000100040400), CONST64(0x0400000004040400), CONST64(0x0400000104040400), + CONST64(0x0400000000000004), CONST64(0x0400000100000004), CONST64(0x0400000004000004), CONST64(0x0400000104000004), + CONST64(0x0400000000040004), CONST64(0x0400000100040004), CONST64(0x0400000004040004), CONST64(0x0400000104040004), + CONST64(0x0400000000000404), CONST64(0x0400000100000404), CONST64(0x0400000004000404), CONST64(0x0400000104000404), + CONST64(0x0400000000040404), CONST64(0x0400000100040404), CONST64(0x0400000004040404), CONST64(0x0400000104040404), + CONST64(0x0004000000000000), CONST64(0x0004000100000000), CONST64(0x0004000004000000), CONST64(0x0004000104000000), + CONST64(0x0004000000040000), CONST64(0x0004000100040000), CONST64(0x0004000004040000), CONST64(0x0004000104040000), + CONST64(0x0004000000000400), CONST64(0x0004000100000400), CONST64(0x0004000004000400), CONST64(0x0004000104000400), + CONST64(0x0004000000040400), CONST64(0x0004000100040400), CONST64(0x0004000004040400), CONST64(0x0004000104040400), + CONST64(0x0004000000000004), CONST64(0x0004000100000004), CONST64(0x0004000004000004), CONST64(0x0004000104000004), + CONST64(0x0004000000040004), CONST64(0x0004000100040004), CONST64(0x0004000004040004), CONST64(0x0004000104040004), + CONST64(0x0004000000000404), CONST64(0x0004000100000404), CONST64(0x0004000004000404), CONST64(0x0004000104000404), + CONST64(0x0004000000040404), CONST64(0x0004000100040404), CONST64(0x0004000004040404), CONST64(0x0004000104040404), + CONST64(0x0404000000000000), CONST64(0x0404000100000000), CONST64(0x0404000004000000), CONST64(0x0404000104000000), + CONST64(0x0404000000040000), CONST64(0x0404000100040000), CONST64(0x0404000004040000), CONST64(0x0404000104040000), + CONST64(0x0404000000000400), CONST64(0x0404000100000400), CONST64(0x0404000004000400), CONST64(0x0404000104000400), + CONST64(0x0404000000040400), CONST64(0x0404000100040400), CONST64(0x0404000004040400), CONST64(0x0404000104040400), + CONST64(0x0404000000000004), CONST64(0x0404000100000004), CONST64(0x0404000004000004), CONST64(0x0404000104000004), + CONST64(0x0404000000040004), CONST64(0x0404000100040004), CONST64(0x0404000004040004), CONST64(0x0404000104040004), + CONST64(0x0404000000000404), CONST64(0x0404000100000404), CONST64(0x0404000004000404), CONST64(0x0404000104000404), + CONST64(0x0404000000040404), CONST64(0x0404000100040404), CONST64(0x0404000004040404), CONST64(0x0404000104040404), + CONST64(0x0000040000000000), CONST64(0x0000040100000000), CONST64(0x0000040004000000), CONST64(0x0000040104000000), + CONST64(0x0000040000040000), CONST64(0x0000040100040000), CONST64(0x0000040004040000), CONST64(0x0000040104040000), + CONST64(0x0000040000000400), CONST64(0x0000040100000400), CONST64(0x0000040004000400), CONST64(0x0000040104000400), + CONST64(0x0000040000040400), CONST64(0x0000040100040400), CONST64(0x0000040004040400), CONST64(0x0000040104040400), + CONST64(0x0000040000000004), CONST64(0x0000040100000004), CONST64(0x0000040004000004), CONST64(0x0000040104000004), + CONST64(0x0000040000040004), CONST64(0x0000040100040004), CONST64(0x0000040004040004), CONST64(0x0000040104040004), + CONST64(0x0000040000000404), CONST64(0x0000040100000404), CONST64(0x0000040004000404), CONST64(0x0000040104000404), + CONST64(0x0000040000040404), CONST64(0x0000040100040404), CONST64(0x0000040004040404), CONST64(0x0000040104040404), + CONST64(0x0400040000000000), CONST64(0x0400040100000000), CONST64(0x0400040004000000), CONST64(0x0400040104000000), + CONST64(0x0400040000040000), CONST64(0x0400040100040000), CONST64(0x0400040004040000), CONST64(0x0400040104040000), + CONST64(0x0400040000000400), CONST64(0x0400040100000400), CONST64(0x0400040004000400), CONST64(0x0400040104000400), + CONST64(0x0400040000040400), CONST64(0x0400040100040400), CONST64(0x0400040004040400), CONST64(0x0400040104040400), + CONST64(0x0400040000000004), CONST64(0x0400040100000004), CONST64(0x0400040004000004), CONST64(0x0400040104000004), + CONST64(0x0400040000040004), CONST64(0x0400040100040004), CONST64(0x0400040004040004), CONST64(0x0400040104040004), + CONST64(0x0400040000000404), CONST64(0x0400040100000404), CONST64(0x0400040004000404), CONST64(0x0400040104000404), + CONST64(0x0400040000040404), CONST64(0x0400040100040404), CONST64(0x0400040004040404), CONST64(0x0400040104040404), + CONST64(0x0004040000000000), CONST64(0x0004040100000000), CONST64(0x0004040004000000), CONST64(0x0004040104000000), + CONST64(0x0004040000040000), CONST64(0x0004040100040000), CONST64(0x0004040004040000), CONST64(0x0004040104040000), + CONST64(0x0004040000000400), CONST64(0x0004040100000400), CONST64(0x0004040004000400), CONST64(0x0004040104000400), + CONST64(0x0004040000040400), CONST64(0x0004040100040400), CONST64(0x0004040004040400), CONST64(0x0004040104040400), + CONST64(0x0004040000000004), CONST64(0x0004040100000004), CONST64(0x0004040004000004), CONST64(0x0004040104000004), + CONST64(0x0004040000040004), CONST64(0x0004040100040004), CONST64(0x0004040004040004), CONST64(0x0004040104040004), + CONST64(0x0004040000000404), CONST64(0x0004040100000404), CONST64(0x0004040004000404), CONST64(0x0004040104000404), + CONST64(0x0004040000040404), CONST64(0x0004040100040404), CONST64(0x0004040004040404), CONST64(0x0004040104040404), + CONST64(0x0404040000000000), CONST64(0x0404040100000000), CONST64(0x0404040004000000), CONST64(0x0404040104000000), + CONST64(0x0404040000040000), CONST64(0x0404040100040000), CONST64(0x0404040004040000), CONST64(0x0404040104040000), + CONST64(0x0404040000000400), CONST64(0x0404040100000400), CONST64(0x0404040004000400), CONST64(0x0404040104000400), + CONST64(0x0404040000040400), CONST64(0x0404040100040400), CONST64(0x0404040004040400), CONST64(0x0404040104040400), + CONST64(0x0404040000000004), CONST64(0x0404040100000004), CONST64(0x0404040004000004), CONST64(0x0404040104000004), + CONST64(0x0404040000040004), CONST64(0x0404040100040004), CONST64(0x0404040004040004), CONST64(0x0404040104040004), + CONST64(0x0404040000000404), CONST64(0x0404040100000404), CONST64(0x0404040004000404), CONST64(0x0404040104000404), + CONST64(0x0404040000040404), CONST64(0x0404040100040404), CONST64(0x0404040004040404), CONST64(0x0404040104040404) + }, +{ CONST64(0x0000000000000000), CONST64(0x0000000400000000), CONST64(0x0000000010000000), CONST64(0x0000000410000000), + CONST64(0x0000000000100000), CONST64(0x0000000400100000), CONST64(0x0000000010100000), CONST64(0x0000000410100000), + CONST64(0x0000000000001000), CONST64(0x0000000400001000), CONST64(0x0000000010001000), CONST64(0x0000000410001000), + CONST64(0x0000000000101000), CONST64(0x0000000400101000), CONST64(0x0000000010101000), CONST64(0x0000000410101000), + CONST64(0x0000000000000010), CONST64(0x0000000400000010), CONST64(0x0000000010000010), CONST64(0x0000000410000010), + CONST64(0x0000000000100010), CONST64(0x0000000400100010), CONST64(0x0000000010100010), CONST64(0x0000000410100010), + CONST64(0x0000000000001010), CONST64(0x0000000400001010), CONST64(0x0000000010001010), CONST64(0x0000000410001010), + CONST64(0x0000000000101010), CONST64(0x0000000400101010), CONST64(0x0000000010101010), CONST64(0x0000000410101010), + CONST64(0x1000000000000000), CONST64(0x1000000400000000), CONST64(0x1000000010000000), CONST64(0x1000000410000000), + CONST64(0x1000000000100000), CONST64(0x1000000400100000), CONST64(0x1000000010100000), CONST64(0x1000000410100000), + CONST64(0x1000000000001000), CONST64(0x1000000400001000), CONST64(0x1000000010001000), CONST64(0x1000000410001000), + CONST64(0x1000000000101000), CONST64(0x1000000400101000), CONST64(0x1000000010101000), CONST64(0x1000000410101000), + CONST64(0x1000000000000010), CONST64(0x1000000400000010), CONST64(0x1000000010000010), CONST64(0x1000000410000010), + CONST64(0x1000000000100010), CONST64(0x1000000400100010), CONST64(0x1000000010100010), CONST64(0x1000000410100010), + CONST64(0x1000000000001010), CONST64(0x1000000400001010), CONST64(0x1000000010001010), CONST64(0x1000000410001010), + CONST64(0x1000000000101010), CONST64(0x1000000400101010), CONST64(0x1000000010101010), CONST64(0x1000000410101010), + CONST64(0x0010000000000000), CONST64(0x0010000400000000), CONST64(0x0010000010000000), CONST64(0x0010000410000000), + CONST64(0x0010000000100000), CONST64(0x0010000400100000), CONST64(0x0010000010100000), CONST64(0x0010000410100000), + CONST64(0x0010000000001000), CONST64(0x0010000400001000), CONST64(0x0010000010001000), CONST64(0x0010000410001000), + CONST64(0x0010000000101000), CONST64(0x0010000400101000), CONST64(0x0010000010101000), CONST64(0x0010000410101000), + CONST64(0x0010000000000010), CONST64(0x0010000400000010), CONST64(0x0010000010000010), CONST64(0x0010000410000010), + CONST64(0x0010000000100010), CONST64(0x0010000400100010), CONST64(0x0010000010100010), CONST64(0x0010000410100010), + CONST64(0x0010000000001010), CONST64(0x0010000400001010), CONST64(0x0010000010001010), CONST64(0x0010000410001010), + CONST64(0x0010000000101010), CONST64(0x0010000400101010), CONST64(0x0010000010101010), CONST64(0x0010000410101010), + CONST64(0x1010000000000000), CONST64(0x1010000400000000), CONST64(0x1010000010000000), CONST64(0x1010000410000000), + CONST64(0x1010000000100000), CONST64(0x1010000400100000), CONST64(0x1010000010100000), CONST64(0x1010000410100000), + CONST64(0x1010000000001000), CONST64(0x1010000400001000), CONST64(0x1010000010001000), CONST64(0x1010000410001000), + CONST64(0x1010000000101000), CONST64(0x1010000400101000), CONST64(0x1010000010101000), CONST64(0x1010000410101000), + CONST64(0x1010000000000010), CONST64(0x1010000400000010), CONST64(0x1010000010000010), CONST64(0x1010000410000010), + CONST64(0x1010000000100010), CONST64(0x1010000400100010), CONST64(0x1010000010100010), CONST64(0x1010000410100010), + CONST64(0x1010000000001010), CONST64(0x1010000400001010), CONST64(0x1010000010001010), CONST64(0x1010000410001010), + CONST64(0x1010000000101010), CONST64(0x1010000400101010), CONST64(0x1010000010101010), CONST64(0x1010000410101010), + CONST64(0x0000100000000000), CONST64(0x0000100400000000), CONST64(0x0000100010000000), CONST64(0x0000100410000000), + CONST64(0x0000100000100000), CONST64(0x0000100400100000), CONST64(0x0000100010100000), CONST64(0x0000100410100000), + CONST64(0x0000100000001000), CONST64(0x0000100400001000), CONST64(0x0000100010001000), CONST64(0x0000100410001000), + CONST64(0x0000100000101000), CONST64(0x0000100400101000), CONST64(0x0000100010101000), CONST64(0x0000100410101000), + CONST64(0x0000100000000010), CONST64(0x0000100400000010), CONST64(0x0000100010000010), CONST64(0x0000100410000010), + CONST64(0x0000100000100010), CONST64(0x0000100400100010), CONST64(0x0000100010100010), CONST64(0x0000100410100010), + CONST64(0x0000100000001010), CONST64(0x0000100400001010), CONST64(0x0000100010001010), CONST64(0x0000100410001010), + CONST64(0x0000100000101010), CONST64(0x0000100400101010), CONST64(0x0000100010101010), CONST64(0x0000100410101010), + CONST64(0x1000100000000000), CONST64(0x1000100400000000), CONST64(0x1000100010000000), CONST64(0x1000100410000000), + CONST64(0x1000100000100000), CONST64(0x1000100400100000), CONST64(0x1000100010100000), CONST64(0x1000100410100000), + CONST64(0x1000100000001000), CONST64(0x1000100400001000), CONST64(0x1000100010001000), CONST64(0x1000100410001000), + CONST64(0x1000100000101000), CONST64(0x1000100400101000), CONST64(0x1000100010101000), CONST64(0x1000100410101000), + CONST64(0x1000100000000010), CONST64(0x1000100400000010), CONST64(0x1000100010000010), CONST64(0x1000100410000010), + CONST64(0x1000100000100010), CONST64(0x1000100400100010), CONST64(0x1000100010100010), CONST64(0x1000100410100010), + CONST64(0x1000100000001010), CONST64(0x1000100400001010), CONST64(0x1000100010001010), CONST64(0x1000100410001010), + CONST64(0x1000100000101010), CONST64(0x1000100400101010), CONST64(0x1000100010101010), CONST64(0x1000100410101010), + CONST64(0x0010100000000000), CONST64(0x0010100400000000), CONST64(0x0010100010000000), CONST64(0x0010100410000000), + CONST64(0x0010100000100000), CONST64(0x0010100400100000), CONST64(0x0010100010100000), CONST64(0x0010100410100000), + CONST64(0x0010100000001000), CONST64(0x0010100400001000), CONST64(0x0010100010001000), CONST64(0x0010100410001000), + CONST64(0x0010100000101000), CONST64(0x0010100400101000), CONST64(0x0010100010101000), CONST64(0x0010100410101000), + CONST64(0x0010100000000010), CONST64(0x0010100400000010), CONST64(0x0010100010000010), CONST64(0x0010100410000010), + CONST64(0x0010100000100010), CONST64(0x0010100400100010), CONST64(0x0010100010100010), CONST64(0x0010100410100010), + CONST64(0x0010100000001010), CONST64(0x0010100400001010), CONST64(0x0010100010001010), CONST64(0x0010100410001010), + CONST64(0x0010100000101010), CONST64(0x0010100400101010), CONST64(0x0010100010101010), CONST64(0x0010100410101010), + CONST64(0x1010100000000000), CONST64(0x1010100400000000), CONST64(0x1010100010000000), CONST64(0x1010100410000000), + CONST64(0x1010100000100000), CONST64(0x1010100400100000), CONST64(0x1010100010100000), CONST64(0x1010100410100000), + CONST64(0x1010100000001000), CONST64(0x1010100400001000), CONST64(0x1010100010001000), CONST64(0x1010100410001000), + CONST64(0x1010100000101000), CONST64(0x1010100400101000), CONST64(0x1010100010101000), CONST64(0x1010100410101000), + CONST64(0x1010100000000010), CONST64(0x1010100400000010), CONST64(0x1010100010000010), CONST64(0x1010100410000010), + CONST64(0x1010100000100010), CONST64(0x1010100400100010), CONST64(0x1010100010100010), CONST64(0x1010100410100010), + CONST64(0x1010100000001010), CONST64(0x1010100400001010), CONST64(0x1010100010001010), CONST64(0x1010100410001010), + CONST64(0x1010100000101010), CONST64(0x1010100400101010), CONST64(0x1010100010101010), CONST64(0x1010100410101010) + }, +{ CONST64(0x0000000000000000), CONST64(0x0000001000000000), CONST64(0x0000000040000000), CONST64(0x0000001040000000), + CONST64(0x0000000000400000), CONST64(0x0000001000400000), CONST64(0x0000000040400000), CONST64(0x0000001040400000), + CONST64(0x0000000000004000), CONST64(0x0000001000004000), CONST64(0x0000000040004000), CONST64(0x0000001040004000), + CONST64(0x0000000000404000), CONST64(0x0000001000404000), CONST64(0x0000000040404000), CONST64(0x0000001040404000), + CONST64(0x0000000000000040), CONST64(0x0000001000000040), CONST64(0x0000000040000040), CONST64(0x0000001040000040), + CONST64(0x0000000000400040), CONST64(0x0000001000400040), CONST64(0x0000000040400040), CONST64(0x0000001040400040), + CONST64(0x0000000000004040), CONST64(0x0000001000004040), CONST64(0x0000000040004040), CONST64(0x0000001040004040), + CONST64(0x0000000000404040), CONST64(0x0000001000404040), CONST64(0x0000000040404040), CONST64(0x0000001040404040), + CONST64(0x4000000000000000), CONST64(0x4000001000000000), CONST64(0x4000000040000000), CONST64(0x4000001040000000), + CONST64(0x4000000000400000), CONST64(0x4000001000400000), CONST64(0x4000000040400000), CONST64(0x4000001040400000), + CONST64(0x4000000000004000), CONST64(0x4000001000004000), CONST64(0x4000000040004000), CONST64(0x4000001040004000), + CONST64(0x4000000000404000), CONST64(0x4000001000404000), CONST64(0x4000000040404000), CONST64(0x4000001040404000), + CONST64(0x4000000000000040), CONST64(0x4000001000000040), CONST64(0x4000000040000040), CONST64(0x4000001040000040), + CONST64(0x4000000000400040), CONST64(0x4000001000400040), CONST64(0x4000000040400040), CONST64(0x4000001040400040), + CONST64(0x4000000000004040), CONST64(0x4000001000004040), CONST64(0x4000000040004040), CONST64(0x4000001040004040), + CONST64(0x4000000000404040), CONST64(0x4000001000404040), CONST64(0x4000000040404040), CONST64(0x4000001040404040), + CONST64(0x0040000000000000), CONST64(0x0040001000000000), CONST64(0x0040000040000000), CONST64(0x0040001040000000), + CONST64(0x0040000000400000), CONST64(0x0040001000400000), CONST64(0x0040000040400000), CONST64(0x0040001040400000), + CONST64(0x0040000000004000), CONST64(0x0040001000004000), CONST64(0x0040000040004000), CONST64(0x0040001040004000), + CONST64(0x0040000000404000), CONST64(0x0040001000404000), CONST64(0x0040000040404000), CONST64(0x0040001040404000), + CONST64(0x0040000000000040), CONST64(0x0040001000000040), CONST64(0x0040000040000040), CONST64(0x0040001040000040), + CONST64(0x0040000000400040), CONST64(0x0040001000400040), CONST64(0x0040000040400040), CONST64(0x0040001040400040), + CONST64(0x0040000000004040), CONST64(0x0040001000004040), CONST64(0x0040000040004040), CONST64(0x0040001040004040), + CONST64(0x0040000000404040), CONST64(0x0040001000404040), CONST64(0x0040000040404040), CONST64(0x0040001040404040), + CONST64(0x4040000000000000), CONST64(0x4040001000000000), CONST64(0x4040000040000000), CONST64(0x4040001040000000), + CONST64(0x4040000000400000), CONST64(0x4040001000400000), CONST64(0x4040000040400000), CONST64(0x4040001040400000), + CONST64(0x4040000000004000), CONST64(0x4040001000004000), CONST64(0x4040000040004000), CONST64(0x4040001040004000), + CONST64(0x4040000000404000), CONST64(0x4040001000404000), CONST64(0x4040000040404000), CONST64(0x4040001040404000), + CONST64(0x4040000000000040), CONST64(0x4040001000000040), CONST64(0x4040000040000040), CONST64(0x4040001040000040), + CONST64(0x4040000000400040), CONST64(0x4040001000400040), CONST64(0x4040000040400040), CONST64(0x4040001040400040), + CONST64(0x4040000000004040), CONST64(0x4040001000004040), CONST64(0x4040000040004040), CONST64(0x4040001040004040), + CONST64(0x4040000000404040), CONST64(0x4040001000404040), CONST64(0x4040000040404040), CONST64(0x4040001040404040), + CONST64(0x0000400000000000), CONST64(0x0000401000000000), CONST64(0x0000400040000000), CONST64(0x0000401040000000), + CONST64(0x0000400000400000), CONST64(0x0000401000400000), CONST64(0x0000400040400000), CONST64(0x0000401040400000), + CONST64(0x0000400000004000), CONST64(0x0000401000004000), CONST64(0x0000400040004000), CONST64(0x0000401040004000), + CONST64(0x0000400000404000), CONST64(0x0000401000404000), CONST64(0x0000400040404000), CONST64(0x0000401040404000), + CONST64(0x0000400000000040), CONST64(0x0000401000000040), CONST64(0x0000400040000040), CONST64(0x0000401040000040), + CONST64(0x0000400000400040), CONST64(0x0000401000400040), CONST64(0x0000400040400040), CONST64(0x0000401040400040), + CONST64(0x0000400000004040), CONST64(0x0000401000004040), CONST64(0x0000400040004040), CONST64(0x0000401040004040), + CONST64(0x0000400000404040), CONST64(0x0000401000404040), CONST64(0x0000400040404040), CONST64(0x0000401040404040), + CONST64(0x4000400000000000), CONST64(0x4000401000000000), CONST64(0x4000400040000000), CONST64(0x4000401040000000), + CONST64(0x4000400000400000), CONST64(0x4000401000400000), CONST64(0x4000400040400000), CONST64(0x4000401040400000), + CONST64(0x4000400000004000), CONST64(0x4000401000004000), CONST64(0x4000400040004000), CONST64(0x4000401040004000), + CONST64(0x4000400000404000), CONST64(0x4000401000404000), CONST64(0x4000400040404000), CONST64(0x4000401040404000), + CONST64(0x4000400000000040), CONST64(0x4000401000000040), CONST64(0x4000400040000040), CONST64(0x4000401040000040), + CONST64(0x4000400000400040), CONST64(0x4000401000400040), CONST64(0x4000400040400040), CONST64(0x4000401040400040), + CONST64(0x4000400000004040), CONST64(0x4000401000004040), CONST64(0x4000400040004040), CONST64(0x4000401040004040), + CONST64(0x4000400000404040), CONST64(0x4000401000404040), CONST64(0x4000400040404040), CONST64(0x4000401040404040), + CONST64(0x0040400000000000), CONST64(0x0040401000000000), CONST64(0x0040400040000000), CONST64(0x0040401040000000), + CONST64(0x0040400000400000), CONST64(0x0040401000400000), CONST64(0x0040400040400000), CONST64(0x0040401040400000), + CONST64(0x0040400000004000), CONST64(0x0040401000004000), CONST64(0x0040400040004000), CONST64(0x0040401040004000), + CONST64(0x0040400000404000), CONST64(0x0040401000404000), CONST64(0x0040400040404000), CONST64(0x0040401040404000), + CONST64(0x0040400000000040), CONST64(0x0040401000000040), CONST64(0x0040400040000040), CONST64(0x0040401040000040), + CONST64(0x0040400000400040), CONST64(0x0040401000400040), CONST64(0x0040400040400040), CONST64(0x0040401040400040), + CONST64(0x0040400000004040), CONST64(0x0040401000004040), CONST64(0x0040400040004040), CONST64(0x0040401040004040), + CONST64(0x0040400000404040), CONST64(0x0040401000404040), CONST64(0x0040400040404040), CONST64(0x0040401040404040), + CONST64(0x4040400000000000), CONST64(0x4040401000000000), CONST64(0x4040400040000000), CONST64(0x4040401040000000), + CONST64(0x4040400000400000), CONST64(0x4040401000400000), CONST64(0x4040400040400000), CONST64(0x4040401040400000), + CONST64(0x4040400000004000), CONST64(0x4040401000004000), CONST64(0x4040400040004000), CONST64(0x4040401040004000), + CONST64(0x4040400000404000), CONST64(0x4040401000404000), CONST64(0x4040400040404000), CONST64(0x4040401040404000), + CONST64(0x4040400000000040), CONST64(0x4040401000000040), CONST64(0x4040400040000040), CONST64(0x4040401040000040), + CONST64(0x4040400000400040), CONST64(0x4040401000400040), CONST64(0x4040400040400040), CONST64(0x4040401040400040), + CONST64(0x4040400000004040), CONST64(0x4040401000004040), CONST64(0x4040400040004040), CONST64(0x4040401040004040), + CONST64(0x4040400000404040), CONST64(0x4040401000404040), CONST64(0x4040400040404040), CONST64(0x4040401040404040) + }}; + +#endif + + +static void cookey(const ulong32 *raw1, ulong32 *keyout); + +#ifdef LTC_CLEAN_STACK +static void _deskey(const unsigned char *key, short edf, ulong32 *keyout) +#else +static void deskey(const unsigned char *key, short edf, ulong32 *keyout) +#endif +{ + ulong32 i, j, l, m, n, kn[32]; + unsigned char pc1m[56], pcr[56]; + + for (j=0; j < 56; j++) { + l = (ulong32)pc1[j]; + m = l & 7; + pc1m[j] = (unsigned char)((key[l >> 3U] & bytebit[m]) == bytebit[m] ? 1 : 0); + } + + for (i=0; i < 16; i++) { + if (edf == DE1) { + m = (15 - i) << 1; + } else { + m = i << 1; + } + n = m + 1; + kn[m] = kn[n] = 0L; + for (j=0; j < 28; j++) { + l = j + (ulong32)totrot[i]; + if (l < 28) { + pcr[j] = pc1m[l]; + } else { + pcr[j] = pc1m[l - 28]; + } + } + for (/*j = 28*/; j < 56; j++) { + l = j + (ulong32)totrot[i]; + if (l < 56) { + pcr[j] = pc1m[l]; + } else { + pcr[j] = pc1m[l - 28]; + } + } + for (j=0; j < 24; j++) { + if ((int)pcr[(int)pc2[j]] != 0) { + kn[m] |= bigbyte[j]; + } + if ((int)pcr[(int)pc2[j+24]] != 0) { + kn[n] |= bigbyte[j]; + } + } + } + + cookey(kn, keyout); +} + +#ifdef LTC_CLEAN_STACK +static void deskey(const unsigned char *key, short edf, ulong32 *keyout) +{ + _deskey(key, edf, keyout); + burn_stack(sizeof(int)*5 + sizeof(ulong32)*32 + sizeof(unsigned char)*112); +} +#endif + +#ifdef LTC_CLEAN_STACK +static void _cookey(const ulong32 *raw1, ulong32 *keyout) +#else +static void cookey(const ulong32 *raw1, ulong32 *keyout) +#endif +{ + ulong32 *cook; + const ulong32 *raw0; + ulong32 dough[32]; + int i; + + cook = dough; + for(i=0; i < 16; i++, raw1++) + { + raw0 = raw1++; + *cook = (*raw0 & 0x00fc0000L) << 6; + *cook |= (*raw0 & 0x00000fc0L) << 10; + *cook |= (*raw1 & 0x00fc0000L) >> 10; + *cook++ |= (*raw1 & 0x00000fc0L) >> 6; + *cook = (*raw0 & 0x0003f000L) << 12; + *cook |= (*raw0 & 0x0000003fL) << 16; + *cook |= (*raw1 & 0x0003f000L) >> 4; + *cook++ |= (*raw1 & 0x0000003fL); + } + + XMEMCPY(keyout, dough, sizeof dough); +} + +#ifdef LTC_CLEAN_STACK +static void cookey(const ulong32 *raw1, ulong32 *keyout) +{ + _cookey(raw1, keyout); + burn_stack(sizeof(ulong32 *) * 2 + sizeof(ulong32)*32 + sizeof(int)); +} +#endif + +#ifndef LTC_CLEAN_STACK +static void desfunc(ulong32 *block, const ulong32 *keys) +#else +static void _desfunc(ulong32 *block, const ulong32 *keys) +#endif +{ + ulong32 work, right, leftt; + int cur_round; + + leftt = block[0]; + right = block[1]; + +#ifdef LTC_SMALL_CODE + work = ((leftt >> 4) ^ right) & 0x0f0f0f0fL; + right ^= work; + leftt ^= (work << 4); + + work = ((leftt >> 16) ^ right) & 0x0000ffffL; + right ^= work; + leftt ^= (work << 16); + + work = ((right >> 2) ^ leftt) & 0x33333333L; + leftt ^= work; + right ^= (work << 2); + + work = ((right >> 8) ^ leftt) & 0x00ff00ffL; + leftt ^= work; + right ^= (work << 8); + + right = ROLc(right, 1); + work = (leftt ^ right) & 0xaaaaaaaaL; + + leftt ^= work; + right ^= work; + leftt = ROLc(leftt, 1); +#else + { + ulong64 tmp; + tmp = des_ip[0][byte(leftt, 0)] ^ + des_ip[1][byte(leftt, 1)] ^ + des_ip[2][byte(leftt, 2)] ^ + des_ip[3][byte(leftt, 3)] ^ + des_ip[4][byte(right, 0)] ^ + des_ip[5][byte(right, 1)] ^ + des_ip[6][byte(right, 2)] ^ + des_ip[7][byte(right, 3)]; + leftt = (ulong32)(tmp >> 32); + right = (ulong32)(tmp & 0xFFFFFFFFUL); + } +#endif + + for (cur_round = 0; cur_round < 8; cur_round++) { + work = RORc(right, 4) ^ *keys++; + leftt ^= SP7[work & 0x3fL] + ^ SP5[(work >> 8) & 0x3fL] + ^ SP3[(work >> 16) & 0x3fL] + ^ SP1[(work >> 24) & 0x3fL]; + work = right ^ *keys++; + leftt ^= SP8[ work & 0x3fL] + ^ SP6[(work >> 8) & 0x3fL] + ^ SP4[(work >> 16) & 0x3fL] + ^ SP2[(work >> 24) & 0x3fL]; + + work = RORc(leftt, 4) ^ *keys++; + right ^= SP7[ work & 0x3fL] + ^ SP5[(work >> 8) & 0x3fL] + ^ SP3[(work >> 16) & 0x3fL] + ^ SP1[(work >> 24) & 0x3fL]; + work = leftt ^ *keys++; + right ^= SP8[ work & 0x3fL] + ^ SP6[(work >> 8) & 0x3fL] + ^ SP4[(work >> 16) & 0x3fL] + ^ SP2[(work >> 24) & 0x3fL]; + } + +#ifdef LTC_SMALL_CODE + right = RORc(right, 1); + work = (leftt ^ right) & 0xaaaaaaaaL; + leftt ^= work; + right ^= work; + leftt = RORc(leftt, 1); + work = ((leftt >> 8) ^ right) & 0x00ff00ffL; + right ^= work; + leftt ^= (work << 8); + /* -- */ + work = ((leftt >> 2) ^ right) & 0x33333333L; + right ^= work; + leftt ^= (work << 2); + work = ((right >> 16) ^ leftt) & 0x0000ffffL; + leftt ^= work; + right ^= (work << 16); + work = ((right >> 4) ^ leftt) & 0x0f0f0f0fL; + leftt ^= work; + right ^= (work << 4); +#else + { + ulong64 tmp; + tmp = des_fp[0][byte(leftt, 0)] ^ + des_fp[1][byte(leftt, 1)] ^ + des_fp[2][byte(leftt, 2)] ^ + des_fp[3][byte(leftt, 3)] ^ + des_fp[4][byte(right, 0)] ^ + des_fp[5][byte(right, 1)] ^ + des_fp[6][byte(right, 2)] ^ + des_fp[7][byte(right, 3)]; + leftt = (ulong32)(tmp >> 32); + right = (ulong32)(tmp & 0xFFFFFFFFUL); + } +#endif + + block[0] = right; + block[1] = leftt; +} + +#ifdef LTC_CLEAN_STACK +static void desfunc(ulong32 *block, const ulong32 *keys) +{ + _desfunc(block, keys); + burn_stack(sizeof(ulong32) * 4 + sizeof(int)); +} +#endif + +#if 0 + /** + Initialize the DES block cipher + @param key The symmetric key you wish to pass + @param keylen The key length in bytes + @param num_rounds The number of rounds desired (0 for default) + @param skey The key in as scheduled by this function. + @return CRYPT_OK if successful + */ +int des_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey) +{ + LTC_ARGCHK(key != NULL); + LTC_ARGCHK(skey != NULL); + + if (num_rounds != 0 && num_rounds != 16) { + return CRYPT_INVALID_ROUNDS; + } + + if (keylen != 8) { + return CRYPT_INVALID_KEYSIZE; + } + + deskey(key, EN0, skey->des.ek); + deskey(key, DE1, skey->des.dk); + + return CRYPT_OK; +} +#endif + + /** + Initialize the 3DES-EDE block cipher + @param key The symmetric key you wish to pass + @param keylen The key length in bytes + @param num_rounds The number of rounds desired (0 for default) + @param skey The key in as scheduled by this function. + @return CRYPT_OK if successful + */ +int des3_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey) +{ + LTC_ARGCHK(key != NULL); + LTC_ARGCHK(skey != NULL); + + if(num_rounds != 0 && num_rounds != 16) { + return CRYPT_INVALID_ROUNDS; + } + + if (keylen != 24) { + return CRYPT_INVALID_KEYSIZE; + } + + deskey(key, EN0, skey->des3.ek[0]); + deskey(key+8, DE1, skey->des3.ek[1]); + deskey(key+16, EN0, skey->des3.ek[2]); + + deskey(key, DE1, skey->des3.dk[2]); + deskey(key+8, EN0, skey->des3.dk[1]); + deskey(key+16, DE1, skey->des3.dk[0]); + + return CRYPT_OK; +} + +#if 0 +/** + Encrypts a block of text with DES + @param pt The input plaintext (8 bytes) + @param ct The output ciphertext (8 bytes) + @param skey The key as scheduled + @return CRYPT_OK if successful +*/ +int des_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key *skey) +{ + ulong32 work[2]; + LTC_ARGCHK(pt != NULL); + LTC_ARGCHK(ct != NULL); + LTC_ARGCHK(skey != NULL); + LOAD32H(work[0], pt+0); + LOAD32H(work[1], pt+4); + desfunc(work, skey->des.ek); + STORE32H(work[0],ct+0); + STORE32H(work[1],ct+4); + return CRYPT_OK; +} + +/** + Decrypts a block of text with DES + @param ct The input ciphertext (8 bytes) + @param pt The output plaintext (8 bytes) + @param skey The key as scheduled + @return CRYPT_OK if successful +*/ +int des_ecb_decrypt(const unsigned char *ct, unsigned char *pt, symmetric_key *skey) +{ + ulong32 work[2]; + LTC_ARGCHK(pt != NULL); + LTC_ARGCHK(ct != NULL); + LTC_ARGCHK(skey != NULL); + LOAD32H(work[0], ct+0); + LOAD32H(work[1], ct+4); + desfunc(work, skey->des.dk); + STORE32H(work[0],pt+0); + STORE32H(work[1],pt+4); + return CRYPT_OK; +} +#endif + +/** + Encrypts a block of text with 3DES-EDE + @param pt The input plaintext (8 bytes) + @param ct The output ciphertext (8 bytes) + @param skey The key as scheduled + @return CRYPT_OK if successful +*/ +int des3_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key *skey) +{ + ulong32 work[2]; + + LTC_ARGCHK(pt != NULL); + LTC_ARGCHK(ct != NULL); + LTC_ARGCHK(skey != NULL); + LOAD32H(work[0], pt+0); + LOAD32H(work[1], pt+4); + desfunc(work, skey->des3.ek[0]); + desfunc(work, skey->des3.ek[1]); + desfunc(work, skey->des3.ek[2]); + STORE32H(work[0],ct+0); + STORE32H(work[1],ct+4); + return CRYPT_OK; +} + +/** + Decrypts a block of text with 3DES-EDE + @param ct The input ciphertext (8 bytes) + @param pt The output plaintext (8 bytes) + @param skey The key as scheduled + @return CRYPT_OK if successful +*/ +int des3_ecb_decrypt(const unsigned char *ct, unsigned char *pt, symmetric_key *skey) +{ + ulong32 work[2]; + LTC_ARGCHK(pt != NULL); + LTC_ARGCHK(ct != NULL); + LTC_ARGCHK(skey != NULL); + LOAD32H(work[0], ct+0); + LOAD32H(work[1], ct+4); + desfunc(work, skey->des3.dk[0]); + desfunc(work, skey->des3.dk[1]); + desfunc(work, skey->des3.dk[2]); + STORE32H(work[0],pt+0); + STORE32H(work[1],pt+4); + return CRYPT_OK; +} + +#if 0 +/** + Performs a self-test of the DES block cipher + @return CRYPT_OK if functional, CRYPT_NOP if self-test has been disabled +*/ +int des_test(void) +{ + #ifndef LTC_TEST + return CRYPT_NOP; + #else + int err; + static const struct des_test_case { + int num, mode; /* mode 1 = encrypt */ + unsigned char key[8], txt[8], out[8]; + } cases[] = { + { 1, 1, { 0x10, 0x31, 0x6E, 0x02, 0x8C, 0x8F, 0x3B, 0x4A }, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0x82, 0xDC, 0xBA, 0xFB, 0xDE, 0xAB, 0x66, 0x02 } }, + { 2, 1, { 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01 }, + { 0x95, 0xF8, 0xA5, 0xE5, 0xDD, 0x31, 0xD9, 0x00 }, + { 0x80, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 } }, + { 3, 1, { 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01 }, + { 0xDD, 0x7F, 0x12, 0x1C, 0xA5, 0x01, 0x56, 0x19 }, + { 0x40, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 } }, + { 4, 1, { 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01 }, + { 0x2E, 0x86, 0x53, 0x10, 0x4F, 0x38, 0x34, 0xEA }, + { 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 } }, + { 5, 1, { 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01 }, + { 0x4B, 0xD3, 0x88, 0xFF, 0x6C, 0xD8, 0x1D, 0x4F }, + { 0x10, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 } }, + { 6, 1, { 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01 }, + { 0x20, 0xB9, 0xE7, 0x67, 0xB2, 0xFB, 0x14, 0x56 }, + { 0x08, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 } }, + { 7, 1, { 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01 }, + { 0x55, 0x57, 0x93, 0x80, 0xD7, 0x71, 0x38, 0xEF }, + { 0x04, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 } }, + { 8, 1, { 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01 }, + { 0x6C, 0xC5, 0xDE, 0xFA, 0xAF, 0x04, 0x51, 0x2F }, + { 0x02, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 } }, + { 9, 1, { 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01 }, + { 0x0D, 0x9F, 0x27, 0x9B, 0xA5, 0xD8, 0x72, 0x60 }, + { 0x01, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 } }, + {10, 1, { 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01 }, + { 0xD9, 0x03, 0x1B, 0x02, 0x71, 0xBD, 0x5A, 0x0A }, + { 0x00, 0x80, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 } }, + + { 1, 0, { 0x10, 0x31, 0x6E, 0x02, 0x8C, 0x8F, 0x3B, 0x4A }, + { 0x82, 0xDC, 0xBA, 0xFB, 0xDE, 0xAB, 0x66, 0x02 }, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 } }, + { 2, 0, { 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01 }, + { 0x80, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0x95, 0xF8, 0xA5, 0xE5, 0xDD, 0x31, 0xD9, 0x00 } }, + { 3, 0, { 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01 }, + { 0x40, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0xDD, 0x7F, 0x12, 0x1C, 0xA5, 0x01, 0x56, 0x19 } }, + { 4, 0, { 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01 }, + { 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0x2E, 0x86, 0x53, 0x10, 0x4F, 0x38, 0x34, 0xEA } }, + { 5, 0, { 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01 }, + { 0x10, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0x4B, 0xD3, 0x88, 0xFF, 0x6C, 0xD8, 0x1D, 0x4F } }, + { 6, 0, { 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01 }, + { 0x08, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0x20, 0xB9, 0xE7, 0x67, 0xB2, 0xFB, 0x14, 0x56 } }, + { 7, 0, { 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01 }, + { 0x04, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0x55, 0x57, 0x93, 0x80, 0xD7, 0x71, 0x38, 0xEF } }, + { 8, 0, { 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01 }, + { 0x02, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0x6C, 0xC5, 0xDE, 0xFA, 0xAF, 0x04, 0x51, 0x2F } }, + { 9, 0, { 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01 }, + { 0x01, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0x0D, 0x9F, 0x27, 0x9B, 0xA5, 0xD8, 0x72, 0x60 } }, + {10, 0, { 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01 }, + { 0x00, 0x80, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0xD9, 0x03, 0x1B, 0x02, 0x71, 0xBD, 0x5A, 0x0A } } + + /*** more test cases you could add if you are not convinced (the above test cases aren't really too good): + + key plaintext ciphertext + 0000000000000000 0000000000000000 8CA64DE9C1B123A7 + FFFFFFFFFFFFFFFF FFFFFFFFFFFFFFFF 7359B2163E4EDC58 + 3000000000000000 1000000000000001 958E6E627A05557B + 1111111111111111 1111111111111111 F40379AB9E0EC533 + 0123456789ABCDEF 1111111111111111 17668DFC7292532D + 1111111111111111 0123456789ABCDEF 8A5AE1F81AB8F2DD + 0000000000000000 0000000000000000 8CA64DE9C1B123A7 + FEDCBA9876543210 0123456789ABCDEF ED39D950FA74BCC4 + 7CA110454A1A6E57 01A1D6D039776742 690F5B0D9A26939B + 0131D9619DC1376E 5CD54CA83DEF57DA 7A389D10354BD271 + 07A1133E4A0B2686 0248D43806F67172 868EBB51CAB4599A + 3849674C2602319E 51454B582DDF440A 7178876E01F19B2A + 04B915BA43FEB5B6 42FD443059577FA2 AF37FB421F8C4095 + 0113B970FD34F2CE 059B5E0851CF143A 86A560F10EC6D85B + 0170F175468FB5E6 0756D8E0774761D2 0CD3DA020021DC09 + 43297FAD38E373FE 762514B829BF486A EA676B2CB7DB2B7A + 07A7137045DA2A16 3BDD119049372802 DFD64A815CAF1A0F + 04689104C2FD3B2F 26955F6835AF609A 5C513C9C4886C088 + 37D06BB516CB7546 164D5E404F275232 0A2AEEAE3FF4AB77 + 1F08260D1AC2465E 6B056E18759F5CCA EF1BF03E5DFA575A + 584023641ABA6176 004BD6EF09176062 88BF0DB6D70DEE56 + 025816164629B007 480D39006EE762F2 A1F9915541020B56 + 49793EBC79B3258F 437540C8698F3CFA 6FBF1CAFCFFD0556 + 4FB05E1515AB73A7 072D43A077075292 2F22E49BAB7CA1AC + 49E95D6D4CA229BF 02FE55778117F12A 5A6B612CC26CCE4A + 018310DC409B26D6 1D9D5C5018F728C2 5F4C038ED12B2E41 + 1C587F1C13924FEF 305532286D6F295A 63FAC0D034D9F793 + 0101010101010101 0123456789ABCDEF 617B3A0CE8F07100 + 1F1F1F1F0E0E0E0E 0123456789ABCDEF DB958605F8C8C606 + E0FEE0FEF1FEF1FE 0123456789ABCDEF EDBFD1C66C29CCC7 + 0000000000000000 FFFFFFFFFFFFFFFF 355550B2150E2451 + FFFFFFFFFFFFFFFF 0000000000000000 CAAAAF4DEAF1DBAE + 0123456789ABCDEF 0000000000000000 D5D44FF720683D0D + FEDCBA9876543210 FFFFFFFFFFFFFFFF 2A2BB008DF97C2F2 + + http://www.ecs.soton.ac.uk/~prw99r/ez438/vectors.txt + ***/ + }; + int i, y; + unsigned char tmp[8]; + symmetric_key des; + + for(i=0; i < (int)(sizeof(cases)/sizeof(cases[0])); i++) + { + if ((err = des_setup(cases[i].key, 8, 0, &des)) != CRYPT_OK) { + return err; + } + if (cases[i].mode != 0) { + des_ecb_encrypt(cases[i].txt, tmp, &des); + } else { + des_ecb_decrypt(cases[i].txt, tmp, &des); + } + + if (XMEMCMP(cases[i].out, tmp, sizeof(tmp)) != 0) { + return CRYPT_FAIL_TESTVECTOR; + } + + /* now see if we can encrypt all zero bytes 1000 times, decrypt and come back where we started */ + for (y = 0; y < 8; y++) tmp[y] = 0; + for (y = 0; y < 1000; y++) des_ecb_encrypt(tmp, tmp, &des); + for (y = 0; y < 1000; y++) des_ecb_decrypt(tmp, tmp, &des); + for (y = 0; y < 8; y++) if (tmp[y] != 0) return CRYPT_FAIL_TESTVECTOR; +} + + return CRYPT_OK; + #endif +} +#endif + +int des3_test(void) +{ + #ifndef LTC_TEST + return CRYPT_NOP; + #else + unsigned char key[24], pt[8], ct[8], tmp[8]; + symmetric_key skey; + int x, err; + + if ((err = des_test()) != CRYPT_OK) { + return err; + } + + for (x = 0; x < 8; x++) { + pt[x] = x; + } + + for (x = 0; x < 24; x++) { + key[x] = x; + } + + if ((err = des3_setup(key, 24, 0, &skey)) != CRYPT_OK) { + return err; + } + + des3_ecb_encrypt(pt, ct, &skey); + des3_ecb_decrypt(ct, tmp, &skey); + + if (XMEMCMP(pt, tmp, 8) != 0) { + return CRYPT_FAIL_TESTVECTOR; + } + + return CRYPT_OK; + #endif +} + +#if 0 +/** Terminate the context + @param skey The scheduled key +*/ +void des_done(symmetric_key *skey) +{ +} +#endif + +/** Terminate the context + @param skey The scheduled key +*/ +void des3_done(symmetric_key *skey) +{ +} + + +#if 0 +/** + Gets suitable key size + @param keysize [in/out] The length of the recommended key (in bytes). This function will store the suitable size back in this variable. + @return CRYPT_OK if the input key size is acceptable. +*/ +int des_keysize(int *keysize) +{ + LTC_ARGCHK(keysize != NULL); + if(*keysize < 8) { + return CRYPT_INVALID_KEYSIZE; + } + *keysize = 8; + return CRYPT_OK; +} +#endif + +/** + Gets suitable key size + @param keysize [in/out] The length of the recommended key (in bytes). This function will store the suitable size back in this variable. + @return CRYPT_OK if the input key size is acceptable. +*/ +int des3_keysize(int *keysize) +{ + LTC_ARGCHK(keysize != NULL); + if(*keysize < 24) { + return CRYPT_INVALID_KEYSIZE; + } + *keysize = 24; + return CRYPT_OK; +} + +#endif + + +/* $Source: /cvs/libtom/libtomcrypt/src/ciphers/des.c,v $ */ +/* $Revision: 1.13 $ */ +/* $Date: 2006/11/08 23:01:06 $ */ diff --git a/libtomcrypt/src/ciphers/kasumi.c b/libtomcrypt/src/ciphers/kasumi.c new file mode 100644 index 0000000..4a075b1 --- /dev/null +++ b/libtomcrypt/src/ciphers/kasumi.c @@ -0,0 +1,318 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ + +/** + @file kasumi.c + Implementation of the 3GPP Kasumi block cipher + Derived from the 3GPP standard source code +*/ + +#include "tomcrypt.h" + +#ifdef LTC_KASUMI + +typedef unsigned u16; + +#define ROL16(x, y) ((((x)<<(y)) | ((x)>>(16-(y)))) & 0xFFFF) + +const struct ltc_cipher_descriptor kasumi_desc = { + "kasumi", + 21, + 16, 16, 8, 8, + &kasumi_setup, + &kasumi_ecb_encrypt, + &kasumi_ecb_decrypt, + &kasumi_test, + &kasumi_done, + &kasumi_keysize, + NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL +}; + +static u16 FI( u16 in, u16 subkey ) +{ + u16 nine, seven; + static const u16 S7[128] = { + 54, 50, 62, 56, 22, 34, 94, 96, 38, 6, 63, 93, 2, 18,123, 33, + 55,113, 39,114, 21, 67, 65, 12, 47, 73, 46, 27, 25,111,124, 81, + 53, 9,121, 79, 52, 60, 58, 48,101,127, 40,120,104, 70, 71, 43, + 20,122, 72, 61, 23,109, 13,100, 77, 1, 16, 7, 82, 10,105, 98, + 117,116, 76, 11, 89,106, 0,125,118, 99, 86, 69, 30, 57,126, 87, + 112, 51, 17, 5, 95, 14, 90, 84, 91, 8, 35,103, 32, 97, 28, 66, + 102, 31, 26, 45, 75, 4, 85, 92, 37, 74, 80, 49, 68, 29,115, 44, + 64,107,108, 24,110, 83, 36, 78, 42, 19, 15, 41, 88,119, 59, 3 }; + static const u16 S9[512] = { + 167,239,161,379,391,334, 9,338, 38,226, 48,358,452,385, 90,397, + 183,253,147,331,415,340, 51,362,306,500,262, 82,216,159,356,177, + 175,241,489, 37,206, 17, 0,333, 44,254,378, 58,143,220, 81,400, + 95, 3,315,245, 54,235,218,405,472,264,172,494,371,290,399, 76, + 165,197,395,121,257,480,423,212,240, 28,462,176,406,507,288,223, + 501,407,249,265, 89,186,221,428,164, 74,440,196,458,421,350,163, + 232,158,134,354, 13,250,491,142,191, 69,193,425,152,227,366,135, + 344,300,276,242,437,320,113,278, 11,243, 87,317, 36, 93,496, 27, + 487,446,482, 41, 68,156,457,131,326,403,339, 20, 39,115,442,124, + 475,384,508, 53,112,170,479,151,126,169, 73,268,279,321,168,364, + 363,292, 46,499,393,327,324, 24,456,267,157,460,488,426,309,229, + 439,506,208,271,349,401,434,236, 16,209,359, 52, 56,120,199,277, + 465,416,252,287,246, 6, 83,305,420,345,153,502, 65, 61,244,282, + 173,222,418, 67,386,368,261,101,476,291,195,430, 49, 79,166,330, + 280,383,373,128,382,408,155,495,367,388,274,107,459,417, 62,454, + 132,225,203,316,234, 14,301, 91,503,286,424,211,347,307,140,374, + 35,103,125,427, 19,214,453,146,498,314,444,230,256,329,198,285, + 50,116, 78,410, 10,205,510,171,231, 45,139,467, 29, 86,505, 32, + 72, 26,342,150,313,490,431,238,411,325,149,473, 40,119,174,355, + 185,233,389, 71,448,273,372, 55,110,178,322, 12,469,392,369,190, + 1,109,375,137,181, 88, 75,308,260,484, 98,272,370,275,412,111, + 336,318, 4,504,492,259,304, 77,337,435, 21,357,303,332,483, 18, + 47, 85, 25,497,474,289,100,269,296,478,270,106, 31,104,433, 84, + 414,486,394, 96, 99,154,511,148,413,361,409,255,162,215,302,201, + 266,351,343,144,441,365,108,298,251, 34,182,509,138,210,335,133, + 311,352,328,141,396,346,123,319,450,281,429,228,443,481, 92,404, + 485,422,248,297, 23,213,130,466, 22,217,283, 70,294,360,419,127, + 312,377, 7,468,194, 2,117,295,463,258,224,447,247,187, 80,398, + 284,353,105,390,299,471,470,184, 57,200,348, 63,204,188, 33,451, + 97, 30,310,219, 94,160,129,493, 64,179,263,102,189,207,114,402, + 438,477,387,122,192, 42,381, 5,145,118,180,449,293,323,136,380, + 43, 66, 60,455,341,445,202,432, 8,237, 15,376,436,464, 59,461}; + + /* The sixteen bit input is split into two unequal halves, * + * nine bits and seven bits - as is the subkey */ + + nine = (u16)(in>>7)&0x1FF; + seven = (u16)(in&0x7F); + + /* Now run the various operations */ + nine = (u16)(S9[nine] ^ seven); + seven = (u16)(S7[seven] ^ (nine & 0x7F)); + seven ^= (subkey>>9); + nine ^= (subkey&0x1FF); + nine = (u16)(S9[nine] ^ seven); + seven = (u16)(S7[seven] ^ (nine & 0x7F)); + return (u16)(seven<<9) + nine; +} + +static ulong32 FO( ulong32 in, int round_no, symmetric_key *key) +{ + u16 left, right; + + /* Split the input into two 16-bit words */ + left = (u16)(in>>16); + right = (u16) in&0xFFFF; + + /* Now apply the same basic transformation three times */ + left ^= key->kasumi.KOi1[round_no]; + left = FI( left, key->kasumi.KIi1[round_no] ); + left ^= right; + + right ^= key->kasumi.KOi2[round_no]; + right = FI( right, key->kasumi.KIi2[round_no] ); + right ^= left; + + left ^= key->kasumi.KOi3[round_no]; + left = FI( left, key->kasumi.KIi3[round_no] ); + left ^= right; + + return (((ulong32)right)<<16)+left; +} + +static ulong32 FL( ulong32 in, int round_no, symmetric_key *key ) +{ + u16 l, r, a, b; + /* split out the left and right halves */ + l = (u16)(in>>16); + r = (u16)(in)&0xFFFF; + /* do the FL() operations */ + a = (u16) (l & key->kasumi.KLi1[round_no]); + r ^= ROL16(a,1); + b = (u16)(r | key->kasumi.KLi2[round_no]); + l ^= ROL16(b,1); + /* put the two halves back together */ + + return (((ulong32)l)<<16) + r; +} + +int kasumi_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key *skey) +{ + ulong32 left, right, temp; + int n; + + LTC_ARGCHK(pt != NULL); + LTC_ARGCHK(ct != NULL); + LTC_ARGCHK(skey != NULL); + + LOAD32H(left, pt); + LOAD32H(right, pt+4); + + for (n = 0; n <= 7; ) { + temp = FL(left, n, skey); + temp = FO(temp, n++, skey); + right ^= temp; + temp = FO(right, n, skey); + temp = FL(temp, n++, skey); + left ^= temp; + } + + STORE32H(left, ct); + STORE32H(right, ct+4); + + return CRYPT_OK; +} + +int kasumi_ecb_decrypt(const unsigned char *ct, unsigned char *pt, symmetric_key *skey) +{ + ulong32 left, right, temp; + int n; + + LTC_ARGCHK(pt != NULL); + LTC_ARGCHK(ct != NULL); + LTC_ARGCHK(skey != NULL); + + LOAD32H(left, ct); + LOAD32H(right, ct+4); + + for (n = 7; n >= 0; ) { + temp = FO(right, n, skey); + temp = FL(temp, n--, skey); + left ^= temp; + temp = FL(left, n, skey); + temp = FO(temp, n--, skey); + right ^= temp; + } + + STORE32H(left, pt); + STORE32H(right, pt+4); + + return CRYPT_OK; +} + +int kasumi_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey) +{ + static const u16 C[8] = { 0x0123,0x4567,0x89AB,0xCDEF, 0xFEDC,0xBA98,0x7654,0x3210 }; + u16 ukey[8], Kprime[8]; + int n; + + LTC_ARGCHK(key != NULL); + LTC_ARGCHK(skey != NULL); + + if (keylen != 16) { + return CRYPT_INVALID_KEYSIZE; + } + + if (num_rounds != 0 && num_rounds != 8) { + return CRYPT_INVALID_ROUNDS; + } + + /* Start by ensuring the subkeys are endian correct on a 16-bit basis */ + for (n = 0; n < 8; n++ ) { + ukey[n] = (((u16)key[2*n]) << 8) | key[2*n+1]; + } + + /* Now build the K'[] keys */ + for (n = 0; n < 8; n++) { + Kprime[n] = ukey[n] ^ C[n]; + } + + /* Finally construct the various sub keys */ + for(n = 0; n < 8; n++) { + skey->kasumi.KLi1[n] = ROL16(ukey[n],1); + skey->kasumi.KLi2[n] = Kprime[(n+2)&0x7]; + skey->kasumi.KOi1[n] = ROL16(ukey[(n+1)&0x7],5); + skey->kasumi.KOi2[n] = ROL16(ukey[(n+5)&0x7],8); + skey->kasumi.KOi3[n] = ROL16(ukey[(n+6)&0x7],13); + skey->kasumi.KIi1[n] = Kprime[(n+4)&0x7]; + skey->kasumi.KIi2[n] = Kprime[(n+3)&0x7]; + skey->kasumi.KIi3[n] = Kprime[(n+7)&0x7]; + } + + return CRYPT_OK; +} + +void kasumi_done(symmetric_key *skey) +{ +} + +int kasumi_keysize(int *keysize) +{ + LTC_ARGCHK(keysize != NULL); + if (*keysize >= 16) { + *keysize = 16; + return CRYPT_OK; + } else { + return CRYPT_INVALID_KEYSIZE; + } +} + +int kasumi_test(void) +{ +#ifndef LTC_TEST + return CRYPT_NOP; +#else + static const struct { + unsigned char key[16], pt[8], ct[8]; + } tests[] = { + +{ + { 0x80, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0x4B, 0x58, 0xA7, 0x71, 0xAF, 0xC7, 0xE5, 0xE8 } +}, + +{ + { 0x00, 0x80, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0x7E, 0xEF, 0x11, 0x3C, 0x95, 0xBB, 0x5A, 0x77 } +}, + +{ + { 0x00, 0x00, 0x80, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0x5F, 0x14, 0x06, 0x86, 0xD7, 0xAD, 0x5A, 0x39 }, +}, + +{ + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x01 }, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0x2E, 0x14, 0x91, 0xCF, 0x70, 0xAA, 0x46, 0x5D } +}, + +{ + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x01, 0x00 }, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0xB5, 0x45, 0x86, 0xF4, 0xAB, 0x9A, 0xE5, 0x46 } +}, + +}; + unsigned char buf[2][8]; + symmetric_key key; + int err, x; + + for (x = 0; x < (int)(sizeof(tests)/sizeof(tests[0])); x++) { + if ((err = kasumi_setup(tests[x].key, 16, 0, &key)) != CRYPT_OK) { + return err; + } + if ((err = kasumi_ecb_encrypt(tests[x].pt, buf[0], &key)) != CRYPT_OK) { + return err; + } + if ((err = kasumi_ecb_decrypt(tests[x].ct, buf[1], &key)) != CRYPT_OK) { + return err; + } + if (XMEMCMP(tests[x].pt, buf[1], 8) || XMEMCMP(tests[x].ct, buf[0], 8)) { + return CRYPT_FAIL_TESTVECTOR; + } + } + return CRYPT_OK; +#endif +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/ciphers/kasumi.c,v $ */ +/* $Revision: 1.7 $ */ +/* $Date: 2006/11/09 03:05:44 $ */ diff --git a/libtomcrypt/src/ciphers/khazad.c b/libtomcrypt/src/ciphers/khazad.c new file mode 100644 index 0000000..8490950 --- /dev/null +++ b/libtomcrypt/src/ciphers/khazad.c @@ -0,0 +1,855 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file khazad.c + Khazad implementation derived from public domain source + Authors: Paulo S.L.M. Barreto and Vincent Rijmen. +*/ + +#ifdef KHAZAD + +const struct ltc_cipher_descriptor khazad_desc = { + "khazad", + 18, + 16, 16, 8, 8, + &khazad_setup, + &khazad_ecb_encrypt, + &khazad_ecb_decrypt, + &khazad_test, + &khazad_done, + &khazad_keysize, + NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL +}; + +#define R 8 +#define KEYSIZE 128 +#define KEYSIZEB (KEYSIZE/8) +#define BLOCKSIZE 64 +#define BLOCKSIZEB (BLOCKSIZE/8) + +static const ulong64 T0[256] = { + CONST64(0xbad3d268bbb96a01), CONST64(0x54fc4d19e59a66b1), CONST64(0x2f71bc93e26514cd), CONST64(0x749ccdb925871b51), + CONST64(0x53f55102f7a257a4), CONST64(0xd3686bb8d0d6be03), CONST64(0xd26b6fbdd6deb504), CONST64(0x4dd72964b35285fe), + CONST64(0x50f05d0dfdba4aad), CONST64(0xace98a26cf09e063), CONST64(0x8d8a0e83091c9684), CONST64(0xbfdcc679a5914d1a), + CONST64(0x7090ddad3da7374d), CONST64(0x52f65507f1aa5ca3), CONST64(0x9ab352c87ba417e1), CONST64(0x4cd42d61b55a8ef9), + CONST64(0xea238f65460320ac), CONST64(0xd56273a6c4e68411), CONST64(0x97a466f155cc68c2), CONST64(0xd16e63b2dcc6a80d), + CONST64(0x3355ccffaa85d099), CONST64(0x51f35908fbb241aa), CONST64(0x5bed712ac7e20f9c), CONST64(0xa6f7a204f359ae55), + CONST64(0xde7f5f81febec120), CONST64(0x48d83d75ad7aa2e5), CONST64(0xa8e59a32d729cc7f), CONST64(0x99b65ec771bc0ae8), + CONST64(0xdb704b90e096e63b), CONST64(0x3256c8faac8ddb9e), CONST64(0xb7c4e65195d11522), CONST64(0xfc19d72b32b3aace), + CONST64(0xe338ab48704b7393), CONST64(0x9ebf42dc63843bfd), CONST64(0x91ae7eef41fc52d0), CONST64(0x9bb056cd7dac1ce6), + CONST64(0xe23baf4d76437894), CONST64(0xbbd0d66dbdb16106), CONST64(0x41c319589b32f1da), CONST64(0x6eb2a5cb7957e517), + CONST64(0xa5f2ae0bf941b35c), CONST64(0xcb400bc08016564b), CONST64(0x6bbdb1da677fc20c), CONST64(0x95a26efb59dc7ecc), + CONST64(0xa1febe1fe1619f40), CONST64(0xf308eb1810cbc3e3), CONST64(0xb1cefe4f81e12f30), CONST64(0x0206080a0c10160e), + CONST64(0xcc4917db922e675e), CONST64(0xc45137f3a26e3f66), CONST64(0x1d2774694ee8cf53), CONST64(0x143c504478a09c6c), + CONST64(0xc3582be8b0560e73), CONST64(0x63a591f2573f9a34), CONST64(0xda734f95e69eed3c), CONST64(0x5de76934d3d2358e), + CONST64(0x5fe1613edfc22380), CONST64(0xdc79578bf2aed72e), CONST64(0x7d87e99413cf486e), CONST64(0xcd4a13de94266c59), + CONST64(0x7f81e19e1fdf5e60), CONST64(0x5aee752fc1ea049b), CONST64(0x6cb4adc17547f319), CONST64(0x5ce46d31d5da3e89), + CONST64(0xf704fb0c08ebefff), CONST64(0x266a98bed42d47f2), CONST64(0xff1cdb2438abb7c7), CONST64(0xed2a937e543b11b9), + CONST64(0xe825876f4a1336a2), CONST64(0x9dba4ed3699c26f4), CONST64(0x6fb1a1ce7f5fee10), CONST64(0x8e8f028c03048b8d), + CONST64(0x192b647d56c8e34f), CONST64(0xa0fdba1ae7699447), CONST64(0xf00de7171ad3deea), CONST64(0x89861e97113cba98), + CONST64(0x0f113c332278692d), CONST64(0x07091c1b12383115), CONST64(0xafec8629c511fd6a), CONST64(0xfb10cb30208b9bdb), + CONST64(0x0818202830405838), CONST64(0x153f54417ea8976b), CONST64(0x0d1734392e687f23), CONST64(0x040c101418202c1c), + CONST64(0x0103040506080b07), CONST64(0x64ac8de94507ab21), CONST64(0xdf7c5b84f8b6ca27), CONST64(0x769ac5b329970d5f), + CONST64(0x798bf9800bef6472), CONST64(0xdd7a538ef4a6dc29), CONST64(0x3d47f4c98ef5b2b3), CONST64(0x163a584e74b08a62), + CONST64(0x3f41fcc382e5a4bd), CONST64(0x3759dcebb2a5fc85), CONST64(0x6db7a9c4734ff81e), CONST64(0x3848e0d890dd95a8), + CONST64(0xb9d6de67b1a17708), CONST64(0x7395d1a237bf2a44), CONST64(0xe926836a4c1b3da5), CONST64(0x355fd4e1beb5ea8b), + CONST64(0x55ff491ce3926db6), CONST64(0x7193d9a83baf3c4a), CONST64(0x7b8df18a07ff727c), CONST64(0x8c890a860f149d83), + CONST64(0x7296d5a731b72143), CONST64(0x88851a921734b19f), CONST64(0xf607ff090ee3e4f8), CONST64(0x2a7ea882fc4d33d6), + CONST64(0x3e42f8c684edafba), CONST64(0x5ee2653bd9ca2887), CONST64(0x27699cbbd2254cf5), CONST64(0x46ca0543890ac0cf), + CONST64(0x0c14303c28607424), CONST64(0x65af89ec430fa026), CONST64(0x68b8bdd56d67df05), CONST64(0x61a399f85b2f8c3a), + CONST64(0x03050c0f0a181d09), CONST64(0xc15e23e2bc46187d), CONST64(0x57f94116ef827bb8), CONST64(0xd6677fa9cefe9918), + CONST64(0xd976439aec86f035), CONST64(0x58e87d25cdfa1295), CONST64(0xd875479fea8efb32), CONST64(0x66aa85e34917bd2f), + CONST64(0xd7647bacc8f6921f), CONST64(0x3a4ee8d29ccd83a6), CONST64(0xc84507cf8a0e4b42), CONST64(0x3c44f0cc88fdb9b4), + CONST64(0xfa13cf35268390dc), CONST64(0x96a762f453c463c5), CONST64(0xa7f4a601f551a552), CONST64(0x98b55ac277b401ef), + CONST64(0xec29977b52331abe), CONST64(0xb8d5da62b7a97c0f), CONST64(0xc7543bfca876226f), CONST64(0xaeef822cc319f66d), + CONST64(0x69bbb9d06b6fd402), CONST64(0x4bdd317aa762bfec), CONST64(0xabe0963ddd31d176), CONST64(0xa9e69e37d121c778), + CONST64(0x67a981e64f1fb628), CONST64(0x0a1e28223c504e36), CONST64(0x47c901468f02cbc8), CONST64(0xf20bef1d16c3c8e4), + CONST64(0xb5c2ee5b99c1032c), CONST64(0x226688aacc0d6bee), CONST64(0xe532b356647b4981), CONST64(0xee2f9f715e230cb0), + CONST64(0xbedfc27ca399461d), CONST64(0x2b7dac87fa4538d1), CONST64(0x819e3ebf217ce2a0), CONST64(0x1236485a6c90a67e), + CONST64(0x839836b52d6cf4ae), CONST64(0x1b2d6c775ad8f541), CONST64(0x0e1238362470622a), CONST64(0x23658cafca0560e9), + CONST64(0xf502f30604fbf9f1), CONST64(0x45cf094c8312ddc6), CONST64(0x216384a5c61576e7), CONST64(0xce4f1fd19e3e7150), + CONST64(0x49db3970ab72a9e2), CONST64(0x2c74b09ce87d09c4), CONST64(0xf916c33a2c9b8dd5), CONST64(0xe637bf596e635488), + CONST64(0xb6c7e25493d91e25), CONST64(0x2878a088f05d25d8), CONST64(0x17395c4b72b88165), CONST64(0x829b32b02b64ffa9), + CONST64(0x1a2e68725cd0fe46), CONST64(0x8b80169d1d2cac96), CONST64(0xfe1fdf213ea3bcc0), CONST64(0x8a8312981b24a791), + CONST64(0x091b242d3648533f), CONST64(0xc94603ca8c064045), CONST64(0x879426a1354cd8b2), CONST64(0x4ed2256bb94a98f7), + CONST64(0xe13ea3427c5b659d), CONST64(0x2e72b896e46d1fca), CONST64(0xe431b75362734286), CONST64(0xe03da7477a536e9a), + CONST64(0xeb208b60400b2bab), CONST64(0x90ad7aea47f459d7), CONST64(0xa4f1aa0eff49b85b), CONST64(0x1e22786644f0d25a), + CONST64(0x85922eab395ccebc), CONST64(0x60a09dfd5d27873d), CONST64(0x0000000000000000), CONST64(0x256f94b1de355afb), + CONST64(0xf401f70302f3f2f6), CONST64(0xf10ee3121cdbd5ed), CONST64(0x94a16afe5fd475cb), CONST64(0x0b1d2c273a584531), + CONST64(0xe734bb5c686b5f8f), CONST64(0x759fc9bc238f1056), CONST64(0xef2c9b74582b07b7), CONST64(0x345cd0e4b8bde18c), + CONST64(0x3153c4f5a695c697), CONST64(0xd46177a3c2ee8f16), CONST64(0xd06d67b7dacea30a), CONST64(0x869722a43344d3b5), + CONST64(0x7e82e59b19d75567), CONST64(0xadea8e23c901eb64), CONST64(0xfd1ad32e34bba1c9), CONST64(0x297ba48df6552edf), + CONST64(0x3050c0f0a09dcd90), CONST64(0x3b4decd79ac588a1), CONST64(0x9fbc46d9658c30fa), CONST64(0xf815c73f2a9386d2), + CONST64(0xc6573ff9ae7e2968), CONST64(0x13354c5f6a98ad79), CONST64(0x060a181e14303a12), CONST64(0x050f14111e28271b), + CONST64(0xc55233f6a4663461), CONST64(0x113344556688bb77), CONST64(0x7799c1b62f9f0658), CONST64(0x7c84ed9115c74369), + CONST64(0x7a8ef58f01f7797b), CONST64(0x7888fd850de76f75), CONST64(0x365ad8eeb4adf782), CONST64(0x1c24706c48e0c454), + CONST64(0x394be4dd96d59eaf), CONST64(0x59eb7920cbf21992), CONST64(0x1828607850c0e848), CONST64(0x56fa4513e98a70bf), + CONST64(0xb3c8f6458df1393e), CONST64(0xb0cdfa4a87e92437), CONST64(0x246c90b4d83d51fc), CONST64(0x206080a0c01d7de0), + CONST64(0xb2cbf2408bf93239), CONST64(0x92ab72e04be44fd9), CONST64(0xa3f8b615ed71894e), CONST64(0xc05d27e7ba4e137a), + CONST64(0x44cc0d49851ad6c1), CONST64(0x62a695f751379133), CONST64(0x103040506080b070), CONST64(0xb4c1ea5e9fc9082b), + CONST64(0x84912aae3f54c5bb), CONST64(0x43c511529722e7d4), CONST64(0x93a876e54dec44de), CONST64(0xc25b2fedb65e0574), + CONST64(0x4ade357fa16ab4eb), CONST64(0xbddace73a9815b14), CONST64(0x8f8c0689050c808a), CONST64(0x2d77b499ee7502c3), + CONST64(0xbcd9ca76af895013), CONST64(0x9cb94ad66f942df3), CONST64(0x6abeb5df6177c90b), CONST64(0x40c01d5d9d3afadd), + CONST64(0xcf4c1bd498367a57), CONST64(0xa2fbb210eb798249), CONST64(0x809d3aba2774e9a7), CONST64(0x4fd1216ebf4293f0), + CONST64(0x1f217c6342f8d95d), CONST64(0xca430fc5861e5d4c), CONST64(0xaae39238db39da71), CONST64(0x42c61557912aecd3), +}; + +static const ulong64 T1[256] = { + CONST64(0xd3ba68d2b9bb016a), CONST64(0xfc54194d9ae5b166), CONST64(0x712f93bc65e2cd14), CONST64(0x9c74b9cd8725511b), + CONST64(0xf5530251a2f7a457), CONST64(0x68d3b86bd6d003be), CONST64(0x6bd2bd6fded604b5), CONST64(0xd74d642952b3fe85), + CONST64(0xf0500d5dbafdad4a), CONST64(0xe9ac268a09cf63e0), CONST64(0x8a8d830e1c098496), CONST64(0xdcbf79c691a51a4d), + CONST64(0x9070addda73d4d37), CONST64(0xf6520755aaf1a35c), CONST64(0xb39ac852a47be117), CONST64(0xd44c612d5ab5f98e), + CONST64(0x23ea658f0346ac20), CONST64(0x62d5a673e6c41184), CONST64(0xa497f166cc55c268), CONST64(0x6ed1b263c6dc0da8), + CONST64(0x5533ffcc85aa99d0), CONST64(0xf3510859b2fbaa41), CONST64(0xed5b2a71e2c79c0f), CONST64(0xf7a604a259f355ae), + CONST64(0x7fde815fbefe20c1), CONST64(0xd848753d7aade5a2), CONST64(0xe5a8329a29d77fcc), CONST64(0xb699c75ebc71e80a), + CONST64(0x70db904b96e03be6), CONST64(0x5632fac88dac9edb), CONST64(0xc4b751e6d1952215), CONST64(0x19fc2bd7b332ceaa), + CONST64(0x38e348ab4b709373), CONST64(0xbf9edc428463fd3b), CONST64(0xae91ef7efc41d052), CONST64(0xb09bcd56ac7de61c), + CONST64(0x3be24daf43769478), CONST64(0xd0bb6dd6b1bd0661), CONST64(0xc3415819329bdaf1), CONST64(0xb26ecba5577917e5), + CONST64(0xf2a50bae41f95cb3), CONST64(0x40cbc00b16804b56), CONST64(0xbd6bdab17f670cc2), CONST64(0xa295fb6edc59cc7e), + CONST64(0xfea11fbe61e1409f), CONST64(0x08f318ebcb10e3c3), CONST64(0xceb14ffee181302f), CONST64(0x06020a08100c0e16), + CONST64(0x49ccdb172e925e67), CONST64(0x51c4f3376ea2663f), CONST64(0x271d6974e84e53cf), CONST64(0x3c144450a0786c9c), + CONST64(0x58c3e82b56b0730e), CONST64(0xa563f2913f57349a), CONST64(0x73da954f9ee63ced), CONST64(0xe75d3469d2d38e35), + CONST64(0xe15f3e61c2df8023), CONST64(0x79dc8b57aef22ed7), CONST64(0x877d94e9cf136e48), CONST64(0x4acdde132694596c), + CONST64(0x817f9ee1df1f605e), CONST64(0xee5a2f75eac19b04), CONST64(0xb46cc1ad477519f3), CONST64(0xe45c316ddad5893e), + CONST64(0x04f70cfbeb08ffef), CONST64(0x6a26be982dd4f247), CONST64(0x1cff24dbab38c7b7), CONST64(0x2aed7e933b54b911), + CONST64(0x25e86f87134aa236), CONST64(0xba9dd34e9c69f426), CONST64(0xb16fcea15f7f10ee), CONST64(0x8f8e8c0204038d8b), + CONST64(0x2b197d64c8564fe3), CONST64(0xfda01aba69e74794), CONST64(0x0df017e7d31aeade), CONST64(0x8689971e3c1198ba), + CONST64(0x110f333c78222d69), CONST64(0x09071b1c38121531), CONST64(0xecaf298611c56afd), CONST64(0x10fb30cb8b20db9b), + CONST64(0x1808282040303858), CONST64(0x3f154154a87e6b97), CONST64(0x170d3934682e237f), CONST64(0x0c04141020181c2c), + CONST64(0x030105040806070b), CONST64(0xac64e98d074521ab), CONST64(0x7cdf845bb6f827ca), CONST64(0x9a76b3c597295f0d), + CONST64(0x8b7980f9ef0b7264), CONST64(0x7add8e53a6f429dc), CONST64(0x473dc9f4f58eb3b2), CONST64(0x3a164e58b074628a), + CONST64(0x413fc3fce582bda4), CONST64(0x5937ebdca5b285fc), CONST64(0xb76dc4a94f731ef8), CONST64(0x4838d8e0dd90a895), + CONST64(0xd6b967dea1b10877), CONST64(0x9573a2d1bf37442a), CONST64(0x26e96a831b4ca53d), CONST64(0x5f35e1d4b5be8bea), + CONST64(0xff551c4992e3b66d), CONST64(0x9371a8d9af3b4a3c), CONST64(0x8d7b8af1ff077c72), CONST64(0x898c860a140f839d), + CONST64(0x9672a7d5b7314321), CONST64(0x8588921a34179fb1), CONST64(0x07f609ffe30ef8e4), CONST64(0x7e2a82a84dfcd633), + CONST64(0x423ec6f8ed84baaf), CONST64(0xe25e3b65cad98728), CONST64(0x6927bb9c25d2f54c), CONST64(0xca4643050a89cfc0), + CONST64(0x140c3c3060282474), CONST64(0xaf65ec890f4326a0), CONST64(0xb868d5bd676d05df), CONST64(0xa361f8992f5b3a8c), + CONST64(0x05030f0c180a091d), CONST64(0x5ec1e22346bc7d18), CONST64(0xf957164182efb87b), CONST64(0x67d6a97ffece1899), + CONST64(0x76d99a4386ec35f0), CONST64(0xe858257dfacd9512), CONST64(0x75d89f478eea32fb), CONST64(0xaa66e38517492fbd), + CONST64(0x64d7ac7bf6c81f92), CONST64(0x4e3ad2e8cd9ca683), CONST64(0x45c8cf070e8a424b), CONST64(0x443cccf0fd88b4b9), + CONST64(0x13fa35cf8326dc90), CONST64(0xa796f462c453c563), CONST64(0xf4a701a651f552a5), CONST64(0xb598c25ab477ef01), + CONST64(0x29ec7b973352be1a), CONST64(0xd5b862daa9b70f7c), CONST64(0x54c7fc3b76a86f22), CONST64(0xefae2c8219c36df6), + CONST64(0xbb69d0b96f6b02d4), CONST64(0xdd4b7a3162a7ecbf), CONST64(0xe0ab3d9631dd76d1), CONST64(0xe6a9379e21d178c7), + CONST64(0xa967e6811f4f28b6), CONST64(0x1e0a2228503c364e), CONST64(0xc9474601028fc8cb), CONST64(0x0bf21defc316e4c8), + CONST64(0xc2b55beec1992c03), CONST64(0x6622aa880dccee6b), CONST64(0x32e556b37b648149), CONST64(0x2fee719f235eb00c), + CONST64(0xdfbe7cc299a31d46), CONST64(0x7d2b87ac45fad138), CONST64(0x9e81bf3e7c21a0e2), CONST64(0x36125a48906c7ea6), + CONST64(0x9883b5366c2daef4), CONST64(0x2d1b776cd85a41f5), CONST64(0x120e363870242a62), CONST64(0x6523af8c05cae960), + CONST64(0x02f506f3fb04f1f9), CONST64(0xcf454c091283c6dd), CONST64(0x6321a58415c6e776), CONST64(0x4fced11f3e9e5071), + CONST64(0xdb49703972abe2a9), CONST64(0x742c9cb07de8c409), CONST64(0x16f93ac39b2cd58d), CONST64(0x37e659bf636e8854), + CONST64(0xc7b654e2d993251e), CONST64(0x782888a05df0d825), CONST64(0x39174b5cb8726581), CONST64(0x9b82b032642ba9ff), + CONST64(0x2e1a7268d05c46fe), CONST64(0x808b9d162c1d96ac), CONST64(0x1ffe21dfa33ec0bc), CONST64(0x838a9812241b91a7), + CONST64(0x1b092d2448363f53), CONST64(0x46c9ca03068c4540), CONST64(0x9487a1264c35b2d8), CONST64(0xd24e6b254ab9f798), + CONST64(0x3ee142a35b7c9d65), CONST64(0x722e96b86de4ca1f), CONST64(0x31e453b773628642), CONST64(0x3de047a7537a9a6e), + CONST64(0x20eb608b0b40ab2b), CONST64(0xad90ea7af447d759), CONST64(0xf1a40eaa49ff5bb8), CONST64(0x221e6678f0445ad2), + CONST64(0x9285ab2e5c39bcce), CONST64(0xa060fd9d275d3d87), CONST64(0x0000000000000000), CONST64(0x6f25b19435defb5a), + CONST64(0x01f403f7f302f6f2), CONST64(0x0ef112e3db1cedd5), CONST64(0xa194fe6ad45fcb75), CONST64(0x1d0b272c583a3145), + CONST64(0x34e75cbb6b688f5f), CONST64(0x9f75bcc98f235610), CONST64(0x2cef749b2b58b707), CONST64(0x5c34e4d0bdb88ce1), + CONST64(0x5331f5c495a697c6), CONST64(0x61d4a377eec2168f), CONST64(0x6dd0b767ceda0aa3), CONST64(0x9786a4224433b5d3), + CONST64(0x827e9be5d7196755), CONST64(0xeaad238e01c964eb), CONST64(0x1afd2ed3bb34c9a1), CONST64(0x7b298da455f6df2e), + CONST64(0x5030f0c09da090cd), CONST64(0x4d3bd7ecc59aa188), CONST64(0xbc9fd9468c65fa30), CONST64(0x15f83fc7932ad286), + CONST64(0x57c6f93f7eae6829), CONST64(0x35135f4c986a79ad), CONST64(0x0a061e183014123a), CONST64(0x0f051114281e1b27), + CONST64(0x52c5f63366a46134), CONST64(0x33115544886677bb), CONST64(0x9977b6c19f2f5806), CONST64(0x847c91edc7156943), + CONST64(0x8e7a8ff5f7017b79), CONST64(0x887885fde70d756f), CONST64(0x5a36eed8adb482f7), CONST64(0x241c6c70e04854c4), + CONST64(0x4b39dde4d596af9e), CONST64(0xeb592079f2cb9219), CONST64(0x28187860c05048e8), CONST64(0xfa5613458ae9bf70), + CONST64(0xc8b345f6f18d3e39), CONST64(0xcdb04afae9873724), CONST64(0x6c24b4903dd8fc51), CONST64(0x6020a0801dc0e07d), + CONST64(0xcbb240f2f98b3932), CONST64(0xab92e072e44bd94f), CONST64(0xf8a315b671ed4e89), CONST64(0x5dc0e7274eba7a13), + CONST64(0xcc44490d1a85c1d6), CONST64(0xa662f79537513391), CONST64(0x30105040806070b0), CONST64(0xc1b45eeac99f2b08), + CONST64(0x9184ae2a543fbbc5), CONST64(0xc54352112297d4e7), CONST64(0xa893e576ec4dde44), CONST64(0x5bc2ed2f5eb67405), + CONST64(0xde4a7f356aa1ebb4), CONST64(0xdabd73ce81a9145b), CONST64(0x8c8f89060c058a80), CONST64(0x772d99b475eec302), + CONST64(0xd9bc76ca89af1350), CONST64(0xb99cd64a946ff32d), CONST64(0xbe6adfb577610bc9), CONST64(0xc0405d1d3a9dddfa), + CONST64(0x4ccfd41b3698577a), CONST64(0xfba210b279eb4982), CONST64(0x9d80ba3a7427a7e9), CONST64(0xd14f6e2142bff093), + CONST64(0x211f637cf8425dd9), CONST64(0x43cac50f1e864c5d), CONST64(0xe3aa389239db71da), CONST64(0xc64257152a91d3ec), +}; + +static const ulong64 T2[256] = { + CONST64(0xd268bad36a01bbb9), CONST64(0x4d1954fc66b1e59a), CONST64(0xbc932f7114cde265), CONST64(0xcdb9749c1b512587), + CONST64(0x510253f557a4f7a2), CONST64(0x6bb8d368be03d0d6), CONST64(0x6fbdd26bb504d6de), CONST64(0x29644dd785feb352), + CONST64(0x5d0d50f04aadfdba), CONST64(0x8a26ace9e063cf09), CONST64(0x0e838d8a9684091c), CONST64(0xc679bfdc4d1aa591), + CONST64(0xddad7090374d3da7), CONST64(0x550752f65ca3f1aa), CONST64(0x52c89ab317e17ba4), CONST64(0x2d614cd48ef9b55a), + CONST64(0x8f65ea2320ac4603), CONST64(0x73a6d5628411c4e6), CONST64(0x66f197a468c255cc), CONST64(0x63b2d16ea80ddcc6), + CONST64(0xccff3355d099aa85), CONST64(0x590851f341aafbb2), CONST64(0x712a5bed0f9cc7e2), CONST64(0xa204a6f7ae55f359), + CONST64(0x5f81de7fc120febe), CONST64(0x3d7548d8a2e5ad7a), CONST64(0x9a32a8e5cc7fd729), CONST64(0x5ec799b60ae871bc), + CONST64(0x4b90db70e63be096), CONST64(0xc8fa3256db9eac8d), CONST64(0xe651b7c4152295d1), CONST64(0xd72bfc19aace32b3), + CONST64(0xab48e3387393704b), CONST64(0x42dc9ebf3bfd6384), CONST64(0x7eef91ae52d041fc), CONST64(0x56cd9bb01ce67dac), + CONST64(0xaf4de23b78947643), CONST64(0xd66dbbd06106bdb1), CONST64(0x195841c3f1da9b32), CONST64(0xa5cb6eb2e5177957), + CONST64(0xae0ba5f2b35cf941), CONST64(0x0bc0cb40564b8016), CONST64(0xb1da6bbdc20c677f), CONST64(0x6efb95a27ecc59dc), + CONST64(0xbe1fa1fe9f40e161), CONST64(0xeb18f308c3e310cb), CONST64(0xfe4fb1ce2f3081e1), CONST64(0x080a0206160e0c10), + CONST64(0x17dbcc49675e922e), CONST64(0x37f3c4513f66a26e), CONST64(0x74691d27cf534ee8), CONST64(0x5044143c9c6c78a0), + CONST64(0x2be8c3580e73b056), CONST64(0x91f263a59a34573f), CONST64(0x4f95da73ed3ce69e), CONST64(0x69345de7358ed3d2), + CONST64(0x613e5fe12380dfc2), CONST64(0x578bdc79d72ef2ae), CONST64(0xe9947d87486e13cf), CONST64(0x13decd4a6c599426), + CONST64(0xe19e7f815e601fdf), CONST64(0x752f5aee049bc1ea), CONST64(0xadc16cb4f3197547), CONST64(0x6d315ce43e89d5da), + CONST64(0xfb0cf704efff08eb), CONST64(0x98be266a47f2d42d), CONST64(0xdb24ff1cb7c738ab), CONST64(0x937eed2a11b9543b), + CONST64(0x876fe82536a24a13), CONST64(0x4ed39dba26f4699c), CONST64(0xa1ce6fb1ee107f5f), CONST64(0x028c8e8f8b8d0304), + CONST64(0x647d192be34f56c8), CONST64(0xba1aa0fd9447e769), CONST64(0xe717f00ddeea1ad3), CONST64(0x1e978986ba98113c), + CONST64(0x3c330f11692d2278), CONST64(0x1c1b070931151238), CONST64(0x8629afecfd6ac511), CONST64(0xcb30fb109bdb208b), + CONST64(0x2028081858383040), CONST64(0x5441153f976b7ea8), CONST64(0x34390d177f232e68), CONST64(0x1014040c2c1c1820), + CONST64(0x040501030b070608), CONST64(0x8de964acab214507), CONST64(0x5b84df7cca27f8b6), CONST64(0xc5b3769a0d5f2997), + CONST64(0xf980798b64720bef), CONST64(0x538edd7adc29f4a6), CONST64(0xf4c93d47b2b38ef5), CONST64(0x584e163a8a6274b0), + CONST64(0xfcc33f41a4bd82e5), CONST64(0xdceb3759fc85b2a5), CONST64(0xa9c46db7f81e734f), CONST64(0xe0d8384895a890dd), + CONST64(0xde67b9d67708b1a1), CONST64(0xd1a273952a4437bf), CONST64(0x836ae9263da54c1b), CONST64(0xd4e1355fea8bbeb5), + CONST64(0x491c55ff6db6e392), CONST64(0xd9a871933c4a3baf), CONST64(0xf18a7b8d727c07ff), CONST64(0x0a868c899d830f14), + CONST64(0xd5a77296214331b7), CONST64(0x1a928885b19f1734), CONST64(0xff09f607e4f80ee3), CONST64(0xa8822a7e33d6fc4d), + CONST64(0xf8c63e42afba84ed), CONST64(0x653b5ee22887d9ca), CONST64(0x9cbb27694cf5d225), CONST64(0x054346cac0cf890a), + CONST64(0x303c0c1474242860), CONST64(0x89ec65afa026430f), CONST64(0xbdd568b8df056d67), CONST64(0x99f861a38c3a5b2f), + CONST64(0x0c0f03051d090a18), CONST64(0x23e2c15e187dbc46), CONST64(0x411657f97bb8ef82), CONST64(0x7fa9d6679918cefe), + CONST64(0x439ad976f035ec86), CONST64(0x7d2558e81295cdfa), CONST64(0x479fd875fb32ea8e), CONST64(0x85e366aabd2f4917), + CONST64(0x7bacd764921fc8f6), CONST64(0xe8d23a4e83a69ccd), CONST64(0x07cfc8454b428a0e), CONST64(0xf0cc3c44b9b488fd), + CONST64(0xcf35fa1390dc2683), CONST64(0x62f496a763c553c4), CONST64(0xa601a7f4a552f551), CONST64(0x5ac298b501ef77b4), + CONST64(0x977bec291abe5233), CONST64(0xda62b8d57c0fb7a9), CONST64(0x3bfcc754226fa876), CONST64(0x822caeeff66dc319), + CONST64(0xb9d069bbd4026b6f), CONST64(0x317a4bddbfeca762), CONST64(0x963dabe0d176dd31), CONST64(0x9e37a9e6c778d121), + CONST64(0x81e667a9b6284f1f), CONST64(0x28220a1e4e363c50), CONST64(0x014647c9cbc88f02), CONST64(0xef1df20bc8e416c3), + CONST64(0xee5bb5c2032c99c1), CONST64(0x88aa22666beecc0d), CONST64(0xb356e5324981647b), CONST64(0x9f71ee2f0cb05e23), + CONST64(0xc27cbedf461da399), CONST64(0xac872b7d38d1fa45), CONST64(0x3ebf819ee2a0217c), CONST64(0x485a1236a67e6c90), + CONST64(0x36b58398f4ae2d6c), CONST64(0x6c771b2df5415ad8), CONST64(0x38360e12622a2470), CONST64(0x8caf236560e9ca05), + CONST64(0xf306f502f9f104fb), CONST64(0x094c45cfddc68312), CONST64(0x84a5216376e7c615), CONST64(0x1fd1ce4f71509e3e), + CONST64(0x397049dba9e2ab72), CONST64(0xb09c2c7409c4e87d), CONST64(0xc33af9168dd52c9b), CONST64(0xbf59e63754886e63), + CONST64(0xe254b6c71e2593d9), CONST64(0xa088287825d8f05d), CONST64(0x5c4b1739816572b8), CONST64(0x32b0829bffa92b64), + CONST64(0x68721a2efe465cd0), CONST64(0x169d8b80ac961d2c), CONST64(0xdf21fe1fbcc03ea3), CONST64(0x12988a83a7911b24), + CONST64(0x242d091b533f3648), CONST64(0x03cac94640458c06), CONST64(0x26a18794d8b2354c), CONST64(0x256b4ed298f7b94a), + CONST64(0xa342e13e659d7c5b), CONST64(0xb8962e721fcae46d), CONST64(0xb753e43142866273), CONST64(0xa747e03d6e9a7a53), + CONST64(0x8b60eb202bab400b), CONST64(0x7aea90ad59d747f4), CONST64(0xaa0ea4f1b85bff49), CONST64(0x78661e22d25a44f0), + CONST64(0x2eab8592cebc395c), CONST64(0x9dfd60a0873d5d27), CONST64(0x0000000000000000), CONST64(0x94b1256f5afbde35), + CONST64(0xf703f401f2f602f3), CONST64(0xe312f10ed5ed1cdb), CONST64(0x6afe94a175cb5fd4), CONST64(0x2c270b1d45313a58), + CONST64(0xbb5ce7345f8f686b), CONST64(0xc9bc759f1056238f), CONST64(0x9b74ef2c07b7582b), CONST64(0xd0e4345ce18cb8bd), + CONST64(0xc4f53153c697a695), CONST64(0x77a3d4618f16c2ee), CONST64(0x67b7d06da30adace), CONST64(0x22a48697d3b53344), + CONST64(0xe59b7e82556719d7), CONST64(0x8e23adeaeb64c901), CONST64(0xd32efd1aa1c934bb), CONST64(0xa48d297b2edff655), + CONST64(0xc0f03050cd90a09d), CONST64(0xecd73b4d88a19ac5), CONST64(0x46d99fbc30fa658c), CONST64(0xc73ff81586d22a93), + CONST64(0x3ff9c6572968ae7e), CONST64(0x4c5f1335ad796a98), CONST64(0x181e060a3a121430), CONST64(0x1411050f271b1e28), + CONST64(0x33f6c5523461a466), CONST64(0x44551133bb776688), CONST64(0xc1b6779906582f9f), CONST64(0xed917c84436915c7), + CONST64(0xf58f7a8e797b01f7), CONST64(0xfd8578886f750de7), CONST64(0xd8ee365af782b4ad), CONST64(0x706c1c24c45448e0), + CONST64(0xe4dd394b9eaf96d5), CONST64(0x792059eb1992cbf2), CONST64(0x60781828e84850c0), CONST64(0x451356fa70bfe98a), + CONST64(0xf645b3c8393e8df1), CONST64(0xfa4ab0cd243787e9), CONST64(0x90b4246c51fcd83d), CONST64(0x80a020607de0c01d), + CONST64(0xf240b2cb32398bf9), CONST64(0x72e092ab4fd94be4), CONST64(0xb615a3f8894eed71), CONST64(0x27e7c05d137aba4e), + CONST64(0x0d4944ccd6c1851a), CONST64(0x95f762a691335137), CONST64(0x40501030b0706080), CONST64(0xea5eb4c1082b9fc9), + CONST64(0x2aae8491c5bb3f54), CONST64(0x115243c5e7d49722), CONST64(0x76e593a844de4dec), CONST64(0x2fedc25b0574b65e), + CONST64(0x357f4adeb4eba16a), CONST64(0xce73bdda5b14a981), CONST64(0x06898f8c808a050c), CONST64(0xb4992d7702c3ee75), + CONST64(0xca76bcd95013af89), CONST64(0x4ad69cb92df36f94), CONST64(0xb5df6abec90b6177), CONST64(0x1d5d40c0fadd9d3a), + CONST64(0x1bd4cf4c7a579836), CONST64(0xb210a2fb8249eb79), CONST64(0x3aba809de9a72774), CONST64(0x216e4fd193f0bf42), + CONST64(0x7c631f21d95d42f8), CONST64(0x0fc5ca435d4c861e), CONST64(0x9238aae3da71db39), CONST64(0x155742c6ecd3912a), +}; + +static const ulong64 T3[256] = { + CONST64(0x68d2d3ba016ab9bb), CONST64(0x194dfc54b1669ae5), CONST64(0x93bc712fcd1465e2), CONST64(0xb9cd9c74511b8725), + CONST64(0x0251f553a457a2f7), CONST64(0xb86b68d303bed6d0), CONST64(0xbd6f6bd204b5ded6), CONST64(0x6429d74dfe8552b3), + CONST64(0x0d5df050ad4abafd), CONST64(0x268ae9ac63e009cf), CONST64(0x830e8a8d84961c09), CONST64(0x79c6dcbf1a4d91a5), + CONST64(0xaddd90704d37a73d), CONST64(0x0755f652a35caaf1), CONST64(0xc852b39ae117a47b), CONST64(0x612dd44cf98e5ab5), + CONST64(0x658f23eaac200346), CONST64(0xa67362d51184e6c4), CONST64(0xf166a497c268cc55), CONST64(0xb2636ed10da8c6dc), + CONST64(0xffcc553399d085aa), CONST64(0x0859f351aa41b2fb), CONST64(0x2a71ed5b9c0fe2c7), CONST64(0x04a2f7a655ae59f3), + CONST64(0x815f7fde20c1befe), CONST64(0x753dd848e5a27aad), CONST64(0x329ae5a87fcc29d7), CONST64(0xc75eb699e80abc71), + CONST64(0x904b70db3be696e0), CONST64(0xfac856329edb8dac), CONST64(0x51e6c4b72215d195), CONST64(0x2bd719fcceaab332), + CONST64(0x48ab38e393734b70), CONST64(0xdc42bf9efd3b8463), CONST64(0xef7eae91d052fc41), CONST64(0xcd56b09be61cac7d), + CONST64(0x4daf3be294784376), CONST64(0x6dd6d0bb0661b1bd), CONST64(0x5819c341daf1329b), CONST64(0xcba5b26e17e55779), + CONST64(0x0baef2a55cb341f9), CONST64(0xc00b40cb4b561680), CONST64(0xdab1bd6b0cc27f67), CONST64(0xfb6ea295cc7edc59), + CONST64(0x1fbefea1409f61e1), CONST64(0x18eb08f3e3c3cb10), CONST64(0x4ffeceb1302fe181), CONST64(0x0a0806020e16100c), + CONST64(0xdb1749cc5e672e92), CONST64(0xf33751c4663f6ea2), CONST64(0x6974271d53cfe84e), CONST64(0x44503c146c9ca078), + CONST64(0xe82b58c3730e56b0), CONST64(0xf291a563349a3f57), CONST64(0x954f73da3ced9ee6), CONST64(0x3469e75d8e35d2d3), + CONST64(0x3e61e15f8023c2df), CONST64(0x8b5779dc2ed7aef2), CONST64(0x94e9877d6e48cf13), CONST64(0xde134acd596c2694), + CONST64(0x9ee1817f605edf1f), CONST64(0x2f75ee5a9b04eac1), CONST64(0xc1adb46c19f34775), CONST64(0x316de45c893edad5), + CONST64(0x0cfb04f7ffefeb08), CONST64(0xbe986a26f2472dd4), CONST64(0x24db1cffc7b7ab38), CONST64(0x7e932aedb9113b54), + CONST64(0x6f8725e8a236134a), CONST64(0xd34eba9df4269c69), CONST64(0xcea1b16f10ee5f7f), CONST64(0x8c028f8e8d8b0403), + CONST64(0x7d642b194fe3c856), CONST64(0x1abafda0479469e7), CONST64(0x17e70df0eaded31a), CONST64(0x971e868998ba3c11), + CONST64(0x333c110f2d697822), CONST64(0x1b1c090715313812), CONST64(0x2986ecaf6afd11c5), CONST64(0x30cb10fbdb9b8b20), + CONST64(0x2820180838584030), CONST64(0x41543f156b97a87e), CONST64(0x3934170d237f682e), CONST64(0x14100c041c2c2018), + CONST64(0x05040301070b0806), CONST64(0xe98dac6421ab0745), CONST64(0x845b7cdf27cab6f8), CONST64(0xb3c59a765f0d9729), + CONST64(0x80f98b797264ef0b), CONST64(0x8e537add29dca6f4), CONST64(0xc9f4473db3b2f58e), CONST64(0x4e583a16628ab074), + CONST64(0xc3fc413fbda4e582), CONST64(0xebdc593785fca5b2), CONST64(0xc4a9b76d1ef84f73), CONST64(0xd8e04838a895dd90), + CONST64(0x67ded6b90877a1b1), CONST64(0xa2d19573442abf37), CONST64(0x6a8326e9a53d1b4c), CONST64(0xe1d45f358beab5be), + CONST64(0x1c49ff55b66d92e3), CONST64(0xa8d993714a3caf3b), CONST64(0x8af18d7b7c72ff07), CONST64(0x860a898c839d140f), + CONST64(0xa7d596724321b731), CONST64(0x921a85889fb13417), CONST64(0x09ff07f6f8e4e30e), CONST64(0x82a87e2ad6334dfc), + CONST64(0xc6f8423ebaafed84), CONST64(0x3b65e25e8728cad9), CONST64(0xbb9c6927f54c25d2), CONST64(0x4305ca46cfc00a89), + CONST64(0x3c30140c24746028), CONST64(0xec89af6526a00f43), CONST64(0xd5bdb86805df676d), CONST64(0xf899a3613a8c2f5b), + CONST64(0x0f0c0503091d180a), CONST64(0xe2235ec17d1846bc), CONST64(0x1641f957b87b82ef), CONST64(0xa97f67d61899fece), + CONST64(0x9a4376d935f086ec), CONST64(0x257de8589512facd), CONST64(0x9f4775d832fb8eea), CONST64(0xe385aa662fbd1749), + CONST64(0xac7b64d71f92f6c8), CONST64(0xd2e84e3aa683cd9c), CONST64(0xcf0745c8424b0e8a), CONST64(0xccf0443cb4b9fd88), + CONST64(0x35cf13fadc908326), CONST64(0xf462a796c563c453), CONST64(0x01a6f4a752a551f5), CONST64(0xc25ab598ef01b477), + CONST64(0x7b9729ecbe1a3352), CONST64(0x62dad5b80f7ca9b7), CONST64(0xfc3b54c76f2276a8), CONST64(0x2c82efae6df619c3), + CONST64(0xd0b9bb6902d46f6b), CONST64(0x7a31dd4becbf62a7), CONST64(0x3d96e0ab76d131dd), CONST64(0x379ee6a978c721d1), + CONST64(0xe681a96728b61f4f), CONST64(0x22281e0a364e503c), CONST64(0x4601c947c8cb028f), CONST64(0x1def0bf2e4c8c316), + CONST64(0x5beec2b52c03c199), CONST64(0xaa886622ee6b0dcc), CONST64(0x56b332e581497b64), CONST64(0x719f2feeb00c235e), + CONST64(0x7cc2dfbe1d4699a3), CONST64(0x87ac7d2bd13845fa), CONST64(0xbf3e9e81a0e27c21), CONST64(0x5a4836127ea6906c), + CONST64(0xb5369883aef46c2d), CONST64(0x776c2d1b41f5d85a), CONST64(0x3638120e2a627024), CONST64(0xaf8c6523e96005ca), + CONST64(0x06f302f5f1f9fb04), CONST64(0x4c09cf45c6dd1283), CONST64(0xa5846321e77615c6), CONST64(0xd11f4fce50713e9e), + CONST64(0x7039db49e2a972ab), CONST64(0x9cb0742cc4097de8), CONST64(0x3ac316f9d58d9b2c), CONST64(0x59bf37e68854636e), + CONST64(0x54e2c7b6251ed993), CONST64(0x88a07828d8255df0), CONST64(0x4b5c39176581b872), CONST64(0xb0329b82a9ff642b), + CONST64(0x72682e1a46fed05c), CONST64(0x9d16808b96ac2c1d), CONST64(0x21df1ffec0bca33e), CONST64(0x9812838a91a7241b), + CONST64(0x2d241b093f534836), CONST64(0xca0346c94540068c), CONST64(0xa1269487b2d84c35), CONST64(0x6b25d24ef7984ab9), + CONST64(0x42a33ee19d655b7c), CONST64(0x96b8722eca1f6de4), CONST64(0x53b731e486427362), CONST64(0x47a73de09a6e537a), + CONST64(0x608b20ebab2b0b40), CONST64(0xea7aad90d759f447), CONST64(0x0eaaf1a45bb849ff), CONST64(0x6678221e5ad2f044), + CONST64(0xab2e9285bcce5c39), CONST64(0xfd9da0603d87275d), CONST64(0x0000000000000000), CONST64(0xb1946f25fb5a35de), + CONST64(0x03f701f4f6f2f302), CONST64(0x12e30ef1edd5db1c), CONST64(0xfe6aa194cb75d45f), CONST64(0x272c1d0b3145583a), + CONST64(0x5cbb34e78f5f6b68), CONST64(0xbcc99f7556108f23), CONST64(0x749b2cefb7072b58), CONST64(0xe4d05c348ce1bdb8), + CONST64(0xf5c4533197c695a6), CONST64(0xa37761d4168feec2), CONST64(0xb7676dd00aa3ceda), CONST64(0xa4229786b5d34433), + CONST64(0x9be5827e6755d719), CONST64(0x238eeaad64eb01c9), CONST64(0x2ed31afdc9a1bb34), CONST64(0x8da47b29df2e55f6), + CONST64(0xf0c0503090cd9da0), CONST64(0xd7ec4d3ba188c59a), CONST64(0xd946bc9ffa308c65), CONST64(0x3fc715f8d286932a), + CONST64(0xf93f57c668297eae), CONST64(0x5f4c351379ad986a), CONST64(0x1e180a06123a3014), CONST64(0x11140f051b27281e), + CONST64(0xf63352c5613466a4), CONST64(0x5544331177bb8866), CONST64(0xb6c1997758069f2f), CONST64(0x91ed847c6943c715), + CONST64(0x8ff58e7a7b79f701), CONST64(0x85fd8878756fe70d), CONST64(0xeed85a3682f7adb4), CONST64(0x6c70241c54c4e048), + CONST64(0xdde44b39af9ed596), CONST64(0x2079eb599219f2cb), CONST64(0x7860281848e8c050), CONST64(0x1345fa56bf708ae9), + CONST64(0x45f6c8b33e39f18d), CONST64(0x4afacdb03724e987), CONST64(0xb4906c24fc513dd8), CONST64(0xa0806020e07d1dc0), + CONST64(0x40f2cbb23932f98b), CONST64(0xe072ab92d94fe44b), CONST64(0x15b6f8a34e8971ed), CONST64(0xe7275dc07a134eba), + CONST64(0x490dcc44c1d61a85), CONST64(0xf795a66233913751), CONST64(0x5040301070b08060), CONST64(0x5eeac1b42b08c99f), + CONST64(0xae2a9184bbc5543f), CONST64(0x5211c543d4e72297), CONST64(0xe576a893de44ec4d), CONST64(0xed2f5bc274055eb6), + CONST64(0x7f35de4aebb46aa1), CONST64(0x73cedabd145b81a9), CONST64(0x89068c8f8a800c05), CONST64(0x99b4772dc30275ee), + CONST64(0x76cad9bc135089af), CONST64(0xd64ab99cf32d946f), CONST64(0xdfb5be6a0bc97761), CONST64(0x5d1dc040ddfa3a9d), + CONST64(0xd41b4ccf577a3698), CONST64(0x10b2fba2498279eb), CONST64(0xba3a9d80a7e97427), CONST64(0x6e21d14ff09342bf), + CONST64(0x637c211f5dd9f842), CONST64(0xc50f43ca4c5d1e86), CONST64(0x3892e3aa71da39db), CONST64(0x5715c642d3ec2a91), +}; + +static const ulong64 T4[256] = { + CONST64(0xbbb96a01bad3d268), CONST64(0xe59a66b154fc4d19), CONST64(0xe26514cd2f71bc93), CONST64(0x25871b51749ccdb9), + CONST64(0xf7a257a453f55102), CONST64(0xd0d6be03d3686bb8), CONST64(0xd6deb504d26b6fbd), CONST64(0xb35285fe4dd72964), + CONST64(0xfdba4aad50f05d0d), CONST64(0xcf09e063ace98a26), CONST64(0x091c96848d8a0e83), CONST64(0xa5914d1abfdcc679), + CONST64(0x3da7374d7090ddad), CONST64(0xf1aa5ca352f65507), CONST64(0x7ba417e19ab352c8), CONST64(0xb55a8ef94cd42d61), + CONST64(0x460320acea238f65), CONST64(0xc4e68411d56273a6), CONST64(0x55cc68c297a466f1), CONST64(0xdcc6a80dd16e63b2), + CONST64(0xaa85d0993355ccff), CONST64(0xfbb241aa51f35908), CONST64(0xc7e20f9c5bed712a), CONST64(0xf359ae55a6f7a204), + CONST64(0xfebec120de7f5f81), CONST64(0xad7aa2e548d83d75), CONST64(0xd729cc7fa8e59a32), CONST64(0x71bc0ae899b65ec7), + CONST64(0xe096e63bdb704b90), CONST64(0xac8ddb9e3256c8fa), CONST64(0x95d11522b7c4e651), CONST64(0x32b3aacefc19d72b), + CONST64(0x704b7393e338ab48), CONST64(0x63843bfd9ebf42dc), CONST64(0x41fc52d091ae7eef), CONST64(0x7dac1ce69bb056cd), + CONST64(0x76437894e23baf4d), CONST64(0xbdb16106bbd0d66d), CONST64(0x9b32f1da41c31958), CONST64(0x7957e5176eb2a5cb), + CONST64(0xf941b35ca5f2ae0b), CONST64(0x8016564bcb400bc0), CONST64(0x677fc20c6bbdb1da), CONST64(0x59dc7ecc95a26efb), + CONST64(0xe1619f40a1febe1f), CONST64(0x10cbc3e3f308eb18), CONST64(0x81e12f30b1cefe4f), CONST64(0x0c10160e0206080a), + CONST64(0x922e675ecc4917db), CONST64(0xa26e3f66c45137f3), CONST64(0x4ee8cf531d277469), CONST64(0x78a09c6c143c5044), + CONST64(0xb0560e73c3582be8), CONST64(0x573f9a3463a591f2), CONST64(0xe69eed3cda734f95), CONST64(0xd3d2358e5de76934), + CONST64(0xdfc223805fe1613e), CONST64(0xf2aed72edc79578b), CONST64(0x13cf486e7d87e994), CONST64(0x94266c59cd4a13de), + CONST64(0x1fdf5e607f81e19e), CONST64(0xc1ea049b5aee752f), CONST64(0x7547f3196cb4adc1), CONST64(0xd5da3e895ce46d31), + CONST64(0x08ebeffff704fb0c), CONST64(0xd42d47f2266a98be), CONST64(0x38abb7c7ff1cdb24), CONST64(0x543b11b9ed2a937e), + CONST64(0x4a1336a2e825876f), CONST64(0x699c26f49dba4ed3), CONST64(0x7f5fee106fb1a1ce), CONST64(0x03048b8d8e8f028c), + CONST64(0x56c8e34f192b647d), CONST64(0xe7699447a0fdba1a), CONST64(0x1ad3deeaf00de717), CONST64(0x113cba9889861e97), + CONST64(0x2278692d0f113c33), CONST64(0x1238311507091c1b), CONST64(0xc511fd6aafec8629), CONST64(0x208b9bdbfb10cb30), + CONST64(0x3040583808182028), CONST64(0x7ea8976b153f5441), CONST64(0x2e687f230d173439), CONST64(0x18202c1c040c1014), + CONST64(0x06080b0701030405), CONST64(0x4507ab2164ac8de9), CONST64(0xf8b6ca27df7c5b84), CONST64(0x29970d5f769ac5b3), + CONST64(0x0bef6472798bf980), CONST64(0xf4a6dc29dd7a538e), CONST64(0x8ef5b2b33d47f4c9), CONST64(0x74b08a62163a584e), + CONST64(0x82e5a4bd3f41fcc3), CONST64(0xb2a5fc853759dceb), CONST64(0x734ff81e6db7a9c4), CONST64(0x90dd95a83848e0d8), + CONST64(0xb1a17708b9d6de67), CONST64(0x37bf2a447395d1a2), CONST64(0x4c1b3da5e926836a), CONST64(0xbeb5ea8b355fd4e1), + CONST64(0xe3926db655ff491c), CONST64(0x3baf3c4a7193d9a8), CONST64(0x07ff727c7b8df18a), CONST64(0x0f149d838c890a86), + CONST64(0x31b721437296d5a7), CONST64(0x1734b19f88851a92), CONST64(0x0ee3e4f8f607ff09), CONST64(0xfc4d33d62a7ea882), + CONST64(0x84edafba3e42f8c6), CONST64(0xd9ca28875ee2653b), CONST64(0xd2254cf527699cbb), CONST64(0x890ac0cf46ca0543), + CONST64(0x286074240c14303c), CONST64(0x430fa02665af89ec), CONST64(0x6d67df0568b8bdd5), CONST64(0x5b2f8c3a61a399f8), + CONST64(0x0a181d0903050c0f), CONST64(0xbc46187dc15e23e2), CONST64(0xef827bb857f94116), CONST64(0xcefe9918d6677fa9), + CONST64(0xec86f035d976439a), CONST64(0xcdfa129558e87d25), CONST64(0xea8efb32d875479f), CONST64(0x4917bd2f66aa85e3), + CONST64(0xc8f6921fd7647bac), CONST64(0x9ccd83a63a4ee8d2), CONST64(0x8a0e4b42c84507cf), CONST64(0x88fdb9b43c44f0cc), + CONST64(0x268390dcfa13cf35), CONST64(0x53c463c596a762f4), CONST64(0xf551a552a7f4a601), CONST64(0x77b401ef98b55ac2), + CONST64(0x52331abeec29977b), CONST64(0xb7a97c0fb8d5da62), CONST64(0xa876226fc7543bfc), CONST64(0xc319f66daeef822c), + CONST64(0x6b6fd40269bbb9d0), CONST64(0xa762bfec4bdd317a), CONST64(0xdd31d176abe0963d), CONST64(0xd121c778a9e69e37), + CONST64(0x4f1fb62867a981e6), CONST64(0x3c504e360a1e2822), CONST64(0x8f02cbc847c90146), CONST64(0x16c3c8e4f20bef1d), + CONST64(0x99c1032cb5c2ee5b), CONST64(0xcc0d6bee226688aa), CONST64(0x647b4981e532b356), CONST64(0x5e230cb0ee2f9f71), + CONST64(0xa399461dbedfc27c), CONST64(0xfa4538d12b7dac87), CONST64(0x217ce2a0819e3ebf), CONST64(0x6c90a67e1236485a), + CONST64(0x2d6cf4ae839836b5), CONST64(0x5ad8f5411b2d6c77), CONST64(0x2470622a0e123836), CONST64(0xca0560e923658caf), + CONST64(0x04fbf9f1f502f306), CONST64(0x8312ddc645cf094c), CONST64(0xc61576e7216384a5), CONST64(0x9e3e7150ce4f1fd1), + CONST64(0xab72a9e249db3970), CONST64(0xe87d09c42c74b09c), CONST64(0x2c9b8dd5f916c33a), CONST64(0x6e635488e637bf59), + CONST64(0x93d91e25b6c7e254), CONST64(0xf05d25d82878a088), CONST64(0x72b8816517395c4b), CONST64(0x2b64ffa9829b32b0), + CONST64(0x5cd0fe461a2e6872), CONST64(0x1d2cac968b80169d), CONST64(0x3ea3bcc0fe1fdf21), CONST64(0x1b24a7918a831298), + CONST64(0x3648533f091b242d), CONST64(0x8c064045c94603ca), CONST64(0x354cd8b2879426a1), CONST64(0xb94a98f74ed2256b), + CONST64(0x7c5b659de13ea342), CONST64(0xe46d1fca2e72b896), CONST64(0x62734286e431b753), CONST64(0x7a536e9ae03da747), + CONST64(0x400b2babeb208b60), CONST64(0x47f459d790ad7aea), CONST64(0xff49b85ba4f1aa0e), CONST64(0x44f0d25a1e227866), + CONST64(0x395ccebc85922eab), CONST64(0x5d27873d60a09dfd), CONST64(0x0000000000000000), CONST64(0xde355afb256f94b1), + CONST64(0x02f3f2f6f401f703), CONST64(0x1cdbd5edf10ee312), CONST64(0x5fd475cb94a16afe), CONST64(0x3a5845310b1d2c27), + CONST64(0x686b5f8fe734bb5c), CONST64(0x238f1056759fc9bc), CONST64(0x582b07b7ef2c9b74), CONST64(0xb8bde18c345cd0e4), + CONST64(0xa695c6973153c4f5), CONST64(0xc2ee8f16d46177a3), CONST64(0xdacea30ad06d67b7), CONST64(0x3344d3b5869722a4), + CONST64(0x19d755677e82e59b), CONST64(0xc901eb64adea8e23), CONST64(0x34bba1c9fd1ad32e), CONST64(0xf6552edf297ba48d), + CONST64(0xa09dcd903050c0f0), CONST64(0x9ac588a13b4decd7), CONST64(0x658c30fa9fbc46d9), CONST64(0x2a9386d2f815c73f), + CONST64(0xae7e2968c6573ff9), CONST64(0x6a98ad7913354c5f), CONST64(0x14303a12060a181e), CONST64(0x1e28271b050f1411), + CONST64(0xa4663461c55233f6), CONST64(0x6688bb7711334455), CONST64(0x2f9f06587799c1b6), CONST64(0x15c743697c84ed91), + CONST64(0x01f7797b7a8ef58f), CONST64(0x0de76f757888fd85), CONST64(0xb4adf782365ad8ee), CONST64(0x48e0c4541c24706c), + CONST64(0x96d59eaf394be4dd), CONST64(0xcbf2199259eb7920), CONST64(0x50c0e84818286078), CONST64(0xe98a70bf56fa4513), + CONST64(0x8df1393eb3c8f645), CONST64(0x87e92437b0cdfa4a), CONST64(0xd83d51fc246c90b4), CONST64(0xc01d7de0206080a0), + CONST64(0x8bf93239b2cbf240), CONST64(0x4be44fd992ab72e0), CONST64(0xed71894ea3f8b615), CONST64(0xba4e137ac05d27e7), + CONST64(0x851ad6c144cc0d49), CONST64(0x5137913362a695f7), CONST64(0x6080b07010304050), CONST64(0x9fc9082bb4c1ea5e), + CONST64(0x3f54c5bb84912aae), CONST64(0x9722e7d443c51152), CONST64(0x4dec44de93a876e5), CONST64(0xb65e0574c25b2fed), + CONST64(0xa16ab4eb4ade357f), CONST64(0xa9815b14bddace73), CONST64(0x050c808a8f8c0689), CONST64(0xee7502c32d77b499), + CONST64(0xaf895013bcd9ca76), CONST64(0x6f942df39cb94ad6), CONST64(0x6177c90b6abeb5df), CONST64(0x9d3afadd40c01d5d), + CONST64(0x98367a57cf4c1bd4), CONST64(0xeb798249a2fbb210), CONST64(0x2774e9a7809d3aba), CONST64(0xbf4293f04fd1216e), + CONST64(0x42f8d95d1f217c63), CONST64(0x861e5d4cca430fc5), CONST64(0xdb39da71aae39238), CONST64(0x912aecd342c61557), +}; + +static const ulong64 T5[256] = { + CONST64(0xb9bb016ad3ba68d2), CONST64(0x9ae5b166fc54194d), CONST64(0x65e2cd14712f93bc), CONST64(0x8725511b9c74b9cd), + CONST64(0xa2f7a457f5530251), CONST64(0xd6d003be68d3b86b), CONST64(0xded604b56bd2bd6f), CONST64(0x52b3fe85d74d6429), + CONST64(0xbafdad4af0500d5d), CONST64(0x09cf63e0e9ac268a), CONST64(0x1c0984968a8d830e), CONST64(0x91a51a4ddcbf79c6), + CONST64(0xa73d4d379070addd), CONST64(0xaaf1a35cf6520755), CONST64(0xa47be117b39ac852), CONST64(0x5ab5f98ed44c612d), + CONST64(0x0346ac2023ea658f), CONST64(0xe6c4118462d5a673), CONST64(0xcc55c268a497f166), CONST64(0xc6dc0da86ed1b263), + CONST64(0x85aa99d05533ffcc), CONST64(0xb2fbaa41f3510859), CONST64(0xe2c79c0fed5b2a71), CONST64(0x59f355aef7a604a2), + CONST64(0xbefe20c17fde815f), CONST64(0x7aade5a2d848753d), CONST64(0x29d77fcce5a8329a), CONST64(0xbc71e80ab699c75e), + CONST64(0x96e03be670db904b), CONST64(0x8dac9edb5632fac8), CONST64(0xd1952215c4b751e6), CONST64(0xb332ceaa19fc2bd7), + CONST64(0x4b70937338e348ab), CONST64(0x8463fd3bbf9edc42), CONST64(0xfc41d052ae91ef7e), CONST64(0xac7de61cb09bcd56), + CONST64(0x437694783be24daf), CONST64(0xb1bd0661d0bb6dd6), CONST64(0x329bdaf1c3415819), CONST64(0x577917e5b26ecba5), + CONST64(0x41f95cb3f2a50bae), CONST64(0x16804b5640cbc00b), CONST64(0x7f670cc2bd6bdab1), CONST64(0xdc59cc7ea295fb6e), + CONST64(0x61e1409ffea11fbe), CONST64(0xcb10e3c308f318eb), CONST64(0xe181302fceb14ffe), CONST64(0x100c0e1606020a08), + CONST64(0x2e925e6749ccdb17), CONST64(0x6ea2663f51c4f337), CONST64(0xe84e53cf271d6974), CONST64(0xa0786c9c3c144450), + CONST64(0x56b0730e58c3e82b), CONST64(0x3f57349aa563f291), CONST64(0x9ee63ced73da954f), CONST64(0xd2d38e35e75d3469), + CONST64(0xc2df8023e15f3e61), CONST64(0xaef22ed779dc8b57), CONST64(0xcf136e48877d94e9), CONST64(0x2694596c4acdde13), + CONST64(0xdf1f605e817f9ee1), CONST64(0xeac19b04ee5a2f75), CONST64(0x477519f3b46cc1ad), CONST64(0xdad5893ee45c316d), + CONST64(0xeb08ffef04f70cfb), CONST64(0x2dd4f2476a26be98), CONST64(0xab38c7b71cff24db), CONST64(0x3b54b9112aed7e93), + CONST64(0x134aa23625e86f87), CONST64(0x9c69f426ba9dd34e), CONST64(0x5f7f10eeb16fcea1), CONST64(0x04038d8b8f8e8c02), + CONST64(0xc8564fe32b197d64), CONST64(0x69e74794fda01aba), CONST64(0xd31aeade0df017e7), CONST64(0x3c1198ba8689971e), + CONST64(0x78222d69110f333c), CONST64(0x3812153109071b1c), CONST64(0x11c56afdecaf2986), CONST64(0x8b20db9b10fb30cb), + CONST64(0x4030385818082820), CONST64(0xa87e6b973f154154), CONST64(0x682e237f170d3934), CONST64(0x20181c2c0c041410), + CONST64(0x0806070b03010504), CONST64(0x074521abac64e98d), CONST64(0xb6f827ca7cdf845b), CONST64(0x97295f0d9a76b3c5), + CONST64(0xef0b72648b7980f9), CONST64(0xa6f429dc7add8e53), CONST64(0xf58eb3b2473dc9f4), CONST64(0xb074628a3a164e58), + CONST64(0xe582bda4413fc3fc), CONST64(0xa5b285fc5937ebdc), CONST64(0x4f731ef8b76dc4a9), CONST64(0xdd90a8954838d8e0), + CONST64(0xa1b10877d6b967de), CONST64(0xbf37442a9573a2d1), CONST64(0x1b4ca53d26e96a83), CONST64(0xb5be8bea5f35e1d4), + CONST64(0x92e3b66dff551c49), CONST64(0xaf3b4a3c9371a8d9), CONST64(0xff077c728d7b8af1), CONST64(0x140f839d898c860a), + CONST64(0xb73143219672a7d5), CONST64(0x34179fb18588921a), CONST64(0xe30ef8e407f609ff), CONST64(0x4dfcd6337e2a82a8), + CONST64(0xed84baaf423ec6f8), CONST64(0xcad98728e25e3b65), CONST64(0x25d2f54c6927bb9c), CONST64(0x0a89cfc0ca464305), + CONST64(0x60282474140c3c30), CONST64(0x0f4326a0af65ec89), CONST64(0x676d05dfb868d5bd), CONST64(0x2f5b3a8ca361f899), + CONST64(0x180a091d05030f0c), CONST64(0x46bc7d185ec1e223), CONST64(0x82efb87bf9571641), CONST64(0xfece189967d6a97f), + CONST64(0x86ec35f076d99a43), CONST64(0xfacd9512e858257d), CONST64(0x8eea32fb75d89f47), CONST64(0x17492fbdaa66e385), + CONST64(0xf6c81f9264d7ac7b), CONST64(0xcd9ca6834e3ad2e8), CONST64(0x0e8a424b45c8cf07), CONST64(0xfd88b4b9443cccf0), + CONST64(0x8326dc9013fa35cf), CONST64(0xc453c563a796f462), CONST64(0x51f552a5f4a701a6), CONST64(0xb477ef01b598c25a), + CONST64(0x3352be1a29ec7b97), CONST64(0xa9b70f7cd5b862da), CONST64(0x76a86f2254c7fc3b), CONST64(0x19c36df6efae2c82), + CONST64(0x6f6b02d4bb69d0b9), CONST64(0x62a7ecbfdd4b7a31), CONST64(0x31dd76d1e0ab3d96), CONST64(0x21d178c7e6a9379e), + CONST64(0x1f4f28b6a967e681), CONST64(0x503c364e1e0a2228), CONST64(0x028fc8cbc9474601), CONST64(0xc316e4c80bf21def), + CONST64(0xc1992c03c2b55bee), CONST64(0x0dccee6b6622aa88), CONST64(0x7b64814932e556b3), CONST64(0x235eb00c2fee719f), + CONST64(0x99a31d46dfbe7cc2), CONST64(0x45fad1387d2b87ac), CONST64(0x7c21a0e29e81bf3e), CONST64(0x906c7ea636125a48), + CONST64(0x6c2daef49883b536), CONST64(0xd85a41f52d1b776c), CONST64(0x70242a62120e3638), CONST64(0x05cae9606523af8c), + CONST64(0xfb04f1f902f506f3), CONST64(0x1283c6ddcf454c09), CONST64(0x15c6e7766321a584), CONST64(0x3e9e50714fced11f), + CONST64(0x72abe2a9db497039), CONST64(0x7de8c409742c9cb0), CONST64(0x9b2cd58d16f93ac3), CONST64(0x636e885437e659bf), + CONST64(0xd993251ec7b654e2), CONST64(0x5df0d825782888a0), CONST64(0xb872658139174b5c), CONST64(0x642ba9ff9b82b032), + CONST64(0xd05c46fe2e1a7268), CONST64(0x2c1d96ac808b9d16), CONST64(0xa33ec0bc1ffe21df), CONST64(0x241b91a7838a9812), + CONST64(0x48363f531b092d24), CONST64(0x068c454046c9ca03), CONST64(0x4c35b2d89487a126), CONST64(0x4ab9f798d24e6b25), + CONST64(0x5b7c9d653ee142a3), CONST64(0x6de4ca1f722e96b8), CONST64(0x7362864231e453b7), CONST64(0x537a9a6e3de047a7), + CONST64(0x0b40ab2b20eb608b), CONST64(0xf447d759ad90ea7a), CONST64(0x49ff5bb8f1a40eaa), CONST64(0xf0445ad2221e6678), + CONST64(0x5c39bcce9285ab2e), CONST64(0x275d3d87a060fd9d), CONST64(0x0000000000000000), CONST64(0x35defb5a6f25b194), + CONST64(0xf302f6f201f403f7), CONST64(0xdb1cedd50ef112e3), CONST64(0xd45fcb75a194fe6a), CONST64(0x583a31451d0b272c), + CONST64(0x6b688f5f34e75cbb), CONST64(0x8f2356109f75bcc9), CONST64(0x2b58b7072cef749b), CONST64(0xbdb88ce15c34e4d0), + CONST64(0x95a697c65331f5c4), CONST64(0xeec2168f61d4a377), CONST64(0xceda0aa36dd0b767), CONST64(0x4433b5d39786a422), + CONST64(0xd7196755827e9be5), CONST64(0x01c964ebeaad238e), CONST64(0xbb34c9a11afd2ed3), CONST64(0x55f6df2e7b298da4), + CONST64(0x9da090cd5030f0c0), CONST64(0xc59aa1884d3bd7ec), CONST64(0x8c65fa30bc9fd946), CONST64(0x932ad28615f83fc7), + CONST64(0x7eae682957c6f93f), CONST64(0x986a79ad35135f4c), CONST64(0x3014123a0a061e18), CONST64(0x281e1b270f051114), + CONST64(0x66a4613452c5f633), CONST64(0x886677bb33115544), CONST64(0x9f2f58069977b6c1), CONST64(0xc7156943847c91ed), + CONST64(0xf7017b798e7a8ff5), CONST64(0xe70d756f887885fd), CONST64(0xadb482f75a36eed8), CONST64(0xe04854c4241c6c70), + CONST64(0xd596af9e4b39dde4), CONST64(0xf2cb9219eb592079), CONST64(0xc05048e828187860), CONST64(0x8ae9bf70fa561345), + CONST64(0xf18d3e39c8b345f6), CONST64(0xe9873724cdb04afa), CONST64(0x3dd8fc516c24b490), CONST64(0x1dc0e07d6020a080), + CONST64(0xf98b3932cbb240f2), CONST64(0xe44bd94fab92e072), CONST64(0x71ed4e89f8a315b6), CONST64(0x4eba7a135dc0e727), + CONST64(0x1a85c1d6cc44490d), CONST64(0x37513391a662f795), CONST64(0x806070b030105040), CONST64(0xc99f2b08c1b45eea), + CONST64(0x543fbbc59184ae2a), CONST64(0x2297d4e7c5435211), CONST64(0xec4dde44a893e576), CONST64(0x5eb674055bc2ed2f), + CONST64(0x6aa1ebb4de4a7f35), CONST64(0x81a9145bdabd73ce), CONST64(0x0c058a808c8f8906), CONST64(0x75eec302772d99b4), + CONST64(0x89af1350d9bc76ca), CONST64(0x946ff32db99cd64a), CONST64(0x77610bc9be6adfb5), CONST64(0x3a9dddfac0405d1d), + CONST64(0x3698577a4ccfd41b), CONST64(0x79eb4982fba210b2), CONST64(0x7427a7e99d80ba3a), CONST64(0x42bff093d14f6e21), + CONST64(0xf8425dd9211f637c), CONST64(0x1e864c5d43cac50f), CONST64(0x39db71dae3aa3892), CONST64(0x2a91d3ecc6425715), +}; + +static const ulong64 T6[256] = { + CONST64(0x6a01bbb9d268bad3), CONST64(0x66b1e59a4d1954fc), CONST64(0x14cde265bc932f71), CONST64(0x1b512587cdb9749c), + CONST64(0x57a4f7a2510253f5), CONST64(0xbe03d0d66bb8d368), CONST64(0xb504d6de6fbdd26b), CONST64(0x85feb35229644dd7), + CONST64(0x4aadfdba5d0d50f0), CONST64(0xe063cf098a26ace9), CONST64(0x9684091c0e838d8a), CONST64(0x4d1aa591c679bfdc), + CONST64(0x374d3da7ddad7090), CONST64(0x5ca3f1aa550752f6), CONST64(0x17e17ba452c89ab3), CONST64(0x8ef9b55a2d614cd4), + CONST64(0x20ac46038f65ea23), CONST64(0x8411c4e673a6d562), CONST64(0x68c255cc66f197a4), CONST64(0xa80ddcc663b2d16e), + CONST64(0xd099aa85ccff3355), CONST64(0x41aafbb2590851f3), CONST64(0x0f9cc7e2712a5bed), CONST64(0xae55f359a204a6f7), + CONST64(0xc120febe5f81de7f), CONST64(0xa2e5ad7a3d7548d8), CONST64(0xcc7fd7299a32a8e5), CONST64(0x0ae871bc5ec799b6), + CONST64(0xe63be0964b90db70), CONST64(0xdb9eac8dc8fa3256), CONST64(0x152295d1e651b7c4), CONST64(0xaace32b3d72bfc19), + CONST64(0x7393704bab48e338), CONST64(0x3bfd638442dc9ebf), CONST64(0x52d041fc7eef91ae), CONST64(0x1ce67dac56cd9bb0), + CONST64(0x78947643af4de23b), CONST64(0x6106bdb1d66dbbd0), CONST64(0xf1da9b32195841c3), CONST64(0xe5177957a5cb6eb2), + CONST64(0xb35cf941ae0ba5f2), CONST64(0x564b80160bc0cb40), CONST64(0xc20c677fb1da6bbd), CONST64(0x7ecc59dc6efb95a2), + CONST64(0x9f40e161be1fa1fe), CONST64(0xc3e310cbeb18f308), CONST64(0x2f3081e1fe4fb1ce), CONST64(0x160e0c10080a0206), + CONST64(0x675e922e17dbcc49), CONST64(0x3f66a26e37f3c451), CONST64(0xcf534ee874691d27), CONST64(0x9c6c78a05044143c), + CONST64(0x0e73b0562be8c358), CONST64(0x9a34573f91f263a5), CONST64(0xed3ce69e4f95da73), CONST64(0x358ed3d269345de7), + CONST64(0x2380dfc2613e5fe1), CONST64(0xd72ef2ae578bdc79), CONST64(0x486e13cfe9947d87), CONST64(0x6c59942613decd4a), + CONST64(0x5e601fdfe19e7f81), CONST64(0x049bc1ea752f5aee), CONST64(0xf3197547adc16cb4), CONST64(0x3e89d5da6d315ce4), + CONST64(0xefff08ebfb0cf704), CONST64(0x47f2d42d98be266a), CONST64(0xb7c738abdb24ff1c), CONST64(0x11b9543b937eed2a), + CONST64(0x36a24a13876fe825), CONST64(0x26f4699c4ed39dba), CONST64(0xee107f5fa1ce6fb1), CONST64(0x8b8d0304028c8e8f), + CONST64(0xe34f56c8647d192b), CONST64(0x9447e769ba1aa0fd), CONST64(0xdeea1ad3e717f00d), CONST64(0xba98113c1e978986), + CONST64(0x692d22783c330f11), CONST64(0x311512381c1b0709), CONST64(0xfd6ac5118629afec), CONST64(0x9bdb208bcb30fb10), + CONST64(0x5838304020280818), CONST64(0x976b7ea85441153f), CONST64(0x7f232e6834390d17), CONST64(0x2c1c18201014040c), + CONST64(0x0b07060804050103), CONST64(0xab2145078de964ac), CONST64(0xca27f8b65b84df7c), CONST64(0x0d5f2997c5b3769a), + CONST64(0x64720beff980798b), CONST64(0xdc29f4a6538edd7a), CONST64(0xb2b38ef5f4c93d47), CONST64(0x8a6274b0584e163a), + CONST64(0xa4bd82e5fcc33f41), CONST64(0xfc85b2a5dceb3759), CONST64(0xf81e734fa9c46db7), CONST64(0x95a890dde0d83848), + CONST64(0x7708b1a1de67b9d6), CONST64(0x2a4437bfd1a27395), CONST64(0x3da54c1b836ae926), CONST64(0xea8bbeb5d4e1355f), + CONST64(0x6db6e392491c55ff), CONST64(0x3c4a3bafd9a87193), CONST64(0x727c07fff18a7b8d), CONST64(0x9d830f140a868c89), + CONST64(0x214331b7d5a77296), CONST64(0xb19f17341a928885), CONST64(0xe4f80ee3ff09f607), CONST64(0x33d6fc4da8822a7e), + CONST64(0xafba84edf8c63e42), CONST64(0x2887d9ca653b5ee2), CONST64(0x4cf5d2259cbb2769), CONST64(0xc0cf890a054346ca), + CONST64(0x74242860303c0c14), CONST64(0xa026430f89ec65af), CONST64(0xdf056d67bdd568b8), CONST64(0x8c3a5b2f99f861a3), + CONST64(0x1d090a180c0f0305), CONST64(0x187dbc4623e2c15e), CONST64(0x7bb8ef82411657f9), CONST64(0x9918cefe7fa9d667), + CONST64(0xf035ec86439ad976), CONST64(0x1295cdfa7d2558e8), CONST64(0xfb32ea8e479fd875), CONST64(0xbd2f491785e366aa), + CONST64(0x921fc8f67bacd764), CONST64(0x83a69ccde8d23a4e), CONST64(0x4b428a0e07cfc845), CONST64(0xb9b488fdf0cc3c44), + CONST64(0x90dc2683cf35fa13), CONST64(0x63c553c462f496a7), CONST64(0xa552f551a601a7f4), CONST64(0x01ef77b45ac298b5), + CONST64(0x1abe5233977bec29), CONST64(0x7c0fb7a9da62b8d5), CONST64(0x226fa8763bfcc754), CONST64(0xf66dc319822caeef), + CONST64(0xd4026b6fb9d069bb), CONST64(0xbfeca762317a4bdd), CONST64(0xd176dd31963dabe0), CONST64(0xc778d1219e37a9e6), + CONST64(0xb6284f1f81e667a9), CONST64(0x4e363c5028220a1e), CONST64(0xcbc88f02014647c9), CONST64(0xc8e416c3ef1df20b), + CONST64(0x032c99c1ee5bb5c2), CONST64(0x6beecc0d88aa2266), CONST64(0x4981647bb356e532), CONST64(0x0cb05e239f71ee2f), + CONST64(0x461da399c27cbedf), CONST64(0x38d1fa45ac872b7d), CONST64(0xe2a0217c3ebf819e), CONST64(0xa67e6c90485a1236), + CONST64(0xf4ae2d6c36b58398), CONST64(0xf5415ad86c771b2d), CONST64(0x622a247038360e12), CONST64(0x60e9ca058caf2365), + CONST64(0xf9f104fbf306f502), CONST64(0xddc68312094c45cf), CONST64(0x76e7c61584a52163), CONST64(0x71509e3e1fd1ce4f), + CONST64(0xa9e2ab72397049db), CONST64(0x09c4e87db09c2c74), CONST64(0x8dd52c9bc33af916), CONST64(0x54886e63bf59e637), + CONST64(0x1e2593d9e254b6c7), CONST64(0x25d8f05da0882878), CONST64(0x816572b85c4b1739), CONST64(0xffa92b6432b0829b), + CONST64(0xfe465cd068721a2e), CONST64(0xac961d2c169d8b80), CONST64(0xbcc03ea3df21fe1f), CONST64(0xa7911b2412988a83), + CONST64(0x533f3648242d091b), CONST64(0x40458c0603cac946), CONST64(0xd8b2354c26a18794), CONST64(0x98f7b94a256b4ed2), + CONST64(0x659d7c5ba342e13e), CONST64(0x1fcae46db8962e72), CONST64(0x42866273b753e431), CONST64(0x6e9a7a53a747e03d), + CONST64(0x2bab400b8b60eb20), CONST64(0x59d747f47aea90ad), CONST64(0xb85bff49aa0ea4f1), CONST64(0xd25a44f078661e22), + CONST64(0xcebc395c2eab8592), CONST64(0x873d5d279dfd60a0), CONST64(0x0000000000000000), CONST64(0x5afbde3594b1256f), + CONST64(0xf2f602f3f703f401), CONST64(0xd5ed1cdbe312f10e), CONST64(0x75cb5fd46afe94a1), CONST64(0x45313a582c270b1d), + CONST64(0x5f8f686bbb5ce734), CONST64(0x1056238fc9bc759f), CONST64(0x07b7582b9b74ef2c), CONST64(0xe18cb8bdd0e4345c), + CONST64(0xc697a695c4f53153), CONST64(0x8f16c2ee77a3d461), CONST64(0xa30adace67b7d06d), CONST64(0xd3b5334422a48697), + CONST64(0x556719d7e59b7e82), CONST64(0xeb64c9018e23adea), CONST64(0xa1c934bbd32efd1a), CONST64(0x2edff655a48d297b), + CONST64(0xcd90a09dc0f03050), CONST64(0x88a19ac5ecd73b4d), CONST64(0x30fa658c46d99fbc), CONST64(0x86d22a93c73ff815), + CONST64(0x2968ae7e3ff9c657), CONST64(0xad796a984c5f1335), CONST64(0x3a121430181e060a), CONST64(0x271b1e281411050f), + CONST64(0x3461a46633f6c552), CONST64(0xbb77668844551133), CONST64(0x06582f9fc1b67799), CONST64(0x436915c7ed917c84), + CONST64(0x797b01f7f58f7a8e), CONST64(0x6f750de7fd857888), CONST64(0xf782b4add8ee365a), CONST64(0xc45448e0706c1c24), + CONST64(0x9eaf96d5e4dd394b), CONST64(0x1992cbf2792059eb), CONST64(0xe84850c060781828), CONST64(0x70bfe98a451356fa), + CONST64(0x393e8df1f645b3c8), CONST64(0x243787e9fa4ab0cd), CONST64(0x51fcd83d90b4246c), CONST64(0x7de0c01d80a02060), + CONST64(0x32398bf9f240b2cb), CONST64(0x4fd94be472e092ab), CONST64(0x894eed71b615a3f8), CONST64(0x137aba4e27e7c05d), + CONST64(0xd6c1851a0d4944cc), CONST64(0x9133513795f762a6), CONST64(0xb070608040501030), CONST64(0x082b9fc9ea5eb4c1), + CONST64(0xc5bb3f542aae8491), CONST64(0xe7d49722115243c5), CONST64(0x44de4dec76e593a8), CONST64(0x0574b65e2fedc25b), + CONST64(0xb4eba16a357f4ade), CONST64(0x5b14a981ce73bdda), CONST64(0x808a050c06898f8c), CONST64(0x02c3ee75b4992d77), + CONST64(0x5013af89ca76bcd9), CONST64(0x2df36f944ad69cb9), CONST64(0xc90b6177b5df6abe), CONST64(0xfadd9d3a1d5d40c0), + CONST64(0x7a5798361bd4cf4c), CONST64(0x8249eb79b210a2fb), CONST64(0xe9a727743aba809d), CONST64(0x93f0bf42216e4fd1), + CONST64(0xd95d42f87c631f21), CONST64(0x5d4c861e0fc5ca43), CONST64(0xda71db399238aae3), CONST64(0xecd3912a155742c6), +}; + +static const ulong64 T7[256] = { + CONST64(0x016ab9bb68d2d3ba), CONST64(0xb1669ae5194dfc54), CONST64(0xcd1465e293bc712f), CONST64(0x511b8725b9cd9c74), + CONST64(0xa457a2f70251f553), CONST64(0x03bed6d0b86b68d3), CONST64(0x04b5ded6bd6f6bd2), CONST64(0xfe8552b36429d74d), + CONST64(0xad4abafd0d5df050), CONST64(0x63e009cf268ae9ac), CONST64(0x84961c09830e8a8d), CONST64(0x1a4d91a579c6dcbf), + CONST64(0x4d37a73daddd9070), CONST64(0xa35caaf10755f652), CONST64(0xe117a47bc852b39a), CONST64(0xf98e5ab5612dd44c), + CONST64(0xac200346658f23ea), CONST64(0x1184e6c4a67362d5), CONST64(0xc268cc55f166a497), CONST64(0x0da8c6dcb2636ed1), + CONST64(0x99d085aaffcc5533), CONST64(0xaa41b2fb0859f351), CONST64(0x9c0fe2c72a71ed5b), CONST64(0x55ae59f304a2f7a6), + CONST64(0x20c1befe815f7fde), CONST64(0xe5a27aad753dd848), CONST64(0x7fcc29d7329ae5a8), CONST64(0xe80abc71c75eb699), + CONST64(0x3be696e0904b70db), CONST64(0x9edb8dacfac85632), CONST64(0x2215d19551e6c4b7), CONST64(0xceaab3322bd719fc), + CONST64(0x93734b7048ab38e3), CONST64(0xfd3b8463dc42bf9e), CONST64(0xd052fc41ef7eae91), CONST64(0xe61cac7dcd56b09b), + CONST64(0x947843764daf3be2), CONST64(0x0661b1bd6dd6d0bb), CONST64(0xdaf1329b5819c341), CONST64(0x17e55779cba5b26e), + CONST64(0x5cb341f90baef2a5), CONST64(0x4b561680c00b40cb), CONST64(0x0cc27f67dab1bd6b), CONST64(0xcc7edc59fb6ea295), + CONST64(0x409f61e11fbefea1), CONST64(0xe3c3cb1018eb08f3), CONST64(0x302fe1814ffeceb1), CONST64(0x0e16100c0a080602), + CONST64(0x5e672e92db1749cc), CONST64(0x663f6ea2f33751c4), CONST64(0x53cfe84e6974271d), CONST64(0x6c9ca07844503c14), + CONST64(0x730e56b0e82b58c3), CONST64(0x349a3f57f291a563), CONST64(0x3ced9ee6954f73da), CONST64(0x8e35d2d33469e75d), + CONST64(0x8023c2df3e61e15f), CONST64(0x2ed7aef28b5779dc), CONST64(0x6e48cf1394e9877d), CONST64(0x596c2694de134acd), + CONST64(0x605edf1f9ee1817f), CONST64(0x9b04eac12f75ee5a), CONST64(0x19f34775c1adb46c), CONST64(0x893edad5316de45c), + CONST64(0xffefeb080cfb04f7), CONST64(0xf2472dd4be986a26), CONST64(0xc7b7ab3824db1cff), CONST64(0xb9113b547e932aed), + CONST64(0xa236134a6f8725e8), CONST64(0xf4269c69d34eba9d), CONST64(0x10ee5f7fcea1b16f), CONST64(0x8d8b04038c028f8e), + CONST64(0x4fe3c8567d642b19), CONST64(0x479469e71abafda0), CONST64(0xeaded31a17e70df0), CONST64(0x98ba3c11971e8689), + CONST64(0x2d697822333c110f), CONST64(0x153138121b1c0907), CONST64(0x6afd11c52986ecaf), CONST64(0xdb9b8b2030cb10fb), + CONST64(0x3858403028201808), CONST64(0x6b97a87e41543f15), CONST64(0x237f682e3934170d), CONST64(0x1c2c201814100c04), + CONST64(0x070b080605040301), CONST64(0x21ab0745e98dac64), CONST64(0x27cab6f8845b7cdf), CONST64(0x5f0d9729b3c59a76), + CONST64(0x7264ef0b80f98b79), CONST64(0x29dca6f48e537add), CONST64(0xb3b2f58ec9f4473d), CONST64(0x628ab0744e583a16), + CONST64(0xbda4e582c3fc413f), CONST64(0x85fca5b2ebdc5937), CONST64(0x1ef84f73c4a9b76d), CONST64(0xa895dd90d8e04838), + CONST64(0x0877a1b167ded6b9), CONST64(0x442abf37a2d19573), CONST64(0xa53d1b4c6a8326e9), CONST64(0x8beab5bee1d45f35), + CONST64(0xb66d92e31c49ff55), CONST64(0x4a3caf3ba8d99371), CONST64(0x7c72ff078af18d7b), CONST64(0x839d140f860a898c), + CONST64(0x4321b731a7d59672), CONST64(0x9fb13417921a8588), CONST64(0xf8e4e30e09ff07f6), CONST64(0xd6334dfc82a87e2a), + CONST64(0xbaafed84c6f8423e), CONST64(0x8728cad93b65e25e), CONST64(0xf54c25d2bb9c6927), CONST64(0xcfc00a894305ca46), + CONST64(0x247460283c30140c), CONST64(0x26a00f43ec89af65), CONST64(0x05df676dd5bdb868), CONST64(0x3a8c2f5bf899a361), + CONST64(0x091d180a0f0c0503), CONST64(0x7d1846bce2235ec1), CONST64(0xb87b82ef1641f957), CONST64(0x1899fecea97f67d6), + CONST64(0x35f086ec9a4376d9), CONST64(0x9512facd257de858), CONST64(0x32fb8eea9f4775d8), CONST64(0x2fbd1749e385aa66), + CONST64(0x1f92f6c8ac7b64d7), CONST64(0xa683cd9cd2e84e3a), CONST64(0x424b0e8acf0745c8), CONST64(0xb4b9fd88ccf0443c), + CONST64(0xdc90832635cf13fa), CONST64(0xc563c453f462a796), CONST64(0x52a551f501a6f4a7), CONST64(0xef01b477c25ab598), + CONST64(0xbe1a33527b9729ec), CONST64(0x0f7ca9b762dad5b8), CONST64(0x6f2276a8fc3b54c7), CONST64(0x6df619c32c82efae), + CONST64(0x02d46f6bd0b9bb69), CONST64(0xecbf62a77a31dd4b), CONST64(0x76d131dd3d96e0ab), CONST64(0x78c721d1379ee6a9), + CONST64(0x28b61f4fe681a967), CONST64(0x364e503c22281e0a), CONST64(0xc8cb028f4601c947), CONST64(0xe4c8c3161def0bf2), + CONST64(0x2c03c1995beec2b5), CONST64(0xee6b0dccaa886622), CONST64(0x81497b6456b332e5), CONST64(0xb00c235e719f2fee), + CONST64(0x1d4699a37cc2dfbe), CONST64(0xd13845fa87ac7d2b), CONST64(0xa0e27c21bf3e9e81), CONST64(0x7ea6906c5a483612), + CONST64(0xaef46c2db5369883), CONST64(0x41f5d85a776c2d1b), CONST64(0x2a6270243638120e), CONST64(0xe96005caaf8c6523), + CONST64(0xf1f9fb0406f302f5), CONST64(0xc6dd12834c09cf45), CONST64(0xe77615c6a5846321), CONST64(0x50713e9ed11f4fce), + CONST64(0xe2a972ab7039db49), CONST64(0xc4097de89cb0742c), CONST64(0xd58d9b2c3ac316f9), CONST64(0x8854636e59bf37e6), + CONST64(0x251ed99354e2c7b6), CONST64(0xd8255df088a07828), CONST64(0x6581b8724b5c3917), CONST64(0xa9ff642bb0329b82), + CONST64(0x46fed05c72682e1a), CONST64(0x96ac2c1d9d16808b), CONST64(0xc0bca33e21df1ffe), CONST64(0x91a7241b9812838a), + CONST64(0x3f5348362d241b09), CONST64(0x4540068cca0346c9), CONST64(0xb2d84c35a1269487), CONST64(0xf7984ab96b25d24e), + CONST64(0x9d655b7c42a33ee1), CONST64(0xca1f6de496b8722e), CONST64(0x8642736253b731e4), CONST64(0x9a6e537a47a73de0), + CONST64(0xab2b0b40608b20eb), CONST64(0xd759f447ea7aad90), CONST64(0x5bb849ff0eaaf1a4), CONST64(0x5ad2f0446678221e), + CONST64(0xbcce5c39ab2e9285), CONST64(0x3d87275dfd9da060), CONST64(0x0000000000000000), CONST64(0xfb5a35deb1946f25), + CONST64(0xf6f2f30203f701f4), CONST64(0xedd5db1c12e30ef1), CONST64(0xcb75d45ffe6aa194), CONST64(0x3145583a272c1d0b), + CONST64(0x8f5f6b685cbb34e7), CONST64(0x56108f23bcc99f75), CONST64(0xb7072b58749b2cef), CONST64(0x8ce1bdb8e4d05c34), + CONST64(0x97c695a6f5c45331), CONST64(0x168feec2a37761d4), CONST64(0x0aa3cedab7676dd0), CONST64(0xb5d34433a4229786), + CONST64(0x6755d7199be5827e), CONST64(0x64eb01c9238eeaad), CONST64(0xc9a1bb342ed31afd), CONST64(0xdf2e55f68da47b29), + CONST64(0x90cd9da0f0c05030), CONST64(0xa188c59ad7ec4d3b), CONST64(0xfa308c65d946bc9f), CONST64(0xd286932a3fc715f8), + CONST64(0x68297eaef93f57c6), CONST64(0x79ad986a5f4c3513), CONST64(0x123a30141e180a06), CONST64(0x1b27281e11140f05), + CONST64(0x613466a4f63352c5), CONST64(0x77bb886655443311), CONST64(0x58069f2fb6c19977), CONST64(0x6943c71591ed847c), + CONST64(0x7b79f7018ff58e7a), CONST64(0x756fe70d85fd8878), CONST64(0x82f7adb4eed85a36), CONST64(0x54c4e0486c70241c), + CONST64(0xaf9ed596dde44b39), CONST64(0x9219f2cb2079eb59), CONST64(0x48e8c05078602818), CONST64(0xbf708ae91345fa56), + CONST64(0x3e39f18d45f6c8b3), CONST64(0x3724e9874afacdb0), CONST64(0xfc513dd8b4906c24), CONST64(0xe07d1dc0a0806020), + CONST64(0x3932f98b40f2cbb2), CONST64(0xd94fe44be072ab92), CONST64(0x4e8971ed15b6f8a3), CONST64(0x7a134ebae7275dc0), + CONST64(0xc1d61a85490dcc44), CONST64(0x33913751f795a662), CONST64(0x70b0806050403010), CONST64(0x2b08c99f5eeac1b4), + CONST64(0xbbc5543fae2a9184), CONST64(0xd4e722975211c543), CONST64(0xde44ec4de576a893), CONST64(0x74055eb6ed2f5bc2), + CONST64(0xebb46aa17f35de4a), CONST64(0x145b81a973cedabd), CONST64(0x8a800c0589068c8f), CONST64(0xc30275ee99b4772d), + CONST64(0x135089af76cad9bc), CONST64(0xf32d946fd64ab99c), CONST64(0x0bc97761dfb5be6a), CONST64(0xddfa3a9d5d1dc040), + CONST64(0x577a3698d41b4ccf), CONST64(0x498279eb10b2fba2), CONST64(0xa7e97427ba3a9d80), CONST64(0xf09342bf6e21d14f), + CONST64(0x5dd9f842637c211f), CONST64(0x4c5d1e86c50f43ca), CONST64(0x71da39db3892e3aa), CONST64(0xd3ec2a915715c642), +}; + +static const ulong64 c[R + 1] = { + CONST64(0xba542f7453d3d24d), + CONST64(0x50ac8dbf70529a4c), + CONST64(0xead597d133515ba6), + CONST64(0xde48a899db32b7fc), + CONST64(0xe39e919be2bb416e), + CONST64(0xa5cb6b95a1f3b102), + CONST64(0xccc41d14c363da5d), + CONST64(0x5fdc7dcd7f5a6c5c), + CONST64(0xf726ffede89d6f8e), +}; + + /** + Initialize the Khazad block cipher + @param key The symmetric key you wish to pass + @param keylen The key length in bytes + @param num_rounds The number of rounds desired (0 for default) + @param skey The key in as scheduled by this function. + @return CRYPT_OK if successful + */ +int khazad_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey) +{ + int r; + const ulong64 *S; + ulong64 K2, K1; + + LTC_ARGCHK(key != NULL); + LTC_ARGCHK(skey != NULL); + if (keylen != 16) { + return CRYPT_INVALID_KEYSIZE; + } + if (num_rounds != 8 && num_rounds != 0) { + return CRYPT_INVALID_ROUNDS; + } + + /* use 7th table */ + S = T7; + + /* + * map unsigned char array cipher key to initial key state (mu): + */ + K2 = + ((ulong64)key[ 0] << 56) ^ + ((ulong64)key[ 1] << 48) ^ + ((ulong64)key[ 2] << 40) ^ + ((ulong64)key[ 3] << 32) ^ + ((ulong64)key[ 4] << 24) ^ + ((ulong64)key[ 5] << 16) ^ + ((ulong64)key[ 6] << 8) ^ + ((ulong64)key[ 7] ); + K1 = + ((ulong64)key[ 8] << 56) ^ + ((ulong64)key[ 9] << 48) ^ + ((ulong64)key[10] << 40) ^ + ((ulong64)key[11] << 32) ^ + ((ulong64)key[12] << 24) ^ + ((ulong64)key[13] << 16) ^ + ((ulong64)key[14] << 8) ^ + ((ulong64)key[15] ); + + /* + * compute the round keys: + */ + for (r = 0; r <= R; r++) { + /* + * K[r] = rho(c[r], K1) ^ K2; + */ + skey->khazad.roundKeyEnc[r] = + T0[(int)(K1 >> 56) ] ^ + T1[(int)(K1 >> 48) & 0xff] ^ + T2[(int)(K1 >> 40) & 0xff] ^ + T3[(int)(K1 >> 32) & 0xff] ^ + T4[(int)(K1 >> 24) & 0xff] ^ + T5[(int)(K1 >> 16) & 0xff] ^ + T6[(int)(K1 >> 8) & 0xff] ^ + T7[(int)(K1 ) & 0xff] ^ + c[r] ^ K2; + K2 = K1; K1 = skey->khazad.roundKeyEnc[r]; + } + /* + * compute the inverse key schedule: + * K'^0 = K^R, K'^R = K^0, K'^r = theta(K^{R-r}) + */ + skey->khazad.roundKeyDec[0] = skey->khazad.roundKeyEnc[R]; + for (r = 1; r < R; r++) { + K1 = skey->khazad.roundKeyEnc[R - r]; + skey->khazad.roundKeyDec[r] = + T0[(int)S[(int)(K1 >> 56) ] & 0xff] ^ + T1[(int)S[(int)(K1 >> 48) & 0xff] & 0xff] ^ + T2[(int)S[(int)(K1 >> 40) & 0xff] & 0xff] ^ + T3[(int)S[(int)(K1 >> 32) & 0xff] & 0xff] ^ + T4[(int)S[(int)(K1 >> 24) & 0xff] & 0xff] ^ + T5[(int)S[(int)(K1 >> 16) & 0xff] & 0xff] ^ + T6[(int)S[(int)(K1 >> 8) & 0xff] & 0xff] ^ + T7[(int)S[(int)(K1 ) & 0xff] & 0xff]; + } + skey->khazad.roundKeyDec[R] = skey->khazad.roundKeyEnc[0]; + + return CRYPT_OK; +} + +static void khazad_crypt(const unsigned char *plaintext, unsigned char *ciphertext, + const ulong64 *roundKey) { + int r; + ulong64 state; + /* + * map plaintext block to cipher state (mu) + * and add initial round key (sigma[K^0]): + */ + state = + ((ulong64)plaintext[0] << 56) ^ + ((ulong64)plaintext[1] << 48) ^ + ((ulong64)plaintext[2] << 40) ^ + ((ulong64)plaintext[3] << 32) ^ + ((ulong64)plaintext[4] << 24) ^ + ((ulong64)plaintext[5] << 16) ^ + ((ulong64)plaintext[6] << 8) ^ + ((ulong64)plaintext[7] ) ^ + roundKey[0]; + + /* + * R - 1 full rounds: + */ + for (r = 1; r < R; r++) { + state = + T0[(int)(state >> 56) ] ^ + T1[(int)(state >> 48) & 0xff] ^ + T2[(int)(state >> 40) & 0xff] ^ + T3[(int)(state >> 32) & 0xff] ^ + T4[(int)(state >> 24) & 0xff] ^ + T5[(int)(state >> 16) & 0xff] ^ + T6[(int)(state >> 8) & 0xff] ^ + T7[(int)(state ) & 0xff] ^ + roundKey[r]; + } + + /* + * last round: + */ + state = + (T0[(int)(state >> 56) ] & CONST64(0xff00000000000000)) ^ + (T1[(int)(state >> 48) & 0xff] & CONST64(0x00ff000000000000)) ^ + (T2[(int)(state >> 40) & 0xff] & CONST64(0x0000ff0000000000)) ^ + (T3[(int)(state >> 32) & 0xff] & CONST64(0x000000ff00000000)) ^ + (T4[(int)(state >> 24) & 0xff] & CONST64(0x00000000ff000000)) ^ + (T5[(int)(state >> 16) & 0xff] & CONST64(0x0000000000ff0000)) ^ + (T6[(int)(state >> 8) & 0xff] & CONST64(0x000000000000ff00)) ^ + (T7[(int)(state ) & 0xff] & CONST64(0x00000000000000ff)) ^ + roundKey[R]; + + /* + * map cipher state to ciphertext block (mu^{-1}): + */ + ciphertext[0] = (unsigned char)(state >> 56); + ciphertext[1] = (unsigned char)(state >> 48); + ciphertext[2] = (unsigned char)(state >> 40); + ciphertext[3] = (unsigned char)(state >> 32); + ciphertext[4] = (unsigned char)(state >> 24); + ciphertext[5] = (unsigned char)(state >> 16); + ciphertext[6] = (unsigned char)(state >> 8); + ciphertext[7] = (unsigned char)(state ); +} + +/** + Encrypts a block of text with Khazad + @param pt The input plaintext (8 bytes) + @param ct The output ciphertext (8 bytes) + @param skey The key as scheduled + @return CRYPT_OK if successful +*/ +int khazad_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key *skey) +{ + LTC_ARGCHK(pt != NULL); + LTC_ARGCHK(ct != NULL); + LTC_ARGCHK(skey != NULL); + khazad_crypt(pt, ct, skey->khazad.roundKeyEnc); + return CRYPT_OK; +} + +/** + Decrypts a block of text with Khazad + @param ct The input ciphertext (8 bytes) + @param pt The output plaintext (8 bytes) + @param skey The key as scheduled + @return CRYPT_OK if successful +*/ +int khazad_ecb_decrypt(const unsigned char *ct, unsigned char *pt, symmetric_key *skey) +{ + LTC_ARGCHK(pt != NULL); + LTC_ARGCHK(ct != NULL); + LTC_ARGCHK(skey != NULL); + khazad_crypt(ct, pt, skey->khazad.roundKeyDec); + return CRYPT_OK; +} + +/** + Performs a self-test of the Khazad block cipher + @return CRYPT_OK if functional, CRYPT_NOP if self-test has been disabled +*/ +int khazad_test(void) +{ +#ifndef LTC_TEST + return CRYPT_NOP; +#else + static const struct test { + unsigned char pt[8], ct[8], key[16]; + } tests[] = { +{ + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0x49, 0xA4, 0xCE, 0x32, 0xAC, 0x19, 0x0E, 0x3F }, + { 0x80, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 } +}, { + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0x64, 0x5D, 0x77, 0x3E, 0x40, 0xAB, 0xDD, 0x53 }, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x01 } +}, { + { 0x80, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0x9E, 0x39, 0x98, 0x64, 0xF7, 0x8E, 0xCA, 0x02 }, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 } +}, { + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x01 }, + { 0xA9, 0xDF, 0x3D, 0x2C, 0x64, 0xD3, 0xEA, 0x28 }, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 } +} +}; + int x, y; + unsigned char buf[2][8]; + symmetric_key skey; + + for (x = 0; x < (int)(sizeof(tests)/sizeof(tests[0])); x++) { + khazad_setup(tests[x].key, 16, 0, &skey); + khazad_ecb_encrypt(tests[x].pt, buf[0], &skey); + khazad_ecb_decrypt(buf[0], buf[1], &skey); + if (XMEMCMP(buf[0], tests[x].ct, 8) || XMEMCMP(buf[1], tests[x].pt, 8)) { + return CRYPT_FAIL_TESTVECTOR; + } + + for (y = 0; y < 1000; y++) khazad_ecb_encrypt(buf[0], buf[0], &skey); + for (y = 0; y < 1000; y++) khazad_ecb_decrypt(buf[0], buf[0], &skey); + if (XMEMCMP(buf[0], tests[x].ct, 8)) { + return CRYPT_FAIL_TESTVECTOR; + } + + } + return CRYPT_OK; +#endif +} + +/** Terminate the context + @param skey The scheduled key +*/ +void khazad_done(symmetric_key *skey) +{ +} + +/** + Gets suitable key size + @param keysize [in/out] The length of the recommended key (in bytes). This function will store the suitable size back in this variable. + @return CRYPT_OK if the input key size is acceptable. +*/ +int khazad_keysize(int *keysize) +{ + LTC_ARGCHK(keysize != NULL); + if (*keysize >= 16) { + *keysize = 16; + return CRYPT_OK; + } else { + return CRYPT_INVALID_KEYSIZE; + } +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/ciphers/khazad.c,v $ */ +/* $Revision: 1.12 $ */ +/* $Date: 2006/11/08 23:01:06 $ */ diff --git a/libtomcrypt/src/ciphers/kseed.c b/libtomcrypt/src/ciphers/kseed.c new file mode 100644 index 0000000..4281ac5 --- /dev/null +++ b/libtomcrypt/src/ciphers/kseed.c @@ -0,0 +1,376 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ + +/** + @file kseed.c + seed implementation of SEED derived from RFC4269 + Tom St Denis +*/ + +#include "tomcrypt.h" + +#ifdef KSEED + +const struct ltc_cipher_descriptor kseed_desc = { + "seed", + 20, + 16, 16, 16, 16, + &kseed_setup, + &kseed_ecb_encrypt, + &kseed_ecb_decrypt, + &kseed_test, + &kseed_done, + &kseed_keysize, + NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL +}; + +static const ulong32 SS0[256] = { +0x2989A1A8UL,0x05858184UL,0x16C6D2D4UL,0x13C3D3D0UL,0x14445054UL,0x1D0D111CUL,0x2C8CA0ACUL,0x25052124UL, +0x1D4D515CUL,0x03434340UL,0x18081018UL,0x1E0E121CUL,0x11415150UL,0x3CCCF0FCUL,0x0ACAC2C8UL,0x23436360UL, +0x28082028UL,0x04444044UL,0x20002020UL,0x1D8D919CUL,0x20C0E0E0UL,0x22C2E2E0UL,0x08C8C0C8UL,0x17071314UL, +0x2585A1A4UL,0x0F8F838CUL,0x03030300UL,0x3B4B7378UL,0x3B8BB3B8UL,0x13031310UL,0x12C2D2D0UL,0x2ECEE2ECUL, +0x30407070UL,0x0C8C808CUL,0x3F0F333CUL,0x2888A0A8UL,0x32023230UL,0x1DCDD1DCUL,0x36C6F2F4UL,0x34447074UL, +0x2CCCE0ECUL,0x15859194UL,0x0B0B0308UL,0x17475354UL,0x1C4C505CUL,0x1B4B5358UL,0x3D8DB1BCUL,0x01010100UL, +0x24042024UL,0x1C0C101CUL,0x33437370UL,0x18889098UL,0x10001010UL,0x0CCCC0CCUL,0x32C2F2F0UL,0x19C9D1D8UL, +0x2C0C202CUL,0x27C7E3E4UL,0x32427270UL,0x03838380UL,0x1B8B9398UL,0x11C1D1D0UL,0x06868284UL,0x09C9C1C8UL, +0x20406060UL,0x10405050UL,0x2383A3A0UL,0x2BCBE3E8UL,0x0D0D010CUL,0x3686B2B4UL,0x1E8E929CUL,0x0F4F434CUL, +0x3787B3B4UL,0x1A4A5258UL,0x06C6C2C4UL,0x38487078UL,0x2686A2A4UL,0x12021210UL,0x2F8FA3ACUL,0x15C5D1D4UL, +0x21416160UL,0x03C3C3C0UL,0x3484B0B4UL,0x01414140UL,0x12425250UL,0x3D4D717CUL,0x0D8D818CUL,0x08080008UL, +0x1F0F131CUL,0x19899198UL,0x00000000UL,0x19091118UL,0x04040004UL,0x13435350UL,0x37C7F3F4UL,0x21C1E1E0UL, +0x3DCDF1FCUL,0x36467274UL,0x2F0F232CUL,0x27072324UL,0x3080B0B0UL,0x0B8B8388UL,0x0E0E020CUL,0x2B8BA3A8UL, +0x2282A2A0UL,0x2E4E626CUL,0x13839390UL,0x0D4D414CUL,0x29496168UL,0x3C4C707CUL,0x09090108UL,0x0A0A0208UL, +0x3F8FB3BCUL,0x2FCFE3ECUL,0x33C3F3F0UL,0x05C5C1C4UL,0x07878384UL,0x14041014UL,0x3ECEF2FCUL,0x24446064UL, +0x1ECED2DCUL,0x2E0E222CUL,0x0B4B4348UL,0x1A0A1218UL,0x06060204UL,0x21012120UL,0x2B4B6368UL,0x26466264UL, +0x02020200UL,0x35C5F1F4UL,0x12829290UL,0x0A8A8288UL,0x0C0C000CUL,0x3383B3B0UL,0x3E4E727CUL,0x10C0D0D0UL, +0x3A4A7278UL,0x07474344UL,0x16869294UL,0x25C5E1E4UL,0x26062224UL,0x00808080UL,0x2D8DA1ACUL,0x1FCFD3DCUL, +0x2181A1A0UL,0x30003030UL,0x37073334UL,0x2E8EA2ACUL,0x36063234UL,0x15051114UL,0x22022220UL,0x38083038UL, +0x34C4F0F4UL,0x2787A3A4UL,0x05454144UL,0x0C4C404CUL,0x01818180UL,0x29C9E1E8UL,0x04848084UL,0x17879394UL, +0x35053134UL,0x0BCBC3C8UL,0x0ECEC2CCUL,0x3C0C303CUL,0x31417170UL,0x11011110UL,0x07C7C3C4UL,0x09898188UL, +0x35457174UL,0x3BCBF3F8UL,0x1ACAD2D8UL,0x38C8F0F8UL,0x14849094UL,0x19495158UL,0x02828280UL,0x04C4C0C4UL, +0x3FCFF3FCUL,0x09494148UL,0x39093138UL,0x27476364UL,0x00C0C0C0UL,0x0FCFC3CCUL,0x17C7D3D4UL,0x3888B0B8UL, +0x0F0F030CUL,0x0E8E828CUL,0x02424240UL,0x23032320UL,0x11819190UL,0x2C4C606CUL,0x1BCBD3D8UL,0x2484A0A4UL, +0x34043034UL,0x31C1F1F0UL,0x08484048UL,0x02C2C2C0UL,0x2F4F636CUL,0x3D0D313CUL,0x2D0D212CUL,0x00404040UL, +0x3E8EB2BCUL,0x3E0E323CUL,0x3C8CB0BCUL,0x01C1C1C0UL,0x2A8AA2A8UL,0x3A8AB2B8UL,0x0E4E424CUL,0x15455154UL, +0x3B0B3338UL,0x1CCCD0DCUL,0x28486068UL,0x3F4F737CUL,0x1C8C909CUL,0x18C8D0D8UL,0x0A4A4248UL,0x16465254UL, +0x37477374UL,0x2080A0A0UL,0x2DCDE1ECUL,0x06464244UL,0x3585B1B4UL,0x2B0B2328UL,0x25456164UL,0x3ACAF2F8UL, +0x23C3E3E0UL,0x3989B1B8UL,0x3181B1B0UL,0x1F8F939CUL,0x1E4E525CUL,0x39C9F1F8UL,0x26C6E2E4UL,0x3282B2B0UL, +0x31013130UL,0x2ACAE2E8UL,0x2D4D616CUL,0x1F4F535CUL,0x24C4E0E4UL,0x30C0F0F0UL,0x0DCDC1CCUL,0x08888088UL, +0x16061214UL,0x3A0A3238UL,0x18485058UL,0x14C4D0D4UL,0x22426260UL,0x29092128UL,0x07070304UL,0x33033330UL, +0x28C8E0E8UL,0x1B0B1318UL,0x05050104UL,0x39497178UL,0x10809090UL,0x2A4A6268UL,0x2A0A2228UL,0x1A8A9298UL +}; + +static const ulong32 SS1[256] = { +0x38380830UL,0xE828C8E0UL,0x2C2D0D21UL,0xA42686A2UL,0xCC0FCFC3UL,0xDC1ECED2UL,0xB03383B3UL,0xB83888B0UL, +0xAC2F8FA3UL,0x60204060UL,0x54154551UL,0xC407C7C3UL,0x44044440UL,0x6C2F4F63UL,0x682B4B63UL,0x581B4B53UL, +0xC003C3C3UL,0x60224262UL,0x30330333UL,0xB43585B1UL,0x28290921UL,0xA02080A0UL,0xE022C2E2UL,0xA42787A3UL, +0xD013C3D3UL,0x90118191UL,0x10110111UL,0x04060602UL,0x1C1C0C10UL,0xBC3C8CB0UL,0x34360632UL,0x480B4B43UL, +0xEC2FCFE3UL,0x88088880UL,0x6C2C4C60UL,0xA82888A0UL,0x14170713UL,0xC404C4C0UL,0x14160612UL,0xF434C4F0UL, +0xC002C2C2UL,0x44054541UL,0xE021C1E1UL,0xD416C6D2UL,0x3C3F0F33UL,0x3C3D0D31UL,0x8C0E8E82UL,0x98188890UL, +0x28280820UL,0x4C0E4E42UL,0xF436C6F2UL,0x3C3E0E32UL,0xA42585A1UL,0xF839C9F1UL,0x0C0D0D01UL,0xDC1FCFD3UL, +0xD818C8D0UL,0x282B0B23UL,0x64264662UL,0x783A4A72UL,0x24270723UL,0x2C2F0F23UL,0xF031C1F1UL,0x70324272UL, +0x40024242UL,0xD414C4D0UL,0x40014141UL,0xC000C0C0UL,0x70334373UL,0x64274763UL,0xAC2C8CA0UL,0x880B8B83UL, +0xF437C7F3UL,0xAC2D8DA1UL,0x80008080UL,0x1C1F0F13UL,0xC80ACAC2UL,0x2C2C0C20UL,0xA82A8AA2UL,0x34340430UL, +0xD012C2D2UL,0x080B0B03UL,0xEC2ECEE2UL,0xE829C9E1UL,0x5C1D4D51UL,0x94148490UL,0x18180810UL,0xF838C8F0UL, +0x54174753UL,0xAC2E8EA2UL,0x08080800UL,0xC405C5C1UL,0x10130313UL,0xCC0DCDC1UL,0x84068682UL,0xB83989B1UL, +0xFC3FCFF3UL,0x7C3D4D71UL,0xC001C1C1UL,0x30310131UL,0xF435C5F1UL,0x880A8A82UL,0x682A4A62UL,0xB03181B1UL, +0xD011C1D1UL,0x20200020UL,0xD417C7D3UL,0x00020202UL,0x20220222UL,0x04040400UL,0x68284860UL,0x70314171UL, +0x04070703UL,0xD81BCBD3UL,0x9C1D8D91UL,0x98198991UL,0x60214161UL,0xBC3E8EB2UL,0xE426C6E2UL,0x58194951UL, +0xDC1DCDD1UL,0x50114151UL,0x90108090UL,0xDC1CCCD0UL,0x981A8A92UL,0xA02383A3UL,0xA82B8BA3UL,0xD010C0D0UL, +0x80018181UL,0x0C0F0F03UL,0x44074743UL,0x181A0A12UL,0xE023C3E3UL,0xEC2CCCE0UL,0x8C0D8D81UL,0xBC3F8FB3UL, +0x94168692UL,0x783B4B73UL,0x5C1C4C50UL,0xA02282A2UL,0xA02181A1UL,0x60234363UL,0x20230323UL,0x4C0D4D41UL, +0xC808C8C0UL,0x9C1E8E92UL,0x9C1C8C90UL,0x383A0A32UL,0x0C0C0C00UL,0x2C2E0E22UL,0xB83A8AB2UL,0x6C2E4E62UL, +0x9C1F8F93UL,0x581A4A52UL,0xF032C2F2UL,0x90128292UL,0xF033C3F3UL,0x48094941UL,0x78384870UL,0xCC0CCCC0UL, +0x14150511UL,0xF83BCBF3UL,0x70304070UL,0x74354571UL,0x7C3F4F73UL,0x34350531UL,0x10100010UL,0x00030303UL, +0x64244460UL,0x6C2D4D61UL,0xC406C6C2UL,0x74344470UL,0xD415C5D1UL,0xB43484B0UL,0xE82ACAE2UL,0x08090901UL, +0x74364672UL,0x18190911UL,0xFC3ECEF2UL,0x40004040UL,0x10120212UL,0xE020C0E0UL,0xBC3D8DB1UL,0x04050501UL, +0xF83ACAF2UL,0x00010101UL,0xF030C0F0UL,0x282A0A22UL,0x5C1E4E52UL,0xA82989A1UL,0x54164652UL,0x40034343UL, +0x84058581UL,0x14140410UL,0x88098981UL,0x981B8B93UL,0xB03080B0UL,0xE425C5E1UL,0x48084840UL,0x78394971UL, +0x94178793UL,0xFC3CCCF0UL,0x1C1E0E12UL,0x80028282UL,0x20210121UL,0x8C0C8C80UL,0x181B0B13UL,0x5C1F4F53UL, +0x74374773UL,0x54144450UL,0xB03282B2UL,0x1C1D0D11UL,0x24250521UL,0x4C0F4F43UL,0x00000000UL,0x44064642UL, +0xEC2DCDE1UL,0x58184850UL,0x50124252UL,0xE82BCBE3UL,0x7C3E4E72UL,0xD81ACAD2UL,0xC809C9C1UL,0xFC3DCDF1UL, +0x30300030UL,0x94158591UL,0x64254561UL,0x3C3C0C30UL,0xB43686B2UL,0xE424C4E0UL,0xB83B8BB3UL,0x7C3C4C70UL, +0x0C0E0E02UL,0x50104050UL,0x38390931UL,0x24260622UL,0x30320232UL,0x84048480UL,0x68294961UL,0x90138393UL, +0x34370733UL,0xE427C7E3UL,0x24240420UL,0xA42484A0UL,0xC80BCBC3UL,0x50134353UL,0x080A0A02UL,0x84078783UL, +0xD819C9D1UL,0x4C0C4C40UL,0x80038383UL,0x8C0F8F83UL,0xCC0ECEC2UL,0x383B0B33UL,0x480A4A42UL,0xB43787B3UL +}; + +static const ulong32 SS2[256] = { +0xA1A82989UL,0x81840585UL,0xD2D416C6UL,0xD3D013C3UL,0x50541444UL,0x111C1D0DUL,0xA0AC2C8CUL,0x21242505UL, +0x515C1D4DUL,0x43400343UL,0x10181808UL,0x121C1E0EUL,0x51501141UL,0xF0FC3CCCUL,0xC2C80ACAUL,0x63602343UL, +0x20282808UL,0x40440444UL,0x20202000UL,0x919C1D8DUL,0xE0E020C0UL,0xE2E022C2UL,0xC0C808C8UL,0x13141707UL, +0xA1A42585UL,0x838C0F8FUL,0x03000303UL,0x73783B4BUL,0xB3B83B8BUL,0x13101303UL,0xD2D012C2UL,0xE2EC2ECEUL, +0x70703040UL,0x808C0C8CUL,0x333C3F0FUL,0xA0A82888UL,0x32303202UL,0xD1DC1DCDUL,0xF2F436C6UL,0x70743444UL, +0xE0EC2CCCUL,0x91941585UL,0x03080B0BUL,0x53541747UL,0x505C1C4CUL,0x53581B4BUL,0xB1BC3D8DUL,0x01000101UL, +0x20242404UL,0x101C1C0CUL,0x73703343UL,0x90981888UL,0x10101000UL,0xC0CC0CCCUL,0xF2F032C2UL,0xD1D819C9UL, +0x202C2C0CUL,0xE3E427C7UL,0x72703242UL,0x83800383UL,0x93981B8BUL,0xD1D011C1UL,0x82840686UL,0xC1C809C9UL, +0x60602040UL,0x50501040UL,0xA3A02383UL,0xE3E82BCBUL,0x010C0D0DUL,0xB2B43686UL,0x929C1E8EUL,0x434C0F4FUL, +0xB3B43787UL,0x52581A4AUL,0xC2C406C6UL,0x70783848UL,0xA2A42686UL,0x12101202UL,0xA3AC2F8FUL,0xD1D415C5UL, +0x61602141UL,0xC3C003C3UL,0xB0B43484UL,0x41400141UL,0x52501242UL,0x717C3D4DUL,0x818C0D8DUL,0x00080808UL, +0x131C1F0FUL,0x91981989UL,0x00000000UL,0x11181909UL,0x00040404UL,0x53501343UL,0xF3F437C7UL,0xE1E021C1UL, +0xF1FC3DCDUL,0x72743646UL,0x232C2F0FUL,0x23242707UL,0xB0B03080UL,0x83880B8BUL,0x020C0E0EUL,0xA3A82B8BUL, +0xA2A02282UL,0x626C2E4EUL,0x93901383UL,0x414C0D4DUL,0x61682949UL,0x707C3C4CUL,0x01080909UL,0x02080A0AUL, +0xB3BC3F8FUL,0xE3EC2FCFUL,0xF3F033C3UL,0xC1C405C5UL,0x83840787UL,0x10141404UL,0xF2FC3ECEUL,0x60642444UL, +0xD2DC1ECEUL,0x222C2E0EUL,0x43480B4BUL,0x12181A0AUL,0x02040606UL,0x21202101UL,0x63682B4BUL,0x62642646UL, +0x02000202UL,0xF1F435C5UL,0x92901282UL,0x82880A8AUL,0x000C0C0CUL,0xB3B03383UL,0x727C3E4EUL,0xD0D010C0UL, +0x72783A4AUL,0x43440747UL,0x92941686UL,0xE1E425C5UL,0x22242606UL,0x80800080UL,0xA1AC2D8DUL,0xD3DC1FCFUL, +0xA1A02181UL,0x30303000UL,0x33343707UL,0xA2AC2E8EUL,0x32343606UL,0x11141505UL,0x22202202UL,0x30383808UL, +0xF0F434C4UL,0xA3A42787UL,0x41440545UL,0x404C0C4CUL,0x81800181UL,0xE1E829C9UL,0x80840484UL,0x93941787UL, +0x31343505UL,0xC3C80BCBUL,0xC2CC0ECEUL,0x303C3C0CUL,0x71703141UL,0x11101101UL,0xC3C407C7UL,0x81880989UL, +0x71743545UL,0xF3F83BCBUL,0xD2D81ACAUL,0xF0F838C8UL,0x90941484UL,0x51581949UL,0x82800282UL,0xC0C404C4UL, +0xF3FC3FCFUL,0x41480949UL,0x31383909UL,0x63642747UL,0xC0C000C0UL,0xC3CC0FCFUL,0xD3D417C7UL,0xB0B83888UL, +0x030C0F0FUL,0x828C0E8EUL,0x42400242UL,0x23202303UL,0x91901181UL,0x606C2C4CUL,0xD3D81BCBUL,0xA0A42484UL, +0x30343404UL,0xF1F031C1UL,0x40480848UL,0xC2C002C2UL,0x636C2F4FUL,0x313C3D0DUL,0x212C2D0DUL,0x40400040UL, +0xB2BC3E8EUL,0x323C3E0EUL,0xB0BC3C8CUL,0xC1C001C1UL,0xA2A82A8AUL,0xB2B83A8AUL,0x424C0E4EUL,0x51541545UL, +0x33383B0BUL,0xD0DC1CCCUL,0x60682848UL,0x737C3F4FUL,0x909C1C8CUL,0xD0D818C8UL,0x42480A4AUL,0x52541646UL, +0x73743747UL,0xA0A02080UL,0xE1EC2DCDUL,0x42440646UL,0xB1B43585UL,0x23282B0BUL,0x61642545UL,0xF2F83ACAUL, +0xE3E023C3UL,0xB1B83989UL,0xB1B03181UL,0x939C1F8FUL,0x525C1E4EUL,0xF1F839C9UL,0xE2E426C6UL,0xB2B03282UL, +0x31303101UL,0xE2E82ACAUL,0x616C2D4DUL,0x535C1F4FUL,0xE0E424C4UL,0xF0F030C0UL,0xC1CC0DCDUL,0x80880888UL, +0x12141606UL,0x32383A0AUL,0x50581848UL,0xD0D414C4UL,0x62602242UL,0x21282909UL,0x03040707UL,0x33303303UL, +0xE0E828C8UL,0x13181B0BUL,0x01040505UL,0x71783949UL,0x90901080UL,0x62682A4AUL,0x22282A0AUL,0x92981A8AUL +}; + +static const ulong32 SS3[256] = { +0x08303838UL,0xC8E0E828UL,0x0D212C2DUL,0x86A2A426UL,0xCFC3CC0FUL,0xCED2DC1EUL,0x83B3B033UL,0x88B0B838UL, +0x8FA3AC2FUL,0x40606020UL,0x45515415UL,0xC7C3C407UL,0x44404404UL,0x4F636C2FUL,0x4B63682BUL,0x4B53581BUL, +0xC3C3C003UL,0x42626022UL,0x03333033UL,0x85B1B435UL,0x09212829UL,0x80A0A020UL,0xC2E2E022UL,0x87A3A427UL, +0xC3D3D013UL,0x81919011UL,0x01111011UL,0x06020406UL,0x0C101C1CUL,0x8CB0BC3CUL,0x06323436UL,0x4B43480BUL, +0xCFE3EC2FUL,0x88808808UL,0x4C606C2CUL,0x88A0A828UL,0x07131417UL,0xC4C0C404UL,0x06121416UL,0xC4F0F434UL, +0xC2C2C002UL,0x45414405UL,0xC1E1E021UL,0xC6D2D416UL,0x0F333C3FUL,0x0D313C3DUL,0x8E828C0EUL,0x88909818UL, +0x08202828UL,0x4E424C0EUL,0xC6F2F436UL,0x0E323C3EUL,0x85A1A425UL,0xC9F1F839UL,0x0D010C0DUL,0xCFD3DC1FUL, +0xC8D0D818UL,0x0B23282BUL,0x46626426UL,0x4A72783AUL,0x07232427UL,0x0F232C2FUL,0xC1F1F031UL,0x42727032UL, +0x42424002UL,0xC4D0D414UL,0x41414001UL,0xC0C0C000UL,0x43737033UL,0x47636427UL,0x8CA0AC2CUL,0x8B83880BUL, +0xC7F3F437UL,0x8DA1AC2DUL,0x80808000UL,0x0F131C1FUL,0xCAC2C80AUL,0x0C202C2CUL,0x8AA2A82AUL,0x04303434UL, +0xC2D2D012UL,0x0B03080BUL,0xCEE2EC2EUL,0xC9E1E829UL,0x4D515C1DUL,0x84909414UL,0x08101818UL,0xC8F0F838UL, +0x47535417UL,0x8EA2AC2EUL,0x08000808UL,0xC5C1C405UL,0x03131013UL,0xCDC1CC0DUL,0x86828406UL,0x89B1B839UL, +0xCFF3FC3FUL,0x4D717C3DUL,0xC1C1C001UL,0x01313031UL,0xC5F1F435UL,0x8A82880AUL,0x4A62682AUL,0x81B1B031UL, +0xC1D1D011UL,0x00202020UL,0xC7D3D417UL,0x02020002UL,0x02222022UL,0x04000404UL,0x48606828UL,0x41717031UL, +0x07030407UL,0xCBD3D81BUL,0x8D919C1DUL,0x89919819UL,0x41616021UL,0x8EB2BC3EUL,0xC6E2E426UL,0x49515819UL, +0xCDD1DC1DUL,0x41515011UL,0x80909010UL,0xCCD0DC1CUL,0x8A92981AUL,0x83A3A023UL,0x8BA3A82BUL,0xC0D0D010UL, +0x81818001UL,0x0F030C0FUL,0x47434407UL,0x0A12181AUL,0xC3E3E023UL,0xCCE0EC2CUL,0x8D818C0DUL,0x8FB3BC3FUL, +0x86929416UL,0x4B73783BUL,0x4C505C1CUL,0x82A2A022UL,0x81A1A021UL,0x43636023UL,0x03232023UL,0x4D414C0DUL, +0xC8C0C808UL,0x8E929C1EUL,0x8C909C1CUL,0x0A32383AUL,0x0C000C0CUL,0x0E222C2EUL,0x8AB2B83AUL,0x4E626C2EUL, +0x8F939C1FUL,0x4A52581AUL,0xC2F2F032UL,0x82929012UL,0xC3F3F033UL,0x49414809UL,0x48707838UL,0xCCC0CC0CUL, +0x05111415UL,0xCBF3F83BUL,0x40707030UL,0x45717435UL,0x4F737C3FUL,0x05313435UL,0x00101010UL,0x03030003UL, +0x44606424UL,0x4D616C2DUL,0xC6C2C406UL,0x44707434UL,0xC5D1D415UL,0x84B0B434UL,0xCAE2E82AUL,0x09010809UL, +0x46727436UL,0x09111819UL,0xCEF2FC3EUL,0x40404000UL,0x02121012UL,0xC0E0E020UL,0x8DB1BC3DUL,0x05010405UL, +0xCAF2F83AUL,0x01010001UL,0xC0F0F030UL,0x0A22282AUL,0x4E525C1EUL,0x89A1A829UL,0x46525416UL,0x43434003UL, +0x85818405UL,0x04101414UL,0x89818809UL,0x8B93981BUL,0x80B0B030UL,0xC5E1E425UL,0x48404808UL,0x49717839UL, +0x87939417UL,0xCCF0FC3CUL,0x0E121C1EUL,0x82828002UL,0x01212021UL,0x8C808C0CUL,0x0B13181BUL,0x4F535C1FUL, +0x47737437UL,0x44505414UL,0x82B2B032UL,0x0D111C1DUL,0x05212425UL,0x4F434C0FUL,0x00000000UL,0x46424406UL, +0xCDE1EC2DUL,0x48505818UL,0x42525012UL,0xCBE3E82BUL,0x4E727C3EUL,0xCAD2D81AUL,0xC9C1C809UL,0xCDF1FC3DUL, +0x00303030UL,0x85919415UL,0x45616425UL,0x0C303C3CUL,0x86B2B436UL,0xC4E0E424UL,0x8BB3B83BUL,0x4C707C3CUL, +0x0E020C0EUL,0x40505010UL,0x09313839UL,0x06222426UL,0x02323032UL,0x84808404UL,0x49616829UL,0x83939013UL, +0x07333437UL,0xC7E3E427UL,0x04202424UL,0x84A0A424UL,0xCBC3C80BUL,0x43535013UL,0x0A02080AUL,0x87838407UL, +0xC9D1D819UL,0x4C404C0CUL,0x83838003UL,0x8F838C0FUL,0xCEC2CC0EUL,0x0B33383BUL,0x4A42480AUL,0x87B3B437UL +}; + +static const ulong32 KCi[16] = { +0x9E3779B9,0x3C6EF373, +0x78DDE6E6,0xF1BBCDCC, +0xE3779B99,0xC6EF3733, +0x8DDE6E67,0x1BBCDCCF, +0x3779B99E,0x6EF3733C, +0xDDE6E678,0xBBCDCCF1, +0x779B99E3,0xEF3733C6, +0xDE6E678D,0xBCDCCF1B +}; + +#define G(x) (SS3[((x)>>24)&255] ^ SS2[((x)>>16)&255] ^ SS1[((x)>>8)&255] ^ SS0[(x)&255]) + +#define F(L1, L2, R1, R2, K1, K2) \ + T2 = G((R1 ^ K1) ^ (R2 ^ K2)); \ + T = G( G(T2 + (R1 ^ K1)) + T2); \ + L2 ^= T; \ + L1 ^= (T + G(T2 + (R1 ^ K1))); \ + + /** + Initialize the SEED block cipher + @param key The symmetric key you wish to pass + @param keylen The key length in bytes + @param num_rounds The number of rounds desired (0 for default) + @param skey The key in as scheduled by this function. + @return CRYPT_OK if successful + */ +int kseed_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey) +{ + int i; + ulong32 tmp, k1, k2, k3, k4; + + if (keylen != 16) { + return CRYPT_INVALID_KEYSIZE; + } + + if (num_rounds != 16 && num_rounds != 0) { + return CRYPT_INVALID_ROUNDS; + } + + /* load key */ + LOAD32H(k1, key); + LOAD32H(k2, key+4); + LOAD32H(k3, key+8); + LOAD32H(k4, key+12); + + for (i = 0; i < 16; i++) { + skey->kseed.K[2*i+0] = G(k1 + k3 - KCi[i]); + skey->kseed.K[2*i+1] = G(k2 - k4 + KCi[i]); + if (i&1) { + tmp = k3; + k3 = ((k3 << 8) | (k4 >> 24)) & 0xFFFFFFFF; + k4 = ((k4 << 8) | (tmp >> 24)) & 0xFFFFFFFF; + } else { + tmp = k1; + k1 = ((k1 >> 8) | (k2 << 24)) & 0xFFFFFFFF; + k2 = ((k2 >> 8) | (tmp << 24)) & 0xFFFFFFFF; + } + /* reverse keys for decrypt */ + skey->kseed.dK[2*(15-i)+0] = skey->kseed.K[2*i+0]; + skey->kseed.dK[2*(15-i)+1] = skey->kseed.K[2*i+1]; + } + + return CRYPT_OK; +} + +static void rounds(ulong32 *P, ulong32 *K) +{ + ulong32 T, T2; + int i; + for (i = 0; i < 16; i += 2) { + F(P[0], P[1], P[2], P[3], K[0], K[1]); + F(P[2], P[3], P[0], P[1], K[2], K[3]); + K += 4; + } +} + +/** + Encrypts a block of text with SEED + @param pt The input plaintext (16 bytes) + @param ct The output ciphertext (16 bytes) + @param skey The key as scheduled + @return CRYPT_OK if successful +*/ +int kseed_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key *skey) +{ + ulong32 P[4]; + LOAD32H(P[0], pt); + LOAD32H(P[1], pt+4); + LOAD32H(P[2], pt+8); + LOAD32H(P[3], pt+12); + rounds(P, skey->kseed.K); + STORE32H(P[2], ct); + STORE32H(P[3], ct+4); + STORE32H(P[0], ct+8); + STORE32H(P[1], ct+12); + return CRYPT_OK; +} + +/** + Decrypts a block of text with SEED + @param ct The input ciphertext (16 bytes) + @param pt The output plaintext (16 bytes) + @param skey The key as scheduled + @return CRYPT_OK if successful +*/ +int kseed_ecb_decrypt(const unsigned char *ct, unsigned char *pt, symmetric_key *skey) +{ + ulong32 P[4]; + LOAD32H(P[0], ct); + LOAD32H(P[1], ct+4); + LOAD32H(P[2], ct+8); + LOAD32H(P[3], ct+12); + rounds(P, skey->kseed.dK); + STORE32H(P[2], pt); + STORE32H(P[3], pt+4); + STORE32H(P[0], pt+8); + STORE32H(P[1], pt+12); + return CRYPT_OK; +} + +/** Terminate the context + @param skey The scheduled key +*/ +void kseed_done(symmetric_key *skey) +{ +} + +/** + Performs a self-test of the SEED block cipher + @return CRYPT_OK if functional, CRYPT_NOP if self-test has been disabled +*/ +int kseed_test(void) +{ +#if !defined(LTC_TEST) + return CRYPT_NOP; +#else + static const struct test { + unsigned char pt[16], ct[16], key[16]; + } tests[] = { + +{ + { 0x00,0x01,0x02,0x03,0x04,0x05,0x06,0x07,0x08,0x09,0x0A,0x0B,0x0C,0x0D,0x0E,0x0F }, + { 0x5E,0xBA,0xC6,0xE0,0x05,0x4E,0x16,0x68,0x19,0xAF,0xF1,0xCC,0x6D,0x34,0x6C,0xDB }, + { 0 }, +}, + +{ + { 0 }, + { 0xC1,0x1F,0x22,0xF2,0x01,0x40,0x50,0x50,0x84,0x48,0x35,0x97,0xE4,0x37,0x0F,0x43 }, + { 0x00,0x01,0x02,0x03,0x04,0x05,0x06,0x07,0x08,0x09,0x0A,0x0B,0x0C,0x0D,0x0E,0x0F }, +}, + +{ + { 0x83,0xA2,0xF8,0xA2,0x88,0x64,0x1F,0xB9,0xA4,0xE9,0xA5,0xCC,0x2F,0x13,0x1C,0x7D }, + { 0xEE,0x54,0xD1,0x3E,0xBC,0xAE,0x70,0x6D,0x22,0x6B,0xC3,0x14,0x2C,0xD4,0x0D,0x4A }, + { 0x47,0x06,0x48,0x08,0x51,0xE6,0x1B,0xE8,0x5D,0x74,0xBF,0xB3,0xFD,0x95,0x61,0x85 }, +}, + +{ + { 0xB4,0x1E,0x6B,0xE2,0xEB,0xA8,0x4A,0x14,0x8E,0x2E,0xED,0x84,0x59,0x3C,0x5E,0xC7 }, + { 0x9B,0x9B,0x7B,0xFC,0xD1,0x81,0x3C,0xB9,0x5D,0x0B,0x36,0x18,0xF4,0x0F,0x51,0x22 }, + { 0x28,0xDB,0xC3,0xBC,0x49,0xFF,0xD8,0x7D,0xCF,0xA5,0x09,0xB1,0x1D,0x42,0x2B,0xE7 }, +} +}; + int x; + unsigned char buf[2][16]; + symmetric_key skey; + + for (x = 0; x < (int)(sizeof(tests)/sizeof(tests[0])); x++) { + kseed_setup(tests[x].key, 16, 0, &skey); + kseed_ecb_encrypt(tests[x].pt, buf[0], &skey); + kseed_ecb_decrypt(buf[0], buf[1], &skey); + if (XMEMCMP(buf[0], tests[x].ct, 16) || XMEMCMP(buf[1], tests[x].pt, 16)) { + return CRYPT_FAIL_TESTVECTOR; + } + } + return CRYPT_OK; +#endif +} + +/** + Gets suitable key size + @param keysize [in/out] The length of the recommended key (in bytes). This function will store the suitable size back in this variable. + @return CRYPT_OK if the input key size is acceptable. +*/ +int kseed_keysize(int *keysize) +{ + LTC_ARGCHK(keysize != NULL); + if (*keysize >= 16) { + *keysize = 16; + } else { + return CRYPT_INVALID_KEYSIZE; + } + return CRYPT_OK; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/ciphers/kseed.c,v $ */ +/* $Revision: 1.8 $ */ +/* $Date: 2006/11/08 23:01:06 $ */ diff --git a/libtomcrypt/src/ciphers/noekeon.c b/libtomcrypt/src/ciphers/noekeon.c new file mode 100644 index 0000000..f467ff2 --- /dev/null +++ b/libtomcrypt/src/ciphers/noekeon.c @@ -0,0 +1,303 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +/** + @file noekeon.c + Implementation of the Noekeon block cipher by Tom St Denis +*/ +#include "tomcrypt.h" + +#ifdef NOEKEON + +const struct ltc_cipher_descriptor noekeon_desc = +{ + "noekeon", + 16, + 16, 16, 16, 16, + &noekeon_setup, + &noekeon_ecb_encrypt, + &noekeon_ecb_decrypt, + &noekeon_test, + &noekeon_done, + &noekeon_keysize, + NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL +}; + +static const ulong32 RC[] = { + 0x00000080UL, 0x0000001bUL, 0x00000036UL, 0x0000006cUL, + 0x000000d8UL, 0x000000abUL, 0x0000004dUL, 0x0000009aUL, + 0x0000002fUL, 0x0000005eUL, 0x000000bcUL, 0x00000063UL, + 0x000000c6UL, 0x00000097UL, 0x00000035UL, 0x0000006aUL, + 0x000000d4UL +}; + +#define kTHETA(a, b, c, d) \ + temp = a^c; temp = temp ^ ROLc(temp, 8) ^ RORc(temp, 8); \ + b ^= temp; d ^= temp; \ + temp = b^d; temp = temp ^ ROLc(temp, 8) ^ RORc(temp, 8); \ + a ^= temp; c ^= temp; + +#define THETA(k, a, b, c, d) \ + temp = a^c; temp = temp ^ ROLc(temp, 8) ^ RORc(temp, 8); \ + b ^= temp ^ k[1]; d ^= temp ^ k[3]; \ + temp = b^d; temp = temp ^ ROLc(temp, 8) ^ RORc(temp, 8); \ + a ^= temp ^ k[0]; c ^= temp ^ k[2]; + +#define GAMMA(a, b, c, d) \ + b ^= ~(d|c); \ + a ^= c&b; \ + temp = d; d = a; a = temp;\ + c ^= a ^ b ^ d; \ + b ^= ~(d|c); \ + a ^= c&b; + +#define PI1(a, b, c, d) \ + a = ROLc(a, 1); c = ROLc(c, 5); d = ROLc(d, 2); + +#define PI2(a, b, c, d) \ + a = RORc(a, 1); c = RORc(c, 5); d = RORc(d, 2); + + /** + Initialize the Noekeon block cipher + @param key The symmetric key you wish to pass + @param keylen The key length in bytes + @param num_rounds The number of rounds desired (0 for default) + @param skey The key in as scheduled by this function. + @return CRYPT_OK if successful + */ +int noekeon_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey) +{ + ulong32 temp; + + LTC_ARGCHK(key != NULL); + LTC_ARGCHK(skey != NULL); + + if (keylen != 16) { + return CRYPT_INVALID_KEYSIZE; + } + + if (num_rounds != 16 && num_rounds != 0) { + return CRYPT_INVALID_ROUNDS; + } + + LOAD32H(skey->noekeon.K[0],&key[0]); + LOAD32H(skey->noekeon.K[1],&key[4]); + LOAD32H(skey->noekeon.K[2],&key[8]); + LOAD32H(skey->noekeon.K[3],&key[12]); + + LOAD32H(skey->noekeon.dK[0],&key[0]); + LOAD32H(skey->noekeon.dK[1],&key[4]); + LOAD32H(skey->noekeon.dK[2],&key[8]); + LOAD32H(skey->noekeon.dK[3],&key[12]); + + kTHETA(skey->noekeon.dK[0], skey->noekeon.dK[1], skey->noekeon.dK[2], skey->noekeon.dK[3]); + + return CRYPT_OK; +} + +/** + Encrypts a block of text with Noekeon + @param pt The input plaintext (16 bytes) + @param ct The output ciphertext (16 bytes) + @param skey The key as scheduled + @return CRYPT_OK if successful +*/ +#ifdef LTC_CLEAN_STACK +static int _noekeon_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key *skey) +#else +int noekeon_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key *skey) +#endif +{ + ulong32 a,b,c,d,temp; + int r; + + LTC_ARGCHK(skey != NULL); + LTC_ARGCHK(pt != NULL); + LTC_ARGCHK(ct != NULL); + + LOAD32H(a,&pt[0]); LOAD32H(b,&pt[4]); + LOAD32H(c,&pt[8]); LOAD32H(d,&pt[12]); + +#define ROUND(i) \ + a ^= RC[i]; \ + THETA(skey->noekeon.K, a,b,c,d); \ + PI1(a,b,c,d); \ + GAMMA(a,b,c,d); \ + PI2(a,b,c,d); + + for (r = 0; r < 16; ++r) { + ROUND(r); + } + +#undef ROUND + + a ^= RC[16]; + THETA(skey->noekeon.K, a, b, c, d); + + STORE32H(a,&ct[0]); STORE32H(b,&ct[4]); + STORE32H(c,&ct[8]); STORE32H(d,&ct[12]); + + return CRYPT_OK; +} + +#ifdef LTC_CLEAN_STACK +int noekeon_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key *skey) +{ + int err = _noekeon_ecb_encrypt(pt, ct, skey); + burn_stack(sizeof(ulong32) * 5 + sizeof(int)); + return CRYPT_OK; +} +#endif + +/** + Decrypts a block of text with Noekeon + @param ct The input ciphertext (16 bytes) + @param pt The output plaintext (16 bytes) + @param skey The key as scheduled + @return CRYPT_OK if successful +*/ +#ifdef LTC_CLEAN_STACK +static int _noekeon_ecb_decrypt(const unsigned char *ct, unsigned char *pt, symmetric_key *skey) +#else +int noekeon_ecb_decrypt(const unsigned char *ct, unsigned char *pt, symmetric_key *skey) +#endif +{ + ulong32 a,b,c,d, temp; + int r; + + LTC_ARGCHK(skey != NULL); + LTC_ARGCHK(pt != NULL); + LTC_ARGCHK(ct != NULL); + + LOAD32H(a,&ct[0]); LOAD32H(b,&ct[4]); + LOAD32H(c,&ct[8]); LOAD32H(d,&ct[12]); + + +#define ROUND(i) \ + THETA(skey->noekeon.dK, a,b,c,d); \ + a ^= RC[i]; \ + PI1(a,b,c,d); \ + GAMMA(a,b,c,d); \ + PI2(a,b,c,d); + + for (r = 16; r > 0; --r) { + ROUND(r); + } + +#undef ROUND + + THETA(skey->noekeon.dK, a,b,c,d); + a ^= RC[0]; + STORE32H(a,&pt[0]); STORE32H(b, &pt[4]); + STORE32H(c,&pt[8]); STORE32H(d, &pt[12]); + return CRYPT_OK; +} + +#ifdef LTC_CLEAN_STACK +int noekeon_ecb_decrypt(const unsigned char *ct, unsigned char *pt, symmetric_key *skey) +{ + int err = _noekeon_ecb_decrypt(ct, pt, skey); + burn_stack(sizeof(ulong32) * 5 + sizeof(int)); + return err; +} +#endif + +/** + Performs a self-test of the Noekeon block cipher + @return CRYPT_OK if functional, CRYPT_NOP if self-test has been disabled +*/ +int noekeon_test(void) +{ + #ifndef LTC_TEST + return CRYPT_NOP; + #else + static const struct { + int keylen; + unsigned char key[16], pt[16], ct[16]; + } tests[] = { + { + 16, + { 0, 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15 }, + { 0, 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15 }, + { 0x18, 0xa6, 0xec, 0xe5, 0x28, 0xaa, 0x79, 0x73, + 0x28, 0xb2, 0xc0, 0x91, 0xa0, 0x2f, 0x54, 0xc5} + } + }; + symmetric_key key; + unsigned char tmp[2][16]; + int err, i, y; + + for (i = 0; i < (int)(sizeof(tests)/sizeof(tests[0])); i++) { + zeromem(&key, sizeof(key)); + if ((err = noekeon_setup(tests[i].key, tests[i].keylen, 0, &key)) != CRYPT_OK) { + return err; + } + + noekeon_ecb_encrypt(tests[i].pt, tmp[0], &key); + noekeon_ecb_decrypt(tmp[0], tmp[1], &key); + if (XMEMCMP(tmp[0], tests[i].ct, 16) || XMEMCMP(tmp[1], tests[i].pt, 16)) { +#if 0 + printf("\n\nTest %d failed\n", i); + if (XMEMCMP(tmp[0], tests[i].ct, 16)) { + printf("CT: "); + for (i = 0; i < 16; i++) { + printf("%02x ", tmp[0][i]); + } + printf("\n"); + } else { + printf("PT: "); + for (i = 0; i < 16; i++) { + printf("%02x ", tmp[1][i]); + } + printf("\n"); + } +#endif + return CRYPT_FAIL_TESTVECTOR; + } + + /* now see if we can encrypt all zero bytes 1000 times, decrypt and come back where we started */ + for (y = 0; y < 16; y++) tmp[0][y] = 0; + for (y = 0; y < 1000; y++) noekeon_ecb_encrypt(tmp[0], tmp[0], &key); + for (y = 0; y < 1000; y++) noekeon_ecb_decrypt(tmp[0], tmp[0], &key); + for (y = 0; y < 16; y++) if (tmp[0][y] != 0) return CRYPT_FAIL_TESTVECTOR; + } + return CRYPT_OK; + #endif +} + +/** Terminate the context + @param skey The scheduled key +*/ +void noekeon_done(symmetric_key *skey) +{ +} + +/** + Gets suitable key size + @param keysize [in/out] The length of the recommended key (in bytes). This function will store the suitable size back in this variable. + @return CRYPT_OK if the input key size is acceptable. +*/ +int noekeon_keysize(int *keysize) +{ + LTC_ARGCHK(keysize != NULL); + if (*keysize < 16) { + return CRYPT_INVALID_KEYSIZE; + } else { + *keysize = 16; + return CRYPT_OK; + } +} + +#endif + + +/* $Source: /cvs/libtom/libtomcrypt/src/ciphers/noekeon.c,v $ */ +/* $Revision: 1.12 $ */ +/* $Date: 2006/11/08 23:01:06 $ */ diff --git a/libtomcrypt/src/ciphers/rc2.c b/libtomcrypt/src/ciphers/rc2.c new file mode 100644 index 0000000..de62cda --- /dev/null +++ b/libtomcrypt/src/ciphers/rc2.c @@ -0,0 +1,362 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +/**********************************************************************\ +* To commemorate the 1996 RSA Data Security Conference, the following * +* code is released into the public domain by its author. Prost! * +* * +* This cipher uses 16-bit words and little-endian byte ordering. * +* I wonder which processor it was optimized for? * +* * +* Thanks to CodeView, SoftIce, and D86 for helping bring this code to * +* the public. * +\**********************************************************************/ +#include <tomcrypt.h> + +/** + @file rc2.c + Implementation of RC2 +*/ + +#ifdef RC2 + +const struct ltc_cipher_descriptor rc2_desc = { + "rc2", + 12, 8, 128, 8, 16, + &rc2_setup, + &rc2_ecb_encrypt, + &rc2_ecb_decrypt, + &rc2_test, + &rc2_done, + &rc2_keysize, + NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL +}; + +/* 256-entry permutation table, probably derived somehow from pi */ +static const unsigned char permute[256] = { + 217,120,249,196, 25,221,181,237, 40,233,253,121, 74,160,216,157, + 198,126, 55,131, 43,118, 83,142, 98, 76,100,136, 68,139,251,162, + 23,154, 89,245,135,179, 79, 19, 97, 69,109,141, 9,129,125, 50, + 189,143, 64,235,134,183,123, 11,240,149, 33, 34, 92,107, 78,130, + 84,214,101,147,206, 96,178, 28,115, 86,192, 20,167,140,241,220, + 18,117,202, 31, 59,190,228,209, 66, 61,212, 48,163, 60,182, 38, + 111,191, 14,218, 70,105, 7, 87, 39,242, 29,155,188,148, 67, 3, + 248, 17,199,246,144,239, 62,231, 6,195,213, 47,200,102, 30,215, + 8,232,234,222,128, 82,238,247,132,170,114,172, 53, 77,106, 42, + 150, 26,210,113, 90, 21, 73,116, 75,159,208, 94, 4, 24,164,236, + 194,224, 65,110, 15, 81,203,204, 36,145,175, 80,161,244,112, 57, + 153,124, 58,133, 35,184,180,122,252, 2, 54, 91, 37, 85,151, 49, + 45, 93,250,152,227,138,146,174, 5,223, 41, 16,103,108,186,201, + 211, 0,230,207,225,158,168, 44, 99, 22, 1, 63, 88,226,137,169, + 13, 56, 52, 27,171, 51,255,176,187, 72, 12, 95,185,177,205, 46, + 197,243,219, 71,229,165,156,119, 10,166, 32,104,254,127,193,173 +}; + + /** + Initialize the RC2 block cipher + @param key The symmetric key you wish to pass + @param keylen The key length in bytes + @param num_rounds The number of rounds desired (0 for default) + @param skey The key in as scheduled by this function. + @return CRYPT_OK if successful + */ +int rc2_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey) +{ + unsigned *xkey = skey->rc2.xkey; + unsigned char tmp[128]; + unsigned T8, TM; + int i, bits; + + LTC_ARGCHK(key != NULL); + LTC_ARGCHK(skey != NULL); + + if (keylen < 8 || keylen > 128) { + return CRYPT_INVALID_KEYSIZE; + } + + if (num_rounds != 0 && num_rounds != 16) { + return CRYPT_INVALID_ROUNDS; + } + + for (i = 0; i < keylen; i++) { + tmp[i] = key[i] & 255; + } + + /* Phase 1: Expand input key to 128 bytes */ + if (keylen < 128) { + for (i = keylen; i < 128; i++) { + tmp[i] = permute[(tmp[i - 1] + tmp[i - keylen]) & 255]; + } + } + + /* Phase 2 - reduce effective key size to "bits" */ + bits = keylen<<3; + T8 = (unsigned)(bits+7)>>3; + TM = (255 >> (unsigned)(7 & -bits)); + tmp[128 - T8] = permute[tmp[128 - T8] & TM]; + for (i = 127 - T8; i >= 0; i--) { + tmp[i] = permute[tmp[i + 1] ^ tmp[i + T8]]; + } + + /* Phase 3 - copy to xkey in little-endian order */ + for (i = 0; i < 64; i++) { + xkey[i] = (unsigned)tmp[2*i] + ((unsigned)tmp[2*i+1] << 8); + } + +#ifdef LTC_CLEAN_STACK + zeromem(tmp, sizeof(tmp)); +#endif + + return CRYPT_OK; +} + +/**********************************************************************\ +* Encrypt an 8-byte block of plaintext using the given key. * +\**********************************************************************/ +/** + Encrypts a block of text with RC2 + @param pt The input plaintext (8 bytes) + @param ct The output ciphertext (8 bytes) + @param skey The key as scheduled + @return CRYPT_OK if successful +*/ +#ifdef LTC_CLEAN_STACK +static int _rc2_ecb_encrypt( const unsigned char *pt, + unsigned char *ct, + symmetric_key *skey) +#else +int rc2_ecb_encrypt( const unsigned char *pt, + unsigned char *ct, + symmetric_key *skey) +#endif +{ + unsigned *xkey; + unsigned x76, x54, x32, x10, i; + + LTC_ARGCHK(pt != NULL); + LTC_ARGCHK(ct != NULL); + LTC_ARGCHK(skey != NULL); + + xkey = skey->rc2.xkey; + + x76 = ((unsigned)pt[7] << 8) + (unsigned)pt[6]; + x54 = ((unsigned)pt[5] << 8) + (unsigned)pt[4]; + x32 = ((unsigned)pt[3] << 8) + (unsigned)pt[2]; + x10 = ((unsigned)pt[1] << 8) + (unsigned)pt[0]; + + for (i = 0; i < 16; i++) { + x10 = (x10 + (x32 & ~x76) + (x54 & x76) + xkey[4*i+0]) & 0xFFFF; + x10 = ((x10 << 1) | (x10 >> 15)); + + x32 = (x32 + (x54 & ~x10) + (x76 & x10) + xkey[4*i+1]) & 0xFFFF; + x32 = ((x32 << 2) | (x32 >> 14)); + + x54 = (x54 + (x76 & ~x32) + (x10 & x32) + xkey[4*i+2]) & 0xFFFF; + x54 = ((x54 << 3) | (x54 >> 13)); + + x76 = (x76 + (x10 & ~x54) + (x32 & x54) + xkey[4*i+3]) & 0xFFFF; + x76 = ((x76 << 5) | (x76 >> 11)); + + if (i == 4 || i == 10) { + x10 = (x10 + xkey[x76 & 63]) & 0xFFFF; + x32 = (x32 + xkey[x10 & 63]) & 0xFFFF; + x54 = (x54 + xkey[x32 & 63]) & 0xFFFF; + x76 = (x76 + xkey[x54 & 63]) & 0xFFFF; + } + } + + ct[0] = (unsigned char)x10; + ct[1] = (unsigned char)(x10 >> 8); + ct[2] = (unsigned char)x32; + ct[3] = (unsigned char)(x32 >> 8); + ct[4] = (unsigned char)x54; + ct[5] = (unsigned char)(x54 >> 8); + ct[6] = (unsigned char)x76; + ct[7] = (unsigned char)(x76 >> 8); + + return CRYPT_OK; +} + +#ifdef LTC_CLEAN_STACK +int rc2_ecb_encrypt( const unsigned char *pt, + unsigned char *ct, + symmetric_key *skey) +{ + int err = _rc2_ecb_encrypt(pt, ct, skey); + burn_stack(sizeof(unsigned *) + sizeof(unsigned) * 5); + return err; +} +#endif + +/**********************************************************************\ +* Decrypt an 8-byte block of ciphertext using the given key. * +\**********************************************************************/ +/** + Decrypts a block of text with RC2 + @param ct The input ciphertext (8 bytes) + @param pt The output plaintext (8 bytes) + @param skey The key as scheduled + @return CRYPT_OK if successful +*/ +#ifdef LTC_CLEAN_STACK +static int _rc2_ecb_decrypt( const unsigned char *ct, + unsigned char *pt, + symmetric_key *skey) +#else +int rc2_ecb_decrypt( const unsigned char *ct, + unsigned char *pt, + symmetric_key *skey) +#endif +{ + unsigned x76, x54, x32, x10; + unsigned *xkey; + int i; + + LTC_ARGCHK(pt != NULL); + LTC_ARGCHK(ct != NULL); + LTC_ARGCHK(skey != NULL); + + xkey = skey->rc2.xkey; + + x76 = ((unsigned)ct[7] << 8) + (unsigned)ct[6]; + x54 = ((unsigned)ct[5] << 8) + (unsigned)ct[4]; + x32 = ((unsigned)ct[3] << 8) + (unsigned)ct[2]; + x10 = ((unsigned)ct[1] << 8) + (unsigned)ct[0]; + + for (i = 15; i >= 0; i--) { + if (i == 4 || i == 10) { + x76 = (x76 - xkey[x54 & 63]) & 0xFFFF; + x54 = (x54 - xkey[x32 & 63]) & 0xFFFF; + x32 = (x32 - xkey[x10 & 63]) & 0xFFFF; + x10 = (x10 - xkey[x76 & 63]) & 0xFFFF; + } + + x76 = ((x76 << 11) | (x76 >> 5)); + x76 = (x76 - ((x10 & ~x54) + (x32 & x54) + xkey[4*i+3])) & 0xFFFF; + + x54 = ((x54 << 13) | (x54 >> 3)); + x54 = (x54 - ((x76 & ~x32) + (x10 & x32) + xkey[4*i+2])) & 0xFFFF; + + x32 = ((x32 << 14) | (x32 >> 2)); + x32 = (x32 - ((x54 & ~x10) + (x76 & x10) + xkey[4*i+1])) & 0xFFFF; + + x10 = ((x10 << 15) | (x10 >> 1)); + x10 = (x10 - ((x32 & ~x76) + (x54 & x76) + xkey[4*i+0])) & 0xFFFF; + } + + pt[0] = (unsigned char)x10; + pt[1] = (unsigned char)(x10 >> 8); + pt[2] = (unsigned char)x32; + pt[3] = (unsigned char)(x32 >> 8); + pt[4] = (unsigned char)x54; + pt[5] = (unsigned char)(x54 >> 8); + pt[6] = (unsigned char)x76; + pt[7] = (unsigned char)(x76 >> 8); + + return CRYPT_OK; +} + +#ifdef LTC_CLEAN_STACK +int rc2_ecb_decrypt( const unsigned char *ct, + unsigned char *pt, + symmetric_key *skey) +{ + int err = _rc2_ecb_decrypt(ct, pt, skey); + burn_stack(sizeof(unsigned *) + sizeof(unsigned) * 4 + sizeof(int)); + return err; +} +#endif + +/** + Performs a self-test of the RC2 block cipher + @return CRYPT_OK if functional, CRYPT_NOP if self-test has been disabled +*/ +int rc2_test(void) +{ + #ifndef LTC_TEST + return CRYPT_NOP; + #else + static const struct { + int keylen; + unsigned char key[16], pt[8], ct[8]; + } tests[] = { + + { 8, + { 0x30, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0x10, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x01 }, + { 0x30, 0x64, 0x9e, 0xdf, 0x9b, 0xe7, 0xd2, 0xc2 } + + }, + { 16, + { 0x88, 0xbc, 0xa9, 0x0e, 0x90, 0x87, 0x5a, 0x7f, + 0x0f, 0x79, 0xc3, 0x84, 0x62, 0x7b, 0xaf, 0xb2 }, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0x22, 0x69, 0x55, 0x2a, 0xb0, 0xf8, 0x5c, 0xa6 } + } + }; + int x, y, err; + symmetric_key skey; + unsigned char tmp[2][8]; + + for (x = 0; x < (int)(sizeof(tests) / sizeof(tests[0])); x++) { + zeromem(tmp, sizeof(tmp)); + if ((err = rc2_setup(tests[x].key, tests[x].keylen, 0, &skey)) != CRYPT_OK) { + return err; + } + + rc2_ecb_encrypt(tests[x].pt, tmp[0], &skey); + rc2_ecb_decrypt(tmp[0], tmp[1], &skey); + + if (XMEMCMP(tmp[0], tests[x].ct, 8) != 0 || XMEMCMP(tmp[1], tests[x].pt, 8) != 0) { + return CRYPT_FAIL_TESTVECTOR; + } + + /* now see if we can encrypt all zero bytes 1000 times, decrypt and come back where we started */ + for (y = 0; y < 8; y++) tmp[0][y] = 0; + for (y = 0; y < 1000; y++) rc2_ecb_encrypt(tmp[0], tmp[0], &skey); + for (y = 0; y < 1000; y++) rc2_ecb_decrypt(tmp[0], tmp[0], &skey); + for (y = 0; y < 8; y++) if (tmp[0][y] != 0) return CRYPT_FAIL_TESTVECTOR; + } + return CRYPT_OK; + #endif +} + +/** Terminate the context + @param skey The scheduled key +*/ +void rc2_done(symmetric_key *skey) +{ +} + +/** + Gets suitable key size + @param keysize [in/out] The length of the recommended key (in bytes). This function will store the suitable size back in this variable. + @return CRYPT_OK if the input key size is acceptable. +*/ +int rc2_keysize(int *keysize) +{ + LTC_ARGCHK(keysize != NULL); + if (*keysize < 8) { + return CRYPT_INVALID_KEYSIZE; + } else if (*keysize > 128) { + *keysize = 128; + } + return CRYPT_OK; +} + +#endif + + + + +/* $Source: /cvs/libtom/libtomcrypt/src/ciphers/rc2.c,v $ */ +/* $Revision: 1.12 $ */ +/* $Date: 2006/11/08 23:01:06 $ */ diff --git a/libtomcrypt/src/ciphers/rc5.c b/libtomcrypt/src/ciphers/rc5.c new file mode 100644 index 0000000..2d5fdb8 --- /dev/null +++ b/libtomcrypt/src/ciphers/rc5.c @@ -0,0 +1,322 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ + +/** + @file rc5.c + RC5 code by Tom St Denis +*/ + +#include "tomcrypt.h" + +#ifdef RC5 + +const struct ltc_cipher_descriptor rc5_desc = +{ + "rc5", + 2, + 8, 128, 8, 12, + &rc5_setup, + &rc5_ecb_encrypt, + &rc5_ecb_decrypt, + &rc5_test, + &rc5_done, + &rc5_keysize, + NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL +}; + +static const ulong32 stab[50] = { +0xb7e15163UL, 0x5618cb1cUL, 0xf45044d5UL, 0x9287be8eUL, 0x30bf3847UL, 0xcef6b200UL, 0x6d2e2bb9UL, 0x0b65a572UL, +0xa99d1f2bUL, 0x47d498e4UL, 0xe60c129dUL, 0x84438c56UL, 0x227b060fUL, 0xc0b27fc8UL, 0x5ee9f981UL, 0xfd21733aUL, +0x9b58ecf3UL, 0x399066acUL, 0xd7c7e065UL, 0x75ff5a1eUL, 0x1436d3d7UL, 0xb26e4d90UL, 0x50a5c749UL, 0xeedd4102UL, +0x8d14babbUL, 0x2b4c3474UL, 0xc983ae2dUL, 0x67bb27e6UL, 0x05f2a19fUL, 0xa42a1b58UL, 0x42619511UL, 0xe0990ecaUL, +0x7ed08883UL, 0x1d08023cUL, 0xbb3f7bf5UL, 0x5976f5aeUL, 0xf7ae6f67UL, 0x95e5e920UL, 0x341d62d9UL, 0xd254dc92UL, +0x708c564bUL, 0x0ec3d004UL, 0xacfb49bdUL, 0x4b32c376UL, 0xe96a3d2fUL, 0x87a1b6e8UL, 0x25d930a1UL, 0xc410aa5aUL, +0x62482413UL, 0x007f9dccUL +}; + + /** + Initialize the RC5 block cipher + @param key The symmetric key you wish to pass + @param keylen The key length in bytes + @param num_rounds The number of rounds desired (0 for default) + @param skey The key in as scheduled by this function. + @return CRYPT_OK if successful + */ +#ifdef LTC_CLEAN_STACK +static int _rc5_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey) +#else +int rc5_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey) +#endif +{ + ulong32 L[64], *S, A, B, i, j, v, s, t, l; + + LTC_ARGCHK(skey != NULL); + LTC_ARGCHK(key != NULL); + + /* test parameters */ + if (num_rounds == 0) { + num_rounds = rc5_desc.default_rounds; + } + + if (num_rounds < 12 || num_rounds > 24) { + return CRYPT_INVALID_ROUNDS; + } + + /* key must be between 64 and 1024 bits */ + if (keylen < 8 || keylen > 128) { + return CRYPT_INVALID_KEYSIZE; + } + + skey->rc5.rounds = num_rounds; + S = skey->rc5.K; + + /* copy the key into the L array */ + for (A = i = j = 0; i < (ulong32)keylen; ) { + A = (A << 8) | ((ulong32)(key[i++] & 255)); + if ((i & 3) == 0) { + L[j++] = BSWAP(A); + A = 0; + } + } + + if ((keylen & 3) != 0) { + A <<= (ulong32)((8 * (4 - (keylen&3)))); + L[j++] = BSWAP(A); + } + + /* setup the S array */ + t = (ulong32)(2 * (num_rounds + 1)); + XMEMCPY(S, stab, t * sizeof(*S)); + + /* mix buffer */ + s = 3 * MAX(t, j); + l = j; + for (A = B = i = j = v = 0; v < s; v++) { + A = S[i] = ROLc(S[i] + A + B, 3); + B = L[j] = ROL(L[j] + A + B, (A+B)); + if (++i == t) { i = 0; } + if (++j == l) { j = 0; } + } + return CRYPT_OK; +} + +#ifdef LTC_CLEAN_STACK +int rc5_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey) +{ + int x; + x = _rc5_setup(key, keylen, num_rounds, skey); + burn_stack(sizeof(ulong32) * 122 + sizeof(int)); + return x; +} +#endif + +/** + Encrypts a block of text with RC5 + @param pt The input plaintext (8 bytes) + @param ct The output ciphertext (8 bytes) + @param skey The key as scheduled + @return CRYPT_OK if successful +*/ +#ifdef LTC_CLEAN_STACK +static int _rc5_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key *skey) +#else +int rc5_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key *skey) +#endif +{ + ulong32 A, B, *K; + int r; + LTC_ARGCHK(skey != NULL); + LTC_ARGCHK(pt != NULL); + LTC_ARGCHK(ct != NULL); + + LOAD32L(A, &pt[0]); + LOAD32L(B, &pt[4]); + A += skey->rc5.K[0]; + B += skey->rc5.K[1]; + K = skey->rc5.K + 2; + + if ((skey->rc5.rounds & 1) == 0) { + for (r = 0; r < skey->rc5.rounds; r += 2) { + A = ROL(A ^ B, B) + K[0]; + B = ROL(B ^ A, A) + K[1]; + A = ROL(A ^ B, B) + K[2]; + B = ROL(B ^ A, A) + K[3]; + K += 4; + } + } else { + for (r = 0; r < skey->rc5.rounds; r++) { + A = ROL(A ^ B, B) + K[0]; + B = ROL(B ^ A, A) + K[1]; + K += 2; + } + } + STORE32L(A, &ct[0]); + STORE32L(B, &ct[4]); + + return CRYPT_OK; +} + +#ifdef LTC_CLEAN_STACK +int rc5_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key *skey) +{ + int err = _rc5_ecb_encrypt(pt, ct, skey); + burn_stack(sizeof(ulong32) * 2 + sizeof(int)); + return err; +} +#endif + +/** + Decrypts a block of text with RC5 + @param ct The input ciphertext (8 bytes) + @param pt The output plaintext (8 bytes) + @param skey The key as scheduled + @return CRYPT_OK if successful +*/ +#ifdef LTC_CLEAN_STACK +static int _rc5_ecb_decrypt(const unsigned char *ct, unsigned char *pt, symmetric_key *skey) +#else +int rc5_ecb_decrypt(const unsigned char *ct, unsigned char *pt, symmetric_key *skey) +#endif +{ + ulong32 A, B, *K; + int r; + LTC_ARGCHK(skey != NULL); + LTC_ARGCHK(pt != NULL); + LTC_ARGCHK(ct != NULL); + + LOAD32L(A, &ct[0]); + LOAD32L(B, &ct[4]); + K = skey->rc5.K + (skey->rc5.rounds << 1); + + if ((skey->rc5.rounds & 1) == 0) { + K -= 2; + for (r = skey->rc5.rounds - 1; r >= 0; r -= 2) { + B = ROR(B - K[3], A) ^ A; + A = ROR(A - K[2], B) ^ B; + B = ROR(B - K[1], A) ^ A; + A = ROR(A - K[0], B) ^ B; + K -= 4; + } + } else { + for (r = skey->rc5.rounds - 1; r >= 0; r--) { + B = ROR(B - K[1], A) ^ A; + A = ROR(A - K[0], B) ^ B; + K -= 2; + } + } + A -= skey->rc5.K[0]; + B -= skey->rc5.K[1]; + STORE32L(A, &pt[0]); + STORE32L(B, &pt[4]); + + return CRYPT_OK; +} + +#ifdef LTC_CLEAN_STACK +int rc5_ecb_decrypt(const unsigned char *ct, unsigned char *pt, symmetric_key *skey) +{ + int err = _rc5_ecb_decrypt(ct, pt, skey); + burn_stack(sizeof(ulong32) * 2 + sizeof(int)); + return err; +} +#endif + +/** + Performs a self-test of the RC5 block cipher + @return CRYPT_OK if functional, CRYPT_NOP if self-test has been disabled +*/ +int rc5_test(void) +{ + #ifndef LTC_TEST + return CRYPT_NOP; + #else + static const struct { + unsigned char key[16], pt[8], ct[8]; + } tests[] = { + { + { 0x91, 0x5f, 0x46, 0x19, 0xbe, 0x41, 0xb2, 0x51, + 0x63, 0x55, 0xa5, 0x01, 0x10, 0xa9, 0xce, 0x91 }, + { 0x21, 0xa5, 0xdb, 0xee, 0x15, 0x4b, 0x8f, 0x6d }, + { 0xf7, 0xc0, 0x13, 0xac, 0x5b, 0x2b, 0x89, 0x52 } + }, + { + { 0x78, 0x33, 0x48, 0xe7, 0x5a, 0xeb, 0x0f, 0x2f, + 0xd7, 0xb1, 0x69, 0xbb, 0x8d, 0xc1, 0x67, 0x87 }, + { 0xF7, 0xC0, 0x13, 0xAC, 0x5B, 0x2B, 0x89, 0x52 }, + { 0x2F, 0x42, 0xB3, 0xB7, 0x03, 0x69, 0xFC, 0x92 } + }, + { + { 0xDC, 0x49, 0xdb, 0x13, 0x75, 0xa5, 0x58, 0x4f, + 0x64, 0x85, 0xb4, 0x13, 0xb5, 0xf1, 0x2b, 0xaf }, + { 0x2F, 0x42, 0xB3, 0xB7, 0x03, 0x69, 0xFC, 0x92 }, + { 0x65, 0xc1, 0x78, 0xb2, 0x84, 0xd1, 0x97, 0xcc } + } + }; + unsigned char tmp[2][8]; + int x, y, err; + symmetric_key key; + + for (x = 0; x < (int)(sizeof(tests) / sizeof(tests[0])); x++) { + /* setup key */ + if ((err = rc5_setup(tests[x].key, 16, 12, &key)) != CRYPT_OK) { + return err; + } + + /* encrypt and decrypt */ + rc5_ecb_encrypt(tests[x].pt, tmp[0], &key); + rc5_ecb_decrypt(tmp[0], tmp[1], &key); + + /* compare */ + if (XMEMCMP(tmp[0], tests[x].ct, 8) != 0 || XMEMCMP(tmp[1], tests[x].pt, 8) != 0) { + return CRYPT_FAIL_TESTVECTOR; + } + + /* now see if we can encrypt all zero bytes 1000 times, decrypt and come back where we started */ + for (y = 0; y < 8; y++) tmp[0][y] = 0; + for (y = 0; y < 1000; y++) rc5_ecb_encrypt(tmp[0], tmp[0], &key); + for (y = 0; y < 1000; y++) rc5_ecb_decrypt(tmp[0], tmp[0], &key); + for (y = 0; y < 8; y++) if (tmp[0][y] != 0) return CRYPT_FAIL_TESTVECTOR; + } + return CRYPT_OK; + #endif +} + +/** Terminate the context + @param skey The scheduled key +*/ +void rc5_done(symmetric_key *skey) +{ +} + +/** + Gets suitable key size + @param keysize [in/out] The length of the recommended key (in bytes). This function will store the suitable size back in this variable. + @return CRYPT_OK if the input key size is acceptable. +*/ +int rc5_keysize(int *keysize) +{ + LTC_ARGCHK(keysize != NULL); + if (*keysize < 8) { + return CRYPT_INVALID_KEYSIZE; + } else if (*keysize > 128) { + *keysize = 128; + } + return CRYPT_OK; +} + +#endif + + + + +/* $Source: /cvs/libtom/libtomcrypt/src/ciphers/rc5.c,v $ */ +/* $Revision: 1.12 $ */ +/* $Date: 2006/11/08 23:01:06 $ */ diff --git a/libtomcrypt/src/ciphers/rc6.c b/libtomcrypt/src/ciphers/rc6.c new file mode 100644 index 0000000..8afa033 --- /dev/null +++ b/libtomcrypt/src/ciphers/rc6.c @@ -0,0 +1,348 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ + +/** + @file rc6.c + RC6 code by Tom St Denis +*/ +#include "tomcrypt.h" + +#ifdef RC6 + +const struct ltc_cipher_descriptor rc6_desc = +{ + "rc6", + 3, + 8, 128, 16, 20, + &rc6_setup, + &rc6_ecb_encrypt, + &rc6_ecb_decrypt, + &rc6_test, + &rc6_done, + &rc6_keysize, + NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL +}; + +static const ulong32 stab[44] = { +0xb7e15163UL, 0x5618cb1cUL, 0xf45044d5UL, 0x9287be8eUL, 0x30bf3847UL, 0xcef6b200UL, 0x6d2e2bb9UL, 0x0b65a572UL, +0xa99d1f2bUL, 0x47d498e4UL, 0xe60c129dUL, 0x84438c56UL, 0x227b060fUL, 0xc0b27fc8UL, 0x5ee9f981UL, 0xfd21733aUL, +0x9b58ecf3UL, 0x399066acUL, 0xd7c7e065UL, 0x75ff5a1eUL, 0x1436d3d7UL, 0xb26e4d90UL, 0x50a5c749UL, 0xeedd4102UL, +0x8d14babbUL, 0x2b4c3474UL, 0xc983ae2dUL, 0x67bb27e6UL, 0x05f2a19fUL, 0xa42a1b58UL, 0x42619511UL, 0xe0990ecaUL, +0x7ed08883UL, 0x1d08023cUL, 0xbb3f7bf5UL, 0x5976f5aeUL, 0xf7ae6f67UL, 0x95e5e920UL, 0x341d62d9UL, 0xd254dc92UL, +0x708c564bUL, 0x0ec3d004UL, 0xacfb49bdUL, 0x4b32c376UL }; + + /** + Initialize the RC6 block cipher + @param key The symmetric key you wish to pass + @param keylen The key length in bytes + @param num_rounds The number of rounds desired (0 for default) + @param skey The key in as scheduled by this function. + @return CRYPT_OK if successful + */ +#ifdef LTC_CLEAN_STACK +static int _rc6_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey) +#else +int rc6_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey) +#endif +{ + ulong32 L[64], S[50], A, B, i, j, v, s, l; + + LTC_ARGCHK(key != NULL); + LTC_ARGCHK(skey != NULL); + + /* test parameters */ + if (num_rounds != 0 && num_rounds != 20) { + return CRYPT_INVALID_ROUNDS; + } + + /* key must be between 64 and 1024 bits */ + if (keylen < 8 || keylen > 128) { + return CRYPT_INVALID_KEYSIZE; + } + + /* copy the key into the L array */ + for (A = i = j = 0; i < (ulong32)keylen; ) { + A = (A << 8) | ((ulong32)(key[i++] & 255)); + if (!(i & 3)) { + L[j++] = BSWAP(A); + A = 0; + } + } + + /* handle odd sized keys */ + if (keylen & 3) { + A <<= (8 * (4 - (keylen&3))); + L[j++] = BSWAP(A); + } + + /* setup the S array */ + XMEMCPY(S, stab, 44 * sizeof(stab[0])); + + /* mix buffer */ + s = 3 * MAX(44, j); + l = j; + for (A = B = i = j = v = 0; v < s; v++) { + A = S[i] = ROLc(S[i] + A + B, 3); + B = L[j] = ROL(L[j] + A + B, (A+B)); + if (++i == 44) { i = 0; } + if (++j == l) { j = 0; } + } + + /* copy to key */ + for (i = 0; i < 44; i++) { + skey->rc6.K[i] = S[i]; + } + return CRYPT_OK; +} + +#ifdef LTC_CLEAN_STACK +int rc6_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey) +{ + int x; + x = _rc6_setup(key, keylen, num_rounds, skey); + burn_stack(sizeof(ulong32) * 122); + return x; +} +#endif + +/** + Encrypts a block of text with RC6 + @param pt The input plaintext (16 bytes) + @param ct The output ciphertext (16 bytes) + @param skey The key as scheduled +*/ +#ifdef LTC_CLEAN_STACK +static int _rc6_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key *skey) +#else +int rc6_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key *skey) +#endif +{ + ulong32 a,b,c,d,t,u, *K; + int r; + + LTC_ARGCHK(skey != NULL); + LTC_ARGCHK(pt != NULL); + LTC_ARGCHK(ct != NULL); + LOAD32L(a,&pt[0]);LOAD32L(b,&pt[4]);LOAD32L(c,&pt[8]);LOAD32L(d,&pt[12]); + + b += skey->rc6.K[0]; + d += skey->rc6.K[1]; + +#define RND(a,b,c,d) \ + t = (b * (b + b + 1)); t = ROLc(t, 5); \ + u = (d * (d + d + 1)); u = ROLc(u, 5); \ + a = ROL(a^t,u) + K[0]; \ + c = ROL(c^u,t) + K[1]; K += 2; + + K = skey->rc6.K + 2; + for (r = 0; r < 20; r += 4) { + RND(a,b,c,d); + RND(b,c,d,a); + RND(c,d,a,b); + RND(d,a,b,c); + } + +#undef RND + + a += skey->rc6.K[42]; + c += skey->rc6.K[43]; + STORE32L(a,&ct[0]);STORE32L(b,&ct[4]);STORE32L(c,&ct[8]);STORE32L(d,&ct[12]); + return CRYPT_OK; +} + +#ifdef LTC_CLEAN_STACK +int rc6_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key *skey) +{ + int err = _rc6_ecb_encrypt(pt, ct, skey); + burn_stack(sizeof(ulong32) * 6 + sizeof(int)); + return err; +} +#endif + +/** + Decrypts a block of text with RC6 + @param ct The input ciphertext (16 bytes) + @param pt The output plaintext (16 bytes) + @param skey The key as scheduled +*/ +#ifdef LTC_CLEAN_STACK +static int _rc6_ecb_decrypt(const unsigned char *ct, unsigned char *pt, symmetric_key *skey) +#else +int rc6_ecb_decrypt(const unsigned char *ct, unsigned char *pt, symmetric_key *skey) +#endif +{ + ulong32 a,b,c,d,t,u, *K; + int r; + + LTC_ARGCHK(skey != NULL); + LTC_ARGCHK(pt != NULL); + LTC_ARGCHK(ct != NULL); + + LOAD32L(a,&ct[0]);LOAD32L(b,&ct[4]);LOAD32L(c,&ct[8]);LOAD32L(d,&ct[12]); + a -= skey->rc6.K[42]; + c -= skey->rc6.K[43]; + +#define RND(a,b,c,d) \ + t = (b * (b + b + 1)); t = ROLc(t, 5); \ + u = (d * (d + d + 1)); u = ROLc(u, 5); \ + c = ROR(c - K[1], t) ^ u; \ + a = ROR(a - K[0], u) ^ t; K -= 2; + + K = skey->rc6.K + 40; + + for (r = 0; r < 20; r += 4) { + RND(d,a,b,c); + RND(c,d,a,b); + RND(b,c,d,a); + RND(a,b,c,d); + } + +#undef RND + + b -= skey->rc6.K[0]; + d -= skey->rc6.K[1]; + STORE32L(a,&pt[0]);STORE32L(b,&pt[4]);STORE32L(c,&pt[8]);STORE32L(d,&pt[12]); + + return CRYPT_OK; +} + +#ifdef LTC_CLEAN_STACK +int rc6_ecb_decrypt(const unsigned char *ct, unsigned char *pt, symmetric_key *skey) +{ + int err = _rc6_ecb_decrypt(ct, pt, skey); + burn_stack(sizeof(ulong32) * 6 + sizeof(int)); + return err; +} +#endif + +/** + Performs a self-test of the RC6 block cipher + @return CRYPT_OK if functional, CRYPT_NOP if self-test has been disabled +*/ +int rc6_test(void) +{ + #ifndef LTC_TEST + return CRYPT_NOP; + #else + static const struct { + int keylen; + unsigned char key[32], pt[16], ct[16]; + } tests[] = { + { + 16, + { 0x01, 0x23, 0x45, 0x67, 0x89, 0xab, 0xcd, 0xef, + 0x01, 0x12, 0x23, 0x34, 0x45, 0x56, 0x67, 0x78, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0x02, 0x13, 0x24, 0x35, 0x46, 0x57, 0x68, 0x79, + 0x8a, 0x9b, 0xac, 0xbd, 0xce, 0xdf, 0xe0, 0xf1 }, + { 0x52, 0x4e, 0x19, 0x2f, 0x47, 0x15, 0xc6, 0x23, + 0x1f, 0x51, 0xf6, 0x36, 0x7e, 0xa4, 0x3f, 0x18 } + }, + { + 24, + { 0x01, 0x23, 0x45, 0x67, 0x89, 0xab, 0xcd, 0xef, + 0x01, 0x12, 0x23, 0x34, 0x45, 0x56, 0x67, 0x78, + 0x89, 0x9a, 0xab, 0xbc, 0xcd, 0xde, 0xef, 0xf0, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0x02, 0x13, 0x24, 0x35, 0x46, 0x57, 0x68, 0x79, + 0x8a, 0x9b, 0xac, 0xbd, 0xce, 0xdf, 0xe0, 0xf1 }, + { 0x68, 0x83, 0x29, 0xd0, 0x19, 0xe5, 0x05, 0x04, + 0x1e, 0x52, 0xe9, 0x2a, 0xf9, 0x52, 0x91, 0xd4 } + }, + { + 32, + { 0x01, 0x23, 0x45, 0x67, 0x89, 0xab, 0xcd, 0xef, + 0x01, 0x12, 0x23, 0x34, 0x45, 0x56, 0x67, 0x78, + 0x89, 0x9a, 0xab, 0xbc, 0xcd, 0xde, 0xef, 0xf0, + 0x10, 0x32, 0x54, 0x76, 0x98, 0xba, 0xdc, 0xfe }, + { 0x02, 0x13, 0x24, 0x35, 0x46, 0x57, 0x68, 0x79, + 0x8a, 0x9b, 0xac, 0xbd, 0xce, 0xdf, 0xe0, 0xf1 }, + { 0xc8, 0x24, 0x18, 0x16, 0xf0, 0xd7, 0xe4, 0x89, + 0x20, 0xad, 0x16, 0xa1, 0x67, 0x4e, 0x5d, 0x48 } + } + }; + unsigned char tmp[2][16]; + int x, y, err; + symmetric_key key; + + for (x = 0; x < (int)(sizeof(tests) / sizeof(tests[0])); x++) { + /* setup key */ + if ((err = rc6_setup(tests[x].key, tests[x].keylen, 0, &key)) != CRYPT_OK) { + return err; + } + + /* encrypt and decrypt */ + rc6_ecb_encrypt(tests[x].pt, tmp[0], &key); + rc6_ecb_decrypt(tmp[0], tmp[1], &key); + + /* compare */ + if (XMEMCMP(tmp[0], tests[x].ct, 16) || XMEMCMP(tmp[1], tests[x].pt, 16)) { +#if 0 + printf("\n\nFailed test %d\n", x); + if (XMEMCMP(tmp[0], tests[x].ct, 16)) { + printf("Ciphertext: "); + for (y = 0; y < 16; y++) printf("%02x ", tmp[0][y]); + printf("\nExpected : "); + for (y = 0; y < 16; y++) printf("%02x ", tests[x].ct[y]); + printf("\n"); + } + if (XMEMCMP(tmp[1], tests[x].pt, 16)) { + printf("Plaintext: "); + for (y = 0; y < 16; y++) printf("%02x ", tmp[0][y]); + printf("\nExpected : "); + for (y = 0; y < 16; y++) printf("%02x ", tests[x].pt[y]); + printf("\n"); + } +#endif + return CRYPT_FAIL_TESTVECTOR; + } + + /* now see if we can encrypt all zero bytes 1000 times, decrypt and come back where we started */ + for (y = 0; y < 16; y++) tmp[0][y] = 0; + for (y = 0; y < 1000; y++) rc6_ecb_encrypt(tmp[0], tmp[0], &key); + for (y = 0; y < 1000; y++) rc6_ecb_decrypt(tmp[0], tmp[0], &key); + for (y = 0; y < 16; y++) if (tmp[0][y] != 0) return CRYPT_FAIL_TESTVECTOR; + } + return CRYPT_OK; + #endif +} + +/** Terminate the context + @param skey The scheduled key +*/ +void rc6_done(symmetric_key *skey) +{ +} + +/** + Gets suitable key size + @param keysize [in/out] The length of the recommended key (in bytes). This function will store the suitable size back in this variable. + @return CRYPT_OK if the input key size is acceptable. +*/ +int rc6_keysize(int *keysize) +{ + LTC_ARGCHK(keysize != NULL); + if (*keysize < 8) { + return CRYPT_INVALID_KEYSIZE; + } else if (*keysize > 128) { + *keysize = 128; + } + return CRYPT_OK; +} + +#endif /*RC6*/ + + + +/* $Source: /cvs/libtom/libtomcrypt/src/ciphers/rc6.c,v $ */ +/* $Revision: 1.12 $ */ +/* $Date: 2006/11/08 23:01:06 $ */ diff --git a/libtomcrypt/src/ciphers/safer/safer.c b/libtomcrypt/src/ciphers/safer/safer.c new file mode 100644 index 0000000..9fdaf37 --- /dev/null +++ b/libtomcrypt/src/ciphers/safer/safer.c @@ -0,0 +1,491 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ + +/******************************************************************************* +* +* FILE: safer.c +* +* DESCRIPTION: block-cipher algorithm SAFER (Secure And Fast Encryption +* Routine) in its four versions: SAFER K-64, SAFER K-128, +* SAFER SK-64 and SAFER SK-128. +* +* AUTHOR: Richard De Moliner (demoliner@isi.ee.ethz.ch) +* Signal and Information Processing Laboratory +* Swiss Federal Institute of Technology +* CH-8092 Zuerich, Switzerland +* +* DATE: September 9, 1995 +* +* CHANGE HISTORY: +* +*******************************************************************************/ + +#include <tomcrypt.h> + +#ifdef SAFER + +const struct ltc_cipher_descriptor + safer_k64_desc = { + "safer-k64", + 8, 8, 8, 8, SAFER_K64_DEFAULT_NOF_ROUNDS, + &safer_k64_setup, + &safer_ecb_encrypt, + &safer_ecb_decrypt, + &safer_k64_test, + &safer_done, + &safer_64_keysize, + NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL + }, + + safer_sk64_desc = { + "safer-sk64", + 9, 8, 8, 8, SAFER_SK64_DEFAULT_NOF_ROUNDS, + &safer_sk64_setup, + &safer_ecb_encrypt, + &safer_ecb_decrypt, + &safer_sk64_test, + &safer_done, + &safer_64_keysize, + NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL + }, + + safer_k128_desc = { + "safer-k128", + 10, 16, 16, 8, SAFER_K128_DEFAULT_NOF_ROUNDS, + &safer_k128_setup, + &safer_ecb_encrypt, + &safer_ecb_decrypt, + &safer_sk128_test, + &safer_done, + &safer_128_keysize, + NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL + }, + + safer_sk128_desc = { + "safer-sk128", + 11, 16, 16, 8, SAFER_SK128_DEFAULT_NOF_ROUNDS, + &safer_sk128_setup, + &safer_ecb_encrypt, + &safer_ecb_decrypt, + &safer_sk128_test, + &safer_done, + &safer_128_keysize, + NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL + }; + +/******************* Constants ************************************************/ +/* #define TAB_LEN 256 */ + +/******************* Assertions ***********************************************/ + +/******************* Macros ***************************************************/ +#define ROL8(x, n) ((unsigned char)((unsigned int)(x) << (n)\ + |(unsigned int)((x) & 0xFF) >> (8 - (n)))) +#define EXP(x) safer_ebox[(x) & 0xFF] +#define LOG(x) safer_lbox[(x) & 0xFF] +#define PHT(x, y) { y += x; x += y; } +#define IPHT(x, y) { x -= y; y -= x; } + +/******************* Types ****************************************************/ +extern const unsigned char safer_ebox[], safer_lbox[]; + +#ifdef LTC_CLEAN_STACK +static void _Safer_Expand_Userkey(const unsigned char *userkey_1, + const unsigned char *userkey_2, + unsigned int nof_rounds, + int strengthened, + safer_key_t key) +#else +static void Safer_Expand_Userkey(const unsigned char *userkey_1, + const unsigned char *userkey_2, + unsigned int nof_rounds, + int strengthened, + safer_key_t key) +#endif +{ unsigned int i, j, k; + unsigned char ka[SAFER_BLOCK_LEN + 1]; + unsigned char kb[SAFER_BLOCK_LEN + 1]; + + if (SAFER_MAX_NOF_ROUNDS < nof_rounds) + nof_rounds = SAFER_MAX_NOF_ROUNDS; + *key++ = (unsigned char)nof_rounds; + ka[SAFER_BLOCK_LEN] = (unsigned char)0; + kb[SAFER_BLOCK_LEN] = (unsigned char)0; + k = 0; + for (j = 0; j < SAFER_BLOCK_LEN; j++) { + ka[j] = ROL8(userkey_1[j], 5); + ka[SAFER_BLOCK_LEN] ^= ka[j]; + kb[j] = *key++ = userkey_2[j]; + kb[SAFER_BLOCK_LEN] ^= kb[j]; + } + for (i = 1; i <= nof_rounds; i++) { + for (j = 0; j < SAFER_BLOCK_LEN + 1; j++) { + ka[j] = ROL8(ka[j], 6); + kb[j] = ROL8(kb[j], 6); + } + if (strengthened) { + k = 2 * i - 1; + while (k >= (SAFER_BLOCK_LEN + 1)) { k -= SAFER_BLOCK_LEN + 1; } + } + for (j = 0; j < SAFER_BLOCK_LEN; j++) { + if (strengthened) { + *key++ = (ka[k] + + safer_ebox[(int)safer_ebox[(int)((18 * i + j + 1)&0xFF)]]) & 0xFF; + if (++k == (SAFER_BLOCK_LEN + 1)) { k = 0; } + } else { + *key++ = (ka[j] + safer_ebox[(int)safer_ebox[(int)((18 * i + j + 1)&0xFF)]]) & 0xFF; + } + } + if (strengthened) { + k = 2 * i; + while (k >= (SAFER_BLOCK_LEN + 1)) { k -= SAFER_BLOCK_LEN + 1; } + } + for (j = 0; j < SAFER_BLOCK_LEN; j++) { + if (strengthened) { + *key++ = (kb[k] + + safer_ebox[(int)safer_ebox[(int)((18 * i + j + 10)&0xFF)]]) & 0xFF; + if (++k == (SAFER_BLOCK_LEN + 1)) { k = 0; } + } else { + *key++ = (kb[j] + safer_ebox[(int)safer_ebox[(int)((18 * i + j + 10)&0xFF)]]) & 0xFF; + } + } + } + +#ifdef LTC_CLEAN_STACK + zeromem(ka, sizeof(ka)); + zeromem(kb, sizeof(kb)); +#endif +} + +#ifdef LTC_CLEAN_STACK +static void Safer_Expand_Userkey(const unsigned char *userkey_1, + const unsigned char *userkey_2, + unsigned int nof_rounds, + int strengthened, + safer_key_t key) +{ + _Safer_Expand_Userkey(userkey_1, userkey_2, nof_rounds, strengthened, key); + burn_stack(sizeof(unsigned char) * (2 * (SAFER_BLOCK_LEN + 1)) + sizeof(unsigned int)*2); +} +#endif + +int safer_k64_setup(const unsigned char *key, int keylen, int numrounds, symmetric_key *skey) +{ + LTC_ARGCHK(key != NULL); + LTC_ARGCHK(skey != NULL); + + if (numrounds != 0 && (numrounds < 6 || numrounds > SAFER_MAX_NOF_ROUNDS)) { + return CRYPT_INVALID_ROUNDS; + } + + if (keylen != 8) { + return CRYPT_INVALID_KEYSIZE; + } + + Safer_Expand_Userkey(key, key, (unsigned int)(numrounds != 0 ?numrounds:SAFER_K64_DEFAULT_NOF_ROUNDS), 0, skey->safer.key); + return CRYPT_OK; +} + +int safer_sk64_setup(const unsigned char *key, int keylen, int numrounds, symmetric_key *skey) +{ + LTC_ARGCHK(key != NULL); + LTC_ARGCHK(skey != NULL); + + if (numrounds != 0 && (numrounds < 6 || numrounds > SAFER_MAX_NOF_ROUNDS)) { + return CRYPT_INVALID_ROUNDS; + } + + if (keylen != 8) { + return CRYPT_INVALID_KEYSIZE; + } + + Safer_Expand_Userkey(key, key, (unsigned int)(numrounds != 0 ?numrounds:SAFER_SK64_DEFAULT_NOF_ROUNDS), 1, skey->safer.key); + return CRYPT_OK; +} + +int safer_k128_setup(const unsigned char *key, int keylen, int numrounds, symmetric_key *skey) +{ + LTC_ARGCHK(key != NULL); + LTC_ARGCHK(skey != NULL); + + if (numrounds != 0 && (numrounds < 6 || numrounds > SAFER_MAX_NOF_ROUNDS)) { + return CRYPT_INVALID_ROUNDS; + } + + if (keylen != 16) { + return CRYPT_INVALID_KEYSIZE; + } + + Safer_Expand_Userkey(key, key+8, (unsigned int)(numrounds != 0 ?numrounds:SAFER_K128_DEFAULT_NOF_ROUNDS), 0, skey->safer.key); + return CRYPT_OK; +} + +int safer_sk128_setup(const unsigned char *key, int keylen, int numrounds, symmetric_key *skey) +{ + LTC_ARGCHK(key != NULL); + LTC_ARGCHK(skey != NULL); + + if (numrounds != 0 && (numrounds < 6 || numrounds > SAFER_MAX_NOF_ROUNDS)) { + return CRYPT_INVALID_ROUNDS; + } + + if (keylen != 16) { + return CRYPT_INVALID_KEYSIZE; + } + + Safer_Expand_Userkey(key, key+8, (unsigned int)(numrounds != 0?numrounds:SAFER_SK128_DEFAULT_NOF_ROUNDS), 1, skey->safer.key); + return CRYPT_OK; +} + +#ifdef LTC_CLEAN_STACK +static int _safer_ecb_encrypt(const unsigned char *block_in, + unsigned char *block_out, + symmetric_key *skey) +#else +int safer_ecb_encrypt(const unsigned char *block_in, + unsigned char *block_out, + symmetric_key *skey) +#endif +{ unsigned char a, b, c, d, e, f, g, h, t; + unsigned int round; + unsigned char *key; + + LTC_ARGCHK(block_in != NULL); + LTC_ARGCHK(block_out != NULL); + LTC_ARGCHK(skey != NULL); + + key = skey->safer.key; + a = block_in[0]; b = block_in[1]; c = block_in[2]; d = block_in[3]; + e = block_in[4]; f = block_in[5]; g = block_in[6]; h = block_in[7]; + if (SAFER_MAX_NOF_ROUNDS < (round = *key)) round = SAFER_MAX_NOF_ROUNDS; + while(round-- > 0) + { + a ^= *++key; b += *++key; c += *++key; d ^= *++key; + e ^= *++key; f += *++key; g += *++key; h ^= *++key; + a = EXP(a) + *++key; b = LOG(b) ^ *++key; + c = LOG(c) ^ *++key; d = EXP(d) + *++key; + e = EXP(e) + *++key; f = LOG(f) ^ *++key; + g = LOG(g) ^ *++key; h = EXP(h) + *++key; + PHT(a, b); PHT(c, d); PHT(e, f); PHT(g, h); + PHT(a, c); PHT(e, g); PHT(b, d); PHT(f, h); + PHT(a, e); PHT(b, f); PHT(c, g); PHT(d, h); + t = b; b = e; e = c; c = t; t = d; d = f; f = g; g = t; + } + a ^= *++key; b += *++key; c += *++key; d ^= *++key; + e ^= *++key; f += *++key; g += *++key; h ^= *++key; + block_out[0] = a & 0xFF; block_out[1] = b & 0xFF; + block_out[2] = c & 0xFF; block_out[3] = d & 0xFF; + block_out[4] = e & 0xFF; block_out[5] = f & 0xFF; + block_out[6] = g & 0xFF; block_out[7] = h & 0xFF; + return CRYPT_OK; +} + +#ifdef LTC_CLEAN_STACK +int safer_ecb_encrypt(const unsigned char *block_in, + unsigned char *block_out, + symmetric_key *skey) +{ + int err = _safer_ecb_encrypt(block_in, block_out, skey); + burn_stack(sizeof(unsigned char) * 9 + sizeof(unsigned int) + sizeof(unsigned char *)); + return err; +} +#endif + +#ifdef LTC_CLEAN_STACK +static int _safer_ecb_decrypt(const unsigned char *block_in, + unsigned char *block_out, + symmetric_key *skey) +#else +int safer_ecb_decrypt(const unsigned char *block_in, + unsigned char *block_out, + symmetric_key *skey) +#endif +{ unsigned char a, b, c, d, e, f, g, h, t; + unsigned int round; + unsigned char *key; + + LTC_ARGCHK(block_in != NULL); + LTC_ARGCHK(block_out != NULL); + LTC_ARGCHK(skey != NULL); + + key = skey->safer.key; + a = block_in[0]; b = block_in[1]; c = block_in[2]; d = block_in[3]; + e = block_in[4]; f = block_in[5]; g = block_in[6]; h = block_in[7]; + if (SAFER_MAX_NOF_ROUNDS < (round = *key)) round = SAFER_MAX_NOF_ROUNDS; + key += SAFER_BLOCK_LEN * (1 + 2 * round); + h ^= *key; g -= *--key; f -= *--key; e ^= *--key; + d ^= *--key; c -= *--key; b -= *--key; a ^= *--key; + while (round--) + { + t = e; e = b; b = c; c = t; t = f; f = d; d = g; g = t; + IPHT(a, e); IPHT(b, f); IPHT(c, g); IPHT(d, h); + IPHT(a, c); IPHT(e, g); IPHT(b, d); IPHT(f, h); + IPHT(a, b); IPHT(c, d); IPHT(e, f); IPHT(g, h); + h -= *--key; g ^= *--key; f ^= *--key; e -= *--key; + d -= *--key; c ^= *--key; b ^= *--key; a -= *--key; + h = LOG(h) ^ *--key; g = EXP(g) - *--key; + f = EXP(f) - *--key; e = LOG(e) ^ *--key; + d = LOG(d) ^ *--key; c = EXP(c) - *--key; + b = EXP(b) - *--key; a = LOG(a) ^ *--key; + } + block_out[0] = a & 0xFF; block_out[1] = b & 0xFF; + block_out[2] = c & 0xFF; block_out[3] = d & 0xFF; + block_out[4] = e & 0xFF; block_out[5] = f & 0xFF; + block_out[6] = g & 0xFF; block_out[7] = h & 0xFF; + return CRYPT_OK; +} + +#ifdef LTC_CLEAN_STACK +int safer_ecb_decrypt(const unsigned char *block_in, + unsigned char *block_out, + symmetric_key *skey) +{ + int err = _safer_ecb_decrypt(block_in, block_out, skey); + burn_stack(sizeof(unsigned char) * 9 + sizeof(unsigned int) + sizeof(unsigned char *)); + return err; +} +#endif + +int safer_64_keysize(int *keysize) +{ + LTC_ARGCHK(keysize != NULL); + if (*keysize < 8) { + return CRYPT_INVALID_KEYSIZE; + } else { + *keysize = 8; + return CRYPT_OK; + } +} + +int safer_128_keysize(int *keysize) +{ + LTC_ARGCHK(keysize != NULL); + if (*keysize < 16) { + return CRYPT_INVALID_KEYSIZE; + } else { + *keysize = 16; + return CRYPT_OK; + } +} + +int safer_k64_test(void) +{ + #ifndef LTC_TEST + return CRYPT_NOP; + #else + static const unsigned char k64_pt[] = { 1, 2, 3, 4, 5, 6, 7, 8 }, + k64_key[] = { 8, 7, 6, 5, 4, 3, 2, 1 }, + k64_ct[] = { 200, 242, 156, 221, 135, 120, 62, 217 }; + + symmetric_key skey; + unsigned char buf[2][8]; + int err; + + /* test K64 */ + if ((err = safer_k64_setup(k64_key, 8, 6, &skey)) != CRYPT_OK) { + return err; + } + safer_ecb_encrypt(k64_pt, buf[0], &skey); + safer_ecb_decrypt(buf[0], buf[1], &skey); + + if (XMEMCMP(buf[0], k64_ct, 8) != 0 || XMEMCMP(buf[1], k64_pt, 8) != 0) { + return CRYPT_FAIL_TESTVECTOR; + } + + return CRYPT_OK; + #endif +} + + +int safer_sk64_test(void) +{ + #ifndef LTC_TEST + return CRYPT_NOP; + #else + static const unsigned char sk64_pt[] = { 1, 2, 3, 4, 5, 6, 7, 8 }, + sk64_key[] = { 1, 2, 3, 4, 5, 6, 7, 8 }, + sk64_ct[] = { 95, 206, 155, 162, 5, 132, 56, 199 }; + + symmetric_key skey; + unsigned char buf[2][8]; + int err, y; + + /* test SK64 */ + if ((err = safer_sk64_setup(sk64_key, 8, 6, &skey)) != CRYPT_OK) { + return err; + } + + safer_ecb_encrypt(sk64_pt, buf[0], &skey); + safer_ecb_decrypt(buf[0], buf[1], &skey); + + if (XMEMCMP(buf[0], sk64_ct, 8) != 0 || XMEMCMP(buf[1], sk64_pt, 8) != 0) { + return CRYPT_FAIL_TESTVECTOR; + } + + /* now see if we can encrypt all zero bytes 1000 times, decrypt and come back where we started */ + for (y = 0; y < 8; y++) buf[0][y] = 0; + for (y = 0; y < 1000; y++) safer_ecb_encrypt(buf[0], buf[0], &skey); + for (y = 0; y < 1000; y++) safer_ecb_decrypt(buf[0], buf[0], &skey); + for (y = 0; y < 8; y++) if (buf[0][y] != 0) return CRYPT_FAIL_TESTVECTOR; + + return CRYPT_OK; + #endif +} + +/** Terminate the context + @param skey The scheduled key +*/ +void safer_done(symmetric_key *skey) +{ +} + +int safer_sk128_test(void) +{ + #ifndef LTC_TEST + return CRYPT_NOP; + #else + static const unsigned char sk128_pt[] = { 1, 2, 3, 4, 5, 6, 7, 8 }, + sk128_key[] = { 1, 2, 3, 4, 5, 6, 7, 8, + 0, 0, 0, 0, 0, 0, 0, 0 }, + sk128_ct[] = { 255, 120, 17, 228, 179, 167, 46, 113 }; + + symmetric_key skey; + unsigned char buf[2][8]; + int err, y; + + /* test SK128 */ + if ((err = safer_sk128_setup(sk128_key, 16, 0, &skey)) != CRYPT_OK) { + return err; + } + safer_ecb_encrypt(sk128_pt, buf[0], &skey); + safer_ecb_decrypt(buf[0], buf[1], &skey); + + if (XMEMCMP(buf[0], sk128_ct, 8) != 0 || XMEMCMP(buf[1], sk128_pt, 8) != 0) { + return CRYPT_FAIL_TESTVECTOR; + } + + /* now see if we can encrypt all zero bytes 1000 times, decrypt and come back where we started */ + for (y = 0; y < 8; y++) buf[0][y] = 0; + for (y = 0; y < 1000; y++) safer_ecb_encrypt(buf[0], buf[0], &skey); + for (y = 0; y < 1000; y++) safer_ecb_decrypt(buf[0], buf[0], &skey); + for (y = 0; y < 8; y++) if (buf[0][y] != 0) return CRYPT_FAIL_TESTVECTOR; + return CRYPT_OK; + #endif +} + +#endif + + + + +/* $Source: /cvs/libtom/libtomcrypt/src/ciphers/safer/safer.c,v $ */ +/* $Revision: 1.13 $ */ +/* $Date: 2006/11/08 23:01:06 $ */ diff --git a/libtomcrypt/src/ciphers/safer/safer_tab.c b/libtomcrypt/src/ciphers/safer/safer_tab.c new file mode 100644 index 0000000..a542768 --- /dev/null +++ b/libtomcrypt/src/ciphers/safer/safer_tab.c @@ -0,0 +1,68 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ + +/** + @file safer_tab.c + Tables for SAFER block ciphers +*/ + +#include "tomcrypt.h" + +#if defined(SAFERP) || defined(SAFER) + +/* This is the box defined by ebox[x] = 45^x mod 257. + * Its assumed that the value "256" corresponds to zero. */ +const unsigned char safer_ebox[256] = { + 1, 45, 226, 147, 190, 69, 21, 174, 120, 3, 135, 164, 184, 56, 207, 63, + 8, 103, 9, 148, 235, 38, 168, 107, 189, 24, 52, 27, 187, 191, 114, 247, + 64, 53, 72, 156, 81, 47, 59, 85, 227, 192, 159, 216, 211, 243, 141, 177, +255, 167, 62, 220, 134, 119, 215, 166, 17, 251, 244, 186, 146, 145, 100, 131, +241, 51, 239, 218, 44, 181, 178, 43, 136, 209, 153, 203, 140, 132, 29, 20, +129, 151, 113, 202, 95, 163, 139, 87, 60, 130, 196, 82, 92, 28, 232, 160, + 4, 180, 133, 74, 246, 19, 84, 182, 223, 12, 26, 142, 222, 224, 57, 252, + 32, 155, 36, 78, 169, 152, 158, 171, 242, 96, 208, 108, 234, 250, 199, 217, + 0, 212, 31, 110, 67, 188, 236, 83, 137, 254, 122, 93, 73, 201, 50, 194, +249, 154, 248, 109, 22, 219, 89, 150, 68, 233, 205, 230, 70, 66, 143, 10, +193, 204, 185, 101, 176, 210, 198, 172, 30, 65, 98, 41, 46, 14, 116, 80, + 2, 90, 195, 37, 123, 138, 42, 91, 240, 6, 13, 71, 111, 112, 157, 126, + 16, 206, 18, 39, 213, 76, 79, 214, 121, 48, 104, 54, 117, 125, 228, 237, +128, 106, 144, 55, 162, 94, 118, 170, 197, 127, 61, 175, 165, 229, 25, 97, +253, 77, 124, 183, 11, 238, 173, 75, 34, 245, 231, 115, 35, 33, 200, 5, +225, 102, 221, 179, 88, 105, 99, 86, 15, 161, 49, 149, 23, 7, 58, 40 +}; + +/* This is the inverse of ebox or the base 45 logarithm */ +const unsigned char safer_lbox[256] = { +128, 0, 176, 9, 96, 239, 185, 253, 16, 18, 159, 228, 105, 186, 173, 248, +192, 56, 194, 101, 79, 6, 148, 252, 25, 222, 106, 27, 93, 78, 168, 130, +112, 237, 232, 236, 114, 179, 21, 195, 255, 171, 182, 71, 68, 1, 172, 37, +201, 250, 142, 65, 26, 33, 203, 211, 13, 110, 254, 38, 88, 218, 50, 15, + 32, 169, 157, 132, 152, 5, 156, 187, 34, 140, 99, 231, 197, 225, 115, 198, +175, 36, 91, 135, 102, 39, 247, 87, 244, 150, 177, 183, 92, 139, 213, 84, +121, 223, 170, 246, 62, 163, 241, 17, 202, 245, 209, 23, 123, 147, 131, 188, +189, 82, 30, 235, 174, 204, 214, 53, 8, 200, 138, 180, 226, 205, 191, 217, +208, 80, 89, 63, 77, 98, 52, 10, 72, 136, 181, 86, 76, 46, 107, 158, +210, 61, 60, 3, 19, 251, 151, 81, 117, 74, 145, 113, 35, 190, 118, 42, + 95, 249, 212, 85, 11, 220, 55, 49, 22, 116, 215, 119, 167, 230, 7, 219, +164, 47, 70, 243, 97, 69, 103, 227, 12, 162, 59, 28, 133, 24, 4, 29, + 41, 160, 143, 178, 90, 216, 166, 126, 238, 141, 83, 75, 161, 154, 193, 14, +122, 73, 165, 44, 129, 196, 199, 54, 43, 127, 67, 149, 51, 242, 108, 104, +109, 240, 2, 40, 206, 221, 155, 234, 94, 153, 124, 20, 134, 207, 229, 66, +184, 64, 120, 45, 58, 233, 100, 31, 146, 144, 125, 57, 111, 224, 137, 48 +}; + +#endif + + + +/* $Source: /cvs/libtom/libtomcrypt/src/ciphers/safer/safer_tab.c,v $ */ +/* $Revision: 1.4 $ */ +/* $Date: 2006/03/31 14:15:35 $ */ diff --git a/libtomcrypt/src/ciphers/safer/saferp.c b/libtomcrypt/src/ciphers/safer/saferp.c new file mode 100644 index 0000000..dff4ee9 --- /dev/null +++ b/libtomcrypt/src/ciphers/safer/saferp.c @@ -0,0 +1,559 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ + +/** + @file saferp.c + SAFER+ Implementation by Tom St Denis +*/ +#include "tomcrypt.h" + +#ifdef SAFERP + +const struct ltc_cipher_descriptor saferp_desc = +{ + "safer+", + 4, + 16, 32, 16, 8, + &saferp_setup, + &saferp_ecb_encrypt, + &saferp_ecb_decrypt, + &saferp_test, + &saferp_done, + &saferp_keysize, + NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL +}; + +/* ROUND(b,i) + * + * This is one forward key application. Note the basic form is + * key addition, substitution, key addition. The safer_ebox and safer_lbox + * are the exponentiation box and logarithm boxes respectively. + * The value of 'i' is the current round number which allows this + * function to be unrolled massively. Most of SAFER+'s speed + * comes from not having to compute indirect accesses into the + * array of 16 bytes b[0..15] which is the block of data +*/ + +extern const unsigned char safer_ebox[], safer_lbox[]; + +#define ROUND(b, i) \ + b[0] = (safer_ebox[(b[0] ^ skey->saferp.K[i][0]) & 255] + skey->saferp.K[i+1][0]) & 255; \ + b[1] = safer_lbox[(b[1] + skey->saferp.K[i][1]) & 255] ^ skey->saferp.K[i+1][1]; \ + b[2] = safer_lbox[(b[2] + skey->saferp.K[i][2]) & 255] ^ skey->saferp.K[i+1][2]; \ + b[3] = (safer_ebox[(b[3] ^ skey->saferp.K[i][3]) & 255] + skey->saferp.K[i+1][3]) & 255; \ + b[4] = (safer_ebox[(b[4] ^ skey->saferp.K[i][4]) & 255] + skey->saferp.K[i+1][4]) & 255; \ + b[5] = safer_lbox[(b[5] + skey->saferp.K[i][5]) & 255] ^ skey->saferp.K[i+1][5]; \ + b[6] = safer_lbox[(b[6] + skey->saferp.K[i][6]) & 255] ^ skey->saferp.K[i+1][6]; \ + b[7] = (safer_ebox[(b[7] ^ skey->saferp.K[i][7]) & 255] + skey->saferp.K[i+1][7]) & 255; \ + b[8] = (safer_ebox[(b[8] ^ skey->saferp.K[i][8]) & 255] + skey->saferp.K[i+1][8]) & 255; \ + b[9] = safer_lbox[(b[9] + skey->saferp.K[i][9]) & 255] ^ skey->saferp.K[i+1][9]; \ + b[10] = safer_lbox[(b[10] + skey->saferp.K[i][10]) & 255] ^ skey->saferp.K[i+1][10]; \ + b[11] = (safer_ebox[(b[11] ^ skey->saferp.K[i][11]) & 255] + skey->saferp.K[i+1][11]) & 255; \ + b[12] = (safer_ebox[(b[12] ^ skey->saferp.K[i][12]) & 255] + skey->saferp.K[i+1][12]) & 255; \ + b[13] = safer_lbox[(b[13] + skey->saferp.K[i][13]) & 255] ^ skey->saferp.K[i+1][13]; \ + b[14] = safer_lbox[(b[14] + skey->saferp.K[i][14]) & 255] ^ skey->saferp.K[i+1][14]; \ + b[15] = (safer_ebox[(b[15] ^ skey->saferp.K[i][15]) & 255] + skey->saferp.K[i+1][15]) & 255; + +/* This is one inverse key application */ +#define iROUND(b, i) \ + b[0] = safer_lbox[(b[0] - skey->saferp.K[i+1][0]) & 255] ^ skey->saferp.K[i][0]; \ + b[1] = (safer_ebox[(b[1] ^ skey->saferp.K[i+1][1]) & 255] - skey->saferp.K[i][1]) & 255; \ + b[2] = (safer_ebox[(b[2] ^ skey->saferp.K[i+1][2]) & 255] - skey->saferp.K[i][2]) & 255; \ + b[3] = safer_lbox[(b[3] - skey->saferp.K[i+1][3]) & 255] ^ skey->saferp.K[i][3]; \ + b[4] = safer_lbox[(b[4] - skey->saferp.K[i+1][4]) & 255] ^ skey->saferp.K[i][4]; \ + b[5] = (safer_ebox[(b[5] ^ skey->saferp.K[i+1][5]) & 255] - skey->saferp.K[i][5]) & 255; \ + b[6] = (safer_ebox[(b[6] ^ skey->saferp.K[i+1][6]) & 255] - skey->saferp.K[i][6]) & 255; \ + b[7] = safer_lbox[(b[7] - skey->saferp.K[i+1][7]) & 255] ^ skey->saferp.K[i][7]; \ + b[8] = safer_lbox[(b[8] - skey->saferp.K[i+1][8]) & 255] ^ skey->saferp.K[i][8]; \ + b[9] = (safer_ebox[(b[9] ^ skey->saferp.K[i+1][9]) & 255] - skey->saferp.K[i][9]) & 255; \ + b[10] = (safer_ebox[(b[10] ^ skey->saferp.K[i+1][10]) & 255] - skey->saferp.K[i][10]) & 255; \ + b[11] = safer_lbox[(b[11] - skey->saferp.K[i+1][11]) & 255] ^ skey->saferp.K[i][11]; \ + b[12] = safer_lbox[(b[12] - skey->saferp.K[i+1][12]) & 255] ^ skey->saferp.K[i][12]; \ + b[13] = (safer_ebox[(b[13] ^ skey->saferp.K[i+1][13]) & 255] - skey->saferp.K[i][13]) & 255; \ + b[14] = (safer_ebox[(b[14] ^ skey->saferp.K[i+1][14]) & 255] - skey->saferp.K[i][14]) & 255; \ + b[15] = safer_lbox[(b[15] - skey->saferp.K[i+1][15]) & 255] ^ skey->saferp.K[i][15]; + +/* This is a forward single layer PHT transform. */ +#define PHT(b) \ + b[0] = (b[0] + (b[1] = (b[0] + b[1]) & 255)) & 255; \ + b[2] = (b[2] + (b[3] = (b[3] + b[2]) & 255)) & 255; \ + b[4] = (b[4] + (b[5] = (b[5] + b[4]) & 255)) & 255; \ + b[6] = (b[6] + (b[7] = (b[7] + b[6]) & 255)) & 255; \ + b[8] = (b[8] + (b[9] = (b[9] + b[8]) & 255)) & 255; \ + b[10] = (b[10] + (b[11] = (b[11] + b[10]) & 255)) & 255; \ + b[12] = (b[12] + (b[13] = (b[13] + b[12]) & 255)) & 255; \ + b[14] = (b[14] + (b[15] = (b[15] + b[14]) & 255)) & 255; + +/* This is an inverse single layer PHT transform */ +#define iPHT(b) \ + b[15] = (b[15] - (b[14] = (b[14] - b[15]) & 255)) & 255; \ + b[13] = (b[13] - (b[12] = (b[12] - b[13]) & 255)) & 255; \ + b[11] = (b[11] - (b[10] = (b[10] - b[11]) & 255)) & 255; \ + b[9] = (b[9] - (b[8] = (b[8] - b[9]) & 255)) & 255; \ + b[7] = (b[7] - (b[6] = (b[6] - b[7]) & 255)) & 255; \ + b[5] = (b[5] - (b[4] = (b[4] - b[5]) & 255)) & 255; \ + b[3] = (b[3] - (b[2] = (b[2] - b[3]) & 255)) & 255; \ + b[1] = (b[1] - (b[0] = (b[0] - b[1]) & 255)) & 255; \ + +/* This is the "Armenian" Shuffle. It takes the input from b and stores it in b2 */ +#define SHUF(b, b2) \ + b2[0] = b[8]; b2[1] = b[11]; b2[2] = b[12]; b2[3] = b[15]; \ + b2[4] = b[2]; b2[5] = b[1]; b2[6] = b[6]; b2[7] = b[5]; \ + b2[8] = b[10]; b2[9] = b[9]; b2[10] = b[14]; b2[11] = b[13]; \ + b2[12] = b[0]; b2[13] = b[7]; b2[14] = b[4]; b2[15] = b[3]; + +/* This is the inverse shuffle. It takes from b and gives to b2 */ +#define iSHUF(b, b2) \ + b2[0] = b[12]; b2[1] = b[5]; b2[2] = b[4]; b2[3] = b[15]; \ + b2[4] = b[14]; b2[5] = b[7]; b2[6] = b[6]; b2[7] = b[13]; \ + b2[8] = b[0]; b2[9] = b[9]; b2[10] = b[8]; b2[11] = b[1]; \ + b2[12] = b[2]; b2[13] = b[11]; b2[14] = b[10]; b2[15] = b[3]; + +/* The complete forward Linear Transform layer. + * Note that alternating usage of b and b2. + * Each round of LT starts in 'b' and ends in 'b2'. + */ +#define LT(b, b2) \ + PHT(b); SHUF(b, b2); \ + PHT(b2); SHUF(b2, b); \ + PHT(b); SHUF(b, b2); \ + PHT(b2); + +/* This is the inverse linear transform layer. */ +#define iLT(b, b2) \ + iPHT(b); \ + iSHUF(b, b2); iPHT(b2); \ + iSHUF(b2, b); iPHT(b); \ + iSHUF(b, b2); iPHT(b2); + +#ifdef LTC_SMALL_CODE + +static void _round(unsigned char *b, int i, symmetric_key *skey) +{ + ROUND(b, i); +} + +static void _iround(unsigned char *b, int i, symmetric_key *skey) +{ + iROUND(b, i); +} + +static void _lt(unsigned char *b, unsigned char *b2) +{ + LT(b, b2); +} + +static void _ilt(unsigned char *b, unsigned char *b2) +{ + iLT(b, b2); +} + +#undef ROUND +#define ROUND(b, i) _round(b, i, skey) + +#undef iROUND +#define iROUND(b, i) _iround(b, i, skey) + +#undef LT +#define LT(b, b2) _lt(b, b2) + +#undef iLT +#define iLT(b, b2) _ilt(b, b2) + +#endif + +/* These are the 33, 128-bit bias words for the key schedule */ +static const unsigned char safer_bias[33][16] = { +{ 70, 151, 177, 186, 163, 183, 16, 10, 197, 55, 179, 201, 90, 40, 172, 100}, +{ 236, 171, 170, 198, 103, 149, 88, 13, 248, 154, 246, 110, 102, 220, 5, 61}, +{ 138, 195, 216, 137, 106, 233, 54, 73, 67, 191, 235, 212, 150, 155, 104, 160}, +{ 93, 87, 146, 31, 213, 113, 92, 187, 34, 193, 190, 123, 188, 153, 99, 148}, +{ 42, 97, 184, 52, 50, 25, 253, 251, 23, 64, 230, 81, 29, 65, 68, 143}, +{ 221, 4, 128, 222, 231, 49, 214, 127, 1, 162, 247, 57, 218, 111, 35, 202}, +{ 58, 208, 28, 209, 48, 62, 18, 161, 205, 15, 224, 168, 175, 130, 89, 44}, +{ 125, 173, 178, 239, 194, 135, 206, 117, 6, 19, 2, 144, 79, 46, 114, 51}, +{ 192, 141, 207, 169, 129, 226, 196, 39, 47, 108, 122, 159, 82, 225, 21, 56}, +{ 252, 32, 66, 199, 8, 228, 9, 85, 94, 140, 20, 118, 96, 255, 223, 215}, +{ 250, 11, 33, 0, 26, 249, 166, 185, 232, 158, 98, 76, 217, 145, 80, 210}, +{ 24, 180, 7, 132, 234, 91, 164, 200, 14, 203, 72, 105, 75, 78, 156, 53}, +{ 69, 77, 84, 229, 37, 60, 12, 74, 139, 63, 204, 167, 219, 107, 174, 244}, +{ 45, 243, 124, 109, 157, 181, 38, 116, 242, 147, 83, 176, 240, 17, 237, 131}, +{ 182, 3, 22, 115, 59, 30, 142, 112, 189, 134, 27, 71, 126, 36, 86, 241}, +{ 136, 70, 151, 177, 186, 163, 183, 16, 10, 197, 55, 179, 201, 90, 40, 172}, +{ 220, 134, 119, 215, 166, 17, 251, 244, 186, 146, 145, 100, 131, 241, 51, 239}, +{ 44, 181, 178, 43, 136, 209, 153, 203, 140, 132, 29, 20, 129, 151, 113, 202}, +{ 163, 139, 87, 60, 130, 196, 82, 92, 28, 232, 160, 4, 180, 133, 74, 246}, +{ 84, 182, 223, 12, 26, 142, 222, 224, 57, 252, 32, 155, 36, 78, 169, 152}, +{ 171, 242, 96, 208, 108, 234, 250, 199, 217, 0, 212, 31, 110, 67, 188, 236}, +{ 137, 254, 122, 93, 73, 201, 50, 194, 249, 154, 248, 109, 22, 219, 89, 150}, +{ 233, 205, 230, 70, 66, 143, 10, 193, 204, 185, 101, 176, 210, 198, 172, 30}, +{ 98, 41, 46, 14, 116, 80, 2, 90, 195, 37, 123, 138, 42, 91, 240, 6}, +{ 71, 111, 112, 157, 126, 16, 206, 18, 39, 213, 76, 79, 214, 121, 48, 104}, +{ 117, 125, 228, 237, 128, 106, 144, 55, 162, 94, 118, 170, 197, 127, 61, 175}, +{ 229, 25, 97, 253, 77, 124, 183, 11, 238, 173, 75, 34, 245, 231, 115, 35}, +{ 200, 5, 225, 102, 221, 179, 88, 105, 99, 86, 15, 161, 49, 149, 23, 7}, +{ 40, 1, 45, 226, 147, 190, 69, 21, 174, 120, 3, 135, 164, 184, 56, 207}, +{ 8, 103, 9, 148, 235, 38, 168, 107, 189, 24, 52, 27, 187, 191, 114, 247}, +{ 53, 72, 156, 81, 47, 59, 85, 227, 192, 159, 216, 211, 243, 141, 177, 255}, +{ 62, 220, 134, 119, 215, 166, 17, 251, 244, 186, 146, 145, 100, 131, 241, 51}}; + + /** + Initialize the SAFER+ block cipher + @param key The symmetric key you wish to pass + @param keylen The key length in bytes + @param num_rounds The number of rounds desired (0 for default) + @param skey The key in as scheduled by this function. + @return CRYPT_OK if successful + */ +int saferp_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey) +{ + unsigned x, y, z; + unsigned char t[33]; + static const int rounds[3] = { 8, 12, 16 }; + + LTC_ARGCHK(key != NULL); + LTC_ARGCHK(skey != NULL); + + /* check arguments */ + if (keylen != 16 && keylen != 24 && keylen != 32) { + return CRYPT_INVALID_KEYSIZE; + } + + /* Is the number of rounds valid? Either use zero for default or + * 8,12,16 rounds for 16,24,32 byte keys + */ + if (num_rounds != 0 && num_rounds != rounds[(keylen/8)-2]) { + return CRYPT_INVALID_ROUNDS; + } + + /* 128 bit key version */ + if (keylen == 16) { + /* copy key into t */ + for (x = y = 0; x < 16; x++) { + t[x] = key[x]; + y ^= key[x]; + } + t[16] = y; + + /* make round keys */ + for (x = 0; x < 16; x++) { + skey->saferp.K[0][x] = t[x]; + } + + /* make the 16 other keys as a transformation of the first key */ + for (x = 1; x < 17; x++) { + /* rotate 3 bits each */ + for (y = 0; y < 17; y++) { + t[y] = ((t[y]<<3)|(t[y]>>5)) & 255; + } + + /* select and add */ + z = x; + for (y = 0; y < 16; y++) { + skey->saferp.K[x][y] = (t[z] + safer_bias[x-1][y]) & 255; + if (++z == 17) { z = 0; } + } + } + skey->saferp.rounds = 8; + } else if (keylen == 24) { + /* copy key into t */ + for (x = y = 0; x < 24; x++) { + t[x] = key[x]; + y ^= key[x]; + } + t[24] = y; + + /* make round keys */ + for (x = 0; x < 16; x++) { + skey->saferp.K[0][x] = t[x]; + } + + for (x = 1; x < 25; x++) { + /* rotate 3 bits each */ + for (y = 0; y < 25; y++) { + t[y] = ((t[y]<<3)|(t[y]>>5)) & 255; + } + + /* select and add */ + z = x; + for (y = 0; y < 16; y++) { + skey->saferp.K[x][y] = (t[z] + safer_bias[x-1][y]) & 255; + if (++z == 25) { z = 0; } + } + } + skey->saferp.rounds = 12; + } else { + /* copy key into t */ + for (x = y = 0; x < 32; x++) { + t[x] = key[x]; + y ^= key[x]; + } + t[32] = y; + + /* make round keys */ + for (x = 0; x < 16; x++) { + skey->saferp.K[0][x] = t[x]; + } + + for (x = 1; x < 33; x++) { + /* rotate 3 bits each */ + for (y = 0; y < 33; y++) { + t[y] = ((t[y]<<3)|(t[y]>>5)) & 255; + } + + /* select and add */ + z = x; + for (y = 0; y < 16; y++) { + skey->saferp.K[x][y] = (t[z] + safer_bias[x-1][y]) & 255; + if (++z == 33) { z = 0; } + } + } + skey->saferp.rounds = 16; + } +#ifdef LTC_CLEAN_STACK + zeromem(t, sizeof(t)); +#endif + return CRYPT_OK; +} + +/** + Encrypts a block of text with SAFER+ + @param pt The input plaintext (16 bytes) + @param ct The output ciphertext (16 bytes) + @param skey The key as scheduled + @return CRYPT_OK if successful +*/ +int saferp_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key *skey) +{ + unsigned char b[16]; + int x; + + LTC_ARGCHK(pt != NULL); + LTC_ARGCHK(ct != NULL); + LTC_ARGCHK(skey != NULL); + + /* do eight rounds */ + for (x = 0; x < 16; x++) { + b[x] = pt[x]; + } + ROUND(b, 0); LT(b, ct); + ROUND(ct, 2); LT(ct, b); + ROUND(b, 4); LT(b, ct); + ROUND(ct, 6); LT(ct, b); + ROUND(b, 8); LT(b, ct); + ROUND(ct, 10); LT(ct, b); + ROUND(b, 12); LT(b, ct); + ROUND(ct, 14); LT(ct, b); + /* 192-bit key? */ + if (skey->saferp.rounds > 8) { + ROUND(b, 16); LT(b, ct); + ROUND(ct, 18); LT(ct, b); + ROUND(b, 20); LT(b, ct); + ROUND(ct, 22); LT(ct, b); + } + /* 256-bit key? */ + if (skey->saferp.rounds > 12) { + ROUND(b, 24); LT(b, ct); + ROUND(ct, 26); LT(ct, b); + ROUND(b, 28); LT(b, ct); + ROUND(ct, 30); LT(ct, b); + } + ct[0] = b[0] ^ skey->saferp.K[skey->saferp.rounds*2][0]; + ct[1] = (b[1] + skey->saferp.K[skey->saferp.rounds*2][1]) & 255; + ct[2] = (b[2] + skey->saferp.K[skey->saferp.rounds*2][2]) & 255; + ct[3] = b[3] ^ skey->saferp.K[skey->saferp.rounds*2][3]; + ct[4] = b[4] ^ skey->saferp.K[skey->saferp.rounds*2][4]; + ct[5] = (b[5] + skey->saferp.K[skey->saferp.rounds*2][5]) & 255; + ct[6] = (b[6] + skey->saferp.K[skey->saferp.rounds*2][6]) & 255; + ct[7] = b[7] ^ skey->saferp.K[skey->saferp.rounds*2][7]; + ct[8] = b[8] ^ skey->saferp.K[skey->saferp.rounds*2][8]; + ct[9] = (b[9] + skey->saferp.K[skey->saferp.rounds*2][9]) & 255; + ct[10] = (b[10] + skey->saferp.K[skey->saferp.rounds*2][10]) & 255; + ct[11] = b[11] ^ skey->saferp.K[skey->saferp.rounds*2][11]; + ct[12] = b[12] ^ skey->saferp.K[skey->saferp.rounds*2][12]; + ct[13] = (b[13] + skey->saferp.K[skey->saferp.rounds*2][13]) & 255; + ct[14] = (b[14] + skey->saferp.K[skey->saferp.rounds*2][14]) & 255; + ct[15] = b[15] ^ skey->saferp.K[skey->saferp.rounds*2][15]; +#ifdef LTC_CLEAN_STACK + zeromem(b, sizeof(b)); +#endif + return CRYPT_OK; +} + +/** + Decrypts a block of text with SAFER+ + @param ct The input ciphertext (16 bytes) + @param pt The output plaintext (16 bytes) + @param skey The key as scheduled + @return CRYPT_OK if successful +*/ +int saferp_ecb_decrypt(const unsigned char *ct, unsigned char *pt, symmetric_key *skey) +{ + unsigned char b[16]; + int x; + + LTC_ARGCHK(pt != NULL); + LTC_ARGCHK(ct != NULL); + LTC_ARGCHK(skey != NULL); + + /* do eight rounds */ + b[0] = ct[0] ^ skey->saferp.K[skey->saferp.rounds*2][0]; + b[1] = (ct[1] - skey->saferp.K[skey->saferp.rounds*2][1]) & 255; + b[2] = (ct[2] - skey->saferp.K[skey->saferp.rounds*2][2]) & 255; + b[3] = ct[3] ^ skey->saferp.K[skey->saferp.rounds*2][3]; + b[4] = ct[4] ^ skey->saferp.K[skey->saferp.rounds*2][4]; + b[5] = (ct[5] - skey->saferp.K[skey->saferp.rounds*2][5]) & 255; + b[6] = (ct[6] - skey->saferp.K[skey->saferp.rounds*2][6]) & 255; + b[7] = ct[7] ^ skey->saferp.K[skey->saferp.rounds*2][7]; + b[8] = ct[8] ^ skey->saferp.K[skey->saferp.rounds*2][8]; + b[9] = (ct[9] - skey->saferp.K[skey->saferp.rounds*2][9]) & 255; + b[10] = (ct[10] - skey->saferp.K[skey->saferp.rounds*2][10]) & 255; + b[11] = ct[11] ^ skey->saferp.K[skey->saferp.rounds*2][11]; + b[12] = ct[12] ^ skey->saferp.K[skey->saferp.rounds*2][12]; + b[13] = (ct[13] - skey->saferp.K[skey->saferp.rounds*2][13]) & 255; + b[14] = (ct[14] - skey->saferp.K[skey->saferp.rounds*2][14]) & 255; + b[15] = ct[15] ^ skey->saferp.K[skey->saferp.rounds*2][15]; + /* 256-bit key? */ + if (skey->saferp.rounds > 12) { + iLT(b, pt); iROUND(pt, 30); + iLT(pt, b); iROUND(b, 28); + iLT(b, pt); iROUND(pt, 26); + iLT(pt, b); iROUND(b, 24); + } + /* 192-bit key? */ + if (skey->saferp.rounds > 8) { + iLT(b, pt); iROUND(pt, 22); + iLT(pt, b); iROUND(b, 20); + iLT(b, pt); iROUND(pt, 18); + iLT(pt, b); iROUND(b, 16); + } + iLT(b, pt); iROUND(pt, 14); + iLT(pt, b); iROUND(b, 12); + iLT(b, pt); iROUND(pt,10); + iLT(pt, b); iROUND(b, 8); + iLT(b, pt); iROUND(pt,6); + iLT(pt, b); iROUND(b, 4); + iLT(b, pt); iROUND(pt,2); + iLT(pt, b); iROUND(b, 0); + for (x = 0; x < 16; x++) { + pt[x] = b[x]; + } +#ifdef LTC_CLEAN_STACK + zeromem(b, sizeof(b)); +#endif + return CRYPT_OK; +} + +/** + Performs a self-test of the SAFER+ block cipher + @return CRYPT_OK if functional, CRYPT_NOP if self-test has been disabled +*/ +int saferp_test(void) +{ + #ifndef LTC_TEST + return CRYPT_NOP; + #else + static const struct { + int keylen; + unsigned char key[32], pt[16], ct[16]; + } tests[] = { + { + 16, + { 41, 35, 190, 132, 225, 108, 214, 174, + 82, 144, 73, 241, 241, 187, 233, 235 }, + { 179, 166, 219, 60, 135, 12, 62, 153, + 36, 94, 13, 28, 6, 183, 71, 222 }, + { 224, 31, 182, 10, 12, 255, 84, 70, + 127, 13, 89, 249, 9, 57, 165, 220 } + }, { + 24, + { 72, 211, 143, 117, 230, 217, 29, 42, + 229, 192, 247, 43, 120, 129, 135, 68, + 14, 95, 80, 0, 212, 97, 141, 190 }, + { 123, 5, 21, 7, 59, 51, 130, 31, + 24, 112, 146, 218, 100, 84, 206, 177 }, + { 92, 136, 4, 63, 57, 95, 100, 0, + 150, 130, 130, 16, 193, 111, 219, 133 } + }, { + 32, + { 243, 168, 141, 254, 190, 242, 235, 113, + 255, 160, 208, 59, 117, 6, 140, 126, + 135, 120, 115, 77, 208, 190, 130, 190, + 219, 194, 70, 65, 43, 140, 250, 48 }, + { 127, 112, 240, 167, 84, 134, 50, 149, + 170, 91, 104, 19, 11, 230, 252, 245 }, + { 88, 11, 25, 36, 172, 229, 202, 213, + 170, 65, 105, 153, 220, 104, 153, 138 } + } + }; + + unsigned char tmp[2][16]; + symmetric_key skey; + int err, i, y; + + for (i = 0; i < (int)(sizeof(tests) / sizeof(tests[0])); i++) { + if ((err = saferp_setup(tests[i].key, tests[i].keylen, 0, &skey)) != CRYPT_OK) { + return err; + } + saferp_ecb_encrypt(tests[i].pt, tmp[0], &skey); + saferp_ecb_decrypt(tmp[0], tmp[1], &skey); + + /* compare */ + if (XMEMCMP(tmp[0], tests[i].ct, 16) || XMEMCMP(tmp[1], tests[i].pt, 16)) { + return CRYPT_FAIL_TESTVECTOR; + } + + /* now see if we can encrypt all zero bytes 1000 times, decrypt and come back where we started */ + for (y = 0; y < 16; y++) tmp[0][y] = 0; + for (y = 0; y < 1000; y++) saferp_ecb_encrypt(tmp[0], tmp[0], &skey); + for (y = 0; y < 1000; y++) saferp_ecb_decrypt(tmp[0], tmp[0], &skey); + for (y = 0; y < 16; y++) if (tmp[0][y] != 0) return CRYPT_FAIL_TESTVECTOR; + } + + return CRYPT_OK; + #endif +} + +/** Terminate the context + @param skey The scheduled key +*/ +void saferp_done(symmetric_key *skey) +{ +} + +/** + Gets suitable key size + @param keysize [in/out] The length of the recommended key (in bytes). This function will store the suitable size back in this variable. + @return CRYPT_OK if the input key size is acceptable. +*/ +int saferp_keysize(int *keysize) +{ + LTC_ARGCHK(keysize != NULL); + + if (*keysize < 16) + return CRYPT_INVALID_KEYSIZE; + if (*keysize < 24) { + *keysize = 16; + } else if (*keysize < 32) { + *keysize = 24; + } else { + *keysize = 32; + } + return CRYPT_OK; +} + +#endif + + + +/* $Source: /cvs/libtom/libtomcrypt/src/ciphers/safer/saferp.c,v $ */ +/* $Revision: 1.12 $ */ +/* $Date: 2006/11/08 23:01:06 $ */ diff --git a/libtomcrypt/src/ciphers/skipjack.c b/libtomcrypt/src/ciphers/skipjack.c new file mode 100644 index 0000000..3e0b576 --- /dev/null +++ b/libtomcrypt/src/ciphers/skipjack.c @@ -0,0 +1,343 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ + +/** + @file skipjack.c + Skipjack Implementation by Tom St Denis +*/ +#include "tomcrypt.h" + +#ifdef SKIPJACK + +const struct ltc_cipher_descriptor skipjack_desc = +{ + "skipjack", + 17, + 10, 10, 8, 32, + &skipjack_setup, + &skipjack_ecb_encrypt, + &skipjack_ecb_decrypt, + &skipjack_test, + &skipjack_done, + &skipjack_keysize, + NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL +}; + +static const unsigned char sbox[256] = { + 0xa3,0xd7,0x09,0x83,0xf8,0x48,0xf6,0xf4,0xb3,0x21,0x15,0x78,0x99,0xb1,0xaf,0xf9, + 0xe7,0x2d,0x4d,0x8a,0xce,0x4c,0xca,0x2e,0x52,0x95,0xd9,0x1e,0x4e,0x38,0x44,0x28, + 0x0a,0xdf,0x02,0xa0,0x17,0xf1,0x60,0x68,0x12,0xb7,0x7a,0xc3,0xe9,0xfa,0x3d,0x53, + 0x96,0x84,0x6b,0xba,0xf2,0x63,0x9a,0x19,0x7c,0xae,0xe5,0xf5,0xf7,0x16,0x6a,0xa2, + 0x39,0xb6,0x7b,0x0f,0xc1,0x93,0x81,0x1b,0xee,0xb4,0x1a,0xea,0xd0,0x91,0x2f,0xb8, + 0x55,0xb9,0xda,0x85,0x3f,0x41,0xbf,0xe0,0x5a,0x58,0x80,0x5f,0x66,0x0b,0xd8,0x90, + 0x35,0xd5,0xc0,0xa7,0x33,0x06,0x65,0x69,0x45,0x00,0x94,0x56,0x6d,0x98,0x9b,0x76, + 0x97,0xfc,0xb2,0xc2,0xb0,0xfe,0xdb,0x20,0xe1,0xeb,0xd6,0xe4,0xdd,0x47,0x4a,0x1d, + 0x42,0xed,0x9e,0x6e,0x49,0x3c,0xcd,0x43,0x27,0xd2,0x07,0xd4,0xde,0xc7,0x67,0x18, + 0x89,0xcb,0x30,0x1f,0x8d,0xc6,0x8f,0xaa,0xc8,0x74,0xdc,0xc9,0x5d,0x5c,0x31,0xa4, + 0x70,0x88,0x61,0x2c,0x9f,0x0d,0x2b,0x87,0x50,0x82,0x54,0x64,0x26,0x7d,0x03,0x40, + 0x34,0x4b,0x1c,0x73,0xd1,0xc4,0xfd,0x3b,0xcc,0xfb,0x7f,0xab,0xe6,0x3e,0x5b,0xa5, + 0xad,0x04,0x23,0x9c,0x14,0x51,0x22,0xf0,0x29,0x79,0x71,0x7e,0xff,0x8c,0x0e,0xe2, + 0x0c,0xef,0xbc,0x72,0x75,0x6f,0x37,0xa1,0xec,0xd3,0x8e,0x62,0x8b,0x86,0x10,0xe8, + 0x08,0x77,0x11,0xbe,0x92,0x4f,0x24,0xc5,0x32,0x36,0x9d,0xcf,0xf3,0xa6,0xbb,0xac, + 0x5e,0x6c,0xa9,0x13,0x57,0x25,0xb5,0xe3,0xbd,0xa8,0x3a,0x01,0x05,0x59,0x2a,0x46 +}; + +/* simple x + 1 (mod 10) in one step. */ +static const int keystep[] = { 1, 2, 3, 4, 5, 6, 7, 8, 9, 0 }; + +/* simple x - 1 (mod 10) in one step */ +static const int ikeystep[] = { 9, 0, 1, 2, 3, 4, 5, 6, 7, 8 }; + + /** + Initialize the Skipjack block cipher + @param key The symmetric key you wish to pass + @param keylen The key length in bytes + @param num_rounds The number of rounds desired (0 for default) + @param skey The key in as scheduled by this function. + @return CRYPT_OK if successful + */ +int skipjack_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey) +{ + int x; + + LTC_ARGCHK(key != NULL); + LTC_ARGCHK(skey != NULL); + + if (keylen != 10) { + return CRYPT_INVALID_KEYSIZE; + } + + if (num_rounds != 32 && num_rounds != 0) { + return CRYPT_INVALID_ROUNDS; + } + + /* make sure the key is in range for platforms where CHAR_BIT != 8 */ + for (x = 0; x < 10; x++) { + skey->skipjack.key[x] = key[x] & 255; + } + + return CRYPT_OK; +} + +#define RULE_A \ + tmp = g_func(w1, &kp, skey->skipjack.key); \ + w1 = tmp ^ w4 ^ x; \ + w4 = w3; w3 = w2; \ + w2 = tmp; + +#define RULE_B \ + tmp = g_func(w1, &kp, skey->skipjack.key); \ + tmp1 = w4; w4 = w3; \ + w3 = w1 ^ w2 ^ x; \ + w1 = tmp1; w2 = tmp; + +#define RULE_A1 \ + tmp = w1 ^ w2 ^ x; \ + w1 = ig_func(w2, &kp, skey->skipjack.key); \ + w2 = w3; w3 = w4; w4 = tmp; + +#define RULE_B1 \ + tmp = ig_func(w2, &kp, skey->skipjack.key); \ + w2 = tmp ^ w3 ^ x; \ + w3 = w4; w4 = w1; w1 = tmp; + +static unsigned g_func(unsigned w, int *kp, unsigned char *key) +{ + unsigned char g1,g2; + + g1 = (w >> 8) & 255; g2 = w & 255; + g1 ^= sbox[g2^key[*kp]]; *kp = keystep[*kp]; + g2 ^= sbox[g1^key[*kp]]; *kp = keystep[*kp]; + g1 ^= sbox[g2^key[*kp]]; *kp = keystep[*kp]; + g2 ^= sbox[g1^key[*kp]]; *kp = keystep[*kp]; + return ((unsigned)g1<<8)|(unsigned)g2; +} + +static unsigned ig_func(unsigned w, int *kp, unsigned char *key) +{ + unsigned char g1,g2; + + g1 = (w >> 8) & 255; g2 = w & 255; + *kp = ikeystep[*kp]; g2 ^= sbox[g1^key[*kp]]; + *kp = ikeystep[*kp]; g1 ^= sbox[g2^key[*kp]]; + *kp = ikeystep[*kp]; g2 ^= sbox[g1^key[*kp]]; + *kp = ikeystep[*kp]; g1 ^= sbox[g2^key[*kp]]; + return ((unsigned)g1<<8)|(unsigned)g2; +} + +/** + Encrypts a block of text with Skipjack + @param pt The input plaintext (8 bytes) + @param ct The output ciphertext (8 bytes) + @param skey The key as scheduled + @return CRYPT_OK if successful +*/ +#ifdef LTC_CLEAN_STACK +static int _skipjack_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key *skey) +#else +int skipjack_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key *skey) +#endif +{ + unsigned w1,w2,w3,w4,tmp,tmp1; + int x, kp; + + LTC_ARGCHK(pt != NULL); + LTC_ARGCHK(ct != NULL); + LTC_ARGCHK(skey != NULL); + + /* load block */ + w1 = ((unsigned)pt[0]<<8)|pt[1]; + w2 = ((unsigned)pt[2]<<8)|pt[3]; + w3 = ((unsigned)pt[4]<<8)|pt[5]; + w4 = ((unsigned)pt[6]<<8)|pt[7]; + + /* 8 rounds of RULE A */ + for (x = 1, kp = 0; x < 9; x++) { + RULE_A; + } + + /* 8 rounds of RULE B */ + for (; x < 17; x++) { + RULE_B; + } + + /* 8 rounds of RULE A */ + for (; x < 25; x++) { + RULE_A; + } + + /* 8 rounds of RULE B */ + for (; x < 33; x++) { + RULE_B; + } + + /* store block */ + ct[0] = (w1>>8)&255; ct[1] = w1&255; + ct[2] = (w2>>8)&255; ct[3] = w2&255; + ct[4] = (w3>>8)&255; ct[5] = w3&255; + ct[6] = (w4>>8)&255; ct[7] = w4&255; + + return CRYPT_OK; +} + +#ifdef LTC_CLEAN_STACK +int skipjack_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key *skey) +{ + int err = _skipjack_ecb_encrypt(pt, ct, skey); + burn_stack(sizeof(unsigned) * 8 + sizeof(int) * 2); + return err; +} +#endif + +/** + Decrypts a block of text with Skipjack + @param ct The input ciphertext (8 bytes) + @param pt The output plaintext (8 bytes) + @param skey The key as scheduled + @return CRYPT_OK if successful +*/ +#ifdef LTC_CLEAN_STACK +static int _skipjack_ecb_decrypt(const unsigned char *ct, unsigned char *pt, symmetric_key *skey) +#else +int skipjack_ecb_decrypt(const unsigned char *ct, unsigned char *pt, symmetric_key *skey) +#endif +{ + unsigned w1,w2,w3,w4,tmp; + int x, kp; + + LTC_ARGCHK(pt != NULL); + LTC_ARGCHK(ct != NULL); + LTC_ARGCHK(skey != NULL); + + /* load block */ + w1 = ((unsigned)ct[0]<<8)|ct[1]; + w2 = ((unsigned)ct[2]<<8)|ct[3]; + w3 = ((unsigned)ct[4]<<8)|ct[5]; + w4 = ((unsigned)ct[6]<<8)|ct[7]; + + /* 8 rounds of RULE B^-1 + + Note the value "kp = 8" comes from "kp = (32 * 4) mod 10" where 32*4 is 128 which mod 10 is 8 + */ + for (x = 32, kp = 8; x > 24; x--) { + RULE_B1; + } + + /* 8 rounds of RULE A^-1 */ + for (; x > 16; x--) { + RULE_A1; + } + + + /* 8 rounds of RULE B^-1 */ + for (; x > 8; x--) { + RULE_B1; + } + + /* 8 rounds of RULE A^-1 */ + for (; x > 0; x--) { + RULE_A1; + } + + /* store block */ + pt[0] = (w1>>8)&255; pt[1] = w1&255; + pt[2] = (w2>>8)&255; pt[3] = w2&255; + pt[4] = (w3>>8)&255; pt[5] = w3&255; + pt[6] = (w4>>8)&255; pt[7] = w4&255; + + return CRYPT_OK; +} + +#ifdef LTC_CLEAN_STACK +int skipjack_ecb_decrypt(const unsigned char *ct, unsigned char *pt, symmetric_key *skey) +{ + int err = _skipjack_ecb_decrypt(ct, pt, skey); + burn_stack(sizeof(unsigned) * 7 + sizeof(int) * 2); + return err; +} +#endif + +/** + Performs a self-test of the Skipjack block cipher + @return CRYPT_OK if functional, CRYPT_NOP if self-test has been disabled +*/ +int skipjack_test(void) +{ + #ifndef LTC_TEST + return CRYPT_NOP; + #else + static const struct { + unsigned char key[10], pt[8], ct[8]; + } tests[] = { + { + { 0x00, 0x99, 0x88, 0x77, 0x66, 0x55, 0x44, 0x33, 0x22, 0x11 }, + { 0x33, 0x22, 0x11, 0x00, 0xdd, 0xcc, 0xbb, 0xaa }, + { 0x25, 0x87, 0xca, 0xe2, 0x7a, 0x12, 0xd3, 0x00 } + } + }; + unsigned char buf[2][8]; + int x, y, err; + symmetric_key key; + + for (x = 0; x < (int)(sizeof(tests) / sizeof(tests[0])); x++) { + /* setup key */ + if ((err = skipjack_setup(tests[x].key, 10, 0, &key)) != CRYPT_OK) { + return err; + } + + /* encrypt and decrypt */ + skipjack_ecb_encrypt(tests[x].pt, buf[0], &key); + skipjack_ecb_decrypt(buf[0], buf[1], &key); + + /* compare */ + if (XMEMCMP(buf[0], tests[x].ct, 8) != 0 || XMEMCMP(buf[1], tests[x].pt, 8) != 0) { + return CRYPT_FAIL_TESTVECTOR; + } + + /* now see if we can encrypt all zero bytes 1000 times, decrypt and come back where we started */ + for (y = 0; y < 8; y++) buf[0][y] = 0; + for (y = 0; y < 1000; y++) skipjack_ecb_encrypt(buf[0], buf[0], &key); + for (y = 0; y < 1000; y++) skipjack_ecb_decrypt(buf[0], buf[0], &key); + for (y = 0; y < 8; y++) if (buf[0][y] != 0) return CRYPT_FAIL_TESTVECTOR; + } + + return CRYPT_OK; + #endif +} + +/** Terminate the context + @param skey The scheduled key +*/ +void skipjack_done(symmetric_key *skey) +{ +} + +/** + Gets suitable key size + @param keysize [in/out] The length of the recommended key (in bytes). This function will store the suitable size back in this variable. + @return CRYPT_OK if the input key size is acceptable. +*/ +int skipjack_keysize(int *keysize) +{ + LTC_ARGCHK(keysize != NULL); + if (*keysize < 10) { + return CRYPT_INVALID_KEYSIZE; + } else if (*keysize > 10) { + *keysize = 10; + } + return CRYPT_OK; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/ciphers/skipjack.c,v $ */ +/* $Revision: 1.12 $ */ +/* $Date: 2006/11/08 23:01:06 $ */ diff --git a/libtomcrypt/src/ciphers/twofish/twofish.c b/libtomcrypt/src/ciphers/twofish/twofish.c new file mode 100644 index 0000000..9e6d0d4 --- /dev/null +++ b/libtomcrypt/src/ciphers/twofish/twofish.c @@ -0,0 +1,718 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ + + /** + @file twofish.c + Implementation of Twofish by Tom St Denis + */ +#include "tomcrypt.h" + +#ifdef TWOFISH + +/* first TWOFISH_ALL_TABLES must ensure TWOFISH_TABLES is defined */ +#ifdef TWOFISH_ALL_TABLES +#ifndef TWOFISH_TABLES +#define TWOFISH_TABLES +#endif +#endif + +const struct ltc_cipher_descriptor twofish_desc = +{ + "twofish", + 7, + 16, 32, 16, 16, + &twofish_setup, + &twofish_ecb_encrypt, + &twofish_ecb_decrypt, + &twofish_test, + &twofish_done, + &twofish_keysize, + NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL +}; + +/* the two polynomials */ +#define MDS_POLY 0x169 +#define RS_POLY 0x14D + +/* The 4x4 MDS Linear Transform */ +#if 0 +static const unsigned char MDS[4][4] = { + { 0x01, 0xEF, 0x5B, 0x5B }, + { 0x5B, 0xEF, 0xEF, 0x01 }, + { 0xEF, 0x5B, 0x01, 0xEF }, + { 0xEF, 0x01, 0xEF, 0x5B } +}; +#endif + +/* The 4x8 RS Linear Transform */ +static const unsigned char RS[4][8] = { + { 0x01, 0xA4, 0x55, 0x87, 0x5A, 0x58, 0xDB, 0x9E }, + { 0xA4, 0x56, 0x82, 0xF3, 0X1E, 0XC6, 0X68, 0XE5 }, + { 0X02, 0XA1, 0XFC, 0XC1, 0X47, 0XAE, 0X3D, 0X19 }, + { 0XA4, 0X55, 0X87, 0X5A, 0X58, 0XDB, 0X9E, 0X03 } +}; + +/* sbox usage orderings */ +static const unsigned char qord[4][5] = { + { 1, 1, 0, 0, 1 }, + { 0, 1, 1, 0, 0 }, + { 0, 0, 0, 1, 1 }, + { 1, 0, 1, 1, 0 } +}; + +#ifdef TWOFISH_TABLES + +#include "twofish_tab.c" + +#define sbox(i, x) ((ulong32)SBOX[i][(x)&255]) + +#else + +/* The Q-box tables */ +static const unsigned char qbox[2][4][16] = { +{ + { 0x8, 0x1, 0x7, 0xD, 0x6, 0xF, 0x3, 0x2, 0x0, 0xB, 0x5, 0x9, 0xE, 0xC, 0xA, 0x4 }, + { 0xE, 0XC, 0XB, 0X8, 0X1, 0X2, 0X3, 0X5, 0XF, 0X4, 0XA, 0X6, 0X7, 0X0, 0X9, 0XD }, + { 0XB, 0XA, 0X5, 0XE, 0X6, 0XD, 0X9, 0X0, 0XC, 0X8, 0XF, 0X3, 0X2, 0X4, 0X7, 0X1 }, + { 0XD, 0X7, 0XF, 0X4, 0X1, 0X2, 0X6, 0XE, 0X9, 0XB, 0X3, 0X0, 0X8, 0X5, 0XC, 0XA } +}, +{ + { 0X2, 0X8, 0XB, 0XD, 0XF, 0X7, 0X6, 0XE, 0X3, 0X1, 0X9, 0X4, 0X0, 0XA, 0XC, 0X5 }, + { 0X1, 0XE, 0X2, 0XB, 0X4, 0XC, 0X3, 0X7, 0X6, 0XD, 0XA, 0X5, 0XF, 0X9, 0X0, 0X8 }, + { 0X4, 0XC, 0X7, 0X5, 0X1, 0X6, 0X9, 0XA, 0X0, 0XE, 0XD, 0X8, 0X2, 0XB, 0X3, 0XF }, + { 0xB, 0X9, 0X5, 0X1, 0XC, 0X3, 0XD, 0XE, 0X6, 0X4, 0X7, 0XF, 0X2, 0X0, 0X8, 0XA } +} +}; + +/* computes S_i[x] */ +#ifdef LTC_CLEAN_STACK +static ulong32 _sbox(int i, ulong32 x) +#else +static ulong32 sbox(int i, ulong32 x) +#endif +{ + unsigned char a0,b0,a1,b1,a2,b2,a3,b3,a4,b4,y; + + /* a0,b0 = [x/16], x mod 16 */ + a0 = (unsigned char)((x>>4)&15); + b0 = (unsigned char)((x)&15); + + /* a1 = a0 ^ b0 */ + a1 = a0 ^ b0; + + /* b1 = a0 ^ ROR(b0, 1) ^ 8a0 */ + b1 = (a0 ^ ((b0<<3)|(b0>>1)) ^ (a0<<3)) & 15; + + /* a2,b2 = t0[a1], t1[b1] */ + a2 = qbox[i][0][(int)a1]; + b2 = qbox[i][1][(int)b1]; + + /* a3 = a2 ^ b2 */ + a3 = a2 ^ b2; + + /* b3 = a2 ^ ROR(b2, 1) ^ 8a2 */ + b3 = (a2 ^ ((b2<<3)|(b2>>1)) ^ (a2<<3)) & 15; + + /* a4,b4 = t2[a3], t3[b3] */ + a4 = qbox[i][2][(int)a3]; + b4 = qbox[i][3][(int)b3]; + + /* y = 16b4 + a4 */ + y = (b4 << 4) + a4; + + /* return result */ + return (ulong32)y; +} + +#ifdef LTC_CLEAN_STACK +static ulong32 sbox(int i, ulong32 x) +{ + ulong32 y; + y = _sbox(i, x); + burn_stack(sizeof(unsigned char) * 11); + return y; +} +#endif /* LTC_CLEAN_STACK */ + +#endif /* TWOFISH_TABLES */ + +/* computes ab mod p */ +static ulong32 gf_mult(ulong32 a, ulong32 b, ulong32 p) +{ + ulong32 result, B[2], P[2]; + + P[1] = p; + B[1] = b; + result = P[0] = B[0] = 0; + + /* unrolled branchless GF multiplier */ + result ^= B[a&1]; a >>= 1; B[1] = P[B[1]>>7] ^ (B[1] << 1); + result ^= B[a&1]; a >>= 1; B[1] = P[B[1]>>7] ^ (B[1] << 1); + result ^= B[a&1]; a >>= 1; B[1] = P[B[1]>>7] ^ (B[1] << 1); + result ^= B[a&1]; a >>= 1; B[1] = P[B[1]>>7] ^ (B[1] << 1); + result ^= B[a&1]; a >>= 1; B[1] = P[B[1]>>7] ^ (B[1] << 1); + result ^= B[a&1]; a >>= 1; B[1] = P[B[1]>>7] ^ (B[1] << 1); + result ^= B[a&1]; a >>= 1; B[1] = P[B[1]>>7] ^ (B[1] << 1); + result ^= B[a&1]; + + return result; +} + +/* computes [y0 y1 y2 y3] = MDS . [x0] */ +#ifndef TWOFISH_TABLES +static ulong32 mds_column_mult(unsigned char in, int col) +{ + ulong32 x01, x5B, xEF; + + x01 = in; + x5B = gf_mult(in, 0x5B, MDS_POLY); + xEF = gf_mult(in, 0xEF, MDS_POLY); + + switch (col) { + case 0: + return (x01 << 0 ) | + (x5B << 8 ) | + (xEF << 16) | + (xEF << 24); + case 1: + return (xEF << 0 ) | + (xEF << 8 ) | + (x5B << 16) | + (x01 << 24); + case 2: + return (x5B << 0 ) | + (xEF << 8 ) | + (x01 << 16) | + (xEF << 24); + case 3: + return (x5B << 0 ) | + (x01 << 8 ) | + (xEF << 16) | + (x5B << 24); + } + /* avoid warnings, we'd never get here normally but just to calm compiler warnings... */ + return 0; +} + +#else /* !TWOFISH_TABLES */ + +#define mds_column_mult(x, i) mds_tab[i][x] + +#endif /* TWOFISH_TABLES */ + +/* Computes [y0 y1 y2 y3] = MDS . [x0 x1 x2 x3] */ +static void mds_mult(const unsigned char *in, unsigned char *out) +{ + int x; + ulong32 tmp; + for (tmp = x = 0; x < 4; x++) { + tmp ^= mds_column_mult(in[x], x); + } + STORE32L(tmp, out); +} + +#ifdef TWOFISH_ALL_TABLES +/* computes [y0 y1 y2 y3] = RS . [x0 x1 x2 x3 x4 x5 x6 x7] */ +static void rs_mult(const unsigned char *in, unsigned char *out) +{ + ulong32 tmp; + tmp = rs_tab0[in[0]] ^ rs_tab1[in[1]] ^ rs_tab2[in[2]] ^ rs_tab3[in[3]] ^ + rs_tab4[in[4]] ^ rs_tab5[in[5]] ^ rs_tab6[in[6]] ^ rs_tab7[in[7]]; + STORE32L(tmp, out); +} + +#else /* !TWOFISH_ALL_TABLES */ + +/* computes [y0 y1 y2 y3] = RS . [x0 x1 x2 x3 x4 x5 x6 x7] */ +static void rs_mult(const unsigned char *in, unsigned char *out) +{ + int x, y; + for (x = 0; x < 4; x++) { + out[x] = 0; + for (y = 0; y < 8; y++) { + out[x] ^= gf_mult(in[y], RS[x][y], RS_POLY); + } + } +} + +#endif + +/* computes h(x) */ +static void h_func(const unsigned char *in, unsigned char *out, unsigned char *M, int k, int offset) +{ + int x; + unsigned char y[4]; + for (x = 0; x < 4; x++) { + y[x] = in[x]; + } + switch (k) { + case 4: + y[0] = (unsigned char)(sbox(1, (ulong32)y[0]) ^ M[4 * (6 + offset) + 0]); + y[1] = (unsigned char)(sbox(0, (ulong32)y[1]) ^ M[4 * (6 + offset) + 1]); + y[2] = (unsigned char)(sbox(0, (ulong32)y[2]) ^ M[4 * (6 + offset) + 2]); + y[3] = (unsigned char)(sbox(1, (ulong32)y[3]) ^ M[4 * (6 + offset) + 3]); + case 3: + y[0] = (unsigned char)(sbox(1, (ulong32)y[0]) ^ M[4 * (4 + offset) + 0]); + y[1] = (unsigned char)(sbox(1, (ulong32)y[1]) ^ M[4 * (4 + offset) + 1]); + y[2] = (unsigned char)(sbox(0, (ulong32)y[2]) ^ M[4 * (4 + offset) + 2]); + y[3] = (unsigned char)(sbox(0, (ulong32)y[3]) ^ M[4 * (4 + offset) + 3]); + case 2: + y[0] = (unsigned char)(sbox(1, sbox(0, sbox(0, (ulong32)y[0]) ^ M[4 * (2 + offset) + 0]) ^ M[4 * (0 + offset) + 0])); + y[1] = (unsigned char)(sbox(0, sbox(0, sbox(1, (ulong32)y[1]) ^ M[4 * (2 + offset) + 1]) ^ M[4 * (0 + offset) + 1])); + y[2] = (unsigned char)(sbox(1, sbox(1, sbox(0, (ulong32)y[2]) ^ M[4 * (2 + offset) + 2]) ^ M[4 * (0 + offset) + 2])); + y[3] = (unsigned char)(sbox(0, sbox(1, sbox(1, (ulong32)y[3]) ^ M[4 * (2 + offset) + 3]) ^ M[4 * (0 + offset) + 3])); + } + mds_mult(y, out); +} + +#ifndef TWOFISH_SMALL + +/* for GCC we don't use pointer aliases */ +#if defined(__GNUC__) + #define S1 skey->twofish.S[0] + #define S2 skey->twofish.S[1] + #define S3 skey->twofish.S[2] + #define S4 skey->twofish.S[3] +#endif + +/* the G function */ +#define g_func(x, dum) (S1[byte(x,0)] ^ S2[byte(x,1)] ^ S3[byte(x,2)] ^ S4[byte(x,3)]) +#define g1_func(x, dum) (S2[byte(x,0)] ^ S3[byte(x,1)] ^ S4[byte(x,2)] ^ S1[byte(x,3)]) + +#else + +#ifdef LTC_CLEAN_STACK +static ulong32 _g_func(ulong32 x, symmetric_key *key) +#else +static ulong32 g_func(ulong32 x, symmetric_key *key) +#endif +{ + unsigned char g, i, y, z; + ulong32 res; + + res = 0; + for (y = 0; y < 4; y++) { + z = key->twofish.start; + + /* do unkeyed substitution */ + g = sbox(qord[y][z++], (x >> (8*y)) & 255); + + /* first subkey */ + i = 0; + + /* do key mixing+sbox until z==5 */ + while (z != 5) { + g = g ^ key->twofish.S[4*i++ + y]; + g = sbox(qord[y][z++], g); + } + + /* multiply g by a column of the MDS */ + res ^= mds_column_mult(g, y); + } + return res; +} + +#define g1_func(x, key) g_func(ROLc(x, 8), key) + +#ifdef LTC_CLEAN_STACK +static ulong32 g_func(ulong32 x, symmetric_key *key) +{ + ulong32 y; + y = _g_func(x, key); + burn_stack(sizeof(unsigned char) * 4 + sizeof(ulong32)); + return y; +} +#endif /* LTC_CLEAN_STACK */ + +#endif /* TWOFISH_SMALL */ + + /** + Initialize the Twofish block cipher + @param key The symmetric key you wish to pass + @param keylen The key length in bytes + @param num_rounds The number of rounds desired (0 for default) + @param skey The key in as scheduled by this function. + @return CRYPT_OK if successful + */ +#ifdef LTC_CLEAN_STACK +static int _twofish_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey) +#else +int twofish_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey) +#endif +{ +#ifndef TWOFISH_SMALL + unsigned char S[4*4], tmpx0, tmpx1; +#endif + int k, x, y; + unsigned char tmp[4], tmp2[4], M[8*4]; + ulong32 A, B; + + LTC_ARGCHK(key != NULL); + LTC_ARGCHK(skey != NULL); + + /* invalid arguments? */ + if (num_rounds != 16 && num_rounds != 0) { + return CRYPT_INVALID_ROUNDS; + } + + if (keylen != 16 && keylen != 24 && keylen != 32) { + return CRYPT_INVALID_KEYSIZE; + } + + /* k = keysize/64 [but since our keysize is in bytes...] */ + k = keylen / 8; + + /* copy the key into M */ + for (x = 0; x < keylen; x++) { + M[x] = key[x] & 255; + } + + /* create the S[..] words */ +#ifndef TWOFISH_SMALL + for (x = 0; x < k; x++) { + rs_mult(M+(x*8), S+(x*4)); + } +#else + for (x = 0; x < k; x++) { + rs_mult(M+(x*8), skey->twofish.S+(x*4)); + } +#endif + + /* make subkeys */ + for (x = 0; x < 20; x++) { + /* A = h(p * 2x, Me) */ + for (y = 0; y < 4; y++) { + tmp[y] = x+x; + } + h_func(tmp, tmp2, M, k, 0); + LOAD32L(A, tmp2); + + /* B = ROL(h(p * (2x + 1), Mo), 8) */ + for (y = 0; y < 4; y++) { + tmp[y] = (unsigned char)(x+x+1); + } + h_func(tmp, tmp2, M, k, 1); + LOAD32L(B, tmp2); + B = ROLc(B, 8); + + /* K[2i] = A + B */ + skey->twofish.K[x+x] = (A + B) & 0xFFFFFFFFUL; + + /* K[2i+1] = (A + 2B) <<< 9 */ + skey->twofish.K[x+x+1] = ROLc(B + B + A, 9); + } + +#ifndef TWOFISH_SMALL + /* make the sboxes (large ram variant) */ + if (k == 2) { + for (x = 0; x < 256; x++) { + tmpx0 = (unsigned char)sbox(0, x); + tmpx1 = (unsigned char)sbox(1, x); + skey->twofish.S[0][x] = mds_column_mult(sbox(1, (sbox(0, tmpx0 ^ S[0]) ^ S[4])),0); + skey->twofish.S[1][x] = mds_column_mult(sbox(0, (sbox(0, tmpx1 ^ S[1]) ^ S[5])),1); + skey->twofish.S[2][x] = mds_column_mult(sbox(1, (sbox(1, tmpx0 ^ S[2]) ^ S[6])),2); + skey->twofish.S[3][x] = mds_column_mult(sbox(0, (sbox(1, tmpx1 ^ S[3]) ^ S[7])),3); + } + } else if (k == 3) { + for (x = 0; x < 256; x++) { + tmpx0 = (unsigned char)sbox(0, x); + tmpx1 = (unsigned char)sbox(1, x); + skey->twofish.S[0][x] = mds_column_mult(sbox(1, (sbox(0, sbox(0, tmpx1 ^ S[0]) ^ S[4]) ^ S[8])),0); + skey->twofish.S[1][x] = mds_column_mult(sbox(0, (sbox(0, sbox(1, tmpx1 ^ S[1]) ^ S[5]) ^ S[9])),1); + skey->twofish.S[2][x] = mds_column_mult(sbox(1, (sbox(1, sbox(0, tmpx0 ^ S[2]) ^ S[6]) ^ S[10])),2); + skey->twofish.S[3][x] = mds_column_mult(sbox(0, (sbox(1, sbox(1, tmpx0 ^ S[3]) ^ S[7]) ^ S[11])),3); + } + } else { + for (x = 0; x < 256; x++) { + tmpx0 = (unsigned char)sbox(0, x); + tmpx1 = (unsigned char)sbox(1, x); + skey->twofish.S[0][x] = mds_column_mult(sbox(1, (sbox(0, sbox(0, sbox(1, tmpx1 ^ S[0]) ^ S[4]) ^ S[8]) ^ S[12])),0); + skey->twofish.S[1][x] = mds_column_mult(sbox(0, (sbox(0, sbox(1, sbox(1, tmpx0 ^ S[1]) ^ S[5]) ^ S[9]) ^ S[13])),1); + skey->twofish.S[2][x] = mds_column_mult(sbox(1, (sbox(1, sbox(0, sbox(0, tmpx0 ^ S[2]) ^ S[6]) ^ S[10]) ^ S[14])),2); + skey->twofish.S[3][x] = mds_column_mult(sbox(0, (sbox(1, sbox(1, sbox(0, tmpx1 ^ S[3]) ^ S[7]) ^ S[11]) ^ S[15])),3); + } + } +#else + /* where to start in the sbox layers */ + /* small ram variant */ + switch (k) { + case 4 : skey->twofish.start = 0; break; + case 3 : skey->twofish.start = 1; break; + default: skey->twofish.start = 2; break; + } +#endif + return CRYPT_OK; +} + +#ifdef LTC_CLEAN_STACK +int twofish_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey) +{ + int x; + x = _twofish_setup(key, keylen, num_rounds, skey); + burn_stack(sizeof(int) * 7 + sizeof(unsigned char) * 56 + sizeof(ulong32) * 2); + return x; +} +#endif + +/** + Encrypts a block of text with Twofish + @param pt The input plaintext (16 bytes) + @param ct The output ciphertext (16 bytes) + @param skey The key as scheduled + @return CRYPT_OK if successful +*/ +#ifdef LTC_CLEAN_STACK +static int _twofish_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key *skey) +#else +int twofish_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key *skey) +#endif +{ + ulong32 a,b,c,d,ta,tb,tc,td,t1,t2, *k; + int r; +#if !defined(TWOFISH_SMALL) && !defined(__GNUC__) + ulong32 *S1, *S2, *S3, *S4; +#endif + + LTC_ARGCHK(pt != NULL); + LTC_ARGCHK(ct != NULL); + LTC_ARGCHK(skey != NULL); + +#if !defined(TWOFISH_SMALL) && !defined(__GNUC__) + S1 = skey->twofish.S[0]; + S2 = skey->twofish.S[1]; + S3 = skey->twofish.S[2]; + S4 = skey->twofish.S[3]; +#endif + + LOAD32L(a,&pt[0]); LOAD32L(b,&pt[4]); + LOAD32L(c,&pt[8]); LOAD32L(d,&pt[12]); + a ^= skey->twofish.K[0]; + b ^= skey->twofish.K[1]; + c ^= skey->twofish.K[2]; + d ^= skey->twofish.K[3]; + + k = skey->twofish.K + 8; + for (r = 8; r != 0; --r) { + t2 = g1_func(b, skey); + t1 = g_func(a, skey) + t2; + c = RORc(c ^ (t1 + k[0]), 1); + d = ROLc(d, 1) ^ (t2 + t1 + k[1]); + + t2 = g1_func(d, skey); + t1 = g_func(c, skey) + t2; + a = RORc(a ^ (t1 + k[2]), 1); + b = ROLc(b, 1) ^ (t2 + t1 + k[3]); + k += 4; + } + + /* output with "undo last swap" */ + ta = c ^ skey->twofish.K[4]; + tb = d ^ skey->twofish.K[5]; + tc = a ^ skey->twofish.K[6]; + td = b ^ skey->twofish.K[7]; + + /* store output */ + STORE32L(ta,&ct[0]); STORE32L(tb,&ct[4]); + STORE32L(tc,&ct[8]); STORE32L(td,&ct[12]); + + return CRYPT_OK; +} + +#ifdef LTC_CLEAN_STACK +int twofish_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key *skey) +{ + int err = _twofish_ecb_encrypt(pt, ct, skey); + burn_stack(sizeof(ulong32) * 10 + sizeof(int)); + return err; +} +#endif + +/** + Decrypts a block of text with Twofish + @param ct The input ciphertext (16 bytes) + @param pt The output plaintext (16 bytes) + @param skey The key as scheduled + @return CRYPT_OK if successful +*/ +#ifdef LTC_CLEAN_STACK +static int _twofish_ecb_decrypt(const unsigned char *ct, unsigned char *pt, symmetric_key *skey) +#else +int twofish_ecb_decrypt(const unsigned char *ct, unsigned char *pt, symmetric_key *skey) +#endif +{ + ulong32 a,b,c,d,ta,tb,tc,td,t1,t2, *k; + int r; +#if !defined(TWOFISH_SMALL) && !defined(__GNUC__) + ulong32 *S1, *S2, *S3, *S4; +#endif + + LTC_ARGCHK(pt != NULL); + LTC_ARGCHK(ct != NULL); + LTC_ARGCHK(skey != NULL); + +#if !defined(TWOFISH_SMALL) && !defined(__GNUC__) + S1 = skey->twofish.S[0]; + S2 = skey->twofish.S[1]; + S3 = skey->twofish.S[2]; + S4 = skey->twofish.S[3]; +#endif + + /* load input */ + LOAD32L(ta,&ct[0]); LOAD32L(tb,&ct[4]); + LOAD32L(tc,&ct[8]); LOAD32L(td,&ct[12]); + + /* undo undo final swap */ + a = tc ^ skey->twofish.K[6]; + b = td ^ skey->twofish.K[7]; + c = ta ^ skey->twofish.K[4]; + d = tb ^ skey->twofish.K[5]; + + k = skey->twofish.K + 36; + for (r = 8; r != 0; --r) { + t2 = g1_func(d, skey); + t1 = g_func(c, skey) + t2; + a = ROLc(a, 1) ^ (t1 + k[2]); + b = RORc(b ^ (t2 + t1 + k[3]), 1); + + t2 = g1_func(b, skey); + t1 = g_func(a, skey) + t2; + c = ROLc(c, 1) ^ (t1 + k[0]); + d = RORc(d ^ (t2 + t1 + k[1]), 1); + k -= 4; + } + + /* pre-white */ + a ^= skey->twofish.K[0]; + b ^= skey->twofish.K[1]; + c ^= skey->twofish.K[2]; + d ^= skey->twofish.K[3]; + + /* store */ + STORE32L(a, &pt[0]); STORE32L(b, &pt[4]); + STORE32L(c, &pt[8]); STORE32L(d, &pt[12]); + return CRYPT_OK; +} + +#ifdef LTC_CLEAN_STACK +int twofish_ecb_decrypt(const unsigned char *ct, unsigned char *pt, symmetric_key *skey) +{ + int err =_twofish_ecb_decrypt(ct, pt, skey); + burn_stack(sizeof(ulong32) * 10 + sizeof(int)); + return err; +} +#endif + +/** + Performs a self-test of the Twofish block cipher + @return CRYPT_OK if functional, CRYPT_NOP if self-test has been disabled +*/ +int twofish_test(void) +{ + #ifndef LTC_TEST + return CRYPT_NOP; + #else + static const struct { + int keylen; + unsigned char key[32], pt[16], ct[16]; + } tests[] = { + { 16, + { 0x9F, 0x58, 0x9F, 0x5C, 0xF6, 0x12, 0x2C, 0x32, + 0xB6, 0xBF, 0xEC, 0x2F, 0x2A, 0xE8, 0xC3, 0x5A }, + { 0xD4, 0x91, 0xDB, 0x16, 0xE7, 0xB1, 0xC3, 0x9E, + 0x86, 0xCB, 0x08, 0x6B, 0x78, 0x9F, 0x54, 0x19 }, + { 0x01, 0x9F, 0x98, 0x09, 0xDE, 0x17, 0x11, 0x85, + 0x8F, 0xAA, 0xC3, 0xA3, 0xBA, 0x20, 0xFB, 0xC3 } + }, { + 24, + { 0x88, 0xB2, 0xB2, 0x70, 0x6B, 0x10, 0x5E, 0x36, + 0xB4, 0x46, 0xBB, 0x6D, 0x73, 0x1A, 0x1E, 0x88, + 0xEF, 0xA7, 0x1F, 0x78, 0x89, 0x65, 0xBD, 0x44 }, + { 0x39, 0xDA, 0x69, 0xD6, 0xBA, 0x49, 0x97, 0xD5, + 0x85, 0xB6, 0xDC, 0x07, 0x3C, 0xA3, 0x41, 0xB2 }, + { 0x18, 0x2B, 0x02, 0xD8, 0x14, 0x97, 0xEA, 0x45, + 0xF9, 0xDA, 0xAC, 0xDC, 0x29, 0x19, 0x3A, 0x65 } + }, { + 32, + { 0xD4, 0x3B, 0xB7, 0x55, 0x6E, 0xA3, 0x2E, 0x46, + 0xF2, 0xA2, 0x82, 0xB7, 0xD4, 0x5B, 0x4E, 0x0D, + 0x57, 0xFF, 0x73, 0x9D, 0x4D, 0xC9, 0x2C, 0x1B, + 0xD7, 0xFC, 0x01, 0x70, 0x0C, 0xC8, 0x21, 0x6F }, + { 0x90, 0xAF, 0xE9, 0x1B, 0xB2, 0x88, 0x54, 0x4F, + 0x2C, 0x32, 0xDC, 0x23, 0x9B, 0x26, 0x35, 0xE6 }, + { 0x6C, 0xB4, 0x56, 0x1C, 0x40, 0xBF, 0x0A, 0x97, + 0x05, 0x93, 0x1C, 0xB6, 0xD4, 0x08, 0xE7, 0xFA } + } +}; + + + symmetric_key key; + unsigned char tmp[2][16]; + int err, i, y; + + for (i = 0; i < (int)(sizeof(tests)/sizeof(tests[0])); i++) { + if ((err = twofish_setup(tests[i].key, tests[i].keylen, 0, &key)) != CRYPT_OK) { + return err; + } + twofish_ecb_encrypt(tests[i].pt, tmp[0], &key); + twofish_ecb_decrypt(tmp[0], tmp[1], &key); + if (XMEMCMP(tmp[0], tests[i].ct, 16) != 0 || XMEMCMP(tmp[1], tests[i].pt, 16) != 0) { +#if 0 + printf("Twofish failed test %d, %d, %d\n", i, XMEMCMP(tmp[0], tests[i].ct, 16), XMEMCMP(tmp[1], tests[i].pt, 16)); +#endif + return CRYPT_FAIL_TESTVECTOR; + } + /* now see if we can encrypt all zero bytes 1000 times, decrypt and come back where we started */ + for (y = 0; y < 16; y++) tmp[0][y] = 0; + for (y = 0; y < 1000; y++) twofish_ecb_encrypt(tmp[0], tmp[0], &key); + for (y = 0; y < 1000; y++) twofish_ecb_decrypt(tmp[0], tmp[0], &key); + for (y = 0; y < 16; y++) if (tmp[0][y] != 0) return CRYPT_FAIL_TESTVECTOR; + } + return CRYPT_OK; +#endif +} + +/** Terminate the context + @param skey The scheduled key +*/ +void twofish_done(symmetric_key *skey) +{ +} + +/** + Gets suitable key size + @param keysize [in/out] The length of the recommended key (in bytes). This function will store the suitable size back in this variable. + @return CRYPT_OK if the input key size is acceptable. +*/ +int twofish_keysize(int *keysize) +{ + LTC_ARGCHK(keysize); + if (*keysize < 16) + return CRYPT_INVALID_KEYSIZE; + if (*keysize < 24) { + *keysize = 16; + return CRYPT_OK; + } else if (*keysize < 32) { + *keysize = 24; + return CRYPT_OK; + } else { + *keysize = 32; + return CRYPT_OK; + } +} + +#endif + + + + +/* $Source: /cvs/libtom/libtomcrypt/src/ciphers/twofish/twofish.c,v $ */ +/* $Revision: 1.14 $ */ +/* $Date: 2006/12/04 21:34:03 $ */ diff --git a/libtomcrypt/src/ciphers/twofish/twofish_tab.c b/libtomcrypt/src/ciphers/twofish/twofish_tab.c new file mode 100644 index 0000000..f8a373f --- /dev/null +++ b/libtomcrypt/src/ciphers/twofish/twofish_tab.c @@ -0,0 +1,496 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ + + /** + @file twofish_tab.c + Twofish tables, Tom St Denis + */ +#ifdef TWOFISH_TABLES + +/* pre generated 8x8 tables from the four 4x4s */ +static const unsigned char SBOX[2][256] = { +{ + 0xa9, 0x67, 0xb3, 0xe8, 0x04, 0xfd, 0xa3, 0x76, 0x9a, 0x92, + 0x80, 0x78, 0xe4, 0xdd, 0xd1, 0x38, 0x0d, 0xc6, 0x35, 0x98, + 0x18, 0xf7, 0xec, 0x6c, 0x43, 0x75, 0x37, 0x26, 0xfa, 0x13, + 0x94, 0x48, 0xf2, 0xd0, 0x8b, 0x30, 0x84, 0x54, 0xdf, 0x23, + 0x19, 0x5b, 0x3d, 0x59, 0xf3, 0xae, 0xa2, 0x82, 0x63, 0x01, + 0x83, 0x2e, 0xd9, 0x51, 0x9b, 0x7c, 0xa6, 0xeb, 0xa5, 0xbe, + 0x16, 0x0c, 0xe3, 0x61, 0xc0, 0x8c, 0x3a, 0xf5, 0x73, 0x2c, + 0x25, 0x0b, 0xbb, 0x4e, 0x89, 0x6b, 0x53, 0x6a, 0xb4, 0xf1, + 0xe1, 0xe6, 0xbd, 0x45, 0xe2, 0xf4, 0xb6, 0x66, 0xcc, 0x95, + 0x03, 0x56, 0xd4, 0x1c, 0x1e, 0xd7, 0xfb, 0xc3, 0x8e, 0xb5, + 0xe9, 0xcf, 0xbf, 0xba, 0xea, 0x77, 0x39, 0xaf, 0x33, 0xc9, + 0x62, 0x71, 0x81, 0x79, 0x09, 0xad, 0x24, 0xcd, 0xf9, 0xd8, + 0xe5, 0xc5, 0xb9, 0x4d, 0x44, 0x08, 0x86, 0xe7, 0xa1, 0x1d, + 0xaa, 0xed, 0x06, 0x70, 0xb2, 0xd2, 0x41, 0x7b, 0xa0, 0x11, + 0x31, 0xc2, 0x27, 0x90, 0x20, 0xf6, 0x60, 0xff, 0x96, 0x5c, + 0xb1, 0xab, 0x9e, 0x9c, 0x52, 0x1b, 0x5f, 0x93, 0x0a, 0xef, + 0x91, 0x85, 0x49, 0xee, 0x2d, 0x4f, 0x8f, 0x3b, 0x47, 0x87, + 0x6d, 0x46, 0xd6, 0x3e, 0x69, 0x64, 0x2a, 0xce, 0xcb, 0x2f, + 0xfc, 0x97, 0x05, 0x7a, 0xac, 0x7f, 0xd5, 0x1a, 0x4b, 0x0e, + 0xa7, 0x5a, 0x28, 0x14, 0x3f, 0x29, 0x88, 0x3c, 0x4c, 0x02, + 0xb8, 0xda, 0xb0, 0x17, 0x55, 0x1f, 0x8a, 0x7d, 0x57, 0xc7, + 0x8d, 0x74, 0xb7, 0xc4, 0x9f, 0x72, 0x7e, 0x15, 0x22, 0x12, + 0x58, 0x07, 0x99, 0x34, 0x6e, 0x50, 0xde, 0x68, 0x65, 0xbc, + 0xdb, 0xf8, 0xc8, 0xa8, 0x2b, 0x40, 0xdc, 0xfe, 0x32, 0xa4, + 0xca, 0x10, 0x21, 0xf0, 0xd3, 0x5d, 0x0f, 0x00, 0x6f, 0x9d, + 0x36, 0x42, 0x4a, 0x5e, 0xc1, 0xe0}, +{ + 0x75, 0xf3, 0xc6, 0xf4, 0xdb, 0x7b, 0xfb, 0xc8, 0x4a, 0xd3, + 0xe6, 0x6b, 0x45, 0x7d, 0xe8, 0x4b, 0xd6, 0x32, 0xd8, 0xfd, + 0x37, 0x71, 0xf1, 0xe1, 0x30, 0x0f, 0xf8, 0x1b, 0x87, 0xfa, + 0x06, 0x3f, 0x5e, 0xba, 0xae, 0x5b, 0x8a, 0x00, 0xbc, 0x9d, + 0x6d, 0xc1, 0xb1, 0x0e, 0x80, 0x5d, 0xd2, 0xd5, 0xa0, 0x84, + 0x07, 0x14, 0xb5, 0x90, 0x2c, 0xa3, 0xb2, 0x73, 0x4c, 0x54, + 0x92, 0x74, 0x36, 0x51, 0x38, 0xb0, 0xbd, 0x5a, 0xfc, 0x60, + 0x62, 0x96, 0x6c, 0x42, 0xf7, 0x10, 0x7c, 0x28, 0x27, 0x8c, + 0x13, 0x95, 0x9c, 0xc7, 0x24, 0x46, 0x3b, 0x70, 0xca, 0xe3, + 0x85, 0xcb, 0x11, 0xd0, 0x93, 0xb8, 0xa6, 0x83, 0x20, 0xff, + 0x9f, 0x77, 0xc3, 0xcc, 0x03, 0x6f, 0x08, 0xbf, 0x40, 0xe7, + 0x2b, 0xe2, 0x79, 0x0c, 0xaa, 0x82, 0x41, 0x3a, 0xea, 0xb9, + 0xe4, 0x9a, 0xa4, 0x97, 0x7e, 0xda, 0x7a, 0x17, 0x66, 0x94, + 0xa1, 0x1d, 0x3d, 0xf0, 0xde, 0xb3, 0x0b, 0x72, 0xa7, 0x1c, + 0xef, 0xd1, 0x53, 0x3e, 0x8f, 0x33, 0x26, 0x5f, 0xec, 0x76, + 0x2a, 0x49, 0x81, 0x88, 0xee, 0x21, 0xc4, 0x1a, 0xeb, 0xd9, + 0xc5, 0x39, 0x99, 0xcd, 0xad, 0x31, 0x8b, 0x01, 0x18, 0x23, + 0xdd, 0x1f, 0x4e, 0x2d, 0xf9, 0x48, 0x4f, 0xf2, 0x65, 0x8e, + 0x78, 0x5c, 0x58, 0x19, 0x8d, 0xe5, 0x98, 0x57, 0x67, 0x7f, + 0x05, 0x64, 0xaf, 0x63, 0xb6, 0xfe, 0xf5, 0xb7, 0x3c, 0xa5, + 0xce, 0xe9, 0x68, 0x44, 0xe0, 0x4d, 0x43, 0x69, 0x29, 0x2e, + 0xac, 0x15, 0x59, 0xa8, 0x0a, 0x9e, 0x6e, 0x47, 0xdf, 0x34, + 0x35, 0x6a, 0xcf, 0xdc, 0x22, 0xc9, 0xc0, 0x9b, 0x89, 0xd4, + 0xed, 0xab, 0x12, 0xa2, 0x0d, 0x52, 0xbb, 0x02, 0x2f, 0xa9, + 0xd7, 0x61, 0x1e, 0xb4, 0x50, 0x04, 0xf6, 0xc2, 0x16, 0x25, + 0x86, 0x56, 0x55, 0x09, 0xbe, 0x91} +}; + +/* the 4x4 MDS in a nicer format */ +static const ulong32 mds_tab[4][256] = { +{ +0x00000000UL, 0xefef5b01UL, 0xb7b7b602UL, 0x5858ed03UL, 0x07070504UL, 0xe8e85e05UL, 0xb0b0b306UL, 0x5f5fe807UL, +0x0e0e0a08UL, 0xe1e15109UL, 0xb9b9bc0aUL, 0x5656e70bUL, 0x09090f0cUL, 0xe6e6540dUL, 0xbebeb90eUL, 0x5151e20fUL, +0x1c1c1410UL, 0xf3f34f11UL, 0xababa212UL, 0x4444f913UL, 0x1b1b1114UL, 0xf4f44a15UL, 0xacaca716UL, 0x4343fc17UL, +0x12121e18UL, 0xfdfd4519UL, 0xa5a5a81aUL, 0x4a4af31bUL, 0x15151b1cUL, 0xfafa401dUL, 0xa2a2ad1eUL, 0x4d4df61fUL, +0x38382820UL, 0xd7d77321UL, 0x8f8f9e22UL, 0x6060c523UL, 0x3f3f2d24UL, 0xd0d07625UL, 0x88889b26UL, 0x6767c027UL, +0x36362228UL, 0xd9d97929UL, 0x8181942aUL, 0x6e6ecf2bUL, 0x3131272cUL, 0xdede7c2dUL, 0x8686912eUL, 0x6969ca2fUL, +0x24243c30UL, 0xcbcb6731UL, 0x93938a32UL, 0x7c7cd133UL, 0x23233934UL, 0xcccc6235UL, 0x94948f36UL, 0x7b7bd437UL, +0x2a2a3638UL, 0xc5c56d39UL, 0x9d9d803aUL, 0x7272db3bUL, 0x2d2d333cUL, 0xc2c2683dUL, 0x9a9a853eUL, 0x7575de3fUL, +0x70705040UL, 0x9f9f0b41UL, 0xc7c7e642UL, 0x2828bd43UL, 0x77775544UL, 0x98980e45UL, 0xc0c0e346UL, 0x2f2fb847UL, +0x7e7e5a48UL, 0x91910149UL, 0xc9c9ec4aUL, 0x2626b74bUL, 0x79795f4cUL, 0x9696044dUL, 0xcecee94eUL, 0x2121b24fUL, +0x6c6c4450UL, 0x83831f51UL, 0xdbdbf252UL, 0x3434a953UL, 0x6b6b4154UL, 0x84841a55UL, 0xdcdcf756UL, 0x3333ac57UL, +0x62624e58UL, 0x8d8d1559UL, 0xd5d5f85aUL, 0x3a3aa35bUL, 0x65654b5cUL, 0x8a8a105dUL, 0xd2d2fd5eUL, 0x3d3da65fUL, +0x48487860UL, 0xa7a72361UL, 0xffffce62UL, 0x10109563UL, 0x4f4f7d64UL, 0xa0a02665UL, 0xf8f8cb66UL, 0x17179067UL, +0x46467268UL, 0xa9a92969UL, 0xf1f1c46aUL, 0x1e1e9f6bUL, 0x4141776cUL, 0xaeae2c6dUL, 0xf6f6c16eUL, 0x19199a6fUL, +0x54546c70UL, 0xbbbb3771UL, 0xe3e3da72UL, 0x0c0c8173UL, 0x53536974UL, 0xbcbc3275UL, 0xe4e4df76UL, 0x0b0b8477UL, +0x5a5a6678UL, 0xb5b53d79UL, 0xededd07aUL, 0x02028b7bUL, 0x5d5d637cUL, 0xb2b2387dUL, 0xeaead57eUL, 0x05058e7fUL, +0xe0e0a080UL, 0x0f0ffb81UL, 0x57571682UL, 0xb8b84d83UL, 0xe7e7a584UL, 0x0808fe85UL, 0x50501386UL, 0xbfbf4887UL, +0xeeeeaa88UL, 0x0101f189UL, 0x59591c8aUL, 0xb6b6478bUL, 0xe9e9af8cUL, 0x0606f48dUL, 0x5e5e198eUL, 0xb1b1428fUL, +0xfcfcb490UL, 0x1313ef91UL, 0x4b4b0292UL, 0xa4a45993UL, 0xfbfbb194UL, 0x1414ea95UL, 0x4c4c0796UL, 0xa3a35c97UL, +0xf2f2be98UL, 0x1d1de599UL, 0x4545089aUL, 0xaaaa539bUL, 0xf5f5bb9cUL, 0x1a1ae09dUL, 0x42420d9eUL, 0xadad569fUL, +0xd8d888a0UL, 0x3737d3a1UL, 0x6f6f3ea2UL, 0x808065a3UL, 0xdfdf8da4UL, 0x3030d6a5UL, 0x68683ba6UL, 0x878760a7UL, +0xd6d682a8UL, 0x3939d9a9UL, 0x616134aaUL, 0x8e8e6fabUL, 0xd1d187acUL, 0x3e3edcadUL, 0x666631aeUL, 0x89896aafUL, +0xc4c49cb0UL, 0x2b2bc7b1UL, 0x73732ab2UL, 0x9c9c71b3UL, 0xc3c399b4UL, 0x2c2cc2b5UL, 0x74742fb6UL, 0x9b9b74b7UL, +0xcaca96b8UL, 0x2525cdb9UL, 0x7d7d20baUL, 0x92927bbbUL, 0xcdcd93bcUL, 0x2222c8bdUL, 0x7a7a25beUL, 0x95957ebfUL, +0x9090f0c0UL, 0x7f7fabc1UL, 0x272746c2UL, 0xc8c81dc3UL, 0x9797f5c4UL, 0x7878aec5UL, 0x202043c6UL, 0xcfcf18c7UL, +0x9e9efac8UL, 0x7171a1c9UL, 0x29294ccaUL, 0xc6c617cbUL, 0x9999ffccUL, 0x7676a4cdUL, 0x2e2e49ceUL, 0xc1c112cfUL, +0x8c8ce4d0UL, 0x6363bfd1UL, 0x3b3b52d2UL, 0xd4d409d3UL, 0x8b8be1d4UL, 0x6464bad5UL, 0x3c3c57d6UL, 0xd3d30cd7UL, +0x8282eed8UL, 0x6d6db5d9UL, 0x353558daUL, 0xdada03dbUL, 0x8585ebdcUL, 0x6a6ab0ddUL, 0x32325ddeUL, 0xdddd06dfUL, +0xa8a8d8e0UL, 0x474783e1UL, 0x1f1f6ee2UL, 0xf0f035e3UL, 0xafafdde4UL, 0x404086e5UL, 0x18186be6UL, 0xf7f730e7UL, +0xa6a6d2e8UL, 0x494989e9UL, 0x111164eaUL, 0xfefe3febUL, 0xa1a1d7ecUL, 0x4e4e8cedUL, 0x161661eeUL, 0xf9f93aefUL, +0xb4b4ccf0UL, 0x5b5b97f1UL, 0x03037af2UL, 0xecec21f3UL, 0xb3b3c9f4UL, 0x5c5c92f5UL, 0x04047ff6UL, 0xebeb24f7UL, +0xbabac6f8UL, 0x55559df9UL, 0x0d0d70faUL, 0xe2e22bfbUL, 0xbdbdc3fcUL, 0x525298fdUL, 0x0a0a75feUL, 0xe5e52effUL +}, +{ +0x00000000UL, 0x015befefUL, 0x02b6b7b7UL, 0x03ed5858UL, 0x04050707UL, 0x055ee8e8UL, 0x06b3b0b0UL, 0x07e85f5fUL, +0x080a0e0eUL, 0x0951e1e1UL, 0x0abcb9b9UL, 0x0be75656UL, 0x0c0f0909UL, 0x0d54e6e6UL, 0x0eb9bebeUL, 0x0fe25151UL, +0x10141c1cUL, 0x114ff3f3UL, 0x12a2ababUL, 0x13f94444UL, 0x14111b1bUL, 0x154af4f4UL, 0x16a7acacUL, 0x17fc4343UL, +0x181e1212UL, 0x1945fdfdUL, 0x1aa8a5a5UL, 0x1bf34a4aUL, 0x1c1b1515UL, 0x1d40fafaUL, 0x1eada2a2UL, 0x1ff64d4dUL, +0x20283838UL, 0x2173d7d7UL, 0x229e8f8fUL, 0x23c56060UL, 0x242d3f3fUL, 0x2576d0d0UL, 0x269b8888UL, 0x27c06767UL, +0x28223636UL, 0x2979d9d9UL, 0x2a948181UL, 0x2bcf6e6eUL, 0x2c273131UL, 0x2d7cdedeUL, 0x2e918686UL, 0x2fca6969UL, +0x303c2424UL, 0x3167cbcbUL, 0x328a9393UL, 0x33d17c7cUL, 0x34392323UL, 0x3562ccccUL, 0x368f9494UL, 0x37d47b7bUL, +0x38362a2aUL, 0x396dc5c5UL, 0x3a809d9dUL, 0x3bdb7272UL, 0x3c332d2dUL, 0x3d68c2c2UL, 0x3e859a9aUL, 0x3fde7575UL, +0x40507070UL, 0x410b9f9fUL, 0x42e6c7c7UL, 0x43bd2828UL, 0x44557777UL, 0x450e9898UL, 0x46e3c0c0UL, 0x47b82f2fUL, +0x485a7e7eUL, 0x49019191UL, 0x4aecc9c9UL, 0x4bb72626UL, 0x4c5f7979UL, 0x4d049696UL, 0x4ee9ceceUL, 0x4fb22121UL, +0x50446c6cUL, 0x511f8383UL, 0x52f2dbdbUL, 0x53a93434UL, 0x54416b6bUL, 0x551a8484UL, 0x56f7dcdcUL, 0x57ac3333UL, +0x584e6262UL, 0x59158d8dUL, 0x5af8d5d5UL, 0x5ba33a3aUL, 0x5c4b6565UL, 0x5d108a8aUL, 0x5efdd2d2UL, 0x5fa63d3dUL, +0x60784848UL, 0x6123a7a7UL, 0x62ceffffUL, 0x63951010UL, 0x647d4f4fUL, 0x6526a0a0UL, 0x66cbf8f8UL, 0x67901717UL, +0x68724646UL, 0x6929a9a9UL, 0x6ac4f1f1UL, 0x6b9f1e1eUL, 0x6c774141UL, 0x6d2caeaeUL, 0x6ec1f6f6UL, 0x6f9a1919UL, +0x706c5454UL, 0x7137bbbbUL, 0x72dae3e3UL, 0x73810c0cUL, 0x74695353UL, 0x7532bcbcUL, 0x76dfe4e4UL, 0x77840b0bUL, +0x78665a5aUL, 0x793db5b5UL, 0x7ad0ededUL, 0x7b8b0202UL, 0x7c635d5dUL, 0x7d38b2b2UL, 0x7ed5eaeaUL, 0x7f8e0505UL, +0x80a0e0e0UL, 0x81fb0f0fUL, 0x82165757UL, 0x834db8b8UL, 0x84a5e7e7UL, 0x85fe0808UL, 0x86135050UL, 0x8748bfbfUL, +0x88aaeeeeUL, 0x89f10101UL, 0x8a1c5959UL, 0x8b47b6b6UL, 0x8cafe9e9UL, 0x8df40606UL, 0x8e195e5eUL, 0x8f42b1b1UL, +0x90b4fcfcUL, 0x91ef1313UL, 0x92024b4bUL, 0x9359a4a4UL, 0x94b1fbfbUL, 0x95ea1414UL, 0x96074c4cUL, 0x975ca3a3UL, +0x98bef2f2UL, 0x99e51d1dUL, 0x9a084545UL, 0x9b53aaaaUL, 0x9cbbf5f5UL, 0x9de01a1aUL, 0x9e0d4242UL, 0x9f56adadUL, +0xa088d8d8UL, 0xa1d33737UL, 0xa23e6f6fUL, 0xa3658080UL, 0xa48ddfdfUL, 0xa5d63030UL, 0xa63b6868UL, 0xa7608787UL, +0xa882d6d6UL, 0xa9d93939UL, 0xaa346161UL, 0xab6f8e8eUL, 0xac87d1d1UL, 0xaddc3e3eUL, 0xae316666UL, 0xaf6a8989UL, +0xb09cc4c4UL, 0xb1c72b2bUL, 0xb22a7373UL, 0xb3719c9cUL, 0xb499c3c3UL, 0xb5c22c2cUL, 0xb62f7474UL, 0xb7749b9bUL, +0xb896cacaUL, 0xb9cd2525UL, 0xba207d7dUL, 0xbb7b9292UL, 0xbc93cdcdUL, 0xbdc82222UL, 0xbe257a7aUL, 0xbf7e9595UL, +0xc0f09090UL, 0xc1ab7f7fUL, 0xc2462727UL, 0xc31dc8c8UL, 0xc4f59797UL, 0xc5ae7878UL, 0xc6432020UL, 0xc718cfcfUL, +0xc8fa9e9eUL, 0xc9a17171UL, 0xca4c2929UL, 0xcb17c6c6UL, 0xccff9999UL, 0xcda47676UL, 0xce492e2eUL, 0xcf12c1c1UL, +0xd0e48c8cUL, 0xd1bf6363UL, 0xd2523b3bUL, 0xd309d4d4UL, 0xd4e18b8bUL, 0xd5ba6464UL, 0xd6573c3cUL, 0xd70cd3d3UL, +0xd8ee8282UL, 0xd9b56d6dUL, 0xda583535UL, 0xdb03dadaUL, 0xdceb8585UL, 0xddb06a6aUL, 0xde5d3232UL, 0xdf06ddddUL, +0xe0d8a8a8UL, 0xe1834747UL, 0xe26e1f1fUL, 0xe335f0f0UL, 0xe4ddafafUL, 0xe5864040UL, 0xe66b1818UL, 0xe730f7f7UL, +0xe8d2a6a6UL, 0xe9894949UL, 0xea641111UL, 0xeb3ffefeUL, 0xecd7a1a1UL, 0xed8c4e4eUL, 0xee611616UL, 0xef3af9f9UL, +0xf0ccb4b4UL, 0xf1975b5bUL, 0xf27a0303UL, 0xf321ececUL, 0xf4c9b3b3UL, 0xf5925c5cUL, 0xf67f0404UL, 0xf724ebebUL, +0xf8c6babaUL, 0xf99d5555UL, 0xfa700d0dUL, 0xfb2be2e2UL, 0xfcc3bdbdUL, 0xfd985252UL, 0xfe750a0aUL, 0xff2ee5e5UL +}, +{ +0x00000000UL, 0xef01ef5bUL, 0xb702b7b6UL, 0x580358edUL, 0x07040705UL, 0xe805e85eUL, 0xb006b0b3UL, 0x5f075fe8UL, +0x0e080e0aUL, 0xe109e151UL, 0xb90ab9bcUL, 0x560b56e7UL, 0x090c090fUL, 0xe60de654UL, 0xbe0ebeb9UL, 0x510f51e2UL, +0x1c101c14UL, 0xf311f34fUL, 0xab12aba2UL, 0x441344f9UL, 0x1b141b11UL, 0xf415f44aUL, 0xac16aca7UL, 0x431743fcUL, +0x1218121eUL, 0xfd19fd45UL, 0xa51aa5a8UL, 0x4a1b4af3UL, 0x151c151bUL, 0xfa1dfa40UL, 0xa21ea2adUL, 0x4d1f4df6UL, +0x38203828UL, 0xd721d773UL, 0x8f228f9eUL, 0x602360c5UL, 0x3f243f2dUL, 0xd025d076UL, 0x8826889bUL, 0x672767c0UL, +0x36283622UL, 0xd929d979UL, 0x812a8194UL, 0x6e2b6ecfUL, 0x312c3127UL, 0xde2dde7cUL, 0x862e8691UL, 0x692f69caUL, +0x2430243cUL, 0xcb31cb67UL, 0x9332938aUL, 0x7c337cd1UL, 0x23342339UL, 0xcc35cc62UL, 0x9436948fUL, 0x7b377bd4UL, +0x2a382a36UL, 0xc539c56dUL, 0x9d3a9d80UL, 0x723b72dbUL, 0x2d3c2d33UL, 0xc23dc268UL, 0x9a3e9a85UL, 0x753f75deUL, +0x70407050UL, 0x9f419f0bUL, 0xc742c7e6UL, 0x284328bdUL, 0x77447755UL, 0x9845980eUL, 0xc046c0e3UL, 0x2f472fb8UL, +0x7e487e5aUL, 0x91499101UL, 0xc94ac9ecUL, 0x264b26b7UL, 0x794c795fUL, 0x964d9604UL, 0xce4ecee9UL, 0x214f21b2UL, +0x6c506c44UL, 0x8351831fUL, 0xdb52dbf2UL, 0x345334a9UL, 0x6b546b41UL, 0x8455841aUL, 0xdc56dcf7UL, 0x335733acUL, +0x6258624eUL, 0x8d598d15UL, 0xd55ad5f8UL, 0x3a5b3aa3UL, 0x655c654bUL, 0x8a5d8a10UL, 0xd25ed2fdUL, 0x3d5f3da6UL, +0x48604878UL, 0xa761a723UL, 0xff62ffceUL, 0x10631095UL, 0x4f644f7dUL, 0xa065a026UL, 0xf866f8cbUL, 0x17671790UL, +0x46684672UL, 0xa969a929UL, 0xf16af1c4UL, 0x1e6b1e9fUL, 0x416c4177UL, 0xae6dae2cUL, 0xf66ef6c1UL, 0x196f199aUL, +0x5470546cUL, 0xbb71bb37UL, 0xe372e3daUL, 0x0c730c81UL, 0x53745369UL, 0xbc75bc32UL, 0xe476e4dfUL, 0x0b770b84UL, +0x5a785a66UL, 0xb579b53dUL, 0xed7aedd0UL, 0x027b028bUL, 0x5d7c5d63UL, 0xb27db238UL, 0xea7eead5UL, 0x057f058eUL, +0xe080e0a0UL, 0x0f810ffbUL, 0x57825716UL, 0xb883b84dUL, 0xe784e7a5UL, 0x088508feUL, 0x50865013UL, 0xbf87bf48UL, +0xee88eeaaUL, 0x018901f1UL, 0x598a591cUL, 0xb68bb647UL, 0xe98ce9afUL, 0x068d06f4UL, 0x5e8e5e19UL, 0xb18fb142UL, +0xfc90fcb4UL, 0x139113efUL, 0x4b924b02UL, 0xa493a459UL, 0xfb94fbb1UL, 0x149514eaUL, 0x4c964c07UL, 0xa397a35cUL, +0xf298f2beUL, 0x1d991de5UL, 0x459a4508UL, 0xaa9baa53UL, 0xf59cf5bbUL, 0x1a9d1ae0UL, 0x429e420dUL, 0xad9fad56UL, +0xd8a0d888UL, 0x37a137d3UL, 0x6fa26f3eUL, 0x80a38065UL, 0xdfa4df8dUL, 0x30a530d6UL, 0x68a6683bUL, 0x87a78760UL, +0xd6a8d682UL, 0x39a939d9UL, 0x61aa6134UL, 0x8eab8e6fUL, 0xd1acd187UL, 0x3ead3edcUL, 0x66ae6631UL, 0x89af896aUL, +0xc4b0c49cUL, 0x2bb12bc7UL, 0x73b2732aUL, 0x9cb39c71UL, 0xc3b4c399UL, 0x2cb52cc2UL, 0x74b6742fUL, 0x9bb79b74UL, +0xcab8ca96UL, 0x25b925cdUL, 0x7dba7d20UL, 0x92bb927bUL, 0xcdbccd93UL, 0x22bd22c8UL, 0x7abe7a25UL, 0x95bf957eUL, +0x90c090f0UL, 0x7fc17fabUL, 0x27c22746UL, 0xc8c3c81dUL, 0x97c497f5UL, 0x78c578aeUL, 0x20c62043UL, 0xcfc7cf18UL, +0x9ec89efaUL, 0x71c971a1UL, 0x29ca294cUL, 0xc6cbc617UL, 0x99cc99ffUL, 0x76cd76a4UL, 0x2ece2e49UL, 0xc1cfc112UL, +0x8cd08ce4UL, 0x63d163bfUL, 0x3bd23b52UL, 0xd4d3d409UL, 0x8bd48be1UL, 0x64d564baUL, 0x3cd63c57UL, 0xd3d7d30cUL, +0x82d882eeUL, 0x6dd96db5UL, 0x35da3558UL, 0xdadbda03UL, 0x85dc85ebUL, 0x6add6ab0UL, 0x32de325dUL, 0xdddfdd06UL, +0xa8e0a8d8UL, 0x47e14783UL, 0x1fe21f6eUL, 0xf0e3f035UL, 0xafe4afddUL, 0x40e54086UL, 0x18e6186bUL, 0xf7e7f730UL, +0xa6e8a6d2UL, 0x49e94989UL, 0x11ea1164UL, 0xfeebfe3fUL, 0xa1eca1d7UL, 0x4eed4e8cUL, 0x16ee1661UL, 0xf9eff93aUL, +0xb4f0b4ccUL, 0x5bf15b97UL, 0x03f2037aUL, 0xecf3ec21UL, 0xb3f4b3c9UL, 0x5cf55c92UL, 0x04f6047fUL, 0xebf7eb24UL, +0xbaf8bac6UL, 0x55f9559dUL, 0x0dfa0d70UL, 0xe2fbe22bUL, 0xbdfcbdc3UL, 0x52fd5298UL, 0x0afe0a75UL, 0xe5ffe52eUL +}, +{ +0x00000000UL, 0x5bef015bUL, 0xb6b702b6UL, 0xed5803edUL, 0x05070405UL, 0x5ee8055eUL, 0xb3b006b3UL, 0xe85f07e8UL, +0x0a0e080aUL, 0x51e10951UL, 0xbcb90abcUL, 0xe7560be7UL, 0x0f090c0fUL, 0x54e60d54UL, 0xb9be0eb9UL, 0xe2510fe2UL, +0x141c1014UL, 0x4ff3114fUL, 0xa2ab12a2UL, 0xf94413f9UL, 0x111b1411UL, 0x4af4154aUL, 0xa7ac16a7UL, 0xfc4317fcUL, +0x1e12181eUL, 0x45fd1945UL, 0xa8a51aa8UL, 0xf34a1bf3UL, 0x1b151c1bUL, 0x40fa1d40UL, 0xada21eadUL, 0xf64d1ff6UL, +0x28382028UL, 0x73d72173UL, 0x9e8f229eUL, 0xc56023c5UL, 0x2d3f242dUL, 0x76d02576UL, 0x9b88269bUL, 0xc06727c0UL, +0x22362822UL, 0x79d92979UL, 0x94812a94UL, 0xcf6e2bcfUL, 0x27312c27UL, 0x7cde2d7cUL, 0x91862e91UL, 0xca692fcaUL, +0x3c24303cUL, 0x67cb3167UL, 0x8a93328aUL, 0xd17c33d1UL, 0x39233439UL, 0x62cc3562UL, 0x8f94368fUL, 0xd47b37d4UL, +0x362a3836UL, 0x6dc5396dUL, 0x809d3a80UL, 0xdb723bdbUL, 0x332d3c33UL, 0x68c23d68UL, 0x859a3e85UL, 0xde753fdeUL, +0x50704050UL, 0x0b9f410bUL, 0xe6c742e6UL, 0xbd2843bdUL, 0x55774455UL, 0x0e98450eUL, 0xe3c046e3UL, 0xb82f47b8UL, +0x5a7e485aUL, 0x01914901UL, 0xecc94aecUL, 0xb7264bb7UL, 0x5f794c5fUL, 0x04964d04UL, 0xe9ce4ee9UL, 0xb2214fb2UL, +0x446c5044UL, 0x1f83511fUL, 0xf2db52f2UL, 0xa93453a9UL, 0x416b5441UL, 0x1a84551aUL, 0xf7dc56f7UL, 0xac3357acUL, +0x4e62584eUL, 0x158d5915UL, 0xf8d55af8UL, 0xa33a5ba3UL, 0x4b655c4bUL, 0x108a5d10UL, 0xfdd25efdUL, 0xa63d5fa6UL, +0x78486078UL, 0x23a76123UL, 0xceff62ceUL, 0x95106395UL, 0x7d4f647dUL, 0x26a06526UL, 0xcbf866cbUL, 0x90176790UL, +0x72466872UL, 0x29a96929UL, 0xc4f16ac4UL, 0x9f1e6b9fUL, 0x77416c77UL, 0x2cae6d2cUL, 0xc1f66ec1UL, 0x9a196f9aUL, +0x6c54706cUL, 0x37bb7137UL, 0xdae372daUL, 0x810c7381UL, 0x69537469UL, 0x32bc7532UL, 0xdfe476dfUL, 0x840b7784UL, +0x665a7866UL, 0x3db5793dUL, 0xd0ed7ad0UL, 0x8b027b8bUL, 0x635d7c63UL, 0x38b27d38UL, 0xd5ea7ed5UL, 0x8e057f8eUL, +0xa0e080a0UL, 0xfb0f81fbUL, 0x16578216UL, 0x4db8834dUL, 0xa5e784a5UL, 0xfe0885feUL, 0x13508613UL, 0x48bf8748UL, +0xaaee88aaUL, 0xf10189f1UL, 0x1c598a1cUL, 0x47b68b47UL, 0xafe98cafUL, 0xf4068df4UL, 0x195e8e19UL, 0x42b18f42UL, +0xb4fc90b4UL, 0xef1391efUL, 0x024b9202UL, 0x59a49359UL, 0xb1fb94b1UL, 0xea1495eaUL, 0x074c9607UL, 0x5ca3975cUL, +0xbef298beUL, 0xe51d99e5UL, 0x08459a08UL, 0x53aa9b53UL, 0xbbf59cbbUL, 0xe01a9de0UL, 0x0d429e0dUL, 0x56ad9f56UL, +0x88d8a088UL, 0xd337a1d3UL, 0x3e6fa23eUL, 0x6580a365UL, 0x8ddfa48dUL, 0xd630a5d6UL, 0x3b68a63bUL, 0x6087a760UL, +0x82d6a882UL, 0xd939a9d9UL, 0x3461aa34UL, 0x6f8eab6fUL, 0x87d1ac87UL, 0xdc3eaddcUL, 0x3166ae31UL, 0x6a89af6aUL, +0x9cc4b09cUL, 0xc72bb1c7UL, 0x2a73b22aUL, 0x719cb371UL, 0x99c3b499UL, 0xc22cb5c2UL, 0x2f74b62fUL, 0x749bb774UL, +0x96cab896UL, 0xcd25b9cdUL, 0x207dba20UL, 0x7b92bb7bUL, 0x93cdbc93UL, 0xc822bdc8UL, 0x257abe25UL, 0x7e95bf7eUL, +0xf090c0f0UL, 0xab7fc1abUL, 0x4627c246UL, 0x1dc8c31dUL, 0xf597c4f5UL, 0xae78c5aeUL, 0x4320c643UL, 0x18cfc718UL, +0xfa9ec8faUL, 0xa171c9a1UL, 0x4c29ca4cUL, 0x17c6cb17UL, 0xff99ccffUL, 0xa476cda4UL, 0x492ece49UL, 0x12c1cf12UL, +0xe48cd0e4UL, 0xbf63d1bfUL, 0x523bd252UL, 0x09d4d309UL, 0xe18bd4e1UL, 0xba64d5baUL, 0x573cd657UL, 0x0cd3d70cUL, +0xee82d8eeUL, 0xb56dd9b5UL, 0x5835da58UL, 0x03dadb03UL, 0xeb85dcebUL, 0xb06addb0UL, 0x5d32de5dUL, 0x06dddf06UL, +0xd8a8e0d8UL, 0x8347e183UL, 0x6e1fe26eUL, 0x35f0e335UL, 0xddafe4ddUL, 0x8640e586UL, 0x6b18e66bUL, 0x30f7e730UL, +0xd2a6e8d2UL, 0x8949e989UL, 0x6411ea64UL, 0x3ffeeb3fUL, 0xd7a1ecd7UL, 0x8c4eed8cUL, 0x6116ee61UL, 0x3af9ef3aUL, +0xccb4f0ccUL, 0x975bf197UL, 0x7a03f27aUL, 0x21ecf321UL, 0xc9b3f4c9UL, 0x925cf592UL, 0x7f04f67fUL, 0x24ebf724UL, +0xc6baf8c6UL, 0x9d55f99dUL, 0x700dfa70UL, 0x2be2fb2bUL, 0xc3bdfcc3UL, 0x9852fd98UL, 0x750afe75UL, 0x2ee5ff2eUL +}}; + +#ifdef TWOFISH_ALL_TABLES + +/* the 4x8 RS transform */ +static const ulong32 rs_tab0[256] = { +0x00000000LU, 0xa402a401LU, 0x05040502LU, 0xa106a103LU, 0x0a080a04LU, 0xae0aae05LU, 0x0f0c0f06LU, 0xab0eab07LU, +0x14101408LU, 0xb012b009LU, 0x1114110aLU, 0xb516b50bLU, 0x1e181e0cLU, 0xba1aba0dLU, 0x1b1c1b0eLU, 0xbf1ebf0fLU, +0x28202810LU, 0x8c228c11LU, 0x2d242d12LU, 0x89268913LU, 0x22282214LU, 0x862a8615LU, 0x272c2716LU, 0x832e8317LU, +0x3c303c18LU, 0x98329819LU, 0x3934391aLU, 0x9d369d1bLU, 0x3638361cLU, 0x923a921dLU, 0x333c331eLU, 0x973e971fLU, +0x50405020LU, 0xf442f421LU, 0x55445522LU, 0xf146f123LU, 0x5a485a24LU, 0xfe4afe25LU, 0x5f4c5f26LU, 0xfb4efb27LU, +0x44504428LU, 0xe052e029LU, 0x4154412aLU, 0xe556e52bLU, 0x4e584e2cLU, 0xea5aea2dLU, 0x4b5c4b2eLU, 0xef5eef2fLU, +0x78607830LU, 0xdc62dc31LU, 0x7d647d32LU, 0xd966d933LU, 0x72687234LU, 0xd66ad635LU, 0x776c7736LU, 0xd36ed337LU, +0x6c706c38LU, 0xc872c839LU, 0x6974693aLU, 0xcd76cd3bLU, 0x6678663cLU, 0xc27ac23dLU, 0x637c633eLU, 0xc77ec73fLU, +0xa080a040LU, 0x04820441LU, 0xa584a542LU, 0x01860143LU, 0xaa88aa44LU, 0x0e8a0e45LU, 0xaf8caf46LU, 0x0b8e0b47LU, +0xb490b448LU, 0x10921049LU, 0xb194b14aLU, 0x1596154bLU, 0xbe98be4cLU, 0x1a9a1a4dLU, 0xbb9cbb4eLU, 0x1f9e1f4fLU, +0x88a08850LU, 0x2ca22c51LU, 0x8da48d52LU, 0x29a62953LU, 0x82a88254LU, 0x26aa2655LU, 0x87ac8756LU, 0x23ae2357LU, +0x9cb09c58LU, 0x38b23859LU, 0x99b4995aLU, 0x3db63d5bLU, 0x96b8965cLU, 0x32ba325dLU, 0x93bc935eLU, 0x37be375fLU, +0xf0c0f060LU, 0x54c25461LU, 0xf5c4f562LU, 0x51c65163LU, 0xfac8fa64LU, 0x5eca5e65LU, 0xffccff66LU, 0x5bce5b67LU, +0xe4d0e468LU, 0x40d24069LU, 0xe1d4e16aLU, 0x45d6456bLU, 0xeed8ee6cLU, 0x4ada4a6dLU, 0xebdceb6eLU, 0x4fde4f6fLU, +0xd8e0d870LU, 0x7ce27c71LU, 0xdde4dd72LU, 0x79e67973LU, 0xd2e8d274LU, 0x76ea7675LU, 0xd7ecd776LU, 0x73ee7377LU, +0xccf0cc78LU, 0x68f26879LU, 0xc9f4c97aLU, 0x6df66d7bLU, 0xc6f8c67cLU, 0x62fa627dLU, 0xc3fcc37eLU, 0x67fe677fLU, +0x0d4d0d80LU, 0xa94fa981LU, 0x08490882LU, 0xac4bac83LU, 0x07450784LU, 0xa347a385LU, 0x02410286LU, 0xa643a687LU, +0x195d1988LU, 0xbd5fbd89LU, 0x1c591c8aLU, 0xb85bb88bLU, 0x1355138cLU, 0xb757b78dLU, 0x1651168eLU, 0xb253b28fLU, +0x256d2590LU, 0x816f8191LU, 0x20692092LU, 0x846b8493LU, 0x2f652f94LU, 0x8b678b95LU, 0x2a612a96LU, 0x8e638e97LU, +0x317d3198LU, 0x957f9599LU, 0x3479349aLU, 0x907b909bLU, 0x3b753b9cLU, 0x9f779f9dLU, 0x3e713e9eLU, 0x9a739a9fLU, +0x5d0d5da0LU, 0xf90ff9a1LU, 0x580958a2LU, 0xfc0bfca3LU, 0x570557a4LU, 0xf307f3a5LU, 0x520152a6LU, 0xf603f6a7LU, +0x491d49a8LU, 0xed1feda9LU, 0x4c194caaLU, 0xe81be8abLU, 0x431543acLU, 0xe717e7adLU, 0x461146aeLU, 0xe213e2afLU, +0x752d75b0LU, 0xd12fd1b1LU, 0x702970b2LU, 0xd42bd4b3LU, 0x7f257fb4LU, 0xdb27dbb5LU, 0x7a217ab6LU, 0xde23deb7LU, +0x613d61b8LU, 0xc53fc5b9LU, 0x643964baLU, 0xc03bc0bbLU, 0x6b356bbcLU, 0xcf37cfbdLU, 0x6e316ebeLU, 0xca33cabfLU, +0xadcdadc0LU, 0x09cf09c1LU, 0xa8c9a8c2LU, 0x0ccb0cc3LU, 0xa7c5a7c4LU, 0x03c703c5LU, 0xa2c1a2c6LU, 0x06c306c7LU, +0xb9ddb9c8LU, 0x1ddf1dc9LU, 0xbcd9bccaLU, 0x18db18cbLU, 0xb3d5b3ccLU, 0x17d717cdLU, 0xb6d1b6ceLU, 0x12d312cfLU, +0x85ed85d0LU, 0x21ef21d1LU, 0x80e980d2LU, 0x24eb24d3LU, 0x8fe58fd4LU, 0x2be72bd5LU, 0x8ae18ad6LU, 0x2ee32ed7LU, +0x91fd91d8LU, 0x35ff35d9LU, 0x94f994daLU, 0x30fb30dbLU, 0x9bf59bdcLU, 0x3ff73fddLU, 0x9ef19edeLU, 0x3af33adfLU, +0xfd8dfde0LU, 0x598f59e1LU, 0xf889f8e2LU, 0x5c8b5ce3LU, 0xf785f7e4LU, 0x538753e5LU, 0xf281f2e6LU, 0x568356e7LU, +0xe99de9e8LU, 0x4d9f4de9LU, 0xec99eceaLU, 0x489b48ebLU, 0xe395e3ecLU, 0x479747edLU, 0xe691e6eeLU, 0x429342efLU, +0xd5add5f0LU, 0x71af71f1LU, 0xd0a9d0f2LU, 0x74ab74f3LU, 0xdfa5dff4LU, 0x7ba77bf5LU, 0xdaa1daf6LU, 0x7ea37ef7LU, +0xc1bdc1f8LU, 0x65bf65f9LU, 0xc4b9c4faLU, 0x60bb60fbLU, 0xcbb5cbfcLU, 0x6fb76ffdLU, 0xceb1cefeLU, 0x6ab36affLU }; + +static const ulong32 rs_tab1[256] = { +0x00000000LU, 0x55a156a4LU, 0xaa0fac05LU, 0xffaefaa1LU, 0x191e150aLU, 0x4cbf43aeLU, 0xb311b90fLU, 0xe6b0efabLU, +0x323c2a14LU, 0x679d7cb0LU, 0x98338611LU, 0xcd92d0b5LU, 0x2b223f1eLU, 0x7e8369baLU, 0x812d931bLU, 0xd48cc5bfLU, +0x64785428LU, 0x31d9028cLU, 0xce77f82dLU, 0x9bd6ae89LU, 0x7d664122LU, 0x28c71786LU, 0xd769ed27LU, 0x82c8bb83LU, +0x56447e3cLU, 0x03e52898LU, 0xfc4bd239LU, 0xa9ea849dLU, 0x4f5a6b36LU, 0x1afb3d92LU, 0xe555c733LU, 0xb0f49197LU, +0xc8f0a850LU, 0x9d51fef4LU, 0x62ff0455LU, 0x375e52f1LU, 0xd1eebd5aLU, 0x844febfeLU, 0x7be1115fLU, 0x2e4047fbLU, +0xfacc8244LU, 0xaf6dd4e0LU, 0x50c32e41LU, 0x056278e5LU, 0xe3d2974eLU, 0xb673c1eaLU, 0x49dd3b4bLU, 0x1c7c6defLU, +0xac88fc78LU, 0xf929aadcLU, 0x0687507dLU, 0x532606d9LU, 0xb596e972LU, 0xe037bfd6LU, 0x1f994577LU, 0x4a3813d3LU, +0x9eb4d66cLU, 0xcb1580c8LU, 0x34bb7a69LU, 0x611a2ccdLU, 0x87aac366LU, 0xd20b95c2LU, 0x2da56f63LU, 0x780439c7LU, +0xddad1da0LU, 0x880c4b04LU, 0x77a2b1a5LU, 0x2203e701LU, 0xc4b308aaLU, 0x91125e0eLU, 0x6ebca4afLU, 0x3b1df20bLU, +0xef9137b4LU, 0xba306110LU, 0x459e9bb1LU, 0x103fcd15LU, 0xf68f22beLU, 0xa32e741aLU, 0x5c808ebbLU, 0x0921d81fLU, +0xb9d54988LU, 0xec741f2cLU, 0x13dae58dLU, 0x467bb329LU, 0xa0cb5c82LU, 0xf56a0a26LU, 0x0ac4f087LU, 0x5f65a623LU, +0x8be9639cLU, 0xde483538LU, 0x21e6cf99LU, 0x7447993dLU, 0x92f77696LU, 0xc7562032LU, 0x38f8da93LU, 0x6d598c37LU, +0x155db5f0LU, 0x40fce354LU, 0xbf5219f5LU, 0xeaf34f51LU, 0x0c43a0faLU, 0x59e2f65eLU, 0xa64c0cffLU, 0xf3ed5a5bLU, +0x27619fe4LU, 0x72c0c940LU, 0x8d6e33e1LU, 0xd8cf6545LU, 0x3e7f8aeeLU, 0x6bdedc4aLU, 0x947026ebLU, 0xc1d1704fLU, +0x7125e1d8LU, 0x2484b77cLU, 0xdb2a4dddLU, 0x8e8b1b79LU, 0x683bf4d2LU, 0x3d9aa276LU, 0xc23458d7LU, 0x97950e73LU, +0x4319cbccLU, 0x16b89d68LU, 0xe91667c9LU, 0xbcb7316dLU, 0x5a07dec6LU, 0x0fa68862LU, 0xf00872c3LU, 0xa5a92467LU, +0xf7173a0dLU, 0xa2b66ca9LU, 0x5d189608LU, 0x08b9c0acLU, 0xee092f07LU, 0xbba879a3LU, 0x44068302LU, 0x11a7d5a6LU, +0xc52b1019LU, 0x908a46bdLU, 0x6f24bc1cLU, 0x3a85eab8LU, 0xdc350513LU, 0x899453b7LU, 0x763aa916LU, 0x239bffb2LU, +0x936f6e25LU, 0xc6ce3881LU, 0x3960c220LU, 0x6cc19484LU, 0x8a717b2fLU, 0xdfd02d8bLU, 0x207ed72aLU, 0x75df818eLU, +0xa1534431LU, 0xf4f21295LU, 0x0b5ce834LU, 0x5efdbe90LU, 0xb84d513bLU, 0xedec079fLU, 0x1242fd3eLU, 0x47e3ab9aLU, +0x3fe7925dLU, 0x6a46c4f9LU, 0x95e83e58LU, 0xc04968fcLU, 0x26f98757LU, 0x7358d1f3LU, 0x8cf62b52LU, 0xd9577df6LU, +0x0ddbb849LU, 0x587aeeedLU, 0xa7d4144cLU, 0xf27542e8LU, 0x14c5ad43LU, 0x4164fbe7LU, 0xbeca0146LU, 0xeb6b57e2LU, +0x5b9fc675LU, 0x0e3e90d1LU, 0xf1906a70LU, 0xa4313cd4LU, 0x4281d37fLU, 0x172085dbLU, 0xe88e7f7aLU, 0xbd2f29deLU, +0x69a3ec61LU, 0x3c02bac5LU, 0xc3ac4064LU, 0x960d16c0LU, 0x70bdf96bLU, 0x251cafcfLU, 0xdab2556eLU, 0x8f1303caLU, +0x2aba27adLU, 0x7f1b7109LU, 0x80b58ba8LU, 0xd514dd0cLU, 0x33a432a7LU, 0x66056403LU, 0x99ab9ea2LU, 0xcc0ac806LU, +0x18860db9LU, 0x4d275b1dLU, 0xb289a1bcLU, 0xe728f718LU, 0x019818b3LU, 0x54394e17LU, 0xab97b4b6LU, 0xfe36e212LU, +0x4ec27385LU, 0x1b632521LU, 0xe4cddf80LU, 0xb16c8924LU, 0x57dc668fLU, 0x027d302bLU, 0xfdd3ca8aLU, 0xa8729c2eLU, +0x7cfe5991LU, 0x295f0f35LU, 0xd6f1f594LU, 0x8350a330LU, 0x65e04c9bLU, 0x30411a3fLU, 0xcfefe09eLU, 0x9a4eb63aLU, +0xe24a8ffdLU, 0xb7ebd959LU, 0x484523f8LU, 0x1de4755cLU, 0xfb549af7LU, 0xaef5cc53LU, 0x515b36f2LU, 0x04fa6056LU, +0xd076a5e9LU, 0x85d7f34dLU, 0x7a7909ecLU, 0x2fd85f48LU, 0xc968b0e3LU, 0x9cc9e647LU, 0x63671ce6LU, 0x36c64a42LU, +0x8632dbd5LU, 0xd3938d71LU, 0x2c3d77d0LU, 0x799c2174LU, 0x9f2ccedfLU, 0xca8d987bLU, 0x352362daLU, 0x6082347eLU, +0xb40ef1c1LU, 0xe1afa765LU, 0x1e015dc4LU, 0x4ba00b60LU, 0xad10e4cbLU, 0xf8b1b26fLU, 0x071f48ceLU, 0x52be1e6aLU }; + +static const ulong32 rs_tab2[256] = { +0x00000000LU, 0x87fc8255LU, 0x43b549aaLU, 0xc449cbffLU, 0x86279219LU, 0x01db104cLU, 0xc592dbb3LU, 0x426e59e6LU, +0x414e6932LU, 0xc6b2eb67LU, 0x02fb2098LU, 0x8507a2cdLU, 0xc769fb2bLU, 0x4095797eLU, 0x84dcb281LU, 0x032030d4LU, +0x829cd264LU, 0x05605031LU, 0xc1299bceLU, 0x46d5199bLU, 0x04bb407dLU, 0x8347c228LU, 0x470e09d7LU, 0xc0f28b82LU, +0xc3d2bb56LU, 0x442e3903LU, 0x8067f2fcLU, 0x079b70a9LU, 0x45f5294fLU, 0xc209ab1aLU, 0x064060e5LU, 0x81bce2b0LU, +0x4975e9c8LU, 0xce896b9dLU, 0x0ac0a062LU, 0x8d3c2237LU, 0xcf527bd1LU, 0x48aef984LU, 0x8ce7327bLU, 0x0b1bb02eLU, +0x083b80faLU, 0x8fc702afLU, 0x4b8ec950LU, 0xcc724b05LU, 0x8e1c12e3LU, 0x09e090b6LU, 0xcda95b49LU, 0x4a55d91cLU, +0xcbe93bacLU, 0x4c15b9f9LU, 0x885c7206LU, 0x0fa0f053LU, 0x4dcea9b5LU, 0xca322be0LU, 0x0e7be01fLU, 0x8987624aLU, +0x8aa7529eLU, 0x0d5bd0cbLU, 0xc9121b34LU, 0x4eee9961LU, 0x0c80c087LU, 0x8b7c42d2LU, 0x4f35892dLU, 0xc8c90b78LU, +0x92ea9fddLU, 0x15161d88LU, 0xd15fd677LU, 0x56a35422LU, 0x14cd0dc4LU, 0x93318f91LU, 0x5778446eLU, 0xd084c63bLU, +0xd3a4f6efLU, 0x545874baLU, 0x9011bf45LU, 0x17ed3d10LU, 0x558364f6LU, 0xd27fe6a3LU, 0x16362d5cLU, 0x91caaf09LU, +0x10764db9LU, 0x978acfecLU, 0x53c30413LU, 0xd43f8646LU, 0x9651dfa0LU, 0x11ad5df5LU, 0xd5e4960aLU, 0x5218145fLU, +0x5138248bLU, 0xd6c4a6deLU, 0x128d6d21LU, 0x9571ef74LU, 0xd71fb692LU, 0x50e334c7LU, 0x94aaff38LU, 0x13567d6dLU, +0xdb9f7615LU, 0x5c63f440LU, 0x982a3fbfLU, 0x1fd6bdeaLU, 0x5db8e40cLU, 0xda446659LU, 0x1e0dada6LU, 0x99f12ff3LU, +0x9ad11f27LU, 0x1d2d9d72LU, 0xd964568dLU, 0x5e98d4d8LU, 0x1cf68d3eLU, 0x9b0a0f6bLU, 0x5f43c494LU, 0xd8bf46c1LU, +0x5903a471LU, 0xdeff2624LU, 0x1ab6eddbLU, 0x9d4a6f8eLU, 0xdf243668LU, 0x58d8b43dLU, 0x9c917fc2LU, 0x1b6dfd97LU, +0x184dcd43LU, 0x9fb14f16LU, 0x5bf884e9LU, 0xdc0406bcLU, 0x9e6a5f5aLU, 0x1996dd0fLU, 0xdddf16f0LU, 0x5a2394a5LU, +0x699973f7LU, 0xee65f1a2LU, 0x2a2c3a5dLU, 0xadd0b808LU, 0xefbee1eeLU, 0x684263bbLU, 0xac0ba844LU, 0x2bf72a11LU, +0x28d71ac5LU, 0xaf2b9890LU, 0x6b62536fLU, 0xec9ed13aLU, 0xaef088dcLU, 0x290c0a89LU, 0xed45c176LU, 0x6ab94323LU, +0xeb05a193LU, 0x6cf923c6LU, 0xa8b0e839LU, 0x2f4c6a6cLU, 0x6d22338aLU, 0xeadeb1dfLU, 0x2e977a20LU, 0xa96bf875LU, +0xaa4bc8a1LU, 0x2db74af4LU, 0xe9fe810bLU, 0x6e02035eLU, 0x2c6c5ab8LU, 0xab90d8edLU, 0x6fd91312LU, 0xe8259147LU, +0x20ec9a3fLU, 0xa710186aLU, 0x6359d395LU, 0xe4a551c0LU, 0xa6cb0826LU, 0x21378a73LU, 0xe57e418cLU, 0x6282c3d9LU, +0x61a2f30dLU, 0xe65e7158LU, 0x2217baa7LU, 0xa5eb38f2LU, 0xe7856114LU, 0x6079e341LU, 0xa43028beLU, 0x23ccaaebLU, +0xa270485bLU, 0x258cca0eLU, 0xe1c501f1LU, 0x663983a4LU, 0x2457da42LU, 0xa3ab5817LU, 0x67e293e8LU, 0xe01e11bdLU, +0xe33e2169LU, 0x64c2a33cLU, 0xa08b68c3LU, 0x2777ea96LU, 0x6519b370LU, 0xe2e53125LU, 0x26acfadaLU, 0xa150788fLU, +0xfb73ec2aLU, 0x7c8f6e7fLU, 0xb8c6a580LU, 0x3f3a27d5LU, 0x7d547e33LU, 0xfaa8fc66LU, 0x3ee13799LU, 0xb91db5ccLU, +0xba3d8518LU, 0x3dc1074dLU, 0xf988ccb2LU, 0x7e744ee7LU, 0x3c1a1701LU, 0xbbe69554LU, 0x7faf5eabLU, 0xf853dcfeLU, +0x79ef3e4eLU, 0xfe13bc1bLU, 0x3a5a77e4LU, 0xbda6f5b1LU, 0xffc8ac57LU, 0x78342e02LU, 0xbc7de5fdLU, 0x3b8167a8LU, +0x38a1577cLU, 0xbf5dd529LU, 0x7b141ed6LU, 0xfce89c83LU, 0xbe86c565LU, 0x397a4730LU, 0xfd338ccfLU, 0x7acf0e9aLU, +0xb20605e2LU, 0x35fa87b7LU, 0xf1b34c48LU, 0x764fce1dLU, 0x342197fbLU, 0xb3dd15aeLU, 0x7794de51LU, 0xf0685c04LU, +0xf3486cd0LU, 0x74b4ee85LU, 0xb0fd257aLU, 0x3701a72fLU, 0x756ffec9LU, 0xf2937c9cLU, 0x36dab763LU, 0xb1263536LU, +0x309ad786LU, 0xb76655d3LU, 0x732f9e2cLU, 0xf4d31c79LU, 0xb6bd459fLU, 0x3141c7caLU, 0xf5080c35LU, 0x72f48e60LU, +0x71d4beb4LU, 0xf6283ce1LU, 0x3261f71eLU, 0xb59d754bLU, 0xf7f32cadLU, 0x700faef8LU, 0xb4466507LU, 0x33bae752LU }; + +static const ulong32 rs_tab3[256] = { +0x00000000LU, 0x5ac1f387LU, 0xb4cfab43LU, 0xee0e58c4LU, 0x25d31b86LU, 0x7f12e801LU, 0x911cb0c5LU, 0xcbdd4342LU, +0x4aeb3641LU, 0x102ac5c6LU, 0xfe249d02LU, 0xa4e56e85LU, 0x6f382dc7LU, 0x35f9de40LU, 0xdbf78684LU, 0x81367503LU, +0x949b6c82LU, 0xce5a9f05LU, 0x2054c7c1LU, 0x7a953446LU, 0xb1487704LU, 0xeb898483LU, 0x0587dc47LU, 0x5f462fc0LU, +0xde705ac3LU, 0x84b1a944LU, 0x6abff180LU, 0x307e0207LU, 0xfba34145LU, 0xa162b2c2LU, 0x4f6cea06LU, 0x15ad1981LU, +0x657bd849LU, 0x3fba2bceLU, 0xd1b4730aLU, 0x8b75808dLU, 0x40a8c3cfLU, 0x1a693048LU, 0xf467688cLU, 0xaea69b0bLU, +0x2f90ee08LU, 0x75511d8fLU, 0x9b5f454bLU, 0xc19eb6ccLU, 0x0a43f58eLU, 0x50820609LU, 0xbe8c5ecdLU, 0xe44dad4aLU, +0xf1e0b4cbLU, 0xab21474cLU, 0x452f1f88LU, 0x1feeec0fLU, 0xd433af4dLU, 0x8ef25ccaLU, 0x60fc040eLU, 0x3a3df789LU, +0xbb0b828aLU, 0xe1ca710dLU, 0x0fc429c9LU, 0x5505da4eLU, 0x9ed8990cLU, 0xc4196a8bLU, 0x2a17324fLU, 0x70d6c1c8LU, +0xcaf6fd92LU, 0x90370e15LU, 0x7e3956d1LU, 0x24f8a556LU, 0xef25e614LU, 0xb5e41593LU, 0x5bea4d57LU, 0x012bbed0LU, +0x801dcbd3LU, 0xdadc3854LU, 0x34d26090LU, 0x6e139317LU, 0xa5ced055LU, 0xff0f23d2LU, 0x11017b16LU, 0x4bc08891LU, +0x5e6d9110LU, 0x04ac6297LU, 0xeaa23a53LU, 0xb063c9d4LU, 0x7bbe8a96LU, 0x217f7911LU, 0xcf7121d5LU, 0x95b0d252LU, +0x1486a751LU, 0x4e4754d6LU, 0xa0490c12LU, 0xfa88ff95LU, 0x3155bcd7LU, 0x6b944f50LU, 0x859a1794LU, 0xdf5be413LU, +0xaf8d25dbLU, 0xf54cd65cLU, 0x1b428e98LU, 0x41837d1fLU, 0x8a5e3e5dLU, 0xd09fcddaLU, 0x3e91951eLU, 0x64506699LU, +0xe566139aLU, 0xbfa7e01dLU, 0x51a9b8d9LU, 0x0b684b5eLU, 0xc0b5081cLU, 0x9a74fb9bLU, 0x747aa35fLU, 0x2ebb50d8LU, +0x3b164959LU, 0x61d7badeLU, 0x8fd9e21aLU, 0xd518119dLU, 0x1ec552dfLU, 0x4404a158LU, 0xaa0af99cLU, 0xf0cb0a1bLU, +0x71fd7f18LU, 0x2b3c8c9fLU, 0xc532d45bLU, 0x9ff327dcLU, 0x542e649eLU, 0x0eef9719LU, 0xe0e1cfddLU, 0xba203c5aLU, +0xd9a1b769LU, 0x836044eeLU, 0x6d6e1c2aLU, 0x37afefadLU, 0xfc72acefLU, 0xa6b35f68LU, 0x48bd07acLU, 0x127cf42bLU, +0x934a8128LU, 0xc98b72afLU, 0x27852a6bLU, 0x7d44d9ecLU, 0xb6999aaeLU, 0xec586929LU, 0x025631edLU, 0x5897c26aLU, +0x4d3adbebLU, 0x17fb286cLU, 0xf9f570a8LU, 0xa334832fLU, 0x68e9c06dLU, 0x322833eaLU, 0xdc266b2eLU, 0x86e798a9LU, +0x07d1edaaLU, 0x5d101e2dLU, 0xb31e46e9LU, 0xe9dfb56eLU, 0x2202f62cLU, 0x78c305abLU, 0x96cd5d6fLU, 0xcc0caee8LU, +0xbcda6f20LU, 0xe61b9ca7LU, 0x0815c463LU, 0x52d437e4LU, 0x990974a6LU, 0xc3c88721LU, 0x2dc6dfe5LU, 0x77072c62LU, +0xf6315961LU, 0xacf0aae6LU, 0x42fef222LU, 0x183f01a5LU, 0xd3e242e7LU, 0x8923b160LU, 0x672de9a4LU, 0x3dec1a23LU, +0x284103a2LU, 0x7280f025LU, 0x9c8ea8e1LU, 0xc64f5b66LU, 0x0d921824LU, 0x5753eba3LU, 0xb95db367LU, 0xe39c40e0LU, +0x62aa35e3LU, 0x386bc664LU, 0xd6659ea0LU, 0x8ca46d27LU, 0x47792e65LU, 0x1db8dde2LU, 0xf3b68526LU, 0xa97776a1LU, +0x13574afbLU, 0x4996b97cLU, 0xa798e1b8LU, 0xfd59123fLU, 0x3684517dLU, 0x6c45a2faLU, 0x824bfa3eLU, 0xd88a09b9LU, +0x59bc7cbaLU, 0x037d8f3dLU, 0xed73d7f9LU, 0xb7b2247eLU, 0x7c6f673cLU, 0x26ae94bbLU, 0xc8a0cc7fLU, 0x92613ff8LU, +0x87cc2679LU, 0xdd0dd5feLU, 0x33038d3aLU, 0x69c27ebdLU, 0xa21f3dffLU, 0xf8dece78LU, 0x16d096bcLU, 0x4c11653bLU, +0xcd271038LU, 0x97e6e3bfLU, 0x79e8bb7bLU, 0x232948fcLU, 0xe8f40bbeLU, 0xb235f839LU, 0x5c3ba0fdLU, 0x06fa537aLU, +0x762c92b2LU, 0x2ced6135LU, 0xc2e339f1LU, 0x9822ca76LU, 0x53ff8934LU, 0x093e7ab3LU, 0xe7302277LU, 0xbdf1d1f0LU, +0x3cc7a4f3LU, 0x66065774LU, 0x88080fb0LU, 0xd2c9fc37LU, 0x1914bf75LU, 0x43d54cf2LU, 0xaddb1436LU, 0xf71ae7b1LU, +0xe2b7fe30LU, 0xb8760db7LU, 0x56785573LU, 0x0cb9a6f4LU, 0xc764e5b6LU, 0x9da51631LU, 0x73ab4ef5LU, 0x296abd72LU, +0xa85cc871LU, 0xf29d3bf6LU, 0x1c936332LU, 0x465290b5LU, 0x8d8fd3f7LU, 0xd74e2070LU, 0x394078b4LU, 0x63818b33LU }; + +static const ulong32 rs_tab4[256] = { +0x00000000LU, 0x58471e5aLU, 0xb08e3cb4LU, 0xe8c922eeLU, 0x2d517825LU, 0x7516667fLU, 0x9ddf4491LU, 0xc5985acbLU, +0x5aa2f04aLU, 0x02e5ee10LU, 0xea2cccfeLU, 0xb26bd2a4LU, 0x77f3886fLU, 0x2fb49635LU, 0xc77db4dbLU, 0x9f3aaa81LU, +0xb409ad94LU, 0xec4eb3ceLU, 0x04879120LU, 0x5cc08f7aLU, 0x9958d5b1LU, 0xc11fcbebLU, 0x29d6e905LU, 0x7191f75fLU, +0xeeab5ddeLU, 0xb6ec4384LU, 0x5e25616aLU, 0x06627f30LU, 0xc3fa25fbLU, 0x9bbd3ba1LU, 0x7374194fLU, 0x2b330715LU, +0x25121765LU, 0x7d55093fLU, 0x959c2bd1LU, 0xcddb358bLU, 0x08436f40LU, 0x5004711aLU, 0xb8cd53f4LU, 0xe08a4daeLU, +0x7fb0e72fLU, 0x27f7f975LU, 0xcf3edb9bLU, 0x9779c5c1LU, 0x52e19f0aLU, 0x0aa68150LU, 0xe26fa3beLU, 0xba28bde4LU, +0x911bbaf1LU, 0xc95ca4abLU, 0x21958645LU, 0x79d2981fLU, 0xbc4ac2d4LU, 0xe40ddc8eLU, 0x0cc4fe60LU, 0x5483e03aLU, +0xcbb94abbLU, 0x93fe54e1LU, 0x7b37760fLU, 0x23706855LU, 0xe6e8329eLU, 0xbeaf2cc4LU, 0x56660e2aLU, 0x0e211070LU, +0x4a242ecaLU, 0x12633090LU, 0xfaaa127eLU, 0xa2ed0c24LU, 0x677556efLU, 0x3f3248b5LU, 0xd7fb6a5bLU, 0x8fbc7401LU, +0x1086de80LU, 0x48c1c0daLU, 0xa008e234LU, 0xf84ffc6eLU, 0x3dd7a6a5LU, 0x6590b8ffLU, 0x8d599a11LU, 0xd51e844bLU, +0xfe2d835eLU, 0xa66a9d04LU, 0x4ea3bfeaLU, 0x16e4a1b0LU, 0xd37cfb7bLU, 0x8b3be521LU, 0x63f2c7cfLU, 0x3bb5d995LU, +0xa48f7314LU, 0xfcc86d4eLU, 0x14014fa0LU, 0x4c4651faLU, 0x89de0b31LU, 0xd199156bLU, 0x39503785LU, 0x611729dfLU, +0x6f3639afLU, 0x377127f5LU, 0xdfb8051bLU, 0x87ff1b41LU, 0x4267418aLU, 0x1a205fd0LU, 0xf2e97d3eLU, 0xaaae6364LU, +0x3594c9e5LU, 0x6dd3d7bfLU, 0x851af551LU, 0xdd5deb0bLU, 0x18c5b1c0LU, 0x4082af9aLU, 0xa84b8d74LU, 0xf00c932eLU, +0xdb3f943bLU, 0x83788a61LU, 0x6bb1a88fLU, 0x33f6b6d5LU, 0xf66eec1eLU, 0xae29f244LU, 0x46e0d0aaLU, 0x1ea7cef0LU, +0x819d6471LU, 0xd9da7a2bLU, 0x311358c5LU, 0x6954469fLU, 0xaccc1c54LU, 0xf48b020eLU, 0x1c4220e0LU, 0x44053ebaLU, +0x94485cd9LU, 0xcc0f4283LU, 0x24c6606dLU, 0x7c817e37LU, 0xb91924fcLU, 0xe15e3aa6LU, 0x09971848LU, 0x51d00612LU, +0xceeaac93LU, 0x96adb2c9LU, 0x7e649027LU, 0x26238e7dLU, 0xe3bbd4b6LU, 0xbbfccaecLU, 0x5335e802LU, 0x0b72f658LU, +0x2041f14dLU, 0x7806ef17LU, 0x90cfcdf9LU, 0xc888d3a3LU, 0x0d108968LU, 0x55579732LU, 0xbd9eb5dcLU, 0xe5d9ab86LU, +0x7ae30107LU, 0x22a41f5dLU, 0xca6d3db3LU, 0x922a23e9LU, 0x57b27922LU, 0x0ff56778LU, 0xe73c4596LU, 0xbf7b5bccLU, +0xb15a4bbcLU, 0xe91d55e6LU, 0x01d47708LU, 0x59936952LU, 0x9c0b3399LU, 0xc44c2dc3LU, 0x2c850f2dLU, 0x74c21177LU, +0xebf8bbf6LU, 0xb3bfa5acLU, 0x5b768742LU, 0x03319918LU, 0xc6a9c3d3LU, 0x9eeedd89LU, 0x7627ff67LU, 0x2e60e13dLU, +0x0553e628LU, 0x5d14f872LU, 0xb5ddda9cLU, 0xed9ac4c6LU, 0x28029e0dLU, 0x70458057LU, 0x988ca2b9LU, 0xc0cbbce3LU, +0x5ff11662LU, 0x07b60838LU, 0xef7f2ad6LU, 0xb738348cLU, 0x72a06e47LU, 0x2ae7701dLU, 0xc22e52f3LU, 0x9a694ca9LU, +0xde6c7213LU, 0x862b6c49LU, 0x6ee24ea7LU, 0x36a550fdLU, 0xf33d0a36LU, 0xab7a146cLU, 0x43b33682LU, 0x1bf428d8LU, +0x84ce8259LU, 0xdc899c03LU, 0x3440beedLU, 0x6c07a0b7LU, 0xa99ffa7cLU, 0xf1d8e426LU, 0x1911c6c8LU, 0x4156d892LU, +0x6a65df87LU, 0x3222c1ddLU, 0xdaebe333LU, 0x82acfd69LU, 0x4734a7a2LU, 0x1f73b9f8LU, 0xf7ba9b16LU, 0xaffd854cLU, +0x30c72fcdLU, 0x68803197LU, 0x80491379LU, 0xd80e0d23LU, 0x1d9657e8LU, 0x45d149b2LU, 0xad186b5cLU, 0xf55f7506LU, +0xfb7e6576LU, 0xa3397b2cLU, 0x4bf059c2LU, 0x13b74798LU, 0xd62f1d53LU, 0x8e680309LU, 0x66a121e7LU, 0x3ee63fbdLU, +0xa1dc953cLU, 0xf99b8b66LU, 0x1152a988LU, 0x4915b7d2LU, 0x8c8ded19LU, 0xd4caf343LU, 0x3c03d1adLU, 0x6444cff7LU, +0x4f77c8e2LU, 0x1730d6b8LU, 0xfff9f456LU, 0xa7beea0cLU, 0x6226b0c7LU, 0x3a61ae9dLU, 0xd2a88c73LU, 0x8aef9229LU, +0x15d538a8LU, 0x4d9226f2LU, 0xa55b041cLU, 0xfd1c1a46LU, 0x3884408dLU, 0x60c35ed7LU, 0x880a7c39LU, 0xd04d6263LU }; + +static const ulong32 rs_tab5[256] = { +0x00000000LU, 0xdbaec658LU, 0xfb11c1b0LU, 0x20bf07e8LU, 0xbb22cf2dLU, 0x608c0975LU, 0x40330e9dLU, 0x9b9dc8c5LU, +0x3b44d35aLU, 0xe0ea1502LU, 0xc05512eaLU, 0x1bfbd4b2LU, 0x80661c77LU, 0x5bc8da2fLU, 0x7b77ddc7LU, 0xa0d91b9fLU, +0x7688ebb4LU, 0xad262decLU, 0x8d992a04LU, 0x5637ec5cLU, 0xcdaa2499LU, 0x1604e2c1LU, 0x36bbe529LU, 0xed152371LU, +0x4dcc38eeLU, 0x9662feb6LU, 0xb6ddf95eLU, 0x6d733f06LU, 0xf6eef7c3LU, 0x2d40319bLU, 0x0dff3673LU, 0xd651f02bLU, +0xec5d9b25LU, 0x37f35d7dLU, 0x174c5a95LU, 0xcce29ccdLU, 0x577f5408LU, 0x8cd19250LU, 0xac6e95b8LU, 0x77c053e0LU, +0xd719487fLU, 0x0cb78e27LU, 0x2c0889cfLU, 0xf7a64f97LU, 0x6c3b8752LU, 0xb795410aLU, 0x972a46e2LU, 0x4c8480baLU, +0x9ad57091LU, 0x417bb6c9LU, 0x61c4b121LU, 0xba6a7779LU, 0x21f7bfbcLU, 0xfa5979e4LU, 0xdae67e0cLU, 0x0148b854LU, +0xa191a3cbLU, 0x7a3f6593LU, 0x5a80627bLU, 0x812ea423LU, 0x1ab36ce6LU, 0xc11daabeLU, 0xe1a2ad56LU, 0x3a0c6b0eLU, +0x95ba7b4aLU, 0x4e14bd12LU, 0x6eabbafaLU, 0xb5057ca2LU, 0x2e98b467LU, 0xf536723fLU, 0xd58975d7LU, 0x0e27b38fLU, +0xaefea810LU, 0x75506e48LU, 0x55ef69a0LU, 0x8e41aff8LU, 0x15dc673dLU, 0xce72a165LU, 0xeecda68dLU, 0x356360d5LU, +0xe33290feLU, 0x389c56a6LU, 0x1823514eLU, 0xc38d9716LU, 0x58105fd3LU, 0x83be998bLU, 0xa3019e63LU, 0x78af583bLU, +0xd87643a4LU, 0x03d885fcLU, 0x23678214LU, 0xf8c9444cLU, 0x63548c89LU, 0xb8fa4ad1LU, 0x98454d39LU, 0x43eb8b61LU, +0x79e7e06fLU, 0xa2492637LU, 0x82f621dfLU, 0x5958e787LU, 0xc2c52f42LU, 0x196be91aLU, 0x39d4eef2LU, 0xe27a28aaLU, +0x42a33335LU, 0x990df56dLU, 0xb9b2f285LU, 0x621c34ddLU, 0xf981fc18LU, 0x222f3a40LU, 0x02903da8LU, 0xd93efbf0LU, +0x0f6f0bdbLU, 0xd4c1cd83LU, 0xf47eca6bLU, 0x2fd00c33LU, 0xb44dc4f6LU, 0x6fe302aeLU, 0x4f5c0546LU, 0x94f2c31eLU, +0x342bd881LU, 0xef851ed9LU, 0xcf3a1931LU, 0x1494df69LU, 0x8f0917acLU, 0x54a7d1f4LU, 0x7418d61cLU, 0xafb61044LU, +0x6739f694LU, 0xbc9730ccLU, 0x9c283724LU, 0x4786f17cLU, 0xdc1b39b9LU, 0x07b5ffe1LU, 0x270af809LU, 0xfca43e51LU, +0x5c7d25ceLU, 0x87d3e396LU, 0xa76ce47eLU, 0x7cc22226LU, 0xe75feae3LU, 0x3cf12cbbLU, 0x1c4e2b53LU, 0xc7e0ed0bLU, +0x11b11d20LU, 0xca1fdb78LU, 0xeaa0dc90LU, 0x310e1ac8LU, 0xaa93d20dLU, 0x713d1455LU, 0x518213bdLU, 0x8a2cd5e5LU, +0x2af5ce7aLU, 0xf15b0822LU, 0xd1e40fcaLU, 0x0a4ac992LU, 0x91d70157LU, 0x4a79c70fLU, 0x6ac6c0e7LU, 0xb16806bfLU, +0x8b646db1LU, 0x50caabe9LU, 0x7075ac01LU, 0xabdb6a59LU, 0x3046a29cLU, 0xebe864c4LU, 0xcb57632cLU, 0x10f9a574LU, +0xb020beebLU, 0x6b8e78b3LU, 0x4b317f5bLU, 0x909fb903LU, 0x0b0271c6LU, 0xd0acb79eLU, 0xf013b076LU, 0x2bbd762eLU, +0xfdec8605LU, 0x2642405dLU, 0x06fd47b5LU, 0xdd5381edLU, 0x46ce4928LU, 0x9d608f70LU, 0xbddf8898LU, 0x66714ec0LU, +0xc6a8555fLU, 0x1d069307LU, 0x3db994efLU, 0xe61752b7LU, 0x7d8a9a72LU, 0xa6245c2aLU, 0x869b5bc2LU, 0x5d359d9aLU, +0xf2838ddeLU, 0x292d4b86LU, 0x09924c6eLU, 0xd23c8a36LU, 0x49a142f3LU, 0x920f84abLU, 0xb2b08343LU, 0x691e451bLU, +0xc9c75e84LU, 0x126998dcLU, 0x32d69f34LU, 0xe978596cLU, 0x72e591a9LU, 0xa94b57f1LU, 0x89f45019LU, 0x525a9641LU, +0x840b666aLU, 0x5fa5a032LU, 0x7f1aa7daLU, 0xa4b46182LU, 0x3f29a947LU, 0xe4876f1fLU, 0xc43868f7LU, 0x1f96aeafLU, +0xbf4fb530LU, 0x64e17368LU, 0x445e7480LU, 0x9ff0b2d8LU, 0x046d7a1dLU, 0xdfc3bc45LU, 0xff7cbbadLU, 0x24d27df5LU, +0x1ede16fbLU, 0xc570d0a3LU, 0xe5cfd74bLU, 0x3e611113LU, 0xa5fcd9d6LU, 0x7e521f8eLU, 0x5eed1866LU, 0x8543de3eLU, +0x259ac5a1LU, 0xfe3403f9LU, 0xde8b0411LU, 0x0525c249LU, 0x9eb80a8cLU, 0x4516ccd4LU, 0x65a9cb3cLU, 0xbe070d64LU, +0x6856fd4fLU, 0xb3f83b17LU, 0x93473cffLU, 0x48e9faa7LU, 0xd3743262LU, 0x08daf43aLU, 0x2865f3d2LU, 0xf3cb358aLU, +0x53122e15LU, 0x88bce84dLU, 0xa803efa5LU, 0x73ad29fdLU, 0xe830e138LU, 0x339e2760LU, 0x13212088LU, 0xc88fe6d0LU }; + +static const ulong32 rs_tab6[256] = { +0x00000000LU, 0x9e3d68dbLU, 0x717ad0fbLU, 0xef47b820LU, 0xe2f4edbbLU, 0x7cc98560LU, 0x938e3d40LU, 0x0db3559bLU, +0x89a5973bLU, 0x1798ffe0LU, 0xf8df47c0LU, 0x66e22f1bLU, 0x6b517a80LU, 0xf56c125bLU, 0x1a2baa7bLU, 0x8416c2a0LU, +0x5f076376LU, 0xc13a0badLU, 0x2e7db38dLU, 0xb040db56LU, 0xbdf38ecdLU, 0x23cee616LU, 0xcc895e36LU, 0x52b436edLU, +0xd6a2f44dLU, 0x489f9c96LU, 0xa7d824b6LU, 0x39e54c6dLU, 0x345619f6LU, 0xaa6b712dLU, 0x452cc90dLU, 0xdb11a1d6LU, +0xbe0ec6ecLU, 0x2033ae37LU, 0xcf741617LU, 0x51497eccLU, 0x5cfa2b57LU, 0xc2c7438cLU, 0x2d80fbacLU, 0xb3bd9377LU, +0x37ab51d7LU, 0xa996390cLU, 0x46d1812cLU, 0xd8ece9f7LU, 0xd55fbc6cLU, 0x4b62d4b7LU, 0xa4256c97LU, 0x3a18044cLU, +0xe109a59aLU, 0x7f34cd41LU, 0x90737561LU, 0x0e4e1dbaLU, 0x03fd4821LU, 0x9dc020faLU, 0x728798daLU, 0xecbaf001LU, +0x68ac32a1LU, 0xf6915a7aLU, 0x19d6e25aLU, 0x87eb8a81LU, 0x8a58df1aLU, 0x1465b7c1LU, 0xfb220fe1LU, 0x651f673aLU, +0x311cc195LU, 0xaf21a94eLU, 0x4066116eLU, 0xde5b79b5LU, 0xd3e82c2eLU, 0x4dd544f5LU, 0xa292fcd5LU, 0x3caf940eLU, +0xb8b956aeLU, 0x26843e75LU, 0xc9c38655LU, 0x57feee8eLU, 0x5a4dbb15LU, 0xc470d3ceLU, 0x2b376beeLU, 0xb50a0335LU, +0x6e1ba2e3LU, 0xf026ca38LU, 0x1f617218LU, 0x815c1ac3LU, 0x8cef4f58LU, 0x12d22783LU, 0xfd959fa3LU, 0x63a8f778LU, +0xe7be35d8LU, 0x79835d03LU, 0x96c4e523LU, 0x08f98df8LU, 0x054ad863LU, 0x9b77b0b8LU, 0x74300898LU, 0xea0d6043LU, +0x8f120779LU, 0x112f6fa2LU, 0xfe68d782LU, 0x6055bf59LU, 0x6de6eac2LU, 0xf3db8219LU, 0x1c9c3a39LU, 0x82a152e2LU, +0x06b79042LU, 0x988af899LU, 0x77cd40b9LU, 0xe9f02862LU, 0xe4437df9LU, 0x7a7e1522LU, 0x9539ad02LU, 0x0b04c5d9LU, +0xd015640fLU, 0x4e280cd4LU, 0xa16fb4f4LU, 0x3f52dc2fLU, 0x32e189b4LU, 0xacdce16fLU, 0x439b594fLU, 0xdda63194LU, +0x59b0f334LU, 0xc78d9befLU, 0x28ca23cfLU, 0xb6f74b14LU, 0xbb441e8fLU, 0x25797654LU, 0xca3ece74LU, 0x5403a6afLU, +0x6238cf67LU, 0xfc05a7bcLU, 0x13421f9cLU, 0x8d7f7747LU, 0x80cc22dcLU, 0x1ef14a07LU, 0xf1b6f227LU, 0x6f8b9afcLU, +0xeb9d585cLU, 0x75a03087LU, 0x9ae788a7LU, 0x04dae07cLU, 0x0969b5e7LU, 0x9754dd3cLU, 0x7813651cLU, 0xe62e0dc7LU, +0x3d3fac11LU, 0xa302c4caLU, 0x4c457ceaLU, 0xd2781431LU, 0xdfcb41aaLU, 0x41f62971LU, 0xaeb19151LU, 0x308cf98aLU, +0xb49a3b2aLU, 0x2aa753f1LU, 0xc5e0ebd1LU, 0x5bdd830aLU, 0x566ed691LU, 0xc853be4aLU, 0x2714066aLU, 0xb9296eb1LU, +0xdc36098bLU, 0x420b6150LU, 0xad4cd970LU, 0x3371b1abLU, 0x3ec2e430LU, 0xa0ff8cebLU, 0x4fb834cbLU, 0xd1855c10LU, +0x55939eb0LU, 0xcbaef66bLU, 0x24e94e4bLU, 0xbad42690LU, 0xb767730bLU, 0x295a1bd0LU, 0xc61da3f0LU, 0x5820cb2bLU, +0x83316afdLU, 0x1d0c0226LU, 0xf24bba06LU, 0x6c76d2ddLU, 0x61c58746LU, 0xfff8ef9dLU, 0x10bf57bdLU, 0x8e823f66LU, +0x0a94fdc6LU, 0x94a9951dLU, 0x7bee2d3dLU, 0xe5d345e6LU, 0xe860107dLU, 0x765d78a6LU, 0x991ac086LU, 0x0727a85dLU, +0x53240ef2LU, 0xcd196629LU, 0x225ede09LU, 0xbc63b6d2LU, 0xb1d0e349LU, 0x2fed8b92LU, 0xc0aa33b2LU, 0x5e975b69LU, +0xda8199c9LU, 0x44bcf112LU, 0xabfb4932LU, 0x35c621e9LU, 0x38757472LU, 0xa6481ca9LU, 0x490fa489LU, 0xd732cc52LU, +0x0c236d84LU, 0x921e055fLU, 0x7d59bd7fLU, 0xe364d5a4LU, 0xeed7803fLU, 0x70eae8e4LU, 0x9fad50c4LU, 0x0190381fLU, +0x8586fabfLU, 0x1bbb9264LU, 0xf4fc2a44LU, 0x6ac1429fLU, 0x67721704LU, 0xf94f7fdfLU, 0x1608c7ffLU, 0x8835af24LU, +0xed2ac81eLU, 0x7317a0c5LU, 0x9c5018e5LU, 0x026d703eLU, 0x0fde25a5LU, 0x91e34d7eLU, 0x7ea4f55eLU, 0xe0999d85LU, +0x648f5f25LU, 0xfab237feLU, 0x15f58fdeLU, 0x8bc8e705LU, 0x867bb29eLU, 0x1846da45LU, 0xf7016265LU, 0x693c0abeLU, +0xb22dab68LU, 0x2c10c3b3LU, 0xc3577b93LU, 0x5d6a1348LU, 0x50d946d3LU, 0xcee42e08LU, 0x21a39628LU, 0xbf9efef3LU, +0x3b883c53LU, 0xa5b55488LU, 0x4af2eca8LU, 0xd4cf8473LU, 0xd97cd1e8LU, 0x4741b933LU, 0xa8060113LU, 0x363b69c8LU }; + +static const ulong32 rs_tab7[256] = { +0x00000000LU, 0x0319e59eLU, 0x06328771LU, 0x052b62efLU, 0x0c6443e2LU, 0x0f7da67cLU, 0x0a56c493LU, 0x094f210dLU, +0x18c88689LU, 0x1bd16317LU, 0x1efa01f8LU, 0x1de3e466LU, 0x14acc56bLU, 0x17b520f5LU, 0x129e421aLU, 0x1187a784LU, +0x30dd415fLU, 0x33c4a4c1LU, 0x36efc62eLU, 0x35f623b0LU, 0x3cb902bdLU, 0x3fa0e723LU, 0x3a8b85ccLU, 0x39926052LU, +0x2815c7d6LU, 0x2b0c2248LU, 0x2e2740a7LU, 0x2d3ea539LU, 0x24718434LU, 0x276861aaLU, 0x22430345LU, 0x215ae6dbLU, +0x60f782beLU, 0x63ee6720LU, 0x66c505cfLU, 0x65dce051LU, 0x6c93c15cLU, 0x6f8a24c2LU, 0x6aa1462dLU, 0x69b8a3b3LU, +0x783f0437LU, 0x7b26e1a9LU, 0x7e0d8346LU, 0x7d1466d8LU, 0x745b47d5LU, 0x7742a24bLU, 0x7269c0a4LU, 0x7170253aLU, +0x502ac3e1LU, 0x5333267fLU, 0x56184490LU, 0x5501a10eLU, 0x5c4e8003LU, 0x5f57659dLU, 0x5a7c0772LU, 0x5965e2ecLU, +0x48e24568LU, 0x4bfba0f6LU, 0x4ed0c219LU, 0x4dc92787LU, 0x4486068aLU, 0x479fe314LU, 0x42b481fbLU, 0x41ad6465LU, +0xc0a34931LU, 0xc3baacafLU, 0xc691ce40LU, 0xc5882bdeLU, 0xccc70ad3LU, 0xcfdeef4dLU, 0xcaf58da2LU, 0xc9ec683cLU, +0xd86bcfb8LU, 0xdb722a26LU, 0xde5948c9LU, 0xdd40ad57LU, 0xd40f8c5aLU, 0xd71669c4LU, 0xd23d0b2bLU, 0xd124eeb5LU, +0xf07e086eLU, 0xf367edf0LU, 0xf64c8f1fLU, 0xf5556a81LU, 0xfc1a4b8cLU, 0xff03ae12LU, 0xfa28ccfdLU, 0xf9312963LU, +0xe8b68ee7LU, 0xebaf6b79LU, 0xee840996LU, 0xed9dec08LU, 0xe4d2cd05LU, 0xe7cb289bLU, 0xe2e04a74LU, 0xe1f9afeaLU, +0xa054cb8fLU, 0xa34d2e11LU, 0xa6664cfeLU, 0xa57fa960LU, 0xac30886dLU, 0xaf296df3LU, 0xaa020f1cLU, 0xa91bea82LU, +0xb89c4d06LU, 0xbb85a898LU, 0xbeaeca77LU, 0xbdb72fe9LU, 0xb4f80ee4LU, 0xb7e1eb7aLU, 0xb2ca8995LU, 0xb1d36c0bLU, +0x90898ad0LU, 0x93906f4eLU, 0x96bb0da1LU, 0x95a2e83fLU, 0x9cedc932LU, 0x9ff42cacLU, 0x9adf4e43LU, 0x99c6abddLU, +0x88410c59LU, 0x8b58e9c7LU, 0x8e738b28LU, 0x8d6a6eb6LU, 0x84254fbbLU, 0x873caa25LU, 0x8217c8caLU, 0x810e2d54LU, +0xcd0b9262LU, 0xce1277fcLU, 0xcb391513LU, 0xc820f08dLU, 0xc16fd180LU, 0xc276341eLU, 0xc75d56f1LU, 0xc444b36fLU, +0xd5c314ebLU, 0xd6daf175LU, 0xd3f1939aLU, 0xd0e87604LU, 0xd9a75709LU, 0xdabeb297LU, 0xdf95d078LU, 0xdc8c35e6LU, +0xfdd6d33dLU, 0xfecf36a3LU, 0xfbe4544cLU, 0xf8fdb1d2LU, 0xf1b290dfLU, 0xf2ab7541LU, 0xf78017aeLU, 0xf499f230LU, +0xe51e55b4LU, 0xe607b02aLU, 0xe32cd2c5LU, 0xe035375bLU, 0xe97a1656LU, 0xea63f3c8LU, 0xef489127LU, 0xec5174b9LU, +0xadfc10dcLU, 0xaee5f542LU, 0xabce97adLU, 0xa8d77233LU, 0xa198533eLU, 0xa281b6a0LU, 0xa7aad44fLU, 0xa4b331d1LU, +0xb5349655LU, 0xb62d73cbLU, 0xb3061124LU, 0xb01ff4baLU, 0xb950d5b7LU, 0xba493029LU, 0xbf6252c6LU, 0xbc7bb758LU, +0x9d215183LU, 0x9e38b41dLU, 0x9b13d6f2LU, 0x980a336cLU, 0x91451261LU, 0x925cf7ffLU, 0x97779510LU, 0x946e708eLU, +0x85e9d70aLU, 0x86f03294LU, 0x83db507bLU, 0x80c2b5e5LU, 0x898d94e8LU, 0x8a947176LU, 0x8fbf1399LU, 0x8ca6f607LU, +0x0da8db53LU, 0x0eb13ecdLU, 0x0b9a5c22LU, 0x0883b9bcLU, 0x01cc98b1LU, 0x02d57d2fLU, 0x07fe1fc0LU, 0x04e7fa5eLU, +0x15605ddaLU, 0x1679b844LU, 0x1352daabLU, 0x104b3f35LU, 0x19041e38LU, 0x1a1dfba6LU, 0x1f369949LU, 0x1c2f7cd7LU, +0x3d759a0cLU, 0x3e6c7f92LU, 0x3b471d7dLU, 0x385ef8e3LU, 0x3111d9eeLU, 0x32083c70LU, 0x37235e9fLU, 0x343abb01LU, +0x25bd1c85LU, 0x26a4f91bLU, 0x238f9bf4LU, 0x20967e6aLU, 0x29d95f67LU, 0x2ac0baf9LU, 0x2febd816LU, 0x2cf23d88LU, +0x6d5f59edLU, 0x6e46bc73LU, 0x6b6dde9cLU, 0x68743b02LU, 0x613b1a0fLU, 0x6222ff91LU, 0x67099d7eLU, 0x641078e0LU, +0x7597df64LU, 0x768e3afaLU, 0x73a55815LU, 0x70bcbd8bLU, 0x79f39c86LU, 0x7aea7918LU, 0x7fc11bf7LU, 0x7cd8fe69LU, +0x5d8218b2LU, 0x5e9bfd2cLU, 0x5bb09fc3LU, 0x58a97a5dLU, 0x51e65b50LU, 0x52ffbeceLU, 0x57d4dc21LU, 0x54cd39bfLU, +0x454a9e3bLU, 0x46537ba5LU, 0x4378194aLU, 0x4061fcd4LU, 0x492eddd9LU, 0x4a373847LU, 0x4f1c5aa8LU, 0x4c05bf36LU }; + +#endif /* TWOFISH_ALL_TABLES */ + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/ciphers/twofish/twofish_tab.c,v $ */ +/* $Revision: 1.4 $ */ +/* $Date: 2006/03/31 14:15:35 $ */ diff --git a/libtomcrypt/src/ciphers/xtea.c b/libtomcrypt/src/ciphers/xtea.c new file mode 100644 index 0000000..ac73400 --- /dev/null +++ b/libtomcrypt/src/ciphers/xtea.c @@ -0,0 +1,211 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ + +/** + @file xtea.c + Implementation of XTEA, Tom St Denis +*/ +#include "tomcrypt.h" + +#ifdef XTEA + +const struct ltc_cipher_descriptor xtea_desc = +{ + "xtea", + 1, + 16, 16, 8, 32, + &xtea_setup, + &xtea_ecb_encrypt, + &xtea_ecb_decrypt, + &xtea_test, + &xtea_done, + &xtea_keysize, + NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL +}; + +int xtea_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey) +{ + unsigned long x, sum, K[4]; + + LTC_ARGCHK(key != NULL); + LTC_ARGCHK(skey != NULL); + + /* check arguments */ + if (keylen != 16) { + return CRYPT_INVALID_KEYSIZE; + } + + if (num_rounds != 0 && num_rounds != 32) { + return CRYPT_INVALID_ROUNDS; + } + + /* load key */ + LOAD32L(K[0], key+0); + LOAD32L(K[1], key+4); + LOAD32L(K[2], key+8); + LOAD32L(K[3], key+12); + + for (x = sum = 0; x < 32; x++) { + skey->xtea.A[x] = (sum + K[sum&3]) & 0xFFFFFFFFUL; + sum = (sum + 0x9E3779B9UL) & 0xFFFFFFFFUL; + skey->xtea.B[x] = (sum + K[(sum>>11)&3]) & 0xFFFFFFFFUL; + } + +#ifdef LTC_CLEAN_STACK + zeromem(&K, sizeof(K)); +#endif + + return CRYPT_OK; +} + +/** + Encrypts a block of text with XTEA + @param pt The input plaintext (8 bytes) + @param ct The output ciphertext (8 bytes) + @param skey The key as scheduled + @return CRYPT_OK if successful +*/ +int xtea_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key *skey) +{ + unsigned long y, z; + int r; + + LTC_ARGCHK(pt != NULL); + LTC_ARGCHK(ct != NULL); + LTC_ARGCHK(skey != NULL); + + LOAD32L(y, &pt[0]); + LOAD32L(z, &pt[4]); + for (r = 0; r < 32; r += 4) { + y = (y + ((((z<<4)^(z>>5)) + z) ^ skey->xtea.A[r])) & 0xFFFFFFFFUL; + z = (z + ((((y<<4)^(y>>5)) + y) ^ skey->xtea.B[r])) & 0xFFFFFFFFUL; + + y = (y + ((((z<<4)^(z>>5)) + z) ^ skey->xtea.A[r+1])) & 0xFFFFFFFFUL; + z = (z + ((((y<<4)^(y>>5)) + y) ^ skey->xtea.B[r+1])) & 0xFFFFFFFFUL; + + y = (y + ((((z<<4)^(z>>5)) + z) ^ skey->xtea.A[r+2])) & 0xFFFFFFFFUL; + z = (z + ((((y<<4)^(y>>5)) + y) ^ skey->xtea.B[r+2])) & 0xFFFFFFFFUL; + + y = (y + ((((z<<4)^(z>>5)) + z) ^ skey->xtea.A[r+3])) & 0xFFFFFFFFUL; + z = (z + ((((y<<4)^(y>>5)) + y) ^ skey->xtea.B[r+3])) & 0xFFFFFFFFUL; + } + STORE32L(y, &ct[0]); + STORE32L(z, &ct[4]); + return CRYPT_OK; +} + +/** + Decrypts a block of text with XTEA + @param ct The input ciphertext (8 bytes) + @param pt The output plaintext (8 bytes) + @param skey The key as scheduled + @return CRYPT_OK if successful +*/ +int xtea_ecb_decrypt(const unsigned char *ct, unsigned char *pt, symmetric_key *skey) +{ + unsigned long y, z; + int r; + + LTC_ARGCHK(pt != NULL); + LTC_ARGCHK(ct != NULL); + LTC_ARGCHK(skey != NULL); + + LOAD32L(y, &ct[0]); + LOAD32L(z, &ct[4]); + for (r = 31; r >= 0; r -= 4) { + z = (z - ((((y<<4)^(y>>5)) + y) ^ skey->xtea.B[r])) & 0xFFFFFFFFUL; + y = (y - ((((z<<4)^(z>>5)) + z) ^ skey->xtea.A[r])) & 0xFFFFFFFFUL; + + z = (z - ((((y<<4)^(y>>5)) + y) ^ skey->xtea.B[r-1])) & 0xFFFFFFFFUL; + y = (y - ((((z<<4)^(z>>5)) + z) ^ skey->xtea.A[r-1])) & 0xFFFFFFFFUL; + + z = (z - ((((y<<4)^(y>>5)) + y) ^ skey->xtea.B[r-2])) & 0xFFFFFFFFUL; + y = (y - ((((z<<4)^(z>>5)) + z) ^ skey->xtea.A[r-2])) & 0xFFFFFFFFUL; + + z = (z - ((((y<<4)^(y>>5)) + y) ^ skey->xtea.B[r-3])) & 0xFFFFFFFFUL; + y = (y - ((((z<<4)^(z>>5)) + z) ^ skey->xtea.A[r-3])) & 0xFFFFFFFFUL; + } + STORE32L(y, &pt[0]); + STORE32L(z, &pt[4]); + return CRYPT_OK; +} + +/** + Performs a self-test of the XTEA block cipher + @return CRYPT_OK if functional, CRYPT_NOP if self-test has been disabled +*/ +int xtea_test(void) +{ + #ifndef LTC_TEST + return CRYPT_NOP; + #else + static const unsigned char key[16] = + { 0x78, 0x56, 0x34, 0x12, 0xf0, 0xcd, 0xcb, 0x9a, + 0x48, 0x37, 0x26, 0x15, 0xc0, 0xbf, 0xae, 0x9d }; + static const unsigned char pt[8] = + { 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07, 0x08 }; + static const unsigned char ct[8] = + { 0x75, 0xd7, 0xc5, 0xbf, 0xcf, 0x58, 0xc9, 0x3f }; + unsigned char tmp[2][8]; + symmetric_key skey; + int err, y; + + if ((err = xtea_setup(key, 16, 0, &skey)) != CRYPT_OK) { + return err; + } + xtea_ecb_encrypt(pt, tmp[0], &skey); + xtea_ecb_decrypt(tmp[0], tmp[1], &skey); + + if (XMEMCMP(tmp[0], ct, 8) != 0 || XMEMCMP(tmp[1], pt, 8) != 0) { + return CRYPT_FAIL_TESTVECTOR; + } + + /* now see if we can encrypt all zero bytes 1000 times, decrypt and come back where we started */ + for (y = 0; y < 8; y++) tmp[0][y] = 0; + for (y = 0; y < 1000; y++) xtea_ecb_encrypt(tmp[0], tmp[0], &skey); + for (y = 0; y < 1000; y++) xtea_ecb_decrypt(tmp[0], tmp[0], &skey); + for (y = 0; y < 8; y++) if (tmp[0][y] != 0) return CRYPT_FAIL_TESTVECTOR; + + return CRYPT_OK; + #endif +} + +/** Terminate the context + @param skey The scheduled key +*/ +void xtea_done(symmetric_key *skey) +{ +} + +/** + Gets suitable key size + @param keysize [in/out] The length of the recommended key (in bytes). This function will store the suitable size back in this variable. + @return CRYPT_OK if the input key size is acceptable. +*/ +int xtea_keysize(int *keysize) +{ + LTC_ARGCHK(keysize != NULL); + if (*keysize < 16) { + return CRYPT_INVALID_KEYSIZE; + } + *keysize = 16; + return CRYPT_OK; +} + + +#endif + + + + +/* $Source: /cvs/libtom/libtomcrypt/src/ciphers/xtea.c,v $ */ +/* $Revision: 1.12 $ */ +/* $Date: 2006/11/08 23:01:06 $ */ diff --git a/libtomcrypt/src/encauth/ccm/ccm_memory.c b/libtomcrypt/src/encauth/ccm/ccm_memory.c new file mode 100644 index 0000000..c5eee18 --- /dev/null +++ b/libtomcrypt/src/encauth/ccm/ccm_memory.c @@ -0,0 +1,351 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file ccm_memory.c + CCM support, process a block of memory, Tom St Denis +*/ + +#ifdef CCM_MODE + +/** + CCM encrypt/decrypt and produce an authentication tag + @param cipher The index of the cipher desired + @param key The secret key to use + @param keylen The length of the secret key (octets) + @param uskey A previously scheduled key [optional can be NULL] + @param nonce The session nonce [use once] + @param noncelen The length of the nonce + @param header The header for the session + @param headerlen The length of the header (octets) + @param pt [out] The plaintext + @param ptlen The length of the plaintext (octets) + @param ct [out] The ciphertext + @param tag [out] The destination tag + @param taglen [in/out] The max size and resulting size of the authentication tag + @param direction Encrypt or Decrypt direction (0 or 1) + @return CRYPT_OK if successful +*/ +int ccm_memory(int cipher, + const unsigned char *key, unsigned long keylen, + symmetric_key *uskey, + const unsigned char *nonce, unsigned long noncelen, + const unsigned char *header, unsigned long headerlen, + unsigned char *pt, unsigned long ptlen, + unsigned char *ct, + unsigned char *tag, unsigned long *taglen, + int direction) +{ + unsigned char PAD[16], ctr[16], CTRPAD[16], b; + symmetric_key *skey; + int err; + unsigned long len, L, x, y, z, CTRlen; + + if (uskey == NULL) { + LTC_ARGCHK(key != NULL); + } + LTC_ARGCHK(nonce != NULL); + if (headerlen > 0) { + LTC_ARGCHK(header != NULL); + } + LTC_ARGCHK(pt != NULL); + LTC_ARGCHK(ct != NULL); + LTC_ARGCHK(tag != NULL); + LTC_ARGCHK(taglen != NULL); + +#ifdef LTC_FAST + if (16 % sizeof(LTC_FAST_TYPE)) { + return CRYPT_INVALID_ARG; + } +#endif + + /* check cipher input */ + if ((err = cipher_is_valid(cipher)) != CRYPT_OK) { + return err; + } + if (cipher_descriptor[cipher].block_length != 16) { + return CRYPT_INVALID_CIPHER; + } + + /* make sure the taglen is even and <= 16 */ + *taglen &= ~1; + if (*taglen > 16) { + *taglen = 16; + } + + /* can't use < 4 */ + if (*taglen < 4) { + return CRYPT_INVALID_ARG; + } + + /* is there an accelerator? */ + if (cipher_descriptor[cipher].accel_ccm_memory != NULL) { + return cipher_descriptor[cipher].accel_ccm_memory( + key, keylen, + uskey, + nonce, noncelen, + header, headerlen, + pt, ptlen, + ct, + tag, taglen, + direction); + } + + /* let's get the L value */ + len = ptlen; + L = 0; + while (len) { + ++L; + len >>= 8; + } + if (L <= 1) { + L = 2; + } + + /* increase L to match the nonce len */ + noncelen = (noncelen > 13) ? 13 : noncelen; + if ((15 - noncelen) > L) { + L = 15 - noncelen; + } + + /* decrease noncelen to match L */ + if ((noncelen + L) > 15) { + noncelen = 15 - L; + } + + /* allocate mem for the symmetric key */ + if (uskey == NULL) { + skey = XMALLOC(sizeof(*skey)); + if (skey == NULL) { + return CRYPT_MEM; + } + + /* initialize the cipher */ + if ((err = cipher_descriptor[cipher].setup(key, keylen, 0, skey)) != CRYPT_OK) { + XFREE(skey); + return err; + } + } else { + skey = uskey; + } + + /* form B_0 == flags | Nonce N | l(m) */ + x = 0; + PAD[x++] = (unsigned char)(((headerlen > 0) ? (1<<6) : 0) | + (((*taglen - 2)>>1)<<3) | + (L-1)); + + /* nonce */ + for (y = 0; y < (16 - (L + 1)); y++) { + PAD[x++] = nonce[y]; + } + + /* store len */ + len = ptlen; + + /* shift len so the upper bytes of len are the contents of the length */ + for (y = L; y < 4; y++) { + len <<= 8; + } + + /* store l(m) (only store 32-bits) */ + for (y = 0; L > 4 && (L-y)>4; y++) { + PAD[x++] = 0; + } + for (; y < L; y++) { + PAD[x++] = (unsigned char)((len >> 24) & 255); + len <<= 8; + } + + /* encrypt PAD */ + if ((err = cipher_descriptor[cipher].ecb_encrypt(PAD, PAD, skey)) != CRYPT_OK) { + goto error; + } + + /* handle header */ + if (headerlen > 0) { + x = 0; + + /* store length */ + if (headerlen < ((1UL<<16) - (1UL<<8))) { + PAD[x++] ^= (headerlen>>8) & 255; + PAD[x++] ^= headerlen & 255; + } else { + PAD[x++] ^= 0xFF; + PAD[x++] ^= 0xFE; + PAD[x++] ^= (headerlen>>24) & 255; + PAD[x++] ^= (headerlen>>16) & 255; + PAD[x++] ^= (headerlen>>8) & 255; + PAD[x++] ^= headerlen & 255; + } + + /* now add the data */ + for (y = 0; y < headerlen; y++) { + if (x == 16) { + /* full block so let's encrypt it */ + if ((err = cipher_descriptor[cipher].ecb_encrypt(PAD, PAD, skey)) != CRYPT_OK) { + goto error; + } + x = 0; + } + PAD[x++] ^= header[y]; + } + + /* remainder? */ + if (x != 0) { + if ((err = cipher_descriptor[cipher].ecb_encrypt(PAD, PAD, skey)) != CRYPT_OK) { + goto error; + } + } + } + + /* setup the ctr counter */ + x = 0; + + /* flags */ + ctr[x++] = (unsigned char)L-1; + + /* nonce */ + for (y = 0; y < (16 - (L+1)); ++y) { + ctr[x++] = nonce[y]; + } + /* offset */ + while (x < 16) { + ctr[x++] = 0; + } + + x = 0; + CTRlen = 16; + + /* now handle the PT */ + if (ptlen > 0) { + y = 0; +#ifdef LTC_FAST + if (ptlen & ~15) { + if (direction == CCM_ENCRYPT) { + for (; y < (ptlen & ~15); y += 16) { + /* increment the ctr? */ + for (z = 15; z > 15-L; z--) { + ctr[z] = (ctr[z] + 1) & 255; + if (ctr[z]) break; + } + if ((err = cipher_descriptor[cipher].ecb_encrypt(ctr, CTRPAD, skey)) != CRYPT_OK) { + goto error; + } + + /* xor the PT against the pad first */ + for (z = 0; z < 16; z += sizeof(LTC_FAST_TYPE)) { + *((LTC_FAST_TYPE*)(&PAD[z])) ^= *((LTC_FAST_TYPE*)(&pt[y+z])); + *((LTC_FAST_TYPE*)(&ct[y+z])) = *((LTC_FAST_TYPE*)(&pt[y+z])) ^ *((LTC_FAST_TYPE*)(&CTRPAD[z])); + } + if ((err = cipher_descriptor[cipher].ecb_encrypt(PAD, PAD, skey)) != CRYPT_OK) { + goto error; + } + } + } else { + for (; y < (ptlen & ~15); y += 16) { + /* increment the ctr? */ + for (z = 15; z > 15-L; z--) { + ctr[z] = (ctr[z] + 1) & 255; + if (ctr[z]) break; + } + if ((err = cipher_descriptor[cipher].ecb_encrypt(ctr, CTRPAD, skey)) != CRYPT_OK) { + goto error; + } + + /* xor the PT against the pad last */ + for (z = 0; z < 16; z += sizeof(LTC_FAST_TYPE)) { + *((LTC_FAST_TYPE*)(&pt[y+z])) = *((LTC_FAST_TYPE*)(&ct[y+z])) ^ *((LTC_FAST_TYPE*)(&CTRPAD[z])); + *((LTC_FAST_TYPE*)(&PAD[z])) ^= *((LTC_FAST_TYPE*)(&pt[y+z])); + } + if ((err = cipher_descriptor[cipher].ecb_encrypt(PAD, PAD, skey)) != CRYPT_OK) { + goto error; + } + } + } + } +#endif + + for (; y < ptlen; y++) { + /* increment the ctr? */ + if (CTRlen == 16) { + for (z = 15; z > 15-L; z--) { + ctr[z] = (ctr[z] + 1) & 255; + if (ctr[z]) break; + } + if ((err = cipher_descriptor[cipher].ecb_encrypt(ctr, CTRPAD, skey)) != CRYPT_OK) { + goto error; + } + CTRlen = 0; + } + + /* if we encrypt we add the bytes to the MAC first */ + if (direction == CCM_ENCRYPT) { + b = pt[y]; + ct[y] = b ^ CTRPAD[CTRlen++]; + } else { + b = ct[y] ^ CTRPAD[CTRlen++]; + pt[y] = b; + } + + if (x == 16) { + if ((err = cipher_descriptor[cipher].ecb_encrypt(PAD, PAD, skey)) != CRYPT_OK) { + goto error; + } + x = 0; + } + PAD[x++] ^= b; + } + + if (x != 0) { + if ((err = cipher_descriptor[cipher].ecb_encrypt(PAD, PAD, skey)) != CRYPT_OK) { + goto error; + } + } + } + + /* setup CTR for the TAG (zero the count) */ + for (y = 15; y > 15 - L; y--) { + ctr[y] = 0x00; + } + if ((err = cipher_descriptor[cipher].ecb_encrypt(ctr, CTRPAD, skey)) != CRYPT_OK) { + goto error; + } + + if (skey != uskey) { + cipher_descriptor[cipher].done(skey); + } + + /* store the TAG */ + for (x = 0; x < 16 && x < *taglen; x++) { + tag[x] = PAD[x] ^ CTRPAD[x]; + } + *taglen = x; + +#ifdef LTC_CLEAN_STACK + zeromem(skey, sizeof(*skey)); + zeromem(PAD, sizeof(PAD)); + zeromem(CTRPAD, sizeof(CTRPAD)); +#endif +error: + if (skey != uskey) { + XFREE(skey); + } + + return err; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/encauth/ccm/ccm_memory.c,v $ */ +/* $Revision: 1.18 $ */ +/* $Date: 2006/12/04 21:34:03 $ */ diff --git a/libtomcrypt/src/encauth/ccm/ccm_test.c b/libtomcrypt/src/encauth/ccm/ccm_test.c new file mode 100644 index 0000000..3a45bfb --- /dev/null +++ b/libtomcrypt/src/encauth/ccm/ccm_test.c @@ -0,0 +1,180 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file ccm_test.c + CCM support, process a block of memory, Tom St Denis +*/ + +#ifdef CCM_MODE + +int ccm_test(void) +{ +#ifndef LTC_TEST + return CRYPT_NOP; +#else + static const struct { + unsigned char key[16]; + unsigned char nonce[16]; + int noncelen; + unsigned char header[64]; + int headerlen; + unsigned char pt[64]; + int ptlen; + unsigned char ct[64]; + unsigned char tag[16]; + int taglen; + } tests[] = { + +/* 13 byte nonce, 8 byte auth, 23 byte pt */ +{ + { 0xC0, 0xC1, 0xC2, 0xC3, 0xC4, 0xC5, 0xC6, 0xC7, + 0xC8, 0xC9, 0xCA, 0xCB, 0xCC, 0xCD, 0xCE, 0xCF }, + { 0x00, 0x00, 0x00, 0x03, 0x02, 0x01, 0x00, 0xA0, + 0xA1, 0xA2, 0xA3, 0xA4, 0xA5 }, + 13, + { 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07 }, + 8, + { 0x08, 0x09, 0x0A, 0x0B, 0x0C, 0x0D, 0x0E, 0x0F, + 0x10, 0x11, 0x12, 0x13, 0x14, 0x15, 0x16, 0x17, + 0x18, 0x19, 0x1A, 0x1B, 0x1C, 0x1D, 0x1E }, + 23, + { 0x58, 0x8C, 0x97, 0x9A, 0x61, 0xC6, 0x63, 0xD2, + 0xF0, 0x66, 0xD0, 0xC2, 0xC0, 0xF9, 0x89, 0x80, + 0x6D, 0x5F, 0x6B, 0x61, 0xDA, 0xC3, 0x84 }, + { 0x17, 0xe8, 0xd1, 0x2c, 0xfd, 0xf9, 0x26, 0xe0 }, + 8 +}, + +/* 13 byte nonce, 12 byte header, 19 byte pt */ +{ + { 0xC0, 0xC1, 0xC2, 0xC3, 0xC4, 0xC5, 0xC6, 0xC7, + 0xC8, 0xC9, 0xCA, 0xCB, 0xCC, 0xCD, 0xCE, 0xCF }, + { 0x00, 0x00, 0x00, 0x06, 0x05, 0x04, 0x03, 0xA0, + 0xA1, 0xA2, 0xA3, 0xA4, 0xA5 }, + 13, + { 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07, + 0x08, 0x09, 0x0A, 0x0B }, + 12, + { 0x0C, 0x0D, 0x0E, 0x0F, 0x10, 0x11, 0x12, 0x13, + 0x14, 0x15, 0x16, 0x17, 0x18, 0x19, 0x1A, 0x1B, + 0x1C, 0x1D, 0x1E }, + 19, + { 0xA2, 0x8C, 0x68, 0x65, 0x93, 0x9A, 0x9A, 0x79, + 0xFA, 0xAA, 0x5C, 0x4C, 0x2A, 0x9D, 0x4A, 0x91, + 0xCD, 0xAC, 0x8C }, + { 0x96, 0xC8, 0x61, 0xB9, 0xC9, 0xE6, 0x1E, 0xF1 }, + 8 +}, + +/* supplied by Brian Gladman */ +{ + { 0x40, 0x41, 0x42, 0x43, 0x44, 0x45, 0x46, 0x47, + 0x48, 0x49, 0x4a, 0x4b, 0x4c, 0x4d, 0x4e, 0x4f }, + { 0x10, 0x11, 0x12, 0x13, 0x14, 0x15, 0x16 }, + 7, + { 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07 }, + 8, + { 0x20, 0x21, 0x22, 0x23 }, + 4, + { 0x71, 0x62, 0x01, 0x5b }, + { 0x4d, 0xac, 0x25, 0x5d }, + 4 +}, + +{ + { 0xc9, 0x7c, 0x1f, 0x67, 0xce, 0x37, 0x11, 0x85, + 0x51, 0x4a, 0x8a, 0x19, 0xf2, 0xbd, 0xd5, 0x2f }, + { 0x00, 0x50, 0x30, 0xf1, 0x84, 0x44, 0x08, 0xb5, + 0x03, 0x97, 0x76, 0xe7, 0x0c }, + 13, + { 0x08, 0x40, 0x0f, 0xd2, 0xe1, 0x28, 0xa5, 0x7c, + 0x50, 0x30, 0xf1, 0x84, 0x44, 0x08, 0xab, 0xae, + 0xa5, 0xb8, 0xfc, 0xba, 0x00, 0x00 }, + 22, + { 0xf8, 0xba, 0x1a, 0x55, 0xd0, 0x2f, 0x85, 0xae, + 0x96, 0x7b, 0xb6, 0x2f, 0xb6, 0xcd, 0xa8, 0xeb, + 0x7e, 0x78, 0xa0, 0x50 }, + 20, + { 0xf3, 0xd0, 0xa2, 0xfe, 0x9a, 0x3d, 0xbf, 0x23, + 0x42, 0xa6, 0x43, 0xe4, 0x32, 0x46, 0xe8, 0x0c, + 0x3c, 0x04, 0xd0, 0x19 }, + { 0x78, 0x45, 0xce, 0x0b, 0x16, 0xf9, 0x76, 0x23 }, + 8 +}, + +}; + unsigned long taglen, x; + unsigned char buf[64], buf2[64], tag2[16], tag[16]; + int err, idx; + symmetric_key skey; + + idx = find_cipher("aes"); + if (idx == -1) { + idx = find_cipher("rijndael"); + if (idx == -1) { + return CRYPT_NOP; + } + } + + for (x = 0; x < (sizeof(tests)/sizeof(tests[0])); x++) { + taglen = tests[x].taglen; + if ((err = cipher_descriptor[idx].setup(tests[x].key, 16, 0, &skey)) != CRYPT_OK) { + return err; + } + + if ((err = ccm_memory(idx, + tests[x].key, 16, + &skey, + tests[x].nonce, tests[x].noncelen, + tests[x].header, tests[x].headerlen, + (unsigned char*)tests[x].pt, tests[x].ptlen, + buf, + tag, &taglen, 0)) != CRYPT_OK) { + return err; + } + + if (XMEMCMP(buf, tests[x].ct, tests[x].ptlen)) { + return CRYPT_FAIL_TESTVECTOR; + } + if (XMEMCMP(tag, tests[x].tag, tests[x].taglen)) { + return CRYPT_FAIL_TESTVECTOR; + } + + if ((err = ccm_memory(idx, + tests[x].key, 16, + NULL, + tests[x].nonce, tests[x].noncelen, + tests[x].header, tests[x].headerlen, + buf2, tests[x].ptlen, + buf, + tag2, &taglen, 1 )) != CRYPT_OK) { + return err; + } + + if (XMEMCMP(buf2, tests[x].pt, tests[x].ptlen)) { + return CRYPT_FAIL_TESTVECTOR; + } + if (XMEMCMP(tag2, tests[x].tag, tests[x].taglen)) { + return CRYPT_FAIL_TESTVECTOR; + } + cipher_descriptor[idx].done(&skey); + } + return CRYPT_OK; +#endif +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/encauth/ccm/ccm_test.c,v $ */ +/* $Revision: 1.8 $ */ +/* $Date: 2006/11/21 00:18:23 $ */ diff --git a/libtomcrypt/src/encauth/eax/eax_addheader.c b/libtomcrypt/src/encauth/eax/eax_addheader.c new file mode 100644 index 0000000..b1054e5 --- /dev/null +++ b/libtomcrypt/src/encauth/eax/eax_addheader.c @@ -0,0 +1,38 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +/** + @file eax_addheader.c + EAX implementation, add meta-data, by Tom St Denis +*/ +#include "tomcrypt.h" + +#ifdef EAX_MODE + +/** + add header (metadata) to the stream + @param eax The current EAX state + @param header The header (meta-data) data you wish to add to the state + @param length The length of the header data + @return CRYPT_OK if successful +*/ +int eax_addheader(eax_state *eax, const unsigned char *header, + unsigned long length) +{ + LTC_ARGCHK(eax != NULL); + LTC_ARGCHK(header != NULL); + return omac_process(&eax->headeromac, header, length); +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/encauth/eax/eax_addheader.c,v $ */ +/* $Revision: 1.4 $ */ +/* $Date: 2006/03/31 14:15:35 $ */ diff --git a/libtomcrypt/src/encauth/eax/eax_decrypt.c b/libtomcrypt/src/encauth/eax/eax_decrypt.c new file mode 100644 index 0000000..22a66ab --- /dev/null +++ b/libtomcrypt/src/encauth/eax/eax_decrypt.c @@ -0,0 +1,50 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ + +/** + @file eax_decrypt.c + EAX implementation, decrypt block, by Tom St Denis +*/ +#include "tomcrypt.h" + +#ifdef EAX_MODE + +/** + Decrypt data with the EAX protocol + @param eax The EAX state + @param ct The ciphertext + @param pt [out] The plaintext + @param length The length (octets) of the ciphertext + @return CRYPT_OK if successful +*/ +int eax_decrypt(eax_state *eax, const unsigned char *ct, unsigned char *pt, + unsigned long length) +{ + int err; + + LTC_ARGCHK(eax != NULL); + LTC_ARGCHK(pt != NULL); + LTC_ARGCHK(ct != NULL); + + /* omac ciphertext */ + if ((err = omac_process(&eax->ctomac, ct, length)) != CRYPT_OK) { + return err; + } + + /* decrypt */ + return ctr_decrypt(ct, pt, length, &eax->ctr); +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/encauth/eax/eax_decrypt.c,v $ */ +/* $Revision: 1.4 $ */ +/* $Date: 2006/03/31 14:15:35 $ */ diff --git a/libtomcrypt/src/encauth/eax/eax_decrypt_verify_memory.c b/libtomcrypt/src/encauth/eax/eax_decrypt_verify_memory.c new file mode 100644 index 0000000..693ddfa --- /dev/null +++ b/libtomcrypt/src/encauth/eax/eax_decrypt_verify_memory.c @@ -0,0 +1,108 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ + +/** + @file eax_decrypt_verify_memory.c + EAX implementation, decrypt block of memory, by Tom St Denis +*/ +#include "tomcrypt.h" + +#ifdef EAX_MODE + +/** + Decrypt a block of memory and verify the provided MAC tag with EAX + @param cipher The index of the cipher desired + @param key The secret key + @param keylen The length of the key (octets) + @param nonce The nonce data (use once) for the session + @param noncelen The length of the nonce data. + @param header The session header data + @param headerlen The length of the header (octets) + @param ct The ciphertext + @param ctlen The length of the ciphertext (octets) + @param pt [out] The plaintext + @param tag The authentication tag provided by the encoder + @param taglen [in/out] The length of the tag (octets) + @param stat [out] The result of the decryption (1==valid tag, 0==invalid) + @return CRYPT_OK if successful regardless of the resulting tag comparison +*/ +int eax_decrypt_verify_memory(int cipher, + const unsigned char *key, unsigned long keylen, + const unsigned char *nonce, unsigned long noncelen, + const unsigned char *header, unsigned long headerlen, + const unsigned char *ct, unsigned long ctlen, + unsigned char *pt, + unsigned char *tag, unsigned long taglen, + int *stat) +{ + int err; + eax_state *eax; + unsigned char *buf; + unsigned long buflen; + + LTC_ARGCHK(stat != NULL); + LTC_ARGCHK(key != NULL); + LTC_ARGCHK(pt != NULL); + LTC_ARGCHK(ct != NULL); + LTC_ARGCHK(tag != NULL); + + /* default to zero */ + *stat = 0; + + /* allocate ram */ + buf = XMALLOC(taglen); + eax = XMALLOC(sizeof(*eax)); + if (eax == NULL || buf == NULL) { + if (eax != NULL) { + XFREE(eax); + } + if (buf != NULL) { + XFREE(buf); + } + return CRYPT_MEM; + } + + if ((err = eax_init(eax, cipher, key, keylen, nonce, noncelen, header, headerlen)) != CRYPT_OK) { + goto LBL_ERR; + } + + if ((err = eax_decrypt(eax, ct, pt, ctlen)) != CRYPT_OK) { + goto LBL_ERR; + } + + buflen = taglen; + if ((err = eax_done(eax, buf, &buflen)) != CRYPT_OK) { + goto LBL_ERR; + } + + /* compare tags */ + if (buflen >= taglen && XMEMCMP(buf, tag, taglen) == 0) { + *stat = 1; + } + + err = CRYPT_OK; +LBL_ERR: +#ifdef LTC_CLEAN_STACK + zeromem(buf, taglen); + zeromem(eax, sizeof(*eax)); +#endif + + XFREE(eax); + XFREE(buf); + + return err; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/encauth/eax/eax_decrypt_verify_memory.c,v $ */ +/* $Revision: 1.5 $ */ +/* $Date: 2006/11/01 09:28:17 $ */ diff --git a/libtomcrypt/src/encauth/eax/eax_done.c b/libtomcrypt/src/encauth/eax/eax_done.c new file mode 100644 index 0000000..1e02939 --- /dev/null +++ b/libtomcrypt/src/encauth/eax/eax_done.c @@ -0,0 +1,94 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ + +/** + @file eax_done.c + EAX implementation, terminate session, by Tom St Denis +*/ +#include "tomcrypt.h" + +#ifdef EAX_MODE + +/** + Terminate an EAX session and get the tag. + @param eax The EAX state + @param tag [out] The destination of the authentication tag + @param taglen [in/out] The max length and resulting length of the authentication tag + @return CRYPT_OK if successful +*/ +int eax_done(eax_state *eax, unsigned char *tag, unsigned long *taglen) +{ + int err; + unsigned char *headermac, *ctmac; + unsigned long x, len; + + LTC_ARGCHK(eax != NULL); + LTC_ARGCHK(tag != NULL); + LTC_ARGCHK(taglen != NULL); + + /* allocate ram */ + headermac = XMALLOC(MAXBLOCKSIZE); + ctmac = XMALLOC(MAXBLOCKSIZE); + + if (headermac == NULL || ctmac == NULL) { + if (headermac != NULL) { + XFREE(headermac); + } + if (ctmac != NULL) { + XFREE(ctmac); + } + return CRYPT_MEM; + } + + /* finish ctomac */ + len = MAXBLOCKSIZE; + if ((err = omac_done(&eax->ctomac, ctmac, &len)) != CRYPT_OK) { + goto LBL_ERR; + } + + /* finish headeromac */ + + /* note we specifically don't reset len so the two lens are minimal */ + + if ((err = omac_done(&eax->headeromac, headermac, &len)) != CRYPT_OK) { + goto LBL_ERR; + } + + /* terminate the CTR chain */ + if ((err = ctr_done(&eax->ctr)) != CRYPT_OK) { + goto LBL_ERR; + } + + /* compute N xor H xor C */ + for (x = 0; x < len && x < *taglen; x++) { + tag[x] = eax->N[x] ^ headermac[x] ^ ctmac[x]; + } + *taglen = x; + + err = CRYPT_OK; +LBL_ERR: +#ifdef LTC_CLEAN_STACK + zeromem(ctmac, MAXBLOCKSIZE); + zeromem(headermac, MAXBLOCKSIZE); + zeromem(eax, sizeof(*eax)); +#endif + + XFREE(ctmac); + XFREE(headermac); + + return err; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/encauth/eax/eax_done.c,v $ */ +/* $Revision: 1.5 $ */ +/* $Date: 2006/03/31 14:15:35 $ */ diff --git a/libtomcrypt/src/encauth/eax/eax_encrypt.c b/libtomcrypt/src/encauth/eax/eax_encrypt.c new file mode 100644 index 0000000..dc8bc3d --- /dev/null +++ b/libtomcrypt/src/encauth/eax/eax_encrypt.c @@ -0,0 +1,51 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ + +/** + @file eax_encrypt.c + EAX implementation, encrypt block by Tom St Denis +*/ +#include "tomcrypt.h" + +#ifdef EAX_MODE + +/** + Encrypt with EAX a block of data. + @param eax The EAX state + @param pt The plaintext to encrypt + @param ct [out] The ciphertext as encrypted + @param length The length of the plaintext (octets) + @return CRYPT_OK if successful +*/ +int eax_encrypt(eax_state *eax, const unsigned char *pt, unsigned char *ct, + unsigned long length) +{ + int err; + + LTC_ARGCHK(eax != NULL); + LTC_ARGCHK(pt != NULL); + LTC_ARGCHK(ct != NULL); + + /* encrypt */ + if ((err = ctr_encrypt(pt, ct, length, &eax->ctr)) != CRYPT_OK) { + return err; + } + + /* omac ciphertext */ + return omac_process(&eax->ctomac, ct, length); +} + +#endif + + +/* $Source: /cvs/libtom/libtomcrypt/src/encauth/eax/eax_encrypt.c,v $ */ +/* $Revision: 1.4 $ */ +/* $Date: 2006/03/31 14:15:35 $ */ diff --git a/libtomcrypt/src/encauth/eax/eax_encrypt_authenticate_memory.c b/libtomcrypt/src/encauth/eax/eax_encrypt_authenticate_memory.c new file mode 100644 index 0000000..e9e52d0 --- /dev/null +++ b/libtomcrypt/src/encauth/eax/eax_encrypt_authenticate_memory.c @@ -0,0 +1,82 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ + +/** + @file eax_encrypt_authenticate_memory.c + EAX implementation, encrypt a block of memory, by Tom St Denis +*/ +#include "tomcrypt.h" + +#ifdef EAX_MODE + +/** + EAX encrypt and produce an authentication tag + @param cipher The index of the cipher desired + @param key The secret key to use + @param keylen The length of the secret key (octets) + @param nonce The session nonce [use once] + @param noncelen The length of the nonce + @param header The header for the session + @param headerlen The length of the header (octets) + @param pt The plaintext + @param ptlen The length of the plaintext (octets) + @param ct [out] The ciphertext + @param tag [out] The destination tag + @param taglen [in/out] The max size and resulting size of the authentication tag + @return CRYPT_OK if successful +*/ +int eax_encrypt_authenticate_memory(int cipher, + const unsigned char *key, unsigned long keylen, + const unsigned char *nonce, unsigned long noncelen, + const unsigned char *header, unsigned long headerlen, + const unsigned char *pt, unsigned long ptlen, + unsigned char *ct, + unsigned char *tag, unsigned long *taglen) +{ + int err; + eax_state *eax; + + LTC_ARGCHK(key != NULL); + LTC_ARGCHK(pt != NULL); + LTC_ARGCHK(ct != NULL); + LTC_ARGCHK(tag != NULL); + LTC_ARGCHK(taglen != NULL); + + eax = XMALLOC(sizeof(*eax)); + + if ((err = eax_init(eax, cipher, key, keylen, nonce, noncelen, header, headerlen)) != CRYPT_OK) { + goto LBL_ERR; + } + + if ((err = eax_encrypt(eax, pt, ct, ptlen)) != CRYPT_OK) { + goto LBL_ERR; + } + + if ((err = eax_done(eax, tag, taglen)) != CRYPT_OK) { + goto LBL_ERR; + } + + err = CRYPT_OK; +LBL_ERR: +#ifdef LTC_CLEAN_STACK + zeromem(eax, sizeof(*eax)); +#endif + + XFREE(eax); + + return err; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/encauth/eax/eax_encrypt_authenticate_memory.c,v $ */ +/* $Revision: 1.4 $ */ +/* $Date: 2006/03/31 14:15:35 $ */ diff --git a/libtomcrypt/src/encauth/eax/eax_init.c b/libtomcrypt/src/encauth/eax/eax_init.c new file mode 100644 index 0000000..48512b5 --- /dev/null +++ b/libtomcrypt/src/encauth/eax/eax_init.c @@ -0,0 +1,144 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ + +/** + @file eax_init.c + EAX implementation, initialized EAX state, by Tom St Denis +*/ +#include "tomcrypt.h" + +#ifdef EAX_MODE + +/** + Initialized an EAX state + @param eax [out] The EAX state to initialize + @param cipher The index of the desired cipher + @param key The secret key + @param keylen The length of the secret key (octets) + @param nonce The use-once nonce for the session + @param noncelen The length of the nonce (octets) + @param header The header for the EAX state + @param headerlen The header length (octets) + @return CRYPT_OK if successful +*/ +int eax_init(eax_state *eax, int cipher, + const unsigned char *key, unsigned long keylen, + const unsigned char *nonce, unsigned long noncelen, + const unsigned char *header, unsigned long headerlen) +{ + unsigned char *buf; + int err, blklen; + omac_state *omac; + unsigned long len; + + + LTC_ARGCHK(eax != NULL); + LTC_ARGCHK(key != NULL); + LTC_ARGCHK(nonce != NULL); + if (headerlen > 0) { + LTC_ARGCHK(header != NULL); + } + + if ((err = cipher_is_valid(cipher)) != CRYPT_OK) { + return err; + } + blklen = cipher_descriptor[cipher].block_length; + + /* allocate ram */ + buf = XMALLOC(MAXBLOCKSIZE); + omac = XMALLOC(sizeof(*omac)); + + if (buf == NULL || omac == NULL) { + if (buf != NULL) { + XFREE(buf); + } + if (omac != NULL) { + XFREE(omac); + } + return CRYPT_MEM; + } + + /* N = OMAC_0K(nonce) */ + zeromem(buf, MAXBLOCKSIZE); + if ((err = omac_init(omac, cipher, key, keylen)) != CRYPT_OK) { + goto LBL_ERR; + } + + /* omac the [0]_n */ + if ((err = omac_process(omac, buf, blklen)) != CRYPT_OK) { + goto LBL_ERR; + } + /* omac the nonce */ + if ((err = omac_process(omac, nonce, noncelen)) != CRYPT_OK) { + goto LBL_ERR; + } + /* store result */ + len = sizeof(eax->N); + if ((err = omac_done(omac, eax->N, &len)) != CRYPT_OK) { + goto LBL_ERR; + } + + /* H = OMAC_1K(header) */ + zeromem(buf, MAXBLOCKSIZE); + buf[blklen - 1] = 1; + + if ((err = omac_init(&eax->headeromac, cipher, key, keylen)) != CRYPT_OK) { + goto LBL_ERR; + } + + /* omac the [1]_n */ + if ((err = omac_process(&eax->headeromac, buf, blklen)) != CRYPT_OK) { + goto LBL_ERR; + } + /* omac the header */ + if (headerlen != 0) { + if ((err = omac_process(&eax->headeromac, header, headerlen)) != CRYPT_OK) { + goto LBL_ERR; + } + } + + /* note we don't finish the headeromac, this allows us to add more header later */ + + /* setup the CTR mode */ + if ((err = ctr_start(cipher, eax->N, key, keylen, 0, CTR_COUNTER_BIG_ENDIAN, &eax->ctr)) != CRYPT_OK) { + goto LBL_ERR; + } + + /* setup the OMAC for the ciphertext */ + if ((err = omac_init(&eax->ctomac, cipher, key, keylen)) != CRYPT_OK) { + goto LBL_ERR; + } + + /* omac [2]_n */ + zeromem(buf, MAXBLOCKSIZE); + buf[blklen-1] = 2; + if ((err = omac_process(&eax->ctomac, buf, blklen)) != CRYPT_OK) { + goto LBL_ERR; + } + + err = CRYPT_OK; +LBL_ERR: +#ifdef LTC_CLEAN_STACK + zeromem(buf, MAXBLOCKSIZE); + zeromem(omac, sizeof(*omac)); +#endif + + XFREE(omac); + XFREE(buf); + + return err; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/encauth/eax/eax_init.c,v $ */ +/* $Revision: 1.5 $ */ +/* $Date: 2006/03/31 14:15:35 $ */ diff --git a/libtomcrypt/src/encauth/eax/eax_test.c b/libtomcrypt/src/encauth/eax/eax_test.c new file mode 100644 index 0000000..d154271 --- /dev/null +++ b/libtomcrypt/src/encauth/eax/eax_test.c @@ -0,0 +1,282 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ + +/** + @file eax_test.c + EAX implementation, self-test, by Tom St Denis +*/ +#include "tomcrypt.h" + +#ifdef EAX_MODE + +/** + Test the EAX implementation + @return CRYPT_OK if successful, CRYPT_NOP if self-testing has been disabled +*/ +int eax_test(void) +{ +#ifndef LTC_TEST + return CRYPT_NOP; +#else + static const struct { + int keylen, + noncelen, + headerlen, + msglen; + + unsigned char key[MAXBLOCKSIZE], + nonce[MAXBLOCKSIZE], + header[MAXBLOCKSIZE], + plaintext[MAXBLOCKSIZE], + ciphertext[MAXBLOCKSIZE], + tag[MAXBLOCKSIZE]; + } tests[] = { + +/* NULL message */ +{ + 16, 0, 0, 0, + /* key */ + { 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07, + 0x08, 0x09, 0x0a, 0x0b, 0x0c, 0x0d, 0x0e, 0x0f }, + /* nonce */ + { 0 }, + /* header */ + { 0 }, + /* plaintext */ + { 0 }, + /* ciphertext */ + { 0 }, + /* tag */ + { 0x9a, 0xd0, 0x7e, 0x7d, 0xbf, 0xf3, 0x01, 0xf5, + 0x05, 0xde, 0x59, 0x6b, 0x96, 0x15, 0xdf, 0xff } +}, + +/* test with nonce */ +{ + 16, 16, 0, 0, + /* key */ + { 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07, + 0x08, 0x09, 0x0a, 0x0b, 0x0c, 0x0d, 0x0e, 0x0f }, + /* nonce */ + { 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07, + 0x08, 0x09, 0x0a, 0x0b, 0x0c, 0x0d, 0x0e, 0x0f }, + /* header */ + { 0 }, + /* plaintext */ + { 0 }, + /* ciphertext */ + { 0 }, + /* tag */ + { 0x1c, 0xe1, 0x0d, 0x3e, 0xff, 0xd4, 0xca, 0xdb, + 0xe2, 0xe4, 0x4b, 0x58, 0xd6, 0x0a, 0xb9, 0xec } +}, + +/* test with header [no nonce] */ +{ + 16, 0, 16, 0, + /* key */ + { 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07, + 0x08, 0x09, 0x0a, 0x0b, 0x0c, 0x0d, 0x0e, 0x0f }, + /* nonce */ + { 0 }, + /* header */ + { 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07, + 0x08, 0x09, 0x0a, 0x0b, 0x0c, 0x0d, 0x0e, 0x0f }, + /* plaintext */ + { 0 }, + /* ciphertext */ + { 0 }, + /* tag */ + { 0x3a, 0x69, 0x8f, 0x7a, 0x27, 0x0e, 0x51, 0xb0, + 0xf6, 0x5b, 0x3d, 0x3e, 0x47, 0x19, 0x3c, 0xff } +}, + +/* test with header + nonce + plaintext */ +{ + 16, 16, 16, 32, + /* key */ + { 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07, + 0x08, 0x09, 0x0a, 0x0b, 0x0c, 0x0d, 0x0e, 0x0f }, + /* nonce */ + { 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07, + 0x08, 0x09, 0x0a, 0x0b, 0x0c, 0x0d, 0x0e, 0x0f }, + /* header */ + { 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07, + 0x08, 0x09, 0x0a, 0x0b, 0x0c, 0x0d, 0x0e, 0x0f }, + /* plaintext */ + { 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07, + 0x08, 0x09, 0x0a, 0x0b, 0x0c, 0x0d, 0x0e, 0x0f, + 0x10, 0x11, 0x12, 0x13, 0x14, 0x15, 0x16, 0x17, + 0x18, 0x19, 0x1a, 0x1b, 0x1c, 0x1d, 0x1e, 0x1f }, + /* ciphertext */ + { 0x29, 0xd8, 0x78, 0xd1, 0xa3, 0xbe, 0x85, 0x7b, + 0x6f, 0xb8, 0xc8, 0xea, 0x59, 0x50, 0xa7, 0x78, + 0x33, 0x1f, 0xbf, 0x2c, 0xcf, 0x33, 0x98, 0x6f, + 0x35, 0xe8, 0xcf, 0x12, 0x1d, 0xcb, 0x30, 0xbc }, + /* tag */ + { 0x4f, 0xbe, 0x03, 0x38, 0xbe, 0x1c, 0x8c, 0x7e, + 0x1d, 0x7a, 0xe7, 0xe4, 0x5b, 0x92, 0xc5, 0x87 } +}, + +/* test with header + nonce + plaintext [not even sizes!] */ +{ + 16, 15, 14, 29, + /* key */ + { 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07, + 0x08, 0x09, 0x0a, 0x0b, 0x0c, 0x0d, 0x0e, 0x0f }, + /* nonce */ + { 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07, + 0x08, 0x09, 0x0a, 0x0b, 0x0c, 0x0d, 0x0e }, + /* header */ + { 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07, + 0x08, 0x09, 0x0a, 0x0b, 0x0c, 0x0d }, + /* plaintext */ + { 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07, + 0x08, 0x09, 0x0a, 0x0b, 0x0c, 0x0d, 0x0e, 0x0f, + 0x10, 0x11, 0x12, 0x13, 0x14, 0x15, 0x16, 0x17, + 0x18, 0x19, 0x1a, 0x1b, 0x1c }, + /* ciphertext */ + { 0xdd, 0x25, 0xc7, 0x54, 0xc5, 0xb1, 0x7c, 0x59, + 0x28, 0xb6, 0x9b, 0x73, 0x15, 0x5f, 0x7b, 0xb8, + 0x88, 0x8f, 0xaf, 0x37, 0x09, 0x1a, 0xd9, 0x2c, + 0x8a, 0x24, 0xdb, 0x86, 0x8b }, + /* tag */ + { 0x0d, 0x1a, 0x14, 0xe5, 0x22, 0x24, 0xff, 0xd2, + 0x3a, 0x05, 0xfa, 0x02, 0xcd, 0xef, 0x52, 0xda } +}, + +/* Vectors from Brian Gladman */ + +{ + 16, 16, 8, 0, + /* key */ + { 0x23, 0x39, 0x52, 0xde, 0xe4, 0xd5, 0xed, 0x5f, + 0x9b, 0x9c, 0x6d, 0x6f, 0xf8, 0x0f, 0xf4, 0x78 }, + /* nonce */ + { 0x62, 0xec, 0x67, 0xf9, 0xc3, 0xa4, 0xa4, 0x07, + 0xfc, 0xb2, 0xa8, 0xc4, 0x90, 0x31, 0xa8, 0xb3 }, + /* header */ + { 0x6b, 0xfb, 0x91, 0x4f, 0xd0, 0x7e, 0xae, 0x6b }, + /* PT */ + { 0x00 }, + /* CT */ + { 0x00 }, + /* tag */ + { 0xe0, 0x37, 0x83, 0x0e, 0x83, 0x89, 0xf2, 0x7b, + 0x02, 0x5a, 0x2d, 0x65, 0x27, 0xe7, 0x9d, 0x01 } +}, + +{ + 16, 16, 8, 2, + /* key */ + { 0x91, 0x94, 0x5d, 0x3f, 0x4d, 0xcb, 0xee, 0x0b, + 0xf4, 0x5e, 0xf5, 0x22, 0x55, 0xf0, 0x95, 0xa4 }, + /* nonce */ + { 0xbe, 0xca, 0xf0, 0x43, 0xb0, 0xa2, 0x3d, 0x84, + 0x31, 0x94, 0xba, 0x97, 0x2c, 0x66, 0xde, 0xbd }, + /* header */ + { 0xfa, 0x3b, 0xfd, 0x48, 0x06, 0xeb, 0x53, 0xfa }, + /* PT */ + { 0xf7, 0xfb }, + /* CT */ + { 0x19, 0xdd }, + /* tag */ + { 0x5c, 0x4c, 0x93, 0x31, 0x04, 0x9d, 0x0b, 0xda, + 0xb0, 0x27, 0x74, 0x08, 0xf6, 0x79, 0x67, 0xe5 } +}, + +{ + 16, 16, 8, 5, + /* key */ + { 0x01, 0xf7, 0x4a, 0xd6, 0x40, 0x77, 0xf2, 0xe7, + 0x04, 0xc0, 0xf6, 0x0a, 0xda, 0x3d, 0xd5, 0x23 }, + /* nonce */ + { 0x70, 0xc3, 0xdb, 0x4f, 0x0d, 0x26, 0x36, 0x84, + 0x00, 0xa1, 0x0e, 0xd0, 0x5d, 0x2b, 0xff, 0x5e }, + /* header */ + { 0x23, 0x4a, 0x34, 0x63, 0xc1, 0x26, 0x4a, 0xc6 }, + /* PT */ + { 0x1a, 0x47, 0xcb, 0x49, 0x33 }, + /* CT */ + { 0xd8, 0x51, 0xd5, 0xba, 0xe0 }, + /* Tag */ + { 0x3a, 0x59, 0xf2, 0x38, 0xa2, 0x3e, 0x39, 0x19, + 0x9d, 0xc9, 0x26, 0x66, 0x26, 0xc4, 0x0f, 0x80 } +} + +}; + int err, x, idx, res; + unsigned long len; + unsigned char outct[MAXBLOCKSIZE], outtag[MAXBLOCKSIZE]; + + /* AES can be under rijndael or aes... try to find it */ + if ((idx = find_cipher("aes")) == -1) { + if ((idx = find_cipher("rijndael")) == -1) { + return CRYPT_NOP; + } + } + + for (x = 0; x < (int)(sizeof(tests)/sizeof(tests[0])); x++) { + len = sizeof(outtag); + if ((err = eax_encrypt_authenticate_memory(idx, tests[x].key, tests[x].keylen, + tests[x].nonce, tests[x].noncelen, tests[x].header, tests[x].headerlen, + tests[x].plaintext, tests[x].msglen, outct, outtag, &len)) != CRYPT_OK) { + return err; + } + if (XMEMCMP(outct, tests[x].ciphertext, tests[x].msglen) || XMEMCMP(outtag, tests[x].tag, len)) { +#if 0 + unsigned long y; + printf("\n\nFailure: \nCT:\n"); + for (y = 0; y < (unsigned long)tests[x].msglen; ) { + printf("0x%02x", outct[y]); + if (y < (unsigned long)(tests[x].msglen-1)) printf(", "); + if (!(++y % 8)) printf("\n"); + } + printf("\nTAG:\n"); + for (y = 0; y < len; ) { + printf("0x%02x", outtag[y]); + if (y < len-1) printf(", "); + if (!(++y % 8)) printf("\n"); + } +#endif + return CRYPT_FAIL_TESTVECTOR; + } + + /* test decrypt */ + if ((err = eax_decrypt_verify_memory(idx, tests[x].key, tests[x].keylen, + tests[x].nonce, tests[x].noncelen, tests[x].header, tests[x].headerlen, + outct, tests[x].msglen, outct, outtag, len, &res)) != CRYPT_OK) { + return err; + } + if ((res != 1) || XMEMCMP(outct, tests[x].plaintext, tests[x].msglen)) { +#if 0 + unsigned long y; + printf("\n\nFailure (res == %d): \nPT:\n", res); + for (y = 0; y < (unsigned long)tests[x].msglen; ) { + printf("0x%02x", outct[y]); + if (y < (unsigned long)(tests[x].msglen-1)) printf(", "); + if (!(++y % 8)) printf("\n"); + } + printf("\n\n"); +#endif + return CRYPT_FAIL_TESTVECTOR; + } + + } + return CRYPT_OK; +#endif /* LTC_TEST */ +} + +#endif /* EAX_MODE */ + +/* $Source: /cvs/libtom/libtomcrypt/src/encauth/eax/eax_test.c,v $ */ +/* $Revision: 1.5 $ */ +/* $Date: 2006/11/01 09:28:17 $ */ diff --git a/libtomcrypt/src/encauth/gcm/gcm_add_aad.c b/libtomcrypt/src/encauth/gcm/gcm_add_aad.c new file mode 100644 index 0000000..6037c6c --- /dev/null +++ b/libtomcrypt/src/encauth/gcm/gcm_add_aad.c @@ -0,0 +1,124 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ + +/** + @file gcm_add_aad.c + GCM implementation, Add AAD data to the stream, by Tom St Denis +*/ +#include "tomcrypt.h" + +#ifdef GCM_MODE + +/** + Add AAD to the GCM state + @param gcm The GCM state + @param adata The additional authentication data to add to the GCM state + @param adatalen The length of the AAD data. + @return CRYPT_OK on success + */ +int gcm_add_aad(gcm_state *gcm, + const unsigned char *adata, unsigned long adatalen) +{ + unsigned long x; + int err; +#ifdef LTC_FAST + unsigned long y; +#endif + + LTC_ARGCHK(gcm != NULL); + if (adatalen > 0) { + LTC_ARGCHK(adata != NULL); + } + + if (gcm->buflen > 16 || gcm->buflen < 0) { + return CRYPT_INVALID_ARG; + } + + if ((err = cipher_is_valid(gcm->cipher)) != CRYPT_OK) { + return err; + } + + /* in IV mode? */ + if (gcm->mode == GCM_MODE_IV) { + /* let's process the IV */ + if (gcm->ivmode || gcm->buflen != 12) { + for (x = 0; x < (unsigned long)gcm->buflen; x++) { + gcm->X[x] ^= gcm->buf[x]; + } + if (gcm->buflen) { + gcm->totlen += gcm->buflen * CONST64(8); + gcm_mult_h(gcm, gcm->X); + } + + /* mix in the length */ + zeromem(gcm->buf, 8); + STORE64H(gcm->totlen, gcm->buf+8); + for (x = 0; x < 16; x++) { + gcm->X[x] ^= gcm->buf[x]; + } + gcm_mult_h(gcm, gcm->X); + + /* copy counter out */ + XMEMCPY(gcm->Y, gcm->X, 16); + zeromem(gcm->X, 16); + } else { + XMEMCPY(gcm->Y, gcm->buf, 12); + gcm->Y[12] = 0; + gcm->Y[13] = 0; + gcm->Y[14] = 0; + gcm->Y[15] = 1; + } + XMEMCPY(gcm->Y_0, gcm->Y, 16); + zeromem(gcm->buf, 16); + gcm->buflen = 0; + gcm->totlen = 0; + gcm->mode = GCM_MODE_AAD; + } + + if (gcm->mode != GCM_MODE_AAD || gcm->buflen >= 16) { + return CRYPT_INVALID_ARG; + } + + x = 0; +#ifdef LTC_FAST + if (gcm->buflen == 0) { + for (x = 0; x < (adatalen & ~15); x += 16) { + for (y = 0; y < 16; y += sizeof(LTC_FAST_TYPE)) { + *((LTC_FAST_TYPE*)(&gcm->X[y])) ^= *((LTC_FAST_TYPE*)(&adata[x + y])); + } + gcm_mult_h(gcm, gcm->X); + gcm->totlen += 128; + } + adata += x; + } +#endif + + + /* start adding AAD data to the state */ + for (; x < adatalen; x++) { + gcm->X[gcm->buflen++] ^= *adata++; + + if (gcm->buflen == 16) { + /* GF mult it */ + gcm_mult_h(gcm, gcm->X); + gcm->buflen = 0; + gcm->totlen += 128; + } + } + + return CRYPT_OK; +} +#endif + + +/* $Source: /cvs/libtom/libtomcrypt/src/encauth/gcm/gcm_add_aad.c,v $ */ +/* $Revision: 1.16 $ */ +/* $Date: 2006/09/23 19:24:21 $ */ diff --git a/libtomcrypt/src/encauth/gcm/gcm_add_iv.c b/libtomcrypt/src/encauth/gcm/gcm_add_iv.c new file mode 100644 index 0000000..44e3167 --- /dev/null +++ b/libtomcrypt/src/encauth/gcm/gcm_add_iv.c @@ -0,0 +1,94 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ + +/** + @file gcm_add_iv.c + GCM implementation, add IV data to the state, by Tom St Denis +*/ +#include "tomcrypt.h" + +#ifdef GCM_MODE + +/** + Add IV data to the GCM state + @param gcm The GCM state + @param IV The initial value data to add + @param IVlen The length of the IV + @return CRYPT_OK on success + */ +int gcm_add_iv(gcm_state *gcm, + const unsigned char *IV, unsigned long IVlen) +{ + unsigned long x, y; + int err; + + LTC_ARGCHK(gcm != NULL); + if (IVlen > 0) { + LTC_ARGCHK(IV != NULL); + } + + /* must be in IV mode */ + if (gcm->mode != GCM_MODE_IV) { + return CRYPT_INVALID_ARG; + } + + if (gcm->buflen >= 16 || gcm->buflen < 0) { + return CRYPT_INVALID_ARG; + } + + if ((err = cipher_is_valid(gcm->cipher)) != CRYPT_OK) { + return err; + } + + + /* trip the ivmode flag */ + if (IVlen + gcm->buflen > 12) { + gcm->ivmode |= 1; + } + + x = 0; +#ifdef LTC_FAST + if (gcm->buflen == 0) { + for (x = 0; x < (IVlen & ~15); x += 16) { + for (y = 0; y < 16; y += sizeof(LTC_FAST_TYPE)) { + *((LTC_FAST_TYPE*)(&gcm->X[y])) ^= *((LTC_FAST_TYPE*)(&IV[x + y])); + } + gcm_mult_h(gcm, gcm->X); + gcm->totlen += 128; + } + IV += x; + } +#endif + + /* start adding IV data to the state */ + for (; x < IVlen; x++) { + gcm->buf[gcm->buflen++] = *IV++; + + if (gcm->buflen == 16) { + /* GF mult it */ + for (y = 0; y < 16; y++) { + gcm->X[y] ^= gcm->buf[y]; + } + gcm_mult_h(gcm, gcm->X); + gcm->buflen = 0; + gcm->totlen += 128; + } + } + + return CRYPT_OK; +} + +#endif + + +/* $Source: /cvs/libtom/libtomcrypt/src/encauth/gcm/gcm_add_iv.c,v $ */ +/* $Revision: 1.7 $ */ +/* $Date: 2006/03/31 14:15:35 $ */ diff --git a/libtomcrypt/src/encauth/gcm/gcm_done.c b/libtomcrypt/src/encauth/gcm/gcm_done.c new file mode 100644 index 0000000..4cbd09f --- /dev/null +++ b/libtomcrypt/src/encauth/gcm/gcm_done.c @@ -0,0 +1,83 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ + +/** + @file gcm_done.c + GCM implementation, Terminate the stream, by Tom St Denis +*/ +#include "tomcrypt.h" + +#ifdef GCM_MODE + +/** + Terminate a GCM stream + @param gcm The GCM state + @param tag [out] The destination for the MAC tag + @param taglen [in/out] The length of the MAC tag + @return CRYPT_OK on success + */ +int gcm_done(gcm_state *gcm, + unsigned char *tag, unsigned long *taglen) +{ + unsigned long x; + int err; + + LTC_ARGCHK(gcm != NULL); + LTC_ARGCHK(tag != NULL); + LTC_ARGCHK(taglen != NULL); + + if (gcm->buflen > 16 || gcm->buflen < 0) { + return CRYPT_INVALID_ARG; + } + + if ((err = cipher_is_valid(gcm->cipher)) != CRYPT_OK) { + return err; + } + + + if (gcm->mode != GCM_MODE_TEXT) { + return CRYPT_INVALID_ARG; + } + + /* handle remaining ciphertext */ + if (gcm->buflen) { + gcm->pttotlen += gcm->buflen * CONST64(8); + gcm_mult_h(gcm, gcm->X); + } + + /* length */ + STORE64H(gcm->totlen, gcm->buf); + STORE64H(gcm->pttotlen, gcm->buf+8); + for (x = 0; x < 16; x++) { + gcm->X[x] ^= gcm->buf[x]; + } + gcm_mult_h(gcm, gcm->X); + + /* encrypt original counter */ + if ((err = cipher_descriptor[gcm->cipher].ecb_encrypt(gcm->Y_0, gcm->buf, &gcm->K)) != CRYPT_OK) { + return err; + } + for (x = 0; x < 16 && x < *taglen; x++) { + tag[x] = gcm->buf[x] ^ gcm->X[x]; + } + *taglen = x; + + cipher_descriptor[gcm->cipher].done(&gcm->K); + + return CRYPT_OK; +} + +#endif + + +/* $Source: /cvs/libtom/libtomcrypt/src/encauth/gcm/gcm_done.c,v $ */ +/* $Revision: 1.9 $ */ +/* $Date: 2006/03/31 14:15:35 $ */ diff --git a/libtomcrypt/src/encauth/gcm/gcm_gf_mult.c b/libtomcrypt/src/encauth/gcm/gcm_gf_mult.c new file mode 100644 index 0000000..52e82dd --- /dev/null +++ b/libtomcrypt/src/encauth/gcm/gcm_gf_mult.c @@ -0,0 +1,221 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ + +/** + @file gcm_gf_mult.c + GCM implementation, do the GF mult, by Tom St Denis +*/ +#include "tomcrypt.h" + +#if defined(GCM_TABLES) || defined(LRW_TABLES) || ((defined(GCM_MODE) || defined(GCM_MODE)) && defined(LTC_FAST)) + +/* this is x*2^128 mod p(x) ... the results are 16 bytes each stored in a packed format. Since only the + * lower 16 bits are not zero'ed I removed the upper 14 bytes */ +const unsigned char gcm_shift_table[256*2] = { +0x00, 0x00, 0x01, 0xc2, 0x03, 0x84, 0x02, 0x46, 0x07, 0x08, 0x06, 0xca, 0x04, 0x8c, 0x05, 0x4e, +0x0e, 0x10, 0x0f, 0xd2, 0x0d, 0x94, 0x0c, 0x56, 0x09, 0x18, 0x08, 0xda, 0x0a, 0x9c, 0x0b, 0x5e, +0x1c, 0x20, 0x1d, 0xe2, 0x1f, 0xa4, 0x1e, 0x66, 0x1b, 0x28, 0x1a, 0xea, 0x18, 0xac, 0x19, 0x6e, +0x12, 0x30, 0x13, 0xf2, 0x11, 0xb4, 0x10, 0x76, 0x15, 0x38, 0x14, 0xfa, 0x16, 0xbc, 0x17, 0x7e, +0x38, 0x40, 0x39, 0x82, 0x3b, 0xc4, 0x3a, 0x06, 0x3f, 0x48, 0x3e, 0x8a, 0x3c, 0xcc, 0x3d, 0x0e, +0x36, 0x50, 0x37, 0x92, 0x35, 0xd4, 0x34, 0x16, 0x31, 0x58, 0x30, 0x9a, 0x32, 0xdc, 0x33, 0x1e, +0x24, 0x60, 0x25, 0xa2, 0x27, 0xe4, 0x26, 0x26, 0x23, 0x68, 0x22, 0xaa, 0x20, 0xec, 0x21, 0x2e, +0x2a, 0x70, 0x2b, 0xb2, 0x29, 0xf4, 0x28, 0x36, 0x2d, 0x78, 0x2c, 0xba, 0x2e, 0xfc, 0x2f, 0x3e, +0x70, 0x80, 0x71, 0x42, 0x73, 0x04, 0x72, 0xc6, 0x77, 0x88, 0x76, 0x4a, 0x74, 0x0c, 0x75, 0xce, +0x7e, 0x90, 0x7f, 0x52, 0x7d, 0x14, 0x7c, 0xd6, 0x79, 0x98, 0x78, 0x5a, 0x7a, 0x1c, 0x7b, 0xde, +0x6c, 0xa0, 0x6d, 0x62, 0x6f, 0x24, 0x6e, 0xe6, 0x6b, 0xa8, 0x6a, 0x6a, 0x68, 0x2c, 0x69, 0xee, +0x62, 0xb0, 0x63, 0x72, 0x61, 0x34, 0x60, 0xf6, 0x65, 0xb8, 0x64, 0x7a, 0x66, 0x3c, 0x67, 0xfe, +0x48, 0xc0, 0x49, 0x02, 0x4b, 0x44, 0x4a, 0x86, 0x4f, 0xc8, 0x4e, 0x0a, 0x4c, 0x4c, 0x4d, 0x8e, +0x46, 0xd0, 0x47, 0x12, 0x45, 0x54, 0x44, 0x96, 0x41, 0xd8, 0x40, 0x1a, 0x42, 0x5c, 0x43, 0x9e, +0x54, 0xe0, 0x55, 0x22, 0x57, 0x64, 0x56, 0xa6, 0x53, 0xe8, 0x52, 0x2a, 0x50, 0x6c, 0x51, 0xae, +0x5a, 0xf0, 0x5b, 0x32, 0x59, 0x74, 0x58, 0xb6, 0x5d, 0xf8, 0x5c, 0x3a, 0x5e, 0x7c, 0x5f, 0xbe, +0xe1, 0x00, 0xe0, 0xc2, 0xe2, 0x84, 0xe3, 0x46, 0xe6, 0x08, 0xe7, 0xca, 0xe5, 0x8c, 0xe4, 0x4e, +0xef, 0x10, 0xee, 0xd2, 0xec, 0x94, 0xed, 0x56, 0xe8, 0x18, 0xe9, 0xda, 0xeb, 0x9c, 0xea, 0x5e, +0xfd, 0x20, 0xfc, 0xe2, 0xfe, 0xa4, 0xff, 0x66, 0xfa, 0x28, 0xfb, 0xea, 0xf9, 0xac, 0xf8, 0x6e, +0xf3, 0x30, 0xf2, 0xf2, 0xf0, 0xb4, 0xf1, 0x76, 0xf4, 0x38, 0xf5, 0xfa, 0xf7, 0xbc, 0xf6, 0x7e, +0xd9, 0x40, 0xd8, 0x82, 0xda, 0xc4, 0xdb, 0x06, 0xde, 0x48, 0xdf, 0x8a, 0xdd, 0xcc, 0xdc, 0x0e, +0xd7, 0x50, 0xd6, 0x92, 0xd4, 0xd4, 0xd5, 0x16, 0xd0, 0x58, 0xd1, 0x9a, 0xd3, 0xdc, 0xd2, 0x1e, +0xc5, 0x60, 0xc4, 0xa2, 0xc6, 0xe4, 0xc7, 0x26, 0xc2, 0x68, 0xc3, 0xaa, 0xc1, 0xec, 0xc0, 0x2e, +0xcb, 0x70, 0xca, 0xb2, 0xc8, 0xf4, 0xc9, 0x36, 0xcc, 0x78, 0xcd, 0xba, 0xcf, 0xfc, 0xce, 0x3e, +0x91, 0x80, 0x90, 0x42, 0x92, 0x04, 0x93, 0xc6, 0x96, 0x88, 0x97, 0x4a, 0x95, 0x0c, 0x94, 0xce, +0x9f, 0x90, 0x9e, 0x52, 0x9c, 0x14, 0x9d, 0xd6, 0x98, 0x98, 0x99, 0x5a, 0x9b, 0x1c, 0x9a, 0xde, +0x8d, 0xa0, 0x8c, 0x62, 0x8e, 0x24, 0x8f, 0xe6, 0x8a, 0xa8, 0x8b, 0x6a, 0x89, 0x2c, 0x88, 0xee, +0x83, 0xb0, 0x82, 0x72, 0x80, 0x34, 0x81, 0xf6, 0x84, 0xb8, 0x85, 0x7a, 0x87, 0x3c, 0x86, 0xfe, +0xa9, 0xc0, 0xa8, 0x02, 0xaa, 0x44, 0xab, 0x86, 0xae, 0xc8, 0xaf, 0x0a, 0xad, 0x4c, 0xac, 0x8e, +0xa7, 0xd0, 0xa6, 0x12, 0xa4, 0x54, 0xa5, 0x96, 0xa0, 0xd8, 0xa1, 0x1a, 0xa3, 0x5c, 0xa2, 0x9e, +0xb5, 0xe0, 0xb4, 0x22, 0xb6, 0x64, 0xb7, 0xa6, 0xb2, 0xe8, 0xb3, 0x2a, 0xb1, 0x6c, 0xb0, 0xae, +0xbb, 0xf0, 0xba, 0x32, 0xb8, 0x74, 0xb9, 0xb6, 0xbc, 0xf8, 0xbd, 0x3a, 0xbf, 0x7c, 0xbe, 0xbe }; + +#endif + + +#if defined(GCM_MODE) || defined(LRW_MODE) + +#ifndef LTC_FAST +/* right shift */ +static void gcm_rightshift(unsigned char *a) +{ + int x; + for (x = 15; x > 0; x--) { + a[x] = (a[x]>>1) | ((a[x-1]<<7)&0x80); + } + a[0] >>= 1; +} + +/* c = b*a */ +static const unsigned char mask[] = { 0x80, 0x40, 0x20, 0x10, 0x08, 0x04, 0x02, 0x01 }; +static const unsigned char poly[] = { 0x00, 0xE1 }; + + +/** + GCM GF multiplier (internal use only) bitserial + @param a First value + @param b Second value + @param c Destination for a * b + */ +void gcm_gf_mult(const unsigned char *a, const unsigned char *b, unsigned char *c) +{ + unsigned char Z[16], V[16]; + unsigned x, y, z; + + zeromem(Z, 16); + XMEMCPY(V, a, 16); + for (x = 0; x < 128; x++) { + if (b[x>>3] & mask[x&7]) { + for (y = 0; y < 16; y++) { + Z[y] ^= V[y]; + } + } + z = V[15] & 0x01; + gcm_rightshift(V); + V[0] ^= poly[z]; + } + XMEMCPY(c, Z, 16); +} + +#else + +/* map normal numbers to "ieee" way ... e.g. bit reversed */ +#define M(x) ( ((x&8)>>3) | ((x&4)>>1) | ((x&2)<<1) | ((x&1)<<3) ) + +#define BPD (sizeof(LTC_FAST_TYPE) * 8) +#define WPV (1 + (16 / sizeof(LTC_FAST_TYPE))) + +/** + GCM GF multiplier (internal use only) word oriented + @param a First value + @param b Second value + @param c Destination for a * b + */ +void gcm_gf_mult(const unsigned char *a, const unsigned char *b, unsigned char *c) +{ + int i, j, k, u; + LTC_FAST_TYPE B[16][WPV], tmp[32 / sizeof(LTC_FAST_TYPE)], pB[16 / sizeof(LTC_FAST_TYPE)], zz, z; + unsigned char pTmp[32]; + + /* create simple tables */ + zeromem(B[0], sizeof(B[0])); + zeromem(B[M(1)], sizeof(B[M(1)])); + +#ifdef ENDIAN_32BITWORD + for (i = 0; i < 4; i++) { + LOAD32H(B[M(1)][i], a + (i<<2)); + LOAD32L(pB[i], b + (i<<2)); + } +#else + for (i = 0; i < 2; i++) { + LOAD64H(B[M(1)][i], a + (i<<3)); + LOAD64L(pB[i], b + (i<<3)); + } +#endif + + /* now create 2, 4 and 8 */ + B[M(2)][0] = B[M(1)][0] >> 1; + B[M(4)][0] = B[M(1)][0] >> 2; + B[M(8)][0] = B[M(1)][0] >> 3; + for (i = 1; i < (int)WPV; i++) { + B[M(2)][i] = (B[M(1)][i-1] << (BPD-1)) | (B[M(1)][i] >> 1); + B[M(4)][i] = (B[M(1)][i-1] << (BPD-2)) | (B[M(1)][i] >> 2); + B[M(8)][i] = (B[M(1)][i-1] << (BPD-3)) | (B[M(1)][i] >> 3); + } + + /* now all values with two bits which are 3, 5, 6, 9, 10, 12 */ + for (i = 0; i < (int)WPV; i++) { + B[M(3)][i] = B[M(1)][i] ^ B[M(2)][i]; + B[M(5)][i] = B[M(1)][i] ^ B[M(4)][i]; + B[M(6)][i] = B[M(2)][i] ^ B[M(4)][i]; + B[M(9)][i] = B[M(1)][i] ^ B[M(8)][i]; + B[M(10)][i] = B[M(2)][i] ^ B[M(8)][i]; + B[M(12)][i] = B[M(8)][i] ^ B[M(4)][i]; + + /* now all 3 bit values and the only 4 bit value: 7, 11, 13, 14, 15 */ + B[M(7)][i] = B[M(3)][i] ^ B[M(4)][i]; + B[M(11)][i] = B[M(3)][i] ^ B[M(8)][i]; + B[M(13)][i] = B[M(1)][i] ^ B[M(12)][i]; + B[M(14)][i] = B[M(6)][i] ^ B[M(8)][i]; + B[M(15)][i] = B[M(7)][i] ^ B[M(8)][i]; + } + + zeromem(tmp, sizeof(tmp)); + + /* compute product four bits of each word at a time */ + /* for each nibble */ + for (i = (BPD/4)-1; i >= 0; i--) { + /* for each word */ + for (j = 0; j < (int)(WPV-1); j++) { + /* grab the 4 bits recall the nibbles are backwards so it's a shift by (i^1)*4 */ + u = (pB[j] >> ((i^1)<<2)) & 15; + + /* add offset by the word count the table looked up value to the result */ + for (k = 0; k < (int)WPV; k++) { + tmp[k+j] ^= B[u][k]; + } + } + /* shift result up by 4 bits */ + if (i != 0) { + for (z = j = 0; j < (int)(32 / sizeof(LTC_FAST_TYPE)); j++) { + zz = tmp[j] << (BPD-4); + tmp[j] = (tmp[j] >> 4) | z; + z = zz; + } + } + } + + /* store product */ +#ifdef ENDIAN_32BITWORD + for (i = 0; i < 8; i++) { + STORE32H(tmp[i], pTmp + (i<<2)); + } +#else + for (i = 0; i < 4; i++) { + STORE64H(tmp[i], pTmp + (i<<3)); + } +#endif + + /* reduce by taking most significant byte and adding the appropriate two byte sequence 16 bytes down */ + for (i = 31; i >= 16; i--) { + pTmp[i-16] ^= gcm_shift_table[((unsigned)pTmp[i]<<1)]; + pTmp[i-15] ^= gcm_shift_table[((unsigned)pTmp[i]<<1)+1]; + } + + for (i = 0; i < 16; i++) { + c[i] = pTmp[i]; + } + +} + +#endif + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/encauth/gcm/gcm_gf_mult.c,v $ */ +/* $Revision: 1.23 $ */ +/* $Date: 2006/03/31 14:15:35 $ */ + diff --git a/libtomcrypt/src/encauth/gcm/gcm_init.c b/libtomcrypt/src/encauth/gcm/gcm_init.c new file mode 100644 index 0000000..c0f7a5a --- /dev/null +++ b/libtomcrypt/src/encauth/gcm/gcm_init.c @@ -0,0 +1,107 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ + +/** + @file gcm_init.c + GCM implementation, initialize state, by Tom St Denis +*/ +#include "tomcrypt.h" + +#ifdef GCM_MODE + +/** + Initialize a GCM state + @param gcm The GCM state to initialize + @param cipher The index of the cipher to use + @param key The secret key + @param keylen The length of the secret key + @return CRYPT_OK on success + */ +int gcm_init(gcm_state *gcm, int cipher, + const unsigned char *key, int keylen) +{ + int err; + unsigned char B[16]; +#ifdef GCM_TABLES + int x, y, z, t; +#endif + + LTC_ARGCHK(gcm != NULL); + LTC_ARGCHK(key != NULL); + +#ifdef LTC_FAST + if (16 % sizeof(LTC_FAST_TYPE)) { + return CRYPT_INVALID_ARG; + } +#endif + + /* is cipher valid? */ + if ((err = cipher_is_valid(cipher)) != CRYPT_OK) { + return err; + } + if (cipher_descriptor[cipher].block_length != 16) { + return CRYPT_INVALID_CIPHER; + } + + /* schedule key */ + if ((err = cipher_descriptor[cipher].setup(key, keylen, 0, &gcm->K)) != CRYPT_OK) { + return err; + } + + /* H = E(0) */ + zeromem(B, 16); + if ((err = cipher_descriptor[cipher].ecb_encrypt(B, gcm->H, &gcm->K)) != CRYPT_OK) { + return err; + } + + /* setup state */ + zeromem(gcm->buf, sizeof(gcm->buf)); + zeromem(gcm->X, sizeof(gcm->X)); + gcm->cipher = cipher; + gcm->mode = GCM_MODE_IV; + gcm->ivmode = 0; + gcm->buflen = 0; + gcm->totlen = 0; + gcm->pttotlen = 0; + +#ifdef GCM_TABLES + /* setup tables */ + + /* generate the first table as it has no shifting (from which we make the other tables) */ + zeromem(B, 16); + for (y = 0; y < 256; y++) { + B[0] = y; + gcm_gf_mult(gcm->H, B, &gcm->PC[0][y][0]); + } + + /* now generate the rest of the tables based the previous table */ + for (x = 1; x < 16; x++) { + for (y = 0; y < 256; y++) { + /* now shift it right by 8 bits */ + t = gcm->PC[x-1][y][15]; + for (z = 15; z > 0; z--) { + gcm->PC[x][y][z] = gcm->PC[x-1][y][z-1]; + } + gcm->PC[x][y][0] = gcm_shift_table[t<<1]; + gcm->PC[x][y][1] ^= gcm_shift_table[(t<<1)+1]; + } + } + +#endif + + return CRYPT_OK; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/encauth/gcm/gcm_init.c,v $ */ +/* $Revision: 1.18 $ */ +/* $Date: 2006/03/31 14:15:35 $ */ diff --git a/libtomcrypt/src/encauth/gcm/gcm_memory.c b/libtomcrypt/src/encauth/gcm/gcm_memory.c new file mode 100644 index 0000000..ddec010 --- /dev/null +++ b/libtomcrypt/src/encauth/gcm/gcm_memory.c @@ -0,0 +1,109 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ + +/** + @file gcm_memory.c + GCM implementation, process a packet, by Tom St Denis +*/ +#include "tomcrypt.h" + +#ifdef GCM_MODE + +/** + Process an entire GCM packet in one call. + @param cipher Index of cipher to use + @param key The secret key + @param keylen The length of the secret key + @param IV The initial vector + @param IVlen The length of the initial vector + @param adata The additional authentication data (header) + @param adatalen The length of the adata + @param pt The plaintext + @param ptlen The length of the plaintext (ciphertext length is the same) + @param ct The ciphertext + @param tag [out] The MAC tag + @param taglen [in/out] The MAC tag length + @param direction Encrypt or Decrypt mode (GCM_ENCRYPT or GCM_DECRYPT) + @return CRYPT_OK on success + */ +int gcm_memory( int cipher, + const unsigned char *key, unsigned long keylen, + const unsigned char *IV, unsigned long IVlen, + const unsigned char *adata, unsigned long adatalen, + unsigned char *pt, unsigned long ptlen, + unsigned char *ct, + unsigned char *tag, unsigned long *taglen, + int direction) +{ + void *orig; + gcm_state *gcm; + int err; + + if ((err = cipher_is_valid(cipher)) != CRYPT_OK) { + return err; + } + + if (cipher_descriptor[cipher].accel_gcm_memory != NULL) { + return + cipher_descriptor[cipher].accel_gcm_memory + (key, keylen, + IV, IVlen, + adata, adatalen, + pt, ptlen, + ct, + tag, taglen, + direction); + } + + + +#ifndef GCM_TABLES_SSE2 + orig = gcm = XMALLOC(sizeof(*gcm)); +#else + orig = gcm = XMALLOC(sizeof(*gcm) + 16); +#endif + if (gcm == NULL) { + return CRYPT_MEM; + } + + /* Force GCM to be on a multiple of 16 so we can use 128-bit aligned operations + * note that we only modify gcm and keep orig intact. This code is not portable + * but again it's only for SSE2 anyways, so who cares? + */ +#ifdef GCM_TABLES_SSE2 + if ((unsigned long)gcm & 15) { + gcm = (gcm_state *)((unsigned long)gcm + (16 - ((unsigned long)gcm & 15))); + } +#endif + + if ((err = gcm_init(gcm, cipher, key, keylen)) != CRYPT_OK) { + goto LTC_ERR; + } + if ((err = gcm_add_iv(gcm, IV, IVlen)) != CRYPT_OK) { + goto LTC_ERR; + } + if ((err = gcm_add_aad(gcm, adata, adatalen)) != CRYPT_OK) { + goto LTC_ERR; + } + if ((err = gcm_process(gcm, pt, ptlen, ct, direction)) != CRYPT_OK) { + goto LTC_ERR; + } + err = gcm_done(gcm, tag, taglen); +LTC_ERR: + XFREE(orig); + return err; +} +#endif + + +/* $Source: /cvs/libtom/libtomcrypt/src/encauth/gcm/gcm_memory.c,v $ */ +/* $Revision: 1.23 $ */ +/* $Date: 2006/09/07 10:00:57 $ */ diff --git a/libtomcrypt/src/encauth/gcm/gcm_mult_h.c b/libtomcrypt/src/encauth/gcm/gcm_mult_h.c new file mode 100644 index 0000000..8391e00 --- /dev/null +++ b/libtomcrypt/src/encauth/gcm/gcm_mult_h.c @@ -0,0 +1,58 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ + +/** + @file gcm_mult_h.c + GCM implementation, do the GF mult, by Tom St Denis +*/ +#include "tomcrypt.h" + +#if defined(GCM_MODE) +/** + GCM multiply by H + @param gcm The GCM state which holds the H value + @param I The value to multiply H by + */ +void gcm_mult_h(gcm_state *gcm, unsigned char *I) +{ + unsigned char T[16]; +#ifdef GCM_TABLES + int x, y; +#ifdef GCM_TABLES_SSE2 + asm("movdqa (%0),%%xmm0"::"r"(&gcm->PC[0][I[0]][0])); + for (x = 1; x < 16; x++) { + asm("pxor (%0),%%xmm0"::"r"(&gcm->PC[x][I[x]][0])); + } + asm("movdqa %%xmm0,(%0)"::"r"(&T)); +#else + XMEMCPY(T, &gcm->PC[0][I[0]][0], 16); + for (x = 1; x < 16; x++) { +#ifdef LTC_FAST + for (y = 0; y < 16; y += sizeof(LTC_FAST_TYPE)) { + *((LTC_FAST_TYPE *)(T + y)) ^= *((LTC_FAST_TYPE *)(&gcm->PC[x][I[x]][y])); + } +#else + for (y = 0; y < 16; y++) { + T[y] ^= gcm->PC[x][I[x]][y]; + } +#endif /* LTC_FAST */ + } +#endif /* GCM_TABLES_SSE2 */ +#else + gcm_gf_mult(gcm->H, I, T); +#endif + XMEMCPY(I, T, 16); +} +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/encauth/gcm/gcm_mult_h.c,v $ */ +/* $Revision: 1.4 $ */ +/* $Date: 2006/08/23 20:40:23 $ */ diff --git a/libtomcrypt/src/encauth/gcm/gcm_process.c b/libtomcrypt/src/encauth/gcm/gcm_process.c new file mode 100644 index 0000000..f4d21d3 --- /dev/null +++ b/libtomcrypt/src/encauth/gcm/gcm_process.c @@ -0,0 +1,152 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ + +/** + @file gcm_process.c + GCM implementation, process message data, by Tom St Denis +*/ +#include "tomcrypt.h" + +#ifdef GCM_MODE + +/** + Process plaintext/ciphertext through GCM + @param gcm The GCM state + @param pt The plaintext + @param ptlen The plaintext length (ciphertext length is the same) + @param ct The ciphertext + @param direction Encrypt or Decrypt mode (GCM_ENCRYPT or GCM_DECRYPT) + @return CRYPT_OK on success + */ +int gcm_process(gcm_state *gcm, + unsigned char *pt, unsigned long ptlen, + unsigned char *ct, + int direction) +{ + unsigned long x; + int y, err; + unsigned char b; + + LTC_ARGCHK(gcm != NULL); + if (ptlen > 0) { + LTC_ARGCHK(pt != NULL); + LTC_ARGCHK(ct != NULL); + } + + if (gcm->buflen > 16 || gcm->buflen < 0) { + return CRYPT_INVALID_ARG; + } + + if ((err = cipher_is_valid(gcm->cipher)) != CRYPT_OK) { + return err; + } + + /* in AAD mode? */ + if (gcm->mode == GCM_MODE_AAD) { + /* let's process the AAD */ + if (gcm->buflen) { + gcm->totlen += gcm->buflen * CONST64(8); + gcm_mult_h(gcm, gcm->X); + } + + /* increment counter */ + for (y = 15; y >= 12; y--) { + if (++gcm->Y[y] & 255) { break; } + } + /* encrypt the counter */ + if ((err = cipher_descriptor[gcm->cipher].ecb_encrypt(gcm->Y, gcm->buf, &gcm->K)) != CRYPT_OK) { + return err; + } + + gcm->buflen = 0; + gcm->mode = GCM_MODE_TEXT; + } + + if (gcm->mode != GCM_MODE_TEXT) { + return CRYPT_INVALID_ARG; + } + + x = 0; +#ifdef LTC_FAST + if (gcm->buflen == 0) { + if (direction == GCM_ENCRYPT) { + for (x = 0; x < (ptlen & ~15); x += 16) { + /* ctr encrypt */ + for (y = 0; y < 16; y += sizeof(LTC_FAST_TYPE)) { + *((LTC_FAST_TYPE*)(&ct[x + y])) = *((LTC_FAST_TYPE*)(&pt[x+y])) ^ *((LTC_FAST_TYPE*)(&gcm->buf[y])); + *((LTC_FAST_TYPE*)(&gcm->X[y])) ^= *((LTC_FAST_TYPE*)(&ct[x+y])); + } + /* GMAC it */ + gcm->pttotlen += 128; + gcm_mult_h(gcm, gcm->X); + /* increment counter */ + for (y = 15; y >= 12; y--) { + if (++gcm->Y[y] & 255) { break; } + } + if ((err = cipher_descriptor[gcm->cipher].ecb_encrypt(gcm->Y, gcm->buf, &gcm->K)) != CRYPT_OK) { + return err; + } + } + } else { + for (x = 0; x < (ptlen & ~15); x += 16) { + /* ctr encrypt */ + for (y = 0; y < 16; y += sizeof(LTC_FAST_TYPE)) { + *((LTC_FAST_TYPE*)(&gcm->X[y])) ^= *((LTC_FAST_TYPE*)(&ct[x+y])); + *((LTC_FAST_TYPE*)(&pt[x + y])) = *((LTC_FAST_TYPE*)(&ct[x+y])) ^ *((LTC_FAST_TYPE*)(&gcm->buf[y])); + } + /* GMAC it */ + gcm->pttotlen += 128; + gcm_mult_h(gcm, gcm->X); + /* increment counter */ + for (y = 15; y >= 12; y--) { + if (++gcm->Y[y] & 255) { break; } + } + if ((err = cipher_descriptor[gcm->cipher].ecb_encrypt(gcm->Y, gcm->buf, &gcm->K)) != CRYPT_OK) { + return err; + } + } + } + } +#endif + + /* process text */ + for (; x < ptlen; x++) { + if (gcm->buflen == 16) { + gcm->pttotlen += 128; + gcm_mult_h(gcm, gcm->X); + + /* increment counter */ + for (y = 15; y >= 12; y--) { + if (++gcm->Y[y] & 255) { break; } + } + if ((err = cipher_descriptor[gcm->cipher].ecb_encrypt(gcm->Y, gcm->buf, &gcm->K)) != CRYPT_OK) { + return err; + } + gcm->buflen = 0; + } + + if (direction == GCM_ENCRYPT) { + b = ct[x] = pt[x] ^ gcm->buf[gcm->buflen]; + } else { + b = ct[x]; + pt[x] = ct[x] ^ gcm->buf[gcm->buflen]; + } + gcm->X[gcm->buflen++] ^= b; + } + + return CRYPT_OK; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/encauth/gcm/gcm_process.c,v $ */ +/* $Revision: 1.14 $ */ +/* $Date: 2006/11/19 19:33:36 $ */ diff --git a/libtomcrypt/src/encauth/gcm/gcm_reset.c b/libtomcrypt/src/encauth/gcm/gcm_reset.c new file mode 100644 index 0000000..a6a8522 --- /dev/null +++ b/libtomcrypt/src/encauth/gcm/gcm_reset.c @@ -0,0 +1,44 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ + +/** + @file gcm_reset.c + GCM implementation, reset a used state so it can accept IV data, by Tom St Denis +*/ +#include "tomcrypt.h" + +#ifdef GCM_MODE + +/** + Reset a GCM state to as if you just called gcm_init(). This saves the initialization time. + @param gcm The GCM state to reset + @return CRYPT_OK on success +*/ +int gcm_reset(gcm_state *gcm) +{ + LTC_ARGCHK(gcm != NULL); + + zeromem(gcm->buf, sizeof(gcm->buf)); + zeromem(gcm->X, sizeof(gcm->X)); + gcm->mode = GCM_MODE_IV; + gcm->ivmode = 0; + gcm->buflen = 0; + gcm->totlen = 0; + gcm->pttotlen = 0; + + return CRYPT_OK; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/encauth/gcm/gcm_reset.c,v $ */ +/* $Revision: 1.4 $ */ +/* $Date: 2006/03/31 14:15:35 $ */ diff --git a/libtomcrypt/src/encauth/gcm/gcm_test.c b/libtomcrypt/src/encauth/gcm/gcm_test.c new file mode 100644 index 0000000..2f8539b --- /dev/null +++ b/libtomcrypt/src/encauth/gcm/gcm_test.c @@ -0,0 +1,413 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ + +/** + @file gcm_test.c + GCM implementation, testing, by Tom St Denis +*/ +#include "tomcrypt.h" + +#ifdef GCM_MODE + +/** + Test the GCM code + @return CRYPT_OK on success + */ +int gcm_test(void) +{ +#ifndef LTC_TEST + return CRYPT_NOP; +#else + static const struct { + unsigned char K[32]; + int keylen; + unsigned char P[128]; + unsigned long ptlen; + unsigned char A[128]; + unsigned long alen; + unsigned char IV[128]; + unsigned long IVlen; + unsigned char C[128]; + unsigned char T[16]; + } tests[] = { + +/* test case #1 */ +{ + /* key */ + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + 16, + + /* plaintext */ + { 0 }, + 0, + + /* AAD data */ + { 0 }, + 0, + + /* IV */ + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00 }, + 12, + + /* ciphertext */ + { 0 }, + + /* tag */ + { 0x58, 0xe2, 0xfc, 0xce, 0xfa, 0x7e, 0x30, 0x61, + 0x36, 0x7f, 0x1d, 0x57, 0xa4, 0xe7, 0x45, 0x5a } +}, + +/* test case #2 */ +{ + /* key */ + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + 16, + + /* PT */ + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + 16, + + /* ADATA */ + { 0 }, + 0, + + /* IV */ + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00 }, + 12, + + /* CT */ + { 0x03, 0x88, 0xda, 0xce, 0x60, 0xb6, 0xa3, 0x92, + 0xf3, 0x28, 0xc2, 0xb9, 0x71, 0xb2, 0xfe, 0x78 }, + + /* TAG */ + { 0xab, 0x6e, 0x47, 0xd4, 0x2c, 0xec, 0x13, 0xbd, + 0xf5, 0x3a, 0x67, 0xb2, 0x12, 0x57, 0xbd, 0xdf } +}, + +/* test case #3 */ +{ + /* key */ + { 0xfe, 0xff, 0xe9, 0x92, 0x86, 0x65, 0x73, 0x1c, + 0x6d, 0x6a, 0x8f, 0x94, 0x67, 0x30, 0x83, 0x08, }, + 16, + + /* PT */ + { 0xd9, 0x31, 0x32, 0x25, 0xf8, 0x84, 0x06, 0xe5, + 0xa5, 0x59, 0x09, 0xc5, 0xaf, 0xf5, 0x26, 0x9a, + 0x86, 0xa7, 0xa9, 0x53, 0x15, 0x34, 0xf7, 0xda, + 0x2e, 0x4c, 0x30, 0x3d, 0x8a, 0x31, 0x8a, 0x72, + 0x1c, 0x3c, 0x0c, 0x95, 0x95, 0x68, 0x09, 0x53, + 0x2f, 0xcf, 0x0e, 0x24, 0x49, 0xa6, 0xb5, 0x25, + 0xb1, 0x6a, 0xed, 0xf5, 0xaa, 0x0d, 0xe6, 0x57, + 0xba, 0x63, 0x7b, 0x39, 0x1a, 0xaf, 0xd2, 0x55, }, + 64, + + /* ADATA */ + { 0 }, + 0, + + /* IV */ + { 0xca, 0xfe, 0xba, 0xbe, 0xfa, 0xce, 0xdb, 0xad, + 0xde, 0xca, 0xf8, 0x88, }, + 12, + + /* CT */ + { 0x42, 0x83, 0x1e, 0xc2, 0x21, 0x77, 0x74, 0x24, + 0x4b, 0x72, 0x21, 0xb7, 0x84, 0xd0, 0xd4, 0x9c, + 0xe3, 0xaa, 0x21, 0x2f, 0x2c, 0x02, 0xa4, 0xe0, + 0x35, 0xc1, 0x7e, 0x23, 0x29, 0xac, 0xa1, 0x2e, + 0x21, 0xd5, 0x14, 0xb2, 0x54, 0x66, 0x93, 0x1c, + 0x7d, 0x8f, 0x6a, 0x5a, 0xac, 0x84, 0xaa, 0x05, + 0x1b, 0xa3, 0x0b, 0x39, 0x6a, 0x0a, 0xac, 0x97, + 0x3d, 0x58, 0xe0, 0x91, 0x47, 0x3f, 0x59, 0x85, }, + + /* TAG */ + { 0x4d, 0x5c, 0x2a, 0xf3, 0x27, 0xcd, 0x64, 0xa6, + 0x2c, 0xf3, 0x5a, 0xbd, 0x2b, 0xa6, 0xfa, 0xb4, } +}, + +/* test case #4 */ +{ + /* key */ + { 0xfe, 0xff, 0xe9, 0x92, 0x86, 0x65, 0x73, 0x1c, + 0x6d, 0x6a, 0x8f, 0x94, 0x67, 0x30, 0x83, 0x08, }, + 16, + + /* PT */ + { 0xd9, 0x31, 0x32, 0x25, 0xf8, 0x84, 0x06, 0xe5, + 0xa5, 0x59, 0x09, 0xc5, 0xaf, 0xf5, 0x26, 0x9a, + 0x86, 0xa7, 0xa9, 0x53, 0x15, 0x34, 0xf7, 0xda, + 0x2e, 0x4c, 0x30, 0x3d, 0x8a, 0x31, 0x8a, 0x72, + 0x1c, 0x3c, 0x0c, 0x95, 0x95, 0x68, 0x09, 0x53, + 0x2f, 0xcf, 0x0e, 0x24, 0x49, 0xa6, 0xb5, 0x25, + 0xb1, 0x6a, 0xed, 0xf5, 0xaa, 0x0d, 0xe6, 0x57, + 0xba, 0x63, 0x7b, 0x39, }, + 60, + + /* ADATA */ + { 0xfe, 0xed, 0xfa, 0xce, 0xde, 0xad, 0xbe, 0xef, + 0xfe, 0xed, 0xfa, 0xce, 0xde, 0xad, 0xbe, 0xef, + 0xab, 0xad, 0xda, 0xd2, }, + 20, + + /* IV */ + { 0xca, 0xfe, 0xba, 0xbe, 0xfa, 0xce, 0xdb, 0xad, + 0xde, 0xca, 0xf8, 0x88, }, + 12, + + /* CT */ + { 0x42, 0x83, 0x1e, 0xc2, 0x21, 0x77, 0x74, 0x24, + 0x4b, 0x72, 0x21, 0xb7, 0x84, 0xd0, 0xd4, 0x9c, + 0xe3, 0xaa, 0x21, 0x2f, 0x2c, 0x02, 0xa4, 0xe0, + 0x35, 0xc1, 0x7e, 0x23, 0x29, 0xac, 0xa1, 0x2e, + 0x21, 0xd5, 0x14, 0xb2, 0x54, 0x66, 0x93, 0x1c, + 0x7d, 0x8f, 0x6a, 0x5a, 0xac, 0x84, 0xaa, 0x05, + 0x1b, 0xa3, 0x0b, 0x39, 0x6a, 0x0a, 0xac, 0x97, + 0x3d, 0x58, 0xe0, 0x91, }, + + /* TAG */ + { 0x5b, 0xc9, 0x4f, 0xbc, 0x32, 0x21, 0xa5, 0xdb, + 0x94, 0xfa, 0xe9, 0x5a, 0xe7, 0x12, 0x1a, 0x47, } + +}, + +/* test case #5 */ +{ + /* key */ + { 0xfe, 0xff, 0xe9, 0x92, 0x86, 0x65, 0x73, 0x1c, + 0x6d, 0x6a, 0x8f, 0x94, 0x67, 0x30, 0x83, 0x08, }, + 16, + + /* PT */ + { 0xd9, 0x31, 0x32, 0x25, 0xf8, 0x84, 0x06, 0xe5, + 0xa5, 0x59, 0x09, 0xc5, 0xaf, 0xf5, 0x26, 0x9a, + 0x86, 0xa7, 0xa9, 0x53, 0x15, 0x34, 0xf7, 0xda, + 0x2e, 0x4c, 0x30, 0x3d, 0x8a, 0x31, 0x8a, 0x72, + 0x1c, 0x3c, 0x0c, 0x95, 0x95, 0x68, 0x09, 0x53, + 0x2f, 0xcf, 0x0e, 0x24, 0x49, 0xa6, 0xb5, 0x25, + 0xb1, 0x6a, 0xed, 0xf5, 0xaa, 0x0d, 0xe6, 0x57, + 0xba, 0x63, 0x7b, 0x39, }, + 60, + + /* ADATA */ + { 0xfe, 0xed, 0xfa, 0xce, 0xde, 0xad, 0xbe, 0xef, + 0xfe, 0xed, 0xfa, 0xce, 0xde, 0xad, 0xbe, 0xef, + 0xab, 0xad, 0xda, 0xd2, }, + 20, + + /* IV */ + { 0xca, 0xfe, 0xba, 0xbe, 0xfa, 0xce, 0xdb, 0xad, }, + 8, + + /* CT */ + { 0x61, 0x35, 0x3b, 0x4c, 0x28, 0x06, 0x93, 0x4a, + 0x77, 0x7f, 0xf5, 0x1f, 0xa2, 0x2a, 0x47, 0x55, + 0x69, 0x9b, 0x2a, 0x71, 0x4f, 0xcd, 0xc6, 0xf8, + 0x37, 0x66, 0xe5, 0xf9, 0x7b, 0x6c, 0x74, 0x23, + 0x73, 0x80, 0x69, 0x00, 0xe4, 0x9f, 0x24, 0xb2, + 0x2b, 0x09, 0x75, 0x44, 0xd4, 0x89, 0x6b, 0x42, + 0x49, 0x89, 0xb5, 0xe1, 0xeb, 0xac, 0x0f, 0x07, + 0xc2, 0x3f, 0x45, 0x98, }, + + /* TAG */ + { 0x36, 0x12, 0xd2, 0xe7, 0x9e, 0x3b, 0x07, 0x85, + 0x56, 0x1b, 0xe1, 0x4a, 0xac, 0xa2, 0xfc, 0xcb, } +}, + +/* test case #6 */ +{ + /* key */ + { 0xfe, 0xff, 0xe9, 0x92, 0x86, 0x65, 0x73, 0x1c, + 0x6d, 0x6a, 0x8f, 0x94, 0x67, 0x30, 0x83, 0x08, }, + 16, + + /* PT */ + { 0xd9, 0x31, 0x32, 0x25, 0xf8, 0x84, 0x06, 0xe5, + 0xa5, 0x59, 0x09, 0xc5, 0xaf, 0xf5, 0x26, 0x9a, + 0x86, 0xa7, 0xa9, 0x53, 0x15, 0x34, 0xf7, 0xda, + 0x2e, 0x4c, 0x30, 0x3d, 0x8a, 0x31, 0x8a, 0x72, + 0x1c, 0x3c, 0x0c, 0x95, 0x95, 0x68, 0x09, 0x53, + 0x2f, 0xcf, 0x0e, 0x24, 0x49, 0xa6, 0xb5, 0x25, + 0xb1, 0x6a, 0xed, 0xf5, 0xaa, 0x0d, 0xe6, 0x57, + 0xba, 0x63, 0x7b, 0x39, }, + 60, + + /* ADATA */ + { 0xfe, 0xed, 0xfa, 0xce, 0xde, 0xad, 0xbe, 0xef, + 0xfe, 0xed, 0xfa, 0xce, 0xde, 0xad, 0xbe, 0xef, + 0xab, 0xad, 0xda, 0xd2, }, + 20, + + /* IV */ + { 0x93, 0x13, 0x22, 0x5d, 0xf8, 0x84, 0x06, 0xe5, + 0x55, 0x90, 0x9c, 0x5a, 0xff, 0x52, 0x69, 0xaa, + 0x6a, 0x7a, 0x95, 0x38, 0x53, 0x4f, 0x7d, 0xa1, + 0xe4, 0xc3, 0x03, 0xd2, 0xa3, 0x18, 0xa7, 0x28, + 0xc3, 0xc0, 0xc9, 0x51, 0x56, 0x80, 0x95, 0x39, + 0xfc, 0xf0, 0xe2, 0x42, 0x9a, 0x6b, 0x52, 0x54, + 0x16, 0xae, 0xdb, 0xf5, 0xa0, 0xde, 0x6a, 0x57, + 0xa6, 0x37, 0xb3, 0x9b, }, + 60, + + /* CT */ + { 0x8c, 0xe2, 0x49, 0x98, 0x62, 0x56, 0x15, 0xb6, + 0x03, 0xa0, 0x33, 0xac, 0xa1, 0x3f, 0xb8, 0x94, + 0xbe, 0x91, 0x12, 0xa5, 0xc3, 0xa2, 0x11, 0xa8, + 0xba, 0x26, 0x2a, 0x3c, 0xca, 0x7e, 0x2c, 0xa7, + 0x01, 0xe4, 0xa9, 0xa4, 0xfb, 0xa4, 0x3c, 0x90, + 0xcc, 0xdc, 0xb2, 0x81, 0xd4, 0x8c, 0x7c, 0x6f, + 0xd6, 0x28, 0x75, 0xd2, 0xac, 0xa4, 0x17, 0x03, + 0x4c, 0x34, 0xae, 0xe5, }, + + /* TAG */ + { 0x61, 0x9c, 0xc5, 0xae, 0xff, 0xfe, 0x0b, 0xfa, + 0x46, 0x2a, 0xf4, 0x3c, 0x16, 0x99, 0xd0, 0x50, } +}, + +/* test case #46 from BG (catches the LTC bug of v1.15) */ +{ + /* key */ + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + 16, + + /* PT */ + { 0xa2, 0xaa, 0xb3, 0xad, 0x8b, 0x17, 0xac, 0xdd, + 0xa2, 0x88, 0x42, 0x6c, 0xd7, 0xc4, 0x29, 0xb7, + 0xca, 0x86, 0xb7, 0xac, 0xa0, 0x58, 0x09, 0xc7, + 0x0c, 0xe8, 0x2d, 0xb2, 0x57, 0x11, 0xcb, 0x53, + 0x02, 0xeb, 0x27, 0x43, 0xb0, 0x36, 0xf3, 0xd7, + 0x50, 0xd6, 0xcf, 0x0d, 0xc0, 0xac, 0xb9, 0x29, + 0x50, 0xd5, 0x46, 0xdb, 0x30, 0x8f, 0x93, 0xb4, + 0xff, 0x24, 0x4a, 0xfa, 0x9d, 0xc7, 0x2b, 0xcd, + 0x75, 0x8d, 0x2c }, + 67, + + /* ADATA */ + { 0x68, 0x8e, 0x1a, 0xa9, 0x84, 0xde, 0x92, 0x6d, + 0xc7, 0xb4, 0xc4, 0x7f, 0x44 }, + 13, + + /* IV */ + { 0xb7, 0x21, 0x38, 0xb5, 0xa0, 0x5f, 0xf5, 0x07, + 0x0e, 0x8c, 0xd9, 0x41, 0x83, 0xf7, 0x61, 0xd8 }, + 16, + + /* CT */ + { 0xcb, 0xc8, 0xd2, 0xf1, 0x54, 0x81, 0xa4, 0xcc, + 0x7d, 0xd1, 0xe1, 0x9a, 0xaa, 0x83, 0xde, 0x56, + 0x78, 0x48, 0x3e, 0xc3, 0x59, 0xae, 0x7d, 0xec, + 0x2a, 0xb8, 0xd5, 0x34, 0xe0, 0x90, 0x6f, 0x4b, + 0x46, 0x63, 0xfa, 0xff, 0x58, 0xa8, 0xb2, 0xd7, + 0x33, 0xb8, 0x45, 0xee, 0xf7, 0xc9, 0xb3, 0x31, + 0xe9, 0xe1, 0x0e, 0xb2, 0x61, 0x2c, 0x99, 0x5f, + 0xeb, 0x1a, 0xc1, 0x5a, 0x62, 0x86, 0xcc, 0xe8, + 0xb2, 0x97, 0xa8 }, + + /* TAG */ + { 0x8d, 0x2d, 0x2a, 0x93, 0x72, 0x62, 0x6f, 0x6b, + 0xee, 0x85, 0x80, 0x27, 0x6a, 0x63, 0x66, 0xbf } +} + +/* rest of test cases are the same except AES key size changes... ignored... */ +}; + int idx, err; + unsigned long x, y; + unsigned char out[2][128], T[2][16]; + + /* find aes */ + idx = find_cipher("aes"); + if (idx == -1) { + idx = find_cipher("rijndael"); + if (idx == -1) { + return CRYPT_NOP; + } + } + + for (x = 0; x < (int)(sizeof(tests)/sizeof(tests[0])); x++) { + y = sizeof(T[0]); + if ((err = gcm_memory(idx, tests[x].K, tests[x].keylen, + tests[x].IV, tests[x].IVlen, + tests[x].A, tests[x].alen, + (unsigned char*)tests[x].P, tests[x].ptlen, + out[0], T[0], &y, GCM_ENCRYPT)) != CRYPT_OK) { + return err; + } + + if (XMEMCMP(out[0], tests[x].C, tests[x].ptlen)) { +#if 0 + printf("\nCiphertext wrong %lu\n", x); + for (y = 0; y < tests[x].ptlen; y++) { + printf("%02x", out[0][y] & 255); + } + printf("\n"); +#endif + return CRYPT_FAIL_TESTVECTOR; + } + + if (XMEMCMP(T[0], tests[x].T, 16)) { +#if 0 + printf("\nTag on plaintext wrong %lu\n", x); + for (y = 0; y < 16; y++) { + printf("%02x", T[0][y] & 255); + } + printf("\n"); +#endif + return CRYPT_FAIL_TESTVECTOR; + } + + y = sizeof(T[1]); + if ((err = gcm_memory(idx, tests[x].K, tests[x].keylen, + tests[x].IV, tests[x].IVlen, + tests[x].A, tests[x].alen, + out[1], tests[x].ptlen, + out[0], T[1], &y, GCM_DECRYPT)) != CRYPT_OK) { + return err; + } + + if (XMEMCMP(out[1], tests[x].P, tests[x].ptlen)) { +#if 0 + printf("\nplaintext wrong %lu\n", x); + for (y = 0; y < tests[x].ptlen; y++) { + printf("%02x", out[0][y] & 255); + } + printf("\n"); +#endif + return CRYPT_FAIL_TESTVECTOR; + } + + if (XMEMCMP(T[1], tests[x].T, 16)) { +#if 0 + printf("\nTag on ciphertext wrong %lu\n", x); + for (y = 0; y < 16; y++) { + printf("%02x", T[1][y] & 255); + } + printf("\n"); +#endif + return CRYPT_FAIL_TESTVECTOR; + } + + } + return CRYPT_OK; +#endif +} + +#endif + + +/* $Source: /cvs/libtom/libtomcrypt/src/encauth/gcm/gcm_test.c,v $ */ +/* $Revision: 1.20 $ */ +/* $Date: 2006/12/03 17:25:44 $ */ diff --git a/libtomcrypt/src/encauth/ocb/ocb_decrypt.c b/libtomcrypt/src/encauth/ocb/ocb_decrypt.c new file mode 100644 index 0000000..58f3825 --- /dev/null +++ b/libtomcrypt/src/encauth/ocb/ocb_decrypt.c @@ -0,0 +1,79 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ + +/** + @file ocb_decrypt.c + OCB implementation, decrypt data, by Tom St Denis +*/ +#include "tomcrypt.h" + +#ifdef OCB_MODE + +/** + Decrypt a block with OCB. + @param ocb The OCB state + @param ct The ciphertext (length of the block size of the block cipher) + @param pt [out] The plaintext (length of ct) + @return CRYPT_OK if successful +*/ +int ocb_decrypt(ocb_state *ocb, const unsigned char *ct, unsigned char *pt) +{ + unsigned char Z[MAXBLOCKSIZE], tmp[MAXBLOCKSIZE]; + int err, x; + + LTC_ARGCHK(ocb != NULL); + LTC_ARGCHK(pt != NULL); + LTC_ARGCHK(ct != NULL); + + /* check if valid cipher */ + if ((err = cipher_is_valid(ocb->cipher)) != CRYPT_OK) { + return err; + } + LTC_ARGCHK(cipher_descriptor[ocb->cipher].ecb_decrypt != NULL); + + /* check length */ + if (ocb->block_len != cipher_descriptor[ocb->cipher].block_length) { + return CRYPT_INVALID_ARG; + } + + /* Get Z[i] value */ + ocb_shift_xor(ocb, Z); + + /* xor ct in, encrypt, xor Z out */ + for (x = 0; x < ocb->block_len; x++) { + tmp[x] = ct[x] ^ Z[x]; + } + if ((err = cipher_descriptor[ocb->cipher].ecb_decrypt(tmp, pt, &ocb->key)) != CRYPT_OK) { + return err; + } + for (x = 0; x < ocb->block_len; x++) { + pt[x] ^= Z[x]; + } + + /* compute checksum */ + for (x = 0; x < ocb->block_len; x++) { + ocb->checksum[x] ^= pt[x]; + } + + +#ifdef LTC_CLEAN_STACK + zeromem(Z, sizeof(Z)); + zeromem(tmp, sizeof(tmp)); +#endif + return CRYPT_OK; +} + +#endif + + +/* $Source: /cvs/libtom/libtomcrypt/src/encauth/ocb/ocb_decrypt.c,v $ */ +/* $Revision: 1.5 $ */ +/* $Date: 2006/03/31 14:15:35 $ */ diff --git a/libtomcrypt/src/encauth/ocb/ocb_decrypt_verify_memory.c b/libtomcrypt/src/encauth/ocb/ocb_decrypt_verify_memory.c new file mode 100644 index 0000000..b7b8840 --- /dev/null +++ b/libtomcrypt/src/encauth/ocb/ocb_decrypt_verify_memory.c @@ -0,0 +1,86 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ + +/** + @file ocb_decrypt_verify_memory.c + OCB implementation, helper to decrypt block of memory, by Tom St Denis +*/ +#include "tomcrypt.h" + +#ifdef OCB_MODE + +/** + Decrypt and compare the tag with OCB. + @param cipher The index of the cipher desired + @param key The secret key + @param keylen The length of the secret key (octets) + @param nonce The session nonce (length of the block size of the block cipher) + @param ct The ciphertext + @param ctlen The length of the ciphertext (octets) + @param pt [out] The plaintext + @param tag The tag to compare against + @param taglen The length of the tag (octets) + @param stat [out] The result of the tag comparison (1==valid, 0==invalid) + @return CRYPT_OK if successful regardless of the tag comparison +*/ +int ocb_decrypt_verify_memory(int cipher, + const unsigned char *key, unsigned long keylen, + const unsigned char *nonce, + const unsigned char *ct, unsigned long ctlen, + unsigned char *pt, + const unsigned char *tag, unsigned long taglen, + int *stat) +{ + int err; + ocb_state *ocb; + + LTC_ARGCHK(key != NULL); + LTC_ARGCHK(nonce != NULL); + LTC_ARGCHK(pt != NULL); + LTC_ARGCHK(ct != NULL); + LTC_ARGCHK(tag != NULL); + LTC_ARGCHK(stat != NULL); + + /* allocate memory */ + ocb = XMALLOC(sizeof(ocb_state)); + if (ocb == NULL) { + return CRYPT_MEM; + } + + if ((err = ocb_init(ocb, cipher, key, keylen, nonce)) != CRYPT_OK) { + goto LBL_ERR; + } + + while (ctlen > (unsigned long)ocb->block_len) { + if ((err = ocb_decrypt(ocb, ct, pt)) != CRYPT_OK) { + goto LBL_ERR; + } + ctlen -= ocb->block_len; + pt += ocb->block_len; + ct += ocb->block_len; + } + + err = ocb_done_decrypt(ocb, ct, ctlen, pt, tag, taglen, stat); +LBL_ERR: +#ifdef LTC_CLEAN_STACK + zeromem(ocb, sizeof(ocb_state)); +#endif + + XFREE(ocb); + + return err; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/encauth/ocb/ocb_decrypt_verify_memory.c,v $ */ +/* $Revision: 1.4 $ */ +/* $Date: 2006/03/31 14:15:35 $ */ diff --git a/libtomcrypt/src/encauth/ocb/ocb_done_decrypt.c b/libtomcrypt/src/encauth/ocb/ocb_done_decrypt.c new file mode 100644 index 0000000..2a3ae39 --- /dev/null +++ b/libtomcrypt/src/encauth/ocb/ocb_done_decrypt.c @@ -0,0 +1,80 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ + +/** + @file ocb_done_decrypt.c + OCB implementation, terminate decryption, by Tom St Denis +*/ +#include "tomcrypt.h" + +#ifdef OCB_MODE + +/** + Terminate a decrypting OCB state + @param ocb The OCB state + @param ct The ciphertext (if any) + @param ctlen The length of the ciphertext (octets) + @param pt [out] The plaintext + @param tag The authentication tag (to compare against) + @param taglen The length of the authentication tag provided + @param stat [out] The result of the tag comparison + @return CRYPT_OK if the process was successful regardless if the tag is valid +*/ +int ocb_done_decrypt(ocb_state *ocb, + const unsigned char *ct, unsigned long ctlen, + unsigned char *pt, + const unsigned char *tag, unsigned long taglen, int *stat) +{ + int err; + unsigned char *tagbuf; + unsigned long tagbuflen; + + LTC_ARGCHK(ocb != NULL); + LTC_ARGCHK(pt != NULL); + LTC_ARGCHK(ct != NULL); + LTC_ARGCHK(tag != NULL); + LTC_ARGCHK(stat != NULL); + + /* default to failed */ + *stat = 0; + + /* allocate memory */ + tagbuf = XMALLOC(MAXBLOCKSIZE); + if (tagbuf == NULL) { + return CRYPT_MEM; + } + + tagbuflen = MAXBLOCKSIZE; + if ((err = s_ocb_done(ocb, ct, ctlen, pt, tagbuf, &tagbuflen, 1)) != CRYPT_OK) { + goto LBL_ERR; + } + + if (taglen <= tagbuflen && XMEMCMP(tagbuf, tag, taglen) == 0) { + *stat = 1; + } + + err = CRYPT_OK; +LBL_ERR: +#ifdef LTC_CLEAN_STACK + zeromem(tagbuf, MAXBLOCKSIZE); +#endif + + XFREE(tagbuf); + + return err; +} + +#endif + + +/* $Source: /cvs/libtom/libtomcrypt/src/encauth/ocb/ocb_done_decrypt.c,v $ */ +/* $Revision: 1.5 $ */ +/* $Date: 2006/11/01 09:28:17 $ */ diff --git a/libtomcrypt/src/encauth/ocb/ocb_done_encrypt.c b/libtomcrypt/src/encauth/ocb/ocb_done_encrypt.c new file mode 100644 index 0000000..5948d82 --- /dev/null +++ b/libtomcrypt/src/encauth/ocb/ocb_done_encrypt.c @@ -0,0 +1,46 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ + +/** + @file ocb_done_encrypt.c + OCB implementation, terminate encryption, by Tom St Denis +*/ +#include "tomcrypt.h" + +#ifdef OCB_MODE + +/** + Terminate an encryption OCB state + @param ocb The OCB state + @param pt Remaining plaintext (if any) + @param ptlen The length of the plaintext (octets) + @param ct [out] The ciphertext (if any) + @param tag [out] The tag for the OCB stream + @param taglen [in/out] The max size and resulting size of the tag + @return CRYPT_OK if successful +*/ +int ocb_done_encrypt(ocb_state *ocb, const unsigned char *pt, unsigned long ptlen, + unsigned char *ct, unsigned char *tag, unsigned long *taglen) +{ + LTC_ARGCHK(ocb != NULL); + LTC_ARGCHK(pt != NULL); + LTC_ARGCHK(ct != NULL); + LTC_ARGCHK(tag != NULL); + LTC_ARGCHK(taglen != NULL); + return s_ocb_done(ocb, pt, ptlen, ct, tag, taglen, 0); +} + +#endif + + +/* $Source: /cvs/libtom/libtomcrypt/src/encauth/ocb/ocb_done_encrypt.c,v $ */ +/* $Revision: 1.4 $ */ +/* $Date: 2006/03/31 14:15:35 $ */ diff --git a/libtomcrypt/src/encauth/ocb/ocb_encrypt.c b/libtomcrypt/src/encauth/ocb/ocb_encrypt.c new file mode 100644 index 0000000..3c4991c --- /dev/null +++ b/libtomcrypt/src/encauth/ocb/ocb_encrypt.c @@ -0,0 +1,72 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ + +/** + @file ocb_encrypt.c + OCB implementation, encrypt data, by Tom St Denis +*/ +#include "tomcrypt.h" + +#ifdef OCB_MODE + +/** + Encrypt a block of data with OCB. + @param ocb The OCB state + @param pt The plaintext (length of the block size of the block cipher) + @param ct [out] The ciphertext (same size as the pt) + @return CRYPT_OK if successful +*/ +int ocb_encrypt(ocb_state *ocb, const unsigned char *pt, unsigned char *ct) +{ + unsigned char Z[MAXBLOCKSIZE], tmp[MAXBLOCKSIZE]; + int err, x; + + LTC_ARGCHK(ocb != NULL); + LTC_ARGCHK(pt != NULL); + LTC_ARGCHK(ct != NULL); + if ((err = cipher_is_valid(ocb->cipher)) != CRYPT_OK) { + return err; + } + if (ocb->block_len != cipher_descriptor[ocb->cipher].block_length) { + return CRYPT_INVALID_ARG; + } + + /* compute checksum */ + for (x = 0; x < ocb->block_len; x++) { + ocb->checksum[x] ^= pt[x]; + } + + /* Get Z[i] value */ + ocb_shift_xor(ocb, Z); + + /* xor pt in, encrypt, xor Z out */ + for (x = 0; x < ocb->block_len; x++) { + tmp[x] = pt[x] ^ Z[x]; + } + if ((err = cipher_descriptor[ocb->cipher].ecb_encrypt(tmp, ct, &ocb->key)) != CRYPT_OK) { + return err; + } + for (x = 0; x < ocb->block_len; x++) { + ct[x] ^= Z[x]; + } + +#ifdef LTC_CLEAN_STACK + zeromem(Z, sizeof(Z)); + zeromem(tmp, sizeof(tmp)); +#endif + return CRYPT_OK; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/encauth/ocb/ocb_encrypt.c,v $ */ +/* $Revision: 1.5 $ */ +/* $Date: 2006/03/31 14:15:35 $ */ diff --git a/libtomcrypt/src/encauth/ocb/ocb_encrypt_authenticate_memory.c b/libtomcrypt/src/encauth/ocb/ocb_encrypt_authenticate_memory.c new file mode 100644 index 0000000..e58975e --- /dev/null +++ b/libtomcrypt/src/encauth/ocb/ocb_encrypt_authenticate_memory.c @@ -0,0 +1,84 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ + +/** + @file ocb_encrypt_authenticate_memory.c + OCB implementation, encrypt block of memory, by Tom St Denis +*/ +#include "tomcrypt.h" + +#ifdef OCB_MODE + +/** + Encrypt and generate an authentication code for a buffer of memory + @param cipher The index of the cipher desired + @param key The secret key + @param keylen The length of the secret key (octets) + @param nonce The session nonce (length of the block ciphers block size) + @param pt The plaintext + @param ptlen The length of the plaintext (octets) + @param ct [out] The ciphertext + @param tag [out] The authentication tag + @param taglen [in/out] The max size and resulting size of the authentication tag + @return CRYPT_OK if successful +*/ +int ocb_encrypt_authenticate_memory(int cipher, + const unsigned char *key, unsigned long keylen, + const unsigned char *nonce, + const unsigned char *pt, unsigned long ptlen, + unsigned char *ct, + unsigned char *tag, unsigned long *taglen) +{ + int err; + ocb_state *ocb; + + LTC_ARGCHK(key != NULL); + LTC_ARGCHK(nonce != NULL); + LTC_ARGCHK(pt != NULL); + LTC_ARGCHK(ct != NULL); + LTC_ARGCHK(tag != NULL); + LTC_ARGCHK(taglen != NULL); + + /* allocate ram */ + ocb = XMALLOC(sizeof(ocb_state)); + if (ocb == NULL) { + return CRYPT_MEM; + } + + if ((err = ocb_init(ocb, cipher, key, keylen, nonce)) != CRYPT_OK) { + goto LBL_ERR; + } + + while (ptlen > (unsigned long)ocb->block_len) { + if ((err = ocb_encrypt(ocb, pt, ct)) != CRYPT_OK) { + goto LBL_ERR; + } + ptlen -= ocb->block_len; + pt += ocb->block_len; + ct += ocb->block_len; + } + + err = ocb_done_encrypt(ocb, pt, ptlen, ct, tag, taglen); +LBL_ERR: +#ifdef LTC_CLEAN_STACK + zeromem(ocb, sizeof(ocb_state)); +#endif + + XFREE(ocb); + + return err; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/encauth/ocb/ocb_encrypt_authenticate_memory.c,v $ */ +/* $Revision: 1.4 $ */ +/* $Date: 2006/03/31 14:15:35 $ */ diff --git a/libtomcrypt/src/encauth/ocb/ocb_init.c b/libtomcrypt/src/encauth/ocb/ocb_init.c new file mode 100644 index 0000000..536af87 --- /dev/null +++ b/libtomcrypt/src/encauth/ocb/ocb_init.c @@ -0,0 +1,137 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ + +/** + @file ocb_init.c + OCB implementation, initialize state, by Tom St Denis +*/ +#include "tomcrypt.h" + +#ifdef OCB_MODE + +static const struct { + int len; + unsigned char poly_div[MAXBLOCKSIZE], + poly_mul[MAXBLOCKSIZE]; +} polys[] = { +{ + 8, + { 0x80, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x0D }, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x1B } +}, { + 16, + { 0x80, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x43 }, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x87 } +} +}; + +/** + Initialize an OCB context. + @param ocb [out] The destination of the OCB state + @param cipher The index of the desired cipher + @param key The secret key + @param keylen The length of the secret key (octets) + @param nonce The session nonce (length of the block size of the cipher) + @return CRYPT_OK if successful +*/ +int ocb_init(ocb_state *ocb, int cipher, + const unsigned char *key, unsigned long keylen, const unsigned char *nonce) +{ + int poly, x, y, m, err; + + LTC_ARGCHK(ocb != NULL); + LTC_ARGCHK(key != NULL); + LTC_ARGCHK(nonce != NULL); + + /* valid cipher? */ + if ((err = cipher_is_valid(cipher)) != CRYPT_OK) { + return err; + } + + /* determine which polys to use */ + ocb->block_len = cipher_descriptor[cipher].block_length; + for (poly = 0; poly < (int)(sizeof(polys)/sizeof(polys[0])); poly++) { + if (polys[poly].len == ocb->block_len) { + break; + } + } + if (polys[poly].len != ocb->block_len) { + return CRYPT_INVALID_ARG; + } + + /* schedule the key */ + if ((err = cipher_descriptor[cipher].setup(key, keylen, 0, &ocb->key)) != CRYPT_OK) { + return err; + } + + /* find L = E[0] */ + zeromem(ocb->L, ocb->block_len); + if ((err = cipher_descriptor[cipher].ecb_encrypt(ocb->L, ocb->L, &ocb->key)) != CRYPT_OK) { + return err; + } + + /* find R = E[N xor L] */ + for (x = 0; x < ocb->block_len; x++) { + ocb->R[x] = ocb->L[x] ^ nonce[x]; + } + if ((err = cipher_descriptor[cipher].ecb_encrypt(ocb->R, ocb->R, &ocb->key)) != CRYPT_OK) { + return err; + } + + /* find Ls[i] = L << i for i == 0..31 */ + XMEMCPY(ocb->Ls[0], ocb->L, ocb->block_len); + for (x = 1; x < 32; x++) { + m = ocb->Ls[x-1][0] >> 7; + for (y = 0; y < ocb->block_len-1; y++) { + ocb->Ls[x][y] = ((ocb->Ls[x-1][y] << 1) | (ocb->Ls[x-1][y+1] >> 7)) & 255; + } + ocb->Ls[x][ocb->block_len-1] = (ocb->Ls[x-1][ocb->block_len-1] << 1) & 255; + + if (m == 1) { + for (y = 0; y < ocb->block_len; y++) { + ocb->Ls[x][y] ^= polys[poly].poly_mul[y]; + } + } + } + + /* find Lr = L / x */ + m = ocb->L[ocb->block_len-1] & 1; + + /* shift right */ + for (x = ocb->block_len - 1; x > 0; x--) { + ocb->Lr[x] = ((ocb->L[x] >> 1) | (ocb->L[x-1] << 7)) & 255; + } + ocb->Lr[0] = ocb->L[0] >> 1; + + if (m == 1) { + for (x = 0; x < ocb->block_len; x++) { + ocb->Lr[x] ^= polys[poly].poly_div[x]; + } + } + + /* set Li, checksum */ + zeromem(ocb->Li, ocb->block_len); + zeromem(ocb->checksum, ocb->block_len); + + /* set other params */ + ocb->block_index = 1; + ocb->cipher = cipher; + + return CRYPT_OK; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/encauth/ocb/ocb_init.c,v $ */ +/* $Revision: 1.5 $ */ +/* $Date: 2006/03/31 14:15:35 $ */ diff --git a/libtomcrypt/src/encauth/ocb/ocb_ntz.c b/libtomcrypt/src/encauth/ocb/ocb_ntz.c new file mode 100644 index 0000000..8100ec0 --- /dev/null +++ b/libtomcrypt/src/encauth/ocb/ocb_ntz.c @@ -0,0 +1,42 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ + +/** + @file ocb_ntz.c + OCB implementation, internal function, by Tom St Denis +*/ + +#include "tomcrypt.h" + +#ifdef OCB_MODE + +/** + Returns the number of leading zero bits [from lsb up] + @param x The 32-bit value to observe + @return The number of bits [from the lsb up] that are zero +*/ +int ocb_ntz(unsigned long x) +{ + int c; + x &= 0xFFFFFFFFUL; + c = 0; + while ((x & 1) == 0) { + ++c; + x >>= 1; + } + return c; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/encauth/ocb/ocb_ntz.c,v $ */ +/* $Revision: 1.4 $ */ +/* $Date: 2006/03/31 14:15:35 $ */ diff --git a/libtomcrypt/src/encauth/ocb/ocb_shift_xor.c b/libtomcrypt/src/encauth/ocb/ocb_shift_xor.c new file mode 100644 index 0000000..dea43ee --- /dev/null +++ b/libtomcrypt/src/encauth/ocb/ocb_shift_xor.c @@ -0,0 +1,39 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ + +/** + @file ocb_shift_xor.c + OCB implementation, internal function, by Tom St Denis +*/ +#include "tomcrypt.h" + +#ifdef OCB_MODE + +/** + Compute the shift/xor for OCB (internal function) + @param ocb The OCB state + @param Z The destination of the shift +*/ +void ocb_shift_xor(ocb_state *ocb, unsigned char *Z) +{ + int x, y; + y = ocb_ntz(ocb->block_index++); + for (x = 0; x < ocb->block_len; x++) { + ocb->Li[x] ^= ocb->Ls[y][x]; + Z[x] = ocb->Li[x] ^ ocb->R[x]; + } +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/encauth/ocb/ocb_shift_xor.c,v $ */ +/* $Revision: 1.4 $ */ +/* $Date: 2006/03/31 14:15:35 $ */ diff --git a/libtomcrypt/src/encauth/ocb/ocb_test.c b/libtomcrypt/src/encauth/ocb/ocb_test.c new file mode 100644 index 0000000..4d7ed78 --- /dev/null +++ b/libtomcrypt/src/encauth/ocb/ocb_test.c @@ -0,0 +1,237 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ + +/** + @file ocb_test.c + OCB implementation, self-test by Tom St Denis +*/ +#include "tomcrypt.h" + +#ifdef OCB_MODE + +/** + Test the OCB protocol + @return CRYPT_OK if successful +*/ +int ocb_test(void) +{ +#ifndef LTC_TEST + return CRYPT_NOP; +#else + static const struct { + int ptlen; + unsigned char key[16], nonce[16], pt[34], ct[34], tag[16]; + } tests[] = { + + /* OCB-AES-128-0B */ +{ + 0, + /* key */ + { 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07, + 0x08, 0x09, 0x0a, 0x0b, 0x0c, 0x0d, 0x0e, 0x0f }, + /* nonce */ + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x01 }, + /* pt */ + { 0 }, + /* ct */ + { 0 }, + /* tag */ + { 0x15, 0xd3, 0x7d, 0xd7, 0xc8, 0x90, 0xd5, 0xd6, + 0xac, 0xab, 0x92, 0x7b, 0xc0, 0xdc, 0x60, 0xee }, +}, + + + /* OCB-AES-128-3B */ +{ + 3, + /* key */ + { 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07, + 0x08, 0x09, 0x0a, 0x0b, 0x0c, 0x0d, 0x0e, 0x0f }, + /* nonce */ + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x01 }, + /* pt */ + { 0x00, 0x01, 0x02 }, + /* ct */ + { 0xfc, 0xd3, 0x7d }, + /* tag */ + { 0x02, 0x25, 0x47, 0x39, 0xa5, 0xe3, 0x56, 0x5a, + 0xe2, 0xdc, 0xd6, 0x2c, 0x65, 0x97, 0x46, 0xba }, +}, + + /* OCB-AES-128-16B */ +{ + 16, + /* key */ + { 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07, + 0x08, 0x09, 0x0a, 0x0b, 0x0c, 0x0d, 0x0e, 0x0f }, + /* nonce */ + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x01 }, + /* pt */ + { 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07, + 0x08, 0x09, 0x0a, 0x0b, 0x0c, 0x0d, 0x0e, 0x0f }, + /* ct */ + { 0x37, 0xdf, 0x8c, 0xe1, 0x5b, 0x48, 0x9b, 0xf3, + 0x1d, 0x0f, 0xc4, 0x4d, 0xa1, 0xfa, 0xf6, 0xd6 }, + /* tag */ + { 0xdf, 0xb7, 0x63, 0xeb, 0xdb, 0x5f, 0x0e, 0x71, + 0x9c, 0x7b, 0x41, 0x61, 0x80, 0x80, 0x04, 0xdf }, +}, + + /* OCB-AES-128-20B */ +{ + 20, + /* key */ + { 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07, + 0x08, 0x09, 0x0a, 0x0b, 0x0c, 0x0d, 0x0e, 0x0f }, + /* nonce */ + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x01 }, + /* pt */ + { 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07, + 0x08, 0x09, 0x0a, 0x0b, 0x0c, 0x0d, 0x0e, 0x0f, + 0x10, 0x11, 0x12, 0x13 }, + /* ct */ + { 0x01, 0xa0, 0x75, 0xf0, 0xd8, 0x15, 0xb1, 0xa4, + 0xe9, 0xc8, 0x81, 0xa1, 0xbc, 0xff, 0xc3, 0xeb, + 0x70, 0x03, 0xeb, 0x55}, + /* tag */ + { 0x75, 0x30, 0x84, 0x14, 0x4e, 0xb6, 0x3b, 0x77, + 0x0b, 0x06, 0x3c, 0x2e, 0x23, 0xcd, 0xa0, 0xbb }, +}, + + /* OCB-AES-128-32B */ +{ + 32, + /* key */ + { 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07, + 0x08, 0x09, 0x0a, 0x0b, 0x0c, 0x0d, 0x0e, 0x0f }, + /* nonce */ + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x01 }, + /* pt */ + { 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07, + 0x08, 0x09, 0x0a, 0x0b, 0x0c, 0x0d, 0x0e, 0x0f, + 0x10, 0x11, 0x12, 0x13, 0x14, 0x15, 0x16, 0x17, + 0x18, 0x19, 0x1a, 0x1b, 0x1c, 0x1d, 0x1e, 0x1f }, + /* ct */ + { 0x01, 0xa0, 0x75, 0xf0, 0xd8, 0x15, 0xb1, 0xa4, + 0xe9, 0xc8, 0x81, 0xa1, 0xbc, 0xff, 0xc3, 0xeb, + 0x4a, 0xfc, 0xbb, 0x7f, 0xed, 0xc0, 0x8c, 0xa8, + 0x65, 0x4c, 0x6d, 0x30, 0x4d, 0x16, 0x12, 0xfa }, + + /* tag */ + { 0xc1, 0x4c, 0xbf, 0x2c, 0x1a, 0x1f, 0x1c, 0x3c, + 0x13, 0x7e, 0xad, 0xea, 0x1f, 0x2f, 0x2f, 0xcf }, +}, + + /* OCB-AES-128-34B */ +{ + 34, + /* key */ + { 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07, + 0x08, 0x09, 0x0a, 0x0b, 0x0c, 0x0d, 0x0e, 0x0f }, + /* nonce */ + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x01 }, + /* pt */ + { 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07, + 0x08, 0x09, 0x0a, 0x0b, 0x0c, 0x0d, 0x0e, 0x0f, + 0x10, 0x11, 0x12, 0x13, 0x14, 0x15, 0x16, 0x17, + 0x18, 0x19, 0x1a, 0x1b, 0x1c, 0x1d, 0x1e, 0x1f, + 0x20, 0x21 }, + /* ct */ + { 0x01, 0xa0, 0x75, 0xf0, 0xd8, 0x15, 0xb1, 0xa4, + 0xe9, 0xc8, 0x81, 0xa1, 0xbc, 0xff, 0xc3, 0xeb, + 0xd4, 0x90, 0x3d, 0xd0, 0x02, 0x5b, 0xa4, 0xaa, + 0x83, 0x7c, 0x74, 0xf1, 0x21, 0xb0, 0x26, 0x0f, + 0xa9, 0x5d }, + + /* tag */ + { 0xcf, 0x83, 0x41, 0xbb, 0x10, 0x82, 0x0c, 0xcf, + 0x14, 0xbd, 0xec, 0x56, 0xb8, 0xd7, 0xd6, 0xab }, +}, + +}; + + int err, x, idx, res; + unsigned long len; + unsigned char outct[MAXBLOCKSIZE], outtag[MAXBLOCKSIZE]; + + /* AES can be under rijndael or aes... try to find it */ + if ((idx = find_cipher("aes")) == -1) { + if ((idx = find_cipher("rijndael")) == -1) { + return CRYPT_NOP; + } + } + + for (x = 0; x < (int)(sizeof(tests)/sizeof(tests[0])); x++) { + len = sizeof(outtag); + if ((err = ocb_encrypt_authenticate_memory(idx, tests[x].key, 16, + tests[x].nonce, tests[x].pt, tests[x].ptlen, outct, outtag, &len)) != CRYPT_OK) { + return err; + } + + if (XMEMCMP(outtag, tests[x].tag, len) || XMEMCMP(outct, tests[x].ct, tests[x].ptlen)) { +#if 0 + unsigned long y; + printf("\n\nFailure: \nCT:\n"); + for (y = 0; y < (unsigned long)tests[x].ptlen; ) { + printf("0x%02x", outct[y]); + if (y < (unsigned long)(tests[x].ptlen-1)) printf(", "); + if (!(++y % 8)) printf("\n"); + } + printf("\nTAG:\n"); + for (y = 0; y < len; ) { + printf("0x%02x", outtag[y]); + if (y < len-1) printf(", "); + if (!(++y % 8)) printf("\n"); + } +#endif + return CRYPT_FAIL_TESTVECTOR; + } + + if ((err = ocb_decrypt_verify_memory(idx, tests[x].key, 16, tests[x].nonce, outct, tests[x].ptlen, + outct, tests[x].tag, len, &res)) != CRYPT_OK) { + return err; + } + if ((res != 1) || XMEMCMP(tests[x].pt, outct, tests[x].ptlen)) { +#if 0 + unsigned long y; + printf("\n\nFailure-decrypt: \nPT:\n"); + for (y = 0; y < (unsigned long)tests[x].ptlen; ) { + printf("0x%02x", outct[y]); + if (y < (unsigned long)(tests[x].ptlen-1)) printf(", "); + if (!(++y % 8)) printf("\n"); + } + printf("\nres = %d\n\n", res); +#endif + } + } + return CRYPT_OK; +#endif /* LTC_TEST */ +} + +#endif /* OCB_MODE */ + + +/* some comments + + -- it's hard to seek + -- hard to stream [you can't emit ciphertext until full block] + -- The setup is somewhat complicated... +*/ + +/* $Source: /cvs/libtom/libtomcrypt/src/encauth/ocb/ocb_test.c,v $ */ +/* $Revision: 1.5 $ */ +/* $Date: 2006/11/01 09:28:17 $ */ diff --git a/libtomcrypt/src/encauth/ocb/s_ocb_done.c b/libtomcrypt/src/encauth/ocb/s_ocb_done.c new file mode 100644 index 0000000..7688a42 --- /dev/null +++ b/libtomcrypt/src/encauth/ocb/s_ocb_done.c @@ -0,0 +1,148 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ + +/** + @file s_ocb_done.c + OCB implementation, internal helper, by Tom St Denis +*/ +#include "tomcrypt.h" + +#ifdef OCB_MODE + +/* Since the last block is encrypted in CTR mode the same code can + * be used to finish a decrypt or encrypt stream. The only difference + * is we XOR the final ciphertext into the checksum so we have to xor it + * before we CTR [decrypt] or after [encrypt] + * + * the names pt/ptlen/ct really just mean in/inlen/out but this is the way I wrote it... + */ + +/** + Shared code to finish an OCB stream + @param ocb The OCB state + @param pt The remaining plaintext [or input] + @param ptlen The length of the input (octets) + @param ct [out] The output buffer + @param tag [out] The destination for the authentication tag + @param taglen [in/out] The max size and resulting size of the authentication tag + @param mode The mode we are terminating, 0==encrypt, 1==decrypt + @return CRYPT_OK if successful +*/ +int s_ocb_done(ocb_state *ocb, const unsigned char *pt, unsigned long ptlen, + unsigned char *ct, unsigned char *tag, unsigned long *taglen, int mode) + +{ + unsigned char *Z, *Y, *X; + int err, x; + + LTC_ARGCHK(ocb != NULL); + LTC_ARGCHK(pt != NULL); + LTC_ARGCHK(ct != NULL); + LTC_ARGCHK(tag != NULL); + LTC_ARGCHK(taglen != NULL); + if ((err = cipher_is_valid(ocb->cipher)) != CRYPT_OK) { + return err; + } + if (ocb->block_len != cipher_descriptor[ocb->cipher].block_length || + (int)ptlen > ocb->block_len || (int)ptlen < 0) { + return CRYPT_INVALID_ARG; + } + + /* allocate ram */ + Z = XMALLOC(MAXBLOCKSIZE); + Y = XMALLOC(MAXBLOCKSIZE); + X = XMALLOC(MAXBLOCKSIZE); + if (X == NULL || Y == NULL || Z == NULL) { + if (X != NULL) { + XFREE(X); + } + if (Y != NULL) { + XFREE(Y); + } + if (Z != NULL) { + XFREE(Z); + } + return CRYPT_MEM; + } + + /* compute X[m] = len(pt[m]) XOR Lr XOR Z[m] */ + ocb_shift_xor(ocb, X); + XMEMCPY(Z, X, ocb->block_len); + + X[ocb->block_len-1] ^= (ptlen*8)&255; + X[ocb->block_len-2] ^= ((ptlen*8)>>8)&255; + for (x = 0; x < ocb->block_len; x++) { + X[x] ^= ocb->Lr[x]; + } + + /* Y[m] = E(X[m])) */ + if ((err = cipher_descriptor[ocb->cipher].ecb_encrypt(X, Y, &ocb->key)) != CRYPT_OK) { + goto error; + } + + if (mode == 1) { + /* decrypt mode, so let's xor it first */ + /* xor C[m] into checksum */ + for (x = 0; x < (int)ptlen; x++) { + ocb->checksum[x] ^= ct[x]; + } + } + + /* C[m] = P[m] xor Y[m] */ + for (x = 0; x < (int)ptlen; x++) { + ct[x] = pt[x] ^ Y[x]; + } + + if (mode == 0) { + /* encrypt mode */ + /* xor C[m] into checksum */ + for (x = 0; x < (int)ptlen; x++) { + ocb->checksum[x] ^= ct[x]; + } + } + + /* xor Y[m] and Z[m] into checksum */ + for (x = 0; x < ocb->block_len; x++) { + ocb->checksum[x] ^= Y[x] ^ Z[x]; + } + + /* encrypt checksum, er... tag!! */ + if ((err = cipher_descriptor[ocb->cipher].ecb_encrypt(ocb->checksum, X, &ocb->key)) != CRYPT_OK) { + goto error; + } + cipher_descriptor[ocb->cipher].done(&ocb->key); + + /* now store it */ + for (x = 0; x < ocb->block_len && x < (int)*taglen; x++) { + tag[x] = X[x]; + } + *taglen = x; + +#ifdef LTC_CLEAN_STACK + zeromem(X, MAXBLOCKSIZE); + zeromem(Y, MAXBLOCKSIZE); + zeromem(Z, MAXBLOCKSIZE); + zeromem(ocb, sizeof(*ocb)); +#endif +error: + XFREE(X); + XFREE(Y); + XFREE(Z); + + return err; +} + +#endif + + +/* $Source: /cvs/libtom/libtomcrypt/src/encauth/ocb/s_ocb_done.c,v $ */ +/* $Revision: 1.6 $ */ +/* $Date: 2006/03/31 14:15:35 $ */ diff --git a/libtomcrypt/src/hashes/chc/chc.c b/libtomcrypt/src/hashes/chc/chc.c new file mode 100644 index 0000000..3f86270 --- /dev/null +++ b/libtomcrypt/src/hashes/chc/chc.c @@ -0,0 +1,298 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ + +#include "tomcrypt.h" + +/** + @file chc.c + CHC support. (Tom St Denis) +*/ + +#ifdef CHC_HASH + +#define UNDEFED_HASH -17 + +/* chc settings */ +static int cipher_idx=UNDEFED_HASH, /* which cipher */ + cipher_blocksize; /* blocksize of cipher */ + + +const struct ltc_hash_descriptor chc_desc = { + "chc_hash", 12, 0, 0, { 0 }, 0, + &chc_init, + &chc_process, + &chc_done, + &chc_test, + NULL +}; + +/** + Initialize the CHC state with a given cipher + @param cipher The index of the cipher you wish to bind + @return CRYPT_OK if successful +*/ +int chc_register(int cipher) +{ + int err, kl, idx; + + if ((err = cipher_is_valid(cipher)) != CRYPT_OK) { + return err; + } + + /* will it be valid? */ + kl = cipher_descriptor[cipher].block_length; + + /* must be >64 bit block */ + if (kl <= 8) { + return CRYPT_INVALID_CIPHER; + } + + /* can we use the ideal keysize? */ + if ((err = cipher_descriptor[cipher].keysize(&kl)) != CRYPT_OK) { + return err; + } + /* we require that key size == block size be a valid choice */ + if (kl != cipher_descriptor[cipher].block_length) { + return CRYPT_INVALID_CIPHER; + } + + /* determine if chc_hash has been register_hash'ed already */ + if ((err = hash_is_valid(idx = find_hash("chc_hash"))) != CRYPT_OK) { + return err; + } + + /* store into descriptor */ + hash_descriptor[idx].hashsize = + hash_descriptor[idx].blocksize = cipher_descriptor[cipher].block_length; + + /* store the idx and block size */ + cipher_idx = cipher; + cipher_blocksize = cipher_descriptor[cipher].block_length; + return CRYPT_OK; +} + +/** + Initialize the hash state + @param md The hash state you wish to initialize + @return CRYPT_OK if successful +*/ +int chc_init(hash_state *md) +{ + symmetric_key *key; + unsigned char buf[MAXBLOCKSIZE]; + int err; + + LTC_ARGCHK(md != NULL); + + /* is the cipher valid? */ + if ((err = cipher_is_valid(cipher_idx)) != CRYPT_OK) { + return err; + } + + if (cipher_blocksize != cipher_descriptor[cipher_idx].block_length) { + return CRYPT_INVALID_CIPHER; + } + + if ((key = XMALLOC(sizeof(*key))) == NULL) { + return CRYPT_MEM; + } + + /* zero key and what not */ + zeromem(buf, cipher_blocksize); + if ((err = cipher_descriptor[cipher_idx].setup(buf, cipher_blocksize, 0, key)) != CRYPT_OK) { + XFREE(key); + return err; + } + + /* encrypt zero block */ + cipher_descriptor[cipher_idx].ecb_encrypt(buf, md->chc.state, key); + + /* zero other members */ + md->chc.length = 0; + md->chc.curlen = 0; + zeromem(md->chc.buf, sizeof(md->chc.buf)); + XFREE(key); + return CRYPT_OK; +} + +/* + key <= state + T0,T1 <= block + T0 <= encrypt T0 + state <= state xor T0 xor T1 +*/ +static int chc_compress(hash_state *md, unsigned char *buf) +{ + unsigned char T[2][MAXBLOCKSIZE]; + symmetric_key *key; + int err, x; + + if ((key = XMALLOC(sizeof(*key))) == NULL) { + return CRYPT_MEM; + } + if ((err = cipher_descriptor[cipher_idx].setup(md->chc.state, cipher_blocksize, 0, key)) != CRYPT_OK) { + XFREE(key); + return err; + } + XMEMCPY(T[1], buf, cipher_blocksize); + cipher_descriptor[cipher_idx].ecb_encrypt(buf, T[0], key); + for (x = 0; x < cipher_blocksize; x++) { + md->chc.state[x] ^= T[0][x] ^ T[1][x]; + } + XFREE(key); +#ifdef LTC_CLEAN_STACK + zeromem(T, sizeof(T)); + zeromem(&key, sizeof(key)); +#endif + return CRYPT_OK; +} + +/* function for processing blocks */ +int _chc_process(hash_state * md, const unsigned char *buf, unsigned long len); +HASH_PROCESS(_chc_process, chc_compress, chc, (unsigned long)cipher_blocksize) + +/** + Process a block of memory though the hash + @param md The hash state + @param in The data to hash + @param inlen The length of the data (octets) + @return CRYPT_OK if successful +*/ +int chc_process(hash_state * md, const unsigned char *in, unsigned long inlen) +{ + int err; + + LTC_ARGCHK(md != NULL); + LTC_ARGCHK(in != NULL); + + /* is the cipher valid? */ + if ((err = cipher_is_valid(cipher_idx)) != CRYPT_OK) { + return err; + } + if (cipher_blocksize != cipher_descriptor[cipher_idx].block_length) { + return CRYPT_INVALID_CIPHER; + } + + return _chc_process(md, in, inlen); +} + +/** + Terminate the hash to get the digest + @param md The hash state + @param out [out] The destination of the hash (length of the block size of the block cipher) + @return CRYPT_OK if successful +*/ +int chc_done(hash_state *md, unsigned char *out) +{ + int err; + + LTC_ARGCHK(md != NULL); + LTC_ARGCHK(out != NULL); + + /* is the cipher valid? */ + if ((err = cipher_is_valid(cipher_idx)) != CRYPT_OK) { + return err; + } + if (cipher_blocksize != cipher_descriptor[cipher_idx].block_length) { + return CRYPT_INVALID_CIPHER; + } + + if (md->chc.curlen >= sizeof(md->chc.buf)) { + return CRYPT_INVALID_ARG; + } + + /* increase the length of the message */ + md->chc.length += md->chc.curlen * 8; + + /* append the '1' bit */ + md->chc.buf[md->chc.curlen++] = (unsigned char)0x80; + + /* if the length is currently above l-8 bytes we append zeros + * then compress. Then we can fall back to padding zeros and length + * encoding like normal. + */ + if (md->chc.curlen > (unsigned long)(cipher_blocksize - 8)) { + while (md->chc.curlen < (unsigned long)cipher_blocksize) { + md->chc.buf[md->chc.curlen++] = (unsigned char)0; + } + chc_compress(md, md->chc.buf); + md->chc.curlen = 0; + } + + /* pad upto l-8 bytes of zeroes */ + while (md->chc.curlen < (unsigned long)(cipher_blocksize - 8)) { + md->chc.buf[md->chc.curlen++] = (unsigned char)0; + } + + /* store length */ + STORE64L(md->chc.length, md->chc.buf+(cipher_blocksize-8)); + chc_compress(md, md->chc.buf); + + /* copy output */ + XMEMCPY(out, md->chc.state, cipher_blocksize); + +#ifdef LTC_CLEAN_STACK + zeromem(md, sizeof(hash_state)); +#endif + return CRYPT_OK; +} + +/** + Self-test the hash + @return CRYPT_OK if successful, CRYPT_NOP if self-tests have been disabled +*/ +int chc_test(void) +{ + static const struct { + unsigned char *msg, + md[MAXBLOCKSIZE]; + int len; + } tests[] = { +{ + (unsigned char *)"hello world", + { 0xcf, 0x57, 0x9d, 0xc3, 0x0a, 0x0e, 0xea, 0x61, + 0x0d, 0x54, 0x47, 0xc4, 0x3c, 0x06, 0xf5, 0x4e }, + 16 +} +}; + int x, oldhashidx, idx; + unsigned char out[MAXBLOCKSIZE]; + hash_state md; + + /* AES can be under rijndael or aes... try to find it */ + if ((idx = find_cipher("aes")) == -1) { + if ((idx = find_cipher("rijndael")) == -1) { + return CRYPT_NOP; + } + } + oldhashidx = cipher_idx; + chc_register(idx); + + for (x = 0; x < (int)(sizeof(tests)/sizeof(tests[0])); x++) { + chc_init(&md); + chc_process(&md, tests[x].msg, strlen((char *)tests[x].msg)); + chc_done(&md, out); + if (XMEMCMP(out, tests[x].md, tests[x].len)) { + return CRYPT_FAIL_TESTVECTOR; + } + } + if (oldhashidx != UNDEFED_HASH) { + chc_register(oldhashidx); + } + + return CRYPT_OK; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/hashes/chc/chc.c,v $ */ +/* $Revision: 1.6 $ */ +/* $Date: 2006/11/01 09:28:17 $ */ diff --git a/libtomcrypt/src/hashes/helper/hash_file.c b/libtomcrypt/src/hashes/helper/hash_file.c new file mode 100644 index 0000000..a92025c --- /dev/null +++ b/libtomcrypt/src/hashes/helper/hash_file.c @@ -0,0 +1,57 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file hash_file.c + Hash a file, Tom St Denis +*/ + +/** + @param hash The index of the hash desired + @param fname The name of the file you wish to hash + @param out [out] The destination of the digest + @param outlen [in/out] The max size and resulting size of the message digest + @result CRYPT_OK if successful +*/ +int hash_file(int hash, const char *fname, unsigned char *out, unsigned long *outlen) +{ +#ifdef LTC_NO_FILE + return CRYPT_NOP; +#else + FILE *in; + int err; + LTC_ARGCHK(fname != NULL); + LTC_ARGCHK(out != NULL); + LTC_ARGCHK(outlen != NULL); + + if ((err = hash_is_valid(hash)) != CRYPT_OK) { + return err; + } + + in = fopen(fname, "rb"); + if (in == NULL) { + return CRYPT_FILE_NOTFOUND; + } + + err = hash_filehandle(hash, in, out, outlen); + if (fclose(in) != 0) { + return CRYPT_ERROR; + } + + return err; +#endif +} + + +/* $Source: /cvs/libtom/libtomcrypt/src/hashes/helper/hash_file.c,v $ */ +/* $Revision: 1.4 $ */ +/* $Date: 2006/03/31 14:15:35 $ */ diff --git a/libtomcrypt/src/hashes/helper/hash_filehandle.c b/libtomcrypt/src/hashes/helper/hash_filehandle.c new file mode 100644 index 0000000..be2cbf9 --- /dev/null +++ b/libtomcrypt/src/hashes/helper/hash_filehandle.c @@ -0,0 +1,71 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file hash_filehandle.c + Hash open files, Tom St Denis +*/ + +/** + Hash data from an open file handle. + @param hash The index of the hash you want to use + @param in The FILE* handle of the file you want to hash + @param out [out] The destination of the digest + @param outlen [in/out] The max size and resulting size of the digest + @result CRYPT_OK if successful +*/ +int hash_filehandle(int hash, FILE *in, unsigned char *out, unsigned long *outlen) +{ +#ifdef LTC_NO_FILE + return CRYPT_NOP; +#else + hash_state md; + unsigned char buf[512]; + size_t x; + int err; + + LTC_ARGCHK(out != NULL); + LTC_ARGCHK(outlen != NULL); + LTC_ARGCHK(in != NULL); + + if ((err = hash_is_valid(hash)) != CRYPT_OK) { + return err; + } + + if (*outlen < hash_descriptor[hash].hashsize) { + *outlen = hash_descriptor[hash].hashsize; + return CRYPT_BUFFER_OVERFLOW; + } + if ((err = hash_descriptor[hash].init(&md)) != CRYPT_OK) { + return err; + } + + *outlen = hash_descriptor[hash].hashsize; + do { + x = fread(buf, 1, sizeof(buf), in); + if ((err = hash_descriptor[hash].process(&md, buf, x)) != CRYPT_OK) { + return err; + } + } while (x == sizeof(buf)); + err = hash_descriptor[hash].done(&md, out); + +#ifdef LTC_CLEAN_STACK + zeromem(buf, sizeof(buf)); +#endif + return err; +#endif +} + + +/* $Source: /cvs/libtom/libtomcrypt/src/hashes/helper/hash_filehandle.c,v $ */ +/* $Revision: 1.5 $ */ +/* $Date: 2006/06/16 21:53:41 $ */ diff --git a/libtomcrypt/src/hashes/helper/hash_memory.c b/libtomcrypt/src/hashes/helper/hash_memory.c new file mode 100644 index 0000000..def9fa7 --- /dev/null +++ b/libtomcrypt/src/hashes/helper/hash_memory.c @@ -0,0 +1,69 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file hash_memory.c + Hash memory helper, Tom St Denis +*/ + +/** + Hash a block of memory and store the digest. + @param hash The index of the hash you wish to use + @param in The data you wish to hash + @param inlen The length of the data to hash (octets) + @param out [out] Where to store the digest + @param outlen [in/out] Max size and resulting size of the digest + @return CRYPT_OK if successful +*/ +int hash_memory(int hash, const unsigned char *in, unsigned long inlen, unsigned char *out, unsigned long *outlen) +{ + hash_state *md; + int err; + + LTC_ARGCHK(in != NULL); + LTC_ARGCHK(out != NULL); + LTC_ARGCHK(outlen != NULL); + + if ((err = hash_is_valid(hash)) != CRYPT_OK) { + return err; + } + + if (*outlen < hash_descriptor[hash].hashsize) { + *outlen = hash_descriptor[hash].hashsize; + return CRYPT_BUFFER_OVERFLOW; + } + + md = XMALLOC(sizeof(hash_state)); + if (md == NULL) { + return CRYPT_MEM; + } + + if ((err = hash_descriptor[hash].init(md)) != CRYPT_OK) { + goto LBL_ERR; + } + if ((err = hash_descriptor[hash].process(md, in, inlen)) != CRYPT_OK) { + goto LBL_ERR; + } + err = hash_descriptor[hash].done(md, out); + *outlen = hash_descriptor[hash].hashsize; +LBL_ERR: +#ifdef LTC_CLEAN_STACK + zeromem(md, sizeof(hash_state)); +#endif + XFREE(md); + + return err; +} + +/* $Source: /cvs/libtom/libtomcrypt/src/hashes/helper/hash_memory.c,v $ */ +/* $Revision: 1.5 $ */ +/* $Date: 2006/06/16 21:53:41 $ */ diff --git a/libtomcrypt/src/hashes/helper/hash_memory_multi.c b/libtomcrypt/src/hashes/helper/hash_memory_multi.c new file mode 100644 index 0000000..91f2d0c --- /dev/null +++ b/libtomcrypt/src/hashes/helper/hash_memory_multi.c @@ -0,0 +1,87 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" +#include <stdarg.h> +/** + @file hash_memory_multi.c + Hash (multiple buffers) memory helper, Tom St Denis +*/ + +/** + Hash multiple (non-adjacent) blocks of memory at once. + @param hash The index of the hash you wish to use + @param out [out] Where to store the digest + @param outlen [in/out] Max size and resulting size of the digest + @param in The data you wish to hash + @param inlen The length of the data to hash (octets) + @param ... tuples of (data,len) pairs to hash, terminated with a (NULL,x) (x=don't care) + @return CRYPT_OK if successful +*/ +int hash_memory_multi(int hash, unsigned char *out, unsigned long *outlen, + const unsigned char *in, unsigned long inlen, ...) +{ + hash_state *md; + int err; + va_list args; + const unsigned char *curptr; + unsigned long curlen; + + LTC_ARGCHK(in != NULL); + LTC_ARGCHK(out != NULL); + LTC_ARGCHK(outlen != NULL); + + if ((err = hash_is_valid(hash)) != CRYPT_OK) { + return err; + } + + if (*outlen < hash_descriptor[hash].hashsize) { + *outlen = hash_descriptor[hash].hashsize; + return CRYPT_BUFFER_OVERFLOW; + } + + md = XMALLOC(sizeof(hash_state)); + if (md == NULL) { + return CRYPT_MEM; + } + + if ((err = hash_descriptor[hash].init(md)) != CRYPT_OK) { + goto LBL_ERR; + } + + va_start(args, inlen); + curptr = in; + curlen = inlen; + for (;;) { + /* process buf */ + if ((err = hash_descriptor[hash].process(md, curptr, curlen)) != CRYPT_OK) { + goto LBL_ERR; + } + /* step to next */ + curptr = va_arg(args, const unsigned char*); + if (curptr == NULL) { + break; + } + curlen = va_arg(args, unsigned long); + } + err = hash_descriptor[hash].done(md, out); + *outlen = hash_descriptor[hash].hashsize; +LBL_ERR: +#ifdef LTC_CLEAN_STACK + zeromem(md, sizeof(hash_state)); +#endif + XFREE(md); + va_end(args); + return err; +} + +/* $Source: /cvs/libtom/libtomcrypt/src/hashes/helper/hash_memory_multi.c,v $ */ +/* $Revision: 1.5 $ */ +/* $Date: 2006/06/16 21:53:41 $ */ diff --git a/libtomcrypt/src/hashes/md2.c b/libtomcrypt/src/hashes/md2.c new file mode 100644 index 0000000..b917213 --- /dev/null +++ b/libtomcrypt/src/hashes/md2.c @@ -0,0 +1,251 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @param md2.c + MD2 (RFC 1319) hash function implementation by Tom St Denis +*/ + +#ifdef MD2 + +const struct ltc_hash_descriptor md2_desc = +{ + "md2", + 7, + 16, + 16, + + /* OID */ + { 1, 2, 840, 113549, 2, 2, }, + 6, + + &md2_init, + &md2_process, + &md2_done, + &md2_test, + NULL +}; + +static const unsigned char PI_SUBST[256] = { + 41, 46, 67, 201, 162, 216, 124, 1, 61, 54, 84, 161, 236, 240, 6, + 19, 98, 167, 5, 243, 192, 199, 115, 140, 152, 147, 43, 217, 188, + 76, 130, 202, 30, 155, 87, 60, 253, 212, 224, 22, 103, 66, 111, 24, + 138, 23, 229, 18, 190, 78, 196, 214, 218, 158, 222, 73, 160, 251, + 245, 142, 187, 47, 238, 122, 169, 104, 121, 145, 21, 178, 7, 63, + 148, 194, 16, 137, 11, 34, 95, 33, 128, 127, 93, 154, 90, 144, 50, + 39, 53, 62, 204, 231, 191, 247, 151, 3, 255, 25, 48, 179, 72, 165, + 181, 209, 215, 94, 146, 42, 172, 86, 170, 198, 79, 184, 56, 210, + 150, 164, 125, 182, 118, 252, 107, 226, 156, 116, 4, 241, 69, 157, + 112, 89, 100, 113, 135, 32, 134, 91, 207, 101, 230, 45, 168, 2, 27, + 96, 37, 173, 174, 176, 185, 246, 28, 70, 97, 105, 52, 64, 126, 15, + 85, 71, 163, 35, 221, 81, 175, 58, 195, 92, 249, 206, 186, 197, + 234, 38, 44, 83, 13, 110, 133, 40, 132, 9, 211, 223, 205, 244, 65, + 129, 77, 82, 106, 220, 55, 200, 108, 193, 171, 250, 36, 225, 123, + 8, 12, 189, 177, 74, 120, 136, 149, 139, 227, 99, 232, 109, 233, + 203, 213, 254, 59, 0, 29, 57, 242, 239, 183, 14, 102, 88, 208, 228, + 166, 119, 114, 248, 235, 117, 75, 10, 49, 68, 80, 180, 143, 237, + 31, 26, 219, 153, 141, 51, 159, 17, 131, 20 +}; + +/* adds 16 bytes to the checksum */ +static void md2_update_chksum(hash_state *md) +{ + int j; + unsigned char L; + L = md->md2.chksum[15]; + for (j = 0; j < 16; j++) { + +/* caution, the RFC says its "C[j] = S[M[i*16+j] xor L]" but the reference source code [and test vectors] say + otherwise. +*/ + L = (md->md2.chksum[j] ^= PI_SUBST[(int)(md->md2.buf[j] ^ L)] & 255); + } +} + +static void md2_compress(hash_state *md) +{ + int j, k; + unsigned char t; + + /* copy block */ + for (j = 0; j < 16; j++) { + md->md2.X[16+j] = md->md2.buf[j]; + md->md2.X[32+j] = md->md2.X[j] ^ md->md2.X[16+j]; + } + + t = (unsigned char)0; + + /* do 18 rounds */ + for (j = 0; j < 18; j++) { + for (k = 0; k < 48; k++) { + t = (md->md2.X[k] ^= PI_SUBST[(int)(t & 255)]); + } + t = (t + (unsigned char)j) & 255; + } +} + +/** + Initialize the hash state + @param md The hash state you wish to initialize + @return CRYPT_OK if successful +*/ +int md2_init(hash_state *md) +{ + LTC_ARGCHK(md != NULL); + + /* MD2 uses a zero'ed state... */ + zeromem(md->md2.X, sizeof(md->md2.X)); + zeromem(md->md2.chksum, sizeof(md->md2.chksum)); + zeromem(md->md2.buf, sizeof(md->md2.buf)); + md->md2.curlen = 0; + return CRYPT_OK; +} + +/** + Process a block of memory though the hash + @param md The hash state + @param in The data to hash + @param inlen The length of the data (octets) + @return CRYPT_OK if successful +*/ +int md2_process(hash_state *md, const unsigned char *in, unsigned long inlen) +{ + unsigned long n; + LTC_ARGCHK(md != NULL); + LTC_ARGCHK(in != NULL); + if (md-> md2 .curlen > sizeof(md-> md2 .buf)) { + return CRYPT_INVALID_ARG; + } + while (inlen > 0) { + n = MIN(inlen, (16 - md->md2.curlen)); + XMEMCPY(md->md2.buf + md->md2.curlen, in, (size_t)n); + md->md2.curlen += n; + in += n; + inlen -= n; + + /* is 16 bytes full? */ + if (md->md2.curlen == 16) { + md2_compress(md); + md2_update_chksum(md); + md->md2.curlen = 0; + } + } + return CRYPT_OK; +} + +/** + Terminate the hash to get the digest + @param md The hash state + @param out [out] The destination of the hash (16 bytes) + @return CRYPT_OK if successful +*/ +int md2_done(hash_state * md, unsigned char *out) +{ + unsigned long i, k; + + LTC_ARGCHK(md != NULL); + LTC_ARGCHK(out != NULL); + + if (md->md2.curlen >= sizeof(md->md2.buf)) { + return CRYPT_INVALID_ARG; + } + + + /* pad the message */ + k = 16 - md->md2.curlen; + for (i = md->md2.curlen; i < 16; i++) { + md->md2.buf[i] = (unsigned char)k; + } + + /* hash and update */ + md2_compress(md); + md2_update_chksum(md); + + /* hash checksum */ + XMEMCPY(md->md2.buf, md->md2.chksum, 16); + md2_compress(md); + + /* output is lower 16 bytes of X */ + XMEMCPY(out, md->md2.X, 16); + +#ifdef LTC_CLEAN_STACK + zeromem(md, sizeof(hash_state)); +#endif + return CRYPT_OK; +} + +/** + Self-test the hash + @return CRYPT_OK if successful, CRYPT_NOP if self-tests have been disabled +*/ +int md2_test(void) +{ + #ifndef LTC_TEST + return CRYPT_NOP; + #else + static const struct { + char *msg; + unsigned char md[16]; + } tests[] = { + { "", + {0x83,0x50,0xe5,0xa3,0xe2,0x4c,0x15,0x3d, + 0xf2,0x27,0x5c,0x9f,0x80,0x69,0x27,0x73 + } + }, + { "a", + {0x32,0xec,0x01,0xec,0x4a,0x6d,0xac,0x72, + 0xc0,0xab,0x96,0xfb,0x34,0xc0,0xb5,0xd1 + } + }, + { "message digest", + {0xab,0x4f,0x49,0x6b,0xfb,0x2a,0x53,0x0b, + 0x21,0x9f,0xf3,0x30,0x31,0xfe,0x06,0xb0 + } + }, + { "abcdefghijklmnopqrstuvwxyz", + {0x4e,0x8d,0xdf,0xf3,0x65,0x02,0x92,0xab, + 0x5a,0x41,0x08,0xc3,0xaa,0x47,0x94,0x0b + } + }, + { "ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789", + {0xda,0x33,0xde,0xf2,0xa4,0x2d,0xf1,0x39, + 0x75,0x35,0x28,0x46,0xc3,0x03,0x38,0xcd + } + }, + { "12345678901234567890123456789012345678901234567890123456789012345678901234567890", + {0xd5,0x97,0x6f,0x79,0xd8,0x3d,0x3a,0x0d, + 0xc9,0x80,0x6c,0x3c,0x66,0xf3,0xef,0xd8 + } + } + }; + int i; + hash_state md; + unsigned char buf[16]; + + for (i = 0; i < (int)(sizeof(tests) / sizeof(tests[0])); i++) { + md2_init(&md); + md2_process(&md, (unsigned char*)tests[i].msg, (unsigned long)strlen(tests[i].msg)); + md2_done(&md, buf); + if (XMEMCMP(buf, tests[i].md, 16) != 0) { + return CRYPT_FAIL_TESTVECTOR; + } + } + return CRYPT_OK; + #endif +} + +#endif + + +/* $Source: /cvs/libtom/libtomcrypt/src/hashes/md2.c,v $ */ +/* $Revision: 1.8 $ */ +/* $Date: 2006/11/01 09:28:17 $ */ diff --git a/libtomcrypt/src/hashes/md4.c b/libtomcrypt/src/hashes/md4.c new file mode 100644 index 0000000..42645ef --- /dev/null +++ b/libtomcrypt/src/hashes/md4.c @@ -0,0 +1,307 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @param md4.c + Submitted by Dobes Vandermeer (dobes@smartt.com) +*/ + +#ifdef MD4 + +const struct ltc_hash_descriptor md4_desc = +{ + "md4", + 6, + 16, + 64, + + /* OID */ + { 1, 2, 840, 113549, 2, 4, }, + 6, + + &md4_init, + &md4_process, + &md4_done, + &md4_test, + NULL +}; + +#define S11 3 +#define S12 7 +#define S13 11 +#define S14 19 +#define S21 3 +#define S22 5 +#define S23 9 +#define S24 13 +#define S31 3 +#define S32 9 +#define S33 11 +#define S34 15 + +/* F, G and H are basic MD4 functions. */ +#define F(x, y, z) (z ^ (x & (y ^ z))) +#define G(x, y, z) ((x & y) | (z & (x | y))) +#define H(x, y, z) ((x) ^ (y) ^ (z)) + +/* ROTATE_LEFT rotates x left n bits. */ +#define ROTATE_LEFT(x, n) ROLc(x, n) + +/* FF, GG and HH are transformations for rounds 1, 2 and 3 */ +/* Rotation is separate from addition to prevent recomputation */ + +#define FF(a, b, c, d, x, s) { \ + (a) += F ((b), (c), (d)) + (x); \ + (a) = ROTATE_LEFT ((a), (s)); \ + } +#define GG(a, b, c, d, x, s) { \ + (a) += G ((b), (c), (d)) + (x) + 0x5a827999UL; \ + (a) = ROTATE_LEFT ((a), (s)); \ + } +#define HH(a, b, c, d, x, s) { \ + (a) += H ((b), (c), (d)) + (x) + 0x6ed9eba1UL; \ + (a) = ROTATE_LEFT ((a), (s)); \ + } + +#ifdef LTC_CLEAN_STACK +static int _md4_compress(hash_state *md, unsigned char *buf) +#else +static int md4_compress(hash_state *md, unsigned char *buf) +#endif +{ + ulong32 x[16], a, b, c, d; + int i; + + /* copy state */ + a = md->md4.state[0]; + b = md->md4.state[1]; + c = md->md4.state[2]; + d = md->md4.state[3]; + + /* copy the state into 512-bits into W[0..15] */ + for (i = 0; i < 16; i++) { + LOAD32L(x[i], buf + (4*i)); + } + + /* Round 1 */ + FF (a, b, c, d, x[ 0], S11); /* 1 */ + FF (d, a, b, c, x[ 1], S12); /* 2 */ + FF (c, d, a, b, x[ 2], S13); /* 3 */ + FF (b, c, d, a, x[ 3], S14); /* 4 */ + FF (a, b, c, d, x[ 4], S11); /* 5 */ + FF (d, a, b, c, x[ 5], S12); /* 6 */ + FF (c, d, a, b, x[ 6], S13); /* 7 */ + FF (b, c, d, a, x[ 7], S14); /* 8 */ + FF (a, b, c, d, x[ 8], S11); /* 9 */ + FF (d, a, b, c, x[ 9], S12); /* 10 */ + FF (c, d, a, b, x[10], S13); /* 11 */ + FF (b, c, d, a, x[11], S14); /* 12 */ + FF (a, b, c, d, x[12], S11); /* 13 */ + FF (d, a, b, c, x[13], S12); /* 14 */ + FF (c, d, a, b, x[14], S13); /* 15 */ + FF (b, c, d, a, x[15], S14); /* 16 */ + + /* Round 2 */ + GG (a, b, c, d, x[ 0], S21); /* 17 */ + GG (d, a, b, c, x[ 4], S22); /* 18 */ + GG (c, d, a, b, x[ 8], S23); /* 19 */ + GG (b, c, d, a, x[12], S24); /* 20 */ + GG (a, b, c, d, x[ 1], S21); /* 21 */ + GG (d, a, b, c, x[ 5], S22); /* 22 */ + GG (c, d, a, b, x[ 9], S23); /* 23 */ + GG (b, c, d, a, x[13], S24); /* 24 */ + GG (a, b, c, d, x[ 2], S21); /* 25 */ + GG (d, a, b, c, x[ 6], S22); /* 26 */ + GG (c, d, a, b, x[10], S23); /* 27 */ + GG (b, c, d, a, x[14], S24); /* 28 */ + GG (a, b, c, d, x[ 3], S21); /* 29 */ + GG (d, a, b, c, x[ 7], S22); /* 30 */ + GG (c, d, a, b, x[11], S23); /* 31 */ + GG (b, c, d, a, x[15], S24); /* 32 */ + + /* Round 3 */ + HH (a, b, c, d, x[ 0], S31); /* 33 */ + HH (d, a, b, c, x[ 8], S32); /* 34 */ + HH (c, d, a, b, x[ 4], S33); /* 35 */ + HH (b, c, d, a, x[12], S34); /* 36 */ + HH (a, b, c, d, x[ 2], S31); /* 37 */ + HH (d, a, b, c, x[10], S32); /* 38 */ + HH (c, d, a, b, x[ 6], S33); /* 39 */ + HH (b, c, d, a, x[14], S34); /* 40 */ + HH (a, b, c, d, x[ 1], S31); /* 41 */ + HH (d, a, b, c, x[ 9], S32); /* 42 */ + HH (c, d, a, b, x[ 5], S33); /* 43 */ + HH (b, c, d, a, x[13], S34); /* 44 */ + HH (a, b, c, d, x[ 3], S31); /* 45 */ + HH (d, a, b, c, x[11], S32); /* 46 */ + HH (c, d, a, b, x[ 7], S33); /* 47 */ + HH (b, c, d, a, x[15], S34); /* 48 */ + + + /* Update our state */ + md->md4.state[0] = md->md4.state[0] + a; + md->md4.state[1] = md->md4.state[1] + b; + md->md4.state[2] = md->md4.state[2] + c; + md->md4.state[3] = md->md4.state[3] + d; + + return CRYPT_OK; +} + +#ifdef LTC_CLEAN_STACK +static int md4_compress(hash_state *md, unsigned char *buf) +{ + int err; + err = _md4_compress(md, buf); + burn_stack(sizeof(ulong32) * 20 + sizeof(int)); + return err; +} +#endif + +/** + Initialize the hash state + @param md The hash state you wish to initialize + @return CRYPT_OK if successful +*/ +int md4_init(hash_state * md) +{ + LTC_ARGCHK(md != NULL); + md->md4.state[0] = 0x67452301UL; + md->md4.state[1] = 0xefcdab89UL; + md->md4.state[2] = 0x98badcfeUL; + md->md4.state[3] = 0x10325476UL; + md->md4.length = 0; + md->md4.curlen = 0; + return CRYPT_OK; +} + +/** + Process a block of memory though the hash + @param md The hash state + @param in The data to hash + @param inlen The length of the data (octets) + @return CRYPT_OK if successful +*/ +HASH_PROCESS(md4_process, md4_compress, md4, 64) + +/** + Terminate the hash to get the digest + @param md The hash state + @param out [out] The destination of the hash (16 bytes) + @return CRYPT_OK if successful +*/ +int md4_done(hash_state * md, unsigned char *out) +{ + int i; + + LTC_ARGCHK(md != NULL); + LTC_ARGCHK(out != NULL); + + if (md->md4.curlen >= sizeof(md->md4.buf)) { + return CRYPT_INVALID_ARG; + } + + /* increase the length of the message */ + md->md4.length += md->md4.curlen * 8; + + /* append the '1' bit */ + md->md4.buf[md->md4.curlen++] = (unsigned char)0x80; + + /* if the length is currently above 56 bytes we append zeros + * then compress. Then we can fall back to padding zeros and length + * encoding like normal. + */ + if (md->md4.curlen > 56) { + while (md->md4.curlen < 64) { + md->md4.buf[md->md4.curlen++] = (unsigned char)0; + } + md4_compress(md, md->md4.buf); + md->md4.curlen = 0; + } + + /* pad upto 56 bytes of zeroes */ + while (md->md4.curlen < 56) { + md->md4.buf[md->md4.curlen++] = (unsigned char)0; + } + + /* store length */ + STORE64L(md->md4.length, md->md4.buf+56); + md4_compress(md, md->md4.buf); + + /* copy output */ + for (i = 0; i < 4; i++) { + STORE32L(md->md4.state[i], out+(4*i)); + } +#ifdef LTC_CLEAN_STACK + zeromem(md, sizeof(hash_state)); +#endif + return CRYPT_OK; +} + +/** + Self-test the hash + @return CRYPT_OK if successful, CRYPT_NOP if self-tests have been disabled +*/ +int md4_test(void) +{ + #ifndef LTC_TEST + return CRYPT_NOP; + #else + static const struct md4_test_case { + char *input; + unsigned char digest[16]; + } cases[] = { + { "", + {0x31, 0xd6, 0xcf, 0xe0, 0xd1, 0x6a, 0xe9, 0x31, + 0xb7, 0x3c, 0x59, 0xd7, 0xe0, 0xc0, 0x89, 0xc0} }, + { "a", + {0xbd, 0xe5, 0x2c, 0xb3, 0x1d, 0xe3, 0x3e, 0x46, + 0x24, 0x5e, 0x05, 0xfb, 0xdb, 0xd6, 0xfb, 0x24} }, + { "abc", + {0xa4, 0x48, 0x01, 0x7a, 0xaf, 0x21, 0xd8, 0x52, + 0x5f, 0xc1, 0x0a, 0xe8, 0x7a, 0xa6, 0x72, 0x9d} }, + { "message digest", + {0xd9, 0x13, 0x0a, 0x81, 0x64, 0x54, 0x9f, 0xe8, + 0x18, 0x87, 0x48, 0x06, 0xe1, 0xc7, 0x01, 0x4b} }, + { "abcdefghijklmnopqrstuvwxyz", + {0xd7, 0x9e, 0x1c, 0x30, 0x8a, 0xa5, 0xbb, 0xcd, + 0xee, 0xa8, 0xed, 0x63, 0xdf, 0x41, 0x2d, 0xa9} }, + { "ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789", + {0x04, 0x3f, 0x85, 0x82, 0xf2, 0x41, 0xdb, 0x35, + 0x1c, 0xe6, 0x27, 0xe1, 0x53, 0xe7, 0xf0, 0xe4} }, + { "12345678901234567890123456789012345678901234567890123456789012345678901234567890", + {0xe3, 0x3b, 0x4d, 0xdc, 0x9c, 0x38, 0xf2, 0x19, + 0x9c, 0x3e, 0x7b, 0x16, 0x4f, 0xcc, 0x05, 0x36} }, + }; + int i; + hash_state md; + unsigned char digest[16]; + + for(i = 0; i < (int)(sizeof(cases) / sizeof(cases[0])); i++) { + md4_init(&md); + md4_process(&md, (unsigned char *)cases[i].input, (unsigned long)strlen(cases[i].input)); + md4_done(&md, digest); + if (XMEMCMP(digest, cases[i].digest, 16) != 0) { + return CRYPT_FAIL_TESTVECTOR; + } + + } + return CRYPT_OK; + #endif +} + +#endif + + + +/* $Source: /cvs/libtom/libtomcrypt/src/hashes/md4.c,v $ */ +/* $Revision: 1.8 $ */ +/* $Date: 2006/11/01 09:28:17 $ */ diff --git a/libtomcrypt/src/hashes/md5.c b/libtomcrypt/src/hashes/md5.c new file mode 100644 index 0000000..f6274f9 --- /dev/null +++ b/libtomcrypt/src/hashes/md5.c @@ -0,0 +1,368 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + + +/** + @file md5.c + MD5 hash function by Tom St Denis +*/ + +#ifdef MD5 + +const struct ltc_hash_descriptor md5_desc = +{ + "md5", + 3, + 16, + 64, + + /* OID */ + { 1, 2, 840, 113549, 2, 5, }, + 6, + + &md5_init, + &md5_process, + &md5_done, + &md5_test, + NULL +}; + +#define F(x,y,z) (z ^ (x & (y ^ z))) +#define G(x,y,z) (y ^ (z & (y ^ x))) +#define H(x,y,z) (x^y^z) +#define I(x,y,z) (y^(x|(~z))) + +#ifdef LTC_SMALL_CODE + +#define FF(a,b,c,d,M,s,t) \ + a = (a + F(b,c,d) + M + t); a = ROL(a, s) + b; + +#define GG(a,b,c,d,M,s,t) \ + a = (a + G(b,c,d) + M + t); a = ROL(a, s) + b; + +#define HH(a,b,c,d,M,s,t) \ + a = (a + H(b,c,d) + M + t); a = ROL(a, s) + b; + +#define II(a,b,c,d,M,s,t) \ + a = (a + I(b,c,d) + M + t); a = ROL(a, s) + b; + +static const unsigned char Worder[64] = { + 0,1,2,3,4,5,6,7,8,9,10,11,12,13,14,15, + 1,6,11,0,5,10,15,4,9,14,3,8,13,2,7,12, + 5,8,11,14,1,4,7,10,13,0,3,6,9,12,15,2, + 0,7,14,5,12,3,10,1,8,15,6,13,4,11,2,9 +}; + +static const unsigned char Rorder[64] = { + 7,12,17,22,7,12,17,22,7,12,17,22,7,12,17,22, + 5,9,14,20,5,9,14,20,5,9,14,20,5,9,14,20, + 4,11,16,23,4,11,16,23,4,11,16,23,4,11,16,23, + 6,10,15,21,6,10,15,21,6,10,15,21,6,10,15,21 +}; + +static const ulong32 Korder[64] = { +0xd76aa478UL, 0xe8c7b756UL, 0x242070dbUL, 0xc1bdceeeUL, 0xf57c0fafUL, 0x4787c62aUL, 0xa8304613UL, 0xfd469501UL, +0x698098d8UL, 0x8b44f7afUL, 0xffff5bb1UL, 0x895cd7beUL, 0x6b901122UL, 0xfd987193UL, 0xa679438eUL, 0x49b40821UL, +0xf61e2562UL, 0xc040b340UL, 0x265e5a51UL, 0xe9b6c7aaUL, 0xd62f105dUL, 0x02441453UL, 0xd8a1e681UL, 0xe7d3fbc8UL, +0x21e1cde6UL, 0xc33707d6UL, 0xf4d50d87UL, 0x455a14edUL, 0xa9e3e905UL, 0xfcefa3f8UL, 0x676f02d9UL, 0x8d2a4c8aUL, +0xfffa3942UL, 0x8771f681UL, 0x6d9d6122UL, 0xfde5380cUL, 0xa4beea44UL, 0x4bdecfa9UL, 0xf6bb4b60UL, 0xbebfbc70UL, +0x289b7ec6UL, 0xeaa127faUL, 0xd4ef3085UL, 0x04881d05UL, 0xd9d4d039UL, 0xe6db99e5UL, 0x1fa27cf8UL, 0xc4ac5665UL, +0xf4292244UL, 0x432aff97UL, 0xab9423a7UL, 0xfc93a039UL, 0x655b59c3UL, 0x8f0ccc92UL, 0xffeff47dUL, 0x85845dd1UL, +0x6fa87e4fUL, 0xfe2ce6e0UL, 0xa3014314UL, 0x4e0811a1UL, 0xf7537e82UL, 0xbd3af235UL, 0x2ad7d2bbUL, 0xeb86d391UL +}; + +#else + +#define FF(a,b,c,d,M,s,t) \ + a = (a + F(b,c,d) + M + t); a = ROLc(a, s) + b; + +#define GG(a,b,c,d,M,s,t) \ + a = (a + G(b,c,d) + M + t); a = ROLc(a, s) + b; + +#define HH(a,b,c,d,M,s,t) \ + a = (a + H(b,c,d) + M + t); a = ROLc(a, s) + b; + +#define II(a,b,c,d,M,s,t) \ + a = (a + I(b,c,d) + M + t); a = ROLc(a, s) + b; + + +#endif + +#ifdef LTC_CLEAN_STACK +static int _md5_compress(hash_state *md, unsigned char *buf) +#else +static int md5_compress(hash_state *md, unsigned char *buf) +#endif +{ + ulong32 i, W[16], a, b, c, d; +#ifdef LTC_SMALL_CODE + ulong32 t; +#endif + + /* copy the state into 512-bits into W[0..15] */ + for (i = 0; i < 16; i++) { + LOAD32L(W[i], buf + (4*i)); + } + + /* copy state */ + a = md->md5.state[0]; + b = md->md5.state[1]; + c = md->md5.state[2]; + d = md->md5.state[3]; + +#ifdef LTC_SMALL_CODE + for (i = 0; i < 16; ++i) { + FF(a,b,c,d,W[Worder[i]],Rorder[i],Korder[i]); + t = d; d = c; c = b; b = a; a = t; + } + + for (; i < 32; ++i) { + GG(a,b,c,d,W[Worder[i]],Rorder[i],Korder[i]); + t = d; d = c; c = b; b = a; a = t; + } + + for (; i < 48; ++i) { + HH(a,b,c,d,W[Worder[i]],Rorder[i],Korder[i]); + t = d; d = c; c = b; b = a; a = t; + } + + for (; i < 64; ++i) { + II(a,b,c,d,W[Worder[i]],Rorder[i],Korder[i]); + t = d; d = c; c = b; b = a; a = t; + } + +#else + FF(a,b,c,d,W[0],7,0xd76aa478UL) + FF(d,a,b,c,W[1],12,0xe8c7b756UL) + FF(c,d,a,b,W[2],17,0x242070dbUL) + FF(b,c,d,a,W[3],22,0xc1bdceeeUL) + FF(a,b,c,d,W[4],7,0xf57c0fafUL) + FF(d,a,b,c,W[5],12,0x4787c62aUL) + FF(c,d,a,b,W[6],17,0xa8304613UL) + FF(b,c,d,a,W[7],22,0xfd469501UL) + FF(a,b,c,d,W[8],7,0x698098d8UL) + FF(d,a,b,c,W[9],12,0x8b44f7afUL) + FF(c,d,a,b,W[10],17,0xffff5bb1UL) + FF(b,c,d,a,W[11],22,0x895cd7beUL) + FF(a,b,c,d,W[12],7,0x6b901122UL) + FF(d,a,b,c,W[13],12,0xfd987193UL) + FF(c,d,a,b,W[14],17,0xa679438eUL) + FF(b,c,d,a,W[15],22,0x49b40821UL) + GG(a,b,c,d,W[1],5,0xf61e2562UL) + GG(d,a,b,c,W[6],9,0xc040b340UL) + GG(c,d,a,b,W[11],14,0x265e5a51UL) + GG(b,c,d,a,W[0],20,0xe9b6c7aaUL) + GG(a,b,c,d,W[5],5,0xd62f105dUL) + GG(d,a,b,c,W[10],9,0x02441453UL) + GG(c,d,a,b,W[15],14,0xd8a1e681UL) + GG(b,c,d,a,W[4],20,0xe7d3fbc8UL) + GG(a,b,c,d,W[9],5,0x21e1cde6UL) + GG(d,a,b,c,W[14],9,0xc33707d6UL) + GG(c,d,a,b,W[3],14,0xf4d50d87UL) + GG(b,c,d,a,W[8],20,0x455a14edUL) + GG(a,b,c,d,W[13],5,0xa9e3e905UL) + GG(d,a,b,c,W[2],9,0xfcefa3f8UL) + GG(c,d,a,b,W[7],14,0x676f02d9UL) + GG(b,c,d,a,W[12],20,0x8d2a4c8aUL) + HH(a,b,c,d,W[5],4,0xfffa3942UL) + HH(d,a,b,c,W[8],11,0x8771f681UL) + HH(c,d,a,b,W[11],16,0x6d9d6122UL) + HH(b,c,d,a,W[14],23,0xfde5380cUL) + HH(a,b,c,d,W[1],4,0xa4beea44UL) + HH(d,a,b,c,W[4],11,0x4bdecfa9UL) + HH(c,d,a,b,W[7],16,0xf6bb4b60UL) + HH(b,c,d,a,W[10],23,0xbebfbc70UL) + HH(a,b,c,d,W[13],4,0x289b7ec6UL) + HH(d,a,b,c,W[0],11,0xeaa127faUL) + HH(c,d,a,b,W[3],16,0xd4ef3085UL) + HH(b,c,d,a,W[6],23,0x04881d05UL) + HH(a,b,c,d,W[9],4,0xd9d4d039UL) + HH(d,a,b,c,W[12],11,0xe6db99e5UL) + HH(c,d,a,b,W[15],16,0x1fa27cf8UL) + HH(b,c,d,a,W[2],23,0xc4ac5665UL) + II(a,b,c,d,W[0],6,0xf4292244UL) + II(d,a,b,c,W[7],10,0x432aff97UL) + II(c,d,a,b,W[14],15,0xab9423a7UL) + II(b,c,d,a,W[5],21,0xfc93a039UL) + II(a,b,c,d,W[12],6,0x655b59c3UL) + II(d,a,b,c,W[3],10,0x8f0ccc92UL) + II(c,d,a,b,W[10],15,0xffeff47dUL) + II(b,c,d,a,W[1],21,0x85845dd1UL) + II(a,b,c,d,W[8],6,0x6fa87e4fUL) + II(d,a,b,c,W[15],10,0xfe2ce6e0UL) + II(c,d,a,b,W[6],15,0xa3014314UL) + II(b,c,d,a,W[13],21,0x4e0811a1UL) + II(a,b,c,d,W[4],6,0xf7537e82UL) + II(d,a,b,c,W[11],10,0xbd3af235UL) + II(c,d,a,b,W[2],15,0x2ad7d2bbUL) + II(b,c,d,a,W[9],21,0xeb86d391UL) +#endif + + md->md5.state[0] = md->md5.state[0] + a; + md->md5.state[1] = md->md5.state[1] + b; + md->md5.state[2] = md->md5.state[2] + c; + md->md5.state[3] = md->md5.state[3] + d; + + return CRYPT_OK; +} + +#ifdef LTC_CLEAN_STACK +static int md5_compress(hash_state *md, unsigned char *buf) +{ + int err; + err = _md5_compress(md, buf); + burn_stack(sizeof(ulong32) * 21); + return err; +} +#endif + +/** + Initialize the hash state + @param md The hash state you wish to initialize + @return CRYPT_OK if successful +*/ +int md5_init(hash_state * md) +{ + LTC_ARGCHK(md != NULL); + md->md5.state[0] = 0x67452301UL; + md->md5.state[1] = 0xefcdab89UL; + md->md5.state[2] = 0x98badcfeUL; + md->md5.state[3] = 0x10325476UL; + md->md5.curlen = 0; + md->md5.length = 0; + return CRYPT_OK; +} + +/** + Process a block of memory though the hash + @param md The hash state + @param in The data to hash + @param inlen The length of the data (octets) + @return CRYPT_OK if successful +*/ +HASH_PROCESS(md5_process, md5_compress, md5, 64) + +/** + Terminate the hash to get the digest + @param md The hash state + @param out [out] The destination of the hash (16 bytes) + @return CRYPT_OK if successful +*/ +int md5_done(hash_state * md, unsigned char *out) +{ + int i; + + LTC_ARGCHK(md != NULL); + LTC_ARGCHK(out != NULL); + + if (md->md5.curlen >= sizeof(md->md5.buf)) { + return CRYPT_INVALID_ARG; + } + + + /* increase the length of the message */ + md->md5.length += md->md5.curlen * 8; + + /* append the '1' bit */ + md->md5.buf[md->md5.curlen++] = (unsigned char)0x80; + + /* if the length is currently above 56 bytes we append zeros + * then compress. Then we can fall back to padding zeros and length + * encoding like normal. + */ + if (md->md5.curlen > 56) { + while (md->md5.curlen < 64) { + md->md5.buf[md->md5.curlen++] = (unsigned char)0; + } + md5_compress(md, md->md5.buf); + md->md5.curlen = 0; + } + + /* pad upto 56 bytes of zeroes */ + while (md->md5.curlen < 56) { + md->md5.buf[md->md5.curlen++] = (unsigned char)0; + } + + /* store length */ + STORE64L(md->md5.length, md->md5.buf+56); + md5_compress(md, md->md5.buf); + + /* copy output */ + for (i = 0; i < 4; i++) { + STORE32L(md->md5.state[i], out+(4*i)); + } +#ifdef LTC_CLEAN_STACK + zeromem(md, sizeof(hash_state)); +#endif + return CRYPT_OK; +} + +/** + Self-test the hash + @return CRYPT_OK if successful, CRYPT_NOP if self-tests have been disabled +*/ +int md5_test(void) +{ + #ifndef LTC_TEST + return CRYPT_NOP; + #else + static const struct { + char *msg; + unsigned char hash[16]; + } tests[] = { + { "", + { 0xd4, 0x1d, 0x8c, 0xd9, 0x8f, 0x00, 0xb2, 0x04, + 0xe9, 0x80, 0x09, 0x98, 0xec, 0xf8, 0x42, 0x7e } }, + { "a", + {0x0c, 0xc1, 0x75, 0xb9, 0xc0, 0xf1, 0xb6, 0xa8, + 0x31, 0xc3, 0x99, 0xe2, 0x69, 0x77, 0x26, 0x61 } }, + { "abc", + { 0x90, 0x01, 0x50, 0x98, 0x3c, 0xd2, 0x4f, 0xb0, + 0xd6, 0x96, 0x3f, 0x7d, 0x28, 0xe1, 0x7f, 0x72 } }, + { "message digest", + { 0xf9, 0x6b, 0x69, 0x7d, 0x7c, 0xb7, 0x93, 0x8d, + 0x52, 0x5a, 0x2f, 0x31, 0xaa, 0xf1, 0x61, 0xd0 } }, + { "abcdefghijklmnopqrstuvwxyz", + { 0xc3, 0xfc, 0xd3, 0xd7, 0x61, 0x92, 0xe4, 0x00, + 0x7d, 0xfb, 0x49, 0x6c, 0xca, 0x67, 0xe1, 0x3b } }, + { "ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789", + { 0xd1, 0x74, 0xab, 0x98, 0xd2, 0x77, 0xd9, 0xf5, + 0xa5, 0x61, 0x1c, 0x2c, 0x9f, 0x41, 0x9d, 0x9f } }, + { "12345678901234567890123456789012345678901234567890123456789012345678901234567890", + { 0x57, 0xed, 0xf4, 0xa2, 0x2b, 0xe3, 0xc9, 0x55, + 0xac, 0x49, 0xda, 0x2e, 0x21, 0x07, 0xb6, 0x7a } }, + { NULL, { 0 } } + }; + + int i; + unsigned char tmp[16]; + hash_state md; + + for (i = 0; tests[i].msg != NULL; i++) { + md5_init(&md); + md5_process(&md, (unsigned char *)tests[i].msg, (unsigned long)strlen(tests[i].msg)); + md5_done(&md, tmp); + if (XMEMCMP(tmp, tests[i].hash, 16) != 0) { + return CRYPT_FAIL_TESTVECTOR; + } + } + return CRYPT_OK; + #endif +} + +#endif + + + +/* $Source: /cvs/libtom/libtomcrypt/src/hashes/md5.c,v $ */ +/* $Revision: 1.8 $ */ +/* $Date: 2006/11/01 09:28:17 $ */ diff --git a/libtomcrypt/src/hashes/rmd128.c b/libtomcrypt/src/hashes/rmd128.c new file mode 100644 index 0000000..d294626 --- /dev/null +++ b/libtomcrypt/src/hashes/rmd128.c @@ -0,0 +1,410 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @param rmd128.c + RMD128 Hash function +*/ + +/* Implementation of RIPEMD-128 based on the source by Antoon Bosselaers, ESAT-COSIC + * + * This source has been radically overhauled to be portable and work within + * the LibTomCrypt API by Tom St Denis + */ + +#ifdef RIPEMD128 + +const struct ltc_hash_descriptor rmd128_desc = +{ + "rmd128", + 8, + 16, + 64, + + /* OID */ + { 1, 0, 10118, 3, 0, 50 }, + 6, + + &rmd128_init, + &rmd128_process, + &rmd128_done, + &rmd128_test, + NULL +}; + +/* the four basic functions F(), G() and H() */ +#define F(x, y, z) ((x) ^ (y) ^ (z)) +#define G(x, y, z) (((x) & (y)) | (~(x) & (z))) +#define H(x, y, z) (((x) | ~(y)) ^ (z)) +#define I(x, y, z) (((x) & (z)) | ((y) & ~(z))) + +/* the eight basic operations FF() through III() */ +#define FF(a, b, c, d, x, s) \ + (a) += F((b), (c), (d)) + (x);\ + (a) = ROLc((a), (s)); + +#define GG(a, b, c, d, x, s) \ + (a) += G((b), (c), (d)) + (x) + 0x5a827999UL;\ + (a) = ROLc((a), (s)); + +#define HH(a, b, c, d, x, s) \ + (a) += H((b), (c), (d)) + (x) + 0x6ed9eba1UL;\ + (a) = ROLc((a), (s)); + +#define II(a, b, c, d, x, s) \ + (a) += I((b), (c), (d)) + (x) + 0x8f1bbcdcUL;\ + (a) = ROLc((a), (s)); + +#define FFF(a, b, c, d, x, s) \ + (a) += F((b), (c), (d)) + (x);\ + (a) = ROLc((a), (s)); + +#define GGG(a, b, c, d, x, s) \ + (a) += G((b), (c), (d)) + (x) + 0x6d703ef3UL;\ + (a) = ROLc((a), (s)); + +#define HHH(a, b, c, d, x, s) \ + (a) += H((b), (c), (d)) + (x) + 0x5c4dd124UL;\ + (a) = ROLc((a), (s)); + +#define III(a, b, c, d, x, s) \ + (a) += I((b), (c), (d)) + (x) + 0x50a28be6UL;\ + (a) = ROLc((a), (s)); + +#ifdef LTC_CLEAN_STACK +static int _rmd128_compress(hash_state *md, unsigned char *buf) +#else +static int rmd128_compress(hash_state *md, unsigned char *buf) +#endif +{ + ulong32 aa,bb,cc,dd,aaa,bbb,ccc,ddd,X[16]; + int i; + + /* load words X */ + for (i = 0; i < 16; i++){ + LOAD32L(X[i], buf + (4 * i)); + } + + /* load state */ + aa = aaa = md->rmd128.state[0]; + bb = bbb = md->rmd128.state[1]; + cc = ccc = md->rmd128.state[2]; + dd = ddd = md->rmd128.state[3]; + + /* round 1 */ + FF(aa, bb, cc, dd, X[ 0], 11); + FF(dd, aa, bb, cc, X[ 1], 14); + FF(cc, dd, aa, bb, X[ 2], 15); + FF(bb, cc, dd, aa, X[ 3], 12); + FF(aa, bb, cc, dd, X[ 4], 5); + FF(dd, aa, bb, cc, X[ 5], 8); + FF(cc, dd, aa, bb, X[ 6], 7); + FF(bb, cc, dd, aa, X[ 7], 9); + FF(aa, bb, cc, dd, X[ 8], 11); + FF(dd, aa, bb, cc, X[ 9], 13); + FF(cc, dd, aa, bb, X[10], 14); + FF(bb, cc, dd, aa, X[11], 15); + FF(aa, bb, cc, dd, X[12], 6); + FF(dd, aa, bb, cc, X[13], 7); + FF(cc, dd, aa, bb, X[14], 9); + FF(bb, cc, dd, aa, X[15], 8); + + /* round 2 */ + GG(aa, bb, cc, dd, X[ 7], 7); + GG(dd, aa, bb, cc, X[ 4], 6); + GG(cc, dd, aa, bb, X[13], 8); + GG(bb, cc, dd, aa, X[ 1], 13); + GG(aa, bb, cc, dd, X[10], 11); + GG(dd, aa, bb, cc, X[ 6], 9); + GG(cc, dd, aa, bb, X[15], 7); + GG(bb, cc, dd, aa, X[ 3], 15); + GG(aa, bb, cc, dd, X[12], 7); + GG(dd, aa, bb, cc, X[ 0], 12); + GG(cc, dd, aa, bb, X[ 9], 15); + GG(bb, cc, dd, aa, X[ 5], 9); + GG(aa, bb, cc, dd, X[ 2], 11); + GG(dd, aa, bb, cc, X[14], 7); + GG(cc, dd, aa, bb, X[11], 13); + GG(bb, cc, dd, aa, X[ 8], 12); + + /* round 3 */ + HH(aa, bb, cc, dd, X[ 3], 11); + HH(dd, aa, bb, cc, X[10], 13); + HH(cc, dd, aa, bb, X[14], 6); + HH(bb, cc, dd, aa, X[ 4], 7); + HH(aa, bb, cc, dd, X[ 9], 14); + HH(dd, aa, bb, cc, X[15], 9); + HH(cc, dd, aa, bb, X[ 8], 13); + HH(bb, cc, dd, aa, X[ 1], 15); + HH(aa, bb, cc, dd, X[ 2], 14); + HH(dd, aa, bb, cc, X[ 7], 8); + HH(cc, dd, aa, bb, X[ 0], 13); + HH(bb, cc, dd, aa, X[ 6], 6); + HH(aa, bb, cc, dd, X[13], 5); + HH(dd, aa, bb, cc, X[11], 12); + HH(cc, dd, aa, bb, X[ 5], 7); + HH(bb, cc, dd, aa, X[12], 5); + + /* round 4 */ + II(aa, bb, cc, dd, X[ 1], 11); + II(dd, aa, bb, cc, X[ 9], 12); + II(cc, dd, aa, bb, X[11], 14); + II(bb, cc, dd, aa, X[10], 15); + II(aa, bb, cc, dd, X[ 0], 14); + II(dd, aa, bb, cc, X[ 8], 15); + II(cc, dd, aa, bb, X[12], 9); + II(bb, cc, dd, aa, X[ 4], 8); + II(aa, bb, cc, dd, X[13], 9); + II(dd, aa, bb, cc, X[ 3], 14); + II(cc, dd, aa, bb, X[ 7], 5); + II(bb, cc, dd, aa, X[15], 6); + II(aa, bb, cc, dd, X[14], 8); + II(dd, aa, bb, cc, X[ 5], 6); + II(cc, dd, aa, bb, X[ 6], 5); + II(bb, cc, dd, aa, X[ 2], 12); + + /* parallel round 1 */ + III(aaa, bbb, ccc, ddd, X[ 5], 8); + III(ddd, aaa, bbb, ccc, X[14], 9); + III(ccc, ddd, aaa, bbb, X[ 7], 9); + III(bbb, ccc, ddd, aaa, X[ 0], 11); + III(aaa, bbb, ccc, ddd, X[ 9], 13); + III(ddd, aaa, bbb, ccc, X[ 2], 15); + III(ccc, ddd, aaa, bbb, X[11], 15); + III(bbb, ccc, ddd, aaa, X[ 4], 5); + III(aaa, bbb, ccc, ddd, X[13], 7); + III(ddd, aaa, bbb, ccc, X[ 6], 7); + III(ccc, ddd, aaa, bbb, X[15], 8); + III(bbb, ccc, ddd, aaa, X[ 8], 11); + III(aaa, bbb, ccc, ddd, X[ 1], 14); + III(ddd, aaa, bbb, ccc, X[10], 14); + III(ccc, ddd, aaa, bbb, X[ 3], 12); + III(bbb, ccc, ddd, aaa, X[12], 6); + + /* parallel round 2 */ + HHH(aaa, bbb, ccc, ddd, X[ 6], 9); + HHH(ddd, aaa, bbb, ccc, X[11], 13); + HHH(ccc, ddd, aaa, bbb, X[ 3], 15); + HHH(bbb, ccc, ddd, aaa, X[ 7], 7); + HHH(aaa, bbb, ccc, ddd, X[ 0], 12); + HHH(ddd, aaa, bbb, ccc, X[13], 8); + HHH(ccc, ddd, aaa, bbb, X[ 5], 9); + HHH(bbb, ccc, ddd, aaa, X[10], 11); + HHH(aaa, bbb, ccc, ddd, X[14], 7); + HHH(ddd, aaa, bbb, ccc, X[15], 7); + HHH(ccc, ddd, aaa, bbb, X[ 8], 12); + HHH(bbb, ccc, ddd, aaa, X[12], 7); + HHH(aaa, bbb, ccc, ddd, X[ 4], 6); + HHH(ddd, aaa, bbb, ccc, X[ 9], 15); + HHH(ccc, ddd, aaa, bbb, X[ 1], 13); + HHH(bbb, ccc, ddd, aaa, X[ 2], 11); + + /* parallel round 3 */ + GGG(aaa, bbb, ccc, ddd, X[15], 9); + GGG(ddd, aaa, bbb, ccc, X[ 5], 7); + GGG(ccc, ddd, aaa, bbb, X[ 1], 15); + GGG(bbb, ccc, ddd, aaa, X[ 3], 11); + GGG(aaa, bbb, ccc, ddd, X[ 7], 8); + GGG(ddd, aaa, bbb, ccc, X[14], 6); + GGG(ccc, ddd, aaa, bbb, X[ 6], 6); + GGG(bbb, ccc, ddd, aaa, X[ 9], 14); + GGG(aaa, bbb, ccc, ddd, X[11], 12); + GGG(ddd, aaa, bbb, ccc, X[ 8], 13); + GGG(ccc, ddd, aaa, bbb, X[12], 5); + GGG(bbb, ccc, ddd, aaa, X[ 2], 14); + GGG(aaa, bbb, ccc, ddd, X[10], 13); + GGG(ddd, aaa, bbb, ccc, X[ 0], 13); + GGG(ccc, ddd, aaa, bbb, X[ 4], 7); + GGG(bbb, ccc, ddd, aaa, X[13], 5); + + /* parallel round 4 */ + FFF(aaa, bbb, ccc, ddd, X[ 8], 15); + FFF(ddd, aaa, bbb, ccc, X[ 6], 5); + FFF(ccc, ddd, aaa, bbb, X[ 4], 8); + FFF(bbb, ccc, ddd, aaa, X[ 1], 11); + FFF(aaa, bbb, ccc, ddd, X[ 3], 14); + FFF(ddd, aaa, bbb, ccc, X[11], 14); + FFF(ccc, ddd, aaa, bbb, X[15], 6); + FFF(bbb, ccc, ddd, aaa, X[ 0], 14); + FFF(aaa, bbb, ccc, ddd, X[ 5], 6); + FFF(ddd, aaa, bbb, ccc, X[12], 9); + FFF(ccc, ddd, aaa, bbb, X[ 2], 12); + FFF(bbb, ccc, ddd, aaa, X[13], 9); + FFF(aaa, bbb, ccc, ddd, X[ 9], 12); + FFF(ddd, aaa, bbb, ccc, X[ 7], 5); + FFF(ccc, ddd, aaa, bbb, X[10], 15); + FFF(bbb, ccc, ddd, aaa, X[14], 8); + + /* combine results */ + ddd += cc + md->rmd128.state[1]; /* final result for MDbuf[0] */ + md->rmd128.state[1] = md->rmd128.state[2] + dd + aaa; + md->rmd128.state[2] = md->rmd128.state[3] + aa + bbb; + md->rmd128.state[3] = md->rmd128.state[0] + bb + ccc; + md->rmd128.state[0] = ddd; + + return CRYPT_OK; +} + +#ifdef LTC_CLEAN_STACK +static int rmd128_compress(hash_state *md, unsigned char *buf) +{ + int err; + err = _rmd128_compress(md, buf); + burn_stack(sizeof(ulong32) * 24 + sizeof(int)); + return err; +} +#endif + +/** + Initialize the hash state + @param md The hash state you wish to initialize + @return CRYPT_OK if successful +*/ +int rmd128_init(hash_state * md) +{ + LTC_ARGCHK(md != NULL); + md->rmd128.state[0] = 0x67452301UL; + md->rmd128.state[1] = 0xefcdab89UL; + md->rmd128.state[2] = 0x98badcfeUL; + md->rmd128.state[3] = 0x10325476UL; + md->rmd128.curlen = 0; + md->rmd128.length = 0; + return CRYPT_OK; +} + +/** + Process a block of memory though the hash + @param md The hash state + @param in The data to hash + @param inlen The length of the data (octets) + @return CRYPT_OK if successful +*/ +HASH_PROCESS(rmd128_process, rmd128_compress, rmd128, 64) + +/** + Terminate the hash to get the digest + @param md The hash state + @param out [out] The destination of the hash (16 bytes) + @return CRYPT_OK if successful +*/ +int rmd128_done(hash_state * md, unsigned char *out) +{ + int i; + + LTC_ARGCHK(md != NULL); + LTC_ARGCHK(out != NULL); + + if (md->rmd128.curlen >= sizeof(md->rmd128.buf)) { + return CRYPT_INVALID_ARG; + } + + + /* increase the length of the message */ + md->rmd128.length += md->rmd128.curlen * 8; + + /* append the '1' bit */ + md->rmd128.buf[md->rmd128.curlen++] = (unsigned char)0x80; + + /* if the length is currently above 56 bytes we append zeros + * then compress. Then we can fall back to padding zeros and length + * encoding like normal. + */ + if (md->rmd128.curlen > 56) { + while (md->rmd128.curlen < 64) { + md->rmd128.buf[md->rmd128.curlen++] = (unsigned char)0; + } + rmd128_compress(md, md->rmd128.buf); + md->rmd128.curlen = 0; + } + + /* pad upto 56 bytes of zeroes */ + while (md->rmd128.curlen < 56) { + md->rmd128.buf[md->rmd128.curlen++] = (unsigned char)0; + } + + /* store length */ + STORE64L(md->rmd128.length, md->rmd128.buf+56); + rmd128_compress(md, md->rmd128.buf); + + /* copy output */ + for (i = 0; i < 4; i++) { + STORE32L(md->rmd128.state[i], out+(4*i)); + } +#ifdef LTC_CLEAN_STACK + zeromem(md, sizeof(hash_state)); +#endif + return CRYPT_OK; +} + +/** + Self-test the hash + @return CRYPT_OK if successful, CRYPT_NOP if self-tests have been disabled +*/ +int rmd128_test(void) +{ +#ifndef LTC_TEST + return CRYPT_NOP; +#else + static const struct { + char *msg; + unsigned char md[16]; + } tests[] = { + { "", + { 0xcd, 0xf2, 0x62, 0x13, 0xa1, 0x50, 0xdc, 0x3e, + 0xcb, 0x61, 0x0f, 0x18, 0xf6, 0xb3, 0x8b, 0x46 } + }, + { "a", + { 0x86, 0xbe, 0x7a, 0xfa, 0x33, 0x9d, 0x0f, 0xc7, + 0xcf, 0xc7, 0x85, 0xe7, 0x2f, 0x57, 0x8d, 0x33 } + }, + { "abc", + { 0xc1, 0x4a, 0x12, 0x19, 0x9c, 0x66, 0xe4, 0xba, + 0x84, 0x63, 0x6b, 0x0f, 0x69, 0x14, 0x4c, 0x77 } + }, + { "message digest", + { 0x9e, 0x32, 0x7b, 0x3d, 0x6e, 0x52, 0x30, 0x62, + 0xaf, 0xc1, 0x13, 0x2d, 0x7d, 0xf9, 0xd1, 0xb8 } + }, + { "abcdefghijklmnopqrstuvwxyz", + { 0xfd, 0x2a, 0xa6, 0x07, 0xf7, 0x1d, 0xc8, 0xf5, + 0x10, 0x71, 0x49, 0x22, 0xb3, 0x71, 0x83, 0x4e } + }, + { "ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789", + { 0xd1, 0xe9, 0x59, 0xeb, 0x17, 0x9c, 0x91, 0x1f, + 0xae, 0xa4, 0x62, 0x4c, 0x60, 0xc5, 0xc7, 0x02 } + } + }; + int x; + unsigned char buf[16]; + hash_state md; + + for (x = 0; x < (int)(sizeof(tests)/sizeof(tests[0])); x++) { + rmd128_init(&md); + rmd128_process(&md, (unsigned char *)tests[x].msg, strlen(tests[x].msg)); + rmd128_done(&md, buf); + if (XMEMCMP(buf, tests[x].md, 16) != 0) { + #if 0 + printf("Failed test %d\n", x); + #endif + return CRYPT_FAIL_TESTVECTOR; + } + } + return CRYPT_OK; +#endif +} + +#endif + + +/* $Source: /cvs/libtom/libtomcrypt/src/hashes/rmd128.c,v $ */ +/* $Revision: 1.9 $ */ +/* $Date: 2006/11/01 09:28:17 $ */ diff --git a/libtomcrypt/src/hashes/rmd160.c b/libtomcrypt/src/hashes/rmd160.c new file mode 100644 index 0000000..a1c090a --- /dev/null +++ b/libtomcrypt/src/hashes/rmd160.c @@ -0,0 +1,469 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file rmd160.c + RMD160 hash function +*/ + +/* Implementation of RIPEMD-160 based on the source by Antoon Bosselaers, ESAT-COSIC + * + * This source has been radically overhauled to be portable and work within + * the LibTomCrypt API by Tom St Denis + */ + +#ifdef RIPEMD160 + +const struct ltc_hash_descriptor rmd160_desc = +{ + "rmd160", + 9, + 20, + 64, + + /* OID */ + { 1, 3, 36, 3, 2, 1, }, + 6, + + &rmd160_init, + &rmd160_process, + &rmd160_done, + &rmd160_test, + NULL +}; + +/* the five basic functions F(), G() and H() */ +#define F(x, y, z) ((x) ^ (y) ^ (z)) +#define G(x, y, z) (((x) & (y)) | (~(x) & (z))) +#define H(x, y, z) (((x) | ~(y)) ^ (z)) +#define I(x, y, z) (((x) & (z)) | ((y) & ~(z))) +#define J(x, y, z) ((x) ^ ((y) | ~(z))) + +/* the ten basic operations FF() through III() */ +#define FF(a, b, c, d, e, x, s) \ + (a) += F((b), (c), (d)) + (x);\ + (a) = ROLc((a), (s)) + (e);\ + (c) = ROLc((c), 10); + +#define GG(a, b, c, d, e, x, s) \ + (a) += G((b), (c), (d)) + (x) + 0x5a827999UL;\ + (a) = ROLc((a), (s)) + (e);\ + (c) = ROLc((c), 10); + +#define HH(a, b, c, d, e, x, s) \ + (a) += H((b), (c), (d)) + (x) + 0x6ed9eba1UL;\ + (a) = ROLc((a), (s)) + (e);\ + (c) = ROLc((c), 10); + +#define II(a, b, c, d, e, x, s) \ + (a) += I((b), (c), (d)) + (x) + 0x8f1bbcdcUL;\ + (a) = ROLc((a), (s)) + (e);\ + (c) = ROLc((c), 10); + +#define JJ(a, b, c, d, e, x, s) \ + (a) += J((b), (c), (d)) + (x) + 0xa953fd4eUL;\ + (a) = ROLc((a), (s)) + (e);\ + (c) = ROLc((c), 10); + +#define FFF(a, b, c, d, e, x, s) \ + (a) += F((b), (c), (d)) + (x);\ + (a) = ROLc((a), (s)) + (e);\ + (c) = ROLc((c), 10); + +#define GGG(a, b, c, d, e, x, s) \ + (a) += G((b), (c), (d)) + (x) + 0x7a6d76e9UL;\ + (a) = ROLc((a), (s)) + (e);\ + (c) = ROLc((c), 10); + +#define HHH(a, b, c, d, e, x, s) \ + (a) += H((b), (c), (d)) + (x) + 0x6d703ef3UL;\ + (a) = ROLc((a), (s)) + (e);\ + (c) = ROLc((c), 10); + +#define III(a, b, c, d, e, x, s) \ + (a) += I((b), (c), (d)) + (x) + 0x5c4dd124UL;\ + (a) = ROLc((a), (s)) + (e);\ + (c) = ROLc((c), 10); + +#define JJJ(a, b, c, d, e, x, s) \ + (a) += J((b), (c), (d)) + (x) + 0x50a28be6UL;\ + (a) = ROLc((a), (s)) + (e);\ + (c) = ROLc((c), 10); + + +#ifdef LTC_CLEAN_STACK +static int _rmd160_compress(hash_state *md, unsigned char *buf) +#else +static int rmd160_compress(hash_state *md, unsigned char *buf) +#endif +{ + ulong32 aa,bb,cc,dd,ee,aaa,bbb,ccc,ddd,eee,X[16]; + int i; + + /* load words X */ + for (i = 0; i < 16; i++){ + LOAD32L(X[i], buf + (4 * i)); + } + + /* load state */ + aa = aaa = md->rmd160.state[0]; + bb = bbb = md->rmd160.state[1]; + cc = ccc = md->rmd160.state[2]; + dd = ddd = md->rmd160.state[3]; + ee = eee = md->rmd160.state[4]; + + /* round 1 */ + FF(aa, bb, cc, dd, ee, X[ 0], 11); + FF(ee, aa, bb, cc, dd, X[ 1], 14); + FF(dd, ee, aa, bb, cc, X[ 2], 15); + FF(cc, dd, ee, aa, bb, X[ 3], 12); + FF(bb, cc, dd, ee, aa, X[ 4], 5); + FF(aa, bb, cc, dd, ee, X[ 5], 8); + FF(ee, aa, bb, cc, dd, X[ 6], 7); + FF(dd, ee, aa, bb, cc, X[ 7], 9); + FF(cc, dd, ee, aa, bb, X[ 8], 11); + FF(bb, cc, dd, ee, aa, X[ 9], 13); + FF(aa, bb, cc, dd, ee, X[10], 14); + FF(ee, aa, bb, cc, dd, X[11], 15); + FF(dd, ee, aa, bb, cc, X[12], 6); + FF(cc, dd, ee, aa, bb, X[13], 7); + FF(bb, cc, dd, ee, aa, X[14], 9); + FF(aa, bb, cc, dd, ee, X[15], 8); + + /* round 2 */ + GG(ee, aa, bb, cc, dd, X[ 7], 7); + GG(dd, ee, aa, bb, cc, X[ 4], 6); + GG(cc, dd, ee, aa, bb, X[13], 8); + GG(bb, cc, dd, ee, aa, X[ 1], 13); + GG(aa, bb, cc, dd, ee, X[10], 11); + GG(ee, aa, bb, cc, dd, X[ 6], 9); + GG(dd, ee, aa, bb, cc, X[15], 7); + GG(cc, dd, ee, aa, bb, X[ 3], 15); + GG(bb, cc, dd, ee, aa, X[12], 7); + GG(aa, bb, cc, dd, ee, X[ 0], 12); + GG(ee, aa, bb, cc, dd, X[ 9], 15); + GG(dd, ee, aa, bb, cc, X[ 5], 9); + GG(cc, dd, ee, aa, bb, X[ 2], 11); + GG(bb, cc, dd, ee, aa, X[14], 7); + GG(aa, bb, cc, dd, ee, X[11], 13); + GG(ee, aa, bb, cc, dd, X[ 8], 12); + + /* round 3 */ + HH(dd, ee, aa, bb, cc, X[ 3], 11); + HH(cc, dd, ee, aa, bb, X[10], 13); + HH(bb, cc, dd, ee, aa, X[14], 6); + HH(aa, bb, cc, dd, ee, X[ 4], 7); + HH(ee, aa, bb, cc, dd, X[ 9], 14); + HH(dd, ee, aa, bb, cc, X[15], 9); + HH(cc, dd, ee, aa, bb, X[ 8], 13); + HH(bb, cc, dd, ee, aa, X[ 1], 15); + HH(aa, bb, cc, dd, ee, X[ 2], 14); + HH(ee, aa, bb, cc, dd, X[ 7], 8); + HH(dd, ee, aa, bb, cc, X[ 0], 13); + HH(cc, dd, ee, aa, bb, X[ 6], 6); + HH(bb, cc, dd, ee, aa, X[13], 5); + HH(aa, bb, cc, dd, ee, X[11], 12); + HH(ee, aa, bb, cc, dd, X[ 5], 7); + HH(dd, ee, aa, bb, cc, X[12], 5); + + /* round 4 */ + II(cc, dd, ee, aa, bb, X[ 1], 11); + II(bb, cc, dd, ee, aa, X[ 9], 12); + II(aa, bb, cc, dd, ee, X[11], 14); + II(ee, aa, bb, cc, dd, X[10], 15); + II(dd, ee, aa, bb, cc, X[ 0], 14); + II(cc, dd, ee, aa, bb, X[ 8], 15); + II(bb, cc, dd, ee, aa, X[12], 9); + II(aa, bb, cc, dd, ee, X[ 4], 8); + II(ee, aa, bb, cc, dd, X[13], 9); + II(dd, ee, aa, bb, cc, X[ 3], 14); + II(cc, dd, ee, aa, bb, X[ 7], 5); + II(bb, cc, dd, ee, aa, X[15], 6); + II(aa, bb, cc, dd, ee, X[14], 8); + II(ee, aa, bb, cc, dd, X[ 5], 6); + II(dd, ee, aa, bb, cc, X[ 6], 5); + II(cc, dd, ee, aa, bb, X[ 2], 12); + + /* round 5 */ + JJ(bb, cc, dd, ee, aa, X[ 4], 9); + JJ(aa, bb, cc, dd, ee, X[ 0], 15); + JJ(ee, aa, bb, cc, dd, X[ 5], 5); + JJ(dd, ee, aa, bb, cc, X[ 9], 11); + JJ(cc, dd, ee, aa, bb, X[ 7], 6); + JJ(bb, cc, dd, ee, aa, X[12], 8); + JJ(aa, bb, cc, dd, ee, X[ 2], 13); + JJ(ee, aa, bb, cc, dd, X[10], 12); + JJ(dd, ee, aa, bb, cc, X[14], 5); + JJ(cc, dd, ee, aa, bb, X[ 1], 12); + JJ(bb, cc, dd, ee, aa, X[ 3], 13); + JJ(aa, bb, cc, dd, ee, X[ 8], 14); + JJ(ee, aa, bb, cc, dd, X[11], 11); + JJ(dd, ee, aa, bb, cc, X[ 6], 8); + JJ(cc, dd, ee, aa, bb, X[15], 5); + JJ(bb, cc, dd, ee, aa, X[13], 6); + + /* parallel round 1 */ + JJJ(aaa, bbb, ccc, ddd, eee, X[ 5], 8); + JJJ(eee, aaa, bbb, ccc, ddd, X[14], 9); + JJJ(ddd, eee, aaa, bbb, ccc, X[ 7], 9); + JJJ(ccc, ddd, eee, aaa, bbb, X[ 0], 11); + JJJ(bbb, ccc, ddd, eee, aaa, X[ 9], 13); + JJJ(aaa, bbb, ccc, ddd, eee, X[ 2], 15); + JJJ(eee, aaa, bbb, ccc, ddd, X[11], 15); + JJJ(ddd, eee, aaa, bbb, ccc, X[ 4], 5); + JJJ(ccc, ddd, eee, aaa, bbb, X[13], 7); + JJJ(bbb, ccc, ddd, eee, aaa, X[ 6], 7); + JJJ(aaa, bbb, ccc, ddd, eee, X[15], 8); + JJJ(eee, aaa, bbb, ccc, ddd, X[ 8], 11); + JJJ(ddd, eee, aaa, bbb, ccc, X[ 1], 14); + JJJ(ccc, ddd, eee, aaa, bbb, X[10], 14); + JJJ(bbb, ccc, ddd, eee, aaa, X[ 3], 12); + JJJ(aaa, bbb, ccc, ddd, eee, X[12], 6); + + /* parallel round 2 */ + III(eee, aaa, bbb, ccc, ddd, X[ 6], 9); + III(ddd, eee, aaa, bbb, ccc, X[11], 13); + III(ccc, ddd, eee, aaa, bbb, X[ 3], 15); + III(bbb, ccc, ddd, eee, aaa, X[ 7], 7); + III(aaa, bbb, ccc, ddd, eee, X[ 0], 12); + III(eee, aaa, bbb, ccc, ddd, X[13], 8); + III(ddd, eee, aaa, bbb, ccc, X[ 5], 9); + III(ccc, ddd, eee, aaa, bbb, X[10], 11); + III(bbb, ccc, ddd, eee, aaa, X[14], 7); + III(aaa, bbb, ccc, ddd, eee, X[15], 7); + III(eee, aaa, bbb, ccc, ddd, X[ 8], 12); + III(ddd, eee, aaa, bbb, ccc, X[12], 7); + III(ccc, ddd, eee, aaa, bbb, X[ 4], 6); + III(bbb, ccc, ddd, eee, aaa, X[ 9], 15); + III(aaa, bbb, ccc, ddd, eee, X[ 1], 13); + III(eee, aaa, bbb, ccc, ddd, X[ 2], 11); + + /* parallel round 3 */ + HHH(ddd, eee, aaa, bbb, ccc, X[15], 9); + HHH(ccc, ddd, eee, aaa, bbb, X[ 5], 7); + HHH(bbb, ccc, ddd, eee, aaa, X[ 1], 15); + HHH(aaa, bbb, ccc, ddd, eee, X[ 3], 11); + HHH(eee, aaa, bbb, ccc, ddd, X[ 7], 8); + HHH(ddd, eee, aaa, bbb, ccc, X[14], 6); + HHH(ccc, ddd, eee, aaa, bbb, X[ 6], 6); + HHH(bbb, ccc, ddd, eee, aaa, X[ 9], 14); + HHH(aaa, bbb, ccc, ddd, eee, X[11], 12); + HHH(eee, aaa, bbb, ccc, ddd, X[ 8], 13); + HHH(ddd, eee, aaa, bbb, ccc, X[12], 5); + HHH(ccc, ddd, eee, aaa, bbb, X[ 2], 14); + HHH(bbb, ccc, ddd, eee, aaa, X[10], 13); + HHH(aaa, bbb, ccc, ddd, eee, X[ 0], 13); + HHH(eee, aaa, bbb, ccc, ddd, X[ 4], 7); + HHH(ddd, eee, aaa, bbb, ccc, X[13], 5); + + /* parallel round 4 */ + GGG(ccc, ddd, eee, aaa, bbb, X[ 8], 15); + GGG(bbb, ccc, ddd, eee, aaa, X[ 6], 5); + GGG(aaa, bbb, ccc, ddd, eee, X[ 4], 8); + GGG(eee, aaa, bbb, ccc, ddd, X[ 1], 11); + GGG(ddd, eee, aaa, bbb, ccc, X[ 3], 14); + GGG(ccc, ddd, eee, aaa, bbb, X[11], 14); + GGG(bbb, ccc, ddd, eee, aaa, X[15], 6); + GGG(aaa, bbb, ccc, ddd, eee, X[ 0], 14); + GGG(eee, aaa, bbb, ccc, ddd, X[ 5], 6); + GGG(ddd, eee, aaa, bbb, ccc, X[12], 9); + GGG(ccc, ddd, eee, aaa, bbb, X[ 2], 12); + GGG(bbb, ccc, ddd, eee, aaa, X[13], 9); + GGG(aaa, bbb, ccc, ddd, eee, X[ 9], 12); + GGG(eee, aaa, bbb, ccc, ddd, X[ 7], 5); + GGG(ddd, eee, aaa, bbb, ccc, X[10], 15); + GGG(ccc, ddd, eee, aaa, bbb, X[14], 8); + + /* parallel round 5 */ + FFF(bbb, ccc, ddd, eee, aaa, X[12] , 8); + FFF(aaa, bbb, ccc, ddd, eee, X[15] , 5); + FFF(eee, aaa, bbb, ccc, ddd, X[10] , 12); + FFF(ddd, eee, aaa, bbb, ccc, X[ 4] , 9); + FFF(ccc, ddd, eee, aaa, bbb, X[ 1] , 12); + FFF(bbb, ccc, ddd, eee, aaa, X[ 5] , 5); + FFF(aaa, bbb, ccc, ddd, eee, X[ 8] , 14); + FFF(eee, aaa, bbb, ccc, ddd, X[ 7] , 6); + FFF(ddd, eee, aaa, bbb, ccc, X[ 6] , 8); + FFF(ccc, ddd, eee, aaa, bbb, X[ 2] , 13); + FFF(bbb, ccc, ddd, eee, aaa, X[13] , 6); + FFF(aaa, bbb, ccc, ddd, eee, X[14] , 5); + FFF(eee, aaa, bbb, ccc, ddd, X[ 0] , 15); + FFF(ddd, eee, aaa, bbb, ccc, X[ 3] , 13); + FFF(ccc, ddd, eee, aaa, bbb, X[ 9] , 11); + FFF(bbb, ccc, ddd, eee, aaa, X[11] , 11); + + /* combine results */ + ddd += cc + md->rmd160.state[1]; /* final result for md->rmd160.state[0] */ + md->rmd160.state[1] = md->rmd160.state[2] + dd + eee; + md->rmd160.state[2] = md->rmd160.state[3] + ee + aaa; + md->rmd160.state[3] = md->rmd160.state[4] + aa + bbb; + md->rmd160.state[4] = md->rmd160.state[0] + bb + ccc; + md->rmd160.state[0] = ddd; + + return CRYPT_OK; +} + +#ifdef LTC_CLEAN_STACK +static int rmd160_compress(hash_state *md, unsigned char *buf) +{ + int err; + err = _rmd160_compress(md, buf); + burn_stack(sizeof(ulong32) * 26 + sizeof(int)); + return err; +} +#endif + +/** + Initialize the hash state + @param md The hash state you wish to initialize + @return CRYPT_OK if successful +*/ +int rmd160_init(hash_state * md) +{ + LTC_ARGCHK(md != NULL); + md->rmd160.state[0] = 0x67452301UL; + md->rmd160.state[1] = 0xefcdab89UL; + md->rmd160.state[2] = 0x98badcfeUL; + md->rmd160.state[3] = 0x10325476UL; + md->rmd160.state[4] = 0xc3d2e1f0UL; + md->rmd160.curlen = 0; + md->rmd160.length = 0; + return CRYPT_OK; +} + +/** + Process a block of memory though the hash + @param md The hash state + @param in The data to hash + @param inlen The length of the data (octets) + @return CRYPT_OK if successful +*/ +HASH_PROCESS(rmd160_process, rmd160_compress, rmd160, 64) + +/** + Terminate the hash to get the digest + @param md The hash state + @param out [out] The destination of the hash (20 bytes) + @return CRYPT_OK if successful +*/ +int rmd160_done(hash_state * md, unsigned char *out) +{ + int i; + + LTC_ARGCHK(md != NULL); + LTC_ARGCHK(out != NULL); + + if (md->rmd160.curlen >= sizeof(md->rmd160.buf)) { + return CRYPT_INVALID_ARG; + } + + + /* increase the length of the message */ + md->rmd160.length += md->rmd160.curlen * 8; + + /* append the '1' bit */ + md->rmd160.buf[md->rmd160.curlen++] = (unsigned char)0x80; + + /* if the length is currently above 56 bytes we append zeros + * then compress. Then we can fall back to padding zeros and length + * encoding like normal. + */ + if (md->rmd160.curlen > 56) { + while (md->rmd160.curlen < 64) { + md->rmd160.buf[md->rmd160.curlen++] = (unsigned char)0; + } + rmd160_compress(md, md->rmd160.buf); + md->rmd160.curlen = 0; + } + + /* pad upto 56 bytes of zeroes */ + while (md->rmd160.curlen < 56) { + md->rmd160.buf[md->rmd160.curlen++] = (unsigned char)0; + } + + /* store length */ + STORE64L(md->rmd160.length, md->rmd160.buf+56); + rmd160_compress(md, md->rmd160.buf); + + /* copy output */ + for (i = 0; i < 5; i++) { + STORE32L(md->rmd160.state[i], out+(4*i)); + } +#ifdef LTC_CLEAN_STACK + zeromem(md, sizeof(hash_state)); +#endif + return CRYPT_OK; +} + +/** + Self-test the hash + @return CRYPT_OK if successful, CRYPT_NOP if self-tests have been disabled +*/ +int rmd160_test(void) +{ +#ifndef LTC_TEST + return CRYPT_NOP; +#else + static const struct { + char *msg; + unsigned char md[20]; + } tests[] = { + { "", + { 0x9c, 0x11, 0x85, 0xa5, 0xc5, 0xe9, 0xfc, 0x54, 0x61, 0x28, + 0x08, 0x97, 0x7e, 0xe8, 0xf5, 0x48, 0xb2, 0x25, 0x8d, 0x31 } + }, + { "a", + { 0x0b, 0xdc, 0x9d, 0x2d, 0x25, 0x6b, 0x3e, 0xe9, 0xda, 0xae, + 0x34, 0x7b, 0xe6, 0xf4, 0xdc, 0x83, 0x5a, 0x46, 0x7f, 0xfe } + }, + { "abc", + { 0x8e, 0xb2, 0x08, 0xf7, 0xe0, 0x5d, 0x98, 0x7a, 0x9b, 0x04, + 0x4a, 0x8e, 0x98, 0xc6, 0xb0, 0x87, 0xf1, 0x5a, 0x0b, 0xfc } + }, + { "message digest", + { 0x5d, 0x06, 0x89, 0xef, 0x49, 0xd2, 0xfa, 0xe5, 0x72, 0xb8, + 0x81, 0xb1, 0x23, 0xa8, 0x5f, 0xfa, 0x21, 0x59, 0x5f, 0x36 } + }, + { "abcdefghijklmnopqrstuvwxyz", + { 0xf7, 0x1c, 0x27, 0x10, 0x9c, 0x69, 0x2c, 0x1b, 0x56, 0xbb, + 0xdc, 0xeb, 0x5b, 0x9d, 0x28, 0x65, 0xb3, 0x70, 0x8d, 0xbc } + }, + { "abcdbcdecdefdefgefghfghighijhijkijkljklmklmnlmnomnopnopq", + { 0x12, 0xa0, 0x53, 0x38, 0x4a, 0x9c, 0x0c, 0x88, 0xe4, 0x05, + 0xa0, 0x6c, 0x27, 0xdc, 0xf4, 0x9a, 0xda, 0x62, 0xeb, 0x2b } + } + }; + int x; + unsigned char buf[20]; + hash_state md; + + for (x = 0; x < (int)(sizeof(tests)/sizeof(tests[0])); x++) { + rmd160_init(&md); + rmd160_process(&md, (unsigned char *)tests[x].msg, strlen(tests[x].msg)); + rmd160_done(&md, buf); + if (XMEMCMP(buf, tests[x].md, 20) != 0) { +#if 0 + printf("Failed test %d\n", x); +#endif + return CRYPT_FAIL_TESTVECTOR; + } + } + return CRYPT_OK; +#endif +} + +#endif + + +/* $Source: /cvs/libtom/libtomcrypt/src/hashes/rmd160.c,v $ */ +/* $Revision: 1.8 $ */ +/* $Date: 2006/11/01 09:28:17 $ */ diff --git a/libtomcrypt/src/hashes/rmd256.c b/libtomcrypt/src/hashes/rmd256.c new file mode 100644 index 0000000..4540ef9 --- /dev/null +++ b/libtomcrypt/src/hashes/rmd256.c @@ -0,0 +1,431 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @param rmd256.c + RMD256 Hash function +*/ + +#ifdef RIPEMD256 + +const struct ltc_hash_descriptor rmd256_desc = +{ + "rmd256", + 8, + 16, + 64, + + /* OID */ + { 1, 3, 36, 3, 2, 3 }, + 6, + + &rmd256_init, + &rmd256_process, + &rmd256_done, + &rmd256_test, + NULL +}; + +/* the four basic functions F(), G() and H() */ +#define F(x, y, z) ((x) ^ (y) ^ (z)) +#define G(x, y, z) (((x) & (y)) | (~(x) & (z))) +#define H(x, y, z) (((x) | ~(y)) ^ (z)) +#define I(x, y, z) (((x) & (z)) | ((y) & ~(z))) + +/* the eight basic operations FF() through III() */ +#define FF(a, b, c, d, x, s) \ + (a) += F((b), (c), (d)) + (x);\ + (a) = ROLc((a), (s)); + +#define GG(a, b, c, d, x, s) \ + (a) += G((b), (c), (d)) + (x) + 0x5a827999UL;\ + (a) = ROLc((a), (s)); + +#define HH(a, b, c, d, x, s) \ + (a) += H((b), (c), (d)) + (x) + 0x6ed9eba1UL;\ + (a) = ROLc((a), (s)); + +#define II(a, b, c, d, x, s) \ + (a) += I((b), (c), (d)) + (x) + 0x8f1bbcdcUL;\ + (a) = ROLc((a), (s)); + +#define FFF(a, b, c, d, x, s) \ + (a) += F((b), (c), (d)) + (x);\ + (a) = ROLc((a), (s)); + +#define GGG(a, b, c, d, x, s) \ + (a) += G((b), (c), (d)) + (x) + 0x6d703ef3UL;\ + (a) = ROLc((a), (s)); + +#define HHH(a, b, c, d, x, s) \ + (a) += H((b), (c), (d)) + (x) + 0x5c4dd124UL;\ + (a) = ROLc((a), (s)); + +#define III(a, b, c, d, x, s) \ + (a) += I((b), (c), (d)) + (x) + 0x50a28be6UL;\ + (a) = ROLc((a), (s)); + +#ifdef LTC_CLEAN_STACK +static int _rmd256_compress(hash_state *md, unsigned char *buf) +#else +static int rmd256_compress(hash_state *md, unsigned char *buf) +#endif +{ + ulong32 aa,bb,cc,dd,aaa,bbb,ccc,ddd,tmp,X[16]; + int i; + + /* load words X */ + for (i = 0; i < 16; i++){ + LOAD32L(X[i], buf + (4 * i)); + } + + /* load state */ + aa = md->rmd256.state[0]; + bb = md->rmd256.state[1]; + cc = md->rmd256.state[2]; + dd = md->rmd256.state[3]; + aaa = md->rmd256.state[4]; + bbb = md->rmd256.state[5]; + ccc = md->rmd256.state[6]; + ddd = md->rmd256.state[7]; + + /* round 1 */ + FF(aa, bb, cc, dd, X[ 0], 11); + FF(dd, aa, bb, cc, X[ 1], 14); + FF(cc, dd, aa, bb, X[ 2], 15); + FF(bb, cc, dd, aa, X[ 3], 12); + FF(aa, bb, cc, dd, X[ 4], 5); + FF(dd, aa, bb, cc, X[ 5], 8); + FF(cc, dd, aa, bb, X[ 6], 7); + FF(bb, cc, dd, aa, X[ 7], 9); + FF(aa, bb, cc, dd, X[ 8], 11); + FF(dd, aa, bb, cc, X[ 9], 13); + FF(cc, dd, aa, bb, X[10], 14); + FF(bb, cc, dd, aa, X[11], 15); + FF(aa, bb, cc, dd, X[12], 6); + FF(dd, aa, bb, cc, X[13], 7); + FF(cc, dd, aa, bb, X[14], 9); + FF(bb, cc, dd, aa, X[15], 8); + + /* parallel round 1 */ + III(aaa, bbb, ccc, ddd, X[ 5], 8); + III(ddd, aaa, bbb, ccc, X[14], 9); + III(ccc, ddd, aaa, bbb, X[ 7], 9); + III(bbb, ccc, ddd, aaa, X[ 0], 11); + III(aaa, bbb, ccc, ddd, X[ 9], 13); + III(ddd, aaa, bbb, ccc, X[ 2], 15); + III(ccc, ddd, aaa, bbb, X[11], 15); + III(bbb, ccc, ddd, aaa, X[ 4], 5); + III(aaa, bbb, ccc, ddd, X[13], 7); + III(ddd, aaa, bbb, ccc, X[ 6], 7); + III(ccc, ddd, aaa, bbb, X[15], 8); + III(bbb, ccc, ddd, aaa, X[ 8], 11); + III(aaa, bbb, ccc, ddd, X[ 1], 14); + III(ddd, aaa, bbb, ccc, X[10], 14); + III(ccc, ddd, aaa, bbb, X[ 3], 12); + III(bbb, ccc, ddd, aaa, X[12], 6); + + tmp = aa; aa = aaa; aaa = tmp; + + /* round 2 */ + GG(aa, bb, cc, dd, X[ 7], 7); + GG(dd, aa, bb, cc, X[ 4], 6); + GG(cc, dd, aa, bb, X[13], 8); + GG(bb, cc, dd, aa, X[ 1], 13); + GG(aa, bb, cc, dd, X[10], 11); + GG(dd, aa, bb, cc, X[ 6], 9); + GG(cc, dd, aa, bb, X[15], 7); + GG(bb, cc, dd, aa, X[ 3], 15); + GG(aa, bb, cc, dd, X[12], 7); + GG(dd, aa, bb, cc, X[ 0], 12); + GG(cc, dd, aa, bb, X[ 9], 15); + GG(bb, cc, dd, aa, X[ 5], 9); + GG(aa, bb, cc, dd, X[ 2], 11); + GG(dd, aa, bb, cc, X[14], 7); + GG(cc, dd, aa, bb, X[11], 13); + GG(bb, cc, dd, aa, X[ 8], 12); + + /* parallel round 2 */ + HHH(aaa, bbb, ccc, ddd, X[ 6], 9); + HHH(ddd, aaa, bbb, ccc, X[11], 13); + HHH(ccc, ddd, aaa, bbb, X[ 3], 15); + HHH(bbb, ccc, ddd, aaa, X[ 7], 7); + HHH(aaa, bbb, ccc, ddd, X[ 0], 12); + HHH(ddd, aaa, bbb, ccc, X[13], 8); + HHH(ccc, ddd, aaa, bbb, X[ 5], 9); + HHH(bbb, ccc, ddd, aaa, X[10], 11); + HHH(aaa, bbb, ccc, ddd, X[14], 7); + HHH(ddd, aaa, bbb, ccc, X[15], 7); + HHH(ccc, ddd, aaa, bbb, X[ 8], 12); + HHH(bbb, ccc, ddd, aaa, X[12], 7); + HHH(aaa, bbb, ccc, ddd, X[ 4], 6); + HHH(ddd, aaa, bbb, ccc, X[ 9], 15); + HHH(ccc, ddd, aaa, bbb, X[ 1], 13); + HHH(bbb, ccc, ddd, aaa, X[ 2], 11); + + tmp = bb; bb = bbb; bbb = tmp; + + /* round 3 */ + HH(aa, bb, cc, dd, X[ 3], 11); + HH(dd, aa, bb, cc, X[10], 13); + HH(cc, dd, aa, bb, X[14], 6); + HH(bb, cc, dd, aa, X[ 4], 7); + HH(aa, bb, cc, dd, X[ 9], 14); + HH(dd, aa, bb, cc, X[15], 9); + HH(cc, dd, aa, bb, X[ 8], 13); + HH(bb, cc, dd, aa, X[ 1], 15); + HH(aa, bb, cc, dd, X[ 2], 14); + HH(dd, aa, bb, cc, X[ 7], 8); + HH(cc, dd, aa, bb, X[ 0], 13); + HH(bb, cc, dd, aa, X[ 6], 6); + HH(aa, bb, cc, dd, X[13], 5); + HH(dd, aa, bb, cc, X[11], 12); + HH(cc, dd, aa, bb, X[ 5], 7); + HH(bb, cc, dd, aa, X[12], 5); + + /* parallel round 3 */ + GGG(aaa, bbb, ccc, ddd, X[15], 9); + GGG(ddd, aaa, bbb, ccc, X[ 5], 7); + GGG(ccc, ddd, aaa, bbb, X[ 1], 15); + GGG(bbb, ccc, ddd, aaa, X[ 3], 11); + GGG(aaa, bbb, ccc, ddd, X[ 7], 8); + GGG(ddd, aaa, bbb, ccc, X[14], 6); + GGG(ccc, ddd, aaa, bbb, X[ 6], 6); + GGG(bbb, ccc, ddd, aaa, X[ 9], 14); + GGG(aaa, bbb, ccc, ddd, X[11], 12); + GGG(ddd, aaa, bbb, ccc, X[ 8], 13); + GGG(ccc, ddd, aaa, bbb, X[12], 5); + GGG(bbb, ccc, ddd, aaa, X[ 2], 14); + GGG(aaa, bbb, ccc, ddd, X[10], 13); + GGG(ddd, aaa, bbb, ccc, X[ 0], 13); + GGG(ccc, ddd, aaa, bbb, X[ 4], 7); + GGG(bbb, ccc, ddd, aaa, X[13], 5); + + tmp = cc; cc = ccc; ccc = tmp; + + /* round 4 */ + II(aa, bb, cc, dd, X[ 1], 11); + II(dd, aa, bb, cc, X[ 9], 12); + II(cc, dd, aa, bb, X[11], 14); + II(bb, cc, dd, aa, X[10], 15); + II(aa, bb, cc, dd, X[ 0], 14); + II(dd, aa, bb, cc, X[ 8], 15); + II(cc, dd, aa, bb, X[12], 9); + II(bb, cc, dd, aa, X[ 4], 8); + II(aa, bb, cc, dd, X[13], 9); + II(dd, aa, bb, cc, X[ 3], 14); + II(cc, dd, aa, bb, X[ 7], 5); + II(bb, cc, dd, aa, X[15], 6); + II(aa, bb, cc, dd, X[14], 8); + II(dd, aa, bb, cc, X[ 5], 6); + II(cc, dd, aa, bb, X[ 6], 5); + II(bb, cc, dd, aa, X[ 2], 12); + + /* parallel round 4 */ + FFF(aaa, bbb, ccc, ddd, X[ 8], 15); + FFF(ddd, aaa, bbb, ccc, X[ 6], 5); + FFF(ccc, ddd, aaa, bbb, X[ 4], 8); + FFF(bbb, ccc, ddd, aaa, X[ 1], 11); + FFF(aaa, bbb, ccc, ddd, X[ 3], 14); + FFF(ddd, aaa, bbb, ccc, X[11], 14); + FFF(ccc, ddd, aaa, bbb, X[15], 6); + FFF(bbb, ccc, ddd, aaa, X[ 0], 14); + FFF(aaa, bbb, ccc, ddd, X[ 5], 6); + FFF(ddd, aaa, bbb, ccc, X[12], 9); + FFF(ccc, ddd, aaa, bbb, X[ 2], 12); + FFF(bbb, ccc, ddd, aaa, X[13], 9); + FFF(aaa, bbb, ccc, ddd, X[ 9], 12); + FFF(ddd, aaa, bbb, ccc, X[ 7], 5); + FFF(ccc, ddd, aaa, bbb, X[10], 15); + FFF(bbb, ccc, ddd, aaa, X[14], 8); + + tmp = dd; dd = ddd; ddd = tmp; + + /* combine results */ + md->rmd256.state[0] += aa; + md->rmd256.state[1] += bb; + md->rmd256.state[2] += cc; + md->rmd256.state[3] += dd; + md->rmd256.state[4] += aaa; + md->rmd256.state[5] += bbb; + md->rmd256.state[6] += ccc; + md->rmd256.state[7] += ddd; + + return CRYPT_OK; +} + +#ifdef LTC_CLEAN_STACK +static int rmd256_compress(hash_state *md, unsigned char *buf) +{ + int err; + err = _rmd256_compress(md, buf); + burn_stack(sizeof(ulong32) * 25 + sizeof(int)); + return err; +} +#endif + +/** + Initialize the hash state + @param md The hash state you wish to initialize + @return CRYPT_OK if successful +*/ +int rmd256_init(hash_state * md) +{ + LTC_ARGCHK(md != NULL); + md->rmd256.state[0] = 0x67452301UL; + md->rmd256.state[1] = 0xefcdab89UL; + md->rmd256.state[2] = 0x98badcfeUL; + md->rmd256.state[3] = 0x10325476UL; + md->rmd256.state[4] = 0x76543210UL; + md->rmd256.state[5] = 0xfedcba98UL; + md->rmd256.state[6] = 0x89abcdefUL; + md->rmd256.state[7] = 0x01234567UL; + md->rmd256.curlen = 0; + md->rmd256.length = 0; + return CRYPT_OK; +} + +/** + Process a block of memory though the hash + @param md The hash state + @param in The data to hash + @param inlen The length of the data (octets) + @return CRYPT_OK if successful +*/ +HASH_PROCESS(rmd256_process, rmd256_compress, rmd256, 64) + +/** + Terminate the hash to get the digest + @param md The hash state + @param out [out] The destination of the hash (16 bytes) + @return CRYPT_OK if successful +*/ +int rmd256_done(hash_state * md, unsigned char *out) +{ + int i; + + LTC_ARGCHK(md != NULL); + LTC_ARGCHK(out != NULL); + + if (md->rmd256.curlen >= sizeof(md->rmd256.buf)) { + return CRYPT_INVALID_ARG; + } + + + /* increase the length of the message */ + md->rmd256.length += md->rmd256.curlen * 8; + + /* append the '1' bit */ + md->rmd256.buf[md->rmd256.curlen++] = (unsigned char)0x80; + + /* if the length is currently above 56 bytes we append zeros + * then compress. Then we can fall back to padding zeros and length + * encoding like normal. + */ + if (md->rmd256.curlen > 56) { + while (md->rmd256.curlen < 64) { + md->rmd256.buf[md->rmd256.curlen++] = (unsigned char)0; + } + rmd256_compress(md, md->rmd256.buf); + md->rmd256.curlen = 0; + } + + /* pad upto 56 bytes of zeroes */ + while (md->rmd256.curlen < 56) { + md->rmd256.buf[md->rmd256.curlen++] = (unsigned char)0; + } + + /* store length */ + STORE64L(md->rmd256.length, md->rmd256.buf+56); + rmd256_compress(md, md->rmd256.buf); + + /* copy output */ + for (i = 0; i < 8; i++) { + STORE32L(md->rmd256.state[i], out+(4*i)); + } +#ifdef LTC_CLEAN_STACK + zeromem(md, sizeof(hash_state)); +#endif + return CRYPT_OK; +} + +/** + Self-test the hash + @return CRYPT_OK if successful, CRYPT_NOP if self-tests have been disabled +*/ +int rmd256_test(void) +{ +#ifndef LTC_TEST + return CRYPT_NOP; +#else + static const struct { + char *msg; + unsigned char md[32]; + } tests[] = { + { "", + { 0x02, 0xba, 0x4c, 0x4e, 0x5f, 0x8e, 0xcd, 0x18, + 0x77, 0xfc, 0x52, 0xd6, 0x4d, 0x30, 0xe3, 0x7a, + 0x2d, 0x97, 0x74, 0xfb, 0x1e, 0x5d, 0x02, 0x63, + 0x80, 0xae, 0x01, 0x68, 0xe3, 0xc5, 0x52, 0x2d } + }, + { "a", + { 0xf9, 0x33, 0x3e, 0x45, 0xd8, 0x57, 0xf5, 0xd9, + 0x0a, 0x91, 0xba, 0xb7, 0x0a, 0x1e, 0xba, 0x0c, + 0xfb, 0x1b, 0xe4, 0xb0, 0x78, 0x3c, 0x9a, 0xcf, + 0xcd, 0x88, 0x3a, 0x91, 0x34, 0x69, 0x29, 0x25 } + }, + { "abc", + { 0xaf, 0xbd, 0x6e, 0x22, 0x8b, 0x9d, 0x8c, 0xbb, + 0xce, 0xf5, 0xca, 0x2d, 0x03, 0xe6, 0xdb, 0xa1, + 0x0a, 0xc0, 0xbc, 0x7d, 0xcb, 0xe4, 0x68, 0x0e, + 0x1e, 0x42, 0xd2, 0xe9, 0x75, 0x45, 0x9b, 0x65 } + }, + { "message digest", + { 0x87, 0xe9, 0x71, 0x75, 0x9a, 0x1c, 0xe4, 0x7a, + 0x51, 0x4d, 0x5c, 0x91, 0x4c, 0x39, 0x2c, 0x90, + 0x18, 0xc7, 0xc4, 0x6b, 0xc1, 0x44, 0x65, 0x55, + 0x4a, 0xfc, 0xdf, 0x54, 0xa5, 0x07, 0x0c, 0x0e } + }, + { "abcdefghijklmnopqrstuvwxyz", + { 0x64, 0x9d, 0x30, 0x34, 0x75, 0x1e, 0xa2, 0x16, + 0x77, 0x6b, 0xf9, 0xa1, 0x8a, 0xcc, 0x81, 0xbc, + 0x78, 0x96, 0x11, 0x8a, 0x51, 0x97, 0x96, 0x87, + 0x82, 0xdd, 0x1f, 0xd9, 0x7d, 0x8d, 0x51, 0x33 } + }, + { "ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789", + { 0x57, 0x40, 0xa4, 0x08, 0xac, 0x16, 0xb7, 0x20, + 0xb8, 0x44, 0x24, 0xae, 0x93, 0x1c, 0xbb, 0x1f, + 0xe3, 0x63, 0xd1, 0xd0, 0xbf, 0x40, 0x17, 0xf1, + 0xa8, 0x9f, 0x7e, 0xa6, 0xde, 0x77, 0xa0, 0xb8 } + } + }; + int x; + unsigned char buf[32]; + hash_state md; + + for (x = 0; x < (int)(sizeof(tests)/sizeof(tests[0])); x++) { + rmd256_init(&md); + rmd256_process(&md, (unsigned char *)tests[x].msg, strlen(tests[x].msg)); + rmd256_done(&md, buf); + if (XMEMCMP(buf, tests[x].md, 32) != 0) { + #if 0 + printf("Failed test %d\n", x); + #endif + return CRYPT_FAIL_TESTVECTOR; + } + } + return CRYPT_OK; +#endif +} + +#endif + diff --git a/libtomcrypt/src/hashes/rmd320.c b/libtomcrypt/src/hashes/rmd320.c new file mode 100644 index 0000000..a11fca4 --- /dev/null +++ b/libtomcrypt/src/hashes/rmd320.c @@ -0,0 +1,495 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file rmd320.c + RMD320 hash function +*/ + +#ifdef RIPEMD320 + +const struct ltc_hash_descriptor rmd320_desc = +{ + "rmd320", + 9, + 20, + 64, + + /* OID */ + { 0 }, + 0, + + &rmd320_init, + &rmd320_process, + &rmd320_done, + &rmd320_test, + NULL +}; + +/* the five basic functions F(), G() and H() */ +#define F(x, y, z) ((x) ^ (y) ^ (z)) +#define G(x, y, z) (((x) & (y)) | (~(x) & (z))) +#define H(x, y, z) (((x) | ~(y)) ^ (z)) +#define I(x, y, z) (((x) & (z)) | ((y) & ~(z))) +#define J(x, y, z) ((x) ^ ((y) | ~(z))) + +/* the ten basic operations FF() through III() */ +#define FF(a, b, c, d, e, x, s) \ + (a) += F((b), (c), (d)) + (x);\ + (a) = ROLc((a), (s)) + (e);\ + (c) = ROLc((c), 10); + +#define GG(a, b, c, d, e, x, s) \ + (a) += G((b), (c), (d)) + (x) + 0x5a827999UL;\ + (a) = ROLc((a), (s)) + (e);\ + (c) = ROLc((c), 10); + +#define HH(a, b, c, d, e, x, s) \ + (a) += H((b), (c), (d)) + (x) + 0x6ed9eba1UL;\ + (a) = ROLc((a), (s)) + (e);\ + (c) = ROLc((c), 10); + +#define II(a, b, c, d, e, x, s) \ + (a) += I((b), (c), (d)) + (x) + 0x8f1bbcdcUL;\ + (a) = ROLc((a), (s)) + (e);\ + (c) = ROLc((c), 10); + +#define JJ(a, b, c, d, e, x, s) \ + (a) += J((b), (c), (d)) + (x) + 0xa953fd4eUL;\ + (a) = ROLc((a), (s)) + (e);\ + (c) = ROLc((c), 10); + +#define FFF(a, b, c, d, e, x, s) \ + (a) += F((b), (c), (d)) + (x);\ + (a) = ROLc((a), (s)) + (e);\ + (c) = ROLc((c), 10); + +#define GGG(a, b, c, d, e, x, s) \ + (a) += G((b), (c), (d)) + (x) + 0x7a6d76e9UL;\ + (a) = ROLc((a), (s)) + (e);\ + (c) = ROLc((c), 10); + +#define HHH(a, b, c, d, e, x, s) \ + (a) += H((b), (c), (d)) + (x) + 0x6d703ef3UL;\ + (a) = ROLc((a), (s)) + (e);\ + (c) = ROLc((c), 10); + +#define III(a, b, c, d, e, x, s) \ + (a) += I((b), (c), (d)) + (x) + 0x5c4dd124UL;\ + (a) = ROLc((a), (s)) + (e);\ + (c) = ROLc((c), 10); + +#define JJJ(a, b, c, d, e, x, s) \ + (a) += J((b), (c), (d)) + (x) + 0x50a28be6UL;\ + (a) = ROLc((a), (s)) + (e);\ + (c) = ROLc((c), 10); + + +#ifdef LTC_CLEAN_STACK +static int _rmd320_compress(hash_state *md, unsigned char *buf) +#else +static int rmd320_compress(hash_state *md, unsigned char *buf) +#endif +{ + ulong32 aa,bb,cc,dd,ee,aaa,bbb,ccc,ddd,eee,tmp,X[16]; + int i; + + /* load words X */ + for (i = 0; i < 16; i++){ + LOAD32L(X[i], buf + (4 * i)); + } + + /* load state */ + aa = md->rmd320.state[0]; + bb = md->rmd320.state[1]; + cc = md->rmd320.state[2]; + dd = md->rmd320.state[3]; + ee = md->rmd320.state[4]; + aaa = md->rmd320.state[5]; + bbb = md->rmd320.state[6]; + ccc = md->rmd320.state[7]; + ddd = md->rmd320.state[8]; + eee = md->rmd320.state[9]; + + /* round 1 */ + FF(aa, bb, cc, dd, ee, X[ 0], 11); + FF(ee, aa, bb, cc, dd, X[ 1], 14); + FF(dd, ee, aa, bb, cc, X[ 2], 15); + FF(cc, dd, ee, aa, bb, X[ 3], 12); + FF(bb, cc, dd, ee, aa, X[ 4], 5); + FF(aa, bb, cc, dd, ee, X[ 5], 8); + FF(ee, aa, bb, cc, dd, X[ 6], 7); + FF(dd, ee, aa, bb, cc, X[ 7], 9); + FF(cc, dd, ee, aa, bb, X[ 8], 11); + FF(bb, cc, dd, ee, aa, X[ 9], 13); + FF(aa, bb, cc, dd, ee, X[10], 14); + FF(ee, aa, bb, cc, dd, X[11], 15); + FF(dd, ee, aa, bb, cc, X[12], 6); + FF(cc, dd, ee, aa, bb, X[13], 7); + FF(bb, cc, dd, ee, aa, X[14], 9); + FF(aa, bb, cc, dd, ee, X[15], 8); + + /* parallel round 1 */ + JJJ(aaa, bbb, ccc, ddd, eee, X[ 5], 8); + JJJ(eee, aaa, bbb, ccc, ddd, X[14], 9); + JJJ(ddd, eee, aaa, bbb, ccc, X[ 7], 9); + JJJ(ccc, ddd, eee, aaa, bbb, X[ 0], 11); + JJJ(bbb, ccc, ddd, eee, aaa, X[ 9], 13); + JJJ(aaa, bbb, ccc, ddd, eee, X[ 2], 15); + JJJ(eee, aaa, bbb, ccc, ddd, X[11], 15); + JJJ(ddd, eee, aaa, bbb, ccc, X[ 4], 5); + JJJ(ccc, ddd, eee, aaa, bbb, X[13], 7); + JJJ(bbb, ccc, ddd, eee, aaa, X[ 6], 7); + JJJ(aaa, bbb, ccc, ddd, eee, X[15], 8); + JJJ(eee, aaa, bbb, ccc, ddd, X[ 8], 11); + JJJ(ddd, eee, aaa, bbb, ccc, X[ 1], 14); + JJJ(ccc, ddd, eee, aaa, bbb, X[10], 14); + JJJ(bbb, ccc, ddd, eee, aaa, X[ 3], 12); + JJJ(aaa, bbb, ccc, ddd, eee, X[12], 6); + + tmp = aa; aa = aaa; aaa = tmp; + + /* round 2 */ + GG(ee, aa, bb, cc, dd, X[ 7], 7); + GG(dd, ee, aa, bb, cc, X[ 4], 6); + GG(cc, dd, ee, aa, bb, X[13], 8); + GG(bb, cc, dd, ee, aa, X[ 1], 13); + GG(aa, bb, cc, dd, ee, X[10], 11); + GG(ee, aa, bb, cc, dd, X[ 6], 9); + GG(dd, ee, aa, bb, cc, X[15], 7); + GG(cc, dd, ee, aa, bb, X[ 3], 15); + GG(bb, cc, dd, ee, aa, X[12], 7); + GG(aa, bb, cc, dd, ee, X[ 0], 12); + GG(ee, aa, bb, cc, dd, X[ 9], 15); + GG(dd, ee, aa, bb, cc, X[ 5], 9); + GG(cc, dd, ee, aa, bb, X[ 2], 11); + GG(bb, cc, dd, ee, aa, X[14], 7); + GG(aa, bb, cc, dd, ee, X[11], 13); + GG(ee, aa, bb, cc, dd, X[ 8], 12); + + /* parallel round 2 */ + III(eee, aaa, bbb, ccc, ddd, X[ 6], 9); + III(ddd, eee, aaa, bbb, ccc, X[11], 13); + III(ccc, ddd, eee, aaa, bbb, X[ 3], 15); + III(bbb, ccc, ddd, eee, aaa, X[ 7], 7); + III(aaa, bbb, ccc, ddd, eee, X[ 0], 12); + III(eee, aaa, bbb, ccc, ddd, X[13], 8); + III(ddd, eee, aaa, bbb, ccc, X[ 5], 9); + III(ccc, ddd, eee, aaa, bbb, X[10], 11); + III(bbb, ccc, ddd, eee, aaa, X[14], 7); + III(aaa, bbb, ccc, ddd, eee, X[15], 7); + III(eee, aaa, bbb, ccc, ddd, X[ 8], 12); + III(ddd, eee, aaa, bbb, ccc, X[12], 7); + III(ccc, ddd, eee, aaa, bbb, X[ 4], 6); + III(bbb, ccc, ddd, eee, aaa, X[ 9], 15); + III(aaa, bbb, ccc, ddd, eee, X[ 1], 13); + III(eee, aaa, bbb, ccc, ddd, X[ 2], 11); + + tmp = bb; bb = bbb; bbb = tmp; + + /* round 3 */ + HH(dd, ee, aa, bb, cc, X[ 3], 11); + HH(cc, dd, ee, aa, bb, X[10], 13); + HH(bb, cc, dd, ee, aa, X[14], 6); + HH(aa, bb, cc, dd, ee, X[ 4], 7); + HH(ee, aa, bb, cc, dd, X[ 9], 14); + HH(dd, ee, aa, bb, cc, X[15], 9); + HH(cc, dd, ee, aa, bb, X[ 8], 13); + HH(bb, cc, dd, ee, aa, X[ 1], 15); + HH(aa, bb, cc, dd, ee, X[ 2], 14); + HH(ee, aa, bb, cc, dd, X[ 7], 8); + HH(dd, ee, aa, bb, cc, X[ 0], 13); + HH(cc, dd, ee, aa, bb, X[ 6], 6); + HH(bb, cc, dd, ee, aa, X[13], 5); + HH(aa, bb, cc, dd, ee, X[11], 12); + HH(ee, aa, bb, cc, dd, X[ 5], 7); + HH(dd, ee, aa, bb, cc, X[12], 5); + + /* parallel round 3 */ + HHH(ddd, eee, aaa, bbb, ccc, X[15], 9); + HHH(ccc, ddd, eee, aaa, bbb, X[ 5], 7); + HHH(bbb, ccc, ddd, eee, aaa, X[ 1], 15); + HHH(aaa, bbb, ccc, ddd, eee, X[ 3], 11); + HHH(eee, aaa, bbb, ccc, ddd, X[ 7], 8); + HHH(ddd, eee, aaa, bbb, ccc, X[14], 6); + HHH(ccc, ddd, eee, aaa, bbb, X[ 6], 6); + HHH(bbb, ccc, ddd, eee, aaa, X[ 9], 14); + HHH(aaa, bbb, ccc, ddd, eee, X[11], 12); + HHH(eee, aaa, bbb, ccc, ddd, X[ 8], 13); + HHH(ddd, eee, aaa, bbb, ccc, X[12], 5); + HHH(ccc, ddd, eee, aaa, bbb, X[ 2], 14); + HHH(bbb, ccc, ddd, eee, aaa, X[10], 13); + HHH(aaa, bbb, ccc, ddd, eee, X[ 0], 13); + HHH(eee, aaa, bbb, ccc, ddd, X[ 4], 7); + HHH(ddd, eee, aaa, bbb, ccc, X[13], 5); + + tmp = cc; cc = ccc; ccc = tmp; + + /* round 4 */ + II(cc, dd, ee, aa, bb, X[ 1], 11); + II(bb, cc, dd, ee, aa, X[ 9], 12); + II(aa, bb, cc, dd, ee, X[11], 14); + II(ee, aa, bb, cc, dd, X[10], 15); + II(dd, ee, aa, bb, cc, X[ 0], 14); + II(cc, dd, ee, aa, bb, X[ 8], 15); + II(bb, cc, dd, ee, aa, X[12], 9); + II(aa, bb, cc, dd, ee, X[ 4], 8); + II(ee, aa, bb, cc, dd, X[13], 9); + II(dd, ee, aa, bb, cc, X[ 3], 14); + II(cc, dd, ee, aa, bb, X[ 7], 5); + II(bb, cc, dd, ee, aa, X[15], 6); + II(aa, bb, cc, dd, ee, X[14], 8); + II(ee, aa, bb, cc, dd, X[ 5], 6); + II(dd, ee, aa, bb, cc, X[ 6], 5); + II(cc, dd, ee, aa, bb, X[ 2], 12); + + /* parallel round 4 */ + GGG(ccc, ddd, eee, aaa, bbb, X[ 8], 15); + GGG(bbb, ccc, ddd, eee, aaa, X[ 6], 5); + GGG(aaa, bbb, ccc, ddd, eee, X[ 4], 8); + GGG(eee, aaa, bbb, ccc, ddd, X[ 1], 11); + GGG(ddd, eee, aaa, bbb, ccc, X[ 3], 14); + GGG(ccc, ddd, eee, aaa, bbb, X[11], 14); + GGG(bbb, ccc, ddd, eee, aaa, X[15], 6); + GGG(aaa, bbb, ccc, ddd, eee, X[ 0], 14); + GGG(eee, aaa, bbb, ccc, ddd, X[ 5], 6); + GGG(ddd, eee, aaa, bbb, ccc, X[12], 9); + GGG(ccc, ddd, eee, aaa, bbb, X[ 2], 12); + GGG(bbb, ccc, ddd, eee, aaa, X[13], 9); + GGG(aaa, bbb, ccc, ddd, eee, X[ 9], 12); + GGG(eee, aaa, bbb, ccc, ddd, X[ 7], 5); + GGG(ddd, eee, aaa, bbb, ccc, X[10], 15); + GGG(ccc, ddd, eee, aaa, bbb, X[14], 8); + + tmp = dd; dd = ddd; ddd = tmp; + + /* round 5 */ + JJ(bb, cc, dd, ee, aa, X[ 4], 9); + JJ(aa, bb, cc, dd, ee, X[ 0], 15); + JJ(ee, aa, bb, cc, dd, X[ 5], 5); + JJ(dd, ee, aa, bb, cc, X[ 9], 11); + JJ(cc, dd, ee, aa, bb, X[ 7], 6); + JJ(bb, cc, dd, ee, aa, X[12], 8); + JJ(aa, bb, cc, dd, ee, X[ 2], 13); + JJ(ee, aa, bb, cc, dd, X[10], 12); + JJ(dd, ee, aa, bb, cc, X[14], 5); + JJ(cc, dd, ee, aa, bb, X[ 1], 12); + JJ(bb, cc, dd, ee, aa, X[ 3], 13); + JJ(aa, bb, cc, dd, ee, X[ 8], 14); + JJ(ee, aa, bb, cc, dd, X[11], 11); + JJ(dd, ee, aa, bb, cc, X[ 6], 8); + JJ(cc, dd, ee, aa, bb, X[15], 5); + JJ(bb, cc, dd, ee, aa, X[13], 6); + + /* parallel round 5 */ + FFF(bbb, ccc, ddd, eee, aaa, X[12] , 8); + FFF(aaa, bbb, ccc, ddd, eee, X[15] , 5); + FFF(eee, aaa, bbb, ccc, ddd, X[10] , 12); + FFF(ddd, eee, aaa, bbb, ccc, X[ 4] , 9); + FFF(ccc, ddd, eee, aaa, bbb, X[ 1] , 12); + FFF(bbb, ccc, ddd, eee, aaa, X[ 5] , 5); + FFF(aaa, bbb, ccc, ddd, eee, X[ 8] , 14); + FFF(eee, aaa, bbb, ccc, ddd, X[ 7] , 6); + FFF(ddd, eee, aaa, bbb, ccc, X[ 6] , 8); + FFF(ccc, ddd, eee, aaa, bbb, X[ 2] , 13); + FFF(bbb, ccc, ddd, eee, aaa, X[13] , 6); + FFF(aaa, bbb, ccc, ddd, eee, X[14] , 5); + FFF(eee, aaa, bbb, ccc, ddd, X[ 0] , 15); + FFF(ddd, eee, aaa, bbb, ccc, X[ 3] , 13); + FFF(ccc, ddd, eee, aaa, bbb, X[ 9] , 11); + FFF(bbb, ccc, ddd, eee, aaa, X[11] , 11); + + tmp = ee; ee = eee; eee = tmp; + + /* combine results */ + md->rmd320.state[0] += aa; + md->rmd320.state[1] += bb; + md->rmd320.state[2] += cc; + md->rmd320.state[3] += dd; + md->rmd320.state[4] += ee; + md->rmd320.state[5] += aaa; + md->rmd320.state[6] += bbb; + md->rmd320.state[7] += ccc; + md->rmd320.state[8] += ddd; + md->rmd320.state[9] += eee; + + return CRYPT_OK; +} + +#ifdef LTC_CLEAN_STACK +static int rmd320_compress(hash_state *md, unsigned char *buf) +{ + int err; + err = _rmd320_compress(md, buf); + burn_stack(sizeof(ulong32) * 27 + sizeof(int)); + return err; +} +#endif + +/** + Initialize the hash state + @param md The hash state you wish to initialize + @return CRYPT_OK if successful +*/ +int rmd320_init(hash_state * md) +{ + LTC_ARGCHK(md != NULL); + md->rmd320.state[0] = 0x67452301UL; + md->rmd320.state[1] = 0xefcdab89UL; + md->rmd320.state[2] = 0x98badcfeUL; + md->rmd320.state[3] = 0x10325476UL; + md->rmd320.state[4] = 0xc3d2e1f0UL; + md->rmd320.state[5] = 0x76543210UL; + md->rmd320.state[6] = 0xfedcba98UL; + md->rmd320.state[7] = 0x89abcdefUL; + md->rmd320.state[8] = 0x01234567UL; + md->rmd320.state[9] = 0x3c2d1e0fUL; + md->rmd320.curlen = 0; + md->rmd320.length = 0; + return CRYPT_OK; +} + +/** + Process a block of memory though the hash + @param md The hash state + @param in The data to hash + @param inlen The length of the data (octets) + @return CRYPT_OK if successful +*/ +HASH_PROCESS(rmd320_process, rmd320_compress, rmd320, 64) + +/** + Terminate the hash to get the digest + @param md The hash state + @param out [out] The destination of the hash (20 bytes) + @return CRYPT_OK if successful +*/ +int rmd320_done(hash_state * md, unsigned char *out) +{ + int i; + + LTC_ARGCHK(md != NULL); + LTC_ARGCHK(out != NULL); + + if (md->rmd320.curlen >= sizeof(md->rmd320.buf)) { + return CRYPT_INVALID_ARG; + } + + + /* increase the length of the message */ + md->rmd320.length += md->rmd320.curlen * 8; + + /* append the '1' bit */ + md->rmd320.buf[md->rmd320.curlen++] = (unsigned char)0x80; + + /* if the length is currently above 56 bytes we append zeros + * then compress. Then we can fall back to padding zeros and length + * encoding like normal. + */ + if (md->rmd320.curlen > 56) { + while (md->rmd320.curlen < 64) { + md->rmd320.buf[md->rmd320.curlen++] = (unsigned char)0; + } + rmd320_compress(md, md->rmd320.buf); + md->rmd320.curlen = 0; + } + + /* pad upto 56 bytes of zeroes */ + while (md->rmd320.curlen < 56) { + md->rmd320.buf[md->rmd320.curlen++] = (unsigned char)0; + } + + /* store length */ + STORE64L(md->rmd320.length, md->rmd320.buf+56); + rmd320_compress(md, md->rmd320.buf); + + /* copy output */ + for (i = 0; i < 10; i++) { + STORE32L(md->rmd320.state[i], out+(4*i)); + } +#ifdef LTC_CLEAN_STACK + zeromem(md, sizeof(hash_state)); +#endif + return CRYPT_OK; +} + +/** + Self-test the hash + @return CRYPT_OK if successful, CRYPT_NOP if self-tests have been disabled +*/ +int rmd320_test(void) +{ +#ifndef LTC_TEST + return CRYPT_NOP; +#else + static const struct { + char *msg; + unsigned char md[40]; + } tests[] = { + { "", + { 0x22, 0xd6, 0x5d, 0x56, 0x61, 0x53, 0x6c, 0xdc, 0x75, 0xc1, + 0xfd, 0xf5, 0xc6, 0xde, 0x7b, 0x41, 0xb9, 0xf2, 0x73, 0x25, + 0xeb, 0xc6, 0x1e, 0x85, 0x57, 0x17, 0x7d, 0x70, 0x5a, 0x0e, + 0xc8, 0x80, 0x15, 0x1c, 0x3a, 0x32, 0xa0, 0x08, 0x99, 0xb8 } + }, + { "a", + { 0xce, 0x78, 0x85, 0x06, 0x38, 0xf9, 0x26, 0x58, 0xa5, 0xa5, + 0x85, 0x09, 0x75, 0x79, 0x92, 0x6d, 0xda, 0x66, 0x7a, 0x57, + 0x16, 0x56, 0x2c, 0xfc, 0xf6, 0xfb, 0xe7, 0x7f, 0x63, 0x54, + 0x2f, 0x99, 0xb0, 0x47, 0x05, 0xd6, 0x97, 0x0d, 0xff, 0x5d } + }, + { "abc", + { 0xde, 0x4c, 0x01, 0xb3, 0x05, 0x4f, 0x89, 0x30, 0xa7, 0x9d, + 0x09, 0xae, 0x73, 0x8e, 0x92, 0x30, 0x1e, 0x5a, 0x17, 0x08, + 0x5b, 0xef, 0xfd, 0xc1, 0xb8, 0xd1, 0x16, 0x71, 0x3e, 0x74, + 0xf8, 0x2f, 0xa9, 0x42, 0xd6, 0x4c, 0xdb, 0xc4, 0x68, 0x2d } + }, + { "message digest", + { 0x3a, 0x8e, 0x28, 0x50, 0x2e, 0xd4, 0x5d, 0x42, 0x2f, 0x68, + 0x84, 0x4f, 0x9d, 0xd3, 0x16, 0xe7, 0xb9, 0x85, 0x33, 0xfa, + 0x3f, 0x2a, 0x91, 0xd2, 0x9f, 0x84, 0xd4, 0x25, 0xc8, 0x8d, + 0x6b, 0x4e, 0xff, 0x72, 0x7d, 0xf6, 0x6a, 0x7c, 0x01, 0x97 } + }, + { "abcdefghijklmnopqrstuvwxyz", + { 0xca, 0xbd, 0xb1, 0x81, 0x0b, 0x92, 0x47, 0x0a, 0x20, 0x93, + 0xaa, 0x6b, 0xce, 0x05, 0x95, 0x2c, 0x28, 0x34, 0x8c, 0xf4, + 0x3f, 0xf6, 0x08, 0x41, 0x97, 0x51, 0x66, 0xbb, 0x40, 0xed, + 0x23, 0x40, 0x04, 0xb8, 0x82, 0x44, 0x63, 0xe6, 0xb0, 0x09 } + }, + { "abcdbcdecdefdefgefghfghighijhijkijkljklmklmnlmnomnopnopq", + { 0xd0, 0x34, 0xa7, 0x95, 0x0c, 0xf7, 0x22, 0x02, 0x1b, 0xa4, + 0xb8, 0x4d, 0xf7, 0x69, 0xa5, 0xde, 0x20, 0x60, 0xe2, 0x59, + 0xdf, 0x4c, 0x9b, 0xb4, 0xa4, 0x26, 0x8c, 0x0e, 0x93, 0x5b, + 0xbc, 0x74, 0x70, 0xa9, 0x69, 0xc9, 0xd0, 0x72, 0xa1, 0xac } + } + }; + int x; + unsigned char buf[40]; + hash_state md; + + for (x = 0; x < (int)(sizeof(tests)/sizeof(tests[0])); x++) { + rmd320_init(&md); + rmd320_process(&md, (unsigned char *)tests[x].msg, strlen(tests[x].msg)); + rmd320_done(&md, buf); + if (XMEMCMP(buf, tests[x].md, 40) != 0) { +#if 0 + printf("Failed test %d\n", x); +#endif + return CRYPT_FAIL_TESTVECTOR; + } + } + return CRYPT_OK; +#endif +} + +#endif + diff --git a/libtomcrypt/src/hashes/sha1.c b/libtomcrypt/src/hashes/sha1.c new file mode 100644 index 0000000..8cc6855 --- /dev/null +++ b/libtomcrypt/src/hashes/sha1.c @@ -0,0 +1,288 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file sha1.c + SHA1 code by Tom St Denis +*/ + + +#ifdef SHA1 + +const struct ltc_hash_descriptor sha1_desc = +{ + "sha1", + 2, + 20, + 64, + + /* OID */ + { 1, 3, 14, 3, 2, 26, }, + 6, + + &sha1_init, + &sha1_process, + &sha1_done, + &sha1_test, + NULL +}; + +#define F0(x,y,z) (z ^ (x & (y ^ z))) +#define F1(x,y,z) (x ^ y ^ z) +#define F2(x,y,z) ((x & y) | (z & (x | y))) +#define F3(x,y,z) (x ^ y ^ z) + +#ifdef LTC_CLEAN_STACK +static int _sha1_compress(hash_state *md, unsigned char *buf) +#else +static int sha1_compress(hash_state *md, unsigned char *buf) +#endif +{ + ulong32 a,b,c,d,e,W[80],i; +#ifdef LTC_SMALL_CODE + ulong32 t; +#endif + + /* copy the state into 512-bits into W[0..15] */ + for (i = 0; i < 16; i++) { + LOAD32H(W[i], buf + (4*i)); + } + + /* copy state */ + a = md->sha1.state[0]; + b = md->sha1.state[1]; + c = md->sha1.state[2]; + d = md->sha1.state[3]; + e = md->sha1.state[4]; + + /* expand it */ + for (i = 16; i < 80; i++) { + W[i] = ROL(W[i-3] ^ W[i-8] ^ W[i-14] ^ W[i-16], 1); + } + + /* compress */ + /* round one */ + #define FF0(a,b,c,d,e,i) e = (ROLc(a, 5) + F0(b,c,d) + e + W[i] + 0x5a827999UL); b = ROLc(b, 30); + #define FF1(a,b,c,d,e,i) e = (ROLc(a, 5) + F1(b,c,d) + e + W[i] + 0x6ed9eba1UL); b = ROLc(b, 30); + #define FF2(a,b,c,d,e,i) e = (ROLc(a, 5) + F2(b,c,d) + e + W[i] + 0x8f1bbcdcUL); b = ROLc(b, 30); + #define FF3(a,b,c,d,e,i) e = (ROLc(a, 5) + F3(b,c,d) + e + W[i] + 0xca62c1d6UL); b = ROLc(b, 30); + +#ifdef LTC_SMALL_CODE + + for (i = 0; i < 20; ) { + FF0(a,b,c,d,e,i++); t = e; e = d; d = c; c = b; b = a; a = t; + } + + for (; i < 40; ) { + FF1(a,b,c,d,e,i++); t = e; e = d; d = c; c = b; b = a; a = t; + } + + for (; i < 60; ) { + FF2(a,b,c,d,e,i++); t = e; e = d; d = c; c = b; b = a; a = t; + } + + for (; i < 80; ) { + FF3(a,b,c,d,e,i++); t = e; e = d; d = c; c = b; b = a; a = t; + } + +#else + + for (i = 0; i < 20; ) { + FF0(a,b,c,d,e,i++); + FF0(e,a,b,c,d,i++); + FF0(d,e,a,b,c,i++); + FF0(c,d,e,a,b,i++); + FF0(b,c,d,e,a,i++); + } + + /* round two */ + for (; i < 40; ) { + FF1(a,b,c,d,e,i++); + FF1(e,a,b,c,d,i++); + FF1(d,e,a,b,c,i++); + FF1(c,d,e,a,b,i++); + FF1(b,c,d,e,a,i++); + } + + /* round three */ + for (; i < 60; ) { + FF2(a,b,c,d,e,i++); + FF2(e,a,b,c,d,i++); + FF2(d,e,a,b,c,i++); + FF2(c,d,e,a,b,i++); + FF2(b,c,d,e,a,i++); + } + + /* round four */ + for (; i < 80; ) { + FF3(a,b,c,d,e,i++); + FF3(e,a,b,c,d,i++); + FF3(d,e,a,b,c,i++); + FF3(c,d,e,a,b,i++); + FF3(b,c,d,e,a,i++); + } +#endif + + #undef FF0 + #undef FF1 + #undef FF2 + #undef FF3 + + /* store */ + md->sha1.state[0] = md->sha1.state[0] + a; + md->sha1.state[1] = md->sha1.state[1] + b; + md->sha1.state[2] = md->sha1.state[2] + c; + md->sha1.state[3] = md->sha1.state[3] + d; + md->sha1.state[4] = md->sha1.state[4] + e; + + return CRYPT_OK; +} + +#ifdef LTC_CLEAN_STACK +static int sha1_compress(hash_state *md, unsigned char *buf) +{ + int err; + err = _sha1_compress(md, buf); + burn_stack(sizeof(ulong32) * 87); + return err; +} +#endif + +/** + Initialize the hash state + @param md The hash state you wish to initialize + @return CRYPT_OK if successful +*/ +int sha1_init(hash_state * md) +{ + LTC_ARGCHK(md != NULL); + md->sha1.state[0] = 0x67452301UL; + md->sha1.state[1] = 0xefcdab89UL; + md->sha1.state[2] = 0x98badcfeUL; + md->sha1.state[3] = 0x10325476UL; + md->sha1.state[4] = 0xc3d2e1f0UL; + md->sha1.curlen = 0; + md->sha1.length = 0; + return CRYPT_OK; +} + +/** + Process a block of memory though the hash + @param md The hash state + @param in The data to hash + @param inlen The length of the data (octets) + @return CRYPT_OK if successful +*/ +HASH_PROCESS(sha1_process, sha1_compress, sha1, 64) + +/** + Terminate the hash to get the digest + @param md The hash state + @param out [out] The destination of the hash (20 bytes) + @return CRYPT_OK if successful +*/ +int sha1_done(hash_state * md, unsigned char *out) +{ + int i; + + LTC_ARGCHK(md != NULL); + LTC_ARGCHK(out != NULL); + + if (md->sha1.curlen >= sizeof(md->sha1.buf)) { + return CRYPT_INVALID_ARG; + } + + /* increase the length of the message */ + md->sha1.length += md->sha1.curlen * 8; + + /* append the '1' bit */ + md->sha1.buf[md->sha1.curlen++] = (unsigned char)0x80; + + /* if the length is currently above 56 bytes we append zeros + * then compress. Then we can fall back to padding zeros and length + * encoding like normal. + */ + if (md->sha1.curlen > 56) { + while (md->sha1.curlen < 64) { + md->sha1.buf[md->sha1.curlen++] = (unsigned char)0; + } + sha1_compress(md, md->sha1.buf); + md->sha1.curlen = 0; + } + + /* pad upto 56 bytes of zeroes */ + while (md->sha1.curlen < 56) { + md->sha1.buf[md->sha1.curlen++] = (unsigned char)0; + } + + /* store length */ + STORE64H(md->sha1.length, md->sha1.buf+56); + sha1_compress(md, md->sha1.buf); + + /* copy output */ + for (i = 0; i < 5; i++) { + STORE32H(md->sha1.state[i], out+(4*i)); + } +#ifdef LTC_CLEAN_STACK + zeromem(md, sizeof(hash_state)); +#endif + return CRYPT_OK; +} + +/** + Self-test the hash + @return CRYPT_OK if successful, CRYPT_NOP if self-tests have been disabled +*/ +int sha1_test(void) +{ + #ifndef LTC_TEST + return CRYPT_NOP; + #else + static const struct { + char *msg; + unsigned char hash[20]; + } tests[] = { + { "abc", + { 0xa9, 0x99, 0x3e, 0x36, 0x47, 0x06, 0x81, 0x6a, + 0xba, 0x3e, 0x25, 0x71, 0x78, 0x50, 0xc2, 0x6c, + 0x9c, 0xd0, 0xd8, 0x9d } + }, + { "abcdbcdecdefdefgefghfghighijhijkijkljklmklmnlmnomnopnopq", + { 0x84, 0x98, 0x3E, 0x44, 0x1C, 0x3B, 0xD2, 0x6E, + 0xBA, 0xAE, 0x4A, 0xA1, 0xF9, 0x51, 0x29, 0xE5, + 0xE5, 0x46, 0x70, 0xF1 } + } + }; + + int i; + unsigned char tmp[20]; + hash_state md; + + for (i = 0; i < (int)(sizeof(tests) / sizeof(tests[0])); i++) { + sha1_init(&md); + sha1_process(&md, (unsigned char*)tests[i].msg, (unsigned long)strlen(tests[i].msg)); + sha1_done(&md, tmp); + if (XMEMCMP(tmp, tests[i].hash, 20) != 0) { + return CRYPT_FAIL_TESTVECTOR; + } + } + return CRYPT_OK; + #endif +} + +#endif + + + +/* $Source: /cvs/libtom/libtomcrypt/src/hashes/sha1.c,v $ */ +/* $Revision: 1.8 $ */ +/* $Date: 2006/11/01 09:28:17 $ */ diff --git a/libtomcrypt/src/hashes/sha2/sha224.c b/libtomcrypt/src/hashes/sha2/sha224.c new file mode 100644 index 0000000..f085d50 --- /dev/null +++ b/libtomcrypt/src/hashes/sha2/sha224.c @@ -0,0 +1,125 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +/** + @param sha224.c + SHA-224 new NIST standard based off of SHA-256 truncated to 224 bits (Tom St Denis) +*/ + +const struct ltc_hash_descriptor sha224_desc = +{ + "sha224", + 10, + 28, + 64, + + /* OID */ + { 2, 16, 840, 1, 101, 3, 4, 2, 4, }, + 9, + + &sha224_init, + &sha256_process, + &sha224_done, + &sha224_test, + NULL +}; + +/* init the sha256 er... sha224 state ;-) */ +/** + Initialize the hash state + @param md The hash state you wish to initialize + @return CRYPT_OK if successful +*/ +int sha224_init(hash_state * md) +{ + LTC_ARGCHK(md != NULL); + + md->sha256.curlen = 0; + md->sha256.length = 0; + md->sha256.state[0] = 0xc1059ed8UL; + md->sha256.state[1] = 0x367cd507UL; + md->sha256.state[2] = 0x3070dd17UL; + md->sha256.state[3] = 0xf70e5939UL; + md->sha256.state[4] = 0xffc00b31UL; + md->sha256.state[5] = 0x68581511UL; + md->sha256.state[6] = 0x64f98fa7UL; + md->sha256.state[7] = 0xbefa4fa4UL; + return CRYPT_OK; +} + +/** + Terminate the hash to get the digest + @param md The hash state + @param out [out] The destination of the hash (28 bytes) + @return CRYPT_OK if successful +*/ +int sha224_done(hash_state * md, unsigned char *out) +{ + unsigned char buf[32]; + int err; + + LTC_ARGCHK(md != NULL); + LTC_ARGCHK(out != NULL); + + err = sha256_done(md, buf); + XMEMCPY(out, buf, 28); +#ifdef LTC_CLEAN_STACK + zeromem(buf, sizeof(buf)); +#endif + return err; +} + +/** + Self-test the hash + @return CRYPT_OK if successful, CRYPT_NOP if self-tests have been disabled +*/ +int sha224_test(void) +{ + #ifndef LTC_TEST + return CRYPT_NOP; + #else + static const struct { + char *msg; + unsigned char hash[28]; + } tests[] = { + { "abc", + { 0x23, 0x09, 0x7d, 0x22, 0x34, 0x05, 0xd8, + 0x22, 0x86, 0x42, 0xa4, 0x77, 0xbd, 0xa2, + 0x55, 0xb3, 0x2a, 0xad, 0xbc, 0xe4, 0xbd, + 0xa0, 0xb3, 0xf7, 0xe3, 0x6c, 0x9d, 0xa7 } + }, + { "abcdbcdecdefdefgefghfghighijhijkijkljklmklmnlmnomnopnopq", + { 0x75, 0x38, 0x8b, 0x16, 0x51, 0x27, 0x76, + 0xcc, 0x5d, 0xba, 0x5d, 0xa1, 0xfd, 0x89, + 0x01, 0x50, 0xb0, 0xc6, 0x45, 0x5c, 0xb4, + 0xf5, 0x8b, 0x19, 0x52, 0x52, 0x25, 0x25 } + }, + }; + + int i; + unsigned char tmp[28]; + hash_state md; + + for (i = 0; i < (int)(sizeof(tests) / sizeof(tests[0])); i++) { + sha224_init(&md); + sha224_process(&md, (unsigned char*)tests[i].msg, (unsigned long)strlen(tests[i].msg)); + sha224_done(&md, tmp); + if (XMEMCMP(tmp, tests[i].hash, 28) != 0) { + return CRYPT_FAIL_TESTVECTOR; + } + } + return CRYPT_OK; + #endif +} + + +/* $Source: /cvs/libtom/libtomcrypt/src/hashes/sha2/sha224.c,v $ */ +/* $Revision: 1.8 $ */ +/* $Date: 2006/11/01 09:28:17 $ */ diff --git a/libtomcrypt/src/hashes/sha2/sha256.c b/libtomcrypt/src/hashes/sha2/sha256.c new file mode 100644 index 0000000..2b42cb7 --- /dev/null +++ b/libtomcrypt/src/hashes/sha2/sha256.c @@ -0,0 +1,340 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file sha256.c + SHA256 by Tom St Denis +*/ + +#ifdef SHA256 + +const struct ltc_hash_descriptor sha256_desc = +{ + "sha256", + 0, + 32, + 64, + + /* OID */ + { 2, 16, 840, 1, 101, 3, 4, 2, 1, }, + 9, + + &sha256_init, + &sha256_process, + &sha256_done, + &sha256_test, + NULL +}; + +#ifdef LTC_SMALL_CODE +/* the K array */ +static const ulong32 K[64] = { + 0x428a2f98UL, 0x71374491UL, 0xb5c0fbcfUL, 0xe9b5dba5UL, 0x3956c25bUL, + 0x59f111f1UL, 0x923f82a4UL, 0xab1c5ed5UL, 0xd807aa98UL, 0x12835b01UL, + 0x243185beUL, 0x550c7dc3UL, 0x72be5d74UL, 0x80deb1feUL, 0x9bdc06a7UL, + 0xc19bf174UL, 0xe49b69c1UL, 0xefbe4786UL, 0x0fc19dc6UL, 0x240ca1ccUL, + 0x2de92c6fUL, 0x4a7484aaUL, 0x5cb0a9dcUL, 0x76f988daUL, 0x983e5152UL, + 0xa831c66dUL, 0xb00327c8UL, 0xbf597fc7UL, 0xc6e00bf3UL, 0xd5a79147UL, + 0x06ca6351UL, 0x14292967UL, 0x27b70a85UL, 0x2e1b2138UL, 0x4d2c6dfcUL, + 0x53380d13UL, 0x650a7354UL, 0x766a0abbUL, 0x81c2c92eUL, 0x92722c85UL, + 0xa2bfe8a1UL, 0xa81a664bUL, 0xc24b8b70UL, 0xc76c51a3UL, 0xd192e819UL, + 0xd6990624UL, 0xf40e3585UL, 0x106aa070UL, 0x19a4c116UL, 0x1e376c08UL, + 0x2748774cUL, 0x34b0bcb5UL, 0x391c0cb3UL, 0x4ed8aa4aUL, 0x5b9cca4fUL, + 0x682e6ff3UL, 0x748f82eeUL, 0x78a5636fUL, 0x84c87814UL, 0x8cc70208UL, + 0x90befffaUL, 0xa4506cebUL, 0xbef9a3f7UL, 0xc67178f2UL +}; +#endif + +/* Various logical functions */ +#define Ch(x,y,z) (z ^ (x & (y ^ z))) +#define Maj(x,y,z) (((x | y) & z) | (x & y)) +#define S(x, n) RORc((x),(n)) +#define R(x, n) (((x)&0xFFFFFFFFUL)>>(n)) +#define Sigma0(x) (S(x, 2) ^ S(x, 13) ^ S(x, 22)) +#define Sigma1(x) (S(x, 6) ^ S(x, 11) ^ S(x, 25)) +#define Gamma0(x) (S(x, 7) ^ S(x, 18) ^ R(x, 3)) +#define Gamma1(x) (S(x, 17) ^ S(x, 19) ^ R(x, 10)) + +/* compress 512-bits */ +#ifdef LTC_CLEAN_STACK +static int _sha256_compress(hash_state * md, unsigned char *buf) +#else +static int sha256_compress(hash_state * md, unsigned char *buf) +#endif +{ + ulong32 S[8], W[64], t0, t1; +#ifdef LTC_SMALL_CODE + ulong32 t; +#endif + int i; + + /* copy state into S */ + for (i = 0; i < 8; i++) { + S[i] = md->sha256.state[i]; + } + + /* copy the state into 512-bits into W[0..15] */ + for (i = 0; i < 16; i++) { + LOAD32H(W[i], buf + (4*i)); + } + + /* fill W[16..63] */ + for (i = 16; i < 64; i++) { + W[i] = Gamma1(W[i - 2]) + W[i - 7] + Gamma0(W[i - 15]) + W[i - 16]; + } + + /* Compress */ +#ifdef LTC_SMALL_CODE +#define RND(a,b,c,d,e,f,g,h,i) \ + t0 = h + Sigma1(e) + Ch(e, f, g) + K[i] + W[i]; \ + t1 = Sigma0(a) + Maj(a, b, c); \ + d += t0; \ + h = t0 + t1; + + for (i = 0; i < 64; ++i) { + RND(S[0],S[1],S[2],S[3],S[4],S[5],S[6],S[7],i); + t = S[7]; S[7] = S[6]; S[6] = S[5]; S[5] = S[4]; + S[4] = S[3]; S[3] = S[2]; S[2] = S[1]; S[1] = S[0]; S[0] = t; + } +#else +#define RND(a,b,c,d,e,f,g,h,i,ki) \ + t0 = h + Sigma1(e) + Ch(e, f, g) + ki + W[i]; \ + t1 = Sigma0(a) + Maj(a, b, c); \ + d += t0; \ + h = t0 + t1; + + RND(S[0],S[1],S[2],S[3],S[4],S[5],S[6],S[7],0,0x428a2f98); + RND(S[7],S[0],S[1],S[2],S[3],S[4],S[5],S[6],1,0x71374491); + RND(S[6],S[7],S[0],S[1],S[2],S[3],S[4],S[5],2,0xb5c0fbcf); + RND(S[5],S[6],S[7],S[0],S[1],S[2],S[3],S[4],3,0xe9b5dba5); + RND(S[4],S[5],S[6],S[7],S[0],S[1],S[2],S[3],4,0x3956c25b); + RND(S[3],S[4],S[5],S[6],S[7],S[0],S[1],S[2],5,0x59f111f1); + RND(S[2],S[3],S[4],S[5],S[6],S[7],S[0],S[1],6,0x923f82a4); + RND(S[1],S[2],S[3],S[4],S[5],S[6],S[7],S[0],7,0xab1c5ed5); + RND(S[0],S[1],S[2],S[3],S[4],S[5],S[6],S[7],8,0xd807aa98); + RND(S[7],S[0],S[1],S[2],S[3],S[4],S[5],S[6],9,0x12835b01); + RND(S[6],S[7],S[0],S[1],S[2],S[3],S[4],S[5],10,0x243185be); + RND(S[5],S[6],S[7],S[0],S[1],S[2],S[3],S[4],11,0x550c7dc3); + RND(S[4],S[5],S[6],S[7],S[0],S[1],S[2],S[3],12,0x72be5d74); + RND(S[3],S[4],S[5],S[6],S[7],S[0],S[1],S[2],13,0x80deb1fe); + RND(S[2],S[3],S[4],S[5],S[6],S[7],S[0],S[1],14,0x9bdc06a7); + RND(S[1],S[2],S[3],S[4],S[5],S[6],S[7],S[0],15,0xc19bf174); + RND(S[0],S[1],S[2],S[3],S[4],S[5],S[6],S[7],16,0xe49b69c1); + RND(S[7],S[0],S[1],S[2],S[3],S[4],S[5],S[6],17,0xefbe4786); + RND(S[6],S[7],S[0],S[1],S[2],S[3],S[4],S[5],18,0x0fc19dc6); + RND(S[5],S[6],S[7],S[0],S[1],S[2],S[3],S[4],19,0x240ca1cc); + RND(S[4],S[5],S[6],S[7],S[0],S[1],S[2],S[3],20,0x2de92c6f); + RND(S[3],S[4],S[5],S[6],S[7],S[0],S[1],S[2],21,0x4a7484aa); + RND(S[2],S[3],S[4],S[5],S[6],S[7],S[0],S[1],22,0x5cb0a9dc); + RND(S[1],S[2],S[3],S[4],S[5],S[6],S[7],S[0],23,0x76f988da); + RND(S[0],S[1],S[2],S[3],S[4],S[5],S[6],S[7],24,0x983e5152); + RND(S[7],S[0],S[1],S[2],S[3],S[4],S[5],S[6],25,0xa831c66d); + RND(S[6],S[7],S[0],S[1],S[2],S[3],S[4],S[5],26,0xb00327c8); + RND(S[5],S[6],S[7],S[0],S[1],S[2],S[3],S[4],27,0xbf597fc7); + RND(S[4],S[5],S[6],S[7],S[0],S[1],S[2],S[3],28,0xc6e00bf3); + RND(S[3],S[4],S[5],S[6],S[7],S[0],S[1],S[2],29,0xd5a79147); + RND(S[2],S[3],S[4],S[5],S[6],S[7],S[0],S[1],30,0x06ca6351); + RND(S[1],S[2],S[3],S[4],S[5],S[6],S[7],S[0],31,0x14292967); + RND(S[0],S[1],S[2],S[3],S[4],S[5],S[6],S[7],32,0x27b70a85); + RND(S[7],S[0],S[1],S[2],S[3],S[4],S[5],S[6],33,0x2e1b2138); + RND(S[6],S[7],S[0],S[1],S[2],S[3],S[4],S[5],34,0x4d2c6dfc); + RND(S[5],S[6],S[7],S[0],S[1],S[2],S[3],S[4],35,0x53380d13); + RND(S[4],S[5],S[6],S[7],S[0],S[1],S[2],S[3],36,0x650a7354); + RND(S[3],S[4],S[5],S[6],S[7],S[0],S[1],S[2],37,0x766a0abb); + RND(S[2],S[3],S[4],S[5],S[6],S[7],S[0],S[1],38,0x81c2c92e); + RND(S[1],S[2],S[3],S[4],S[5],S[6],S[7],S[0],39,0x92722c85); + RND(S[0],S[1],S[2],S[3],S[4],S[5],S[6],S[7],40,0xa2bfe8a1); + RND(S[7],S[0],S[1],S[2],S[3],S[4],S[5],S[6],41,0xa81a664b); + RND(S[6],S[7],S[0],S[1],S[2],S[3],S[4],S[5],42,0xc24b8b70); + RND(S[5],S[6],S[7],S[0],S[1],S[2],S[3],S[4],43,0xc76c51a3); + RND(S[4],S[5],S[6],S[7],S[0],S[1],S[2],S[3],44,0xd192e819); + RND(S[3],S[4],S[5],S[6],S[7],S[0],S[1],S[2],45,0xd6990624); + RND(S[2],S[3],S[4],S[5],S[6],S[7],S[0],S[1],46,0xf40e3585); + RND(S[1],S[2],S[3],S[4],S[5],S[6],S[7],S[0],47,0x106aa070); + RND(S[0],S[1],S[2],S[3],S[4],S[5],S[6],S[7],48,0x19a4c116); + RND(S[7],S[0],S[1],S[2],S[3],S[4],S[5],S[6],49,0x1e376c08); + RND(S[6],S[7],S[0],S[1],S[2],S[3],S[4],S[5],50,0x2748774c); + RND(S[5],S[6],S[7],S[0],S[1],S[2],S[3],S[4],51,0x34b0bcb5); + RND(S[4],S[5],S[6],S[7],S[0],S[1],S[2],S[3],52,0x391c0cb3); + RND(S[3],S[4],S[5],S[6],S[7],S[0],S[1],S[2],53,0x4ed8aa4a); + RND(S[2],S[3],S[4],S[5],S[6],S[7],S[0],S[1],54,0x5b9cca4f); + RND(S[1],S[2],S[3],S[4],S[5],S[6],S[7],S[0],55,0x682e6ff3); + RND(S[0],S[1],S[2],S[3],S[4],S[5],S[6],S[7],56,0x748f82ee); + RND(S[7],S[0],S[1],S[2],S[3],S[4],S[5],S[6],57,0x78a5636f); + RND(S[6],S[7],S[0],S[1],S[2],S[3],S[4],S[5],58,0x84c87814); + RND(S[5],S[6],S[7],S[0],S[1],S[2],S[3],S[4],59,0x8cc70208); + RND(S[4],S[5],S[6],S[7],S[0],S[1],S[2],S[3],60,0x90befffa); + RND(S[3],S[4],S[5],S[6],S[7],S[0],S[1],S[2],61,0xa4506ceb); + RND(S[2],S[3],S[4],S[5],S[6],S[7],S[0],S[1],62,0xbef9a3f7); + RND(S[1],S[2],S[3],S[4],S[5],S[6],S[7],S[0],63,0xc67178f2); + +#undef RND + +#endif + + /* feedback */ + for (i = 0; i < 8; i++) { + md->sha256.state[i] = md->sha256.state[i] + S[i]; + } + return CRYPT_OK; +} + +#ifdef LTC_CLEAN_STACK +static int sha256_compress(hash_state * md, unsigned char *buf) +{ + int err; + err = _sha256_compress(md, buf); + burn_stack(sizeof(ulong32) * 74); + return err; +} +#endif + +/** + Initialize the hash state + @param md The hash state you wish to initialize + @return CRYPT_OK if successful +*/ +int sha256_init(hash_state * md) +{ + LTC_ARGCHK(md != NULL); + + md->sha256.curlen = 0; + md->sha256.length = 0; + md->sha256.state[0] = 0x6A09E667UL; + md->sha256.state[1] = 0xBB67AE85UL; + md->sha256.state[2] = 0x3C6EF372UL; + md->sha256.state[3] = 0xA54FF53AUL; + md->sha256.state[4] = 0x510E527FUL; + md->sha256.state[5] = 0x9B05688CUL; + md->sha256.state[6] = 0x1F83D9ABUL; + md->sha256.state[7] = 0x5BE0CD19UL; + return CRYPT_OK; +} + +/** + Process a block of memory though the hash + @param md The hash state + @param in The data to hash + @param inlen The length of the data (octets) + @return CRYPT_OK if successful +*/ +HASH_PROCESS(sha256_process, sha256_compress, sha256, 64) + +/** + Terminate the hash to get the digest + @param md The hash state + @param out [out] The destination of the hash (32 bytes) + @return CRYPT_OK if successful +*/ +int sha256_done(hash_state * md, unsigned char *out) +{ + int i; + + LTC_ARGCHK(md != NULL); + LTC_ARGCHK(out != NULL); + + if (md->sha256.curlen >= sizeof(md->sha256.buf)) { + return CRYPT_INVALID_ARG; + } + + + /* increase the length of the message */ + md->sha256.length += md->sha256.curlen * 8; + + /* append the '1' bit */ + md->sha256.buf[md->sha256.curlen++] = (unsigned char)0x80; + + /* if the length is currently above 56 bytes we append zeros + * then compress. Then we can fall back to padding zeros and length + * encoding like normal. + */ + if (md->sha256.curlen > 56) { + while (md->sha256.curlen < 64) { + md->sha256.buf[md->sha256.curlen++] = (unsigned char)0; + } + sha256_compress(md, md->sha256.buf); + md->sha256.curlen = 0; + } + + /* pad upto 56 bytes of zeroes */ + while (md->sha256.curlen < 56) { + md->sha256.buf[md->sha256.curlen++] = (unsigned char)0; + } + + /* store length */ + STORE64H(md->sha256.length, md->sha256.buf+56); + sha256_compress(md, md->sha256.buf); + + /* copy output */ + for (i = 0; i < 8; i++) { + STORE32H(md->sha256.state[i], out+(4*i)); + } +#ifdef LTC_CLEAN_STACK + zeromem(md, sizeof(hash_state)); +#endif + return CRYPT_OK; +} + +/** + Self-test the hash + @return CRYPT_OK if successful, CRYPT_NOP if self-tests have been disabled +*/ +int sha256_test(void) +{ + #ifndef LTC_TEST + return CRYPT_NOP; + #else + static const struct { + char *msg; + unsigned char hash[32]; + } tests[] = { + { "abc", + { 0xba, 0x78, 0x16, 0xbf, 0x8f, 0x01, 0xcf, 0xea, + 0x41, 0x41, 0x40, 0xde, 0x5d, 0xae, 0x22, 0x23, + 0xb0, 0x03, 0x61, 0xa3, 0x96, 0x17, 0x7a, 0x9c, + 0xb4, 0x10, 0xff, 0x61, 0xf2, 0x00, 0x15, 0xad } + }, + { "abcdbcdecdefdefgefghfghighijhijkijkljklmklmnlmnomnopnopq", + { 0x24, 0x8d, 0x6a, 0x61, 0xd2, 0x06, 0x38, 0xb8, + 0xe5, 0xc0, 0x26, 0x93, 0x0c, 0x3e, 0x60, 0x39, + 0xa3, 0x3c, 0xe4, 0x59, 0x64, 0xff, 0x21, 0x67, + 0xf6, 0xec, 0xed, 0xd4, 0x19, 0xdb, 0x06, 0xc1 } + }, + }; + + int i; + unsigned char tmp[32]; + hash_state md; + + for (i = 0; i < (int)(sizeof(tests) / sizeof(tests[0])); i++) { + sha256_init(&md); + sha256_process(&md, (unsigned char*)tests[i].msg, (unsigned long)strlen(tests[i].msg)); + sha256_done(&md, tmp); + if (XMEMCMP(tmp, tests[i].hash, 32) != 0) { + return CRYPT_FAIL_TESTVECTOR; + } + } + return CRYPT_OK; + #endif +} + +#ifdef SHA224 +#include "sha224.c" +#endif + +#endif + + + +/* $Source: /cvs/libtom/libtomcrypt/src/hashes/sha2/sha256.c,v $ */ +/* $Revision: 1.9 $ */ +/* $Date: 2006/11/01 09:28:17 $ */ diff --git a/libtomcrypt/src/hashes/sha2/sha384.c b/libtomcrypt/src/hashes/sha2/sha384.c new file mode 100644 index 0000000..ac7709c --- /dev/null +++ b/libtomcrypt/src/hashes/sha2/sha384.c @@ -0,0 +1,135 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +/** + @param sha384.c + SHA384 hash included in sha512.c, Tom St Denis +*/ + +const struct ltc_hash_descriptor sha384_desc = +{ + "sha384", + 4, + 48, + 128, + + /* OID */ + { 2, 16, 840, 1, 101, 3, 4, 2, 2, }, + 9, + + &sha384_init, + &sha512_process, + &sha384_done, + &sha384_test, + NULL +}; + +/** + Initialize the hash state + @param md The hash state you wish to initialize + @return CRYPT_OK if successful +*/ +int sha384_init(hash_state * md) +{ + LTC_ARGCHK(md != NULL); + + md->sha512.curlen = 0; + md->sha512.length = 0; + md->sha512.state[0] = CONST64(0xcbbb9d5dc1059ed8); + md->sha512.state[1] = CONST64(0x629a292a367cd507); + md->sha512.state[2] = CONST64(0x9159015a3070dd17); + md->sha512.state[3] = CONST64(0x152fecd8f70e5939); + md->sha512.state[4] = CONST64(0x67332667ffc00b31); + md->sha512.state[5] = CONST64(0x8eb44a8768581511); + md->sha512.state[6] = CONST64(0xdb0c2e0d64f98fa7); + md->sha512.state[7] = CONST64(0x47b5481dbefa4fa4); + return CRYPT_OK; +} + +/** + Terminate the hash to get the digest + @param md The hash state + @param out [out] The destination of the hash (48 bytes) + @return CRYPT_OK if successful +*/ +int sha384_done(hash_state * md, unsigned char *out) +{ + unsigned char buf[64]; + + LTC_ARGCHK(md != NULL); + LTC_ARGCHK(out != NULL); + + if (md->sha512.curlen >= sizeof(md->sha512.buf)) { + return CRYPT_INVALID_ARG; + } + + sha512_done(md, buf); + XMEMCPY(out, buf, 48); +#ifdef LTC_CLEAN_STACK + zeromem(buf, sizeof(buf)); +#endif + return CRYPT_OK; +} + +/** + Self-test the hash + @return CRYPT_OK if successful, CRYPT_NOP if self-tests have been disabled +*/ +int sha384_test(void) +{ + #ifndef LTC_TEST + return CRYPT_NOP; + #else + static const struct { + char *msg; + unsigned char hash[48]; + } tests[] = { + { "abc", + { 0xcb, 0x00, 0x75, 0x3f, 0x45, 0xa3, 0x5e, 0x8b, + 0xb5, 0xa0, 0x3d, 0x69, 0x9a, 0xc6, 0x50, 0x07, + 0x27, 0x2c, 0x32, 0xab, 0x0e, 0xde, 0xd1, 0x63, + 0x1a, 0x8b, 0x60, 0x5a, 0x43, 0xff, 0x5b, 0xed, + 0x80, 0x86, 0x07, 0x2b, 0xa1, 0xe7, 0xcc, 0x23, + 0x58, 0xba, 0xec, 0xa1, 0x34, 0xc8, 0x25, 0xa7 } + }, + { "abcdefghbcdefghicdefghijdefghijkefghijklfghijklmghijklmnhijklmnoijklmnopjklmnopqklmnopqrlmnopqrsmnopqrstnopqrstu", + { 0x09, 0x33, 0x0c, 0x33, 0xf7, 0x11, 0x47, 0xe8, + 0x3d, 0x19, 0x2f, 0xc7, 0x82, 0xcd, 0x1b, 0x47, + 0x53, 0x11, 0x1b, 0x17, 0x3b, 0x3b, 0x05, 0xd2, + 0x2f, 0xa0, 0x80, 0x86, 0xe3, 0xb0, 0xf7, 0x12, + 0xfc, 0xc7, 0xc7, 0x1a, 0x55, 0x7e, 0x2d, 0xb9, + 0x66, 0xc3, 0xe9, 0xfa, 0x91, 0x74, 0x60, 0x39 } + }, + }; + + int i; + unsigned char tmp[48]; + hash_state md; + + for (i = 0; i < (int)(sizeof(tests) / sizeof(tests[0])); i++) { + sha384_init(&md); + sha384_process(&md, (unsigned char*)tests[i].msg, (unsigned long)strlen(tests[i].msg)); + sha384_done(&md, tmp); + if (XMEMCMP(tmp, tests[i].hash, 48) != 0) { + return CRYPT_FAIL_TESTVECTOR; + } + } + return CRYPT_OK; + #endif +} + + + + + + +/* $Source: /cvs/libtom/libtomcrypt/src/hashes/sha2/sha384.c,v $ */ +/* $Revision: 1.8 $ */ +/* $Date: 2006/11/01 09:28:17 $ */ diff --git a/libtomcrypt/src/hashes/sha2/sha512.c b/libtomcrypt/src/hashes/sha2/sha512.c new file mode 100644 index 0000000..08c95ef --- /dev/null +++ b/libtomcrypt/src/hashes/sha2/sha512.c @@ -0,0 +1,319 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @param sha512.c + SHA512 by Tom St Denis +*/ + +#ifdef SHA512 + +const struct ltc_hash_descriptor sha512_desc = +{ + "sha512", + 5, + 64, + 128, + + /* OID */ + { 2, 16, 840, 1, 101, 3, 4, 2, 3, }, + 9, + + &sha512_init, + &sha512_process, + &sha512_done, + &sha512_test, + NULL +}; + +/* the K array */ +static const ulong64 K[80] = { +CONST64(0x428a2f98d728ae22), CONST64(0x7137449123ef65cd), +CONST64(0xb5c0fbcfec4d3b2f), CONST64(0xe9b5dba58189dbbc), +CONST64(0x3956c25bf348b538), CONST64(0x59f111f1b605d019), +CONST64(0x923f82a4af194f9b), CONST64(0xab1c5ed5da6d8118), +CONST64(0xd807aa98a3030242), CONST64(0x12835b0145706fbe), +CONST64(0x243185be4ee4b28c), CONST64(0x550c7dc3d5ffb4e2), +CONST64(0x72be5d74f27b896f), CONST64(0x80deb1fe3b1696b1), +CONST64(0x9bdc06a725c71235), CONST64(0xc19bf174cf692694), +CONST64(0xe49b69c19ef14ad2), CONST64(0xefbe4786384f25e3), +CONST64(0x0fc19dc68b8cd5b5), CONST64(0x240ca1cc77ac9c65), +CONST64(0x2de92c6f592b0275), CONST64(0x4a7484aa6ea6e483), +CONST64(0x5cb0a9dcbd41fbd4), CONST64(0x76f988da831153b5), +CONST64(0x983e5152ee66dfab), CONST64(0xa831c66d2db43210), +CONST64(0xb00327c898fb213f), CONST64(0xbf597fc7beef0ee4), +CONST64(0xc6e00bf33da88fc2), CONST64(0xd5a79147930aa725), +CONST64(0x06ca6351e003826f), CONST64(0x142929670a0e6e70), +CONST64(0x27b70a8546d22ffc), CONST64(0x2e1b21385c26c926), +CONST64(0x4d2c6dfc5ac42aed), CONST64(0x53380d139d95b3df), +CONST64(0x650a73548baf63de), CONST64(0x766a0abb3c77b2a8), +CONST64(0x81c2c92e47edaee6), CONST64(0x92722c851482353b), +CONST64(0xa2bfe8a14cf10364), CONST64(0xa81a664bbc423001), +CONST64(0xc24b8b70d0f89791), CONST64(0xc76c51a30654be30), +CONST64(0xd192e819d6ef5218), CONST64(0xd69906245565a910), +CONST64(0xf40e35855771202a), CONST64(0x106aa07032bbd1b8), +CONST64(0x19a4c116b8d2d0c8), CONST64(0x1e376c085141ab53), +CONST64(0x2748774cdf8eeb99), CONST64(0x34b0bcb5e19b48a8), +CONST64(0x391c0cb3c5c95a63), CONST64(0x4ed8aa4ae3418acb), +CONST64(0x5b9cca4f7763e373), CONST64(0x682e6ff3d6b2b8a3), +CONST64(0x748f82ee5defb2fc), CONST64(0x78a5636f43172f60), +CONST64(0x84c87814a1f0ab72), CONST64(0x8cc702081a6439ec), +CONST64(0x90befffa23631e28), CONST64(0xa4506cebde82bde9), +CONST64(0xbef9a3f7b2c67915), CONST64(0xc67178f2e372532b), +CONST64(0xca273eceea26619c), CONST64(0xd186b8c721c0c207), +CONST64(0xeada7dd6cde0eb1e), CONST64(0xf57d4f7fee6ed178), +CONST64(0x06f067aa72176fba), CONST64(0x0a637dc5a2c898a6), +CONST64(0x113f9804bef90dae), CONST64(0x1b710b35131c471b), +CONST64(0x28db77f523047d84), CONST64(0x32caab7b40c72493), +CONST64(0x3c9ebe0a15c9bebc), CONST64(0x431d67c49c100d4c), +CONST64(0x4cc5d4becb3e42b6), CONST64(0x597f299cfc657e2a), +CONST64(0x5fcb6fab3ad6faec), CONST64(0x6c44198c4a475817) +}; + +/* Various logical functions */ +#define Ch(x,y,z) (z ^ (x & (y ^ z))) +#define Maj(x,y,z) (((x | y) & z) | (x & y)) +#define S(x, n) ROR64c(x, n) +#define R(x, n) (((x)&CONST64(0xFFFFFFFFFFFFFFFF))>>((ulong64)n)) +#define Sigma0(x) (S(x, 28) ^ S(x, 34) ^ S(x, 39)) +#define Sigma1(x) (S(x, 14) ^ S(x, 18) ^ S(x, 41)) +#define Gamma0(x) (S(x, 1) ^ S(x, 8) ^ R(x, 7)) +#define Gamma1(x) (S(x, 19) ^ S(x, 61) ^ R(x, 6)) + +/* compress 1024-bits */ +#ifdef LTC_CLEAN_STACK +static int _sha512_compress(hash_state * md, unsigned char *buf) +#else +static int sha512_compress(hash_state * md, unsigned char *buf) +#endif +{ + ulong64 S[8], W[80], t0, t1; + int i; + + /* copy state into S */ + for (i = 0; i < 8; i++) { + S[i] = md->sha512.state[i]; + } + + /* copy the state into 1024-bits into W[0..15] */ + for (i = 0; i < 16; i++) { + LOAD64H(W[i], buf + (8*i)); + } + + /* fill W[16..79] */ + for (i = 16; i < 80; i++) { + W[i] = Gamma1(W[i - 2]) + W[i - 7] + Gamma0(W[i - 15]) + W[i - 16]; + } + + /* Compress */ +#ifdef LTC_SMALL_CODE + for (i = 0; i < 80; i++) { + t0 = S[7] + Sigma1(S[4]) + Ch(S[4], S[5], S[6]) + K[i] + W[i]; + t1 = Sigma0(S[0]) + Maj(S[0], S[1], S[2]); + S[7] = S[6]; + S[6] = S[5]; + S[5] = S[4]; + S[4] = S[3] + t0; + S[3] = S[2]; + S[2] = S[1]; + S[1] = S[0]; + S[0] = t0 + t1; + } +#else +#define RND(a,b,c,d,e,f,g,h,i) \ + t0 = h + Sigma1(e) + Ch(e, f, g) + K[i] + W[i]; \ + t1 = Sigma0(a) + Maj(a, b, c); \ + d += t0; \ + h = t0 + t1; + + for (i = 0; i < 80; i += 8) { + RND(S[0],S[1],S[2],S[3],S[4],S[5],S[6],S[7],i+0); + RND(S[7],S[0],S[1],S[2],S[3],S[4],S[5],S[6],i+1); + RND(S[6],S[7],S[0],S[1],S[2],S[3],S[4],S[5],i+2); + RND(S[5],S[6],S[7],S[0],S[1],S[2],S[3],S[4],i+3); + RND(S[4],S[5],S[6],S[7],S[0],S[1],S[2],S[3],i+4); + RND(S[3],S[4],S[5],S[6],S[7],S[0],S[1],S[2],i+5); + RND(S[2],S[3],S[4],S[5],S[6],S[7],S[0],S[1],i+6); + RND(S[1],S[2],S[3],S[4],S[5],S[6],S[7],S[0],i+7); + } +#endif + + + /* feedback */ + for (i = 0; i < 8; i++) { + md->sha512.state[i] = md->sha512.state[i] + S[i]; + } + + return CRYPT_OK; +} + +/* compress 1024-bits */ +#ifdef LTC_CLEAN_STACK +static int sha512_compress(hash_state * md, unsigned char *buf) +{ + int err; + err = _sha512_compress(md, buf); + burn_stack(sizeof(ulong64) * 90 + sizeof(int)); + return err; +} +#endif + +/** + Initialize the hash state + @param md The hash state you wish to initialize + @return CRYPT_OK if successful +*/ +int sha512_init(hash_state * md) +{ + LTC_ARGCHK(md != NULL); + md->sha512.curlen = 0; + md->sha512.length = 0; + md->sha512.state[0] = CONST64(0x6a09e667f3bcc908); + md->sha512.state[1] = CONST64(0xbb67ae8584caa73b); + md->sha512.state[2] = CONST64(0x3c6ef372fe94f82b); + md->sha512.state[3] = CONST64(0xa54ff53a5f1d36f1); + md->sha512.state[4] = CONST64(0x510e527fade682d1); + md->sha512.state[5] = CONST64(0x9b05688c2b3e6c1f); + md->sha512.state[6] = CONST64(0x1f83d9abfb41bd6b); + md->sha512.state[7] = CONST64(0x5be0cd19137e2179); + return CRYPT_OK; +} + +/** + Process a block of memory though the hash + @param md The hash state + @param in The data to hash + @param inlen The length of the data (octets) + @return CRYPT_OK if successful +*/ +HASH_PROCESS(sha512_process, sha512_compress, sha512, 128) + +/** + Terminate the hash to get the digest + @param md The hash state + @param out [out] The destination of the hash (64 bytes) + @return CRYPT_OK if successful +*/ +int sha512_done(hash_state * md, unsigned char *out) +{ + int i; + + LTC_ARGCHK(md != NULL); + LTC_ARGCHK(out != NULL); + + if (md->sha512.curlen >= sizeof(md->sha512.buf)) { + return CRYPT_INVALID_ARG; + } + + /* increase the length of the message */ + md->sha512.length += md->sha512.curlen * CONST64(8); + + /* append the '1' bit */ + md->sha512.buf[md->sha512.curlen++] = (unsigned char)0x80; + + /* if the length is currently above 112 bytes we append zeros + * then compress. Then we can fall back to padding zeros and length + * encoding like normal. + */ + if (md->sha512.curlen > 112) { + while (md->sha512.curlen < 128) { + md->sha512.buf[md->sha512.curlen++] = (unsigned char)0; + } + sha512_compress(md, md->sha512.buf); + md->sha512.curlen = 0; + } + + /* pad upto 120 bytes of zeroes + * note: that from 112 to 120 is the 64 MSB of the length. We assume that you won't hash + * > 2^64 bits of data... :-) + */ + while (md->sha512.curlen < 120) { + md->sha512.buf[md->sha512.curlen++] = (unsigned char)0; + } + + /* store length */ + STORE64H(md->sha512.length, md->sha512.buf+120); + sha512_compress(md, md->sha512.buf); + + /* copy output */ + for (i = 0; i < 8; i++) { + STORE64H(md->sha512.state[i], out+(8*i)); + } +#ifdef LTC_CLEAN_STACK + zeromem(md, sizeof(hash_state)); +#endif + return CRYPT_OK; +} + +/** + Self-test the hash + @return CRYPT_OK if successful, CRYPT_NOP if self-tests have been disabled +*/ +int sha512_test(void) +{ + #ifndef LTC_TEST + return CRYPT_NOP; + #else + static const struct { + char *msg; + unsigned char hash[64]; + } tests[] = { + { "abc", + { 0xdd, 0xaf, 0x35, 0xa1, 0x93, 0x61, 0x7a, 0xba, + 0xcc, 0x41, 0x73, 0x49, 0xae, 0x20, 0x41, 0x31, + 0x12, 0xe6, 0xfa, 0x4e, 0x89, 0xa9, 0x7e, 0xa2, + 0x0a, 0x9e, 0xee, 0xe6, 0x4b, 0x55, 0xd3, 0x9a, + 0x21, 0x92, 0x99, 0x2a, 0x27, 0x4f, 0xc1, 0xa8, + 0x36, 0xba, 0x3c, 0x23, 0xa3, 0xfe, 0xeb, 0xbd, + 0x45, 0x4d, 0x44, 0x23, 0x64, 0x3c, 0xe8, 0x0e, + 0x2a, 0x9a, 0xc9, 0x4f, 0xa5, 0x4c, 0xa4, 0x9f } + }, + { "abcdefghbcdefghicdefghijdefghijkefghijklfghijklmghijklmnhijklmnoijklmnopjklmnopqklmnopqrlmnopqrsmnopqrstnopqrstu", + { 0x8e, 0x95, 0x9b, 0x75, 0xda, 0xe3, 0x13, 0xda, + 0x8c, 0xf4, 0xf7, 0x28, 0x14, 0xfc, 0x14, 0x3f, + 0x8f, 0x77, 0x79, 0xc6, 0xeb, 0x9f, 0x7f, 0xa1, + 0x72, 0x99, 0xae, 0xad, 0xb6, 0x88, 0x90, 0x18, + 0x50, 0x1d, 0x28, 0x9e, 0x49, 0x00, 0xf7, 0xe4, + 0x33, 0x1b, 0x99, 0xde, 0xc4, 0xb5, 0x43, 0x3a, + 0xc7, 0xd3, 0x29, 0xee, 0xb6, 0xdd, 0x26, 0x54, + 0x5e, 0x96, 0xe5, 0x5b, 0x87, 0x4b, 0xe9, 0x09 } + }, + }; + + int i; + unsigned char tmp[64]; + hash_state md; + + for (i = 0; i < (int)(sizeof(tests) / sizeof(tests[0])); i++) { + sha512_init(&md); + sha512_process(&md, (unsigned char *)tests[i].msg, (unsigned long)strlen(tests[i].msg)); + sha512_done(&md, tmp); + if (XMEMCMP(tmp, tests[i].hash, 64) != 0) { + return CRYPT_FAIL_TESTVECTOR; + } + } + return CRYPT_OK; + #endif +} + +#ifdef SHA384 + #include "sha384.c" +#endif + +#endif + + + + +/* $Source: /cvs/libtom/libtomcrypt/src/hashes/sha2/sha512.c,v $ */ +/* $Revision: 1.8 $ */ +/* $Date: 2006/11/01 09:28:17 $ */ diff --git a/libtomcrypt/src/hashes/tiger.c b/libtomcrypt/src/hashes/tiger.c new file mode 100644 index 0000000..9a4052c --- /dev/null +++ b/libtomcrypt/src/hashes/tiger.c @@ -0,0 +1,814 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ + +#include "tomcrypt.h" + +/** + @file tiger.c + Tiger hash function, Tom St Denis +*/ + +#ifdef TIGER + +const struct ltc_hash_descriptor tiger_desc = +{ + "tiger", + 1, + 24, + 64, + + /* OID */ + { 1, 3, 6, 1, 4, 1, 11591, 12, 2, }, + 9, + + &tiger_init, + &tiger_process, + &tiger_done, + &tiger_test, + NULL +}; + +#define t1 (table) +#define t2 (table+256) +#define t3 (table+256*2) +#define t4 (table+256*3) + +static const ulong64 table[4*256] = { + CONST64(0x02AAB17CF7E90C5E) /* 0 */, CONST64(0xAC424B03E243A8EC) /* 1 */, + CONST64(0x72CD5BE30DD5FCD3) /* 2 */, CONST64(0x6D019B93F6F97F3A) /* 3 */, + CONST64(0xCD9978FFD21F9193) /* 4 */, CONST64(0x7573A1C9708029E2) /* 5 */, + CONST64(0xB164326B922A83C3) /* 6 */, CONST64(0x46883EEE04915870) /* 7 */, + CONST64(0xEAACE3057103ECE6) /* 8 */, CONST64(0xC54169B808A3535C) /* 9 */, + CONST64(0x4CE754918DDEC47C) /* 10 */, CONST64(0x0AA2F4DFDC0DF40C) /* 11 */, + CONST64(0x10B76F18A74DBEFA) /* 12 */, CONST64(0xC6CCB6235AD1AB6A) /* 13 */, + CONST64(0x13726121572FE2FF) /* 14 */, CONST64(0x1A488C6F199D921E) /* 15 */, + CONST64(0x4BC9F9F4DA0007CA) /* 16 */, CONST64(0x26F5E6F6E85241C7) /* 17 */, + CONST64(0x859079DBEA5947B6) /* 18 */, CONST64(0x4F1885C5C99E8C92) /* 19 */, + CONST64(0xD78E761EA96F864B) /* 20 */, CONST64(0x8E36428C52B5C17D) /* 21 */, + CONST64(0x69CF6827373063C1) /* 22 */, CONST64(0xB607C93D9BB4C56E) /* 23 */, + CONST64(0x7D820E760E76B5EA) /* 24 */, CONST64(0x645C9CC6F07FDC42) /* 25 */, + CONST64(0xBF38A078243342E0) /* 26 */, CONST64(0x5F6B343C9D2E7D04) /* 27 */, + CONST64(0xF2C28AEB600B0EC6) /* 28 */, CONST64(0x6C0ED85F7254BCAC) /* 29 */, + CONST64(0x71592281A4DB4FE5) /* 30 */, CONST64(0x1967FA69CE0FED9F) /* 31 */, + CONST64(0xFD5293F8B96545DB) /* 32 */, CONST64(0xC879E9D7F2A7600B) /* 33 */, + CONST64(0x860248920193194E) /* 34 */, CONST64(0xA4F9533B2D9CC0B3) /* 35 */, + CONST64(0x9053836C15957613) /* 36 */, CONST64(0xDB6DCF8AFC357BF1) /* 37 */, + CONST64(0x18BEEA7A7A370F57) /* 38 */, CONST64(0x037117CA50B99066) /* 39 */, + CONST64(0x6AB30A9774424A35) /* 40 */, CONST64(0xF4E92F02E325249B) /* 41 */, + CONST64(0x7739DB07061CCAE1) /* 42 */, CONST64(0xD8F3B49CECA42A05) /* 43 */, + CONST64(0xBD56BE3F51382F73) /* 44 */, CONST64(0x45FAED5843B0BB28) /* 45 */, + CONST64(0x1C813D5C11BF1F83) /* 46 */, CONST64(0x8AF0E4B6D75FA169) /* 47 */, + CONST64(0x33EE18A487AD9999) /* 48 */, CONST64(0x3C26E8EAB1C94410) /* 49 */, + CONST64(0xB510102BC0A822F9) /* 50 */, CONST64(0x141EEF310CE6123B) /* 51 */, + CONST64(0xFC65B90059DDB154) /* 52 */, CONST64(0xE0158640C5E0E607) /* 53 */, + CONST64(0x884E079826C3A3CF) /* 54 */, CONST64(0x930D0D9523C535FD) /* 55 */, + CONST64(0x35638D754E9A2B00) /* 56 */, CONST64(0x4085FCCF40469DD5) /* 57 */, + CONST64(0xC4B17AD28BE23A4C) /* 58 */, CONST64(0xCAB2F0FC6A3E6A2E) /* 59 */, + CONST64(0x2860971A6B943FCD) /* 60 */, CONST64(0x3DDE6EE212E30446) /* 61 */, + CONST64(0x6222F32AE01765AE) /* 62 */, CONST64(0x5D550BB5478308FE) /* 63 */, + CONST64(0xA9EFA98DA0EDA22A) /* 64 */, CONST64(0xC351A71686C40DA7) /* 65 */, + CONST64(0x1105586D9C867C84) /* 66 */, CONST64(0xDCFFEE85FDA22853) /* 67 */, + CONST64(0xCCFBD0262C5EEF76) /* 68 */, CONST64(0xBAF294CB8990D201) /* 69 */, + CONST64(0xE69464F52AFAD975) /* 70 */, CONST64(0x94B013AFDF133E14) /* 71 */, + CONST64(0x06A7D1A32823C958) /* 72 */, CONST64(0x6F95FE5130F61119) /* 73 */, + CONST64(0xD92AB34E462C06C0) /* 74 */, CONST64(0xED7BDE33887C71D2) /* 75 */, + CONST64(0x79746D6E6518393E) /* 76 */, CONST64(0x5BA419385D713329) /* 77 */, + CONST64(0x7C1BA6B948A97564) /* 78 */, CONST64(0x31987C197BFDAC67) /* 79 */, + CONST64(0xDE6C23C44B053D02) /* 80 */, CONST64(0x581C49FED002D64D) /* 81 */, + CONST64(0xDD474D6338261571) /* 82 */, CONST64(0xAA4546C3E473D062) /* 83 */, + CONST64(0x928FCE349455F860) /* 84 */, CONST64(0x48161BBACAAB94D9) /* 85 */, + CONST64(0x63912430770E6F68) /* 86 */, CONST64(0x6EC8A5E602C6641C) /* 87 */, + CONST64(0x87282515337DDD2B) /* 88 */, CONST64(0x2CDA6B42034B701B) /* 89 */, + CONST64(0xB03D37C181CB096D) /* 90 */, CONST64(0xE108438266C71C6F) /* 91 */, + CONST64(0x2B3180C7EB51B255) /* 92 */, CONST64(0xDF92B82F96C08BBC) /* 93 */, + CONST64(0x5C68C8C0A632F3BA) /* 94 */, CONST64(0x5504CC861C3D0556) /* 95 */, + CONST64(0xABBFA4E55FB26B8F) /* 96 */, CONST64(0x41848B0AB3BACEB4) /* 97 */, + CONST64(0xB334A273AA445D32) /* 98 */, CONST64(0xBCA696F0A85AD881) /* 99 */, + CONST64(0x24F6EC65B528D56C) /* 100 */, CONST64(0x0CE1512E90F4524A) /* 101 */, + CONST64(0x4E9DD79D5506D35A) /* 102 */, CONST64(0x258905FAC6CE9779) /* 103 */, + CONST64(0x2019295B3E109B33) /* 104 */, CONST64(0xF8A9478B73A054CC) /* 105 */, + CONST64(0x2924F2F934417EB0) /* 106 */, CONST64(0x3993357D536D1BC4) /* 107 */, + CONST64(0x38A81AC21DB6FF8B) /* 108 */, CONST64(0x47C4FBF17D6016BF) /* 109 */, + CONST64(0x1E0FAADD7667E3F5) /* 110 */, CONST64(0x7ABCFF62938BEB96) /* 111 */, + CONST64(0xA78DAD948FC179C9) /* 112 */, CONST64(0x8F1F98B72911E50D) /* 113 */, + CONST64(0x61E48EAE27121A91) /* 114 */, CONST64(0x4D62F7AD31859808) /* 115 */, + CONST64(0xECEBA345EF5CEAEB) /* 116 */, CONST64(0xF5CEB25EBC9684CE) /* 117 */, + CONST64(0xF633E20CB7F76221) /* 118 */, CONST64(0xA32CDF06AB8293E4) /* 119 */, + CONST64(0x985A202CA5EE2CA4) /* 120 */, CONST64(0xCF0B8447CC8A8FB1) /* 121 */, + CONST64(0x9F765244979859A3) /* 122 */, CONST64(0xA8D516B1A1240017) /* 123 */, + CONST64(0x0BD7BA3EBB5DC726) /* 124 */, CONST64(0xE54BCA55B86ADB39) /* 125 */, + CONST64(0x1D7A3AFD6C478063) /* 126 */, CONST64(0x519EC608E7669EDD) /* 127 */, + CONST64(0x0E5715A2D149AA23) /* 128 */, CONST64(0x177D4571848FF194) /* 129 */, + CONST64(0xEEB55F3241014C22) /* 130 */, CONST64(0x0F5E5CA13A6E2EC2) /* 131 */, + CONST64(0x8029927B75F5C361) /* 132 */, CONST64(0xAD139FABC3D6E436) /* 133 */, + CONST64(0x0D5DF1A94CCF402F) /* 134 */, CONST64(0x3E8BD948BEA5DFC8) /* 135 */, + CONST64(0xA5A0D357BD3FF77E) /* 136 */, CONST64(0xA2D12E251F74F645) /* 137 */, + CONST64(0x66FD9E525E81A082) /* 138 */, CONST64(0x2E0C90CE7F687A49) /* 139 */, + CONST64(0xC2E8BCBEBA973BC5) /* 140 */, CONST64(0x000001BCE509745F) /* 141 */, + CONST64(0x423777BBE6DAB3D6) /* 142 */, CONST64(0xD1661C7EAEF06EB5) /* 143 */, + CONST64(0xA1781F354DAACFD8) /* 144 */, CONST64(0x2D11284A2B16AFFC) /* 145 */, + CONST64(0xF1FC4F67FA891D1F) /* 146 */, CONST64(0x73ECC25DCB920ADA) /* 147 */, + CONST64(0xAE610C22C2A12651) /* 148 */, CONST64(0x96E0A810D356B78A) /* 149 */, + CONST64(0x5A9A381F2FE7870F) /* 150 */, CONST64(0xD5AD62EDE94E5530) /* 151 */, + CONST64(0xD225E5E8368D1427) /* 152 */, CONST64(0x65977B70C7AF4631) /* 153 */, + CONST64(0x99F889B2DE39D74F) /* 154 */, CONST64(0x233F30BF54E1D143) /* 155 */, + CONST64(0x9A9675D3D9A63C97) /* 156 */, CONST64(0x5470554FF334F9A8) /* 157 */, + CONST64(0x166ACB744A4F5688) /* 158 */, CONST64(0x70C74CAAB2E4AEAD) /* 159 */, + CONST64(0xF0D091646F294D12) /* 160 */, CONST64(0x57B82A89684031D1) /* 161 */, + CONST64(0xEFD95A5A61BE0B6B) /* 162 */, CONST64(0x2FBD12E969F2F29A) /* 163 */, + CONST64(0x9BD37013FEFF9FE8) /* 164 */, CONST64(0x3F9B0404D6085A06) /* 165 */, + CONST64(0x4940C1F3166CFE15) /* 166 */, CONST64(0x09542C4DCDF3DEFB) /* 167 */, + CONST64(0xB4C5218385CD5CE3) /* 168 */, CONST64(0xC935B7DC4462A641) /* 169 */, + CONST64(0x3417F8A68ED3B63F) /* 170 */, CONST64(0xB80959295B215B40) /* 171 */, + CONST64(0xF99CDAEF3B8C8572) /* 172 */, CONST64(0x018C0614F8FCB95D) /* 173 */, + CONST64(0x1B14ACCD1A3ACDF3) /* 174 */, CONST64(0x84D471F200BB732D) /* 175 */, + CONST64(0xC1A3110E95E8DA16) /* 176 */, CONST64(0x430A7220BF1A82B8) /* 177 */, + CONST64(0xB77E090D39DF210E) /* 178 */, CONST64(0x5EF4BD9F3CD05E9D) /* 179 */, + CONST64(0x9D4FF6DA7E57A444) /* 180 */, CONST64(0xDA1D60E183D4A5F8) /* 181 */, + CONST64(0xB287C38417998E47) /* 182 */, CONST64(0xFE3EDC121BB31886) /* 183 */, + CONST64(0xC7FE3CCC980CCBEF) /* 184 */, CONST64(0xE46FB590189BFD03) /* 185 */, + CONST64(0x3732FD469A4C57DC) /* 186 */, CONST64(0x7EF700A07CF1AD65) /* 187 */, + CONST64(0x59C64468A31D8859) /* 188 */, CONST64(0x762FB0B4D45B61F6) /* 189 */, + CONST64(0x155BAED099047718) /* 190 */, CONST64(0x68755E4C3D50BAA6) /* 191 */, + CONST64(0xE9214E7F22D8B4DF) /* 192 */, CONST64(0x2ADDBF532EAC95F4) /* 193 */, + CONST64(0x32AE3909B4BD0109) /* 194 */, CONST64(0x834DF537B08E3450) /* 195 */, + CONST64(0xFA209DA84220728D) /* 196 */, CONST64(0x9E691D9B9EFE23F7) /* 197 */, + CONST64(0x0446D288C4AE8D7F) /* 198 */, CONST64(0x7B4CC524E169785B) /* 199 */, + CONST64(0x21D87F0135CA1385) /* 200 */, CONST64(0xCEBB400F137B8AA5) /* 201 */, + CONST64(0x272E2B66580796BE) /* 202 */, CONST64(0x3612264125C2B0DE) /* 203 */, + CONST64(0x057702BDAD1EFBB2) /* 204 */, CONST64(0xD4BABB8EACF84BE9) /* 205 */, + CONST64(0x91583139641BC67B) /* 206 */, CONST64(0x8BDC2DE08036E024) /* 207 */, + CONST64(0x603C8156F49F68ED) /* 208 */, CONST64(0xF7D236F7DBEF5111) /* 209 */, + CONST64(0x9727C4598AD21E80) /* 210 */, CONST64(0xA08A0896670A5FD7) /* 211 */, + CONST64(0xCB4A8F4309EBA9CB) /* 212 */, CONST64(0x81AF564B0F7036A1) /* 213 */, + CONST64(0xC0B99AA778199ABD) /* 214 */, CONST64(0x959F1EC83FC8E952) /* 215 */, + CONST64(0x8C505077794A81B9) /* 216 */, CONST64(0x3ACAAF8F056338F0) /* 217 */, + CONST64(0x07B43F50627A6778) /* 218 */, CONST64(0x4A44AB49F5ECCC77) /* 219 */, + CONST64(0x3BC3D6E4B679EE98) /* 220 */, CONST64(0x9CC0D4D1CF14108C) /* 221 */, + CONST64(0x4406C00B206BC8A0) /* 222 */, CONST64(0x82A18854C8D72D89) /* 223 */, + CONST64(0x67E366B35C3C432C) /* 224 */, CONST64(0xB923DD61102B37F2) /* 225 */, + CONST64(0x56AB2779D884271D) /* 226 */, CONST64(0xBE83E1B0FF1525AF) /* 227 */, + CONST64(0xFB7C65D4217E49A9) /* 228 */, CONST64(0x6BDBE0E76D48E7D4) /* 229 */, + CONST64(0x08DF828745D9179E) /* 230 */, CONST64(0x22EA6A9ADD53BD34) /* 231 */, + CONST64(0xE36E141C5622200A) /* 232 */, CONST64(0x7F805D1B8CB750EE) /* 233 */, + CONST64(0xAFE5C7A59F58E837) /* 234 */, CONST64(0xE27F996A4FB1C23C) /* 235 */, + CONST64(0xD3867DFB0775F0D0) /* 236 */, CONST64(0xD0E673DE6E88891A) /* 237 */, + CONST64(0x123AEB9EAFB86C25) /* 238 */, CONST64(0x30F1D5D5C145B895) /* 239 */, + CONST64(0xBB434A2DEE7269E7) /* 240 */, CONST64(0x78CB67ECF931FA38) /* 241 */, + CONST64(0xF33B0372323BBF9C) /* 242 */, CONST64(0x52D66336FB279C74) /* 243 */, + CONST64(0x505F33AC0AFB4EAA) /* 244 */, CONST64(0xE8A5CD99A2CCE187) /* 245 */, + CONST64(0x534974801E2D30BB) /* 246 */, CONST64(0x8D2D5711D5876D90) /* 247 */, + CONST64(0x1F1A412891BC038E) /* 248 */, CONST64(0xD6E2E71D82E56648) /* 249 */, + CONST64(0x74036C3A497732B7) /* 250 */, CONST64(0x89B67ED96361F5AB) /* 251 */, + CONST64(0xFFED95D8F1EA02A2) /* 252 */, CONST64(0xE72B3BD61464D43D) /* 253 */, + CONST64(0xA6300F170BDC4820) /* 254 */, CONST64(0xEBC18760ED78A77A) /* 255 */, + CONST64(0xE6A6BE5A05A12138) /* 256 */, CONST64(0xB5A122A5B4F87C98) /* 257 */, + CONST64(0x563C6089140B6990) /* 258 */, CONST64(0x4C46CB2E391F5DD5) /* 259 */, + CONST64(0xD932ADDBC9B79434) /* 260 */, CONST64(0x08EA70E42015AFF5) /* 261 */, + CONST64(0xD765A6673E478CF1) /* 262 */, CONST64(0xC4FB757EAB278D99) /* 263 */, + CONST64(0xDF11C6862D6E0692) /* 264 */, CONST64(0xDDEB84F10D7F3B16) /* 265 */, + CONST64(0x6F2EF604A665EA04) /* 266 */, CONST64(0x4A8E0F0FF0E0DFB3) /* 267 */, + CONST64(0xA5EDEEF83DBCBA51) /* 268 */, CONST64(0xFC4F0A2A0EA4371E) /* 269 */, + CONST64(0xE83E1DA85CB38429) /* 270 */, CONST64(0xDC8FF882BA1B1CE2) /* 271 */, + CONST64(0xCD45505E8353E80D) /* 272 */, CONST64(0x18D19A00D4DB0717) /* 273 */, + CONST64(0x34A0CFEDA5F38101) /* 274 */, CONST64(0x0BE77E518887CAF2) /* 275 */, + CONST64(0x1E341438B3C45136) /* 276 */, CONST64(0xE05797F49089CCF9) /* 277 */, + CONST64(0xFFD23F9DF2591D14) /* 278 */, CONST64(0x543DDA228595C5CD) /* 279 */, + CONST64(0x661F81FD99052A33) /* 280 */, CONST64(0x8736E641DB0F7B76) /* 281 */, + CONST64(0x15227725418E5307) /* 282 */, CONST64(0xE25F7F46162EB2FA) /* 283 */, + CONST64(0x48A8B2126C13D9FE) /* 284 */, CONST64(0xAFDC541792E76EEA) /* 285 */, + CONST64(0x03D912BFC6D1898F) /* 286 */, CONST64(0x31B1AAFA1B83F51B) /* 287 */, + CONST64(0xF1AC2796E42AB7D9) /* 288 */, CONST64(0x40A3A7D7FCD2EBAC) /* 289 */, + CONST64(0x1056136D0AFBBCC5) /* 290 */, CONST64(0x7889E1DD9A6D0C85) /* 291 */, + CONST64(0xD33525782A7974AA) /* 292 */, CONST64(0xA7E25D09078AC09B) /* 293 */, + CONST64(0xBD4138B3EAC6EDD0) /* 294 */, CONST64(0x920ABFBE71EB9E70) /* 295 */, + CONST64(0xA2A5D0F54FC2625C) /* 296 */, CONST64(0xC054E36B0B1290A3) /* 297 */, + CONST64(0xF6DD59FF62FE932B) /* 298 */, CONST64(0x3537354511A8AC7D) /* 299 */, + CONST64(0xCA845E9172FADCD4) /* 300 */, CONST64(0x84F82B60329D20DC) /* 301 */, + CONST64(0x79C62CE1CD672F18) /* 302 */, CONST64(0x8B09A2ADD124642C) /* 303 */, + CONST64(0xD0C1E96A19D9E726) /* 304 */, CONST64(0x5A786A9B4BA9500C) /* 305 */, + CONST64(0x0E020336634C43F3) /* 306 */, CONST64(0xC17B474AEB66D822) /* 307 */, + CONST64(0x6A731AE3EC9BAAC2) /* 308 */, CONST64(0x8226667AE0840258) /* 309 */, + CONST64(0x67D4567691CAECA5) /* 310 */, CONST64(0x1D94155C4875ADB5) /* 311 */, + CONST64(0x6D00FD985B813FDF) /* 312 */, CONST64(0x51286EFCB774CD06) /* 313 */, + CONST64(0x5E8834471FA744AF) /* 314 */, CONST64(0xF72CA0AEE761AE2E) /* 315 */, + CONST64(0xBE40E4CDAEE8E09A) /* 316 */, CONST64(0xE9970BBB5118F665) /* 317 */, + CONST64(0x726E4BEB33DF1964) /* 318 */, CONST64(0x703B000729199762) /* 319 */, + CONST64(0x4631D816F5EF30A7) /* 320 */, CONST64(0xB880B5B51504A6BE) /* 321 */, + CONST64(0x641793C37ED84B6C) /* 322 */, CONST64(0x7B21ED77F6E97D96) /* 323 */, + CONST64(0x776306312EF96B73) /* 324 */, CONST64(0xAE528948E86FF3F4) /* 325 */, + CONST64(0x53DBD7F286A3F8F8) /* 326 */, CONST64(0x16CADCE74CFC1063) /* 327 */, + CONST64(0x005C19BDFA52C6DD) /* 328 */, CONST64(0x68868F5D64D46AD3) /* 329 */, + CONST64(0x3A9D512CCF1E186A) /* 330 */, CONST64(0x367E62C2385660AE) /* 331 */, + CONST64(0xE359E7EA77DCB1D7) /* 332 */, CONST64(0x526C0773749ABE6E) /* 333 */, + CONST64(0x735AE5F9D09F734B) /* 334 */, CONST64(0x493FC7CC8A558BA8) /* 335 */, + CONST64(0xB0B9C1533041AB45) /* 336 */, CONST64(0x321958BA470A59BD) /* 337 */, + CONST64(0x852DB00B5F46C393) /* 338 */, CONST64(0x91209B2BD336B0E5) /* 339 */, + CONST64(0x6E604F7D659EF19F) /* 340 */, CONST64(0xB99A8AE2782CCB24) /* 341 */, + CONST64(0xCCF52AB6C814C4C7) /* 342 */, CONST64(0x4727D9AFBE11727B) /* 343 */, + CONST64(0x7E950D0C0121B34D) /* 344 */, CONST64(0x756F435670AD471F) /* 345 */, + CONST64(0xF5ADD442615A6849) /* 346 */, CONST64(0x4E87E09980B9957A) /* 347 */, + CONST64(0x2ACFA1DF50AEE355) /* 348 */, CONST64(0xD898263AFD2FD556) /* 349 */, + CONST64(0xC8F4924DD80C8FD6) /* 350 */, CONST64(0xCF99CA3D754A173A) /* 351 */, + CONST64(0xFE477BACAF91BF3C) /* 352 */, CONST64(0xED5371F6D690C12D) /* 353 */, + CONST64(0x831A5C285E687094) /* 354 */, CONST64(0xC5D3C90A3708A0A4) /* 355 */, + CONST64(0x0F7F903717D06580) /* 356 */, CONST64(0x19F9BB13B8FDF27F) /* 357 */, + CONST64(0xB1BD6F1B4D502843) /* 358 */, CONST64(0x1C761BA38FFF4012) /* 359 */, + CONST64(0x0D1530C4E2E21F3B) /* 360 */, CONST64(0x8943CE69A7372C8A) /* 361 */, + CONST64(0xE5184E11FEB5CE66) /* 362 */, CONST64(0x618BDB80BD736621) /* 363 */, + CONST64(0x7D29BAD68B574D0B) /* 364 */, CONST64(0x81BB613E25E6FE5B) /* 365 */, + CONST64(0x071C9C10BC07913F) /* 366 */, CONST64(0xC7BEEB7909AC2D97) /* 367 */, + CONST64(0xC3E58D353BC5D757) /* 368 */, CONST64(0xEB017892F38F61E8) /* 369 */, + CONST64(0xD4EFFB9C9B1CC21A) /* 370 */, CONST64(0x99727D26F494F7AB) /* 371 */, + CONST64(0xA3E063A2956B3E03) /* 372 */, CONST64(0x9D4A8B9A4AA09C30) /* 373 */, + CONST64(0x3F6AB7D500090FB4) /* 374 */, CONST64(0x9CC0F2A057268AC0) /* 375 */, + CONST64(0x3DEE9D2DEDBF42D1) /* 376 */, CONST64(0x330F49C87960A972) /* 377 */, + CONST64(0xC6B2720287421B41) /* 378 */, CONST64(0x0AC59EC07C00369C) /* 379 */, + CONST64(0xEF4EAC49CB353425) /* 380 */, CONST64(0xF450244EEF0129D8) /* 381 */, + CONST64(0x8ACC46E5CAF4DEB6) /* 382 */, CONST64(0x2FFEAB63989263F7) /* 383 */, + CONST64(0x8F7CB9FE5D7A4578) /* 384 */, CONST64(0x5BD8F7644E634635) /* 385 */, + CONST64(0x427A7315BF2DC900) /* 386 */, CONST64(0x17D0C4AA2125261C) /* 387 */, + CONST64(0x3992486C93518E50) /* 388 */, CONST64(0xB4CBFEE0A2D7D4C3) /* 389 */, + CONST64(0x7C75D6202C5DDD8D) /* 390 */, CONST64(0xDBC295D8E35B6C61) /* 391 */, + CONST64(0x60B369D302032B19) /* 392 */, CONST64(0xCE42685FDCE44132) /* 393 */, + CONST64(0x06F3DDB9DDF65610) /* 394 */, CONST64(0x8EA4D21DB5E148F0) /* 395 */, + CONST64(0x20B0FCE62FCD496F) /* 396 */, CONST64(0x2C1B912358B0EE31) /* 397 */, + CONST64(0xB28317B818F5A308) /* 398 */, CONST64(0xA89C1E189CA6D2CF) /* 399 */, + CONST64(0x0C6B18576AAADBC8) /* 400 */, CONST64(0xB65DEAA91299FAE3) /* 401 */, + CONST64(0xFB2B794B7F1027E7) /* 402 */, CONST64(0x04E4317F443B5BEB) /* 403 */, + CONST64(0x4B852D325939D0A6) /* 404 */, CONST64(0xD5AE6BEEFB207FFC) /* 405 */, + CONST64(0x309682B281C7D374) /* 406 */, CONST64(0xBAE309A194C3B475) /* 407 */, + CONST64(0x8CC3F97B13B49F05) /* 408 */, CONST64(0x98A9422FF8293967) /* 409 */, + CONST64(0x244B16B01076FF7C) /* 410 */, CONST64(0xF8BF571C663D67EE) /* 411 */, + CONST64(0x1F0D6758EEE30DA1) /* 412 */, CONST64(0xC9B611D97ADEB9B7) /* 413 */, + CONST64(0xB7AFD5887B6C57A2) /* 414 */, CONST64(0x6290AE846B984FE1) /* 415 */, + CONST64(0x94DF4CDEACC1A5FD) /* 416 */, CONST64(0x058A5BD1C5483AFF) /* 417 */, + CONST64(0x63166CC142BA3C37) /* 418 */, CONST64(0x8DB8526EB2F76F40) /* 419 */, + CONST64(0xE10880036F0D6D4E) /* 420 */, CONST64(0x9E0523C9971D311D) /* 421 */, + CONST64(0x45EC2824CC7CD691) /* 422 */, CONST64(0x575B8359E62382C9) /* 423 */, + CONST64(0xFA9E400DC4889995) /* 424 */, CONST64(0xD1823ECB45721568) /* 425 */, + CONST64(0xDAFD983B8206082F) /* 426 */, CONST64(0xAA7D29082386A8CB) /* 427 */, + CONST64(0x269FCD4403B87588) /* 428 */, CONST64(0x1B91F5F728BDD1E0) /* 429 */, + CONST64(0xE4669F39040201F6) /* 430 */, CONST64(0x7A1D7C218CF04ADE) /* 431 */, + CONST64(0x65623C29D79CE5CE) /* 432 */, CONST64(0x2368449096C00BB1) /* 433 */, + CONST64(0xAB9BF1879DA503BA) /* 434 */, CONST64(0xBC23ECB1A458058E) /* 435 */, + CONST64(0x9A58DF01BB401ECC) /* 436 */, CONST64(0xA070E868A85F143D) /* 437 */, + CONST64(0x4FF188307DF2239E) /* 438 */, CONST64(0x14D565B41A641183) /* 439 */, + CONST64(0xEE13337452701602) /* 440 */, CONST64(0x950E3DCF3F285E09) /* 441 */, + CONST64(0x59930254B9C80953) /* 442 */, CONST64(0x3BF299408930DA6D) /* 443 */, + CONST64(0xA955943F53691387) /* 444 */, CONST64(0xA15EDECAA9CB8784) /* 445 */, + CONST64(0x29142127352BE9A0) /* 446 */, CONST64(0x76F0371FFF4E7AFB) /* 447 */, + CONST64(0x0239F450274F2228) /* 448 */, CONST64(0xBB073AF01D5E868B) /* 449 */, + CONST64(0xBFC80571C10E96C1) /* 450 */, CONST64(0xD267088568222E23) /* 451 */, + CONST64(0x9671A3D48E80B5B0) /* 452 */, CONST64(0x55B5D38AE193BB81) /* 453 */, + CONST64(0x693AE2D0A18B04B8) /* 454 */, CONST64(0x5C48B4ECADD5335F) /* 455 */, + CONST64(0xFD743B194916A1CA) /* 456 */, CONST64(0x2577018134BE98C4) /* 457 */, + CONST64(0xE77987E83C54A4AD) /* 458 */, CONST64(0x28E11014DA33E1B9) /* 459 */, + CONST64(0x270CC59E226AA213) /* 460 */, CONST64(0x71495F756D1A5F60) /* 461 */, + CONST64(0x9BE853FB60AFEF77) /* 462 */, CONST64(0xADC786A7F7443DBF) /* 463 */, + CONST64(0x0904456173B29A82) /* 464 */, CONST64(0x58BC7A66C232BD5E) /* 465 */, + CONST64(0xF306558C673AC8B2) /* 466 */, CONST64(0x41F639C6B6C9772A) /* 467 */, + CONST64(0x216DEFE99FDA35DA) /* 468 */, CONST64(0x11640CC71C7BE615) /* 469 */, + CONST64(0x93C43694565C5527) /* 470 */, CONST64(0xEA038E6246777839) /* 471 */, + CONST64(0xF9ABF3CE5A3E2469) /* 472 */, CONST64(0x741E768D0FD312D2) /* 473 */, + CONST64(0x0144B883CED652C6) /* 474 */, CONST64(0xC20B5A5BA33F8552) /* 475 */, + CONST64(0x1AE69633C3435A9D) /* 476 */, CONST64(0x97A28CA4088CFDEC) /* 477 */, + CONST64(0x8824A43C1E96F420) /* 478 */, CONST64(0x37612FA66EEEA746) /* 479 */, + CONST64(0x6B4CB165F9CF0E5A) /* 480 */, CONST64(0x43AA1C06A0ABFB4A) /* 481 */, + CONST64(0x7F4DC26FF162796B) /* 482 */, CONST64(0x6CBACC8E54ED9B0F) /* 483 */, + CONST64(0xA6B7FFEFD2BB253E) /* 484 */, CONST64(0x2E25BC95B0A29D4F) /* 485 */, + CONST64(0x86D6A58BDEF1388C) /* 486 */, CONST64(0xDED74AC576B6F054) /* 487 */, + CONST64(0x8030BDBC2B45805D) /* 488 */, CONST64(0x3C81AF70E94D9289) /* 489 */, + CONST64(0x3EFF6DDA9E3100DB) /* 490 */, CONST64(0xB38DC39FDFCC8847) /* 491 */, + CONST64(0x123885528D17B87E) /* 492 */, CONST64(0xF2DA0ED240B1B642) /* 493 */, + CONST64(0x44CEFADCD54BF9A9) /* 494 */, CONST64(0x1312200E433C7EE6) /* 495 */, + CONST64(0x9FFCC84F3A78C748) /* 496 */, CONST64(0xF0CD1F72248576BB) /* 497 */, + CONST64(0xEC6974053638CFE4) /* 498 */, CONST64(0x2BA7B67C0CEC4E4C) /* 499 */, + CONST64(0xAC2F4DF3E5CE32ED) /* 500 */, CONST64(0xCB33D14326EA4C11) /* 501 */, + CONST64(0xA4E9044CC77E58BC) /* 502 */, CONST64(0x5F513293D934FCEF) /* 503 */, + CONST64(0x5DC9645506E55444) /* 504 */, CONST64(0x50DE418F317DE40A) /* 505 */, + CONST64(0x388CB31A69DDE259) /* 506 */, CONST64(0x2DB4A83455820A86) /* 507 */, + CONST64(0x9010A91E84711AE9) /* 508 */, CONST64(0x4DF7F0B7B1498371) /* 509 */, + CONST64(0xD62A2EABC0977179) /* 510 */, CONST64(0x22FAC097AA8D5C0E) /* 511 */, + CONST64(0xF49FCC2FF1DAF39B) /* 512 */, CONST64(0x487FD5C66FF29281) /* 513 */, + CONST64(0xE8A30667FCDCA83F) /* 514 */, CONST64(0x2C9B4BE3D2FCCE63) /* 515 */, + CONST64(0xDA3FF74B93FBBBC2) /* 516 */, CONST64(0x2FA165D2FE70BA66) /* 517 */, + CONST64(0xA103E279970E93D4) /* 518 */, CONST64(0xBECDEC77B0E45E71) /* 519 */, + CONST64(0xCFB41E723985E497) /* 520 */, CONST64(0xB70AAA025EF75017) /* 521 */, + CONST64(0xD42309F03840B8E0) /* 522 */, CONST64(0x8EFC1AD035898579) /* 523 */, + CONST64(0x96C6920BE2B2ABC5) /* 524 */, CONST64(0x66AF4163375A9172) /* 525 */, + CONST64(0x2174ABDCCA7127FB) /* 526 */, CONST64(0xB33CCEA64A72FF41) /* 527 */, + CONST64(0xF04A4933083066A5) /* 528 */, CONST64(0x8D970ACDD7289AF5) /* 529 */, + CONST64(0x8F96E8E031C8C25E) /* 530 */, CONST64(0xF3FEC02276875D47) /* 531 */, + CONST64(0xEC7BF310056190DD) /* 532 */, CONST64(0xF5ADB0AEBB0F1491) /* 533 */, + CONST64(0x9B50F8850FD58892) /* 534 */, CONST64(0x4975488358B74DE8) /* 535 */, + CONST64(0xA3354FF691531C61) /* 536 */, CONST64(0x0702BBE481D2C6EE) /* 537 */, + CONST64(0x89FB24057DEDED98) /* 538 */, CONST64(0xAC3075138596E902) /* 539 */, + CONST64(0x1D2D3580172772ED) /* 540 */, CONST64(0xEB738FC28E6BC30D) /* 541 */, + CONST64(0x5854EF8F63044326) /* 542 */, CONST64(0x9E5C52325ADD3BBE) /* 543 */, + CONST64(0x90AA53CF325C4623) /* 544 */, CONST64(0xC1D24D51349DD067) /* 545 */, + CONST64(0x2051CFEEA69EA624) /* 546 */, CONST64(0x13220F0A862E7E4F) /* 547 */, + CONST64(0xCE39399404E04864) /* 548 */, CONST64(0xD9C42CA47086FCB7) /* 549 */, + CONST64(0x685AD2238A03E7CC) /* 550 */, CONST64(0x066484B2AB2FF1DB) /* 551 */, + CONST64(0xFE9D5D70EFBF79EC) /* 552 */, CONST64(0x5B13B9DD9C481854) /* 553 */, + CONST64(0x15F0D475ED1509AD) /* 554 */, CONST64(0x0BEBCD060EC79851) /* 555 */, + CONST64(0xD58C6791183AB7F8) /* 556 */, CONST64(0xD1187C5052F3EEE4) /* 557 */, + CONST64(0xC95D1192E54E82FF) /* 558 */, CONST64(0x86EEA14CB9AC6CA2) /* 559 */, + CONST64(0x3485BEB153677D5D) /* 560 */, CONST64(0xDD191D781F8C492A) /* 561 */, + CONST64(0xF60866BAA784EBF9) /* 562 */, CONST64(0x518F643BA2D08C74) /* 563 */, + CONST64(0x8852E956E1087C22) /* 564 */, CONST64(0xA768CB8DC410AE8D) /* 565 */, + CONST64(0x38047726BFEC8E1A) /* 566 */, CONST64(0xA67738B4CD3B45AA) /* 567 */, + CONST64(0xAD16691CEC0DDE19) /* 568 */, CONST64(0xC6D4319380462E07) /* 569 */, + CONST64(0xC5A5876D0BA61938) /* 570 */, CONST64(0x16B9FA1FA58FD840) /* 571 */, + CONST64(0x188AB1173CA74F18) /* 572 */, CONST64(0xABDA2F98C99C021F) /* 573 */, + CONST64(0x3E0580AB134AE816) /* 574 */, CONST64(0x5F3B05B773645ABB) /* 575 */, + CONST64(0x2501A2BE5575F2F6) /* 576 */, CONST64(0x1B2F74004E7E8BA9) /* 577 */, + CONST64(0x1CD7580371E8D953) /* 578 */, CONST64(0x7F6ED89562764E30) /* 579 */, + CONST64(0xB15926FF596F003D) /* 580 */, CONST64(0x9F65293DA8C5D6B9) /* 581 */, + CONST64(0x6ECEF04DD690F84C) /* 582 */, CONST64(0x4782275FFF33AF88) /* 583 */, + CONST64(0xE41433083F820801) /* 584 */, CONST64(0xFD0DFE409A1AF9B5) /* 585 */, + CONST64(0x4325A3342CDB396B) /* 586 */, CONST64(0x8AE77E62B301B252) /* 587 */, + CONST64(0xC36F9E9F6655615A) /* 588 */, CONST64(0x85455A2D92D32C09) /* 589 */, + CONST64(0xF2C7DEA949477485) /* 590 */, CONST64(0x63CFB4C133A39EBA) /* 591 */, + CONST64(0x83B040CC6EBC5462) /* 592 */, CONST64(0x3B9454C8FDB326B0) /* 593 */, + CONST64(0x56F56A9E87FFD78C) /* 594 */, CONST64(0x2DC2940D99F42BC6) /* 595 */, + CONST64(0x98F7DF096B096E2D) /* 596 */, CONST64(0x19A6E01E3AD852BF) /* 597 */, + CONST64(0x42A99CCBDBD4B40B) /* 598 */, CONST64(0xA59998AF45E9C559) /* 599 */, + CONST64(0x366295E807D93186) /* 600 */, CONST64(0x6B48181BFAA1F773) /* 601 */, + CONST64(0x1FEC57E2157A0A1D) /* 602 */, CONST64(0x4667446AF6201AD5) /* 603 */, + CONST64(0xE615EBCACFB0F075) /* 604 */, CONST64(0xB8F31F4F68290778) /* 605 */, + CONST64(0x22713ED6CE22D11E) /* 606 */, CONST64(0x3057C1A72EC3C93B) /* 607 */, + CONST64(0xCB46ACC37C3F1F2F) /* 608 */, CONST64(0xDBB893FD02AAF50E) /* 609 */, + CONST64(0x331FD92E600B9FCF) /* 610 */, CONST64(0xA498F96148EA3AD6) /* 611 */, + CONST64(0xA8D8426E8B6A83EA) /* 612 */, CONST64(0xA089B274B7735CDC) /* 613 */, + CONST64(0x87F6B3731E524A11) /* 614 */, CONST64(0x118808E5CBC96749) /* 615 */, + CONST64(0x9906E4C7B19BD394) /* 616 */, CONST64(0xAFED7F7E9B24A20C) /* 617 */, + CONST64(0x6509EADEEB3644A7) /* 618 */, CONST64(0x6C1EF1D3E8EF0EDE) /* 619 */, + CONST64(0xB9C97D43E9798FB4) /* 620 */, CONST64(0xA2F2D784740C28A3) /* 621 */, + CONST64(0x7B8496476197566F) /* 622 */, CONST64(0x7A5BE3E6B65F069D) /* 623 */, + CONST64(0xF96330ED78BE6F10) /* 624 */, CONST64(0xEEE60DE77A076A15) /* 625 */, + CONST64(0x2B4BEE4AA08B9BD0) /* 626 */, CONST64(0x6A56A63EC7B8894E) /* 627 */, + CONST64(0x02121359BA34FEF4) /* 628 */, CONST64(0x4CBF99F8283703FC) /* 629 */, + CONST64(0x398071350CAF30C8) /* 630 */, CONST64(0xD0A77A89F017687A) /* 631 */, + CONST64(0xF1C1A9EB9E423569) /* 632 */, CONST64(0x8C7976282DEE8199) /* 633 */, + CONST64(0x5D1737A5DD1F7ABD) /* 634 */, CONST64(0x4F53433C09A9FA80) /* 635 */, + CONST64(0xFA8B0C53DF7CA1D9) /* 636 */, CONST64(0x3FD9DCBC886CCB77) /* 637 */, + CONST64(0xC040917CA91B4720) /* 638 */, CONST64(0x7DD00142F9D1DCDF) /* 639 */, + CONST64(0x8476FC1D4F387B58) /* 640 */, CONST64(0x23F8E7C5F3316503) /* 641 */, + CONST64(0x032A2244E7E37339) /* 642 */, CONST64(0x5C87A5D750F5A74B) /* 643 */, + CONST64(0x082B4CC43698992E) /* 644 */, CONST64(0xDF917BECB858F63C) /* 645 */, + CONST64(0x3270B8FC5BF86DDA) /* 646 */, CONST64(0x10AE72BB29B5DD76) /* 647 */, + CONST64(0x576AC94E7700362B) /* 648 */, CONST64(0x1AD112DAC61EFB8F) /* 649 */, + CONST64(0x691BC30EC5FAA427) /* 650 */, CONST64(0xFF246311CC327143) /* 651 */, + CONST64(0x3142368E30E53206) /* 652 */, CONST64(0x71380E31E02CA396) /* 653 */, + CONST64(0x958D5C960AAD76F1) /* 654 */, CONST64(0xF8D6F430C16DA536) /* 655 */, + CONST64(0xC8FFD13F1BE7E1D2) /* 656 */, CONST64(0x7578AE66004DDBE1) /* 657 */, + CONST64(0x05833F01067BE646) /* 658 */, CONST64(0xBB34B5AD3BFE586D) /* 659 */, + CONST64(0x095F34C9A12B97F0) /* 660 */, CONST64(0x247AB64525D60CA8) /* 661 */, + CONST64(0xDCDBC6F3017477D1) /* 662 */, CONST64(0x4A2E14D4DECAD24D) /* 663 */, + CONST64(0xBDB5E6D9BE0A1EEB) /* 664 */, CONST64(0x2A7E70F7794301AB) /* 665 */, + CONST64(0xDEF42D8A270540FD) /* 666 */, CONST64(0x01078EC0A34C22C1) /* 667 */, + CONST64(0xE5DE511AF4C16387) /* 668 */, CONST64(0x7EBB3A52BD9A330A) /* 669 */, + CONST64(0x77697857AA7D6435) /* 670 */, CONST64(0x004E831603AE4C32) /* 671 */, + CONST64(0xE7A21020AD78E312) /* 672 */, CONST64(0x9D41A70C6AB420F2) /* 673 */, + CONST64(0x28E06C18EA1141E6) /* 674 */, CONST64(0xD2B28CBD984F6B28) /* 675 */, + CONST64(0x26B75F6C446E9D83) /* 676 */, CONST64(0xBA47568C4D418D7F) /* 677 */, + CONST64(0xD80BADBFE6183D8E) /* 678 */, CONST64(0x0E206D7F5F166044) /* 679 */, + CONST64(0xE258A43911CBCA3E) /* 680 */, CONST64(0x723A1746B21DC0BC) /* 681 */, + CONST64(0xC7CAA854F5D7CDD3) /* 682 */, CONST64(0x7CAC32883D261D9C) /* 683 */, + CONST64(0x7690C26423BA942C) /* 684 */, CONST64(0x17E55524478042B8) /* 685 */, + CONST64(0xE0BE477656A2389F) /* 686 */, CONST64(0x4D289B5E67AB2DA0) /* 687 */, + CONST64(0x44862B9C8FBBFD31) /* 688 */, CONST64(0xB47CC8049D141365) /* 689 */, + CONST64(0x822C1B362B91C793) /* 690 */, CONST64(0x4EB14655FB13DFD8) /* 691 */, + CONST64(0x1ECBBA0714E2A97B) /* 692 */, CONST64(0x6143459D5CDE5F14) /* 693 */, + CONST64(0x53A8FBF1D5F0AC89) /* 694 */, CONST64(0x97EA04D81C5E5B00) /* 695 */, + CONST64(0x622181A8D4FDB3F3) /* 696 */, CONST64(0xE9BCD341572A1208) /* 697 */, + CONST64(0x1411258643CCE58A) /* 698 */, CONST64(0x9144C5FEA4C6E0A4) /* 699 */, + CONST64(0x0D33D06565CF620F) /* 700 */, CONST64(0x54A48D489F219CA1) /* 701 */, + CONST64(0xC43E5EAC6D63C821) /* 702 */, CONST64(0xA9728B3A72770DAF) /* 703 */, + CONST64(0xD7934E7B20DF87EF) /* 704 */, CONST64(0xE35503B61A3E86E5) /* 705 */, + CONST64(0xCAE321FBC819D504) /* 706 */, CONST64(0x129A50B3AC60BFA6) /* 707 */, + CONST64(0xCD5E68EA7E9FB6C3) /* 708 */, CONST64(0xB01C90199483B1C7) /* 709 */, + CONST64(0x3DE93CD5C295376C) /* 710 */, CONST64(0xAED52EDF2AB9AD13) /* 711 */, + CONST64(0x2E60F512C0A07884) /* 712 */, CONST64(0xBC3D86A3E36210C9) /* 713 */, + CONST64(0x35269D9B163951CE) /* 714 */, CONST64(0x0C7D6E2AD0CDB5FA) /* 715 */, + CONST64(0x59E86297D87F5733) /* 716 */, CONST64(0x298EF221898DB0E7) /* 717 */, + CONST64(0x55000029D1A5AA7E) /* 718 */, CONST64(0x8BC08AE1B5061B45) /* 719 */, + CONST64(0xC2C31C2B6C92703A) /* 720 */, CONST64(0x94CC596BAF25EF42) /* 721 */, + CONST64(0x0A1D73DB22540456) /* 722 */, CONST64(0x04B6A0F9D9C4179A) /* 723 */, + CONST64(0xEFFDAFA2AE3D3C60) /* 724 */, CONST64(0xF7C8075BB49496C4) /* 725 */, + CONST64(0x9CC5C7141D1CD4E3) /* 726 */, CONST64(0x78BD1638218E5534) /* 727 */, + CONST64(0xB2F11568F850246A) /* 728 */, CONST64(0xEDFABCFA9502BC29) /* 729 */, + CONST64(0x796CE5F2DA23051B) /* 730 */, CONST64(0xAAE128B0DC93537C) /* 731 */, + CONST64(0x3A493DA0EE4B29AE) /* 732 */, CONST64(0xB5DF6B2C416895D7) /* 733 */, + CONST64(0xFCABBD25122D7F37) /* 734 */, CONST64(0x70810B58105DC4B1) /* 735 */, + CONST64(0xE10FDD37F7882A90) /* 736 */, CONST64(0x524DCAB5518A3F5C) /* 737 */, + CONST64(0x3C9E85878451255B) /* 738 */, CONST64(0x4029828119BD34E2) /* 739 */, + CONST64(0x74A05B6F5D3CECCB) /* 740 */, CONST64(0xB610021542E13ECA) /* 741 */, + CONST64(0x0FF979D12F59E2AC) /* 742 */, CONST64(0x6037DA27E4F9CC50) /* 743 */, + CONST64(0x5E92975A0DF1847D) /* 744 */, CONST64(0xD66DE190D3E623FE) /* 745 */, + CONST64(0x5032D6B87B568048) /* 746 */, CONST64(0x9A36B7CE8235216E) /* 747 */, + CONST64(0x80272A7A24F64B4A) /* 748 */, CONST64(0x93EFED8B8C6916F7) /* 749 */, + CONST64(0x37DDBFF44CCE1555) /* 750 */, CONST64(0x4B95DB5D4B99BD25) /* 751 */, + CONST64(0x92D3FDA169812FC0) /* 752 */, CONST64(0xFB1A4A9A90660BB6) /* 753 */, + CONST64(0x730C196946A4B9B2) /* 754 */, CONST64(0x81E289AA7F49DA68) /* 755 */, + CONST64(0x64669A0F83B1A05F) /* 756 */, CONST64(0x27B3FF7D9644F48B) /* 757 */, + CONST64(0xCC6B615C8DB675B3) /* 758 */, CONST64(0x674F20B9BCEBBE95) /* 759 */, + CONST64(0x6F31238275655982) /* 760 */, CONST64(0x5AE488713E45CF05) /* 761 */, + CONST64(0xBF619F9954C21157) /* 762 */, CONST64(0xEABAC46040A8EAE9) /* 763 */, + CONST64(0x454C6FE9F2C0C1CD) /* 764 */, CONST64(0x419CF6496412691C) /* 765 */, + CONST64(0xD3DC3BEF265B0F70) /* 766 */, CONST64(0x6D0E60F5C3578A9E) /* 767 */, + CONST64(0x5B0E608526323C55) /* 768 */, CONST64(0x1A46C1A9FA1B59F5) /* 769 */, + CONST64(0xA9E245A17C4C8FFA) /* 770 */, CONST64(0x65CA5159DB2955D7) /* 771 */, + CONST64(0x05DB0A76CE35AFC2) /* 772 */, CONST64(0x81EAC77EA9113D45) /* 773 */, + CONST64(0x528EF88AB6AC0A0D) /* 774 */, CONST64(0xA09EA253597BE3FF) /* 775 */, + CONST64(0x430DDFB3AC48CD56) /* 776 */, CONST64(0xC4B3A67AF45CE46F) /* 777 */, + CONST64(0x4ECECFD8FBE2D05E) /* 778 */, CONST64(0x3EF56F10B39935F0) /* 779 */, + CONST64(0x0B22D6829CD619C6) /* 780 */, CONST64(0x17FD460A74DF2069) /* 781 */, + CONST64(0x6CF8CC8E8510ED40) /* 782 */, CONST64(0xD6C824BF3A6ECAA7) /* 783 */, + CONST64(0x61243D581A817049) /* 784 */, CONST64(0x048BACB6BBC163A2) /* 785 */, + CONST64(0xD9A38AC27D44CC32) /* 786 */, CONST64(0x7FDDFF5BAAF410AB) /* 787 */, + CONST64(0xAD6D495AA804824B) /* 788 */, CONST64(0xE1A6A74F2D8C9F94) /* 789 */, + CONST64(0xD4F7851235DEE8E3) /* 790 */, CONST64(0xFD4B7F886540D893) /* 791 */, + CONST64(0x247C20042AA4BFDA) /* 792 */, CONST64(0x096EA1C517D1327C) /* 793 */, + CONST64(0xD56966B4361A6685) /* 794 */, CONST64(0x277DA5C31221057D) /* 795 */, + CONST64(0x94D59893A43ACFF7) /* 796 */, CONST64(0x64F0C51CCDC02281) /* 797 */, + CONST64(0x3D33BCC4FF6189DB) /* 798 */, CONST64(0xE005CB184CE66AF1) /* 799 */, + CONST64(0xFF5CCD1D1DB99BEA) /* 800 */, CONST64(0xB0B854A7FE42980F) /* 801 */, + CONST64(0x7BD46A6A718D4B9F) /* 802 */, CONST64(0xD10FA8CC22A5FD8C) /* 803 */, + CONST64(0xD31484952BE4BD31) /* 804 */, CONST64(0xC7FA975FCB243847) /* 805 */, + CONST64(0x4886ED1E5846C407) /* 806 */, CONST64(0x28CDDB791EB70B04) /* 807 */, + CONST64(0xC2B00BE2F573417F) /* 808 */, CONST64(0x5C9590452180F877) /* 809 */, + CONST64(0x7A6BDDFFF370EB00) /* 810 */, CONST64(0xCE509E38D6D9D6A4) /* 811 */, + CONST64(0xEBEB0F00647FA702) /* 812 */, CONST64(0x1DCC06CF76606F06) /* 813 */, + CONST64(0xE4D9F28BA286FF0A) /* 814 */, CONST64(0xD85A305DC918C262) /* 815 */, + CONST64(0x475B1D8732225F54) /* 816 */, CONST64(0x2D4FB51668CCB5FE) /* 817 */, + CONST64(0xA679B9D9D72BBA20) /* 818 */, CONST64(0x53841C0D912D43A5) /* 819 */, + CONST64(0x3B7EAA48BF12A4E8) /* 820 */, CONST64(0x781E0E47F22F1DDF) /* 821 */, + CONST64(0xEFF20CE60AB50973) /* 822 */, CONST64(0x20D261D19DFFB742) /* 823 */, + CONST64(0x16A12B03062A2E39) /* 824 */, CONST64(0x1960EB2239650495) /* 825 */, + CONST64(0x251C16FED50EB8B8) /* 826 */, CONST64(0x9AC0C330F826016E) /* 827 */, + CONST64(0xED152665953E7671) /* 828 */, CONST64(0x02D63194A6369570) /* 829 */, + CONST64(0x5074F08394B1C987) /* 830 */, CONST64(0x70BA598C90B25CE1) /* 831 */, + CONST64(0x794A15810B9742F6) /* 832 */, CONST64(0x0D5925E9FCAF8C6C) /* 833 */, + CONST64(0x3067716CD868744E) /* 834 */, CONST64(0x910AB077E8D7731B) /* 835 */, + CONST64(0x6A61BBDB5AC42F61) /* 836 */, CONST64(0x93513EFBF0851567) /* 837 */, + CONST64(0xF494724B9E83E9D5) /* 838 */, CONST64(0xE887E1985C09648D) /* 839 */, + CONST64(0x34B1D3C675370CFD) /* 840 */, CONST64(0xDC35E433BC0D255D) /* 841 */, + CONST64(0xD0AAB84234131BE0) /* 842 */, CONST64(0x08042A50B48B7EAF) /* 843 */, + CONST64(0x9997C4EE44A3AB35) /* 844 */, CONST64(0x829A7B49201799D0) /* 845 */, + CONST64(0x263B8307B7C54441) /* 846 */, CONST64(0x752F95F4FD6A6CA6) /* 847 */, + CONST64(0x927217402C08C6E5) /* 848 */, CONST64(0x2A8AB754A795D9EE) /* 849 */, + CONST64(0xA442F7552F72943D) /* 850 */, CONST64(0x2C31334E19781208) /* 851 */, + CONST64(0x4FA98D7CEAEE6291) /* 852 */, CONST64(0x55C3862F665DB309) /* 853 */, + CONST64(0xBD0610175D53B1F3) /* 854 */, CONST64(0x46FE6CB840413F27) /* 855 */, + CONST64(0x3FE03792DF0CFA59) /* 856 */, CONST64(0xCFE700372EB85E8F) /* 857 */, + CONST64(0xA7BE29E7ADBCE118) /* 858 */, CONST64(0xE544EE5CDE8431DD) /* 859 */, + CONST64(0x8A781B1B41F1873E) /* 860 */, CONST64(0xA5C94C78A0D2F0E7) /* 861 */, + CONST64(0x39412E2877B60728) /* 862 */, CONST64(0xA1265EF3AFC9A62C) /* 863 */, + CONST64(0xBCC2770C6A2506C5) /* 864 */, CONST64(0x3AB66DD5DCE1CE12) /* 865 */, + CONST64(0xE65499D04A675B37) /* 866 */, CONST64(0x7D8F523481BFD216) /* 867 */, + CONST64(0x0F6F64FCEC15F389) /* 868 */, CONST64(0x74EFBE618B5B13C8) /* 869 */, + CONST64(0xACDC82B714273E1D) /* 870 */, CONST64(0xDD40BFE003199D17) /* 871 */, + CONST64(0x37E99257E7E061F8) /* 872 */, CONST64(0xFA52626904775AAA) /* 873 */, + CONST64(0x8BBBF63A463D56F9) /* 874 */, CONST64(0xF0013F1543A26E64) /* 875 */, + CONST64(0xA8307E9F879EC898) /* 876 */, CONST64(0xCC4C27A4150177CC) /* 877 */, + CONST64(0x1B432F2CCA1D3348) /* 878 */, CONST64(0xDE1D1F8F9F6FA013) /* 879 */, + CONST64(0x606602A047A7DDD6) /* 880 */, CONST64(0xD237AB64CC1CB2C7) /* 881 */, + CONST64(0x9B938E7225FCD1D3) /* 882 */, CONST64(0xEC4E03708E0FF476) /* 883 */, + CONST64(0xFEB2FBDA3D03C12D) /* 884 */, CONST64(0xAE0BCED2EE43889A) /* 885 */, + CONST64(0x22CB8923EBFB4F43) /* 886 */, CONST64(0x69360D013CF7396D) /* 887 */, + CONST64(0x855E3602D2D4E022) /* 888 */, CONST64(0x073805BAD01F784C) /* 889 */, + CONST64(0x33E17A133852F546) /* 890 */, CONST64(0xDF4874058AC7B638) /* 891 */, + CONST64(0xBA92B29C678AA14A) /* 892 */, CONST64(0x0CE89FC76CFAADCD) /* 893 */, + CONST64(0x5F9D4E0908339E34) /* 894 */, CONST64(0xF1AFE9291F5923B9) /* 895 */, + CONST64(0x6E3480F60F4A265F) /* 896 */, CONST64(0xEEBF3A2AB29B841C) /* 897 */, + CONST64(0xE21938A88F91B4AD) /* 898 */, CONST64(0x57DFEFF845C6D3C3) /* 899 */, + CONST64(0x2F006B0BF62CAAF2) /* 900 */, CONST64(0x62F479EF6F75EE78) /* 901 */, + CONST64(0x11A55AD41C8916A9) /* 902 */, CONST64(0xF229D29084FED453) /* 903 */, + CONST64(0x42F1C27B16B000E6) /* 904 */, CONST64(0x2B1F76749823C074) /* 905 */, + CONST64(0x4B76ECA3C2745360) /* 906 */, CONST64(0x8C98F463B91691BD) /* 907 */, + CONST64(0x14BCC93CF1ADE66A) /* 908 */, CONST64(0x8885213E6D458397) /* 909 */, + CONST64(0x8E177DF0274D4711) /* 910 */, CONST64(0xB49B73B5503F2951) /* 911 */, + CONST64(0x10168168C3F96B6B) /* 912 */, CONST64(0x0E3D963B63CAB0AE) /* 913 */, + CONST64(0x8DFC4B5655A1DB14) /* 914 */, CONST64(0xF789F1356E14DE5C) /* 915 */, + CONST64(0x683E68AF4E51DAC1) /* 916 */, CONST64(0xC9A84F9D8D4B0FD9) /* 917 */, + CONST64(0x3691E03F52A0F9D1) /* 918 */, CONST64(0x5ED86E46E1878E80) /* 919 */, + CONST64(0x3C711A0E99D07150) /* 920 */, CONST64(0x5A0865B20C4E9310) /* 921 */, + CONST64(0x56FBFC1FE4F0682E) /* 922 */, CONST64(0xEA8D5DE3105EDF9B) /* 923 */, + CONST64(0x71ABFDB12379187A) /* 924 */, CONST64(0x2EB99DE1BEE77B9C) /* 925 */, + CONST64(0x21ECC0EA33CF4523) /* 926 */, CONST64(0x59A4D7521805C7A1) /* 927 */, + CONST64(0x3896F5EB56AE7C72) /* 928 */, CONST64(0xAA638F3DB18F75DC) /* 929 */, + CONST64(0x9F39358DABE9808E) /* 930 */, CONST64(0xB7DEFA91C00B72AC) /* 931 */, + CONST64(0x6B5541FD62492D92) /* 932 */, CONST64(0x6DC6DEE8F92E4D5B) /* 933 */, + CONST64(0x353F57ABC4BEEA7E) /* 934 */, CONST64(0x735769D6DA5690CE) /* 935 */, + CONST64(0x0A234AA642391484) /* 936 */, CONST64(0xF6F9508028F80D9D) /* 937 */, + CONST64(0xB8E319A27AB3F215) /* 938 */, CONST64(0x31AD9C1151341A4D) /* 939 */, + CONST64(0x773C22A57BEF5805) /* 940 */, CONST64(0x45C7561A07968633) /* 941 */, + CONST64(0xF913DA9E249DBE36) /* 942 */, CONST64(0xDA652D9B78A64C68) /* 943 */, + CONST64(0x4C27A97F3BC334EF) /* 944 */, CONST64(0x76621220E66B17F4) /* 945 */, + CONST64(0x967743899ACD7D0B) /* 946 */, CONST64(0xF3EE5BCAE0ED6782) /* 947 */, + CONST64(0x409F753600C879FC) /* 948 */, CONST64(0x06D09A39B5926DB6) /* 949 */, + CONST64(0x6F83AEB0317AC588) /* 950 */, CONST64(0x01E6CA4A86381F21) /* 951 */, + CONST64(0x66FF3462D19F3025) /* 952 */, CONST64(0x72207C24DDFD3BFB) /* 953 */, + CONST64(0x4AF6B6D3E2ECE2EB) /* 954 */, CONST64(0x9C994DBEC7EA08DE) /* 955 */, + CONST64(0x49ACE597B09A8BC4) /* 956 */, CONST64(0xB38C4766CF0797BA) /* 957 */, + CONST64(0x131B9373C57C2A75) /* 958 */, CONST64(0xB1822CCE61931E58) /* 959 */, + CONST64(0x9D7555B909BA1C0C) /* 960 */, CONST64(0x127FAFDD937D11D2) /* 961 */, + CONST64(0x29DA3BADC66D92E4) /* 962 */, CONST64(0xA2C1D57154C2ECBC) /* 963 */, + CONST64(0x58C5134D82F6FE24) /* 964 */, CONST64(0x1C3AE3515B62274F) /* 965 */, + CONST64(0xE907C82E01CB8126) /* 966 */, CONST64(0xF8ED091913E37FCB) /* 967 */, + CONST64(0x3249D8F9C80046C9) /* 968 */, CONST64(0x80CF9BEDE388FB63) /* 969 */, + CONST64(0x1881539A116CF19E) /* 970 */, CONST64(0x5103F3F76BD52457) /* 971 */, + CONST64(0x15B7E6F5AE47F7A8) /* 972 */, CONST64(0xDBD7C6DED47E9CCF) /* 973 */, + CONST64(0x44E55C410228BB1A) /* 974 */, CONST64(0xB647D4255EDB4E99) /* 975 */, + CONST64(0x5D11882BB8AAFC30) /* 976 */, CONST64(0xF5098BBB29D3212A) /* 977 */, + CONST64(0x8FB5EA14E90296B3) /* 978 */, CONST64(0x677B942157DD025A) /* 979 */, + CONST64(0xFB58E7C0A390ACB5) /* 980 */, CONST64(0x89D3674C83BD4A01) /* 981 */, + CONST64(0x9E2DA4DF4BF3B93B) /* 982 */, CONST64(0xFCC41E328CAB4829) /* 983 */, + CONST64(0x03F38C96BA582C52) /* 984 */, CONST64(0xCAD1BDBD7FD85DB2) /* 985 */, + CONST64(0xBBB442C16082AE83) /* 986 */, CONST64(0xB95FE86BA5DA9AB0) /* 987 */, + CONST64(0xB22E04673771A93F) /* 988 */, CONST64(0x845358C9493152D8) /* 989 */, + CONST64(0xBE2A488697B4541E) /* 990 */, CONST64(0x95A2DC2DD38E6966) /* 991 */, + CONST64(0xC02C11AC923C852B) /* 992 */, CONST64(0x2388B1990DF2A87B) /* 993 */, + CONST64(0x7C8008FA1B4F37BE) /* 994 */, CONST64(0x1F70D0C84D54E503) /* 995 */, + CONST64(0x5490ADEC7ECE57D4) /* 996 */, CONST64(0x002B3C27D9063A3A) /* 997 */, + CONST64(0x7EAEA3848030A2BF) /* 998 */, CONST64(0xC602326DED2003C0) /* 999 */, + CONST64(0x83A7287D69A94086) /* 1000 */, CONST64(0xC57A5FCB30F57A8A) /* 1001 */, + CONST64(0xB56844E479EBE779) /* 1002 */, CONST64(0xA373B40F05DCBCE9) /* 1003 */, + CONST64(0xD71A786E88570EE2) /* 1004 */, CONST64(0x879CBACDBDE8F6A0) /* 1005 */, + CONST64(0x976AD1BCC164A32F) /* 1006 */, CONST64(0xAB21E25E9666D78B) /* 1007 */, + CONST64(0x901063AAE5E5C33C) /* 1008 */, CONST64(0x9818B34448698D90) /* 1009 */, + CONST64(0xE36487AE3E1E8ABB) /* 1010 */, CONST64(0xAFBDF931893BDCB4) /* 1011 */, + CONST64(0x6345A0DC5FBBD519) /* 1012 */, CONST64(0x8628FE269B9465CA) /* 1013 */, + CONST64(0x1E5D01603F9C51EC) /* 1014 */, CONST64(0x4DE44006A15049B7) /* 1015 */, + CONST64(0xBF6C70E5F776CBB1) /* 1016 */, CONST64(0x411218F2EF552BED) /* 1017 */, + CONST64(0xCB0C0708705A36A3) /* 1018 */, CONST64(0xE74D14754F986044) /* 1019 */, + CONST64(0xCD56D9430EA8280E) /* 1020 */, CONST64(0xC12591D7535F5065) /* 1021 */, + CONST64(0xC83223F1720AEF96) /* 1022 */, CONST64(0xC3A0396F7363A51F) /* 1023 */}; + +#ifdef _MSC_VER + #define INLINE __inline +#else + #define INLINE +#endif + +/* one round of the hash function */ +INLINE static void tiger_round(ulong64 *a, ulong64 *b, ulong64 *c, ulong64 x, int mul) +{ + ulong64 tmp; + tmp = (*c ^= x); + *a -= t1[byte(tmp, 0)] ^ t2[byte(tmp, 2)] ^ t3[byte(tmp, 4)] ^ t4[byte(tmp, 6)]; + tmp = (*b += t4[byte(tmp, 1)] ^ t3[byte(tmp, 3)] ^ t2[byte(tmp,5)] ^ t1[byte(tmp,7)]); + switch (mul) { + case 5: *b = (tmp << 2) + tmp; break; + case 7: *b = (tmp << 3) - tmp; break; + case 9: *b = (tmp << 3) + tmp; break; + } +} + +/* one complete pass */ +static void pass(ulong64 *a, ulong64 *b, ulong64 *c, ulong64 *x, int mul) +{ + tiger_round(a,b,c,x[0],mul); + tiger_round(b,c,a,x[1],mul); + tiger_round(c,a,b,x[2],mul); + tiger_round(a,b,c,x[3],mul); + tiger_round(b,c,a,x[4],mul); + tiger_round(c,a,b,x[5],mul); + tiger_round(a,b,c,x[6],mul); + tiger_round(b,c,a,x[7],mul); +} + +/* The key mixing schedule */ +static void key_schedule(ulong64 *x) +{ + x[0] -= x[7] ^ CONST64(0xA5A5A5A5A5A5A5A5); + x[1] ^= x[0]; + x[2] += x[1]; + x[3] -= x[2] ^ ((~x[1])<<19); + x[4] ^= x[3]; + x[5] += x[4]; + x[6] -= x[5] ^ ((~x[4])>>23); + x[7] ^= x[6]; + x[0] += x[7]; + x[1] -= x[0] ^ ((~x[7])<<19); + x[2] ^= x[1]; + x[3] += x[2]; + x[4] -= x[3] ^ ((~x[2])>>23); + x[5] ^= x[4]; + x[6] += x[5]; + x[7] -= x[6] ^ CONST64(0x0123456789ABCDEF); +} + +#ifdef LTC_CLEAN_STACK +static int _tiger_compress(hash_state *md, unsigned char *buf) +#else +static int tiger_compress(hash_state *md, unsigned char *buf) +#endif +{ + ulong64 a, b, c, x[8]; + unsigned long i; + + /* load words */ + for (i = 0; i < 8; i++) { + LOAD64L(x[i],&buf[8*i]); + } + a = md->tiger.state[0]; + b = md->tiger.state[1]; + c = md->tiger.state[2]; + + pass(&a,&b,&c,x,5); + key_schedule(x); + pass(&c,&a,&b,x,7); + key_schedule(x); + pass(&b,&c,&a,x,9); + + /* store state */ + md->tiger.state[0] = a ^ md->tiger.state[0]; + md->tiger.state[1] = b - md->tiger.state[1]; + md->tiger.state[2] = c + md->tiger.state[2]; + + return CRYPT_OK; +} + +#ifdef LTC_CLEAN_STACK +static int tiger_compress(hash_state *md, unsigned char *buf) +{ + int err; + err = _tiger_compress(md, buf); + burn_stack(sizeof(ulong64) * 11 + sizeof(unsigned long)); + return err; +} +#endif + +/** + Initialize the hash state + @param md The hash state you wish to initialize + @return CRYPT_OK if successful +*/ +int tiger_init(hash_state *md) +{ + LTC_ARGCHK(md != NULL); + md->tiger.state[0] = CONST64(0x0123456789ABCDEF); + md->tiger.state[1] = CONST64(0xFEDCBA9876543210); + md->tiger.state[2] = CONST64(0xF096A5B4C3B2E187); + md->tiger.curlen = 0; + md->tiger.length = 0; + return CRYPT_OK; +} + +/** + Process a block of memory though the hash + @param md The hash state + @param in The data to hash + @param inlen The length of the data (octets) + @return CRYPT_OK if successful +*/ +HASH_PROCESS(tiger_process, tiger_compress, tiger, 64) + +/** + Terminate the hash to get the digest + @param md The hash state + @param out [out] The destination of the hash (24 bytes) + @return CRYPT_OK if successful +*/ +int tiger_done(hash_state * md, unsigned char *out) +{ + LTC_ARGCHK(md != NULL); + LTC_ARGCHK(out != NULL); + + if (md->tiger.curlen >= sizeof(md->tiger.buf)) { + return CRYPT_INVALID_ARG; + } + + /* increase the length of the message */ + md->tiger.length += md->tiger.curlen * 8; + + /* append the '1' bit */ + md->tiger.buf[md->tiger.curlen++] = (unsigned char)0x01; + + /* if the length is currently above 56 bytes we append zeros + * then compress. Then we can fall back to padding zeros and length + * encoding like normal. */ + if (md->tiger.curlen > 56) { + while (md->tiger.curlen < 64) { + md->tiger.buf[md->tiger.curlen++] = (unsigned char)0; + } + tiger_compress(md, md->tiger.buf); + md->tiger.curlen = 0; + } + + /* pad upto 56 bytes of zeroes */ + while (md->tiger.curlen < 56) { + md->tiger.buf[md->tiger.curlen++] = (unsigned char)0; + } + + /* store length */ + STORE64L(md->tiger.length, md->tiger.buf+56); + tiger_compress(md, md->tiger.buf); + + /* copy output */ + STORE64L(md->tiger.state[0], &out[0]); + STORE64L(md->tiger.state[1], &out[8]); + STORE64L(md->tiger.state[2], &out[16]); +#ifdef LTC_CLEAN_STACK + zeromem(md, sizeof(hash_state)); +#endif + + return CRYPT_OK; +} + +/** + Self-test the hash + @return CRYPT_OK if successful, CRYPT_NOP if self-tests have been disabled +*/ +int tiger_test(void) +{ + #ifndef LTC_TEST + return CRYPT_NOP; + #else + static const struct { + char *msg; + unsigned char hash[24]; + } tests[] = { + { "", + { 0x32, 0x93, 0xac, 0x63, 0x0c, 0x13, 0xf0, 0x24, + 0x5f, 0x92, 0xbb, 0xb1, 0x76, 0x6e, 0x16, 0x16, + 0x7a, 0x4e, 0x58, 0x49, 0x2d, 0xde, 0x73, 0xf3 } + }, + { "abc", + { 0x2a, 0xab, 0x14, 0x84, 0xe8, 0xc1, 0x58, 0xf2, + 0xbf, 0xb8, 0xc5, 0xff, 0x41, 0xb5, 0x7a, 0x52, + 0x51, 0x29, 0x13, 0x1c, 0x95, 0x7b, 0x5f, 0x93 } + }, + { "Tiger", + { 0xdd, 0x00, 0x23, 0x07, 0x99, 0xf5, 0x00, 0x9f, + 0xec, 0x6d, 0xeb, 0xc8, 0x38, 0xbb, 0x6a, 0x27, + 0xdf, 0x2b, 0x9d, 0x6f, 0x11, 0x0c, 0x79, 0x37 } + }, + { "ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+-", + { 0xf7, 0x1c, 0x85, 0x83, 0x90, 0x2a, 0xfb, 0x87, + 0x9e, 0xdf, 0xe6, 0x10, 0xf8, 0x2c, 0x0d, 0x47, + 0x86, 0xa3, 0xa5, 0x34, 0x50, 0x44, 0x86, 0xb5 } + }, + { "ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+-ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+-", + { 0xc5, 0x40, 0x34, 0xe5, 0xb4, 0x3e, 0xb8, 0x00, + 0x58, 0x48, 0xa7, 0xe0, 0xae, 0x6a, 0xac, 0x76, + 0xe4, 0xff, 0x59, 0x0a, 0xe7, 0x15, 0xfd, 0x25 } + }, + }; + + int i; + unsigned char tmp[24]; + hash_state md; + + for (i = 0; i < (int)(sizeof(tests) / sizeof(tests[0])); i++) { + tiger_init(&md); + tiger_process(&md, (unsigned char *)tests[i].msg, (unsigned long)strlen(tests[i].msg)); + tiger_done(&md, tmp); + if (XMEMCMP(tmp, tests[i].hash, 24) != 0) { + return CRYPT_FAIL_TESTVECTOR; + } + } + return CRYPT_OK; + #endif +} + +#endif + +/* +Hash of "": + 24F0130C63AC9332 16166E76B1BB925F F373DE2D49584E7A +Hash of "abc": + F258C1E88414AB2A 527AB541FFC5B8BF 935F7B951C132951 +Hash of "Tiger": + 9F00F599072300DD 276ABB38C8EB6DEC 37790C116F9D2BDF +Hash of "ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+-": + 87FB2A9083851CF7 470D2CF810E6DF9E B586445034A5A386 +Hash of "ABCDEFGHIJKLMNOPQRSTUVWXYZ=abcdefghijklmnopqrstuvwxyz+0123456789": + 467DB80863EBCE48 8DF1CD1261655DE9 57896565975F9197 +Hash of "Tiger - A Fast New Hash Function, by Ross Anderson and Eli Biham": + 0C410A042968868A 1671DA5A3FD29A72 5EC1E457D3CDB303 +Hash of "Tiger - A Fast New Hash Function, by Ross Anderson and Eli Biham, proceedings of Fast Software Encryption 3, Cambridge.": + EBF591D5AFA655CE 7F22894FF87F54AC 89C811B6B0DA3193 +Hash of "Tiger - A Fast New Hash Function, by Ross Anderson and Eli Biham, proceedings of Fast Software Encryption 3, Cambridge, 1996.": + 3D9AEB03D1BD1A63 57B2774DFD6D5B24 DD68151D503974FC +Hash of "ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+-ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+-": + 00B83EB4E53440C5 76AC6AAEE0A74858 25FD15E70A59FFE4 +*/ + + + + +/* $Source: /cvs/libtom/libtomcrypt/src/hashes/tiger.c,v $ */ +/* $Revision: 1.8 $ */ +/* $Date: 2006/11/01 09:28:17 $ */ diff --git a/libtomcrypt/src/hashes/whirl/whirl.c b/libtomcrypt/src/hashes/whirl/whirl.c new file mode 100644 index 0000000..65e38a7 --- /dev/null +++ b/libtomcrypt/src/hashes/whirl/whirl.c @@ -0,0 +1,314 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ + +/** + @file whirl.c + WHIRLPOOL (using their new sbox) hash function by Tom St Denis +*/ + +#include "tomcrypt.h" + +#ifdef WHIRLPOOL + +const struct ltc_hash_descriptor whirlpool_desc = +{ + "whirlpool", + 11, + 64, + 64, + + /* OID */ + { 1, 0, 10118, 3, 0, 55 }, + 6, + + &whirlpool_init, + &whirlpool_process, + &whirlpool_done, + &whirlpool_test, + NULL +}; + +/* the sboxes */ +#include "whirltab.c" + +/* get a_{i,j} */ +#define GB(a,i,j) ((a[(i) & 7] >> (8 * (j))) & 255) + +/* shortcut macro to perform three functions at once */ +#define theta_pi_gamma(a, i) \ + SB0(GB(a, i-0, 7)) ^ \ + SB1(GB(a, i-1, 6)) ^ \ + SB2(GB(a, i-2, 5)) ^ \ + SB3(GB(a, i-3, 4)) ^ \ + SB4(GB(a, i-4, 3)) ^ \ + SB5(GB(a, i-5, 2)) ^ \ + SB6(GB(a, i-6, 1)) ^ \ + SB7(GB(a, i-7, 0)) + +#ifdef LTC_CLEAN_STACK +static int _whirlpool_compress(hash_state *md, unsigned char *buf) +#else +static int whirlpool_compress(hash_state *md, unsigned char *buf) +#endif +{ + ulong64 K[2][8], T[3][8]; + int x, y; + + /* load the block/state */ + for (x = 0; x < 8; x++) { + K[0][x] = md->whirlpool.state[x]; + + LOAD64H(T[0][x], buf + (8 * x)); + T[2][x] = T[0][x]; + T[0][x] ^= K[0][x]; + } + + /* do rounds 1..10 */ + for (x = 0; x < 10; x += 2) { + /* odd round */ + /* apply main transform to K[0] into K[1] */ + for (y = 0; y < 8; y++) { + K[1][y] = theta_pi_gamma(K[0], y); + } + /* xor the constant */ + K[1][0] ^= cont[x]; + + /* apply main transform to T[0] into T[1] */ + for (y = 0; y < 8; y++) { + T[1][y] = theta_pi_gamma(T[0], y) ^ K[1][y]; + } + + /* even round */ + /* apply main transform to K[1] into K[0] */ + for (y = 0; y < 8; y++) { + K[0][y] = theta_pi_gamma(K[1], y); + } + /* xor the constant */ + K[0][0] ^= cont[x+1]; + + /* apply main transform to T[1] into T[0] */ + for (y = 0; y < 8; y++) { + T[0][y] = theta_pi_gamma(T[1], y) ^ K[0][y]; + } + } + + /* store state */ + for (x = 0; x < 8; x++) { + md->whirlpool.state[x] ^= T[0][x] ^ T[2][x]; + } + + return CRYPT_OK; +} + + +#ifdef LTC_CLEAN_STACK +static int whirlpool_compress(hash_state *md, unsigned char *buf) +{ + int err; + err = _whirlpool_compress(md, buf); + burn_stack((5 * 8 * sizeof(ulong64)) + (2 * sizeof(int))); + return err; +} +#endif + + +/** + Initialize the hash state + @param md The hash state you wish to initialize + @return CRYPT_OK if successful +*/ +int whirlpool_init(hash_state * md) +{ + LTC_ARGCHK(md != NULL); + zeromem(&md->whirlpool, sizeof(md->whirlpool)); + return CRYPT_OK; +} + +/** + Process a block of memory though the hash + @param md The hash state + @param in The data to hash + @param inlen The length of the data (octets) + @return CRYPT_OK if successful +*/ +HASH_PROCESS(whirlpool_process, whirlpool_compress, whirlpool, 64) + +/** + Terminate the hash to get the digest + @param md The hash state + @param out [out] The destination of the hash (64 bytes) + @return CRYPT_OK if successful +*/ +int whirlpool_done(hash_state * md, unsigned char *out) +{ + int i; + + LTC_ARGCHK(md != NULL); + LTC_ARGCHK(out != NULL); + + if (md->whirlpool.curlen >= sizeof(md->whirlpool.buf)) { + return CRYPT_INVALID_ARG; + } + + /* increase the length of the message */ + md->whirlpool.length += md->whirlpool.curlen * 8; + + /* append the '1' bit */ + md->whirlpool.buf[md->whirlpool.curlen++] = (unsigned char)0x80; + + /* if the length is currently above 32 bytes we append zeros + * then compress. Then we can fall back to padding zeros and length + * encoding like normal. + */ + if (md->whirlpool.curlen > 32) { + while (md->whirlpool.curlen < 64) { + md->whirlpool.buf[md->whirlpool.curlen++] = (unsigned char)0; + } + whirlpool_compress(md, md->whirlpool.buf); + md->whirlpool.curlen = 0; + } + + /* pad upto 56 bytes of zeroes (should be 32 but we only support 64-bit lengths) */ + while (md->whirlpool.curlen < 56) { + md->whirlpool.buf[md->whirlpool.curlen++] = (unsigned char)0; + } + + /* store length */ + STORE64H(md->whirlpool.length, md->whirlpool.buf+56); + whirlpool_compress(md, md->whirlpool.buf); + + /* copy output */ + for (i = 0; i < 8; i++) { + STORE64H(md->whirlpool.state[i], out+(8*i)); + } +#ifdef LTC_CLEAN_STACK + zeromem(md, sizeof(*md)); +#endif + return CRYPT_OK; +} + +/** + Self-test the hash + @return CRYPT_OK if successful, CRYPT_NOP if self-tests have been disabled +*/ +int whirlpool_test(void) +{ + #ifndef LTC_TEST + return CRYPT_NOP; + #else + static const struct { + int len; + unsigned char msg[128], hash[64]; + } tests[] = { + + /* NULL Message */ +{ + 0, + { 0x00 }, + { 0x19, 0xFA, 0x61, 0xD7, 0x55, 0x22, 0xA4, 0x66, 0x9B, 0x44, 0xE3, 0x9C, 0x1D, 0x2E, 0x17, 0x26, + 0xC5, 0x30, 0x23, 0x21, 0x30, 0xD4, 0x07, 0xF8, 0x9A, 0xFE, 0xE0, 0x96, 0x49, 0x97, 0xF7, 0xA7, + 0x3E, 0x83, 0xBE, 0x69, 0x8B, 0x28, 0x8F, 0xEB, 0xCF, 0x88, 0xE3, 0xE0, 0x3C, 0x4F, 0x07, 0x57, + 0xEA, 0x89, 0x64, 0xE5, 0x9B, 0x63, 0xD9, 0x37, 0x08, 0xB1, 0x38, 0xCC, 0x42, 0xA6, 0x6E, 0xB3 } +}, + + + /* 448-bits of 0 bits */ +{ + + 56, + { 0x00 }, + { 0x0B, 0x3F, 0x53, 0x78, 0xEB, 0xED, 0x2B, 0xF4, 0xD7, 0xBE, 0x3C, 0xFD, 0x81, 0x8C, 0x1B, 0x03, + 0xB6, 0xBB, 0x03, 0xD3, 0x46, 0x94, 0x8B, 0x04, 0xF4, 0xF4, 0x0C, 0x72, 0x6F, 0x07, 0x58, 0x70, + 0x2A, 0x0F, 0x1E, 0x22, 0x58, 0x80, 0xE3, 0x8D, 0xD5, 0xF6, 0xED, 0x6D, 0xE9, 0xB1, 0xE9, 0x61, + 0xE4, 0x9F, 0xC1, 0x31, 0x8D, 0x7C, 0xB7, 0x48, 0x22, 0xF3, 0xD0, 0xE2, 0xE9, 0xA7, 0xE7, 0xB0 } +}, + + /* 520-bits of 0 bits */ +{ + 65, + { 0x00 }, + { 0x85, 0xE1, 0x24, 0xC4, 0x41, 0x5B, 0xCF, 0x43, 0x19, 0x54, 0x3E, 0x3A, 0x63, 0xFF, 0x57, 0x1D, + 0x09, 0x35, 0x4C, 0xEE, 0xBE, 0xE1, 0xE3, 0x25, 0x30, 0x8C, 0x90, 0x69, 0xF4, 0x3E, 0x2A, 0xE4, + 0xD0, 0xE5, 0x1D, 0x4E, 0xB1, 0xE8, 0x64, 0x28, 0x70, 0x19, 0x4E, 0x95, 0x30, 0xD8, 0xD8, 0xAF, + 0x65, 0x89, 0xD1, 0xBF, 0x69, 0x49, 0xDD, 0xF9, 0x0A, 0x7F, 0x12, 0x08, 0x62, 0x37, 0x95, 0xB9 } +}, + + /* 512-bits, leading set */ +{ + 64, + { 0x80, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0x10, 0x3E, 0x00, 0x55, 0xA9, 0xB0, 0x90, 0xE1, 0x1C, 0x8F, 0xDD, 0xEB, 0xBA, 0x06, 0xC0, 0x5A, + 0xCE, 0x8B, 0x64, 0xB8, 0x96, 0x12, 0x8F, 0x6E, 0xED, 0x30, 0x71, 0xFC, 0xF3, 0xDC, 0x16, 0x94, + 0x67, 0x78, 0xE0, 0x72, 0x23, 0x23, 0x3F, 0xD1, 0x80, 0xFC, 0x40, 0xCC, 0xDB, 0x84, 0x30, 0xA6, + 0x40, 0xE3, 0x76, 0x34, 0x27, 0x1E, 0x65, 0x5C, 0xA1, 0x67, 0x4E, 0xBF, 0xF5, 0x07, 0xF8, 0xCB } +}, + + /* 512-bits, leading set of second byte */ +{ + 64, + { 0x00, 0x80, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, + { 0x35, 0x7B, 0x42, 0xEA, 0x79, 0xBC, 0x97, 0x86, 0x97, 0x5A, 0x3C, 0x44, 0x70, 0xAA, 0xB2, 0x3E, + 0x62, 0x29, 0x79, 0x7B, 0xAD, 0xBD, 0x54, 0x36, 0x5B, 0x54, 0x96, 0xE5, 0x5D, 0x9D, 0xD7, 0x9F, + 0xE9, 0x62, 0x4F, 0xB4, 0x22, 0x66, 0x93, 0x0A, 0x62, 0x8E, 0xD4, 0xDB, 0x08, 0xF9, 0xDD, 0x35, + 0xEF, 0x1B, 0xE1, 0x04, 0x53, 0xFC, 0x18, 0xF4, 0x2C, 0x7F, 0x5E, 0x1F, 0x9B, 0xAE, 0x55, 0xE0 } +}, + + /* 512-bits, leading set of last byte */ +{ + 64, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x80 }, + { 0x8B, 0x39, 0x04, 0xDD, 0x19, 0x81, 0x41, 0x26, 0xFD, 0x02, 0x74, 0xAB, 0x49, 0xC5, 0x97, 0xF6, + 0xD7, 0x75, 0x33, 0x52, 0xA2, 0xDD, 0x91, 0xFD, 0x8F, 0x9F, 0x54, 0x05, 0x4C, 0x54, 0xBF, 0x0F, + 0x06, 0xDB, 0x4F, 0xF7, 0x08, 0xA3, 0xA2, 0x8B, 0xC3, 0x7A, 0x92, 0x1E, 0xEE, 0x11, 0xED, 0x7B, + 0x6A, 0x53, 0x79, 0x32, 0xCC, 0x5E, 0x94, 0xEE, 0x1E, 0xA6, 0x57, 0x60, 0x7E, 0x36, 0xC9, 0xF7 } +}, + +}; + + int i; + unsigned char tmp[64]; + hash_state md; + + for (i = 0; i < (int)(sizeof(tests)/sizeof(tests[0])); i++) { + whirlpool_init(&md); + whirlpool_process(&md, (unsigned char *)tests[i].msg, tests[i].len); + whirlpool_done(&md, tmp); + if (XMEMCMP(tmp, tests[i].hash, 64) != 0) { +#if 0 + printf("\nFailed test %d\n", i); + for (i = 0; i < 64; ) { + printf("%02x ", tmp[i]); + if (!(++i & 15)) printf("\n"); + } +#endif + return CRYPT_FAIL_TESTVECTOR; + } + } + return CRYPT_OK; + #endif +} + + +#endif + + +/* $Source: /cvs/libtom/libtomcrypt/src/hashes/whirl/whirl.c,v $ */ +/* $Revision: 1.8 $ */ +/* $Date: 2006/11/01 09:28:17 $ */ diff --git a/libtomcrypt/src/hashes/whirl/whirltab.c b/libtomcrypt/src/hashes/whirl/whirltab.c new file mode 100644 index 0000000..c83d0b2 --- /dev/null +++ b/libtomcrypt/src/hashes/whirl/whirltab.c @@ -0,0 +1,583 @@ +/** + @file whirltab.c + WHIRLPOOL tables, Tom St Denis +*/ +static const ulong64 sbox0[] = { +CONST64(0x18186018c07830d8), CONST64(0x23238c2305af4626), CONST64(0xc6c63fc67ef991b8), CONST64(0xe8e887e8136fcdfb), +CONST64(0x878726874ca113cb), CONST64(0xb8b8dab8a9626d11), CONST64(0x0101040108050209), CONST64(0x4f4f214f426e9e0d), +CONST64(0x3636d836adee6c9b), CONST64(0xa6a6a2a6590451ff), CONST64(0xd2d26fd2debdb90c), CONST64(0xf5f5f3f5fb06f70e), +CONST64(0x7979f979ef80f296), CONST64(0x6f6fa16f5fcede30), CONST64(0x91917e91fcef3f6d), CONST64(0x52525552aa07a4f8), +CONST64(0x60609d6027fdc047), CONST64(0xbcbccabc89766535), CONST64(0x9b9b569baccd2b37), CONST64(0x8e8e028e048c018a), +CONST64(0xa3a3b6a371155bd2), CONST64(0x0c0c300c603c186c), CONST64(0x7b7bf17bff8af684), CONST64(0x3535d435b5e16a80), +CONST64(0x1d1d741de8693af5), CONST64(0xe0e0a7e05347ddb3), CONST64(0xd7d77bd7f6acb321), CONST64(0xc2c22fc25eed999c), +CONST64(0x2e2eb82e6d965c43), CONST64(0x4b4b314b627a9629), CONST64(0xfefedffea321e15d), CONST64(0x575741578216aed5), +CONST64(0x15155415a8412abd), CONST64(0x7777c1779fb6eee8), CONST64(0x3737dc37a5eb6e92), CONST64(0xe5e5b3e57b56d79e), +CONST64(0x9f9f469f8cd92313), CONST64(0xf0f0e7f0d317fd23), CONST64(0x4a4a354a6a7f9420), CONST64(0xdada4fda9e95a944), +CONST64(0x58587d58fa25b0a2), CONST64(0xc9c903c906ca8fcf), CONST64(0x2929a429558d527c), CONST64(0x0a0a280a5022145a), +CONST64(0xb1b1feb1e14f7f50), CONST64(0xa0a0baa0691a5dc9), CONST64(0x6b6bb16b7fdad614), CONST64(0x85852e855cab17d9), +CONST64(0xbdbdcebd8173673c), CONST64(0x5d5d695dd234ba8f), CONST64(0x1010401080502090), CONST64(0xf4f4f7f4f303f507), +CONST64(0xcbcb0bcb16c08bdd), CONST64(0x3e3ef83eedc67cd3), CONST64(0x0505140528110a2d), CONST64(0x676781671fe6ce78), +CONST64(0xe4e4b7e47353d597), CONST64(0x27279c2725bb4e02), CONST64(0x4141194132588273), CONST64(0x8b8b168b2c9d0ba7), +CONST64(0xa7a7a6a7510153f6), CONST64(0x7d7de97dcf94fab2), CONST64(0x95956e95dcfb3749), CONST64(0xd8d847d88e9fad56), +CONST64(0xfbfbcbfb8b30eb70), CONST64(0xeeee9fee2371c1cd), CONST64(0x7c7ced7cc791f8bb), CONST64(0x6666856617e3cc71), +CONST64(0xdddd53dda68ea77b), CONST64(0x17175c17b84b2eaf), CONST64(0x4747014702468e45), CONST64(0x9e9e429e84dc211a), +CONST64(0xcaca0fca1ec589d4), CONST64(0x2d2db42d75995a58), CONST64(0xbfbfc6bf9179632e), CONST64(0x07071c07381b0e3f), +CONST64(0xadad8ead012347ac), CONST64(0x5a5a755aea2fb4b0), CONST64(0x838336836cb51bef), CONST64(0x3333cc3385ff66b6), +CONST64(0x636391633ff2c65c), CONST64(0x02020802100a0412), CONST64(0xaaaa92aa39384993), CONST64(0x7171d971afa8e2de), +CONST64(0xc8c807c80ecf8dc6), CONST64(0x19196419c87d32d1), CONST64(0x494939497270923b), CONST64(0xd9d943d9869aaf5f), +CONST64(0xf2f2eff2c31df931), CONST64(0xe3e3abe34b48dba8), CONST64(0x5b5b715be22ab6b9), CONST64(0x88881a8834920dbc), +CONST64(0x9a9a529aa4c8293e), CONST64(0x262698262dbe4c0b), CONST64(0x3232c8328dfa64bf), CONST64(0xb0b0fab0e94a7d59), +CONST64(0xe9e983e91b6acff2), CONST64(0x0f0f3c0f78331e77), CONST64(0xd5d573d5e6a6b733), CONST64(0x80803a8074ba1df4), +CONST64(0xbebec2be997c6127), CONST64(0xcdcd13cd26de87eb), CONST64(0x3434d034bde46889), CONST64(0x48483d487a759032), +CONST64(0xffffdbffab24e354), CONST64(0x7a7af57af78ff48d), CONST64(0x90907a90f4ea3d64), CONST64(0x5f5f615fc23ebe9d), +CONST64(0x202080201da0403d), CONST64(0x6868bd6867d5d00f), CONST64(0x1a1a681ad07234ca), CONST64(0xaeae82ae192c41b7), +CONST64(0xb4b4eab4c95e757d), CONST64(0x54544d549a19a8ce), CONST64(0x93937693ece53b7f), CONST64(0x222288220daa442f), +CONST64(0x64648d6407e9c863), CONST64(0xf1f1e3f1db12ff2a), CONST64(0x7373d173bfa2e6cc), CONST64(0x12124812905a2482), +CONST64(0x40401d403a5d807a), CONST64(0x0808200840281048), CONST64(0xc3c32bc356e89b95), CONST64(0xecec97ec337bc5df), +CONST64(0xdbdb4bdb9690ab4d), CONST64(0xa1a1bea1611f5fc0), CONST64(0x8d8d0e8d1c830791), CONST64(0x3d3df43df5c97ac8), +CONST64(0x97976697ccf1335b), CONST64(0x0000000000000000), CONST64(0xcfcf1bcf36d483f9), CONST64(0x2b2bac2b4587566e), +CONST64(0x7676c57697b3ece1), CONST64(0x8282328264b019e6), CONST64(0xd6d67fd6fea9b128), CONST64(0x1b1b6c1bd87736c3), +CONST64(0xb5b5eeb5c15b7774), CONST64(0xafaf86af112943be), CONST64(0x6a6ab56a77dfd41d), CONST64(0x50505d50ba0da0ea), +CONST64(0x45450945124c8a57), CONST64(0xf3f3ebf3cb18fb38), CONST64(0x3030c0309df060ad), CONST64(0xefef9bef2b74c3c4), +CONST64(0x3f3ffc3fe5c37eda), CONST64(0x55554955921caac7), CONST64(0xa2a2b2a2791059db), CONST64(0xeaea8fea0365c9e9), +CONST64(0x656589650fecca6a), CONST64(0xbabad2bab9686903), CONST64(0x2f2fbc2f65935e4a), CONST64(0xc0c027c04ee79d8e), +CONST64(0xdede5fdebe81a160), CONST64(0x1c1c701ce06c38fc), CONST64(0xfdfdd3fdbb2ee746), CONST64(0x4d4d294d52649a1f), +CONST64(0x92927292e4e03976), CONST64(0x7575c9758fbceafa), CONST64(0x06061806301e0c36), CONST64(0x8a8a128a249809ae), +CONST64(0xb2b2f2b2f940794b), CONST64(0xe6e6bfe66359d185), CONST64(0x0e0e380e70361c7e), CONST64(0x1f1f7c1ff8633ee7), +CONST64(0x6262956237f7c455), CONST64(0xd4d477d4eea3b53a), CONST64(0xa8a89aa829324d81), CONST64(0x96966296c4f43152), +CONST64(0xf9f9c3f99b3aef62), CONST64(0xc5c533c566f697a3), CONST64(0x2525942535b14a10), CONST64(0x59597959f220b2ab), +CONST64(0x84842a8454ae15d0), CONST64(0x7272d572b7a7e4c5), CONST64(0x3939e439d5dd72ec), CONST64(0x4c4c2d4c5a619816), +CONST64(0x5e5e655eca3bbc94), CONST64(0x7878fd78e785f09f), CONST64(0x3838e038ddd870e5), CONST64(0x8c8c0a8c14860598), +CONST64(0xd1d163d1c6b2bf17), CONST64(0xa5a5aea5410b57e4), CONST64(0xe2e2afe2434dd9a1), CONST64(0x616199612ff8c24e), +CONST64(0xb3b3f6b3f1457b42), CONST64(0x2121842115a54234), CONST64(0x9c9c4a9c94d62508), CONST64(0x1e1e781ef0663cee), +CONST64(0x4343114322528661), CONST64(0xc7c73bc776fc93b1), CONST64(0xfcfcd7fcb32be54f), CONST64(0x0404100420140824), +CONST64(0x51515951b208a2e3), CONST64(0x99995e99bcc72f25), CONST64(0x6d6da96d4fc4da22), CONST64(0x0d0d340d68391a65), +CONST64(0xfafacffa8335e979), CONST64(0xdfdf5bdfb684a369), CONST64(0x7e7ee57ed79bfca9), CONST64(0x242490243db44819), +CONST64(0x3b3bec3bc5d776fe), CONST64(0xabab96ab313d4b9a), CONST64(0xcece1fce3ed181f0), CONST64(0x1111441188552299), +CONST64(0x8f8f068f0c890383), CONST64(0x4e4e254e4a6b9c04), CONST64(0xb7b7e6b7d1517366), CONST64(0xebeb8beb0b60cbe0), +CONST64(0x3c3cf03cfdcc78c1), CONST64(0x81813e817cbf1ffd), CONST64(0x94946a94d4fe3540), CONST64(0xf7f7fbf7eb0cf31c), +CONST64(0xb9b9deb9a1676f18), CONST64(0x13134c13985f268b), CONST64(0x2c2cb02c7d9c5851), CONST64(0xd3d36bd3d6b8bb05), +CONST64(0xe7e7bbe76b5cd38c), CONST64(0x6e6ea56e57cbdc39), CONST64(0xc4c437c46ef395aa), CONST64(0x03030c03180f061b), +CONST64(0x565645568a13acdc), CONST64(0x44440d441a49885e), CONST64(0x7f7fe17fdf9efea0), CONST64(0xa9a99ea921374f88), +CONST64(0x2a2aa82a4d825467), CONST64(0xbbbbd6bbb16d6b0a), CONST64(0xc1c123c146e29f87), CONST64(0x53535153a202a6f1), +CONST64(0xdcdc57dcae8ba572), CONST64(0x0b0b2c0b58271653), CONST64(0x9d9d4e9d9cd32701), CONST64(0x6c6cad6c47c1d82b), +CONST64(0x3131c43195f562a4), CONST64(0x7474cd7487b9e8f3), CONST64(0xf6f6fff6e309f115), CONST64(0x464605460a438c4c), +CONST64(0xacac8aac092645a5), CONST64(0x89891e893c970fb5), CONST64(0x14145014a04428b4), CONST64(0xe1e1a3e15b42dfba), +CONST64(0x16165816b04e2ca6), CONST64(0x3a3ae83acdd274f7), CONST64(0x6969b9696fd0d206), CONST64(0x09092409482d1241), +CONST64(0x7070dd70a7ade0d7), CONST64(0xb6b6e2b6d954716f), CONST64(0xd0d067d0ceb7bd1e), CONST64(0xeded93ed3b7ec7d6), +CONST64(0xcccc17cc2edb85e2), CONST64(0x424215422a578468), CONST64(0x98985a98b4c22d2c), CONST64(0xa4a4aaa4490e55ed), +CONST64(0x2828a0285d885075), CONST64(0x5c5c6d5cda31b886), CONST64(0xf8f8c7f8933fed6b), CONST64(0x8686228644a411c2) +}; + +#ifdef LTC_SMALL_CODE + +#define SB0(x) sbox0[x] +#define SB1(x) ROR64c(sbox0[x], 8) +#define SB2(x) ROR64c(sbox0[x], 16) +#define SB3(x) ROR64c(sbox0[x], 24) +#define SB4(x) ROR64c(sbox0[x], 32) +#define SB5(x) ROR64c(sbox0[x], 40) +#define SB6(x) ROR64c(sbox0[x], 48) +#define SB7(x) ROR64c(sbox0[x], 56) + +#else + +#define SB0(x) sbox0[x] +#define SB1(x) sbox1[x] +#define SB2(x) sbox2[x] +#define SB3(x) sbox3[x] +#define SB4(x) sbox4[x] +#define SB5(x) sbox5[x] +#define SB6(x) sbox6[x] +#define SB7(x) sbox7[x] + + +static const ulong64 sbox1[] = { +CONST64(0xd818186018c07830), CONST64(0x2623238c2305af46), CONST64(0xb8c6c63fc67ef991), CONST64(0xfbe8e887e8136fcd), +CONST64(0xcb878726874ca113), CONST64(0x11b8b8dab8a9626d), CONST64(0x0901010401080502), CONST64(0x0d4f4f214f426e9e), +CONST64(0x9b3636d836adee6c), CONST64(0xffa6a6a2a6590451), CONST64(0x0cd2d26fd2debdb9), CONST64(0x0ef5f5f3f5fb06f7), +CONST64(0x967979f979ef80f2), CONST64(0x306f6fa16f5fcede), CONST64(0x6d91917e91fcef3f), CONST64(0xf852525552aa07a4), +CONST64(0x4760609d6027fdc0), CONST64(0x35bcbccabc897665), CONST64(0x379b9b569baccd2b), CONST64(0x8a8e8e028e048c01), +CONST64(0xd2a3a3b6a371155b), CONST64(0x6c0c0c300c603c18), CONST64(0x847b7bf17bff8af6), CONST64(0x803535d435b5e16a), +CONST64(0xf51d1d741de8693a), CONST64(0xb3e0e0a7e05347dd), CONST64(0x21d7d77bd7f6acb3), CONST64(0x9cc2c22fc25eed99), +CONST64(0x432e2eb82e6d965c), CONST64(0x294b4b314b627a96), CONST64(0x5dfefedffea321e1), CONST64(0xd5575741578216ae), +CONST64(0xbd15155415a8412a), CONST64(0xe87777c1779fb6ee), CONST64(0x923737dc37a5eb6e), CONST64(0x9ee5e5b3e57b56d7), +CONST64(0x139f9f469f8cd923), CONST64(0x23f0f0e7f0d317fd), CONST64(0x204a4a354a6a7f94), CONST64(0x44dada4fda9e95a9), +CONST64(0xa258587d58fa25b0), CONST64(0xcfc9c903c906ca8f), CONST64(0x7c2929a429558d52), CONST64(0x5a0a0a280a502214), +CONST64(0x50b1b1feb1e14f7f), CONST64(0xc9a0a0baa0691a5d), CONST64(0x146b6bb16b7fdad6), CONST64(0xd985852e855cab17), +CONST64(0x3cbdbdcebd817367), CONST64(0x8f5d5d695dd234ba), CONST64(0x9010104010805020), CONST64(0x07f4f4f7f4f303f5), +CONST64(0xddcbcb0bcb16c08b), CONST64(0xd33e3ef83eedc67c), CONST64(0x2d0505140528110a), CONST64(0x78676781671fe6ce), +CONST64(0x97e4e4b7e47353d5), CONST64(0x0227279c2725bb4e), CONST64(0x7341411941325882), CONST64(0xa78b8b168b2c9d0b), +CONST64(0xf6a7a7a6a7510153), CONST64(0xb27d7de97dcf94fa), CONST64(0x4995956e95dcfb37), CONST64(0x56d8d847d88e9fad), +CONST64(0x70fbfbcbfb8b30eb), CONST64(0xcdeeee9fee2371c1), CONST64(0xbb7c7ced7cc791f8), CONST64(0x716666856617e3cc), +CONST64(0x7bdddd53dda68ea7), CONST64(0xaf17175c17b84b2e), CONST64(0x454747014702468e), CONST64(0x1a9e9e429e84dc21), +CONST64(0xd4caca0fca1ec589), CONST64(0x582d2db42d75995a), CONST64(0x2ebfbfc6bf917963), CONST64(0x3f07071c07381b0e), +CONST64(0xacadad8ead012347), CONST64(0xb05a5a755aea2fb4), CONST64(0xef838336836cb51b), CONST64(0xb63333cc3385ff66), +CONST64(0x5c636391633ff2c6), CONST64(0x1202020802100a04), CONST64(0x93aaaa92aa393849), CONST64(0xde7171d971afa8e2), +CONST64(0xc6c8c807c80ecf8d), CONST64(0xd119196419c87d32), CONST64(0x3b49493949727092), CONST64(0x5fd9d943d9869aaf), +CONST64(0x31f2f2eff2c31df9), CONST64(0xa8e3e3abe34b48db), CONST64(0xb95b5b715be22ab6), CONST64(0xbc88881a8834920d), +CONST64(0x3e9a9a529aa4c829), CONST64(0x0b262698262dbe4c), CONST64(0xbf3232c8328dfa64), CONST64(0x59b0b0fab0e94a7d), +CONST64(0xf2e9e983e91b6acf), CONST64(0x770f0f3c0f78331e), CONST64(0x33d5d573d5e6a6b7), CONST64(0xf480803a8074ba1d), +CONST64(0x27bebec2be997c61), CONST64(0xebcdcd13cd26de87), CONST64(0x893434d034bde468), CONST64(0x3248483d487a7590), +CONST64(0x54ffffdbffab24e3), CONST64(0x8d7a7af57af78ff4), CONST64(0x6490907a90f4ea3d), CONST64(0x9d5f5f615fc23ebe), +CONST64(0x3d202080201da040), CONST64(0x0f6868bd6867d5d0), CONST64(0xca1a1a681ad07234), CONST64(0xb7aeae82ae192c41), +CONST64(0x7db4b4eab4c95e75), CONST64(0xce54544d549a19a8), CONST64(0x7f93937693ece53b), CONST64(0x2f222288220daa44), +CONST64(0x6364648d6407e9c8), CONST64(0x2af1f1e3f1db12ff), CONST64(0xcc7373d173bfa2e6), CONST64(0x8212124812905a24), +CONST64(0x7a40401d403a5d80), CONST64(0x4808082008402810), CONST64(0x95c3c32bc356e89b), CONST64(0xdfecec97ec337bc5), +CONST64(0x4ddbdb4bdb9690ab), CONST64(0xc0a1a1bea1611f5f), CONST64(0x918d8d0e8d1c8307), CONST64(0xc83d3df43df5c97a), +CONST64(0x5b97976697ccf133), CONST64(0x0000000000000000), CONST64(0xf9cfcf1bcf36d483), CONST64(0x6e2b2bac2b458756), +CONST64(0xe17676c57697b3ec), CONST64(0xe68282328264b019), CONST64(0x28d6d67fd6fea9b1), CONST64(0xc31b1b6c1bd87736), +CONST64(0x74b5b5eeb5c15b77), CONST64(0xbeafaf86af112943), CONST64(0x1d6a6ab56a77dfd4), CONST64(0xea50505d50ba0da0), +CONST64(0x5745450945124c8a), CONST64(0x38f3f3ebf3cb18fb), CONST64(0xad3030c0309df060), CONST64(0xc4efef9bef2b74c3), +CONST64(0xda3f3ffc3fe5c37e), CONST64(0xc755554955921caa), CONST64(0xdba2a2b2a2791059), CONST64(0xe9eaea8fea0365c9), +CONST64(0x6a656589650fecca), CONST64(0x03babad2bab96869), CONST64(0x4a2f2fbc2f65935e), CONST64(0x8ec0c027c04ee79d), +CONST64(0x60dede5fdebe81a1), CONST64(0xfc1c1c701ce06c38), CONST64(0x46fdfdd3fdbb2ee7), CONST64(0x1f4d4d294d52649a), +CONST64(0x7692927292e4e039), CONST64(0xfa7575c9758fbcea), CONST64(0x3606061806301e0c), CONST64(0xae8a8a128a249809), +CONST64(0x4bb2b2f2b2f94079), CONST64(0x85e6e6bfe66359d1), CONST64(0x7e0e0e380e70361c), CONST64(0xe71f1f7c1ff8633e), +CONST64(0x556262956237f7c4), CONST64(0x3ad4d477d4eea3b5), CONST64(0x81a8a89aa829324d), CONST64(0x5296966296c4f431), +CONST64(0x62f9f9c3f99b3aef), CONST64(0xa3c5c533c566f697), CONST64(0x102525942535b14a), CONST64(0xab59597959f220b2), +CONST64(0xd084842a8454ae15), CONST64(0xc57272d572b7a7e4), CONST64(0xec3939e439d5dd72), CONST64(0x164c4c2d4c5a6198), +CONST64(0x945e5e655eca3bbc), CONST64(0x9f7878fd78e785f0), CONST64(0xe53838e038ddd870), CONST64(0x988c8c0a8c148605), +CONST64(0x17d1d163d1c6b2bf), CONST64(0xe4a5a5aea5410b57), CONST64(0xa1e2e2afe2434dd9), CONST64(0x4e616199612ff8c2), +CONST64(0x42b3b3f6b3f1457b), CONST64(0x342121842115a542), CONST64(0x089c9c4a9c94d625), CONST64(0xee1e1e781ef0663c), +CONST64(0x6143431143225286), CONST64(0xb1c7c73bc776fc93), CONST64(0x4ffcfcd7fcb32be5), CONST64(0x2404041004201408), +CONST64(0xe351515951b208a2), CONST64(0x2599995e99bcc72f), CONST64(0x226d6da96d4fc4da), CONST64(0x650d0d340d68391a), +CONST64(0x79fafacffa8335e9), CONST64(0x69dfdf5bdfb684a3), CONST64(0xa97e7ee57ed79bfc), CONST64(0x19242490243db448), +CONST64(0xfe3b3bec3bc5d776), CONST64(0x9aabab96ab313d4b), CONST64(0xf0cece1fce3ed181), CONST64(0x9911114411885522), +CONST64(0x838f8f068f0c8903), CONST64(0x044e4e254e4a6b9c), CONST64(0x66b7b7e6b7d15173), CONST64(0xe0ebeb8beb0b60cb), +CONST64(0xc13c3cf03cfdcc78), CONST64(0xfd81813e817cbf1f), CONST64(0x4094946a94d4fe35), CONST64(0x1cf7f7fbf7eb0cf3), +CONST64(0x18b9b9deb9a1676f), CONST64(0x8b13134c13985f26), CONST64(0x512c2cb02c7d9c58), CONST64(0x05d3d36bd3d6b8bb), +CONST64(0x8ce7e7bbe76b5cd3), CONST64(0x396e6ea56e57cbdc), CONST64(0xaac4c437c46ef395), CONST64(0x1b03030c03180f06), +CONST64(0xdc565645568a13ac), CONST64(0x5e44440d441a4988), CONST64(0xa07f7fe17fdf9efe), CONST64(0x88a9a99ea921374f), +CONST64(0x672a2aa82a4d8254), CONST64(0x0abbbbd6bbb16d6b), CONST64(0x87c1c123c146e29f), CONST64(0xf153535153a202a6), +CONST64(0x72dcdc57dcae8ba5), CONST64(0x530b0b2c0b582716), CONST64(0x019d9d4e9d9cd327), CONST64(0x2b6c6cad6c47c1d8), +CONST64(0xa43131c43195f562), CONST64(0xf37474cd7487b9e8), CONST64(0x15f6f6fff6e309f1), CONST64(0x4c464605460a438c), +CONST64(0xa5acac8aac092645), CONST64(0xb589891e893c970f), CONST64(0xb414145014a04428), CONST64(0xbae1e1a3e15b42df), +CONST64(0xa616165816b04e2c), CONST64(0xf73a3ae83acdd274), CONST64(0x066969b9696fd0d2), CONST64(0x4109092409482d12), +CONST64(0xd77070dd70a7ade0), CONST64(0x6fb6b6e2b6d95471), CONST64(0x1ed0d067d0ceb7bd), CONST64(0xd6eded93ed3b7ec7), +CONST64(0xe2cccc17cc2edb85), CONST64(0x68424215422a5784), CONST64(0x2c98985a98b4c22d), CONST64(0xeda4a4aaa4490e55), +CONST64(0x752828a0285d8850), CONST64(0x865c5c6d5cda31b8), CONST64(0x6bf8f8c7f8933fed), CONST64(0xc28686228644a411) +}; + +static const ulong64 sbox2[] = { +CONST64(0x30d818186018c078), CONST64(0x462623238c2305af), CONST64(0x91b8c6c63fc67ef9), CONST64(0xcdfbe8e887e8136f), +CONST64(0x13cb878726874ca1), CONST64(0x6d11b8b8dab8a962), CONST64(0x0209010104010805), CONST64(0x9e0d4f4f214f426e), +CONST64(0x6c9b3636d836adee), CONST64(0x51ffa6a6a2a65904), CONST64(0xb90cd2d26fd2debd), CONST64(0xf70ef5f5f3f5fb06), +CONST64(0xf2967979f979ef80), CONST64(0xde306f6fa16f5fce), CONST64(0x3f6d91917e91fcef), CONST64(0xa4f852525552aa07), +CONST64(0xc04760609d6027fd), CONST64(0x6535bcbccabc8976), CONST64(0x2b379b9b569baccd), CONST64(0x018a8e8e028e048c), +CONST64(0x5bd2a3a3b6a37115), CONST64(0x186c0c0c300c603c), CONST64(0xf6847b7bf17bff8a), CONST64(0x6a803535d435b5e1), +CONST64(0x3af51d1d741de869), CONST64(0xddb3e0e0a7e05347), CONST64(0xb321d7d77bd7f6ac), CONST64(0x999cc2c22fc25eed), +CONST64(0x5c432e2eb82e6d96), CONST64(0x96294b4b314b627a), CONST64(0xe15dfefedffea321), CONST64(0xaed5575741578216), +CONST64(0x2abd15155415a841), CONST64(0xeee87777c1779fb6), CONST64(0x6e923737dc37a5eb), CONST64(0xd79ee5e5b3e57b56), +CONST64(0x23139f9f469f8cd9), CONST64(0xfd23f0f0e7f0d317), CONST64(0x94204a4a354a6a7f), CONST64(0xa944dada4fda9e95), +CONST64(0xb0a258587d58fa25), CONST64(0x8fcfc9c903c906ca), CONST64(0x527c2929a429558d), CONST64(0x145a0a0a280a5022), +CONST64(0x7f50b1b1feb1e14f), CONST64(0x5dc9a0a0baa0691a), CONST64(0xd6146b6bb16b7fda), CONST64(0x17d985852e855cab), +CONST64(0x673cbdbdcebd8173), CONST64(0xba8f5d5d695dd234), CONST64(0x2090101040108050), CONST64(0xf507f4f4f7f4f303), +CONST64(0x8bddcbcb0bcb16c0), CONST64(0x7cd33e3ef83eedc6), CONST64(0x0a2d050514052811), CONST64(0xce78676781671fe6), +CONST64(0xd597e4e4b7e47353), CONST64(0x4e0227279c2725bb), CONST64(0x8273414119413258), CONST64(0x0ba78b8b168b2c9d), +CONST64(0x53f6a7a7a6a75101), CONST64(0xfab27d7de97dcf94), CONST64(0x374995956e95dcfb), CONST64(0xad56d8d847d88e9f), +CONST64(0xeb70fbfbcbfb8b30), CONST64(0xc1cdeeee9fee2371), CONST64(0xf8bb7c7ced7cc791), CONST64(0xcc716666856617e3), +CONST64(0xa77bdddd53dda68e), CONST64(0x2eaf17175c17b84b), CONST64(0x8e45474701470246), CONST64(0x211a9e9e429e84dc), +CONST64(0x89d4caca0fca1ec5), CONST64(0x5a582d2db42d7599), CONST64(0x632ebfbfc6bf9179), CONST64(0x0e3f07071c07381b), +CONST64(0x47acadad8ead0123), CONST64(0xb4b05a5a755aea2f), CONST64(0x1bef838336836cb5), CONST64(0x66b63333cc3385ff), +CONST64(0xc65c636391633ff2), CONST64(0x041202020802100a), CONST64(0x4993aaaa92aa3938), CONST64(0xe2de7171d971afa8), +CONST64(0x8dc6c8c807c80ecf), CONST64(0x32d119196419c87d), CONST64(0x923b494939497270), CONST64(0xaf5fd9d943d9869a), +CONST64(0xf931f2f2eff2c31d), CONST64(0xdba8e3e3abe34b48), CONST64(0xb6b95b5b715be22a), CONST64(0x0dbc88881a883492), +CONST64(0x293e9a9a529aa4c8), CONST64(0x4c0b262698262dbe), CONST64(0x64bf3232c8328dfa), CONST64(0x7d59b0b0fab0e94a), +CONST64(0xcff2e9e983e91b6a), CONST64(0x1e770f0f3c0f7833), CONST64(0xb733d5d573d5e6a6), CONST64(0x1df480803a8074ba), +CONST64(0x6127bebec2be997c), CONST64(0x87ebcdcd13cd26de), CONST64(0x68893434d034bde4), CONST64(0x903248483d487a75), +CONST64(0xe354ffffdbffab24), CONST64(0xf48d7a7af57af78f), CONST64(0x3d6490907a90f4ea), CONST64(0xbe9d5f5f615fc23e), +CONST64(0x403d202080201da0), CONST64(0xd00f6868bd6867d5), CONST64(0x34ca1a1a681ad072), CONST64(0x41b7aeae82ae192c), +CONST64(0x757db4b4eab4c95e), CONST64(0xa8ce54544d549a19), CONST64(0x3b7f93937693ece5), CONST64(0x442f222288220daa), +CONST64(0xc86364648d6407e9), CONST64(0xff2af1f1e3f1db12), CONST64(0xe6cc7373d173bfa2), CONST64(0x248212124812905a), +CONST64(0x807a40401d403a5d), CONST64(0x1048080820084028), CONST64(0x9b95c3c32bc356e8), CONST64(0xc5dfecec97ec337b), +CONST64(0xab4ddbdb4bdb9690), CONST64(0x5fc0a1a1bea1611f), CONST64(0x07918d8d0e8d1c83), CONST64(0x7ac83d3df43df5c9), +CONST64(0x335b97976697ccf1), CONST64(0x0000000000000000), CONST64(0x83f9cfcf1bcf36d4), CONST64(0x566e2b2bac2b4587), +CONST64(0xece17676c57697b3), CONST64(0x19e68282328264b0), CONST64(0xb128d6d67fd6fea9), CONST64(0x36c31b1b6c1bd877), +CONST64(0x7774b5b5eeb5c15b), CONST64(0x43beafaf86af1129), CONST64(0xd41d6a6ab56a77df), CONST64(0xa0ea50505d50ba0d), +CONST64(0x8a5745450945124c), CONST64(0xfb38f3f3ebf3cb18), CONST64(0x60ad3030c0309df0), CONST64(0xc3c4efef9bef2b74), +CONST64(0x7eda3f3ffc3fe5c3), CONST64(0xaac755554955921c), CONST64(0x59dba2a2b2a27910), CONST64(0xc9e9eaea8fea0365), +CONST64(0xca6a656589650fec), CONST64(0x6903babad2bab968), CONST64(0x5e4a2f2fbc2f6593), CONST64(0x9d8ec0c027c04ee7), +CONST64(0xa160dede5fdebe81), CONST64(0x38fc1c1c701ce06c), CONST64(0xe746fdfdd3fdbb2e), CONST64(0x9a1f4d4d294d5264), +CONST64(0x397692927292e4e0), CONST64(0xeafa7575c9758fbc), CONST64(0x0c3606061806301e), CONST64(0x09ae8a8a128a2498), +CONST64(0x794bb2b2f2b2f940), CONST64(0xd185e6e6bfe66359), CONST64(0x1c7e0e0e380e7036), CONST64(0x3ee71f1f7c1ff863), +CONST64(0xc4556262956237f7), CONST64(0xb53ad4d477d4eea3), CONST64(0x4d81a8a89aa82932), CONST64(0x315296966296c4f4), +CONST64(0xef62f9f9c3f99b3a), CONST64(0x97a3c5c533c566f6), CONST64(0x4a102525942535b1), CONST64(0xb2ab59597959f220), +CONST64(0x15d084842a8454ae), CONST64(0xe4c57272d572b7a7), CONST64(0x72ec3939e439d5dd), CONST64(0x98164c4c2d4c5a61), +CONST64(0xbc945e5e655eca3b), CONST64(0xf09f7878fd78e785), CONST64(0x70e53838e038ddd8), CONST64(0x05988c8c0a8c1486), +CONST64(0xbf17d1d163d1c6b2), CONST64(0x57e4a5a5aea5410b), CONST64(0xd9a1e2e2afe2434d), CONST64(0xc24e616199612ff8), +CONST64(0x7b42b3b3f6b3f145), CONST64(0x42342121842115a5), CONST64(0x25089c9c4a9c94d6), CONST64(0x3cee1e1e781ef066), +CONST64(0x8661434311432252), CONST64(0x93b1c7c73bc776fc), CONST64(0xe54ffcfcd7fcb32b), CONST64(0x0824040410042014), +CONST64(0xa2e351515951b208), CONST64(0x2f2599995e99bcc7), CONST64(0xda226d6da96d4fc4), CONST64(0x1a650d0d340d6839), +CONST64(0xe979fafacffa8335), CONST64(0xa369dfdf5bdfb684), CONST64(0xfca97e7ee57ed79b), CONST64(0x4819242490243db4), +CONST64(0x76fe3b3bec3bc5d7), CONST64(0x4b9aabab96ab313d), CONST64(0x81f0cece1fce3ed1), CONST64(0x2299111144118855), +CONST64(0x03838f8f068f0c89), CONST64(0x9c044e4e254e4a6b), CONST64(0x7366b7b7e6b7d151), CONST64(0xcbe0ebeb8beb0b60), +CONST64(0x78c13c3cf03cfdcc), CONST64(0x1ffd81813e817cbf), CONST64(0x354094946a94d4fe), CONST64(0xf31cf7f7fbf7eb0c), +CONST64(0x6f18b9b9deb9a167), CONST64(0x268b13134c13985f), CONST64(0x58512c2cb02c7d9c), CONST64(0xbb05d3d36bd3d6b8), +CONST64(0xd38ce7e7bbe76b5c), CONST64(0xdc396e6ea56e57cb), CONST64(0x95aac4c437c46ef3), CONST64(0x061b03030c03180f), +CONST64(0xacdc565645568a13), CONST64(0x885e44440d441a49), CONST64(0xfea07f7fe17fdf9e), CONST64(0x4f88a9a99ea92137), +CONST64(0x54672a2aa82a4d82), CONST64(0x6b0abbbbd6bbb16d), CONST64(0x9f87c1c123c146e2), CONST64(0xa6f153535153a202), +CONST64(0xa572dcdc57dcae8b), CONST64(0x16530b0b2c0b5827), CONST64(0x27019d9d4e9d9cd3), CONST64(0xd82b6c6cad6c47c1), +CONST64(0x62a43131c43195f5), CONST64(0xe8f37474cd7487b9), CONST64(0xf115f6f6fff6e309), CONST64(0x8c4c464605460a43), +CONST64(0x45a5acac8aac0926), CONST64(0x0fb589891e893c97), CONST64(0x28b414145014a044), CONST64(0xdfbae1e1a3e15b42), +CONST64(0x2ca616165816b04e), CONST64(0x74f73a3ae83acdd2), CONST64(0xd2066969b9696fd0), CONST64(0x124109092409482d), +CONST64(0xe0d77070dd70a7ad), CONST64(0x716fb6b6e2b6d954), CONST64(0xbd1ed0d067d0ceb7), CONST64(0xc7d6eded93ed3b7e), +CONST64(0x85e2cccc17cc2edb), CONST64(0x8468424215422a57), CONST64(0x2d2c98985a98b4c2), CONST64(0x55eda4a4aaa4490e), +CONST64(0x50752828a0285d88), CONST64(0xb8865c5c6d5cda31), CONST64(0xed6bf8f8c7f8933f), CONST64(0x11c28686228644a4) +}; + +static const ulong64 sbox3[] = { +CONST64(0x7830d818186018c0), CONST64(0xaf462623238c2305), CONST64(0xf991b8c6c63fc67e), CONST64(0x6fcdfbe8e887e813), +CONST64(0xa113cb878726874c), CONST64(0x626d11b8b8dab8a9), CONST64(0x0502090101040108), CONST64(0x6e9e0d4f4f214f42), +CONST64(0xee6c9b3636d836ad), CONST64(0x0451ffa6a6a2a659), CONST64(0xbdb90cd2d26fd2de), CONST64(0x06f70ef5f5f3f5fb), +CONST64(0x80f2967979f979ef), CONST64(0xcede306f6fa16f5f), CONST64(0xef3f6d91917e91fc), CONST64(0x07a4f852525552aa), +CONST64(0xfdc04760609d6027), CONST64(0x766535bcbccabc89), CONST64(0xcd2b379b9b569bac), CONST64(0x8c018a8e8e028e04), +CONST64(0x155bd2a3a3b6a371), CONST64(0x3c186c0c0c300c60), CONST64(0x8af6847b7bf17bff), CONST64(0xe16a803535d435b5), +CONST64(0x693af51d1d741de8), CONST64(0x47ddb3e0e0a7e053), CONST64(0xacb321d7d77bd7f6), CONST64(0xed999cc2c22fc25e), +CONST64(0x965c432e2eb82e6d), CONST64(0x7a96294b4b314b62), CONST64(0x21e15dfefedffea3), CONST64(0x16aed55757415782), +CONST64(0x412abd15155415a8), CONST64(0xb6eee87777c1779f), CONST64(0xeb6e923737dc37a5), CONST64(0x56d79ee5e5b3e57b), +CONST64(0xd923139f9f469f8c), CONST64(0x17fd23f0f0e7f0d3), CONST64(0x7f94204a4a354a6a), CONST64(0x95a944dada4fda9e), +CONST64(0x25b0a258587d58fa), CONST64(0xca8fcfc9c903c906), CONST64(0x8d527c2929a42955), CONST64(0x22145a0a0a280a50), +CONST64(0x4f7f50b1b1feb1e1), CONST64(0x1a5dc9a0a0baa069), CONST64(0xdad6146b6bb16b7f), CONST64(0xab17d985852e855c), +CONST64(0x73673cbdbdcebd81), CONST64(0x34ba8f5d5d695dd2), CONST64(0x5020901010401080), CONST64(0x03f507f4f4f7f4f3), +CONST64(0xc08bddcbcb0bcb16), CONST64(0xc67cd33e3ef83eed), CONST64(0x110a2d0505140528), CONST64(0xe6ce78676781671f), +CONST64(0x53d597e4e4b7e473), CONST64(0xbb4e0227279c2725), CONST64(0x5882734141194132), CONST64(0x9d0ba78b8b168b2c), +CONST64(0x0153f6a7a7a6a751), CONST64(0x94fab27d7de97dcf), CONST64(0xfb374995956e95dc), CONST64(0x9fad56d8d847d88e), +CONST64(0x30eb70fbfbcbfb8b), CONST64(0x71c1cdeeee9fee23), CONST64(0x91f8bb7c7ced7cc7), CONST64(0xe3cc716666856617), +CONST64(0x8ea77bdddd53dda6), CONST64(0x4b2eaf17175c17b8), CONST64(0x468e454747014702), CONST64(0xdc211a9e9e429e84), +CONST64(0xc589d4caca0fca1e), CONST64(0x995a582d2db42d75), CONST64(0x79632ebfbfc6bf91), CONST64(0x1b0e3f07071c0738), +CONST64(0x2347acadad8ead01), CONST64(0x2fb4b05a5a755aea), CONST64(0xb51bef838336836c), CONST64(0xff66b63333cc3385), +CONST64(0xf2c65c636391633f), CONST64(0x0a04120202080210), CONST64(0x384993aaaa92aa39), CONST64(0xa8e2de7171d971af), +CONST64(0xcf8dc6c8c807c80e), CONST64(0x7d32d119196419c8), CONST64(0x70923b4949394972), CONST64(0x9aaf5fd9d943d986), +CONST64(0x1df931f2f2eff2c3), CONST64(0x48dba8e3e3abe34b), CONST64(0x2ab6b95b5b715be2), CONST64(0x920dbc88881a8834), +CONST64(0xc8293e9a9a529aa4), CONST64(0xbe4c0b262698262d), CONST64(0xfa64bf3232c8328d), CONST64(0x4a7d59b0b0fab0e9), +CONST64(0x6acff2e9e983e91b), CONST64(0x331e770f0f3c0f78), CONST64(0xa6b733d5d573d5e6), CONST64(0xba1df480803a8074), +CONST64(0x7c6127bebec2be99), CONST64(0xde87ebcdcd13cd26), CONST64(0xe468893434d034bd), CONST64(0x75903248483d487a), +CONST64(0x24e354ffffdbffab), CONST64(0x8ff48d7a7af57af7), CONST64(0xea3d6490907a90f4), CONST64(0x3ebe9d5f5f615fc2), +CONST64(0xa0403d202080201d), CONST64(0xd5d00f6868bd6867), CONST64(0x7234ca1a1a681ad0), CONST64(0x2c41b7aeae82ae19), +CONST64(0x5e757db4b4eab4c9), CONST64(0x19a8ce54544d549a), CONST64(0xe53b7f93937693ec), CONST64(0xaa442f222288220d), +CONST64(0xe9c86364648d6407), CONST64(0x12ff2af1f1e3f1db), CONST64(0xa2e6cc7373d173bf), CONST64(0x5a24821212481290), +CONST64(0x5d807a40401d403a), CONST64(0x2810480808200840), CONST64(0xe89b95c3c32bc356), CONST64(0x7bc5dfecec97ec33), +CONST64(0x90ab4ddbdb4bdb96), CONST64(0x1f5fc0a1a1bea161), CONST64(0x8307918d8d0e8d1c), CONST64(0xc97ac83d3df43df5), +CONST64(0xf1335b97976697cc), CONST64(0x0000000000000000), CONST64(0xd483f9cfcf1bcf36), CONST64(0x87566e2b2bac2b45), +CONST64(0xb3ece17676c57697), CONST64(0xb019e68282328264), CONST64(0xa9b128d6d67fd6fe), CONST64(0x7736c31b1b6c1bd8), +CONST64(0x5b7774b5b5eeb5c1), CONST64(0x2943beafaf86af11), CONST64(0xdfd41d6a6ab56a77), CONST64(0x0da0ea50505d50ba), +CONST64(0x4c8a574545094512), CONST64(0x18fb38f3f3ebf3cb), CONST64(0xf060ad3030c0309d), CONST64(0x74c3c4efef9bef2b), +CONST64(0xc37eda3f3ffc3fe5), CONST64(0x1caac75555495592), CONST64(0x1059dba2a2b2a279), CONST64(0x65c9e9eaea8fea03), +CONST64(0xecca6a656589650f), CONST64(0x686903babad2bab9), CONST64(0x935e4a2f2fbc2f65), CONST64(0xe79d8ec0c027c04e), +CONST64(0x81a160dede5fdebe), CONST64(0x6c38fc1c1c701ce0), CONST64(0x2ee746fdfdd3fdbb), CONST64(0x649a1f4d4d294d52), +CONST64(0xe0397692927292e4), CONST64(0xbceafa7575c9758f), CONST64(0x1e0c360606180630), CONST64(0x9809ae8a8a128a24), +CONST64(0x40794bb2b2f2b2f9), CONST64(0x59d185e6e6bfe663), CONST64(0x361c7e0e0e380e70), CONST64(0x633ee71f1f7c1ff8), +CONST64(0xf7c4556262956237), CONST64(0xa3b53ad4d477d4ee), CONST64(0x324d81a8a89aa829), CONST64(0xf4315296966296c4), +CONST64(0x3aef62f9f9c3f99b), CONST64(0xf697a3c5c533c566), CONST64(0xb14a102525942535), CONST64(0x20b2ab59597959f2), +CONST64(0xae15d084842a8454), CONST64(0xa7e4c57272d572b7), CONST64(0xdd72ec3939e439d5), CONST64(0x6198164c4c2d4c5a), +CONST64(0x3bbc945e5e655eca), CONST64(0x85f09f7878fd78e7), CONST64(0xd870e53838e038dd), CONST64(0x8605988c8c0a8c14), +CONST64(0xb2bf17d1d163d1c6), CONST64(0x0b57e4a5a5aea541), CONST64(0x4dd9a1e2e2afe243), CONST64(0xf8c24e616199612f), +CONST64(0x457b42b3b3f6b3f1), CONST64(0xa542342121842115), CONST64(0xd625089c9c4a9c94), CONST64(0x663cee1e1e781ef0), +CONST64(0x5286614343114322), CONST64(0xfc93b1c7c73bc776), CONST64(0x2be54ffcfcd7fcb3), CONST64(0x1408240404100420), +CONST64(0x08a2e351515951b2), CONST64(0xc72f2599995e99bc), CONST64(0xc4da226d6da96d4f), CONST64(0x391a650d0d340d68), +CONST64(0x35e979fafacffa83), CONST64(0x84a369dfdf5bdfb6), CONST64(0x9bfca97e7ee57ed7), CONST64(0xb44819242490243d), +CONST64(0xd776fe3b3bec3bc5), CONST64(0x3d4b9aabab96ab31), CONST64(0xd181f0cece1fce3e), CONST64(0x5522991111441188), +CONST64(0x8903838f8f068f0c), CONST64(0x6b9c044e4e254e4a), CONST64(0x517366b7b7e6b7d1), CONST64(0x60cbe0ebeb8beb0b), +CONST64(0xcc78c13c3cf03cfd), CONST64(0xbf1ffd81813e817c), CONST64(0xfe354094946a94d4), CONST64(0x0cf31cf7f7fbf7eb), +CONST64(0x676f18b9b9deb9a1), CONST64(0x5f268b13134c1398), CONST64(0x9c58512c2cb02c7d), CONST64(0xb8bb05d3d36bd3d6), +CONST64(0x5cd38ce7e7bbe76b), CONST64(0xcbdc396e6ea56e57), CONST64(0xf395aac4c437c46e), CONST64(0x0f061b03030c0318), +CONST64(0x13acdc565645568a), CONST64(0x49885e44440d441a), CONST64(0x9efea07f7fe17fdf), CONST64(0x374f88a9a99ea921), +CONST64(0x8254672a2aa82a4d), CONST64(0x6d6b0abbbbd6bbb1), CONST64(0xe29f87c1c123c146), CONST64(0x02a6f153535153a2), +CONST64(0x8ba572dcdc57dcae), CONST64(0x2716530b0b2c0b58), CONST64(0xd327019d9d4e9d9c), CONST64(0xc1d82b6c6cad6c47), +CONST64(0xf562a43131c43195), CONST64(0xb9e8f37474cd7487), CONST64(0x09f115f6f6fff6e3), CONST64(0x438c4c464605460a), +CONST64(0x2645a5acac8aac09), CONST64(0x970fb589891e893c), CONST64(0x4428b414145014a0), CONST64(0x42dfbae1e1a3e15b), +CONST64(0x4e2ca616165816b0), CONST64(0xd274f73a3ae83acd), CONST64(0xd0d2066969b9696f), CONST64(0x2d12410909240948), +CONST64(0xade0d77070dd70a7), CONST64(0x54716fb6b6e2b6d9), CONST64(0xb7bd1ed0d067d0ce), CONST64(0x7ec7d6eded93ed3b), +CONST64(0xdb85e2cccc17cc2e), CONST64(0x578468424215422a), CONST64(0xc22d2c98985a98b4), CONST64(0x0e55eda4a4aaa449), +CONST64(0x8850752828a0285d), CONST64(0x31b8865c5c6d5cda), CONST64(0x3fed6bf8f8c7f893), CONST64(0xa411c28686228644) +}; + +static const ulong64 sbox4[] = { +CONST64(0xc07830d818186018), CONST64(0x05af462623238c23), CONST64(0x7ef991b8c6c63fc6), CONST64(0x136fcdfbe8e887e8), +CONST64(0x4ca113cb87872687), CONST64(0xa9626d11b8b8dab8), CONST64(0x0805020901010401), CONST64(0x426e9e0d4f4f214f), +CONST64(0xadee6c9b3636d836), CONST64(0x590451ffa6a6a2a6), CONST64(0xdebdb90cd2d26fd2), CONST64(0xfb06f70ef5f5f3f5), +CONST64(0xef80f2967979f979), CONST64(0x5fcede306f6fa16f), CONST64(0xfcef3f6d91917e91), CONST64(0xaa07a4f852525552), +CONST64(0x27fdc04760609d60), CONST64(0x89766535bcbccabc), CONST64(0xaccd2b379b9b569b), CONST64(0x048c018a8e8e028e), +CONST64(0x71155bd2a3a3b6a3), CONST64(0x603c186c0c0c300c), CONST64(0xff8af6847b7bf17b), CONST64(0xb5e16a803535d435), +CONST64(0xe8693af51d1d741d), CONST64(0x5347ddb3e0e0a7e0), CONST64(0xf6acb321d7d77bd7), CONST64(0x5eed999cc2c22fc2), +CONST64(0x6d965c432e2eb82e), CONST64(0x627a96294b4b314b), CONST64(0xa321e15dfefedffe), CONST64(0x8216aed557574157), +CONST64(0xa8412abd15155415), CONST64(0x9fb6eee87777c177), CONST64(0xa5eb6e923737dc37), CONST64(0x7b56d79ee5e5b3e5), +CONST64(0x8cd923139f9f469f), CONST64(0xd317fd23f0f0e7f0), CONST64(0x6a7f94204a4a354a), CONST64(0x9e95a944dada4fda), +CONST64(0xfa25b0a258587d58), CONST64(0x06ca8fcfc9c903c9), CONST64(0x558d527c2929a429), CONST64(0x5022145a0a0a280a), +CONST64(0xe14f7f50b1b1feb1), CONST64(0x691a5dc9a0a0baa0), CONST64(0x7fdad6146b6bb16b), CONST64(0x5cab17d985852e85), +CONST64(0x8173673cbdbdcebd), CONST64(0xd234ba8f5d5d695d), CONST64(0x8050209010104010), CONST64(0xf303f507f4f4f7f4), +CONST64(0x16c08bddcbcb0bcb), CONST64(0xedc67cd33e3ef83e), CONST64(0x28110a2d05051405), CONST64(0x1fe6ce7867678167), +CONST64(0x7353d597e4e4b7e4), CONST64(0x25bb4e0227279c27), CONST64(0x3258827341411941), CONST64(0x2c9d0ba78b8b168b), +CONST64(0x510153f6a7a7a6a7), CONST64(0xcf94fab27d7de97d), CONST64(0xdcfb374995956e95), CONST64(0x8e9fad56d8d847d8), +CONST64(0x8b30eb70fbfbcbfb), CONST64(0x2371c1cdeeee9fee), CONST64(0xc791f8bb7c7ced7c), CONST64(0x17e3cc7166668566), +CONST64(0xa68ea77bdddd53dd), CONST64(0xb84b2eaf17175c17), CONST64(0x02468e4547470147), CONST64(0x84dc211a9e9e429e), +CONST64(0x1ec589d4caca0fca), CONST64(0x75995a582d2db42d), CONST64(0x9179632ebfbfc6bf), CONST64(0x381b0e3f07071c07), +CONST64(0x012347acadad8ead), CONST64(0xea2fb4b05a5a755a), CONST64(0x6cb51bef83833683), CONST64(0x85ff66b63333cc33), +CONST64(0x3ff2c65c63639163), CONST64(0x100a041202020802), CONST64(0x39384993aaaa92aa), CONST64(0xafa8e2de7171d971), +CONST64(0x0ecf8dc6c8c807c8), CONST64(0xc87d32d119196419), CONST64(0x7270923b49493949), CONST64(0x869aaf5fd9d943d9), +CONST64(0xc31df931f2f2eff2), CONST64(0x4b48dba8e3e3abe3), CONST64(0xe22ab6b95b5b715b), CONST64(0x34920dbc88881a88), +CONST64(0xa4c8293e9a9a529a), CONST64(0x2dbe4c0b26269826), CONST64(0x8dfa64bf3232c832), CONST64(0xe94a7d59b0b0fab0), +CONST64(0x1b6acff2e9e983e9), CONST64(0x78331e770f0f3c0f), CONST64(0xe6a6b733d5d573d5), CONST64(0x74ba1df480803a80), +CONST64(0x997c6127bebec2be), CONST64(0x26de87ebcdcd13cd), CONST64(0xbde468893434d034), CONST64(0x7a75903248483d48), +CONST64(0xab24e354ffffdbff), CONST64(0xf78ff48d7a7af57a), CONST64(0xf4ea3d6490907a90), CONST64(0xc23ebe9d5f5f615f), +CONST64(0x1da0403d20208020), CONST64(0x67d5d00f6868bd68), CONST64(0xd07234ca1a1a681a), CONST64(0x192c41b7aeae82ae), +CONST64(0xc95e757db4b4eab4), CONST64(0x9a19a8ce54544d54), CONST64(0xece53b7f93937693), CONST64(0x0daa442f22228822), +CONST64(0x07e9c86364648d64), CONST64(0xdb12ff2af1f1e3f1), CONST64(0xbfa2e6cc7373d173), CONST64(0x905a248212124812), +CONST64(0x3a5d807a40401d40), CONST64(0x4028104808082008), CONST64(0x56e89b95c3c32bc3), CONST64(0x337bc5dfecec97ec), +CONST64(0x9690ab4ddbdb4bdb), CONST64(0x611f5fc0a1a1bea1), CONST64(0x1c8307918d8d0e8d), CONST64(0xf5c97ac83d3df43d), +CONST64(0xccf1335b97976697), CONST64(0x0000000000000000), CONST64(0x36d483f9cfcf1bcf), CONST64(0x4587566e2b2bac2b), +CONST64(0x97b3ece17676c576), CONST64(0x64b019e682823282), CONST64(0xfea9b128d6d67fd6), CONST64(0xd87736c31b1b6c1b), +CONST64(0xc15b7774b5b5eeb5), CONST64(0x112943beafaf86af), CONST64(0x77dfd41d6a6ab56a), CONST64(0xba0da0ea50505d50), +CONST64(0x124c8a5745450945), CONST64(0xcb18fb38f3f3ebf3), CONST64(0x9df060ad3030c030), CONST64(0x2b74c3c4efef9bef), +CONST64(0xe5c37eda3f3ffc3f), CONST64(0x921caac755554955), CONST64(0x791059dba2a2b2a2), CONST64(0x0365c9e9eaea8fea), +CONST64(0x0fecca6a65658965), CONST64(0xb9686903babad2ba), CONST64(0x65935e4a2f2fbc2f), CONST64(0x4ee79d8ec0c027c0), +CONST64(0xbe81a160dede5fde), CONST64(0xe06c38fc1c1c701c), CONST64(0xbb2ee746fdfdd3fd), CONST64(0x52649a1f4d4d294d), +CONST64(0xe4e0397692927292), CONST64(0x8fbceafa7575c975), CONST64(0x301e0c3606061806), CONST64(0x249809ae8a8a128a), +CONST64(0xf940794bb2b2f2b2), CONST64(0x6359d185e6e6bfe6), CONST64(0x70361c7e0e0e380e), CONST64(0xf8633ee71f1f7c1f), +CONST64(0x37f7c45562629562), CONST64(0xeea3b53ad4d477d4), CONST64(0x29324d81a8a89aa8), CONST64(0xc4f4315296966296), +CONST64(0x9b3aef62f9f9c3f9), CONST64(0x66f697a3c5c533c5), CONST64(0x35b14a1025259425), CONST64(0xf220b2ab59597959), +CONST64(0x54ae15d084842a84), CONST64(0xb7a7e4c57272d572), CONST64(0xd5dd72ec3939e439), CONST64(0x5a6198164c4c2d4c), +CONST64(0xca3bbc945e5e655e), CONST64(0xe785f09f7878fd78), CONST64(0xddd870e53838e038), CONST64(0x148605988c8c0a8c), +CONST64(0xc6b2bf17d1d163d1), CONST64(0x410b57e4a5a5aea5), CONST64(0x434dd9a1e2e2afe2), CONST64(0x2ff8c24e61619961), +CONST64(0xf1457b42b3b3f6b3), CONST64(0x15a5423421218421), CONST64(0x94d625089c9c4a9c), CONST64(0xf0663cee1e1e781e), +CONST64(0x2252866143431143), CONST64(0x76fc93b1c7c73bc7), CONST64(0xb32be54ffcfcd7fc), CONST64(0x2014082404041004), +CONST64(0xb208a2e351515951), CONST64(0xbcc72f2599995e99), CONST64(0x4fc4da226d6da96d), CONST64(0x68391a650d0d340d), +CONST64(0x8335e979fafacffa), CONST64(0xb684a369dfdf5bdf), CONST64(0xd79bfca97e7ee57e), CONST64(0x3db4481924249024), +CONST64(0xc5d776fe3b3bec3b), CONST64(0x313d4b9aabab96ab), CONST64(0x3ed181f0cece1fce), CONST64(0x8855229911114411), +CONST64(0x0c8903838f8f068f), CONST64(0x4a6b9c044e4e254e), CONST64(0xd1517366b7b7e6b7), CONST64(0x0b60cbe0ebeb8beb), +CONST64(0xfdcc78c13c3cf03c), CONST64(0x7cbf1ffd81813e81), CONST64(0xd4fe354094946a94), CONST64(0xeb0cf31cf7f7fbf7), +CONST64(0xa1676f18b9b9deb9), CONST64(0x985f268b13134c13), CONST64(0x7d9c58512c2cb02c), CONST64(0xd6b8bb05d3d36bd3), +CONST64(0x6b5cd38ce7e7bbe7), CONST64(0x57cbdc396e6ea56e), CONST64(0x6ef395aac4c437c4), CONST64(0x180f061b03030c03), +CONST64(0x8a13acdc56564556), CONST64(0x1a49885e44440d44), CONST64(0xdf9efea07f7fe17f), CONST64(0x21374f88a9a99ea9), +CONST64(0x4d8254672a2aa82a), CONST64(0xb16d6b0abbbbd6bb), CONST64(0x46e29f87c1c123c1), CONST64(0xa202a6f153535153), +CONST64(0xae8ba572dcdc57dc), CONST64(0x582716530b0b2c0b), CONST64(0x9cd327019d9d4e9d), CONST64(0x47c1d82b6c6cad6c), +CONST64(0x95f562a43131c431), CONST64(0x87b9e8f37474cd74), CONST64(0xe309f115f6f6fff6), CONST64(0x0a438c4c46460546), +CONST64(0x092645a5acac8aac), CONST64(0x3c970fb589891e89), CONST64(0xa04428b414145014), CONST64(0x5b42dfbae1e1a3e1), +CONST64(0xb04e2ca616165816), CONST64(0xcdd274f73a3ae83a), CONST64(0x6fd0d2066969b969), CONST64(0x482d124109092409), +CONST64(0xa7ade0d77070dd70), CONST64(0xd954716fb6b6e2b6), CONST64(0xceb7bd1ed0d067d0), CONST64(0x3b7ec7d6eded93ed), +CONST64(0x2edb85e2cccc17cc), CONST64(0x2a57846842421542), CONST64(0xb4c22d2c98985a98), CONST64(0x490e55eda4a4aaa4), +CONST64(0x5d8850752828a028), CONST64(0xda31b8865c5c6d5c), CONST64(0x933fed6bf8f8c7f8), CONST64(0x44a411c286862286) +}; + +static const ulong64 sbox5[] = { +CONST64(0x18c07830d8181860), CONST64(0x2305af462623238c), CONST64(0xc67ef991b8c6c63f), CONST64(0xe8136fcdfbe8e887), +CONST64(0x874ca113cb878726), CONST64(0xb8a9626d11b8b8da), CONST64(0x0108050209010104), CONST64(0x4f426e9e0d4f4f21), +CONST64(0x36adee6c9b3636d8), CONST64(0xa6590451ffa6a6a2), CONST64(0xd2debdb90cd2d26f), CONST64(0xf5fb06f70ef5f5f3), +CONST64(0x79ef80f2967979f9), CONST64(0x6f5fcede306f6fa1), CONST64(0x91fcef3f6d91917e), CONST64(0x52aa07a4f8525255), +CONST64(0x6027fdc04760609d), CONST64(0xbc89766535bcbcca), CONST64(0x9baccd2b379b9b56), CONST64(0x8e048c018a8e8e02), +CONST64(0xa371155bd2a3a3b6), CONST64(0x0c603c186c0c0c30), CONST64(0x7bff8af6847b7bf1), CONST64(0x35b5e16a803535d4), +CONST64(0x1de8693af51d1d74), CONST64(0xe05347ddb3e0e0a7), CONST64(0xd7f6acb321d7d77b), CONST64(0xc25eed999cc2c22f), +CONST64(0x2e6d965c432e2eb8), CONST64(0x4b627a96294b4b31), CONST64(0xfea321e15dfefedf), CONST64(0x578216aed5575741), +CONST64(0x15a8412abd151554), CONST64(0x779fb6eee87777c1), CONST64(0x37a5eb6e923737dc), CONST64(0xe57b56d79ee5e5b3), +CONST64(0x9f8cd923139f9f46), CONST64(0xf0d317fd23f0f0e7), CONST64(0x4a6a7f94204a4a35), CONST64(0xda9e95a944dada4f), +CONST64(0x58fa25b0a258587d), CONST64(0xc906ca8fcfc9c903), CONST64(0x29558d527c2929a4), CONST64(0x0a5022145a0a0a28), +CONST64(0xb1e14f7f50b1b1fe), CONST64(0xa0691a5dc9a0a0ba), CONST64(0x6b7fdad6146b6bb1), CONST64(0x855cab17d985852e), +CONST64(0xbd8173673cbdbdce), CONST64(0x5dd234ba8f5d5d69), CONST64(0x1080502090101040), CONST64(0xf4f303f507f4f4f7), +CONST64(0xcb16c08bddcbcb0b), CONST64(0x3eedc67cd33e3ef8), CONST64(0x0528110a2d050514), CONST64(0x671fe6ce78676781), +CONST64(0xe47353d597e4e4b7), CONST64(0x2725bb4e0227279c), CONST64(0x4132588273414119), CONST64(0x8b2c9d0ba78b8b16), +CONST64(0xa7510153f6a7a7a6), CONST64(0x7dcf94fab27d7de9), CONST64(0x95dcfb374995956e), CONST64(0xd88e9fad56d8d847), +CONST64(0xfb8b30eb70fbfbcb), CONST64(0xee2371c1cdeeee9f), CONST64(0x7cc791f8bb7c7ced), CONST64(0x6617e3cc71666685), +CONST64(0xdda68ea77bdddd53), CONST64(0x17b84b2eaf17175c), CONST64(0x4702468e45474701), CONST64(0x9e84dc211a9e9e42), +CONST64(0xca1ec589d4caca0f), CONST64(0x2d75995a582d2db4), CONST64(0xbf9179632ebfbfc6), CONST64(0x07381b0e3f07071c), +CONST64(0xad012347acadad8e), CONST64(0x5aea2fb4b05a5a75), CONST64(0x836cb51bef838336), CONST64(0x3385ff66b63333cc), +CONST64(0x633ff2c65c636391), CONST64(0x02100a0412020208), CONST64(0xaa39384993aaaa92), CONST64(0x71afa8e2de7171d9), +CONST64(0xc80ecf8dc6c8c807), CONST64(0x19c87d32d1191964), CONST64(0x497270923b494939), CONST64(0xd9869aaf5fd9d943), +CONST64(0xf2c31df931f2f2ef), CONST64(0xe34b48dba8e3e3ab), CONST64(0x5be22ab6b95b5b71), CONST64(0x8834920dbc88881a), +CONST64(0x9aa4c8293e9a9a52), CONST64(0x262dbe4c0b262698), CONST64(0x328dfa64bf3232c8), CONST64(0xb0e94a7d59b0b0fa), +CONST64(0xe91b6acff2e9e983), CONST64(0x0f78331e770f0f3c), CONST64(0xd5e6a6b733d5d573), CONST64(0x8074ba1df480803a), +CONST64(0xbe997c6127bebec2), CONST64(0xcd26de87ebcdcd13), CONST64(0x34bde468893434d0), CONST64(0x487a75903248483d), +CONST64(0xffab24e354ffffdb), CONST64(0x7af78ff48d7a7af5), CONST64(0x90f4ea3d6490907a), CONST64(0x5fc23ebe9d5f5f61), +CONST64(0x201da0403d202080), CONST64(0x6867d5d00f6868bd), CONST64(0x1ad07234ca1a1a68), CONST64(0xae192c41b7aeae82), +CONST64(0xb4c95e757db4b4ea), CONST64(0x549a19a8ce54544d), CONST64(0x93ece53b7f939376), CONST64(0x220daa442f222288), +CONST64(0x6407e9c86364648d), CONST64(0xf1db12ff2af1f1e3), CONST64(0x73bfa2e6cc7373d1), CONST64(0x12905a2482121248), +CONST64(0x403a5d807a40401d), CONST64(0x0840281048080820), CONST64(0xc356e89b95c3c32b), CONST64(0xec337bc5dfecec97), +CONST64(0xdb9690ab4ddbdb4b), CONST64(0xa1611f5fc0a1a1be), CONST64(0x8d1c8307918d8d0e), CONST64(0x3df5c97ac83d3df4), +CONST64(0x97ccf1335b979766), CONST64(0x0000000000000000), CONST64(0xcf36d483f9cfcf1b), CONST64(0x2b4587566e2b2bac), +CONST64(0x7697b3ece17676c5), CONST64(0x8264b019e6828232), CONST64(0xd6fea9b128d6d67f), CONST64(0x1bd87736c31b1b6c), +CONST64(0xb5c15b7774b5b5ee), CONST64(0xaf112943beafaf86), CONST64(0x6a77dfd41d6a6ab5), CONST64(0x50ba0da0ea50505d), +CONST64(0x45124c8a57454509), CONST64(0xf3cb18fb38f3f3eb), CONST64(0x309df060ad3030c0), CONST64(0xef2b74c3c4efef9b), +CONST64(0x3fe5c37eda3f3ffc), CONST64(0x55921caac7555549), CONST64(0xa2791059dba2a2b2), CONST64(0xea0365c9e9eaea8f), +CONST64(0x650fecca6a656589), CONST64(0xbab9686903babad2), CONST64(0x2f65935e4a2f2fbc), CONST64(0xc04ee79d8ec0c027), +CONST64(0xdebe81a160dede5f), CONST64(0x1ce06c38fc1c1c70), CONST64(0xfdbb2ee746fdfdd3), CONST64(0x4d52649a1f4d4d29), +CONST64(0x92e4e03976929272), CONST64(0x758fbceafa7575c9), CONST64(0x06301e0c36060618), CONST64(0x8a249809ae8a8a12), +CONST64(0xb2f940794bb2b2f2), CONST64(0xe66359d185e6e6bf), CONST64(0x0e70361c7e0e0e38), CONST64(0x1ff8633ee71f1f7c), +CONST64(0x6237f7c455626295), CONST64(0xd4eea3b53ad4d477), CONST64(0xa829324d81a8a89a), CONST64(0x96c4f43152969662), +CONST64(0xf99b3aef62f9f9c3), CONST64(0xc566f697a3c5c533), CONST64(0x2535b14a10252594), CONST64(0x59f220b2ab595979), +CONST64(0x8454ae15d084842a), CONST64(0x72b7a7e4c57272d5), CONST64(0x39d5dd72ec3939e4), CONST64(0x4c5a6198164c4c2d), +CONST64(0x5eca3bbc945e5e65), CONST64(0x78e785f09f7878fd), CONST64(0x38ddd870e53838e0), CONST64(0x8c148605988c8c0a), +CONST64(0xd1c6b2bf17d1d163), CONST64(0xa5410b57e4a5a5ae), CONST64(0xe2434dd9a1e2e2af), CONST64(0x612ff8c24e616199), +CONST64(0xb3f1457b42b3b3f6), CONST64(0x2115a54234212184), CONST64(0x9c94d625089c9c4a), CONST64(0x1ef0663cee1e1e78), +CONST64(0x4322528661434311), CONST64(0xc776fc93b1c7c73b), CONST64(0xfcb32be54ffcfcd7), CONST64(0x0420140824040410), +CONST64(0x51b208a2e3515159), CONST64(0x99bcc72f2599995e), CONST64(0x6d4fc4da226d6da9), CONST64(0x0d68391a650d0d34), +CONST64(0xfa8335e979fafacf), CONST64(0xdfb684a369dfdf5b), CONST64(0x7ed79bfca97e7ee5), CONST64(0x243db44819242490), +CONST64(0x3bc5d776fe3b3bec), CONST64(0xab313d4b9aabab96), CONST64(0xce3ed181f0cece1f), CONST64(0x1188552299111144), +CONST64(0x8f0c8903838f8f06), CONST64(0x4e4a6b9c044e4e25), CONST64(0xb7d1517366b7b7e6), CONST64(0xeb0b60cbe0ebeb8b), +CONST64(0x3cfdcc78c13c3cf0), CONST64(0x817cbf1ffd81813e), CONST64(0x94d4fe354094946a), CONST64(0xf7eb0cf31cf7f7fb), +CONST64(0xb9a1676f18b9b9de), CONST64(0x13985f268b13134c), CONST64(0x2c7d9c58512c2cb0), CONST64(0xd3d6b8bb05d3d36b), +CONST64(0xe76b5cd38ce7e7bb), CONST64(0x6e57cbdc396e6ea5), CONST64(0xc46ef395aac4c437), CONST64(0x03180f061b03030c), +CONST64(0x568a13acdc565645), CONST64(0x441a49885e44440d), CONST64(0x7fdf9efea07f7fe1), CONST64(0xa921374f88a9a99e), +CONST64(0x2a4d8254672a2aa8), CONST64(0xbbb16d6b0abbbbd6), CONST64(0xc146e29f87c1c123), CONST64(0x53a202a6f1535351), +CONST64(0xdcae8ba572dcdc57), CONST64(0x0b582716530b0b2c), CONST64(0x9d9cd327019d9d4e), CONST64(0x6c47c1d82b6c6cad), +CONST64(0x3195f562a43131c4), CONST64(0x7487b9e8f37474cd), CONST64(0xf6e309f115f6f6ff), CONST64(0x460a438c4c464605), +CONST64(0xac092645a5acac8a), CONST64(0x893c970fb589891e), CONST64(0x14a04428b4141450), CONST64(0xe15b42dfbae1e1a3), +CONST64(0x16b04e2ca6161658), CONST64(0x3acdd274f73a3ae8), CONST64(0x696fd0d2066969b9), CONST64(0x09482d1241090924), +CONST64(0x70a7ade0d77070dd), CONST64(0xb6d954716fb6b6e2), CONST64(0xd0ceb7bd1ed0d067), CONST64(0xed3b7ec7d6eded93), +CONST64(0xcc2edb85e2cccc17), CONST64(0x422a578468424215), CONST64(0x98b4c22d2c98985a), CONST64(0xa4490e55eda4a4aa), +CONST64(0x285d8850752828a0), CONST64(0x5cda31b8865c5c6d), CONST64(0xf8933fed6bf8f8c7), CONST64(0x8644a411c2868622) +}; + +static const ulong64 sbox6[] = { +CONST64(0x6018c07830d81818), CONST64(0x8c2305af46262323), CONST64(0x3fc67ef991b8c6c6), CONST64(0x87e8136fcdfbe8e8), +CONST64(0x26874ca113cb8787), CONST64(0xdab8a9626d11b8b8), CONST64(0x0401080502090101), CONST64(0x214f426e9e0d4f4f), +CONST64(0xd836adee6c9b3636), CONST64(0xa2a6590451ffa6a6), CONST64(0x6fd2debdb90cd2d2), CONST64(0xf3f5fb06f70ef5f5), +CONST64(0xf979ef80f2967979), CONST64(0xa16f5fcede306f6f), CONST64(0x7e91fcef3f6d9191), CONST64(0x5552aa07a4f85252), +CONST64(0x9d6027fdc0476060), CONST64(0xcabc89766535bcbc), CONST64(0x569baccd2b379b9b), CONST64(0x028e048c018a8e8e), +CONST64(0xb6a371155bd2a3a3), CONST64(0x300c603c186c0c0c), CONST64(0xf17bff8af6847b7b), CONST64(0xd435b5e16a803535), +CONST64(0x741de8693af51d1d), CONST64(0xa7e05347ddb3e0e0), CONST64(0x7bd7f6acb321d7d7), CONST64(0x2fc25eed999cc2c2), +CONST64(0xb82e6d965c432e2e), CONST64(0x314b627a96294b4b), CONST64(0xdffea321e15dfefe), CONST64(0x41578216aed55757), +CONST64(0x5415a8412abd1515), CONST64(0xc1779fb6eee87777), CONST64(0xdc37a5eb6e923737), CONST64(0xb3e57b56d79ee5e5), +CONST64(0x469f8cd923139f9f), CONST64(0xe7f0d317fd23f0f0), CONST64(0x354a6a7f94204a4a), CONST64(0x4fda9e95a944dada), +CONST64(0x7d58fa25b0a25858), CONST64(0x03c906ca8fcfc9c9), CONST64(0xa429558d527c2929), CONST64(0x280a5022145a0a0a), +CONST64(0xfeb1e14f7f50b1b1), CONST64(0xbaa0691a5dc9a0a0), CONST64(0xb16b7fdad6146b6b), CONST64(0x2e855cab17d98585), +CONST64(0xcebd8173673cbdbd), CONST64(0x695dd234ba8f5d5d), CONST64(0x4010805020901010), CONST64(0xf7f4f303f507f4f4), +CONST64(0x0bcb16c08bddcbcb), CONST64(0xf83eedc67cd33e3e), CONST64(0x140528110a2d0505), CONST64(0x81671fe6ce786767), +CONST64(0xb7e47353d597e4e4), CONST64(0x9c2725bb4e022727), CONST64(0x1941325882734141), CONST64(0x168b2c9d0ba78b8b), +CONST64(0xa6a7510153f6a7a7), CONST64(0xe97dcf94fab27d7d), CONST64(0x6e95dcfb37499595), CONST64(0x47d88e9fad56d8d8), +CONST64(0xcbfb8b30eb70fbfb), CONST64(0x9fee2371c1cdeeee), CONST64(0xed7cc791f8bb7c7c), CONST64(0x856617e3cc716666), +CONST64(0x53dda68ea77bdddd), CONST64(0x5c17b84b2eaf1717), CONST64(0x014702468e454747), CONST64(0x429e84dc211a9e9e), +CONST64(0x0fca1ec589d4caca), CONST64(0xb42d75995a582d2d), CONST64(0xc6bf9179632ebfbf), CONST64(0x1c07381b0e3f0707), +CONST64(0x8ead012347acadad), CONST64(0x755aea2fb4b05a5a), CONST64(0x36836cb51bef8383), CONST64(0xcc3385ff66b63333), +CONST64(0x91633ff2c65c6363), CONST64(0x0802100a04120202), CONST64(0x92aa39384993aaaa), CONST64(0xd971afa8e2de7171), +CONST64(0x07c80ecf8dc6c8c8), CONST64(0x6419c87d32d11919), CONST64(0x39497270923b4949), CONST64(0x43d9869aaf5fd9d9), +CONST64(0xeff2c31df931f2f2), CONST64(0xabe34b48dba8e3e3), CONST64(0x715be22ab6b95b5b), CONST64(0x1a8834920dbc8888), +CONST64(0x529aa4c8293e9a9a), CONST64(0x98262dbe4c0b2626), CONST64(0xc8328dfa64bf3232), CONST64(0xfab0e94a7d59b0b0), +CONST64(0x83e91b6acff2e9e9), CONST64(0x3c0f78331e770f0f), CONST64(0x73d5e6a6b733d5d5), CONST64(0x3a8074ba1df48080), +CONST64(0xc2be997c6127bebe), CONST64(0x13cd26de87ebcdcd), CONST64(0xd034bde468893434), CONST64(0x3d487a7590324848), +CONST64(0xdbffab24e354ffff), CONST64(0xf57af78ff48d7a7a), CONST64(0x7a90f4ea3d649090), CONST64(0x615fc23ebe9d5f5f), +CONST64(0x80201da0403d2020), CONST64(0xbd6867d5d00f6868), CONST64(0x681ad07234ca1a1a), CONST64(0x82ae192c41b7aeae), +CONST64(0xeab4c95e757db4b4), CONST64(0x4d549a19a8ce5454), CONST64(0x7693ece53b7f9393), CONST64(0x88220daa442f2222), +CONST64(0x8d6407e9c8636464), CONST64(0xe3f1db12ff2af1f1), CONST64(0xd173bfa2e6cc7373), CONST64(0x4812905a24821212), +CONST64(0x1d403a5d807a4040), CONST64(0x2008402810480808), CONST64(0x2bc356e89b95c3c3), CONST64(0x97ec337bc5dfecec), +CONST64(0x4bdb9690ab4ddbdb), CONST64(0xbea1611f5fc0a1a1), CONST64(0x0e8d1c8307918d8d), CONST64(0xf43df5c97ac83d3d), +CONST64(0x6697ccf1335b9797), CONST64(0x0000000000000000), CONST64(0x1bcf36d483f9cfcf), CONST64(0xac2b4587566e2b2b), +CONST64(0xc57697b3ece17676), CONST64(0x328264b019e68282), CONST64(0x7fd6fea9b128d6d6), CONST64(0x6c1bd87736c31b1b), +CONST64(0xeeb5c15b7774b5b5), CONST64(0x86af112943beafaf), CONST64(0xb56a77dfd41d6a6a), CONST64(0x5d50ba0da0ea5050), +CONST64(0x0945124c8a574545), CONST64(0xebf3cb18fb38f3f3), CONST64(0xc0309df060ad3030), CONST64(0x9bef2b74c3c4efef), +CONST64(0xfc3fe5c37eda3f3f), CONST64(0x4955921caac75555), CONST64(0xb2a2791059dba2a2), CONST64(0x8fea0365c9e9eaea), +CONST64(0x89650fecca6a6565), CONST64(0xd2bab9686903baba), CONST64(0xbc2f65935e4a2f2f), CONST64(0x27c04ee79d8ec0c0), +CONST64(0x5fdebe81a160dede), CONST64(0x701ce06c38fc1c1c), CONST64(0xd3fdbb2ee746fdfd), CONST64(0x294d52649a1f4d4d), +CONST64(0x7292e4e039769292), CONST64(0xc9758fbceafa7575), CONST64(0x1806301e0c360606), CONST64(0x128a249809ae8a8a), +CONST64(0xf2b2f940794bb2b2), CONST64(0xbfe66359d185e6e6), CONST64(0x380e70361c7e0e0e), CONST64(0x7c1ff8633ee71f1f), +CONST64(0x956237f7c4556262), CONST64(0x77d4eea3b53ad4d4), CONST64(0x9aa829324d81a8a8), CONST64(0x6296c4f431529696), +CONST64(0xc3f99b3aef62f9f9), CONST64(0x33c566f697a3c5c5), CONST64(0x942535b14a102525), CONST64(0x7959f220b2ab5959), +CONST64(0x2a8454ae15d08484), CONST64(0xd572b7a7e4c57272), CONST64(0xe439d5dd72ec3939), CONST64(0x2d4c5a6198164c4c), +CONST64(0x655eca3bbc945e5e), CONST64(0xfd78e785f09f7878), CONST64(0xe038ddd870e53838), CONST64(0x0a8c148605988c8c), +CONST64(0x63d1c6b2bf17d1d1), CONST64(0xaea5410b57e4a5a5), CONST64(0xafe2434dd9a1e2e2), CONST64(0x99612ff8c24e6161), +CONST64(0xf6b3f1457b42b3b3), CONST64(0x842115a542342121), CONST64(0x4a9c94d625089c9c), CONST64(0x781ef0663cee1e1e), +CONST64(0x1143225286614343), CONST64(0x3bc776fc93b1c7c7), CONST64(0xd7fcb32be54ffcfc), CONST64(0x1004201408240404), +CONST64(0x5951b208a2e35151), CONST64(0x5e99bcc72f259999), CONST64(0xa96d4fc4da226d6d), CONST64(0x340d68391a650d0d), +CONST64(0xcffa8335e979fafa), CONST64(0x5bdfb684a369dfdf), CONST64(0xe57ed79bfca97e7e), CONST64(0x90243db448192424), +CONST64(0xec3bc5d776fe3b3b), CONST64(0x96ab313d4b9aabab), CONST64(0x1fce3ed181f0cece), CONST64(0x4411885522991111), +CONST64(0x068f0c8903838f8f), CONST64(0x254e4a6b9c044e4e), CONST64(0xe6b7d1517366b7b7), CONST64(0x8beb0b60cbe0ebeb), +CONST64(0xf03cfdcc78c13c3c), CONST64(0x3e817cbf1ffd8181), CONST64(0x6a94d4fe35409494), CONST64(0xfbf7eb0cf31cf7f7), +CONST64(0xdeb9a1676f18b9b9), CONST64(0x4c13985f268b1313), CONST64(0xb02c7d9c58512c2c), CONST64(0x6bd3d6b8bb05d3d3), +CONST64(0xbbe76b5cd38ce7e7), CONST64(0xa56e57cbdc396e6e), CONST64(0x37c46ef395aac4c4), CONST64(0x0c03180f061b0303), +CONST64(0x45568a13acdc5656), CONST64(0x0d441a49885e4444), CONST64(0xe17fdf9efea07f7f), CONST64(0x9ea921374f88a9a9), +CONST64(0xa82a4d8254672a2a), CONST64(0xd6bbb16d6b0abbbb), CONST64(0x23c146e29f87c1c1), CONST64(0x5153a202a6f15353), +CONST64(0x57dcae8ba572dcdc), CONST64(0x2c0b582716530b0b), CONST64(0x4e9d9cd327019d9d), CONST64(0xad6c47c1d82b6c6c), +CONST64(0xc43195f562a43131), CONST64(0xcd7487b9e8f37474), CONST64(0xfff6e309f115f6f6), CONST64(0x05460a438c4c4646), +CONST64(0x8aac092645a5acac), CONST64(0x1e893c970fb58989), CONST64(0x5014a04428b41414), CONST64(0xa3e15b42dfbae1e1), +CONST64(0x5816b04e2ca61616), CONST64(0xe83acdd274f73a3a), CONST64(0xb9696fd0d2066969), CONST64(0x2409482d12410909), +CONST64(0xdd70a7ade0d77070), CONST64(0xe2b6d954716fb6b6), CONST64(0x67d0ceb7bd1ed0d0), CONST64(0x93ed3b7ec7d6eded), +CONST64(0x17cc2edb85e2cccc), CONST64(0x15422a5784684242), CONST64(0x5a98b4c22d2c9898), CONST64(0xaaa4490e55eda4a4), +CONST64(0xa0285d8850752828), CONST64(0x6d5cda31b8865c5c), CONST64(0xc7f8933fed6bf8f8), CONST64(0x228644a411c28686) +}; + +static const ulong64 sbox7[] = { +CONST64(0x186018c07830d818), CONST64(0x238c2305af462623), CONST64(0xc63fc67ef991b8c6), CONST64(0xe887e8136fcdfbe8), +CONST64(0x8726874ca113cb87), CONST64(0xb8dab8a9626d11b8), CONST64(0x0104010805020901), CONST64(0x4f214f426e9e0d4f), +CONST64(0x36d836adee6c9b36), CONST64(0xa6a2a6590451ffa6), CONST64(0xd26fd2debdb90cd2), CONST64(0xf5f3f5fb06f70ef5), +CONST64(0x79f979ef80f29679), CONST64(0x6fa16f5fcede306f), CONST64(0x917e91fcef3f6d91), CONST64(0x525552aa07a4f852), +CONST64(0x609d6027fdc04760), CONST64(0xbccabc89766535bc), CONST64(0x9b569baccd2b379b), CONST64(0x8e028e048c018a8e), +CONST64(0xa3b6a371155bd2a3), CONST64(0x0c300c603c186c0c), CONST64(0x7bf17bff8af6847b), CONST64(0x35d435b5e16a8035), +CONST64(0x1d741de8693af51d), CONST64(0xe0a7e05347ddb3e0), CONST64(0xd77bd7f6acb321d7), CONST64(0xc22fc25eed999cc2), +CONST64(0x2eb82e6d965c432e), CONST64(0x4b314b627a96294b), CONST64(0xfedffea321e15dfe), CONST64(0x5741578216aed557), +CONST64(0x155415a8412abd15), CONST64(0x77c1779fb6eee877), CONST64(0x37dc37a5eb6e9237), CONST64(0xe5b3e57b56d79ee5), +CONST64(0x9f469f8cd923139f), CONST64(0xf0e7f0d317fd23f0), CONST64(0x4a354a6a7f94204a), CONST64(0xda4fda9e95a944da), +CONST64(0x587d58fa25b0a258), CONST64(0xc903c906ca8fcfc9), CONST64(0x29a429558d527c29), CONST64(0x0a280a5022145a0a), +CONST64(0xb1feb1e14f7f50b1), CONST64(0xa0baa0691a5dc9a0), CONST64(0x6bb16b7fdad6146b), CONST64(0x852e855cab17d985), +CONST64(0xbdcebd8173673cbd), CONST64(0x5d695dd234ba8f5d), CONST64(0x1040108050209010), CONST64(0xf4f7f4f303f507f4), +CONST64(0xcb0bcb16c08bddcb), CONST64(0x3ef83eedc67cd33e), CONST64(0x05140528110a2d05), CONST64(0x6781671fe6ce7867), +CONST64(0xe4b7e47353d597e4), CONST64(0x279c2725bb4e0227), CONST64(0x4119413258827341), CONST64(0x8b168b2c9d0ba78b), +CONST64(0xa7a6a7510153f6a7), CONST64(0x7de97dcf94fab27d), CONST64(0x956e95dcfb374995), CONST64(0xd847d88e9fad56d8), +CONST64(0xfbcbfb8b30eb70fb), CONST64(0xee9fee2371c1cdee), CONST64(0x7ced7cc791f8bb7c), CONST64(0x66856617e3cc7166), +CONST64(0xdd53dda68ea77bdd), CONST64(0x175c17b84b2eaf17), CONST64(0x47014702468e4547), CONST64(0x9e429e84dc211a9e), +CONST64(0xca0fca1ec589d4ca), CONST64(0x2db42d75995a582d), CONST64(0xbfc6bf9179632ebf), CONST64(0x071c07381b0e3f07), +CONST64(0xad8ead012347acad), CONST64(0x5a755aea2fb4b05a), CONST64(0x8336836cb51bef83), CONST64(0x33cc3385ff66b633), +CONST64(0x6391633ff2c65c63), CONST64(0x020802100a041202), CONST64(0xaa92aa39384993aa), CONST64(0x71d971afa8e2de71), +CONST64(0xc807c80ecf8dc6c8), CONST64(0x196419c87d32d119), CONST64(0x4939497270923b49), CONST64(0xd943d9869aaf5fd9), +CONST64(0xf2eff2c31df931f2), CONST64(0xe3abe34b48dba8e3), CONST64(0x5b715be22ab6b95b), CONST64(0x881a8834920dbc88), +CONST64(0x9a529aa4c8293e9a), CONST64(0x2698262dbe4c0b26), CONST64(0x32c8328dfa64bf32), CONST64(0xb0fab0e94a7d59b0), +CONST64(0xe983e91b6acff2e9), CONST64(0x0f3c0f78331e770f), CONST64(0xd573d5e6a6b733d5), CONST64(0x803a8074ba1df480), +CONST64(0xbec2be997c6127be), CONST64(0xcd13cd26de87ebcd), CONST64(0x34d034bde4688934), CONST64(0x483d487a75903248), +CONST64(0xffdbffab24e354ff), CONST64(0x7af57af78ff48d7a), CONST64(0x907a90f4ea3d6490), CONST64(0x5f615fc23ebe9d5f), +CONST64(0x2080201da0403d20), CONST64(0x68bd6867d5d00f68), CONST64(0x1a681ad07234ca1a), CONST64(0xae82ae192c41b7ae), +CONST64(0xb4eab4c95e757db4), CONST64(0x544d549a19a8ce54), CONST64(0x937693ece53b7f93), CONST64(0x2288220daa442f22), +CONST64(0x648d6407e9c86364), CONST64(0xf1e3f1db12ff2af1), CONST64(0x73d173bfa2e6cc73), CONST64(0x124812905a248212), +CONST64(0x401d403a5d807a40), CONST64(0x0820084028104808), CONST64(0xc32bc356e89b95c3), CONST64(0xec97ec337bc5dfec), +CONST64(0xdb4bdb9690ab4ddb), CONST64(0xa1bea1611f5fc0a1), CONST64(0x8d0e8d1c8307918d), CONST64(0x3df43df5c97ac83d), +CONST64(0x976697ccf1335b97), CONST64(0x0000000000000000), CONST64(0xcf1bcf36d483f9cf), CONST64(0x2bac2b4587566e2b), +CONST64(0x76c57697b3ece176), CONST64(0x82328264b019e682), CONST64(0xd67fd6fea9b128d6), CONST64(0x1b6c1bd87736c31b), +CONST64(0xb5eeb5c15b7774b5), CONST64(0xaf86af112943beaf), CONST64(0x6ab56a77dfd41d6a), CONST64(0x505d50ba0da0ea50), +CONST64(0x450945124c8a5745), CONST64(0xf3ebf3cb18fb38f3), CONST64(0x30c0309df060ad30), CONST64(0xef9bef2b74c3c4ef), +CONST64(0x3ffc3fe5c37eda3f), CONST64(0x554955921caac755), CONST64(0xa2b2a2791059dba2), CONST64(0xea8fea0365c9e9ea), +CONST64(0x6589650fecca6a65), CONST64(0xbad2bab9686903ba), CONST64(0x2fbc2f65935e4a2f), CONST64(0xc027c04ee79d8ec0), +CONST64(0xde5fdebe81a160de), CONST64(0x1c701ce06c38fc1c), CONST64(0xfdd3fdbb2ee746fd), CONST64(0x4d294d52649a1f4d), +CONST64(0x927292e4e0397692), CONST64(0x75c9758fbceafa75), CONST64(0x061806301e0c3606), CONST64(0x8a128a249809ae8a), +CONST64(0xb2f2b2f940794bb2), CONST64(0xe6bfe66359d185e6), CONST64(0x0e380e70361c7e0e), CONST64(0x1f7c1ff8633ee71f), +CONST64(0x62956237f7c45562), CONST64(0xd477d4eea3b53ad4), CONST64(0xa89aa829324d81a8), CONST64(0x966296c4f4315296), +CONST64(0xf9c3f99b3aef62f9), CONST64(0xc533c566f697a3c5), CONST64(0x25942535b14a1025), CONST64(0x597959f220b2ab59), +CONST64(0x842a8454ae15d084), CONST64(0x72d572b7a7e4c572), CONST64(0x39e439d5dd72ec39), CONST64(0x4c2d4c5a6198164c), +CONST64(0x5e655eca3bbc945e), CONST64(0x78fd78e785f09f78), CONST64(0x38e038ddd870e538), CONST64(0x8c0a8c148605988c), +CONST64(0xd163d1c6b2bf17d1), CONST64(0xa5aea5410b57e4a5), CONST64(0xe2afe2434dd9a1e2), CONST64(0x6199612ff8c24e61), +CONST64(0xb3f6b3f1457b42b3), CONST64(0x21842115a5423421), CONST64(0x9c4a9c94d625089c), CONST64(0x1e781ef0663cee1e), +CONST64(0x4311432252866143), CONST64(0xc73bc776fc93b1c7), CONST64(0xfcd7fcb32be54ffc), CONST64(0x0410042014082404), +CONST64(0x515951b208a2e351), CONST64(0x995e99bcc72f2599), CONST64(0x6da96d4fc4da226d), CONST64(0x0d340d68391a650d), +CONST64(0xfacffa8335e979fa), CONST64(0xdf5bdfb684a369df), CONST64(0x7ee57ed79bfca97e), CONST64(0x2490243db4481924), +CONST64(0x3bec3bc5d776fe3b), CONST64(0xab96ab313d4b9aab), CONST64(0xce1fce3ed181f0ce), CONST64(0x1144118855229911), +CONST64(0x8f068f0c8903838f), CONST64(0x4e254e4a6b9c044e), CONST64(0xb7e6b7d1517366b7), CONST64(0xeb8beb0b60cbe0eb), +CONST64(0x3cf03cfdcc78c13c), CONST64(0x813e817cbf1ffd81), CONST64(0x946a94d4fe354094), CONST64(0xf7fbf7eb0cf31cf7), +CONST64(0xb9deb9a1676f18b9), CONST64(0x134c13985f268b13), CONST64(0x2cb02c7d9c58512c), CONST64(0xd36bd3d6b8bb05d3), +CONST64(0xe7bbe76b5cd38ce7), CONST64(0x6ea56e57cbdc396e), CONST64(0xc437c46ef395aac4), CONST64(0x030c03180f061b03), +CONST64(0x5645568a13acdc56), CONST64(0x440d441a49885e44), CONST64(0x7fe17fdf9efea07f), CONST64(0xa99ea921374f88a9), +CONST64(0x2aa82a4d8254672a), CONST64(0xbbd6bbb16d6b0abb), CONST64(0xc123c146e29f87c1), CONST64(0x535153a202a6f153), +CONST64(0xdc57dcae8ba572dc), CONST64(0x0b2c0b582716530b), CONST64(0x9d4e9d9cd327019d), CONST64(0x6cad6c47c1d82b6c), +CONST64(0x31c43195f562a431), CONST64(0x74cd7487b9e8f374), CONST64(0xf6fff6e309f115f6), CONST64(0x4605460a438c4c46), +CONST64(0xac8aac092645a5ac), CONST64(0x891e893c970fb589), CONST64(0x145014a04428b414), CONST64(0xe1a3e15b42dfbae1), +CONST64(0x165816b04e2ca616), CONST64(0x3ae83acdd274f73a), CONST64(0x69b9696fd0d20669), CONST64(0x092409482d124109), +CONST64(0x70dd70a7ade0d770), CONST64(0xb6e2b6d954716fb6), CONST64(0xd067d0ceb7bd1ed0), CONST64(0xed93ed3b7ec7d6ed), +CONST64(0xcc17cc2edb85e2cc), CONST64(0x4215422a57846842), CONST64(0x985a98b4c22d2c98), CONST64(0xa4aaa4490e55eda4), +CONST64(0x28a0285d88507528), CONST64(0x5c6d5cda31b8865c), CONST64(0xf8c7f8933fed6bf8), CONST64(0x86228644a411c286) +}; + +#endif + +static const ulong64 cont[] = { +CONST64(0x1823c6e887b8014f), +CONST64(0x36a6d2f5796f9152), +CONST64(0x60bc9b8ea30c7b35), +CONST64(0x1de0d7c22e4bfe57), +CONST64(0x157737e59ff04ada), +CONST64(0x58c9290ab1a06b85), +CONST64(0xbd5d10f4cb3e0567), +CONST64(0xe427418ba77d95d8), +CONST64(0xfbee7c66dd17479e), +CONST64(0xca2dbf07ad5a8333), +CONST64(0x6302aa71c81949d9), +}; + + +/* $Source: /cvs/libtom/libtomcrypt/src/hashes/whirl/whirltab.c,v $ */ +/* $Revision: 1.2 $ */ +/* $Date: 2005/05/05 14:35:58 $ */ diff --git a/libtomcrypt/src/headers/tomcrypt.h b/libtomcrypt/src/headers/tomcrypt.h new file mode 100644 index 0000000..15ccd04 --- /dev/null +++ b/libtomcrypt/src/headers/tomcrypt.h @@ -0,0 +1,88 @@ +#ifndef TOMCRYPT_H_ +#define TOMCRYPT_H_ +#include <assert.h> +#include <stdio.h> +#include <string.h> +#include <stdlib.h> +#include <time.h> +#include <ctype.h> +#include <limits.h> + +/* use configuration data */ +#include <tomcrypt_custom.h> + +#ifdef __cplusplus +extern "C" { +#endif + +/* version */ +#define CRYPT 0x0116 +#define SCRYPT "1.16" + +/* max size of either a cipher/hash block or symmetric key [largest of the two] */ +#define MAXBLOCKSIZE 128 + +/* descriptor table size */ +/* Dropbear change - this should be smaller, saves some size */ +#define TAB_SIZE 4 + +/* error codes [will be expanded in future releases] */ +enum { + CRYPT_OK=0, /* Result OK */ + CRYPT_ERROR, /* Generic Error */ + CRYPT_NOP, /* Not a failure but no operation was performed */ + + CRYPT_INVALID_KEYSIZE, /* Invalid key size given */ + CRYPT_INVALID_ROUNDS, /* Invalid number of rounds */ + CRYPT_FAIL_TESTVECTOR, /* Algorithm failed test vectors */ + + CRYPT_BUFFER_OVERFLOW, /* Not enough space for output */ + CRYPT_INVALID_PACKET, /* Invalid input packet given */ + + CRYPT_INVALID_PRNGSIZE, /* Invalid number of bits for a PRNG */ + CRYPT_ERROR_READPRNG, /* Could not read enough from PRNG */ + + CRYPT_INVALID_CIPHER, /* Invalid cipher specified */ + CRYPT_INVALID_HASH, /* Invalid hash specified */ + CRYPT_INVALID_PRNG, /* Invalid PRNG specified */ + + CRYPT_MEM, /* Out of memory */ + + CRYPT_PK_TYPE_MISMATCH, /* Not equivalent types of PK keys */ + CRYPT_PK_NOT_PRIVATE, /* Requires a private PK key */ + + CRYPT_INVALID_ARG, /* Generic invalid argument */ + CRYPT_FILE_NOTFOUND, /* File Not Found */ + + CRYPT_PK_INVALID_TYPE, /* Invalid type of PK key */ + CRYPT_PK_INVALID_SYSTEM,/* Invalid PK system specified */ + CRYPT_PK_DUP, /* Duplicate key already in key ring */ + CRYPT_PK_NOT_FOUND, /* Key not found in keyring */ + CRYPT_PK_INVALID_SIZE, /* Invalid size input for PK parameters */ + + CRYPT_INVALID_PRIME_SIZE,/* Invalid size of prime requested */ + CRYPT_PK_INVALID_PADDING /* Invalid padding on input */ +}; + +#include <tomcrypt_cfg.h> +#include <tomcrypt_macros.h> +#include <tomcrypt_cipher.h> +#include <tomcrypt_hash.h> +#include <tomcrypt_mac.h> +#include <tomcrypt_prng.h> +#include <tomcrypt_pk.h> +#include <tomcrypt_math.h> +#include <tomcrypt_misc.h> +#include <tomcrypt_argchk.h> +#include <tomcrypt_pkcs.h> + +#ifdef __cplusplus + } +#endif + +#endif /* TOMCRYPT_H_ */ + + +/* $Source: /cvs/libtom/libtomcrypt/src/headers/tomcrypt.h,v $ */ +/* $Revision: 1.20 $ */ +/* $Date: 2006/11/26 01:45:14 $ */ diff --git a/libtomcrypt/src/headers/tomcrypt_argchk.h b/libtomcrypt/src/headers/tomcrypt_argchk.h new file mode 100644 index 0000000..cfc93ad --- /dev/null +++ b/libtomcrypt/src/headers/tomcrypt_argchk.h @@ -0,0 +1,38 @@ +/* Defines the LTC_ARGCHK macro used within the library */ +/* ARGTYPE is defined in mycrypt_cfg.h */ +#if ARGTYPE == 0 + +#include <signal.h> + +/* this is the default LibTomCrypt macro */ +void crypt_argchk(char *v, char *s, int d); +#define LTC_ARGCHK(x) if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } +#define LTC_ARGCHKVD(x) LTC_ARGCHK(x) + +#elif ARGTYPE == 1 + +/* fatal type of error */ +#define LTC_ARGCHK(x) assert((x)) +#define LTC_ARGCHKVD(x) LTC_ARGCHK(x) + +#elif ARGTYPE == 2 + +#define LTC_ARGCHK(x) if (!(x)) { fprintf(stderr, "\nwarning: ARGCHK failed at %s:%d\n", __FILE__, __LINE__); } +#define LTC_ARGCHKVD(x) LTC_ARGCHK(x) + +#elif ARGTYPE == 3 + +#define LTC_ARGCHK(x) +#define LTC_ARGCHKVD(x) LTC_ARGCHK(x) + +#elif ARGTYPE == 4 + +#define LTC_ARGCHK(x) if (!(x)) return CRYPT_INVALID_ARG; +#define LTC_ARGCHKVD(x) if (!(x)) return; + +#endif + + +/* $Source: /cvs/libtom/libtomcrypt/src/headers/tomcrypt_argchk.h,v $ */ +/* $Revision: 1.5 $ */ +/* $Date: 2006/08/27 20:50:21 $ */ diff --git a/libtomcrypt/src/headers/tomcrypt_cfg.h b/libtomcrypt/src/headers/tomcrypt_cfg.h new file mode 100644 index 0000000..7feae6e --- /dev/null +++ b/libtomcrypt/src/headers/tomcrypt_cfg.h @@ -0,0 +1,136 @@ +/* This is the build config file. + * + * With this you can setup what to inlcude/exclude automatically during any build. Just comment + * out the line that #define's the word for the thing you want to remove. phew! + */ + +#ifndef TOMCRYPT_CFG_H +#define TOMCRYPT_CFG_H + +#if defined(_WIN32) || defined(_MSC_VER) +#define LTC_CALL __cdecl +#else +#ifndef LTC_CALL + #define LTC_CALL +#endif +#endif + +#ifndef LTC_EXPORT +#define LTC_EXPORT +#endif + +/* certain platforms use macros for these, making the prototypes broken */ +#ifndef LTC_NO_PROTOTYPES + +/* you can change how memory allocation works ... */ +LTC_EXPORT void * LTC_CALL XMALLOC(size_t n); +LTC_EXPORT void * LTC_CALL XREALLOC(void *p, size_t n); +LTC_EXPORT void * LTC_CALL XCALLOC(size_t n, size_t s); +LTC_EXPORT void LTC_CALL XFREE(void *p); + +LTC_EXPORT void LTC_CALL XQSORT(void *base, size_t nmemb, size_t size, int(*compar)(const void *, const void *)); + + +/* change the clock function too */ +LTC_EXPORT clock_t LTC_CALL XCLOCK(void); + +/* various other functions */ +LTC_EXPORT void * LTC_CALL XMEMCPY(void *dest, const void *src, size_t n); +LTC_EXPORT int LTC_CALL XMEMCMP(const void *s1, const void *s2, size_t n); +LTC_EXPORT void * LTC_CALL XMEMSET(void *s, int c, size_t n); + +LTC_EXPORT int LTC_CALL XSTRCMP(const char *s1, const char *s2); + +#endif + +/* type of argument checking, 0=default, 1=fatal and 2=error+continue, 3=nothing */ +#ifndef ARGTYPE + #define ARGTYPE 0 +#endif + +/* Controls endianess and size of registers. Leave uncommented to get platform neutral [slower] code + * + * Note: in order to use the optimized macros your platform must support unaligned 32 and 64 bit read/writes. + * The x86 platforms allow this but some others [ARM for instance] do not. On those platforms you **MUST** + * use the portable [slower] macros. + */ + +/* detect x86-32 machines somewhat */ +#if !defined(__STRICT_ANSI__) && (defined(INTEL_CC) || (defined(_MSC_VER) && defined(WIN32)) || (defined(__GNUC__) && (defined(__DJGPP__) || defined(__CYGWIN__) || defined(__MINGW32__) || defined(__i386__)))) + #define ENDIAN_LITTLE + #define ENDIAN_32BITWORD + #define LTC_FAST + #define LTC_FAST_TYPE unsigned long +#endif + +/* detects MIPS R5900 processors (PS2) */ +#if (defined(__R5900) || defined(R5900) || defined(__R5900__)) && (defined(_mips) || defined(__mips__) || defined(mips)) + #define ENDIAN_LITTLE + #define ENDIAN_64BITWORD +#endif + +/* detect amd64 */ +#if !defined(__STRICT_ANSI__) && defined(__x86_64__) + #define ENDIAN_LITTLE + #define ENDIAN_64BITWORD + #define LTC_FAST + #define LTC_FAST_TYPE unsigned long +#endif + +/* detect PPC32 */ +#if !defined(__STRICT_ANSI__) && defined(LTC_PPC32) + #define ENDIAN_BIG + #define ENDIAN_32BITWORD + #define LTC_FAST + #define LTC_FAST_TYPE unsigned long +#endif + +/* detect sparc and sparc64 */ +#if defined(__sparc__) + #define ENDIAN_BIG + #if defined(__arch64__) + #define ENDIAN_64BITWORD + #else + #define ENDIAN_32BITWORD + #endif +#endif + + +#ifdef LTC_NO_FAST + #ifdef LTC_FAST + #undef LTC_FAST + #endif +#endif + +/* No asm is a quick way to disable anything "not portable" */ +#ifdef LTC_NO_ASM + #undef ENDIAN_LITTLE + #undef ENDIAN_BIG + #undef ENDIAN_32BITWORD + #undef ENDIAN_64BITWORD + #undef LTC_FAST + #undef LTC_FAST_TYPE + #define LTC_NO_ROLC + #define LTC_NO_BSWAP +#endif + +/* #define ENDIAN_LITTLE */ +/* #define ENDIAN_BIG */ + +/* #define ENDIAN_32BITWORD */ +/* #define ENDIAN_64BITWORD */ + +#if (defined(ENDIAN_BIG) || defined(ENDIAN_LITTLE)) && !(defined(ENDIAN_32BITWORD) || defined(ENDIAN_64BITWORD)) + #error You must specify a word size as well as endianess in tomcrypt_cfg.h +#endif + +#if !(defined(ENDIAN_BIG) || defined(ENDIAN_LITTLE)) + #define ENDIAN_NEUTRAL +#endif + +#endif + + +/* $Source: /cvs/libtom/libtomcrypt/src/headers/tomcrypt_cfg.h,v $ */ +/* $Revision: 1.19 $ */ +/* $Date: 2006/12/04 02:19:48 $ */ diff --git a/libtomcrypt/src/headers/tomcrypt_cipher.h b/libtomcrypt/src/headers/tomcrypt_cipher.h new file mode 100644 index 0000000..62a26c7 --- /dev/null +++ b/libtomcrypt/src/headers/tomcrypt_cipher.h @@ -0,0 +1,839 @@ +/* ---- SYMMETRIC KEY STUFF ----- + * + * We put each of the ciphers scheduled keys in their own structs then we put all of + * the key formats in one union. This makes the function prototypes easier to use. + */ +#ifdef BLOWFISH +struct blowfish_key { + ulong32 S[4][256]; + ulong32 K[18]; +}; +#endif + +#ifdef RC5 +struct rc5_key { + int rounds; + ulong32 K[50]; +}; +#endif + +#ifdef RC6 +struct rc6_key { + ulong32 K[44]; +}; +#endif + +#ifdef SAFERP +struct saferp_key { + unsigned char K[33][16]; + long rounds; +}; +#endif + +#ifdef RIJNDAEL +struct rijndael_key { + ulong32 eK[60], dK[60]; + int Nr; +}; +#endif + +#ifdef KSEED +struct kseed_key { + ulong32 K[32], dK[32]; +}; +#endif + +#ifdef LTC_KASUMI +struct kasumi_key { + ulong32 KLi1[8], KLi2[8], + KOi1[8], KOi2[8], KOi3[8], + KIi1[8], KIi2[8], KIi3[8]; +}; +#endif + +#ifdef XTEA +struct xtea_key { + unsigned long A[32], B[32]; +}; +#endif + +#ifdef TWOFISH +#ifndef TWOFISH_SMALL + struct twofish_key { + ulong32 S[4][256], K[40]; + }; +#else + struct twofish_key { + ulong32 K[40]; + unsigned char S[32], start; + }; +#endif +#endif + +#ifdef SAFER +#define SAFER_K64_DEFAULT_NOF_ROUNDS 6 +#define SAFER_K128_DEFAULT_NOF_ROUNDS 10 +#define SAFER_SK64_DEFAULT_NOF_ROUNDS 8 +#define SAFER_SK128_DEFAULT_NOF_ROUNDS 10 +#define SAFER_MAX_NOF_ROUNDS 13 +#define SAFER_BLOCK_LEN 8 +#define SAFER_KEY_LEN (1 + SAFER_BLOCK_LEN * (1 + 2 * SAFER_MAX_NOF_ROUNDS)) +typedef unsigned char safer_block_t[SAFER_BLOCK_LEN]; +typedef unsigned char safer_key_t[SAFER_KEY_LEN]; +struct safer_key { safer_key_t key; }; +#endif + +#ifdef RC2 +struct rc2_key { unsigned xkey[64]; }; +#endif + +#ifdef DES +struct des_key { + ulong32 ek[32], dk[32]; +}; + +struct des3_key { + ulong32 ek[3][32], dk[3][32]; +}; +#endif + +#ifdef CAST5 +struct cast5_key { + ulong32 K[32], keylen; +}; +#endif + +#ifdef NOEKEON +struct noekeon_key { + ulong32 K[4], dK[4]; +}; +#endif + +#ifdef SKIPJACK +struct skipjack_key { + unsigned char key[10]; +}; +#endif + +#ifdef KHAZAD +struct khazad_key { + ulong64 roundKeyEnc[8 + 1]; + ulong64 roundKeyDec[8 + 1]; +}; +#endif + +#ifdef ANUBIS +struct anubis_key { + int keyBits; + int R; + ulong32 roundKeyEnc[18 + 1][4]; + ulong32 roundKeyDec[18 + 1][4]; +}; +#endif + +typedef union Symmetric_key { +#ifdef DES + struct des_key des; + struct des3_key des3; +#endif +#ifdef RC2 + struct rc2_key rc2; +#endif +#ifdef SAFER + struct safer_key safer; +#endif +#ifdef TWOFISH + struct twofish_key twofish; +#endif +#ifdef BLOWFISH + struct blowfish_key blowfish; +#endif +#ifdef RC5 + struct rc5_key rc5; +#endif +#ifdef RC6 + struct rc6_key rc6; +#endif +#ifdef SAFERP + struct saferp_key saferp; +#endif +#ifdef RIJNDAEL + struct rijndael_key rijndael; +#endif +#ifdef XTEA + struct xtea_key xtea; +#endif +#ifdef CAST5 + struct cast5_key cast5; +#endif +#ifdef NOEKEON + struct noekeon_key noekeon; +#endif +#ifdef SKIPJACK + struct skipjack_key skipjack; +#endif +#ifdef KHAZAD + struct khazad_key khazad; +#endif +#ifdef ANUBIS + struct anubis_key anubis; +#endif +#ifdef KSEED + struct kseed_key kseed; +#endif +#ifdef LTC_KASUMI + struct kasumi_key kasumi; +#endif + void *data; +} symmetric_key; + +#ifdef LTC_ECB_MODE +/** A block cipher ECB structure */ +typedef struct { + /** The index of the cipher chosen */ + int cipher, + /** The block size of the given cipher */ + blocklen; + /** The scheduled key */ + symmetric_key key; +} symmetric_ECB; +#endif + +#ifdef LTC_CFB_MODE +/** A block cipher CFB structure */ +typedef struct { + /** The index of the cipher chosen */ + int cipher, + /** The block size of the given cipher */ + blocklen, + /** The padding offset */ + padlen; + /** The current IV */ + unsigned char IV[MAXBLOCKSIZE], + /** The pad used to encrypt/decrypt */ + pad[MAXBLOCKSIZE]; + /** The scheduled key */ + symmetric_key key; +} symmetric_CFB; +#endif + +#ifdef LTC_OFB_MODE +/** A block cipher OFB structure */ +typedef struct { + /** The index of the cipher chosen */ + int cipher, + /** The block size of the given cipher */ + blocklen, + /** The padding offset */ + padlen; + /** The current IV */ + unsigned char IV[MAXBLOCKSIZE]; + /** The scheduled key */ + symmetric_key key; +} symmetric_OFB; +#endif + +#ifdef LTC_CBC_MODE +/** A block cipher CBC structure */ +typedef struct { + /** The index of the cipher chosen */ + int cipher, + /** The block size of the given cipher */ + blocklen; + /** The current IV */ + unsigned char IV[MAXBLOCKSIZE]; + /** The scheduled key */ + symmetric_key key; +} symmetric_CBC; +#endif + + +#ifdef LTC_CTR_MODE +/** A block cipher CTR structure */ +typedef struct { + /** The index of the cipher chosen */ + int cipher, + /** The block size of the given cipher */ + blocklen, + /** The padding offset */ + padlen, + /** The mode (endianess) of the CTR, 0==little, 1==big */ + mode; + /** The counter */ + unsigned char ctr[MAXBLOCKSIZE], + /** The pad used to encrypt/decrypt */ + pad[MAXBLOCKSIZE]; + /** The scheduled key */ + symmetric_key key; +} symmetric_CTR; +#endif + + +#ifdef LTC_LRW_MODE +/** A LRW structure */ +typedef struct { + /** The index of the cipher chosen (must be a 128-bit block cipher) */ + int cipher; + + /** The current IV */ + unsigned char IV[16], + + /** the tweak key */ + tweak[16], + + /** The current pad, it's the product of the first 15 bytes against the tweak key */ + pad[16]; + + /** The scheduled symmetric key */ + symmetric_key key; + +#ifdef LRW_TABLES + /** The pre-computed multiplication table */ + unsigned char PC[16][256][16]; +#endif +} symmetric_LRW; +#endif + +#ifdef LTC_F8_MODE +/** A block cipher F8 structure */ +typedef struct { + /** The index of the cipher chosen */ + int cipher, + /** The block size of the given cipher */ + blocklen, + /** The padding offset */ + padlen; + /** The current IV */ + unsigned char IV[MAXBLOCKSIZE], + MIV[MAXBLOCKSIZE]; + /** Current block count */ + ulong32 blockcnt; + /** The scheduled key */ + symmetric_key key; +} symmetric_F8; +#endif + + +/** cipher descriptor table, last entry has "name == NULL" to mark the end of table */ +extern struct ltc_cipher_descriptor { + /** name of cipher */ + char *name; + /** internal ID */ + unsigned char ID; + /** min keysize (octets) */ + int min_key_length, + /** max keysize (octets) */ + max_key_length, + /** block size (octets) */ + block_length, + /** default number of rounds */ + default_rounds; + /** Setup the cipher + @param key The input symmetric key + @param keylen The length of the input key (octets) + @param num_rounds The requested number of rounds (0==default) + @param skey [out] The destination of the scheduled key + @return CRYPT_OK if successful + */ + int (*setup)(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey); + /** Encrypt a block + @param pt The plaintext + @param ct [out] The ciphertext + @param skey The scheduled key + @return CRYPT_OK if successful + */ + int (*ecb_encrypt)(const unsigned char *pt, unsigned char *ct, symmetric_key *skey); + /** Decrypt a block + @param ct The ciphertext + @param pt [out] The plaintext + @param skey The scheduled key + @return CRYPT_OK if successful + */ + int (*ecb_decrypt)(const unsigned char *ct, unsigned char *pt, symmetric_key *skey); + /** Test the block cipher + @return CRYPT_OK if successful, CRYPT_NOP if self-testing has been disabled + */ + int (*test)(void); + + /** Terminate the context + @param skey The scheduled key + */ + void (*done)(symmetric_key *skey); + + /** Determine a key size + @param keysize [in/out] The size of the key desired and the suggested size + @return CRYPT_OK if successful + */ + int (*keysize)(int *keysize); + +/** Accelerators **/ + /** Accelerated ECB encryption + @param pt Plaintext + @param ct Ciphertext + @param blocks The number of complete blocks to process + @param skey The scheduled key context + @return CRYPT_OK if successful + */ + int (*accel_ecb_encrypt)(const unsigned char *pt, unsigned char *ct, unsigned long blocks, symmetric_key *skey); + + /** Accelerated ECB decryption + @param pt Plaintext + @param ct Ciphertext + @param blocks The number of complete blocks to process + @param skey The scheduled key context + @return CRYPT_OK if successful + */ + int (*accel_ecb_decrypt)(const unsigned char *ct, unsigned char *pt, unsigned long blocks, symmetric_key *skey); + + /** Accelerated CBC encryption + @param pt Plaintext + @param ct Ciphertext + @param blocks The number of complete blocks to process + @param IV The initial value (input/output) + @param skey The scheduled key context + @return CRYPT_OK if successful + */ + int (*accel_cbc_encrypt)(const unsigned char *pt, unsigned char *ct, unsigned long blocks, unsigned char *IV, symmetric_key *skey); + + /** Accelerated CBC decryption + @param pt Plaintext + @param ct Ciphertext + @param blocks The number of complete blocks to process + @param IV The initial value (input/output) + @param skey The scheduled key context + @return CRYPT_OK if successful + */ + int (*accel_cbc_decrypt)(const unsigned char *ct, unsigned char *pt, unsigned long blocks, unsigned char *IV, symmetric_key *skey); + + /** Accelerated CTR encryption + @param pt Plaintext + @param ct Ciphertext + @param blocks The number of complete blocks to process + @param IV The initial value (input/output) + @param mode little or big endian counter (mode=0 or mode=1) + @param skey The scheduled key context + @return CRYPT_OK if successful + */ + int (*accel_ctr_encrypt)(const unsigned char *pt, unsigned char *ct, unsigned long blocks, unsigned char *IV, int mode, symmetric_key *skey); + + /** Accelerated LRW + @param pt Plaintext + @param ct Ciphertext + @param blocks The number of complete blocks to process + @param IV The initial value (input/output) + @param tweak The LRW tweak + @param skey The scheduled key context + @return CRYPT_OK if successful + */ + int (*accel_lrw_encrypt)(const unsigned char *pt, unsigned char *ct, unsigned long blocks, unsigned char *IV, const unsigned char *tweak, symmetric_key *skey); + + /** Accelerated LRW + @param ct Ciphertext + @param pt Plaintext + @param blocks The number of complete blocks to process + @param IV The initial value (input/output) + @param tweak The LRW tweak + @param skey The scheduled key context + @return CRYPT_OK if successful + */ + int (*accel_lrw_decrypt)(const unsigned char *ct, unsigned char *pt, unsigned long blocks, unsigned char *IV, const unsigned char *tweak, symmetric_key *skey); + + /** Accelerated CCM packet (one-shot) + @param key The secret key to use + @param keylen The length of the secret key (octets) + @param uskey A previously scheduled key [optional can be NULL] + @param nonce The session nonce [use once] + @param noncelen The length of the nonce + @param header The header for the session + @param headerlen The length of the header (octets) + @param pt [out] The plaintext + @param ptlen The length of the plaintext (octets) + @param ct [out] The ciphertext + @param tag [out] The destination tag + @param taglen [in/out] The max size and resulting size of the authentication tag + @param direction Encrypt or Decrypt direction (0 or 1) + @return CRYPT_OK if successful + */ + int (*accel_ccm_memory)( + const unsigned char *key, unsigned long keylen, + symmetric_key *uskey, + const unsigned char *nonce, unsigned long noncelen, + const unsigned char *header, unsigned long headerlen, + unsigned char *pt, unsigned long ptlen, + unsigned char *ct, + unsigned char *tag, unsigned long *taglen, + int direction); + + /** Accelerated GCM packet (one shot) + @param key The secret key + @param keylen The length of the secret key + @param IV The initial vector + @param IVlen The length of the initial vector + @param adata The additional authentication data (header) + @param adatalen The length of the adata + @param pt The plaintext + @param ptlen The length of the plaintext (ciphertext length is the same) + @param ct The ciphertext + @param tag [out] The MAC tag + @param taglen [in/out] The MAC tag length + @param direction Encrypt or Decrypt mode (GCM_ENCRYPT or GCM_DECRYPT) + @return CRYPT_OK on success + */ + int (*accel_gcm_memory)( + const unsigned char *key, unsigned long keylen, + const unsigned char *IV, unsigned long IVlen, + const unsigned char *adata, unsigned long adatalen, + unsigned char *pt, unsigned long ptlen, + unsigned char *ct, + unsigned char *tag, unsigned long *taglen, + int direction); + + /** Accelerated one shot OMAC + @param key The secret key + @param keylen The key length (octets) + @param in The message + @param inlen Length of message (octets) + @param out [out] Destination for tag + @param outlen [in/out] Initial and final size of out + @return CRYPT_OK on success + */ + int (*omac_memory)( + const unsigned char *key, unsigned long keylen, + const unsigned char *in, unsigned long inlen, + unsigned char *out, unsigned long *outlen); + + /** Accelerated one shot XCBC + @param key The secret key + @param keylen The key length (octets) + @param in The message + @param inlen Length of message (octets) + @param out [out] Destination for tag + @param outlen [in/out] Initial and final size of out + @return CRYPT_OK on success + */ + int (*xcbc_memory)( + const unsigned char *key, unsigned long keylen, + const unsigned char *in, unsigned long inlen, + unsigned char *out, unsigned long *outlen); + + /** Accelerated one shot F9 + @param key The secret key + @param keylen The key length (octets) + @param in The message + @param inlen Length of message (octets) + @param out [out] Destination for tag + @param outlen [in/out] Initial and final size of out + @return CRYPT_OK on success + @remark Requires manual padding + */ + int (*f9_memory)( + const unsigned char *key, unsigned long keylen, + const unsigned char *in, unsigned long inlen, + unsigned char *out, unsigned long *outlen); +} cipher_descriptor[]; + +#ifdef BLOWFISH +int blowfish_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey); +int blowfish_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key *skey); +int blowfish_ecb_decrypt(const unsigned char *ct, unsigned char *pt, symmetric_key *skey); +int blowfish_test(void); +void blowfish_done(symmetric_key *skey); +int blowfish_keysize(int *keysize); +extern const struct ltc_cipher_descriptor blowfish_desc; +#endif + +#ifdef RC5 +int rc5_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey); +int rc5_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key *skey); +int rc5_ecb_decrypt(const unsigned char *ct, unsigned char *pt, symmetric_key *skey); +int rc5_test(void); +void rc5_done(symmetric_key *skey); +int rc5_keysize(int *keysize); +extern const struct ltc_cipher_descriptor rc5_desc; +#endif + +#ifdef RC6 +int rc6_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey); +int rc6_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key *skey); +int rc6_ecb_decrypt(const unsigned char *ct, unsigned char *pt, symmetric_key *skey); +int rc6_test(void); +void rc6_done(symmetric_key *skey); +int rc6_keysize(int *keysize); +extern const struct ltc_cipher_descriptor rc6_desc; +#endif + +#ifdef RC2 +int rc2_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey); +int rc2_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key *skey); +int rc2_ecb_decrypt(const unsigned char *ct, unsigned char *pt, symmetric_key *skey); +int rc2_test(void); +void rc2_done(symmetric_key *skey); +int rc2_keysize(int *keysize); +extern const struct ltc_cipher_descriptor rc2_desc; +#endif + +#ifdef SAFERP +int saferp_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey); +int saferp_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key *skey); +int saferp_ecb_decrypt(const unsigned char *ct, unsigned char *pt, symmetric_key *skey); +int saferp_test(void); +void saferp_done(symmetric_key *skey); +int saferp_keysize(int *keysize); +extern const struct ltc_cipher_descriptor saferp_desc; +#endif + +#ifdef SAFER +int safer_k64_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey); +int safer_sk64_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey); +int safer_k128_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey); +int safer_sk128_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey); +int safer_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key *key); +int safer_ecb_decrypt(const unsigned char *ct, unsigned char *pt, symmetric_key *key); +int safer_k64_test(void); +int safer_sk64_test(void); +int safer_sk128_test(void); +void safer_done(symmetric_key *skey); +int safer_64_keysize(int *keysize); +int safer_128_keysize(int *keysize); +extern const struct ltc_cipher_descriptor safer_k64_desc, safer_k128_desc, safer_sk64_desc, safer_sk128_desc; +#endif + +#ifdef RIJNDAEL + +/* make aes an alias */ +#define aes_setup rijndael_setup +#define aes_ecb_encrypt rijndael_ecb_encrypt +#define aes_ecb_decrypt rijndael_ecb_decrypt +#define aes_test rijndael_test +#define aes_done rijndael_done +#define aes_keysize rijndael_keysize + +#define aes_enc_setup rijndael_enc_setup +#define aes_enc_ecb_encrypt rijndael_enc_ecb_encrypt +#define aes_enc_keysize rijndael_enc_keysize + +int rijndael_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey); +int rijndael_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key *skey); +int rijndael_ecb_decrypt(const unsigned char *ct, unsigned char *pt, symmetric_key *skey); +int rijndael_test(void); +void rijndael_done(symmetric_key *skey); +int rijndael_keysize(int *keysize); +int rijndael_enc_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey); +int rijndael_enc_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key *skey); +void rijndael_enc_done(symmetric_key *skey); +int rijndael_enc_keysize(int *keysize); +extern const struct ltc_cipher_descriptor rijndael_desc, aes_desc; +extern const struct ltc_cipher_descriptor rijndael_enc_desc, aes_enc_desc; +#endif + +#ifdef XTEA +int xtea_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey); +int xtea_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key *skey); +int xtea_ecb_decrypt(const unsigned char *ct, unsigned char *pt, symmetric_key *skey); +int xtea_test(void); +void xtea_done(symmetric_key *skey); +int xtea_keysize(int *keysize); +extern const struct ltc_cipher_descriptor xtea_desc; +#endif + +#ifdef TWOFISH +int twofish_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey); +int twofish_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key *skey); +int twofish_ecb_decrypt(const unsigned char *ct, unsigned char *pt, symmetric_key *skey); +int twofish_test(void); +void twofish_done(symmetric_key *skey); +int twofish_keysize(int *keysize); +extern const struct ltc_cipher_descriptor twofish_desc; +#endif + +#ifdef DES +int des_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey); +int des_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key *skey); +int des_ecb_decrypt(const unsigned char *ct, unsigned char *pt, symmetric_key *skey); +int des_test(void); +void des_done(symmetric_key *skey); +int des_keysize(int *keysize); +int des3_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey); +int des3_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key *skey); +int des3_ecb_decrypt(const unsigned char *ct, unsigned char *pt, symmetric_key *skey); +int des3_test(void); +void des3_done(symmetric_key *skey); +int des3_keysize(int *keysize); +extern const struct ltc_cipher_descriptor des_desc, des3_desc; +#endif + +#ifdef CAST5 +int cast5_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey); +int cast5_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key *skey); +int cast5_ecb_decrypt(const unsigned char *ct, unsigned char *pt, symmetric_key *skey); +int cast5_test(void); +void cast5_done(symmetric_key *skey); +int cast5_keysize(int *keysize); +extern const struct ltc_cipher_descriptor cast5_desc; +#endif + +#ifdef NOEKEON +int noekeon_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey); +int noekeon_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key *skey); +int noekeon_ecb_decrypt(const unsigned char *ct, unsigned char *pt, symmetric_key *skey); +int noekeon_test(void); +void noekeon_done(symmetric_key *skey); +int noekeon_keysize(int *keysize); +extern const struct ltc_cipher_descriptor noekeon_desc; +#endif + +#ifdef SKIPJACK +int skipjack_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey); +int skipjack_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key *skey); +int skipjack_ecb_decrypt(const unsigned char *ct, unsigned char *pt, symmetric_key *skey); +int skipjack_test(void); +void skipjack_done(symmetric_key *skey); +int skipjack_keysize(int *keysize); +extern const struct ltc_cipher_descriptor skipjack_desc; +#endif + +#ifdef KHAZAD +int khazad_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey); +int khazad_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key *skey); +int khazad_ecb_decrypt(const unsigned char *ct, unsigned char *pt, symmetric_key *skey); +int khazad_test(void); +void khazad_done(symmetric_key *skey); +int khazad_keysize(int *keysize); +extern const struct ltc_cipher_descriptor khazad_desc; +#endif + +#ifdef ANUBIS +int anubis_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey); +int anubis_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key *skey); +int anubis_ecb_decrypt(const unsigned char *ct, unsigned char *pt, symmetric_key *skey); +int anubis_test(void); +void anubis_done(symmetric_key *skey); +int anubis_keysize(int *keysize); +extern const struct ltc_cipher_descriptor anubis_desc; +#endif + +#ifdef KSEED +int kseed_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey); +int kseed_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key *skey); +int kseed_ecb_decrypt(const unsigned char *ct, unsigned char *pt, symmetric_key *skey); +int kseed_test(void); +void kseed_done(symmetric_key *skey); +int kseed_keysize(int *keysize); +extern const struct ltc_cipher_descriptor kseed_desc; +#endif + +#ifdef LTC_KASUMI +int kasumi_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey); +int kasumi_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key *skey); +int kasumi_ecb_decrypt(const unsigned char *ct, unsigned char *pt, symmetric_key *skey); +int kasumi_test(void); +void kasumi_done(symmetric_key *skey); +int kasumi_keysize(int *keysize); +extern const struct ltc_cipher_descriptor kasumi_desc; +#endif + +#ifdef LTC_ECB_MODE +int ecb_start(int cipher, const unsigned char *key, + int keylen, int num_rounds, symmetric_ECB *ecb); +int ecb_encrypt(const unsigned char *pt, unsigned char *ct, unsigned long len, symmetric_ECB *ecb); +int ecb_decrypt(const unsigned char *ct, unsigned char *pt, unsigned long len, symmetric_ECB *ecb); +int ecb_done(symmetric_ECB *ecb); +#endif + +#ifdef LTC_CFB_MODE +int cfb_start(int cipher, const unsigned char *IV, const unsigned char *key, + int keylen, int num_rounds, symmetric_CFB *cfb); +int cfb_encrypt(const unsigned char *pt, unsigned char *ct, unsigned long len, symmetric_CFB *cfb); +int cfb_decrypt(const unsigned char *ct, unsigned char *pt, unsigned long len, symmetric_CFB *cfb); +int cfb_getiv(unsigned char *IV, unsigned long *len, symmetric_CFB *cfb); +int cfb_setiv(const unsigned char *IV, unsigned long len, symmetric_CFB *cfb); +int cfb_done(symmetric_CFB *cfb); +#endif + +#ifdef LTC_OFB_MODE +int ofb_start(int cipher, const unsigned char *IV, const unsigned char *key, + int keylen, int num_rounds, symmetric_OFB *ofb); +int ofb_encrypt(const unsigned char *pt, unsigned char *ct, unsigned long len, symmetric_OFB *ofb); +int ofb_decrypt(const unsigned char *ct, unsigned char *pt, unsigned long len, symmetric_OFB *ofb); +int ofb_getiv(unsigned char *IV, unsigned long *len, symmetric_OFB *ofb); +int ofb_setiv(const unsigned char *IV, unsigned long len, symmetric_OFB *ofb); +int ofb_done(symmetric_OFB *ofb); +#endif + +#ifdef LTC_CBC_MODE +int cbc_start(int cipher, const unsigned char *IV, const unsigned char *key, + int keylen, int num_rounds, symmetric_CBC *cbc); +int cbc_encrypt(const unsigned char *pt, unsigned char *ct, unsigned long len, symmetric_CBC *cbc); +int cbc_decrypt(const unsigned char *ct, unsigned char *pt, unsigned long len, symmetric_CBC *cbc); +int cbc_getiv(unsigned char *IV, unsigned long *len, symmetric_CBC *cbc); +int cbc_setiv(const unsigned char *IV, unsigned long len, symmetric_CBC *cbc); +int cbc_done(symmetric_CBC *cbc); +#endif + +#ifdef LTC_CTR_MODE + +#define CTR_COUNTER_LITTLE_ENDIAN 0 +#define CTR_COUNTER_BIG_ENDIAN 1 +#define LTC_CTR_RFC3686 2 + +int ctr_start( int cipher, + const unsigned char *IV, + const unsigned char *key, int keylen, + int num_rounds, int ctr_mode, + symmetric_CTR *ctr); +int ctr_encrypt(const unsigned char *pt, unsigned char *ct, unsigned long len, symmetric_CTR *ctr); +int ctr_decrypt(const unsigned char *ct, unsigned char *pt, unsigned long len, symmetric_CTR *ctr); +int ctr_getiv(unsigned char *IV, unsigned long *len, symmetric_CTR *ctr); +int ctr_setiv(const unsigned char *IV, unsigned long len, symmetric_CTR *ctr); +int ctr_done(symmetric_CTR *ctr); +int ctr_test(void); +#endif + +#ifdef LTC_LRW_MODE + +#define LRW_ENCRYPT 0 +#define LRW_DECRYPT 1 + +int lrw_start( int cipher, + const unsigned char *IV, + const unsigned char *key, int keylen, + const unsigned char *tweak, + int num_rounds, + symmetric_LRW *lrw); +int lrw_encrypt(const unsigned char *pt, unsigned char *ct, unsigned long len, symmetric_LRW *lrw); +int lrw_decrypt(const unsigned char *ct, unsigned char *pt, unsigned long len, symmetric_LRW *lrw); +int lrw_getiv(unsigned char *IV, unsigned long *len, symmetric_LRW *lrw); +int lrw_setiv(const unsigned char *IV, unsigned long len, symmetric_LRW *lrw); +int lrw_done(symmetric_LRW *lrw); +int lrw_test(void); + +/* don't call */ +int lrw_process(const unsigned char *pt, unsigned char *ct, unsigned long len, int mode, symmetric_LRW *lrw); +#endif + +#ifdef LTC_F8_MODE +int f8_start( int cipher, const unsigned char *IV, + const unsigned char *key, int keylen, + const unsigned char *salt_key, int skeylen, + int num_rounds, symmetric_F8 *f8); +int f8_encrypt(const unsigned char *pt, unsigned char *ct, unsigned long len, symmetric_F8 *f8); +int f8_decrypt(const unsigned char *ct, unsigned char *pt, unsigned long len, symmetric_F8 *f8); +int f8_getiv(unsigned char *IV, unsigned long *len, symmetric_F8 *f8); +int f8_setiv(const unsigned char *IV, unsigned long len, symmetric_F8 *f8); +int f8_done(symmetric_F8 *f8); +int f8_test_mode(void); +#endif + + +int find_cipher(const char *name); +int find_cipher_any(const char *name, int blocklen, int keylen); +int find_cipher_id(unsigned char ID); +int register_cipher(const struct ltc_cipher_descriptor *cipher); +int unregister_cipher(const struct ltc_cipher_descriptor *cipher); +int cipher_is_valid(int idx); + +LTC_MUTEX_PROTO(ltc_cipher_mutex) + +/* $Source: /cvs/libtom/libtomcrypt/src/headers/tomcrypt_cipher.h,v $ */ +/* $Revision: 1.46 $ */ +/* $Date: 2006/11/13 23:09:38 $ */ diff --git a/libtomcrypt/src/headers/tomcrypt_custom.h b/libtomcrypt/src/headers/tomcrypt_custom.h new file mode 100644 index 0000000..540514e --- /dev/null +++ b/libtomcrypt/src/headers/tomcrypt_custom.h @@ -0,0 +1,153 @@ +#ifndef TOMCRYPT_CUSTOM_H_ +#define TOMCRYPT_CUSTOM_H_ + +/* this will sort out which stuff based on the user-config in options.h */ +#include "options.h" + +/* macros for various libc functions you can change for embedded targets */ +#ifndef XMALLOC + #ifdef malloc + #define LTC_NO_PROTOTYPES + #endif +#define XMALLOC malloc +#endif +#ifndef XREALLOC + #ifdef realloc + #define LTC_NO_PROTOTYPES + #endif +#define XREALLOC realloc +#endif +#ifndef XCALLOC + #ifdef calloc + #define LTC_NO_PROTOTYPES + #endif +#define XCALLOC calloc +#endif +#ifndef XFREE + #ifdef free + #define LTC_NO_PROTOTYPES + #endif +#define XFREE free +#endif + +#ifndef XMEMSET + #ifdef memset + #define LTC_NO_PROTOTYPES + #endif +#define XMEMSET memset +#endif +#ifndef XMEMCPY + #ifdef memcpy + #define LTC_NO_PROTOTYPES + #endif +#define XMEMCPY memcpy +#endif +#ifndef XMEMCMP + #ifdef memcmp + #define LTC_NO_PROTOTYPES + #endif +#define XMEMCMP memcmp +#endif +#ifndef XSTRCMP + #ifdef strcmp + #define LTC_NO_PROTOTYPES + #endif +#define XSTRCMP strcmp +#endif + +#ifndef XCLOCK +#define XCLOCK clock +#endif +#ifndef XCLOCKS_PER_SEC +#define XCLOCKS_PER_SEC CLOCKS_PER_SEC +#endif + + #define LTC_NO_PRNGS + #define LTC_NO_PK +#ifdef DROPBEAR_SMALL_CODE +#define LTC_SMALL_CODE +#endif +/* These spit out warnings etc */ +#define LTC_NO_ROLC + +/* Enable self-test test vector checking */ +/* Not for dropbear */ +//#define LTC_TEST + +/* clean the stack of functions which put private information on stack */ +/* #define LTC_CLEAN_STACK */ + +/* disable all file related functions */ +/* #define LTC_NO_FILE */ + +/* disable all forms of ASM */ +/* #define LTC_NO_ASM */ + +/* disable FAST mode */ +/* #define LTC_NO_FAST */ + +/* disable BSWAP on x86 */ +/* #define LTC_NO_BSWAP */ + + +#ifdef DROPBEAR_BLOWFISH_CBC +#define BLOWFISH +#endif + +#ifdef DROPBEAR_AES_CBC +#define RIJNDAEL +#endif + +#ifdef DROPBEAR_TWOFISH_CBC +#define TWOFISH + +/* enabling just TWOFISH_SMALL will make the binary ~1kB smaller, turning on + * TWOFISH_TABLES will make it a few kB bigger, but perhaps reduces runtime + * memory usage? */ +#define TWOFISH_SMALL +/*#define TWOFISH_TABLES*/ +#endif + +#ifdef DROPBEAR_3DES_CBC +#define DES +#endif +#define CBC + +#if defined(DROPBEAR_DSS) && defined(DSS_PROTOK) +#define SHA512 +#endif + +#define SHA1 + +#ifdef DROPBEAR_MD5_HMAC +#define MD5 +#endif + +#define HMAC + +/* Various tidbits of modern neatoness */ +#define BASE64 + +/* default no functions */ +#define LTC_MUTEX_GLOBAL(x) +#define LTC_MUTEX_PROTO(x) +#define LTC_MUTEX_TYPE(x) +#define LTC_MUTEX_INIT(x) +#define LTC_MUTEX_LOCK(x) +#define LTC_MUTEX_UNLOCK(x) +#define FORTUNA_POOLS 0 + +#endif + +/* Debuggers */ + +/* define this if you use Valgrind, note: it CHANGES the way SOBER-128 and RC4 work (see the code) */ +/* #define LTC_VALGRIND */ + +#endif + + + +/* $Source: /cvs/libtom/libtomcrypt/src/headers/tomcrypt_custom.h,v $ */ +/* $Revision: 1.66 $ */ +/* $Date: 2006/12/04 02:50:11 $ */ diff --git a/libtomcrypt/src/headers/tomcrypt_hash.h b/libtomcrypt/src/headers/tomcrypt_hash.h new file mode 100644 index 0000000..d9916ac --- /dev/null +++ b/libtomcrypt/src/headers/tomcrypt_hash.h @@ -0,0 +1,379 @@ +/* ---- HASH FUNCTIONS ---- */ +#ifdef SHA512 +struct sha512_state { + ulong64 length, state[8]; + unsigned long curlen; + unsigned char buf[128]; +}; +#endif + +#ifdef SHA256 +struct sha256_state { + ulong64 length; + ulong32 state[8], curlen; + unsigned char buf[64]; +}; +#endif + +#ifdef SHA1 +struct sha1_state { + ulong64 length; + ulong32 state[5], curlen; + unsigned char buf[64]; +}; +#endif + +#ifdef MD5 +struct md5_state { + ulong64 length; + ulong32 state[4], curlen; + unsigned char buf[64]; +}; +#endif + +#ifdef MD4 +struct md4_state { + ulong64 length; + ulong32 state[4], curlen; + unsigned char buf[64]; +}; +#endif + +#ifdef TIGER +struct tiger_state { + ulong64 state[3], length; + unsigned long curlen; + unsigned char buf[64]; +}; +#endif + +#ifdef MD2 +struct md2_state { + unsigned char chksum[16], X[48], buf[16]; + unsigned long curlen; +}; +#endif + +#ifdef RIPEMD128 +struct rmd128_state { + ulong64 length; + unsigned char buf[64]; + ulong32 curlen, state[4]; +}; +#endif + +#ifdef RIPEMD160 +struct rmd160_state { + ulong64 length; + unsigned char buf[64]; + ulong32 curlen, state[5]; +}; +#endif + +#ifdef RIPEMD256 +struct rmd256_state { + ulong64 length; + unsigned char buf[64]; + ulong32 curlen, state[8]; +}; +#endif + +#ifdef RIPEMD320 +struct rmd320_state { + ulong64 length; + unsigned char buf[64]; + ulong32 curlen, state[10]; +}; +#endif + +#ifdef WHIRLPOOL +struct whirlpool_state { + ulong64 length, state[8]; + unsigned char buf[64]; + ulong32 curlen; +}; +#endif + +#ifdef CHC_HASH +struct chc_state { + ulong64 length; + unsigned char state[MAXBLOCKSIZE], buf[MAXBLOCKSIZE]; + ulong32 curlen; +}; +#endif + +typedef union Hash_state { + char dummy[1]; +#ifdef CHC_HASH + struct chc_state chc; +#endif +#ifdef WHIRLPOOL + struct whirlpool_state whirlpool; +#endif +#ifdef SHA512 + struct sha512_state sha512; +#endif +#ifdef SHA256 + struct sha256_state sha256; +#endif +#ifdef SHA1 + struct sha1_state sha1; +#endif +#ifdef MD5 + struct md5_state md5; +#endif +#ifdef MD4 + struct md4_state md4; +#endif +#ifdef MD2 + struct md2_state md2; +#endif +#ifdef TIGER + struct tiger_state tiger; +#endif +#ifdef RIPEMD128 + struct rmd128_state rmd128; +#endif +#ifdef RIPEMD160 + struct rmd160_state rmd160; +#endif +#ifdef RIPEMD256 + struct rmd256_state rmd256; +#endif +#ifdef RIPEMD320 + struct rmd320_state rmd320; +#endif + void *data; +} hash_state; + +/** hash descriptor */ +extern struct ltc_hash_descriptor { + /** name of hash */ + char *name; + /** internal ID */ + unsigned char ID; + /** Size of digest in octets */ + unsigned long hashsize; + /** Input block size in octets */ + unsigned long blocksize; + /** ASN.1 OID */ + unsigned long OID[16]; + /** Length of DER encoding */ + unsigned long OIDlen; + + /** Init a hash state + @param hash The hash to initialize + @return CRYPT_OK if successful + */ + int (*init)(hash_state *hash); + /** Process a block of data + @param hash The hash state + @param in The data to hash + @param inlen The length of the data (octets) + @return CRYPT_OK if successful + */ + int (*process)(hash_state *hash, const unsigned char *in, unsigned long inlen); + /** Produce the digest and store it + @param hash The hash state + @param out [out] The destination of the digest + @return CRYPT_OK if successful + */ + int (*done)(hash_state *hash, unsigned char *out); + /** Self-test + @return CRYPT_OK if successful, CRYPT_NOP if self-tests have been disabled + */ + int (*test)(void); + + /* accelerated hmac callback: if you need to-do multiple packets just use the generic hmac_memory and provide a hash callback */ + int (*hmac_block)(const unsigned char *key, unsigned long keylen, + const unsigned char *in, unsigned long inlen, + unsigned char *out, unsigned long *outlen); + +} hash_descriptor[]; + +#ifdef CHC_HASH +int chc_register(int cipher); +int chc_init(hash_state * md); +int chc_process(hash_state * md, const unsigned char *in, unsigned long inlen); +int chc_done(hash_state * md, unsigned char *hash); +int chc_test(void); +extern const struct ltc_hash_descriptor chc_desc; +#endif + +#ifdef WHIRLPOOL +int whirlpool_init(hash_state * md); +int whirlpool_process(hash_state * md, const unsigned char *in, unsigned long inlen); +int whirlpool_done(hash_state * md, unsigned char *hash); +int whirlpool_test(void); +extern const struct ltc_hash_descriptor whirlpool_desc; +#endif + +#ifdef SHA512 +int sha512_init(hash_state * md); +int sha512_process(hash_state * md, const unsigned char *in, unsigned long inlen); +int sha512_done(hash_state * md, unsigned char *hash); +int sha512_test(void); +extern const struct ltc_hash_descriptor sha512_desc; +#endif + +#ifdef SHA384 +#ifndef SHA512 + #error SHA512 is required for SHA384 +#endif +int sha384_init(hash_state * md); +#define sha384_process sha512_process +int sha384_done(hash_state * md, unsigned char *hash); +int sha384_test(void); +extern const struct ltc_hash_descriptor sha384_desc; +#endif + +#ifdef SHA256 +int sha256_init(hash_state * md); +int sha256_process(hash_state * md, const unsigned char *in, unsigned long inlen); +int sha256_done(hash_state * md, unsigned char *hash); +int sha256_test(void); +extern const struct ltc_hash_descriptor sha256_desc; + +#ifdef SHA224 +#ifndef SHA256 + #error SHA256 is required for SHA224 +#endif +int sha224_init(hash_state * md); +#define sha224_process sha256_process +int sha224_done(hash_state * md, unsigned char *hash); +int sha224_test(void); +extern const struct ltc_hash_descriptor sha224_desc; +#endif +#endif + +#ifdef SHA1 +int sha1_init(hash_state * md); +int sha1_process(hash_state * md, const unsigned char *in, unsigned long inlen); +int sha1_done(hash_state * md, unsigned char *hash); +int sha1_test(void); +extern const struct ltc_hash_descriptor sha1_desc; +#endif + +#ifdef MD5 +int md5_init(hash_state * md); +int md5_process(hash_state * md, const unsigned char *in, unsigned long inlen); +int md5_done(hash_state * md, unsigned char *hash); +int md5_test(void); +extern const struct ltc_hash_descriptor md5_desc; +#endif + +#ifdef MD4 +int md4_init(hash_state * md); +int md4_process(hash_state * md, const unsigned char *in, unsigned long inlen); +int md4_done(hash_state * md, unsigned char *hash); +int md4_test(void); +extern const struct ltc_hash_descriptor md4_desc; +#endif + +#ifdef MD2 +int md2_init(hash_state * md); +int md2_process(hash_state * md, const unsigned char *in, unsigned long inlen); +int md2_done(hash_state * md, unsigned char *hash); +int md2_test(void); +extern const struct ltc_hash_descriptor md2_desc; +#endif + +#ifdef TIGER +int tiger_init(hash_state * md); +int tiger_process(hash_state * md, const unsigned char *in, unsigned long inlen); +int tiger_done(hash_state * md, unsigned char *hash); +int tiger_test(void); +extern const struct ltc_hash_descriptor tiger_desc; +#endif + +#ifdef RIPEMD128 +int rmd128_init(hash_state * md); +int rmd128_process(hash_state * md, const unsigned char *in, unsigned long inlen); +int rmd128_done(hash_state * md, unsigned char *hash); +int rmd128_test(void); +extern const struct ltc_hash_descriptor rmd128_desc; +#endif + +#ifdef RIPEMD160 +int rmd160_init(hash_state * md); +int rmd160_process(hash_state * md, const unsigned char *in, unsigned long inlen); +int rmd160_done(hash_state * md, unsigned char *hash); +int rmd160_test(void); +extern const struct ltc_hash_descriptor rmd160_desc; +#endif + +#ifdef RIPEMD256 +int rmd256_init(hash_state * md); +int rmd256_process(hash_state * md, const unsigned char *in, unsigned long inlen); +int rmd256_done(hash_state * md, unsigned char *hash); +int rmd256_test(void); +extern const struct ltc_hash_descriptor rmd256_desc; +#endif + +#ifdef RIPEMD320 +int rmd320_init(hash_state * md); +int rmd320_process(hash_state * md, const unsigned char *in, unsigned long inlen); +int rmd320_done(hash_state * md, unsigned char *hash); +int rmd320_test(void); +extern const struct ltc_hash_descriptor rmd320_desc; +#endif + + +int find_hash(const char *name); +int find_hash_id(unsigned char ID); +int find_hash_oid(const unsigned long *ID, unsigned long IDlen); +int find_hash_any(const char *name, int digestlen); +int register_hash(const struct ltc_hash_descriptor *hash); +int unregister_hash(const struct ltc_hash_descriptor *hash); +int hash_is_valid(int idx); + +LTC_MUTEX_PROTO(ltc_hash_mutex) + +int hash_memory(int hash, + const unsigned char *in, unsigned long inlen, + unsigned char *out, unsigned long *outlen); +int hash_memory_multi(int hash, unsigned char *out, unsigned long *outlen, + const unsigned char *in, unsigned long inlen, ...); +int hash_filehandle(int hash, FILE *in, unsigned char *out, unsigned long *outlen); +int hash_file(int hash, const char *fname, unsigned char *out, unsigned long *outlen); + +/* a simple macro for making hash "process" functions */ +#define HASH_PROCESS(func_name, compress_name, state_var, block_size) \ +int func_name (hash_state * md, const unsigned char *in, unsigned long inlen) \ +{ \ + unsigned long n; \ + int err; \ + LTC_ARGCHK(md != NULL); \ + LTC_ARGCHK(in != NULL); \ + if (md-> state_var .curlen > sizeof(md-> state_var .buf)) { \ + return CRYPT_INVALID_ARG; \ + } \ + while (inlen > 0) { \ + if (md-> state_var .curlen == 0 && inlen >= block_size) { \ + if ((err = compress_name (md, (unsigned char *)in)) != CRYPT_OK) { \ + return err; \ + } \ + md-> state_var .length += block_size * 8; \ + in += block_size; \ + inlen -= block_size; \ + } else { \ + n = MIN(inlen, (block_size - md-> state_var .curlen)); \ + memcpy(md-> state_var .buf + md-> state_var.curlen, in, (size_t)n); \ + md-> state_var .curlen += n; \ + in += n; \ + inlen -= n; \ + if (md-> state_var .curlen == block_size) { \ + if ((err = compress_name (md, md-> state_var .buf)) != CRYPT_OK) { \ + return err; \ + } \ + md-> state_var .length += 8*block_size; \ + md-> state_var .curlen = 0; \ + } \ + } \ + } \ + return CRYPT_OK; \ +} + +/* $Source: /cvs/libtom/libtomcrypt/src/headers/tomcrypt_hash.h,v $ */ +/* $Revision: 1.19 $ */ +/* $Date: 2006/11/05 01:36:43 $ */ diff --git a/libtomcrypt/src/headers/tomcrypt_mac.h b/libtomcrypt/src/headers/tomcrypt_mac.h new file mode 100644 index 0000000..42bf680 --- /dev/null +++ b/libtomcrypt/src/headers/tomcrypt_mac.h @@ -0,0 +1,381 @@ +#ifdef LTC_HMAC +typedef struct Hmac_state { + hash_state md; + int hash; + hash_state hashstate; + unsigned char *key; +} hmac_state; + +int hmac_init(hmac_state *hmac, int hash, const unsigned char *key, unsigned long keylen); +int hmac_process(hmac_state *hmac, const unsigned char *in, unsigned long inlen); +int hmac_done(hmac_state *hmac, unsigned char *out, unsigned long *outlen); +int hmac_test(void); +int hmac_memory(int hash, + const unsigned char *key, unsigned long keylen, + const unsigned char *in, unsigned long inlen, + unsigned char *out, unsigned long *outlen); +int hmac_memory_multi(int hash, + const unsigned char *key, unsigned long keylen, + unsigned char *out, unsigned long *outlen, + const unsigned char *in, unsigned long inlen, ...); +int hmac_file(int hash, const char *fname, const unsigned char *key, + unsigned long keylen, + unsigned char *dst, unsigned long *dstlen); +#endif + +#ifdef LTC_OMAC + +typedef struct { + int cipher_idx, + buflen, + blklen; + unsigned char block[MAXBLOCKSIZE], + prev[MAXBLOCKSIZE], + Lu[2][MAXBLOCKSIZE]; + symmetric_key key; +} omac_state; + +int omac_init(omac_state *omac, int cipher, const unsigned char *key, unsigned long keylen); +int omac_process(omac_state *omac, const unsigned char *in, unsigned long inlen); +int omac_done(omac_state *omac, unsigned char *out, unsigned long *outlen); +int omac_memory(int cipher, + const unsigned char *key, unsigned long keylen, + const unsigned char *in, unsigned long inlen, + unsigned char *out, unsigned long *outlen); +int omac_memory_multi(int cipher, + const unsigned char *key, unsigned long keylen, + unsigned char *out, unsigned long *outlen, + const unsigned char *in, unsigned long inlen, ...); +int omac_file(int cipher, + const unsigned char *key, unsigned long keylen, + const char *filename, + unsigned char *out, unsigned long *outlen); +int omac_test(void); +#endif /* OMAC */ + +#ifdef LTC_PMAC + +typedef struct { + unsigned char Ls[32][MAXBLOCKSIZE], /* L shifted by i bits to the left */ + Li[MAXBLOCKSIZE], /* value of Li [current value, we calc from previous recall] */ + Lr[MAXBLOCKSIZE], /* L * x^-1 */ + block[MAXBLOCKSIZE], /* currently accumulated block */ + checksum[MAXBLOCKSIZE]; /* current checksum */ + + symmetric_key key; /* scheduled key for cipher */ + unsigned long block_index; /* index # for current block */ + int cipher_idx, /* cipher idx */ + block_len, /* length of block */ + buflen; /* number of bytes in the buffer */ +} pmac_state; + +int pmac_init(pmac_state *pmac, int cipher, const unsigned char *key, unsigned long keylen); +int pmac_process(pmac_state *pmac, const unsigned char *in, unsigned long inlen); +int pmac_done(pmac_state *pmac, unsigned char *out, unsigned long *outlen); + +int pmac_memory(int cipher, + const unsigned char *key, unsigned long keylen, + const unsigned char *msg, unsigned long msglen, + unsigned char *out, unsigned long *outlen); + +int pmac_memory_multi(int cipher, + const unsigned char *key, unsigned long keylen, + unsigned char *out, unsigned long *outlen, + const unsigned char *in, unsigned long inlen, ...); + +int pmac_file(int cipher, + const unsigned char *key, unsigned long keylen, + const char *filename, + unsigned char *out, unsigned long *outlen); + +int pmac_test(void); + +/* internal functions */ +int pmac_ntz(unsigned long x); +void pmac_shift_xor(pmac_state *pmac); + +#endif /* PMAC */ + +#ifdef EAX_MODE + +#if !(defined(LTC_OMAC) && defined(LTC_CTR_MODE)) + #error EAX_MODE requires OMAC and CTR +#endif + +typedef struct { + unsigned char N[MAXBLOCKSIZE]; + symmetric_CTR ctr; + omac_state headeromac, ctomac; +} eax_state; + +int eax_init(eax_state *eax, int cipher, const unsigned char *key, unsigned long keylen, + const unsigned char *nonce, unsigned long noncelen, + const unsigned char *header, unsigned long headerlen); + +int eax_encrypt(eax_state *eax, const unsigned char *pt, unsigned char *ct, unsigned long length); +int eax_decrypt(eax_state *eax, const unsigned char *ct, unsigned char *pt, unsigned long length); +int eax_addheader(eax_state *eax, const unsigned char *header, unsigned long length); +int eax_done(eax_state *eax, unsigned char *tag, unsigned long *taglen); + +int eax_encrypt_authenticate_memory(int cipher, + const unsigned char *key, unsigned long keylen, + const unsigned char *nonce, unsigned long noncelen, + const unsigned char *header, unsigned long headerlen, + const unsigned char *pt, unsigned long ptlen, + unsigned char *ct, + unsigned char *tag, unsigned long *taglen); + +int eax_decrypt_verify_memory(int cipher, + const unsigned char *key, unsigned long keylen, + const unsigned char *nonce, unsigned long noncelen, + const unsigned char *header, unsigned long headerlen, + const unsigned char *ct, unsigned long ctlen, + unsigned char *pt, + unsigned char *tag, unsigned long taglen, + int *stat); + + int eax_test(void); +#endif /* EAX MODE */ + +#ifdef OCB_MODE +typedef struct { + unsigned char L[MAXBLOCKSIZE], /* L value */ + Ls[32][MAXBLOCKSIZE], /* L shifted by i bits to the left */ + Li[MAXBLOCKSIZE], /* value of Li [current value, we calc from previous recall] */ + Lr[MAXBLOCKSIZE], /* L * x^-1 */ + R[MAXBLOCKSIZE], /* R value */ + checksum[MAXBLOCKSIZE]; /* current checksum */ + + symmetric_key key; /* scheduled key for cipher */ + unsigned long block_index; /* index # for current block */ + int cipher, /* cipher idx */ + block_len; /* length of block */ +} ocb_state; + +int ocb_init(ocb_state *ocb, int cipher, + const unsigned char *key, unsigned long keylen, const unsigned char *nonce); + +int ocb_encrypt(ocb_state *ocb, const unsigned char *pt, unsigned char *ct); +int ocb_decrypt(ocb_state *ocb, const unsigned char *ct, unsigned char *pt); + +int ocb_done_encrypt(ocb_state *ocb, + const unsigned char *pt, unsigned long ptlen, + unsigned char *ct, + unsigned char *tag, unsigned long *taglen); + +int ocb_done_decrypt(ocb_state *ocb, + const unsigned char *ct, unsigned long ctlen, + unsigned char *pt, + const unsigned char *tag, unsigned long taglen, int *stat); + +int ocb_encrypt_authenticate_memory(int cipher, + const unsigned char *key, unsigned long keylen, + const unsigned char *nonce, + const unsigned char *pt, unsigned long ptlen, + unsigned char *ct, + unsigned char *tag, unsigned long *taglen); + +int ocb_decrypt_verify_memory(int cipher, + const unsigned char *key, unsigned long keylen, + const unsigned char *nonce, + const unsigned char *ct, unsigned long ctlen, + unsigned char *pt, + const unsigned char *tag, unsigned long taglen, + int *stat); + +int ocb_test(void); + +/* internal functions */ +void ocb_shift_xor(ocb_state *ocb, unsigned char *Z); +int ocb_ntz(unsigned long x); +int s_ocb_done(ocb_state *ocb, const unsigned char *pt, unsigned long ptlen, + unsigned char *ct, unsigned char *tag, unsigned long *taglen, int mode); + +#endif /* OCB_MODE */ + +#ifdef CCM_MODE + +#define CCM_ENCRYPT 0 +#define CCM_DECRYPT 1 + +int ccm_memory(int cipher, + const unsigned char *key, unsigned long keylen, + symmetric_key *uskey, + const unsigned char *nonce, unsigned long noncelen, + const unsigned char *header, unsigned long headerlen, + unsigned char *pt, unsigned long ptlen, + unsigned char *ct, + unsigned char *tag, unsigned long *taglen, + int direction); + +int ccm_test(void); + +#endif /* CCM_MODE */ + +#if defined(LRW_MODE) || defined(GCM_MODE) +void gcm_gf_mult(const unsigned char *a, const unsigned char *b, unsigned char *c); +#endif + + +/* table shared between GCM and LRW */ +#if defined(GCM_TABLES) || defined(LRW_TABLES) || ((defined(GCM_MODE) || defined(GCM_MODE)) && defined(LTC_FAST)) +extern const unsigned char gcm_shift_table[]; +#endif + +#ifdef GCM_MODE + +#define GCM_ENCRYPT 0 +#define GCM_DECRYPT 1 + +#define GCM_MODE_IV 0 +#define GCM_MODE_AAD 1 +#define GCM_MODE_TEXT 2 + +typedef struct { + symmetric_key K; + unsigned char H[16], /* multiplier */ + X[16], /* accumulator */ + Y[16], /* counter */ + Y_0[16], /* initial counter */ + buf[16]; /* buffer for stuff */ + + int cipher, /* which cipher */ + ivmode, /* Which mode is the IV in? */ + mode, /* mode the GCM code is in */ + buflen; /* length of data in buf */ + + ulong64 totlen, /* 64-bit counter used for IV and AAD */ + pttotlen; /* 64-bit counter for the PT */ + +#ifdef GCM_TABLES + unsigned char PC[16][256][16] /* 16 tables of 8x128 */ +#ifdef GCM_TABLES_SSE2 +__attribute__ ((aligned (16))) +#endif +; +#endif +} gcm_state; + +void gcm_mult_h(gcm_state *gcm, unsigned char *I); + +int gcm_init(gcm_state *gcm, int cipher, + const unsigned char *key, int keylen); + +int gcm_reset(gcm_state *gcm); + +int gcm_add_iv(gcm_state *gcm, + const unsigned char *IV, unsigned long IVlen); + +int gcm_add_aad(gcm_state *gcm, + const unsigned char *adata, unsigned long adatalen); + +int gcm_process(gcm_state *gcm, + unsigned char *pt, unsigned long ptlen, + unsigned char *ct, + int direction); + +int gcm_done(gcm_state *gcm, + unsigned char *tag, unsigned long *taglen); + +int gcm_memory( int cipher, + const unsigned char *key, unsigned long keylen, + const unsigned char *IV, unsigned long IVlen, + const unsigned char *adata, unsigned long adatalen, + unsigned char *pt, unsigned long ptlen, + unsigned char *ct, + unsigned char *tag, unsigned long *taglen, + int direction); +int gcm_test(void); + +#endif /* GCM_MODE */ + +#ifdef PELICAN + +typedef struct pelican_state +{ + symmetric_key K; + unsigned char state[16]; + int buflen; +} pelican_state; + +int pelican_init(pelican_state *pelmac, const unsigned char *key, unsigned long keylen); +int pelican_process(pelican_state *pelmac, const unsigned char *in, unsigned long inlen); +int pelican_done(pelican_state *pelmac, unsigned char *out); +int pelican_test(void); + +int pelican_memory(const unsigned char *key, unsigned long keylen, + const unsigned char *in, unsigned long inlen, + unsigned char *out); + +#endif + +#ifdef LTC_XCBC + +typedef struct { + unsigned char K[3][MAXBLOCKSIZE], + IV[MAXBLOCKSIZE]; + + symmetric_key key; + + int cipher, + buflen, + blocksize; +} xcbc_state; + +int xcbc_init(xcbc_state *xcbc, int cipher, const unsigned char *key, unsigned long keylen); +int xcbc_process(xcbc_state *xcbc, const unsigned char *in, unsigned long inlen); +int xcbc_done(xcbc_state *xcbc, unsigned char *out, unsigned long *outlen); +int xcbc_memory(int cipher, + const unsigned char *key, unsigned long keylen, + const unsigned char *in, unsigned long inlen, + unsigned char *out, unsigned long *outlen); +int xcbc_memory_multi(int cipher, + const unsigned char *key, unsigned long keylen, + unsigned char *out, unsigned long *outlen, + const unsigned char *in, unsigned long inlen, ...); +int xcbc_file(int cipher, + const unsigned char *key, unsigned long keylen, + const char *filename, + unsigned char *out, unsigned long *outlen); +int xcbc_test(void); + +#endif + +#ifdef LTC_F9_MODE + +typedef struct { + unsigned char akey[MAXBLOCKSIZE], + ACC[MAXBLOCKSIZE], + IV[MAXBLOCKSIZE]; + + symmetric_key key; + + int cipher, + buflen, + keylen, + blocksize; +} f9_state; + +int f9_init(f9_state *f9, int cipher, const unsigned char *key, unsigned long keylen); +int f9_process(f9_state *f9, const unsigned char *in, unsigned long inlen); +int f9_done(f9_state *f9, unsigned char *out, unsigned long *outlen); +int f9_memory(int cipher, + const unsigned char *key, unsigned long keylen, + const unsigned char *in, unsigned long inlen, + unsigned char *out, unsigned long *outlen); +int f9_memory_multi(int cipher, + const unsigned char *key, unsigned long keylen, + unsigned char *out, unsigned long *outlen, + const unsigned char *in, unsigned long inlen, ...); +int f9_file(int cipher, + const unsigned char *key, unsigned long keylen, + const char *filename, + unsigned char *out, unsigned long *outlen); +int f9_test(void); + +#endif + + +/* $Source: /cvs/libtom/libtomcrypt/src/headers/tomcrypt_mac.h,v $ */ +/* $Revision: 1.20 $ */ +/* $Date: 2006/11/08 21:57:04 $ */ diff --git a/libtomcrypt/src/headers/tomcrypt_macros.h b/libtomcrypt/src/headers/tomcrypt_macros.h new file mode 100644 index 0000000..53bda9b --- /dev/null +++ b/libtomcrypt/src/headers/tomcrypt_macros.h @@ -0,0 +1,424 @@ +/* fix for MSVC ...evil! */ +#ifdef _MSC_VER + #define CONST64(n) n ## ui64 + typedef unsigned __int64 ulong64; +#else + #define CONST64(n) n ## ULL + typedef unsigned long long ulong64; +#endif + +/* this is the "32-bit at least" data type + * Re-define it to suit your platform but it must be at least 32-bits + */ +#if defined(__x86_64__) || (defined(__sparc__) && defined(__arch64__)) + typedef unsigned ulong32; +#else + typedef unsigned long ulong32; +#endif + +/* ---- HELPER MACROS ---- */ +#ifdef ENDIAN_NEUTRAL + +#define STORE32L(x, y) \ + { (y)[3] = (unsigned char)(((x)>>24)&255); (y)[2] = (unsigned char)(((x)>>16)&255); \ + (y)[1] = (unsigned char)(((x)>>8)&255); (y)[0] = (unsigned char)((x)&255); } + +#define LOAD32L(x, y) \ + { x = ((unsigned long)((y)[3] & 255)<<24) | \ + ((unsigned long)((y)[2] & 255)<<16) | \ + ((unsigned long)((y)[1] & 255)<<8) | \ + ((unsigned long)((y)[0] & 255)); } + +#define STORE64L(x, y) \ + { (y)[7] = (unsigned char)(((x)>>56)&255); (y)[6] = (unsigned char)(((x)>>48)&255); \ + (y)[5] = (unsigned char)(((x)>>40)&255); (y)[4] = (unsigned char)(((x)>>32)&255); \ + (y)[3] = (unsigned char)(((x)>>24)&255); (y)[2] = (unsigned char)(((x)>>16)&255); \ + (y)[1] = (unsigned char)(((x)>>8)&255); (y)[0] = (unsigned char)((x)&255); } + +#define LOAD64L(x, y) \ + { x = (((ulong64)((y)[7] & 255))<<56)|(((ulong64)((y)[6] & 255))<<48)| \ + (((ulong64)((y)[5] & 255))<<40)|(((ulong64)((y)[4] & 255))<<32)| \ + (((ulong64)((y)[3] & 255))<<24)|(((ulong64)((y)[2] & 255))<<16)| \ + (((ulong64)((y)[1] & 255))<<8)|(((ulong64)((y)[0] & 255))); } + +#define STORE32H(x, y) \ + { (y)[0] = (unsigned char)(((x)>>24)&255); (y)[1] = (unsigned char)(((x)>>16)&255); \ + (y)[2] = (unsigned char)(((x)>>8)&255); (y)[3] = (unsigned char)((x)&255); } + +#define LOAD32H(x, y) \ + { x = ((unsigned long)((y)[0] & 255)<<24) | \ + ((unsigned long)((y)[1] & 255)<<16) | \ + ((unsigned long)((y)[2] & 255)<<8) | \ + ((unsigned long)((y)[3] & 255)); } + +#define STORE64H(x, y) \ + { (y)[0] = (unsigned char)(((x)>>56)&255); (y)[1] = (unsigned char)(((x)>>48)&255); \ + (y)[2] = (unsigned char)(((x)>>40)&255); (y)[3] = (unsigned char)(((x)>>32)&255); \ + (y)[4] = (unsigned char)(((x)>>24)&255); (y)[5] = (unsigned char)(((x)>>16)&255); \ + (y)[6] = (unsigned char)(((x)>>8)&255); (y)[7] = (unsigned char)((x)&255); } + +#define LOAD64H(x, y) \ + { x = (((ulong64)((y)[0] & 255))<<56)|(((ulong64)((y)[1] & 255))<<48) | \ + (((ulong64)((y)[2] & 255))<<40)|(((ulong64)((y)[3] & 255))<<32) | \ + (((ulong64)((y)[4] & 255))<<24)|(((ulong64)((y)[5] & 255))<<16) | \ + (((ulong64)((y)[6] & 255))<<8)|(((ulong64)((y)[7] & 255))); } + +#endif /* ENDIAN_NEUTRAL */ + +#ifdef ENDIAN_LITTLE + +#if !defined(LTC_NO_BSWAP) && (defined(INTEL_CC) || (defined(__GNUC__) && (defined(__DJGPP__) || defined(__CYGWIN__) || defined(__MINGW32__) || defined(__i386__) || defined(__x86_64__)))) + +#define STORE32H(x, y) \ +asm __volatile__ ( \ + "bswapl %0 \n\t" \ + "movl %0,(%1)\n\t" \ + "bswapl %0 \n\t" \ + ::"r"(x), "r"(y)); + +#define LOAD32H(x, y) \ +asm __volatile__ ( \ + "movl (%1),%0\n\t" \ + "bswapl %0\n\t" \ + :"=r"(x): "r"(y)); + +#else + +#define STORE32H(x, y) \ + { (y)[0] = (unsigned char)(((x)>>24)&255); (y)[1] = (unsigned char)(((x)>>16)&255); \ + (y)[2] = (unsigned char)(((x)>>8)&255); (y)[3] = (unsigned char)((x)&255); } + +#define LOAD32H(x, y) \ + { x = ((unsigned long)((y)[0] & 255)<<24) | \ + ((unsigned long)((y)[1] & 255)<<16) | \ + ((unsigned long)((y)[2] & 255)<<8) | \ + ((unsigned long)((y)[3] & 255)); } + +#endif + + +/* x86_64 processor */ +#if !defined(LTC_NO_BSWAP) && (defined(__GNUC__) && defined(__x86_64__)) + +#define STORE64H(x, y) \ +asm __volatile__ ( \ + "bswapq %0 \n\t" \ + "movq %0,(%1)\n\t" \ + "bswapq %0 \n\t" \ + ::"r"(x), "r"(y)); + +#define LOAD64H(x, y) \ +asm __volatile__ ( \ + "movq (%1),%0\n\t" \ + "bswapq %0\n\t" \ + :"=r"(x): "r"(y)); + +#else + +#define STORE64H(x, y) \ + { (y)[0] = (unsigned char)(((x)>>56)&255); (y)[1] = (unsigned char)(((x)>>48)&255); \ + (y)[2] = (unsigned char)(((x)>>40)&255); (y)[3] = (unsigned char)(((x)>>32)&255); \ + (y)[4] = (unsigned char)(((x)>>24)&255); (y)[5] = (unsigned char)(((x)>>16)&255); \ + (y)[6] = (unsigned char)(((x)>>8)&255); (y)[7] = (unsigned char)((x)&255); } + +#define LOAD64H(x, y) \ + { x = (((ulong64)((y)[0] & 255))<<56)|(((ulong64)((y)[1] & 255))<<48) | \ + (((ulong64)((y)[2] & 255))<<40)|(((ulong64)((y)[3] & 255))<<32) | \ + (((ulong64)((y)[4] & 255))<<24)|(((ulong64)((y)[5] & 255))<<16) | \ + (((ulong64)((y)[6] & 255))<<8)|(((ulong64)((y)[7] & 255))); } + +#endif + +#ifdef ENDIAN_32BITWORD + +#define STORE32L(x, y) \ + { ulong32 __t = (x); XMEMCPY(y, &__t, 4); } + +#define LOAD32L(x, y) \ + XMEMCPY(&(x), y, 4); + +#define STORE64L(x, y) \ + { (y)[7] = (unsigned char)(((x)>>56)&255); (y)[6] = (unsigned char)(((x)>>48)&255); \ + (y)[5] = (unsigned char)(((x)>>40)&255); (y)[4] = (unsigned char)(((x)>>32)&255); \ + (y)[3] = (unsigned char)(((x)>>24)&255); (y)[2] = (unsigned char)(((x)>>16)&255); \ + (y)[1] = (unsigned char)(((x)>>8)&255); (y)[0] = (unsigned char)((x)&255); } + +#define LOAD64L(x, y) \ + { x = (((ulong64)((y)[7] & 255))<<56)|(((ulong64)((y)[6] & 255))<<48)| \ + (((ulong64)((y)[5] & 255))<<40)|(((ulong64)((y)[4] & 255))<<32)| \ + (((ulong64)((y)[3] & 255))<<24)|(((ulong64)((y)[2] & 255))<<16)| \ + (((ulong64)((y)[1] & 255))<<8)|(((ulong64)((y)[0] & 255))); } + +#else /* 64-bit words then */ + +#define STORE32L(x, y) \ + { ulong32 __t = (x); XMEMCPY(y, &__t, 4); } + +#define LOAD32L(x, y) \ + { XMEMCPY(&(x), y, 4); x &= 0xFFFFFFFF; } + +#define STORE64L(x, y) \ + { ulong64 __t = (x); XMEMCPY(y, &__t, 8); } + +#define LOAD64L(x, y) \ + { XMEMCPY(&(x), y, 8); } + +#endif /* ENDIAN_64BITWORD */ + +#endif /* ENDIAN_LITTLE */ + +#ifdef ENDIAN_BIG +#define STORE32L(x, y) \ + { (y)[3] = (unsigned char)(((x)>>24)&255); (y)[2] = (unsigned char)(((x)>>16)&255); \ + (y)[1] = (unsigned char)(((x)>>8)&255); (y)[0] = (unsigned char)((x)&255); } + +#define LOAD32L(x, y) \ + { x = ((unsigned long)((y)[3] & 255)<<24) | \ + ((unsigned long)((y)[2] & 255)<<16) | \ + ((unsigned long)((y)[1] & 255)<<8) | \ + ((unsigned long)((y)[0] & 255)); } + +#define STORE64L(x, y) \ + { (y)[7] = (unsigned char)(((x)>>56)&255); (y)[6] = (unsigned char)(((x)>>48)&255); \ + (y)[5] = (unsigned char)(((x)>>40)&255); (y)[4] = (unsigned char)(((x)>>32)&255); \ + (y)[3] = (unsigned char)(((x)>>24)&255); (y)[2] = (unsigned char)(((x)>>16)&255); \ + (y)[1] = (unsigned char)(((x)>>8)&255); (y)[0] = (unsigned char)((x)&255); } + +#define LOAD64L(x, y) \ + { x = (((ulong64)((y)[7] & 255))<<56)|(((ulong64)((y)[6] & 255))<<48) | \ + (((ulong64)((y)[5] & 255))<<40)|(((ulong64)((y)[4] & 255))<<32) | \ + (((ulong64)((y)[3] & 255))<<24)|(((ulong64)((y)[2] & 255))<<16) | \ + (((ulong64)((y)[1] & 255))<<8)|(((ulong64)((y)[0] & 255))); } + +#ifdef ENDIAN_32BITWORD + +#define STORE32H(x, y) \ + { ulong32 __t = (x); XMEMCPY(y, &__t, 4); } + +#define LOAD32H(x, y) \ + XMEMCPY(&(x), y, 4); + +#define STORE64H(x, y) \ + { (y)[0] = (unsigned char)(((x)>>56)&255); (y)[1] = (unsigned char)(((x)>>48)&255); \ + (y)[2] = (unsigned char)(((x)>>40)&255); (y)[3] = (unsigned char)(((x)>>32)&255); \ + (y)[4] = (unsigned char)(((x)>>24)&255); (y)[5] = (unsigned char)(((x)>>16)&255); \ + (y)[6] = (unsigned char)(((x)>>8)&255); (y)[7] = (unsigned char)((x)&255); } + +#define LOAD64H(x, y) \ + { x = (((ulong64)((y)[0] & 255))<<56)|(((ulong64)((y)[1] & 255))<<48)| \ + (((ulong64)((y)[2] & 255))<<40)|(((ulong64)((y)[3] & 255))<<32)| \ + (((ulong64)((y)[4] & 255))<<24)|(((ulong64)((y)[5] & 255))<<16)| \ + (((ulong64)((y)[6] & 255))<<8)| (((ulong64)((y)[7] & 255))); } + +#else /* 64-bit words then */ + +#define STORE32H(x, y) \ + { ulong32 __t = (x); XMEMCPY(y, &__t, 4); } + +#define LOAD32H(x, y) \ + { XMEMCPY(&(x), y, 4); x &= 0xFFFFFFFF; } + +#define STORE64H(x, y) \ + { ulong64 __t = (x); XMEMCPY(y, &__t, 8); } + +#define LOAD64H(x, y) \ + { XMEMCPY(&(x), y, 8); } + +#endif /* ENDIAN_64BITWORD */ +#endif /* ENDIAN_BIG */ + +#define BSWAP(x) ( ((x>>24)&0x000000FFUL) | ((x<<24)&0xFF000000UL) | \ + ((x>>8)&0x0000FF00UL) | ((x<<8)&0x00FF0000UL) ) + + +/* 32-bit Rotates */ +#if defined(_MSC_VER) + +/* instrinsic rotate */ +#include <stdlib.h> +#pragma intrinsic(_lrotr,_lrotl) +#define ROR(x,n) _lrotr(x,n) +#define ROL(x,n) _lrotl(x,n) +#define RORc(x,n) _lrotr(x,n) +#define ROLc(x,n) _lrotl(x,n) + +#elif !defined(__STRICT_ANSI__) && defined(__GNUC__) && (defined(__i386__) || defined(__x86_64__)) && !defined(INTEL_CC) && !defined(LTC_NO_ASM) + +static inline unsigned ROL(unsigned word, int i) +{ + asm ("roll %%cl,%0" + :"=r" (word) + :"0" (word),"c" (i)); + return word; +} + +static inline unsigned ROR(unsigned word, int i) +{ + asm ("rorl %%cl,%0" + :"=r" (word) + :"0" (word),"c" (i)); + return word; +} + +#ifndef LTC_NO_ROLC + +static inline unsigned ROLc(unsigned word, const int i) +{ + asm ("roll %2,%0" + :"=r" (word) + :"0" (word),"I" (i)); + return word; +} + +static inline unsigned RORc(unsigned word, const int i) +{ + asm ("rorl %2,%0" + :"=r" (word) + :"0" (word),"I" (i)); + return word; +} + +#else + +#define ROLc ROL +#define RORc ROR + +#endif + +#elif !defined(__STRICT_ANSI__) && defined(LTC_PPC32) + +static inline unsigned ROL(unsigned word, int i) +{ + asm ("rotlw %0,%0,%2" + :"=r" (word) + :"0" (word),"r" (i)); + return word; +} + +static inline unsigned ROR(unsigned word, int i) +{ + asm ("rotlw %0,%0,%2" + :"=r" (word) + :"0" (word),"r" (32-i)); + return word; +} + +#ifndef LTC_NO_ROLC + +static inline unsigned ROLc(unsigned word, const int i) +{ + asm ("rotlwi %0,%0,%2" + :"=r" (word) + :"0" (word),"I" (i)); + return word; +} + +static inline unsigned RORc(unsigned word, const int i) +{ + asm ("rotrwi %0,%0,%2" + :"=r" (word) + :"0" (word),"I" (i)); + return word; +} + +#else + +#define ROLc ROL +#define RORc ROR + +#endif + + +#else + +/* rotates the hard way */ +#define ROL(x, y) ( (((unsigned long)(x)<<(unsigned long)((y)&31)) | (((unsigned long)(x)&0xFFFFFFFFUL)>>(unsigned long)(32-((y)&31)))) & 0xFFFFFFFFUL) +#define ROR(x, y) ( ((((unsigned long)(x)&0xFFFFFFFFUL)>>(unsigned long)((y)&31)) | ((unsigned long)(x)<<(unsigned long)(32-((y)&31)))) & 0xFFFFFFFFUL) +#define ROLc(x, y) ( (((unsigned long)(x)<<(unsigned long)((y)&31)) | (((unsigned long)(x)&0xFFFFFFFFUL)>>(unsigned long)(32-((y)&31)))) & 0xFFFFFFFFUL) +#define RORc(x, y) ( ((((unsigned long)(x)&0xFFFFFFFFUL)>>(unsigned long)((y)&31)) | ((unsigned long)(x)<<(unsigned long)(32-((y)&31)))) & 0xFFFFFFFFUL) + +#endif + + +/* 64-bit Rotates */ +#if !defined(__STRICT_ANSI__) && defined(__GNUC__) && defined(__x86_64__) && !defined(LTC_NO_ASM) + +static inline unsigned long ROL64(unsigned long word, int i) +{ + asm("rolq %%cl,%0" + :"=r" (word) + :"0" (word),"c" (i)); + return word; +} + +static inline unsigned long ROR64(unsigned long word, int i) +{ + asm("rorq %%cl,%0" + :"=r" (word) + :"0" (word),"c" (i)); + return word; +} + +#ifndef LTC_NO_ROLC + +static inline unsigned long ROL64c(unsigned long word, const int i) +{ + asm("rolq %2,%0" + :"=r" (word) + :"0" (word),"J" (i)); + return word; +} + +static inline unsigned long ROR64c(unsigned long word, const int i) +{ + asm("rorq %2,%0" + :"=r" (word) + :"0" (word),"J" (i)); + return word; +} + +#else /* LTC_NO_ROLC */ + +#define ROL64c ROL64 +#define ROR64c ROR64 + +#endif + +#else /* Not x86_64 */ + +#define ROL64(x, y) \ + ( (((x)<<((ulong64)(y)&63)) | \ + (((x)&CONST64(0xFFFFFFFFFFFFFFFF))>>((ulong64)64-((y)&63)))) & CONST64(0xFFFFFFFFFFFFFFFF)) + +#define ROR64(x, y) \ + ( ((((x)&CONST64(0xFFFFFFFFFFFFFFFF))>>((ulong64)(y)&CONST64(63))) | \ + ((x)<<((ulong64)(64-((y)&CONST64(63)))))) & CONST64(0xFFFFFFFFFFFFFFFF)) + +#define ROL64c(x, y) \ + ( (((x)<<((ulong64)(y)&63)) | \ + (((x)&CONST64(0xFFFFFFFFFFFFFFFF))>>((ulong64)64-((y)&63)))) & CONST64(0xFFFFFFFFFFFFFFFF)) + +#define ROR64c(x, y) \ + ( ((((x)&CONST64(0xFFFFFFFFFFFFFFFF))>>((ulong64)(y)&CONST64(63))) | \ + ((x)<<((ulong64)(64-((y)&CONST64(63)))))) & CONST64(0xFFFFFFFFFFFFFFFF)) + +#endif + +#ifndef MAX + #define MAX(x, y) ( ((x)>(y))?(x):(y) ) +#endif + +#ifndef MIN + #define MIN(x, y) ( ((x)<(y))?(x):(y) ) +#endif + +/* extract a byte portably */ +#ifdef _MSC_VER + #define byte(x, n) ((unsigned char)((x) >> (8 * (n)))) +#else + #define byte(x, n) (((x) >> (8 * (n))) & 255) +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/headers/tomcrypt_macros.h,v $ */ +/* $Revision: 1.15 $ */ +/* $Date: 2006/11/29 23:43:57 $ */ diff --git a/libtomcrypt/src/headers/tomcrypt_math.h b/libtomcrypt/src/headers/tomcrypt_math.h new file mode 100644 index 0000000..c996e41 --- /dev/null +++ b/libtomcrypt/src/headers/tomcrypt_math.h @@ -0,0 +1,500 @@ +/** math functions **/ + +#define LTC_MP_LT -1 +#define LTC_MP_EQ 0 +#define LTC_MP_GT 1 + +#define LTC_MP_NO 0 +#define LTC_MP_YES 1 + +#ifndef MECC + typedef void ecc_point; +#endif + +#ifndef MRSA + typedef void rsa_key; +#endif + +/** math descriptor */ +typedef struct { + /** Name of the math provider */ + char *name; + + /** Bits per digit, amount of bits must fit in an unsigned long */ + int bits_per_digit; + +/* ---- init/deinit functions ---- */ + + /** initialize a bignum + @param a The number to initialize + @return CRYPT_OK on success + */ + int (*init)(void **a); + + /** init copy + @param dst The number to initialize and write to + @param src The number to copy from + @return CRYPT_OK on success + */ + int (*init_copy)(void **dst, void *src); + + /** deinit + @param a The number to free + @return CRYPT_OK on success + */ + void (*deinit)(void *a); + +/* ---- data movement ---- */ + + /** negate + @param src The number to negate + @param dst The destination + @return CRYPT_OK on success + */ + int (*neg)(void *src, void *dst); + + /** copy + @param src The number to copy from + @param dst The number to write to + @return CRYPT_OK on success + */ + int (*copy)(void *src, void *dst); + +/* ---- trivial low level functions ---- */ + + /** set small constant + @param a Number to write to + @param n Source upto bits_per_digit (actually meant for very small constants) + @return CRYPT_OK on succcess + */ + int (*set_int)(void *a, unsigned long n); + + /** get small constant + @param a Number to read, only fetches upto bits_per_digit from the number + @return The lower bits_per_digit of the integer (unsigned) + */ + unsigned long (*get_int)(void *a); + + /** get digit n + @param a The number to read from + @param n The number of the digit to fetch + @return The bits_per_digit sized n'th digit of a + */ + unsigned long (*get_digit)(void *a, int n); + + /** Get the number of digits that represent the number + @param a The number to count + @return The number of digits used to represent the number + */ + int (*get_digit_count)(void *a); + + /** compare two integers + @param a The left side integer + @param b The right side integer + @return LTC_MP_LT if a < b, LTC_MP_GT if a > b and LTC_MP_EQ otherwise. (signed comparison) + */ + int (*compare)(void *a, void *b); + + /** compare against int + @param a The left side integer + @param b The right side integer (upto bits_per_digit) + @return LTC_MP_LT if a < b, LTC_MP_GT if a > b and LTC_MP_EQ otherwise. (signed comparison) + */ + int (*compare_d)(void *a, unsigned long n); + + /** Count the number of bits used to represent the integer + @param a The integer to count + @return The number of bits required to represent the integer + */ + int (*count_bits)(void * a); + + /** Count the number of LSB bits which are zero + @param a The integer to count + @return The number of contiguous zero LSB bits + */ + int (*count_lsb_bits)(void *a); + + /** Compute a power of two + @param a The integer to store the power in + @param n The power of two you want to store (a = 2^n) + @return CRYPT_OK on success + */ + int (*twoexpt)(void *a , int n); + +/* ---- radix conversions ---- */ + + /** read ascii string + @param a The integer to store into + @param str The string to read + @param radix The radix the integer has been represented in (2-64) + @return CRYPT_OK on success + */ + int (*read_radix)(void *a, const char *str, int radix); + + /** write number to string + @param a The integer to store + @param str The destination for the string + @param radix The radix the integer is to be represented in (2-64) + @return CRYPT_OK on success + */ + int (*write_radix)(void *a, char *str, int radix); + + /** get size as unsigned char string + @param a The integer to get the size (when stored in array of octets) + @return The length of the integer + */ + unsigned long (*unsigned_size)(void *a); + + /** store an integer as an array of octets + @param src The integer to store + @param dst The buffer to store the integer in + @return CRYPT_OK on success + */ + int (*unsigned_write)(void *src, unsigned char *dst); + + /** read an array of octets and store as integer + @param dst The integer to load + @param src The array of octets + @param len The number of octets + @return CRYPT_OK on success + */ + int (*unsigned_read)(void *dst, unsigned char *src, unsigned long len); + +/* ---- basic math ---- */ + + /** add two integers + @param a The first source integer + @param b The second source integer + @param c The destination of "a + b" + @return CRYPT_OK on success + */ + int (*add)(void *a, void *b, void *c); + + + /** add two integers + @param a The first source integer + @param b The second source integer (single digit of upto bits_per_digit in length) + @param c The destination of "a + b" + @return CRYPT_OK on success + */ + int (*addi)(void *a, unsigned long b, void *c); + + /** subtract two integers + @param a The first source integer + @param b The second source integer + @param c The destination of "a - b" + @return CRYPT_OK on success + */ + int (*sub)(void *a, void *b, void *c); + + /** subtract two integers + @param a The first source integer + @param b The second source integer (single digit of upto bits_per_digit in length) + @param c The destination of "a - b" + @return CRYPT_OK on success + */ + int (*subi)(void *a, unsigned long b, void *c); + + /** multiply two integers + @param a The first source integer + @param b The second source integer (single digit of upto bits_per_digit in length) + @param c The destination of "a * b" + @return CRYPT_OK on success + */ + int (*mul)(void *a, void *b, void *c); + + /** multiply two integers + @param a The first source integer + @param b The second source integer (single digit of upto bits_per_digit in length) + @param c The destination of "a * b" + @return CRYPT_OK on success + */ + int (*muli)(void *a, unsigned long b, void *c); + + /** Square an integer + @param a The integer to square + @param b The destination + @return CRYPT_OK on success + */ + int (*sqr)(void *a, void *b); + + /** Divide an integer + @param a The dividend + @param b The divisor + @param c The quotient (can be NULL to signify don't care) + @param d The remainder (can be NULL to signify don't care) + @return CRYPT_OK on success + */ + int (*mpdiv)(void *a, void *b, void *c, void *d); + + /** divide by two + @param a The integer to divide (shift right) + @param b The destination + @return CRYPT_OK on success + */ + int (*div_2)(void *a, void *b); + + /** Get remainder (small value) + @param a The integer to reduce + @param b The modulus (upto bits_per_digit in length) + @param c The destination for the residue + @return CRYPT_OK on success + */ + int (*modi)(void *a, unsigned long b, unsigned long *c); + + /** gcd + @param a The first integer + @param b The second integer + @param c The destination for (a, b) + @return CRYPT_OK on success + */ + int (*gcd)(void *a, void *b, void *c); + + /** lcm + @param a The first integer + @param b The second integer + @param c The destination for [a, b] + @return CRYPT_OK on success + */ + int (*lcm)(void *a, void *b, void *c); + + /** Modular multiplication + @param a The first source + @param b The second source + @param c The modulus + @param d The destination (a*b mod c) + @return CRYPT_OK on success + */ + int (*mulmod)(void *a, void *b, void *c, void *d); + + /** Modular squaring + @param a The first source + @param b The modulus + @param c The destination (a*a mod b) + @return CRYPT_OK on success + */ + int (*sqrmod)(void *a, void *b, void *c); + + /** Modular inversion + @param a The value to invert + @param b The modulus + @param c The destination (1/a mod b) + @return CRYPT_OK on success + */ + int (*invmod)(void *, void *, void *); + +/* ---- reduction ---- */ + + /** setup montgomery + @param a The modulus + @param b The destination for the reduction digit + @return CRYPT_OK on success + */ + int (*montgomery_setup)(void *a, void **b); + + /** get normalization value + @param a The destination for the normalization value + @param b The modulus + @return CRYPT_OK on success + */ + int (*montgomery_normalization)(void *a, void *b); + + /** reduce a number + @param a The number [and dest] to reduce + @param b The modulus + @param c The value "b" from montgomery_setup() + @return CRYPT_OK on success + */ + int (*montgomery_reduce)(void *a, void *b, void *c); + + /** clean up (frees memory) + @param a The value "b" from montgomery_setup() + @return CRYPT_OK on success + */ + void (*montgomery_deinit)(void *a); + +/* ---- exponentiation ---- */ + + /** Modular exponentiation + @param a The base integer + @param b The power (can be negative) integer + @param c The modulus integer + @param d The destination + @return CRYPT_OK on success + */ + int (*exptmod)(void *a, void *b, void *c, void *d); + + /** Primality testing + @param a The integer to test + @param b The destination of the result (FP_YES if prime) + @return CRYPT_OK on success + */ + int (*isprime)(void *a, int *b); + +/* ---- (optional) ecc point math ---- */ + + /** ECC GF(p) point multiplication (from the NIST curves) + @param k The integer to multiply the point by + @param G The point to multiply + @param R The destination for kG + @param modulus The modulus for the field + @param map Boolean indicated whether to map back to affine or not (can be ignored if you work in affine only) + @return CRYPT_OK on success + */ + int (*ecc_ptmul)(void *k, ecc_point *G, ecc_point *R, void *modulus, int map); + + /** ECC GF(p) point addition + @param P The first point + @param Q The second point + @param R The destination of P + Q + @param modulus The modulus + @param mp The "b" value from montgomery_setup() + @return CRYPT_OK on success + */ + int (*ecc_ptadd)(ecc_point *P, ecc_point *Q, ecc_point *R, void *modulus, void *mp); + + /** ECC GF(p) point double + @param P The first point + @param R The destination of 2P + @param modulus The modulus + @param mp The "b" value from montgomery_setup() + @return CRYPT_OK on success + */ + int (*ecc_ptdbl)(ecc_point *P, ecc_point *R, void *modulus, void *mp); + + /** ECC mapping from projective to affine, currently uses (x,y,z) => (x/z^2, y/z^3, 1) + @param P The point to map + @param modulus The modulus + @param mp The "b" value from montgomery_setup() + @return CRYPT_OK on success + @remark The mapping can be different but keep in mind a ecc_point only has three + integers (x,y,z) so if you use a different mapping you have to make it fit. + */ + int (*ecc_map)(ecc_point *P, void *modulus, void *mp); + + /** Computes kA*A + kB*B = C using Shamir's Trick + @param A First point to multiply + @param kA What to multiple A by + @param B Second point to multiply + @param kB What to multiple B by + @param C [out] Destination point (can overlap with A or B + @param modulus Modulus for curve + @return CRYPT_OK on success + */ + int (*ecc_mul2add)(ecc_point *A, void *kA, + ecc_point *B, void *kB, + ecc_point *C, + void *modulus); + +/* ---- (optional) rsa optimized math (for internal CRT) ---- */ + + /** RSA Key Generation + @param prng An active PRNG state + @param wprng The index of the PRNG desired + @param size The size of the modulus (key size) desired (octets) + @param e The "e" value (public key). e==65537 is a good choice + @param key [out] Destination of a newly created private key pair + @return CRYPT_OK if successful, upon error all allocated ram is freed + */ + int (*rsa_keygen)(prng_state *prng, int wprng, int size, long e, rsa_key *key); + + + /** RSA exponentiation + @param in The octet array representing the base + @param inlen The length of the input + @param out The destination (to be stored in an octet array format) + @param outlen The length of the output buffer and the resulting size (zero padded to the size of the modulus) + @param which PK_PUBLIC for public RSA and PK_PRIVATE for private RSA + @param key The RSA key to use + @return CRYPT_OK on success + */ + int (*rsa_me)(const unsigned char *in, unsigned long inlen, + unsigned char *out, unsigned long *outlen, int which, + rsa_key *key); +} ltc_math_descriptor; + +extern ltc_math_descriptor ltc_mp; + +int ltc_init_multi(void **a, ...); +void ltc_deinit_multi(void *a, ...); + +#ifdef LTM_DESC +extern const ltc_math_descriptor ltm_desc; +#endif + +#ifdef TFM_DESC +extern const ltc_math_descriptor tfm_desc; +#endif + +#ifdef GMP_DESC +extern const ltc_math_descriptor gmp_desc; +#endif + +#if !defined(DESC_DEF_ONLY) && defined(LTC_SOURCE) + +#define MP_DIGIT_BIT ltc_mp.bits_per_digit + +/* some handy macros */ +#define mp_init(a) ltc_mp.init(a) +#define mp_init_multi ltc_init_multi +#define mp_clear(a) ltc_mp.deinit(a) +#define mp_clear_multi ltc_deinit_multi +#define mp_init_copy(a, b) ltc_mp.init_copy(a, b) + +#define mp_neg(a, b) ltc_mp.neg(a, b) +#define mp_copy(a, b) ltc_mp.copy(a, b) + +#define mp_set(a, b) ltc_mp.set_int(a, b) +#define mp_set_int(a, b) ltc_mp.set_int(a, b) +#define mp_get_int(a) ltc_mp.get_int(a) +#define mp_get_digit(a, n) ltc_mp.get_digit(a, n) +#define mp_get_digit_count(a) ltc_mp.get_digit_count(a) +#define mp_cmp(a, b) ltc_mp.compare(a, b) +#define mp_cmp_d(a, b) ltc_mp.compare_d(a, b) +#define mp_count_bits(a) ltc_mp.count_bits(a) +#define mp_cnt_lsb(a) ltc_mp.count_lsb_bits(a) +#define mp_2expt(a, b) ltc_mp.twoexpt(a, b) + +#define mp_read_radix(a, b, c) ltc_mp.read_radix(a, b, c) +#define mp_toradix(a, b, c) ltc_mp.write_radix(a, b, c) +#define mp_unsigned_bin_size(a) ltc_mp.unsigned_size(a) +#define mp_to_unsigned_bin(a, b) ltc_mp.unsigned_write(a, b) +#define mp_read_unsigned_bin(a, b, c) ltc_mp.unsigned_read(a, b, c) + +#define mp_add(a, b, c) ltc_mp.add(a, b, c) +#define mp_add_d(a, b, c) ltc_mp.addi(a, b, c) +#define mp_sub(a, b, c) ltc_mp.sub(a, b, c) +#define mp_sub_d(a, b, c) ltc_mp.subi(a, b, c) +#define mp_mul(a, b, c) ltc_mp.mul(a, b, c) +#define mp_mul_d(a, b, c) ltc_mp.muli(a, b, c) +#define mp_sqr(a, b) ltc_mp.sqr(a, b) +#define mp_div(a, b, c, d) ltc_mp.mpdiv(a, b, c, d) +#define mp_div_2(a, b) ltc_mp.div_2(a, b) +#define mp_mod(a, b, c) ltc_mp.mpdiv(a, b, NULL, c) +#define mp_mod_d(a, b, c) ltc_mp.modi(a, b, c) +#define mp_gcd(a, b, c) ltc_mp.gcd(a, b, c) +#define mp_lcm(a, b, c) ltc_mp.lcm(a, b, c) + +#define mp_mulmod(a, b, c, d) ltc_mp.mulmod(a, b, c, d) +#define mp_sqrmod(a, b, c) ltc_mp.sqrmod(a, b, c) +#define mp_invmod(a, b, c) ltc_mp.invmod(a, b, c) + +#define mp_montgomery_setup(a, b) ltc_mp.montgomery_setup(a, b) +#define mp_montgomery_normalization(a, b) ltc_mp.montgomery_normalization(a, b) +#define mp_montgomery_reduce(a, b, c) ltc_mp.montgomery_reduce(a, b, c) +#define mp_montgomery_free(a) ltc_mp.montgomery_deinit(a) + +#define mp_exptmod(a,b,c,d) ltc_mp.exptmod(a,b,c,d) +#define mp_prime_is_prime(a, b, c) ltc_mp.isprime(a, c) + +#define mp_iszero(a) (mp_cmp_d(a, 0) == LTC_MP_EQ ? LTC_MP_YES : LTC_MP_NO) +#define mp_isodd(a) (mp_get_digit_count(a) > 0 ? (mp_get_digit(a, 0) & 1 ? LTC_MP_YES : LTC_MP_NO) : LTC_MP_NO) +#define mp_exch(a, b) do { void *ABC__tmp = a; a = b; b = ABC__tmp; } while(0); + +#define mp_tohex(a, b) mp_toradix(a, b, 16) + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/headers/tomcrypt_math.h,v $ */ +/* $Revision: 1.43 $ */ +/* $Date: 2006/12/02 19:23:13 $ */ diff --git a/libtomcrypt/src/headers/tomcrypt_misc.h b/libtomcrypt/src/headers/tomcrypt_misc.h new file mode 100644 index 0000000..0b444f8 --- /dev/null +++ b/libtomcrypt/src/headers/tomcrypt_misc.h @@ -0,0 +1,23 @@ +/* ---- BASE64 Routines ---- */ +#ifdef BASE64 +int base64_encode(const unsigned char *in, unsigned long len, + unsigned char *out, unsigned long *outlen); + +int base64_decode(const unsigned char *in, unsigned long len, + unsigned char *out, unsigned long *outlen); +#endif + +/* ---- MEM routines ---- */ +void zeromem(void *dst, size_t len); +void burn_stack(unsigned long len); + +const char *error_to_string(int err); + +extern const char *crypt_build_settings; + +/* ---- HMM ---- */ +int crypt_fsa(void *mp, ...); + +/* $Source: /cvs/libtom/libtomcrypt/src/headers/tomcrypt_misc.h,v $ */ +/* $Revision: 1.4 $ */ +/* $Date: 2006/11/06 03:03:01 $ */ diff --git a/libtomcrypt/src/headers/tomcrypt_pk.h b/libtomcrypt/src/headers/tomcrypt_pk.h new file mode 100644 index 0000000..3a0d7ab --- /dev/null +++ b/libtomcrypt/src/headers/tomcrypt_pk.h @@ -0,0 +1,544 @@ +/* ---- NUMBER THEORY ---- */ + +enum { + PK_PUBLIC=0, + PK_PRIVATE=1 +}; + +int rand_prime(void *N, long len, prng_state *prng, int wprng); + +/* ---- RSA ---- */ +#ifdef MRSA + +/* Min and Max RSA key sizes (in bits) */ +#define MIN_RSA_SIZE 1024 +#define MAX_RSA_SIZE 4096 + +/** RSA PKCS style key */ +typedef struct Rsa_key { + /** Type of key, PK_PRIVATE or PK_PUBLIC */ + int type; + /** The public exponent */ + void *e; + /** The private exponent */ + void *d; + /** The modulus */ + void *N; + /** The p factor of N */ + void *p; + /** The q factor of N */ + void *q; + /** The 1/q mod p CRT param */ + void *qP; + /** The d mod (p - 1) CRT param */ + void *dP; + /** The d mod (q - 1) CRT param */ + void *dQ; +} rsa_key; + +int rsa_make_key(prng_state *prng, int wprng, int size, long e, rsa_key *key); + +int rsa_exptmod(const unsigned char *in, unsigned long inlen, + unsigned char *out, unsigned long *outlen, int which, + rsa_key *key); + +void rsa_free(rsa_key *key); + +/* These use PKCS #1 v2.0 padding */ +#define rsa_encrypt_key(_in, _inlen, _out, _outlen, _lparam, _lparamlen, _prng, _prng_idx, _hash_idx, _key) \ + rsa_encrypt_key_ex(_in, _inlen, _out, _outlen, _lparam, _lparamlen, _prng, _prng_idx, _hash_idx, LTC_PKCS_1_OAEP, _key) + +#define rsa_decrypt_key(_in, _inlen, _out, _outlen, _lparam, _lparamlen, _hash_idx, _stat, _key) \ + rsa_decrypt_key_ex(_in, _inlen, _out, _outlen, _lparam, _lparamlen, _hash_idx, LTC_PKCS_1_OAEP, _stat, _key) + +#define rsa_sign_hash(_in, _inlen, _out, _outlen, _prng, _prng_idx, _hash_idx, _saltlen, _key) \ + rsa_sign_hash_ex(_in, _inlen, _out, _outlen, LTC_PKCS_1_PSS, _prng, _prng_idx, _hash_idx, _saltlen, _key) + +#define rsa_verify_hash(_sig, _siglen, _hash, _hashlen, _hash_idx, _saltlen, _stat, _key) \ + rsa_verify_hash_ex(_sig, _siglen, _hash, _hashlen, LTC_PKCS_1_PSS, _hash_idx, _saltlen, _stat, _key) + +/* These can be switched between PKCS #1 v2.x and PKCS #1 v1.5 paddings */ +int rsa_encrypt_key_ex(const unsigned char *in, unsigned long inlen, + unsigned char *out, unsigned long *outlen, + const unsigned char *lparam, unsigned long lparamlen, + prng_state *prng, int prng_idx, int hash_idx, int padding, rsa_key *key); + +int rsa_decrypt_key_ex(const unsigned char *in, unsigned long inlen, + unsigned char *out, unsigned long *outlen, + const unsigned char *lparam, unsigned long lparamlen, + int hash_idx, int padding, + int *stat, rsa_key *key); + +int rsa_sign_hash_ex(const unsigned char *in, unsigned long inlen, + unsigned char *out, unsigned long *outlen, + int padding, + prng_state *prng, int prng_idx, + int hash_idx, unsigned long saltlen, + rsa_key *key); + +int rsa_verify_hash_ex(const unsigned char *sig, unsigned long siglen, + const unsigned char *hash, unsigned long hashlen, + int padding, + int hash_idx, unsigned long saltlen, + int *stat, rsa_key *key); + +/* PKCS #1 import/export */ +int rsa_export(unsigned char *out, unsigned long *outlen, int type, rsa_key *key); +int rsa_import(const unsigned char *in, unsigned long inlen, rsa_key *key); + +#endif + +/* ---- Katja ---- */ +#ifdef MKAT + +/* Min and Max KAT key sizes (in bits) */ +#define MIN_KAT_SIZE 1024 +#define MAX_KAT_SIZE 4096 + +/** Katja PKCS style key */ +typedef struct KAT_key { + /** Type of key, PK_PRIVATE or PK_PUBLIC */ + int type; + /** The private exponent */ + void *d; + /** The modulus */ + void *N; + /** The p factor of N */ + void *p; + /** The q factor of N */ + void *q; + /** The 1/q mod p CRT param */ + void *qP; + /** The d mod (p - 1) CRT param */ + void *dP; + /** The d mod (q - 1) CRT param */ + void *dQ; + /** The pq param */ + void *pq; +} katja_key; + +int katja_make_key(prng_state *prng, int wprng, int size, katja_key *key); + +int katja_exptmod(const unsigned char *in, unsigned long inlen, + unsigned char *out, unsigned long *outlen, int which, + katja_key *key); + +void katja_free(katja_key *key); + +/* These use PKCS #1 v2.0 padding */ +int katja_encrypt_key(const unsigned char *in, unsigned long inlen, + unsigned char *out, unsigned long *outlen, + const unsigned char *lparam, unsigned long lparamlen, + prng_state *prng, int prng_idx, int hash_idx, katja_key *key); + +int katja_decrypt_key(const unsigned char *in, unsigned long inlen, + unsigned char *out, unsigned long *outlen, + const unsigned char *lparam, unsigned long lparamlen, + int hash_idx, int *stat, + katja_key *key); + +/* PKCS #1 import/export */ +int katja_export(unsigned char *out, unsigned long *outlen, int type, katja_key *key); +int katja_import(const unsigned char *in, unsigned long inlen, katja_key *key); + +#endif + +/* ---- ECC Routines ---- */ +#ifdef MECC + +/* size of our temp buffers for exported keys */ +#define ECC_BUF_SIZE 256 + +/* max private key size */ +#define ECC_MAXSIZE 66 + +/** Structure defines a NIST GF(p) curve */ +typedef struct { + /** The size of the curve in octets */ + int size; + + /** name of curve */ + char *name; + + /** The prime that defines the field the curve is in (encoded in hex) */ + char *prime; + + /** The fields B param (hex) */ + char *B; + + /** The order of the curve (hex) */ + char *order; + + /** The x co-ordinate of the base point on the curve (hex) */ + char *Gx; + + /** The y co-ordinate of the base point on the curve (hex) */ + char *Gy; +} ltc_ecc_set_type; + +/** A point on a ECC curve, stored in Jacbobian format such that (x,y,z) => (x/z^2, y/z^3, 1) when interpretted as affine */ +typedef struct { + /** The x co-ordinate */ + void *x; + + /** The y co-ordinate */ + void *y; + + /** The z co-ordinate */ + void *z; +} ecc_point; + +/** An ECC key */ +typedef struct { + /** Type of key, PK_PRIVATE or PK_PUBLIC */ + int type; + + /** Index into the ltc_ecc_sets[] for the parameters of this curve; if -1, then this key is using user supplied curve in dp */ + int idx; + + /** pointer to domain parameters; either points to NIST curves (identified by idx >= 0) or user supplied curve */ + const ltc_ecc_set_type *dp; + + /** The public key */ + ecc_point pubkey; + + /** The private key */ + void *k; +} ecc_key; + +/** the ECC params provided */ +extern const ltc_ecc_set_type ltc_ecc_sets[]; + +int ecc_test(void); +void ecc_sizes(int *low, int *high); +int ecc_get_size(ecc_key *key); + +int ecc_make_key(prng_state *prng, int wprng, int keysize, ecc_key *key); +int ecc_make_key_ex(prng_state *prng, int wprng, ecc_key *key, const ltc_ecc_set_type *dp); +void ecc_free(ecc_key *key); + +int ecc_export(unsigned char *out, unsigned long *outlen, int type, ecc_key *key); +int ecc_import(const unsigned char *in, unsigned long inlen, ecc_key *key); +int ecc_import_ex(const unsigned char *in, unsigned long inlen, ecc_key *key, const ltc_ecc_set_type *dp); + +int ecc_ansi_x963_export(ecc_key *key, unsigned char *out, unsigned long *outlen); +int ecc_ansi_x963_import(const unsigned char *in, unsigned long inlen, ecc_key *key); +int ecc_ansi_x963_import_ex(const unsigned char *in, unsigned long inlen, ecc_key *key, ltc_ecc_set_type *dp); + +int ecc_shared_secret(ecc_key *private_key, ecc_key *public_key, + unsigned char *out, unsigned long *outlen); + +int ecc_encrypt_key(const unsigned char *in, unsigned long inlen, + unsigned char *out, unsigned long *outlen, + prng_state *prng, int wprng, int hash, + ecc_key *key); + +int ecc_decrypt_key(const unsigned char *in, unsigned long inlen, + unsigned char *out, unsigned long *outlen, + ecc_key *key); + +int ecc_sign_hash(const unsigned char *in, unsigned long inlen, + unsigned char *out, unsigned long *outlen, + prng_state *prng, int wprng, ecc_key *key); + +int ecc_verify_hash(const unsigned char *sig, unsigned long siglen, + const unsigned char *hash, unsigned long hashlen, + int *stat, ecc_key *key); + +/* low level functions */ +ecc_point *ltc_ecc_new_point(void); +void ltc_ecc_del_point(ecc_point *p); +int ltc_ecc_is_valid_idx(int n); + +/* point ops (mp == montgomery digit) */ +#if !defined(MECC_ACCEL) || defined(LTM_DESC) || defined(GMP_DESC) +/* R = 2P */ +int ltc_ecc_projective_dbl_point(ecc_point *P, ecc_point *R, void *modulus, void *mp); + +/* R = P + Q */ +int ltc_ecc_projective_add_point(ecc_point *P, ecc_point *Q, ecc_point *R, void *modulus, void *mp); +#endif + +#if defined(MECC_FP) +int ltc_ecc_fp_mulmod(void *k, ecc_point *G, ecc_point *R, void *modulus, int map); +int ltc_ecc_fp_save_state(unsigned char **out, unsigned long *outlen); +int ltc_ecc_fp_restore_state(unsigned char *in, unsigned long inlen); +void ltc_ecc_fp_free(void); +#endif + +/* R = kG */ +int ltc_ecc_mulmod(void *k, ecc_point *G, ecc_point *R, void *modulus, int map); + +#ifdef LTC_ECC_SHAMIR +/* kA*A + kB*B = C */ +int ltc_ecc_mul2add(ecc_point *A, void *kA, + ecc_point *B, void *kB, + ecc_point *C, + void *modulus); + +#ifdef MECC_FP +int ltc_ecc_fp_mul2add(ecc_point *A, void *kA, + ecc_point *B, void *kB, + ecc_point *C, void *modulus); +#endif + +#endif + + +/* map P to affine from projective */ +int ltc_ecc_map(ecc_point *P, void *modulus, void *mp); + +#endif + +#ifdef MDSA + +/* Max diff between group and modulus size in bytes */ +#define MDSA_DELTA 512 + +/* Max DSA group size in bytes (default allows 4k-bit groups) */ +#define MDSA_MAX_GROUP 512 + +/** DSA key structure */ +typedef struct { + /** The key type, PK_PRIVATE or PK_PUBLIC */ + int type; + + /** The order of the sub-group used in octets */ + int qord; + + /** The generator */ + void *g; + + /** The prime used to generate the sub-group */ + void *q; + + /** The large prime that generats the field the contains the sub-group */ + void *p; + + /** The private key */ + void *x; + + /** The public key */ + void *y; +} dsa_key; + +int dsa_make_key(prng_state *prng, int wprng, int group_size, int modulus_size, dsa_key *key); +void dsa_free(dsa_key *key); + +int dsa_sign_hash_raw(const unsigned char *in, unsigned long inlen, + void *r, void *s, + prng_state *prng, int wprng, dsa_key *key); + +int dsa_sign_hash(const unsigned char *in, unsigned long inlen, + unsigned char *out, unsigned long *outlen, + prng_state *prng, int wprng, dsa_key *key); + +int dsa_verify_hash_raw( void *r, void *s, + const unsigned char *hash, unsigned long hashlen, + int *stat, dsa_key *key); + +int dsa_verify_hash(const unsigned char *sig, unsigned long siglen, + const unsigned char *hash, unsigned long hashlen, + int *stat, dsa_key *key); + +int dsa_encrypt_key(const unsigned char *in, unsigned long inlen, + unsigned char *out, unsigned long *outlen, + prng_state *prng, int wprng, int hash, + dsa_key *key); + +int dsa_decrypt_key(const unsigned char *in, unsigned long inlen, + unsigned char *out, unsigned long *outlen, + dsa_key *key); + +int dsa_import(const unsigned char *in, unsigned long inlen, dsa_key *key); +int dsa_export(unsigned char *out, unsigned long *outlen, int type, dsa_key *key); +int dsa_verify_key(dsa_key *key, int *stat); + +int dsa_shared_secret(void *private_key, void *base, + dsa_key *public_key, + unsigned char *out, unsigned long *outlen); +#endif + +#ifdef LTC_DER +/* DER handling */ + +enum { + LTC_ASN1_EOL, + LTC_ASN1_BOOLEAN, + LTC_ASN1_INTEGER, + LTC_ASN1_SHORT_INTEGER, + LTC_ASN1_BIT_STRING, + LTC_ASN1_OCTET_STRING, + LTC_ASN1_NULL, + LTC_ASN1_OBJECT_IDENTIFIER, + LTC_ASN1_IA5_STRING, + LTC_ASN1_PRINTABLE_STRING, + LTC_ASN1_UTF8_STRING, + LTC_ASN1_UTCTIME, + LTC_ASN1_CHOICE, + LTC_ASN1_SEQUENCE, + LTC_ASN1_SET, + LTC_ASN1_SETOF +}; + +/** A LTC ASN.1 list type */ +typedef struct ltc_asn1_list_ { + /** The LTC ASN.1 enumerated type identifier */ + int type; + /** The data to encode or place for decoding */ + void *data; + /** The size of the input or resulting output */ + unsigned long size; + /** The used flag, this is used by the CHOICE ASN.1 type to indicate which choice was made */ + int used; + /** prev/next entry in the list */ + struct ltc_asn1_list_ *prev, *next, *child, *parent; +} ltc_asn1_list; + +#define LTC_SET_ASN1(list, index, Type, Data, Size) \ + do { \ + int LTC_MACRO_temp = (index); \ + ltc_asn1_list *LTC_MACRO_list = (list); \ + LTC_MACRO_list[LTC_MACRO_temp].type = (Type); \ + LTC_MACRO_list[LTC_MACRO_temp].data = (void*)(Data); \ + LTC_MACRO_list[LTC_MACRO_temp].size = (Size); \ + LTC_MACRO_list[LTC_MACRO_temp].used = 0; \ + } while (0); + +/* SEQUENCE */ +int der_encode_sequence_ex(ltc_asn1_list *list, unsigned long inlen, + unsigned char *out, unsigned long *outlen, int type_of); + +#define der_encode_sequence(list, inlen, out, outlen) der_encode_sequence_ex(list, inlen, out, outlen, LTC_ASN1_SEQUENCE) + +int der_decode_sequence_ex(const unsigned char *in, unsigned long inlen, + ltc_asn1_list *list, unsigned long outlen, int ordered); + +#define der_decode_sequence(in, inlen, list, outlen) der_decode_sequence_ex(in, inlen, list, outlen, 1) + +int der_length_sequence(ltc_asn1_list *list, unsigned long inlen, + unsigned long *outlen); + +/* SET */ +#define der_decode_set(in, inlen, list, outlen) der_decode_sequence_ex(in, inlen, list, outlen, 0) +#define der_length_set der_length_sequence +int der_encode_set(ltc_asn1_list *list, unsigned long inlen, + unsigned char *out, unsigned long *outlen); + +int der_encode_setof(ltc_asn1_list *list, unsigned long inlen, + unsigned char *out, unsigned long *outlen); + +/* VA list handy helpers with triplets of <type, size, data> */ +int der_encode_sequence_multi(unsigned char *out, unsigned long *outlen, ...); +int der_decode_sequence_multi(const unsigned char *in, unsigned long inlen, ...); + +/* FLEXI DECODER handle unknown list decoder */ +int der_decode_sequence_flexi(const unsigned char *in, unsigned long *inlen, ltc_asn1_list **out); +void der_free_sequence_flexi(ltc_asn1_list *list); +void der_sequence_free(ltc_asn1_list *in); + +/* BOOLEAN */ +int der_length_boolean(unsigned long *outlen); +int der_encode_boolean(int in, + unsigned char *out, unsigned long *outlen); +int der_decode_boolean(const unsigned char *in, unsigned long inlen, + int *out); +/* INTEGER */ +int der_encode_integer(void *num, unsigned char *out, unsigned long *outlen); +int der_decode_integer(const unsigned char *in, unsigned long inlen, void *num); +int der_length_integer(void *num, unsigned long *len); + +/* INTEGER -- handy for 0..2^32-1 values */ +int der_decode_short_integer(const unsigned char *in, unsigned long inlen, unsigned long *num); +int der_encode_short_integer(unsigned long num, unsigned char *out, unsigned long *outlen); +int der_length_short_integer(unsigned long num, unsigned long *outlen); + +/* BIT STRING */ +int der_encode_bit_string(const unsigned char *in, unsigned long inlen, + unsigned char *out, unsigned long *outlen); +int der_decode_bit_string(const unsigned char *in, unsigned long inlen, + unsigned char *out, unsigned long *outlen); +int der_length_bit_string(unsigned long nbits, unsigned long *outlen); + +/* OCTET STRING */ +int der_encode_octet_string(const unsigned char *in, unsigned long inlen, + unsigned char *out, unsigned long *outlen); +int der_decode_octet_string(const unsigned char *in, unsigned long inlen, + unsigned char *out, unsigned long *outlen); +int der_length_octet_string(unsigned long noctets, unsigned long *outlen); + +/* OBJECT IDENTIFIER */ +int der_encode_object_identifier(unsigned long *words, unsigned long nwords, + unsigned char *out, unsigned long *outlen); +int der_decode_object_identifier(const unsigned char *in, unsigned long inlen, + unsigned long *words, unsigned long *outlen); +int der_length_object_identifier(unsigned long *words, unsigned long nwords, unsigned long *outlen); +unsigned long der_object_identifier_bits(unsigned long x); + +/* IA5 STRING */ +int der_encode_ia5_string(const unsigned char *in, unsigned long inlen, + unsigned char *out, unsigned long *outlen); +int der_decode_ia5_string(const unsigned char *in, unsigned long inlen, + unsigned char *out, unsigned long *outlen); +int der_length_ia5_string(const unsigned char *octets, unsigned long noctets, unsigned long *outlen); + +int der_ia5_char_encode(int c); +int der_ia5_value_decode(int v); + +/* Printable STRING */ +int der_encode_printable_string(const unsigned char *in, unsigned long inlen, + unsigned char *out, unsigned long *outlen); +int der_decode_printable_string(const unsigned char *in, unsigned long inlen, + unsigned char *out, unsigned long *outlen); +int der_length_printable_string(const unsigned char *octets, unsigned long noctets, unsigned long *outlen); + +int der_printable_char_encode(int c); +int der_printable_value_decode(int v); + +/* UTF-8 */ +#if (defined(SIZE_MAX) || __STDC_VERSION__ >= 199901L || defined(WCHAR_MAX) || defined(_WCHAR_T) || defined(_WCHAR_T_DEFINED)) && !defined(LTC_NO_WCHAR) +#include <wchar.h> +#else +typedef ulong32 wchar_t; +#endif + +int der_encode_utf8_string(const wchar_t *in, unsigned long inlen, + unsigned char *out, unsigned long *outlen); + +int der_decode_utf8_string(const unsigned char *in, unsigned long inlen, + wchar_t *out, unsigned long *outlen); +unsigned long der_utf8_charsize(const wchar_t c); +int der_length_utf8_string(const wchar_t *in, unsigned long noctets, unsigned long *outlen); + + +/* CHOICE */ +int der_decode_choice(const unsigned char *in, unsigned long *inlen, + ltc_asn1_list *list, unsigned long outlen); + +/* UTCTime */ +typedef struct { + unsigned YY, /* year */ + MM, /* month */ + DD, /* day */ + hh, /* hour */ + mm, /* minute */ + ss, /* second */ + off_dir, /* timezone offset direction 0 == +, 1 == - */ + off_hh, /* timezone offset hours */ + off_mm; /* timezone offset minutes */ +} ltc_utctime; + +int der_encode_utctime(ltc_utctime *utctime, + unsigned char *out, unsigned long *outlen); + +int der_decode_utctime(const unsigned char *in, unsigned long *inlen, + ltc_utctime *out); + +int der_length_utctime(ltc_utctime *utctime, unsigned long *outlen); + + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/headers/tomcrypt_pk.h,v $ */ +/* $Revision: 1.77 $ */ +/* $Date: 2006/12/03 00:39:56 $ */ diff --git a/libtomcrypt/src/headers/tomcrypt_pkcs.h b/libtomcrypt/src/headers/tomcrypt_pkcs.h new file mode 100644 index 0000000..71bcdb9 --- /dev/null +++ b/libtomcrypt/src/headers/tomcrypt_pkcs.h @@ -0,0 +1,89 @@ +/* PKCS Header Info */ + +/* ===> PKCS #1 -- RSA Cryptography <=== */ +#ifdef PKCS_1 + +enum ltc_pkcs_1_v1_5_blocks +{ + LTC_PKCS_1_EMSA = 1, /* Block type 1 (PKCS #1 v1.5 signature padding) */ + LTC_PKCS_1_EME = 2 /* Block type 2 (PKCS #1 v1.5 encryption padding) */ +}; + +enum ltc_pkcs_1_paddings +{ + LTC_PKCS_1_V1_5 = 1, /* PKCS #1 v1.5 padding (\sa ltc_pkcs_1_v1_5_blocks) */ + LTC_PKCS_1_OAEP = 2, /* PKCS #1 v2.0 encryption padding */ + LTC_PKCS_1_PSS = 3 /* PKCS #1 v2.1 signature padding */ +}; + +int pkcs_1_mgf1( int hash_idx, + const unsigned char *seed, unsigned long seedlen, + unsigned char *mask, unsigned long masklen); + +int pkcs_1_i2osp(void *n, unsigned long modulus_len, unsigned char *out); +int pkcs_1_os2ip(void *n, unsigned char *in, unsigned long inlen); + +/* *** v1.5 padding */ +int pkcs_1_v1_5_encode(const unsigned char *msg, + unsigned long msglen, + int block_type, + unsigned long modulus_bitlen, + prng_state *prng, + int prng_idx, + unsigned char *out, + unsigned long *outlen); + +int pkcs_1_v1_5_decode(const unsigned char *msg, + unsigned long msglen, + int block_type, + unsigned long modulus_bitlen, + unsigned char *out, + unsigned long *outlen, + int *is_valid); + +/* *** v2.1 padding */ +int pkcs_1_oaep_encode(const unsigned char *msg, unsigned long msglen, + const unsigned char *lparam, unsigned long lparamlen, + unsigned long modulus_bitlen, prng_state *prng, + int prng_idx, int hash_idx, + unsigned char *out, unsigned long *outlen); + +int pkcs_1_oaep_decode(const unsigned char *msg, unsigned long msglen, + const unsigned char *lparam, unsigned long lparamlen, + unsigned long modulus_bitlen, int hash_idx, + unsigned char *out, unsigned long *outlen, + int *res); + +int pkcs_1_pss_encode(const unsigned char *msghash, unsigned long msghashlen, + unsigned long saltlen, prng_state *prng, + int prng_idx, int hash_idx, + unsigned long modulus_bitlen, + unsigned char *out, unsigned long *outlen); + +int pkcs_1_pss_decode(const unsigned char *msghash, unsigned long msghashlen, + const unsigned char *sig, unsigned long siglen, + unsigned long saltlen, int hash_idx, + unsigned long modulus_bitlen, int *res); + +#endif /* PKCS_1 */ + +/* ===> PKCS #5 -- Password Based Cryptography <=== */ +#ifdef PKCS_5 + +/* Algorithm #1 (old) */ +int pkcs_5_alg1(const unsigned char *password, unsigned long password_len, + const unsigned char *salt, + int iteration_count, int hash_idx, + unsigned char *out, unsigned long *outlen); + +/* Algorithm #2 (new) */ +int pkcs_5_alg2(const unsigned char *password, unsigned long password_len, + const unsigned char *salt, unsigned long salt_len, + int iteration_count, int hash_idx, + unsigned char *out, unsigned long *outlen); + +#endif /* PKCS_5 */ + +/* $Source: /cvs/libtom/libtomcrypt/src/headers/tomcrypt_pkcs.h,v $ */ +/* $Revision: 1.7 $ */ +/* $Date: 2006/11/15 12:44:59 $ */ diff --git a/libtomcrypt/src/headers/tomcrypt_prng.h b/libtomcrypt/src/headers/tomcrypt_prng.h new file mode 100644 index 0000000..dd640c9 --- /dev/null +++ b/libtomcrypt/src/headers/tomcrypt_prng.h @@ -0,0 +1,199 @@ +/* ---- PRNG Stuff ---- */ +#ifdef YARROW +struct yarrow_prng { + int cipher, hash; + unsigned char pool[MAXBLOCKSIZE]; + symmetric_CTR ctr; + LTC_MUTEX_TYPE(prng_lock) +}; +#endif + +#ifdef RC4 +struct rc4_prng { + int x, y; + unsigned char buf[256]; +}; +#endif + +#ifdef FORTUNA +struct fortuna_prng { + hash_state pool[FORTUNA_POOLS]; /* the pools */ + + symmetric_key skey; + + unsigned char K[32], /* the current key */ + IV[16]; /* IV for CTR mode */ + + unsigned long pool_idx, /* current pool we will add to */ + pool0_len, /* length of 0'th pool */ + wd; + + ulong64 reset_cnt; /* number of times we have reset */ + LTC_MUTEX_TYPE(prng_lock) +}; +#endif + +#ifdef SOBER128 +struct sober128_prng { + ulong32 R[17], /* Working storage for the shift register */ + initR[17], /* saved register contents */ + konst, /* key dependent constant */ + sbuf; /* partial word encryption buffer */ + + int nbuf, /* number of part-word stream bits buffered */ + flag, /* first add_entropy call or not? */ + set; /* did we call add_entropy to set key? */ + +}; +#endif + +typedef union Prng_state { + char dummy[1]; +#ifdef YARROW + struct yarrow_prng yarrow; +#endif +#ifdef RC4 + struct rc4_prng rc4; +#endif +#ifdef FORTUNA + struct fortuna_prng fortuna; +#endif +#ifdef SOBER128 + struct sober128_prng sober128; +#endif +} prng_state; + +/** PRNG descriptor */ +extern struct ltc_prng_descriptor { + /** Name of the PRNG */ + char *name; + /** size in bytes of exported state */ + int export_size; + /** Start a PRNG state + @param prng [out] The state to initialize + @return CRYPT_OK if successful + */ + int (*start)(prng_state *prng); + /** Add entropy to the PRNG + @param in The entropy + @param inlen Length of the entropy (octets)\ + @param prng The PRNG state + @return CRYPT_OK if successful + */ + int (*add_entropy)(const unsigned char *in, unsigned long inlen, prng_state *prng); + /** Ready a PRNG state to read from + @param prng The PRNG state to ready + @return CRYPT_OK if successful + */ + int (*ready)(prng_state *prng); + /** Read from the PRNG + @param out [out] Where to store the data + @param outlen Length of data desired (octets) + @param prng The PRNG state to read from + @return Number of octets read + */ + unsigned long (*read)(unsigned char *out, unsigned long outlen, prng_state *prng); + /** Terminate a PRNG state + @param prng The PRNG state to terminate + @return CRYPT_OK if successful + */ + int (*done)(prng_state *prng); + /** Export a PRNG state + @param out [out] The destination for the state + @param outlen [in/out] The max size and resulting size of the PRNG state + @param prng The PRNG to export + @return CRYPT_OK if successful + */ + int (*pexport)(unsigned char *out, unsigned long *outlen, prng_state *prng); + /** Import a PRNG state + @param in The data to import + @param inlen The length of the data to import (octets) + @param prng The PRNG to initialize/import + @return CRYPT_OK if successful + */ + int (*pimport)(const unsigned char *in, unsigned long inlen, prng_state *prng); + /** Self-test the PRNG + @return CRYPT_OK if successful, CRYPT_NOP if self-testing has been disabled + */ + int (*test)(void); +} prng_descriptor[]; + +#ifdef YARROW +int yarrow_start(prng_state *prng); +int yarrow_add_entropy(const unsigned char *in, unsigned long inlen, prng_state *prng); +int yarrow_ready(prng_state *prng); +unsigned long yarrow_read(unsigned char *out, unsigned long outlen, prng_state *prng); +int yarrow_done(prng_state *prng); +int yarrow_export(unsigned char *out, unsigned long *outlen, prng_state *prng); +int yarrow_import(const unsigned char *in, unsigned long inlen, prng_state *prng); +int yarrow_test(void); +extern const struct ltc_prng_descriptor yarrow_desc; +#endif + +#ifdef FORTUNA +int fortuna_start(prng_state *prng); +int fortuna_add_entropy(const unsigned char *in, unsigned long inlen, prng_state *prng); +int fortuna_ready(prng_state *prng); +unsigned long fortuna_read(unsigned char *out, unsigned long outlen, prng_state *prng); +int fortuna_done(prng_state *prng); +int fortuna_export(unsigned char *out, unsigned long *outlen, prng_state *prng); +int fortuna_import(const unsigned char *in, unsigned long inlen, prng_state *prng); +int fortuna_test(void); +extern const struct ltc_prng_descriptor fortuna_desc; +#endif + +#ifdef RC4 +int rc4_start(prng_state *prng); +int rc4_add_entropy(const unsigned char *in, unsigned long inlen, prng_state *prng); +int rc4_ready(prng_state *prng); +unsigned long rc4_read(unsigned char *out, unsigned long outlen, prng_state *prng); +int rc4_done(prng_state *prng); +int rc4_export(unsigned char *out, unsigned long *outlen, prng_state *prng); +int rc4_import(const unsigned char *in, unsigned long inlen, prng_state *prng); +int rc4_test(void); +extern const struct ltc_prng_descriptor rc4_desc; +#endif + +#ifdef SPRNG +int sprng_start(prng_state *prng); +int sprng_add_entropy(const unsigned char *in, unsigned long inlen, prng_state *prng); +int sprng_ready(prng_state *prng); +unsigned long sprng_read(unsigned char *out, unsigned long outlen, prng_state *prng); +int sprng_done(prng_state *prng); +int sprng_export(unsigned char *out, unsigned long *outlen, prng_state *prng); +int sprng_import(const unsigned char *in, unsigned long inlen, prng_state *prng); +int sprng_test(void); +extern const struct ltc_prng_descriptor sprng_desc; +#endif + +#ifdef SOBER128 +int sober128_start(prng_state *prng); +int sober128_add_entropy(const unsigned char *in, unsigned long inlen, prng_state *prng); +int sober128_ready(prng_state *prng); +unsigned long sober128_read(unsigned char *out, unsigned long outlen, prng_state *prng); +int sober128_done(prng_state *prng); +int sober128_export(unsigned char *out, unsigned long *outlen, prng_state *prng); +int sober128_import(const unsigned char *in, unsigned long inlen, prng_state *prng); +int sober128_test(void); +extern const struct ltc_prng_descriptor sober128_desc; +#endif + +int find_prng(const char *name); +int register_prng(const struct ltc_prng_descriptor *prng); +int unregister_prng(const struct ltc_prng_descriptor *prng); +int prng_is_valid(int idx); +LTC_MUTEX_PROTO(ltc_prng_mutex) + +/* Slow RNG you **might** be able to use to seed a PRNG with. Be careful as this + * might not work on all platforms as planned + */ +unsigned long rng_get_bytes(unsigned char *out, + unsigned long outlen, + void (*callback)(void)); + +int rng_make_prng(int bits, int wprng, prng_state *prng, void (*callback)(void)); + + +/* $Source: /cvs/libtom/libtomcrypt/src/headers/tomcrypt_prng.h,v $ */ +/* $Revision: 1.8 $ */ +/* $Date: 2006/11/05 01:36:43 $ */ diff --git a/libtomcrypt/src/mac/f9/f9_done.c b/libtomcrypt/src/mac/f9/f9_done.c new file mode 100644 index 0000000..1794ecc --- /dev/null +++ b/libtomcrypt/src/mac/f9/f9_done.c @@ -0,0 +1,77 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file f9_done.c + f9 Support, terminate the state +*/ + +#ifdef LTC_F9_MODE + +/** Terminate the f9-MAC state + @param f9 f9 state to terminate + @param out [out] Destination for the MAC tag + @param outlen [in/out] Destination size and final tag size + Return CRYPT_OK on success +*/ +int f9_done(f9_state *f9, unsigned char *out, unsigned long *outlen) +{ + int err, x; + LTC_ARGCHK(f9 != NULL); + LTC_ARGCHK(out != NULL); + + /* check structure */ + if ((err = cipher_is_valid(f9->cipher)) != CRYPT_OK) { + return err; + } + + if ((f9->blocksize > cipher_descriptor[f9->cipher].block_length) || (f9->blocksize < 0) || + (f9->buflen > f9->blocksize) || (f9->buflen < 0)) { + return CRYPT_INVALID_ARG; + } + + if (f9->buflen != 0) { + /* encrypt */ + cipher_descriptor[f9->cipher].ecb_encrypt(f9->IV, f9->IV, &f9->key); + f9->buflen = 0; + for (x = 0; x < f9->blocksize; x++) { + f9->ACC[x] ^= f9->IV[x]; + } + } + + /* schedule modified key */ + if ((err = cipher_descriptor[f9->cipher].setup(f9->akey, f9->keylen, 0, &f9->key)) != CRYPT_OK) { + return err; + } + + /* encrypt the ACC */ + cipher_descriptor[f9->cipher].ecb_encrypt(f9->ACC, f9->ACC, &f9->key); + cipher_descriptor[f9->cipher].done(&f9->key); + + /* extract tag */ + for (x = 0; x < f9->blocksize && (unsigned long)x < *outlen; x++) { + out[x] = f9->ACC[x]; + } + *outlen = x; + +#ifdef LTC_CLEAN_STACK + zeromem(f9, sizeof(*f9)); +#endif + return CRYPT_OK; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/mac/f9/f9_done.c,v $ */ +/* $Revision: 1.5 $ */ +/* $Date: 2006/11/09 01:53:32 $ */ + diff --git a/libtomcrypt/src/mac/f9/f9_file.c b/libtomcrypt/src/mac/f9/f9_file.c new file mode 100644 index 0000000..4c53e76 --- /dev/null +++ b/libtomcrypt/src/mac/f9/f9_file.c @@ -0,0 +1,83 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file f9_file.c + f9 support, process a file, Tom St Denis +*/ + +#ifdef LTC_F9_MODE + +/** + f9 a file + @param cipher The index of the cipher desired + @param key The secret key + @param keylen The length of the secret key (octets) + @param filename The name of the file you wish to f9 + @param out [out] Where the authentication tag is to be stored + @param outlen [in/out] The max size and resulting size of the authentication tag + @return CRYPT_OK if successful, CRYPT_NOP if file support has been disabled +*/ +int f9_file(int cipher, + const unsigned char *key, unsigned long keylen, + const char *filename, + unsigned char *out, unsigned long *outlen) +{ +#ifdef LTC_NO_FILE + return CRYPT_NOP; +#else + int err, x; + f9_state f9; + FILE *in; + unsigned char buf[512]; + + LTC_ARGCHK(key != NULL); + LTC_ARGCHK(filename != NULL); + LTC_ARGCHK(out != NULL); + LTC_ARGCHK(outlen != NULL); + + in = fopen(filename, "rb"); + if (in == NULL) { + return CRYPT_FILE_NOTFOUND; + } + + if ((err = f9_init(&f9, cipher, key, keylen)) != CRYPT_OK) { + fclose(in); + return err; + } + + do { + x = fread(buf, 1, sizeof(buf), in); + if ((err = f9_process(&f9, buf, x)) != CRYPT_OK) { + fclose(in); + return err; + } + } while (x == sizeof(buf)); + fclose(in); + + if ((err = f9_done(&f9, out, outlen)) != CRYPT_OK) { + return err; + } + +#ifdef LTC_CLEAN_STACK + zeromem(buf, sizeof(buf)); +#endif + + return CRYPT_OK; +#endif +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/mac/f9/f9_file.c,v $ */ +/* $Revision: 1.4 $ */ +/* $Date: 2006/11/21 00:18:23 $ */ diff --git a/libtomcrypt/src/mac/f9/f9_init.c b/libtomcrypt/src/mac/f9/f9_init.c new file mode 100644 index 0000000..aefd8a7 --- /dev/null +++ b/libtomcrypt/src/mac/f9/f9_init.c @@ -0,0 +1,70 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file f9_init.c + F9 Support, start an F9 state +*/ + +#ifdef LTC_F9_MODE + +/** Initialize F9-MAC state + @param f9 [out] f9 state to initialize + @param cipher Index of cipher to use + @param key [in] Secret key + @param keylen Length of secret key in octets + Return CRYPT_OK on success +*/ +int f9_init(f9_state *f9, int cipher, const unsigned char *key, unsigned long keylen) +{ + int x, err; + + LTC_ARGCHK(f9 != NULL); + LTC_ARGCHK(key != NULL); + + /* schedule the key */ + if ((err = cipher_is_valid(cipher)) != CRYPT_OK) { + return err; + } + +#ifdef LTC_FAST + if (cipher_descriptor[cipher].block_length % sizeof(LTC_FAST_TYPE)) { + return CRYPT_INVALID_ARG; + } +#endif + + if ((err = cipher_descriptor[cipher].setup(key, keylen, 0, &f9->key)) != CRYPT_OK) { + goto done; + } + + /* make the second key */ + for (x = 0; (unsigned)x < keylen; x++) { + f9->akey[x] = key[x] ^ 0xAA; + } + + /* setup struct */ + zeromem(f9->IV, cipher_descriptor[cipher].block_length); + zeromem(f9->ACC, cipher_descriptor[cipher].block_length); + f9->blocksize = cipher_descriptor[cipher].block_length; + f9->cipher = cipher; + f9->buflen = 0; + f9->keylen = keylen; +done: + return err; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/mac/f9/f9_init.c,v $ */ +/* $Revision: 1.4 $ */ +/* $Date: 2006/11/08 22:54:18 $ */ + diff --git a/libtomcrypt/src/mac/f9/f9_memory.c b/libtomcrypt/src/mac/f9/f9_memory.c new file mode 100644 index 0000000..2b3901a --- /dev/null +++ b/libtomcrypt/src/mac/f9/f9_memory.c @@ -0,0 +1,71 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file f9_process.c + f9 Support, Process a block through F9-MAC +*/ + +#ifdef LTC_F9_MODE + +/** f9-MAC a block of memory + @param cipher Index of cipher to use + @param key [in] Secret key + @param keylen Length of key in octets + @param in [in] Message to MAC + @param inlen Length of input in octets + @param out [out] Destination for the MAC tag + @param outlen [in/out] Output size and final tag size + Return CRYPT_OK on success. +*/ +int f9_memory(int cipher, + const unsigned char *key, unsigned long keylen, + const unsigned char *in, unsigned long inlen, + unsigned char *out, unsigned long *outlen) +{ + f9_state *f9; + int err; + + /* is the cipher valid? */ + if ((err = cipher_is_valid(cipher)) != CRYPT_OK) { + return err; + } + + /* Use accelerator if found */ + if (cipher_descriptor[cipher].f9_memory != NULL) { + return cipher_descriptor[cipher].f9_memory(key, keylen, in, inlen, out, outlen); + } + + f9 = XCALLOC(1, sizeof(*f9)); + if (f9 == NULL) { + return CRYPT_MEM; + } + + if ((err = f9_init(f9, cipher, key, keylen)) != CRYPT_OK) { + goto done; + } + + if ((err = f9_process(f9, in, inlen)) != CRYPT_OK) { + goto done; + } + + err = f9_done(f9, out, outlen); +done: + XFREE(f9); + return err; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/mac/f9/f9_memory.c,v $ */ +/* $Revision: 1.4 $ */ +/* $Date: 2006/11/21 23:02:42 $ */ diff --git a/libtomcrypt/src/mac/f9/f9_memory_multi.c b/libtomcrypt/src/mac/f9/f9_memory_multi.c new file mode 100644 index 0000000..5b315f5 --- /dev/null +++ b/libtomcrypt/src/mac/f9/f9_memory_multi.c @@ -0,0 +1,90 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" +#include <stdarg.h> + +/** + @file f9_memory_multi.c + f9 support, process multiple blocks of memory, Tom St Denis +*/ + +#ifdef LTC_F9_MODE + +/** + f9 multiple blocks of memory + @param cipher The index of the desired cipher + @param key The secret key + @param keylen The length of the secret key (octets) + @param out [out] The destination of the authentication tag + @param outlen [in/out] The max size and resulting size of the authentication tag (octets) + @param in The data to send through f9 + @param inlen The length of the data to send through f9 (octets) + @param ... tuples of (data,len) pairs to f9, terminated with a (NULL,x) (x=don't care) + @return CRYPT_OK if successful +*/ +int f9_memory_multi(int cipher, + const unsigned char *key, unsigned long keylen, + unsigned char *out, unsigned long *outlen, + const unsigned char *in, unsigned long inlen, ...) +{ + int err; + f9_state *f9; + va_list args; + const unsigned char *curptr; + unsigned long curlen; + + LTC_ARGCHK(key != NULL); + LTC_ARGCHK(in != NULL); + LTC_ARGCHK(out != NULL); + LTC_ARGCHK(outlen != NULL); + + /* allocate ram for f9 state */ + f9 = XMALLOC(sizeof(f9_state)); + if (f9 == NULL) { + return CRYPT_MEM; + } + + /* f9 process the message */ + if ((err = f9_init(f9, cipher, key, keylen)) != CRYPT_OK) { + goto LBL_ERR; + } + va_start(args, inlen); + curptr = in; + curlen = inlen; + for (;;) { + /* process buf */ + if ((err = f9_process(f9, curptr, curlen)) != CRYPT_OK) { + goto LBL_ERR; + } + /* step to next */ + curptr = va_arg(args, const unsigned char*); + if (curptr == NULL) { + break; + } + curlen = va_arg(args, unsigned long); + } + if ((err = f9_done(f9, out, outlen)) != CRYPT_OK) { + goto LBL_ERR; + } +LBL_ERR: +#ifdef LTC_CLEAN_STACK + zeromem(f9, sizeof(f9_state)); +#endif + XFREE(f9); + va_end(args); + return err; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/mac/f9/f9_memory_multi.c,v $ */ +/* $Revision: 1.2 $ */ +/* $Date: 2006/11/08 21:50:13 $ */ diff --git a/libtomcrypt/src/mac/f9/f9_process.c b/libtomcrypt/src/mac/f9/f9_process.c new file mode 100644 index 0000000..e8bd88b --- /dev/null +++ b/libtomcrypt/src/mac/f9/f9_process.c @@ -0,0 +1,78 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file f9_process.c + f9 Support, process blocks with f9 +*/ + +#ifdef LTC_F9_MODE + +/** Process data through f9-MAC + @param f9 The f9-MAC state + @param in Input data to process + @param inlen Length of input in octets + Return CRYPT_OK on success +*/ +int f9_process(f9_state *f9, const unsigned char *in, unsigned long inlen) +{ + int err, x; + + LTC_ARGCHK(f9 != NULL); + LTC_ARGCHK(in != NULL); + + /* check structure */ + if ((err = cipher_is_valid(f9->cipher)) != CRYPT_OK) { + return err; + } + + if ((f9->blocksize > cipher_descriptor[f9->cipher].block_length) || (f9->blocksize < 0) || + (f9->buflen > f9->blocksize) || (f9->buflen < 0)) { + return CRYPT_INVALID_ARG; + } + +#ifdef LTC_FAST + if (f9->buflen == 0) { + while (inlen >= (unsigned long)f9->blocksize) { + for (x = 0; x < f9->blocksize; x += sizeof(LTC_FAST_TYPE)) { + *((LTC_FAST_TYPE*)&(f9->IV[x])) ^= *((LTC_FAST_TYPE*)&(in[x])); + } + cipher_descriptor[f9->cipher].ecb_encrypt(f9->IV, f9->IV, &f9->key); + for (x = 0; x < f9->blocksize; x += sizeof(LTC_FAST_TYPE)) { + *((LTC_FAST_TYPE*)&(f9->ACC[x])) ^= *((LTC_FAST_TYPE*)&(f9->IV[x])); + } + in += f9->blocksize; + inlen -= f9->blocksize; + } + } +#endif + + while (inlen) { + if (f9->buflen == f9->blocksize) { + cipher_descriptor[f9->cipher].ecb_encrypt(f9->IV, f9->IV, &f9->key); + for (x = 0; x < f9->blocksize; x++) { + f9->ACC[x] ^= f9->IV[x]; + } + f9->buflen = 0; + } + f9->IV[f9->buflen++] ^= *in++; + --inlen; + } + return CRYPT_OK; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/mac/f9/f9_process.c,v $ */ +/* $Revision: 1.3 $ */ +/* $Date: 2006/12/16 17:41:21 $ */ + diff --git a/libtomcrypt/src/mac/f9/f9_test.c b/libtomcrypt/src/mac/f9/f9_test.c new file mode 100644 index 0000000..4cddfe6 --- /dev/null +++ b/libtomcrypt/src/mac/f9/f9_test.c @@ -0,0 +1,78 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file f9_test.c + f9 Support, Test F9 mode +*/ + +#ifdef LTC_F9_MODE + +/** Test f9-MAC mode + Return CRYPT_OK on succes +*/ +int f9_test(void) +{ +#ifdef LTC_NO_TEST + return CRYPT_NOP; +#else + static const struct { + int msglen; + unsigned char K[16], M[128], T[4]; + } tests[] = { +{ + 20, + { 0x2B, 0xD6, 0x45, 0x9F, 0x82, 0xC5, 0xB3, 0x00, 0x95, 0x2C, 0x49, 0x10, 0x48, 0x81, 0xFF, 0x48 }, + { 0x38, 0xA6, 0xF0, 0x56, 0xB8, 0xAE, 0xFD, 0xA9, 0x33, 0x32, 0x34, 0x62, 0x63, 0x39, 0x38, 0x61, 0x37, 0x34, 0x79, 0x40 }, + { 0x46, 0xE0, 0x0D, 0x4B } +}, + +{ + 105, + { 0x83, 0xFD, 0x23, 0xA2, 0x44, 0xA7, 0x4C, 0xF3, 0x58, 0xDA, 0x30, 0x19, 0xF1, 0x72, 0x26, 0x35 }, + { 0x36, 0xAF, 0x61, 0x44, 0x4F, 0x30, 0x2A, 0xD2, + 0x35, 0xC6, 0x87, 0x16, 0x63, 0x3C, 0x66, 0xFB, 0x75, 0x0C, 0x26, 0x68, 0x65, 0xD5, 0x3C, 0x11, 0xEA, 0x05, 0xB1, 0xE9, 0xFA, 0x49, 0xC8, 0x39, 0x8D, 0x48, 0xE1, 0xEF, 0xA5, 0x90, 0x9D, 0x39, + 0x47, 0x90, 0x28, 0x37, 0xF5, 0xAE, 0x96, 0xD5, 0xA0, 0x5B, 0xC8, 0xD6, 0x1C, 0xA8, 0xDB, 0xEF, 0x1B, 0x13, 0xA4, 0xB4, 0xAB, 0xFE, 0x4F, 0xB1, 0x00, 0x60, 0x45, 0xB6, 0x74, 0xBB, 0x54, 0x72, + 0x93, 0x04, 0xC3, 0x82, 0xBE, 0x53, 0xA5, 0xAF, 0x05, 0x55, 0x61, 0x76, 0xF6, 0xEA, 0xA2, 0xEF, 0x1D, 0x05, 0xE4, 0xB0, 0x83, 0x18, 0x1E, 0xE6, 0x74, 0xCD, 0xA5, 0xA4, 0x85, 0xF7, 0x4D, 0x7A, + 0x40|0x80 }, + { 0x95, 0xAE, 0x41, 0xBA }, +} +}; + unsigned char T[16]; + unsigned long taglen; + int err, x, idx; + + /* find kasumi */ + if ((idx = find_cipher("kasumi")) == -1) { + return CRYPT_NOP; + } + + for (x = 0; x < (int)(sizeof(tests)/sizeof(tests[0])); x++) { + taglen = 4; + if ((err = f9_memory(idx, tests[x].K, 16, tests[x].M, tests[x].msglen, T, &taglen)) != CRYPT_OK) { + return err; + } + if (taglen != 4 || XMEMCMP(T, tests[x].T, 4)) { + return CRYPT_FAIL_TESTVECTOR; + } + } + + return CRYPT_OK; +#endif +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/mac/f9/f9_test.c,v $ */ +/* $Revision: 1.8 $ */ +/* $Date: 2006/11/21 23:02:42 $ */ + diff --git a/libtomcrypt/src/mac/hmac/hmac_done.c b/libtomcrypt/src/mac/hmac/hmac_done.c new file mode 100644 index 0000000..5ba541a --- /dev/null +++ b/libtomcrypt/src/mac/hmac/hmac_done.c @@ -0,0 +1,109 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file hmac_done.c + HMAC support, terminate stream, Tom St Denis/Dobes Vandermeer +*/ + +#ifdef LTC_HMAC + +#define HMAC_BLOCKSIZE hash_descriptor[hash].blocksize + +/** + Terminate an HMAC session + @param hmac The HMAC state + @param out [out] The destination of the HMAC authentication tag + @param outlen [in/out] The max size and resulting size of the HMAC authentication tag + @return CRYPT_OK if successful +*/ +int hmac_done(hmac_state *hmac, unsigned char *out, unsigned long *outlen) +{ + unsigned char *buf, *isha; + unsigned long hashsize, i; + int hash, err; + + LTC_ARGCHK(hmac != NULL); + LTC_ARGCHK(out != NULL); + + /* test hash */ + hash = hmac->hash; + if((err = hash_is_valid(hash)) != CRYPT_OK) { + return err; + } + + /* get the hash message digest size */ + hashsize = hash_descriptor[hash].hashsize; + + /* allocate buffers */ + buf = XMALLOC(HMAC_BLOCKSIZE); + isha = XMALLOC(hashsize); + if (buf == NULL || isha == NULL) { + if (buf != NULL) { + XFREE(buf); + } + if (isha != NULL) { + XFREE(isha); + } + return CRYPT_MEM; + } + + /* Get the hash of the first HMAC vector plus the data */ + if ((err = hash_descriptor[hash].done(&hmac->md, isha)) != CRYPT_OK) { + goto LBL_ERR; + } + + /* Create the second HMAC vector vector for step (3) */ + for(i=0; i < HMAC_BLOCKSIZE; i++) { + buf[i] = hmac->key[i] ^ 0x5C; + } + + /* Now calculate the "outer" hash for step (5), (6), and (7) */ + if ((err = hash_descriptor[hash].init(&hmac->md)) != CRYPT_OK) { + goto LBL_ERR; + } + if ((err = hash_descriptor[hash].process(&hmac->md, buf, HMAC_BLOCKSIZE)) != CRYPT_OK) { + goto LBL_ERR; + } + if ((err = hash_descriptor[hash].process(&hmac->md, isha, hashsize)) != CRYPT_OK) { + goto LBL_ERR; + } + if ((err = hash_descriptor[hash].done(&hmac->md, buf)) != CRYPT_OK) { + goto LBL_ERR; + } + + /* copy to output */ + for (i = 0; i < hashsize && i < *outlen; i++) { + out[i] = buf[i]; + } + *outlen = i; + + err = CRYPT_OK; +LBL_ERR: + XFREE(hmac->key); +#ifdef LTC_CLEAN_STACK + zeromem(isha, hashsize); + zeromem(buf, hashsize); + zeromem(hmac, sizeof(*hmac)); +#endif + + XFREE(isha); + XFREE(buf); + + return err; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/mac/hmac/hmac_done.c,v $ */ +/* $Revision: 1.5 $ */ +/* $Date: 2006/11/03 00:39:49 $ */ diff --git a/libtomcrypt/src/mac/hmac/hmac_file.c b/libtomcrypt/src/mac/hmac/hmac_file.c new file mode 100644 index 0000000..b296320 --- /dev/null +++ b/libtomcrypt/src/mac/hmac/hmac_file.c @@ -0,0 +1,93 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file hmac_file.c + HMAC support, process a file, Tom St Denis/Dobes Vandermeer +*/ + +#ifdef LTC_HMAC + +/** + HMAC a file + @param hash The index of the hash you wish to use + @param fname The name of the file you wish to HMAC + @param key The secret key + @param keylen The length of the secret key + @param out [out] The HMAC authentication tag + @param outlen [in/out] The max size and resulting size of the authentication tag + @return CRYPT_OK if successful, CRYPT_NOP if file support has been disabled +*/ +int hmac_file(int hash, const char *fname, + const unsigned char *key, unsigned long keylen, + unsigned char *out, unsigned long *outlen) +{ +#ifdef LTC_NO_FILE + return CRYPT_NOP; +#else + hmac_state hmac; + FILE *in; + unsigned char buf[512]; + size_t x; + int err; + + LTC_ARGCHK(fname != NULL); + LTC_ARGCHK(key != NULL); + LTC_ARGCHK(out != NULL); + LTC_ARGCHK(outlen != NULL); + + if((err = hash_is_valid(hash)) != CRYPT_OK) { + return err; + } + + if ((err = hmac_init(&hmac, hash, key, keylen)) != CRYPT_OK) { + return err; + } + + in = fopen(fname, "rb"); + if (in == NULL) { + return CRYPT_FILE_NOTFOUND; + } + + /* process the file contents */ + do { + x = fread(buf, 1, sizeof(buf), in); + if ((err = hmac_process(&hmac, buf, (unsigned long)x)) != CRYPT_OK) { + /* we don't trap this error since we're already returning an error! */ + fclose(in); + return err; + } + } while (x == sizeof(buf)); + + if (fclose(in) != 0) { + return CRYPT_ERROR; + } + + /* get final hmac */ + if ((err = hmac_done(&hmac, out, outlen)) != CRYPT_OK) { + return err; + } + +#ifdef LTC_CLEAN_STACK + /* clear memory */ + zeromem(buf, sizeof(buf)); +#endif + return CRYPT_OK; +#endif +} + +#endif + + +/* $Source: /cvs/libtom/libtomcrypt/src/mac/hmac/hmac_file.c,v $ */ +/* $Revision: 1.5 $ */ +/* $Date: 2006/11/03 00:39:49 $ */ diff --git a/libtomcrypt/src/mac/hmac/hmac_init.c b/libtomcrypt/src/mac/hmac/hmac_init.c new file mode 100644 index 0000000..2d61a9a --- /dev/null +++ b/libtomcrypt/src/mac/hmac/hmac_init.c @@ -0,0 +1,112 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file hmac_init.c + HMAC support, initialize state, Tom St Denis/Dobes Vandermeer +*/ + +#ifdef LTC_HMAC + +#define HMAC_BLOCKSIZE hash_descriptor[hash].blocksize + +/** + Initialize an HMAC context. + @param hmac The HMAC state + @param hash The index of the hash you want to use + @param key The secret key + @param keylen The length of the secret key (octets) + @return CRYPT_OK if successful +*/ +int hmac_init(hmac_state *hmac, int hash, const unsigned char *key, unsigned long keylen) +{ + unsigned char *buf; + unsigned long hashsize; + unsigned long i, z; + int err; + + LTC_ARGCHK(hmac != NULL); + LTC_ARGCHK(key != NULL); + + /* valid hash? */ + if ((err = hash_is_valid(hash)) != CRYPT_OK) { + return err; + } + hmac->hash = hash; + hashsize = hash_descriptor[hash].hashsize; + + /* valid key length? */ + if (keylen == 0) { + return CRYPT_INVALID_KEYSIZE; + } + + /* allocate ram for buf */ + buf = XMALLOC(HMAC_BLOCKSIZE); + if (buf == NULL) { + return CRYPT_MEM; + } + + /* allocate memory for key */ + hmac->key = XMALLOC(HMAC_BLOCKSIZE); + if (hmac->key == NULL) { + XFREE(buf); + return CRYPT_MEM; + } + + /* (1) make sure we have a large enough key */ + if(keylen > HMAC_BLOCKSIZE) { + z = HMAC_BLOCKSIZE; + if ((err = hash_memory(hash, key, keylen, hmac->key, &z)) != CRYPT_OK) { + goto LBL_ERR; + } + if(hashsize < HMAC_BLOCKSIZE) { + zeromem((hmac->key) + hashsize, (size_t)(HMAC_BLOCKSIZE - hashsize)); + } + keylen = hashsize; + } else { + XMEMCPY(hmac->key, key, (size_t)keylen); + if(keylen < HMAC_BLOCKSIZE) { + zeromem((hmac->key) + keylen, (size_t)(HMAC_BLOCKSIZE - keylen)); + } + } + + /* Create the initial vector for step (3) */ + for(i=0; i < HMAC_BLOCKSIZE; i++) { + buf[i] = hmac->key[i] ^ 0x36; + } + + /* Pre-pend that to the hash data */ + if ((err = hash_descriptor[hash].init(&hmac->md)) != CRYPT_OK) { + goto LBL_ERR; + } + + if ((err = hash_descriptor[hash].process(&hmac->md, buf, HMAC_BLOCKSIZE)) != CRYPT_OK) { + goto LBL_ERR; + } + goto done; +LBL_ERR: + /* free the key since we failed */ + XFREE(hmac->key); +done: +#ifdef LTC_CLEAN_STACK + zeromem(buf, HMAC_BLOCKSIZE); +#endif + + XFREE(buf); + return err; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/mac/hmac/hmac_init.c,v $ */ +/* $Revision: 1.5 $ */ +/* $Date: 2006/11/03 00:39:49 $ */ diff --git a/libtomcrypt/src/mac/hmac/hmac_memory.c b/libtomcrypt/src/mac/hmac/hmac_memory.c new file mode 100644 index 0000000..7dc364a --- /dev/null +++ b/libtomcrypt/src/mac/hmac/hmac_memory.c @@ -0,0 +1,88 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file hmac_memory.c + HMAC support, process a block of memory, Tom St Denis/Dobes Vandermeer +*/ + +#ifdef LTC_HMAC + +/** + HMAC a block of memory to produce the authentication tag + @param hash The index of the hash to use + @param key The secret key + @param keylen The length of the secret key (octets) + @param in The data to HMAC + @param inlen The length of the data to HMAC (octets) + @param out [out] Destination of the authentication tag + @param outlen [in/out] Max size and resulting size of authentication tag + @return CRYPT_OK if successful +*/ +int hmac_memory(int hash, + const unsigned char *key, unsigned long keylen, + const unsigned char *in, unsigned long inlen, + unsigned char *out, unsigned long *outlen) +{ + hmac_state *hmac; + int err; + + LTC_ARGCHK(key != NULL); + LTC_ARGCHK(in != NULL); + LTC_ARGCHK(out != NULL); + LTC_ARGCHK(outlen != NULL); + + /* make sure hash descriptor is valid */ + if ((err = hash_is_valid(hash)) != CRYPT_OK) { + return err; + } + + /* is there a descriptor? */ + if (hash_descriptor[hash].hmac_block != NULL) { + return hash_descriptor[hash].hmac_block(key, keylen, in, inlen, out, outlen); + } + + /* nope, so call the hmac functions */ + /* allocate ram for hmac state */ + hmac = XMALLOC(sizeof(hmac_state)); + if (hmac == NULL) { + return CRYPT_MEM; + } + + if ((err = hmac_init(hmac, hash, key, keylen)) != CRYPT_OK) { + goto LBL_ERR; + } + + if ((err = hmac_process(hmac, in, inlen)) != CRYPT_OK) { + goto LBL_ERR; + } + + if ((err = hmac_done(hmac, out, outlen)) != CRYPT_OK) { + goto LBL_ERR; + } + + err = CRYPT_OK; +LBL_ERR: +#ifdef LTC_CLEAN_STACK + zeromem(hmac, sizeof(hmac_state)); +#endif + + XFREE(hmac); + return err; +} + +#endif + + +/* $Source: /cvs/libtom/libtomcrypt/src/mac/hmac/hmac_memory.c,v $ */ +/* $Revision: 1.6 $ */ +/* $Date: 2006/11/03 00:39:49 $ */ diff --git a/libtomcrypt/src/mac/hmac/hmac_memory_multi.c b/libtomcrypt/src/mac/hmac/hmac_memory_multi.c new file mode 100644 index 0000000..2382502 --- /dev/null +++ b/libtomcrypt/src/mac/hmac/hmac_memory_multi.c @@ -0,0 +1,92 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" +#include <stdarg.h> + +/** + @file hmac_memory_multi.c + HMAC support, process multiple blocks of memory, Tom St Denis/Dobes Vandermeer +*/ + +#ifdef LTC_HMAC + +/** + HMAC multiple blocks of memory to produce the authentication tag + @param hash The index of the hash to use + @param key The secret key + @param keylen The length of the secret key (octets) + @param out [out] Destination of the authentication tag + @param outlen [in/out] Max size and resulting size of authentication tag + @param in The data to HMAC + @param inlen The length of the data to HMAC (octets) + @param ... tuples of (data,len) pairs to HMAC, terminated with a (NULL,x) (x=don't care) + @return CRYPT_OK if successful +*/ +int hmac_memory_multi(int hash, + const unsigned char *key, unsigned long keylen, + unsigned char *out, unsigned long *outlen, + const unsigned char *in, unsigned long inlen, ...) + +{ + hmac_state *hmac; + int err; + va_list args; + const unsigned char *curptr; + unsigned long curlen; + + LTC_ARGCHK(key != NULL); + LTC_ARGCHK(in != NULL); + LTC_ARGCHK(out != NULL); + LTC_ARGCHK(outlen != NULL); + + /* allocate ram for hmac state */ + hmac = XMALLOC(sizeof(hmac_state)); + if (hmac == NULL) { + return CRYPT_MEM; + } + + if ((err = hmac_init(hmac, hash, key, keylen)) != CRYPT_OK) { + goto LBL_ERR; + } + + va_start(args, inlen); + curptr = in; + curlen = inlen; + for (;;) { + /* process buf */ + if ((err = hmac_process(hmac, curptr, curlen)) != CRYPT_OK) { + goto LBL_ERR; + } + /* step to next */ + curptr = va_arg(args, const unsigned char*); + if (curptr == NULL) { + break; + } + curlen = va_arg(args, unsigned long); + } + if ((err = hmac_done(hmac, out, outlen)) != CRYPT_OK) { + goto LBL_ERR; + } +LBL_ERR: +#ifdef LTC_CLEAN_STACK + zeromem(hmac, sizeof(hmac_state)); +#endif + XFREE(hmac); + va_end(args); + return err; +} + +#endif + + +/* $Source: /cvs/libtom/libtomcrypt/src/mac/hmac/hmac_memory_multi.c,v $ */ +/* $Revision: 1.5 $ */ +/* $Date: 2006/11/03 00:39:49 $ */ diff --git a/libtomcrypt/src/mac/hmac/hmac_process.c b/libtomcrypt/src/mac/hmac/hmac_process.c new file mode 100644 index 0000000..04b5ee2 --- /dev/null +++ b/libtomcrypt/src/mac/hmac/hmac_process.c @@ -0,0 +1,43 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file hmac_process.c + HMAC support, process data, Tom St Denis/Dobes Vandermeer +*/ + +#ifdef LTC_HMAC + +/** + Process data through HMAC + @param hmac The hmac state + @param in The data to send through HMAC + @param inlen The length of the data to HMAC (octets) + @return CRYPT_OK if successful +*/ +int hmac_process(hmac_state *hmac, const unsigned char *in, unsigned long inlen) +{ + int err; + LTC_ARGCHK(hmac != NULL); + LTC_ARGCHK(in != NULL); + if ((err = hash_is_valid(hmac->hash)) != CRYPT_OK) { + return err; + } + return hash_descriptor[hmac->hash].process(&hmac->md, in, inlen); +} + +#endif + + +/* $Source: /cvs/libtom/libtomcrypt/src/mac/hmac/hmac_process.c,v $ */ +/* $Revision: 1.5 $ */ +/* $Date: 2006/11/03 00:39:49 $ */ diff --git a/libtomcrypt/src/mac/hmac/hmac_test.c b/libtomcrypt/src/mac/hmac/hmac_test.c new file mode 100644 index 0000000..4a03f87 --- /dev/null +++ b/libtomcrypt/src/mac/hmac/hmac_test.c @@ -0,0 +1,316 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file hmac_test.c + HMAC support, self-test, Tom St Denis/Dobes Vandermeer +*/ + +#ifdef LTC_HMAC + +#define HMAC_BLOCKSIZE hash_descriptor[hash].blocksize + +/* + TEST CASES SOURCE: + +Network Working Group P. Cheng +Request for Comments: 2202 IBM +Category: Informational R. Glenn + NIST + September 1997 + Test Cases for HMAC-MD5 and HMAC-SHA-1 +*/ + +/** + HMAC self-test + @return CRYPT_OK if successful, CRYPT_NOP if tests have been disabled. +*/ +int hmac_test(void) +{ + #ifndef LTC_TEST + return CRYPT_NOP; + #else + unsigned char digest[MAXBLOCKSIZE]; + int i; + + static const struct hmac_test_case { + int num; + char *algo; + unsigned char key[128]; + unsigned long keylen; + unsigned char data[128]; + unsigned long datalen; + unsigned char digest[MAXBLOCKSIZE]; + } cases[] = { + /* + 3. Test Cases for HMAC-SHA-1 + + test_case = 1 + key = 0x0c0c0c0c0c0c0c0c0c0c0c0c0c0c0c0c0c0c0c0c + key_len = 20 + data = "Hi Ther 20 + digest = 0x4c1a03424b55e07fe7f27be1d58bb9324a9a5a04 + digest-96 = 0x4c1a03424b55e07fe7f27be1 + */ + { 5, "sha1", + {0x0c, 0x0c, 0x0c, 0x0c, 0x0c, 0x0c, 0x0c, 0x0c, + 0x0c, 0x0c, 0x0c, 0x0c, 0x0c, 0x0c, 0x0c, 0x0c, + 0x0c, 0x0c, 0x0c, 0x0c}, 20, + "Test With Truncation", 20, + {0x4c, 0x1a, 0x03, 0x42, 0x4b, 0x55, 0xe0, 0x7f, 0xe7, 0xf2, + 0x7b, 0xe1, 0xd5, 0x8b, 0xb9, 0x32, 0x4a, 0x9a, 0x5a, 0x04} }, + + /* + test_case = 6 + key = 0xaa repeated 80 times + key_len = 80 + data = "Test Using Larger Than Block-Size Key - Hash Key First" + data_len = 54 + digest = 0xaa4ae5e15272d00e95705637ce8a3b55ed402112 + */ + { 6, "sha1", + {0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, + 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, + 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, + 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, + 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, + 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, + 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, + 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, + 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, + 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa}, 80, + "Test Using Larger Than Block-Size Key - Hash Key First", 54, + {0xaa, 0x4a, 0xe5, 0xe1, 0x52, 0x72, 0xd0, 0x0e, + 0x95, 0x70, 0x56, 0x37, 0xce, 0x8a, 0x3b, 0x55, + 0xed, 0x40, 0x21, 0x12} }, + + /* + test_case = 7 + key = 0xaa repeated 80 times + key_len = 80 + data = "Test Using Larger Than Block-Size Key and Larger + Than One Block-Size Data" + data_len = 73 + digest = 0xe8e99d0f45237d786d6bbaa7965c7808bbff1a91 + */ + { 7, "sha1", + {0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, + 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, + 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, + 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, + 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, + 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, + 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, + 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, + 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, + 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa}, 80, + "Test Using Larger Than Block-Size Key and Larger Than One Block-Size Data", 73, + {0xe8, 0xe9, 0x9d, 0x0f, 0x45, 0x23, 0x7d, 0x78, 0x6d, + 0x6b, 0xba, 0xa7, 0x96, 0x5c, 0x78, 0x08, 0xbb, 0xff, 0x1a, 0x91} }, + + /* + 2. Test Cases for HMAC-MD5 + + test_case = 1 + key = 0x0b 0b 0b 0b + 0b 0b 0b 0b + 0b 0b 0b 0b + 0b 0b 0b 0b + key_len = 16 + data = "Hi There" + data_len = 8 + digest = 0x92 94 72 7a + 36 38 bb 1c + 13 f4 8e f8 + 15 8b fc 9d + */ + { 1, "md5", + {0x0b, 0x0b, 0x0b, 0x0b, 0x0b, 0x0b, 0x0b, 0x0b, + 0x0b, 0x0b, 0x0b, 0x0b, 0x0b, 0x0b, 0x0b, 0x0b}, 16, + "Hi There", 8, + {0x92, 0x94, 0x72, 0x7a, 0x36, 0x38, 0xbb, 0x1c, + 0x13, 0xf4, 0x8e, 0xf8, 0x15, 0x8b, 0xfc, 0x9d} }, + /* + test_case = 2 + key = "Jefe" + key_len = 4 + data = "what do ya want for nothing?" + data_len = 28 + digest = 0x750c783e6ab0b503eaa86e310a5db738 + */ + { 2, "md5", + "Jefe", 4, + "what do ya want for nothing?", 28, + {0x75, 0x0c, 0x78, 0x3e, 0x6a, 0xb0, 0xb5, 0x03, + 0xea, 0xa8, 0x6e, 0x31, 0x0a, 0x5d, 0xb7, 0x38} }, + + /* + test_case = 3 + key = 0xaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaa + key_len 16 + data = 0xdd repeated 50 times + data_len = 50 + digest = 0x56be34521d144c88dbb8c733f0e8b3f6 + */ + { 3, "md5", + {0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, + 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa}, 16, + {0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, + 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, + 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, + 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, + 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd, 0xdd}, 50, + {0x56, 0xbe, 0x34, 0x52, 0x1d, 0x14, 0x4c, 0x88, + 0xdb, 0xb8, 0xc7, 0x33, 0xf0, 0xe8, 0xb3, 0xf6} }, + /* + + test_case = 4 + key = 0x0102030405060708090a0b0c0d0e0f10111213141516171819 + key_len 25 + data = 0xcd repeated 50 times + data_len = 50 + digest = 0x697eaf0aca3a3aea3a75164746ffaa79 + */ + { 4, "md5", + {0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07, 0x08, 0x09, 0x0a, + 0x0b, 0x0c, 0x0d, 0x0e, 0x0f, 0x10, 0x11, 0x12, 0x13, 0x14, + 0x15, 0x16, 0x17, 0x18, 0x19}, 25, + {0xcd, 0xcd, 0xcd, 0xcd, 0xcd, 0xcd, 0xcd, 0xcd, 0xcd, 0xcd, + 0xcd, 0xcd, 0xcd, 0xcd, 0xcd, 0xcd, 0xcd, 0xcd, 0xcd, 0xcd, + 0xcd, 0xcd, 0xcd, 0xcd, 0xcd, 0xcd, 0xcd, 0xcd, 0xcd, 0xcd, + 0xcd, 0xcd, 0xcd, 0xcd, 0xcd, 0xcd, 0xcd, 0xcd, 0xcd, 0xcd, + 0xcd, 0xcd, 0xcd, 0xcd, 0xcd, 0xcd, 0xcd, 0xcd, 0xcd, 0xcd}, 50, + {0x69, 0x7e, 0xaf, 0x0a, 0xca, 0x3a, 0x3a, 0xea, + 0x3a, 0x75, 0x16, 0x47, 0x46, 0xff, 0xaa, 0x79} }, + + + /* + + test_case = 5 + key = 0x0c0c0c0c0c0c0c0c0c0c0c0c0c0c0c0c + key_len = 16 + data = "Test With Truncation" + data_len = 20 + digest = 0x56461ef2342edc00f9bab995690efd4c + digest-96 0x56461ef2342edc00f9bab995 + */ + { 5, "md5", + {0x0c, 0x0c, 0x0c, 0x0c, 0x0c, 0x0c, 0x0c, 0x0c, + 0x0c, 0x0c, 0x0c, 0x0c, 0x0c, 0x0c, 0x0c, 0x0c}, 16, + "Test With Truncation", 20, + {0x56, 0x46, 0x1e, 0xf2, 0x34, 0x2e, 0xdc, 0x00, + 0xf9, 0xba, 0xb9, 0x95, 0x69, 0x0e, 0xfd, 0x4c} }, + + /* + + test_case = 6 + key = 0xaa repeated 80 times + key_len = 80 + data = "Test Using Larger Than Block-Size Key - Hash +Key First" + data_len = 54 + digest = 0x6b1ab7fe4bd7bf8f0b62e6ce61b9d0cd + */ + { 6, "md5", + {0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, + 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, + 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, + 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, + 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, + + 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, + 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, + 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, + 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, + 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa}, 80, + "Test Using Larger Than Block-Size Key - Hash Key First", 54, + {0x6b, 0x1a, 0xb7, 0xfe, 0x4b, 0xd7, 0xbf, 0x8f, + 0x0b, 0x62, 0xe6, 0xce, 0x61, 0xb9, 0xd0, 0xcd} }, + + /* + + test_case = 7 + key = 0xaa repeated 80 times + key_len = 80 + data = "Test Using Larger Than Block-Size Key and Larger + Than One Block-Size Data" + data_len = 73 + digest = 0x6f630fad67cda0ee1fb1f562db3aa53e + */ + { 7, "md5", + {0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, + 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, + 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, + 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, + 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, + 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, + 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, + 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, + 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, + 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa, 0xaa}, 80, + "Test Using Larger Than Block-Size Key and Larger Than One Block-Size Data", 73, + {0x6f, 0x63, 0x0f, 0xad, 0x67, 0xcd, 0xa0, 0xee, + 0x1f, 0xb1, 0xf5, 0x62, 0xdb, 0x3a, 0xa5, 0x3e} } + }; + + unsigned long outlen; + int err; + int tested=0,failed=0; + for(i=0; i < (int)(sizeof(cases) / sizeof(cases[0])); i++) { + int hash = find_hash(cases[i].algo); + if (hash == -1) continue; + ++tested; + outlen = sizeof(digest); + if((err = hmac_memory(hash, cases[i].key, cases[i].keylen, cases[i].data, cases[i].datalen, digest, &outlen)) != CRYPT_OK) { +#if 0 + printf("HMAC-%s test #%d, %s\n", cases[i].algo, cases[i].num, error_to_string(err)); +#endif + return err; + } + + if(XMEMCMP(digest, cases[i].digest, (size_t)hash_descriptor[hash].hashsize) != 0) { + failed++; +#if 0 + unsigned int j; + printf("\nHMAC-%s test #%d:\n", cases[i].algo, cases[i].num); + printf( "Result: 0x"); + for(j=0; j < hash_descriptor[hash].hashsize; j++) { + printf("%2x ", digest[j]); + } + printf("\nCorrect: 0x"); + for(j=0; j < hash_descriptor[hash].hashsize; j++) { + printf("%2x ", cases[i].digest[j]); + } + printf("\n"); + return CRYPT_ERROR; +#endif + } else { + /* printf("HMAC-%s test #%d: Passed\n", cases[i].algo, cases[i].num); */ + } + } + + if (failed != 0) { + return CRYPT_FAIL_TESTVECTOR; + } else if (tested == 0) { + return CRYPT_NOP; + } else { + return CRYPT_OK; + } + #endif +} + +#endif + + +/* $Source: /cvs/libtom/libtomcrypt/src/mac/hmac/hmac_test.c,v $ */ +/* $Revision: 1.7 $ */ +/* $Date: 2006/11/03 00:39:49 $ */ diff --git a/libtomcrypt/src/mac/omac/omac_done.c b/libtomcrypt/src/mac/omac/omac_done.c new file mode 100644 index 0000000..7a0453b --- /dev/null +++ b/libtomcrypt/src/mac/omac/omac_done.c @@ -0,0 +1,86 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file omac_done.c + OMAC1 support, terminate a stream, Tom St Denis +*/ + +#ifdef LTC_OMAC + +/** + Terminate an OMAC stream + @param omac The OMAC state + @param out [out] Destination for the authentication tag + @param outlen [in/out] The max size and resulting size of the authentication tag + @return CRYPT_OK if successful +*/ +int omac_done(omac_state *omac, unsigned char *out, unsigned long *outlen) +{ + int err, mode; + unsigned x; + + LTC_ARGCHK(omac != NULL); + LTC_ARGCHK(out != NULL); + LTC_ARGCHK(outlen != NULL); + if ((err = cipher_is_valid(omac->cipher_idx)) != CRYPT_OK) { + return err; + } + + if ((omac->buflen > (int)sizeof(omac->block)) || (omac->buflen < 0) || + (omac->blklen > (int)sizeof(omac->block)) || (omac->buflen > omac->blklen)) { + return CRYPT_INVALID_ARG; + } + + /* figure out mode */ + if (omac->buflen != omac->blklen) { + /* add the 0x80 byte */ + omac->block[omac->buflen++] = 0x80; + + /* pad with 0x00 */ + while (omac->buflen < omac->blklen) { + omac->block[omac->buflen++] = 0x00; + } + mode = 1; + } else { + mode = 0; + } + + /* now xor prev + Lu[mode] */ + for (x = 0; x < (unsigned)omac->blklen; x++) { + omac->block[x] ^= omac->prev[x] ^ omac->Lu[mode][x]; + } + + /* encrypt it */ + if ((err = cipher_descriptor[omac->cipher_idx].ecb_encrypt(omac->block, omac->block, &omac->key)) != CRYPT_OK) { + return err; + } + cipher_descriptor[omac->cipher_idx].done(&omac->key); + + /* output it */ + for (x = 0; x < (unsigned)omac->blklen && x < *outlen; x++) { + out[x] = omac->block[x]; + } + *outlen = x; + +#ifdef LTC_CLEAN_STACK + zeromem(omac, sizeof(*omac)); +#endif + return CRYPT_OK; +} + +#endif + + +/* $Source: /cvs/libtom/libtomcrypt/src/mac/omac/omac_done.c,v $ */ +/* $Revision: 1.7 $ */ +/* $Date: 2006/11/03 00:39:49 $ */ diff --git a/libtomcrypt/src/mac/omac/omac_file.c b/libtomcrypt/src/mac/omac/omac_file.c new file mode 100644 index 0000000..7117ae3 --- /dev/null +++ b/libtomcrypt/src/mac/omac/omac_file.c @@ -0,0 +1,83 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file omac_file.c + OMAC1 support, process a file, Tom St Denis +*/ + +#ifdef LTC_OMAC + +/** + OMAC a file + @param cipher The index of the cipher desired + @param key The secret key + @param keylen The length of the secret key (octets) + @param filename The name of the file you wish to OMAC + @param out [out] Where the authentication tag is to be stored + @param outlen [in/out] The max size and resulting size of the authentication tag + @return CRYPT_OK if successful, CRYPT_NOP if file support has been disabled +*/ +int omac_file(int cipher, + const unsigned char *key, unsigned long keylen, + const char *filename, + unsigned char *out, unsigned long *outlen) +{ +#ifdef LTC_NO_FILE + return CRYPT_NOP; +#else + int err, x; + omac_state omac; + FILE *in; + unsigned char buf[512]; + + LTC_ARGCHK(key != NULL); + LTC_ARGCHK(filename != NULL); + LTC_ARGCHK(out != NULL); + LTC_ARGCHK(outlen != NULL); + + in = fopen(filename, "rb"); + if (in == NULL) { + return CRYPT_FILE_NOTFOUND; + } + + if ((err = omac_init(&omac, cipher, key, keylen)) != CRYPT_OK) { + fclose(in); + return err; + } + + do { + x = fread(buf, 1, sizeof(buf), in); + if ((err = omac_process(&omac, buf, x)) != CRYPT_OK) { + fclose(in); + return err; + } + } while (x == sizeof(buf)); + fclose(in); + + if ((err = omac_done(&omac, out, outlen)) != CRYPT_OK) { + return err; + } + +#ifdef LTC_CLEAN_STACK + zeromem(buf, sizeof(buf)); +#endif + + return CRYPT_OK; +#endif +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/mac/omac/omac_file.c,v $ */ +/* $Revision: 1.5 $ */ +/* $Date: 2006/11/03 00:39:49 $ */ diff --git a/libtomcrypt/src/mac/omac/omac_init.c b/libtomcrypt/src/mac/omac/omac_init.c new file mode 100644 index 0000000..cbf26a2 --- /dev/null +++ b/libtomcrypt/src/mac/omac/omac_init.c @@ -0,0 +1,101 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file omac_init.c + OMAC1 support, initialize state, by Tom St Denis +*/ + + +#ifdef LTC_OMAC + +/** + Initialize an OMAC state + @param omac The OMAC state to initialize + @param cipher The index of the desired cipher + @param key The secret key + @param keylen The length of the secret key (octets) + @return CRYPT_OK if successful +*/ +int omac_init(omac_state *omac, int cipher, const unsigned char *key, unsigned long keylen) +{ + int err, x, y, mask, msb, len; + + LTC_ARGCHK(omac != NULL); + LTC_ARGCHK(key != NULL); + + /* schedule the key */ + if ((err = cipher_is_valid(cipher)) != CRYPT_OK) { + return err; + } + +#ifdef LTC_FAST + if (cipher_descriptor[cipher].block_length % sizeof(LTC_FAST_TYPE)) { + return CRYPT_INVALID_ARG; + } +#endif + + /* now setup the system */ + switch (cipher_descriptor[cipher].block_length) { + case 8: mask = 0x1B; + len = 8; + break; + case 16: mask = 0x87; + len = 16; + break; + default: return CRYPT_INVALID_ARG; + } + + if ((err = cipher_descriptor[cipher].setup(key, keylen, 0, &omac->key)) != CRYPT_OK) { + return err; + } + + /* ok now we need Lu and Lu^2 [calc one from the other] */ + + /* first calc L which is Ek(0) */ + zeromem(omac->Lu[0], cipher_descriptor[cipher].block_length); + if ((err = cipher_descriptor[cipher].ecb_encrypt(omac->Lu[0], omac->Lu[0], &omac->key)) != CRYPT_OK) { + return err; + } + + /* now do the mults, whoopy! */ + for (x = 0; x < 2; x++) { + /* if msb(L * u^(x+1)) = 0 then just shift, otherwise shift and xor constant mask */ + msb = omac->Lu[x][0] >> 7; + + /* shift left */ + for (y = 0; y < (len - 1); y++) { + omac->Lu[x][y] = ((omac->Lu[x][y] << 1) | (omac->Lu[x][y+1] >> 7)) & 255; + } + omac->Lu[x][len - 1] = ((omac->Lu[x][len - 1] << 1) ^ (msb ? mask : 0)) & 255; + + /* copy up as require */ + if (x == 0) { + XMEMCPY(omac->Lu[1], omac->Lu[0], sizeof(omac->Lu[0])); + } + } + + /* setup state */ + omac->cipher_idx = cipher; + omac->buflen = 0; + omac->blklen = len; + zeromem(omac->prev, sizeof(omac->prev)); + zeromem(omac->block, sizeof(omac->block)); + + return CRYPT_OK; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/mac/omac/omac_init.c,v $ */ +/* $Revision: 1.10 $ */ +/* $Date: 2006/11/03 00:39:49 $ */ diff --git a/libtomcrypt/src/mac/omac/omac_memory.c b/libtomcrypt/src/mac/omac/omac_memory.c new file mode 100644 index 0000000..50b2db0 --- /dev/null +++ b/libtomcrypt/src/mac/omac/omac_memory.c @@ -0,0 +1,85 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file omac_memory.c + OMAC1 support, process a block of memory, Tom St Denis +*/ + +#ifdef LTC_OMAC + +/** + OMAC a block of memory + @param cipher The index of the desired cipher + @param key The secret key + @param keylen The length of the secret key (octets) + @param in The data to send through OMAC + @param inlen The length of the data to send through OMAC (octets) + @param out [out] The destination of the authentication tag + @param outlen [in/out] The max size and resulting size of the authentication tag (octets) + @return CRYPT_OK if successful +*/ +int omac_memory(int cipher, + const unsigned char *key, unsigned long keylen, + const unsigned char *in, unsigned long inlen, + unsigned char *out, unsigned long *outlen) +{ + int err; + omac_state *omac; + + LTC_ARGCHK(key != NULL); + LTC_ARGCHK(in != NULL); + LTC_ARGCHK(out != NULL); + LTC_ARGCHK(outlen != NULL); + + /* is the cipher valid? */ + if ((err = cipher_is_valid(cipher)) != CRYPT_OK) { + return err; + } + + /* Use accelerator if found */ + if (cipher_descriptor[cipher].omac_memory != NULL) { + return cipher_descriptor[cipher].omac_memory(key, keylen, in, inlen, out, outlen); + } + + /* allocate ram for omac state */ + omac = XMALLOC(sizeof(omac_state)); + if (omac == NULL) { + return CRYPT_MEM; + } + + /* omac process the message */ + if ((err = omac_init(omac, cipher, key, keylen)) != CRYPT_OK) { + goto LBL_ERR; + } + if ((err = omac_process(omac, in, inlen)) != CRYPT_OK) { + goto LBL_ERR; + } + if ((err = omac_done(omac, out, outlen)) != CRYPT_OK) { + goto LBL_ERR; + } + + err = CRYPT_OK; +LBL_ERR: +#ifdef LTC_CLEAN_STACK + zeromem(omac, sizeof(omac_state)); +#endif + + XFREE(omac); + return err; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/mac/omac/omac_memory.c,v $ */ +/* $Revision: 1.6 $ */ +/* $Date: 2006/11/08 23:01:06 $ */ diff --git a/libtomcrypt/src/mac/omac/omac_memory_multi.c b/libtomcrypt/src/mac/omac/omac_memory_multi.c new file mode 100644 index 0000000..4445ca2 --- /dev/null +++ b/libtomcrypt/src/mac/omac/omac_memory_multi.c @@ -0,0 +1,90 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" +#include <stdarg.h> + +/** + @file omac_memory_multi.c + OMAC1 support, process multiple blocks of memory, Tom St Denis +*/ + +#ifdef LTC_OMAC + +/** + OMAC multiple blocks of memory + @param cipher The index of the desired cipher + @param key The secret key + @param keylen The length of the secret key (octets) + @param out [out] The destination of the authentication tag + @param outlen [in/out] The max size and resulting size of the authentication tag (octets) + @param in The data to send through OMAC + @param inlen The length of the data to send through OMAC (octets) + @param ... tuples of (data,len) pairs to OMAC, terminated with a (NULL,x) (x=don't care) + @return CRYPT_OK if successful +*/ +int omac_memory_multi(int cipher, + const unsigned char *key, unsigned long keylen, + unsigned char *out, unsigned long *outlen, + const unsigned char *in, unsigned long inlen, ...) +{ + int err; + omac_state *omac; + va_list args; + const unsigned char *curptr; + unsigned long curlen; + + LTC_ARGCHK(key != NULL); + LTC_ARGCHK(in != NULL); + LTC_ARGCHK(out != NULL); + LTC_ARGCHK(outlen != NULL); + + /* allocate ram for omac state */ + omac = XMALLOC(sizeof(omac_state)); + if (omac == NULL) { + return CRYPT_MEM; + } + + /* omac process the message */ + if ((err = omac_init(omac, cipher, key, keylen)) != CRYPT_OK) { + goto LBL_ERR; + } + va_start(args, inlen); + curptr = in; + curlen = inlen; + for (;;) { + /* process buf */ + if ((err = omac_process(omac, curptr, curlen)) != CRYPT_OK) { + goto LBL_ERR; + } + /* step to next */ + curptr = va_arg(args, const unsigned char*); + if (curptr == NULL) { + break; + } + curlen = va_arg(args, unsigned long); + } + if ((err = omac_done(omac, out, outlen)) != CRYPT_OK) { + goto LBL_ERR; + } +LBL_ERR: +#ifdef LTC_CLEAN_STACK + zeromem(omac, sizeof(omac_state)); +#endif + XFREE(omac); + va_end(args); + return err; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/mac/omac/omac_memory_multi.c,v $ */ +/* $Revision: 1.5 $ */ +/* $Date: 2006/11/03 00:39:49 $ */ diff --git a/libtomcrypt/src/mac/omac/omac_process.c b/libtomcrypt/src/mac/omac/omac_process.c new file mode 100644 index 0000000..f4b96f5 --- /dev/null +++ b/libtomcrypt/src/mac/omac/omac_process.c @@ -0,0 +1,88 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file omac_process.c + OMAC1 support, process data, Tom St Denis +*/ + + +#ifdef LTC_OMAC + +/** + Process data through OMAC + @param omac The OMAC state + @param in The input data to send through OMAC + @param inlen The length of the input (octets) + @return CRYPT_OK if successful +*/ +int omac_process(omac_state *omac, const unsigned char *in, unsigned long inlen) +{ + unsigned long n, x; + int err; + + LTC_ARGCHK(omac != NULL); + LTC_ARGCHK(in != NULL); + if ((err = cipher_is_valid(omac->cipher_idx)) != CRYPT_OK) { + return err; + } + + if ((omac->buflen > (int)sizeof(omac->block)) || (omac->buflen < 0) || + (omac->blklen > (int)sizeof(omac->block)) || (omac->buflen > omac->blklen)) { + return CRYPT_INVALID_ARG; + } + +#ifdef LTC_FAST + if (omac->buflen == 0 && inlen > 16) { + int y; + for (x = 0; x < (inlen - 16); x += 16) { + for (y = 0; y < 16; y += sizeof(LTC_FAST_TYPE)) { + *((LTC_FAST_TYPE*)(&omac->prev[y])) ^= *((LTC_FAST_TYPE*)(&in[y])); + } + in += 16; + if ((err = cipher_descriptor[omac->cipher_idx].ecb_encrypt(omac->prev, omac->prev, &omac->key)) != CRYPT_OK) { + return err; + } + } + inlen -= x; + } +#endif + + while (inlen != 0) { + /* ok if the block is full we xor in prev, encrypt and replace prev */ + if (omac->buflen == omac->blklen) { + for (x = 0; x < (unsigned long)omac->blklen; x++) { + omac->block[x] ^= omac->prev[x]; + } + if ((err = cipher_descriptor[omac->cipher_idx].ecb_encrypt(omac->block, omac->prev, &omac->key)) != CRYPT_OK) { + return err; + } + omac->buflen = 0; + } + + /* add bytes */ + n = MIN(inlen, (unsigned long)(omac->blklen - omac->buflen)); + XMEMCPY(omac->block + omac->buflen, in, n); + omac->buflen += n; + inlen -= n; + in += n; + } + + return CRYPT_OK; +} + +#endif + + +/* $Source: /cvs/libtom/libtomcrypt/src/mac/omac/omac_process.c,v $ */ +/* $Revision: 1.9 $ */ +/* $Date: 2006/11/03 00:39:49 $ */ diff --git a/libtomcrypt/src/mac/omac/omac_test.c b/libtomcrypt/src/mac/omac/omac_test.c new file mode 100644 index 0000000..3230a8c --- /dev/null +++ b/libtomcrypt/src/mac/omac/omac_test.c @@ -0,0 +1,110 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file omac_test.c + OMAC1 support, self-test, by Tom St Denis +*/ + +#ifdef LTC_OMAC + +/** + Test the OMAC setup + @return CRYPT_OK if successful, CRYPT_NOP if tests have been disabled +*/ +int omac_test(void) +{ +#if !defined(LTC_TEST) + return CRYPT_NOP; +#else + static const struct { + int keylen, msglen; + unsigned char key[16], msg[64], tag[16]; + } tests[] = { + { 16, 0, + { 0x2b, 0x7e, 0x15, 0x16, 0x28, 0xae, 0xd2, 0xa6, + 0xab, 0xf7, 0x15, 0x88, 0x09, 0xcf, 0x4f, 0x3c }, + { 0x00 }, + { 0xbb, 0x1d, 0x69, 0x29, 0xe9, 0x59, 0x37, 0x28, + 0x7f, 0xa3, 0x7d, 0x12, 0x9b, 0x75, 0x67, 0x46 } + }, + { 16, 16, + { 0x2b, 0x7e, 0x15, 0x16, 0x28, 0xae, 0xd2, 0xa6, + 0xab, 0xf7, 0x15, 0x88, 0x09, 0xcf, 0x4f, 0x3c }, + { 0x6b, 0xc1, 0xbe, 0xe2, 0x2e, 0x40, 0x9f, 0x96, + 0xe9, 0x3d, 0x7e, 0x11, 0x73, 0x93, 0x17, 0x2a }, + { 0x07, 0x0a, 0x16, 0xb4, 0x6b, 0x4d, 0x41, 0x44, + 0xf7, 0x9b, 0xdd, 0x9d, 0xd0, 0x4a, 0x28, 0x7c } + }, + { 16, 40, + { 0x2b, 0x7e, 0x15, 0x16, 0x28, 0xae, 0xd2, 0xa6, + 0xab, 0xf7, 0x15, 0x88, 0x09, 0xcf, 0x4f, 0x3c }, + { 0x6b, 0xc1, 0xbe, 0xe2, 0x2e, 0x40, 0x9f, 0x96, + 0xe9, 0x3d, 0x7e, 0x11, 0x73, 0x93, 0x17, 0x2a, + 0xae, 0x2d, 0x8a, 0x57, 0x1e, 0x03, 0xac, 0x9c, + 0x9e, 0xb7, 0x6f, 0xac, 0x45, 0xaf, 0x8e, 0x51, + 0x30, 0xc8, 0x1c, 0x46, 0xa3, 0x5c, 0xe4, 0x11 }, + { 0xdf, 0xa6, 0x67, 0x47, 0xde, 0x9a, 0xe6, 0x30, + 0x30, 0xca, 0x32, 0x61, 0x14, 0x97, 0xc8, 0x27 } + }, + { 16, 64, + { 0x2b, 0x7e, 0x15, 0x16, 0x28, 0xae, 0xd2, 0xa6, + 0xab, 0xf7, 0x15, 0x88, 0x09, 0xcf, 0x4f, 0x3c }, + { 0x6b, 0xc1, 0xbe, 0xe2, 0x2e, 0x40, 0x9f, 0x96, + 0xe9, 0x3d, 0x7e, 0x11, 0x73, 0x93, 0x17, 0x2a, + 0xae, 0x2d, 0x8a, 0x57, 0x1e, 0x03, 0xac, 0x9c, + 0x9e, 0xb7, 0x6f, 0xac, 0x45, 0xaf, 0x8e, 0x51, + 0x30, 0xc8, 0x1c, 0x46, 0xa3, 0x5c, 0xe4, 0x11, + 0xe5, 0xfb, 0xc1, 0x19, 0x1a, 0x0a, 0x52, 0xef, + 0xf6, 0x9f, 0x24, 0x45, 0xdf, 0x4f, 0x9b, 0x17, + 0xad, 0x2b, 0x41, 0x7b, 0xe6, 0x6c, 0x37, 0x10 }, + { 0x51, 0xf0, 0xbe, 0xbf, 0x7e, 0x3b, 0x9d, 0x92, + 0xfc, 0x49, 0x74, 0x17, 0x79, 0x36, 0x3c, 0xfe } + } + + }; + unsigned char out[16]; + int x, err, idx; + unsigned long len; + + + /* AES can be under rijndael or aes... try to find it */ + if ((idx = find_cipher("aes")) == -1) { + if ((idx = find_cipher("rijndael")) == -1) { + return CRYPT_NOP; + } + } + + for (x = 0; x < (int)(sizeof(tests)/sizeof(tests[0])); x++) { + len = sizeof(out); + if ((err = omac_memory(idx, tests[x].key, tests[x].keylen, tests[x].msg, tests[x].msglen, out, &len)) != CRYPT_OK) { + return err; + } + + if (XMEMCMP(out, tests[x].tag, 16) != 0) { +#if 0 + int y; + printf("\n\nTag: "); + for (y = 0; y < 16; y++) printf("%02x", out[y]); printf("\n\n"); +#endif + return CRYPT_FAIL_TESTVECTOR; + } + } + return CRYPT_OK; +#endif +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/mac/omac/omac_test.c,v $ */ +/* $Revision: 1.6 $ */ +/* $Date: 2006/11/03 00:39:49 $ */ diff --git a/libtomcrypt/src/mac/pelican/pelican.c b/libtomcrypt/src/mac/pelican/pelican.c new file mode 100644 index 0000000..734cd38 --- /dev/null +++ b/libtomcrypt/src/mac/pelican/pelican.c @@ -0,0 +1,165 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file pelican.c + Pelican MAC, initialize state, by Tom St Denis +*/ + +#ifdef PELICAN + +#define ENCRYPT_ONLY +#define PELI_TAB +#include "../../ciphers/aes/aes_tab.c" + +/** + Initialize a Pelican state + @param pelmac The Pelican state to initialize + @param key The secret key + @param keylen The length of the secret key (octets) + @return CRYPT_OK if successful +*/ +int pelican_init(pelican_state *pelmac, const unsigned char *key, unsigned long keylen) +{ + int err; + + LTC_ARGCHK(pelmac != NULL); + LTC_ARGCHK(key != NULL); + +#ifdef LTC_FAST + if (16 % sizeof(LTC_FAST_TYPE)) { + return CRYPT_INVALID_ARG; + } +#endif + + if ((err = aes_setup(key, keylen, 0, &pelmac->K)) != CRYPT_OK) { + return err; + } + + zeromem(pelmac->state, 16); + aes_ecb_encrypt(pelmac->state, pelmac->state, &pelmac->K); + pelmac->buflen = 0; + + return CRYPT_OK; +} + +static void four_rounds(pelican_state *pelmac) +{ + ulong32 s0, s1, s2, s3, t0, t1, t2, t3; + int r; + + LOAD32H(s0, pelmac->state ); + LOAD32H(s1, pelmac->state + 4); + LOAD32H(s2, pelmac->state + 8); + LOAD32H(s3, pelmac->state + 12); + for (r = 0; r < 4; r++) { + t0 = + Te0(byte(s0, 3)) ^ + Te1(byte(s1, 2)) ^ + Te2(byte(s2, 1)) ^ + Te3(byte(s3, 0)); + t1 = + Te0(byte(s1, 3)) ^ + Te1(byte(s2, 2)) ^ + Te2(byte(s3, 1)) ^ + Te3(byte(s0, 0)); + t2 = + Te0(byte(s2, 3)) ^ + Te1(byte(s3, 2)) ^ + Te2(byte(s0, 1)) ^ + Te3(byte(s1, 0)); + t3 = + Te0(byte(s3, 3)) ^ + Te1(byte(s0, 2)) ^ + Te2(byte(s1, 1)) ^ + Te3(byte(s2, 0)); + s0 = t0; s1 = t1; s2 = t2; s3 = t3; + } + STORE32H(s0, pelmac->state ); + STORE32H(s1, pelmac->state + 4); + STORE32H(s2, pelmac->state + 8); + STORE32H(s3, pelmac->state + 12); +} + +/** + Process a block of text through Pelican + @param pelmac The Pelican MAC state + @param in The input + @param inlen The length input (octets) + @return CRYPT_OK on success + */ +int pelican_process(pelican_state *pelmac, const unsigned char *in, unsigned long inlen) +{ + + LTC_ARGCHK(pelmac != NULL); + LTC_ARGCHK(in != NULL); + + /* check range */ + if (pelmac->buflen < 0 || pelmac->buflen > 15) { + return CRYPT_INVALID_ARG; + } + +#ifdef LTC_FAST + if (pelmac->buflen == 0) { + while (inlen & ~15) { + int x; + for (x = 0; x < 16; x += sizeof(LTC_FAST_TYPE)) { + *((LTC_FAST_TYPE*)((unsigned char *)pelmac->state + x)) ^= *((LTC_FAST_TYPE*)((unsigned char *)in + x)); + } + four_rounds(pelmac); + in += 16; + inlen -= 16; + } + } +#endif + + while (inlen--) { + pelmac->state[pelmac->buflen++] ^= *in++; + if (pelmac->buflen == 16) { + four_rounds(pelmac); + pelmac->buflen = 0; + } + } + return CRYPT_OK; +} + +/** + Terminate Pelican MAC + @param pelmac The Pelican MAC state + @param out [out] The TAG + @return CRYPT_OK on sucess +*/ +int pelican_done(pelican_state *pelmac, unsigned char *out) +{ + LTC_ARGCHK(pelmac != NULL); + LTC_ARGCHK(out != NULL); + + /* check range */ + if (pelmac->buflen < 0 || pelmac->buflen > 16) { + return CRYPT_INVALID_ARG; + } + + if (pelmac->buflen == 16) { + four_rounds(pelmac); + pelmac->buflen = 0; + } + pelmac->state[pelmac->buflen++] ^= 0x80; + aes_ecb_encrypt(pelmac->state, out, &pelmac->K); + aes_done(&pelmac->K); + return CRYPT_OK; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/mac/pelican/pelican.c,v $ */ +/* $Revision: 1.18 $ */ +/* $Date: 2006/04/02 13:19:10 $ */ diff --git a/libtomcrypt/src/mac/pelican/pelican_memory.c b/libtomcrypt/src/mac/pelican/pelican_memory.c new file mode 100644 index 0000000..7dde843 --- /dev/null +++ b/libtomcrypt/src/mac/pelican/pelican_memory.c @@ -0,0 +1,59 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file pelican_memory.c + Pelican MAC, MAC a block of memory, by Tom St Denis +*/ + +#ifdef PELICAN + +/** + Pelican block of memory + @param key The key for the MAC + @param keylen The length of the key (octets) + @param in The input to MAC + @param inlen The length of the input (octets) + @param out [out] The output TAG + @return CRYPT_OK on success +*/ +int pelican_memory(const unsigned char *key, unsigned long keylen, + const unsigned char *in, unsigned long inlen, + unsigned char *out) +{ + pelican_state *pel; + int err; + + pel = XMALLOC(sizeof(*pel)); + if (pel == NULL) { + return CRYPT_MEM; + } + + if ((err = pelican_init(pel, key, keylen)) != CRYPT_OK) { + XFREE(pel); + return err; + } + if ((err = pelican_process(pel, in ,inlen)) != CRYPT_OK) { + XFREE(pel); + return err; + } + err = pelican_done(pel, out); + XFREE(pel); + return err; +} + + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/mac/pelican/pelican_memory.c,v $ */ +/* $Revision: 1.6 $ */ +/* $Date: 2006/03/31 14:15:35 $ */ diff --git a/libtomcrypt/src/mac/pelican/pelican_test.c b/libtomcrypt/src/mac/pelican/pelican_test.c new file mode 100644 index 0000000..3cff8ec --- /dev/null +++ b/libtomcrypt/src/mac/pelican/pelican_test.c @@ -0,0 +1,120 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file pelican_test.c + Pelican MAC, test, by Tom St Denis +*/ + +#ifdef PELICAN + +int pelican_test(void) +{ +#ifndef LTC_TEST + return CRYPT_NOP; +#else + static const struct { + unsigned char K[32], MSG[64], T[16]; + int keylen, ptlen; + } tests[] = { +/* K=16, M=0 */ +{ + { 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07, + 0x08, 0x09, 0x0A, 0x0B, 0x0C, 0x0D, 0x0E, 0x0F }, + { 0 }, + { 0xeb, 0x58, 0x37, 0x15, 0xf8, 0x34, 0xde, 0xe5, + 0xa4, 0xd1, 0x6e, 0xe4, 0xb9, 0xd7, 0x76, 0x0e, }, + 16, 0 +}, + +/* K=16, M=3 */ +{ + { 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07, + 0x08, 0x09, 0x0A, 0x0B, 0x0C, 0x0D, 0x0E, 0x0F }, + { 0x00, 0x01, 0x02 }, + { 0x1c, 0x97, 0x40, 0x60, 0x6c, 0x58, 0x17, 0x2d, + 0x03, 0x94, 0x19, 0x70, 0x81, 0xc4, 0x38, 0x54, }, + 16, 3 +}, + +/* K=16, M=16 */ +{ + { 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07, + 0x08, 0x09, 0x0A, 0x0B, 0x0C, 0x0D, 0x0E, 0x0F }, + { 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07, + 0x08, 0x09, 0x0A, 0x0B, 0x0C, 0x0D, 0x0E, 0x0F }, + { 0x03, 0xcc, 0x46, 0xb8, 0xac, 0xa7, 0x9c, 0x36, + 0x1e, 0x8c, 0x6e, 0xa6, 0x7b, 0x89, 0x32, 0x49, }, + 16, 16 +}, + +/* K=16, M=32 */ +{ + { 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07, + 0x08, 0x09, 0x0A, 0x0B, 0x0C, 0x0D, 0x0E, 0x0F }, + { 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07, + 0x08, 0x09, 0x0A, 0x0B, 0x0C, 0x0D, 0x0E, 0x0F, + 0x10, 0x11, 0x12, 0x13, 0x14, 0x15, 0x16, 0x17, + 0x18, 0x19, 0x1A, 0x1B, 0x1C, 0x1D, 0x1E, 0x1F }, + { 0x89, 0xcc, 0x36, 0x58, 0x1b, 0xdd, 0x4d, 0xb5, + 0x78, 0xbb, 0xac, 0xf0, 0xff, 0x8b, 0x08, 0x15, }, + 16, 32 +}, + +/* K=16, M=35 */ +{ + { 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07, + 0x08, 0x09, 0x0A, 0x0B, 0x0C, 0x0D, 0x0E, 0x0F }, + { 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07, + 0x08, 0x09, 0x0A, 0x0B, 0x0C, 0x0D, 0x0E, 0x0F, + 0x10, 0x11, 0x12, 0x13, 0x14, 0x15, 0x16, 0x17, + 0x18, 0x19, 0x1A, 0x1B, 0x1C, 0x1D, 0x1E, 0x1F, + 0x20, 0x21, 0x23 }, + { 0x4a, 0x7d, 0x45, 0x4d, 0xcd, 0xb5, 0xda, 0x8d, + 0x48, 0x78, 0x16, 0x48, 0x5d, 0x45, 0x95, 0x99, }, + 16, 35 +}, +}; + int x, err; + unsigned char out[16]; + pelican_state pel; + + for (x = 0; x < (int)(sizeof(tests)/sizeof(tests[0])); x++) { + if ((err = pelican_init(&pel, tests[x].K, tests[x].keylen)) != CRYPT_OK) { + return err; + } + if ((err = pelican_process(&pel, tests[x].MSG, tests[x].ptlen)) != CRYPT_OK) { + return err; + } + if ((err = pelican_done(&pel, out)) != CRYPT_OK) { + return err; + } + + if (XMEMCMP(out, tests[x].T, 16)) { +#if 0 + int y; + printf("\nFailed test %d\n", x); + printf("{ "); for (y = 0; y < 16; ) { printf("0x%02x, ", out[y]); if (!(++y & 7)) printf("\n"); } printf(" }\n"); +#endif + return CRYPT_FAIL_TESTVECTOR; + } + } + return CRYPT_OK; +#endif +} + + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/mac/pelican/pelican_test.c,v $ */ +/* $Revision: 1.12 $ */ +/* $Date: 2006/11/21 00:18:23 $ */ diff --git a/libtomcrypt/src/mac/pmac/pmac_done.c b/libtomcrypt/src/mac/pmac/pmac_done.c new file mode 100644 index 0000000..005f94f --- /dev/null +++ b/libtomcrypt/src/mac/pmac/pmac_done.c @@ -0,0 +1,74 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file pmac_done.c + PMAC implementation, terminate a session, by Tom St Denis +*/ + +#ifdef LTC_PMAC + +int pmac_done(pmac_state *state, unsigned char *out, unsigned long *outlen) +{ + int err, x; + + LTC_ARGCHK(state != NULL); + LTC_ARGCHK(out != NULL); + if ((err = cipher_is_valid(state->cipher_idx)) != CRYPT_OK) { + return err; + } + + if ((state->buflen > (int)sizeof(state->block)) || (state->buflen < 0) || + (state->block_len > (int)sizeof(state->block)) || (state->buflen > state->block_len)) { + return CRYPT_INVALID_ARG; + } + + + /* handle padding. If multiple xor in L/x */ + + if (state->buflen == state->block_len) { + /* xor Lr against the checksum */ + for (x = 0; x < state->block_len; x++) { + state->checksum[x] ^= state->block[x] ^ state->Lr[x]; + } + } else { + /* otherwise xor message bytes then the 0x80 byte */ + for (x = 0; x < state->buflen; x++) { + state->checksum[x] ^= state->block[x]; + } + state->checksum[x] ^= 0x80; + } + + /* encrypt it */ + if ((err = cipher_descriptor[state->cipher_idx].ecb_encrypt(state->checksum, state->checksum, &state->key)) != CRYPT_OK) { + return err; + } + cipher_descriptor[state->cipher_idx].done(&state->key); + + /* store it */ + for (x = 0; x < state->block_len && x < (int)*outlen; x++) { + out[x] = state->checksum[x]; + } + *outlen = x; + +#ifdef LTC_CLEAN_STACK + zeromem(state, sizeof(*state)); +#endif + return CRYPT_OK; +} + +#endif + + +/* $Source: /cvs/libtom/libtomcrypt/src/mac/pmac/pmac_done.c,v $ */ +/* $Revision: 1.8 $ */ +/* $Date: 2006/11/03 00:39:49 $ */ diff --git a/libtomcrypt/src/mac/pmac/pmac_file.c b/libtomcrypt/src/mac/pmac/pmac_file.c new file mode 100644 index 0000000..f8809e8 --- /dev/null +++ b/libtomcrypt/src/mac/pmac/pmac_file.c @@ -0,0 +1,84 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file pmac_file.c + PMAC implementation, process a file, by Tom St Denis +*/ + +#ifdef LTC_PMAC + +/** + PMAC a file + @param cipher The index of the cipher desired + @param key The secret key + @param keylen The length of the secret key (octets) + @param filename The name of the file to send through PMAC + @param out [out] Destination for the authentication tag + @param outlen [in/out] Max size and resulting size of the authentication tag + @return CRYPT_OK if successful, CRYPT_NOP if file support has been disabled +*/ +int pmac_file(int cipher, + const unsigned char *key, unsigned long keylen, + const char *filename, + unsigned char *out, unsigned long *outlen) +{ +#ifdef LTC_NO_FILE + return CRYPT_NOP; +#else + int err, x; + pmac_state pmac; + FILE *in; + unsigned char buf[512]; + + + LTC_ARGCHK(key != NULL); + LTC_ARGCHK(filename != NULL); + LTC_ARGCHK(out != NULL); + LTC_ARGCHK(outlen != NULL); + + in = fopen(filename, "rb"); + if (in == NULL) { + return CRYPT_FILE_NOTFOUND; + } + + if ((err = pmac_init(&pmac, cipher, key, keylen)) != CRYPT_OK) { + fclose(in); + return err; + } + + do { + x = fread(buf, 1, sizeof(buf), in); + if ((err = pmac_process(&pmac, buf, x)) != CRYPT_OK) { + fclose(in); + return err; + } + } while (x == sizeof(buf)); + fclose(in); + + if ((err = pmac_done(&pmac, out, outlen)) != CRYPT_OK) { + return err; + } + +#ifdef LTC_CLEAN_STACK + zeromem(buf, sizeof(buf)); +#endif + + return CRYPT_OK; +#endif +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/mac/pmac/pmac_file.c,v $ */ +/* $Revision: 1.5 $ */ +/* $Date: 2006/11/03 00:39:49 $ */ diff --git a/libtomcrypt/src/mac/pmac/pmac_init.c b/libtomcrypt/src/mac/pmac/pmac_init.c new file mode 100644 index 0000000..c842160 --- /dev/null +++ b/libtomcrypt/src/mac/pmac/pmac_init.c @@ -0,0 +1,147 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file pmac_init.c + PMAC implementation, initialize state, by Tom St Denis +*/ + +#ifdef LTC_PMAC + +static const struct { + int len; + unsigned char poly_div[MAXBLOCKSIZE], + poly_mul[MAXBLOCKSIZE]; +} polys[] = { +{ + 8, + { 0x80, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x0D }, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x1B } +}, { + 16, + { 0x80, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x43 }, + { 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x87 } +} +}; + +/** + Initialize a PMAC state + @param pmac The PMAC state to initialize + @param cipher The index of the desired cipher + @param key The secret key + @param keylen The length of the secret key (octets) + @return CRYPT_OK if successful +*/ +int pmac_init(pmac_state *pmac, int cipher, const unsigned char *key, unsigned long keylen) +{ + int poly, x, y, m, err; + unsigned char *L; + + LTC_ARGCHK(pmac != NULL); + LTC_ARGCHK(key != NULL); + + /* valid cipher? */ + if ((err = cipher_is_valid(cipher)) != CRYPT_OK) { + return err; + } + + /* determine which polys to use */ + pmac->block_len = cipher_descriptor[cipher].block_length; + for (poly = 0; poly < (int)(sizeof(polys)/sizeof(polys[0])); poly++) { + if (polys[poly].len == pmac->block_len) { + break; + } + } + if (polys[poly].len != pmac->block_len) { + return CRYPT_INVALID_ARG; + } + +#ifdef LTC_FAST + if (pmac->block_len % sizeof(LTC_FAST_TYPE)) { + return CRYPT_INVALID_ARG; + } +#endif + + + /* schedule the key */ + if ((err = cipher_descriptor[cipher].setup(key, keylen, 0, &pmac->key)) != CRYPT_OK) { + return err; + } + + /* allocate L */ + L = XMALLOC(pmac->block_len); + if (L == NULL) { + return CRYPT_MEM; + } + + /* find L = E[0] */ + zeromem(L, pmac->block_len); + if ((err = cipher_descriptor[cipher].ecb_encrypt(L, L, &pmac->key)) != CRYPT_OK) { + goto error; + } + + /* find Ls[i] = L << i for i == 0..31 */ + XMEMCPY(pmac->Ls[0], L, pmac->block_len); + for (x = 1; x < 32; x++) { + m = pmac->Ls[x-1][0] >> 7; + for (y = 0; y < pmac->block_len-1; y++) { + pmac->Ls[x][y] = ((pmac->Ls[x-1][y] << 1) | (pmac->Ls[x-1][y+1] >> 7)) & 255; + } + pmac->Ls[x][pmac->block_len-1] = (pmac->Ls[x-1][pmac->block_len-1] << 1) & 255; + + if (m == 1) { + for (y = 0; y < pmac->block_len; y++) { + pmac->Ls[x][y] ^= polys[poly].poly_mul[y]; + } + } + } + + /* find Lr = L / x */ + m = L[pmac->block_len-1] & 1; + + /* shift right */ + for (x = pmac->block_len - 1; x > 0; x--) { + pmac->Lr[x] = ((L[x] >> 1) | (L[x-1] << 7)) & 255; + } + pmac->Lr[0] = L[0] >> 1; + + if (m == 1) { + for (x = 0; x < pmac->block_len; x++) { + pmac->Lr[x] ^= polys[poly].poly_div[x]; + } + } + + /* zero buffer, counters, etc... */ + pmac->block_index = 1; + pmac->cipher_idx = cipher; + pmac->buflen = 0; + zeromem(pmac->block, sizeof(pmac->block)); + zeromem(pmac->Li, sizeof(pmac->Li)); + zeromem(pmac->checksum, sizeof(pmac->checksum)); + err = CRYPT_OK; +error: +#ifdef LTC_CLEAN_STACK + zeromem(L, pmac->block_len); +#endif + + XFREE(L); + + return err; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/mac/pmac/pmac_init.c,v $ */ +/* $Revision: 1.7 $ */ +/* $Date: 2006/11/03 00:39:49 $ */ diff --git a/libtomcrypt/src/mac/pmac/pmac_memory.c b/libtomcrypt/src/mac/pmac/pmac_memory.c new file mode 100644 index 0000000..ca15e63 --- /dev/null +++ b/libtomcrypt/src/mac/pmac/pmac_memory.c @@ -0,0 +1,74 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file pmac_memory.c + PMAC implementation, process a block of memory, by Tom St Denis +*/ + +#ifdef LTC_PMAC + +/** + PMAC a block of memory + @param cipher The index of the cipher desired + @param key The secret key + @param keylen The length of the secret key (octets) + @param in The data you wish to send through PMAC + @param inlen The length of data you wish to send through PMAC (octets) + @param out [out] Destination for the authentication tag + @param outlen [in/out] The max size and resulting size of the authentication tag + @return CRYPT_OK if successful +*/ +int pmac_memory(int cipher, + const unsigned char *key, unsigned long keylen, + const unsigned char *in, unsigned long inlen, + unsigned char *out, unsigned long *outlen) +{ + int err; + pmac_state *pmac; + + LTC_ARGCHK(key != NULL); + LTC_ARGCHK(in != NULL); + LTC_ARGCHK(out != NULL); + LTC_ARGCHK(outlen != NULL); + + /* allocate ram for pmac state */ + pmac = XMALLOC(sizeof(pmac_state)); + if (pmac == NULL) { + return CRYPT_MEM; + } + + if ((err = pmac_init(pmac, cipher, key, keylen)) != CRYPT_OK) { + goto LBL_ERR; + } + if ((err = pmac_process(pmac, in, inlen)) != CRYPT_OK) { + goto LBL_ERR; + } + if ((err = pmac_done(pmac, out, outlen)) != CRYPT_OK) { + goto LBL_ERR; + } + + err = CRYPT_OK; +LBL_ERR: +#ifdef LTC_CLEAN_STACK + zeromem(pmac, sizeof(pmac_state)); +#endif + + XFREE(pmac); + return err; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/mac/pmac/pmac_memory.c,v $ */ +/* $Revision: 1.5 $ */ +/* $Date: 2006/11/03 00:39:49 $ */ diff --git a/libtomcrypt/src/mac/pmac/pmac_memory_multi.c b/libtomcrypt/src/mac/pmac/pmac_memory_multi.c new file mode 100644 index 0000000..70e2398 --- /dev/null +++ b/libtomcrypt/src/mac/pmac/pmac_memory_multi.c @@ -0,0 +1,89 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" +#include <stdarg.h> + +/** + @file pmac_memory_multi.c + PMAC implementation, process multiple blocks of memory, by Tom St Denis +*/ + +#ifdef LTC_PMAC + +/** + PMAC multiple blocks of memory + @param cipher The index of the cipher desired + @param key The secret key + @param keylen The length of the secret key (octets) + @param out [out] Destination for the authentication tag + @param outlen [in/out] The max size and resulting size of the authentication tag + @param in The data you wish to send through PMAC + @param inlen The length of data you wish to send through PMAC (octets) + @param ... tuples of (data,len) pairs to PMAC, terminated with a (NULL,x) (x=don't care) + @return CRYPT_OK if successful +*/ +int pmac_memory_multi(int cipher, + const unsigned char *key, unsigned long keylen, + unsigned char *out, unsigned long *outlen, + const unsigned char *in, unsigned long inlen, ...) +{ + int err; + pmac_state *pmac; + va_list args; + const unsigned char *curptr; + unsigned long curlen; + + LTC_ARGCHK(key != NULL); + LTC_ARGCHK(in != NULL); + LTC_ARGCHK(out != NULL); + LTC_ARGCHK(outlen != NULL); + + /* allocate ram for pmac state */ + pmac = XMALLOC(sizeof(pmac_state)); + if (pmac == NULL) { + return CRYPT_MEM; + } + + if ((err = pmac_init(pmac, cipher, key, keylen)) != CRYPT_OK) { + goto LBL_ERR; + } + va_start(args, inlen); + curptr = in; + curlen = inlen; + for (;;) { + /* process buf */ + if ((err = pmac_process(pmac, curptr, curlen)) != CRYPT_OK) { + goto LBL_ERR; + } + /* step to next */ + curptr = va_arg(args, const unsigned char*); + if (curptr == NULL) { + break; + } + curlen = va_arg(args, unsigned long); + } + if ((err = pmac_done(pmac, out, outlen)) != CRYPT_OK) { + goto LBL_ERR; + } +LBL_ERR: +#ifdef LTC_CLEAN_STACK + zeromem(pmac, sizeof(pmac_state)); +#endif + XFREE(pmac); + va_end(args); + return err; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/mac/pmac/pmac_memory_multi.c,v $ */ +/* $Revision: 1.6 $ */ +/* $Date: 2006/11/03 00:39:49 $ */ diff --git a/libtomcrypt/src/mac/pmac/pmac_ntz.c b/libtomcrypt/src/mac/pmac/pmac_ntz.c new file mode 100644 index 0000000..8322563 --- /dev/null +++ b/libtomcrypt/src/mac/pmac/pmac_ntz.c @@ -0,0 +1,39 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file pmac_ntz.c + PMAC implementation, internal function, by Tom St Denis +*/ + +#ifdef LTC_PMAC + +/** + Internal PMAC function +*/ +int pmac_ntz(unsigned long x) +{ + int c; + x &= 0xFFFFFFFFUL; + c = 0; + while ((x & 1) == 0) { + ++c; + x >>= 1; + } + return c; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/mac/pmac/pmac_ntz.c,v $ */ +/* $Revision: 1.5 $ */ +/* $Date: 2006/11/03 00:39:49 $ */ diff --git a/libtomcrypt/src/mac/pmac/pmac_process.c b/libtomcrypt/src/mac/pmac/pmac_process.c new file mode 100644 index 0000000..a191812 --- /dev/null +++ b/libtomcrypt/src/mac/pmac/pmac_process.c @@ -0,0 +1,100 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file pmac_process.c + PMAC implementation, process data, by Tom St Denis +*/ + + +#ifdef LTC_PMAC + +/** + Process data in a PMAC stream + @param pmac The PMAC state + @param in The data to send through PMAC + @param inlen The length of the data to send through PMAC + @return CRYPT_OK if successful +*/ +int pmac_process(pmac_state *pmac, const unsigned char *in, unsigned long inlen) +{ + int err, n; + unsigned long x; + unsigned char Z[MAXBLOCKSIZE]; + + LTC_ARGCHK(pmac != NULL); + LTC_ARGCHK(in != NULL); + if ((err = cipher_is_valid(pmac->cipher_idx)) != CRYPT_OK) { + return err; + } + + if ((pmac->buflen > (int)sizeof(pmac->block)) || (pmac->buflen < 0) || + (pmac->block_len > (int)sizeof(pmac->block)) || (pmac->buflen > pmac->block_len)) { + return CRYPT_INVALID_ARG; + } + +#ifdef LTC_FAST + if (pmac->buflen == 0 && inlen > 16) { + unsigned long y; + for (x = 0; x < (inlen - 16); x += 16) { + pmac_shift_xor(pmac); + for (y = 0; y < 16; y += sizeof(LTC_FAST_TYPE)) { + *((LTC_FAST_TYPE*)(&Z[y])) = *((LTC_FAST_TYPE*)(&in[y])) ^ *((LTC_FAST_TYPE*)(&pmac->Li[y])); + } + if ((err = cipher_descriptor[pmac->cipher_idx].ecb_encrypt(Z, Z, &pmac->key)) != CRYPT_OK) { + return err; + } + for (y = 0; y < 16; y += sizeof(LTC_FAST_TYPE)) { + *((LTC_FAST_TYPE*)(&pmac->checksum[y])) ^= *((LTC_FAST_TYPE*)(&Z[y])); + } + in += 16; + } + inlen -= x; + } +#endif + + while (inlen != 0) { + /* ok if the block is full we xor in prev, encrypt and replace prev */ + if (pmac->buflen == pmac->block_len) { + pmac_shift_xor(pmac); + for (x = 0; x < (unsigned long)pmac->block_len; x++) { + Z[x] = pmac->Li[x] ^ pmac->block[x]; + } + if ((err = cipher_descriptor[pmac->cipher_idx].ecb_encrypt(Z, Z, &pmac->key)) != CRYPT_OK) { + return err; + } + for (x = 0; x < (unsigned long)pmac->block_len; x++) { + pmac->checksum[x] ^= Z[x]; + } + pmac->buflen = 0; + } + + /* add bytes */ + n = MIN(inlen, (unsigned long)(pmac->block_len - pmac->buflen)); + XMEMCPY(pmac->block + pmac->buflen, in, n); + pmac->buflen += n; + inlen -= n; + in += n; + } + +#ifdef LTC_CLEAN_STACK + zeromem(Z, sizeof(Z)); +#endif + + return CRYPT_OK; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/mac/pmac/pmac_process.c,v $ */ +/* $Revision: 1.8 $ */ +/* $Date: 2006/11/03 00:39:49 $ */ diff --git a/libtomcrypt/src/mac/pmac/pmac_shift_xor.c b/libtomcrypt/src/mac/pmac/pmac_shift_xor.c new file mode 100644 index 0000000..694a423 --- /dev/null +++ b/libtomcrypt/src/mac/pmac/pmac_shift_xor.c @@ -0,0 +1,44 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file pmac_shift_xor.c + PMAC implementation, internal function, by Tom St Denis +*/ + +#ifdef LTC_PMAC + +/** + Internal function. Performs the state update (adding correct multiple) + @param pmac The PMAC state. +*/ +void pmac_shift_xor(pmac_state *pmac) +{ + int x, y; + y = pmac_ntz(pmac->block_index++); +#ifdef LTC_FAST + for (x = 0; x < pmac->block_len; x += sizeof(LTC_FAST_TYPE)) { + *((LTC_FAST_TYPE*)((unsigned char *)pmac->Li + x)) ^= + *((LTC_FAST_TYPE*)((unsigned char *)pmac->Ls[y] + x)); + } +#else + for (x = 0; x < pmac->block_len; x++) { + pmac->Li[x] ^= pmac->Ls[y][x]; + } +#endif +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/mac/pmac/pmac_shift_xor.c,v $ */ +/* $Revision: 1.6 $ */ +/* $Date: 2006/11/03 00:39:49 $ */ diff --git a/libtomcrypt/src/mac/pmac/pmac_test.c b/libtomcrypt/src/mac/pmac/pmac_test.c new file mode 100644 index 0000000..a635e15 --- /dev/null +++ b/libtomcrypt/src/mac/pmac/pmac_test.c @@ -0,0 +1,165 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file pmac_test.c + PMAC implementation, self-test, by Tom St Denis +*/ + + +#ifdef LTC_PMAC + +/** + Test the OMAC implementation + @return CRYPT_OK if successful, CRYPT_NOP if testing has been disabled +*/ +int pmac_test(void) +{ +#if !defined(LTC_TEST) + return CRYPT_NOP; +#else + static const struct { + int msglen; + unsigned char key[16], msg[34], tag[16]; + } tests[] = { + + /* PMAC-AES-128-0B */ +{ + 0, + /* key */ + { 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07, + 0x08, 0x09, 0x0a, 0x0b, 0x0c, 0x0d, 0x0e, 0x0f }, + /* msg */ + { 0x00 }, + /* tag */ + { 0x43, 0x99, 0x57, 0x2c, 0xd6, 0xea, 0x53, 0x41, + 0xb8, 0xd3, 0x58, 0x76, 0xa7, 0x09, 0x8a, 0xf7 } +}, + + /* PMAC-AES-128-3B */ +{ + 3, + /* key */ + { 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07, + 0x08, 0x09, 0x0a, 0x0b, 0x0c, 0x0d, 0x0e, 0x0f }, + /* msg */ + { 0x00, 0x01, 0x02 }, + /* tag */ + { 0x25, 0x6b, 0xa5, 0x19, 0x3c, 0x1b, 0x99, 0x1b, + 0x4d, 0xf0, 0xc5, 0x1f, 0x38, 0x8a, 0x9e, 0x27 } +}, + + /* PMAC-AES-128-16B */ +{ + 16, + /* key */ + { 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07, + 0x08, 0x09, 0x0a, 0x0b, 0x0c, 0x0d, 0x0e, 0x0f }, + /* msg */ + { 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07, + 0x08, 0x09, 0x0a, 0x0b, 0x0c, 0x0d, 0x0e, 0x0f }, + /* tag */ + { 0xeb, 0xbd, 0x82, 0x2f, 0xa4, 0x58, 0xda, 0xf6, + 0xdf, 0xda, 0xd7, 0xc2, 0x7d, 0xa7, 0x63, 0x38 } +}, + + /* PMAC-AES-128-20B */ +{ + 20, + /* key */ + { 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07, + 0x08, 0x09, 0x0a, 0x0b, 0x0c, 0x0d, 0x0e, 0x0f }, + /* msg */ + { 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07, + 0x08, 0x09, 0x0a, 0x0b, 0x0c, 0x0d, 0x0e, 0x0f, + 0x10, 0x11, 0x12, 0x13 }, + /* tag */ + { 0x04, 0x12, 0xca, 0x15, 0x0b, 0xbf, 0x79, 0x05, + 0x8d, 0x8c, 0x75, 0xa5, 0x8c, 0x99, 0x3f, 0x55 } +}, + + /* PMAC-AES-128-32B */ +{ + 32, + /* key */ + { 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07, + 0x08, 0x09, 0x0a, 0x0b, 0x0c, 0x0d, 0x0e, 0x0f }, + /* msg */ + { 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07, + 0x08, 0x09, 0x0a, 0x0b, 0x0c, 0x0d, 0x0e, 0x0f, + 0x10, 0x11, 0x12, 0x13, 0x14, 0x15, 0x16, 0x17, + 0x18, 0x19, 0x1a, 0x1b, 0x1c, 0x1d, 0x1e, 0x1f }, + /* tag */ + { 0xe9, 0x7a, 0xc0, 0x4e, 0x9e, 0x5e, 0x33, 0x99, + 0xce, 0x53, 0x55, 0xcd, 0x74, 0x07, 0xbc, 0x75 } +}, + + /* PMAC-AES-128-34B */ +{ + 34, + /* key */ + { 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07, + 0x08, 0x09, 0x0a, 0x0b, 0x0c, 0x0d, 0x0e, 0x0f }, + /* msg */ + { 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07, + 0x08, 0x09, 0x0a, 0x0b, 0x0c, 0x0d, 0x0e, 0x0f, + 0x10, 0x11, 0x12, 0x13, 0x14, 0x15, 0x16, 0x17, + 0x18, 0x19, 0x1a, 0x1b, 0x1c, 0x1d, 0x1e, 0x1f, + 0x20, 0x21 }, + /* tag */ + { 0x5c, 0xba, 0x7d, 0x5e, 0xb2, 0x4f, 0x7c, 0x86, + 0xcc, 0xc5, 0x46, 0x04, 0xe5, 0x3d, 0x55, 0x12 } +} + +}; + int err, x, idx; + unsigned long len; + unsigned char outtag[MAXBLOCKSIZE]; + + /* AES can be under rijndael or aes... try to find it */ + if ((idx = find_cipher("aes")) == -1) { + if ((idx = find_cipher("rijndael")) == -1) { + return CRYPT_NOP; + } + } + + for (x = 0; x < (int)(sizeof(tests)/sizeof(tests[0])); x++) { + len = sizeof(outtag); + if ((err = pmac_memory(idx, tests[x].key, 16, tests[x].msg, tests[x].msglen, outtag, &len)) != CRYPT_OK) { + return err; + } + + if (XMEMCMP(outtag, tests[x].tag, len)) { +#if 0 + unsigned long y; + printf("\nTAG:\n"); + for (y = 0; y < len; ) { + printf("0x%02x", outtag[y]); + if (y < len-1) printf(", "); + if (!(++y % 8)) printf("\n"); + } +#endif + return CRYPT_FAIL_TESTVECTOR; + } + } + return CRYPT_OK; +#endif /* LTC_TEST */ +} + +#endif /* PMAC_MODE */ + + + + +/* $Source: /cvs/libtom/libtomcrypt/src/mac/pmac/pmac_test.c,v $ */ +/* $Revision: 1.6 $ */ +/* $Date: 2006/11/03 00:39:49 $ */ diff --git a/libtomcrypt/src/mac/xcbc/xcbc_done.c b/libtomcrypt/src/mac/xcbc/xcbc_done.c new file mode 100644 index 0000000..687c24d --- /dev/null +++ b/libtomcrypt/src/mac/xcbc/xcbc_done.c @@ -0,0 +1,77 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file xcbc_done.c + XCBC Support, terminate the state +*/ + +#ifdef LTC_XCBC + +/** Terminate the XCBC-MAC state + @param xcbc XCBC state to terminate + @param out [out] Destination for the MAC tag + @param outlen [in/out] Destination size and final tag size + Return CRYPT_OK on success +*/ +int xcbc_done(xcbc_state *xcbc, unsigned char *out, unsigned long *outlen) +{ + int err, x; + LTC_ARGCHK(xcbc != NULL); + LTC_ARGCHK(out != NULL); + + /* check structure */ + if ((err = cipher_is_valid(xcbc->cipher)) != CRYPT_OK) { + return err; + } + + if ((xcbc->blocksize > cipher_descriptor[xcbc->cipher].block_length) || (xcbc->blocksize < 0) || + (xcbc->buflen > xcbc->blocksize) || (xcbc->buflen < 0)) { + return CRYPT_INVALID_ARG; + } + + /* which key do we use? */ + if (xcbc->buflen == xcbc->blocksize) { + /* k2 */ + for (x = 0; x < xcbc->blocksize; x++) { + xcbc->IV[x] ^= xcbc->K[1][x]; + } + } else { + xcbc->IV[xcbc->buflen] ^= 0x80; + /* k3 */ + for (x = 0; x < xcbc->blocksize; x++) { + xcbc->IV[x] ^= xcbc->K[2][x]; + } + } + + /* encrypt */ + cipher_descriptor[xcbc->cipher].ecb_encrypt(xcbc->IV, xcbc->IV, &xcbc->key); + cipher_descriptor[xcbc->cipher].done(&xcbc->key); + + /* extract tag */ + for (x = 0; x < xcbc->blocksize && (unsigned long)x < *outlen; x++) { + out[x] = xcbc->IV[x]; + } + *outlen = x; + +#ifdef LTC_CLEAN_STACK + zeromem(xcbc, sizeof(*xcbc)); +#endif + return CRYPT_OK; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/mac/xcbc/xcbc_done.c,v $ */ +/* $Revision: 1.4 $ */ +/* $Date: 2006/11/07 03:23:46 $ */ + diff --git a/libtomcrypt/src/mac/xcbc/xcbc_file.c b/libtomcrypt/src/mac/xcbc/xcbc_file.c new file mode 100644 index 0000000..4a8f7af --- /dev/null +++ b/libtomcrypt/src/mac/xcbc/xcbc_file.c @@ -0,0 +1,83 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file xcbc_file.c + XCBC support, process a file, Tom St Denis +*/ + +#ifdef LTC_XCBC + +/** + XCBC a file + @param cipher The index of the cipher desired + @param key The secret key + @param keylen The length of the secret key (octets) + @param filename The name of the file you wish to XCBC + @param out [out] Where the authentication tag is to be stored + @param outlen [in/out] The max size and resulting size of the authentication tag + @return CRYPT_OK if successful, CRYPT_NOP if file support has been disabled +*/ +int xcbc_file(int cipher, + const unsigned char *key, unsigned long keylen, + const char *filename, + unsigned char *out, unsigned long *outlen) +{ +#ifdef LTC_NO_FILE + return CRYPT_NOP; +#else + int err, x; + xcbc_state xcbc; + FILE *in; + unsigned char buf[512]; + + LTC_ARGCHK(key != NULL); + LTC_ARGCHK(filename != NULL); + LTC_ARGCHK(out != NULL); + LTC_ARGCHK(outlen != NULL); + + in = fopen(filename, "rb"); + if (in == NULL) { + return CRYPT_FILE_NOTFOUND; + } + + if ((err = xcbc_init(&xcbc, cipher, key, keylen)) != CRYPT_OK) { + fclose(in); + return err; + } + + do { + x = fread(buf, 1, sizeof(buf), in); + if ((err = xcbc_process(&xcbc, buf, x)) != CRYPT_OK) { + fclose(in); + return err; + } + } while (x == sizeof(buf)); + fclose(in); + + if ((err = xcbc_done(&xcbc, out, outlen)) != CRYPT_OK) { + return err; + } + +#ifdef LTC_CLEAN_STACK + zeromem(buf, sizeof(buf)); +#endif + + return CRYPT_OK; +#endif +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/mac/xcbc/xcbc_file.c,v $ */ +/* $Revision: 1.1 $ */ +/* $Date: 2006/11/03 01:56:41 $ */ diff --git a/libtomcrypt/src/mac/xcbc/xcbc_init.c b/libtomcrypt/src/mac/xcbc/xcbc_init.c new file mode 100644 index 0000000..3a0dcaf --- /dev/null +++ b/libtomcrypt/src/mac/xcbc/xcbc_init.c @@ -0,0 +1,86 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file xcbc_init.c + XCBC Support, start an XCBC state +*/ + +#ifdef LTC_XCBC + +/** Initialize XCBC-MAC state + @param xcbc [out] XCBC state to initialize + @param cipher Index of cipher to use + @param key [in] Secret key + @param keylen Length of secret key in octets + Return CRYPT_OK on success +*/ +int xcbc_init(xcbc_state *xcbc, int cipher, const unsigned char *key, unsigned long keylen) +{ + int x, y, err; + symmetric_key *skey; + + LTC_ARGCHK(xcbc != NULL); + LTC_ARGCHK(key != NULL); + + /* schedule the key */ + if ((err = cipher_is_valid(cipher)) != CRYPT_OK) { + return err; + } + +#ifdef LTC_FAST + if (cipher_descriptor[cipher].block_length % sizeof(LTC_FAST_TYPE)) { + return CRYPT_INVALID_ARG; + } +#endif + + /* schedule the user key */ + skey = XCALLOC(1, sizeof(*skey)); + if (skey == NULL) { + return CRYPT_MEM; + } + + if ((err = cipher_descriptor[cipher].setup(key, keylen, 0, skey)) != CRYPT_OK) { + goto done; + } + + /* make the three keys */ + for (y = 0; y < 3; y++) { + for (x = 0; x < cipher_descriptor[cipher].block_length; x++) { + xcbc->K[y][x] = y + 1; + } + cipher_descriptor[cipher].ecb_encrypt(xcbc->K[y], xcbc->K[y], skey); + } + + /* setup K1 */ + err = cipher_descriptor[cipher].setup(xcbc->K[0], cipher_descriptor[cipher].block_length, 0, &xcbc->key); + + /* setup struct */ + zeromem(xcbc->IV, cipher_descriptor[cipher].block_length); + xcbc->blocksize = cipher_descriptor[cipher].block_length; + xcbc->cipher = cipher; + xcbc->buflen = 0; +done: + cipher_descriptor[cipher].done(skey); +#ifdef LTC_CLEAN_STACK + zeromem(skey, sizeof(*skey)); +#endif + XFREE(skey); + return err; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/mac/xcbc/xcbc_init.c,v $ */ +/* $Revision: 1.4 $ */ +/* $Date: 2006/11/07 03:23:46 $ */ + diff --git a/libtomcrypt/src/mac/xcbc/xcbc_memory.c b/libtomcrypt/src/mac/xcbc/xcbc_memory.c new file mode 100644 index 0000000..1826b6b --- /dev/null +++ b/libtomcrypt/src/mac/xcbc/xcbc_memory.c @@ -0,0 +1,71 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file xcbc_process.c + XCBC Support, XCBC-MAC a block of memory +*/ + +#ifdef LTC_XCBC + +/** XCBC-MAC a block of memory + @param cipher Index of cipher to use + @param key [in] Secret key + @param keylen Length of key in octets + @param in [in] Message to MAC + @param inlen Length of input in octets + @param out [out] Destination for the MAC tag + @param outlen [in/out] Output size and final tag size + Return CRYPT_OK on success. +*/ +int xcbc_memory(int cipher, + const unsigned char *key, unsigned long keylen, + const unsigned char *in, unsigned long inlen, + unsigned char *out, unsigned long *outlen) +{ + xcbc_state *xcbc; + int err; + + /* is the cipher valid? */ + if ((err = cipher_is_valid(cipher)) != CRYPT_OK) { + return err; + } + + /* Use accelerator if found */ + if (cipher_descriptor[cipher].xcbc_memory != NULL) { + return cipher_descriptor[cipher].xcbc_memory(key, keylen, in, inlen, out, outlen); + } + + xcbc = XCALLOC(1, sizeof(*xcbc)); + if (xcbc == NULL) { + return CRYPT_MEM; + } + + if ((err = xcbc_init(xcbc, cipher, key, keylen)) != CRYPT_OK) { + goto done; + } + + if ((err = xcbc_process(xcbc, in, inlen)) != CRYPT_OK) { + goto done; + } + + err = xcbc_done(xcbc, out, outlen); +done: + XFREE(xcbc); + return err; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/mac/xcbc/xcbc_memory.c,v $ */ +/* $Revision: 1.4 $ */ +/* $Date: 2006/11/21 23:02:42 $ */ diff --git a/libtomcrypt/src/mac/xcbc/xcbc_memory_multi.c b/libtomcrypt/src/mac/xcbc/xcbc_memory_multi.c new file mode 100644 index 0000000..ccae9de --- /dev/null +++ b/libtomcrypt/src/mac/xcbc/xcbc_memory_multi.c @@ -0,0 +1,90 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" +#include <stdarg.h> + +/** + @file xcbc_memory_multi.c + XCBC support, process multiple blocks of memory, Tom St Denis +*/ + +#ifdef LTC_XCBC + +/** + XCBC multiple blocks of memory + @param cipher The index of the desired cipher + @param key The secret key + @param keylen The length of the secret key (octets) + @param out [out] The destination of the authentication tag + @param outlen [in/out] The max size and resulting size of the authentication tag (octets) + @param in The data to send through XCBC + @param inlen The length of the data to send through XCBC (octets) + @param ... tuples of (data,len) pairs to XCBC, terminated with a (NULL,x) (x=don't care) + @return CRYPT_OK if successful +*/ +int xcbc_memory_multi(int cipher, + const unsigned char *key, unsigned long keylen, + unsigned char *out, unsigned long *outlen, + const unsigned char *in, unsigned long inlen, ...) +{ + int err; + xcbc_state *xcbc; + va_list args; + const unsigned char *curptr; + unsigned long curlen; + + LTC_ARGCHK(key != NULL); + LTC_ARGCHK(in != NULL); + LTC_ARGCHK(out != NULL); + LTC_ARGCHK(outlen != NULL); + + /* allocate ram for xcbc state */ + xcbc = XMALLOC(sizeof(xcbc_state)); + if (xcbc == NULL) { + return CRYPT_MEM; + } + + /* xcbc process the message */ + if ((err = xcbc_init(xcbc, cipher, key, keylen)) != CRYPT_OK) { + goto LBL_ERR; + } + va_start(args, inlen); + curptr = in; + curlen = inlen; + for (;;) { + /* process buf */ + if ((err = xcbc_process(xcbc, curptr, curlen)) != CRYPT_OK) { + goto LBL_ERR; + } + /* step to next */ + curptr = va_arg(args, const unsigned char*); + if (curptr == NULL) { + break; + } + curlen = va_arg(args, unsigned long); + } + if ((err = xcbc_done(xcbc, out, outlen)) != CRYPT_OK) { + goto LBL_ERR; + } +LBL_ERR: +#ifdef LTC_CLEAN_STACK + zeromem(xcbc, sizeof(xcbc_state)); +#endif + XFREE(xcbc); + va_end(args); + return err; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/mac/xcbc/xcbc_memory_multi.c,v $ */ +/* $Revision: 1.1 $ */ +/* $Date: 2006/11/03 01:53:25 $ */ diff --git a/libtomcrypt/src/mac/xcbc/xcbc_process.c b/libtomcrypt/src/mac/xcbc/xcbc_process.c new file mode 100644 index 0000000..4dd63b5 --- /dev/null +++ b/libtomcrypt/src/mac/xcbc/xcbc_process.c @@ -0,0 +1,75 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file xcbc_process.c + XCBC Support, process blocks with XCBC +*/ + +#ifdef LTC_XCBC + +/** Process data through XCBC-MAC + @param xcbc The XCBC-MAC state + @param in Input data to process + @param inlen Length of input in octets + Return CRYPT_OK on success +*/ +int xcbc_process(xcbc_state *xcbc, const unsigned char *in, unsigned long inlen) +{ + int err; +#ifdef LTC_FAST + int x; +#endif + + LTC_ARGCHK(xcbc != NULL); + LTC_ARGCHK(in != NULL); + + /* check structure */ + if ((err = cipher_is_valid(xcbc->cipher)) != CRYPT_OK) { + return err; + } + + if ((xcbc->blocksize > cipher_descriptor[xcbc->cipher].block_length) || (xcbc->blocksize < 0) || + (xcbc->buflen > xcbc->blocksize) || (xcbc->buflen < 0)) { + return CRYPT_INVALID_ARG; + } + +#ifdef LTC_FAST + if (xcbc->buflen == 0) { + while (inlen > (unsigned long)xcbc->blocksize) { + for (x = 0; x < xcbc->blocksize; x += sizeof(LTC_FAST_TYPE)) { + *((LTC_FAST_TYPE*)&(xcbc->IV[x])) ^= *((LTC_FAST_TYPE*)&(in[x])); + } + cipher_descriptor[xcbc->cipher].ecb_encrypt(xcbc->IV, xcbc->IV, &xcbc->key); + in += xcbc->blocksize; + inlen -= xcbc->blocksize; + } + } +#endif + + while (inlen) { + if (xcbc->buflen == xcbc->blocksize) { + cipher_descriptor[xcbc->cipher].ecb_encrypt(xcbc->IV, xcbc->IV, &xcbc->key); + xcbc->buflen = 0; + } + xcbc->IV[xcbc->buflen++] ^= *in++; + --inlen; + } + return CRYPT_OK; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/mac/xcbc/xcbc_process.c,v $ */ +/* $Revision: 1.9 $ */ +/* $Date: 2006/11/09 22:43:52 $ */ + diff --git a/libtomcrypt/src/mac/xcbc/xcbc_test.c b/libtomcrypt/src/mac/xcbc/xcbc_test.c new file mode 100644 index 0000000..2c56c0a --- /dev/null +++ b/libtomcrypt/src/mac/xcbc/xcbc_test.c @@ -0,0 +1,128 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file xcbc_test.c + XCBC Support, Test XCBC-MAC mode +*/ + +#ifdef LTC_XCBC + +/** Test XCBC-MAC mode + Return CRYPT_OK on succes +*/ +int xcbc_test(void) +{ +#ifdef LTC_NO_TEST + return CRYPT_NOP; +#else + static const struct { + int msglen; + unsigned char K[16], M[34], T[16]; + } tests[] = { +{ + 0, + { 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07, + 0x08, 0x09, 0x0a, 0x0b, 0x0c, 0x0d, 0x0e, 0x0f }, + + { 0 }, + + { 0x75, 0xf0, 0x25, 0x1d, 0x52, 0x8a, 0xc0, 0x1c, + 0x45, 0x73, 0xdf, 0xd5, 0x84, 0xd7, 0x9f, 0x29 } +}, + +{ + 3, + { 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07, + 0x08, 0x09, 0x0a, 0x0b, 0x0c, 0x0d, 0x0e, 0x0f }, + + { 0x00, 0x01, 0x02 }, + + { 0x5b, 0x37, 0x65, 0x80, 0xae, 0x2f, 0x19, 0xaf, + 0xe7, 0x21, 0x9c, 0xee, 0xf1, 0x72, 0x75, 0x6f } +}, + +{ + 16, + { 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07, + 0x08, 0x09, 0x0a, 0x0b, 0x0c, 0x0d, 0x0e, 0x0f }, + + { 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07, + 0x08, 0x09, 0x0a, 0x0b, 0x0c, 0x0d, 0x0e, 0x0f }, + + { 0xd2, 0xa2, 0x46, 0xfa, 0x34, 0x9b, 0x68, 0xa7, + 0x99, 0x98, 0xa4, 0x39, 0x4f, 0xf7, 0xa2, 0x63 } +}, + +{ + 32, + { 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07, + 0x08, 0x09, 0x0a, 0x0b, 0x0c, 0x0d, 0x0e, 0x0f }, + + { 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07, + 0x08, 0x09, 0x0a, 0x0b, 0x0c, 0x0d, 0x0e, 0x0f, + 0x10, 0x11, 0x12, 0x13, 0x14, 0x15, 0x16, 0x17, + 0x18, 0x19, 0x1a, 0x1b, 0x1c, 0x1d, 0x1e, 0x1f }, + + { 0xf5, 0x4f, 0x0e, 0xc8, 0xd2, 0xb9, 0xf3, 0xd3, + 0x68, 0x07, 0x73, 0x4b, 0xd5, 0x28, 0x3f, 0xd4 } +}, + +{ + 34, + { 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07, + 0x08, 0x09, 0x0a, 0x0b, 0x0c, 0x0d, 0x0e, 0x0f }, + + { 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07, + 0x08, 0x09, 0x0a, 0x0b, 0x0c, 0x0d, 0x0e, 0x0f, + 0x10, 0x11, 0x12, 0x13, 0x14, 0x15, 0x16, 0x17, + 0x18, 0x19, 0x1a, 0x1b, 0x1c, 0x1d, 0x1e, 0x1f, + 0x20, 0x21 }, + + { 0xbe, 0xcb, 0xb3, 0xbc, 0xcd, 0xb5, 0x18, 0xa3, + 0x06, 0x77, 0xd5, 0x48, 0x1f, 0xb6, 0xb4, 0xd8 }, +}, + + + +}; + unsigned char T[16]; + unsigned long taglen; + int err, x, idx; + + /* AES can be under rijndael or aes... try to find it */ + if ((idx = find_cipher("aes")) == -1) { + if ((idx = find_cipher("rijndael")) == -1) { + return CRYPT_NOP; + } + } + + for (x = 0; x < (int)(sizeof(tests)/sizeof(tests[0])); x++) { + taglen = 16; + if ((err = xcbc_memory(idx, tests[x].K, 16, tests[x].M, tests[x].msglen, T, &taglen)) != CRYPT_OK) { + return err; + } + if (taglen != 16 || XMEMCMP(T, tests[x].T, 16)) { + return CRYPT_FAIL_TESTVECTOR; + } + } + + return CRYPT_OK; +#endif +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/mac/xcbc/xcbc_test.c,v $ */ +/* $Revision: 1.5 $ */ +/* $Date: 2006/11/21 23:02:42 $ */ + diff --git a/libtomcrypt/src/math/fp/ltc_ecc_fp_mulmod.c b/libtomcrypt/src/math/fp/ltc_ecc_fp_mulmod.c new file mode 100644 index 0000000..d3c02c3 --- /dev/null +++ b/libtomcrypt/src/math/fp/ltc_ecc_fp_mulmod.c @@ -0,0 +1,1314 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file ltc_ecc_fp_mulmod.c + ECC Crypto, Tom St Denis +*/ + +#if defined(MECC) && defined(MECC_FP) +#include <limits.h> + +/* number of entries in the cache */ +#ifndef FP_ENTRIES +#define FP_ENTRIES 16 +#endif + +/* number of bits in LUT */ +#ifndef FP_LUT +#define FP_LUT 8U +#endif + +#if (FP_LUT > 12) || (FP_LUT < 2) + #error FP_LUT must be between 2 and 12 inclusively +#endif + +/** Our FP cache */ +static struct { + ecc_point *g, /* cached COPY of base point */ + *LUT[1U<<FP_LUT]; /* fixed point lookup */ + void *mu; /* copy of the montgomery constant */ + int lru_count; /* amount of times this entry has been used */ +} fp_cache[FP_ENTRIES]; + +LTC_MUTEX_GLOBAL(ltc_ecc_fp_lock) + +/* simple table to help direct the generation of the LUT */ +static const struct { + int ham, terma, termb; +} lut_orders[] = { + { 0, 0, 0 }, { 1, 0, 0 }, { 1, 0, 0 }, { 2, 1, 2 }, { 1, 0, 0 }, { 2, 1, 4 }, { 2, 2, 4 }, { 3, 3, 4 }, + { 1, 0, 0 }, { 2, 1, 8 }, { 2, 2, 8 }, { 3, 3, 8 }, { 2, 4, 8 }, { 3, 5, 8 }, { 3, 6, 8 }, { 4, 7, 8 }, + { 1, 0, 0 }, { 2, 1, 16 }, { 2, 2, 16 }, { 3, 3, 16 }, { 2, 4, 16 }, { 3, 5, 16 }, { 3, 6, 16 }, { 4, 7, 16 }, + { 2, 8, 16 }, { 3, 9, 16 }, { 3, 10, 16 }, { 4, 11, 16 }, { 3, 12, 16 }, { 4, 13, 16 }, { 4, 14, 16 }, { 5, 15, 16 }, + { 1, 0, 0 }, { 2, 1, 32 }, { 2, 2, 32 }, { 3, 3, 32 }, { 2, 4, 32 }, { 3, 5, 32 }, { 3, 6, 32 }, { 4, 7, 32 }, + { 2, 8, 32 }, { 3, 9, 32 }, { 3, 10, 32 }, { 4, 11, 32 }, { 3, 12, 32 }, { 4, 13, 32 }, { 4, 14, 32 }, { 5, 15, 32 }, + { 2, 16, 32 }, { 3, 17, 32 }, { 3, 18, 32 }, { 4, 19, 32 }, { 3, 20, 32 }, { 4, 21, 32 }, { 4, 22, 32 }, { 5, 23, 32 }, + { 3, 24, 32 }, { 4, 25, 32 }, { 4, 26, 32 }, { 5, 27, 32 }, { 4, 28, 32 }, { 5, 29, 32 }, { 5, 30, 32 }, { 6, 31, 32 }, +#if FP_LUT > 6 + { 1, 0, 0 }, { 2, 1, 64 }, { 2, 2, 64 }, { 3, 3, 64 }, { 2, 4, 64 }, { 3, 5, 64 }, { 3, 6, 64 }, { 4, 7, 64 }, + { 2, 8, 64 }, { 3, 9, 64 }, { 3, 10, 64 }, { 4, 11, 64 }, { 3, 12, 64 }, { 4, 13, 64 }, { 4, 14, 64 }, { 5, 15, 64 }, + { 2, 16, 64 }, { 3, 17, 64 }, { 3, 18, 64 }, { 4, 19, 64 }, { 3, 20, 64 }, { 4, 21, 64 }, { 4, 22, 64 }, { 5, 23, 64 }, + { 3, 24, 64 }, { 4, 25, 64 }, { 4, 26, 64 }, { 5, 27, 64 }, { 4, 28, 64 }, { 5, 29, 64 }, { 5, 30, 64 }, { 6, 31, 64 }, + { 2, 32, 64 }, { 3, 33, 64 }, { 3, 34, 64 }, { 4, 35, 64 }, { 3, 36, 64 }, { 4, 37, 64 }, { 4, 38, 64 }, { 5, 39, 64 }, + { 3, 40, 64 }, { 4, 41, 64 }, { 4, 42, 64 }, { 5, 43, 64 }, { 4, 44, 64 }, { 5, 45, 64 }, { 5, 46, 64 }, { 6, 47, 64 }, + { 3, 48, 64 }, { 4, 49, 64 }, { 4, 50, 64 }, { 5, 51, 64 }, { 4, 52, 64 }, { 5, 53, 64 }, { 5, 54, 64 }, { 6, 55, 64 }, + { 4, 56, 64 }, { 5, 57, 64 }, { 5, 58, 64 }, { 6, 59, 64 }, { 5, 60, 64 }, { 6, 61, 64 }, { 6, 62, 64 }, { 7, 63, 64 }, +#if FP_LUT > 7 + { 1, 0, 0 }, { 2, 1, 128 }, { 2, 2, 128 }, { 3, 3, 128 }, { 2, 4, 128 }, { 3, 5, 128 }, { 3, 6, 128 }, { 4, 7, 128 }, + { 2, 8, 128 }, { 3, 9, 128 }, { 3, 10, 128 }, { 4, 11, 128 }, { 3, 12, 128 }, { 4, 13, 128 }, { 4, 14, 128 }, { 5, 15, 128 }, + { 2, 16, 128 }, { 3, 17, 128 }, { 3, 18, 128 }, { 4, 19, 128 }, { 3, 20, 128 }, { 4, 21, 128 }, { 4, 22, 128 }, { 5, 23, 128 }, + { 3, 24, 128 }, { 4, 25, 128 }, { 4, 26, 128 }, { 5, 27, 128 }, { 4, 28, 128 }, { 5, 29, 128 }, { 5, 30, 128 }, { 6, 31, 128 }, + { 2, 32, 128 }, { 3, 33, 128 }, { 3, 34, 128 }, { 4, 35, 128 }, { 3, 36, 128 }, { 4, 37, 128 }, { 4, 38, 128 }, { 5, 39, 128 }, + { 3, 40, 128 }, { 4, 41, 128 }, { 4, 42, 128 }, { 5, 43, 128 }, { 4, 44, 128 }, { 5, 45, 128 }, { 5, 46, 128 }, { 6, 47, 128 }, + { 3, 48, 128 }, { 4, 49, 128 }, { 4, 50, 128 }, { 5, 51, 128 }, { 4, 52, 128 }, { 5, 53, 128 }, { 5, 54, 128 }, { 6, 55, 128 }, + { 4, 56, 128 }, { 5, 57, 128 }, { 5, 58, 128 }, { 6, 59, 128 }, { 5, 60, 128 }, { 6, 61, 128 }, { 6, 62, 128 }, { 7, 63, 128 }, + { 2, 64, 128 }, { 3, 65, 128 }, { 3, 66, 128 }, { 4, 67, 128 }, { 3, 68, 128 }, { 4, 69, 128 }, { 4, 70, 128 }, { 5, 71, 128 }, + { 3, 72, 128 }, { 4, 73, 128 }, { 4, 74, 128 }, { 5, 75, 128 }, { 4, 76, 128 }, { 5, 77, 128 }, { 5, 78, 128 }, { 6, 79, 128 }, + { 3, 80, 128 }, { 4, 81, 128 }, { 4, 82, 128 }, { 5, 83, 128 }, { 4, 84, 128 }, { 5, 85, 128 }, { 5, 86, 128 }, { 6, 87, 128 }, + { 4, 88, 128 }, { 5, 89, 128 }, { 5, 90, 128 }, { 6, 91, 128 }, { 5, 92, 128 }, { 6, 93, 128 }, { 6, 94, 128 }, { 7, 95, 128 }, + { 3, 96, 128 }, { 4, 97, 128 }, { 4, 98, 128 }, { 5, 99, 128 }, { 4, 100, 128 }, { 5, 101, 128 }, { 5, 102, 128 }, { 6, 103, 128 }, + { 4, 104, 128 }, { 5, 105, 128 }, { 5, 106, 128 }, { 6, 107, 128 }, { 5, 108, 128 }, { 6, 109, 128 }, { 6, 110, 128 }, { 7, 111, 128 }, + { 4, 112, 128 }, { 5, 113, 128 }, { 5, 114, 128 }, { 6, 115, 128 }, { 5, 116, 128 }, { 6, 117, 128 }, { 6, 118, 128 }, { 7, 119, 128 }, + { 5, 120, 128 }, { 6, 121, 128 }, { 6, 122, 128 }, { 7, 123, 128 }, { 6, 124, 128 }, { 7, 125, 128 }, { 7, 126, 128 }, { 8, 127, 128 }, +#if FP_LUT > 8 + { 1, 0, 0 }, { 2, 1, 256 }, { 2, 2, 256 }, { 3, 3, 256 }, { 2, 4, 256 }, { 3, 5, 256 }, { 3, 6, 256 }, { 4, 7, 256 }, + { 2, 8, 256 }, { 3, 9, 256 }, { 3, 10, 256 }, { 4, 11, 256 }, { 3, 12, 256 }, { 4, 13, 256 }, { 4, 14, 256 }, { 5, 15, 256 }, + { 2, 16, 256 }, { 3, 17, 256 }, { 3, 18, 256 }, { 4, 19, 256 }, { 3, 20, 256 }, { 4, 21, 256 }, { 4, 22, 256 }, { 5, 23, 256 }, + { 3, 24, 256 }, { 4, 25, 256 }, { 4, 26, 256 }, { 5, 27, 256 }, { 4, 28, 256 }, { 5, 29, 256 }, { 5, 30, 256 }, { 6, 31, 256 }, + { 2, 32, 256 }, { 3, 33, 256 }, { 3, 34, 256 }, { 4, 35, 256 }, { 3, 36, 256 }, { 4, 37, 256 }, { 4, 38, 256 }, { 5, 39, 256 }, + { 3, 40, 256 }, { 4, 41, 256 }, { 4, 42, 256 }, { 5, 43, 256 }, { 4, 44, 256 }, { 5, 45, 256 }, { 5, 46, 256 }, { 6, 47, 256 }, + { 3, 48, 256 }, { 4, 49, 256 }, { 4, 50, 256 }, { 5, 51, 256 }, { 4, 52, 256 }, { 5, 53, 256 }, { 5, 54, 256 }, { 6, 55, 256 }, + { 4, 56, 256 }, { 5, 57, 256 }, { 5, 58, 256 }, { 6, 59, 256 }, { 5, 60, 256 }, { 6, 61, 256 }, { 6, 62, 256 }, { 7, 63, 256 }, + { 2, 64, 256 }, { 3, 65, 256 }, { 3, 66, 256 }, { 4, 67, 256 }, { 3, 68, 256 }, { 4, 69, 256 }, { 4, 70, 256 }, { 5, 71, 256 }, + { 3, 72, 256 }, { 4, 73, 256 }, { 4, 74, 256 }, { 5, 75, 256 }, { 4, 76, 256 }, { 5, 77, 256 }, { 5, 78, 256 }, { 6, 79, 256 }, + { 3, 80, 256 }, { 4, 81, 256 }, { 4, 82, 256 }, { 5, 83, 256 }, { 4, 84, 256 }, { 5, 85, 256 }, { 5, 86, 256 }, { 6, 87, 256 }, + { 4, 88, 256 }, { 5, 89, 256 }, { 5, 90, 256 }, { 6, 91, 256 }, { 5, 92, 256 }, { 6, 93, 256 }, { 6, 94, 256 }, { 7, 95, 256 }, + { 3, 96, 256 }, { 4, 97, 256 }, { 4, 98, 256 }, { 5, 99, 256 }, { 4, 100, 256 }, { 5, 101, 256 }, { 5, 102, 256 }, { 6, 103, 256 }, + { 4, 104, 256 }, { 5, 105, 256 }, { 5, 106, 256 }, { 6, 107, 256 }, { 5, 108, 256 }, { 6, 109, 256 }, { 6, 110, 256 }, { 7, 111, 256 }, + { 4, 112, 256 }, { 5, 113, 256 }, { 5, 114, 256 }, { 6, 115, 256 }, { 5, 116, 256 }, { 6, 117, 256 }, { 6, 118, 256 }, { 7, 119, 256 }, + { 5, 120, 256 }, { 6, 121, 256 }, { 6, 122, 256 }, { 7, 123, 256 }, { 6, 124, 256 }, { 7, 125, 256 }, { 7, 126, 256 }, { 8, 127, 256 }, + { 2, 128, 256 }, { 3, 129, 256 }, { 3, 130, 256 }, { 4, 131, 256 }, { 3, 132, 256 }, { 4, 133, 256 }, { 4, 134, 256 }, { 5, 135, 256 }, + { 3, 136, 256 }, { 4, 137, 256 }, { 4, 138, 256 }, { 5, 139, 256 }, { 4, 140, 256 }, { 5, 141, 256 }, { 5, 142, 256 }, { 6, 143, 256 }, + { 3, 144, 256 }, { 4, 145, 256 }, { 4, 146, 256 }, { 5, 147, 256 }, { 4, 148, 256 }, { 5, 149, 256 }, { 5, 150, 256 }, { 6, 151, 256 }, + { 4, 152, 256 }, { 5, 153, 256 }, { 5, 154, 256 }, { 6, 155, 256 }, { 5, 156, 256 }, { 6, 157, 256 }, { 6, 158, 256 }, { 7, 159, 256 }, + { 3, 160, 256 }, { 4, 161, 256 }, { 4, 162, 256 }, { 5, 163, 256 }, { 4, 164, 256 }, { 5, 165, 256 }, { 5, 166, 256 }, { 6, 167, 256 }, + { 4, 168, 256 }, { 5, 169, 256 }, { 5, 170, 256 }, { 6, 171, 256 }, { 5, 172, 256 }, { 6, 173, 256 }, { 6, 174, 256 }, { 7, 175, 256 }, + { 4, 176, 256 }, { 5, 177, 256 }, { 5, 178, 256 }, { 6, 179, 256 }, { 5, 180, 256 }, { 6, 181, 256 }, { 6, 182, 256 }, { 7, 183, 256 }, + { 5, 184, 256 }, { 6, 185, 256 }, { 6, 186, 256 }, { 7, 187, 256 }, { 6, 188, 256 }, { 7, 189, 256 }, { 7, 190, 256 }, { 8, 191, 256 }, + { 3, 192, 256 }, { 4, 193, 256 }, { 4, 194, 256 }, { 5, 195, 256 }, { 4, 196, 256 }, { 5, 197, 256 }, { 5, 198, 256 }, { 6, 199, 256 }, + { 4, 200, 256 }, { 5, 201, 256 }, { 5, 202, 256 }, { 6, 203, 256 }, { 5, 204, 256 }, { 6, 205, 256 }, { 6, 206, 256 }, { 7, 207, 256 }, + { 4, 208, 256 }, { 5, 209, 256 }, { 5, 210, 256 }, { 6, 211, 256 }, { 5, 212, 256 }, { 6, 213, 256 }, { 6, 214, 256 }, { 7, 215, 256 }, + { 5, 216, 256 }, { 6, 217, 256 }, { 6, 218, 256 }, { 7, 219, 256 }, { 6, 220, 256 }, { 7, 221, 256 }, { 7, 222, 256 }, { 8, 223, 256 }, + { 4, 224, 256 }, { 5, 225, 256 }, { 5, 226, 256 }, { 6, 227, 256 }, { 5, 228, 256 }, { 6, 229, 256 }, { 6, 230, 256 }, { 7, 231, 256 }, + { 5, 232, 256 }, { 6, 233, 256 }, { 6, 234, 256 }, { 7, 235, 256 }, { 6, 236, 256 }, { 7, 237, 256 }, { 7, 238, 256 }, { 8, 239, 256 }, + { 5, 240, 256 }, { 6, 241, 256 }, { 6, 242, 256 }, { 7, 243, 256 }, { 6, 244, 256 }, { 7, 245, 256 }, { 7, 246, 256 }, { 8, 247, 256 }, + { 6, 248, 256 }, { 7, 249, 256 }, { 7, 250, 256 }, { 8, 251, 256 }, { 7, 252, 256 }, { 8, 253, 256 }, { 8, 254, 256 }, { 9, 255, 256 }, +#if FP_LUT > 9 + { 1, 0, 0 }, { 2, 1, 512 }, { 2, 2, 512 }, { 3, 3, 512 }, { 2, 4, 512 }, { 3, 5, 512 }, { 3, 6, 512 }, { 4, 7, 512 }, + { 2, 8, 512 }, { 3, 9, 512 }, { 3, 10, 512 }, { 4, 11, 512 }, { 3, 12, 512 }, { 4, 13, 512 }, { 4, 14, 512 }, { 5, 15, 512 }, + { 2, 16, 512 }, { 3, 17, 512 }, { 3, 18, 512 }, { 4, 19, 512 }, { 3, 20, 512 }, { 4, 21, 512 }, { 4, 22, 512 }, { 5, 23, 512 }, + { 3, 24, 512 }, { 4, 25, 512 }, { 4, 26, 512 }, { 5, 27, 512 }, { 4, 28, 512 }, { 5, 29, 512 }, { 5, 30, 512 }, { 6, 31, 512 }, + { 2, 32, 512 }, { 3, 33, 512 }, { 3, 34, 512 }, { 4, 35, 512 }, { 3, 36, 512 }, { 4, 37, 512 }, { 4, 38, 512 }, { 5, 39, 512 }, + { 3, 40, 512 }, { 4, 41, 512 }, { 4, 42, 512 }, { 5, 43, 512 }, { 4, 44, 512 }, { 5, 45, 512 }, { 5, 46, 512 }, { 6, 47, 512 }, + { 3, 48, 512 }, { 4, 49, 512 }, { 4, 50, 512 }, { 5, 51, 512 }, { 4, 52, 512 }, { 5, 53, 512 }, { 5, 54, 512 }, { 6, 55, 512 }, + { 4, 56, 512 }, { 5, 57, 512 }, { 5, 58, 512 }, { 6, 59, 512 }, { 5, 60, 512 }, { 6, 61, 512 }, { 6, 62, 512 }, { 7, 63, 512 }, + { 2, 64, 512 }, { 3, 65, 512 }, { 3, 66, 512 }, { 4, 67, 512 }, { 3, 68, 512 }, { 4, 69, 512 }, { 4, 70, 512 }, { 5, 71, 512 }, + { 3, 72, 512 }, { 4, 73, 512 }, { 4, 74, 512 }, { 5, 75, 512 }, { 4, 76, 512 }, { 5, 77, 512 }, { 5, 78, 512 }, { 6, 79, 512 }, + { 3, 80, 512 }, { 4, 81, 512 }, { 4, 82, 512 }, { 5, 83, 512 }, { 4, 84, 512 }, { 5, 85, 512 }, { 5, 86, 512 }, { 6, 87, 512 }, + { 4, 88, 512 }, { 5, 89, 512 }, { 5, 90, 512 }, { 6, 91, 512 }, { 5, 92, 512 }, { 6, 93, 512 }, { 6, 94, 512 }, { 7, 95, 512 }, + { 3, 96, 512 }, { 4, 97, 512 }, { 4, 98, 512 }, { 5, 99, 512 }, { 4, 100, 512 }, { 5, 101, 512 }, { 5, 102, 512 }, { 6, 103, 512 }, + { 4, 104, 512 }, { 5, 105, 512 }, { 5, 106, 512 }, { 6, 107, 512 }, { 5, 108, 512 }, { 6, 109, 512 }, { 6, 110, 512 }, { 7, 111, 512 }, + { 4, 112, 512 }, { 5, 113, 512 }, { 5, 114, 512 }, { 6, 115, 512 }, { 5, 116, 512 }, { 6, 117, 512 }, { 6, 118, 512 }, { 7, 119, 512 }, + { 5, 120, 512 }, { 6, 121, 512 }, { 6, 122, 512 }, { 7, 123, 512 }, { 6, 124, 512 }, { 7, 125, 512 }, { 7, 126, 512 }, { 8, 127, 512 }, + { 2, 128, 512 }, { 3, 129, 512 }, { 3, 130, 512 }, { 4, 131, 512 }, { 3, 132, 512 }, { 4, 133, 512 }, { 4, 134, 512 }, { 5, 135, 512 }, + { 3, 136, 512 }, { 4, 137, 512 }, { 4, 138, 512 }, { 5, 139, 512 }, { 4, 140, 512 }, { 5, 141, 512 }, { 5, 142, 512 }, { 6, 143, 512 }, + { 3, 144, 512 }, { 4, 145, 512 }, { 4, 146, 512 }, { 5, 147, 512 }, { 4, 148, 512 }, { 5, 149, 512 }, { 5, 150, 512 }, { 6, 151, 512 }, + { 4, 152, 512 }, { 5, 153, 512 }, { 5, 154, 512 }, { 6, 155, 512 }, { 5, 156, 512 }, { 6, 157, 512 }, { 6, 158, 512 }, { 7, 159, 512 }, + { 3, 160, 512 }, { 4, 161, 512 }, { 4, 162, 512 }, { 5, 163, 512 }, { 4, 164, 512 }, { 5, 165, 512 }, { 5, 166, 512 }, { 6, 167, 512 }, + { 4, 168, 512 }, { 5, 169, 512 }, { 5, 170, 512 }, { 6, 171, 512 }, { 5, 172, 512 }, { 6, 173, 512 }, { 6, 174, 512 }, { 7, 175, 512 }, + { 4, 176, 512 }, { 5, 177, 512 }, { 5, 178, 512 }, { 6, 179, 512 }, { 5, 180, 512 }, { 6, 181, 512 }, { 6, 182, 512 }, { 7, 183, 512 }, + { 5, 184, 512 }, { 6, 185, 512 }, { 6, 186, 512 }, { 7, 187, 512 }, { 6, 188, 512 }, { 7, 189, 512 }, { 7, 190, 512 }, { 8, 191, 512 }, + { 3, 192, 512 }, { 4, 193, 512 }, { 4, 194, 512 }, { 5, 195, 512 }, { 4, 196, 512 }, { 5, 197, 512 }, { 5, 198, 512 }, { 6, 199, 512 }, + { 4, 200, 512 }, { 5, 201, 512 }, { 5, 202, 512 }, { 6, 203, 512 }, { 5, 204, 512 }, { 6, 205, 512 }, { 6, 206, 512 }, { 7, 207, 512 }, + { 4, 208, 512 }, { 5, 209, 512 }, { 5, 210, 512 }, { 6, 211, 512 }, { 5, 212, 512 }, { 6, 213, 512 }, { 6, 214, 512 }, { 7, 215, 512 }, + { 5, 216, 512 }, { 6, 217, 512 }, { 6, 218, 512 }, { 7, 219, 512 }, { 6, 220, 512 }, { 7, 221, 512 }, { 7, 222, 512 }, { 8, 223, 512 }, + { 4, 224, 512 }, { 5, 225, 512 }, { 5, 226, 512 }, { 6, 227, 512 }, { 5, 228, 512 }, { 6, 229, 512 }, { 6, 230, 512 }, { 7, 231, 512 }, + { 5, 232, 512 }, { 6, 233, 512 }, { 6, 234, 512 }, { 7, 235, 512 }, { 6, 236, 512 }, { 7, 237, 512 }, { 7, 238, 512 }, { 8, 239, 512 }, + { 5, 240, 512 }, { 6, 241, 512 }, { 6, 242, 512 }, { 7, 243, 512 }, { 6, 244, 512 }, { 7, 245, 512 }, { 7, 246, 512 }, { 8, 247, 512 }, + { 6, 248, 512 }, { 7, 249, 512 }, { 7, 250, 512 }, { 8, 251, 512 }, { 7, 252, 512 }, { 8, 253, 512 }, { 8, 254, 512 }, { 9, 255, 512 }, + { 2, 256, 512 }, { 3, 257, 512 }, { 3, 258, 512 }, { 4, 259, 512 }, { 3, 260, 512 }, { 4, 261, 512 }, { 4, 262, 512 }, { 5, 263, 512 }, + { 3, 264, 512 }, { 4, 265, 512 }, { 4, 266, 512 }, { 5, 267, 512 }, { 4, 268, 512 }, { 5, 269, 512 }, { 5, 270, 512 }, { 6, 271, 512 }, + { 3, 272, 512 }, { 4, 273, 512 }, { 4, 274, 512 }, { 5, 275, 512 }, { 4, 276, 512 }, { 5, 277, 512 }, { 5, 278, 512 }, { 6, 279, 512 }, + { 4, 280, 512 }, { 5, 281, 512 }, { 5, 282, 512 }, { 6, 283, 512 }, { 5, 284, 512 }, { 6, 285, 512 }, { 6, 286, 512 }, { 7, 287, 512 }, + { 3, 288, 512 }, { 4, 289, 512 }, { 4, 290, 512 }, { 5, 291, 512 }, { 4, 292, 512 }, { 5, 293, 512 }, { 5, 294, 512 }, { 6, 295, 512 }, + { 4, 296, 512 }, { 5, 297, 512 }, { 5, 298, 512 }, { 6, 299, 512 }, { 5, 300, 512 }, { 6, 301, 512 }, { 6, 302, 512 }, { 7, 303, 512 }, + { 4, 304, 512 }, { 5, 305, 512 }, { 5, 306, 512 }, { 6, 307, 512 }, { 5, 308, 512 }, { 6, 309, 512 }, { 6, 310, 512 }, { 7, 311, 512 }, + { 5, 312, 512 }, { 6, 313, 512 }, { 6, 314, 512 }, { 7, 315, 512 }, { 6, 316, 512 }, { 7, 317, 512 }, { 7, 318, 512 }, { 8, 319, 512 }, + { 3, 320, 512 }, { 4, 321, 512 }, { 4, 322, 512 }, { 5, 323, 512 }, { 4, 324, 512 }, { 5, 325, 512 }, { 5, 326, 512 }, { 6, 327, 512 }, + { 4, 328, 512 }, { 5, 329, 512 }, { 5, 330, 512 }, { 6, 331, 512 }, { 5, 332, 512 }, { 6, 333, 512 }, { 6, 334, 512 }, { 7, 335, 512 }, + { 4, 336, 512 }, { 5, 337, 512 }, { 5, 338, 512 }, { 6, 339, 512 }, { 5, 340, 512 }, { 6, 341, 512 }, { 6, 342, 512 }, { 7, 343, 512 }, + { 5, 344, 512 }, { 6, 345, 512 }, { 6, 346, 512 }, { 7, 347, 512 }, { 6, 348, 512 }, { 7, 349, 512 }, { 7, 350, 512 }, { 8, 351, 512 }, + { 4, 352, 512 }, { 5, 353, 512 }, { 5, 354, 512 }, { 6, 355, 512 }, { 5, 356, 512 }, { 6, 357, 512 }, { 6, 358, 512 }, { 7, 359, 512 }, + { 5, 360, 512 }, { 6, 361, 512 }, { 6, 362, 512 }, { 7, 363, 512 }, { 6, 364, 512 }, { 7, 365, 512 }, { 7, 366, 512 }, { 8, 367, 512 }, + { 5, 368, 512 }, { 6, 369, 512 }, { 6, 370, 512 }, { 7, 371, 512 }, { 6, 372, 512 }, { 7, 373, 512 }, { 7, 374, 512 }, { 8, 375, 512 }, + { 6, 376, 512 }, { 7, 377, 512 }, { 7, 378, 512 }, { 8, 379, 512 }, { 7, 380, 512 }, { 8, 381, 512 }, { 8, 382, 512 }, { 9, 383, 512 }, + { 3, 384, 512 }, { 4, 385, 512 }, { 4, 386, 512 }, { 5, 387, 512 }, { 4, 388, 512 }, { 5, 389, 512 }, { 5, 390, 512 }, { 6, 391, 512 }, + { 4, 392, 512 }, { 5, 393, 512 }, { 5, 394, 512 }, { 6, 395, 512 }, { 5, 396, 512 }, { 6, 397, 512 }, { 6, 398, 512 }, { 7, 399, 512 }, + { 4, 400, 512 }, { 5, 401, 512 }, { 5, 402, 512 }, { 6, 403, 512 }, { 5, 404, 512 }, { 6, 405, 512 }, { 6, 406, 512 }, { 7, 407, 512 }, + { 5, 408, 512 }, { 6, 409, 512 }, { 6, 410, 512 }, { 7, 411, 512 }, { 6, 412, 512 }, { 7, 413, 512 }, { 7, 414, 512 }, { 8, 415, 512 }, + { 4, 416, 512 }, { 5, 417, 512 }, { 5, 418, 512 }, { 6, 419, 512 }, { 5, 420, 512 }, { 6, 421, 512 }, { 6, 422, 512 }, { 7, 423, 512 }, + { 5, 424, 512 }, { 6, 425, 512 }, { 6, 426, 512 }, { 7, 427, 512 }, { 6, 428, 512 }, { 7, 429, 512 }, { 7, 430, 512 }, { 8, 431, 512 }, + { 5, 432, 512 }, { 6, 433, 512 }, { 6, 434, 512 }, { 7, 435, 512 }, { 6, 436, 512 }, { 7, 437, 512 }, { 7, 438, 512 }, { 8, 439, 512 }, + { 6, 440, 512 }, { 7, 441, 512 }, { 7, 442, 512 }, { 8, 443, 512 }, { 7, 444, 512 }, { 8, 445, 512 }, { 8, 446, 512 }, { 9, 447, 512 }, + { 4, 448, 512 }, { 5, 449, 512 }, { 5, 450, 512 }, { 6, 451, 512 }, { 5, 452, 512 }, { 6, 453, 512 }, { 6, 454, 512 }, { 7, 455, 512 }, + { 5, 456, 512 }, { 6, 457, 512 }, { 6, 458, 512 }, { 7, 459, 512 }, { 6, 460, 512 }, { 7, 461, 512 }, { 7, 462, 512 }, { 8, 463, 512 }, + { 5, 464, 512 }, { 6, 465, 512 }, { 6, 466, 512 }, { 7, 467, 512 }, { 6, 468, 512 }, { 7, 469, 512 }, { 7, 470, 512 }, { 8, 471, 512 }, + { 6, 472, 512 }, { 7, 473, 512 }, { 7, 474, 512 }, { 8, 475, 512 }, { 7, 476, 512 }, { 8, 477, 512 }, { 8, 478, 512 }, { 9, 479, 512 }, + { 5, 480, 512 }, { 6, 481, 512 }, { 6, 482, 512 }, { 7, 483, 512 }, { 6, 484, 512 }, { 7, 485, 512 }, { 7, 486, 512 }, { 8, 487, 512 }, + { 6, 488, 512 }, { 7, 489, 512 }, { 7, 490, 512 }, { 8, 491, 512 }, { 7, 492, 512 }, { 8, 493, 512 }, { 8, 494, 512 }, { 9, 495, 512 }, + { 6, 496, 512 }, { 7, 497, 512 }, { 7, 498, 512 }, { 8, 499, 512 }, { 7, 500, 512 }, { 8, 501, 512 }, { 8, 502, 512 }, { 9, 503, 512 }, + { 7, 504, 512 }, { 8, 505, 512 }, { 8, 506, 512 }, { 9, 507, 512 }, { 8, 508, 512 }, { 9, 509, 512 }, { 9, 510, 512 }, { 10, 511, 512 }, +#if FP_LUT > 10 + { 1, 0, 0 }, { 2, 1, 1024 }, { 2, 2, 1024 }, { 3, 3, 1024 }, { 2, 4, 1024 }, { 3, 5, 1024 }, { 3, 6, 1024 }, { 4, 7, 1024 }, + { 2, 8, 1024 }, { 3, 9, 1024 }, { 3, 10, 1024 }, { 4, 11, 1024 }, { 3, 12, 1024 }, { 4, 13, 1024 }, { 4, 14, 1024 }, { 5, 15, 1024 }, + { 2, 16, 1024 }, { 3, 17, 1024 }, { 3, 18, 1024 }, { 4, 19, 1024 }, { 3, 20, 1024 }, { 4, 21, 1024 }, { 4, 22, 1024 }, { 5, 23, 1024 }, + { 3, 24, 1024 }, { 4, 25, 1024 }, { 4, 26, 1024 }, { 5, 27, 1024 }, { 4, 28, 1024 }, { 5, 29, 1024 }, { 5, 30, 1024 }, { 6, 31, 1024 }, + { 2, 32, 1024 }, { 3, 33, 1024 }, { 3, 34, 1024 }, { 4, 35, 1024 }, { 3, 36, 1024 }, { 4, 37, 1024 }, { 4, 38, 1024 }, { 5, 39, 1024 }, + { 3, 40, 1024 }, { 4, 41, 1024 }, { 4, 42, 1024 }, { 5, 43, 1024 }, { 4, 44, 1024 }, { 5, 45, 1024 }, { 5, 46, 1024 }, { 6, 47, 1024 }, + { 3, 48, 1024 }, { 4, 49, 1024 }, { 4, 50, 1024 }, { 5, 51, 1024 }, { 4, 52, 1024 }, { 5, 53, 1024 }, { 5, 54, 1024 }, { 6, 55, 1024 }, + { 4, 56, 1024 }, { 5, 57, 1024 }, { 5, 58, 1024 }, { 6, 59, 1024 }, { 5, 60, 1024 }, { 6, 61, 1024 }, { 6, 62, 1024 }, { 7, 63, 1024 }, + { 2, 64, 1024 }, { 3, 65, 1024 }, { 3, 66, 1024 }, { 4, 67, 1024 }, { 3, 68, 1024 }, { 4, 69, 1024 }, { 4, 70, 1024 }, { 5, 71, 1024 }, + { 3, 72, 1024 }, { 4, 73, 1024 }, { 4, 74, 1024 }, { 5, 75, 1024 }, { 4, 76, 1024 }, { 5, 77, 1024 }, { 5, 78, 1024 }, { 6, 79, 1024 }, + { 3, 80, 1024 }, { 4, 81, 1024 }, { 4, 82, 1024 }, { 5, 83, 1024 }, { 4, 84, 1024 }, { 5, 85, 1024 }, { 5, 86, 1024 }, { 6, 87, 1024 }, + { 4, 88, 1024 }, { 5, 89, 1024 }, { 5, 90, 1024 }, { 6, 91, 1024 }, { 5, 92, 1024 }, { 6, 93, 1024 }, { 6, 94, 1024 }, { 7, 95, 1024 }, + { 3, 96, 1024 }, { 4, 97, 1024 }, { 4, 98, 1024 }, { 5, 99, 1024 }, { 4, 100, 1024 }, { 5, 101, 1024 }, { 5, 102, 1024 }, { 6, 103, 1024 }, + { 4, 104, 1024 }, { 5, 105, 1024 }, { 5, 106, 1024 }, { 6, 107, 1024 }, { 5, 108, 1024 }, { 6, 109, 1024 }, { 6, 110, 1024 }, { 7, 111, 1024 }, + { 4, 112, 1024 }, { 5, 113, 1024 }, { 5, 114, 1024 }, { 6, 115, 1024 }, { 5, 116, 1024 }, { 6, 117, 1024 }, { 6, 118, 1024 }, { 7, 119, 1024 }, + { 5, 120, 1024 }, { 6, 121, 1024 }, { 6, 122, 1024 }, { 7, 123, 1024 }, { 6, 124, 1024 }, { 7, 125, 1024 }, { 7, 126, 1024 }, { 8, 127, 1024 }, + { 2, 128, 1024 }, { 3, 129, 1024 }, { 3, 130, 1024 }, { 4, 131, 1024 }, { 3, 132, 1024 }, { 4, 133, 1024 }, { 4, 134, 1024 }, { 5, 135, 1024 }, + { 3, 136, 1024 }, { 4, 137, 1024 }, { 4, 138, 1024 }, { 5, 139, 1024 }, { 4, 140, 1024 }, { 5, 141, 1024 }, { 5, 142, 1024 }, { 6, 143, 1024 }, + { 3, 144, 1024 }, { 4, 145, 1024 }, { 4, 146, 1024 }, { 5, 147, 1024 }, { 4, 148, 1024 }, { 5, 149, 1024 }, { 5, 150, 1024 }, { 6, 151, 1024 }, + { 4, 152, 1024 }, { 5, 153, 1024 }, { 5, 154, 1024 }, { 6, 155, 1024 }, { 5, 156, 1024 }, { 6, 157, 1024 }, { 6, 158, 1024 }, { 7, 159, 1024 }, + { 3, 160, 1024 }, { 4, 161, 1024 }, { 4, 162, 1024 }, { 5, 163, 1024 }, { 4, 164, 1024 }, { 5, 165, 1024 }, { 5, 166, 1024 }, { 6, 167, 1024 }, + { 4, 168, 1024 }, { 5, 169, 1024 }, { 5, 170, 1024 }, { 6, 171, 1024 }, { 5, 172, 1024 }, { 6, 173, 1024 }, { 6, 174, 1024 }, { 7, 175, 1024 }, + { 4, 176, 1024 }, { 5, 177, 1024 }, { 5, 178, 1024 }, { 6, 179, 1024 }, { 5, 180, 1024 }, { 6, 181, 1024 }, { 6, 182, 1024 }, { 7, 183, 1024 }, + { 5, 184, 1024 }, { 6, 185, 1024 }, { 6, 186, 1024 }, { 7, 187, 1024 }, { 6, 188, 1024 }, { 7, 189, 1024 }, { 7, 190, 1024 }, { 8, 191, 1024 }, + { 3, 192, 1024 }, { 4, 193, 1024 }, { 4, 194, 1024 }, { 5, 195, 1024 }, { 4, 196, 1024 }, { 5, 197, 1024 }, { 5, 198, 1024 }, { 6, 199, 1024 }, + { 4, 200, 1024 }, { 5, 201, 1024 }, { 5, 202, 1024 }, { 6, 203, 1024 }, { 5, 204, 1024 }, { 6, 205, 1024 }, { 6, 206, 1024 }, { 7, 207, 1024 }, + { 4, 208, 1024 }, { 5, 209, 1024 }, { 5, 210, 1024 }, { 6, 211, 1024 }, { 5, 212, 1024 }, { 6, 213, 1024 }, { 6, 214, 1024 }, { 7, 215, 1024 }, + { 5, 216, 1024 }, { 6, 217, 1024 }, { 6, 218, 1024 }, { 7, 219, 1024 }, { 6, 220, 1024 }, { 7, 221, 1024 }, { 7, 222, 1024 }, { 8, 223, 1024 }, + { 4, 224, 1024 }, { 5, 225, 1024 }, { 5, 226, 1024 }, { 6, 227, 1024 }, { 5, 228, 1024 }, { 6, 229, 1024 }, { 6, 230, 1024 }, { 7, 231, 1024 }, + { 5, 232, 1024 }, { 6, 233, 1024 }, { 6, 234, 1024 }, { 7, 235, 1024 }, { 6, 236, 1024 }, { 7, 237, 1024 }, { 7, 238, 1024 }, { 8, 239, 1024 }, + { 5, 240, 1024 }, { 6, 241, 1024 }, { 6, 242, 1024 }, { 7, 243, 1024 }, { 6, 244, 1024 }, { 7, 245, 1024 }, { 7, 246, 1024 }, { 8, 247, 1024 }, + { 6, 248, 1024 }, { 7, 249, 1024 }, { 7, 250, 1024 }, { 8, 251, 1024 }, { 7, 252, 1024 }, { 8, 253, 1024 }, { 8, 254, 1024 }, { 9, 255, 1024 }, + { 2, 256, 1024 }, { 3, 257, 1024 }, { 3, 258, 1024 }, { 4, 259, 1024 }, { 3, 260, 1024 }, { 4, 261, 1024 }, { 4, 262, 1024 }, { 5, 263, 1024 }, + { 3, 264, 1024 }, { 4, 265, 1024 }, { 4, 266, 1024 }, { 5, 267, 1024 }, { 4, 268, 1024 }, { 5, 269, 1024 }, { 5, 270, 1024 }, { 6, 271, 1024 }, + { 3, 272, 1024 }, { 4, 273, 1024 }, { 4, 274, 1024 }, { 5, 275, 1024 }, { 4, 276, 1024 }, { 5, 277, 1024 }, { 5, 278, 1024 }, { 6, 279, 1024 }, + { 4, 280, 1024 }, { 5, 281, 1024 }, { 5, 282, 1024 }, { 6, 283, 1024 }, { 5, 284, 1024 }, { 6, 285, 1024 }, { 6, 286, 1024 }, { 7, 287, 1024 }, + { 3, 288, 1024 }, { 4, 289, 1024 }, { 4, 290, 1024 }, { 5, 291, 1024 }, { 4, 292, 1024 }, { 5, 293, 1024 }, { 5, 294, 1024 }, { 6, 295, 1024 }, + { 4, 296, 1024 }, { 5, 297, 1024 }, { 5, 298, 1024 }, { 6, 299, 1024 }, { 5, 300, 1024 }, { 6, 301, 1024 }, { 6, 302, 1024 }, { 7, 303, 1024 }, + { 4, 304, 1024 }, { 5, 305, 1024 }, { 5, 306, 1024 }, { 6, 307, 1024 }, { 5, 308, 1024 }, { 6, 309, 1024 }, { 6, 310, 1024 }, { 7, 311, 1024 }, + { 5, 312, 1024 }, { 6, 313, 1024 }, { 6, 314, 1024 }, { 7, 315, 1024 }, { 6, 316, 1024 }, { 7, 317, 1024 }, { 7, 318, 1024 }, { 8, 319, 1024 }, + { 3, 320, 1024 }, { 4, 321, 1024 }, { 4, 322, 1024 }, { 5, 323, 1024 }, { 4, 324, 1024 }, { 5, 325, 1024 }, { 5, 326, 1024 }, { 6, 327, 1024 }, + { 4, 328, 1024 }, { 5, 329, 1024 }, { 5, 330, 1024 }, { 6, 331, 1024 }, { 5, 332, 1024 }, { 6, 333, 1024 }, { 6, 334, 1024 }, { 7, 335, 1024 }, + { 4, 336, 1024 }, { 5, 337, 1024 }, { 5, 338, 1024 }, { 6, 339, 1024 }, { 5, 340, 1024 }, { 6, 341, 1024 }, { 6, 342, 1024 }, { 7, 343, 1024 }, + { 5, 344, 1024 }, { 6, 345, 1024 }, { 6, 346, 1024 }, { 7, 347, 1024 }, { 6, 348, 1024 }, { 7, 349, 1024 }, { 7, 350, 1024 }, { 8, 351, 1024 }, + { 4, 352, 1024 }, { 5, 353, 1024 }, { 5, 354, 1024 }, { 6, 355, 1024 }, { 5, 356, 1024 }, { 6, 357, 1024 }, { 6, 358, 1024 }, { 7, 359, 1024 }, + { 5, 360, 1024 }, { 6, 361, 1024 }, { 6, 362, 1024 }, { 7, 363, 1024 }, { 6, 364, 1024 }, { 7, 365, 1024 }, { 7, 366, 1024 }, { 8, 367, 1024 }, + { 5, 368, 1024 }, { 6, 369, 1024 }, { 6, 370, 1024 }, { 7, 371, 1024 }, { 6, 372, 1024 }, { 7, 373, 1024 }, { 7, 374, 1024 }, { 8, 375, 1024 }, + { 6, 376, 1024 }, { 7, 377, 1024 }, { 7, 378, 1024 }, { 8, 379, 1024 }, { 7, 380, 1024 }, { 8, 381, 1024 }, { 8, 382, 1024 }, { 9, 383, 1024 }, + { 3, 384, 1024 }, { 4, 385, 1024 }, { 4, 386, 1024 }, { 5, 387, 1024 }, { 4, 388, 1024 }, { 5, 389, 1024 }, { 5, 390, 1024 }, { 6, 391, 1024 }, + { 4, 392, 1024 }, { 5, 393, 1024 }, { 5, 394, 1024 }, { 6, 395, 1024 }, { 5, 396, 1024 }, { 6, 397, 1024 }, { 6, 398, 1024 }, { 7, 399, 1024 }, + { 4, 400, 1024 }, { 5, 401, 1024 }, { 5, 402, 1024 }, { 6, 403, 1024 }, { 5, 404, 1024 }, { 6, 405, 1024 }, { 6, 406, 1024 }, { 7, 407, 1024 }, + { 5, 408, 1024 }, { 6, 409, 1024 }, { 6, 410, 1024 }, { 7, 411, 1024 }, { 6, 412, 1024 }, { 7, 413, 1024 }, { 7, 414, 1024 }, { 8, 415, 1024 }, + { 4, 416, 1024 }, { 5, 417, 1024 }, { 5, 418, 1024 }, { 6, 419, 1024 }, { 5, 420, 1024 }, { 6, 421, 1024 }, { 6, 422, 1024 }, { 7, 423, 1024 }, + { 5, 424, 1024 }, { 6, 425, 1024 }, { 6, 426, 1024 }, { 7, 427, 1024 }, { 6, 428, 1024 }, { 7, 429, 1024 }, { 7, 430, 1024 }, { 8, 431, 1024 }, + { 5, 432, 1024 }, { 6, 433, 1024 }, { 6, 434, 1024 }, { 7, 435, 1024 }, { 6, 436, 1024 }, { 7, 437, 1024 }, { 7, 438, 1024 }, { 8, 439, 1024 }, + { 6, 440, 1024 }, { 7, 441, 1024 }, { 7, 442, 1024 }, { 8, 443, 1024 }, { 7, 444, 1024 }, { 8, 445, 1024 }, { 8, 446, 1024 }, { 9, 447, 1024 }, + { 4, 448, 1024 }, { 5, 449, 1024 }, { 5, 450, 1024 }, { 6, 451, 1024 }, { 5, 452, 1024 }, { 6, 453, 1024 }, { 6, 454, 1024 }, { 7, 455, 1024 }, + { 5, 456, 1024 }, { 6, 457, 1024 }, { 6, 458, 1024 }, { 7, 459, 1024 }, { 6, 460, 1024 }, { 7, 461, 1024 }, { 7, 462, 1024 }, { 8, 463, 1024 }, + { 5, 464, 1024 }, { 6, 465, 1024 }, { 6, 466, 1024 }, { 7, 467, 1024 }, { 6, 468, 1024 }, { 7, 469, 1024 }, { 7, 470, 1024 }, { 8, 471, 1024 }, + { 6, 472, 1024 }, { 7, 473, 1024 }, { 7, 474, 1024 }, { 8, 475, 1024 }, { 7, 476, 1024 }, { 8, 477, 1024 }, { 8, 478, 1024 }, { 9, 479, 1024 }, + { 5, 480, 1024 }, { 6, 481, 1024 }, { 6, 482, 1024 }, { 7, 483, 1024 }, { 6, 484, 1024 }, { 7, 485, 1024 }, { 7, 486, 1024 }, { 8, 487, 1024 }, + { 6, 488, 1024 }, { 7, 489, 1024 }, { 7, 490, 1024 }, { 8, 491, 1024 }, { 7, 492, 1024 }, { 8, 493, 1024 }, { 8, 494, 1024 }, { 9, 495, 1024 }, + { 6, 496, 1024 }, { 7, 497, 1024 }, { 7, 498, 1024 }, { 8, 499, 1024 }, { 7, 500, 1024 }, { 8, 501, 1024 }, { 8, 502, 1024 }, { 9, 503, 1024 }, + { 7, 504, 1024 }, { 8, 505, 1024 }, { 8, 506, 1024 }, { 9, 507, 1024 }, { 8, 508, 1024 }, { 9, 509, 1024 }, { 9, 510, 1024 }, { 10, 511, 1024 }, + { 2, 512, 1024 }, { 3, 513, 1024 }, { 3, 514, 1024 }, { 4, 515, 1024 }, { 3, 516, 1024 }, { 4, 517, 1024 }, { 4, 518, 1024 }, { 5, 519, 1024 }, + { 3, 520, 1024 }, { 4, 521, 1024 }, { 4, 522, 1024 }, { 5, 523, 1024 }, { 4, 524, 1024 }, { 5, 525, 1024 }, { 5, 526, 1024 }, { 6, 527, 1024 }, + { 3, 528, 1024 }, { 4, 529, 1024 }, { 4, 530, 1024 }, { 5, 531, 1024 }, { 4, 532, 1024 }, { 5, 533, 1024 }, { 5, 534, 1024 }, { 6, 535, 1024 }, + { 4, 536, 1024 }, { 5, 537, 1024 }, { 5, 538, 1024 }, { 6, 539, 1024 }, { 5, 540, 1024 }, { 6, 541, 1024 }, { 6, 542, 1024 }, { 7, 543, 1024 }, + { 3, 544, 1024 }, { 4, 545, 1024 }, { 4, 546, 1024 }, { 5, 547, 1024 }, { 4, 548, 1024 }, { 5, 549, 1024 }, { 5, 550, 1024 }, { 6, 551, 1024 }, + { 4, 552, 1024 }, { 5, 553, 1024 }, { 5, 554, 1024 }, { 6, 555, 1024 }, { 5, 556, 1024 }, { 6, 557, 1024 }, { 6, 558, 1024 }, { 7, 559, 1024 }, + { 4, 560, 1024 }, { 5, 561, 1024 }, { 5, 562, 1024 }, { 6, 563, 1024 }, { 5, 564, 1024 }, { 6, 565, 1024 }, { 6, 566, 1024 }, { 7, 567, 1024 }, + { 5, 568, 1024 }, { 6, 569, 1024 }, { 6, 570, 1024 }, { 7, 571, 1024 }, { 6, 572, 1024 }, { 7, 573, 1024 }, { 7, 574, 1024 }, { 8, 575, 1024 }, + { 3, 576, 1024 }, { 4, 577, 1024 }, { 4, 578, 1024 }, { 5, 579, 1024 }, { 4, 580, 1024 }, { 5, 581, 1024 }, { 5, 582, 1024 }, { 6, 583, 1024 }, + { 4, 584, 1024 }, { 5, 585, 1024 }, { 5, 586, 1024 }, { 6, 587, 1024 }, { 5, 588, 1024 }, { 6, 589, 1024 }, { 6, 590, 1024 }, { 7, 591, 1024 }, + { 4, 592, 1024 }, { 5, 593, 1024 }, { 5, 594, 1024 }, { 6, 595, 1024 }, { 5, 596, 1024 }, { 6, 597, 1024 }, { 6, 598, 1024 }, { 7, 599, 1024 }, + { 5, 600, 1024 }, { 6, 601, 1024 }, { 6, 602, 1024 }, { 7, 603, 1024 }, { 6, 604, 1024 }, { 7, 605, 1024 }, { 7, 606, 1024 }, { 8, 607, 1024 }, + { 4, 608, 1024 }, { 5, 609, 1024 }, { 5, 610, 1024 }, { 6, 611, 1024 }, { 5, 612, 1024 }, { 6, 613, 1024 }, { 6, 614, 1024 }, { 7, 615, 1024 }, + { 5, 616, 1024 }, { 6, 617, 1024 }, { 6, 618, 1024 }, { 7, 619, 1024 }, { 6, 620, 1024 }, { 7, 621, 1024 }, { 7, 622, 1024 }, { 8, 623, 1024 }, + { 5, 624, 1024 }, { 6, 625, 1024 }, { 6, 626, 1024 }, { 7, 627, 1024 }, { 6, 628, 1024 }, { 7, 629, 1024 }, { 7, 630, 1024 }, { 8, 631, 1024 }, + { 6, 632, 1024 }, { 7, 633, 1024 }, { 7, 634, 1024 }, { 8, 635, 1024 }, { 7, 636, 1024 }, { 8, 637, 1024 }, { 8, 638, 1024 }, { 9, 639, 1024 }, + { 3, 640, 1024 }, { 4, 641, 1024 }, { 4, 642, 1024 }, { 5, 643, 1024 }, { 4, 644, 1024 }, { 5, 645, 1024 }, { 5, 646, 1024 }, { 6, 647, 1024 }, + { 4, 648, 1024 }, { 5, 649, 1024 }, { 5, 650, 1024 }, { 6, 651, 1024 }, { 5, 652, 1024 }, { 6, 653, 1024 }, { 6, 654, 1024 }, { 7, 655, 1024 }, + { 4, 656, 1024 }, { 5, 657, 1024 }, { 5, 658, 1024 }, { 6, 659, 1024 }, { 5, 660, 1024 }, { 6, 661, 1024 }, { 6, 662, 1024 }, { 7, 663, 1024 }, + { 5, 664, 1024 }, { 6, 665, 1024 }, { 6, 666, 1024 }, { 7, 667, 1024 }, { 6, 668, 1024 }, { 7, 669, 1024 }, { 7, 670, 1024 }, { 8, 671, 1024 }, + { 4, 672, 1024 }, { 5, 673, 1024 }, { 5, 674, 1024 }, { 6, 675, 1024 }, { 5, 676, 1024 }, { 6, 677, 1024 }, { 6, 678, 1024 }, { 7, 679, 1024 }, + { 5, 680, 1024 }, { 6, 681, 1024 }, { 6, 682, 1024 }, { 7, 683, 1024 }, { 6, 684, 1024 }, { 7, 685, 1024 }, { 7, 686, 1024 }, { 8, 687, 1024 }, + { 5, 688, 1024 }, { 6, 689, 1024 }, { 6, 690, 1024 }, { 7, 691, 1024 }, { 6, 692, 1024 }, { 7, 693, 1024 }, { 7, 694, 1024 }, { 8, 695, 1024 }, + { 6, 696, 1024 }, { 7, 697, 1024 }, { 7, 698, 1024 }, { 8, 699, 1024 }, { 7, 700, 1024 }, { 8, 701, 1024 }, { 8, 702, 1024 }, { 9, 703, 1024 }, + { 4, 704, 1024 }, { 5, 705, 1024 }, { 5, 706, 1024 }, { 6, 707, 1024 }, { 5, 708, 1024 }, { 6, 709, 1024 }, { 6, 710, 1024 }, { 7, 711, 1024 }, + { 5, 712, 1024 }, { 6, 713, 1024 }, { 6, 714, 1024 }, { 7, 715, 1024 }, { 6, 716, 1024 }, { 7, 717, 1024 }, { 7, 718, 1024 }, { 8, 719, 1024 }, + { 5, 720, 1024 }, { 6, 721, 1024 }, { 6, 722, 1024 }, { 7, 723, 1024 }, { 6, 724, 1024 }, { 7, 725, 1024 }, { 7, 726, 1024 }, { 8, 727, 1024 }, + { 6, 728, 1024 }, { 7, 729, 1024 }, { 7, 730, 1024 }, { 8, 731, 1024 }, { 7, 732, 1024 }, { 8, 733, 1024 }, { 8, 734, 1024 }, { 9, 735, 1024 }, + { 5, 736, 1024 }, { 6, 737, 1024 }, { 6, 738, 1024 }, { 7, 739, 1024 }, { 6, 740, 1024 }, { 7, 741, 1024 }, { 7, 742, 1024 }, { 8, 743, 1024 }, + { 6, 744, 1024 }, { 7, 745, 1024 }, { 7, 746, 1024 }, { 8, 747, 1024 }, { 7, 748, 1024 }, { 8, 749, 1024 }, { 8, 750, 1024 }, { 9, 751, 1024 }, + { 6, 752, 1024 }, { 7, 753, 1024 }, { 7, 754, 1024 }, { 8, 755, 1024 }, { 7, 756, 1024 }, { 8, 757, 1024 }, { 8, 758, 1024 }, { 9, 759, 1024 }, + { 7, 760, 1024 }, { 8, 761, 1024 }, { 8, 762, 1024 }, { 9, 763, 1024 }, { 8, 764, 1024 }, { 9, 765, 1024 }, { 9, 766, 1024 }, { 10, 767, 1024 }, + { 3, 768, 1024 }, { 4, 769, 1024 }, { 4, 770, 1024 }, { 5, 771, 1024 }, { 4, 772, 1024 }, { 5, 773, 1024 }, { 5, 774, 1024 }, { 6, 775, 1024 }, + { 4, 776, 1024 }, { 5, 777, 1024 }, { 5, 778, 1024 }, { 6, 779, 1024 }, { 5, 780, 1024 }, { 6, 781, 1024 }, { 6, 782, 1024 }, { 7, 783, 1024 }, + { 4, 784, 1024 }, { 5, 785, 1024 }, { 5, 786, 1024 }, { 6, 787, 1024 }, { 5, 788, 1024 }, { 6, 789, 1024 }, { 6, 790, 1024 }, { 7, 791, 1024 }, + { 5, 792, 1024 }, { 6, 793, 1024 }, { 6, 794, 1024 }, { 7, 795, 1024 }, { 6, 796, 1024 }, { 7, 797, 1024 }, { 7, 798, 1024 }, { 8, 799, 1024 }, + { 4, 800, 1024 }, { 5, 801, 1024 }, { 5, 802, 1024 }, { 6, 803, 1024 }, { 5, 804, 1024 }, { 6, 805, 1024 }, { 6, 806, 1024 }, { 7, 807, 1024 }, + { 5, 808, 1024 }, { 6, 809, 1024 }, { 6, 810, 1024 }, { 7, 811, 1024 }, { 6, 812, 1024 }, { 7, 813, 1024 }, { 7, 814, 1024 }, { 8, 815, 1024 }, + { 5, 816, 1024 }, { 6, 817, 1024 }, { 6, 818, 1024 }, { 7, 819, 1024 }, { 6, 820, 1024 }, { 7, 821, 1024 }, { 7, 822, 1024 }, { 8, 823, 1024 }, + { 6, 824, 1024 }, { 7, 825, 1024 }, { 7, 826, 1024 }, { 8, 827, 1024 }, { 7, 828, 1024 }, { 8, 829, 1024 }, { 8, 830, 1024 }, { 9, 831, 1024 }, + { 4, 832, 1024 }, { 5, 833, 1024 }, { 5, 834, 1024 }, { 6, 835, 1024 }, { 5, 836, 1024 }, { 6, 837, 1024 }, { 6, 838, 1024 }, { 7, 839, 1024 }, + { 5, 840, 1024 }, { 6, 841, 1024 }, { 6, 842, 1024 }, { 7, 843, 1024 }, { 6, 844, 1024 }, { 7, 845, 1024 }, { 7, 846, 1024 }, { 8, 847, 1024 }, + { 5, 848, 1024 }, { 6, 849, 1024 }, { 6, 850, 1024 }, { 7, 851, 1024 }, { 6, 852, 1024 }, { 7, 853, 1024 }, { 7, 854, 1024 }, { 8, 855, 1024 }, + { 6, 856, 1024 }, { 7, 857, 1024 }, { 7, 858, 1024 }, { 8, 859, 1024 }, { 7, 860, 1024 }, { 8, 861, 1024 }, { 8, 862, 1024 }, { 9, 863, 1024 }, + { 5, 864, 1024 }, { 6, 865, 1024 }, { 6, 866, 1024 }, { 7, 867, 1024 }, { 6, 868, 1024 }, { 7, 869, 1024 }, { 7, 870, 1024 }, { 8, 871, 1024 }, + { 6, 872, 1024 }, { 7, 873, 1024 }, { 7, 874, 1024 }, { 8, 875, 1024 }, { 7, 876, 1024 }, { 8, 877, 1024 }, { 8, 878, 1024 }, { 9, 879, 1024 }, + { 6, 880, 1024 }, { 7, 881, 1024 }, { 7, 882, 1024 }, { 8, 883, 1024 }, { 7, 884, 1024 }, { 8, 885, 1024 }, { 8, 886, 1024 }, { 9, 887, 1024 }, + { 7, 888, 1024 }, { 8, 889, 1024 }, { 8, 890, 1024 }, { 9, 891, 1024 }, { 8, 892, 1024 }, { 9, 893, 1024 }, { 9, 894, 1024 }, { 10, 895, 1024 }, + { 4, 896, 1024 }, { 5, 897, 1024 }, { 5, 898, 1024 }, { 6, 899, 1024 }, { 5, 900, 1024 }, { 6, 901, 1024 }, { 6, 902, 1024 }, { 7, 903, 1024 }, + { 5, 904, 1024 }, { 6, 905, 1024 }, { 6, 906, 1024 }, { 7, 907, 1024 }, { 6, 908, 1024 }, { 7, 909, 1024 }, { 7, 910, 1024 }, { 8, 911, 1024 }, + { 5, 912, 1024 }, { 6, 913, 1024 }, { 6, 914, 1024 }, { 7, 915, 1024 }, { 6, 916, 1024 }, { 7, 917, 1024 }, { 7, 918, 1024 }, { 8, 919, 1024 }, + { 6, 920, 1024 }, { 7, 921, 1024 }, { 7, 922, 1024 }, { 8, 923, 1024 }, { 7, 924, 1024 }, { 8, 925, 1024 }, { 8, 926, 1024 }, { 9, 927, 1024 }, + { 5, 928, 1024 }, { 6, 929, 1024 }, { 6, 930, 1024 }, { 7, 931, 1024 }, { 6, 932, 1024 }, { 7, 933, 1024 }, { 7, 934, 1024 }, { 8, 935, 1024 }, + { 6, 936, 1024 }, { 7, 937, 1024 }, { 7, 938, 1024 }, { 8, 939, 1024 }, { 7, 940, 1024 }, { 8, 941, 1024 }, { 8, 942, 1024 }, { 9, 943, 1024 }, + { 6, 944, 1024 }, { 7, 945, 1024 }, { 7, 946, 1024 }, { 8, 947, 1024 }, { 7, 948, 1024 }, { 8, 949, 1024 }, { 8, 950, 1024 }, { 9, 951, 1024 }, + { 7, 952, 1024 }, { 8, 953, 1024 }, { 8, 954, 1024 }, { 9, 955, 1024 }, { 8, 956, 1024 }, { 9, 957, 1024 }, { 9, 958, 1024 }, { 10, 959, 1024 }, + { 5, 960, 1024 }, { 6, 961, 1024 }, { 6, 962, 1024 }, { 7, 963, 1024 }, { 6, 964, 1024 }, { 7, 965, 1024 }, { 7, 966, 1024 }, { 8, 967, 1024 }, + { 6, 968, 1024 }, { 7, 969, 1024 }, { 7, 970, 1024 }, { 8, 971, 1024 }, { 7, 972, 1024 }, { 8, 973, 1024 }, { 8, 974, 1024 }, { 9, 975, 1024 }, + { 6, 976, 1024 }, { 7, 977, 1024 }, { 7, 978, 1024 }, { 8, 979, 1024 }, { 7, 980, 1024 }, { 8, 981, 1024 }, { 8, 982, 1024 }, { 9, 983, 1024 }, + { 7, 984, 1024 }, { 8, 985, 1024 }, { 8, 986, 1024 }, { 9, 987, 1024 }, { 8, 988, 1024 }, { 9, 989, 1024 }, { 9, 990, 1024 }, { 10, 991, 1024 }, + { 6, 992, 1024 }, { 7, 993, 1024 }, { 7, 994, 1024 }, { 8, 995, 1024 }, { 7, 996, 1024 }, { 8, 997, 1024 }, { 8, 998, 1024 }, { 9, 999, 1024 }, + { 7, 1000, 1024 }, { 8, 1001, 1024 }, { 8, 1002, 1024 }, { 9, 1003, 1024 }, { 8, 1004, 1024 }, { 9, 1005, 1024 }, { 9, 1006, 1024 }, { 10, 1007, 1024 }, + { 7, 1008, 1024 }, { 8, 1009, 1024 }, { 8, 1010, 1024 }, { 9, 1011, 1024 }, { 8, 1012, 1024 }, { 9, 1013, 1024 }, { 9, 1014, 1024 }, { 10, 1015, 1024 }, + { 8, 1016, 1024 }, { 9, 1017, 1024 }, { 9, 1018, 1024 }, { 10, 1019, 1024 }, { 9, 1020, 1024 }, { 10, 1021, 1024 }, { 10, 1022, 1024 }, { 11, 1023, 1024 }, +#if FP_LUT > 11 + { 1, 0, 0 }, { 2, 1, 2048 }, { 2, 2, 2048 }, { 3, 3, 2048 }, { 2, 4, 2048 }, { 3, 5, 2048 }, { 3, 6, 2048 }, { 4, 7, 2048 }, + { 2, 8, 2048 }, { 3, 9, 2048 }, { 3, 10, 2048 }, { 4, 11, 2048 }, { 3, 12, 2048 }, { 4, 13, 2048 }, { 4, 14, 2048 }, { 5, 15, 2048 }, + { 2, 16, 2048 }, { 3, 17, 2048 }, { 3, 18, 2048 }, { 4, 19, 2048 }, { 3, 20, 2048 }, { 4, 21, 2048 }, { 4, 22, 2048 }, { 5, 23, 2048 }, + { 3, 24, 2048 }, { 4, 25, 2048 }, { 4, 26, 2048 }, { 5, 27, 2048 }, { 4, 28, 2048 }, { 5, 29, 2048 }, { 5, 30, 2048 }, { 6, 31, 2048 }, + { 2, 32, 2048 }, { 3, 33, 2048 }, { 3, 34, 2048 }, { 4, 35, 2048 }, { 3, 36, 2048 }, { 4, 37, 2048 }, { 4, 38, 2048 }, { 5, 39, 2048 }, + { 3, 40, 2048 }, { 4, 41, 2048 }, { 4, 42, 2048 }, { 5, 43, 2048 }, { 4, 44, 2048 }, { 5, 45, 2048 }, { 5, 46, 2048 }, { 6, 47, 2048 }, + { 3, 48, 2048 }, { 4, 49, 2048 }, { 4, 50, 2048 }, { 5, 51, 2048 }, { 4, 52, 2048 }, { 5, 53, 2048 }, { 5, 54, 2048 }, { 6, 55, 2048 }, + { 4, 56, 2048 }, { 5, 57, 2048 }, { 5, 58, 2048 }, { 6, 59, 2048 }, { 5, 60, 2048 }, { 6, 61, 2048 }, { 6, 62, 2048 }, { 7, 63, 2048 }, + { 2, 64, 2048 }, { 3, 65, 2048 }, { 3, 66, 2048 }, { 4, 67, 2048 }, { 3, 68, 2048 }, { 4, 69, 2048 }, { 4, 70, 2048 }, { 5, 71, 2048 }, + { 3, 72, 2048 }, { 4, 73, 2048 }, { 4, 74, 2048 }, { 5, 75, 2048 }, { 4, 76, 2048 }, { 5, 77, 2048 }, { 5, 78, 2048 }, { 6, 79, 2048 }, + { 3, 80, 2048 }, { 4, 81, 2048 }, { 4, 82, 2048 }, { 5, 83, 2048 }, { 4, 84, 2048 }, { 5, 85, 2048 }, { 5, 86, 2048 }, { 6, 87, 2048 }, + { 4, 88, 2048 }, { 5, 89, 2048 }, { 5, 90, 2048 }, { 6, 91, 2048 }, { 5, 92, 2048 }, { 6, 93, 2048 }, { 6, 94, 2048 }, { 7, 95, 2048 }, + { 3, 96, 2048 }, { 4, 97, 2048 }, { 4, 98, 2048 }, { 5, 99, 2048 }, { 4, 100, 2048 }, { 5, 101, 2048 }, { 5, 102, 2048 }, { 6, 103, 2048 }, + { 4, 104, 2048 }, { 5, 105, 2048 }, { 5, 106, 2048 }, { 6, 107, 2048 }, { 5, 108, 2048 }, { 6, 109, 2048 }, { 6, 110, 2048 }, { 7, 111, 2048 }, + { 4, 112, 2048 }, { 5, 113, 2048 }, { 5, 114, 2048 }, { 6, 115, 2048 }, { 5, 116, 2048 }, { 6, 117, 2048 }, { 6, 118, 2048 }, { 7, 119, 2048 }, + { 5, 120, 2048 }, { 6, 121, 2048 }, { 6, 122, 2048 }, { 7, 123, 2048 }, { 6, 124, 2048 }, { 7, 125, 2048 }, { 7, 126, 2048 }, { 8, 127, 2048 }, + { 2, 128, 2048 }, { 3, 129, 2048 }, { 3, 130, 2048 }, { 4, 131, 2048 }, { 3, 132, 2048 }, { 4, 133, 2048 }, { 4, 134, 2048 }, { 5, 135, 2048 }, + { 3, 136, 2048 }, { 4, 137, 2048 }, { 4, 138, 2048 }, { 5, 139, 2048 }, { 4, 140, 2048 }, { 5, 141, 2048 }, { 5, 142, 2048 }, { 6, 143, 2048 }, + { 3, 144, 2048 }, { 4, 145, 2048 }, { 4, 146, 2048 }, { 5, 147, 2048 }, { 4, 148, 2048 }, { 5, 149, 2048 }, { 5, 150, 2048 }, { 6, 151, 2048 }, + { 4, 152, 2048 }, { 5, 153, 2048 }, { 5, 154, 2048 }, { 6, 155, 2048 }, { 5, 156, 2048 }, { 6, 157, 2048 }, { 6, 158, 2048 }, { 7, 159, 2048 }, + { 3, 160, 2048 }, { 4, 161, 2048 }, { 4, 162, 2048 }, { 5, 163, 2048 }, { 4, 164, 2048 }, { 5, 165, 2048 }, { 5, 166, 2048 }, { 6, 167, 2048 }, + { 4, 168, 2048 }, { 5, 169, 2048 }, { 5, 170, 2048 }, { 6, 171, 2048 }, { 5, 172, 2048 }, { 6, 173, 2048 }, { 6, 174, 2048 }, { 7, 175, 2048 }, + { 4, 176, 2048 }, { 5, 177, 2048 }, { 5, 178, 2048 }, { 6, 179, 2048 }, { 5, 180, 2048 }, { 6, 181, 2048 }, { 6, 182, 2048 }, { 7, 183, 2048 }, + { 5, 184, 2048 }, { 6, 185, 2048 }, { 6, 186, 2048 }, { 7, 187, 2048 }, { 6, 188, 2048 }, { 7, 189, 2048 }, { 7, 190, 2048 }, { 8, 191, 2048 }, + { 3, 192, 2048 }, { 4, 193, 2048 }, { 4, 194, 2048 }, { 5, 195, 2048 }, { 4, 196, 2048 }, { 5, 197, 2048 }, { 5, 198, 2048 }, { 6, 199, 2048 }, + { 4, 200, 2048 }, { 5, 201, 2048 }, { 5, 202, 2048 }, { 6, 203, 2048 }, { 5, 204, 2048 }, { 6, 205, 2048 }, { 6, 206, 2048 }, { 7, 207, 2048 }, + { 4, 208, 2048 }, { 5, 209, 2048 }, { 5, 210, 2048 }, { 6, 211, 2048 }, { 5, 212, 2048 }, { 6, 213, 2048 }, { 6, 214, 2048 }, { 7, 215, 2048 }, + { 5, 216, 2048 }, { 6, 217, 2048 }, { 6, 218, 2048 }, { 7, 219, 2048 }, { 6, 220, 2048 }, { 7, 221, 2048 }, { 7, 222, 2048 }, { 8, 223, 2048 }, + { 4, 224, 2048 }, { 5, 225, 2048 }, { 5, 226, 2048 }, { 6, 227, 2048 }, { 5, 228, 2048 }, { 6, 229, 2048 }, { 6, 230, 2048 }, { 7, 231, 2048 }, + { 5, 232, 2048 }, { 6, 233, 2048 }, { 6, 234, 2048 }, { 7, 235, 2048 }, { 6, 236, 2048 }, { 7, 237, 2048 }, { 7, 238, 2048 }, { 8, 239, 2048 }, + { 5, 240, 2048 }, { 6, 241, 2048 }, { 6, 242, 2048 }, { 7, 243, 2048 }, { 6, 244, 2048 }, { 7, 245, 2048 }, { 7, 246, 2048 }, { 8, 247, 2048 }, + { 6, 248, 2048 }, { 7, 249, 2048 }, { 7, 250, 2048 }, { 8, 251, 2048 }, { 7, 252, 2048 }, { 8, 253, 2048 }, { 8, 254, 2048 }, { 9, 255, 2048 }, + { 2, 256, 2048 }, { 3, 257, 2048 }, { 3, 258, 2048 }, { 4, 259, 2048 }, { 3, 260, 2048 }, { 4, 261, 2048 }, { 4, 262, 2048 }, { 5, 263, 2048 }, + { 3, 264, 2048 }, { 4, 265, 2048 }, { 4, 266, 2048 }, { 5, 267, 2048 }, { 4, 268, 2048 }, { 5, 269, 2048 }, { 5, 270, 2048 }, { 6, 271, 2048 }, + { 3, 272, 2048 }, { 4, 273, 2048 }, { 4, 274, 2048 }, { 5, 275, 2048 }, { 4, 276, 2048 }, { 5, 277, 2048 }, { 5, 278, 2048 }, { 6, 279, 2048 }, + { 4, 280, 2048 }, { 5, 281, 2048 }, { 5, 282, 2048 }, { 6, 283, 2048 }, { 5, 284, 2048 }, { 6, 285, 2048 }, { 6, 286, 2048 }, { 7, 287, 2048 }, + { 3, 288, 2048 }, { 4, 289, 2048 }, { 4, 290, 2048 }, { 5, 291, 2048 }, { 4, 292, 2048 }, { 5, 293, 2048 }, { 5, 294, 2048 }, { 6, 295, 2048 }, + { 4, 296, 2048 }, { 5, 297, 2048 }, { 5, 298, 2048 }, { 6, 299, 2048 }, { 5, 300, 2048 }, { 6, 301, 2048 }, { 6, 302, 2048 }, { 7, 303, 2048 }, + { 4, 304, 2048 }, { 5, 305, 2048 }, { 5, 306, 2048 }, { 6, 307, 2048 }, { 5, 308, 2048 }, { 6, 309, 2048 }, { 6, 310, 2048 }, { 7, 311, 2048 }, + { 5, 312, 2048 }, { 6, 313, 2048 }, { 6, 314, 2048 }, { 7, 315, 2048 }, { 6, 316, 2048 }, { 7, 317, 2048 }, { 7, 318, 2048 }, { 8, 319, 2048 }, + { 3, 320, 2048 }, { 4, 321, 2048 }, { 4, 322, 2048 }, { 5, 323, 2048 }, { 4, 324, 2048 }, { 5, 325, 2048 }, { 5, 326, 2048 }, { 6, 327, 2048 }, + { 4, 328, 2048 }, { 5, 329, 2048 }, { 5, 330, 2048 }, { 6, 331, 2048 }, { 5, 332, 2048 }, { 6, 333, 2048 }, { 6, 334, 2048 }, { 7, 335, 2048 }, + { 4, 336, 2048 }, { 5, 337, 2048 }, { 5, 338, 2048 }, { 6, 339, 2048 }, { 5, 340, 2048 }, { 6, 341, 2048 }, { 6, 342, 2048 }, { 7, 343, 2048 }, + { 5, 344, 2048 }, { 6, 345, 2048 }, { 6, 346, 2048 }, { 7, 347, 2048 }, { 6, 348, 2048 }, { 7, 349, 2048 }, { 7, 350, 2048 }, { 8, 351, 2048 }, + { 4, 352, 2048 }, { 5, 353, 2048 }, { 5, 354, 2048 }, { 6, 355, 2048 }, { 5, 356, 2048 }, { 6, 357, 2048 }, { 6, 358, 2048 }, { 7, 359, 2048 }, + { 5, 360, 2048 }, { 6, 361, 2048 }, { 6, 362, 2048 }, { 7, 363, 2048 }, { 6, 364, 2048 }, { 7, 365, 2048 }, { 7, 366, 2048 }, { 8, 367, 2048 }, + { 5, 368, 2048 }, { 6, 369, 2048 }, { 6, 370, 2048 }, { 7, 371, 2048 }, { 6, 372, 2048 }, { 7, 373, 2048 }, { 7, 374, 2048 }, { 8, 375, 2048 }, + { 6, 376, 2048 }, { 7, 377, 2048 }, { 7, 378, 2048 }, { 8, 379, 2048 }, { 7, 380, 2048 }, { 8, 381, 2048 }, { 8, 382, 2048 }, { 9, 383, 2048 }, + { 3, 384, 2048 }, { 4, 385, 2048 }, { 4, 386, 2048 }, { 5, 387, 2048 }, { 4, 388, 2048 }, { 5, 389, 2048 }, { 5, 390, 2048 }, { 6, 391, 2048 }, + { 4, 392, 2048 }, { 5, 393, 2048 }, { 5, 394, 2048 }, { 6, 395, 2048 }, { 5, 396, 2048 }, { 6, 397, 2048 }, { 6, 398, 2048 }, { 7, 399, 2048 }, + { 4, 400, 2048 }, { 5, 401, 2048 }, { 5, 402, 2048 }, { 6, 403, 2048 }, { 5, 404, 2048 }, { 6, 405, 2048 }, { 6, 406, 2048 }, { 7, 407, 2048 }, + { 5, 408, 2048 }, { 6, 409, 2048 }, { 6, 410, 2048 }, { 7, 411, 2048 }, { 6, 412, 2048 }, { 7, 413, 2048 }, { 7, 414, 2048 }, { 8, 415, 2048 }, + { 4, 416, 2048 }, { 5, 417, 2048 }, { 5, 418, 2048 }, { 6, 419, 2048 }, { 5, 420, 2048 }, { 6, 421, 2048 }, { 6, 422, 2048 }, { 7, 423, 2048 }, + { 5, 424, 2048 }, { 6, 425, 2048 }, { 6, 426, 2048 }, { 7, 427, 2048 }, { 6, 428, 2048 }, { 7, 429, 2048 }, { 7, 430, 2048 }, { 8, 431, 2048 }, + { 5, 432, 2048 }, { 6, 433, 2048 }, { 6, 434, 2048 }, { 7, 435, 2048 }, { 6, 436, 2048 }, { 7, 437, 2048 }, { 7, 438, 2048 }, { 8, 439, 2048 }, + { 6, 440, 2048 }, { 7, 441, 2048 }, { 7, 442, 2048 }, { 8, 443, 2048 }, { 7, 444, 2048 }, { 8, 445, 2048 }, { 8, 446, 2048 }, { 9, 447, 2048 }, + { 4, 448, 2048 }, { 5, 449, 2048 }, { 5, 450, 2048 }, { 6, 451, 2048 }, { 5, 452, 2048 }, { 6, 453, 2048 }, { 6, 454, 2048 }, { 7, 455, 2048 }, + { 5, 456, 2048 }, { 6, 457, 2048 }, { 6, 458, 2048 }, { 7, 459, 2048 }, { 6, 460, 2048 }, { 7, 461, 2048 }, { 7, 462, 2048 }, { 8, 463, 2048 }, + { 5, 464, 2048 }, { 6, 465, 2048 }, { 6, 466, 2048 }, { 7, 467, 2048 }, { 6, 468, 2048 }, { 7, 469, 2048 }, { 7, 470, 2048 }, { 8, 471, 2048 }, + { 6, 472, 2048 }, { 7, 473, 2048 }, { 7, 474, 2048 }, { 8, 475, 2048 }, { 7, 476, 2048 }, { 8, 477, 2048 }, { 8, 478, 2048 }, { 9, 479, 2048 }, + { 5, 480, 2048 }, { 6, 481, 2048 }, { 6, 482, 2048 }, { 7, 483, 2048 }, { 6, 484, 2048 }, { 7, 485, 2048 }, { 7, 486, 2048 }, { 8, 487, 2048 }, + { 6, 488, 2048 }, { 7, 489, 2048 }, { 7, 490, 2048 }, { 8, 491, 2048 }, { 7, 492, 2048 }, { 8, 493, 2048 }, { 8, 494, 2048 }, { 9, 495, 2048 }, + { 6, 496, 2048 }, { 7, 497, 2048 }, { 7, 498, 2048 }, { 8, 499, 2048 }, { 7, 500, 2048 }, { 8, 501, 2048 }, { 8, 502, 2048 }, { 9, 503, 2048 }, + { 7, 504, 2048 }, { 8, 505, 2048 }, { 8, 506, 2048 }, { 9, 507, 2048 }, { 8, 508, 2048 }, { 9, 509, 2048 }, { 9, 510, 2048 }, { 10, 511, 2048 }, + { 2, 512, 2048 }, { 3, 513, 2048 }, { 3, 514, 2048 }, { 4, 515, 2048 }, { 3, 516, 2048 }, { 4, 517, 2048 }, { 4, 518, 2048 }, { 5, 519, 2048 }, + { 3, 520, 2048 }, { 4, 521, 2048 }, { 4, 522, 2048 }, { 5, 523, 2048 }, { 4, 524, 2048 }, { 5, 525, 2048 }, { 5, 526, 2048 }, { 6, 527, 2048 }, + { 3, 528, 2048 }, { 4, 529, 2048 }, { 4, 530, 2048 }, { 5, 531, 2048 }, { 4, 532, 2048 }, { 5, 533, 2048 }, { 5, 534, 2048 }, { 6, 535, 2048 }, + { 4, 536, 2048 }, { 5, 537, 2048 }, { 5, 538, 2048 }, { 6, 539, 2048 }, { 5, 540, 2048 }, { 6, 541, 2048 }, { 6, 542, 2048 }, { 7, 543, 2048 }, + { 3, 544, 2048 }, { 4, 545, 2048 }, { 4, 546, 2048 }, { 5, 547, 2048 }, { 4, 548, 2048 }, { 5, 549, 2048 }, { 5, 550, 2048 }, { 6, 551, 2048 }, + { 4, 552, 2048 }, { 5, 553, 2048 }, { 5, 554, 2048 }, { 6, 555, 2048 }, { 5, 556, 2048 }, { 6, 557, 2048 }, { 6, 558, 2048 }, { 7, 559, 2048 }, + { 4, 560, 2048 }, { 5, 561, 2048 }, { 5, 562, 2048 }, { 6, 563, 2048 }, { 5, 564, 2048 }, { 6, 565, 2048 }, { 6, 566, 2048 }, { 7, 567, 2048 }, + { 5, 568, 2048 }, { 6, 569, 2048 }, { 6, 570, 2048 }, { 7, 571, 2048 }, { 6, 572, 2048 }, { 7, 573, 2048 }, { 7, 574, 2048 }, { 8, 575, 2048 }, + { 3, 576, 2048 }, { 4, 577, 2048 }, { 4, 578, 2048 }, { 5, 579, 2048 }, { 4, 580, 2048 }, { 5, 581, 2048 }, { 5, 582, 2048 }, { 6, 583, 2048 }, + { 4, 584, 2048 }, { 5, 585, 2048 }, { 5, 586, 2048 }, { 6, 587, 2048 }, { 5, 588, 2048 }, { 6, 589, 2048 }, { 6, 590, 2048 }, { 7, 591, 2048 }, + { 4, 592, 2048 }, { 5, 593, 2048 }, { 5, 594, 2048 }, { 6, 595, 2048 }, { 5, 596, 2048 }, { 6, 597, 2048 }, { 6, 598, 2048 }, { 7, 599, 2048 }, + { 5, 600, 2048 }, { 6, 601, 2048 }, { 6, 602, 2048 }, { 7, 603, 2048 }, { 6, 604, 2048 }, { 7, 605, 2048 }, { 7, 606, 2048 }, { 8, 607, 2048 }, + { 4, 608, 2048 }, { 5, 609, 2048 }, { 5, 610, 2048 }, { 6, 611, 2048 }, { 5, 612, 2048 }, { 6, 613, 2048 }, { 6, 614, 2048 }, { 7, 615, 2048 }, + { 5, 616, 2048 }, { 6, 617, 2048 }, { 6, 618, 2048 }, { 7, 619, 2048 }, { 6, 620, 2048 }, { 7, 621, 2048 }, { 7, 622, 2048 }, { 8, 623, 2048 }, + { 5, 624, 2048 }, { 6, 625, 2048 }, { 6, 626, 2048 }, { 7, 627, 2048 }, { 6, 628, 2048 }, { 7, 629, 2048 }, { 7, 630, 2048 }, { 8, 631, 2048 }, + { 6, 632, 2048 }, { 7, 633, 2048 }, { 7, 634, 2048 }, { 8, 635, 2048 }, { 7, 636, 2048 }, { 8, 637, 2048 }, { 8, 638, 2048 }, { 9, 639, 2048 }, + { 3, 640, 2048 }, { 4, 641, 2048 }, { 4, 642, 2048 }, { 5, 643, 2048 }, { 4, 644, 2048 }, { 5, 645, 2048 }, { 5, 646, 2048 }, { 6, 647, 2048 }, + { 4, 648, 2048 }, { 5, 649, 2048 }, { 5, 650, 2048 }, { 6, 651, 2048 }, { 5, 652, 2048 }, { 6, 653, 2048 }, { 6, 654, 2048 }, { 7, 655, 2048 }, + { 4, 656, 2048 }, { 5, 657, 2048 }, { 5, 658, 2048 }, { 6, 659, 2048 }, { 5, 660, 2048 }, { 6, 661, 2048 }, { 6, 662, 2048 }, { 7, 663, 2048 }, + { 5, 664, 2048 }, { 6, 665, 2048 }, { 6, 666, 2048 }, { 7, 667, 2048 }, { 6, 668, 2048 }, { 7, 669, 2048 }, { 7, 670, 2048 }, { 8, 671, 2048 }, + { 4, 672, 2048 }, { 5, 673, 2048 }, { 5, 674, 2048 }, { 6, 675, 2048 }, { 5, 676, 2048 }, { 6, 677, 2048 }, { 6, 678, 2048 }, { 7, 679, 2048 }, + { 5, 680, 2048 }, { 6, 681, 2048 }, { 6, 682, 2048 }, { 7, 683, 2048 }, { 6, 684, 2048 }, { 7, 685, 2048 }, { 7, 686, 2048 }, { 8, 687, 2048 }, + { 5, 688, 2048 }, { 6, 689, 2048 }, { 6, 690, 2048 }, { 7, 691, 2048 }, { 6, 692, 2048 }, { 7, 693, 2048 }, { 7, 694, 2048 }, { 8, 695, 2048 }, + { 6, 696, 2048 }, { 7, 697, 2048 }, { 7, 698, 2048 }, { 8, 699, 2048 }, { 7, 700, 2048 }, { 8, 701, 2048 }, { 8, 702, 2048 }, { 9, 703, 2048 }, + { 4, 704, 2048 }, { 5, 705, 2048 }, { 5, 706, 2048 }, { 6, 707, 2048 }, { 5, 708, 2048 }, { 6, 709, 2048 }, { 6, 710, 2048 }, { 7, 711, 2048 }, + { 5, 712, 2048 }, { 6, 713, 2048 }, { 6, 714, 2048 }, { 7, 715, 2048 }, { 6, 716, 2048 }, { 7, 717, 2048 }, { 7, 718, 2048 }, { 8, 719, 2048 }, + { 5, 720, 2048 }, { 6, 721, 2048 }, { 6, 722, 2048 }, { 7, 723, 2048 }, { 6, 724, 2048 }, { 7, 725, 2048 }, { 7, 726, 2048 }, { 8, 727, 2048 }, + { 6, 728, 2048 }, { 7, 729, 2048 }, { 7, 730, 2048 }, { 8, 731, 2048 }, { 7, 732, 2048 }, { 8, 733, 2048 }, { 8, 734, 2048 }, { 9, 735, 2048 }, + { 5, 736, 2048 }, { 6, 737, 2048 }, { 6, 738, 2048 }, { 7, 739, 2048 }, { 6, 740, 2048 }, { 7, 741, 2048 }, { 7, 742, 2048 }, { 8, 743, 2048 }, + { 6, 744, 2048 }, { 7, 745, 2048 }, { 7, 746, 2048 }, { 8, 747, 2048 }, { 7, 748, 2048 }, { 8, 749, 2048 }, { 8, 750, 2048 }, { 9, 751, 2048 }, + { 6, 752, 2048 }, { 7, 753, 2048 }, { 7, 754, 2048 }, { 8, 755, 2048 }, { 7, 756, 2048 }, { 8, 757, 2048 }, { 8, 758, 2048 }, { 9, 759, 2048 }, + { 7, 760, 2048 }, { 8, 761, 2048 }, { 8, 762, 2048 }, { 9, 763, 2048 }, { 8, 764, 2048 }, { 9, 765, 2048 }, { 9, 766, 2048 }, { 10, 767, 2048 }, + { 3, 768, 2048 }, { 4, 769, 2048 }, { 4, 770, 2048 }, { 5, 771, 2048 }, { 4, 772, 2048 }, { 5, 773, 2048 }, { 5, 774, 2048 }, { 6, 775, 2048 }, + { 4, 776, 2048 }, { 5, 777, 2048 }, { 5, 778, 2048 }, { 6, 779, 2048 }, { 5, 780, 2048 }, { 6, 781, 2048 }, { 6, 782, 2048 }, { 7, 783, 2048 }, + { 4, 784, 2048 }, { 5, 785, 2048 }, { 5, 786, 2048 }, { 6, 787, 2048 }, { 5, 788, 2048 }, { 6, 789, 2048 }, { 6, 790, 2048 }, { 7, 791, 2048 }, + { 5, 792, 2048 }, { 6, 793, 2048 }, { 6, 794, 2048 }, { 7, 795, 2048 }, { 6, 796, 2048 }, { 7, 797, 2048 }, { 7, 798, 2048 }, { 8, 799, 2048 }, + { 4, 800, 2048 }, { 5, 801, 2048 }, { 5, 802, 2048 }, { 6, 803, 2048 }, { 5, 804, 2048 }, { 6, 805, 2048 }, { 6, 806, 2048 }, { 7, 807, 2048 }, + { 5, 808, 2048 }, { 6, 809, 2048 }, { 6, 810, 2048 }, { 7, 811, 2048 }, { 6, 812, 2048 }, { 7, 813, 2048 }, { 7, 814, 2048 }, { 8, 815, 2048 }, + { 5, 816, 2048 }, { 6, 817, 2048 }, { 6, 818, 2048 }, { 7, 819, 2048 }, { 6, 820, 2048 }, { 7, 821, 2048 }, { 7, 822, 2048 }, { 8, 823, 2048 }, + { 6, 824, 2048 }, { 7, 825, 2048 }, { 7, 826, 2048 }, { 8, 827, 2048 }, { 7, 828, 2048 }, { 8, 829, 2048 }, { 8, 830, 2048 }, { 9, 831, 2048 }, + { 4, 832, 2048 }, { 5, 833, 2048 }, { 5, 834, 2048 }, { 6, 835, 2048 }, { 5, 836, 2048 }, { 6, 837, 2048 }, { 6, 838, 2048 }, { 7, 839, 2048 }, + { 5, 840, 2048 }, { 6, 841, 2048 }, { 6, 842, 2048 }, { 7, 843, 2048 }, { 6, 844, 2048 }, { 7, 845, 2048 }, { 7, 846, 2048 }, { 8, 847, 2048 }, + { 5, 848, 2048 }, { 6, 849, 2048 }, { 6, 850, 2048 }, { 7, 851, 2048 }, { 6, 852, 2048 }, { 7, 853, 2048 }, { 7, 854, 2048 }, { 8, 855, 2048 }, + { 6, 856, 2048 }, { 7, 857, 2048 }, { 7, 858, 2048 }, { 8, 859, 2048 }, { 7, 860, 2048 }, { 8, 861, 2048 }, { 8, 862, 2048 }, { 9, 863, 2048 }, + { 5, 864, 2048 }, { 6, 865, 2048 }, { 6, 866, 2048 }, { 7, 867, 2048 }, { 6, 868, 2048 }, { 7, 869, 2048 }, { 7, 870, 2048 }, { 8, 871, 2048 }, + { 6, 872, 2048 }, { 7, 873, 2048 }, { 7, 874, 2048 }, { 8, 875, 2048 }, { 7, 876, 2048 }, { 8, 877, 2048 }, { 8, 878, 2048 }, { 9, 879, 2048 }, + { 6, 880, 2048 }, { 7, 881, 2048 }, { 7, 882, 2048 }, { 8, 883, 2048 }, { 7, 884, 2048 }, { 8, 885, 2048 }, { 8, 886, 2048 }, { 9, 887, 2048 }, + { 7, 888, 2048 }, { 8, 889, 2048 }, { 8, 890, 2048 }, { 9, 891, 2048 }, { 8, 892, 2048 }, { 9, 893, 2048 }, { 9, 894, 2048 }, { 10, 895, 2048 }, + { 4, 896, 2048 }, { 5, 897, 2048 }, { 5, 898, 2048 }, { 6, 899, 2048 }, { 5, 900, 2048 }, { 6, 901, 2048 }, { 6, 902, 2048 }, { 7, 903, 2048 }, + { 5, 904, 2048 }, { 6, 905, 2048 }, { 6, 906, 2048 }, { 7, 907, 2048 }, { 6, 908, 2048 }, { 7, 909, 2048 }, { 7, 910, 2048 }, { 8, 911, 2048 }, + { 5, 912, 2048 }, { 6, 913, 2048 }, { 6, 914, 2048 }, { 7, 915, 2048 }, { 6, 916, 2048 }, { 7, 917, 2048 }, { 7, 918, 2048 }, { 8, 919, 2048 }, + { 6, 920, 2048 }, { 7, 921, 2048 }, { 7, 922, 2048 }, { 8, 923, 2048 }, { 7, 924, 2048 }, { 8, 925, 2048 }, { 8, 926, 2048 }, { 9, 927, 2048 }, + { 5, 928, 2048 }, { 6, 929, 2048 }, { 6, 930, 2048 }, { 7, 931, 2048 }, { 6, 932, 2048 }, { 7, 933, 2048 }, { 7, 934, 2048 }, { 8, 935, 2048 }, + { 6, 936, 2048 }, { 7, 937, 2048 }, { 7, 938, 2048 }, { 8, 939, 2048 }, { 7, 940, 2048 }, { 8, 941, 2048 }, { 8, 942, 2048 }, { 9, 943, 2048 }, + { 6, 944, 2048 }, { 7, 945, 2048 }, { 7, 946, 2048 }, { 8, 947, 2048 }, { 7, 948, 2048 }, { 8, 949, 2048 }, { 8, 950, 2048 }, { 9, 951, 2048 }, + { 7, 952, 2048 }, { 8, 953, 2048 }, { 8, 954, 2048 }, { 9, 955, 2048 }, { 8, 956, 2048 }, { 9, 957, 2048 }, { 9, 958, 2048 }, { 10, 959, 2048 }, + { 5, 960, 2048 }, { 6, 961, 2048 }, { 6, 962, 2048 }, { 7, 963, 2048 }, { 6, 964, 2048 }, { 7, 965, 2048 }, { 7, 966, 2048 }, { 8, 967, 2048 }, + { 6, 968, 2048 }, { 7, 969, 2048 }, { 7, 970, 2048 }, { 8, 971, 2048 }, { 7, 972, 2048 }, { 8, 973, 2048 }, { 8, 974, 2048 }, { 9, 975, 2048 }, + { 6, 976, 2048 }, { 7, 977, 2048 }, { 7, 978, 2048 }, { 8, 979, 2048 }, { 7, 980, 2048 }, { 8, 981, 2048 }, { 8, 982, 2048 }, { 9, 983, 2048 }, + { 7, 984, 2048 }, { 8, 985, 2048 }, { 8, 986, 2048 }, { 9, 987, 2048 }, { 8, 988, 2048 }, { 9, 989, 2048 }, { 9, 990, 2048 }, { 10, 991, 2048 }, + { 6, 992, 2048 }, { 7, 993, 2048 }, { 7, 994, 2048 }, { 8, 995, 2048 }, { 7, 996, 2048 }, { 8, 997, 2048 }, { 8, 998, 2048 }, { 9, 999, 2048 }, + { 7, 1000, 2048 }, { 8, 1001, 2048 }, { 8, 1002, 2048 }, { 9, 1003, 2048 }, { 8, 1004, 2048 }, { 9, 1005, 2048 }, { 9, 1006, 2048 }, { 10, 1007, 2048 }, + { 7, 1008, 2048 }, { 8, 1009, 2048 }, { 8, 1010, 2048 }, { 9, 1011, 2048 }, { 8, 1012, 2048 }, { 9, 1013, 2048 }, { 9, 1014, 2048 }, { 10, 1015, 2048 }, + { 8, 1016, 2048 }, { 9, 1017, 2048 }, { 9, 1018, 2048 }, { 10, 1019, 2048 }, { 9, 1020, 2048 }, { 10, 1021, 2048 }, { 10, 1022, 2048 }, { 11, 1023, 2048 }, + { 2, 1024, 2048 }, { 3, 1025, 2048 }, { 3, 1026, 2048 }, { 4, 1027, 2048 }, { 3, 1028, 2048 }, { 4, 1029, 2048 }, { 4, 1030, 2048 }, { 5, 1031, 2048 }, + { 3, 1032, 2048 }, { 4, 1033, 2048 }, { 4, 1034, 2048 }, { 5, 1035, 2048 }, { 4, 1036, 2048 }, { 5, 1037, 2048 }, { 5, 1038, 2048 }, { 6, 1039, 2048 }, + { 3, 1040, 2048 }, { 4, 1041, 2048 }, { 4, 1042, 2048 }, { 5, 1043, 2048 }, { 4, 1044, 2048 }, { 5, 1045, 2048 }, { 5, 1046, 2048 }, { 6, 1047, 2048 }, + { 4, 1048, 2048 }, { 5, 1049, 2048 }, { 5, 1050, 2048 }, { 6, 1051, 2048 }, { 5, 1052, 2048 }, { 6, 1053, 2048 }, { 6, 1054, 2048 }, { 7, 1055, 2048 }, + { 3, 1056, 2048 }, { 4, 1057, 2048 }, { 4, 1058, 2048 }, { 5, 1059, 2048 }, { 4, 1060, 2048 }, { 5, 1061, 2048 }, { 5, 1062, 2048 }, { 6, 1063, 2048 }, + { 4, 1064, 2048 }, { 5, 1065, 2048 }, { 5, 1066, 2048 }, { 6, 1067, 2048 }, { 5, 1068, 2048 }, { 6, 1069, 2048 }, { 6, 1070, 2048 }, { 7, 1071, 2048 }, + { 4, 1072, 2048 }, { 5, 1073, 2048 }, { 5, 1074, 2048 }, { 6, 1075, 2048 }, { 5, 1076, 2048 }, { 6, 1077, 2048 }, { 6, 1078, 2048 }, { 7, 1079, 2048 }, + { 5, 1080, 2048 }, { 6, 1081, 2048 }, { 6, 1082, 2048 }, { 7, 1083, 2048 }, { 6, 1084, 2048 }, { 7, 1085, 2048 }, { 7, 1086, 2048 }, { 8, 1087, 2048 }, + { 3, 1088, 2048 }, { 4, 1089, 2048 }, { 4, 1090, 2048 }, { 5, 1091, 2048 }, { 4, 1092, 2048 }, { 5, 1093, 2048 }, { 5, 1094, 2048 }, { 6, 1095, 2048 }, + { 4, 1096, 2048 }, { 5, 1097, 2048 }, { 5, 1098, 2048 }, { 6, 1099, 2048 }, { 5, 1100, 2048 }, { 6, 1101, 2048 }, { 6, 1102, 2048 }, { 7, 1103, 2048 }, + { 4, 1104, 2048 }, { 5, 1105, 2048 }, { 5, 1106, 2048 }, { 6, 1107, 2048 }, { 5, 1108, 2048 }, { 6, 1109, 2048 }, { 6, 1110, 2048 }, { 7, 1111, 2048 }, + { 5, 1112, 2048 }, { 6, 1113, 2048 }, { 6, 1114, 2048 }, { 7, 1115, 2048 }, { 6, 1116, 2048 }, { 7, 1117, 2048 }, { 7, 1118, 2048 }, { 8, 1119, 2048 }, + { 4, 1120, 2048 }, { 5, 1121, 2048 }, { 5, 1122, 2048 }, { 6, 1123, 2048 }, { 5, 1124, 2048 }, { 6, 1125, 2048 }, { 6, 1126, 2048 }, { 7, 1127, 2048 }, + { 5, 1128, 2048 }, { 6, 1129, 2048 }, { 6, 1130, 2048 }, { 7, 1131, 2048 }, { 6, 1132, 2048 }, { 7, 1133, 2048 }, { 7, 1134, 2048 }, { 8, 1135, 2048 }, + { 5, 1136, 2048 }, { 6, 1137, 2048 }, { 6, 1138, 2048 }, { 7, 1139, 2048 }, { 6, 1140, 2048 }, { 7, 1141, 2048 }, { 7, 1142, 2048 }, { 8, 1143, 2048 }, + { 6, 1144, 2048 }, { 7, 1145, 2048 }, { 7, 1146, 2048 }, { 8, 1147, 2048 }, { 7, 1148, 2048 }, { 8, 1149, 2048 }, { 8, 1150, 2048 }, { 9, 1151, 2048 }, + { 3, 1152, 2048 }, { 4, 1153, 2048 }, { 4, 1154, 2048 }, { 5, 1155, 2048 }, { 4, 1156, 2048 }, { 5, 1157, 2048 }, { 5, 1158, 2048 }, { 6, 1159, 2048 }, + { 4, 1160, 2048 }, { 5, 1161, 2048 }, { 5, 1162, 2048 }, { 6, 1163, 2048 }, { 5, 1164, 2048 }, { 6, 1165, 2048 }, { 6, 1166, 2048 }, { 7, 1167, 2048 }, + { 4, 1168, 2048 }, { 5, 1169, 2048 }, { 5, 1170, 2048 }, { 6, 1171, 2048 }, { 5, 1172, 2048 }, { 6, 1173, 2048 }, { 6, 1174, 2048 }, { 7, 1175, 2048 }, + { 5, 1176, 2048 }, { 6, 1177, 2048 }, { 6, 1178, 2048 }, { 7, 1179, 2048 }, { 6, 1180, 2048 }, { 7, 1181, 2048 }, { 7, 1182, 2048 }, { 8, 1183, 2048 }, + { 4, 1184, 2048 }, { 5, 1185, 2048 }, { 5, 1186, 2048 }, { 6, 1187, 2048 }, { 5, 1188, 2048 }, { 6, 1189, 2048 }, { 6, 1190, 2048 }, { 7, 1191, 2048 }, + { 5, 1192, 2048 }, { 6, 1193, 2048 }, { 6, 1194, 2048 }, { 7, 1195, 2048 }, { 6, 1196, 2048 }, { 7, 1197, 2048 }, { 7, 1198, 2048 }, { 8, 1199, 2048 }, + { 5, 1200, 2048 }, { 6, 1201, 2048 }, { 6, 1202, 2048 }, { 7, 1203, 2048 }, { 6, 1204, 2048 }, { 7, 1205, 2048 }, { 7, 1206, 2048 }, { 8, 1207, 2048 }, + { 6, 1208, 2048 }, { 7, 1209, 2048 }, { 7, 1210, 2048 }, { 8, 1211, 2048 }, { 7, 1212, 2048 }, { 8, 1213, 2048 }, { 8, 1214, 2048 }, { 9, 1215, 2048 }, + { 4, 1216, 2048 }, { 5, 1217, 2048 }, { 5, 1218, 2048 }, { 6, 1219, 2048 }, { 5, 1220, 2048 }, { 6, 1221, 2048 }, { 6, 1222, 2048 }, { 7, 1223, 2048 }, + { 5, 1224, 2048 }, { 6, 1225, 2048 }, { 6, 1226, 2048 }, { 7, 1227, 2048 }, { 6, 1228, 2048 }, { 7, 1229, 2048 }, { 7, 1230, 2048 }, { 8, 1231, 2048 }, + { 5, 1232, 2048 }, { 6, 1233, 2048 }, { 6, 1234, 2048 }, { 7, 1235, 2048 }, { 6, 1236, 2048 }, { 7, 1237, 2048 }, { 7, 1238, 2048 }, { 8, 1239, 2048 }, + { 6, 1240, 2048 }, { 7, 1241, 2048 }, { 7, 1242, 2048 }, { 8, 1243, 2048 }, { 7, 1244, 2048 }, { 8, 1245, 2048 }, { 8, 1246, 2048 }, { 9, 1247, 2048 }, + { 5, 1248, 2048 }, { 6, 1249, 2048 }, { 6, 1250, 2048 }, { 7, 1251, 2048 }, { 6, 1252, 2048 }, { 7, 1253, 2048 }, { 7, 1254, 2048 }, { 8, 1255, 2048 }, + { 6, 1256, 2048 }, { 7, 1257, 2048 }, { 7, 1258, 2048 }, { 8, 1259, 2048 }, { 7, 1260, 2048 }, { 8, 1261, 2048 }, { 8, 1262, 2048 }, { 9, 1263, 2048 }, + { 6, 1264, 2048 }, { 7, 1265, 2048 }, { 7, 1266, 2048 }, { 8, 1267, 2048 }, { 7, 1268, 2048 }, { 8, 1269, 2048 }, { 8, 1270, 2048 }, { 9, 1271, 2048 }, + { 7, 1272, 2048 }, { 8, 1273, 2048 }, { 8, 1274, 2048 }, { 9, 1275, 2048 }, { 8, 1276, 2048 }, { 9, 1277, 2048 }, { 9, 1278, 2048 }, { 10, 1279, 2048 }, + { 3, 1280, 2048 }, { 4, 1281, 2048 }, { 4, 1282, 2048 }, { 5, 1283, 2048 }, { 4, 1284, 2048 }, { 5, 1285, 2048 }, { 5, 1286, 2048 }, { 6, 1287, 2048 }, + { 4, 1288, 2048 }, { 5, 1289, 2048 }, { 5, 1290, 2048 }, { 6, 1291, 2048 }, { 5, 1292, 2048 }, { 6, 1293, 2048 }, { 6, 1294, 2048 }, { 7, 1295, 2048 }, + { 4, 1296, 2048 }, { 5, 1297, 2048 }, { 5, 1298, 2048 }, { 6, 1299, 2048 }, { 5, 1300, 2048 }, { 6, 1301, 2048 }, { 6, 1302, 2048 }, { 7, 1303, 2048 }, + { 5, 1304, 2048 }, { 6, 1305, 2048 }, { 6, 1306, 2048 }, { 7, 1307, 2048 }, { 6, 1308, 2048 }, { 7, 1309, 2048 }, { 7, 1310, 2048 }, { 8, 1311, 2048 }, + { 4, 1312, 2048 }, { 5, 1313, 2048 }, { 5, 1314, 2048 }, { 6, 1315, 2048 }, { 5, 1316, 2048 }, { 6, 1317, 2048 }, { 6, 1318, 2048 }, { 7, 1319, 2048 }, + { 5, 1320, 2048 }, { 6, 1321, 2048 }, { 6, 1322, 2048 }, { 7, 1323, 2048 }, { 6, 1324, 2048 }, { 7, 1325, 2048 }, { 7, 1326, 2048 }, { 8, 1327, 2048 }, + { 5, 1328, 2048 }, { 6, 1329, 2048 }, { 6, 1330, 2048 }, { 7, 1331, 2048 }, { 6, 1332, 2048 }, { 7, 1333, 2048 }, { 7, 1334, 2048 }, { 8, 1335, 2048 }, + { 6, 1336, 2048 }, { 7, 1337, 2048 }, { 7, 1338, 2048 }, { 8, 1339, 2048 }, { 7, 1340, 2048 }, { 8, 1341, 2048 }, { 8, 1342, 2048 }, { 9, 1343, 2048 }, + { 4, 1344, 2048 }, { 5, 1345, 2048 }, { 5, 1346, 2048 }, { 6, 1347, 2048 }, { 5, 1348, 2048 }, { 6, 1349, 2048 }, { 6, 1350, 2048 }, { 7, 1351, 2048 }, + { 5, 1352, 2048 }, { 6, 1353, 2048 }, { 6, 1354, 2048 }, { 7, 1355, 2048 }, { 6, 1356, 2048 }, { 7, 1357, 2048 }, { 7, 1358, 2048 }, { 8, 1359, 2048 }, + { 5, 1360, 2048 }, { 6, 1361, 2048 }, { 6, 1362, 2048 }, { 7, 1363, 2048 }, { 6, 1364, 2048 }, { 7, 1365, 2048 }, { 7, 1366, 2048 }, { 8, 1367, 2048 }, + { 6, 1368, 2048 }, { 7, 1369, 2048 }, { 7, 1370, 2048 }, { 8, 1371, 2048 }, { 7, 1372, 2048 }, { 8, 1373, 2048 }, { 8, 1374, 2048 }, { 9, 1375, 2048 }, + { 5, 1376, 2048 }, { 6, 1377, 2048 }, { 6, 1378, 2048 }, { 7, 1379, 2048 }, { 6, 1380, 2048 }, { 7, 1381, 2048 }, { 7, 1382, 2048 }, { 8, 1383, 2048 }, + { 6, 1384, 2048 }, { 7, 1385, 2048 }, { 7, 1386, 2048 }, { 8, 1387, 2048 }, { 7, 1388, 2048 }, { 8, 1389, 2048 }, { 8, 1390, 2048 }, { 9, 1391, 2048 }, + { 6, 1392, 2048 }, { 7, 1393, 2048 }, { 7, 1394, 2048 }, { 8, 1395, 2048 }, { 7, 1396, 2048 }, { 8, 1397, 2048 }, { 8, 1398, 2048 }, { 9, 1399, 2048 }, + { 7, 1400, 2048 }, { 8, 1401, 2048 }, { 8, 1402, 2048 }, { 9, 1403, 2048 }, { 8, 1404, 2048 }, { 9, 1405, 2048 }, { 9, 1406, 2048 }, { 10, 1407, 2048 }, + { 4, 1408, 2048 }, { 5, 1409, 2048 }, { 5, 1410, 2048 }, { 6, 1411, 2048 }, { 5, 1412, 2048 }, { 6, 1413, 2048 }, { 6, 1414, 2048 }, { 7, 1415, 2048 }, + { 5, 1416, 2048 }, { 6, 1417, 2048 }, { 6, 1418, 2048 }, { 7, 1419, 2048 }, { 6, 1420, 2048 }, { 7, 1421, 2048 }, { 7, 1422, 2048 }, { 8, 1423, 2048 }, + { 5, 1424, 2048 }, { 6, 1425, 2048 }, { 6, 1426, 2048 }, { 7, 1427, 2048 }, { 6, 1428, 2048 }, { 7, 1429, 2048 }, { 7, 1430, 2048 }, { 8, 1431, 2048 }, + { 6, 1432, 2048 }, { 7, 1433, 2048 }, { 7, 1434, 2048 }, { 8, 1435, 2048 }, { 7, 1436, 2048 }, { 8, 1437, 2048 }, { 8, 1438, 2048 }, { 9, 1439, 2048 }, + { 5, 1440, 2048 }, { 6, 1441, 2048 }, { 6, 1442, 2048 }, { 7, 1443, 2048 }, { 6, 1444, 2048 }, { 7, 1445, 2048 }, { 7, 1446, 2048 }, { 8, 1447, 2048 }, + { 6, 1448, 2048 }, { 7, 1449, 2048 }, { 7, 1450, 2048 }, { 8, 1451, 2048 }, { 7, 1452, 2048 }, { 8, 1453, 2048 }, { 8, 1454, 2048 }, { 9, 1455, 2048 }, + { 6, 1456, 2048 }, { 7, 1457, 2048 }, { 7, 1458, 2048 }, { 8, 1459, 2048 }, { 7, 1460, 2048 }, { 8, 1461, 2048 }, { 8, 1462, 2048 }, { 9, 1463, 2048 }, + { 7, 1464, 2048 }, { 8, 1465, 2048 }, { 8, 1466, 2048 }, { 9, 1467, 2048 }, { 8, 1468, 2048 }, { 9, 1469, 2048 }, { 9, 1470, 2048 }, { 10, 1471, 2048 }, + { 5, 1472, 2048 }, { 6, 1473, 2048 }, { 6, 1474, 2048 }, { 7, 1475, 2048 }, { 6, 1476, 2048 }, { 7, 1477, 2048 }, { 7, 1478, 2048 }, { 8, 1479, 2048 }, + { 6, 1480, 2048 }, { 7, 1481, 2048 }, { 7, 1482, 2048 }, { 8, 1483, 2048 }, { 7, 1484, 2048 }, { 8, 1485, 2048 }, { 8, 1486, 2048 }, { 9, 1487, 2048 }, + { 6, 1488, 2048 }, { 7, 1489, 2048 }, { 7, 1490, 2048 }, { 8, 1491, 2048 }, { 7, 1492, 2048 }, { 8, 1493, 2048 }, { 8, 1494, 2048 }, { 9, 1495, 2048 }, + { 7, 1496, 2048 }, { 8, 1497, 2048 }, { 8, 1498, 2048 }, { 9, 1499, 2048 }, { 8, 1500, 2048 }, { 9, 1501, 2048 }, { 9, 1502, 2048 }, { 10, 1503, 2048 }, + { 6, 1504, 2048 }, { 7, 1505, 2048 }, { 7, 1506, 2048 }, { 8, 1507, 2048 }, { 7, 1508, 2048 }, { 8, 1509, 2048 }, { 8, 1510, 2048 }, { 9, 1511, 2048 }, + { 7, 1512, 2048 }, { 8, 1513, 2048 }, { 8, 1514, 2048 }, { 9, 1515, 2048 }, { 8, 1516, 2048 }, { 9, 1517, 2048 }, { 9, 1518, 2048 }, { 10, 1519, 2048 }, + { 7, 1520, 2048 }, { 8, 1521, 2048 }, { 8, 1522, 2048 }, { 9, 1523, 2048 }, { 8, 1524, 2048 }, { 9, 1525, 2048 }, { 9, 1526, 2048 }, { 10, 1527, 2048 }, + { 8, 1528, 2048 }, { 9, 1529, 2048 }, { 9, 1530, 2048 }, { 10, 1531, 2048 }, { 9, 1532, 2048 }, { 10, 1533, 2048 }, { 10, 1534, 2048 }, { 11, 1535, 2048 }, + { 3, 1536, 2048 }, { 4, 1537, 2048 }, { 4, 1538, 2048 }, { 5, 1539, 2048 }, { 4, 1540, 2048 }, { 5, 1541, 2048 }, { 5, 1542, 2048 }, { 6, 1543, 2048 }, + { 4, 1544, 2048 }, { 5, 1545, 2048 }, { 5, 1546, 2048 }, { 6, 1547, 2048 }, { 5, 1548, 2048 }, { 6, 1549, 2048 }, { 6, 1550, 2048 }, { 7, 1551, 2048 }, + { 4, 1552, 2048 }, { 5, 1553, 2048 }, { 5, 1554, 2048 }, { 6, 1555, 2048 }, { 5, 1556, 2048 }, { 6, 1557, 2048 }, { 6, 1558, 2048 }, { 7, 1559, 2048 }, + { 5, 1560, 2048 }, { 6, 1561, 2048 }, { 6, 1562, 2048 }, { 7, 1563, 2048 }, { 6, 1564, 2048 }, { 7, 1565, 2048 }, { 7, 1566, 2048 }, { 8, 1567, 2048 }, + { 4, 1568, 2048 }, { 5, 1569, 2048 }, { 5, 1570, 2048 }, { 6, 1571, 2048 }, { 5, 1572, 2048 }, { 6, 1573, 2048 }, { 6, 1574, 2048 }, { 7, 1575, 2048 }, + { 5, 1576, 2048 }, { 6, 1577, 2048 }, { 6, 1578, 2048 }, { 7, 1579, 2048 }, { 6, 1580, 2048 }, { 7, 1581, 2048 }, { 7, 1582, 2048 }, { 8, 1583, 2048 }, + { 5, 1584, 2048 }, { 6, 1585, 2048 }, { 6, 1586, 2048 }, { 7, 1587, 2048 }, { 6, 1588, 2048 }, { 7, 1589, 2048 }, { 7, 1590, 2048 }, { 8, 1591, 2048 }, + { 6, 1592, 2048 }, { 7, 1593, 2048 }, { 7, 1594, 2048 }, { 8, 1595, 2048 }, { 7, 1596, 2048 }, { 8, 1597, 2048 }, { 8, 1598, 2048 }, { 9, 1599, 2048 }, + { 4, 1600, 2048 }, { 5, 1601, 2048 }, { 5, 1602, 2048 }, { 6, 1603, 2048 }, { 5, 1604, 2048 }, { 6, 1605, 2048 }, { 6, 1606, 2048 }, { 7, 1607, 2048 }, + { 5, 1608, 2048 }, { 6, 1609, 2048 }, { 6, 1610, 2048 }, { 7, 1611, 2048 }, { 6, 1612, 2048 }, { 7, 1613, 2048 }, { 7, 1614, 2048 }, { 8, 1615, 2048 }, + { 5, 1616, 2048 }, { 6, 1617, 2048 }, { 6, 1618, 2048 }, { 7, 1619, 2048 }, { 6, 1620, 2048 }, { 7, 1621, 2048 }, { 7, 1622, 2048 }, { 8, 1623, 2048 }, + { 6, 1624, 2048 }, { 7, 1625, 2048 }, { 7, 1626, 2048 }, { 8, 1627, 2048 }, { 7, 1628, 2048 }, { 8, 1629, 2048 }, { 8, 1630, 2048 }, { 9, 1631, 2048 }, + { 5, 1632, 2048 }, { 6, 1633, 2048 }, { 6, 1634, 2048 }, { 7, 1635, 2048 }, { 6, 1636, 2048 }, { 7, 1637, 2048 }, { 7, 1638, 2048 }, { 8, 1639, 2048 }, + { 6, 1640, 2048 }, { 7, 1641, 2048 }, { 7, 1642, 2048 }, { 8, 1643, 2048 }, { 7, 1644, 2048 }, { 8, 1645, 2048 }, { 8, 1646, 2048 }, { 9, 1647, 2048 }, + { 6, 1648, 2048 }, { 7, 1649, 2048 }, { 7, 1650, 2048 }, { 8, 1651, 2048 }, { 7, 1652, 2048 }, { 8, 1653, 2048 }, { 8, 1654, 2048 }, { 9, 1655, 2048 }, + { 7, 1656, 2048 }, { 8, 1657, 2048 }, { 8, 1658, 2048 }, { 9, 1659, 2048 }, { 8, 1660, 2048 }, { 9, 1661, 2048 }, { 9, 1662, 2048 }, { 10, 1663, 2048 }, + { 4, 1664, 2048 }, { 5, 1665, 2048 }, { 5, 1666, 2048 }, { 6, 1667, 2048 }, { 5, 1668, 2048 }, { 6, 1669, 2048 }, { 6, 1670, 2048 }, { 7, 1671, 2048 }, + { 5, 1672, 2048 }, { 6, 1673, 2048 }, { 6, 1674, 2048 }, { 7, 1675, 2048 }, { 6, 1676, 2048 }, { 7, 1677, 2048 }, { 7, 1678, 2048 }, { 8, 1679, 2048 }, + { 5, 1680, 2048 }, { 6, 1681, 2048 }, { 6, 1682, 2048 }, { 7, 1683, 2048 }, { 6, 1684, 2048 }, { 7, 1685, 2048 }, { 7, 1686, 2048 }, { 8, 1687, 2048 }, + { 6, 1688, 2048 }, { 7, 1689, 2048 }, { 7, 1690, 2048 }, { 8, 1691, 2048 }, { 7, 1692, 2048 }, { 8, 1693, 2048 }, { 8, 1694, 2048 }, { 9, 1695, 2048 }, + { 5, 1696, 2048 }, { 6, 1697, 2048 }, { 6, 1698, 2048 }, { 7, 1699, 2048 }, { 6, 1700, 2048 }, { 7, 1701, 2048 }, { 7, 1702, 2048 }, { 8, 1703, 2048 }, + { 6, 1704, 2048 }, { 7, 1705, 2048 }, { 7, 1706, 2048 }, { 8, 1707, 2048 }, { 7, 1708, 2048 }, { 8, 1709, 2048 }, { 8, 1710, 2048 }, { 9, 1711, 2048 }, + { 6, 1712, 2048 }, { 7, 1713, 2048 }, { 7, 1714, 2048 }, { 8, 1715, 2048 }, { 7, 1716, 2048 }, { 8, 1717, 2048 }, { 8, 1718, 2048 }, { 9, 1719, 2048 }, + { 7, 1720, 2048 }, { 8, 1721, 2048 }, { 8, 1722, 2048 }, { 9, 1723, 2048 }, { 8, 1724, 2048 }, { 9, 1725, 2048 }, { 9, 1726, 2048 }, { 10, 1727, 2048 }, + { 5, 1728, 2048 }, { 6, 1729, 2048 }, { 6, 1730, 2048 }, { 7, 1731, 2048 }, { 6, 1732, 2048 }, { 7, 1733, 2048 }, { 7, 1734, 2048 }, { 8, 1735, 2048 }, + { 6, 1736, 2048 }, { 7, 1737, 2048 }, { 7, 1738, 2048 }, { 8, 1739, 2048 }, { 7, 1740, 2048 }, { 8, 1741, 2048 }, { 8, 1742, 2048 }, { 9, 1743, 2048 }, + { 6, 1744, 2048 }, { 7, 1745, 2048 }, { 7, 1746, 2048 }, { 8, 1747, 2048 }, { 7, 1748, 2048 }, { 8, 1749, 2048 }, { 8, 1750, 2048 }, { 9, 1751, 2048 }, + { 7, 1752, 2048 }, { 8, 1753, 2048 }, { 8, 1754, 2048 }, { 9, 1755, 2048 }, { 8, 1756, 2048 }, { 9, 1757, 2048 }, { 9, 1758, 2048 }, { 10, 1759, 2048 }, + { 6, 1760, 2048 }, { 7, 1761, 2048 }, { 7, 1762, 2048 }, { 8, 1763, 2048 }, { 7, 1764, 2048 }, { 8, 1765, 2048 }, { 8, 1766, 2048 }, { 9, 1767, 2048 }, + { 7, 1768, 2048 }, { 8, 1769, 2048 }, { 8, 1770, 2048 }, { 9, 1771, 2048 }, { 8, 1772, 2048 }, { 9, 1773, 2048 }, { 9, 1774, 2048 }, { 10, 1775, 2048 }, + { 7, 1776, 2048 }, { 8, 1777, 2048 }, { 8, 1778, 2048 }, { 9, 1779, 2048 }, { 8, 1780, 2048 }, { 9, 1781, 2048 }, { 9, 1782, 2048 }, { 10, 1783, 2048 }, + { 8, 1784, 2048 }, { 9, 1785, 2048 }, { 9, 1786, 2048 }, { 10, 1787, 2048 }, { 9, 1788, 2048 }, { 10, 1789, 2048 }, { 10, 1790, 2048 }, { 11, 1791, 2048 }, + { 4, 1792, 2048 }, { 5, 1793, 2048 }, { 5, 1794, 2048 }, { 6, 1795, 2048 }, { 5, 1796, 2048 }, { 6, 1797, 2048 }, { 6, 1798, 2048 }, { 7, 1799, 2048 }, + { 5, 1800, 2048 }, { 6, 1801, 2048 }, { 6, 1802, 2048 }, { 7, 1803, 2048 }, { 6, 1804, 2048 }, { 7, 1805, 2048 }, { 7, 1806, 2048 }, { 8, 1807, 2048 }, + { 5, 1808, 2048 }, { 6, 1809, 2048 }, { 6, 1810, 2048 }, { 7, 1811, 2048 }, { 6, 1812, 2048 }, { 7, 1813, 2048 }, { 7, 1814, 2048 }, { 8, 1815, 2048 }, + { 6, 1816, 2048 }, { 7, 1817, 2048 }, { 7, 1818, 2048 }, { 8, 1819, 2048 }, { 7, 1820, 2048 }, { 8, 1821, 2048 }, { 8, 1822, 2048 }, { 9, 1823, 2048 }, + { 5, 1824, 2048 }, { 6, 1825, 2048 }, { 6, 1826, 2048 }, { 7, 1827, 2048 }, { 6, 1828, 2048 }, { 7, 1829, 2048 }, { 7, 1830, 2048 }, { 8, 1831, 2048 }, + { 6, 1832, 2048 }, { 7, 1833, 2048 }, { 7, 1834, 2048 }, { 8, 1835, 2048 }, { 7, 1836, 2048 }, { 8, 1837, 2048 }, { 8, 1838, 2048 }, { 9, 1839, 2048 }, + { 6, 1840, 2048 }, { 7, 1841, 2048 }, { 7, 1842, 2048 }, { 8, 1843, 2048 }, { 7, 1844, 2048 }, { 8, 1845, 2048 }, { 8, 1846, 2048 }, { 9, 1847, 2048 }, + { 7, 1848, 2048 }, { 8, 1849, 2048 }, { 8, 1850, 2048 }, { 9, 1851, 2048 }, { 8, 1852, 2048 }, { 9, 1853, 2048 }, { 9, 1854, 2048 }, { 10, 1855, 2048 }, + { 5, 1856, 2048 }, { 6, 1857, 2048 }, { 6, 1858, 2048 }, { 7, 1859, 2048 }, { 6, 1860, 2048 }, { 7, 1861, 2048 }, { 7, 1862, 2048 }, { 8, 1863, 2048 }, + { 6, 1864, 2048 }, { 7, 1865, 2048 }, { 7, 1866, 2048 }, { 8, 1867, 2048 }, { 7, 1868, 2048 }, { 8, 1869, 2048 }, { 8, 1870, 2048 }, { 9, 1871, 2048 }, + { 6, 1872, 2048 }, { 7, 1873, 2048 }, { 7, 1874, 2048 }, { 8, 1875, 2048 }, { 7, 1876, 2048 }, { 8, 1877, 2048 }, { 8, 1878, 2048 }, { 9, 1879, 2048 }, + { 7, 1880, 2048 }, { 8, 1881, 2048 }, { 8, 1882, 2048 }, { 9, 1883, 2048 }, { 8, 1884, 2048 }, { 9, 1885, 2048 }, { 9, 1886, 2048 }, { 10, 1887, 2048 }, + { 6, 1888, 2048 }, { 7, 1889, 2048 }, { 7, 1890, 2048 }, { 8, 1891, 2048 }, { 7, 1892, 2048 }, { 8, 1893, 2048 }, { 8, 1894, 2048 }, { 9, 1895, 2048 }, + { 7, 1896, 2048 }, { 8, 1897, 2048 }, { 8, 1898, 2048 }, { 9, 1899, 2048 }, { 8, 1900, 2048 }, { 9, 1901, 2048 }, { 9, 1902, 2048 }, { 10, 1903, 2048 }, + { 7, 1904, 2048 }, { 8, 1905, 2048 }, { 8, 1906, 2048 }, { 9, 1907, 2048 }, { 8, 1908, 2048 }, { 9, 1909, 2048 }, { 9, 1910, 2048 }, { 10, 1911, 2048 }, + { 8, 1912, 2048 }, { 9, 1913, 2048 }, { 9, 1914, 2048 }, { 10, 1915, 2048 }, { 9, 1916, 2048 }, { 10, 1917, 2048 }, { 10, 1918, 2048 }, { 11, 1919, 2048 }, + { 5, 1920, 2048 }, { 6, 1921, 2048 }, { 6, 1922, 2048 }, { 7, 1923, 2048 }, { 6, 1924, 2048 }, { 7, 1925, 2048 }, { 7, 1926, 2048 }, { 8, 1927, 2048 }, + { 6, 1928, 2048 }, { 7, 1929, 2048 }, { 7, 1930, 2048 }, { 8, 1931, 2048 }, { 7, 1932, 2048 }, { 8, 1933, 2048 }, { 8, 1934, 2048 }, { 9, 1935, 2048 }, + { 6, 1936, 2048 }, { 7, 1937, 2048 }, { 7, 1938, 2048 }, { 8, 1939, 2048 }, { 7, 1940, 2048 }, { 8, 1941, 2048 }, { 8, 1942, 2048 }, { 9, 1943, 2048 }, + { 7, 1944, 2048 }, { 8, 1945, 2048 }, { 8, 1946, 2048 }, { 9, 1947, 2048 }, { 8, 1948, 2048 }, { 9, 1949, 2048 }, { 9, 1950, 2048 }, { 10, 1951, 2048 }, + { 6, 1952, 2048 }, { 7, 1953, 2048 }, { 7, 1954, 2048 }, { 8, 1955, 2048 }, { 7, 1956, 2048 }, { 8, 1957, 2048 }, { 8, 1958, 2048 }, { 9, 1959, 2048 }, + { 7, 1960, 2048 }, { 8, 1961, 2048 }, { 8, 1962, 2048 }, { 9, 1963, 2048 }, { 8, 1964, 2048 }, { 9, 1965, 2048 }, { 9, 1966, 2048 }, { 10, 1967, 2048 }, + { 7, 1968, 2048 }, { 8, 1969, 2048 }, { 8, 1970, 2048 }, { 9, 1971, 2048 }, { 8, 1972, 2048 }, { 9, 1973, 2048 }, { 9, 1974, 2048 }, { 10, 1975, 2048 }, + { 8, 1976, 2048 }, { 9, 1977, 2048 }, { 9, 1978, 2048 }, { 10, 1979, 2048 }, { 9, 1980, 2048 }, { 10, 1981, 2048 }, { 10, 1982, 2048 }, { 11, 1983, 2048 }, + { 6, 1984, 2048 }, { 7, 1985, 2048 }, { 7, 1986, 2048 }, { 8, 1987, 2048 }, { 7, 1988, 2048 }, { 8, 1989, 2048 }, { 8, 1990, 2048 }, { 9, 1991, 2048 }, + { 7, 1992, 2048 }, { 8, 1993, 2048 }, { 8, 1994, 2048 }, { 9, 1995, 2048 }, { 8, 1996, 2048 }, { 9, 1997, 2048 }, { 9, 1998, 2048 }, { 10, 1999, 2048 }, + { 7, 2000, 2048 }, { 8, 2001, 2048 }, { 8, 2002, 2048 }, { 9, 2003, 2048 }, { 8, 2004, 2048 }, { 9, 2005, 2048 }, { 9, 2006, 2048 }, { 10, 2007, 2048 }, + { 8, 2008, 2048 }, { 9, 2009, 2048 }, { 9, 2010, 2048 }, { 10, 2011, 2048 }, { 9, 2012, 2048 }, { 10, 2013, 2048 }, { 10, 2014, 2048 }, { 11, 2015, 2048 }, + { 7, 2016, 2048 }, { 8, 2017, 2048 }, { 8, 2018, 2048 }, { 9, 2019, 2048 }, { 8, 2020, 2048 }, { 9, 2021, 2048 }, { 9, 2022, 2048 }, { 10, 2023, 2048 }, + { 8, 2024, 2048 }, { 9, 2025, 2048 }, { 9, 2026, 2048 }, { 10, 2027, 2048 }, { 9, 2028, 2048 }, { 10, 2029, 2048 }, { 10, 2030, 2048 }, { 11, 2031, 2048 }, + { 8, 2032, 2048 }, { 9, 2033, 2048 }, { 9, 2034, 2048 }, { 10, 2035, 2048 }, { 9, 2036, 2048 }, { 10, 2037, 2048 }, { 10, 2038, 2048 }, { 11, 2039, 2048 }, + { 9, 2040, 2048 }, { 10, 2041, 2048 }, { 10, 2042, 2048 }, { 11, 2043, 2048 }, { 10, 2044, 2048 }, { 11, 2045, 2048 }, { 11, 2046, 2048 }, { 12, 2047, 2048 }, +#endif +#endif +#endif +#endif +#endif +#endif +}; + +/* find a hole and free as required */ +static int find_hole(void) +{ + unsigned x; + int y, z; + for (z = 0, y = INT_MAX, x = 0; x < FP_ENTRIES; x++) { + if (fp_cache[x].lru_count < y) { + z = x; + y = fp_cache[x].lru_count; + } + } + + /* decrease all */ + for (x = 0; x < FP_ENTRIES; x++) { + if (fp_cache[x].lru_count > 3) { + --(fp_cache[x].lru_count); + } + } + + /* free entry z */ + if (fp_cache[z].g) { + if (fp_cache[z].mu != NULL) { + mp_clear(fp_cache[z].mu); + fp_cache[z].mu = NULL; + } + ltc_ecc_del_point(fp_cache[z].g); + fp_cache[z].g = NULL; + for (x = 0; x < (1U<<FP_LUT); x++) { + ltc_ecc_del_point(fp_cache[z].LUT[x]); + fp_cache[z].LUT[x] = NULL; + } + fp_cache[z].lru_count = 0; + } + return z; +} + +/* determine if a base is already in the cache and if so, where */ +static int find_base(ecc_point *g) +{ + int x; + for (x = 0; x < FP_ENTRIES; x++) { + if (fp_cache[x].g != NULL && + mp_cmp(fp_cache[x].g->x, g->x) == LTC_MP_EQ && + mp_cmp(fp_cache[x].g->y, g->y) == LTC_MP_EQ && + mp_cmp(fp_cache[x].g->z, g->z) == LTC_MP_EQ) { + break; + } + } + if (x == FP_ENTRIES) { + x = -1; + } + return x; +} + +/* add a new base to the cache */ +static int add_entry(int idx, ecc_point *g) +{ + unsigned x, y; + + /* allocate base and LUT */ + fp_cache[idx].g = ltc_ecc_new_point(); + if (fp_cache[idx].g == NULL) { + return CRYPT_MEM; + } + + /* copy x and y */ + if ((mp_copy(g->x, fp_cache[idx].g->x) != CRYPT_OK) || + (mp_copy(g->y, fp_cache[idx].g->y) != CRYPT_OK) || + (mp_copy(g->z, fp_cache[idx].g->z) != CRYPT_OK)) { + ltc_ecc_del_point(fp_cache[idx].g); + fp_cache[idx].g = NULL; + return CRYPT_MEM; + } + + for (x = 0; x < (1U<<FP_LUT); x++) { + fp_cache[idx].LUT[x] = ltc_ecc_new_point(); + if (fp_cache[idx].LUT[x] == NULL) { + for (y = 0; y < x; y++) { + ltc_ecc_del_point(fp_cache[idx].LUT[y]); + fp_cache[idx].LUT[y] = NULL; + } + ltc_ecc_del_point(fp_cache[idx].g); + fp_cache[idx].g = NULL; + fp_cache[idx].lru_count = 0; + return CRYPT_MEM; + } + } + + fp_cache[idx].lru_count = 0; + return CRYPT_OK; +} + +/* build the LUT by spacing the bits of the input by #modulus/FP_LUT bits apart + * + * The algorithm builds patterns in increasing bit order by first making all + * single bit input patterns, then all two bit input patterns and so on + */ +static int build_lut(int idx, void *modulus, void *mp, void *mu) +{ + unsigned x, y, err, bitlen, lut_gap; + void *tmp; + + tmp = NULL; + + /* sanity check to make sure lut_order table is of correct size, should compile out to a NOP if true */ + if ((sizeof(lut_orders) / sizeof(lut_orders[0])) < (1U<<FP_LUT)) { + err = CRYPT_INVALID_ARG; + goto DONE; + } + + /* get bitlen and round up to next multiple of FP_LUT */ + bitlen = mp_unsigned_bin_size(modulus) << 3; + x = bitlen % FP_LUT; + if (x) { + bitlen += FP_LUT - x; + } + lut_gap = bitlen / FP_LUT; + + /* init the mu */ + if ((err = mp_init_copy(&fp_cache[idx].mu, mu)) != CRYPT_OK) { + goto ERR; + } + + /* copy base */ + if ((mp_mulmod(fp_cache[idx].g->x, mu, modulus, fp_cache[idx].LUT[1]->x) != CRYPT_OK) || + (mp_mulmod(fp_cache[idx].g->y, mu, modulus, fp_cache[idx].LUT[1]->y) != CRYPT_OK) || + (mp_mulmod(fp_cache[idx].g->z, mu, modulus, fp_cache[idx].LUT[1]->z) != CRYPT_OK)) { goto ERR; } + + /* make all single bit entries */ + for (x = 1; x < FP_LUT; x++) { + if ((mp_copy(fp_cache[idx].LUT[1<<(x-1)]->x, fp_cache[idx].LUT[1<<x]->x) != CRYPT_OK) || + (mp_copy(fp_cache[idx].LUT[1<<(x-1)]->y, fp_cache[idx].LUT[1<<x]->y) != CRYPT_OK) || + (mp_copy(fp_cache[idx].LUT[1<<(x-1)]->z, fp_cache[idx].LUT[1<<x]->z) != CRYPT_OK)) { goto ERR; } + + /* now double it bitlen/FP_LUT times */ + for (y = 0; y < lut_gap; y++) { + if ((err = ltc_mp.ecc_ptdbl(fp_cache[idx].LUT[1<<x], fp_cache[idx].LUT[1<<x], modulus, mp)) != CRYPT_OK) { + goto ERR; + } + } + } + + /* now make all entries in increase order of hamming weight */ + for (x = 2; x <= FP_LUT; x++) { + for (y = 0; y < (1UL<<FP_LUT); y++) { + if (lut_orders[y].ham != (int)x) continue; + + /* perform the add */ + if ((err = ltc_mp.ecc_ptadd(fp_cache[idx].LUT[lut_orders[y].terma], fp_cache[idx].LUT[lut_orders[y].termb], + fp_cache[idx].LUT[y], modulus, mp)) != CRYPT_OK) { + goto ERR; + } + } + } + + /* now map all entries back to affine space to make point addition faster */ + if ((err = mp_init(&tmp)) != CRYPT_OK) { goto ERR; } + for (x = 1; x < (1UL<<FP_LUT); x++) { + /* convert z to normal from montgomery */ + if ((err = mp_montgomery_reduce(fp_cache[idx].LUT[x]->z, modulus, mp)) != CRYPT_OK) { goto ERR; } + + /* invert it */ + if ((err = mp_invmod(fp_cache[idx].LUT[x]->z, modulus, fp_cache[idx].LUT[x]->z)) != CRYPT_OK) { goto ERR; } + + /* now square it */ + if ((err = mp_sqrmod(fp_cache[idx].LUT[x]->z, modulus, tmp)) != CRYPT_OK) { goto ERR; } + + /* fix x */ + if ((err = mp_mulmod(fp_cache[idx].LUT[x]->x, tmp, modulus, fp_cache[idx].LUT[x]->x)) != CRYPT_OK) { goto ERR; } + + /* get 1/z^3 */ + if ((err = mp_mulmod(tmp, fp_cache[idx].LUT[x]->z, modulus, tmp)) != CRYPT_OK) { goto ERR; } + + /* fix y */ + if ((err = mp_mulmod(fp_cache[idx].LUT[x]->y, tmp, modulus, fp_cache[idx].LUT[x]->y)) != CRYPT_OK) { goto ERR; } + + /* free z */ + mp_clear(fp_cache[idx].LUT[x]->z); + fp_cache[idx].LUT[x]->z = NULL; + } + mp_clear(tmp); + + return CRYPT_OK; +ERR: + err = CRYPT_MEM; +DONE: + for (y = 0; y < (1U<<FP_LUT); y++) { + ltc_ecc_del_point(fp_cache[idx].LUT[y]); + fp_cache[idx].LUT[y] = NULL; + } + ltc_ecc_del_point(fp_cache[idx].g); + fp_cache[idx].g = NULL; + fp_cache[idx].lru_count = 0; + if (fp_cache[idx].mu != NULL) { + mp_clear(fp_cache[idx].mu); + fp_cache[idx].mu = NULL; + } + if (tmp != NULL) { + mp_clear(tmp); + } + return err; +} + +/* perform a fixed point ECC mulmod */ +static int accel_fp_mul(int idx, void *k, ecc_point *R, void *modulus, void *mp, int map) +{ + unsigned char kb[128]; + int x; + unsigned y, z, err, bitlen, bitpos, lut_gap, first; + void *tk, *order; + + /* if it's smaller than modulus we fine */ + if (mp_unsigned_bin_size(k) > mp_unsigned_bin_size(modulus)) { + /* find order */ + y = mp_unsigned_bin_size(modulus); + for (x = 0; ltc_ecc_sets[x].size; x++) { + if (y <= (unsigned)ltc_ecc_sets[x].size) break; + } + + /* back off if we are on the 521 bit curve */ + if (y == 66) --x; + + if ((err = mp_init(&order)) != CRYPT_OK) { + return err; + } + if ((err = mp_read_radix(order, ltc_ecc_sets[x].order, 16)) != CRYPT_OK) { + mp_clear(&order); + return err; + } + + /* k must be less than modulus */ + if (mp_cmp(k, order) != LTC_MP_LT) { + if ((err = mp_init(&tk)) != CRYPT_OK) { + mp_clear(order); + return err; + } + if ((err = mp_mod(k, order, tk)) != CRYPT_OK) { + mp_clear(tk); + mp_clear(order); + return err; + } + } else { + tk = k; + } + mp_clear(order); + } else { + tk = k; + } + + /* get bitlen and round up to next multiple of FP_LUT */ + bitlen = mp_unsigned_bin_size(modulus) << 3; + x = bitlen % FP_LUT; + if (x) { + bitlen += FP_LUT - x; + } + lut_gap = bitlen / FP_LUT; + + /* get the k value */ + if (mp_unsigned_bin_size(tk) > (sizeof(kb) - 2)) { + if (tk != k) { + mp_clear(tk); + } + return CRYPT_BUFFER_OVERFLOW; + } + + /* store k */ + zeromem(kb, sizeof(kb)); + if ((err = mp_to_unsigned_bin(tk, kb)) != CRYPT_OK) { + if (tk != k) { + mp_clear(tk); + } + return err; + } + + /* let's reverse kb so it's little endian */ + x = 0; + y = mp_unsigned_bin_size(tk) - 1; + if (tk != k) { + mp_clear(tk); + } + while ((unsigned)x < y) { + z = kb[x]; kb[x] = kb[y]; kb[y] = z; + ++x; --y; + } + + /* at this point we can start, yipee */ + first = 1; + for (x = lut_gap-1; x >= 0; x--) { + /* extract FP_LUT bits from kb spread out by lut_gap bits and offset by x bits from the start */ + bitpos = x; + for (y = z = 0; y < FP_LUT; y++) { + z |= ((kb[bitpos>>3] >> (bitpos&7)) & 1) << y; + bitpos += lut_gap; /* it's y*lut_gap + x, but here we can avoid the mult in each loop */ + } + + /* double if not first */ + if (!first) { + if ((err = ltc_mp.ecc_ptdbl(R, R, modulus, mp)) != CRYPT_OK) { + return err; + } + } + + /* add if not first, otherwise copy */ + if (!first && z) { + if ((err = ltc_mp.ecc_ptadd(R, fp_cache[idx].LUT[z], R, modulus, mp)) != CRYPT_OK) { + return err; + } + } else if (z) { + if ((mp_copy(fp_cache[idx].LUT[z]->x, R->x) != CRYPT_OK) || + (mp_copy(fp_cache[idx].LUT[z]->y, R->y) != CRYPT_OK) || + (mp_copy(fp_cache[idx].mu, R->z) != CRYPT_OK)) { return CRYPT_MEM; } + first = 0; + } + } + z = 0; + zeromem(kb, sizeof(kb)); + /* map R back from projective space */ + if (map) { + err = ltc_ecc_map(R, modulus, mp); + } else { + err = CRYPT_OK; + } + return err; +} + +#ifdef LTC_ECC_SHAMIR +/* perform a fixed point ECC mulmod */ +static int accel_fp_mul2add(int idx1, int idx2, + void *kA, void *kB, + ecc_point *R, void *modulus, void *mp) +{ + unsigned char kb[2][128]; + int x; + unsigned y, z, err, bitlen, bitpos, lut_gap, first, zA, zB; + void *tka, *tkb, *order; + + /* if it's smaller than modulus we fine */ + if (mp_unsigned_bin_size(kA) > mp_unsigned_bin_size(modulus)) { + /* find order */ + y = mp_unsigned_bin_size(modulus); + for (x = 0; ltc_ecc_sets[x].size; x++) { + if (y <= (unsigned)ltc_ecc_sets[x].size) break; + } + + /* back off if we are on the 521 bit curve */ + if (y == 66) --x; + + if ((err = mp_init(&order)) != CRYPT_OK) { + return err; + } + if ((err = mp_read_radix(order, ltc_ecc_sets[x].order, 16)) != CRYPT_OK) { + mp_clear(&order); + return err; + } + + /* kA must be less than modulus */ + if (mp_cmp(kA, order) != LTC_MP_LT) { + if ((err = mp_init(&tka)) != CRYPT_OK) { + mp_clear(order); + return err; + } + if ((err = mp_mod(kA, order, tka)) != CRYPT_OK) { + mp_clear(tka); + mp_clear(order); + return err; + } + } else { + tka = kA; + } + mp_clear(order); + } else { + tka = kA; + } + + /* if it's smaller than modulus we fine */ + if (mp_unsigned_bin_size(kB) > mp_unsigned_bin_size(modulus)) { + /* find order */ + y = mp_unsigned_bin_size(modulus); + for (x = 0; ltc_ecc_sets[x].size; x++) { + if (y <= (unsigned)ltc_ecc_sets[x].size) break; + } + + /* back off if we are on the 521 bit curve */ + if (y == 66) --x; + + if ((err = mp_init(&order)) != CRYPT_OK) { + return err; + } + if ((err = mp_read_radix(order, ltc_ecc_sets[x].order, 16)) != CRYPT_OK) { + mp_clear(&order); + return err; + } + + /* kB must be less than modulus */ + if (mp_cmp(kB, order) != LTC_MP_LT) { + if ((err = mp_init(&tkb)) != CRYPT_OK) { + mp_clear(order); + return err; + } + if ((err = mp_mod(kB, order, tkb)) != CRYPT_OK) { + mp_clear(tkb); + mp_clear(order); + return err; + } + } else { + tkb = kB; + } + mp_clear(order); + } else { + tkb = kB; + } + + /* get bitlen and round up to next multiple of FP_LUT */ + bitlen = mp_unsigned_bin_size(modulus) << 3; + x = bitlen % FP_LUT; + if (x) { + bitlen += FP_LUT - x; + } + lut_gap = bitlen / FP_LUT; + + /* get the k value */ + if ((mp_unsigned_bin_size(tka) > (sizeof(kb[0]) - 2)) || (mp_unsigned_bin_size(tkb) > (sizeof(kb[0]) - 2)) ) { + if (tka != kA) { + mp_clear(tka); + } + if (tkb != kB) { + mp_clear(tkb); + } + return CRYPT_BUFFER_OVERFLOW; + } + + /* store k */ + zeromem(kb, sizeof(kb)); + if ((err = mp_to_unsigned_bin(tka, kb[0])) != CRYPT_OK) { + if (tka != kA) { + mp_clear(tka); + } + if (tkb != kB) { + mp_clear(tkb); + } + return err; + } + + /* let's reverse kb so it's little endian */ + x = 0; + y = mp_unsigned_bin_size(tka) - 1; + if (tka != kA) { + mp_clear(tka); + } + while ((unsigned)x < y) { + z = kb[0][x]; kb[0][x] = kb[0][y]; kb[0][y] = z; + ++x; --y; + } + + /* store b */ + if ((err = mp_to_unsigned_bin(tkb, kb[1])) != CRYPT_OK) { + if (tkb != kB) { + mp_clear(tkb); + } + return err; + } + + x = 0; + y = mp_unsigned_bin_size(tkb) - 1; + if (tkb != kB) { + mp_clear(tkb); + } + while ((unsigned)x < y) { + z = kb[1][x]; kb[1][x] = kb[1][y]; kb[1][y] = z; + ++x; --y; + } + + /* at this point we can start, yipee */ + first = 1; + for (x = lut_gap-1; x >= 0; x--) { + /* extract FP_LUT bits from kb spread out by lut_gap bits and offset by x bits from the start */ + bitpos = x; + for (y = zA = zB = 0; y < FP_LUT; y++) { + zA |= ((kb[0][bitpos>>3] >> (bitpos&7)) & 1) << y; + zB |= ((kb[1][bitpos>>3] >> (bitpos&7)) & 1) << y; + bitpos += lut_gap; /* it's y*lut_gap + x, but here we can avoid the mult in each loop */ + } + + /* double if not first */ + if (!first) { + if ((err = ltc_mp.ecc_ptdbl(R, R, modulus, mp)) != CRYPT_OK) { + return err; + } + } + + /* add if not first, otherwise copy */ + if (!first) { + if (zA) { + if ((err = ltc_mp.ecc_ptadd(R, fp_cache[idx1].LUT[zA], R, modulus, mp)) != CRYPT_OK) { + return err; + } + } + if (zB) { + if ((err = ltc_mp.ecc_ptadd(R, fp_cache[idx2].LUT[zB], R, modulus, mp)) != CRYPT_OK) { + return err; + } + } + } else { + if (zA) { + if ((mp_copy(fp_cache[idx1].LUT[zA]->x, R->x) != CRYPT_OK) || + (mp_copy(fp_cache[idx1].LUT[zA]->y, R->y) != CRYPT_OK) || + (mp_copy(fp_cache[idx1].mu, R->z) != CRYPT_OK)) { return CRYPT_MEM; } + first = 0; + } + if (zB && first == 0) { + if (zB) { + if ((err = ltc_mp.ecc_ptadd(R, fp_cache[idx2].LUT[zB], R, modulus, mp)) != CRYPT_OK) { + return err; + } + } + } else if (zB && first == 1) { + if ((mp_copy(fp_cache[idx2].LUT[zB]->x, R->x) != CRYPT_OK) || + (mp_copy(fp_cache[idx2].LUT[zB]->y, R->y) != CRYPT_OK) || + (mp_copy(fp_cache[idx2].mu, R->z) != CRYPT_OK)) { return CRYPT_MEM; } + first = 0; + } + } + } + zeromem(kb, sizeof(kb)); + return ltc_ecc_map(R, modulus, mp); +} + +/** ECC Fixed Point mulmod global + @param k The multiplicand + @param G Base point to multiply + @param R [out] Destination of product + @param modulus The modulus for the curve + @param map [boolean] If non-zero maps the point back to affine co-ordinates, otherwise it's left in jacobian-montgomery form + @return CRYPT_OK if successful +*/ +int ltc_ecc_fp_mul2add(ecc_point *A, void *kA, + ecc_point *B, void *kB, + ecc_point *C, void *modulus) +{ + int idx1, idx2, err; + void *mp, *mu; + + mp = NULL; + mu = NULL; + LTC_MUTEX_LOCK(<c_ecc_fp_lock); + /* find point */ + idx1 = find_base(A); + + /* no entry? */ + if (idx1 == -1) { + /* find hole and add it */ + idx1 = find_hole(); + + if ((err = add_entry(idx1, A)) != CRYPT_OK) { + goto LBL_ERR; + } + } + + /* increment LRU */ + ++(fp_cache[idx1].lru_count); + + /* find point */ + idx2 = find_base(B); + + /* no entry? */ + if (idx2 == -1) { + /* find hole and add it */ + idx2 = find_hole(); + + if ((err = add_entry(idx2, B)) != CRYPT_OK) { + goto LBL_ERR; + } + } + + /* increment LRU */ + ++(fp_cache[idx2].lru_count); + + /* if it's 2 build the LUT, if it's higher just use the LUT */ + if (fp_cache[idx1].lru_count == 2) { + /* compute mp */ + if ((err = mp_montgomery_setup(modulus, &mp)) != CRYPT_OK) { goto LBL_ERR; } + + /* compute mu */ + if ((err = mp_init(&mu)) != CRYPT_OK) { + goto LBL_ERR; + } + if ((err = mp_montgomery_normalization(mu, modulus)) != CRYPT_OK) { + goto LBL_ERR; + } + + /* build the LUT */ + if ((err = build_lut(idx1, modulus, mp, mu)) != CRYPT_OK) { + goto LBL_ERR;; + } + } + + /* if it's 2 build the LUT, if it's higher just use the LUT */ + if (fp_cache[idx2].lru_count == 2) { + if (mp == NULL) { + /* compute mp */ + if ((err = mp_montgomery_setup(modulus, &mp)) != CRYPT_OK) { goto LBL_ERR; } + + /* compute mu */ + if ((err = mp_init(&mu)) != CRYPT_OK) { + goto LBL_ERR; + } + if ((err = mp_montgomery_normalization(mu, modulus)) != CRYPT_OK) { + goto LBL_ERR; + } + } + + /* build the LUT */ + if ((err = build_lut(idx2, modulus, mp, mu)) != CRYPT_OK) { + goto LBL_ERR;; + } + } + + + if (fp_cache[idx1].lru_count >= 2 && fp_cache[idx2].lru_count >= 2) { + if (mp == NULL) { + /* compute mp */ + if ((err = mp_montgomery_setup(modulus, &mp)) != CRYPT_OK) { goto LBL_ERR; } + } + err = accel_fp_mul2add(idx1, idx2, kA, kB, C, modulus, mp); + } else { + err = ltc_ecc_mul2add(A, kA, B, kB, C, modulus); + } +LBL_ERR: + LTC_MUTEX_UNLOCK(<c_ecc_fp_lock); + if (mp != NULL) { + mp_montgomery_free(mp); + } + if (mu != NULL) { + mp_clear(mu); + } + return err; +} +#endif + +/** ECC Fixed Point mulmod global + @param k The multiplicand + @param G Base point to multiply + @param R [out] Destination of product + @param modulus The modulus for the curve + @param map [boolean] If non-zero maps the point back to affine co-ordinates, otherwise it's left in jacobian-montgomery form + @return CRYPT_OK if successful +*/ +int ltc_ecc_fp_mulmod(void *k, ecc_point *G, ecc_point *R, void *modulus, int map) +{ + int idx, err; + void *mp, *mu; + + mp = NULL; + mu = NULL; + LTC_MUTEX_LOCK(<c_ecc_fp_lock); + /* find point */ + idx = find_base(G); + + /* no entry? */ + if (idx == -1) { + /* find hole and add it */ + idx = find_hole(); + + if ((err = add_entry(idx, G)) != CRYPT_OK) { + goto LBL_ERR; + } + } + + /* increment LRU */ + ++(fp_cache[idx].lru_count); + + /* if it's 2 build the LUT, if it's higher just use the LUT */ + if (fp_cache[idx].lru_count == 2) { + /* compute mp */ + if ((err = mp_montgomery_setup(modulus, &mp)) != CRYPT_OK) { goto LBL_ERR; } + + /* compute mu */ + if ((err = mp_init(&mu)) != CRYPT_OK) { + goto LBL_ERR; + } + if ((err = mp_montgomery_normalization(mu, modulus)) != CRYPT_OK) { + goto LBL_ERR; + } + + /* build the LUT */ + if ((err = build_lut(idx, modulus, mp, mu)) != CRYPT_OK) { + goto LBL_ERR;; + } + } + + if (fp_cache[idx].lru_count >= 2) { + if (mp == NULL) { + /* compute mp */ + if ((err = mp_montgomery_setup(modulus, &mp)) != CRYPT_OK) { goto LBL_ERR; } + } + err = accel_fp_mul(idx, k, R, modulus, mp, map); + } else { + err = ltc_ecc_mulmod(k, G, R, modulus, map); + } +LBL_ERR: + LTC_MUTEX_UNLOCK(<c_ecc_fp_lock); + if (mp != NULL) { + mp_montgomery_free(mp); + } + if (mu != NULL) { + mp_clear(mu); + } + return err; +} + +/** Free the Fixed Point tables */ +void ltc_ecc_fp_free(void) +{ + unsigned x, y; + LTC_MUTEX_LOCK(<c_ecc_fp_lock); + for (x = 0; x < FP_ENTRIES; x++) { + if (fp_cache[x].g != NULL) { + for (y = 0; y < (1U<<FP_LUT); y++) { + ltc_ecc_del_point(fp_cache[x].LUT[y]); + fp_cache[x].LUT[y] = NULL; + } + ltc_ecc_del_point(fp_cache[x].g); + fp_cache[x].g = NULL; + if (fp_cache[x].mu != NULL) { + mp_clear(fp_cache[x].mu); + fp_cache[x].mu = NULL; + } + fp_cache[x].lru_count = 0; + } + } + LTC_MUTEX_UNLOCK(<c_ecc_fp_lock); +} + +#endif + + +/* $Source: /cvs/libtom/libtomcrypt/src/math/fp/ltc_ecc_fp_mulmod.c,v $ */ +/* $Revision: 1.27 $ */ +/* $Date: 2006/12/03 00:39:56 $ */ + diff --git a/libtomcrypt/src/math/gmp_desc.c b/libtomcrypt/src/math/gmp_desc.c new file mode 100644 index 0000000..66c279e --- /dev/null +++ b/libtomcrypt/src/math/gmp_desc.c @@ -0,0 +1,478 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ + +#define DESC_DEF_ONLY +#include "tomcrypt.h" + +#ifdef GMP_DESC + +#include <stdio.h> +#include <gmp.h> + +static int init(void **a) +{ + LTC_ARGCHK(a != NULL); + + *a = XCALLOC(1, sizeof(__mpz_struct)); + if (*a == NULL) { + return CRYPT_MEM; + } + mpz_init(((__mpz_struct *)*a)); + return CRYPT_OK; +} + +static void deinit(void *a) +{ + LTC_ARGCHKVD(a != NULL); + mpz_clear(a); + XFREE(a); +} + +static int neg(void *a, void *b) +{ + LTC_ARGCHK(a != NULL); + LTC_ARGCHK(b != NULL); + mpz_neg(b, a); + return CRYPT_OK; +} + +static int copy(void *a, void *b) +{ + LTC_ARGCHK(a != NULL); + LTC_ARGCHK(b != NULL); + mpz_set(b, a); + return CRYPT_OK; +} + +static int init_copy(void **a, void *b) +{ + if (init(a) != CRYPT_OK) { + return CRYPT_MEM; + } + return copy(b, *a); +} + +/* ---- trivial ---- */ +static int set_int(void *a, unsigned long b) +{ + LTC_ARGCHK(a != NULL); + mpz_set_ui(((__mpz_struct *)a), b); + return CRYPT_OK; +} + +static unsigned long get_int(void *a) +{ + LTC_ARGCHK(a != NULL); + return mpz_get_ui(a); +} + +static unsigned long get_digit(void *a, int n) +{ + LTC_ARGCHK(a != NULL); + return mpz_getlimbn(a, n); +} + +static int get_digit_count(void *a) +{ + LTC_ARGCHK(a != NULL); + return mpz_size(a); +} + +static int compare(void *a, void *b) +{ + int ret; + LTC_ARGCHK(a != NULL); + LTC_ARGCHK(b != NULL); + ret = mpz_cmp(a, b); + if (ret < 0) { + return LTC_MP_LT; + } else if (ret > 0) { + return LTC_MP_GT; + } else { + return LTC_MP_EQ; + } +} + +static int compare_d(void *a, unsigned long b) +{ + int ret; + LTC_ARGCHK(a != NULL); + ret = mpz_cmp_ui(((__mpz_struct *)a), b); + if (ret < 0) { + return LTC_MP_LT; + } else if (ret > 0) { + return LTC_MP_GT; + } else { + return LTC_MP_EQ; + } +} + +static int count_bits(void *a) +{ + LTC_ARGCHK(a != NULL); + return mpz_sizeinbase(a, 2); +} + +static int count_lsb_bits(void *a) +{ + LTC_ARGCHK(a != NULL); + return mpz_scan1(a, 0); +} + + +static int twoexpt(void *a, int n) +{ + LTC_ARGCHK(a != NULL); + mpz_set_ui(a, 0); + mpz_setbit(a, n); + return CRYPT_OK; +} + +/* ---- conversions ---- */ + +/* read ascii string */ +static int read_radix(void *a, const char *b, int radix) +{ + LTC_ARGCHK(a != NULL); + LTC_ARGCHK(b != NULL); + mpz_set_str(a, b, radix); + return CRYPT_OK; +} + +/* write one */ +static int write_radix(void *a, char *b, int radix) +{ + LTC_ARGCHK(a != NULL); + LTC_ARGCHK(b != NULL); + mpz_get_str(b, radix, a); + return CRYPT_OK; +} + +/* get size as unsigned char string */ +static unsigned long unsigned_size(void *a) +{ + unsigned long t; + LTC_ARGCHK(a != NULL); + t = mpz_sizeinbase(a, 2); + if (mpz_cmp_ui(((__mpz_struct *)a), 0) == 0) return 0; + return (t>>3) + ((t&7)?1:0); +} + +/* store */ +static int unsigned_write(void *a, unsigned char *b) +{ + LTC_ARGCHK(a != NULL); + LTC_ARGCHK(b != NULL); + mpz_export(b, NULL, 1, 1, 1, 0, ((__mpz_struct*)a)); + return CRYPT_OK; +} + +/* read */ +static int unsigned_read(void *a, unsigned char *b, unsigned long len) +{ + LTC_ARGCHK(a != NULL); + LTC_ARGCHK(b != NULL); + mpz_import(a, len, 1, 1, 1, 0, b); + return CRYPT_OK; +} + +/* add */ +static int add(void *a, void *b, void *c) +{ + LTC_ARGCHK(a != NULL); + LTC_ARGCHK(b != NULL); + LTC_ARGCHK(c != NULL); + mpz_add(c, a, b); + return CRYPT_OK; +} + +static int addi(void *a, unsigned long b, void *c) +{ + LTC_ARGCHK(a != NULL); + LTC_ARGCHK(c != NULL); + mpz_add_ui(c, a, b); + return CRYPT_OK; +} + +/* sub */ +static int sub(void *a, void *b, void *c) +{ + LTC_ARGCHK(a != NULL); + LTC_ARGCHK(b != NULL); + LTC_ARGCHK(c != NULL); + mpz_sub(c, a, b); + return CRYPT_OK; +} + +static int subi(void *a, unsigned long b, void *c) +{ + LTC_ARGCHK(a != NULL); + LTC_ARGCHK(c != NULL); + mpz_sub_ui(c, a, b); + return CRYPT_OK; +} + +/* mul */ +static int mul(void *a, void *b, void *c) +{ + LTC_ARGCHK(a != NULL); + LTC_ARGCHK(b != NULL); + LTC_ARGCHK(c != NULL); + mpz_mul(c, a, b); + return CRYPT_OK; +} + +static int muli(void *a, unsigned long b, void *c) +{ + LTC_ARGCHK(a != NULL); + LTC_ARGCHK(c != NULL); + mpz_mul_ui(c, a, b); + return CRYPT_OK; +} + +/* sqr */ +static int sqr(void *a, void *b) +{ + LTC_ARGCHK(a != NULL); + LTC_ARGCHK(b != NULL); + mpz_mul(b, a, a); + return CRYPT_OK; +} + +/* div */ +static int divide(void *a, void *b, void *c, void *d) +{ + mpz_t tmp; + LTC_ARGCHK(a != NULL); + LTC_ARGCHK(b != NULL); + if (c != NULL) { + mpz_init(tmp); + mpz_divexact(tmp, a, b); + } + if (d != NULL) { + mpz_mod(d, a, b); + } + if (c != NULL) { + mpz_set(c, tmp); + mpz_clear(tmp); + } + return CRYPT_OK; +} + +static int div_2(void *a, void *b) +{ + LTC_ARGCHK(a != NULL); + LTC_ARGCHK(b != NULL); + mpz_divexact_ui(b, a, 2); + return CRYPT_OK; +} + +/* modi */ +static int modi(void *a, unsigned long b, unsigned long *c) +{ + LTC_ARGCHK(a != NULL); + LTC_ARGCHK(c != NULL); + + *c = mpz_fdiv_ui(a, b); + return CRYPT_OK; +} + +/* gcd */ +static int gcd(void *a, void *b, void *c) +{ + LTC_ARGCHK(a != NULL); + LTC_ARGCHK(b != NULL); + LTC_ARGCHK(c != NULL); + mpz_gcd(c, a, b); + return CRYPT_OK; +} + +/* lcm */ +static int lcm(void *a, void *b, void *c) +{ + LTC_ARGCHK(a != NULL); + LTC_ARGCHK(b != NULL); + LTC_ARGCHK(c != NULL); + mpz_lcm(c, a, b); + return CRYPT_OK; +} + +static int mulmod(void *a, void *b, void *c, void *d) +{ + LTC_ARGCHK(a != NULL); + LTC_ARGCHK(b != NULL); + LTC_ARGCHK(c != NULL); + LTC_ARGCHK(d != NULL); + mpz_mul(d, a, b); + mpz_mod(d, d, c); + return CRYPT_OK; +} + +static int sqrmod(void *a, void *b, void *c) +{ + LTC_ARGCHK(a != NULL); + LTC_ARGCHK(b != NULL); + LTC_ARGCHK(c != NULL); + mpz_mul(c, a, a); + mpz_mod(c, c, b); + return CRYPT_OK; +} + +/* invmod */ +static int invmod(void *a, void *b, void *c) +{ + LTC_ARGCHK(a != NULL); + LTC_ARGCHK(b != NULL); + LTC_ARGCHK(c != NULL); + mpz_invert(c, a, b); + return CRYPT_OK; +} + +/* setup */ +static int montgomery_setup(void *a, void **b) +{ + LTC_ARGCHK(a != NULL); + LTC_ARGCHK(b != NULL); + *b = (void *)1; + return CRYPT_OK; +} + +/* get normalization value */ +static int montgomery_normalization(void *a, void *b) +{ + LTC_ARGCHK(a != NULL); + LTC_ARGCHK(b != NULL); + mpz_set_ui(a, 1); + return CRYPT_OK; +} + +/* reduce */ +static int montgomery_reduce(void *a, void *b, void *c) +{ + LTC_ARGCHK(a != NULL); + LTC_ARGCHK(b != NULL); + LTC_ARGCHK(c != NULL); + mpz_mod(a, a, b); + return CRYPT_OK; +} + +/* clean up */ +static void montgomery_deinit(void *a) +{ +} + +static int exptmod(void *a, void *b, void *c, void *d) +{ + LTC_ARGCHK(a != NULL); + LTC_ARGCHK(b != NULL); + LTC_ARGCHK(c != NULL); + LTC_ARGCHK(d != NULL); + mpz_powm(d, a, b, c); + return CRYPT_OK; +} + +static int isprime(void *a, int *b) +{ + LTC_ARGCHK(a != NULL); + LTC_ARGCHK(b != NULL); + *b = mpz_probab_prime_p(a, 8) > 0 ? LTC_MP_YES : LTC_MP_NO; + return CRYPT_OK; +} + +const ltc_math_descriptor gmp_desc = { + "GNU MP", + sizeof(mp_limb_t) * CHAR_BIT - GMP_NAIL_BITS, + + &init, + &init_copy, + &deinit, + + &neg, + ©, + + &set_int, + &get_int, + &get_digit, + &get_digit_count, + &compare, + &compare_d, + &count_bits, + &count_lsb_bits, + &twoexpt, + + &read_radix, + &write_radix, + &unsigned_size, + &unsigned_write, + &unsigned_read, + + &add, + &addi, + &sub, + &subi, + &mul, + &muli, + &sqr, + ÷, + &div_2, + &modi, + &gcd, + &lcm, + + &mulmod, + &sqrmod, + &invmod, + + &montgomery_setup, + &montgomery_normalization, + &montgomery_reduce, + &montgomery_deinit, + + &exptmod, + &isprime, + +#ifdef MECC +#ifdef MECC_FP + <c_ecc_fp_mulmod, +#else + <c_ecc_mulmod, +#endif /* MECC_FP */ + <c_ecc_projective_add_point, + <c_ecc_projective_dbl_point, + <c_ecc_map, +#ifdef LTC_ECC_SHAMIR +#ifdef MECC_FP + <c_ecc_fp_mul2add, +#else + <c_ecc_mul2add, +#endif /* MECC_FP */ +#else + NULL, +#endif /* LTC_ECC_SHAMIR */ +#else + NULL, NULL, NULL, NULL, NULL +#endif /* MECC */ + +#ifdef MRSA + &rsa_make_key, + &rsa_exptmod, +#else + NULL, NULL +#endif + +}; + + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/math/gmp_desc.c,v $ */ +/* $Revision: 1.14 $ */ +/* $Date: 2006/12/03 00:39:56 $ */ diff --git a/libtomcrypt/src/math/ltm_desc.c b/libtomcrypt/src/math/ltm_desc.c new file mode 100644 index 0000000..07fdd5a --- /dev/null +++ b/libtomcrypt/src/math/ltm_desc.c @@ -0,0 +1,483 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ + +#define DESC_DEF_ONLY +#include "tomcrypt.h" + +#ifdef LTM_DESC + +#include <tommath.h> + +static const struct { + int mpi_code, ltc_code; +} mpi_to_ltc_codes[] = { + { MP_OKAY , CRYPT_OK}, + { MP_MEM , CRYPT_MEM}, + { MP_VAL , CRYPT_INVALID_ARG}, +}; + +/** + Convert a MPI error to a LTC error (Possibly the most powerful function ever! Oh wait... no) + @param err The error to convert + @return The equivalent LTC error code or CRYPT_ERROR if none found +*/ +static int mpi_to_ltc_error(int err) +{ + int x; + + for (x = 0; x < (int)(sizeof(mpi_to_ltc_codes)/sizeof(mpi_to_ltc_codes[0])); x++) { + if (err == mpi_to_ltc_codes[x].mpi_code) { + return mpi_to_ltc_codes[x].ltc_code; + } + } + return CRYPT_ERROR; +} + +static int init(void **a) +{ + int err; + + LTC_ARGCHK(a != NULL); + + *a = XCALLOC(1, sizeof(mp_int)); + if (*a == NULL) { + return CRYPT_MEM; + } + + if ((err = mpi_to_ltc_error(mp_init(*a))) != CRYPT_OK) { + XFREE(*a); + } + return err; +} + +static void deinit(void *a) +{ + LTC_ARGCHKVD(a != NULL); + mp_clear(a); + XFREE(a); +} + +static int neg(void *a, void *b) +{ + LTC_ARGCHK(a != NULL); + LTC_ARGCHK(b != NULL); + return mpi_to_ltc_error(mp_neg(a, b)); +} + +static int copy(void *a, void *b) +{ + LTC_ARGCHK(a != NULL); + LTC_ARGCHK(b != NULL); + return mpi_to_ltc_error(mp_copy(a, b)); +} + +static int init_copy(void **a, void *b) +{ + if (init(a) != CRYPT_OK) { + return CRYPT_MEM; + } + return copy(b, *a); +} + +/* ---- trivial ---- */ +static int set_int(void *a, unsigned long b) +{ + LTC_ARGCHK(a != NULL); + return mpi_to_ltc_error(mp_set_int(a, b)); +} + +static unsigned long get_int(void *a) +{ + LTC_ARGCHK(a != NULL); + return mp_get_int(a); +} + +static unsigned long get_digit(void *a, int n) +{ + mp_int *A; + LTC_ARGCHK(a != NULL); + A = a; + return (n >= A->used || n < 0) ? 0 : A->dp[n]; +} + +static int get_digit_count(void *a) +{ + mp_int *A; + LTC_ARGCHK(a != NULL); + A = a; + return A->used; +} + +static int compare(void *a, void *b) +{ + int ret; + LTC_ARGCHK(a != NULL); + LTC_ARGCHK(b != NULL); + ret = mp_cmp(a, b); + switch (ret) { + case MP_LT: return LTC_MP_LT; + case MP_EQ: return LTC_MP_EQ; + case MP_GT: return LTC_MP_GT; + } + return 0; +} + +static int compare_d(void *a, unsigned long b) +{ + int ret; + LTC_ARGCHK(a != NULL); + ret = mp_cmp_d(a, b); + switch (ret) { + case MP_LT: return LTC_MP_LT; + case MP_EQ: return LTC_MP_EQ; + case MP_GT: return LTC_MP_GT; + } + return 0; +} + +static int count_bits(void *a) +{ + LTC_ARGCHK(a != NULL); + return mp_count_bits(a); +} + +static int count_lsb_bits(void *a) +{ + LTC_ARGCHK(a != NULL); + return mp_cnt_lsb(a); +} + + +static int twoexpt(void *a, int n) +{ + LTC_ARGCHK(a != NULL); + return mpi_to_ltc_error(mp_2expt(a, n)); +} + +/* ---- conversions ---- */ + +/* read ascii string */ +static int read_radix(void *a, const char *b, int radix) +{ + LTC_ARGCHK(a != NULL); + LTC_ARGCHK(b != NULL); + return mpi_to_ltc_error(mp_read_radix(a, b, radix)); +} + +/* write one */ +static int write_radix(void *a, char *b, int radix) +{ + LTC_ARGCHK(a != NULL); + LTC_ARGCHK(b != NULL); + return mpi_to_ltc_error(mp_toradix(a, b, radix)); +} + +/* get size as unsigned char string */ +static unsigned long unsigned_size(void *a) +{ + LTC_ARGCHK(a != NULL); + return mp_unsigned_bin_size(a); +} + +/* store */ +static int unsigned_write(void *a, unsigned char *b) +{ + LTC_ARGCHK(a != NULL); + LTC_ARGCHK(b != NULL); + return mpi_to_ltc_error(mp_to_unsigned_bin(a, b)); +} + +/* read */ +static int unsigned_read(void *a, unsigned char *b, unsigned long len) +{ + LTC_ARGCHK(a != NULL); + LTC_ARGCHK(b != NULL); + return mpi_to_ltc_error(mp_read_unsigned_bin(a, b, len)); +} + +/* add */ +static int add(void *a, void *b, void *c) +{ + LTC_ARGCHK(a != NULL); + LTC_ARGCHK(b != NULL); + LTC_ARGCHK(c != NULL); + return mpi_to_ltc_error(mp_add(a, b, c)); +} + +static int addi(void *a, unsigned long b, void *c) +{ + LTC_ARGCHK(a != NULL); + LTC_ARGCHK(c != NULL); + return mpi_to_ltc_error(mp_add_d(a, b, c)); +} + +/* sub */ +static int sub(void *a, void *b, void *c) +{ + LTC_ARGCHK(a != NULL); + LTC_ARGCHK(b != NULL); + LTC_ARGCHK(c != NULL); + return mpi_to_ltc_error(mp_sub(a, b, c)); +} + +static int subi(void *a, unsigned long b, void *c) +{ + LTC_ARGCHK(a != NULL); + LTC_ARGCHK(c != NULL); + return mpi_to_ltc_error(mp_sub_d(a, b, c)); +} + +/* mul */ +static int mul(void *a, void *b, void *c) +{ + LTC_ARGCHK(a != NULL); + LTC_ARGCHK(b != NULL); + LTC_ARGCHK(c != NULL); + return mpi_to_ltc_error(mp_mul(a, b, c)); +} + +static int muli(void *a, unsigned long b, void *c) +{ + LTC_ARGCHK(a != NULL); + LTC_ARGCHK(c != NULL); + return mpi_to_ltc_error(mp_mul_d(a, b, c)); +} + +/* sqr */ +static int sqr(void *a, void *b) +{ + LTC_ARGCHK(a != NULL); + LTC_ARGCHK(b != NULL); + return mpi_to_ltc_error(mp_sqr(a, b)); +} + +/* div */ +static int divide(void *a, void *b, void *c, void *d) +{ + LTC_ARGCHK(a != NULL); + LTC_ARGCHK(b != NULL); + return mpi_to_ltc_error(mp_div(a, b, c, d)); +} + +static int div_2(void *a, void *b) +{ + LTC_ARGCHK(a != NULL); + LTC_ARGCHK(b != NULL); + return mpi_to_ltc_error(mp_div_2(a, b)); +} + +/* modi */ +static int modi(void *a, unsigned long b, unsigned long *c) +{ + mp_digit tmp; + int err; + + LTC_ARGCHK(a != NULL); + LTC_ARGCHK(c != NULL); + + if ((err = mpi_to_ltc_error(mp_mod_d(a, b, &tmp))) != CRYPT_OK) { + return err; + } + *c = tmp; + return CRYPT_OK; +} + +/* gcd */ +static int gcd(void *a, void *b, void *c) +{ + LTC_ARGCHK(a != NULL); + LTC_ARGCHK(b != NULL); + LTC_ARGCHK(c != NULL); + return mpi_to_ltc_error(mp_gcd(a, b, c)); +} + +/* lcm */ +static int lcm(void *a, void *b, void *c) +{ + LTC_ARGCHK(a != NULL); + LTC_ARGCHK(b != NULL); + LTC_ARGCHK(c != NULL); + return mpi_to_ltc_error(mp_lcm(a, b, c)); +} + +static int mulmod(void *a, void *b, void *c, void *d) +{ + LTC_ARGCHK(a != NULL); + LTC_ARGCHK(b != NULL); + LTC_ARGCHK(c != NULL); + LTC_ARGCHK(d != NULL); + return mpi_to_ltc_error(mp_mulmod(a,b,c,d)); +} + +static int sqrmod(void *a, void *b, void *c) +{ + LTC_ARGCHK(a != NULL); + LTC_ARGCHK(b != NULL); + LTC_ARGCHK(c != NULL); + return mpi_to_ltc_error(mp_sqrmod(a,b,c)); +} + +/* invmod */ +static int invmod(void *a, void *b, void *c) +{ + LTC_ARGCHK(a != NULL); + LTC_ARGCHK(b != NULL); + LTC_ARGCHK(c != NULL); + return mpi_to_ltc_error(mp_invmod(a, b, c)); +} + +/* setup */ +static int montgomery_setup(void *a, void **b) +{ + int err; + LTC_ARGCHK(a != NULL); + LTC_ARGCHK(b != NULL); + *b = XCALLOC(1, sizeof(mp_digit)); + if (*b == NULL) { + return CRYPT_MEM; + } + if ((err = mpi_to_ltc_error(mp_montgomery_setup(a, (mp_digit *)*b))) != CRYPT_OK) { + XFREE(*b); + } + return err; +} + +/* get normalization value */ +static int montgomery_normalization(void *a, void *b) +{ + LTC_ARGCHK(a != NULL); + LTC_ARGCHK(b != NULL); + return mpi_to_ltc_error(mp_montgomery_calc_normalization(a, b)); +} + +/* reduce */ +static int montgomery_reduce(void *a, void *b, void *c) +{ + LTC_ARGCHK(a != NULL); + LTC_ARGCHK(b != NULL); + LTC_ARGCHK(c != NULL); + return mpi_to_ltc_error(mp_montgomery_reduce(a, b, *((mp_digit *)c))); +} + +/* clean up */ +static void montgomery_deinit(void *a) +{ + XFREE(a); +} + +static int exptmod(void *a, void *b, void *c, void *d) +{ + LTC_ARGCHK(a != NULL); + LTC_ARGCHK(b != NULL); + LTC_ARGCHK(c != NULL); + LTC_ARGCHK(d != NULL); + return mpi_to_ltc_error(mp_exptmod(a,b,c,d)); +} + +static int isprime(void *a, int *b) +{ + int err; + LTC_ARGCHK(a != NULL); + LTC_ARGCHK(b != NULL); + err = mpi_to_ltc_error(mp_prime_is_prime(a, 8, b)); + *b = (*b == MP_YES) ? LTC_MP_YES : LTC_MP_NO; + return err; +} + +const ltc_math_descriptor ltm_desc = { + + "LibTomMath", + (int)DIGIT_BIT, + + &init, + &init_copy, + &deinit, + + &neg, + ©, + + &set_int, + &get_int, + &get_digit, + &get_digit_count, + &compare, + &compare_d, + &count_bits, + &count_lsb_bits, + &twoexpt, + + &read_radix, + &write_radix, + &unsigned_size, + &unsigned_write, + &unsigned_read, + + &add, + &addi, + &sub, + &subi, + &mul, + &muli, + &sqr, + ÷, + &div_2, + &modi, + &gcd, + &lcm, + + &mulmod, + &sqrmod, + &invmod, + + &montgomery_setup, + &montgomery_normalization, + &montgomery_reduce, + &montgomery_deinit, + + &exptmod, + &isprime, + +#ifdef MECC +#ifdef MECC_FP + <c_ecc_fp_mulmod, +#else + <c_ecc_mulmod, +#endif + <c_ecc_projective_add_point, + <c_ecc_projective_dbl_point, + <c_ecc_map, +#ifdef LTC_ECC_SHAMIR +#ifdef MECC_FP + <c_ecc_fp_mul2add, +#else + <c_ecc_mul2add, +#endif /* MECC_FP */ +#else + NULL, +#endif /* LTC_ECC_SHAMIR */ +#else + NULL, NULL, NULL, NULL, NULL, +#endif /* MECC */ + +#ifdef MRSA + &rsa_make_key, + &rsa_exptmod, +#else + NULL, NULL +#endif +}; + + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/math/ltm_desc.c,v $ */ +/* $Revision: 1.29 $ */ +/* $Date: 2006/12/03 00:39:56 $ */ diff --git a/libtomcrypt/src/math/multi.c b/libtomcrypt/src/math/multi.c new file mode 100644 index 0000000..8ee4d79 --- /dev/null +++ b/libtomcrypt/src/math/multi.c @@ -0,0 +1,61 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +#ifdef MPI +#include <stdarg.h> + +int ltc_init_multi(void **a, ...) +{ + void **cur = a; + int np = 0; + va_list args; + + va_start(args, a); + while (cur != NULL) { + if (mp_init(cur) != CRYPT_OK) { + /* failed */ + va_list clean_list; + + va_start(clean_list, a); + cur = a; + while (np--) { + mp_clear(*cur); + cur = va_arg(clean_list, void**); + } + va_end(clean_list); + return CRYPT_MEM; + } + ++np; + cur = va_arg(args, void**); + } + va_end(args); + return CRYPT_OK; +} + +void ltc_deinit_multi(void *a, ...) +{ + void *cur = a; + va_list args; + + va_start(args, a); + while (cur != NULL) { + mp_clear(cur); + cur = va_arg(args, void *); + } + va_end(args); +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/math/multi.c,v $ */ +/* $Revision: 1.5 $ */ +/* $Date: 2006/03/31 14:15:35 $ */ diff --git a/libtomcrypt/src/math/rand_prime.c b/libtomcrypt/src/math/rand_prime.c new file mode 100644 index 0000000..05477fe --- /dev/null +++ b/libtomcrypt/src/math/rand_prime.c @@ -0,0 +1,87 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file rand_prime.c + Generate a random prime, Tom St Denis +*/ + +#define USE_BBS 1 + +int rand_prime(void *N, long len, prng_state *prng, int wprng) +{ + int err, res, type; + unsigned char *buf; + + LTC_ARGCHK(N != NULL); + + /* get type */ + if (len < 0) { + type = USE_BBS; + len = -len; + } else { + type = 0; + } + + /* allow sizes between 2 and 512 bytes for a prime size */ + if (len < 2 || len > 512) { + return CRYPT_INVALID_PRIME_SIZE; + } + + /* valid PRNG? Better be! */ + if ((err = prng_is_valid(wprng)) != CRYPT_OK) { + return err; + } + + /* allocate buffer to work with */ + buf = XCALLOC(1, len); + if (buf == NULL) { + return CRYPT_MEM; + } + + do { + /* generate value */ + if (prng_descriptor[wprng].read(buf, len, prng) != (unsigned long)len) { + XFREE(buf); + return CRYPT_ERROR_READPRNG; + } + + /* munge bits */ + buf[0] |= 0x80 | 0x40; + buf[len-1] |= 0x01 | ((type & USE_BBS) ? 0x02 : 0x00); + + /* load value */ + if ((err = mp_read_unsigned_bin(N, buf, len)) != CRYPT_OK) { + XFREE(buf); + return err; + } + + /* test */ + if ((err = mp_prime_is_prime(N, 8, &res)) != CRYPT_OK) { + XFREE(buf); + return err; + } + } while (res == LTC_MP_NO); + +#ifdef LTC_CLEAN_STACK + zeromem(buf, len); +#endif + + XFREE(buf); + return CRYPT_OK; +} + + + +/* $Source: /cvs/libtom/libtomcrypt/src/math/rand_prime.c,v $ */ +/* $Revision: 1.6 $ */ +/* $Date: 2006/03/31 14:15:35 $ */ diff --git a/libtomcrypt/src/math/tfm_desc.c b/libtomcrypt/src/math/tfm_desc.c new file mode 100644 index 0000000..023756d --- /dev/null +++ b/libtomcrypt/src/math/tfm_desc.c @@ -0,0 +1,777 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ + +#define DESC_DEF_ONLY +#include "tomcrypt.h" + +#ifdef TFM_DESC + +#include <tfm.h> + +static const struct { + int tfm_code, ltc_code; +} tfm_to_ltc_codes[] = { + { FP_OKAY , CRYPT_OK}, + { FP_MEM , CRYPT_MEM}, + { FP_VAL , CRYPT_INVALID_ARG}, +}; + +/** + Convert a tfm error to a LTC error (Possibly the most powerful function ever! Oh wait... no) + @param err The error to convert + @return The equivalent LTC error code or CRYPT_ERROR if none found +*/ +static int tfm_to_ltc_error(int err) +{ + int x; + + for (x = 0; x < (int)(sizeof(tfm_to_ltc_codes)/sizeof(tfm_to_ltc_codes[0])); x++) { + if (err == tfm_to_ltc_codes[x].tfm_code) { + return tfm_to_ltc_codes[x].ltc_code; + } + } + return CRYPT_ERROR; +} + +static int init(void **a) +{ + LTC_ARGCHK(a != NULL); + + *a = XCALLOC(1, sizeof(fp_int)); + if (*a == NULL) { + return CRYPT_MEM; + } + fp_init(*a); + return CRYPT_OK; +} + +static void deinit(void *a) +{ + LTC_ARGCHKVD(a != NULL); + XFREE(a); +} + +static int neg(void *a, void *b) +{ + LTC_ARGCHK(a != NULL); + LTC_ARGCHK(b != NULL); + fp_neg(((fp_int*)a), ((fp_int*)b)); + return CRYPT_OK; +} + +static int copy(void *a, void *b) +{ + LTC_ARGCHK(a != NULL); + LTC_ARGCHK(b != NULL); + fp_copy(a, b); + return CRYPT_OK; +} + +static int init_copy(void **a, void *b) +{ + if (init(a) != CRYPT_OK) { + return CRYPT_MEM; + } + return copy(b, *a); +} + +/* ---- trivial ---- */ +static int set_int(void *a, unsigned long b) +{ + LTC_ARGCHK(a != NULL); + fp_set(a, b); + return CRYPT_OK; +} + +static unsigned long get_int(void *a) +{ + fp_int *A; + LTC_ARGCHK(a != NULL); + A = a; + return A->used > 0 ? A->dp[0] : 0; +} + +static unsigned long get_digit(void *a, int n) +{ + fp_int *A; + LTC_ARGCHK(a != NULL); + A = a; + return (n >= A->used || n < 0) ? 0 : A->dp[n]; +} + +static int get_digit_count(void *a) +{ + fp_int *A; + LTC_ARGCHK(a != NULL); + A = a; + return A->used; +} + +static int compare(void *a, void *b) +{ + int ret; + LTC_ARGCHK(a != NULL); + LTC_ARGCHK(b != NULL); + ret = fp_cmp(a, b); + switch (ret) { + case FP_LT: return LTC_MP_LT; + case FP_EQ: return LTC_MP_EQ; + case FP_GT: return LTC_MP_GT; + } + return 0; +} + +static int compare_d(void *a, unsigned long b) +{ + int ret; + LTC_ARGCHK(a != NULL); + ret = fp_cmp_d(a, b); + switch (ret) { + case FP_LT: return LTC_MP_LT; + case FP_EQ: return LTC_MP_EQ; + case FP_GT: return LTC_MP_GT; + } + return 0; +} + +static int count_bits(void *a) +{ + LTC_ARGCHK(a != NULL); + return fp_count_bits(a); +} + +static int count_lsb_bits(void *a) +{ + LTC_ARGCHK(a != NULL); + return fp_cnt_lsb(a); +} + +static int twoexpt(void *a, int n) +{ + LTC_ARGCHK(a != NULL); + fp_2expt(a, n); + return CRYPT_OK; +} + +/* ---- conversions ---- */ + +/* read ascii string */ +static int read_radix(void *a, const char *b, int radix) +{ + LTC_ARGCHK(a != NULL); + LTC_ARGCHK(b != NULL); + return tfm_to_ltc_error(fp_read_radix(a, (char *)b, radix)); +} + +/* write one */ +static int write_radix(void *a, char *b, int radix) +{ + LTC_ARGCHK(a != NULL); + LTC_ARGCHK(b != NULL); + return tfm_to_ltc_error(fp_toradix(a, b, radix)); +} + +/* get size as unsigned char string */ +static unsigned long unsigned_size(void *a) +{ + LTC_ARGCHK(a != NULL); + return fp_unsigned_bin_size(a); +} + +/* store */ +static int unsigned_write(void *a, unsigned char *b) +{ + LTC_ARGCHK(a != NULL); + LTC_ARGCHK(b != NULL); + fp_to_unsigned_bin(a, b); + return CRYPT_OK; +} + +/* read */ +static int unsigned_read(void *a, unsigned char *b, unsigned long len) +{ + LTC_ARGCHK(a != NULL); + LTC_ARGCHK(b != NULL); + fp_read_unsigned_bin(a, b, len); + return CRYPT_OK; +} + +/* add */ +static int add(void *a, void *b, void *c) +{ + LTC_ARGCHK(a != NULL); + LTC_ARGCHK(b != NULL); + LTC_ARGCHK(c != NULL); + fp_add(a, b, c); + return CRYPT_OK; +} + +static int addi(void *a, unsigned long b, void *c) +{ + LTC_ARGCHK(a != NULL); + LTC_ARGCHK(c != NULL); + fp_add_d(a, b, c); + return CRYPT_OK; +} + +/* sub */ +static int sub(void *a, void *b, void *c) +{ + LTC_ARGCHK(a != NULL); + LTC_ARGCHK(b != NULL); + LTC_ARGCHK(c != NULL); + fp_sub(a, b, c); + return CRYPT_OK; +} + +static int subi(void *a, unsigned long b, void *c) +{ + LTC_ARGCHK(a != NULL); + LTC_ARGCHK(c != NULL); + fp_sub_d(a, b, c); + return CRYPT_OK; +} + +/* mul */ +static int mul(void *a, void *b, void *c) +{ + LTC_ARGCHK(a != NULL); + LTC_ARGCHK(b != NULL); + LTC_ARGCHK(c != NULL); + fp_mul(a, b, c); + return CRYPT_OK; +} + +static int muli(void *a, unsigned long b, void *c) +{ + LTC_ARGCHK(a != NULL); + LTC_ARGCHK(c != NULL); + fp_mul_d(a, b, c); + return CRYPT_OK; +} + +/* sqr */ +static int sqr(void *a, void *b) +{ + LTC_ARGCHK(a != NULL); + LTC_ARGCHK(b != NULL); + fp_sqr(a, b); + return CRYPT_OK; +} + +/* div */ +static int divide(void *a, void *b, void *c, void *d) +{ + LTC_ARGCHK(a != NULL); + LTC_ARGCHK(b != NULL); + return tfm_to_ltc_error(fp_div(a, b, c, d)); +} + +static int div_2(void *a, void *b) +{ + LTC_ARGCHK(a != NULL); + LTC_ARGCHK(b != NULL); + fp_div_2(a, b); + return CRYPT_OK; +} + +/* modi */ +static int modi(void *a, unsigned long b, unsigned long *c) +{ + fp_digit tmp; + int err; + + LTC_ARGCHK(a != NULL); + LTC_ARGCHK(c != NULL); + + if ((err = tfm_to_ltc_error(fp_mod_d(a, b, &tmp))) != CRYPT_OK) { + return err; + } + *c = tmp; + return CRYPT_OK; +} + +/* gcd */ +static int gcd(void *a, void *b, void *c) +{ + LTC_ARGCHK(a != NULL); + LTC_ARGCHK(b != NULL); + LTC_ARGCHK(c != NULL); + fp_gcd(a, b, c); + return CRYPT_OK; +} + +/* lcm */ +static int lcm(void *a, void *b, void *c) +{ + LTC_ARGCHK(a != NULL); + LTC_ARGCHK(b != NULL); + LTC_ARGCHK(c != NULL); + fp_lcm(a, b, c); + return CRYPT_OK; +} + +static int mulmod(void *a, void *b, void *c, void *d) +{ + LTC_ARGCHK(a != NULL); + LTC_ARGCHK(b != NULL); + LTC_ARGCHK(c != NULL); + LTC_ARGCHK(d != NULL); + return tfm_to_ltc_error(fp_mulmod(a,b,c,d)); +} + +static int sqrmod(void *a, void *b, void *c) +{ + LTC_ARGCHK(a != NULL); + LTC_ARGCHK(b != NULL); + LTC_ARGCHK(c != NULL); + return tfm_to_ltc_error(fp_sqrmod(a,b,c)); +} + +/* invmod */ +static int invmod(void *a, void *b, void *c) +{ + LTC_ARGCHK(a != NULL); + LTC_ARGCHK(b != NULL); + LTC_ARGCHK(c != NULL); + return tfm_to_ltc_error(fp_invmod(a, b, c)); +} + +/* setup */ +static int montgomery_setup(void *a, void **b) +{ + int err; + LTC_ARGCHK(a != NULL); + LTC_ARGCHK(b != NULL); + *b = XCALLOC(1, sizeof(fp_digit)); + if (*b == NULL) { + return CRYPT_MEM; + } + if ((err = tfm_to_ltc_error(fp_montgomery_setup(a, (fp_digit *)*b))) != CRYPT_OK) { + XFREE(*b); + } + return err; +} + +/* get normalization value */ +static int montgomery_normalization(void *a, void *b) +{ + LTC_ARGCHK(a != NULL); + LTC_ARGCHK(b != NULL); + fp_montgomery_calc_normalization(a, b); + return CRYPT_OK; +} + +/* reduce */ +static int montgomery_reduce(void *a, void *b, void *c) +{ + LTC_ARGCHK(a != NULL); + LTC_ARGCHK(b != NULL); + LTC_ARGCHK(c != NULL); + fp_montgomery_reduce(a, b, *((fp_digit *)c)); + return CRYPT_OK; +} + +/* clean up */ +static void montgomery_deinit(void *a) +{ + XFREE(a); +} + +static int exptmod(void *a, void *b, void *c, void *d) +{ + LTC_ARGCHK(a != NULL); + LTC_ARGCHK(b != NULL); + LTC_ARGCHK(c != NULL); + LTC_ARGCHK(d != NULL); + return tfm_to_ltc_error(fp_exptmod(a,b,c,d)); +} + +static int isprime(void *a, int *b) +{ + LTC_ARGCHK(a != NULL); + LTC_ARGCHK(b != NULL); + *b = (fp_isprime(a) == FP_YES) ? LTC_MP_YES : LTC_MP_NO; + return CRYPT_OK; +} + +#if defined(MECC) && defined(MECC_ACCEL) + +static int tfm_ecc_projective_dbl_point(ecc_point *P, ecc_point *R, void *modulus, void *Mp) +{ + fp_int t1, t2; + fp_digit mp; + + LTC_ARGCHK(P != NULL); + LTC_ARGCHK(R != NULL); + LTC_ARGCHK(modulus != NULL); + LTC_ARGCHK(Mp != NULL); + + mp = *((fp_digit*)Mp); + + fp_init(&t1); + fp_init(&t2); + + if (P != R) { + fp_copy(P->x, R->x); + fp_copy(P->y, R->y); + fp_copy(P->z, R->z); + } + + /* t1 = Z * Z */ + fp_sqr(R->z, &t1); + fp_montgomery_reduce(&t1, modulus, mp); + /* Z = Y * Z */ + fp_mul(R->z, R->y, R->z); + fp_montgomery_reduce(R->z, modulus, mp); + /* Z = 2Z */ + fp_add(R->z, R->z, R->z); + if (fp_cmp(R->z, modulus) != FP_LT) { + fp_sub(R->z, modulus, R->z); + } + + /* &t2 = X - T1 */ + fp_sub(R->x, &t1, &t2); + if (fp_cmp_d(&t2, 0) == FP_LT) { + fp_add(&t2, modulus, &t2); + } + /* T1 = X + T1 */ + fp_add(&t1, R->x, &t1); + if (fp_cmp(&t1, modulus) != FP_LT) { + fp_sub(&t1, modulus, &t1); + } + /* T2 = T1 * T2 */ + fp_mul(&t1, &t2, &t2); + fp_montgomery_reduce(&t2, modulus, mp); + /* T1 = 2T2 */ + fp_add(&t2, &t2, &t1); + if (fp_cmp(&t1, modulus) != FP_LT) { + fp_sub(&t1, modulus, &t1); + } + /* T1 = T1 + T2 */ + fp_add(&t1, &t2, &t1); + if (fp_cmp(&t1, modulus) != FP_LT) { + fp_sub(&t1, modulus, &t1); + } + + /* Y = 2Y */ + fp_add(R->y, R->y, R->y); + if (fp_cmp(R->y, modulus) != FP_LT) { + fp_sub(R->y, modulus, R->y); + } + /* Y = Y * Y */ + fp_sqr(R->y, R->y); + fp_montgomery_reduce(R->y, modulus, mp); + /* T2 = Y * Y */ + fp_sqr(R->y, &t2); + fp_montgomery_reduce(&t2, modulus, mp); + /* T2 = T2/2 */ + if (fp_isodd(&t2)) { + fp_add(&t2, modulus, &t2); + } + fp_div_2(&t2, &t2); + /* Y = Y * X */ + fp_mul(R->y, R->x, R->y); + fp_montgomery_reduce(R->y, modulus, mp); + + /* X = T1 * T1 */ + fp_sqr(&t1, R->x); + fp_montgomery_reduce(R->x, modulus, mp); + /* X = X - Y */ + fp_sub(R->x, R->y, R->x); + if (fp_cmp_d(R->x, 0) == FP_LT) { + fp_add(R->x, modulus, R->x); + } + /* X = X - Y */ + fp_sub(R->x, R->y, R->x); + if (fp_cmp_d(R->x, 0) == FP_LT) { + fp_add(R->x, modulus, R->x); + } + + /* Y = Y - X */ + fp_sub(R->y, R->x, R->y); + if (fp_cmp_d(R->y, 0) == FP_LT) { + fp_add(R->y, modulus, R->y); + } + /* Y = Y * T1 */ + fp_mul(R->y, &t1, R->y); + fp_montgomery_reduce(R->y, modulus, mp); + /* Y = Y - T2 */ + fp_sub(R->y, &t2, R->y); + if (fp_cmp_d(R->y, 0) == FP_LT) { + fp_add(R->y, modulus, R->y); + } + + return CRYPT_OK; +} + +/** + Add two ECC points + @param P The point to add + @param Q The point to add + @param R [out] The destination of the double + @param modulus The modulus of the field the ECC curve is in + @param mp The "b" value from montgomery_setup() + @return CRYPT_OK on success +*/ +static int tfm_ecc_projective_add_point(ecc_point *P, ecc_point *Q, ecc_point *R, void *modulus, void *Mp) +{ + fp_int t1, t2, x, y, z; + fp_digit mp; + + LTC_ARGCHK(P != NULL); + LTC_ARGCHK(Q != NULL); + LTC_ARGCHK(R != NULL); + LTC_ARGCHK(modulus != NULL); + LTC_ARGCHK(Mp != NULL); + + mp = *((fp_digit*)Mp); + + fp_init(&t1); + fp_init(&t2); + fp_init(&x); + fp_init(&y); + fp_init(&z); + + /* should we dbl instead? */ + fp_sub(modulus, Q->y, &t1); + if ( (fp_cmp(P->x, Q->x) == FP_EQ) && + (Q->z != NULL && fp_cmp(P->z, Q->z) == FP_EQ) && + (fp_cmp(P->y, Q->y) == FP_EQ || fp_cmp(P->y, &t1) == FP_EQ)) { + return tfm_ecc_projective_dbl_point(P, R, modulus, Mp); + } + + fp_copy(P->x, &x); + fp_copy(P->y, &y); + fp_copy(P->z, &z); + + /* if Z is one then these are no-operations */ + if (Q->z != NULL) { + /* T1 = Z' * Z' */ + fp_sqr(Q->z, &t1); + fp_montgomery_reduce(&t1, modulus, mp); + /* X = X * T1 */ + fp_mul(&t1, &x, &x); + fp_montgomery_reduce(&x, modulus, mp); + /* T1 = Z' * T1 */ + fp_mul(Q->z, &t1, &t1); + fp_montgomery_reduce(&t1, modulus, mp); + /* Y = Y * T1 */ + fp_mul(&t1, &y, &y); + fp_montgomery_reduce(&y, modulus, mp); + } + + /* T1 = Z*Z */ + fp_sqr(&z, &t1); + fp_montgomery_reduce(&t1, modulus, mp); + /* T2 = X' * T1 */ + fp_mul(Q->x, &t1, &t2); + fp_montgomery_reduce(&t2, modulus, mp); + /* T1 = Z * T1 */ + fp_mul(&z, &t1, &t1); + fp_montgomery_reduce(&t1, modulus, mp); + /* T1 = Y' * T1 */ + fp_mul(Q->y, &t1, &t1); + fp_montgomery_reduce(&t1, modulus, mp); + + /* Y = Y - T1 */ + fp_sub(&y, &t1, &y); + if (fp_cmp_d(&y, 0) == FP_LT) { + fp_add(&y, modulus, &y); + } + /* T1 = 2T1 */ + fp_add(&t1, &t1, &t1); + if (fp_cmp(&t1, modulus) != FP_LT) { + fp_sub(&t1, modulus, &t1); + } + /* T1 = Y + T1 */ + fp_add(&t1, &y, &t1); + if (fp_cmp(&t1, modulus) != FP_LT) { + fp_sub(&t1, modulus, &t1); + } + /* X = X - T2 */ + fp_sub(&x, &t2, &x); + if (fp_cmp_d(&x, 0) == FP_LT) { + fp_add(&x, modulus, &x); + } + /* T2 = 2T2 */ + fp_add(&t2, &t2, &t2); + if (fp_cmp(&t2, modulus) != FP_LT) { + fp_sub(&t2, modulus, &t2); + } + /* T2 = X + T2 */ + fp_add(&t2, &x, &t2); + if (fp_cmp(&t2, modulus) != FP_LT) { + fp_sub(&t2, modulus, &t2); + } + + /* if Z' != 1 */ + if (Q->z != NULL) { + /* Z = Z * Z' */ + fp_mul(&z, Q->z, &z); + fp_montgomery_reduce(&z, modulus, mp); + } + + /* Z = Z * X */ + fp_mul(&z, &x, &z); + fp_montgomery_reduce(&z, modulus, mp); + + /* T1 = T1 * X */ + fp_mul(&t1, &x, &t1); + fp_montgomery_reduce(&t1, modulus, mp); + /* X = X * X */ + fp_sqr(&x, &x); + fp_montgomery_reduce(&x, modulus, mp); + /* T2 = T2 * x */ + fp_mul(&t2, &x, &t2); + fp_montgomery_reduce(&t2, modulus, mp); + /* T1 = T1 * X */ + fp_mul(&t1, &x, &t1); + fp_montgomery_reduce(&t1, modulus, mp); + + /* X = Y*Y */ + fp_sqr(&y, &x); + fp_montgomery_reduce(&x, modulus, mp); + /* X = X - T2 */ + fp_sub(&x, &t2, &x); + if (fp_cmp_d(&x, 0) == FP_LT) { + fp_add(&x, modulus, &x); + } + + /* T2 = T2 - X */ + fp_sub(&t2, &x, &t2); + if (fp_cmp_d(&t2, 0) == FP_LT) { + fp_add(&t2, modulus, &t2); + } + /* T2 = T2 - X */ + fp_sub(&t2, &x, &t2); + if (fp_cmp_d(&t2, 0) == FP_LT) { + fp_add(&t2, modulus, &t2); + } + /* T2 = T2 * Y */ + fp_mul(&t2, &y, &t2); + fp_montgomery_reduce(&t2, modulus, mp); + /* Y = T2 - T1 */ + fp_sub(&t2, &t1, &y); + if (fp_cmp_d(&y, 0) == FP_LT) { + fp_add(&y, modulus, &y); + } + /* Y = Y/2 */ + if (fp_isodd(&y)) { + fp_add(&y, modulus, &y); + } + fp_div_2(&y, &y); + + fp_copy(&x, R->x); + fp_copy(&y, R->y); + fp_copy(&z, R->z); + + return CRYPT_OK; +} + + +#endif + +const ltc_math_descriptor tfm_desc = { + + "TomsFastMath", + (int)DIGIT_BIT, + + &init, + &init_copy, + &deinit, + + &neg, + ©, + + &set_int, + &get_int, + &get_digit, + &get_digit_count, + &compare, + &compare_d, + &count_bits, + &count_lsb_bits, + &twoexpt, + + &read_radix, + &write_radix, + &unsigned_size, + &unsigned_write, + &unsigned_read, + + &add, + &addi, + &sub, + &subi, + &mul, + &muli, + &sqr, + ÷, + &div_2, + &modi, + &gcd, + &lcm, + + &mulmod, + &sqrmod, + &invmod, + + &montgomery_setup, + &montgomery_normalization, + &montgomery_reduce, + &montgomery_deinit, + + &exptmod, + &isprime, + +#ifdef MECC +#ifdef MECC_FP + <c_ecc_fp_mulmod, +#else + <c_ecc_mulmod, +#endif /* MECC_FP */ +#ifdef MECC_ACCEL + &tfm_ecc_projective_add_point, + &tfm_ecc_projective_dbl_point, +#else + <c_ecc_projective_add_point, + <c_ecc_projective_dbl_point, +#endif /* MECC_ACCEL */ + <c_ecc_map, +#ifdef LTC_ECC_SHAMIR +#ifdef MECC_FP + <c_ecc_fp_mul2add, +#else + <c_ecc_mul2add, +#endif /* MECC_FP */ +#else + NULL, +#endif /* LTC_ECC_SHAMIR */ +#else + NULL, NULL, NULL, NULL, NULL, +#endif /* MECC */ + +#ifdef MRSA + &rsa_make_key, + &rsa_exptmod, +#else + NULL, NULL +#endif + +}; + + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/math/tfm_desc.c,v $ */ +/* $Revision: 1.26 $ */ +/* $Date: 2006/12/03 00:39:56 $ */ diff --git a/libtomcrypt/src/misc/base64/base64_decode.c b/libtomcrypt/src/misc/base64/base64_decode.c new file mode 100644 index 0000000..6a39baf --- /dev/null +++ b/libtomcrypt/src/misc/base64/base64_decode.c @@ -0,0 +1,104 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file base64_decode.c + Compliant base64 code donated by Wayne Scott (wscott@bitmover.com) +*/ + + +#ifdef BASE64 + +static const unsigned char map[256] = { +255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, +255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, +255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, +255, 255, 255, 255, 255, 255, 255, 62, 255, 255, 255, 63, + 52, 53, 54, 55, 56, 57, 58, 59, 60, 61, 255, 255, +255, 254, 255, 255, 255, 0, 1, 2, 3, 4, 5, 6, + 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, + 19, 20, 21, 22, 23, 24, 25, 255, 255, 255, 255, 255, +255, 26, 27, 28, 29, 30, 31, 32, 33, 34, 35, 36, + 37, 38, 39, 40, 41, 42, 43, 44, 45, 46, 47, 48, + 49, 50, 51, 255, 255, 255, 255, 255, 255, 255, 255, 255, +255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, +255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, +255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, +255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, +255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, +255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, +255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, +255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, +255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, +255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, +255, 255, 255, 255 }; + +/** + base64 decode a block of memory + @param in The base64 data to decode + @param inlen The length of the base64 data + @param out [out] The destination of the binary decoded data + @param outlen [in/out] The max size and resulting size of the decoded data + @return CRYPT_OK if successful +*/ +int base64_decode(const unsigned char *in, unsigned long inlen, + unsigned char *out, unsigned long *outlen) +{ + unsigned long t, x, y, z; + unsigned char c; + int g; + + LTC_ARGCHK(in != NULL); + LTC_ARGCHK(out != NULL); + LTC_ARGCHK(outlen != NULL); + + g = 3; + for (x = y = z = t = 0; x < inlen; x++) { + c = map[in[x]&0xFF]; + if (c == 255) continue; + /* the final = symbols are read and used to trim the remaining bytes */ + if (c == 254) { + c = 0; + /* prevent g < 0 which would potentially allow an overflow later */ + if (--g < 0) { + return CRYPT_INVALID_PACKET; + } + } else if (g != 3) { + /* we only allow = to be at the end */ + return CRYPT_INVALID_PACKET; + } + + t = (t<<6)|c; + + if (++y == 4) { + if (z + g > *outlen) { + return CRYPT_BUFFER_OVERFLOW; + } + out[z++] = (unsigned char)((t>>16)&255); + if (g > 1) out[z++] = (unsigned char)((t>>8)&255); + if (g > 2) out[z++] = (unsigned char)(t&255); + y = t = 0; + } + } + if (y != 0) { + return CRYPT_INVALID_PACKET; + } + *outlen = z; + return CRYPT_OK; +} + +#endif + + +/* $Source: /cvs/libtom/libtomcrypt/src/misc/base64/base64_decode.c,v $ */ +/* $Revision: 1.4 $ */ +/* $Date: 2006/03/31 14:15:35 $ */ diff --git a/libtomcrypt/src/misc/base64/base64_encode.c b/libtomcrypt/src/misc/base64/base64_encode.c new file mode 100644 index 0000000..ac4df35 --- /dev/null +++ b/libtomcrypt/src/misc/base64/base64_encode.c @@ -0,0 +1,81 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file base64_encode.c + Compliant base64 encoder donated by Wayne Scott (wscott@bitmover.com) +*/ + + +#ifdef BASE64 + +static const char *codes = +"ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/"; + +/** + base64 Encode a buffer (NUL terminated) + @param in The input buffer to encode + @param inlen The length of the input buffer + @param out [out] The destination of the base64 encoded data + @param outlen [in/out] The max size and resulting size + @return CRYPT_OK if successful +*/ +int base64_encode(const unsigned char *in, unsigned long inlen, + unsigned char *out, unsigned long *outlen) +{ + unsigned long i, len2, leven; + unsigned char *p; + + LTC_ARGCHK(in != NULL); + LTC_ARGCHK(out != NULL); + LTC_ARGCHK(outlen != NULL); + + /* valid output size ? */ + len2 = 4 * ((inlen + 2) / 3); + if (*outlen < len2 + 1) { + *outlen = len2 + 1; + return CRYPT_BUFFER_OVERFLOW; + } + p = out; + leven = 3*(inlen / 3); + for (i = 0; i < leven; i += 3) { + *p++ = codes[(in[0] >> 2) & 0x3F]; + *p++ = codes[(((in[0] & 3) << 4) + (in[1] >> 4)) & 0x3F]; + *p++ = codes[(((in[1] & 0xf) << 2) + (in[2] >> 6)) & 0x3F]; + *p++ = codes[in[2] & 0x3F]; + in += 3; + } + /* Pad it if necessary... */ + if (i < inlen) { + unsigned a = in[0]; + unsigned b = (i+1 < inlen) ? in[1] : 0; + + *p++ = codes[(a >> 2) & 0x3F]; + *p++ = codes[(((a & 3) << 4) + (b >> 4)) & 0x3F]; + *p++ = (i+1 < inlen) ? codes[(((b & 0xf) << 2)) & 0x3F] : '='; + *p++ = '='; + } + + /* append a NULL byte */ + *p = '\0'; + + /* return ok */ + *outlen = p - out; + return CRYPT_OK; +} + +#endif + + +/* $Source: /cvs/libtom/libtomcrypt/src/misc/base64/base64_encode.c,v $ */ +/* $Revision: 1.5 $ */ +/* $Date: 2006/06/16 21:53:41 $ */ diff --git a/libtomcrypt/src/misc/burn_stack.c b/libtomcrypt/src/misc/burn_stack.c new file mode 100644 index 0000000..0beee92 --- /dev/null +++ b/libtomcrypt/src/misc/burn_stack.c @@ -0,0 +1,34 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file burn_stack.c + Burn stack, Tom St Denis +*/ + +/** + Burn some stack memory + @param len amount of stack to burn in bytes +*/ +void burn_stack(unsigned long len) +{ + unsigned char buf[32]; + zeromem(buf, sizeof(buf)); + if (len > (unsigned long)sizeof(buf)) + burn_stack(len - sizeof(buf)); +} + + + +/* $Source: /cvs/libtom/libtomcrypt/src/misc/burn_stack.c,v $ */ +/* $Revision: 1.4 $ */ +/* $Date: 2006/03/31 14:15:35 $ */ diff --git a/libtomcrypt/src/misc/crypt/crypt.c b/libtomcrypt/src/misc/crypt/crypt.c new file mode 100644 index 0000000..8603943 --- /dev/null +++ b/libtomcrypt/src/misc/crypt/crypt.c @@ -0,0 +1,366 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file crypt.c + Build strings, Tom St Denis +*/ + +/* +const char *crypt_build_settings = + "LibTomCrypt " SCRYPT " (Tom St Denis, tomstdenis@gmail.com)\n" + "LibTomCrypt is public domain software.\n" + "Built on " __DATE__ " at " __TIME__ "\n\n\n" + "Endianess: " +#if defined(ENDIAN_NEUTRAL) + "neutral\n" +#elif defined(ENDIAN_LITTLE) + "little" + #if defined(ENDIAN_32BITWORD) + " (32-bit words)\n" + #else + " (64-bit words)\n" + #endif +#elif defined(ENDIAN_BIG) + "big" + #if defined(ENDIAN_32BITWORD) + " (32-bit words)\n" + #else + " (64-bit words)\n" + #endif +#endif + "Clean stack: " +#if defined(LTC_CLEAN_STACK) + "enabled\n" +#else + "disabled\n" +#endif + "Ciphers built-in:\n" +#if defined(BLOWFISH) + " Blowfish\n" +#endif +#if defined(RC2) + " RC2\n" +#endif +#if defined(RC5) + " RC5\n" +#endif +#if defined(RC6) + " RC6\n" +#endif +#if defined(SAFERP) + " Safer+\n" +#endif +#if defined(SAFER) + " Safer\n" +#endif +#if defined(RIJNDAEL) + " Rijndael\n" +#endif +#if defined(XTEA) + " XTEA\n" +#endif +#if defined(TWOFISH) + " Twofish " + #if defined(TWOFISH_SMALL) && defined(TWOFISH_TABLES) && defined(TWOFISH_ALL_TABLES) + "(small, tables, all_tables)\n" + #elif defined(TWOFISH_SMALL) && defined(TWOFISH_TABLES) + "(small, tables)\n" + #elif defined(TWOFISH_SMALL) && defined(TWOFISH_ALL_TABLES) + "(small, all_tables)\n" + #elif defined(TWOFISH_TABLES) && defined(TWOFISH_ALL_TABLES) + "(tables, all_tables)\n" + #elif defined(TWOFISH_SMALL) + "(small)\n" + #elif defined(TWOFISH_TABLES) + "(tables)\n" + #elif defined(TWOFISH_ALL_TABLES) + "(all_tables)\n" + #else + "\n" + #endif +#endif +#if defined(DES) + " DES\n" +#endif +#if defined(CAST5) + " CAST5\n" +#endif +#if defined(NOEKEON) + " Noekeon\n" +#endif +#if defined(SKIPJACK) + " Skipjack\n" +#endif +#if defined(KHAZAD) + " Khazad\n" +#endif +#if defined(ANUBIS) + " Anubis " +#endif +#if defined(ANUBIS_TWEAK) + " (tweaked)" +#endif + "\n" +#if defined(KSEED) + " KSEED\n" +#endif +#if defined(LTC_KASUMI) + " KASUMI\n" +#endif + + "\nHashes built-in:\n" +#if defined(SHA512) + " SHA-512\n" +#endif +#if defined(SHA384) + " SHA-384\n" +#endif +#if defined(SHA256) + " SHA-256\n" +#endif +#if defined(SHA224) + " SHA-224\n" +#endif +#if defined(TIGER) + " TIGER\n" +#endif +#if defined(SHA1) + " SHA1\n" +#endif +#if defined(MD5) + " MD5\n" +#endif +#if defined(MD4) + " MD4\n" +#endif +#if defined(MD2) + " MD2\n" +#endif +#if defined(RIPEMD128) + " RIPEMD128\n" +#endif +#if defined(RIPEMD160) + " RIPEMD160\n" +#endif +#if defined(WHIRLPOOL) + " WHIRLPOOL\n" +#endif +#if defined(CHC_HASH) + " CHC_HASH \n" +#endif + + "\nBlock Chaining Modes:\n" +#if defined(LTC_CFB_MODE) + " CFB\n" +#endif +#if defined(LTC_OFB_MODE) + " OFB\n" +#endif +#if defined(LTC_ECB_MODE) + " ECB\n" +#endif +#if defined(LTC_CBC_MODE) + " CBC\n" +#endif +#if defined(LTC_CTR_MODE) + " CTR " +#endif +#if defined(LTC_CTR_OLD) + " (CTR_OLD) " +#endif + "\n" +#if defined(LRW_MODE) + " LRW_MODE" +#if defined(LRW_TABLES) + " (LRW_TABLES) " +#endif + "\n" +#endif +#if defined(LTC_F8_MODE) + " F8 MODE\n" +#endif + + "\nMACs:\n" +#if defined(LTC_HMAC) + " HMAC\n" +#endif +#if defined(LTC_OMAC) + " OMAC\n" +#endif +#if defined(LTC_PMAC) + " PMAC\n" +#endif +#if defined(PELICAN) + " PELICAN\n" +#endif +#if defined(LTC_XCBC) + " XCBC-MAC\n" +#endif +#if defined(LTC_F9_MODE) + " F9-MAC\n" +#endif + + "\nENC + AUTH modes:\n" +#if defined(EAX_MODE) + " EAX_MODE\n" +#endif +#if defined(OCB_MODE) + " OCB_MODE\n" +#endif +#if defined(CCM_MODE) + " CCM_MODE\n" +#endif +#if defined(GCM_MODE) + " GCM_MODE " +#endif +#if defined(GCM_TABLES) + " (GCM_TABLES) " +#endif + "\n" + + "\nPRNG:\n" +#if defined(YARROW) + " Yarrow\n" +#endif +#if defined(SPRNG) + " SPRNG\n" +#endif +#if defined(RC4) + " RC4\n" +#endif +#if defined(FORTUNA) + " Fortuna\n" +#endif +#if defined(SOBER128) + " SOBER128\n" +#endif + + "\nPK Algs:\n" +#if defined(MRSA) + " RSA \n" +#endif +#if defined(MECC) + " ECC\n" +#endif +#if defined(MDSA) + " DSA\n" +#endif +#if defined(MKAT) + " Katja\n" +#endif + + "\nCompiler:\n" +#if defined(WIN32) + " WIN32 platform detected.\n" +#endif +#if defined(__CYGWIN__) + " CYGWIN Detected.\n" +#endif +#if defined(__DJGPP__) + " DJGPP Detected.\n" +#endif +#if defined(_MSC_VER) + " MSVC compiler detected.\n" +#endif +#if defined(__GNUC__) + " GCC compiler detected.\n" +#endif +#if defined(INTEL_CC) + " Intel C Compiler detected.\n" +#endif +#if defined(__x86_64__) + " x86-64 detected.\n" +#endif +#if defined(LTC_PPC32) + " LTC_PPC32 defined \n" +#endif + + "\nVarious others: " +#if defined(BASE64) + " BASE64 " +#endif +#if defined(MPI) + " MPI " +#endif +#if defined(TRY_UNRANDOM_FIRST) + " TRY_UNRANDOM_FIRST " +#endif +#if defined(LTC_TEST) + " LTC_TEST " +#endif +#if defined(PKCS_1) + " PKCS#1 " +#endif +#if defined(PKCS_5) + " PKCS#5 " +#endif +#if defined(LTC_SMALL_CODE) + " LTC_SMALL_CODE " +#endif +#if defined(LTC_NO_FILE) + " LTC_NO_FILE " +#endif +#if defined(LTC_DER) + " LTC_DER " +#endif +#if defined(LTC_FAST) + " LTC_FAST " +#endif +#if defined(LTC_NO_FAST) + " LTC_NO_FAST " +#endif +#if defined(LTC_NO_BSWAP) + " LTC_NO_BSWAP " +#endif +#if defined(LTC_NO_ASM) + " LTC_NO_ASM " +#endif +#if defined(LTC_NO_TEST) + " LTC_NO_TEST " +#endif +#if defined(LTC_NO_TABLES) + " LTC_NO_TABLES " +#endif +#if defined(LTC_PTHREAD) + " LTC_PTHREAD " +#endif +#if defined(LTM_DESC) + " LTM_DESC " +#endif +#if defined(TFM_DESC) + " TFM_DESC " +#endif +#if defined(MECC_ACCEL) + " MECC_ACCEL " +#endif +#if defined(GMP_DESC) + " GMP_DESC " +#endif +#if defined(LTC_EASY) + " (easy) " +#endif +#if defined(MECC_FP) + " MECC_FP " +#endif +#if defined(LTC_ECC_SHAMIR) + " LTC_ECC_SHAMIR " +#endif + "\n" + "\n\n\n" + ; + */ + + +/* $Source: /cvs/libtom/libtomcrypt/src/misc/crypt/crypt.c,v $ */ +/* $Revision: 1.27 $ */ +/* $Date: 2006/12/03 03:50:45 $ */ diff --git a/libtomcrypt/src/misc/crypt/crypt_argchk.c b/libtomcrypt/src/misc/crypt/crypt_argchk.c new file mode 100644 index 0000000..c6675ef --- /dev/null +++ b/libtomcrypt/src/misc/crypt/crypt_argchk.c @@ -0,0 +1,30 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" +#include <signal.h> + +/** + @file crypt_argchk.c + Perform argument checking, Tom St Denis +*/ + +#if (ARGTYPE == 0) +void crypt_argchk(char *v, char *s, int d) +{ + fprintf(stderr, "LTC_ARGCHK '%s' failure on line %d of file %s\n", + v, d, s); + (void)raise(SIGABRT); +} +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/misc/crypt/crypt_argchk.c,v $ */ +/* $Revision: 1.4 $ */ +/* $Date: 2006/03/31 14:15:35 $ */ diff --git a/libtomcrypt/src/misc/crypt/crypt_cipher_descriptor.c b/libtomcrypt/src/misc/crypt/crypt_cipher_descriptor.c new file mode 100644 index 0000000..880c149 --- /dev/null +++ b/libtomcrypt/src/misc/crypt/crypt_cipher_descriptor.c @@ -0,0 +1,27 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file crypt_cipher_descriptor.c + Stores the cipher descriptor table, Tom St Denis +*/ + +struct ltc_cipher_descriptor cipher_descriptor[TAB_SIZE] = { +{ NULL, 0, 0, 0, 0, 0, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL } + }; + +LTC_MUTEX_GLOBAL(ltc_cipher_mutex) + + +/* $Source: /cvs/libtom/libtomcrypt/src/misc/crypt/crypt_cipher_descriptor.c,v $ */ +/* $Revision: 1.12 $ */ +/* $Date: 2006/11/08 23:01:06 $ */ diff --git a/libtomcrypt/src/misc/crypt/crypt_cipher_is_valid.c b/libtomcrypt/src/misc/crypt/crypt_cipher_is_valid.c new file mode 100644 index 0000000..0f8202b --- /dev/null +++ b/libtomcrypt/src/misc/crypt/crypt_cipher_is_valid.c @@ -0,0 +1,36 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file crypt_cipher_is_valid.c + Determine if cipher is valid, Tom St Denis +*/ + +/* + Test if a cipher index is valid + @param idx The index of the cipher to search for + @return CRYPT_OK if valid +*/ +int cipher_is_valid(int idx) +{ + LTC_MUTEX_LOCK(<c_cipher_mutex); + if (idx < 0 || idx >= TAB_SIZE || cipher_descriptor[idx].name == NULL) { + LTC_MUTEX_UNLOCK(<c_cipher_mutex); + return CRYPT_INVALID_CIPHER; + } + LTC_MUTEX_UNLOCK(<c_cipher_mutex); + return CRYPT_OK; +} + +/* $Source: /cvs/libtom/libtomcrypt/src/misc/crypt/crypt_cipher_is_valid.c,v $ */ +/* $Revision: 1.5 $ */ +/* $Date: 2006/03/31 14:15:35 $ */ diff --git a/libtomcrypt/src/misc/crypt/crypt_find_cipher.c b/libtomcrypt/src/misc/crypt/crypt_find_cipher.c new file mode 100644 index 0000000..27c59eb --- /dev/null +++ b/libtomcrypt/src/misc/crypt/crypt_find_cipher.c @@ -0,0 +1,41 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file crypt_find_cipher.c + Find a cipher in the descriptor tables, Tom St Denis +*/ + +/** + Find a registered cipher by name + @param name The name of the cipher to look for + @return >= 0 if found, -1 if not present +*/ +int find_cipher(const char *name) +{ + int x; + LTC_ARGCHK(name != NULL); + LTC_MUTEX_LOCK(<c_cipher_mutex); + for (x = 0; x < TAB_SIZE; x++) { + if (cipher_descriptor[x].name != NULL && !XSTRCMP(cipher_descriptor[x].name, name)) { + LTC_MUTEX_UNLOCK(<c_cipher_mutex); + return x; + } + } + LTC_MUTEX_UNLOCK(<c_cipher_mutex); + return -1; +} + + +/* $Source: /cvs/libtom/libtomcrypt/src/misc/crypt/crypt_find_cipher.c,v $ */ +/* $Revision: 1.6 $ */ +/* $Date: 2006/11/29 23:43:57 $ */ diff --git a/libtomcrypt/src/misc/crypt/crypt_find_cipher_any.c b/libtomcrypt/src/misc/crypt/crypt_find_cipher_any.c new file mode 100644 index 0000000..393eded --- /dev/null +++ b/libtomcrypt/src/misc/crypt/crypt_find_cipher_any.c @@ -0,0 +1,50 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file crypt_find_cipher_any.c + Find a cipher in the descriptor tables, Tom St Denis +*/ + +/** + Find a cipher flexibly. First by name then if not present by block and key size + @param name The name of the cipher desired + @param blocklen The minimum length of the block cipher desired (octets) + @param keylen The minimum length of the key size desired (octets) + @return >= 0 if found, -1 if not present +*/ +int find_cipher_any(const char *name, int blocklen, int keylen) +{ + int x; + + LTC_ARGCHK(name != NULL); + + x = find_cipher(name); + if (x != -1) return x; + + LTC_MUTEX_LOCK(<c_cipher_mutex); + for (x = 0; x < TAB_SIZE; x++) { + if (cipher_descriptor[x].name == NULL) { + continue; + } + if (blocklen <= (int)cipher_descriptor[x].block_length && keylen <= (int)cipher_descriptor[x].max_key_length) { + LTC_MUTEX_UNLOCK(<c_cipher_mutex); + return x; + } + } + LTC_MUTEX_UNLOCK(<c_cipher_mutex); + return -1; +} + +/* $Source: /cvs/libtom/libtomcrypt/src/misc/crypt/crypt_find_cipher_any.c,v $ */ +/* $Revision: 1.5 $ */ +/* $Date: 2006/03/31 14:15:35 $ */ diff --git a/libtomcrypt/src/misc/crypt/crypt_find_cipher_id.c b/libtomcrypt/src/misc/crypt/crypt_find_cipher_id.c new file mode 100644 index 0000000..8de73c6 --- /dev/null +++ b/libtomcrypt/src/misc/crypt/crypt_find_cipher_id.c @@ -0,0 +1,40 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file crypt_find_cipher_id.c + Find cipher by ID, Tom St Denis +*/ + +/** + Find a cipher by ID number + @param ID The ID (not same as index) of the cipher to find + @return >= 0 if found, -1 if not present +*/ +int find_cipher_id(unsigned char ID) +{ + int x; + LTC_MUTEX_LOCK(<c_cipher_mutex); + for (x = 0; x < TAB_SIZE; x++) { + if (cipher_descriptor[x].ID == ID) { + x = (cipher_descriptor[x].name == NULL) ? -1 : x; + LTC_MUTEX_UNLOCK(<c_cipher_mutex); + return x; + } + } + LTC_MUTEX_UNLOCK(<c_cipher_mutex); + return -1; +} + +/* $Source: /cvs/libtom/libtomcrypt/src/misc/crypt/crypt_find_cipher_id.c,v $ */ +/* $Revision: 1.5 $ */ +/* $Date: 2006/03/31 14:15:35 $ */ diff --git a/libtomcrypt/src/misc/crypt/crypt_find_hash.c b/libtomcrypt/src/misc/crypt/crypt_find_hash.c new file mode 100644 index 0000000..cd60413 --- /dev/null +++ b/libtomcrypt/src/misc/crypt/crypt_find_hash.c @@ -0,0 +1,40 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file crypt_find_hash.c + Find a hash, Tom St Denis +*/ + +/** + Find a registered hash by name + @param name The name of the hash to look for + @return >= 0 if found, -1 if not present +*/ +int find_hash(const char *name) +{ + int x; + LTC_ARGCHK(name != NULL); + LTC_MUTEX_LOCK(<c_hash_mutex); + for (x = 0; x < TAB_SIZE; x++) { + if (hash_descriptor[x].name != NULL && XSTRCMP(hash_descriptor[x].name, name) == 0) { + LTC_MUTEX_UNLOCK(<c_hash_mutex); + return x; + } + } + LTC_MUTEX_UNLOCK(<c_hash_mutex); + return -1; +} + +/* $Source: /cvs/libtom/libtomcrypt/src/misc/crypt/crypt_find_hash.c,v $ */ +/* $Revision: 1.6 $ */ +/* $Date: 2006/11/29 23:43:57 $ */ diff --git a/libtomcrypt/src/misc/crypt/crypt_find_hash_any.c b/libtomcrypt/src/misc/crypt/crypt_find_hash_any.c new file mode 100644 index 0000000..b2cfccd --- /dev/null +++ b/libtomcrypt/src/misc/crypt/crypt_find_hash_any.c @@ -0,0 +1,49 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file crypt_find_hash_any.c + Find a hash, Tom St Denis +*/ + +/** + Find a hash flexibly. First by name then if not present by digest size + @param name The name of the hash desired + @param digestlen The minimum length of the digest size (octets) + @return >= 0 if found, -1 if not present +*/int find_hash_any(const char *name, int digestlen) +{ + int x, y, z; + LTC_ARGCHK(name != NULL); + + x = find_hash(name); + if (x != -1) return x; + + LTC_MUTEX_LOCK(<c_hash_mutex); + y = MAXBLOCKSIZE+1; + z = -1; + for (x = 0; x < TAB_SIZE; x++) { + if (hash_descriptor[x].name == NULL) { + continue; + } + if ((int)hash_descriptor[x].hashsize >= digestlen && (int)hash_descriptor[x].hashsize < y) { + z = x; + y = hash_descriptor[x].hashsize; + } + } + LTC_MUTEX_UNLOCK(<c_hash_mutex); + return z; +} + +/* $Source: /cvs/libtom/libtomcrypt/src/misc/crypt/crypt_find_hash_any.c,v $ */ +/* $Revision: 1.5 $ */ +/* $Date: 2006/03/31 14:15:35 $ */ diff --git a/libtomcrypt/src/misc/crypt/crypt_find_hash_id.c b/libtomcrypt/src/misc/crypt/crypt_find_hash_id.c new file mode 100644 index 0000000..e59ca00 --- /dev/null +++ b/libtomcrypt/src/misc/crypt/crypt_find_hash_id.c @@ -0,0 +1,40 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file crypt_find_hash_id.c + Find hash by ID, Tom St Denis +*/ + +/** + Find a hash by ID number + @param ID The ID (not same as index) of the hash to find + @return >= 0 if found, -1 if not present +*/ +int find_hash_id(unsigned char ID) +{ + int x; + LTC_MUTEX_LOCK(<c_hash_mutex); + for (x = 0; x < TAB_SIZE; x++) { + if (hash_descriptor[x].ID == ID) { + x = (hash_descriptor[x].name == NULL) ? -1 : x; + LTC_MUTEX_UNLOCK(<c_hash_mutex); + return x; + } + } + LTC_MUTEX_UNLOCK(<c_hash_mutex); + return -1; +} + +/* $Source: /cvs/libtom/libtomcrypt/src/misc/crypt/crypt_find_hash_id.c,v $ */ +/* $Revision: 1.6 $ */ +/* $Date: 2006/03/31 14:15:35 $ */ diff --git a/libtomcrypt/src/misc/crypt/crypt_find_hash_oid.c b/libtomcrypt/src/misc/crypt/crypt_find_hash_oid.c new file mode 100644 index 0000000..d04f80c --- /dev/null +++ b/libtomcrypt/src/misc/crypt/crypt_find_hash_oid.c @@ -0,0 +1,35 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file crypt_find_hash_oid.c + Find a hash, Tom St Denis +*/ + +int find_hash_oid(const unsigned long *ID, unsigned long IDlen) +{ + int x; + LTC_ARGCHK(ID != NULL); + LTC_MUTEX_LOCK(<c_hash_mutex); + for (x = 0; x < TAB_SIZE; x++) { + if (hash_descriptor[x].name != NULL && hash_descriptor[x].OIDlen == IDlen && !XMEMCMP(hash_descriptor[x].OID, ID, sizeof(unsigned long) * IDlen)) { + LTC_MUTEX_UNLOCK(<c_hash_mutex); + return x; + } + } + LTC_MUTEX_UNLOCK(<c_hash_mutex); + return -1; +} + +/* $Source: /cvs/libtom/libtomcrypt/src/misc/crypt/crypt_find_hash_oid.c,v $ */ +/* $Revision: 1.4 $ */ +/* $Date: 2006/11/01 09:28:17 $ */ diff --git a/libtomcrypt/src/misc/crypt/crypt_find_prng.c b/libtomcrypt/src/misc/crypt/crypt_find_prng.c new file mode 100644 index 0000000..4b3bc5a --- /dev/null +++ b/libtomcrypt/src/misc/crypt/crypt_find_prng.c @@ -0,0 +1,41 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file crypt_find_prng.c + Find a PRNG, Tom St Denis +*/ + +/** + Find a registered PRNG by name + @param name The name of the PRNG to look for + @return >= 0 if found, -1 if not present +*/ +int find_prng(const char *name) +{ + int x; + LTC_ARGCHK(name != NULL); + LTC_MUTEX_LOCK(<c_prng_mutex); + for (x = 0; x < TAB_SIZE; x++) { + if ((prng_descriptor[x].name != NULL) && XSTRCMP(prng_descriptor[x].name, name) == 0) { + LTC_MUTEX_UNLOCK(<c_prng_mutex); + return x; + } + } + LTC_MUTEX_UNLOCK(<c_prng_mutex); + return -1; +} + + +/* $Source: /cvs/libtom/libtomcrypt/src/misc/crypt/crypt_find_prng.c,v $ */ +/* $Revision: 1.6 $ */ +/* $Date: 2006/11/29 23:43:57 $ */ diff --git a/libtomcrypt/src/misc/crypt/crypt_fsa.c b/libtomcrypt/src/misc/crypt/crypt_fsa.c new file mode 100644 index 0000000..a9569b7 --- /dev/null +++ b/libtomcrypt/src/misc/crypt/crypt_fsa.c @@ -0,0 +1,59 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" +#include <stdarg.h> + +/** + @file crypt_fsa.c + LibTomCrypt FULL SPEED AHEAD!, Tom St Denis +*/ + +/* format is ltc_mp, cipher_desc, [cipher_desc], NULL, hash_desc, [hash_desc], NULL, prng_desc, [prng_desc], NULL */ +int crypt_fsa(void *mp, ...) +{ + int err; + va_list args; + void *p; + + va_start(args, mp); + if (mp != NULL) { + XMEMCPY(<c_mp, mp, sizeof(ltc_mp)); + } + + while ((p = va_arg(args, void*)) != NULL) { + if ((err = register_cipher(p)) != CRYPT_OK) { + va_end(args); + return err; + } + } + + while ((p = va_arg(args, void*)) != NULL) { + if ((err = register_hash(p)) != CRYPT_OK) { + va_end(args); + return err; + } + } + + while ((p = va_arg(args, void*)) != NULL) { + if ((err = register_prng(p)) != CRYPT_OK) { + va_end(args); + return err; + } + } + + va_end(args); + return CRYPT_OK; +} + + +/* $Source: /cvs/libtom/libtomcrypt/src/misc/crypt/crypt_fsa.c,v $ */ +/* $Revision: 1.4 $ */ +/* $Date: 2006/11/13 23:14:33 $ */ diff --git a/libtomcrypt/src/misc/crypt/crypt_hash_descriptor.c b/libtomcrypt/src/misc/crypt/crypt_hash_descriptor.c new file mode 100644 index 0000000..5fa59f1 --- /dev/null +++ b/libtomcrypt/src/misc/crypt/crypt_hash_descriptor.c @@ -0,0 +1,27 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file crypt_hash_descriptor.c + Stores the hash descriptor table, Tom St Denis +*/ + +struct ltc_hash_descriptor hash_descriptor[TAB_SIZE] = { +{ NULL, 0, 0, 0, { 0 }, 0, NULL, NULL, NULL, NULL, NULL } +}; + +LTC_MUTEX_GLOBAL(ltc_hash_mutex) + + +/* $Source: /cvs/libtom/libtomcrypt/src/misc/crypt/crypt_hash_descriptor.c,v $ */ +/* $Revision: 1.9 $ */ +/* $Date: 2006/03/31 14:15:35 $ */ diff --git a/libtomcrypt/src/misc/crypt/crypt_hash_is_valid.c b/libtomcrypt/src/misc/crypt/crypt_hash_is_valid.c new file mode 100644 index 0000000..54a91eb --- /dev/null +++ b/libtomcrypt/src/misc/crypt/crypt_hash_is_valid.c @@ -0,0 +1,36 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file crypt_hash_is_valid.c + Determine if hash is valid, Tom St Denis +*/ + +/* + Test if a hash index is valid + @param idx The index of the hash to search for + @return CRYPT_OK if valid +*/ +int hash_is_valid(int idx) +{ + LTC_MUTEX_LOCK(<c_hash_mutex); + if (idx < 0 || idx >= TAB_SIZE || hash_descriptor[idx].name == NULL) { + LTC_MUTEX_UNLOCK(<c_hash_mutex); + return CRYPT_INVALID_HASH; + } + LTC_MUTEX_UNLOCK(<c_hash_mutex); + return CRYPT_OK; +} + +/* $Source: /cvs/libtom/libtomcrypt/src/misc/crypt/crypt_hash_is_valid.c,v $ */ +/* $Revision: 1.5 $ */ +/* $Date: 2006/03/31 14:15:35 $ */ diff --git a/libtomcrypt/src/misc/crypt/crypt_ltc_mp_descriptor.c b/libtomcrypt/src/misc/crypt/crypt_ltc_mp_descriptor.c new file mode 100644 index 0000000..907862f --- /dev/null +++ b/libtomcrypt/src/misc/crypt/crypt_ltc_mp_descriptor.c @@ -0,0 +1,13 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +ltc_math_descriptor ltc_mp; diff --git a/libtomcrypt/src/misc/crypt/crypt_prng_descriptor.c b/libtomcrypt/src/misc/crypt/crypt_prng_descriptor.c new file mode 100644 index 0000000..a2b5f0e --- /dev/null +++ b/libtomcrypt/src/misc/crypt/crypt_prng_descriptor.c @@ -0,0 +1,26 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file crypt_prng_descriptor.c + Stores the PRNG descriptors, Tom St Denis +*/ +struct ltc_prng_descriptor prng_descriptor[TAB_SIZE] = { +{ NULL, 0, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL } +}; + +LTC_MUTEX_GLOBAL(ltc_prng_mutex) + + +/* $Source: /cvs/libtom/libtomcrypt/src/misc/crypt/crypt_prng_descriptor.c,v $ */ +/* $Revision: 1.7 $ */ +/* $Date: 2006/03/31 14:15:35 $ */ diff --git a/libtomcrypt/src/misc/crypt/crypt_prng_is_valid.c b/libtomcrypt/src/misc/crypt/crypt_prng_is_valid.c new file mode 100644 index 0000000..6af0a3c --- /dev/null +++ b/libtomcrypt/src/misc/crypt/crypt_prng_is_valid.c @@ -0,0 +1,36 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file crypt_prng_is_valid.c + Determine if PRNG is valid, Tom St Denis +*/ + +/* + Test if a PRNG index is valid + @param idx The index of the PRNG to search for + @return CRYPT_OK if valid +*/ +int prng_is_valid(int idx) +{ + LTC_MUTEX_LOCK(<c_prng_mutex); + if (idx < 0 || idx >= TAB_SIZE || prng_descriptor[idx].name == NULL) { + LTC_MUTEX_UNLOCK(<c_prng_mutex); + return CRYPT_INVALID_PRNG; + } + LTC_MUTEX_UNLOCK(<c_prng_mutex); + return CRYPT_OK; +} + +/* $Source: /cvs/libtom/libtomcrypt/src/misc/crypt/crypt_prng_is_valid.c,v $ */ +/* $Revision: 1.5 $ */ +/* $Date: 2006/03/31 14:15:35 $ */ diff --git a/libtomcrypt/src/misc/crypt/crypt_register_cipher.c b/libtomcrypt/src/misc/crypt/crypt_register_cipher.c new file mode 100644 index 0000000..8d74cc5 --- /dev/null +++ b/libtomcrypt/src/misc/crypt/crypt_register_cipher.c @@ -0,0 +1,54 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file crypt_register_cipher.c + Register a cipher, Tom St Denis +*/ + +/** + Register a cipher with the descriptor table + @param cipher The cipher you wish to register + @return value >= 0 if successfully added (or already present), -1 if unsuccessful +*/ +int register_cipher(const struct ltc_cipher_descriptor *cipher) +{ + int x; + + LTC_ARGCHK(cipher != NULL); + + /* is it already registered? */ + LTC_MUTEX_LOCK(<c_cipher_mutex); + for (x = 0; x < TAB_SIZE; x++) { + if (cipher_descriptor[x].name != NULL && cipher_descriptor[x].ID == cipher->ID) { + LTC_MUTEX_UNLOCK(<c_cipher_mutex); + return x; + } + } + + /* find a blank spot */ + for (x = 0; x < TAB_SIZE; x++) { + if (cipher_descriptor[x].name == NULL) { + XMEMCPY(&cipher_descriptor[x], cipher, sizeof(struct ltc_cipher_descriptor)); + LTC_MUTEX_UNLOCK(<c_cipher_mutex); + return x; + } + } + + /* no spot */ + LTC_MUTEX_UNLOCK(<c_cipher_mutex); + return -1; +} + +/* $Source: /cvs/libtom/libtomcrypt/src/misc/crypt/crypt_register_cipher.c,v $ */ +/* $Revision: 1.5 $ */ +/* $Date: 2006/03/31 14:15:35 $ */ diff --git a/libtomcrypt/src/misc/crypt/crypt_register_hash.c b/libtomcrypt/src/misc/crypt/crypt_register_hash.c new file mode 100644 index 0000000..45d0e85 --- /dev/null +++ b/libtomcrypt/src/misc/crypt/crypt_register_hash.c @@ -0,0 +1,54 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file crypt_register_hash.c + Register a HASH, Tom St Denis +*/ + +/** + Register a hash with the descriptor table + @param hash The hash you wish to register + @return value >= 0 if successfully added (or already present), -1 if unsuccessful +*/ +int register_hash(const struct ltc_hash_descriptor *hash) +{ + int x; + + LTC_ARGCHK(hash != NULL); + + /* is it already registered? */ + LTC_MUTEX_LOCK(<c_hash_mutex); + for (x = 0; x < TAB_SIZE; x++) { + if (XMEMCMP(&hash_descriptor[x], hash, sizeof(struct ltc_hash_descriptor)) == 0) { + LTC_MUTEX_UNLOCK(<c_hash_mutex); + return x; + } + } + + /* find a blank spot */ + for (x = 0; x < TAB_SIZE; x++) { + if (hash_descriptor[x].name == NULL) { + XMEMCPY(&hash_descriptor[x], hash, sizeof(struct ltc_hash_descriptor)); + LTC_MUTEX_UNLOCK(<c_hash_mutex); + return x; + } + } + + /* no spot */ + LTC_MUTEX_UNLOCK(<c_hash_mutex); + return -1; +} + +/* $Source: /cvs/libtom/libtomcrypt/src/misc/crypt/crypt_register_hash.c,v $ */ +/* $Revision: 1.6 $ */ +/* $Date: 2006/11/01 09:28:17 $ */ diff --git a/libtomcrypt/src/misc/crypt/crypt_register_prng.c b/libtomcrypt/src/misc/crypt/crypt_register_prng.c new file mode 100644 index 0000000..a834c47 --- /dev/null +++ b/libtomcrypt/src/misc/crypt/crypt_register_prng.c @@ -0,0 +1,54 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file crypt_register_prng.c + Register a PRNG, Tom St Denis +*/ + +/** + Register a PRNG with the descriptor table + @param prng The PRNG you wish to register + @return value >= 0 if successfully added (or already present), -1 if unsuccessful +*/ +int register_prng(const struct ltc_prng_descriptor *prng) +{ + int x; + + LTC_ARGCHK(prng != NULL); + + /* is it already registered? */ + LTC_MUTEX_LOCK(<c_prng_mutex); + for (x = 0; x < TAB_SIZE; x++) { + if (XMEMCMP(&prng_descriptor[x], prng, sizeof(struct ltc_prng_descriptor)) == 0) { + LTC_MUTEX_UNLOCK(<c_prng_mutex); + return x; + } + } + + /* find a blank spot */ + for (x = 0; x < TAB_SIZE; x++) { + if (prng_descriptor[x].name == NULL) { + XMEMCPY(&prng_descriptor[x], prng, sizeof(struct ltc_prng_descriptor)); + LTC_MUTEX_UNLOCK(<c_prng_mutex); + return x; + } + } + + /* no spot */ + LTC_MUTEX_UNLOCK(<c_prng_mutex); + return -1; +} + +/* $Source: /cvs/libtom/libtomcrypt/src/misc/crypt/crypt_register_prng.c,v $ */ +/* $Revision: 1.7 $ */ +/* $Date: 2006/11/01 09:28:17 $ */ diff --git a/libtomcrypt/src/misc/crypt/crypt_unregister_cipher.c b/libtomcrypt/src/misc/crypt/crypt_unregister_cipher.c new file mode 100644 index 0000000..3cb46c4 --- /dev/null +++ b/libtomcrypt/src/misc/crypt/crypt_unregister_cipher.c @@ -0,0 +1,45 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file crypt_unregister_cipher.c + Unregister a cipher, Tom St Denis +*/ + +/** + Unregister a cipher from the descriptor table + @param cipher The cipher descriptor to remove + @return CRYPT_OK on success +*/ +int unregister_cipher(const struct ltc_cipher_descriptor *cipher) +{ + int x; + + LTC_ARGCHK(cipher != NULL); + + /* is it already registered? */ + LTC_MUTEX_LOCK(<c_cipher_mutex); + for (x = 0; x < TAB_SIZE; x++) { + if (XMEMCMP(&cipher_descriptor[x], cipher, sizeof(struct ltc_cipher_descriptor)) == 0) { + cipher_descriptor[x].name = NULL; + cipher_descriptor[x].ID = 255; + LTC_MUTEX_UNLOCK(<c_cipher_mutex); + return CRYPT_OK; + } + } + LTC_MUTEX_UNLOCK(<c_cipher_mutex); + return CRYPT_ERROR; +} + +/* $Source: /cvs/libtom/libtomcrypt/src/misc/crypt/crypt_unregister_cipher.c,v $ */ +/* $Revision: 1.6 $ */ +/* $Date: 2006/11/01 09:28:17 $ */ diff --git a/libtomcrypt/src/misc/crypt/crypt_unregister_hash.c b/libtomcrypt/src/misc/crypt/crypt_unregister_hash.c new file mode 100644 index 0000000..a87a399 --- /dev/null +++ b/libtomcrypt/src/misc/crypt/crypt_unregister_hash.c @@ -0,0 +1,44 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file crypt_unregister_hash.c + Unregister a hash, Tom St Denis +*/ + +/** + Unregister a hash from the descriptor table + @param hash The hash descriptor to remove + @return CRYPT_OK on success +*/ +int unregister_hash(const struct ltc_hash_descriptor *hash) +{ + int x; + + LTC_ARGCHK(hash != NULL); + + /* is it already registered? */ + LTC_MUTEX_LOCK(<c_hash_mutex); + for (x = 0; x < TAB_SIZE; x++) { + if (XMEMCMP(&hash_descriptor[x], hash, sizeof(struct ltc_hash_descriptor)) == 0) { + hash_descriptor[x].name = NULL; + LTC_MUTEX_UNLOCK(<c_hash_mutex); + return CRYPT_OK; + } + } + LTC_MUTEX_UNLOCK(<c_hash_mutex); + return CRYPT_ERROR; +} + +/* $Source: /cvs/libtom/libtomcrypt/src/misc/crypt/crypt_unregister_hash.c,v $ */ +/* $Revision: 1.6 $ */ +/* $Date: 2006/11/01 09:28:17 $ */ diff --git a/libtomcrypt/src/misc/crypt/crypt_unregister_prng.c b/libtomcrypt/src/misc/crypt/crypt_unregister_prng.c new file mode 100644 index 0000000..694cbcf --- /dev/null +++ b/libtomcrypt/src/misc/crypt/crypt_unregister_prng.c @@ -0,0 +1,44 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file crypt_unregister_prng.c + Unregister a PRNG, Tom St Denis +*/ + +/** + Unregister a PRNG from the descriptor table + @param prng The PRNG descriptor to remove + @return CRYPT_OK on success +*/ +int unregister_prng(const struct ltc_prng_descriptor *prng) +{ + int x; + + LTC_ARGCHK(prng != NULL); + + /* is it already registered? */ + LTC_MUTEX_LOCK(<c_prng_mutex); + for (x = 0; x < TAB_SIZE; x++) { + if (XMEMCMP(&prng_descriptor[x], prng, sizeof(struct ltc_prng_descriptor)) != 0) { + prng_descriptor[x].name = NULL; + LTC_MUTEX_UNLOCK(<c_prng_mutex); + return CRYPT_OK; + } + } + LTC_MUTEX_UNLOCK(<c_prng_mutex); + return CRYPT_ERROR; +} + +/* $Source: /cvs/libtom/libtomcrypt/src/misc/crypt/crypt_unregister_prng.c,v $ */ +/* $Revision: 1.6 $ */ +/* $Date: 2006/11/01 09:28:17 $ */ diff --git a/libtomcrypt/src/misc/error_to_string.c b/libtomcrypt/src/misc/error_to_string.c new file mode 100644 index 0000000..1da2597 --- /dev/null +++ b/libtomcrypt/src/misc/error_to_string.c @@ -0,0 +1,74 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ + +#include "tomcrypt.h" + +/** + @file error_to_string.c + Convert error codes to ASCII strings, Tom St Denis +*/ + +static const char *err_2_str[] = +{ + "CRYPT_OK", + "CRYPT_ERROR", + "Non-fatal 'no-operation' requested.", + + "Invalid keysize for block cipher.", + "Invalid number of rounds for block cipher.", + "Algorithm failed test vectors.", + + "Buffer overflow.", + "Invalid input packet.", + + "Invalid number of bits for a PRNG.", + "Error reading the PRNG.", + + "Invalid cipher specified.", + "Invalid hash specified.", + "Invalid PRNG specified.", + + "Out of memory.", + + "Invalid PK key or key type specified for function.", + "A private PK key is required.", + + "Invalid argument provided.", + "File Not Found", + + "Invalid PK type.", + "Invalid PK system.", + "Duplicate PK key found on keyring.", + "Key not found in keyring.", + "Invalid sized parameter.", + + "Invalid size for prime.", + +}; + +/** + Convert an LTC error code to ASCII + @param err The error code + @return A pointer to the ASCII NUL terminated string for the error or "Invalid error code." if the err code was not valid. +*/ +const char *error_to_string(int err) +{ + if (err < 0 || err >= (int)(sizeof(err_2_str)/sizeof(err_2_str[0]))) { + return "Invalid error code."; + } else { + return err_2_str[err]; + } +} + + +/* $Source: /cvs/libtom/libtomcrypt/src/misc/error_to_string.c,v $ */ +/* $Revision: 1.4 $ */ +/* $Date: 2006/03/31 14:15:35 $ */ diff --git a/libtomcrypt/src/misc/pkcs5/pkcs_5_1.c b/libtomcrypt/src/misc/pkcs5/pkcs_5_1.c new file mode 100644 index 0000000..e6f7b0c --- /dev/null +++ b/libtomcrypt/src/misc/pkcs5/pkcs_5_1.c @@ -0,0 +1,106 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include <tomcrypt.h> + +/** + @file pkcs_5_1.c + PKCS #5, Algorithm #1, Tom St Denis +*/ +#ifdef PKCS_5 +/** + Execute PKCS #5 v1 + @param password The password (or key) + @param password_len The length of the password (octet) + @param salt The salt (or nonce) which is 8 octets long + @param iteration_count The PKCS #5 v1 iteration count + @param hash_idx The index of the hash desired + @param out [out] The destination for this algorithm + @param outlen [in/out] The max size and resulting size of the algorithm output + @return CRYPT_OK if successful +*/ +int pkcs_5_alg1(const unsigned char *password, unsigned long password_len, + const unsigned char *salt, + int iteration_count, int hash_idx, + unsigned char *out, unsigned long *outlen) +{ + int err; + unsigned long x; + hash_state *md; + unsigned char *buf; + + LTC_ARGCHK(password != NULL); + LTC_ARGCHK(salt != NULL); + LTC_ARGCHK(out != NULL); + LTC_ARGCHK(outlen != NULL); + + /* test hash IDX */ + if ((err = hash_is_valid(hash_idx)) != CRYPT_OK) { + return err; + } + + /* allocate memory */ + md = XMALLOC(sizeof(hash_state)); + buf = XMALLOC(MAXBLOCKSIZE); + if (md == NULL || buf == NULL) { + if (md != NULL) { + XFREE(md); + } + if (buf != NULL) { + XFREE(buf); + } + return CRYPT_MEM; + } + + /* hash initial password + salt */ + if ((err = hash_descriptor[hash_idx].init(md)) != CRYPT_OK) { + goto LBL_ERR; + } + if ((err = hash_descriptor[hash_idx].process(md, password, password_len)) != CRYPT_OK) { + goto LBL_ERR; + } + if ((err = hash_descriptor[hash_idx].process(md, salt, 8)) != CRYPT_OK) { + goto LBL_ERR; + } + if ((err = hash_descriptor[hash_idx].done(md, buf)) != CRYPT_OK) { + goto LBL_ERR; + } + + while (--iteration_count) { + /* code goes here. */ + x = MAXBLOCKSIZE; + if ((err = hash_memory(hash_idx, buf, hash_descriptor[hash_idx].hashsize, buf, &x)) != CRYPT_OK) { + goto LBL_ERR; + } + } + + /* copy upto outlen bytes */ + for (x = 0; x < hash_descriptor[hash_idx].hashsize && x < *outlen; x++) { + out[x] = buf[x]; + } + *outlen = x; + err = CRYPT_OK; +LBL_ERR: +#ifdef LTC_CLEAN_STACK + zeromem(buf, MAXBLOCKSIZE); + zeromem(md, sizeof(hash_state)); +#endif + + XFREE(buf); + XFREE(md); + + return err; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/misc/pkcs5/pkcs_5_1.c,v $ */ +/* $Revision: 1.5 $ */ +/* $Date: 2006/03/31 14:15:35 $ */ diff --git a/libtomcrypt/src/misc/pkcs5/pkcs_5_2.c b/libtomcrypt/src/misc/pkcs5/pkcs_5_2.c new file mode 100644 index 0000000..6e8d161 --- /dev/null +++ b/libtomcrypt/src/misc/pkcs5/pkcs_5_2.c @@ -0,0 +1,129 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include <tomcrypt.h> + +/** + @file pkcs_5_2.c + PKCS #5, Algorithm #2, Tom St Denis +*/ +#ifdef PKCS_5 + +/** + Execute PKCS #5 v2 + @param password The input password (or key) + @param password_len The length of the password (octets) + @param salt The salt (or nonce) + @param salt_len The length of the salt (octets) + @param iteration_count # of iterations desired for PKCS #5 v2 [read specs for more] + @param hash_idx The index of the hash desired + @param out [out] The destination for this algorithm + @param outlen [in/out] The max size and resulting size of the algorithm output + @return CRYPT_OK if successful +*/ +int pkcs_5_alg2(const unsigned char *password, unsigned long password_len, + const unsigned char *salt, unsigned long salt_len, + int iteration_count, int hash_idx, + unsigned char *out, unsigned long *outlen) +{ + int err, itts; + ulong32 blkno; + unsigned long stored, left, x, y; + unsigned char *buf[2]; + hmac_state *hmac; + + LTC_ARGCHK(password != NULL); + LTC_ARGCHK(salt != NULL); + LTC_ARGCHK(out != NULL); + LTC_ARGCHK(outlen != NULL); + + /* test hash IDX */ + if ((err = hash_is_valid(hash_idx)) != CRYPT_OK) { + return err; + } + + buf[0] = XMALLOC(MAXBLOCKSIZE * 2); + hmac = XMALLOC(sizeof(hmac_state)); + if (hmac == NULL || buf[0] == NULL) { + if (hmac != NULL) { + XFREE(hmac); + } + if (buf[0] != NULL) { + XFREE(buf[0]); + } + return CRYPT_MEM; + } + /* buf[1] points to the second block of MAXBLOCKSIZE bytes */ + buf[1] = buf[0] + MAXBLOCKSIZE; + + left = *outlen; + blkno = 1; + stored = 0; + while (left != 0) { + /* process block number blkno */ + zeromem(buf[0], MAXBLOCKSIZE*2); + + /* store current block number and increment for next pass */ + STORE32H(blkno, buf[1]); + ++blkno; + + /* get PRF(P, S||int(blkno)) */ + if ((err = hmac_init(hmac, hash_idx, password, password_len)) != CRYPT_OK) { + goto LBL_ERR; + } + if ((err = hmac_process(hmac, salt, salt_len)) != CRYPT_OK) { + goto LBL_ERR; + } + if ((err = hmac_process(hmac, buf[1], 4)) != CRYPT_OK) { + goto LBL_ERR; + } + x = MAXBLOCKSIZE; + if ((err = hmac_done(hmac, buf[0], &x)) != CRYPT_OK) { + goto LBL_ERR; + } + + /* now compute repeated and XOR it in buf[1] */ + XMEMCPY(buf[1], buf[0], x); + for (itts = 1; itts < iteration_count; ++itts) { + if ((err = hmac_memory(hash_idx, password, password_len, buf[0], x, buf[0], &x)) != CRYPT_OK) { + goto LBL_ERR; + } + for (y = 0; y < x; y++) { + buf[1][y] ^= buf[0][y]; + } + } + + /* now emit upto x bytes of buf[1] to output */ + for (y = 0; y < x && left != 0; ++y) { + out[stored++] = buf[1][y]; + --left; + } + } + *outlen = stored; + + err = CRYPT_OK; +LBL_ERR: +#ifdef LTC_CLEAN_STACK + zeromem(buf[0], MAXBLOCKSIZE*2); + zeromem(hmac, sizeof(hmac_state)); +#endif + + XFREE(hmac); + XFREE(buf[0]); + + return err; +} + +#endif + + +/* $Source: /cvs/libtom/libtomcrypt/src/misc/pkcs5/pkcs_5_2.c,v $ */ +/* $Revision: 1.5 $ */ +/* $Date: 2006/03/31 14:15:35 $ */ diff --git a/libtomcrypt/src/misc/zeromem.c b/libtomcrypt/src/misc/zeromem.c new file mode 100644 index 0000000..42dc3c2 --- /dev/null +++ b/libtomcrypt/src/misc/zeromem.c @@ -0,0 +1,34 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file zeromem.c + Zero a block of memory, Tom St Denis +*/ + +/** + Zero a block of memory + @param out The destination of the area to zero + @param outlen The length of the area to zero (octets) +*/ +void zeromem(void *out, size_t outlen) +{ + unsigned char *mem = out; + LTC_ARGCHKVD(out != NULL); + while (outlen-- > 0) { + *mem++ = 0; + } +} + +/* $Source: /cvs/libtom/libtomcrypt/src/misc/zeromem.c,v $ */ +/* $Revision: 1.6 $ */ +/* $Date: 2006/06/09 01:38:13 $ */ diff --git a/libtomcrypt/src/modes/cbc/cbc_decrypt.c b/libtomcrypt/src/modes/cbc/cbc_decrypt.c new file mode 100644 index 0000000..d768d88 --- /dev/null +++ b/libtomcrypt/src/modes/cbc/cbc_decrypt.c @@ -0,0 +1,97 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file cbc_decrypt.c + CBC implementation, encrypt block, Tom St Denis +*/ + + +#ifdef LTC_CBC_MODE + +/** + CBC decrypt + @param ct Ciphertext + @param pt [out] Plaintext + @param len The number of bytes to process (must be multiple of block length) + @param cbc CBC state + @return CRYPT_OK if successful +*/ +int cbc_decrypt(const unsigned char *ct, unsigned char *pt, unsigned long len, symmetric_CBC *cbc) +{ + int x, err; + unsigned char tmp[16]; +#ifdef LTC_FAST + LTC_FAST_TYPE tmpy; +#else + unsigned char tmpy; +#endif + + LTC_ARGCHK(pt != NULL); + LTC_ARGCHK(ct != NULL); + LTC_ARGCHK(cbc != NULL); + + if ((err = cipher_is_valid(cbc->cipher)) != CRYPT_OK) { + return err; + } + + /* is blocklen valid? */ + if (cbc->blocklen < 1 || cbc->blocklen > (int)sizeof(cbc->IV)) { + return CRYPT_INVALID_ARG; + } + + if (len % cbc->blocklen) { + return CRYPT_INVALID_ARG; + } +#ifdef LTC_FAST + if (cbc->blocklen % sizeof(LTC_FAST_TYPE)) { + return CRYPT_INVALID_ARG; + } +#endif + + if (cipher_descriptor[cbc->cipher].accel_cbc_decrypt != NULL) { + return cipher_descriptor[cbc->cipher].accel_cbc_decrypt(ct, pt, len / cbc->blocklen, cbc->IV, &cbc->key); + } else { + while (len) { + /* decrypt */ + if ((err = cipher_descriptor[cbc->cipher].ecb_decrypt(ct, tmp, &cbc->key)) != CRYPT_OK) { + return err; + } + + /* xor IV against plaintext */ + #if defined(LTC_FAST) + for (x = 0; x < cbc->blocklen; x += sizeof(LTC_FAST_TYPE)) { + tmpy = *((LTC_FAST_TYPE*)((unsigned char *)cbc->IV + x)) ^ *((LTC_FAST_TYPE*)((unsigned char *)tmp + x)); + *((LTC_FAST_TYPE*)((unsigned char *)cbc->IV + x)) = *((LTC_FAST_TYPE*)((unsigned char *)ct + x)); + *((LTC_FAST_TYPE*)((unsigned char *)pt + x)) = tmpy; + } + #else + for (x = 0; x < cbc->blocklen; x++) { + tmpy = tmp[x] ^ cbc->IV[x]; + cbc->IV[x] = ct[x]; + pt[x] = tmpy; + } + #endif + + ct += cbc->blocklen; + pt += cbc->blocklen; + len -= cbc->blocklen; + } + } + return CRYPT_OK; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/modes/cbc/cbc_decrypt.c,v $ */ +/* $Revision: 1.15 $ */ +/* $Date: 2006/11/21 00:18:23 $ */ diff --git a/libtomcrypt/src/modes/cbc/cbc_done.c b/libtomcrypt/src/modes/cbc/cbc_done.c new file mode 100644 index 0000000..99b035e --- /dev/null +++ b/libtomcrypt/src/modes/cbc/cbc_done.c @@ -0,0 +1,42 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file cbc_done.c + CBC implementation, finish chain, Tom St Denis +*/ + +#ifdef LTC_CBC_MODE + +/** Terminate the chain + @param cbc The CBC chain to terminate + @return CRYPT_OK on success +*/ +int cbc_done(symmetric_CBC *cbc) +{ + int err; + LTC_ARGCHK(cbc != NULL); + + if ((err = cipher_is_valid(cbc->cipher)) != CRYPT_OK) { + return err; + } + cipher_descriptor[cbc->cipher].done(&cbc->key); + return CRYPT_OK; +} + + + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/modes/cbc/cbc_done.c,v $ */ +/* $Revision: 1.6 $ */ +/* $Date: 2006/06/29 01:46:46 $ */ diff --git a/libtomcrypt/src/modes/cbc/cbc_encrypt.c b/libtomcrypt/src/modes/cbc/cbc_encrypt.c new file mode 100644 index 0000000..bbfd1c4 --- /dev/null +++ b/libtomcrypt/src/modes/cbc/cbc_encrypt.c @@ -0,0 +1,98 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file cbc_encrypt.c + CBC implementation, encrypt block, Tom St Denis +*/ + + +#ifdef LTC_CBC_MODE + +/** + CBC encrypt + @param pt Plaintext + @param ct [out] Ciphertext + @param len The number of bytes to process (must be multiple of block length) + @param cbc CBC state + @return CRYPT_OK if successful +*/ +int cbc_encrypt(const unsigned char *pt, unsigned char *ct, unsigned long len, symmetric_CBC *cbc) +{ + int x, err; + + LTC_ARGCHK(pt != NULL); + LTC_ARGCHK(ct != NULL); + LTC_ARGCHK(cbc != NULL); + + if ((err = cipher_is_valid(cbc->cipher)) != CRYPT_OK) { + return err; + } + + /* is blocklen valid? */ + if (cbc->blocklen < 1 || cbc->blocklen > (int)sizeof(cbc->IV)) { + return CRYPT_INVALID_ARG; + } + + if (len % cbc->blocklen) { + return CRYPT_INVALID_ARG; + } +#ifdef LTC_FAST + if (cbc->blocklen % sizeof(LTC_FAST_TYPE)) { + return CRYPT_INVALID_ARG; + } +#endif + + if (cipher_descriptor[cbc->cipher].accel_cbc_encrypt != NULL) { + return cipher_descriptor[cbc->cipher].accel_cbc_encrypt(pt, ct, len / cbc->blocklen, cbc->IV, &cbc->key); + } else { + while (len) { + /* xor IV against plaintext */ + #if defined(LTC_FAST) + for (x = 0; x < cbc->blocklen; x += sizeof(LTC_FAST_TYPE)) { + *((LTC_FAST_TYPE*)((unsigned char *)cbc->IV + x)) ^= *((LTC_FAST_TYPE*)((unsigned char *)pt + x)); + } + #else + for (x = 0; x < cbc->blocklen; x++) { + cbc->IV[x] ^= pt[x]; + } + #endif + + /* encrypt */ + if ((err = cipher_descriptor[cbc->cipher].ecb_encrypt(cbc->IV, ct, &cbc->key)) != CRYPT_OK) { + return err; + } + + /* store IV [ciphertext] for a future block */ + #if defined(LTC_FAST) + for (x = 0; x < cbc->blocklen; x += sizeof(LTC_FAST_TYPE)) { + *((LTC_FAST_TYPE*)((unsigned char *)cbc->IV + x)) = *((LTC_FAST_TYPE*)((unsigned char *)ct + x)); + } + #else + for (x = 0; x < cbc->blocklen; x++) { + cbc->IV[x] = ct[x]; + } + #endif + + ct += cbc->blocklen; + pt += cbc->blocklen; + len -= cbc->blocklen; + } + } + return CRYPT_OK; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/modes/cbc/cbc_encrypt.c,v $ */ +/* $Revision: 1.13 $ */ +/* $Date: 2006/11/21 00:18:23 $ */ diff --git a/libtomcrypt/src/modes/cbc/cbc_getiv.c b/libtomcrypt/src/modes/cbc/cbc_getiv.c new file mode 100644 index 0000000..c54d558 --- /dev/null +++ b/libtomcrypt/src/modes/cbc/cbc_getiv.c @@ -0,0 +1,46 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file cbc_getiv.c + CBC implementation, get IV, Tom St Denis +*/ + +#ifdef LTC_CBC_MODE + +/** + Get the current initial vector + @param IV [out] The destination of the initial vector + @param len [in/out] The max size and resulting size of the initial vector + @param cbc The CBC state + @return CRYPT_OK if successful +*/ +int cbc_getiv(unsigned char *IV, unsigned long *len, symmetric_CBC *cbc) +{ + LTC_ARGCHK(IV != NULL); + LTC_ARGCHK(len != NULL); + LTC_ARGCHK(cbc != NULL); + if ((unsigned long)cbc->blocklen > *len) { + *len = cbc->blocklen; + return CRYPT_BUFFER_OVERFLOW; + } + XMEMCPY(IV, cbc->IV, cbc->blocklen); + *len = cbc->blocklen; + + return CRYPT_OK; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/modes/cbc/cbc_getiv.c,v $ */ +/* $Revision: 1.6 $ */ +/* $Date: 2006/06/29 01:46:46 $ */ diff --git a/libtomcrypt/src/modes/cbc/cbc_setiv.c b/libtomcrypt/src/modes/cbc/cbc_setiv.c new file mode 100644 index 0000000..6fb70ca --- /dev/null +++ b/libtomcrypt/src/modes/cbc/cbc_setiv.c @@ -0,0 +1,44 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file cbc_setiv.c + CBC implementation, set IV, Tom St Denis +*/ + + +#ifdef LTC_CBC_MODE + +/** + Set an initial vector + @param IV The initial vector + @param len The length of the vector (in octets) + @param cbc The CBC state + @return CRYPT_OK if successful +*/ +int cbc_setiv(const unsigned char *IV, unsigned long len, symmetric_CBC *cbc) +{ + LTC_ARGCHK(IV != NULL); + LTC_ARGCHK(cbc != NULL); + if (len != (unsigned long)cbc->blocklen) { + return CRYPT_INVALID_ARG; + } + XMEMCPY(cbc->IV, IV, len); + return CRYPT_OK; +} + +#endif + + +/* $Source: /cvs/libtom/libtomcrypt/src/modes/cbc/cbc_setiv.c,v $ */ +/* $Revision: 1.5 $ */ +/* $Date: 2006/06/29 01:46:46 $ */ diff --git a/libtomcrypt/src/modes/cbc/cbc_start.c b/libtomcrypt/src/modes/cbc/cbc_start.c new file mode 100644 index 0000000..86ec7b9 --- /dev/null +++ b/libtomcrypt/src/modes/cbc/cbc_start.c @@ -0,0 +1,62 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file cbc_start.c + CBC implementation, start chain, Tom St Denis +*/ + +#ifdef LTC_CBC_MODE + +/** + Initialize a CBC context + @param cipher The index of the cipher desired + @param IV The initial vector + @param key The secret key + @param keylen The length of the secret key (octets) + @param num_rounds Number of rounds in the cipher desired (0 for default) + @param cbc The CBC state to initialize + @return CRYPT_OK if successful +*/ +int cbc_start(int cipher, const unsigned char *IV, const unsigned char *key, + int keylen, int num_rounds, symmetric_CBC *cbc) +{ + int x, err; + + LTC_ARGCHK(IV != NULL); + LTC_ARGCHK(key != NULL); + LTC_ARGCHK(cbc != NULL); + + /* bad param? */ + if ((err = cipher_is_valid(cipher)) != CRYPT_OK) { + return err; + } + + /* setup cipher */ + if ((err = cipher_descriptor[cipher].setup(key, keylen, num_rounds, &cbc->key)) != CRYPT_OK) { + return err; + } + + /* copy IV */ + cbc->blocklen = cipher_descriptor[cipher].block_length; + cbc->cipher = cipher; + for (x = 0; x < cbc->blocklen; x++) { + cbc->IV[x] = IV[x]; + } + return CRYPT_OK; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/modes/cbc/cbc_start.c,v $ */ +/* $Revision: 1.5 $ */ +/* $Date: 2006/06/29 01:46:46 $ */ diff --git a/libtomcrypt/src/modes/cfb/cfb_decrypt.c b/libtomcrypt/src/modes/cfb/cfb_decrypt.c new file mode 100644 index 0000000..76a4de1 --- /dev/null +++ b/libtomcrypt/src/modes/cfb/cfb_decrypt.c @@ -0,0 +1,67 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file cfb_decrypt.c + CFB implementation, decrypt data, Tom St Denis +*/ + +#ifdef LTC_CFB_MODE + +/** + CFB decrypt + @param ct Ciphertext + @param pt [out] Plaintext + @param len Length of ciphertext (octets) + @param cfb CFB state + @return CRYPT_OK if successful +*/ +int cfb_decrypt(const unsigned char *ct, unsigned char *pt, unsigned long len, symmetric_CFB *cfb) +{ + int err; + + LTC_ARGCHK(pt != NULL); + LTC_ARGCHK(ct != NULL); + LTC_ARGCHK(cfb != NULL); + + if ((err = cipher_is_valid(cfb->cipher)) != CRYPT_OK) { + return err; + } + + /* is blocklen/padlen valid? */ + if (cfb->blocklen < 0 || cfb->blocklen > (int)sizeof(cfb->IV) || + cfb->padlen < 0 || cfb->padlen > (int)sizeof(cfb->pad)) { + return CRYPT_INVALID_ARG; + } + + while (len-- > 0) { + if (cfb->padlen == cfb->blocklen) { + if ((err = cipher_descriptor[cfb->cipher].ecb_encrypt(cfb->pad, cfb->IV, &cfb->key)) != CRYPT_OK) { + return err; + } + cfb->padlen = 0; + } + cfb->pad[cfb->padlen] = *ct; + *pt = *ct ^ cfb->IV[cfb->padlen]; + ++pt; + ++ct; + ++(cfb->padlen); + } + return CRYPT_OK; +} + +#endif + + +/* $Source: /cvs/libtom/libtomcrypt/src/modes/cfb/cfb_decrypt.c,v $ */ +/* $Revision: 1.7 $ */ +/* $Date: 2006/11/26 01:45:14 $ */ diff --git a/libtomcrypt/src/modes/cfb/cfb_done.c b/libtomcrypt/src/modes/cfb/cfb_done.c new file mode 100644 index 0000000..4ee9d50 --- /dev/null +++ b/libtomcrypt/src/modes/cfb/cfb_done.c @@ -0,0 +1,42 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file cfb_done.c + CFB implementation, finish chain, Tom St Denis +*/ + +#ifdef LTC_CFB_MODE + +/** Terminate the chain + @param cfb The CFB chain to terminate + @return CRYPT_OK on success +*/ +int cfb_done(symmetric_CFB *cfb) +{ + int err; + LTC_ARGCHK(cfb != NULL); + + if ((err = cipher_is_valid(cfb->cipher)) != CRYPT_OK) { + return err; + } + cipher_descriptor[cfb->cipher].done(&cfb->key); + return CRYPT_OK; +} + + + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/modes/cfb/cfb_done.c,v $ */ +/* $Revision: 1.6 $ */ +/* $Date: 2006/06/29 01:51:34 $ */ diff --git a/libtomcrypt/src/modes/cfb/cfb_encrypt.c b/libtomcrypt/src/modes/cfb/cfb_encrypt.c new file mode 100644 index 0000000..b619682 --- /dev/null +++ b/libtomcrypt/src/modes/cfb/cfb_encrypt.c @@ -0,0 +1,65 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file cfb_encrypt.c + CFB implementation, encrypt data, Tom St Denis +*/ + +#ifdef LTC_CFB_MODE + +/** + CFB encrypt + @param pt Plaintext + @param ct [out] Ciphertext + @param len Length of plaintext (octets) + @param cfb CFB state + @return CRYPT_OK if successful +*/ +int cfb_encrypt(const unsigned char *pt, unsigned char *ct, unsigned long len, symmetric_CFB *cfb) +{ + int err; + + LTC_ARGCHK(pt != NULL); + LTC_ARGCHK(ct != NULL); + LTC_ARGCHK(cfb != NULL); + + if ((err = cipher_is_valid(cfb->cipher)) != CRYPT_OK) { + return err; + } + + /* is blocklen/padlen valid? */ + if (cfb->blocklen < 0 || cfb->blocklen > (int)sizeof(cfb->IV) || + cfb->padlen < 0 || cfb->padlen > (int)sizeof(cfb->pad)) { + return CRYPT_INVALID_ARG; + } + + while (len-- > 0) { + if (cfb->padlen == cfb->blocklen) { + if ((err = cipher_descriptor[cfb->cipher].ecb_encrypt(cfb->pad, cfb->IV, &cfb->key)) != CRYPT_OK) { + return err; + } + cfb->padlen = 0; + } + cfb->pad[cfb->padlen] = (*ct = *pt ^ cfb->IV[cfb->padlen]); + ++pt; + ++ct; + ++(cfb->padlen); + } + return CRYPT_OK; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/modes/cfb/cfb_encrypt.c,v $ */ +/* $Revision: 1.7 $ */ +/* $Date: 2006/11/26 01:45:14 $ */ diff --git a/libtomcrypt/src/modes/cfb/cfb_getiv.c b/libtomcrypt/src/modes/cfb/cfb_getiv.c new file mode 100644 index 0000000..1689a75 --- /dev/null +++ b/libtomcrypt/src/modes/cfb/cfb_getiv.c @@ -0,0 +1,46 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file cfb_getiv.c + CFB implementation, get IV, Tom St Denis +*/ + +#ifdef LTC_CFB_MODE + +/** + Get the current initial vector + @param IV [out] The destination of the initial vector + @param len [in/out] The max size and resulting size of the initial vector + @param cfb The CFB state + @return CRYPT_OK if successful +*/ +int cfb_getiv(unsigned char *IV, unsigned long *len, symmetric_CFB *cfb) +{ + LTC_ARGCHK(IV != NULL); + LTC_ARGCHK(len != NULL); + LTC_ARGCHK(cfb != NULL); + if ((unsigned long)cfb->blocklen > *len) { + *len = cfb->blocklen; + return CRYPT_BUFFER_OVERFLOW; + } + XMEMCPY(IV, cfb->IV, cfb->blocklen); + *len = cfb->blocklen; + + return CRYPT_OK; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/modes/cfb/cfb_getiv.c,v $ */ +/* $Revision: 1.6 $ */ +/* $Date: 2006/06/29 01:51:34 $ */ diff --git a/libtomcrypt/src/modes/cfb/cfb_setiv.c b/libtomcrypt/src/modes/cfb/cfb_setiv.c new file mode 100644 index 0000000..efb848b --- /dev/null +++ b/libtomcrypt/src/modes/cfb/cfb_setiv.c @@ -0,0 +1,52 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file cfb_setiv.c + CFB implementation, set IV, Tom St Denis +*/ + +#ifdef LTC_CFB_MODE + +/** + Set an initial vector + @param IV The initial vector + @param len The length of the vector (in octets) + @param cfb The CFB state + @return CRYPT_OK if successful +*/ +int cfb_setiv(const unsigned char *IV, unsigned long len, symmetric_CFB *cfb) +{ + int err; + + LTC_ARGCHK(IV != NULL); + LTC_ARGCHK(cfb != NULL); + + if ((err = cipher_is_valid(cfb->cipher)) != CRYPT_OK) { + return err; + } + + if (len != (unsigned long)cfb->blocklen) { + return CRYPT_INVALID_ARG; + } + + /* force next block */ + cfb->padlen = 0; + return cipher_descriptor[cfb->cipher].ecb_encrypt(IV, cfb->IV, &cfb->key); +} + +#endif + + +/* $Source: /cvs/libtom/libtomcrypt/src/modes/cfb/cfb_setiv.c,v $ */ +/* $Revision: 1.6 $ */ +/* $Date: 2006/06/29 01:51:34 $ */ diff --git a/libtomcrypt/src/modes/cfb/cfb_start.c b/libtomcrypt/src/modes/cfb/cfb_start.c new file mode 100644 index 0000000..e70d635 --- /dev/null +++ b/libtomcrypt/src/modes/cfb/cfb_start.c @@ -0,0 +1,65 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file cfb_start.c + CFB implementation, start chain, Tom St Denis +*/ + + +#ifdef LTC_CFB_MODE + +/** + Initialize a CFB context + @param cipher The index of the cipher desired + @param IV The initial vector + @param key The secret key + @param keylen The length of the secret key (octets) + @param num_rounds Number of rounds in the cipher desired (0 for default) + @param cfb The CFB state to initialize + @return CRYPT_OK if successful +*/ +int cfb_start(int cipher, const unsigned char *IV, const unsigned char *key, + int keylen, int num_rounds, symmetric_CFB *cfb) +{ + int x, err; + + LTC_ARGCHK(IV != NULL); + LTC_ARGCHK(key != NULL); + LTC_ARGCHK(cfb != NULL); + + if ((err = cipher_is_valid(cipher)) != CRYPT_OK) { + return err; + } + + + /* copy data */ + cfb->cipher = cipher; + cfb->blocklen = cipher_descriptor[cipher].block_length; + for (x = 0; x < cfb->blocklen; x++) + cfb->IV[x] = IV[x]; + + /* init the cipher */ + if ((err = cipher_descriptor[cipher].setup(key, keylen, num_rounds, &cfb->key)) != CRYPT_OK) { + return err; + } + + /* encrypt the IV */ + cfb->padlen = 0; + return cipher_descriptor[cfb->cipher].ecb_encrypt(cfb->IV, cfb->IV, &cfb->key); +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/modes/cfb/cfb_start.c,v $ */ +/* $Revision: 1.6 $ */ +/* $Date: 2006/06/29 01:51:34 $ */ diff --git a/libtomcrypt/src/modes/ctr/ctr_decrypt.c b/libtomcrypt/src/modes/ctr/ctr_decrypt.c new file mode 100644 index 0000000..f32821f --- /dev/null +++ b/libtomcrypt/src/modes/ctr/ctr_decrypt.c @@ -0,0 +1,42 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file ctr_decrypt.c + CTR implementation, decrypt data, Tom St Denis +*/ + +#ifdef LTC_CTR_MODE + +/** + CTR decrypt + @param ct Ciphertext + @param pt [out] Plaintext + @param len Length of ciphertext (octets) + @param ctr CTR state + @return CRYPT_OK if successful +*/ +int ctr_decrypt(const unsigned char *ct, unsigned char *pt, unsigned long len, symmetric_CTR *ctr) +{ + LTC_ARGCHK(pt != NULL); + LTC_ARGCHK(ct != NULL); + LTC_ARGCHK(ctr != NULL); + + return ctr_encrypt(ct, pt, len, ctr); +} + +#endif + + +/* $Source: /cvs/libtom/libtomcrypt/src/modes/ctr/ctr_decrypt.c,v $ */ +/* $Revision: 1.5 $ */ +/* $Date: 2006/06/29 01:46:46 $ */ diff --git a/libtomcrypt/src/modes/ctr/ctr_done.c b/libtomcrypt/src/modes/ctr/ctr_done.c new file mode 100644 index 0000000..074c8b6 --- /dev/null +++ b/libtomcrypt/src/modes/ctr/ctr_done.c @@ -0,0 +1,42 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file ctr_done.c + CTR implementation, finish chain, Tom St Denis +*/ + +#ifdef LTC_CTR_MODE + +/** Terminate the chain + @param ctr The CTR chain to terminate + @return CRYPT_OK on success +*/ +int ctr_done(symmetric_CTR *ctr) +{ + int err; + LTC_ARGCHK(ctr != NULL); + + if ((err = cipher_is_valid(ctr->cipher)) != CRYPT_OK) { + return err; + } + cipher_descriptor[ctr->cipher].done(&ctr->key); + return CRYPT_OK; +} + + + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/modes/ctr/ctr_done.c,v $ */ +/* $Revision: 1.6 $ */ +/* $Date: 2006/06/29 01:46:46 $ */ diff --git a/libtomcrypt/src/modes/ctr/ctr_encrypt.c b/libtomcrypt/src/modes/ctr/ctr_encrypt.c new file mode 100644 index 0000000..84dd65b --- /dev/null +++ b/libtomcrypt/src/modes/ctr/ctr_encrypt.c @@ -0,0 +1,112 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file ctr_encrypt.c + CTR implementation, encrypt data, Tom St Denis +*/ + + +#ifdef LTC_CTR_MODE + +/** + CTR encrypt + @param pt Plaintext + @param ct [out] Ciphertext + @param len Length of plaintext (octets) + @param ctr CTR state + @return CRYPT_OK if successful +*/ +int ctr_encrypt(const unsigned char *pt, unsigned char *ct, unsigned long len, symmetric_CTR *ctr) +{ + int x, err; + + LTC_ARGCHK(pt != NULL); + LTC_ARGCHK(ct != NULL); + LTC_ARGCHK(ctr != NULL); + + if ((err = cipher_is_valid(ctr->cipher)) != CRYPT_OK) { + return err; + } + + /* is blocklen/padlen valid? */ + if (ctr->blocklen < 1 || ctr->blocklen > (int)sizeof(ctr->ctr) || + ctr->padlen < 0 || ctr->padlen > (int)sizeof(ctr->pad)) { + return CRYPT_INVALID_ARG; + } + +#ifdef LTC_FAST + if (ctr->blocklen % sizeof(LTC_FAST_TYPE)) { + return CRYPT_INVALID_ARG; + } +#endif + + /* handle acceleration only if pad is empty, accelerator is present and length is >= a block size */ + if ((ctr->padlen == ctr->blocklen) && cipher_descriptor[ctr->cipher].accel_ctr_encrypt != NULL && (len >= (unsigned long)ctr->blocklen)) { + if ((err = cipher_descriptor[ctr->cipher].accel_ctr_encrypt(pt, ct, len/ctr->blocklen, ctr->ctr, ctr->mode, &ctr->key)) != CRYPT_OK) { + return err; + } + len %= ctr->blocklen; + } + + while (len) { + /* is the pad empty? */ + if (ctr->padlen == ctr->blocklen) { + /* increment counter */ + if (ctr->mode == CTR_COUNTER_LITTLE_ENDIAN) { + /* little-endian */ + for (x = 0; x < ctr->blocklen; x++) { + ctr->ctr[x] = (ctr->ctr[x] + (unsigned char)1) & (unsigned char)255; + if (ctr->ctr[x] != (unsigned char)0) { + break; + } + } + } else { + /* big-endian */ + for (x = ctr->blocklen-1; x >= 0; x--) { + ctr->ctr[x] = (ctr->ctr[x] + (unsigned char)1) & (unsigned char)255; + if (ctr->ctr[x] != (unsigned char)0) { + break; + } + } + } + + /* encrypt it */ + if ((err = cipher_descriptor[ctr->cipher].ecb_encrypt(ctr->ctr, ctr->pad, &ctr->key)) != CRYPT_OK) { + return err; + } + ctr->padlen = 0; + } +#ifdef LTC_FAST + if (ctr->padlen == 0 && len >= (unsigned long)ctr->blocklen) { + for (x = 0; x < ctr->blocklen; x += sizeof(LTC_FAST_TYPE)) { + *((LTC_FAST_TYPE*)((unsigned char *)ct + x)) = *((LTC_FAST_TYPE*)((unsigned char *)pt + x)) ^ + *((LTC_FAST_TYPE*)((unsigned char *)ctr->pad + x)); + } + pt += ctr->blocklen; + ct += ctr->blocklen; + len -= ctr->blocklen; + ctr->padlen = ctr->blocklen; + continue; + } +#endif + *ct++ = *pt++ ^ ctr->pad[ctr->padlen++]; + --len; + } + return CRYPT_OK; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/modes/ctr/ctr_encrypt.c,v $ */ +/* $Revision: 1.20 $ */ +/* $Date: 2006/11/21 00:18:23 $ */ diff --git a/libtomcrypt/src/modes/ctr/ctr_getiv.c b/libtomcrypt/src/modes/ctr/ctr_getiv.c new file mode 100644 index 0000000..2fbf888 --- /dev/null +++ b/libtomcrypt/src/modes/ctr/ctr_getiv.c @@ -0,0 +1,46 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file ctr_getiv.c + CTR implementation, get IV, Tom St Denis +*/ + +#ifdef LTC_CTR_MODE + +/** + Get the current initial vector + @param IV [out] The destination of the initial vector + @param len [in/out] The max size and resulting size of the initial vector + @param ctr The CTR state + @return CRYPT_OK if successful +*/ +int ctr_getiv(unsigned char *IV, unsigned long *len, symmetric_CTR *ctr) +{ + LTC_ARGCHK(IV != NULL); + LTC_ARGCHK(len != NULL); + LTC_ARGCHK(ctr != NULL); + if ((unsigned long)ctr->blocklen > *len) { + *len = ctr->blocklen; + return CRYPT_BUFFER_OVERFLOW; + } + XMEMCPY(IV, ctr->ctr, ctr->blocklen); + *len = ctr->blocklen; + + return CRYPT_OK; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/modes/ctr/ctr_getiv.c,v $ */ +/* $Revision: 1.6 $ */ +/* $Date: 2006/06/29 01:46:46 $ */ diff --git a/libtomcrypt/src/modes/ctr/ctr_setiv.c b/libtomcrypt/src/modes/ctr/ctr_setiv.c new file mode 100644 index 0000000..8e8649f --- /dev/null +++ b/libtomcrypt/src/modes/ctr/ctr_setiv.c @@ -0,0 +1,56 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file ctr_setiv.c + CTR implementation, set IV, Tom St Denis +*/ + +#ifdef LTC_CTR_MODE + +/** + Set an initial vector + @param IV The initial vector + @param len The length of the vector (in octets) + @param ctr The CTR state + @return CRYPT_OK if successful +*/ +int ctr_setiv(const unsigned char *IV, unsigned long len, symmetric_CTR *ctr) +{ + int err; + + LTC_ARGCHK(IV != NULL); + LTC_ARGCHK(ctr != NULL); + + /* bad param? */ + if ((err = cipher_is_valid(ctr->cipher)) != CRYPT_OK) { + return err; + } + + if (len != (unsigned long)ctr->blocklen) { + return CRYPT_INVALID_ARG; + } + + /* set IV */ + XMEMCPY(ctr->ctr, IV, len); + + /* force next block */ + ctr->padlen = 0; + return cipher_descriptor[ctr->cipher].ecb_encrypt(IV, ctr->pad, &ctr->key); +} + +#endif + + +/* $Source: /cvs/libtom/libtomcrypt/src/modes/ctr/ctr_setiv.c,v $ */ +/* $Revision: 1.6 $ */ +/* $Date: 2006/06/29 01:46:46 $ */ diff --git a/libtomcrypt/src/modes/ctr/ctr_start.c b/libtomcrypt/src/modes/ctr/ctr_start.c new file mode 100644 index 0000000..895c8a4 --- /dev/null +++ b/libtomcrypt/src/modes/ctr/ctr_start.c @@ -0,0 +1,91 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file ctr_start.c + CTR implementation, start chain, Tom St Denis +*/ + + +#ifdef LTC_CTR_MODE + +/** + Initialize a CTR context + @param cipher The index of the cipher desired + @param IV The initial vector + @param key The secret key + @param keylen The length of the secret key (octets) + @param num_rounds Number of rounds in the cipher desired (0 for default) + @param ctr_mode The counter mode (CTR_COUNTER_LITTLE_ENDIAN or CTR_COUNTER_BIG_ENDIAN) + @param ctr The CTR state to initialize + @return CRYPT_OK if successful +*/ +int ctr_start( int cipher, + const unsigned char *IV, + const unsigned char *key, int keylen, + int num_rounds, int ctr_mode, + symmetric_CTR *ctr) +{ + int x, err; + + LTC_ARGCHK(IV != NULL); + LTC_ARGCHK(key != NULL); + LTC_ARGCHK(ctr != NULL); + + /* bad param? */ + if ((err = cipher_is_valid(cipher)) != CRYPT_OK) { + return err; + } + + /* setup cipher */ + if ((err = cipher_descriptor[cipher].setup(key, keylen, num_rounds, &ctr->key)) != CRYPT_OK) { + return err; + } + + /* copy ctr */ + ctr->blocklen = cipher_descriptor[cipher].block_length; + ctr->cipher = cipher; + ctr->padlen = 0; + ctr->mode = ctr_mode & 1; + for (x = 0; x < ctr->blocklen; x++) { + ctr->ctr[x] = IV[x]; + } + + if (ctr_mode & LTC_CTR_RFC3686) { + /* increment the IV as per RFC 3686 */ + if (ctr->mode == CTR_COUNTER_LITTLE_ENDIAN) { + /* little-endian */ + for (x = 0; x < ctr->blocklen; x++) { + ctr->ctr[x] = (ctr->ctr[x] + (unsigned char)1) & (unsigned char)255; + if (ctr->ctr[x] != (unsigned char)0) { + break; + } + } + } else { + /* big-endian */ + for (x = ctr->blocklen-1; x >= 0; x--) { + ctr->ctr[x] = (ctr->ctr[x] + (unsigned char)1) & (unsigned char)255; + if (ctr->ctr[x] != (unsigned char)0) { + break; + } + } + } + } + + return cipher_descriptor[ctr->cipher].ecb_encrypt(ctr->ctr, ctr->pad, &ctr->key); +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/modes/ctr/ctr_start.c,v $ */ +/* $Revision: 1.11 $ */ +/* $Date: 2006/11/05 01:46:35 $ */ diff --git a/libtomcrypt/src/modes/ctr/ctr_test.c b/libtomcrypt/src/modes/ctr/ctr_test.c new file mode 100644 index 0000000..ad20778 --- /dev/null +++ b/libtomcrypt/src/modes/ctr/ctr_test.c @@ -0,0 +1,85 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file ctr_test.c + CTR implementation, Tests again RFC 3686, Tom St Denis +*/ + +#ifdef LTC_CTR_MODE + +int ctr_test(void) +{ +#ifdef LTC_NO_TEST + return CRYPT_NOP; +#else + static const struct { + int keylen, msglen; + unsigned char key[32], IV[16], pt[64], ct[64]; + } tests[] = { +/* 128-bit key, 16-byte pt */ +{ + 16, 16, + {0xAE,0x68,0x52,0xF8,0x12,0x10,0x67,0xCC,0x4B,0xF7,0xA5,0x76,0x55,0x77,0xF3,0x9E }, + {0x00,0x00,0x00,0x30,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00 }, + {0x53,0x69,0x6E,0x67,0x6C,0x65,0x20,0x62,0x6C,0x6F,0x63,0x6B,0x20,0x6D,0x73,0x67 }, + {0xE4,0x09,0x5D,0x4F,0xB7,0xA7,0xB3,0x79,0x2D,0x61,0x75,0xA3,0x26,0x13,0x11,0xB8 }, +}, + +/* 128-bit key, 36-byte pt */ +{ + 16, 36, + {0x76,0x91,0xBE,0x03,0x5E,0x50,0x20,0xA8,0xAC,0x6E,0x61,0x85,0x29,0xF9,0xA0,0xDC }, + {0x00,0xE0,0x01,0x7B,0x27,0x77,0x7F,0x3F,0x4A,0x17,0x86,0xF0,0x00,0x00,0x00,0x00 }, + {0x00,0x01,0x02,0x03,0x04,0x05,0x06,0x07,0x08,0x09,0x0A,0x0B,0x0C,0x0D,0x0E,0x0F, + 0x10,0x11,0x12,0x13,0x14,0x15,0x16,0x17,0x18,0x19,0x1A,0x1B,0x1C,0x1D,0x1E,0x1F, + 0x20,0x21,0x22,0x23}, + {0xC1,0xCF,0x48,0xA8,0x9F,0x2F,0xFD,0xD9,0xCF,0x46,0x52,0xE9,0xEF,0xDB,0x72,0xD7, + 0x45,0x40,0xA4,0x2B,0xDE,0x6D,0x78,0x36,0xD5,0x9A,0x5C,0xEA,0xAE,0xF3,0x10,0x53, + 0x25,0xB2,0x07,0x2F }, +}, +}; + int idx, err, x; + unsigned char buf[64]; + symmetric_CTR ctr; + + /* AES can be under rijndael or aes... try to find it */ + if ((idx = find_cipher("aes")) == -1) { + if ((idx = find_cipher("rijndael")) == -1) { + return CRYPT_NOP; + } + } + + for (x = 0; x < (int)(sizeof(tests)/sizeof(tests[0])); x++) { + if ((err = ctr_start(idx, tests[x].IV, tests[x].key, tests[x].keylen, 0, CTR_COUNTER_BIG_ENDIAN|LTC_CTR_RFC3686, &ctr)) != CRYPT_OK) { + return err; + } + if ((err = ctr_encrypt(tests[x].pt, buf, tests[x].msglen, &ctr)) != CRYPT_OK) { + return err; + } + ctr_done(&ctr); + if (XMEMCMP(buf, tests[x].ct, tests[x].msglen)) { + return CRYPT_FAIL_TESTVECTOR; + } + } + return CRYPT_OK; +#endif +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/modes/ctr/ctr_test.c,v $ */ +/* $Revision: 1.3 $ */ +/* $Date: 2006/11/05 02:06:49 $ */ + + + diff --git a/libtomcrypt/src/modes/ecb/ecb_decrypt.c b/libtomcrypt/src/modes/ecb/ecb_decrypt.c new file mode 100644 index 0000000..c16fce0 --- /dev/null +++ b/libtomcrypt/src/modes/ecb/ecb_decrypt.c @@ -0,0 +1,61 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file ecb_decrypt.c + ECB implementation, decrypt a block, Tom St Denis +*/ + +#ifdef LTC_ECB_MODE + +/** + ECB decrypt + @param ct Ciphertext + @param pt [out] Plaintext + @param len The number of octets to process (must be multiple of the cipher block size) + @param ecb ECB state + @return CRYPT_OK if successful +*/ +int ecb_decrypt(const unsigned char *ct, unsigned char *pt, unsigned long len, symmetric_ECB *ecb) +{ + int err; + LTC_ARGCHK(pt != NULL); + LTC_ARGCHK(ct != NULL); + LTC_ARGCHK(ecb != NULL); + if ((err = cipher_is_valid(ecb->cipher)) != CRYPT_OK) { + return err; + } + if (len % cipher_descriptor[ecb->cipher].block_length) { + return CRYPT_INVALID_ARG; + } + + /* check for accel */ + if (cipher_descriptor[ecb->cipher].accel_ecb_decrypt != NULL) { + return cipher_descriptor[ecb->cipher].accel_ecb_decrypt(ct, pt, len / cipher_descriptor[ecb->cipher].block_length, &ecb->key); + } else { + while (len) { + if ((err = cipher_descriptor[ecb->cipher].ecb_decrypt(ct, pt, &ecb->key)) != CRYPT_OK) { + return err; + } + pt += cipher_descriptor[ecb->cipher].block_length; + ct += cipher_descriptor[ecb->cipher].block_length; + len -= cipher_descriptor[ecb->cipher].block_length; + } + } + return CRYPT_OK; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/modes/ecb/ecb_decrypt.c,v $ */ +/* $Revision: 1.9 $ */ +/* $Date: 2006/06/29 01:51:34 $ */ diff --git a/libtomcrypt/src/modes/ecb/ecb_done.c b/libtomcrypt/src/modes/ecb/ecb_done.c new file mode 100644 index 0000000..2af3a83 --- /dev/null +++ b/libtomcrypt/src/modes/ecb/ecb_done.c @@ -0,0 +1,42 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file ecb_done.c + ECB implementation, finish chain, Tom St Denis +*/ + +#ifdef LTC_ECB_MODE + +/** Terminate the chain + @param ecb The ECB chain to terminate + @return CRYPT_OK on success +*/ +int ecb_done(symmetric_ECB *ecb) +{ + int err; + LTC_ARGCHK(ecb != NULL); + + if ((err = cipher_is_valid(ecb->cipher)) != CRYPT_OK) { + return err; + } + cipher_descriptor[ecb->cipher].done(&ecb->key); + return CRYPT_OK; +} + + + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/modes/ecb/ecb_done.c,v $ */ +/* $Revision: 1.7 $ */ +/* $Date: 2006/06/29 01:51:34 $ */ diff --git a/libtomcrypt/src/modes/ecb/ecb_encrypt.c b/libtomcrypt/src/modes/ecb/ecb_encrypt.c new file mode 100644 index 0000000..f6910c6 --- /dev/null +++ b/libtomcrypt/src/modes/ecb/ecb_encrypt.c @@ -0,0 +1,61 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file ecb_encrypt.c + ECB implementation, encrypt a block, Tom St Denis +*/ + +#ifdef LTC_ECB_MODE + +/** + ECB encrypt + @param pt Plaintext + @param ct [out] Ciphertext + @param len The number of octets to process (must be multiple of the cipher block size) + @param ecb ECB state + @return CRYPT_OK if successful +*/ +int ecb_encrypt(const unsigned char *pt, unsigned char *ct, unsigned long len, symmetric_ECB *ecb) +{ + int err; + LTC_ARGCHK(pt != NULL); + LTC_ARGCHK(ct != NULL); + LTC_ARGCHK(ecb != NULL); + if ((err = cipher_is_valid(ecb->cipher)) != CRYPT_OK) { + return err; + } + if (len % cipher_descriptor[ecb->cipher].block_length) { + return CRYPT_INVALID_ARG; + } + + /* check for accel */ + if (cipher_descriptor[ecb->cipher].accel_ecb_encrypt != NULL) { + return cipher_descriptor[ecb->cipher].accel_ecb_encrypt(pt, ct, len / cipher_descriptor[ecb->cipher].block_length, &ecb->key); + } else { + while (len) { + if ((err = cipher_descriptor[ecb->cipher].ecb_encrypt(pt, ct, &ecb->key)) != CRYPT_OK) { + return err; + } + pt += cipher_descriptor[ecb->cipher].block_length; + ct += cipher_descriptor[ecb->cipher].block_length; + len -= cipher_descriptor[ecb->cipher].block_length; + } + } + return CRYPT_OK; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/modes/ecb/ecb_encrypt.c,v $ */ +/* $Revision: 1.9 $ */ +/* $Date: 2006/06/29 01:51:34 $ */ diff --git a/libtomcrypt/src/modes/ecb/ecb_start.c b/libtomcrypt/src/modes/ecb/ecb_start.c new file mode 100644 index 0000000..cc84579 --- /dev/null +++ b/libtomcrypt/src/modes/ecb/ecb_start.c @@ -0,0 +1,48 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file ecb_start.c + ECB implementation, start chain, Tom St Denis +*/ + + +#ifdef LTC_ECB_MODE + +/** + Initialize a ECB context + @param cipher The index of the cipher desired + @param key The secret key + @param keylen The length of the secret key (octets) + @param num_rounds Number of rounds in the cipher desired (0 for default) + @param ecb The ECB state to initialize + @return CRYPT_OK if successful +*/ +int ecb_start(int cipher, const unsigned char *key, int keylen, int num_rounds, symmetric_ECB *ecb) +{ + int err; + LTC_ARGCHK(key != NULL); + LTC_ARGCHK(ecb != NULL); + + if ((err = cipher_is_valid(cipher)) != CRYPT_OK) { + return err; + } + ecb->cipher = cipher; + ecb->blocklen = cipher_descriptor[cipher].block_length; + return cipher_descriptor[cipher].setup(key, keylen, num_rounds, &ecb->key); +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/modes/ecb/ecb_start.c,v $ */ +/* $Revision: 1.5 $ */ +/* $Date: 2006/06/29 01:51:34 $ */ diff --git a/libtomcrypt/src/modes/f8/f8_decrypt.c b/libtomcrypt/src/modes/f8/f8_decrypt.c new file mode 100644 index 0000000..fc8f61a --- /dev/null +++ b/libtomcrypt/src/modes/f8/f8_decrypt.c @@ -0,0 +1,43 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file f8_decrypt.c + F8 implementation, decrypt data, Tom St Denis +*/ + +#ifdef LTC_F8_MODE + +/** + F8 decrypt + @param ct Ciphertext + @param pt [out] Plaintext + @param len Length of ciphertext (octets) + @param f8 F8 state + @return CRYPT_OK if successful +*/ +int f8_decrypt(const unsigned char *ct, unsigned char *pt, unsigned long len, symmetric_F8 *f8) +{ + LTC_ARGCHK(pt != NULL); + LTC_ARGCHK(ct != NULL); + LTC_ARGCHK(f8 != NULL); + return f8_encrypt(ct, pt, len, f8); +} + + +#endif + + + +/* $Source: /cvs/libtom/libtomcrypt/src/modes/f8/f8_decrypt.c,v $ */ +/* $Revision: 1.2 $ */ +/* $Date: 2006/06/16 22:49:25 $ */ diff --git a/libtomcrypt/src/modes/f8/f8_done.c b/libtomcrypt/src/modes/f8/f8_done.c new file mode 100644 index 0000000..c864767 --- /dev/null +++ b/libtomcrypt/src/modes/f8/f8_done.c @@ -0,0 +1,42 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file f8_done.c + F8 implementation, finish chain, Tom St Denis +*/ + +#ifdef LTC_F8_MODE + +/** Terminate the chain + @param f8 The F8 chain to terminate + @return CRYPT_OK on success +*/ +int f8_done(symmetric_F8 *f8) +{ + int err; + LTC_ARGCHK(f8 != NULL); + + if ((err = cipher_is_valid(f8->cipher)) != CRYPT_OK) { + return err; + } + cipher_descriptor[f8->cipher].done(&f8->key); + return CRYPT_OK; +} + + + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/modes/f8/f8_done.c,v $ */ +/* $Revision: 1.2 $ */ +/* $Date: 2006/06/16 22:49:25 $ */ diff --git a/libtomcrypt/src/modes/f8/f8_encrypt.c b/libtomcrypt/src/modes/f8/f8_encrypt.c new file mode 100644 index 0000000..fc33be9 --- /dev/null +++ b/libtomcrypt/src/modes/f8/f8_encrypt.c @@ -0,0 +1,103 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file f8_encrypt.c + F8 implementation, encrypt data, Tom St Denis +*/ + +#ifdef LTC_F8_MODE + +/** + F8 encrypt + @param pt Plaintext + @param ct [out] Ciphertext + @param len Length of plaintext (octets) + @param f8 F8 state + @return CRYPT_OK if successful +*/ +int f8_encrypt(const unsigned char *pt, unsigned char *ct, unsigned long len, symmetric_F8 *f8) +{ + int err, x; + unsigned char buf[MAXBLOCKSIZE]; + LTC_ARGCHK(pt != NULL); + LTC_ARGCHK(ct != NULL); + LTC_ARGCHK(f8 != NULL); + if ((err = cipher_is_valid(f8->cipher)) != CRYPT_OK) { + return err; + } + + /* is blocklen/padlen valid? */ + if (f8->blocklen < 0 || f8->blocklen > (int)sizeof(f8->IV) || + f8->padlen < 0 || f8->padlen > (int)sizeof(f8->IV)) { + return CRYPT_INVALID_ARG; + } + + zeromem(buf, sizeof(buf)); + + /* make sure the pad is empty */ + if (f8->padlen == f8->blocklen) { + /* xor of IV, MIV and blockcnt == what goes into cipher */ + STORE32H(f8->blockcnt, (buf+(f8->blocklen-4))); + ++(f8->blockcnt); + for (x = 0; x < f8->blocklen; x++) { + f8->IV[x] ^= f8->MIV[x] ^ buf[x]; + } + if ((err = cipher_descriptor[f8->cipher].ecb_encrypt(f8->IV, f8->IV, &f8->key)) != CRYPT_OK) { + return err; + } + f8->padlen = 0; + } + +#ifdef LTC_FAST + if (f8->padlen == 0) { + while (len >= (unsigned long)f8->blocklen) { + STORE32H(f8->blockcnt, (buf+(f8->blocklen-4))); + ++(f8->blockcnt); + for (x = 0; x < f8->blocklen; x += sizeof(LTC_FAST_TYPE)) { + *((LTC_FAST_TYPE*)(&ct[x])) = *((LTC_FAST_TYPE*)(&pt[x])) ^ *((LTC_FAST_TYPE*)(&f8->IV[x])); + *((LTC_FAST_TYPE*)(&f8->IV[x])) ^= *((LTC_FAST_TYPE*)(&f8->MIV[x])) ^ *((LTC_FAST_TYPE*)(&buf[x])); + } + if ((err = cipher_descriptor[f8->cipher].ecb_encrypt(f8->IV, f8->IV, &f8->key)) != CRYPT_OK) { + return err; + } + len -= x; + pt += x; + ct += x; + } + } +#endif + + while (len > 0) { + if (f8->padlen == f8->blocklen) { + /* xor of IV, MIV and blockcnt == what goes into cipher */ + STORE32H(f8->blockcnt, (buf+(f8->blocklen-4))); + ++(f8->blockcnt); + for (x = 0; x < f8->blocklen; x++) { + f8->IV[x] ^= f8->MIV[x] ^ buf[x]; + } + if ((err = cipher_descriptor[f8->cipher].ecb_encrypt(f8->IV, f8->IV, &f8->key)) != CRYPT_OK) { + return err; + } + f8->padlen = 0; + } + *ct++ = *pt++ ^ f8->IV[f8->padlen++]; + --len; + } + return CRYPT_OK; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/modes/f8/f8_encrypt.c,v $ */ +/* $Revision: 1.6 $ */ +/* $Date: 2006/11/05 04:16:32 $ */ diff --git a/libtomcrypt/src/modes/f8/f8_getiv.c b/libtomcrypt/src/modes/f8/f8_getiv.c new file mode 100644 index 0000000..2c5d92f --- /dev/null +++ b/libtomcrypt/src/modes/f8/f8_getiv.c @@ -0,0 +1,46 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file ofb_getiv.c + F8 implementation, get IV, Tom St Denis +*/ + +#ifdef LTC_F8_MODE + +/** + Get the current initial vector + @param IV [out] The destination of the initial vector + @param len [in/out] The max size and resulting size of the initial vector + @param f8 The F8 state + @return CRYPT_OK if successful +*/ +int f8_getiv(unsigned char *IV, unsigned long *len, symmetric_F8 *f8) +{ + LTC_ARGCHK(IV != NULL); + LTC_ARGCHK(len != NULL); + LTC_ARGCHK(f8 != NULL); + if ((unsigned long)f8->blocklen > *len) { + *len = f8->blocklen; + return CRYPT_BUFFER_OVERFLOW; + } + XMEMCPY(IV, f8->IV, f8->blocklen); + *len = f8->blocklen; + + return CRYPT_OK; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/modes/f8/f8_getiv.c,v $ */ +/* $Revision: 1.2 $ */ +/* $Date: 2006/06/16 22:49:25 $ */ diff --git a/libtomcrypt/src/modes/f8/f8_setiv.c b/libtomcrypt/src/modes/f8/f8_setiv.c new file mode 100644 index 0000000..469cc15 --- /dev/null +++ b/libtomcrypt/src/modes/f8/f8_setiv.c @@ -0,0 +1,52 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file f8_setiv.c + F8 implementation, set IV, Tom St Denis +*/ + +#ifdef LTC_F8_MODE + +/** + Set an initial vector + @param IV The initial vector + @param len The length of the vector (in octets) + @param f8 The F8 state + @return CRYPT_OK if successful +*/ +int f8_setiv(const unsigned char *IV, unsigned long len, symmetric_F8 *f8) +{ + int err; + + LTC_ARGCHK(IV != NULL); + LTC_ARGCHK(f8 != NULL); + + if ((err = cipher_is_valid(f8->cipher)) != CRYPT_OK) { + return err; + } + + if (len != (unsigned long)f8->blocklen) { + return CRYPT_INVALID_ARG; + } + + /* force next block */ + f8->padlen = 0; + return cipher_descriptor[f8->cipher].ecb_encrypt(IV, f8->IV, &f8->key); +} + +#endif + + +/* $Source: /cvs/libtom/libtomcrypt/src/modes/f8/f8_setiv.c,v $ */ +/* $Revision: 1.2 $ */ +/* $Date: 2006/06/16 22:49:25 $ */ diff --git a/libtomcrypt/src/modes/f8/f8_start.c b/libtomcrypt/src/modes/f8/f8_start.c new file mode 100644 index 0000000..bb05c16 --- /dev/null +++ b/libtomcrypt/src/modes/f8/f8_start.c @@ -0,0 +1,98 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file f8_start.c + F8 implementation, start chain, Tom St Denis +*/ + + +#ifdef LTC_F8_MODE + +/** + Initialize an F8 context + @param cipher The index of the cipher desired + @param IV The initial vector + @param key The secret key + @param keylen The length of the secret key (octets) + @param salt_key The salting key for the IV + @param skeylen The length of the salting key (octets) + @param num_rounds Number of rounds in the cipher desired (0 for default) + @param f8 The F8 state to initialize + @return CRYPT_OK if successful +*/ +int f8_start( int cipher, const unsigned char *IV, + const unsigned char *key, int keylen, + const unsigned char *salt_key, int skeylen, + int num_rounds, symmetric_F8 *f8) +{ + int x, err; + unsigned char tkey[MAXBLOCKSIZE]; + + LTC_ARGCHK(IV != NULL); + LTC_ARGCHK(key != NULL); + LTC_ARGCHK(salt_key != NULL); + LTC_ARGCHK(f8 != NULL); + + if ((err = cipher_is_valid(cipher)) != CRYPT_OK) { + return err; + } + +#ifdef LTC_FAST + if (cipher_descriptor[cipher].block_length % sizeof(LTC_FAST_TYPE)) { + return CRYPT_INVALID_ARG; + } +#endif + + /* copy details */ + f8->blockcnt = 0; + f8->cipher = cipher; + f8->blocklen = cipher_descriptor[cipher].block_length; + f8->padlen = f8->blocklen; + + /* now get key ^ salt_key [extend salt_ket with 0x55 as required to match length] */ + zeromem(tkey, sizeof(tkey)); + for (x = 0; x < keylen && x < (int)sizeof(tkey); x++) { + tkey[x] = key[x]; + } + for (x = 0; x < skeylen && x < (int)sizeof(tkey); x++) { + tkey[x] ^= salt_key[x]; + } + for (; x < keylen && x < (int)sizeof(tkey); x++) { + tkey[x] ^= 0x55; + } + + /* now encrypt with tkey[0..keylen-1] the IV and use that as the IV */ + if ((err = cipher_descriptor[cipher].setup(tkey, keylen, num_rounds, &f8->key)) != CRYPT_OK) { + return err; + } + + /* encrypt IV */ + if ((err = cipher_descriptor[f8->cipher].ecb_encrypt(IV, f8->MIV, &f8->key)) != CRYPT_OK) { + cipher_descriptor[f8->cipher].done(&f8->key); + return err; + } + zeromem(tkey, sizeof(tkey)); + zeromem(f8->IV, sizeof(f8->IV)); + + /* terminate this cipher */ + cipher_descriptor[f8->cipher].done(&f8->key); + + /* init the cipher */ + return cipher_descriptor[cipher].setup(key, keylen, num_rounds, &f8->key); +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/modes/f8/f8_start.c,v $ */ +/* $Revision: 1.7 $ */ +/* $Date: 2006/11/05 01:36:43 $ */ diff --git a/libtomcrypt/src/modes/f8/f8_test_mode.c b/libtomcrypt/src/modes/f8/f8_test_mode.c new file mode 100644 index 0000000..68160ea --- /dev/null +++ b/libtomcrypt/src/modes/f8/f8_test_mode.c @@ -0,0 +1,76 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file f8_test_mode.c + F8 implementation, test, Tom St Denis +*/ + + +#ifdef LTC_F8_MODE + +int f8_test_mode(void) +{ +#ifndef LTC_TEST + return CRYPT_NOP; +#else + static const unsigned char key[16] = { 0x23, 0x48, 0x29, 0x00, 0x84, 0x67, 0xbe, 0x18, + 0x6c, 0x3d, 0xe1, 0x4a, 0xae, 0x72, 0xd6, 0x2c }; + static const unsigned char salt[4] = { 0x32, 0xf2, 0x87, 0x0d }; + static const unsigned char IV[16] = { 0x00, 0x6e, 0x5c, 0xba, 0x50, 0x68, 0x1d, 0xe5, + 0x5c, 0x62, 0x15, 0x99, 0xd4, 0x62, 0x56, 0x4a }; + static const unsigned char pt[39] = { 0x70, 0x73, 0x65, 0x75, 0x64, 0x6f, 0x72, 0x61, + 0x6e, 0x64, 0x6f, 0x6d, 0x6e, 0x65, 0x73, 0x73, + 0x20, 0x69, 0x73, 0x20, 0x74, 0x68, 0x65, 0x20, + 0x6e, 0x65, 0x78, 0x74, 0x20, 0x62, 0x65, 0x73, + 0x74, 0x20, 0x74, 0x68, 0x69, 0x6e, 0x67 }; + static const unsigned char ct[39] = { 0x01, 0x9c, 0xe7, 0xa2, 0x6e, 0x78, 0x54, 0x01, + 0x4a, 0x63, 0x66, 0xaa, 0x95, 0xd4, 0xee, 0xfd, + 0x1a, 0xd4, 0x17, 0x2a, 0x14, 0xf9, 0xfa, 0xf4, + 0x55, 0xb7, 0xf1, 0xd4, 0xb6, 0x2b, 0xd0, 0x8f, + 0x56, 0x2c, 0x0e, 0xef, 0x7c, 0x48, 0x02 }; + unsigned char buf[39]; + symmetric_F8 f8; + int err, idx; + + idx = find_cipher("aes"); + if (idx == -1) { + idx = find_cipher("rijndael"); + if (idx == -1) return CRYPT_NOP; + } + + /* initialize the context */ + if ((err = f8_start(idx, IV, key, sizeof(key), salt, sizeof(salt), 0, &f8)) != CRYPT_OK) { + return err; + } + + /* encrypt block */ + if ((err = f8_encrypt(pt, buf, sizeof(pt), &f8)) != CRYPT_OK) { + f8_done(&f8); + return err; + } + f8_done(&f8); + + /* compare */ + if (XMEMCMP(buf, ct, sizeof(ct))) { + return CRYPT_FAIL_TESTVECTOR; + } + + return CRYPT_OK; +#endif +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/modes/f8/f8_test_mode.c,v $ */ +/* $Revision: 1.3 $ */ +/* $Date: 2006/11/13 11:55:25 $ */ diff --git a/libtomcrypt/src/modes/lrw/lrw_decrypt.c b/libtomcrypt/src/modes/lrw/lrw_decrypt.c new file mode 100644 index 0000000..24eece8 --- /dev/null +++ b/libtomcrypt/src/modes/lrw/lrw_decrypt.c @@ -0,0 +1,51 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file lrw_decrypt.c + LRW_MODE implementation, Decrypt blocks, Tom St Denis +*/ + +#ifdef LTC_LRW_MODE + +/** + LRW decrypt blocks + @param ct The ciphertext + @param pt [out] The plaintext + @param len The length in octets, must be a multiple of 16 + @param lrw The LRW state +*/ +int lrw_decrypt(const unsigned char *ct, unsigned char *pt, unsigned long len, symmetric_LRW *lrw) +{ + int err; + + LTC_ARGCHK(pt != NULL); + LTC_ARGCHK(ct != NULL); + LTC_ARGCHK(lrw != NULL); + + if ((err = cipher_is_valid(lrw->cipher)) != CRYPT_OK) { + return err; + } + + if (cipher_descriptor[lrw->cipher].accel_lrw_decrypt != NULL) { + return cipher_descriptor[lrw->cipher].accel_lrw_decrypt(ct, pt, len, lrw->IV, lrw->tweak, &lrw->key); + } + + return lrw_process(ct, pt, len, LRW_DECRYPT, lrw); +} + + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/modes/lrw/lrw_decrypt.c,v $ */ +/* $Revision: 1.8 $ */ +/* $Date: 2006/06/29 01:53:13 $ */ diff --git a/libtomcrypt/src/modes/lrw/lrw_done.c b/libtomcrypt/src/modes/lrw/lrw_done.c new file mode 100644 index 0000000..4ae75c3 --- /dev/null +++ b/libtomcrypt/src/modes/lrw/lrw_done.c @@ -0,0 +1,42 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file lrw_done.c + LRW_MODE implementation, Free resources, Tom St Denis +*/ + +#ifdef LTC_LRW_MODE + +/** + Terminate a LRW state + @param lrw The state to terminate + @return CRYPT_OK if successful +*/ +int lrw_done(symmetric_LRW *lrw) +{ + int err; + + LTC_ARGCHK(lrw != NULL); + + if ((err = cipher_is_valid(lrw->cipher)) != CRYPT_OK) { + return err; + } + cipher_descriptor[lrw->cipher].done(&lrw->key); + + return CRYPT_OK; +} + +#endif +/* $Source: /cvs/libtom/libtomcrypt/src/modes/lrw/lrw_done.c,v $ */ +/* $Revision: 1.6 $ */ +/* $Date: 2006/06/29 01:53:13 $ */ diff --git a/libtomcrypt/src/modes/lrw/lrw_encrypt.c b/libtomcrypt/src/modes/lrw/lrw_encrypt.c new file mode 100644 index 0000000..5ed11c9 --- /dev/null +++ b/libtomcrypt/src/modes/lrw/lrw_encrypt.c @@ -0,0 +1,50 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file lrw_encrypt.c + LRW_MODE implementation, Encrypt blocks, Tom St Denis +*/ + +#ifdef LTC_LRW_MODE + +/** + LRW encrypt blocks + @param pt The plaintext + @param ct [out] The ciphertext + @param len The length in octets, must be a multiple of 16 + @param lrw The LRW state +*/ +int lrw_encrypt(const unsigned char *pt, unsigned char *ct, unsigned long len, symmetric_LRW *lrw) +{ + int err; + + LTC_ARGCHK(pt != NULL); + LTC_ARGCHK(ct != NULL); + LTC_ARGCHK(lrw != NULL); + + if ((err = cipher_is_valid(lrw->cipher)) != CRYPT_OK) { + return err; + } + + if (cipher_descriptor[lrw->cipher].accel_lrw_encrypt != NULL) { + return cipher_descriptor[lrw->cipher].accel_lrw_encrypt(pt, ct, len, lrw->IV, lrw->tweak, &lrw->key); + } + + return lrw_process(pt, ct, len, LRW_ENCRYPT, lrw); +} + + +#endif +/* $Source: /cvs/libtom/libtomcrypt/src/modes/lrw/lrw_encrypt.c,v $ */ +/* $Revision: 1.9 $ */ +/* $Date: 2006/06/29 01:53:13 $ */ diff --git a/libtomcrypt/src/modes/lrw/lrw_getiv.c b/libtomcrypt/src/modes/lrw/lrw_getiv.c new file mode 100644 index 0000000..00159ce --- /dev/null +++ b/libtomcrypt/src/modes/lrw/lrw_getiv.c @@ -0,0 +1,45 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file lrw_getiv.c + LRW_MODE implementation, Retrieve the current IV, Tom St Denis +*/ + +#ifdef LTC_LRW_MODE + +/** + Get the IV for LRW + @param IV [out] The IV, must be 16 octets + @param len Length ... must be at least 16 :-) + @param lrw The LRW state to read + @return CRYPT_OK if successful +*/ +int lrw_getiv(unsigned char *IV, unsigned long *len, symmetric_LRW *lrw) +{ + LTC_ARGCHK(IV != NULL); + LTC_ARGCHK(len != NULL); + LTC_ARGCHK(lrw != NULL); + if (*len < 16) { + *len = 16; + return CRYPT_BUFFER_OVERFLOW; + } + + XMEMCPY(IV, lrw->IV, 16); + *len = 16; + return CRYPT_OK; +} + +#endif +/* $Source: /cvs/libtom/libtomcrypt/src/modes/lrw/lrw_getiv.c,v $ */ +/* $Revision: 1.9 $ */ +/* $Date: 2006/06/29 01:53:13 $ */ diff --git a/libtomcrypt/src/modes/lrw/lrw_process.c b/libtomcrypt/src/modes/lrw/lrw_process.c new file mode 100644 index 0000000..451d4ce --- /dev/null +++ b/libtomcrypt/src/modes/lrw/lrw_process.c @@ -0,0 +1,120 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file lrw_process.c + LRW_MODE implementation, Encrypt/decrypt blocks, Tom St Denis +*/ + +#ifdef LTC_LRW_MODE + +/** + Process blocks with LRW, since decrypt/encrypt are largely the same they share this code. + @param pt The "input" data + @param ct [out] The "output" data + @param len The length of the input, must be a multiple of 128-bits (16 octets) + @param mode LRW_ENCRYPT or LRW_DECRYPT + @param lrw The LRW state + @return CRYPT_OK if successful +*/ +int lrw_process(const unsigned char *pt, unsigned char *ct, unsigned long len, int mode, symmetric_LRW *lrw) +{ + unsigned char prod[16]; + int x, err; +#ifdef LRW_TABLES + int y; +#endif + + LTC_ARGCHK(pt != NULL); + LTC_ARGCHK(ct != NULL); + LTC_ARGCHK(lrw != NULL); + + if (len & 15) { + return CRYPT_INVALID_ARG; + } + + while (len) { + /* copy pad */ + XMEMCPY(prod, lrw->pad, 16); + + /* increment IV */ + for (x = 15; x >= 0; x--) { + lrw->IV[x] = (lrw->IV[x] + 1) & 255; + if (lrw->IV[x]) { + break; + } + } + + /* update pad */ +#ifdef LRW_TABLES + /* for each byte changed we undo it's affect on the pad then add the new product */ + for (; x < 16; x++) { +#ifdef LTC_FAST + for (y = 0; y < 16; y += sizeof(LTC_FAST_TYPE)) { + *((LTC_FAST_TYPE *)(lrw->pad + y)) ^= *((LTC_FAST_TYPE *)(&lrw->PC[x][lrw->IV[x]][y])) ^ *((LTC_FAST_TYPE *)(&lrw->PC[x][(lrw->IV[x]-1)&255][y])); + } +#else + for (y = 0; y < 16; y++) { + lrw->pad[y] ^= lrw->PC[x][lrw->IV[x]][y] ^ lrw->PC[x][(lrw->IV[x]-1)&255][y]; + } +#endif + } +#else + gcm_gf_mult(lrw->tweak, lrw->IV, lrw->pad); +#endif + + /* xor prod */ +#ifdef LTC_FAST + for (x = 0; x < 16; x += sizeof(LTC_FAST_TYPE)) { + *((LTC_FAST_TYPE *)(ct + x)) = *((LTC_FAST_TYPE *)(pt + x)) ^ *((LTC_FAST_TYPE *)(prod + x)); + } +#else + for (x = 0; x < 16; x++) { + ct[x] = pt[x] ^ prod[x]; + } +#endif + + /* send through cipher */ + if (mode == LRW_ENCRYPT) { + if ((err = cipher_descriptor[lrw->cipher].ecb_encrypt(ct, ct, &lrw->key)) != CRYPT_OK) { + return err; + } + } else { + if ((err = cipher_descriptor[lrw->cipher].ecb_decrypt(ct, ct, &lrw->key)) != CRYPT_OK) { + return err; + } + } + + /* xor prod */ +#ifdef LTC_FAST + for (x = 0; x < 16; x += sizeof(LTC_FAST_TYPE)) { + *((LTC_FAST_TYPE *)(ct + x)) = *((LTC_FAST_TYPE *)(ct + x)) ^ *((LTC_FAST_TYPE *)(prod + x)); + } +#else + for (x = 0; x < 16; x++) { + ct[x] = ct[x] ^ prod[x]; + } +#endif + + /* move to next */ + pt += 16; + ct += 16; + len -= 16; + } + + return CRYPT_OK; +} + +#endif +/* $Source: /cvs/libtom/libtomcrypt/src/modes/lrw/lrw_process.c,v $ */ +/* $Revision: 1.10 $ */ +/* $Date: 2006/06/29 01:53:13 $ */ diff --git a/libtomcrypt/src/modes/lrw/lrw_setiv.c b/libtomcrypt/src/modes/lrw/lrw_setiv.c new file mode 100644 index 0000000..bb3c0aa --- /dev/null +++ b/libtomcrypt/src/modes/lrw/lrw_setiv.c @@ -0,0 +1,79 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file lrw_setiv.c + LRW_MODE implementation, Set the current IV, Tom St Denis +*/ + +#ifdef LTC_LRW_MODE + +/** + Set the IV for LRW + @param IV The IV, must be 16 octets + @param len Length ... must be 16 :-) + @param lrw The LRW state to update + @return CRYPT_OK if successful +*/ +int lrw_setiv(const unsigned char *IV, unsigned long len, symmetric_LRW *lrw) +{ + int err; +#ifdef LRW_TABLES + unsigned char T[16]; + int x, y; +#endif + LTC_ARGCHK(IV != NULL); + LTC_ARGCHK(lrw != NULL); + + if (len != 16) { + return CRYPT_INVALID_ARG; + } + + if ((err = cipher_is_valid(lrw->cipher)) != CRYPT_OK) { + return err; + } + + /* copy the IV */ + XMEMCPY(lrw->IV, IV, 16); + + /* check if we have to actually do work */ + if (cipher_descriptor[lrw->cipher].accel_lrw_encrypt != NULL && cipher_descriptor[lrw->cipher].accel_lrw_decrypt != NULL) { + /* we have accelerators, let's bail since they don't use lrw->pad anyways */ + return CRYPT_OK; + } + +#ifdef LRW_TABLES + XMEMCPY(T, &lrw->PC[0][IV[0]][0], 16); + for (x = 1; x < 16; x++) { +#ifdef LTC_FAST + for (y = 0; y < 16; y += sizeof(LTC_FAST_TYPE)) { + *((LTC_FAST_TYPE *)(T + y)) ^= *((LTC_FAST_TYPE *)(&lrw->PC[x][IV[x]][y])); + } +#else + for (y = 0; y < 16; y++) { + T[y] ^= lrw->PC[x][IV[x]][y]; + } +#endif + } + XMEMCPY(lrw->pad, T, 16); +#else + gcm_gf_mult(lrw->tweak, IV, lrw->pad); +#endif + + return CRYPT_OK; +} + + +#endif +/* $Source: /cvs/libtom/libtomcrypt/src/modes/lrw/lrw_setiv.c,v $ */ +/* $Revision: 1.12 $ */ +/* $Date: 2006/06/29 01:53:13 $ */ diff --git a/libtomcrypt/src/modes/lrw/lrw_start.c b/libtomcrypt/src/modes/lrw/lrw_start.c new file mode 100644 index 0000000..a9f24b5 --- /dev/null +++ b/libtomcrypt/src/modes/lrw/lrw_start.c @@ -0,0 +1,103 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file lrw_start.c + LRW_MODE implementation, start mode, Tom St Denis +*/ + +#ifdef LTC_LRW_MODE + +/** + Initialize the LRW context + @param cipher The cipher desired, must be a 128-bit block cipher + @param IV The index value, must be 128-bits + @param key The cipher key + @param keylen The length of the cipher key in octets + @param tweak The tweak value (second key), must be 128-bits + @param num_rounds The number of rounds for the cipher (0 == default) + @param lrw [out] The LRW state + @return CRYPT_OK on success. +*/ +int lrw_start( int cipher, + const unsigned char *IV, + const unsigned char *key, int keylen, + const unsigned char *tweak, + int num_rounds, + symmetric_LRW *lrw) +{ + int err; +#ifdef LRW_TABLES + unsigned char B[16]; + int x, y, z, t; +#endif + + LTC_ARGCHK(IV != NULL); + LTC_ARGCHK(key != NULL); + LTC_ARGCHK(tweak != NULL); + LTC_ARGCHK(lrw != NULL); + +#ifdef LTC_FAST + if (16 % sizeof(LTC_FAST_TYPE)) { + return CRYPT_INVALID_ARG; + } +#endif + + /* is cipher valid? */ + if ((err = cipher_is_valid(cipher)) != CRYPT_OK) { + return err; + } + if (cipher_descriptor[cipher].block_length != 16) { + return CRYPT_INVALID_CIPHER; + } + + /* schedule key */ + if ((err = cipher_descriptor[cipher].setup(key, keylen, num_rounds, &lrw->key)) != CRYPT_OK) { + return err; + } + lrw->cipher = cipher; + + /* copy the IV and tweak */ + XMEMCPY(lrw->tweak, tweak, 16); + +#ifdef LRW_TABLES + /* setup tables */ + /* generate the first table as it has no shifting (from which we make the other tables) */ + zeromem(B, 16); + for (y = 0; y < 256; y++) { + B[0] = y; + gcm_gf_mult(tweak, B, &lrw->PC[0][y][0]); + } + + /* now generate the rest of the tables based the previous table */ + for (x = 1; x < 16; x++) { + for (y = 0; y < 256; y++) { + /* now shift it right by 8 bits */ + t = lrw->PC[x-1][y][15]; + for (z = 15; z > 0; z--) { + lrw->PC[x][y][z] = lrw->PC[x-1][y][z-1]; + } + lrw->PC[x][y][0] = gcm_shift_table[t<<1]; + lrw->PC[x][y][1] ^= gcm_shift_table[(t<<1)+1]; + } + } +#endif + + /* generate first pad */ + return lrw_setiv(IV, 16, lrw); +} + + +#endif +/* $Source: /cvs/libtom/libtomcrypt/src/modes/lrw/lrw_start.c,v $ */ +/* $Revision: 1.11 $ */ +/* $Date: 2006/06/29 01:53:13 $ */ diff --git a/libtomcrypt/src/modes/lrw/lrw_test.c b/libtomcrypt/src/modes/lrw/lrw_test.c new file mode 100644 index 0000000..fe33845 --- /dev/null +++ b/libtomcrypt/src/modes/lrw/lrw_test.c @@ -0,0 +1,136 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file lrw_test.c + LRW_MODE implementation, test LRW, Tom St Denis +*/ + +#ifdef LTC_LRW_MODE + +/** + Test LRW against specs + @return CRYPT_OK if goodly +*/ +int lrw_test(void) +{ +#ifndef LTC_TEST + return CRYPT_NOP; +#else + static const struct { + unsigned char key[16], tweak[16], IV[16], P[16], expected_tweak[16], C[16]; + } tests[] = { + +{ +{ 0x45, 0x62, 0xac, 0x25, 0xf8, 0x28, 0x17, 0x6d, 0x4c, 0x26, 0x84, 0x14, 0xb5, 0x68, 0x01, 0x85 }, +{ 0x25, 0x8e, 0x2a, 0x05, 0xe7, 0x3e, 0x9d, 0x03, 0xee, 0x5a, 0x83, 0x0c, 0xcc, 0x09, 0x4c, 0x87 }, +{ 0x80, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, +{ 0x30, 0x31, 0x32, 0x33, 0x34, 0x35, 0x36, 0x37, 0x38, 0x39, 0x41, 0x42, 0x43, 0x44, 0x45, 0x46 }, +{ 0x25, 0x8e, 0x2a, 0x05, 0xe7, 0x3e, 0x9d, 0x03, 0xee, 0x5a, 0x83, 0x0c, 0xcc, 0x09, 0x4c, 0x87 }, +{ 0xf1, 0xb2, 0x73, 0xcd, 0x65, 0xa3, 0xdf, 0x5f, 0xe9, 0x5d, 0x48, 0x92, 0x54, 0x63, 0x4e, 0xb8 } +}, + +{ +{ 0x59, 0x70, 0x47, 0x14, 0xf5, 0x57, 0x47, 0x8c, 0xd7, 0x79, 0xe8, 0x0f, 0x54, 0x88, 0x79, 0x44 }, +{ 0x35, 0x23, 0xc2, 0xde, 0xc5, 0x69, 0x4f, 0xa8, 0x72, 0xa9, 0xac, 0xa7, 0x0b, 0x2b, 0xee, 0xbc }, +{ 0x40, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 }, +{ 0x30, 0x31, 0x32, 0x33, 0x34, 0x35, 0x36, 0x37, 0x38, 0x39, 0x41, 0x42, 0x43, 0x44, 0x45, 0x46 }, +{ 0x1a, 0x91, 0xe1, 0x6f, 0x62, 0xb4, 0xa7, 0xd4, 0x39, 0x54, 0xd6, 0x53, 0x85, 0x95, 0xf7, 0x5e }, +{ 0x00, 0xc8, 0x2b, 0xae, 0x95, 0xbb, 0xcd, 0xe5, 0x27, 0x4f, 0x07, 0x69, 0xb2, 0x60, 0xe1, 0x36 }, +}, + +{ +{ 0x59, 0x70, 0x47, 0x14, 0xf5, 0x57, 0x47, 0x8c, 0xd7, 0x79, 0xe8, 0x0f, 0x54, 0x88, 0x79, 0x44 }, +{ 0x67, 0x53, 0xc9, 0x0c, 0xb7, 0xd8, 0xcd, 0xe5, 0x06, 0xa0, 0x47, 0x78, 0x1a, 0xad, 0x85, 0x11 }, +{ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x02 }, +{ 0x30, 0x31, 0x32, 0x33, 0x34, 0x35, 0x36, 0x37, 0x38, 0x39, 0x41, 0x42, 0x43, 0x44, 0x45, 0x46 }, +{ 0x1a, 0x91, 0xe1, 0x6f, 0x62, 0xb4, 0xa7, 0xd4, 0x39, 0x54, 0xd6, 0x53, 0x85, 0x95, 0xf7, 0x5e }, +{ 0x00, 0xc8, 0x2b, 0xae, 0x95, 0xbb, 0xcd, 0xe5, 0x27, 0x4f, 0x07, 0x69, 0xb2, 0x60, 0xe1, 0x36 }, +}, + +{ + +{ 0xd8, 0x2a, 0x91, 0x34, 0xb2, 0x6a, 0x56, 0x50, 0x30, 0xfe, 0x69, 0xe2, 0x37, 0x7f, 0x98, 0x47 }, +{ 0x4e, 0xb5, 0x5d, 0x31, 0x05, 0x97, 0x3a, 0x3f, 0x5e, 0x23, 0xda, 0xfb, 0x5a, 0x45, 0xd6, 0xc0 }, +{ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x02, 0x00, 0x00, 0x00, 0x00 }, +{ 0x30, 0x31, 0x32, 0x33, 0x34, 0x35, 0x36, 0x37, 0x38, 0x39, 0x41, 0x42, 0x43, 0x44, 0x45, 0x46 }, +{ 0x18, 0xc9, 0x1f, 0x6d, 0x60, 0x1a, 0x1a, 0x37, 0x5d, 0x0b, 0x0e, 0xf7, 0x3a, 0xd5, 0x74, 0xc4 }, +{ 0x76, 0x32, 0x21, 0x83, 0xed, 0x8f, 0xf1, 0x82, 0xf9, 0x59, 0x62, 0x03, 0x69, 0x0e, 0x5e, 0x01 }, + +} +}; + + int idx, err, x; + symmetric_LRW lrw; + unsigned char buf[2][16]; + + idx = find_cipher("aes"); + if (idx == -1) { + idx = find_cipher("rijndael"); + if (idx == -1) { + return CRYPT_NOP; + } + } + + for (x = 0; x < (int)(sizeof(tests)/sizeof(tests[0])); x++) { + /* schedule it */ + if ((err = lrw_start(idx, tests[x].IV, tests[x].key, 16, tests[x].tweak, 0, &lrw)) != CRYPT_OK) { + return err; + } + + /* check pad against expected tweak */ + if (XMEMCMP(tests[x].expected_tweak, lrw.pad, 16)) { + lrw_done(&lrw); + return CRYPT_FAIL_TESTVECTOR; + } + + /* process block */ + if ((err = lrw_encrypt(tests[x].P, buf[0], 16, &lrw)) != CRYPT_OK) { + lrw_done(&lrw); + return err; + } + + if (XMEMCMP(buf[0], tests[x].C, 16)) { + lrw_done(&lrw); + return CRYPT_FAIL_TESTVECTOR; + } + + /* process block */ + if ((err = lrw_setiv(tests[x].IV, 16, &lrw)) != CRYPT_OK) { + lrw_done(&lrw); + return err; + } + + if ((err = lrw_decrypt(buf[0], buf[1], 16, &lrw)) != CRYPT_OK) { + lrw_done(&lrw); + return err; + } + + if (XMEMCMP(buf[1], tests[x].P, 16)) { + lrw_done(&lrw); + return CRYPT_FAIL_TESTVECTOR; + } + if ((err = lrw_done(&lrw)) != CRYPT_OK) { + return err; + } + } + return CRYPT_OK; +#endif +} + +#endif + + + +/* $Source: /cvs/libtom/libtomcrypt/src/modes/lrw/lrw_test.c,v $ */ +/* $Revision: 1.11 $ */ +/* $Date: 2006/06/29 01:53:13 $ */ diff --git a/libtomcrypt/src/modes/ofb/ofb_decrypt.c b/libtomcrypt/src/modes/ofb/ofb_decrypt.c new file mode 100644 index 0000000..1ada1ed --- /dev/null +++ b/libtomcrypt/src/modes/ofb/ofb_decrypt.c @@ -0,0 +1,43 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file ofb_decrypt.c + OFB implementation, decrypt data, Tom St Denis +*/ + +#ifdef LTC_OFB_MODE + +/** + OFB decrypt + @param ct Ciphertext + @param pt [out] Plaintext + @param len Length of ciphertext (octets) + @param ofb OFB state + @return CRYPT_OK if successful +*/ +int ofb_decrypt(const unsigned char *ct, unsigned char *pt, unsigned long len, symmetric_OFB *ofb) +{ + LTC_ARGCHK(pt != NULL); + LTC_ARGCHK(ct != NULL); + LTC_ARGCHK(ofb != NULL); + return ofb_encrypt(ct, pt, len, ofb); +} + + +#endif + + + +/* $Source: /cvs/libtom/libtomcrypt/src/modes/ofb/ofb_decrypt.c,v $ */ +/* $Revision: 1.5 $ */ +/* $Date: 2006/06/29 01:51:34 $ */ diff --git a/libtomcrypt/src/modes/ofb/ofb_done.c b/libtomcrypt/src/modes/ofb/ofb_done.c new file mode 100644 index 0000000..50a9de2 --- /dev/null +++ b/libtomcrypt/src/modes/ofb/ofb_done.c @@ -0,0 +1,42 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file ofb_done.c + OFB implementation, finish chain, Tom St Denis +*/ + +#ifdef LTC_OFB_MODE + +/** Terminate the chain + @param ofb The OFB chain to terminate + @return CRYPT_OK on success +*/ +int ofb_done(symmetric_OFB *ofb) +{ + int err; + LTC_ARGCHK(ofb != NULL); + + if ((err = cipher_is_valid(ofb->cipher)) != CRYPT_OK) { + return err; + } + cipher_descriptor[ofb->cipher].done(&ofb->key); + return CRYPT_OK; +} + + + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/modes/ofb/ofb_done.c,v $ */ +/* $Revision: 1.6 $ */ +/* $Date: 2006/06/29 01:51:34 $ */ diff --git a/libtomcrypt/src/modes/ofb/ofb_encrypt.c b/libtomcrypt/src/modes/ofb/ofb_encrypt.c new file mode 100644 index 0000000..2c19f1d --- /dev/null +++ b/libtomcrypt/src/modes/ofb/ofb_encrypt.c @@ -0,0 +1,60 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file ofb_encrypt.c + OFB implementation, encrypt data, Tom St Denis +*/ + +#ifdef LTC_OFB_MODE + +/** + OFB encrypt + @param pt Plaintext + @param ct [out] Ciphertext + @param len Length of plaintext (octets) + @param ofb OFB state + @return CRYPT_OK if successful +*/ +int ofb_encrypt(const unsigned char *pt, unsigned char *ct, unsigned long len, symmetric_OFB *ofb) +{ + int err; + LTC_ARGCHK(pt != NULL); + LTC_ARGCHK(ct != NULL); + LTC_ARGCHK(ofb != NULL); + if ((err = cipher_is_valid(ofb->cipher)) != CRYPT_OK) { + return err; + } + + /* is blocklen/padlen valid? */ + if (ofb->blocklen < 0 || ofb->blocklen > (int)sizeof(ofb->IV) || + ofb->padlen < 0 || ofb->padlen > (int)sizeof(ofb->IV)) { + return CRYPT_INVALID_ARG; + } + + while (len-- > 0) { + if (ofb->padlen == ofb->blocklen) { + if ((err = cipher_descriptor[ofb->cipher].ecb_encrypt(ofb->IV, ofb->IV, &ofb->key)) != CRYPT_OK) { + return err; + } + ofb->padlen = 0; + } + *ct++ = *pt++ ^ ofb->IV[(ofb->padlen)++]; + } + return CRYPT_OK; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/modes/ofb/ofb_encrypt.c,v $ */ +/* $Revision: 1.7 $ */ +/* $Date: 2006/11/26 01:45:14 $ */ diff --git a/libtomcrypt/src/modes/ofb/ofb_getiv.c b/libtomcrypt/src/modes/ofb/ofb_getiv.c new file mode 100644 index 0000000..641d14b --- /dev/null +++ b/libtomcrypt/src/modes/ofb/ofb_getiv.c @@ -0,0 +1,46 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file ofb_getiv.c + OFB implementation, get IV, Tom St Denis +*/ + +#ifdef LTC_OFB_MODE + +/** + Get the current initial vector + @param IV [out] The destination of the initial vector + @param len [in/out] The max size and resulting size of the initial vector + @param ofb The OFB state + @return CRYPT_OK if successful +*/ +int ofb_getiv(unsigned char *IV, unsigned long *len, symmetric_OFB *ofb) +{ + LTC_ARGCHK(IV != NULL); + LTC_ARGCHK(len != NULL); + LTC_ARGCHK(ofb != NULL); + if ((unsigned long)ofb->blocklen > *len) { + *len = ofb->blocklen; + return CRYPT_BUFFER_OVERFLOW; + } + XMEMCPY(IV, ofb->IV, ofb->blocklen); + *len = ofb->blocklen; + + return CRYPT_OK; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/modes/ofb/ofb_getiv.c,v $ */ +/* $Revision: 1.6 $ */ +/* $Date: 2006/06/29 01:51:34 $ */ diff --git a/libtomcrypt/src/modes/ofb/ofb_setiv.c b/libtomcrypt/src/modes/ofb/ofb_setiv.c new file mode 100644 index 0000000..35a84e9 --- /dev/null +++ b/libtomcrypt/src/modes/ofb/ofb_setiv.c @@ -0,0 +1,52 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file ofb_setiv.c + OFB implementation, set IV, Tom St Denis +*/ + +#ifdef LTC_OFB_MODE + +/** + Set an initial vector + @param IV The initial vector + @param len The length of the vector (in octets) + @param ofb The OFB state + @return CRYPT_OK if successful +*/ +int ofb_setiv(const unsigned char *IV, unsigned long len, symmetric_OFB *ofb) +{ + int err; + + LTC_ARGCHK(IV != NULL); + LTC_ARGCHK(ofb != NULL); + + if ((err = cipher_is_valid(ofb->cipher)) != CRYPT_OK) { + return err; + } + + if (len != (unsigned long)ofb->blocklen) { + return CRYPT_INVALID_ARG; + } + + /* force next block */ + ofb->padlen = 0; + return cipher_descriptor[ofb->cipher].ecb_encrypt(IV, ofb->IV, &ofb->key); +} + +#endif + + +/* $Source: /cvs/libtom/libtomcrypt/src/modes/ofb/ofb_setiv.c,v $ */ +/* $Revision: 1.6 $ */ +/* $Date: 2006/06/29 01:51:34 $ */ diff --git a/libtomcrypt/src/modes/ofb/ofb_start.c b/libtomcrypt/src/modes/ofb/ofb_start.c new file mode 100644 index 0000000..1f0f65a --- /dev/null +++ b/libtomcrypt/src/modes/ofb/ofb_start.c @@ -0,0 +1,60 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file ofb_start.c + OFB implementation, start chain, Tom St Denis +*/ + + +#ifdef LTC_OFB_MODE + +/** + Initialize a OFB context + @param cipher The index of the cipher desired + @param IV The initial vector + @param key The secret key + @param keylen The length of the secret key (octets) + @param num_rounds Number of rounds in the cipher desired (0 for default) + @param ofb The OFB state to initialize + @return CRYPT_OK if successful +*/ +int ofb_start(int cipher, const unsigned char *IV, const unsigned char *key, + int keylen, int num_rounds, symmetric_OFB *ofb) +{ + int x, err; + + LTC_ARGCHK(IV != NULL); + LTC_ARGCHK(key != NULL); + LTC_ARGCHK(ofb != NULL); + + if ((err = cipher_is_valid(cipher)) != CRYPT_OK) { + return err; + } + + /* copy details */ + ofb->cipher = cipher; + ofb->blocklen = cipher_descriptor[cipher].block_length; + for (x = 0; x < ofb->blocklen; x++) { + ofb->IV[x] = IV[x]; + } + + /* init the cipher */ + ofb->padlen = ofb->blocklen; + return cipher_descriptor[cipher].setup(key, keylen, num_rounds, &ofb->key); +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/modes/ofb/ofb_start.c,v $ */ +/* $Revision: 1.5 $ */ +/* $Date: 2006/06/29 01:51:34 $ */ diff --git a/libtomcrypt/src/pk/asn1/der/bit/der_decode_bit_string.c b/libtomcrypt/src/pk/asn1/der/bit/der_decode_bit_string.c new file mode 100644 index 0000000..1d3569c --- /dev/null +++ b/libtomcrypt/src/pk/asn1/der/bit/der_decode_bit_string.c @@ -0,0 +1,102 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file der_decode_bit_string.c + ASN.1 DER, encode a BIT STRING, Tom St Denis +*/ + + +#ifdef LTC_DER + +/** + Store a BIT STRING + @param in The DER encoded BIT STRING + @param inlen The size of the DER BIT STRING + @param out [out] The array of bits stored (one per char) + @param outlen [in/out] The number of bits stored + @return CRYPT_OK if successful +*/ +int der_decode_bit_string(const unsigned char *in, unsigned long inlen, + unsigned char *out, unsigned long *outlen) +{ + unsigned long dlen, blen, x, y; + + LTC_ARGCHK(in != NULL); + LTC_ARGCHK(out != NULL); + LTC_ARGCHK(outlen != NULL); + + /* packet must be at least 4 bytes */ + if (inlen < 4) { + return CRYPT_INVALID_ARG; + } + + /* check for 0x03 */ + if ((in[0]&0x1F) != 0x03) { + return CRYPT_INVALID_PACKET; + } + + /* offset in the data */ + x = 1; + + /* get the length of the data */ + if (in[x] & 0x80) { + /* long format get number of length bytes */ + y = in[x++] & 0x7F; + + /* invalid if 0 or > 2 */ + if (y == 0 || y > 2) { + return CRYPT_INVALID_PACKET; + } + + /* read the data len */ + dlen = 0; + while (y--) { + dlen = (dlen << 8) | (unsigned long)in[x++]; + } + } else { + /* short format */ + dlen = in[x++] & 0x7F; + } + + /* is the data len too long or too short? */ + if ((dlen == 0) || (dlen + x > inlen)) { + return CRYPT_INVALID_PACKET; + } + + /* get padding count */ + blen = ((dlen - 1) << 3) - (in[x++] & 7); + + /* too many bits? */ + if (blen > *outlen) { + *outlen = blen; + return CRYPT_BUFFER_OVERFLOW; + } + + /* decode/store the bits */ + for (y = 0; y < blen; y++) { + out[y] = (in[x] & (1 << (7 - (y & 7)))) ? 1 : 0; + if ((y & 7) == 7) { + ++x; + } + } + + /* we done */ + *outlen = blen; + return CRYPT_OK; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/pk/asn1/der/bit/der_decode_bit_string.c,v $ */ +/* $Revision: 1.4 $ */ +/* $Date: 2006/06/16 21:53:41 $ */ diff --git a/libtomcrypt/src/pk/asn1/der/bit/der_encode_bit_string.c b/libtomcrypt/src/pk/asn1/der/bit/der_encode_bit_string.c new file mode 100644 index 0000000..757963c --- /dev/null +++ b/libtomcrypt/src/pk/asn1/der/bit/der_encode_bit_string.c @@ -0,0 +1,89 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file der_encode_bit_string.c + ASN.1 DER, encode a BIT STRING, Tom St Denis +*/ + + +#ifdef LTC_DER + +/** + Store a BIT STRING + @param in The array of bits to store (one per char) + @param inlen The number of bits tostore + @param out [out] The destination for the DER encoded BIT STRING + @param outlen [in/out] The max size and resulting size of the DER BIT STRING + @return CRYPT_OK if successful +*/ +int der_encode_bit_string(const unsigned char *in, unsigned long inlen, + unsigned char *out, unsigned long *outlen) +{ + unsigned long len, x, y; + unsigned char buf; + int err; + + LTC_ARGCHK(in != NULL); + LTC_ARGCHK(out != NULL); + LTC_ARGCHK(outlen != NULL); + + /* avoid overflows */ + if ((err = der_length_bit_string(inlen, &len)) != CRYPT_OK) { + return err; + } + + if (len > *outlen) { + *outlen = len; + return CRYPT_BUFFER_OVERFLOW; + } + + /* store header (include bit padding count in length) */ + x = 0; + y = (inlen >> 3) + ((inlen&7) ? 1 : 0) + 1; + + out[x++] = 0x03; + if (y < 128) { + out[x++] = (unsigned char)y; + } else if (y < 256) { + out[x++] = 0x81; + out[x++] = (unsigned char)y; + } else if (y < 65536) { + out[x++] = 0x82; + out[x++] = (unsigned char)((y>>8)&255); + out[x++] = (unsigned char)(y&255); + } + + /* store number of zero padding bits */ + out[x++] = (unsigned char)((8 - inlen) & 7); + + /* store the bits in big endian format */ + for (y = buf = 0; y < inlen; y++) { + buf |= (in[y] ? 1 : 0) << (7 - (y & 7)); + if ((y & 7) == 7) { + out[x++] = buf; + buf = 0; + } + } + /* store last byte */ + if (inlen & 7) { + out[x++] = buf; + } + *outlen = x; + return CRYPT_OK; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/pk/asn1/der/bit/der_encode_bit_string.c,v $ */ +/* $Revision: 1.4 $ */ +/* $Date: 2006/12/04 21:34:03 $ */ diff --git a/libtomcrypt/src/pk/asn1/der/bit/der_length_bit_string.c b/libtomcrypt/src/pk/asn1/der/bit/der_length_bit_string.c new file mode 100644 index 0000000..3dc2abf --- /dev/null +++ b/libtomcrypt/src/pk/asn1/der/bit/der_length_bit_string.c @@ -0,0 +1,54 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file der_length_bit_string.c + ASN.1 DER, get length of BIT STRING, Tom St Denis +*/ + +#ifdef LTC_DER +/** + Gets length of DER encoding of BIT STRING + @param nbits The number of bits in the string to encode + @param outlen [out] The length of the DER encoding for the given string + @return CRYPT_OK if successful +*/ +int der_length_bit_string(unsigned long nbits, unsigned long *outlen) +{ + unsigned long nbytes; + LTC_ARGCHK(outlen != NULL); + + /* get the number of the bytes */ + nbytes = (nbits >> 3) + ((nbits & 7) ? 1 : 0) + 1; + + if (nbytes < 128) { + /* 03 LL PP DD DD DD ... */ + *outlen = 2 + nbytes; + } else if (nbytes < 256) { + /* 03 81 LL PP DD DD DD ... */ + *outlen = 3 + nbytes; + } else if (nbytes < 65536) { + /* 03 82 LL LL PP DD DD DD ... */ + *outlen = 4 + nbytes; + } else { + return CRYPT_INVALID_ARG; + } + + return CRYPT_OK; +} + +#endif + + +/* $Source: /cvs/libtom/libtomcrypt/src/pk/asn1/der/bit/der_length_bit_string.c,v $ */ +/* $Revision: 1.2 $ */ +/* $Date: 2006/03/31 14:15:35 $ */ diff --git a/libtomcrypt/src/pk/asn1/der/boolean/der_decode_boolean.c b/libtomcrypt/src/pk/asn1/der/boolean/der_decode_boolean.c new file mode 100644 index 0000000..7259e51 --- /dev/null +++ b/libtomcrypt/src/pk/asn1/der/boolean/der_decode_boolean.c @@ -0,0 +1,47 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file der_decode_boolean.c + ASN.1 DER, decode a BOOLEAN, Tom St Denis +*/ + + +#ifdef LTC_DER + +/** + Read a BOOLEAN + @param in The destination for the DER encoded BOOLEAN + @param inlen The size of the DER BOOLEAN + @param out [out] The boolean to decode + @return CRYPT_OK if successful +*/ +int der_decode_boolean(const unsigned char *in, unsigned long inlen, + int *out) +{ + LTC_ARGCHK(in != NULL); + LTC_ARGCHK(out != NULL); + + if (inlen != 3 || in[0] != 0x01 || in[1] != 0x01 || (in[2] != 0x00 && in[2] != 0xFF)) { + return CRYPT_INVALID_ARG; + } + + *out = (in[2]==0xFF) ? 1 : 0; + + return CRYPT_OK; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/pk/asn1/der/boolean/der_decode_boolean.c,v $ */ +/* $Revision: 1.1 $ */ +/* $Date: 2006/04/22 17:01:59 $ */ diff --git a/libtomcrypt/src/pk/asn1/der/boolean/der_encode_boolean.c b/libtomcrypt/src/pk/asn1/der/boolean/der_encode_boolean.c new file mode 100644 index 0000000..9344a79 --- /dev/null +++ b/libtomcrypt/src/pk/asn1/der/boolean/der_encode_boolean.c @@ -0,0 +1,51 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file der_encode_boolean.c + ASN.1 DER, encode a BOOLEAN, Tom St Denis +*/ + + +#ifdef LTC_DER + +/** + Store a BOOLEAN + @param in The boolean to encode + @param out [out] The destination for the DER encoded BOOLEAN + @param outlen [in/out] The max size and resulting size of the DER BOOLEAN + @return CRYPT_OK if successful +*/ +int der_encode_boolean(int in, + unsigned char *out, unsigned long *outlen) +{ + LTC_ARGCHK(outlen != NULL); + LTC_ARGCHK(out != NULL); + + if (*outlen < 3) { + *outlen = 3; + return CRYPT_BUFFER_OVERFLOW; + } + + *outlen = 3; + out[0] = 0x01; + out[1] = 0x01; + out[2] = in ? 0xFF : 0x00; + + return CRYPT_OK; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/pk/asn1/der/boolean/der_encode_boolean.c,v $ */ +/* $Revision: 1.3 $ */ +/* $Date: 2006/06/16 21:53:41 $ */ diff --git a/libtomcrypt/src/pk/asn1/der/boolean/der_length_boolean.c b/libtomcrypt/src/pk/asn1/der/boolean/der_length_boolean.c new file mode 100644 index 0000000..cd5bf2d --- /dev/null +++ b/libtomcrypt/src/pk/asn1/der/boolean/der_length_boolean.c @@ -0,0 +1,35 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file der_length_boolean.c + ASN.1 DER, get length of a BOOLEAN, Tom St Denis +*/ + +#ifdef LTC_DER +/** + Gets length of DER encoding of a BOOLEAN + @param outlen [out] The length of the DER encoding + @return CRYPT_OK if successful +*/ +int der_length_boolean(unsigned long *outlen) +{ + LTC_ARGCHK(outlen != NULL); + *outlen = 3; + return CRYPT_OK; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/pk/asn1/der/boolean/der_length_boolean.c,v $ */ +/* $Revision: 1.2 $ */ +/* $Date: 2006/04/22 17:28:38 $ */ diff --git a/libtomcrypt/src/pk/asn1/der/choice/der_decode_choice.c b/libtomcrypt/src/pk/asn1/der/choice/der_decode_choice.c new file mode 100644 index 0000000..4ff6f17 --- /dev/null +++ b/libtomcrypt/src/pk/asn1/der/choice/der_decode_choice.c @@ -0,0 +1,182 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file der_decode_choice.c + ASN.1 DER, decode a CHOICE, Tom St Denis +*/ + +#ifdef LTC_DER + +/** + Decode a CHOICE + @param in The DER encoded input + @param inlen [in/out] The size of the input and resulting size of read type + @param list The list of items to decode + @param outlen The number of items in the list + @return CRYPT_OK on success +*/ +int der_decode_choice(const unsigned char *in, unsigned long *inlen, + ltc_asn1_list *list, unsigned long outlen) +{ + unsigned long size, x, z; + void *data; + + LTC_ARGCHK(in != NULL); + LTC_ARGCHK(inlen != NULL); + LTC_ARGCHK(list != NULL); + + /* get blk size */ + if (*inlen < 2) { + return CRYPT_INVALID_PACKET; + } + + /* set all of the "used" flags to zero */ + for (x = 0; x < outlen; x++) { + list[x].used = 0; + } + + /* now scan until we have a winner */ + for (x = 0; x < outlen; x++) { + size = list[x].size; + data = list[x].data; + + switch (list[x].type) { + case LTC_ASN1_INTEGER: + if (der_decode_integer(in, *inlen, data) == CRYPT_OK) { + if (der_length_integer(data, &z) == CRYPT_OK) { + list[x].used = 1; + *inlen = z; + return CRYPT_OK; + } + } + break; + + case LTC_ASN1_SHORT_INTEGER: + if (der_decode_short_integer(in, *inlen, data) == CRYPT_OK) { + if (der_length_short_integer(size, &z) == CRYPT_OK) { + list[x].used = 1; + *inlen = z; + return CRYPT_OK; + } + } + break; + + case LTC_ASN1_BIT_STRING: + if (der_decode_bit_string(in, *inlen, data, &size) == CRYPT_OK) { + if (der_length_bit_string(size, &z) == CRYPT_OK) { + list[x].used = 1; + list[x].size = size; + *inlen = z; + return CRYPT_OK; + } + } + break; + + case LTC_ASN1_OCTET_STRING: + if (der_decode_octet_string(in, *inlen, data, &size) == CRYPT_OK) { + if (der_length_octet_string(size, &z) == CRYPT_OK) { + list[x].used = 1; + list[x].size = size; + *inlen = z; + return CRYPT_OK; + } + } + break; + + case LTC_ASN1_NULL: + if (*inlen == 2 && in[x] == 0x05 && in[x+1] == 0x00) { + *inlen = 2; + list[x].used = 1; + return CRYPT_OK; + } + break; + + case LTC_ASN1_OBJECT_IDENTIFIER: + if (der_decode_object_identifier(in, *inlen, data, &size) == CRYPT_OK) { + if (der_length_object_identifier(data, size, &z) == CRYPT_OK) { + list[x].used = 1; + list[x].size = size; + *inlen = z; + return CRYPT_OK; + } + } + break; + + case LTC_ASN1_IA5_STRING: + if (der_decode_ia5_string(in, *inlen, data, &size) == CRYPT_OK) { + if (der_length_ia5_string(data, size, &z) == CRYPT_OK) { + list[x].used = 1; + list[x].size = size; + *inlen = z; + return CRYPT_OK; + } + } + break; + + + case LTC_ASN1_PRINTABLE_STRING: + if (der_decode_printable_string(in, *inlen, data, &size) == CRYPT_OK) { + if (der_length_printable_string(data, size, &z) == CRYPT_OK) { + list[x].used = 1; + list[x].size = size; + *inlen = z; + return CRYPT_OK; + } + } + break; + + case LTC_ASN1_UTF8_STRING: + if (der_decode_utf8_string(in, *inlen, data, &size) == CRYPT_OK) { + if (der_length_utf8_string(data, size, &z) == CRYPT_OK) { + list[x].used = 1; + list[x].size = size; + *inlen = z; + return CRYPT_OK; + } + } + break; + + case LTC_ASN1_UTCTIME: + z = *inlen; + if (der_decode_utctime(in, &z, data) == CRYPT_OK) { + list[x].used = 1; + *inlen = z; + return CRYPT_OK; + } + break; + + case LTC_ASN1_SET: + case LTC_ASN1_SETOF: + case LTC_ASN1_SEQUENCE: + if (der_decode_sequence(in, *inlen, data, size) == CRYPT_OK) { + if (der_length_sequence(data, size, &z) == CRYPT_OK) { + list[x].used = 1; + *inlen = z; + return CRYPT_OK; + } + } + break; + + default: + return CRYPT_INVALID_ARG; + } + } + + return CRYPT_INVALID_PACKET; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/pk/asn1/der/choice/der_decode_choice.c,v $ */ +/* $Revision: 1.8 $ */ +/* $Date: 2006/12/06 02:23:49 $ */ diff --git a/libtomcrypt/src/pk/asn1/der/ia5/der_decode_ia5_string.c b/libtomcrypt/src/pk/asn1/der/ia5/der_decode_ia5_string.c new file mode 100644 index 0000000..2514b77 --- /dev/null +++ b/libtomcrypt/src/pk/asn1/der/ia5/der_decode_ia5_string.c @@ -0,0 +1,96 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file der_decode_ia5_string.c + ASN.1 DER, encode a IA5 STRING, Tom St Denis +*/ + + +#ifdef LTC_DER + +/** + Store a IA5 STRING + @param in The DER encoded IA5 STRING + @param inlen The size of the DER IA5 STRING + @param out [out] The array of octets stored (one per char) + @param outlen [in/out] The number of octets stored + @return CRYPT_OK if successful +*/ +int der_decode_ia5_string(const unsigned char *in, unsigned long inlen, + unsigned char *out, unsigned long *outlen) +{ + unsigned long x, y, len; + int t; + + LTC_ARGCHK(in != NULL); + LTC_ARGCHK(out != NULL); + LTC_ARGCHK(outlen != NULL); + + /* must have header at least */ + if (inlen < 2) { + return CRYPT_INVALID_PACKET; + } + + /* check for 0x16 */ + if ((in[0] & 0x1F) != 0x16) { + return CRYPT_INVALID_PACKET; + } + x = 1; + + /* decode the length */ + if (in[x] & 0x80) { + /* valid # of bytes in length are 1,2,3 */ + y = in[x] & 0x7F; + if ((y == 0) || (y > 3) || ((x + y) > inlen)) { + return CRYPT_INVALID_PACKET; + } + + /* read the length in */ + len = 0; + ++x; + while (y--) { + len = (len << 8) | in[x++]; + } + } else { + len = in[x++] & 0x7F; + } + + /* is it too long? */ + if (len > *outlen) { + *outlen = len; + return CRYPT_BUFFER_OVERFLOW; + } + + if (len + x > inlen) { + return CRYPT_INVALID_PACKET; + } + + /* read the data */ + for (y = 0; y < len; y++) { + t = der_ia5_value_decode(in[x++]); + if (t == -1) { + return CRYPT_INVALID_ARG; + } + out[y] = t; + } + + *outlen = y; + + return CRYPT_OK; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/pk/asn1/der/ia5/der_decode_ia5_string.c,v $ */ +/* $Revision: 1.3 $ */ +/* $Date: 2006/06/16 21:53:41 $ */ diff --git a/libtomcrypt/src/pk/asn1/der/ia5/der_encode_ia5_string.c b/libtomcrypt/src/pk/asn1/der/ia5/der_encode_ia5_string.c new file mode 100644 index 0000000..aff3392 --- /dev/null +++ b/libtomcrypt/src/pk/asn1/der/ia5/der_encode_ia5_string.c @@ -0,0 +1,85 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file der_encode_ia5_string.c + ASN.1 DER, encode a IA5 STRING, Tom St Denis +*/ + +#ifdef LTC_DER + +/** + Store an IA5 STRING + @param in The array of IA5 to store (one per char) + @param inlen The number of IA5 to store + @param out [out] The destination for the DER encoded IA5 STRING + @param outlen [in/out] The max size and resulting size of the DER IA5 STRING + @return CRYPT_OK if successful +*/ +int der_encode_ia5_string(const unsigned char *in, unsigned long inlen, + unsigned char *out, unsigned long *outlen) +{ + unsigned long x, y, len; + int err; + + LTC_ARGCHK(in != NULL); + LTC_ARGCHK(out != NULL); + LTC_ARGCHK(outlen != NULL); + + /* get the size */ + if ((err = der_length_ia5_string(in, inlen, &len)) != CRYPT_OK) { + return err; + } + + /* too big? */ + if (len > *outlen) { + *outlen = len; + return CRYPT_BUFFER_OVERFLOW; + } + + /* encode the header+len */ + x = 0; + out[x++] = 0x16; + if (inlen < 128) { + out[x++] = (unsigned char)inlen; + } else if (inlen < 256) { + out[x++] = 0x81; + out[x++] = (unsigned char)inlen; + } else if (inlen < 65536UL) { + out[x++] = 0x82; + out[x++] = (unsigned char)((inlen>>8)&255); + out[x++] = (unsigned char)(inlen&255); + } else if (inlen < 16777216UL) { + out[x++] = 0x83; + out[x++] = (unsigned char)((inlen>>16)&255); + out[x++] = (unsigned char)((inlen>>8)&255); + out[x++] = (unsigned char)(inlen&255); + } else { + return CRYPT_INVALID_ARG; + } + + /* store octets */ + for (y = 0; y < inlen; y++) { + out[x++] = der_ia5_char_encode(in[y]); + } + + /* retun length */ + *outlen = x; + + return CRYPT_OK; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/pk/asn1/der/ia5/der_encode_ia5_string.c,v $ */ +/* $Revision: 1.4 $ */ +/* $Date: 2006/12/04 21:34:03 $ */ diff --git a/libtomcrypt/src/pk/asn1/der/ia5/der_length_ia5_string.c b/libtomcrypt/src/pk/asn1/der/ia5/der_length_ia5_string.c new file mode 100644 index 0000000..6278dd2 --- /dev/null +++ b/libtomcrypt/src/pk/asn1/der/ia5/der_length_ia5_string.c @@ -0,0 +1,194 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file der_length_ia5_string.c + ASN.1 DER, get length of IA5 STRING, Tom St Denis +*/ + +#ifdef LTC_DER + +static const struct { + int code, value; +} ia5_table[] = { +{ '\0', 0 }, +{ '\a', 7 }, +{ '\b', 8 }, +{ '\t', 9 }, +{ '\n', 10 }, +{ '\f', 12 }, +{ '\r', 13 }, +{ ' ', 32 }, +{ '!', 33 }, +{ '"', 34 }, +{ '#', 35 }, +{ '$', 36 }, +{ '%', 37 }, +{ '&', 38 }, +{ '\'', 39 }, +{ '(', 40 }, +{ ')', 41 }, +{ '*', 42 }, +{ '+', 43 }, +{ ',', 44 }, +{ '-', 45 }, +{ '.', 46 }, +{ '/', 47 }, +{ '0', 48 }, +{ '1', 49 }, +{ '2', 50 }, +{ '3', 51 }, +{ '4', 52 }, +{ '5', 53 }, +{ '6', 54 }, +{ '7', 55 }, +{ '8', 56 }, +{ '9', 57 }, +{ ':', 58 }, +{ ';', 59 }, +{ '<', 60 }, +{ '=', 61 }, +{ '>', 62 }, +{ '?', 63 }, +{ '@', 64 }, +{ 'A', 65 }, +{ 'B', 66 }, +{ 'C', 67 }, +{ 'D', 68 }, +{ 'E', 69 }, +{ 'F', 70 }, +{ 'G', 71 }, +{ 'H', 72 }, +{ 'I', 73 }, +{ 'J', 74 }, +{ 'K', 75 }, +{ 'L', 76 }, +{ 'M', 77 }, +{ 'N', 78 }, +{ 'O', 79 }, +{ 'P', 80 }, +{ 'Q', 81 }, +{ 'R', 82 }, +{ 'S', 83 }, +{ 'T', 84 }, +{ 'U', 85 }, +{ 'V', 86 }, +{ 'W', 87 }, +{ 'X', 88 }, +{ 'Y', 89 }, +{ 'Z', 90 }, +{ '[', 91 }, +{ '\\', 92 }, +{ ']', 93 }, +{ '^', 94 }, +{ '_', 95 }, +{ '`', 96 }, +{ 'a', 97 }, +{ 'b', 98 }, +{ 'c', 99 }, +{ 'd', 100 }, +{ 'e', 101 }, +{ 'f', 102 }, +{ 'g', 103 }, +{ 'h', 104 }, +{ 'i', 105 }, +{ 'j', 106 }, +{ 'k', 107 }, +{ 'l', 108 }, +{ 'm', 109 }, +{ 'n', 110 }, +{ 'o', 111 }, +{ 'p', 112 }, +{ 'q', 113 }, +{ 'r', 114 }, +{ 's', 115 }, +{ 't', 116 }, +{ 'u', 117 }, +{ 'v', 118 }, +{ 'w', 119 }, +{ 'x', 120 }, +{ 'y', 121 }, +{ 'z', 122 }, +{ '{', 123 }, +{ '|', 124 }, +{ '}', 125 }, +{ '~', 126 } +}; + +int der_ia5_char_encode(int c) +{ + int x; + for (x = 0; x < (int)(sizeof(ia5_table)/sizeof(ia5_table[0])); x++) { + if (ia5_table[x].code == c) { + return ia5_table[x].value; + } + } + return -1; +} + +int der_ia5_value_decode(int v) +{ + int x; + for (x = 0; x < (int)(sizeof(ia5_table)/sizeof(ia5_table[0])); x++) { + if (ia5_table[x].value == v) { + return ia5_table[x].code; + } + } + return -1; +} + +/** + Gets length of DER encoding of IA5 STRING + @param octets The values you want to encode + @param noctets The number of octets in the string to encode + @param outlen [out] The length of the DER encoding for the given string + @return CRYPT_OK if successful +*/ +int der_length_ia5_string(const unsigned char *octets, unsigned long noctets, unsigned long *outlen) +{ + unsigned long x; + + LTC_ARGCHK(outlen != NULL); + LTC_ARGCHK(octets != NULL); + + /* scan string for validity */ + for (x = 0; x < noctets; x++) { + if (der_ia5_char_encode(octets[x]) == -1) { + return CRYPT_INVALID_ARG; + } + } + + if (noctets < 128) { + /* 16 LL DD DD DD ... */ + *outlen = 2 + noctets; + } else if (noctets < 256) { + /* 16 81 LL DD DD DD ... */ + *outlen = 3 + noctets; + } else if (noctets < 65536UL) { + /* 16 82 LL LL DD DD DD ... */ + *outlen = 4 + noctets; + } else if (noctets < 16777216UL) { + /* 16 83 LL LL LL DD DD DD ... */ + *outlen = 5 + noctets; + } else { + return CRYPT_INVALID_ARG; + } + + return CRYPT_OK; +} + +#endif + + +/* $Source: /cvs/libtom/libtomcrypt/src/pk/asn1/der/ia5/der_length_ia5_string.c,v $ */ +/* $Revision: 1.2 $ */ +/* $Date: 2006/03/31 14:15:35 $ */ diff --git a/libtomcrypt/src/pk/asn1/der/integer/der_decode_integer.c b/libtomcrypt/src/pk/asn1/der/integer/der_decode_integer.c new file mode 100644 index 0000000..aef87a3 --- /dev/null +++ b/libtomcrypt/src/pk/asn1/der/integer/der_decode_integer.c @@ -0,0 +1,110 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file der_decode_integer.c + ASN.1 DER, decode an integer, Tom St Denis +*/ + + +#ifdef LTC_DER + +/** + Read a mp_int integer + @param in The DER encoded data + @param inlen Size of DER encoded data + @param num The first mp_int to decode + @return CRYPT_OK if successful +*/ +int der_decode_integer(const unsigned char *in, unsigned long inlen, void *num) +{ + unsigned long x, y, z; + int err; + + LTC_ARGCHK(num != NULL); + LTC_ARGCHK(in != NULL); + + /* min DER INTEGER is 0x02 01 00 == 0 */ + if (inlen < (1 + 1 + 1)) { + return CRYPT_INVALID_PACKET; + } + + /* ok expect 0x02 when we AND with 0001 1111 [1F] */ + x = 0; + if ((in[x++] & 0x1F) != 0x02) { + return CRYPT_INVALID_PACKET; + } + + /* now decode the len stuff */ + z = in[x++]; + + if ((z & 0x80) == 0x00) { + /* short form */ + + /* will it overflow? */ + if (x + z > inlen) { + return CRYPT_INVALID_PACKET; + } + + /* no so read it */ + if ((err = mp_read_unsigned_bin(num, (unsigned char *)in + x, z)) != CRYPT_OK) { + return err; + } + } else { + /* long form */ + z &= 0x7F; + + /* will number of length bytes overflow? (or > 4) */ + if (((x + z) > inlen) || (z > 4) || (z == 0)) { + return CRYPT_INVALID_PACKET; + } + + /* now read it in */ + y = 0; + while (z--) { + y = ((unsigned long)(in[x++])) | (y << 8); + } + + /* now will reading y bytes overrun? */ + if ((x + y) > inlen) { + return CRYPT_INVALID_PACKET; + } + + /* no so read it */ + if ((err = mp_read_unsigned_bin(num, (unsigned char *)in + x, y)) != CRYPT_OK) { + return err; + } + } + + /* see if it's negative */ + if (in[x] & 0x80) { + void *tmp; + if (mp_init(&tmp) != CRYPT_OK) { + return CRYPT_MEM; + } + + if (mp_2expt(tmp, mp_count_bits(num)) != CRYPT_OK || mp_sub(num, tmp, num) != CRYPT_OK) { + mp_clear(tmp); + return CRYPT_MEM; + } + mp_clear(tmp); + } + + return CRYPT_OK; + +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/pk/asn1/der/integer/der_decode_integer.c,v $ */ +/* $Revision: 1.4 $ */ +/* $Date: 2006/03/31 14:15:35 $ */ diff --git a/libtomcrypt/src/pk/asn1/der/integer/der_encode_integer.c b/libtomcrypt/src/pk/asn1/der/integer/der_encode_integer.c new file mode 100644 index 0000000..ff4fce6 --- /dev/null +++ b/libtomcrypt/src/pk/asn1/der/integer/der_encode_integer.c @@ -0,0 +1,130 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file der_encode_integer.c + ASN.1 DER, encode an integer, Tom St Denis +*/ + + +#ifdef LTC_DER + +/* Exports a positive bignum as DER format (upto 2^32 bytes in size) */ +/** + Store a mp_int integer + @param num The first mp_int to encode + @param out [out] The destination for the DER encoded integers + @param outlen [in/out] The max size and resulting size of the DER encoded integers + @return CRYPT_OK if successful +*/ +int der_encode_integer(void *num, unsigned char *out, unsigned long *outlen) +{ + unsigned long tmplen, y; + int err, leading_zero; + + LTC_ARGCHK(num != NULL); + LTC_ARGCHK(out != NULL); + LTC_ARGCHK(outlen != NULL); + + /* find out how big this will be */ + if ((err = der_length_integer(num, &tmplen)) != CRYPT_OK) { + return err; + } + + if (*outlen < tmplen) { + *outlen = tmplen; + return CRYPT_BUFFER_OVERFLOW; + } + + if (mp_cmp_d(num, 0) != LTC_MP_LT) { + /* we only need a leading zero if the msb of the first byte is one */ + if ((mp_count_bits(num) & 7) == 0 || mp_iszero(num) == LTC_MP_YES) { + leading_zero = 1; + } else { + leading_zero = 0; + } + + /* get length of num in bytes (plus 1 since we force the msbyte to zero) */ + y = mp_unsigned_bin_size(num) + leading_zero; + } else { + leading_zero = 0; + y = mp_count_bits(num); + y = y + (8 - (y & 7)); + y = y >> 3; + if (((mp_cnt_lsb(num)+1)==mp_count_bits(num)) && ((mp_count_bits(num)&7)==0)) --y; + } + + /* now store initial data */ + *out++ = 0x02; + if (y < 128) { + /* short form */ + *out++ = (unsigned char)y; + } else if (y < 256) { + *out++ = 0x81; + *out++ = (unsigned char)y; + } else if (y < 65536UL) { + *out++ = 0x82; + *out++ = (unsigned char)((y>>8)&255); + *out++ = (unsigned char)y; + } else if (y < 16777216UL) { + *out++ = 0x83; + *out++ = (unsigned char)((y>>16)&255); + *out++ = (unsigned char)((y>>8)&255); + *out++ = (unsigned char)y; + } else { + return CRYPT_INVALID_ARG; + } + + /* now store msbyte of zero if num is non-zero */ + if (leading_zero) { + *out++ = 0x00; + } + + /* if it's not zero store it as big endian */ + if (mp_cmp_d(num, 0) == LTC_MP_GT) { + /* now store the mpint */ + if ((err = mp_to_unsigned_bin(num, out)) != CRYPT_OK) { + return err; + } + } else if (mp_iszero(num) != LTC_MP_YES) { + void *tmp; + + /* negative */ + if (mp_init(&tmp) != CRYPT_OK) { + return CRYPT_MEM; + } + + /* 2^roundup and subtract */ + y = mp_count_bits(num); + y = y + (8 - (y & 7)); + if (((mp_cnt_lsb(num)+1)==mp_count_bits(num)) && ((mp_count_bits(num)&7)==0)) y -= 8; + if (mp_2expt(tmp, y) != CRYPT_OK || mp_add(tmp, num, tmp) != CRYPT_OK) { + mp_clear(tmp); + return CRYPT_MEM; + } + if ((err = mp_to_unsigned_bin(tmp, out)) != CRYPT_OK) { + mp_clear(tmp); + return err; + } + mp_clear(tmp); + } + + /* we good */ + *outlen = tmplen; + return CRYPT_OK; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/pk/asn1/der/integer/der_encode_integer.c,v $ */ +/* $Revision: 1.8 $ */ +/* $Date: 2006/12/04 21:34:03 $ */ diff --git a/libtomcrypt/src/pk/asn1/der/integer/der_length_integer.c b/libtomcrypt/src/pk/asn1/der/integer/der_length_integer.c new file mode 100644 index 0000000..bcc331d --- /dev/null +++ b/libtomcrypt/src/pk/asn1/der/integer/der_length_integer.c @@ -0,0 +1,82 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file der_length_integer.c + ASN.1 DER, get length of encoding, Tom St Denis +*/ + + +#ifdef LTC_DER +/** + Gets length of DER encoding of num + @param num The int to get the size of + @param outlen [out] The length of the DER encoding for the given integer + @return CRYPT_OK if successful +*/ +int der_length_integer(void *num, unsigned long *outlen) +{ + unsigned long z, len; + int leading_zero; + + LTC_ARGCHK(num != NULL); + LTC_ARGCHK(outlen != NULL); + + if (mp_cmp_d(num, 0) != LTC_MP_LT) { + /* positive */ + + /* we only need a leading zero if the msb of the first byte is one */ + if ((mp_count_bits(num) & 7) == 0 || mp_iszero(num) == LTC_MP_YES) { + leading_zero = 1; + } else { + leading_zero = 0; + } + + /* size for bignum */ + z = len = leading_zero + mp_unsigned_bin_size(num); + } else { + /* it's negative */ + /* find power of 2 that is a multiple of eight and greater than count bits */ + leading_zero = 0; + z = mp_count_bits(num); + z = z + (8 - (z & 7)); + if (((mp_cnt_lsb(num)+1)==mp_count_bits(num)) && ((mp_count_bits(num)&7)==0)) --z; + len = z = z >> 3; + } + + /* now we need a length */ + if (z < 128) { + /* short form */ + ++len; + } else { + /* long form (relies on z != 0), assumes length bytes < 128 */ + ++len; + + while (z) { + ++len; + z >>= 8; + } + } + + /* we need a 0x02 to indicate it's INTEGER */ + ++len; + + /* return length */ + *outlen = len; + return CRYPT_OK; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/pk/asn1/der/integer/der_length_integer.c,v $ */ +/* $Revision: 1.4 $ */ +/* $Date: 2006/04/22 01:22:55 $ */ diff --git a/libtomcrypt/src/pk/asn1/der/object_identifier/der_decode_object_identifier.c b/libtomcrypt/src/pk/asn1/der/object_identifier/der_decode_object_identifier.c new file mode 100644 index 0000000..1fa87d8 --- /dev/null +++ b/libtomcrypt/src/pk/asn1/der/object_identifier/der_decode_object_identifier.c @@ -0,0 +1,99 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file der_decode_object_identifier.c + ASN.1 DER, Decode Object Identifier, Tom St Denis +*/ + +#ifdef LTC_DER +/** + Decode OID data and store the array of integers in words + @param in The OID DER encoded data + @param inlen The length of the OID data + @param words [out] The destination of the OID words + @param outlen [in/out] The number of OID words + @return CRYPT_OK if successful +*/ +int der_decode_object_identifier(const unsigned char *in, unsigned long inlen, + unsigned long *words, unsigned long *outlen) +{ + unsigned long x, y, t, len; + + LTC_ARGCHK(in != NULL); + LTC_ARGCHK(words != NULL); + LTC_ARGCHK(outlen != NULL); + + /* header is at least 3 bytes */ + if (inlen < 3) { + return CRYPT_INVALID_PACKET; + } + + /* must be room for at least two words */ + if (*outlen < 2) { + return CRYPT_BUFFER_OVERFLOW; + } + + /* decode the packet header */ + x = 0; + if ((in[x++] & 0x1F) != 0x06) { + return CRYPT_INVALID_PACKET; + } + + /* get the length */ + if (in[x] < 128) { + len = in[x++]; + } else { + if (in[x] < 0x81 || in[x] > 0x82) { + return CRYPT_INVALID_PACKET; + } + y = in[x++] & 0x7F; + len = 0; + while (y--) { + len = (len << 8) | (unsigned long)in[x++]; + } + } + + if (len < 1 || (len + x) > inlen) { + return CRYPT_INVALID_PACKET; + } + + /* decode words */ + y = 0; + t = 0; + while (len--) { + t = (t << 7) | (in[x] & 0x7F); + if (!(in[x++] & 0x80)) { + /* store t */ + if (y >= *outlen) { + return CRYPT_BUFFER_OVERFLOW; + } + if (y == 0) { + words[0] = t / 40; + words[1] = t % 40; + y = 2; + } else { + words[y++] = t; + } + t = 0; + } + } + + *outlen = y; + return CRYPT_OK; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/pk/asn1/der/object_identifier/der_decode_object_identifier.c,v $ */ +/* $Revision: 1.5 $ */ +/* $Date: 2006/11/21 00:18:23 $ */ diff --git a/libtomcrypt/src/pk/asn1/der/object_identifier/der_encode_object_identifier.c b/libtomcrypt/src/pk/asn1/der/object_identifier/der_encode_object_identifier.c new file mode 100644 index 0000000..b343aaa --- /dev/null +++ b/libtomcrypt/src/pk/asn1/der/object_identifier/der_encode_object_identifier.c @@ -0,0 +1,111 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file der_encode_object_identifier.c + ASN.1 DER, Encode Object Identifier, Tom St Denis +*/ + +#ifdef LTC_DER +/** + Encode an OID + @param words The words to encode (upto 32-bits each) + @param nwords The number of words in the OID + @param out [out] Destination of OID data + @param outlen [in/out] The max and resulting size of the OID + @return CRYPT_OK if successful +*/ +int der_encode_object_identifier(unsigned long *words, unsigned long nwords, + unsigned char *out, unsigned long *outlen) +{ + unsigned long i, x, y, z, t, mask, wordbuf; + int err; + + LTC_ARGCHK(words != NULL); + LTC_ARGCHK(out != NULL); + LTC_ARGCHK(outlen != NULL); + + /* check length */ + if ((err = der_length_object_identifier(words, nwords, &x)) != CRYPT_OK) { + return err; + } + if (x > *outlen) { + *outlen = x; + return CRYPT_BUFFER_OVERFLOW; + } + + /* compute length to store OID data */ + z = 0; + wordbuf = words[0] * 40 + words[1]; + for (y = 1; y < nwords; y++) { + t = der_object_identifier_bits(wordbuf); + z += t/7 + ((t%7) ? 1 : 0) + (wordbuf == 0 ? 1 : 0); + if (y < nwords - 1) { + wordbuf = words[y + 1]; + } + } + + /* store header + length */ + x = 0; + out[x++] = 0x06; + if (z < 128) { + out[x++] = (unsigned char)z; + } else if (z < 256) { + out[x++] = 0x81; + out[x++] = (unsigned char)z; + } else if (z < 65536UL) { + out[x++] = 0x82; + out[x++] = (unsigned char)((z>>8)&255); + out[x++] = (unsigned char)(z&255); + } else { + return CRYPT_INVALID_ARG; + } + + /* store first byte */ + wordbuf = words[0] * 40 + words[1]; + for (i = 1; i < nwords; i++) { + /* store 7 bit words in little endian */ + t = wordbuf & 0xFFFFFFFF; + if (t) { + y = x; + mask = 0; + while (t) { + out[x++] = (unsigned char)((t & 0x7F) | mask); + t >>= 7; + mask |= 0x80; /* upper bit is set on all but the last byte */ + } + /* now swap bytes y...x-1 */ + z = x - 1; + while (y < z) { + t = out[y]; out[y] = out[z]; out[z] = (unsigned char)t; + ++y; + --z; + } + } else { + /* zero word */ + out[x++] = 0x00; + } + + if (i < nwords - 1) { + wordbuf = words[i + 1]; + } + } + + *outlen = x; + return CRYPT_OK; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/pk/asn1/der/object_identifier/der_encode_object_identifier.c,v $ */ +/* $Revision: 1.6 $ */ +/* $Date: 2006/12/04 21:34:03 $ */ diff --git a/libtomcrypt/src/pk/asn1/der/object_identifier/der_length_object_identifier.c b/libtomcrypt/src/pk/asn1/der/object_identifier/der_length_object_identifier.c new file mode 100644 index 0000000..a4cf53f --- /dev/null +++ b/libtomcrypt/src/pk/asn1/der/object_identifier/der_length_object_identifier.c @@ -0,0 +1,89 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file der_length_object_identifier.c + ASN.1 DER, get length of Object Identifier, Tom St Denis +*/ + +#ifdef LTC_DER + +unsigned long der_object_identifier_bits(unsigned long x) +{ + unsigned long c; + x &= 0xFFFFFFFF; + c = 0; + while (x) { + ++c; + x >>= 1; + } + return c; +} + + +/** + Gets length of DER encoding of Object Identifier + @param nwords The number of OID words + @param words The actual OID words to get the size of + @param outlen [out] The length of the DER encoding for the given string + @return CRYPT_OK if successful +*/ +int der_length_object_identifier(unsigned long *words, unsigned long nwords, unsigned long *outlen) +{ + unsigned long y, z, t, wordbuf; + + LTC_ARGCHK(words != NULL); + LTC_ARGCHK(outlen != NULL); + + + /* must be >= 2 words */ + if (nwords < 2) { + return CRYPT_INVALID_ARG; + } + + /* word1 = 0,1,2,3 and word2 0..39 */ + if (words[0] > 3 || (words[0] < 2 && words[1] > 39)) { + return CRYPT_INVALID_ARG; + } + + /* leading word is the first two */ + z = 0; + wordbuf = words[0] * 40 + words[1]; + for (y = 1; y < nwords; y++) { + t = der_object_identifier_bits(wordbuf); + z += t/7 + ((t%7) ? 1 : 0) + (wordbuf == 0 ? 1 : 0); + if (y < nwords - 1) { + /* grab next word */ + wordbuf = words[y+1]; + } + } + + /* now depending on the length our length encoding changes */ + if (z < 128) { + z += 2; + } else if (z < 256) { + z += 3; + } else if (z < 65536UL) { + z += 4; + } else { + return CRYPT_INVALID_ARG; + } + + *outlen = z; + return CRYPT_OK; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/pk/asn1/der/object_identifier/der_length_object_identifier.c,v $ */ +/* $Revision: 1.4 $ */ +/* $Date: 2006/04/16 20:17:42 $ */ diff --git a/libtomcrypt/src/pk/asn1/der/octet/der_decode_octet_string.c b/libtomcrypt/src/pk/asn1/der/octet/der_decode_octet_string.c new file mode 100644 index 0000000..b937e63 --- /dev/null +++ b/libtomcrypt/src/pk/asn1/der/octet/der_decode_octet_string.c @@ -0,0 +1,91 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file der_decode_octet_string.c + ASN.1 DER, encode a OCTET STRING, Tom St Denis +*/ + + +#ifdef LTC_DER + +/** + Store a OCTET STRING + @param in The DER encoded OCTET STRING + @param inlen The size of the DER OCTET STRING + @param out [out] The array of octets stored (one per char) + @param outlen [in/out] The number of octets stored + @return CRYPT_OK if successful +*/ +int der_decode_octet_string(const unsigned char *in, unsigned long inlen, + unsigned char *out, unsigned long *outlen) +{ + unsigned long x, y, len; + + LTC_ARGCHK(in != NULL); + LTC_ARGCHK(out != NULL); + LTC_ARGCHK(outlen != NULL); + + /* must have header at least */ + if (inlen < 2) { + return CRYPT_INVALID_PACKET; + } + + /* check for 0x04 */ + if ((in[0] & 0x1F) != 0x04) { + return CRYPT_INVALID_PACKET; + } + x = 1; + + /* decode the length */ + if (in[x] & 0x80) { + /* valid # of bytes in length are 1,2,3 */ + y = in[x] & 0x7F; + if ((y == 0) || (y > 3) || ((x + y) > inlen)) { + return CRYPT_INVALID_PACKET; + } + + /* read the length in */ + len = 0; + ++x; + while (y--) { + len = (len << 8) | in[x++]; + } + } else { + len = in[x++] & 0x7F; + } + + /* is it too long? */ + if (len > *outlen) { + *outlen = len; + return CRYPT_BUFFER_OVERFLOW; + } + + if (len + x > inlen) { + return CRYPT_INVALID_PACKET; + } + + /* read the data */ + for (y = 0; y < len; y++) { + out[y] = in[x++]; + } + + *outlen = y; + + return CRYPT_OK; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/pk/asn1/der/octet/der_decode_octet_string.c,v $ */ +/* $Revision: 1.3 $ */ +/* $Date: 2006/06/16 21:53:41 $ */ diff --git a/libtomcrypt/src/pk/asn1/der/octet/der_encode_octet_string.c b/libtomcrypt/src/pk/asn1/der/octet/der_encode_octet_string.c new file mode 100644 index 0000000..fe0f163 --- /dev/null +++ b/libtomcrypt/src/pk/asn1/der/octet/der_encode_octet_string.c @@ -0,0 +1,86 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file der_encode_octet_string.c + ASN.1 DER, encode a OCTET STRING, Tom St Denis +*/ + + +#ifdef LTC_DER + +/** + Store an OCTET STRING + @param in The array of OCTETS to store (one per char) + @param inlen The number of OCTETS to store + @param out [out] The destination for the DER encoded OCTET STRING + @param outlen [in/out] The max size and resulting size of the DER OCTET STRING + @return CRYPT_OK if successful +*/ +int der_encode_octet_string(const unsigned char *in, unsigned long inlen, + unsigned char *out, unsigned long *outlen) +{ + unsigned long x, y, len; + int err; + + LTC_ARGCHK(in != NULL); + LTC_ARGCHK(out != NULL); + LTC_ARGCHK(outlen != NULL); + + /* get the size */ + if ((err = der_length_octet_string(inlen, &len)) != CRYPT_OK) { + return err; + } + + /* too big? */ + if (len > *outlen) { + *outlen = len; + return CRYPT_BUFFER_OVERFLOW; + } + + /* encode the header+len */ + x = 0; + out[x++] = 0x04; + if (inlen < 128) { + out[x++] = (unsigned char)inlen; + } else if (inlen < 256) { + out[x++] = 0x81; + out[x++] = (unsigned char)inlen; + } else if (inlen < 65536UL) { + out[x++] = 0x82; + out[x++] = (unsigned char)((inlen>>8)&255); + out[x++] = (unsigned char)(inlen&255); + } else if (inlen < 16777216UL) { + out[x++] = 0x83; + out[x++] = (unsigned char)((inlen>>16)&255); + out[x++] = (unsigned char)((inlen>>8)&255); + out[x++] = (unsigned char)(inlen&255); + } else { + return CRYPT_INVALID_ARG; + } + + /* store octets */ + for (y = 0; y < inlen; y++) { + out[x++] = in[y]; + } + + /* retun length */ + *outlen = x; + + return CRYPT_OK; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/pk/asn1/der/octet/der_encode_octet_string.c,v $ */ +/* $Revision: 1.4 $ */ +/* $Date: 2006/12/04 21:34:03 $ */ diff --git a/libtomcrypt/src/pk/asn1/der/octet/der_length_octet_string.c b/libtomcrypt/src/pk/asn1/der/octet/der_length_octet_string.c new file mode 100644 index 0000000..3caf352 --- /dev/null +++ b/libtomcrypt/src/pk/asn1/der/octet/der_length_octet_string.c @@ -0,0 +1,53 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file der_length_octet_string.c + ASN.1 DER, get length of OCTET STRING, Tom St Denis +*/ + +#ifdef LTC_DER +/** + Gets length of DER encoding of OCTET STRING + @param noctets The number of octets in the string to encode + @param outlen [out] The length of the DER encoding for the given string + @return CRYPT_OK if successful +*/ +int der_length_octet_string(unsigned long noctets, unsigned long *outlen) +{ + LTC_ARGCHK(outlen != NULL); + + if (noctets < 128) { + /* 04 LL DD DD DD ... */ + *outlen = 2 + noctets; + } else if (noctets < 256) { + /* 04 81 LL DD DD DD ... */ + *outlen = 3 + noctets; + } else if (noctets < 65536UL) { + /* 04 82 LL LL DD DD DD ... */ + *outlen = 4 + noctets; + } else if (noctets < 16777216UL) { + /* 04 83 LL LL LL DD DD DD ... */ + *outlen = 5 + noctets; + } else { + return CRYPT_INVALID_ARG; + } + + return CRYPT_OK; +} + +#endif + + +/* $Source: /cvs/libtom/libtomcrypt/src/pk/asn1/der/octet/der_length_octet_string.c,v $ */ +/* $Revision: 1.2 $ */ +/* $Date: 2006/03/31 14:15:35 $ */ diff --git a/libtomcrypt/src/pk/asn1/der/printable_string/der_decode_printable_string.c b/libtomcrypt/src/pk/asn1/der/printable_string/der_decode_printable_string.c new file mode 100644 index 0000000..cae96d8 --- /dev/null +++ b/libtomcrypt/src/pk/asn1/der/printable_string/der_decode_printable_string.c @@ -0,0 +1,96 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file der_decode_printable_string.c + ASN.1 DER, encode a printable STRING, Tom St Denis +*/ + + +#ifdef LTC_DER + +/** + Store a printable STRING + @param in The DER encoded printable STRING + @param inlen The size of the DER printable STRING + @param out [out] The array of octets stored (one per char) + @param outlen [in/out] The number of octets stored + @return CRYPT_OK if successful +*/ +int der_decode_printable_string(const unsigned char *in, unsigned long inlen, + unsigned char *out, unsigned long *outlen) +{ + unsigned long x, y, len; + int t; + + LTC_ARGCHK(in != NULL); + LTC_ARGCHK(out != NULL); + LTC_ARGCHK(outlen != NULL); + + /* must have header at least */ + if (inlen < 2) { + return CRYPT_INVALID_PACKET; + } + + /* check for 0x13 */ + if ((in[0] & 0x1F) != 0x13) { + return CRYPT_INVALID_PACKET; + } + x = 1; + + /* decode the length */ + if (in[x] & 0x80) { + /* valid # of bytes in length are 1,2,3 */ + y = in[x] & 0x7F; + if ((y == 0) || (y > 3) || ((x + y) > inlen)) { + return CRYPT_INVALID_PACKET; + } + + /* read the length in */ + len = 0; + ++x; + while (y--) { + len = (len << 8) | in[x++]; + } + } else { + len = in[x++] & 0x7F; + } + + /* is it too long? */ + if (len > *outlen) { + *outlen = len; + return CRYPT_BUFFER_OVERFLOW; + } + + if (len + x > inlen) { + return CRYPT_INVALID_PACKET; + } + + /* read the data */ + for (y = 0; y < len; y++) { + t = der_printable_value_decode(in[x++]); + if (t == -1) { + return CRYPT_INVALID_ARG; + } + out[y] = t; + } + + *outlen = y; + + return CRYPT_OK; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/pk/asn1/der/printable_string/der_decode_printable_string.c,v $ */ +/* $Revision: 1.3 $ */ +/* $Date: 2006/06/16 21:53:41 $ */ diff --git a/libtomcrypt/src/pk/asn1/der/printable_string/der_encode_printable_string.c b/libtomcrypt/src/pk/asn1/der/printable_string/der_encode_printable_string.c new file mode 100644 index 0000000..9061b1f --- /dev/null +++ b/libtomcrypt/src/pk/asn1/der/printable_string/der_encode_printable_string.c @@ -0,0 +1,85 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file der_encode_printable_string.c + ASN.1 DER, encode a printable STRING, Tom St Denis +*/ + +#ifdef LTC_DER + +/** + Store an printable STRING + @param in The array of printable to store (one per char) + @param inlen The number of printable to store + @param out [out] The destination for the DER encoded printable STRING + @param outlen [in/out] The max size and resulting size of the DER printable STRING + @return CRYPT_OK if successful +*/ +int der_encode_printable_string(const unsigned char *in, unsigned long inlen, + unsigned char *out, unsigned long *outlen) +{ + unsigned long x, y, len; + int err; + + LTC_ARGCHK(in != NULL); + LTC_ARGCHK(out != NULL); + LTC_ARGCHK(outlen != NULL); + + /* get the size */ + if ((err = der_length_printable_string(in, inlen, &len)) != CRYPT_OK) { + return err; + } + + /* too big? */ + if (len > *outlen) { + *outlen = len; + return CRYPT_BUFFER_OVERFLOW; + } + + /* encode the header+len */ + x = 0; + out[x++] = 0x13; + if (inlen < 128) { + out[x++] = (unsigned char)inlen; + } else if (inlen < 256) { + out[x++] = 0x81; + out[x++] = (unsigned char)inlen; + } else if (inlen < 65536UL) { + out[x++] = 0x82; + out[x++] = (unsigned char)((inlen>>8)&255); + out[x++] = (unsigned char)(inlen&255); + } else if (inlen < 16777216UL) { + out[x++] = 0x83; + out[x++] = (unsigned char)((inlen>>16)&255); + out[x++] = (unsigned char)((inlen>>8)&255); + out[x++] = (unsigned char)(inlen&255); + } else { + return CRYPT_INVALID_ARG; + } + + /* store octets */ + for (y = 0; y < inlen; y++) { + out[x++] = der_printable_char_encode(in[y]); + } + + /* retun length */ + *outlen = x; + + return CRYPT_OK; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/pk/asn1/der/printable_string/der_encode_printable_string.c,v $ */ +/* $Revision: 1.4 $ */ +/* $Date: 2006/12/04 21:34:03 $ */ diff --git a/libtomcrypt/src/pk/asn1/der/printable_string/der_length_printable_string.c b/libtomcrypt/src/pk/asn1/der/printable_string/der_length_printable_string.c new file mode 100644 index 0000000..799b6b6 --- /dev/null +++ b/libtomcrypt/src/pk/asn1/der/printable_string/der_length_printable_string.c @@ -0,0 +1,166 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file der_length_printable_string.c + ASN.1 DER, get length of Printable STRING, Tom St Denis +*/ + +#ifdef LTC_DER + +static const struct { + int code, value; +} printable_table[] = { +{ ' ', 32 }, +{ '\'', 39 }, +{ '(', 40 }, +{ ')', 41 }, +{ '+', 43 }, +{ ',', 44 }, +{ '-', 45 }, +{ '.', 46 }, +{ '/', 47 }, +{ '0', 48 }, +{ '1', 49 }, +{ '2', 50 }, +{ '3', 51 }, +{ '4', 52 }, +{ '5', 53 }, +{ '6', 54 }, +{ '7', 55 }, +{ '8', 56 }, +{ '9', 57 }, +{ ':', 58 }, +{ '=', 61 }, +{ '?', 63 }, +{ 'A', 65 }, +{ 'B', 66 }, +{ 'C', 67 }, +{ 'D', 68 }, +{ 'E', 69 }, +{ 'F', 70 }, +{ 'G', 71 }, +{ 'H', 72 }, +{ 'I', 73 }, +{ 'J', 74 }, +{ 'K', 75 }, +{ 'L', 76 }, +{ 'M', 77 }, +{ 'N', 78 }, +{ 'O', 79 }, +{ 'P', 80 }, +{ 'Q', 81 }, +{ 'R', 82 }, +{ 'S', 83 }, +{ 'T', 84 }, +{ 'U', 85 }, +{ 'V', 86 }, +{ 'W', 87 }, +{ 'X', 88 }, +{ 'Y', 89 }, +{ 'Z', 90 }, +{ 'a', 97 }, +{ 'b', 98 }, +{ 'c', 99 }, +{ 'd', 100 }, +{ 'e', 101 }, +{ 'f', 102 }, +{ 'g', 103 }, +{ 'h', 104 }, +{ 'i', 105 }, +{ 'j', 106 }, +{ 'k', 107 }, +{ 'l', 108 }, +{ 'm', 109 }, +{ 'n', 110 }, +{ 'o', 111 }, +{ 'p', 112 }, +{ 'q', 113 }, +{ 'r', 114 }, +{ 's', 115 }, +{ 't', 116 }, +{ 'u', 117 }, +{ 'v', 118 }, +{ 'w', 119 }, +{ 'x', 120 }, +{ 'y', 121 }, +{ 'z', 122 }, +}; + +int der_printable_char_encode(int c) +{ + int x; + for (x = 0; x < (int)(sizeof(printable_table)/sizeof(printable_table[0])); x++) { + if (printable_table[x].code == c) { + return printable_table[x].value; + } + } + return -1; +} + +int der_printable_value_decode(int v) +{ + int x; + for (x = 0; x < (int)(sizeof(printable_table)/sizeof(printable_table[0])); x++) { + if (printable_table[x].value == v) { + return printable_table[x].code; + } + } + return -1; +} + +/** + Gets length of DER encoding of Printable STRING + @param octets The values you want to encode + @param noctets The number of octets in the string to encode + @param outlen [out] The length of the DER encoding for the given string + @return CRYPT_OK if successful +*/ +int der_length_printable_string(const unsigned char *octets, unsigned long noctets, unsigned long *outlen) +{ + unsigned long x; + + LTC_ARGCHK(outlen != NULL); + LTC_ARGCHK(octets != NULL); + + /* scan string for validity */ + for (x = 0; x < noctets; x++) { + if (der_printable_char_encode(octets[x]) == -1) { + return CRYPT_INVALID_ARG; + } + } + + if (noctets < 128) { + /* 16 LL DD DD DD ... */ + *outlen = 2 + noctets; + } else if (noctets < 256) { + /* 16 81 LL DD DD DD ... */ + *outlen = 3 + noctets; + } else if (noctets < 65536UL) { + /* 16 82 LL LL DD DD DD ... */ + *outlen = 4 + noctets; + } else if (noctets < 16777216UL) { + /* 16 83 LL LL LL DD DD DD ... */ + *outlen = 5 + noctets; + } else { + return CRYPT_INVALID_ARG; + } + + return CRYPT_OK; +} + +#endif + + +/* $Source: /cvs/libtom/libtomcrypt/src/pk/asn1/der/printable_string/der_length_printable_string.c,v $ */ +/* $Revision: 1.2 $ */ +/* $Date: 2006/03/31 14:15:35 $ */ diff --git a/libtomcrypt/src/pk/asn1/der/sequence/der_decode_sequence_ex.c b/libtomcrypt/src/pk/asn1/der/sequence/der_decode_sequence_ex.c new file mode 100644 index 0000000..1f65602 --- /dev/null +++ b/libtomcrypt/src/pk/asn1/der/sequence/der_decode_sequence_ex.c @@ -0,0 +1,287 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" +#include <stdarg.h> + + +/** + @file der_decode_sequence_ex.c + ASN.1 DER, decode a SEQUENCE, Tom St Denis +*/ + +#ifdef LTC_DER + +/** + Decode a SEQUENCE + @param in The DER encoded input + @param inlen The size of the input + @param list The list of items to decode + @param outlen The number of items in the list + @param ordered Search an unordeded or ordered list + @return CRYPT_OK on success +*/ +int der_decode_sequence_ex(const unsigned char *in, unsigned long inlen, + ltc_asn1_list *list, unsigned long outlen, int ordered) +{ + int err, type; + unsigned long size, x, y, z, i, blksize; + void *data; + + LTC_ARGCHK(in != NULL); + LTC_ARGCHK(list != NULL); + + /* get blk size */ + if (inlen < 2) { + return CRYPT_INVALID_PACKET; + } + + /* sequence type? We allow 0x30 SEQUENCE and 0x31 SET since fundamentally they're the same structure */ + x = 0; + if (in[x] != 0x30 && in[x] != 0x31) { + return CRYPT_INVALID_PACKET; + } + ++x; + + if (in[x] < 128) { + blksize = in[x++]; + } else if (in[x] & 0x80) { + if (in[x] < 0x81 || in[x] > 0x83) { + return CRYPT_INVALID_PACKET; + } + y = in[x++] & 0x7F; + + /* would reading the len bytes overrun? */ + if (x + y > inlen) { + return CRYPT_INVALID_PACKET; + } + + /* read len */ + blksize = 0; + while (y--) { + blksize = (blksize << 8) | (unsigned long)in[x++]; + } + } + + /* would this blksize overflow? */ + if (x + blksize > inlen) { + return CRYPT_INVALID_PACKET; + } + + /* mark all as unused */ + for (i = 0; i < outlen; i++) { + list[i].used = 0; + } + + /* ok read data */ + inlen = blksize; + for (i = 0; i < outlen; i++) { + z = 0; + type = list[i].type; + size = list[i].size; + data = list[i].data; + if (!ordered && list[i].used == 1) { continue; } + + if (type == LTC_ASN1_EOL) { + break; + } + + switch (type) { + case LTC_ASN1_BOOLEAN: + z = inlen; + if ((err = der_decode_boolean(in + x, z, ((int *)data))) != CRYPT_OK) { + goto LBL_ERR; + } + if ((err = der_length_boolean(&z)) != CRYPT_OK) { + goto LBL_ERR; + } + break; + + case LTC_ASN1_INTEGER: + z = inlen; + if ((err = der_decode_integer(in + x, z, data)) != CRYPT_OK) { + if (!ordered) { continue; } + goto LBL_ERR; + } + if ((err = der_length_integer(data, &z)) != CRYPT_OK) { + goto LBL_ERR; + } + break; + + case LTC_ASN1_SHORT_INTEGER: + z = inlen; + if ((err = der_decode_short_integer(in + x, z, data)) != CRYPT_OK) { + if (!ordered) { continue; } + goto LBL_ERR; + } + if ((err = der_length_short_integer(((unsigned long*)data)[0], &z)) != CRYPT_OK) { + goto LBL_ERR; + } + + break; + + case LTC_ASN1_BIT_STRING: + z = inlen; + if ((err = der_decode_bit_string(in + x, z, data, &size)) != CRYPT_OK) { + if (!ordered) { continue; } + goto LBL_ERR; + } + list[i].size = size; + if ((err = der_length_bit_string(size, &z)) != CRYPT_OK) { + goto LBL_ERR; + } + break; + + case LTC_ASN1_OCTET_STRING: + z = inlen; + if ((err = der_decode_octet_string(in + x, z, data, &size)) != CRYPT_OK) { + if (!ordered) { continue; } + goto LBL_ERR; + } + list[i].size = size; + if ((err = der_length_octet_string(size, &z)) != CRYPT_OK) { + goto LBL_ERR; + } + break; + + case LTC_ASN1_NULL: + if (inlen < 2 || in[x] != 0x05 || in[x+1] != 0x00) { + if (!ordered) { continue; } + err = CRYPT_INVALID_PACKET; + goto LBL_ERR; + } + z = 2; + break; + + case LTC_ASN1_OBJECT_IDENTIFIER: + z = inlen; + if ((err = der_decode_object_identifier(in + x, z, data, &size)) != CRYPT_OK) { + if (!ordered) { continue; } + goto LBL_ERR; + } + list[i].size = size; + if ((err = der_length_object_identifier(data, size, &z)) != CRYPT_OK) { + goto LBL_ERR; + } + break; + + case LTC_ASN1_IA5_STRING: + z = inlen; + if ((err = der_decode_ia5_string(in + x, z, data, &size)) != CRYPT_OK) { + if (!ordered) { continue; } + goto LBL_ERR; + } + list[i].size = size; + if ((err = der_length_ia5_string(data, size, &z)) != CRYPT_OK) { + goto LBL_ERR; + } + break; + + + case LTC_ASN1_PRINTABLE_STRING: + z = inlen; + if ((err = der_decode_printable_string(in + x, z, data, &size)) != CRYPT_OK) { + if (!ordered) { continue; } + goto LBL_ERR; + } + list[i].size = size; + if ((err = der_length_printable_string(data, size, &z)) != CRYPT_OK) { + goto LBL_ERR; + } + break; + + case LTC_ASN1_UTF8_STRING: + z = inlen; + if ((err = der_decode_utf8_string(in + x, z, data, &size)) != CRYPT_OK) { + if (!ordered) { continue; } + goto LBL_ERR; + } + list[i].size = size; + if ((err = der_length_utf8_string(data, size, &z)) != CRYPT_OK) { + goto LBL_ERR; + } + break; + + case LTC_ASN1_UTCTIME: + z = inlen; + if ((err = der_decode_utctime(in + x, &z, data)) != CRYPT_OK) { + if (!ordered) { continue; } + goto LBL_ERR; + } + break; + + case LTC_ASN1_SET: + z = inlen; + if ((err = der_decode_set(in + x, z, data, size)) != CRYPT_OK) { + if (!ordered) { continue; } + goto LBL_ERR; + } + if ((err = der_length_sequence(data, size, &z)) != CRYPT_OK) { + goto LBL_ERR; + } + break; + + case LTC_ASN1_SETOF: + case LTC_ASN1_SEQUENCE: + /* detect if we have the right type */ + if ((type == LTC_ASN1_SETOF && (in[x] & 0x3F) != 0x31) || (type == LTC_ASN1_SEQUENCE && (in[x] & 0x3F) != 0x30)) { + err = CRYPT_INVALID_PACKET; + goto LBL_ERR; + } + + z = inlen; + if ((err = der_decode_sequence(in + x, z, data, size)) != CRYPT_OK) { + if (!ordered) { continue; } + goto LBL_ERR; + } + if ((err = der_length_sequence(data, size, &z)) != CRYPT_OK) { + goto LBL_ERR; + } + break; + + + case LTC_ASN1_CHOICE: + z = inlen; + if ((err = der_decode_choice(in + x, &z, data, size)) != CRYPT_OK) { + if (!ordered) { continue; } + goto LBL_ERR; + } + break; + + default: + err = CRYPT_INVALID_ARG; + goto LBL_ERR; + } + x += z; + inlen -= z; + list[i].used = 1; + if (!ordered) { + /* restart the decoder */ + i = -1; + } + } + + for (i = 0; i < outlen; i++) { + if (list[i].used == 0) { + err = CRYPT_INVALID_PACKET; + goto LBL_ERR; + } + } + err = CRYPT_OK; + +LBL_ERR: + return err; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/pk/asn1/der/sequence/der_decode_sequence_ex.c,v $ */ +/* $Revision: 1.15 $ */ +/* $Date: 2006/11/26 02:25:18 $ */ diff --git a/libtomcrypt/src/pk/asn1/der/sequence/der_decode_sequence_flexi.c b/libtomcrypt/src/pk/asn1/der/sequence/der_decode_sequence_flexi.c new file mode 100644 index 0000000..19d8c86 --- /dev/null +++ b/libtomcrypt/src/pk/asn1/der/sequence/der_decode_sequence_flexi.c @@ -0,0 +1,386 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file der_decode_sequence_flexi.c + ASN.1 DER, decode an array of ASN.1 types with a flexi parser, Tom St Denis +*/ + +#ifdef LTC_DER + +static unsigned long fetch_length(const unsigned char *in, unsigned long inlen) +{ + unsigned long x, y, z; + + y = 0; + + /* skip type and read len */ + if (inlen < 2) { + return 0xFFFFFFFF; + } + ++in; ++y; + + /* read len */ + x = *in++; ++y; + + /* <128 means literal */ + if (x < 128) { + return x+y; + } + x &= 0x7F; /* the lower 7 bits are the length of the length */ + inlen -= 2; + + /* len means len of len! */ + if (x == 0 || x > 4 || x > inlen) { + return 0xFFFFFFFF; + } + + y += x; + z = 0; + while (x--) { + z = (z<<8) | ((unsigned long)*in); + ++in; + } + return z+y; +} + +/** + ASN.1 DER Flexi(ble) decoder will decode arbitrary DER packets and create a linked list of the decoded elements. + @param in The input buffer + @param inlen [in/out] The length of the input buffer and on output the amount of decoded data + @param out [out] A pointer to the linked list + @return CRYPT_OK on success. +*/ +int der_decode_sequence_flexi(const unsigned char *in, unsigned long *inlen, ltc_asn1_list **out) +{ + ltc_asn1_list *l; + unsigned long err, type, len, totlen, x, y; + void *realloc_tmp; + + LTC_ARGCHK(in != NULL); + LTC_ARGCHK(inlen != NULL); + LTC_ARGCHK(out != NULL); + + l = NULL; + totlen = 0; + + /* scan the input and and get lengths and what not */ + while (*inlen) { + /* read the type byte */ + type = *in; + + /* fetch length */ + len = fetch_length(in, *inlen); + if (len > *inlen) { + err = CRYPT_INVALID_PACKET; + goto error; + } + + /* alloc new link */ + if (l == NULL) { + l = XCALLOC(1, sizeof(*l)); + if (l == NULL) { + err = CRYPT_MEM; + goto error; + } + } else { + l->next = XCALLOC(1, sizeof(*l)); + if (l->next == NULL) { + err = CRYPT_MEM; + goto error; + } + l->next->prev = l; + l = l->next; + } + + /* now switch on type */ + switch (type) { + case 0x01: /* BOOLEAN */ + l->type = LTC_ASN1_BOOLEAN; + l->size = 1; + l->data = XCALLOC(1, sizeof(int)); + + if ((err = der_decode_boolean(in, *inlen, l->data)) != CRYPT_OK) { + goto error; + } + + if ((err = der_length_boolean(&len)) != CRYPT_OK) { + goto error; + } + break; + + case 0x02: /* INTEGER */ + /* init field */ + l->type = LTC_ASN1_INTEGER; + l->size = 1; + if ((err = mp_init(&l->data)) != CRYPT_OK) { + goto error; + } + + /* decode field */ + if ((err = der_decode_integer(in, *inlen, l->data)) != CRYPT_OK) { + goto error; + } + + /* calc length of object */ + if ((err = der_length_integer(l->data, &len)) != CRYPT_OK) { + goto error; + } + break; + + case 0x03: /* BIT */ + /* init field */ + l->type = LTC_ASN1_BIT_STRING; + l->size = len * 8; /* *8 because we store decoded bits one per char and they are encoded 8 per char. */ + + if ((l->data = XCALLOC(1, l->size)) == NULL) { + err = CRYPT_MEM; + goto error; + } + + if ((err = der_decode_bit_string(in, *inlen, l->data, &l->size)) != CRYPT_OK) { + goto error; + } + + if ((err = der_length_bit_string(l->size, &len)) != CRYPT_OK) { + goto error; + } + break; + + case 0x04: /* OCTET */ + + /* init field */ + l->type = LTC_ASN1_OCTET_STRING; + l->size = len; + + if ((l->data = XCALLOC(1, l->size)) == NULL) { + err = CRYPT_MEM; + goto error; + } + + if ((err = der_decode_octet_string(in, *inlen, l->data, &l->size)) != CRYPT_OK) { + goto error; + } + + if ((err = der_length_octet_string(l->size, &len)) != CRYPT_OK) { + goto error; + } + break; + + case 0x05: /* NULL */ + + /* valid NULL is 0x05 0x00 */ + if (in[0] != 0x05 || in[1] != 0x00) { + err = CRYPT_INVALID_PACKET; + goto error; + } + + /* simple to store ;-) */ + l->type = LTC_ASN1_NULL; + l->data = NULL; + l->size = 0; + len = 2; + + break; + + case 0x06: /* OID */ + + /* init field */ + l->type = LTC_ASN1_OBJECT_IDENTIFIER; + l->size = len; + + if ((l->data = XCALLOC(len, sizeof(unsigned long))) == NULL) { + err = CRYPT_MEM; + goto error; + } + + if ((err = der_decode_object_identifier(in, *inlen, l->data, &l->size)) != CRYPT_OK) { + goto error; + } + + if ((err = der_length_object_identifier(l->data, l->size, &len)) != CRYPT_OK) { + goto error; + } + + /* resize it to save a bunch of mem */ + if ((realloc_tmp = XREALLOC(l->data, l->size * sizeof(unsigned long))) == NULL) { + /* out of heap but this is not an error */ + break; + } + l->data = realloc_tmp; + break; + + case 0x0C: /* UTF8 */ + + /* init field */ + l->type = LTC_ASN1_UTF8_STRING; + l->size = len; + + if ((l->data = XCALLOC(sizeof(wchar_t), l->size)) == NULL) { + err = CRYPT_MEM; + goto error; + } + + if ((err = der_decode_utf8_string(in, *inlen, l->data, &l->size)) != CRYPT_OK) { + goto error; + } + + if ((err = der_length_utf8_string(l->data, l->size, &len)) != CRYPT_OK) { + goto error; + } + break; + + case 0x13: /* PRINTABLE */ + + /* init field */ + l->type = LTC_ASN1_PRINTABLE_STRING; + l->size = len; + + if ((l->data = XCALLOC(1, l->size)) == NULL) { + err = CRYPT_MEM; + goto error; + } + + if ((err = der_decode_printable_string(in, *inlen, l->data, &l->size)) != CRYPT_OK) { + goto error; + } + + if ((err = der_length_printable_string(l->data, l->size, &len)) != CRYPT_OK) { + goto error; + } + break; + + case 0x16: /* IA5 */ + + /* init field */ + l->type = LTC_ASN1_IA5_STRING; + l->size = len; + + if ((l->data = XCALLOC(1, l->size)) == NULL) { + err = CRYPT_MEM; + goto error; + } + + if ((err = der_decode_ia5_string(in, *inlen, l->data, &l->size)) != CRYPT_OK) { + goto error; + } + + if ((err = der_length_ia5_string(l->data, l->size, &len)) != CRYPT_OK) { + goto error; + } + break; + + case 0x17: /* UTC TIME */ + + /* init field */ + l->type = LTC_ASN1_UTCTIME; + l->size = 1; + + if ((l->data = XCALLOC(1, sizeof(ltc_utctime))) == NULL) { + err = CRYPT_MEM; + goto error; + } + + len = *inlen; + if ((err = der_decode_utctime(in, &len, l->data)) != CRYPT_OK) { + goto error; + } + + if ((err = der_length_utctime(l->data, &len)) != CRYPT_OK) { + goto error; + } + break; + + case 0x30: /* SEQUENCE */ + case 0x31: /* SET */ + + /* init field */ + l->type = (type == 0x30) ? LTC_ASN1_SEQUENCE : LTC_ASN1_SET; + + /* we have to decode the SEQUENCE header and get it's length */ + + /* move past type */ + ++in; --(*inlen); + + /* read length byte */ + x = *in++; --(*inlen); + + /* smallest SEQUENCE/SET header */ + y = 2; + + /* now if it's > 127 the next bytes are the length of the length */ + if (x > 128) { + x &= 0x7F; + in += x; + *inlen -= x; + + /* update sequence header len */ + y += x; + } + + /* Sequence elements go as child */ + len = len - y; + if ((err = der_decode_sequence_flexi(in, &len, &(l->child))) != CRYPT_OK) { + goto error; + } + + /* len update */ + totlen += y; + + /* link them up y0 */ + l->child->parent = l; + + break; + default: + /* invalid byte ... this is a soft error */ + /* remove link */ + l = l->prev; + XFREE(l->next); + l->next = NULL; + goto outside; + } + + /* advance pointers */ + totlen += len; + in += len; + *inlen -= len; + } + +outside: + + /* rewind l please */ + while (l->prev != NULL || l->parent != NULL) { + if (l->parent != NULL) { + l = l->parent; + } else { + l = l->prev; + } + } + + /* return */ + *out = l; + *inlen = totlen; + return CRYPT_OK; + +error: + /* free list */ + der_sequence_free(l); + + return err; +} + +#endif + + +/* $Source: /cvs/libtom/libtomcrypt/src/pk/asn1/der/sequence/der_decode_sequence_flexi.c,v $ */ +/* $Revision: 1.25 $ */ +/* $Date: 2006/11/26 02:25:18 $ */ diff --git a/libtomcrypt/src/pk/asn1/der/sequence/der_decode_sequence_multi.c b/libtomcrypt/src/pk/asn1/der/sequence/der_decode_sequence_multi.c new file mode 100644 index 0000000..a15c182 --- /dev/null +++ b/libtomcrypt/src/pk/asn1/der/sequence/der_decode_sequence_multi.c @@ -0,0 +1,139 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" +#include <stdarg.h> + + +/** + @file der_decode_sequence_multi.c + ASN.1 DER, decode a SEQUENCE, Tom St Denis +*/ + +#ifdef LTC_DER + +/** + Decode a SEQUENCE type using a VA list + @param in Input buffer + @param inlen Length of input in octets + @remark <...> is of the form <type, size, data> (int, unsigned long, void*) + @return CRYPT_OK on success +*/ +int der_decode_sequence_multi(const unsigned char *in, unsigned long inlen, ...) +{ + int err, type; + unsigned long size, x; + void *data; + va_list args; + ltc_asn1_list *list; + + LTC_ARGCHK(in != NULL); + + /* get size of output that will be required */ + va_start(args, inlen); + x = 0; + for (;;) { + type = va_arg(args, int); + size = va_arg(args, unsigned long); + data = va_arg(args, void*); + + if (type == LTC_ASN1_EOL) { + break; + } + + switch (type) { + case LTC_ASN1_BOOLEAN: + case LTC_ASN1_INTEGER: + case LTC_ASN1_SHORT_INTEGER: + case LTC_ASN1_BIT_STRING: + case LTC_ASN1_OCTET_STRING: + case LTC_ASN1_NULL: + case LTC_ASN1_OBJECT_IDENTIFIER: + case LTC_ASN1_IA5_STRING: + case LTC_ASN1_PRINTABLE_STRING: + case LTC_ASN1_UTF8_STRING: + case LTC_ASN1_UTCTIME: + case LTC_ASN1_SET: + case LTC_ASN1_SETOF: + case LTC_ASN1_SEQUENCE: + case LTC_ASN1_CHOICE: + ++x; + break; + + default: + va_end(args); + return CRYPT_INVALID_ARG; + } + } + va_end(args); + + /* allocate structure for x elements */ + if (x == 0) { + return CRYPT_NOP; + } + + list = XCALLOC(sizeof(*list), x); + if (list == NULL) { + return CRYPT_MEM; + } + + /* fill in the structure */ + va_start(args, inlen); + x = 0; + for (;;) { + type = va_arg(args, int); + size = va_arg(args, unsigned long); + data = va_arg(args, void*); + + if (type == LTC_ASN1_EOL) { + break; + } + + switch (type) { + case LTC_ASN1_BOOLEAN: + case LTC_ASN1_INTEGER: + case LTC_ASN1_SHORT_INTEGER: + case LTC_ASN1_BIT_STRING: + case LTC_ASN1_OCTET_STRING: + case LTC_ASN1_NULL: + case LTC_ASN1_OBJECT_IDENTIFIER: + case LTC_ASN1_IA5_STRING: + case LTC_ASN1_PRINTABLE_STRING: + case LTC_ASN1_UTF8_STRING: + case LTC_ASN1_UTCTIME: + case LTC_ASN1_SEQUENCE: + case LTC_ASN1_SET: + case LTC_ASN1_SETOF: + case LTC_ASN1_CHOICE: + list[x].type = type; + list[x].size = size; + list[x++].data = data; + break; + + default: + va_end(args); + err = CRYPT_INVALID_ARG; + goto LBL_ERR; + } + } + va_end(args); + + err = der_decode_sequence(in, inlen, list, x); +LBL_ERR: + XFREE(list); + return err; +} + +#endif + + +/* $Source: /cvs/libtom/libtomcrypt/src/pk/asn1/der/sequence/der_decode_sequence_multi.c,v $ */ +/* $Revision: 1.12 $ */ +/* $Date: 2006/11/26 02:25:18 $ */ diff --git a/libtomcrypt/src/pk/asn1/der/sequence/der_encode_sequence_ex.c b/libtomcrypt/src/pk/asn1/der/sequence/der_encode_sequence_ex.c new file mode 100644 index 0000000..cdb4f1e --- /dev/null +++ b/libtomcrypt/src/pk/asn1/der/sequence/der_encode_sequence_ex.c @@ -0,0 +1,335 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" +#include <stdarg.h> + + +/** + @file der_encode_sequence_ex.c + ASN.1 DER, encode a SEQUENCE, Tom St Denis +*/ + +#ifdef LTC_DER + +/** + Encode a SEQUENCE + @param list The list of items to encode + @param inlen The number of items in the list + @param out [out] The destination + @param outlen [in/out] The size of the output + @param type_of LTC_ASN1_SEQUENCE or LTC_ASN1_SET/LTC_ASN1_SETOF + @return CRYPT_OK on success +*/ +int der_encode_sequence_ex(ltc_asn1_list *list, unsigned long inlen, + unsigned char *out, unsigned long *outlen, int type_of) +{ + int err, type; + unsigned long size, x, y, z, i; + void *data; + + LTC_ARGCHK(list != NULL); + LTC_ARGCHK(out != NULL); + LTC_ARGCHK(outlen != NULL); + + /* get size of output that will be required */ + y = 0; + for (i = 0; i < inlen; i++) { + type = list[i].type; + size = list[i].size; + data = list[i].data; + + if (type == LTC_ASN1_EOL) { + break; + } + + switch (type) { + case LTC_ASN1_BOOLEAN: + if ((err = der_length_boolean(&x)) != CRYPT_OK) { + goto LBL_ERR; + } + y += x; + break; + + case LTC_ASN1_INTEGER: + if ((err = der_length_integer(data, &x)) != CRYPT_OK) { + goto LBL_ERR; + } + y += x; + break; + + case LTC_ASN1_SHORT_INTEGER: + if ((err = der_length_short_integer(*((unsigned long*)data), &x)) != CRYPT_OK) { + goto LBL_ERR; + } + y += x; + break; + + case LTC_ASN1_BIT_STRING: + if ((err = der_length_bit_string(size, &x)) != CRYPT_OK) { + goto LBL_ERR; + } + y += x; + break; + + case LTC_ASN1_OCTET_STRING: + if ((err = der_length_octet_string(size, &x)) != CRYPT_OK) { + goto LBL_ERR; + } + y += x; + break; + + case LTC_ASN1_NULL: + y += 2; + break; + + case LTC_ASN1_OBJECT_IDENTIFIER: + if ((err = der_length_object_identifier(data, size, &x)) != CRYPT_OK) { + goto LBL_ERR; + } + y += x; + break; + + case LTC_ASN1_IA5_STRING: + if ((err = der_length_ia5_string(data, size, &x)) != CRYPT_OK) { + goto LBL_ERR; + } + y += x; + break; + + case LTC_ASN1_PRINTABLE_STRING: + if ((err = der_length_printable_string(data, size, &x)) != CRYPT_OK) { + goto LBL_ERR; + } + y += x; + break; + + case LTC_ASN1_UTF8_STRING: + if ((err = der_length_utf8_string(data, size, &x)) != CRYPT_OK) { + goto LBL_ERR; + } + y += x; + break; + + case LTC_ASN1_UTCTIME: + if ((err = der_length_utctime(data, &x)) != CRYPT_OK) { + goto LBL_ERR; + } + y += x; + break; + + case LTC_ASN1_SET: + case LTC_ASN1_SETOF: + case LTC_ASN1_SEQUENCE: + if ((err = der_length_sequence(data, size, &x)) != CRYPT_OK) { + goto LBL_ERR; + } + y += x; + break; + + default: + err = CRYPT_INVALID_ARG; + goto LBL_ERR; + } + } + + /* calc header size */ + z = y; + if (y < 128) { + y += 2; + } else if (y < 256) { + /* 0x30 0x81 LL */ + y += 3; + } else if (y < 65536UL) { + /* 0x30 0x82 LL LL */ + y += 4; + } else if (y < 16777216UL) { + /* 0x30 0x83 LL LL LL */ + y += 5; + } else { + err = CRYPT_INVALID_ARG; + goto LBL_ERR; + } + + /* too big ? */ + if (*outlen < y) { + *outlen = y; + err = CRYPT_BUFFER_OVERFLOW; + goto LBL_ERR; + } + + /* store header */ + x = 0; + out[x++] = (type_of == LTC_ASN1_SEQUENCE) ? 0x30 : 0x31; + + if (z < 128) { + out[x++] = (unsigned char)z; + } else if (z < 256) { + out[x++] = 0x81; + out[x++] = (unsigned char)z; + } else if (z < 65536UL) { + out[x++] = 0x82; + out[x++] = (unsigned char)((z>>8UL)&255); + out[x++] = (unsigned char)(z&255); + } else if (z < 16777216UL) { + out[x++] = 0x83; + out[x++] = (unsigned char)((z>>16UL)&255); + out[x++] = (unsigned char)((z>>8UL)&255); + out[x++] = (unsigned char)(z&255); + } + + /* store data */ + *outlen -= x; + for (i = 0; i < inlen; i++) { + type = list[i].type; + size = list[i].size; + data = list[i].data; + + if (type == LTC_ASN1_EOL) { + break; + } + + switch (type) { + case LTC_ASN1_BOOLEAN: + z = *outlen; + if ((err = der_encode_boolean(*((int *)data), out + x, &z)) != CRYPT_OK) { + goto LBL_ERR; + } + x += z; + *outlen -= z; + break; + + case LTC_ASN1_INTEGER: + z = *outlen; + if ((err = der_encode_integer(data, out + x, &z)) != CRYPT_OK) { + goto LBL_ERR; + } + x += z; + *outlen -= z; + break; + + case LTC_ASN1_SHORT_INTEGER: + z = *outlen; + if ((err = der_encode_short_integer(*((unsigned long*)data), out + x, &z)) != CRYPT_OK) { + goto LBL_ERR; + } + x += z; + *outlen -= z; + break; + + case LTC_ASN1_BIT_STRING: + z = *outlen; + if ((err = der_encode_bit_string(data, size, out + x, &z)) != CRYPT_OK) { + goto LBL_ERR; + } + x += z; + *outlen -= z; + break; + + case LTC_ASN1_OCTET_STRING: + z = *outlen; + if ((err = der_encode_octet_string(data, size, out + x, &z)) != CRYPT_OK) { + goto LBL_ERR; + } + x += z; + *outlen -= z; + break; + + case LTC_ASN1_NULL: + out[x++] = 0x05; + out[x++] = 0x00; + *outlen -= 2; + break; + + case LTC_ASN1_OBJECT_IDENTIFIER: + z = *outlen; + if ((err = der_encode_object_identifier(data, size, out + x, &z)) != CRYPT_OK) { + goto LBL_ERR; + } + x += z; + *outlen -= z; + break; + + case LTC_ASN1_IA5_STRING: + z = *outlen; + if ((err = der_encode_ia5_string(data, size, out + x, &z)) != CRYPT_OK) { + goto LBL_ERR; + } + x += z; + *outlen -= z; + break; + + case LTC_ASN1_PRINTABLE_STRING: + z = *outlen; + if ((err = der_encode_printable_string(data, size, out + x, &z)) != CRYPT_OK) { + goto LBL_ERR; + } + x += z; + *outlen -= z; + break; + + case LTC_ASN1_UTF8_STRING: + z = *outlen; + if ((err = der_encode_utf8_string(data, size, out + x, &z)) != CRYPT_OK) { + goto LBL_ERR; + } + x += z; + *outlen -= z; + break; + + case LTC_ASN1_UTCTIME: + z = *outlen; + if ((err = der_encode_utctime(data, out + x, &z)) != CRYPT_OK) { + goto LBL_ERR; + } + x += z; + *outlen -= z; + break; + + case LTC_ASN1_SET: + z = *outlen; + if ((err = der_encode_set(data, size, out + x, &z)) != CRYPT_OK) { + goto LBL_ERR; + } + x += z; + *outlen -= z; + break; + + case LTC_ASN1_SETOF: + z = *outlen; + if ((err = der_encode_setof(data, size, out + x, &z)) != CRYPT_OK) { + goto LBL_ERR; + } + x += z; + *outlen -= z; + break; + + case LTC_ASN1_SEQUENCE: + z = *outlen; + if ((err = der_encode_sequence_ex(data, size, out + x, &z, type)) != CRYPT_OK) { + goto LBL_ERR; + } + x += z; + *outlen -= z; + break; + + default: + err = CRYPT_INVALID_ARG; + goto LBL_ERR; + } + } + *outlen = x; + err = CRYPT_OK; + +LBL_ERR: + return err; +} + +#endif diff --git a/libtomcrypt/src/pk/asn1/der/sequence/der_encode_sequence_multi.c b/libtomcrypt/src/pk/asn1/der/sequence/der_encode_sequence_multi.c new file mode 100644 index 0000000..da34c64 --- /dev/null +++ b/libtomcrypt/src/pk/asn1/der/sequence/der_encode_sequence_multi.c @@ -0,0 +1,138 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" +#include <stdarg.h> + + +/** + @file der_encode_sequence_multi.c + ASN.1 DER, encode a SEQUENCE, Tom St Denis +*/ + +#ifdef LTC_DER + +/** + Encode a SEQUENCE type using a VA list + @param out [out] Destination for data + @param outlen [in/out] Length of buffer and resulting length of output + @remark <...> is of the form <type, size, data> (int, unsigned long, void*) + @return CRYPT_OK on success +*/ +int der_encode_sequence_multi(unsigned char *out, unsigned long *outlen, ...) +{ + int err, type; + unsigned long size, x; + void *data; + va_list args; + ltc_asn1_list *list; + + LTC_ARGCHK(out != NULL); + LTC_ARGCHK(outlen != NULL); + + /* get size of output that will be required */ + va_start(args, outlen); + x = 0; + for (;;) { + type = va_arg(args, int); + size = va_arg(args, unsigned long); + data = va_arg(args, void*); + + if (type == LTC_ASN1_EOL) { + break; + } + + switch (type) { + case LTC_ASN1_BOOLEAN: + case LTC_ASN1_INTEGER: + case LTC_ASN1_SHORT_INTEGER: + case LTC_ASN1_BIT_STRING: + case LTC_ASN1_OCTET_STRING: + case LTC_ASN1_NULL: + case LTC_ASN1_OBJECT_IDENTIFIER: + case LTC_ASN1_IA5_STRING: + case LTC_ASN1_PRINTABLE_STRING: + case LTC_ASN1_UTF8_STRING: + case LTC_ASN1_UTCTIME: + case LTC_ASN1_SEQUENCE: + case LTC_ASN1_SET: + case LTC_ASN1_SETOF: + ++x; + break; + + default: + va_end(args); + return CRYPT_INVALID_ARG; + } + } + va_end(args); + + /* allocate structure for x elements */ + if (x == 0) { + return CRYPT_NOP; + } + + list = XCALLOC(sizeof(*list), x); + if (list == NULL) { + return CRYPT_MEM; + } + + /* fill in the structure */ + va_start(args, outlen); + x = 0; + for (;;) { + type = va_arg(args, int); + size = va_arg(args, unsigned long); + data = va_arg(args, void*); + + if (type == LTC_ASN1_EOL) { + break; + } + + switch (type) { + case LTC_ASN1_BOOLEAN: + case LTC_ASN1_INTEGER: + case LTC_ASN1_SHORT_INTEGER: + case LTC_ASN1_BIT_STRING: + case LTC_ASN1_OCTET_STRING: + case LTC_ASN1_NULL: + case LTC_ASN1_OBJECT_IDENTIFIER: + case LTC_ASN1_IA5_STRING: + case LTC_ASN1_PRINTABLE_STRING: + case LTC_ASN1_UTF8_STRING: + case LTC_ASN1_UTCTIME: + case LTC_ASN1_SEQUENCE: + case LTC_ASN1_SET: + case LTC_ASN1_SETOF: + list[x].type = type; + list[x].size = size; + list[x++].data = data; + break; + + default: + va_end(args); + err = CRYPT_INVALID_ARG; + goto LBL_ERR; + } + } + va_end(args); + + err = der_encode_sequence(list, x, out, outlen); +LBL_ERR: + XFREE(list); + return err; +} + +#endif + + +/* $Source: /cvs/libtom/libtomcrypt/src/pk/asn1/der/sequence/der_encode_sequence_multi.c,v $ */ +/* $Revision: 1.11 $ */ +/* $Date: 2006/11/26 02:25:18 $ */ diff --git a/libtomcrypt/src/pk/asn1/der/sequence/der_length_sequence.c b/libtomcrypt/src/pk/asn1/der/sequence/der_length_sequence.c new file mode 100644 index 0000000..36f4a2a --- /dev/null +++ b/libtomcrypt/src/pk/asn1/der/sequence/der_length_sequence.c @@ -0,0 +1,169 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file der_length_sequence.c + ASN.1 DER, length a SEQUENCE, Tom St Denis +*/ + +#ifdef LTC_DER + +/** + Get the length of a DER sequence + @param list The sequences of items in the SEQUENCE + @param inlen The number of items + @param outlen [out] The length required in octets to store it + @return CRYPT_OK on success +*/ +int der_length_sequence(ltc_asn1_list *list, unsigned long inlen, + unsigned long *outlen) +{ + int err, type; + unsigned long size, x, y, z, i; + void *data; + + LTC_ARGCHK(list != NULL); + LTC_ARGCHK(outlen != NULL); + + /* get size of output that will be required */ + y = 0; + for (i = 0; i < inlen; i++) { + type = list[i].type; + size = list[i].size; + data = list[i].data; + + if (type == LTC_ASN1_EOL) { + break; + } + + switch (type) { + case LTC_ASN1_BOOLEAN: + if ((err = der_length_boolean(&x)) != CRYPT_OK) { + goto LBL_ERR; + } + y += x; + break; + + case LTC_ASN1_INTEGER: + if ((err = der_length_integer(data, &x)) != CRYPT_OK) { + goto LBL_ERR; + } + y += x; + break; + + case LTC_ASN1_SHORT_INTEGER: + if ((err = der_length_short_integer(*((unsigned long *)data), &x)) != CRYPT_OK) { + goto LBL_ERR; + } + y += x; + break; + + case LTC_ASN1_BIT_STRING: + if ((err = der_length_bit_string(size, &x)) != CRYPT_OK) { + goto LBL_ERR; + } + y += x; + break; + + case LTC_ASN1_OCTET_STRING: + if ((err = der_length_octet_string(size, &x)) != CRYPT_OK) { + goto LBL_ERR; + } + y += x; + break; + + case LTC_ASN1_NULL: + y += 2; + break; + + case LTC_ASN1_OBJECT_IDENTIFIER: + if ((err = der_length_object_identifier(data, size, &x)) != CRYPT_OK) { + goto LBL_ERR; + } + y += x; + break; + + case LTC_ASN1_IA5_STRING: + if ((err = der_length_ia5_string(data, size, &x)) != CRYPT_OK) { + goto LBL_ERR; + } + y += x; + break; + + case LTC_ASN1_PRINTABLE_STRING: + if ((err = der_length_printable_string(data, size, &x)) != CRYPT_OK) { + goto LBL_ERR; + } + y += x; + break; + + case LTC_ASN1_UTCTIME: + if ((err = der_length_utctime(data, &x)) != CRYPT_OK) { + goto LBL_ERR; + } + y += x; + break; + + case LTC_ASN1_UTF8_STRING: + if ((err = der_length_utf8_string(data, size, &x)) != CRYPT_OK) { + goto LBL_ERR; + } + y += x; + break; + + case LTC_ASN1_SET: + case LTC_ASN1_SETOF: + case LTC_ASN1_SEQUENCE: + if ((err = der_length_sequence(data, size, &x)) != CRYPT_OK) { + goto LBL_ERR; + } + y += x; + break; + + + default: + err = CRYPT_INVALID_ARG; + goto LBL_ERR; + } + } + + /* calc header size */ + z = y; + if (y < 128) { + y += 2; + } else if (y < 256) { + /* 0x30 0x81 LL */ + y += 3; + } else if (y < 65536UL) { + /* 0x30 0x82 LL LL */ + y += 4; + } else if (y < 16777216UL) { + /* 0x30 0x83 LL LL LL */ + y += 5; + } else { + err = CRYPT_INVALID_ARG; + goto LBL_ERR; + } + + /* store size */ + *outlen = y; + err = CRYPT_OK; + +LBL_ERR: + return err; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/pk/asn1/der/sequence/der_length_sequence.c,v $ */ +/* $Revision: 1.13 $ */ +/* $Date: 2006/11/26 02:25:18 $ */ diff --git a/libtomcrypt/src/pk/asn1/der/sequence/der_sequence_free.c b/libtomcrypt/src/pk/asn1/der/sequence/der_sequence_free.c new file mode 100644 index 0000000..dc826e3 --- /dev/null +++ b/libtomcrypt/src/pk/asn1/der/sequence/der_sequence_free.c @@ -0,0 +1,65 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file der_sequence_free.c + ASN.1 DER, free's a structure allocated by der_decode_sequence_flexi(), Tom St Denis +*/ + +#ifdef LTC_DER + +/** + Free memory allocated by der_decode_sequence_flexi() + @param in The list to free +*/ +void der_sequence_free(ltc_asn1_list *in) +{ + ltc_asn1_list *l; + + /* walk to the start of the chain */ + while (in->prev != NULL || in->parent != NULL) { + if (in->parent != NULL) { + in = in->parent; + } else { + in = in->prev; + } + } + + /* now walk the list and free stuff */ + while (in != NULL) { + /* is there a child? */ + if (in->child) { + /* disconnect */ + in->child->parent = NULL; + der_sequence_free(in->child); + } + + switch (in->type) { + case LTC_ASN1_SET: + case LTC_ASN1_SETOF: + case LTC_ASN1_SEQUENCE: break; + case LTC_ASN1_INTEGER : if (in->data != NULL) { mp_clear(in->data); } break; + default : if (in->data != NULL) { XFREE(in->data); } + } + + /* move to next and free current */ + l = in->next; + free(in); + in = l; + } +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/pk/asn1/der/sequence/der_sequence_free.c,v $ */ +/* $Revision: 1.3 $ */ +/* $Date: 2006/03/31 14:15:35 $ */ diff --git a/libtomcrypt/src/pk/asn1/der/set/der_encode_set.c b/libtomcrypt/src/pk/asn1/der/set/der_encode_set.c new file mode 100644 index 0000000..a08d2b0 --- /dev/null +++ b/libtomcrypt/src/pk/asn1/der/set/der_encode_set.c @@ -0,0 +1,103 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file der_encode_set.c + ASN.1 DER, Encode a SET, Tom St Denis +*/ + +#ifdef LTC_DER + +/* LTC define to ASN.1 TAG */ +static int ltc_to_asn1(int v) +{ + switch (v) { + case LTC_ASN1_BOOLEAN: return 0x01; + case LTC_ASN1_INTEGER: + case LTC_ASN1_SHORT_INTEGER: return 0x02; + case LTC_ASN1_BIT_STRING: return 0x03; + case LTC_ASN1_OCTET_STRING: return 0x04; + case LTC_ASN1_NULL: return 0x05; + case LTC_ASN1_OBJECT_IDENTIFIER: return 0x06; + case LTC_ASN1_UTF8_STRING: return 0x0C; + case LTC_ASN1_PRINTABLE_STRING: return 0x13; + case LTC_ASN1_IA5_STRING: return 0x16; + case LTC_ASN1_UTCTIME: return 0x17; + case LTC_ASN1_SEQUENCE: return 0x30; + case LTC_ASN1_SET: + case LTC_ASN1_SETOF: return 0x31; + default: return -1; + } +} + + +static int qsort_helper(const void *a, const void *b) +{ + ltc_asn1_list *A = (ltc_asn1_list *)a, *B = (ltc_asn1_list *)b; + int r; + + r = ltc_to_asn1(A->type) - ltc_to_asn1(B->type); + + /* for QSORT the order is UNDEFINED if they are "equal" which means it is NOT DETERMINISTIC. So we force it to be :-) */ + if (r == 0) { + /* their order in the original list now determines the position */ + return A->used - B->used; + } else { + return r; + } +} + +/* + Encode a SET type + @param list The list of items to encode + @param inlen The number of items in the list + @param out [out] The destination + @param outlen [in/out] The size of the output + @return CRYPT_OK on success +*/ +int der_encode_set(ltc_asn1_list *list, unsigned long inlen, + unsigned char *out, unsigned long *outlen) +{ + ltc_asn1_list *copy; + unsigned long x; + int err; + + /* make copy of list */ + copy = XCALLOC(inlen, sizeof(*copy)); + if (copy == NULL) { + return CRYPT_MEM; + } + + /* fill in used member with index so we can fully sort it */ + for (x = 0; x < inlen; x++) { + copy[x] = list[x]; + copy[x].used = x; + } + + /* sort it by the "type" field */ + XQSORT(copy, inlen, sizeof(*copy), &qsort_helper); + + /* call der_encode_sequence_ex() */ + err = der_encode_sequence_ex(copy, inlen, out, outlen, LTC_ASN1_SET); + + /* free list */ + XFREE(copy); + + return err; +} + + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/pk/asn1/der/set/der_encode_set.c,v $ */ +/* $Revision: 1.11 $ */ +/* $Date: 2006/11/26 02:27:37 $ */ diff --git a/libtomcrypt/src/pk/asn1/der/set/der_encode_setof.c b/libtomcrypt/src/pk/asn1/der/set/der_encode_setof.c new file mode 100644 index 0000000..6c12eb4 --- /dev/null +++ b/libtomcrypt/src/pk/asn1/der/set/der_encode_setof.c @@ -0,0 +1,162 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file der_encode_setof.c + ASN.1 DER, Encode SET OF, Tom St Denis +*/ + +#ifdef LTC_DER + +struct edge { + unsigned char *start; + unsigned long size; +}; + +static int qsort_helper(const void *a, const void *b) +{ + struct edge *A = (struct edge *)a, *B = (struct edge *)b; + int r; + unsigned long x; + + /* compare min length */ + r = XMEMCMP(A->start, B->start, MIN(A->size, B->size)); + + if (r == 0 && A->size != B->size) { + if (A->size > B->size) { + for (x = B->size; x < A->size; x++) { + if (A->start[x]) { + return 1; + } + } + } else { + for (x = A->size; x < B->size; x++) { + if (B->start[x]) { + return -1; + } + } + } + } + + return r; +} + +/** + Encode a SETOF stucture + @param list The list of items to encode + @param inlen The number of items in the list + @param out [out] The destination + @param outlen [in/out] The size of the output + @return CRYPT_OK on success +*/ +int der_encode_setof(ltc_asn1_list *list, unsigned long inlen, + unsigned char *out, unsigned long *outlen) +{ + unsigned long x, y, z, hdrlen; + int err; + struct edge *edges; + unsigned char *ptr, *buf; + + /* check that they're all the same type */ + for (x = 1; x < inlen; x++) { + if (list[x].type != list[x-1].type) { + return CRYPT_INVALID_ARG; + } + } + + /* alloc buffer to store copy of output */ + buf = XCALLOC(1, *outlen); + if (buf == NULL) { + return CRYPT_MEM; + } + + /* encode list */ + if ((err = der_encode_sequence_ex(list, inlen, buf, outlen, LTC_ASN1_SETOF)) != CRYPT_OK) { + XFREE(buf); + return err; + } + + /* allocate edges */ + edges = XCALLOC(inlen, sizeof(*edges)); + if (edges == NULL) { + XFREE(buf); + return CRYPT_MEM; + } + + /* skip header */ + ptr = buf + 1; + + /* now skip length data */ + x = *ptr++; + if (x >= 0x80) { + ptr += (x & 0x7F); + } + + /* get the size of the static header */ + hdrlen = ((unsigned long)ptr) - ((unsigned long)buf); + + + /* scan for edges */ + x = 0; + while (ptr < (buf + *outlen)) { + /* store start */ + edges[x].start = ptr; + + /* skip type */ + z = 1; + + /* parse length */ + y = ptr[z++]; + if (y < 128) { + edges[x].size = y; + } else { + y &= 0x7F; + edges[x].size = 0; + while (y--) { + edges[x].size = (edges[x].size << 8) | ((unsigned long)ptr[z++]); + } + } + + /* skip content */ + edges[x].size += z; + ptr += edges[x].size; + ++x; + } + + /* sort based on contents (using edges) */ + XQSORT(edges, inlen, sizeof(*edges), &qsort_helper); + + /* copy static header */ + XMEMCPY(out, buf, hdrlen); + + /* copy+sort using edges+indecies to output from buffer */ + for (y = hdrlen, x = 0; x < inlen; x++) { + XMEMCPY(out+y, edges[x].start, edges[x].size); + y += edges[x].size; + } + +#ifdef LTC_CLEAN_STACK + zeromem(buf, *outlen); +#endif + + /* free buffers */ + XFREE(edges); + XFREE(buf); + + return CRYPT_OK; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/pk/asn1/der/set/der_encode_setof.c,v $ */ +/* $Revision: 1.11 $ */ +/* $Date: 2006/03/31 14:15:35 $ */ diff --git a/libtomcrypt/src/pk/asn1/der/short_integer/der_decode_short_integer.c b/libtomcrypt/src/pk/asn1/der/short_integer/der_decode_short_integer.c new file mode 100644 index 0000000..1407e9a --- /dev/null +++ b/libtomcrypt/src/pk/asn1/der/short_integer/der_decode_short_integer.c @@ -0,0 +1,68 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file der_decode_short_integer.c + ASN.1 DER, decode an integer, Tom St Denis +*/ + + +#ifdef LTC_DER + +/** + Read a short integer + @param in The DER encoded data + @param inlen Size of data + @param num [out] The integer to decode + @return CRYPT_OK if successful +*/ +int der_decode_short_integer(const unsigned char *in, unsigned long inlen, unsigned long *num) +{ + unsigned long len, x, y; + + LTC_ARGCHK(num != NULL); + LTC_ARGCHK(in != NULL); + + /* check length */ + if (inlen < 2) { + return CRYPT_INVALID_PACKET; + } + + /* check header */ + x = 0; + if ((in[x++] & 0x1F) != 0x02) { + return CRYPT_INVALID_PACKET; + } + + /* get the packet len */ + len = in[x++]; + + if (x + len > inlen) { + return CRYPT_INVALID_PACKET; + } + + /* read number */ + y = 0; + while (len--) { + y = (y<<8) | (unsigned long)in[x++]; + } + *num = y; + + return CRYPT_OK; + +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/pk/asn1/der/short_integer/der_decode_short_integer.c,v $ */ +/* $Revision: 1.6 $ */ +/* $Date: 2006/03/31 14:15:35 $ */ diff --git a/libtomcrypt/src/pk/asn1/der/short_integer/der_encode_short_integer.c b/libtomcrypt/src/pk/asn1/der/short_integer/der_encode_short_integer.c new file mode 100644 index 0000000..95da2fa --- /dev/null +++ b/libtomcrypt/src/pk/asn1/der/short_integer/der_encode_short_integer.c @@ -0,0 +1,97 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file der_encode_short_integer.c + ASN.1 DER, encode an integer, Tom St Denis +*/ + + +#ifdef LTC_DER + +/** + Store a short integer in the range (0,2^32-1) + @param num The integer to encode + @param out [out] The destination for the DER encoded integers + @param outlen [in/out] The max size and resulting size of the DER encoded integers + @return CRYPT_OK if successful +*/ +int der_encode_short_integer(unsigned long num, unsigned char *out, unsigned long *outlen) +{ + unsigned long len, x, y, z; + int err; + + LTC_ARGCHK(out != NULL); + LTC_ARGCHK(outlen != NULL); + + /* force to 32 bits */ + num &= 0xFFFFFFFFUL; + + /* find out how big this will be */ + if ((err = der_length_short_integer(num, &len)) != CRYPT_OK) { + return err; + } + + if (*outlen < len) { + *outlen = len; + return CRYPT_BUFFER_OVERFLOW; + } + + /* get len of output */ + z = 0; + y = num; + while (y) { + ++z; + y >>= 8; + } + + /* handle zero */ + if (z == 0) { + z = 1; + } + + /* see if msb is set */ + z += (num&(1UL<<((z<<3) - 1))) ? 1 : 0; + + /* adjust the number so the msB is non-zero */ + for (x = 0; (z <= 4) && (x < (4 - z)); x++) { + num <<= 8; + } + + /* store header */ + x = 0; + out[x++] = 0x02; + out[x++] = (unsigned char)z; + + /* if 31st bit is set output a leading zero and decrement count */ + if (z == 5) { + out[x++] = 0; + --z; + } + + /* store values */ + for (y = 0; y < z; y++) { + out[x++] = (unsigned char)((num >> 24) & 0xFF); + num <<= 8; + } + + /* we good */ + *outlen = x; + + return CRYPT_OK; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/pk/asn1/der/short_integer/der_encode_short_integer.c,v $ */ +/* $Revision: 1.7 $ */ +/* $Date: 2006/12/04 21:34:03 $ */ diff --git a/libtomcrypt/src/pk/asn1/der/short_integer/der_length_short_integer.c b/libtomcrypt/src/pk/asn1/der/short_integer/der_length_short_integer.c new file mode 100644 index 0000000..073e294 --- /dev/null +++ b/libtomcrypt/src/pk/asn1/der/short_integer/der_length_short_integer.c @@ -0,0 +1,70 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file der_length_short_integer.c + ASN.1 DER, get length of encoding, Tom St Denis +*/ + + +#ifdef LTC_DER +/** + Gets length of DER encoding of num + @param num The integer to get the size of + @param outlen [out] The length of the DER encoding for the given integer + @return CRYPT_OK if successful +*/ +int der_length_short_integer(unsigned long num, unsigned long *outlen) +{ + unsigned long z, y, len; + + LTC_ARGCHK(outlen != NULL); + + /* force to 32 bits */ + num &= 0xFFFFFFFFUL; + + /* get the number of bytes */ + z = 0; + y = num; + while (y) { + ++z; + y >>= 8; + } + + /* handle zero */ + if (z == 0) { + z = 1; + } + + /* we need a 0x02 to indicate it's INTEGER */ + len = 1; + + /* length byte */ + ++len; + + /* bytes in value */ + len += z; + + /* see if msb is set */ + len += (num&(1UL<<((z<<3) - 1))) ? 1 : 0; + + /* return length */ + *outlen = len; + + return CRYPT_OK; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/pk/asn1/der/short_integer/der_length_short_integer.c,v $ */ +/* $Revision: 1.5 $ */ +/* $Date: 2006/03/31 14:15:35 $ */ diff --git a/libtomcrypt/src/pk/asn1/der/utctime/der_decode_utctime.c b/libtomcrypt/src/pk/asn1/der/utctime/der_decode_utctime.c new file mode 100644 index 0000000..8a1f5fb --- /dev/null +++ b/libtomcrypt/src/pk/asn1/der/utctime/der_decode_utctime.c @@ -0,0 +1,127 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file der_decode_utctime.c + ASN.1 DER, decode a UTCTIME, Tom St Denis +*/ + +#ifdef LTC_DER + +static int char_to_int(unsigned char x) +{ + switch (x) { + case '0': return 0; + case '1': return 1; + case '2': return 2; + case '3': return 3; + case '4': return 4; + case '5': return 5; + case '6': return 6; + case '7': return 7; + case '8': return 8; + case '9': return 9; + } + return 100; +} + +#define DECODE_V(y, max) \ + y = char_to_int(buf[x])*10 + char_to_int(buf[x+1]); \ + if (y >= max) return CRYPT_INVALID_PACKET; \ + x += 2; + +/** + Decodes a UTC time structure in DER format (reads all 6 valid encoding formats) + @param in Input buffer + @param inlen Length of input buffer in octets + @param out [out] Destination of UTC time structure + @return CRYPT_OK if successful +*/ +int der_decode_utctime(const unsigned char *in, unsigned long *inlen, + ltc_utctime *out) +{ + unsigned char buf[32]; + unsigned long x; + int y; + + LTC_ARGCHK(in != NULL); + LTC_ARGCHK(inlen != NULL); + LTC_ARGCHK(out != NULL); + + /* check header */ + if (*inlen < 2UL || (in[1] >= sizeof(buf)) || ((in[1] + 2UL) > *inlen)) { + return CRYPT_INVALID_PACKET; + } + + /* decode the string */ + for (x = 0; x < in[1]; x++) { + y = der_ia5_value_decode(in[x+2]); + if (y == -1) { + return CRYPT_INVALID_PACKET; + } + buf[x] = y; + } + *inlen = 2 + x; + + + /* possible encodings are +YYMMDDhhmmZ +YYMMDDhhmm+hh'mm' +YYMMDDhhmm-hh'mm' +YYMMDDhhmmssZ +YYMMDDhhmmss+hh'mm' +YYMMDDhhmmss-hh'mm' + + So let's do a trivial decode upto [including] mm + */ + + x = 0; + DECODE_V(out->YY, 100); + DECODE_V(out->MM, 13); + DECODE_V(out->DD, 32); + DECODE_V(out->hh, 24); + DECODE_V(out->mm, 60); + + /* clear timezone and seconds info */ + out->off_dir = out->off_hh = out->off_mm = out->ss = 0; + + /* now is it Z, +, - or 0-9 */ + if (buf[x] == 'Z') { + return CRYPT_OK; + } else if (buf[x] == '+' || buf[x] == '-') { + out->off_dir = (buf[x++] == '+') ? 0 : 1; + DECODE_V(out->off_hh, 24); + DECODE_V(out->off_mm, 60); + return CRYPT_OK; + } + + /* decode seconds */ + DECODE_V(out->ss, 60); + + /* now is it Z, +, - */ + if (buf[x] == 'Z') { + return CRYPT_OK; + } else if (buf[x] == '+' || buf[x] == '-') { + out->off_dir = (buf[x++] == '+') ? 0 : 1; + DECODE_V(out->off_hh, 24); + DECODE_V(out->off_mm, 60); + return CRYPT_OK; + } else { + return CRYPT_INVALID_PACKET; + } +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/pk/asn1/der/utctime/der_decode_utctime.c,v $ */ +/* $Revision: 1.8 $ */ +/* $Date: 2006/03/31 14:15:35 $ */ diff --git a/libtomcrypt/src/pk/asn1/der/utctime/der_encode_utctime.c b/libtomcrypt/src/pk/asn1/der/utctime/der_encode_utctime.c new file mode 100644 index 0000000..ae2ccbe --- /dev/null +++ b/libtomcrypt/src/pk/asn1/der/utctime/der_encode_utctime.c @@ -0,0 +1,83 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file der_encode_utctime.c + ASN.1 DER, encode a UTCTIME, Tom St Denis +*/ + +#ifdef LTC_DER + +static const char *baseten = "0123456789"; + +#define STORE_V(y) \ + out[x++] = der_ia5_char_encode(baseten[(y/10) % 10]); \ + out[x++] = der_ia5_char_encode(baseten[y % 10]); + +/** + Encodes a UTC time structure in DER format + @param utctime The UTC time structure to encode + @param out The destination of the DER encoding of the UTC time structure + @param outlen [in/out] The length of the DER encoding + @return CRYPT_OK if successful +*/ +int der_encode_utctime(ltc_utctime *utctime, + unsigned char *out, unsigned long *outlen) +{ + unsigned long x, tmplen; + int err; + + LTC_ARGCHK(utctime != NULL); + LTC_ARGCHK(out != NULL); + LTC_ARGCHK(outlen != NULL); + + if ((err = der_length_utctime(utctime, &tmplen)) != CRYPT_OK) { + return err; + } + if (tmplen > *outlen) { + *outlen = tmplen; + return CRYPT_BUFFER_OVERFLOW; + } + + /* store header */ + out[0] = 0x17; + + /* store values */ + x = 2; + STORE_V(utctime->YY); + STORE_V(utctime->MM); + STORE_V(utctime->DD); + STORE_V(utctime->hh); + STORE_V(utctime->mm); + STORE_V(utctime->ss); + + if (utctime->off_mm || utctime->off_hh) { + out[x++] = der_ia5_char_encode(utctime->off_dir ? '-' : '+'); + STORE_V(utctime->off_hh); + STORE_V(utctime->off_mm); + } else { + out[x++] = der_ia5_char_encode('Z'); + } + + /* store length */ + out[1] = (unsigned char)(x - 2); + + /* all good let's return */ + *outlen = x; + return CRYPT_OK; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/pk/asn1/der/utctime/der_encode_utctime.c,v $ */ +/* $Revision: 1.9 $ */ +/* $Date: 2006/12/04 21:34:03 $ */ diff --git a/libtomcrypt/src/pk/asn1/der/utctime/der_length_utctime.c b/libtomcrypt/src/pk/asn1/der/utctime/der_length_utctime.c new file mode 100644 index 0000000..60f09de --- /dev/null +++ b/libtomcrypt/src/pk/asn1/der/utctime/der_length_utctime.c @@ -0,0 +1,46 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file der_length_utctime.c + ASN.1 DER, get length of UTCTIME, Tom St Denis +*/ + +#ifdef LTC_DER + +/** + Gets length of DER encoding of UTCTIME + @param utctime The UTC time structure to get the size of + @param outlen [out] The length of the DER encoding + @return CRYPT_OK if successful +*/ +int der_length_utctime(ltc_utctime *utctime, unsigned long *outlen) +{ + LTC_ARGCHK(outlen != NULL); + LTC_ARGCHK(utctime != NULL); + + if (utctime->off_hh == 0 && utctime->off_mm == 0) { + /* we encode as YYMMDDhhmmssZ */ + *outlen = 2 + 13; + } else { + /* we encode as YYMMDDhhmmss{+|-}hh'mm' */ + *outlen = 2 + 17; + } + + return CRYPT_OK; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/pk/asn1/der/utctime/der_length_utctime.c,v $ */ +/* $Revision: 1.4 $ */ +/* $Date: 2006/03/31 14:15:35 $ */ diff --git a/libtomcrypt/src/pk/asn1/der/utf8/der_decode_utf8_string.c b/libtomcrypt/src/pk/asn1/der/utf8/der_decode_utf8_string.c new file mode 100644 index 0000000..28b5520 --- /dev/null +++ b/libtomcrypt/src/pk/asn1/der/utf8/der_decode_utf8_string.c @@ -0,0 +1,111 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file der_decode_utf8_string.c + ASN.1 DER, encode a UTF8 STRING, Tom St Denis +*/ + + +#ifdef LTC_DER + +/** + Store a UTF8 STRING + @param in The DER encoded UTF8 STRING + @param inlen The size of the DER UTF8 STRING + @param out [out] The array of utf8s stored (one per char) + @param outlen [in/out] The number of utf8s stored + @return CRYPT_OK if successful +*/ +int der_decode_utf8_string(const unsigned char *in, unsigned long inlen, + wchar_t *out, unsigned long *outlen) +{ + wchar_t tmp; + unsigned long x, y, z, len; + + LTC_ARGCHK(in != NULL); + LTC_ARGCHK(out != NULL); + LTC_ARGCHK(outlen != NULL); + + /* must have header at least */ + if (inlen < 2) { + return CRYPT_INVALID_PACKET; + } + + /* check for 0x0C */ + if ((in[0] & 0x1F) != 0x0C) { + return CRYPT_INVALID_PACKET; + } + x = 1; + + /* decode the length */ + if (in[x] & 0x80) { + /* valid # of bytes in length are 1,2,3 */ + y = in[x] & 0x7F; + if ((y == 0) || (y > 3) || ((x + y) > inlen)) { + return CRYPT_INVALID_PACKET; + } + + /* read the length in */ + len = 0; + ++x; + while (y--) { + len = (len << 8) | in[x++]; + } + } else { + len = in[x++] & 0x7F; + } + + if (len + x > inlen) { + return CRYPT_INVALID_PACKET; + } + + /* proceed to decode */ + for (y = 0; x < inlen; ) { + /* get first byte */ + tmp = in[x++]; + + /* count number of bytes */ + for (z = 0; (tmp & 0x80) && (z <= 4); z++, tmp = (tmp << 1) & 0xFF); + + if (z > 4 || (x + (z - 1) > inlen)) { + return CRYPT_INVALID_PACKET; + } + + /* decode, grab upper bits */ + tmp >>= z; + + /* grab remaining bytes */ + if (z > 1) { --z; } + while (z-- != 0) { + if ((in[x] & 0xC0) != 0x80) { + return CRYPT_INVALID_PACKET; + } + tmp = (tmp << 6) | ((wchar_t)in[x++] & 0x3F); + } + + if (y > *outlen) { + *outlen = y; + return CRYPT_BUFFER_OVERFLOW; + } + out[y++] = tmp; + } + *outlen = y; + + return CRYPT_OK; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/pk/asn1/der/utf8/der_decode_utf8_string.c,v $ */ +/* $Revision: 1.7 $ */ +/* $Date: 2006/11/26 02:27:37 $ */ diff --git a/libtomcrypt/src/pk/asn1/der/utf8/der_encode_utf8_string.c b/libtomcrypt/src/pk/asn1/der/utf8/der_encode_utf8_string.c new file mode 100644 index 0000000..2dd6081 --- /dev/null +++ b/libtomcrypt/src/pk/asn1/der/utf8/der_encode_utf8_string.c @@ -0,0 +1,105 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file der_encode_utf8_string.c + ASN.1 DER, encode a UTF8 STRING, Tom St Denis +*/ + + +#ifdef LTC_DER + +/** + Store an UTF8 STRING + @param in The array of UTF8 to store (one per wchar_t) + @param inlen The number of UTF8 to store + @param out [out] The destination for the DER encoded UTF8 STRING + @param outlen [in/out] The max size and resulting size of the DER UTF8 STRING + @return CRYPT_OK if successful +*/ +int der_encode_utf8_string(const wchar_t *in, unsigned long inlen, + unsigned char *out, unsigned long *outlen) +{ + unsigned long x, y, len; + + LTC_ARGCHK(in != NULL); + LTC_ARGCHK(out != NULL); + LTC_ARGCHK(outlen != NULL); + + /* get the size */ + for (x = len = 0; x < inlen; x++) { + if (in[x] < 0 || in[x] > 0x1FFFF) { + return CRYPT_INVALID_ARG; + } + len += der_utf8_charsize(in[x]); + } + + if (len < 128) { + y = 2 + len; + } else if (len < 256) { + y = 3 + len; + } else if (len < 65536UL) { + y = 4 + len; + } else if (len < 16777216UL) { + y = 5 + len; + } else { + return CRYPT_INVALID_ARG; + } + + /* too big? */ + if (y > *outlen) { + *outlen = len; + return CRYPT_BUFFER_OVERFLOW; + } + + /* encode the header+len */ + x = 0; + out[x++] = 0x0C; + if (len < 128) { + out[x++] = len; + } else if (len < 256) { + out[x++] = 0x81; + out[x++] = len; + } else if (len < 65536UL) { + out[x++] = 0x82; + out[x++] = (len>>8)&255; + out[x++] = len&255; + } else if (len < 16777216UL) { + out[x++] = 0x83; + out[x++] = (len>>16)&255; + out[x++] = (len>>8)&255; + out[x++] = len&255; + } else { + return CRYPT_INVALID_ARG; + } + + /* store UTF8 */ + for (y = 0; y < inlen; y++) { + switch (der_utf8_charsize(in[y])) { + case 1: out[x++] = in[y]; break; + case 2: out[x++] = 0xC0 | ((in[y] >> 6) & 0x1F); out[x++] = 0x80 | (in[y] & 0x3F); break; + case 3: out[x++] = 0xE0 | ((in[y] >> 12) & 0x0F); out[x++] = 0x80 | ((in[y] >> 6) & 0x3F); out[x++] = 0x80 | (in[y] & 0x3F); break; + case 4: out[x++] = 0xF0 | ((in[y] >> 18) & 0x07); out[x++] = 0x80 | ((in[y] >> 12) & 0x3F); out[x++] = 0x80 | ((in[y] >> 6) & 0x3F); out[x++] = 0x80 | (in[y] & 0x3F); break; + } + } + + /* retun length */ + *outlen = x; + + return CRYPT_OK; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/pk/asn1/der/utf8/der_encode_utf8_string.c,v $ */ +/* $Revision: 1.7 $ */ +/* $Date: 2006/12/16 17:41:21 $ */ diff --git a/libtomcrypt/src/pk/asn1/der/utf8/der_length_utf8_string.c b/libtomcrypt/src/pk/asn1/der/utf8/der_length_utf8_string.c new file mode 100644 index 0000000..b5b2bc6 --- /dev/null +++ b/libtomcrypt/src/pk/asn1/der/utf8/der_length_utf8_string.c @@ -0,0 +1,83 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file der_length_utf8_string.c + ASN.1 DER, get length of UTF8 STRING, Tom St Denis +*/ + +#ifdef LTC_DER + +/** Return the size in bytes of a UTF-8 character + @param c The UTF-8 character to measure + @return The size in bytes +*/ +unsigned long der_utf8_charsize(const wchar_t c) +{ + if (c <= 0x7F) { + return 1; + } else if (c <= 0x7FF) { + return 2; + } else if (c <= 0xFFFF) { + return 3; + } else { + return 4; + } +} + +/** + Gets length of DER encoding of UTF8 STRING + @param in The characters to measure the length of + @param noctets The number of octets in the string to encode + @param outlen [out] The length of the DER encoding for the given string + @return CRYPT_OK if successful +*/ +int der_length_utf8_string(const wchar_t *in, unsigned long noctets, unsigned long *outlen) +{ + unsigned long x, len; + + LTC_ARGCHK(in != NULL); + LTC_ARGCHK(outlen != NULL); + + len = 0; + for (x = 0; x < noctets; x++) { + if (in[x] < 0 || in[x] > 0x10FFFF) { + return CRYPT_INVALID_ARG; + } + len += der_utf8_charsize(in[x]); + } + + if (len < 128) { + /* 0C LL DD DD DD ... */ + *outlen = 2 + len; + } else if (len < 256) { + /* 0C 81 LL DD DD DD ... */ + *outlen = 3 + len; + } else if (len < 65536UL) { + /* 0C 82 LL LL DD DD DD ... */ + *outlen = 4 + len; + } else if (len < 16777216UL) { + /* 0C 83 LL LL LL DD DD DD ... */ + *outlen = 5 + len; + } else { + return CRYPT_INVALID_ARG; + } + + return CRYPT_OK; +} + +#endif + + +/* $Source: /cvs/libtom/libtomcrypt/src/pk/asn1/der/utf8/der_length_utf8_string.c,v $ */ +/* $Revision: 1.5 $ */ +/* $Date: 2006/12/16 17:41:21 $ */ diff --git a/libtomcrypt/src/pk/dsa/dsa_decrypt_key.c b/libtomcrypt/src/pk/dsa/dsa_decrypt_key.c new file mode 100644 index 0000000..5cbedc6 --- /dev/null +++ b/libtomcrypt/src/pk/dsa/dsa_decrypt_key.c @@ -0,0 +1,139 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file dsa_decrypt_key.c + DSA Crypto, Tom St Denis +*/ + +#ifdef MDSA + +/** + Decrypt an DSA encrypted key + @param in The ciphertext + @param inlen The length of the ciphertext (octets) + @param out [out] The plaintext + @param outlen [in/out] The max size and resulting size of the plaintext + @param key The corresponding private DSA key + @return CRYPT_OK if successful +*/ +int dsa_decrypt_key(const unsigned char *in, unsigned long inlen, + unsigned char *out, unsigned long *outlen, + dsa_key *key) +{ + unsigned char *skey, *expt; + void *g_pub; + unsigned long x, y, hashOID[32]; + int hash, err; + ltc_asn1_list decode[3]; + + LTC_ARGCHK(in != NULL); + LTC_ARGCHK(out != NULL); + LTC_ARGCHK(outlen != NULL); + LTC_ARGCHK(key != NULL); + + /* right key type? */ + if (key->type != PK_PRIVATE) { + return CRYPT_PK_NOT_PRIVATE; + } + + /* decode to find out hash */ + LTC_SET_ASN1(decode, 0, LTC_ASN1_OBJECT_IDENTIFIER, hashOID, sizeof(hashOID)/sizeof(hashOID[0])); + + if ((err = der_decode_sequence(in, inlen, decode, 1)) != CRYPT_OK) { + return err; + } + + hash = find_hash_oid(hashOID, decode[0].size); + if (hash_is_valid(hash) != CRYPT_OK) { + return CRYPT_INVALID_PACKET; + } + + /* we now have the hash! */ + + if ((err = mp_init(&g_pub)) != CRYPT_OK) { + return err; + } + + /* allocate memory */ + expt = XMALLOC(mp_unsigned_bin_size(key->p) + 1); + skey = XMALLOC(MAXBLOCKSIZE); + if (expt == NULL || skey == NULL) { + if (expt != NULL) { + XFREE(expt); + } + if (skey != NULL) { + XFREE(skey); + } + mp_clear(g_pub); + return CRYPT_MEM; + } + + LTC_SET_ASN1(decode, 1, LTC_ASN1_INTEGER, g_pub, 1UL); + LTC_SET_ASN1(decode, 2, LTC_ASN1_OCTET_STRING, skey, MAXBLOCKSIZE); + + /* read the structure in now */ + if ((err = der_decode_sequence(in, inlen, decode, 3)) != CRYPT_OK) { + goto LBL_ERR; + } + + /* make shared key */ + x = mp_unsigned_bin_size(key->p) + 1; + if ((err = dsa_shared_secret(key->x, g_pub, key, expt, &x)) != CRYPT_OK) { + goto LBL_ERR; + } + + y = MIN(mp_unsigned_bin_size(key->p) + 1, MAXBLOCKSIZE); + if ((err = hash_memory(hash, expt, x, expt, &y)) != CRYPT_OK) { + goto LBL_ERR; + } + + /* ensure the hash of the shared secret is at least as big as the encrypt itself */ + if (decode[2].size > y) { + err = CRYPT_INVALID_PACKET; + goto LBL_ERR; + } + + /* avoid buffer overflow */ + if (*outlen < decode[2].size) { + *outlen = decode[2].size; + err = CRYPT_BUFFER_OVERFLOW; + goto LBL_ERR; + } + + /* Decrypt the key */ + for (x = 0; x < decode[2].size; x++) { + out[x] = expt[x] ^ skey[x]; + } + *outlen = x; + + err = CRYPT_OK; +LBL_ERR: +#ifdef LTC_CLEAN_STACK + zeromem(expt, mp_unsigned_bin_size(key->p) + 1); + zeromem(skey, MAXBLOCKSIZE); +#endif + + XFREE(expt); + XFREE(skey); + + mp_clear(g_pub); + + return err; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/pk/dsa/dsa_decrypt_key.c,v $ */ +/* $Revision: 1.9 $ */ +/* $Date: 2006/12/04 03:18:43 $ */ + diff --git a/libtomcrypt/src/pk/dsa/dsa_encrypt_key.c b/libtomcrypt/src/pk/dsa/dsa_encrypt_key.c new file mode 100644 index 0000000..cefa4de --- /dev/null +++ b/libtomcrypt/src/pk/dsa/dsa_encrypt_key.c @@ -0,0 +1,135 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file dsa_encrypt_key.c + DSA Crypto, Tom St Denis +*/ + +#ifdef MDSA + +/** + Encrypt a symmetric key with DSA + @param in The symmetric key you want to encrypt + @param inlen The length of the key to encrypt (octets) + @param out [out] The destination for the ciphertext + @param outlen [in/out] The max size and resulting size of the ciphertext + @param prng An active PRNG state + @param wprng The index of the PRNG you wish to use + @param hash The index of the hash you want to use + @param key The DSA key you want to encrypt to + @return CRYPT_OK if successful +*/ +int dsa_encrypt_key(const unsigned char *in, unsigned long inlen, + unsigned char *out, unsigned long *outlen, + prng_state *prng, int wprng, int hash, + dsa_key *key) +{ + unsigned char *expt, *skey; + void *g_pub, *g_priv; + unsigned long x, y; + int err; + + LTC_ARGCHK(in != NULL); + LTC_ARGCHK(out != NULL); + LTC_ARGCHK(outlen != NULL); + LTC_ARGCHK(key != NULL); + + /* check that wprng/cipher/hash are not invalid */ + if ((err = prng_is_valid(wprng)) != CRYPT_OK) { + return err; + } + + if ((err = hash_is_valid(hash)) != CRYPT_OK) { + return err; + } + + if (inlen > hash_descriptor[hash].hashsize) { + return CRYPT_INVALID_HASH; + } + + /* make a random key and export the public copy */ + if ((err = mp_init_multi(&g_pub, &g_priv, NULL)) != CRYPT_OK) { + return err; + } + + expt = XMALLOC(mp_unsigned_bin_size(key->p) + 1); + skey = XMALLOC(MAXBLOCKSIZE); + if (expt == NULL || skey == NULL) { + if (expt != NULL) { + XFREE(expt); + } + if (skey != NULL) { + XFREE(skey); + } + mp_clear_multi(g_pub, g_priv, NULL); + return CRYPT_MEM; + } + + /* make a random x, g^x pair */ + x = mp_unsigned_bin_size(key->q); + if (prng_descriptor[wprng].read(expt, x, prng) != x) { + err = CRYPT_ERROR_READPRNG; + goto LBL_ERR; + } + + /* load x */ + if ((err = mp_read_unsigned_bin(g_priv, expt, x)) != CRYPT_OK) { + goto LBL_ERR; + } + + /* compute y */ + if ((err = mp_exptmod(key->g, g_priv, key->p, g_pub)) != CRYPT_OK) { + goto LBL_ERR; + } + + /* make random key */ + x = mp_unsigned_bin_size(key->p) + 1; + if ((err = dsa_shared_secret(g_priv, key->y, key, expt, &x)) != CRYPT_OK) { + goto LBL_ERR; + } + + y = MAXBLOCKSIZE; + if ((err = hash_memory(hash, expt, x, skey, &y)) != CRYPT_OK) { + goto LBL_ERR; + } + + /* Encrypt key */ + for (x = 0; x < inlen; x++) { + skey[x] ^= in[x]; + } + + err = der_encode_sequence_multi(out, outlen, + LTC_ASN1_OBJECT_IDENTIFIER, hash_descriptor[hash].OIDlen, hash_descriptor[hash].OID, + LTC_ASN1_INTEGER, 1UL, g_pub, + LTC_ASN1_OCTET_STRING, inlen, skey, + LTC_ASN1_EOL, 0UL, NULL); + +LBL_ERR: +#ifdef LTC_CLEAN_STACK + /* clean up */ + zeromem(expt, mp_unsigned_bin_size(key->p) + 1); + zeromem(skey, MAXBLOCKSIZE); +#endif + + XFREE(skey); + XFREE(expt); + + mp_clear_multi(g_pub, g_priv, NULL); + return err; +} + +#endif +/* $Source: /cvs/libtom/libtomcrypt/src/pk/dsa/dsa_encrypt_key.c,v $ */ +/* $Revision: 1.7 $ */ +/* $Date: 2006/12/04 03:18:43 $ */ + diff --git a/libtomcrypt/src/pk/dsa/dsa_export.c b/libtomcrypt/src/pk/dsa/dsa_export.c new file mode 100644 index 0000000..d882779 --- /dev/null +++ b/libtomcrypt/src/pk/dsa/dsa_export.c @@ -0,0 +1,72 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file dsa_export.c + DSA implementation, export key, Tom St Denis +*/ + +#ifdef MDSA + +/** + Export a DSA key to a binary packet + @param out [out] Where to store the packet + @param outlen [in/out] The max size and resulting size of the packet + @param type The type of key to export (PK_PRIVATE or PK_PUBLIC) + @param key The key to export + @return CRYPT_OK if successful +*/ +int dsa_export(unsigned char *out, unsigned long *outlen, int type, dsa_key *key) +{ + unsigned char flags[1]; + + LTC_ARGCHK(out != NULL); + LTC_ARGCHK(outlen != NULL); + LTC_ARGCHK(key != NULL); + + /* can we store the static header? */ + if (type == PK_PRIVATE && key->type != PK_PRIVATE) { + return CRYPT_PK_TYPE_MISMATCH; + } + + if (type != PK_PUBLIC && type != PK_PRIVATE) { + return CRYPT_INVALID_ARG; + } + + flags[0] = (type != PK_PUBLIC) ? 1 : 0; + + if (type == PK_PRIVATE) { + return der_encode_sequence_multi(out, outlen, + LTC_ASN1_BIT_STRING, 1UL, flags, + LTC_ASN1_INTEGER, 1UL, key->g, + LTC_ASN1_INTEGER, 1UL, key->p, + LTC_ASN1_INTEGER, 1UL, key->q, + LTC_ASN1_INTEGER, 1UL, key->y, + LTC_ASN1_INTEGER, 1UL, key->x, + LTC_ASN1_EOL, 0UL, NULL); + } else { + return der_encode_sequence_multi(out, outlen, + LTC_ASN1_BIT_STRING, 1UL, flags, + LTC_ASN1_INTEGER, 1UL, key->g, + LTC_ASN1_INTEGER, 1UL, key->p, + LTC_ASN1_INTEGER, 1UL, key->q, + LTC_ASN1_INTEGER, 1UL, key->y, + LTC_ASN1_EOL, 0UL, NULL); + } +} + +#endif + + +/* $Source: /cvs/libtom/libtomcrypt/src/pk/dsa/dsa_export.c,v $ */ +/* $Revision: 1.8 $ */ +/* $Date: 2006/03/31 14:15:35 $ */ diff --git a/libtomcrypt/src/pk/dsa/dsa_free.c b/libtomcrypt/src/pk/dsa/dsa_free.c new file mode 100644 index 0000000..92a1eb7 --- /dev/null +++ b/libtomcrypt/src/pk/dsa/dsa_free.c @@ -0,0 +1,34 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file dsa_free.c + DSA implementation, free a DSA key, Tom St Denis +*/ + +#ifdef MDSA + +/** + Free a DSA key + @param key The key to free from memory +*/ +void dsa_free(dsa_key *key) +{ + LTC_ARGCHKVD(key != NULL); + mp_clear_multi(key->g, key->q, key->p, key->x, key->y, NULL); +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/pk/dsa/dsa_free.c,v $ */ +/* $Revision: 1.6 $ */ +/* $Date: 2006/06/09 01:38:13 $ */ diff --git a/libtomcrypt/src/pk/dsa/dsa_import.c b/libtomcrypt/src/pk/dsa/dsa_import.c new file mode 100644 index 0000000..bb2272a --- /dev/null +++ b/libtomcrypt/src/pk/dsa/dsa_import.c @@ -0,0 +1,90 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file dsa_import.c + DSA implementation, import a DSA key, Tom St Denis +*/ + +#ifdef MDSA + +/** + Import a DSA key + @param in The binary packet to import from + @param inlen The length of the binary packet + @param key [out] Where to store the imported key + @return CRYPT_OK if successful, upon error this function will free all allocated memory +*/ +int dsa_import(const unsigned char *in, unsigned long inlen, dsa_key *key) +{ + unsigned char flags[1]; + int err; + + LTC_ARGCHK(in != NULL); + LTC_ARGCHK(key != NULL); + LTC_ARGCHK(ltc_mp.name != NULL); + + /* init key */ + if (mp_init_multi(&key->p, &key->g, &key->q, &key->x, &key->y, NULL) != CRYPT_OK) { + return CRYPT_MEM; + } + + /* get key type */ + if ((err = der_decode_sequence_multi(in, inlen, + LTC_ASN1_BIT_STRING, 1UL, flags, + LTC_ASN1_EOL, 0UL, NULL)) != CRYPT_OK) { + goto error; + } + + if (flags[0] == 1) { + if ((err = der_decode_sequence_multi(in, inlen, + LTC_ASN1_BIT_STRING, 1UL, flags, + LTC_ASN1_INTEGER, 1UL, key->g, + LTC_ASN1_INTEGER, 1UL, key->p, + LTC_ASN1_INTEGER, 1UL, key->q, + LTC_ASN1_INTEGER, 1UL, key->y, + LTC_ASN1_INTEGER, 1UL, key->x, + LTC_ASN1_EOL, 0UL, NULL)) != CRYPT_OK) { + goto error; + } + key->type = PK_PRIVATE; + } else { + if ((err = der_decode_sequence_multi(in, inlen, + LTC_ASN1_BIT_STRING, 1UL, flags, + LTC_ASN1_INTEGER, 1UL, key->g, + LTC_ASN1_INTEGER, 1UL, key->p, + LTC_ASN1_INTEGER, 1UL, key->q, + LTC_ASN1_INTEGER, 1UL, key->y, + LTC_ASN1_EOL, 0UL, NULL)) != CRYPT_OK) { + goto error; + } + key->type = PK_PUBLIC; + } + key->qord = mp_unsigned_bin_size(key->q); + + if (key->qord >= MDSA_MAX_GROUP || key->qord <= 15 || + (unsigned long)key->qord >= mp_unsigned_bin_size(key->p) || (mp_unsigned_bin_size(key->p) - key->qord) >= MDSA_DELTA) { + err = CRYPT_INVALID_PACKET; + goto error; + } + + return CRYPT_OK; +error: + mp_clear_multi(key->p, key->g, key->q, key->x, key->y, NULL); + return err; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/pk/dsa/dsa_import.c,v $ */ +/* $Revision: 1.12 $ */ +/* $Date: 2006/03/31 14:15:35 $ */ diff --git a/libtomcrypt/src/pk/dsa/dsa_make_key.c b/libtomcrypt/src/pk/dsa/dsa_make_key.c new file mode 100644 index 0000000..293e814 --- /dev/null +++ b/libtomcrypt/src/pk/dsa/dsa_make_key.c @@ -0,0 +1,137 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file dsa_make_key.c + DSA implementation, generate a DSA key, Tom St Denis +*/ + +#ifdef MDSA + +/** + Create a DSA key + @param prng An active PRNG state + @param wprng The index of the PRNG desired + @param group_size Size of the multiplicative group (octets) + @param modulus_size Size of the modulus (octets) + @param key [out] Where to store the created key + @return CRYPT_OK if successful, upon error this function will free all allocated memory +*/ +int dsa_make_key(prng_state *prng, int wprng, int group_size, int modulus_size, dsa_key *key) +{ + void *tmp, *tmp2; + int err, res; + unsigned char *buf; + + LTC_ARGCHK(key != NULL); + LTC_ARGCHK(ltc_mp.name != NULL); + + /* check prng */ + if ((err = prng_is_valid(wprng)) != CRYPT_OK) { + return err; + } + + /* check size */ + if (group_size >= MDSA_MAX_GROUP || group_size <= 15 || + group_size >= modulus_size || (modulus_size - group_size) >= MDSA_DELTA) { + return CRYPT_INVALID_ARG; + } + + /* allocate ram */ + buf = XMALLOC(MDSA_DELTA); + if (buf == NULL) { + return CRYPT_MEM; + } + + /* init mp_ints */ + if ((err = mp_init_multi(&tmp, &tmp2, &key->g, &key->q, &key->p, &key->x, &key->y, NULL)) != CRYPT_OK) { + XFREE(buf); + return err; + } + + /* make our prime q */ + if ((err = rand_prime(key->q, group_size, prng, wprng)) != CRYPT_OK) { goto error; } + + /* double q */ + if ((err = mp_add(key->q, key->q, tmp)) != CRYPT_OK) { goto error; } + + /* now make a random string and multply it against q */ + if (prng_descriptor[wprng].read(buf+1, modulus_size - group_size, prng) != (unsigned long)(modulus_size - group_size)) { + err = CRYPT_ERROR_READPRNG; + goto error; + } + + /* force magnitude */ + buf[0] |= 0xC0; + + /* force even */ + buf[modulus_size - group_size - 1] &= ~1; + + if ((err = mp_read_unsigned_bin(tmp2, buf, modulus_size - group_size)) != CRYPT_OK) { goto error; } + if ((err = mp_mul(key->q, tmp2, key->p)) != CRYPT_OK) { goto error; } + if ((err = mp_add_d(key->p, 1, key->p)) != CRYPT_OK) { goto error; } + + /* now loop until p is prime */ + for (;;) { + if ((err = mp_prime_is_prime(key->p, 8, &res)) != CRYPT_OK) { goto error; } + if (res == LTC_MP_YES) break; + + /* add 2q to p and 2 to tmp2 */ + if ((err = mp_add(tmp, key->p, key->p)) != CRYPT_OK) { goto error; } + if ((err = mp_add_d(tmp2, 2, tmp2)) != CRYPT_OK) { goto error; } + } + + /* now p = (q * tmp2) + 1 is prime, find a value g for which g^tmp2 != 1 */ + mp_set(key->g, 1); + + do { + if ((err = mp_add_d(key->g, 1, key->g)) != CRYPT_OK) { goto error; } + if ((err = mp_exptmod(key->g, tmp2, key->p, tmp)) != CRYPT_OK) { goto error; } + } while (mp_cmp_d(tmp, 1) == LTC_MP_EQ); + + /* at this point tmp generates a group of order q mod p */ + mp_exch(tmp, key->g); + + /* so now we have our DH structure, generator g, order q, modulus p + Now we need a random exponent [mod q] and it's power g^x mod p + */ + do { + if (prng_descriptor[wprng].read(buf, group_size, prng) != (unsigned long)group_size) { + err = CRYPT_ERROR_READPRNG; + goto error; + } + if ((err = mp_read_unsigned_bin(key->x, buf, group_size)) != CRYPT_OK) { goto error; } + } while (mp_cmp_d(key->x, 1) != LTC_MP_GT); + if ((err = mp_exptmod(key->g, key->x, key->p, key->y)) != CRYPT_OK) { goto error; } + + key->type = PK_PRIVATE; + key->qord = group_size; + +#ifdef LTC_CLEAN_STACK + zeromem(buf, MDSA_DELTA); +#endif + + err = CRYPT_OK; + goto done; +error: + mp_clear_multi(key->g, key->q, key->p, key->x, key->y, NULL); +done: + mp_clear_multi(tmp, tmp2, NULL); + XFREE(buf); + return err; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/pk/dsa/dsa_make_key.c,v $ */ +/* $Revision: 1.10 $ */ +/* $Date: 2006/12/04 03:18:43 $ */ diff --git a/libtomcrypt/src/pk/dsa/dsa_shared_secret.c b/libtomcrypt/src/pk/dsa/dsa_shared_secret.c new file mode 100644 index 0000000..570d637 --- /dev/null +++ b/libtomcrypt/src/pk/dsa/dsa_shared_secret.c @@ -0,0 +1,72 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file dsa_shared_secret.c + DSA Crypto, Tom St Denis +*/ + +#ifdef MDSA + +/** + Create a DSA shared secret between two keys + @param private_key The private DSA key (the exponent) + @param base The base of the exponentiation (allows this to be used for both encrypt and decrypt) + @param public_key The public key + @param out [out] Destination of the shared secret + @param outlen [in/out] The max size and resulting size of the shared secret + @return CRYPT_OK if successful +*/ +int dsa_shared_secret(void *private_key, void *base, + dsa_key *public_key, + unsigned char *out, unsigned long *outlen) +{ + unsigned long x; + void *res; + int err; + + LTC_ARGCHK(private_key != NULL); + LTC_ARGCHK(public_key != NULL); + LTC_ARGCHK(out != NULL); + LTC_ARGCHK(outlen != NULL); + + /* make new point */ + if ((err = mp_init(&res)) != CRYPT_OK) { + return err; + } + + if ((err = mp_exptmod(base, private_key, public_key->p, res)) != CRYPT_OK) { + mp_clear(res); + return err; + } + + x = (unsigned long)mp_unsigned_bin_size(res); + if (*outlen < x) { + *outlen = x; + err = CRYPT_BUFFER_OVERFLOW; + goto done; + } + zeromem(out, x); + if ((err = mp_to_unsigned_bin(res, out + (x - mp_unsigned_bin_size(res)))) != CRYPT_OK) { goto done; } + + err = CRYPT_OK; + *outlen = x; +done: + mp_clear(res); + return err; +} + +#endif +/* $Source: /cvs/libtom/libtomcrypt/src/pk/dsa/dsa_shared_secret.c,v $ */ +/* $Revision: 1.7 $ */ +/* $Date: 2006/12/04 03:18:43 $ */ + diff --git a/libtomcrypt/src/pk/dsa/dsa_sign_hash.c b/libtomcrypt/src/pk/dsa/dsa_sign_hash.c new file mode 100644 index 0000000..f84dd28 --- /dev/null +++ b/libtomcrypt/src/pk/dsa/dsa_sign_hash.c @@ -0,0 +1,156 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file dsa_sign_hash.c + DSA implementation, sign a hash, Tom St Denis +*/ + +#ifdef MDSA + +/** + Sign a hash with DSA + @param in The hash to sign + @param inlen The length of the hash to sign + @param r The "r" integer of the signature (caller must initialize with mp_init() first) + @param s The "s" integer of the signature (caller must initialize with mp_init() first) + @param prng An active PRNG state + @param wprng The index of the PRNG desired + @param key A private DSA key + @return CRYPT_OK if successful +*/ +int dsa_sign_hash_raw(const unsigned char *in, unsigned long inlen, + void *r, void *s, + prng_state *prng, int wprng, dsa_key *key) +{ + void *k, *kinv, *tmp; + unsigned char *buf; + int err; + + LTC_ARGCHK(in != NULL); + LTC_ARGCHK(r != NULL); + LTC_ARGCHK(s != NULL); + LTC_ARGCHK(key != NULL); + + if ((err = prng_is_valid(wprng)) != CRYPT_OK) { + return err; + } + if (key->type != PK_PRIVATE) { + return CRYPT_PK_NOT_PRIVATE; + } + + /* check group order size */ + if (key->qord >= MDSA_MAX_GROUP) { + return CRYPT_INVALID_ARG; + } + + buf = XMALLOC(MDSA_MAX_GROUP); + if (buf == NULL) { + return CRYPT_MEM; + } + + /* Init our temps */ + if ((err = mp_init_multi(&k, &kinv, &tmp, NULL)) != CRYPT_OK) { goto ERRBUF; } + +retry: + + do { + /* gen random k */ + if (prng_descriptor[wprng].read(buf, key->qord, prng) != (unsigned long)key->qord) { + err = CRYPT_ERROR_READPRNG; + goto error; + } + + /* read k */ + if ((err = mp_read_unsigned_bin(k, buf, key->qord)) != CRYPT_OK) { goto error; } + + /* k > 1 ? */ + if (mp_cmp_d(k, 1) != LTC_MP_GT) { goto retry; } + + /* test gcd */ + if ((err = mp_gcd(k, key->q, tmp)) != CRYPT_OK) { goto error; } + } while (mp_cmp_d(tmp, 1) != LTC_MP_EQ); + + /* now find 1/k mod q */ + if ((err = mp_invmod(k, key->q, kinv)) != CRYPT_OK) { goto error; } + + /* now find r = g^k mod p mod q */ + if ((err = mp_exptmod(key->g, k, key->p, r)) != CRYPT_OK) { goto error; } + if ((err = mp_mod(r, key->q, r)) != CRYPT_OK) { goto error; } + + if (mp_iszero(r) == LTC_MP_YES) { goto retry; } + + /* now find s = (in + xr)/k mod q */ + if ((err = mp_read_unsigned_bin(tmp, (unsigned char *)in, inlen)) != CRYPT_OK) { goto error; } + if ((err = mp_mul(key->x, r, s)) != CRYPT_OK) { goto error; } + if ((err = mp_add(s, tmp, s)) != CRYPT_OK) { goto error; } + if ((err = mp_mulmod(s, kinv, key->q, s)) != CRYPT_OK) { goto error; } + + if (mp_iszero(s) == LTC_MP_YES) { goto retry; } + + err = CRYPT_OK; +error: + mp_clear_multi(k, kinv, tmp, NULL); +ERRBUF: +#ifdef LTC_CLEAN_STACK + zeromem(buf, MDSA_MAX_GROUP); +#endif + XFREE(buf); + return err; +} + +/** + Sign a hash with DSA + @param in The hash to sign + @param inlen The length of the hash to sign + @param out [out] Where to store the signature + @param outlen [in/out] The max size and resulting size of the signature + @param prng An active PRNG state + @param wprng The index of the PRNG desired + @param key A private DSA key + @return CRYPT_OK if successful +*/ +int dsa_sign_hash(const unsigned char *in, unsigned long inlen, + unsigned char *out, unsigned long *outlen, + prng_state *prng, int wprng, dsa_key *key) +{ + void *r, *s; + int err; + + LTC_ARGCHK(in != NULL); + LTC_ARGCHK(out != NULL); + LTC_ARGCHK(outlen != NULL); + LTC_ARGCHK(key != NULL); + + if (mp_init_multi(&r, &s, NULL) != CRYPT_OK) { + return CRYPT_MEM; + } + + if ((err = dsa_sign_hash_raw(in, inlen, r, s, prng, wprng, key)) != CRYPT_OK) { + goto error; + } + + err = der_encode_sequence_multi(out, outlen, + LTC_ASN1_INTEGER, 1UL, r, + LTC_ASN1_INTEGER, 1UL, s, + LTC_ASN1_EOL, 0UL, NULL); + +error: + mp_clear_multi(r, s, NULL); + return err; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/pk/dsa/dsa_sign_hash.c,v $ */ +/* $Revision: 1.12 $ */ +/* $Date: 2006/12/04 22:27:56 $ */ diff --git a/libtomcrypt/src/pk/dsa/dsa_verify_hash.c b/libtomcrypt/src/pk/dsa/dsa_verify_hash.c new file mode 100644 index 0000000..0e8ff22 --- /dev/null +++ b/libtomcrypt/src/pk/dsa/dsa_verify_hash.c @@ -0,0 +1,126 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file dsa_verify_hash.c + DSA implementation, verify a signature, Tom St Denis +*/ + + +#ifdef MDSA + +/** + Verify a DSA signature + @param r DSA "r" parameter + @param s DSA "s" parameter + @param hash The hash that was signed + @param hashlen The length of the hash that was signed + @param stat [out] The result of the signature verification, 1==valid, 0==invalid + @param key The corresponding public DH key + @return CRYPT_OK if successful (even if the signature is invalid) +*/ +int dsa_verify_hash_raw( void *r, void *s, + const unsigned char *hash, unsigned long hashlen, + int *stat, dsa_key *key) +{ + void *w, *v, *u1, *u2; + int err; + + LTC_ARGCHK(r != NULL); + LTC_ARGCHK(s != NULL); + LTC_ARGCHK(stat != NULL); + LTC_ARGCHK(key != NULL); + + /* default to invalid signature */ + *stat = 0; + + /* init our variables */ + if ((err = mp_init_multi(&w, &v, &u1, &u2, NULL)) != CRYPT_OK) { + return err; + } + + /* neither r or s can be null or >q*/ + if (mp_iszero(r) == LTC_MP_YES || mp_iszero(s) == LTC_MP_YES || mp_cmp(r, key->q) != LTC_MP_LT || mp_cmp(s, key->q) != LTC_MP_LT) { + err = CRYPT_INVALID_PACKET; + goto error; + } + + /* w = 1/s mod q */ + if ((err = mp_invmod(s, key->q, w)) != CRYPT_OK) { goto error; } + + /* u1 = m * w mod q */ + if ((err = mp_read_unsigned_bin(u1, (unsigned char *)hash, hashlen)) != CRYPT_OK) { goto error; } + if ((err = mp_mulmod(u1, w, key->q, u1)) != CRYPT_OK) { goto error; } + + /* u2 = r*w mod q */ + if ((err = mp_mulmod(r, w, key->q, u2)) != CRYPT_OK) { goto error; } + + /* v = g^u1 * y^u2 mod p mod q */ + if ((err = mp_exptmod(key->g, u1, key->p, u1)) != CRYPT_OK) { goto error; } + if ((err = mp_exptmod(key->y, u2, key->p, u2)) != CRYPT_OK) { goto error; } + if ((err = mp_mulmod(u1, u2, key->p, v)) != CRYPT_OK) { goto error; } + if ((err = mp_mod(v, key->q, v)) != CRYPT_OK) { goto error; } + + /* if r = v then we're set */ + if (mp_cmp(r, v) == LTC_MP_EQ) { + *stat = 1; + } + + err = CRYPT_OK; +error: + mp_clear_multi(w, v, u1, u2, NULL); + return err; +} + +/** + Verify a DSA signature + @param sig The signature + @param siglen The length of the signature (octets) + @param hash The hash that was signed + @param hashlen The length of the hash that was signed + @param stat [out] The result of the signature verification, 1==valid, 0==invalid + @param key The corresponding public DH key + @return CRYPT_OK if successful (even if the signature is invalid) +*/ +int dsa_verify_hash(const unsigned char *sig, unsigned long siglen, + const unsigned char *hash, unsigned long hashlen, + int *stat, dsa_key *key) +{ + int err; + void *r, *s; + + if ((err = mp_init_multi(&r, &s, NULL)) != CRYPT_OK) { + return CRYPT_MEM; + } + + /* decode the sequence */ + if ((err = der_decode_sequence_multi(sig, siglen, + LTC_ASN1_INTEGER, 1UL, r, + LTC_ASN1_INTEGER, 1UL, s, + LTC_ASN1_EOL, 0UL, NULL)) != CRYPT_OK) { + goto LBL_ERR; + } + + /* do the op */ + err = dsa_verify_hash_raw(r, s, hash, hashlen, stat, key); + +LBL_ERR: + mp_clear_multi(r, s, NULL); + return err; +} + +#endif + + +/* $Source: /cvs/libtom/libtomcrypt/src/pk/dsa/dsa_verify_hash.c,v $ */ +/* $Revision: 1.13 $ */ +/* $Date: 2006/12/04 03:18:43 $ */ diff --git a/libtomcrypt/src/pk/dsa/dsa_verify_key.c b/libtomcrypt/src/pk/dsa/dsa_verify_key.c new file mode 100644 index 0000000..27054d6 --- /dev/null +++ b/libtomcrypt/src/pk/dsa/dsa_verify_key.c @@ -0,0 +1,100 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file dsa_verify_key.c + DSA implementation, verify a key, Tom St Denis +*/ + +#ifdef MDSA + +/** + Verify a DSA key for validity + @param key The key to verify + @param stat [out] Result of test, 1==valid, 0==invalid + @return CRYPT_OK if successful +*/ +int dsa_verify_key(dsa_key *key, int *stat) +{ + void *tmp, *tmp2; + int res, err; + + LTC_ARGCHK(key != NULL); + LTC_ARGCHK(stat != NULL); + + /* default to an invalid key */ + *stat = 0; + + /* first make sure key->q and key->p are prime */ + if ((err = mp_prime_is_prime(key->q, 8, &res)) != CRYPT_OK) { + return err; + } + if (res == 0) { + return CRYPT_OK; + } + + if ((err = mp_prime_is_prime(key->p, 8, &res)) != CRYPT_OK) { + return err; + } + if (res == 0) { + return CRYPT_OK; + } + + /* now make sure that g is not -1, 0 or 1 and <p */ + if (mp_cmp_d(key->g, 0) == LTC_MP_EQ || mp_cmp_d(key->g, 1) == LTC_MP_EQ) { + return CRYPT_OK; + } + if ((err = mp_init_multi(&tmp, &tmp2, NULL)) != CRYPT_OK) { return err; } + if ((err = mp_sub_d(key->p, 1, tmp)) != CRYPT_OK) { goto error; } + if (mp_cmp(tmp, key->g) == LTC_MP_EQ || mp_cmp(key->g, key->p) != LTC_MP_LT) { + err = CRYPT_OK; + goto error; + } + + /* 1 < y < p-1 */ + if (!(mp_cmp_d(key->y, 1) == LTC_MP_GT && mp_cmp(key->y, tmp) == LTC_MP_LT)) { + err = CRYPT_OK; + goto error; + } + + /* now we have to make sure that g^q = 1, and that p-1/q gives 0 remainder */ + if ((err = mp_div(tmp, key->q, tmp, tmp2)) != CRYPT_OK) { goto error; } + if (mp_iszero(tmp2) != LTC_MP_YES) { + err = CRYPT_OK; + goto error; + } + + if ((err = mp_exptmod(key->g, key->q, key->p, tmp)) != CRYPT_OK) { goto error; } + if (mp_cmp_d(tmp, 1) != LTC_MP_EQ) { + err = CRYPT_OK; + goto error; + } + + /* now we have to make sure that y^q = 1, this makes sure y \in g^x mod p */ + if ((err = mp_exptmod(key->y, key->q, key->p, tmp)) != CRYPT_OK) { goto error; } + if (mp_cmp_d(tmp, 1) != LTC_MP_EQ) { + err = CRYPT_OK; + goto error; + } + + /* at this point we are out of tests ;-( */ + err = CRYPT_OK; + *stat = 1; +error: + mp_clear_multi(tmp, tmp2, NULL); + return err; +} +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/pk/dsa/dsa_verify_key.c,v $ */ +/* $Revision: 1.6 $ */ +/* $Date: 2006/12/04 03:18:43 $ */ diff --git a/libtomcrypt/src/pk/ecc/ecc.c b/libtomcrypt/src/pk/ecc/ecc.c new file mode 100644 index 0000000..90bbed4 --- /dev/null +++ b/libtomcrypt/src/pk/ecc/ecc.c @@ -0,0 +1,127 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ + +/* Implements ECC over Z/pZ for curve y^2 = x^3 - 3x + b + * + * All curves taken from NIST recommendation paper of July 1999 + * Available at http://csrc.nist.gov/cryptval/dss.htm + */ +#include "tomcrypt.h" + +/** + @file ecc.c + ECC Crypto, Tom St Denis +*/ + +#ifdef MECC + +/* This holds the key settings. ***MUST*** be organized by size from smallest to largest. */ +const ltc_ecc_set_type ltc_ecc_sets[] = { +#ifdef ECC112 +{ + 14, + "SECP112R1", + "DB7C2ABF62E35E668076BEAD208B", + "659EF8BA043916EEDE8911702B22", + "DB7C2ABF62E35E7628DFAC6561C5", + "09487239995A5EE76B55F9C2F098", + "A89CE5AF8724C0A23E0E0FF77500" +}, +#endif +#ifdef ECC128 +{ + 16, + "SECP128R1", + "FFFFFFFDFFFFFFFFFFFFFFFFFFFFFFFF", + "E87579C11079F43DD824993C2CEE5ED3", + "FFFFFFFE0000000075A30D1B9038A115", + "161FF7528B899B2D0C28607CA52C5B86", + "CF5AC8395BAFEB13C02DA292DDED7A83", +}, +#endif +#ifdef ECC160 +{ + 20, + "SECP160R1", + "FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF7FFFFFFF", + "1C97BEFC54BD7A8B65ACF89F81D4D4ADC565FA45", + "0100000000000000000001F4C8F927AED3CA752257", + "4A96B5688EF573284664698968C38BB913CBFC82", + "23A628553168947D59DCC912042351377AC5FB32", +}, +#endif +#ifdef ECC192 +{ + 24, + "ECC-192", + "FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFEFFFFFFFFFFFFFFFF", + "64210519E59C80E70FA7E9AB72243049FEB8DEECC146B9B1", + "FFFFFFFFFFFFFFFFFFFFFFFF99DEF836146BC9B1B4D22831", + "188DA80EB03090F67CBF20EB43A18800F4FF0AFD82FF1012", + "7192B95FFC8DA78631011ED6B24CDD573F977A11E794811", +}, +#endif +#ifdef ECC224 +{ + 28, + "ECC-224", + "FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF000000000000000000000001", + "B4050A850C04B3ABF54132565044B0B7D7BFD8BA270B39432355FFB4", + "FFFFFFFFFFFFFFFFFFFFFFFFFFFF16A2E0B8F03E13DD29455C5C2A3D", + "B70E0CBD6BB4BF7F321390B94A03C1D356C21122343280D6115C1D21", + "BD376388B5F723FB4C22DFE6CD4375A05A07476444D5819985007E34", +}, +#endif +#ifdef ECC256 +{ + 32, + "ECC-256", + "FFFFFFFF00000001000000000000000000000000FFFFFFFFFFFFFFFFFFFFFFFF", + "5AC635D8AA3A93E7B3EBBD55769886BC651D06B0CC53B0F63BCE3C3E27D2604B", + "FFFFFFFF00000000FFFFFFFFFFFFFFFFBCE6FAADA7179E84F3B9CAC2FC632551", + "6B17D1F2E12C4247F8BCE6E563A440F277037D812DEB33A0F4A13945D898C296", + "4FE342E2FE1A7F9B8EE7EB4A7C0F9E162BCE33576B315ECECBB6406837BF51F5", +}, +#endif +#ifdef ECC384 +{ + 48, + "ECC-384", + "FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFEFFFFFFFF0000000000000000FFFFFFFF", + "B3312FA7E23EE7E4988E056BE3F82D19181D9C6EFE8141120314088F5013875AC656398D8A2ED19D2A85C8EDD3EC2AEF", + "FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFC7634D81F4372DDF581A0DB248B0A77AECEC196ACCC52973", + "AA87CA22BE8B05378EB1C71EF320AD746E1D3B628BA79B9859F741E082542A385502F25DBF55296C3A545E3872760AB7", + "3617DE4A96262C6F5D9E98BF9292DC29F8F41DBD289A147CE9DA3113B5F0B8C00A60B1CE1D7E819D7A431D7C90EA0E5F", +}, +#endif +#ifdef ECC521 +{ + 66, + "ECC-521", + "1FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF", + "51953EB9618E1C9A1F929A21A0B68540EEA2DA725B99B315F3B8B489918EF109E156193951EC7E937B1652C0BD3BB1BF073573DF883D2C34F1EF451FD46B503F00", + "1FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFA51868783BF2F966B7FCC0148F709A5D03BB5C9B8899C47AEBB6FB71E91386409", + "C6858E06B70404E9CD9E3ECB662395B4429C648139053FB521F828AF606B4D3DBAA14B5E77EFE75928FE1DC127A2FFA8DE3348B3C1856A429BF97E7E31C2E5BD66", + "11839296A789A3BC0045C8A5FB42C7D1BD998F54449579B446817AFBD17273E662C97EE72995EF42640C550B9013FAD0761353C7086A272C24088BE94769FD16650", +}, +#endif +{ + 0, + NULL, NULL, NULL, NULL, NULL, NULL +} +}; + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/pk/ecc/ecc.c,v $ */ +/* $Revision: 1.38 $ */ +/* $Date: 2006/11/07 23:14:28 $ */ + diff --git a/libtomcrypt/src/pk/ecc/ecc_ansi_x963_export.c b/libtomcrypt/src/pk/ecc/ecc_ansi_x963_export.c new file mode 100644 index 0000000..2a32912 --- /dev/null +++ b/libtomcrypt/src/pk/ecc/ecc_ansi_x963_export.c @@ -0,0 +1,72 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ + +/* Implements ECC over Z/pZ for curve y^2 = x^3 - 3x + b + * + * All curves taken from NIST recommendation paper of July 1999 + * Available at http://csrc.nist.gov/cryptval/dss.htm + */ +#include "tomcrypt.h" + +/** + @file ecc_ansi_x963_export.c + ECC Crypto, Tom St Denis +*/ + +#ifdef MECC + +/** ECC X9.63 (Sec. 4.3.6) uncompressed export + @param key Key to export + @param out [out] destination of export + @param outlen [in/out] Length of destination and final output size + Return CRYPT_OK on success +*/ +int ecc_ansi_x963_export(ecc_key *key, unsigned char *out, unsigned long *outlen) +{ + unsigned char buf[ECC_BUF_SIZE]; + unsigned long numlen; + + LTC_ARGCHK(key != NULL); + LTC_ARGCHK(out != NULL); + LTC_ARGCHK(outlen != NULL); + + if (ltc_ecc_is_valid_idx(key->idx) == 0) { + return CRYPT_INVALID_ARG; + } + numlen = key->dp->size; + + if (*outlen < (1 + 2*numlen)) { + *outlen = 1 + 2*numlen; + return CRYPT_BUFFER_OVERFLOW; + } + + /* store byte 0x04 */ + out[0] = 0x04; + + /* pad and store x */ + zeromem(buf, sizeof(buf)); + mp_to_unsigned_bin(key->pubkey.x, buf + (numlen - mp_unsigned_bin_size(key->pubkey.x))); + XMEMCPY(out+1, buf, numlen); + + /* pad and store y */ + zeromem(buf, sizeof(buf)); + mp_to_unsigned_bin(key->pubkey.y, buf + (numlen - mp_unsigned_bin_size(key->pubkey.y))); + XMEMCPY(out+1+numlen, buf, numlen); + + *outlen = 1 + 2*numlen; + return CRYPT_OK; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/pk/ecc/ecc_ansi_x963_export.c,v $ */ +/* $Revision: 1.4 $ */ +/* $Date: 2006/12/04 02:50:11 $ */ diff --git a/libtomcrypt/src/pk/ecc/ecc_ansi_x963_import.c b/libtomcrypt/src/pk/ecc/ecc_ansi_x963_import.c new file mode 100644 index 0000000..e92f5f4 --- /dev/null +++ b/libtomcrypt/src/pk/ecc/ecc_ansi_x963_import.c @@ -0,0 +1,104 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ + +/* Implements ECC over Z/pZ for curve y^2 = x^3 - 3x + b + * + * All curves taken from NIST recommendation paper of July 1999 + * Available at http://csrc.nist.gov/cryptval/dss.htm + */ +#include "tomcrypt.h" + +/** + @file ecc_ansi_x963_import.c + ECC Crypto, Tom St Denis +*/ + +#ifdef MECC + +/** Import an ANSI X9.63 format public key + @param in The input data to read + @param inlen The length of the input data + @param key [out] destination to store imported key \ +*/ +int ecc_ansi_x963_import(const unsigned char *in, unsigned long inlen, ecc_key *key) +{ + return ecc_ansi_x963_import_ex(in, inlen, key, NULL); +} + +int ecc_ansi_x963_import_ex(const unsigned char *in, unsigned long inlen, ecc_key *key, ltc_ecc_set_type *dp) +{ + int x, err; + + LTC_ARGCHK(in != NULL); + LTC_ARGCHK(key != NULL); + + /* must be odd */ + if ((inlen & 1) == 0) { + return CRYPT_INVALID_ARG; + } + + /* init key */ + if (mp_init_multi(&key->pubkey.x, &key->pubkey.y, &key->pubkey.z, &key->k, NULL) != CRYPT_OK) { + return CRYPT_MEM; + } + + /* check for 4, 6 or 7 */ + if (in[0] != 4 && in[0] != 6 && in[0] != 7) { + err = CRYPT_INVALID_PACKET; + goto error; + } + + /* read data */ + if ((err = mp_read_unsigned_bin(key->pubkey.x, (unsigned char *)in+1, (inlen-1)>>1)) != CRYPT_OK) { + goto error; + } + + if ((err = mp_read_unsigned_bin(key->pubkey.y, (unsigned char *)in+1+((inlen-1)>>1), (inlen-1)>>1)) != CRYPT_OK) { + goto error; + } + if ((err = mp_set(key->pubkey.z, 1)) != CRYPT_OK) { goto error; } + + if (dp == NULL) { + /* determine the idx */ + for (x = 0; ltc_ecc_sets[x].size != 0; x++) { + if ((unsigned)ltc_ecc_sets[x].size >= ((inlen-1)>>1)) { + break; + } + } + if (ltc_ecc_sets[x].size == 0) { + err = CRYPT_INVALID_PACKET; + goto error; + } + /* set the idx */ + key->idx = x; + key->dp = <c_ecc_sets[x]; + } else { + if (((inlen-1)>>1) != (unsigned long) dp->size) { + err = CRYPT_INVALID_PACKET; + goto error; + } + key->idx = -1; + key->dp = dp; + } + key->type = PK_PUBLIC; + + /* we're done */ + return CRYPT_OK; +error: + mp_clear_multi(key->pubkey.x, key->pubkey.y, key->pubkey.z, key->k, NULL); + return err; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/pk/ecc/ecc_ansi_x963_import.c,v $ */ +/* $Revision: 1.9 $ */ +/* $Date: 2006/12/04 22:17:46 $ */ diff --git a/libtomcrypt/src/pk/ecc/ecc_decrypt_key.c b/libtomcrypt/src/pk/ecc/ecc_decrypt_key.c new file mode 100644 index 0000000..bb56208 --- /dev/null +++ b/libtomcrypt/src/pk/ecc/ecc_decrypt_key.c @@ -0,0 +1,150 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ + +/* Implements ECC over Z/pZ for curve y^2 = x^3 - 3x + b + * + * All curves taken from NIST recommendation paper of July 1999 + * Available at http://csrc.nist.gov/cryptval/dss.htm + */ +#include "tomcrypt.h" + +/** + @file ecc_decrypt_key.c + ECC Crypto, Tom St Denis +*/ + +#ifdef MECC + +/** + Decrypt an ECC encrypted key + @param in The ciphertext + @param inlen The length of the ciphertext (octets) + @param out [out] The plaintext + @param outlen [in/out] The max size and resulting size of the plaintext + @param key The corresponding private ECC key + @return CRYPT_OK if successful +*/ +int ecc_decrypt_key(const unsigned char *in, unsigned long inlen, + unsigned char *out, unsigned long *outlen, + ecc_key *key) +{ + unsigned char *ecc_shared, *skey, *pub_expt; + unsigned long x, y, hashOID[32]; + int hash, err; + ecc_key pubkey; + ltc_asn1_list decode[3]; + + LTC_ARGCHK(in != NULL); + LTC_ARGCHK(out != NULL); + LTC_ARGCHK(outlen != NULL); + LTC_ARGCHK(key != NULL); + + /* right key type? */ + if (key->type != PK_PRIVATE) { + return CRYPT_PK_NOT_PRIVATE; + } + + /* decode to find out hash */ + LTC_SET_ASN1(decode, 0, LTC_ASN1_OBJECT_IDENTIFIER, hashOID, sizeof(hashOID)/sizeof(hashOID[0])); + + if ((err = der_decode_sequence(in, inlen, decode, 1)) != CRYPT_OK) { + return err; + } + + hash = find_hash_oid(hashOID, decode[0].size); + if (hash_is_valid(hash) != CRYPT_OK) { + return CRYPT_INVALID_PACKET; + } + + /* we now have the hash! */ + + /* allocate memory */ + pub_expt = XMALLOC(ECC_BUF_SIZE); + ecc_shared = XMALLOC(ECC_BUF_SIZE); + skey = XMALLOC(MAXBLOCKSIZE); + if (pub_expt == NULL || ecc_shared == NULL || skey == NULL) { + if (pub_expt != NULL) { + XFREE(pub_expt); + } + if (ecc_shared != NULL) { + XFREE(ecc_shared); + } + if (skey != NULL) { + XFREE(skey); + } + return CRYPT_MEM; + } + LTC_SET_ASN1(decode, 1, LTC_ASN1_OCTET_STRING, pub_expt, ECC_BUF_SIZE); + LTC_SET_ASN1(decode, 2, LTC_ASN1_OCTET_STRING, skey, MAXBLOCKSIZE); + + /* read the structure in now */ + if ((err = der_decode_sequence(in, inlen, decode, 3)) != CRYPT_OK) { + goto LBL_ERR; + } + + /* import ECC key from packet */ + if ((err = ecc_import(decode[1].data, decode[1].size, &pubkey)) != CRYPT_OK) { + goto LBL_ERR; + } + + /* make shared key */ + x = ECC_BUF_SIZE; + if ((err = ecc_shared_secret(key, &pubkey, ecc_shared, &x)) != CRYPT_OK) { + ecc_free(&pubkey); + goto LBL_ERR; + } + ecc_free(&pubkey); + + y = MIN(ECC_BUF_SIZE, MAXBLOCKSIZE); + if ((err = hash_memory(hash, ecc_shared, x, ecc_shared, &y)) != CRYPT_OK) { + goto LBL_ERR; + } + + /* ensure the hash of the shared secret is at least as big as the encrypt itself */ + if (decode[2].size > y) { + err = CRYPT_INVALID_PACKET; + goto LBL_ERR; + } + + /* avoid buffer overflow */ + if (*outlen < decode[2].size) { + *outlen = decode[2].size; + err = CRYPT_BUFFER_OVERFLOW; + goto LBL_ERR; + } + + /* Decrypt the key */ + for (x = 0; x < decode[2].size; x++) { + out[x] = skey[x] ^ ecc_shared[x]; + } + *outlen = x; + + err = CRYPT_OK; +LBL_ERR: +#ifdef LTC_CLEAN_STACK + zeromem(pub_expt, ECC_BUF_SIZE); + zeromem(ecc_shared, ECC_BUF_SIZE); + zeromem(skey, MAXBLOCKSIZE); +#endif + + XFREE(pub_expt); + XFREE(ecc_shared); + XFREE(skey); + + return err; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/pk/ecc/ecc_decrypt_key.c,v $ */ +/* $Revision: 1.5 $ */ +/* $Date: 2006/06/16 21:53:41 $ */ + diff --git a/libtomcrypt/src/pk/ecc/ecc_encrypt_key.c b/libtomcrypt/src/pk/ecc/ecc_encrypt_key.c new file mode 100644 index 0000000..dd9bab0 --- /dev/null +++ b/libtomcrypt/src/pk/ecc/ecc_encrypt_key.c @@ -0,0 +1,136 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ + +/* Implements ECC over Z/pZ for curve y^2 = x^3 - 3x + b + * + * All curves taken from NIST recommendation paper of July 1999 + * Available at http://csrc.nist.gov/cryptval/dss.htm + */ +#include "tomcrypt.h" + +/** + @file ecc_encrypt_key.c + ECC Crypto, Tom St Denis +*/ + +#ifdef MECC + +/** + Encrypt a symmetric key with ECC + @param in The symmetric key you want to encrypt + @param inlen The length of the key to encrypt (octets) + @param out [out] The destination for the ciphertext + @param outlen [in/out] The max size and resulting size of the ciphertext + @param prng An active PRNG state + @param wprng The index of the PRNG you wish to use + @param hash The index of the hash you want to use + @param key The ECC key you want to encrypt to + @return CRYPT_OK if successful +*/ +int ecc_encrypt_key(const unsigned char *in, unsigned long inlen, + unsigned char *out, unsigned long *outlen, + prng_state *prng, int wprng, int hash, + ecc_key *key) +{ + unsigned char *pub_expt, *ecc_shared, *skey; + ecc_key pubkey; + unsigned long x, y, pubkeysize; + int err; + + LTC_ARGCHK(in != NULL); + LTC_ARGCHK(out != NULL); + LTC_ARGCHK(outlen != NULL); + LTC_ARGCHK(key != NULL); + + /* check that wprng/cipher/hash are not invalid */ + if ((err = prng_is_valid(wprng)) != CRYPT_OK) { + return err; + } + + if ((err = hash_is_valid(hash)) != CRYPT_OK) { + return err; + } + + if (inlen > hash_descriptor[hash].hashsize) { + return CRYPT_INVALID_HASH; + } + + /* make a random key and export the public copy */ + if ((err = ecc_make_key_ex(prng, wprng, &pubkey, key->dp)) != CRYPT_OK) { + return err; + } + + pub_expt = XMALLOC(ECC_BUF_SIZE); + ecc_shared = XMALLOC(ECC_BUF_SIZE); + skey = XMALLOC(MAXBLOCKSIZE); + if (pub_expt == NULL || ecc_shared == NULL || skey == NULL) { + if (pub_expt != NULL) { + XFREE(pub_expt); + } + if (ecc_shared != NULL) { + XFREE(ecc_shared); + } + if (skey != NULL) { + XFREE(skey); + } + ecc_free(&pubkey); + return CRYPT_MEM; + } + + pubkeysize = ECC_BUF_SIZE; + if ((err = ecc_export(pub_expt, &pubkeysize, PK_PUBLIC, &pubkey)) != CRYPT_OK) { + ecc_free(&pubkey); + goto LBL_ERR; + } + + /* make random key */ + x = ECC_BUF_SIZE; + if ((err = ecc_shared_secret(&pubkey, key, ecc_shared, &x)) != CRYPT_OK) { + ecc_free(&pubkey); + goto LBL_ERR; + } + ecc_free(&pubkey); + y = MAXBLOCKSIZE; + if ((err = hash_memory(hash, ecc_shared, x, skey, &y)) != CRYPT_OK) { + goto LBL_ERR; + } + + /* Encrypt key */ + for (x = 0; x < inlen; x++) { + skey[x] ^= in[x]; + } + + err = der_encode_sequence_multi(out, outlen, + LTC_ASN1_OBJECT_IDENTIFIER, hash_descriptor[hash].OIDlen, hash_descriptor[hash].OID, + LTC_ASN1_OCTET_STRING, pubkeysize, pub_expt, + LTC_ASN1_OCTET_STRING, inlen, skey, + LTC_ASN1_EOL, 0UL, NULL); + +LBL_ERR: +#ifdef LTC_CLEAN_STACK + /* clean up */ + zeromem(pub_expt, ECC_BUF_SIZE); + zeromem(ecc_shared, ECC_BUF_SIZE); + zeromem(skey, MAXBLOCKSIZE); +#endif + + XFREE(skey); + XFREE(ecc_shared); + XFREE(pub_expt); + + return err; +} + +#endif +/* $Source: /cvs/libtom/libtomcrypt/src/pk/ecc/ecc_encrypt_key.c,v $ */ +/* $Revision: 1.4 $ */ +/* $Date: 2006/11/21 00:10:18 $ */ + diff --git a/libtomcrypt/src/pk/ecc/ecc_export.c b/libtomcrypt/src/pk/ecc/ecc_export.c new file mode 100644 index 0000000..1919849 --- /dev/null +++ b/libtomcrypt/src/pk/ecc/ecc_export.c @@ -0,0 +1,82 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ + +/* Implements ECC over Z/pZ for curve y^2 = x^3 - 3x + b + * + * All curves taken from NIST recommendation paper of July 1999 + * Available at http://csrc.nist.gov/cryptval/dss.htm + */ +#include "tomcrypt.h" + +/** + @file ecc_export.c + ECC Crypto, Tom St Denis +*/ + +#ifdef MECC + +/** + Export an ECC key as a binary packet + @param out [out] Destination for the key + @param outlen [in/out] Max size and resulting size of the exported key + @param type The type of key you want to export (PK_PRIVATE or PK_PUBLIC) + @param key The key to export + @return CRYPT_OK if successful +*/ +int ecc_export(unsigned char *out, unsigned long *outlen, int type, ecc_key *key) +{ + int err; + unsigned char flags[1]; + unsigned long key_size; + + LTC_ARGCHK(out != NULL); + LTC_ARGCHK(outlen != NULL); + LTC_ARGCHK(key != NULL); + + /* type valid? */ + if (key->type != PK_PRIVATE && type == PK_PRIVATE) { + return CRYPT_PK_TYPE_MISMATCH; + } + + if (ltc_ecc_is_valid_idx(key->idx) == 0) { + return CRYPT_INVALID_ARG; + } + + /* we store the NIST byte size */ + key_size = key->dp->size; + + if (type == PK_PRIVATE) { + flags[0] = 1; + err = der_encode_sequence_multi(out, outlen, + LTC_ASN1_BIT_STRING, 1UL, flags, + LTC_ASN1_SHORT_INTEGER, 1UL, &key_size, + LTC_ASN1_INTEGER, 1UL, key->pubkey.x, + LTC_ASN1_INTEGER, 1UL, key->pubkey.y, + LTC_ASN1_INTEGER, 1UL, key->k, + LTC_ASN1_EOL, 0UL, NULL); + } else { + flags[0] = 0; + err = der_encode_sequence_multi(out, outlen, + LTC_ASN1_BIT_STRING, 1UL, flags, + LTC_ASN1_SHORT_INTEGER, 1UL, &key_size, + LTC_ASN1_INTEGER, 1UL, key->pubkey.x, + LTC_ASN1_INTEGER, 1UL, key->pubkey.y, + LTC_ASN1_EOL, 0UL, NULL); + } + + return err; +} + +#endif +/* $Source: /cvs/libtom/libtomcrypt/src/pk/ecc/ecc_export.c,v $ */ +/* $Revision: 1.4 $ */ +/* $Date: 2006/11/21 00:10:18 $ */ + diff --git a/libtomcrypt/src/pk/ecc/ecc_free.c b/libtomcrypt/src/pk/ecc/ecc_free.c new file mode 100644 index 0000000..039178d --- /dev/null +++ b/libtomcrypt/src/pk/ecc/ecc_free.c @@ -0,0 +1,40 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ + +/* Implements ECC over Z/pZ for curve y^2 = x^3 - 3x + b + * + * All curves taken from NIST recommendation paper of July 1999 + * Available at http://csrc.nist.gov/cryptval/dss.htm + */ +#include "tomcrypt.h" + +/** + @file ecc_free.c + ECC Crypto, Tom St Denis +*/ + +#ifdef MECC + +/** + Free an ECC key from memory + @param key The key you wish to free +*/ +void ecc_free(ecc_key *key) +{ + LTC_ARGCHKVD(key != NULL); + mp_clear_multi(key->pubkey.x, key->pubkey.y, key->pubkey.z, key->k, NULL); +} + +#endif +/* $Source: /cvs/libtom/libtomcrypt/src/pk/ecc/ecc_free.c,v $ */ +/* $Revision: 1.4 $ */ +/* $Date: 2006/06/09 01:38:14 $ */ + diff --git a/libtomcrypt/src/pk/ecc/ecc_get_size.c b/libtomcrypt/src/pk/ecc/ecc_get_size.c new file mode 100644 index 0000000..9eafdeb --- /dev/null +++ b/libtomcrypt/src/pk/ecc/ecc_get_size.c @@ -0,0 +1,44 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ + +/* Implements ECC over Z/pZ for curve y^2 = x^3 - 3x + b + * + * All curves taken from NIST recommendation paper of July 1999 + * Available at http://csrc.nist.gov/cryptval/dss.htm + */ +#include "tomcrypt.h" + +/** + @file ecc_get_size.c + ECC Crypto, Tom St Denis +*/ + +#ifdef MECC + +/** + Get the size of an ECC key + @param key The key to get the size of + @return The size (octets) of the key or INT_MAX on error +*/ +int ecc_get_size(ecc_key *key) +{ + LTC_ARGCHK(key != NULL); + if (ltc_ecc_is_valid_idx(key->idx)) + return key->dp->size; + else + return INT_MAX; /* large value known to cause it to fail when passed to ecc_make_key() */ +} + +#endif +/* $Source: /cvs/libtom/libtomcrypt/src/pk/ecc/ecc_get_size.c,v $ */ +/* $Revision: 1.4 $ */ +/* $Date: 2006/11/21 00:10:18 $ */ + diff --git a/libtomcrypt/src/pk/ecc/ecc_import.c b/libtomcrypt/src/pk/ecc/ecc_import.c new file mode 100644 index 0000000..4adb28e --- /dev/null +++ b/libtomcrypt/src/pk/ecc/ecc_import.c @@ -0,0 +1,172 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ + +/* Implements ECC over Z/pZ for curve y^2 = x^3 - 3x + b + * + * All curves taken from NIST recommendation paper of July 1999 + * Available at http://csrc.nist.gov/cryptval/dss.htm + */ +#include "tomcrypt.h" + +/** + @file ecc_import.c + ECC Crypto, Tom St Denis +*/ + +#ifdef MECC + +static int is_point(ecc_key *key) +{ + void *prime, *b, *t1, *t2; + int err; + + if ((err = mp_init_multi(&prime, &b, &t1, &t2, NULL)) != CRYPT_OK) { + return err; + } + + /* load prime and b */ + if ((err = mp_read_radix(prime, key->dp->prime, 16)) != CRYPT_OK) { goto error; } + if ((err = mp_read_radix(b, key->dp->B, 16)) != CRYPT_OK) { goto error; } + + /* compute y^2 */ + if ((err = mp_sqr(key->pubkey.y, t1)) != CRYPT_OK) { goto error; } + + /* compute x^3 */ + if ((err = mp_sqr(key->pubkey.x, t2)) != CRYPT_OK) { goto error; } + if ((err = mp_mod(t2, prime, t2)) != CRYPT_OK) { goto error; } + if ((err = mp_mul(key->pubkey.x, t2, t2)) != CRYPT_OK) { goto error; } + + /* compute y^2 - x^3 */ + if ((err = mp_sub(t1, t2, t1)) != CRYPT_OK) { goto error; } + + /* compute y^2 - x^3 + 3x */ + if ((err = mp_add(t1, key->pubkey.x, t1)) != CRYPT_OK) { goto error; } + if ((err = mp_add(t1, key->pubkey.x, t1)) != CRYPT_OK) { goto error; } + if ((err = mp_add(t1, key->pubkey.x, t1)) != CRYPT_OK) { goto error; } + if ((err = mp_mod(t1, prime, t1)) != CRYPT_OK) { goto error; } + while (mp_cmp_d(t1, 0) == LTC_MP_LT) { + if ((err = mp_add(t1, prime, t1)) != CRYPT_OK) { goto error; } + } + while (mp_cmp(t1, prime) != LTC_MP_LT) { + if ((err = mp_sub(t1, prime, t1)) != CRYPT_OK) { goto error; } + } + + /* compare to b */ + if (mp_cmp(t1, b) != LTC_MP_EQ) { + err = CRYPT_INVALID_PACKET; + } else { + err = CRYPT_OK; + } + +error: + mp_clear_multi(prime, b, t1, t2, NULL); + return err; +} + +/** + Import an ECC key from a binary packet + @param in The packet to import + @param inlen The length of the packet + @param key [out] The destination of the import + @return CRYPT_OK if successful, upon error all allocated memory will be freed +*/ +int ecc_import(const unsigned char *in, unsigned long inlen, ecc_key *key) +{ + return ecc_import_ex(in, inlen, key, NULL); +} + +/** + Import an ECC key from a binary packet, using user supplied domain params rather than one of the NIST ones + @param in The packet to import + @param inlen The length of the packet + @param key [out] The destination of the import + @param dp pointer to user supplied params; must be the same as the params used when exporting + @return CRYPT_OK if successful, upon error all allocated memory will be freed +*/ +int ecc_import_ex(const unsigned char *in, unsigned long inlen, ecc_key *key, const ltc_ecc_set_type *dp) +{ + unsigned long key_size; + unsigned char flags[1]; + int err; + + LTC_ARGCHK(in != NULL); + LTC_ARGCHK(key != NULL); + LTC_ARGCHK(ltc_mp.name != NULL); + + /* init key */ + if (mp_init_multi(&key->pubkey.x, &key->pubkey.y, &key->pubkey.z, &key->k, NULL) != CRYPT_OK) { + return CRYPT_MEM; + } + + /* find out what type of key it is */ + if ((err = der_decode_sequence_multi(in, inlen, + LTC_ASN1_BIT_STRING, 1UL, &flags, + LTC_ASN1_EOL, 0UL, NULL)) != CRYPT_OK) { + goto done; + } + + + if (flags[0] == 1) { + /* private key */ + key->type = PK_PRIVATE; + if ((err = der_decode_sequence_multi(in, inlen, + LTC_ASN1_BIT_STRING, 1UL, flags, + LTC_ASN1_SHORT_INTEGER, 1UL, &key_size, + LTC_ASN1_INTEGER, 1UL, key->pubkey.x, + LTC_ASN1_INTEGER, 1UL, key->pubkey.y, + LTC_ASN1_INTEGER, 1UL, key->k, + LTC_ASN1_EOL, 0UL, NULL)) != CRYPT_OK) { + goto done; + } + } else { + /* public key */ + key->type = PK_PUBLIC; + if ((err = der_decode_sequence_multi(in, inlen, + LTC_ASN1_BIT_STRING, 1UL, flags, + LTC_ASN1_SHORT_INTEGER, 1UL, &key_size, + LTC_ASN1_INTEGER, 1UL, key->pubkey.x, + LTC_ASN1_INTEGER, 1UL, key->pubkey.y, + LTC_ASN1_EOL, 0UL, NULL)) != CRYPT_OK) { + goto done; + } + } + + if (dp == NULL) { + /* find the idx */ + for (key->idx = 0; ltc_ecc_sets[key->idx].size && (unsigned long)ltc_ecc_sets[key->idx].size != key_size; ++key->idx); + if (ltc_ecc_sets[key->idx].size == 0) { + err = CRYPT_INVALID_PACKET; + goto done; + } + key->dp = <c_ecc_sets[key->idx]; + } else { + key->idx = -1; + key->dp = dp; + } + /* set z */ + if ((err = mp_set(key->pubkey.z, 1)) != CRYPT_OK) { goto done; } + + /* is it a point on the curve? */ + if ((err = is_point(key)) != CRYPT_OK) { + goto done; + } + + /* we're good */ + return CRYPT_OK; +done: + mp_clear_multi(key->pubkey.x, key->pubkey.y, key->pubkey.z, key->k, NULL); + return err; +} +#endif +/* $Source: /cvs/libtom/libtomcrypt/src/pk/ecc/ecc_import.c,v $ */ +/* $Revision: 1.11 $ */ +/* $Date: 2006/12/04 02:19:48 $ */ + diff --git a/libtomcrypt/src/pk/ecc/ecc_make_key.c b/libtomcrypt/src/pk/ecc/ecc_make_key.c new file mode 100644 index 0000000..796b674 --- /dev/null +++ b/libtomcrypt/src/pk/ecc/ecc_make_key.c @@ -0,0 +1,125 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ + +/* Implements ECC over Z/pZ for curve y^2 = x^3 - 3x + b + * + * All curves taken from NIST recommendation paper of July 1999 + * Available at http://csrc.nist.gov/cryptval/dss.htm + */ +#include "tomcrypt.h" + +/** + @file ecc_make_key.c + ECC Crypto, Tom St Denis +*/ + +#ifdef MECC + +/** + Make a new ECC key + @param prng An active PRNG state + @param wprng The index of the PRNG you wish to use + @param keysize The keysize for the new key (in octets from 20 to 65 bytes) + @param key [out] Destination of the newly created key + @return CRYPT_OK if successful, upon error all allocated memory will be freed +*/ +int ecc_make_key(prng_state *prng, int wprng, int keysize, ecc_key *key) +{ + int x, err; + + /* find key size */ + for (x = 0; (keysize > ltc_ecc_sets[x].size) && (ltc_ecc_sets[x].size != 0); x++); + keysize = ltc_ecc_sets[x].size; + + if (keysize > ECC_MAXSIZE || ltc_ecc_sets[x].size == 0) { + return CRYPT_INVALID_KEYSIZE; + } + err = ecc_make_key_ex(prng, wprng, key, <c_ecc_sets[x]); + key->idx = x; + return err; +} + +int ecc_make_key_ex(prng_state *prng, int wprng, ecc_key *key, const ltc_ecc_set_type *dp) +{ + int err; + ecc_point *base; + void *prime; + unsigned char *buf; + int keysize; + + LTC_ARGCHK(key != NULL); + LTC_ARGCHK(ltc_mp.name != NULL); + LTC_ARGCHK(dp != NULL); + + /* good prng? */ + if ((err = prng_is_valid(wprng)) != CRYPT_OK) { + return err; + } + + key->idx = -1; + key->dp = dp; + keysize = dp->size; + + /* allocate ram */ + base = NULL; + buf = XMALLOC(ECC_MAXSIZE); + if (buf == NULL) { + return CRYPT_MEM; + } + + /* make up random string */ + if (prng_descriptor[wprng].read(buf, (unsigned long)keysize, prng) != (unsigned long)keysize) { + err = CRYPT_ERROR_READPRNG; + goto ERR_BUF; + } + + /* setup the key variables */ + if ((err = mp_init_multi(&key->pubkey.x, &key->pubkey.y, &key->pubkey.z, &key->k, &prime, NULL)) != CRYPT_OK) { + goto ERR_BUF; + } + base = ltc_ecc_new_point(); + if (base == NULL) { + err = CRYPT_MEM; + goto errkey; + } + + /* read in the specs for this key */ + if ((err = mp_read_radix(prime, (char *)key->dp->prime, 16)) != CRYPT_OK) { goto errkey; } + if ((err = mp_read_radix(base->x, (char *)key->dp->Gx, 16)) != CRYPT_OK) { goto errkey; } + if ((err = mp_read_radix(base->y, (char *)key->dp->Gy, 16)) != CRYPT_OK) { goto errkey; } + if ((err = mp_set(base->z, 1)) != CRYPT_OK) { goto errkey; } + if ((err = mp_read_unsigned_bin(key->k, (unsigned char *)buf, keysize)) != CRYPT_OK) { goto errkey; } + + /* make the public key */ + if ((err = ltc_mp.ecc_ptmul(key->k, base, &key->pubkey, prime, 1)) != CRYPT_OK) { goto errkey; } + key->type = PK_PRIVATE; + + /* free up ram */ + err = CRYPT_OK; + goto cleanup; +errkey: + mp_clear_multi(key->pubkey.x, key->pubkey.y, key->pubkey.z, key->k, NULL); +cleanup: + ltc_ecc_del_point(base); + mp_clear(prime); +ERR_BUF: +#ifdef LTC_CLEAN_STACK + zeromem(buf, ECC_MAXSIZE); +#endif + XFREE(buf); + return err; +} + +#endif +/* $Source: /cvs/libtom/libtomcrypt/src/pk/ecc/ecc_make_key.c,v $ */ +/* $Revision: 1.9 $ */ +/* $Date: 2006/12/04 02:50:11 $ */ + diff --git a/libtomcrypt/src/pk/ecc/ecc_shared_secret.c b/libtomcrypt/src/pk/ecc/ecc_shared_secret.c new file mode 100644 index 0000000..ddef847 --- /dev/null +++ b/libtomcrypt/src/pk/ecc/ecc_shared_secret.c @@ -0,0 +1,95 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ + +/* Implements ECC over Z/pZ for curve y^2 = x^3 - 3x + b + * + * All curves taken from NIST recommendation paper of July 1999 + * Available at http://csrc.nist.gov/cryptval/dss.htm + */ +#include "tomcrypt.h" + +/** + @file ecc_shared_secret.c + ECC Crypto, Tom St Denis +*/ + +#ifdef MECC + +/** + Create an ECC shared secret between two keys + @param private_key The private ECC key + @param public_key The public key + @param out [out] Destination of the shared secret (Conforms to EC-DH from ANSI X9.63) + @param outlen [in/out] The max size and resulting size of the shared secret + @return CRYPT_OK if successful +*/ +int ecc_shared_secret(ecc_key *private_key, ecc_key *public_key, + unsigned char *out, unsigned long *outlen) +{ + unsigned long x; + ecc_point *result; + void *prime; + int err; + + LTC_ARGCHK(private_key != NULL); + LTC_ARGCHK(public_key != NULL); + LTC_ARGCHK(out != NULL); + LTC_ARGCHK(outlen != NULL); + + /* type valid? */ + if (private_key->type != PK_PRIVATE) { + return CRYPT_PK_NOT_PRIVATE; + } + + if (ltc_ecc_is_valid_idx(private_key->idx) == 0 || ltc_ecc_is_valid_idx(public_key->idx) == 0) { + return CRYPT_INVALID_ARG; + } + + if (XSTRCMP(private_key->dp->name, public_key->dp->name) != 0) { + return CRYPT_PK_TYPE_MISMATCH; + } + + /* make new point */ + result = ltc_ecc_new_point(); + if (result == NULL) { + return CRYPT_MEM; + } + + if ((err = mp_init(&prime)) != CRYPT_OK) { + ltc_ecc_del_point(result); + return err; + } + + if ((err = mp_read_radix(prime, (char *)private_key->dp->prime, 16)) != CRYPT_OK) { goto done; } + if ((err = ltc_mp.ecc_ptmul(private_key->k, &public_key->pubkey, result, prime, 1)) != CRYPT_OK) { goto done; } + + x = (unsigned long)mp_unsigned_bin_size(prime); + if (*outlen < x) { + *outlen = x; + err = CRYPT_BUFFER_OVERFLOW; + goto done; + } + zeromem(out, x); + if ((err = mp_to_unsigned_bin(result->x, out + (x - mp_unsigned_bin_size(result->x)))) != CRYPT_OK) { goto done; } + + err = CRYPT_OK; + *outlen = x; +done: + mp_clear(prime); + ltc_ecc_del_point(result); + return err; +} + +#endif +/* $Source: /cvs/libtom/libtomcrypt/src/pk/ecc/ecc_shared_secret.c,v $ */ +/* $Revision: 1.8 $ */ +/* $Date: 2006/12/04 02:19:48 $ */ + diff --git a/libtomcrypt/src/pk/ecc/ecc_sign_hash.c b/libtomcrypt/src/pk/ecc/ecc_sign_hash.c new file mode 100644 index 0000000..44f949e --- /dev/null +++ b/libtomcrypt/src/pk/ecc/ecc_sign_hash.c @@ -0,0 +1,114 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ + +/* Implements ECC over Z/pZ for curve y^2 = x^3 - 3x + b + * + * All curves taken from NIST recommendation paper of July 1999 + * Available at http://csrc.nist.gov/cryptval/dss.htm + */ +#include "tomcrypt.h" + +/** + @file ecc_sign_hash.c + ECC Crypto, Tom St Denis +*/ + +#ifdef MECC + +/** + Sign a message digest + @param in The message digest to sign + @param inlen The length of the digest + @param out [out] The destination for the signature + @param outlen [in/out] The max size and resulting size of the signature + @param prng An active PRNG state + @param wprng The index of the PRNG you wish to use + @param key A private ECC key + @return CRYPT_OK if successful +*/ +int ecc_sign_hash(const unsigned char *in, unsigned long inlen, + unsigned char *out, unsigned long *outlen, + prng_state *prng, int wprng, ecc_key *key) +{ + ecc_key pubkey; + void *r, *s, *e, *p; + int err; + + LTC_ARGCHK(in != NULL); + LTC_ARGCHK(out != NULL); + LTC_ARGCHK(outlen != NULL); + LTC_ARGCHK(key != NULL); + + /* is this a private key? */ + if (key->type != PK_PRIVATE) { + return CRYPT_PK_NOT_PRIVATE; + } + + /* is the IDX valid ? */ + if (ltc_ecc_is_valid_idx(key->idx) != 1) { + return CRYPT_PK_INVALID_TYPE; + } + + if ((err = prng_is_valid(wprng)) != CRYPT_OK) { + return err; + } + + /* get the hash and load it as a bignum into 'e' */ + /* init the bignums */ + if ((err = mp_init_multi(&r, &s, &p, &e, NULL)) != CRYPT_OK) { + return err; + } + if ((err = mp_read_radix(p, (char *)key->dp->order, 16)) != CRYPT_OK) { goto errnokey; } + if ((err = mp_read_unsigned_bin(e, (unsigned char *)in, (int)inlen)) != CRYPT_OK) { goto errnokey; } + + /* make up a key and export the public copy */ + for (;;) { + if ((err = ecc_make_key_ex(prng, wprng, &pubkey, key->dp)) != CRYPT_OK) { + goto errnokey; + } + + /* find r = x1 mod n */ + if ((err = mp_mod(pubkey.pubkey.x, p, r)) != CRYPT_OK) { goto error; } + + if (mp_iszero(r) == LTC_MP_YES) { + ecc_free(&pubkey); + } else { + /* find s = (e + xr)/k */ + if ((err = mp_invmod(pubkey.k, p, pubkey.k)) != CRYPT_OK) { goto error; } /* k = 1/k */ + if ((err = mp_mulmod(key->k, r, p, s)) != CRYPT_OK) { goto error; } /* s = xr */ + if ((err = mp_add(e, s, s)) != CRYPT_OK) { goto error; } /* s = e + xr */ + if ((err = mp_mod(s, p, s)) != CRYPT_OK) { goto error; } /* s = e + xr */ + if ((err = mp_mulmod(s, pubkey.k, p, s)) != CRYPT_OK) { goto error; } /* s = (e + xr)/k */ + ecc_free(&pubkey); + if (mp_iszero(s) == LTC_MP_NO) { + break; + } + } + } + + /* store as SEQUENCE { r, s -- integer } */ + err = der_encode_sequence_multi(out, outlen, + LTC_ASN1_INTEGER, 1UL, r, + LTC_ASN1_INTEGER, 1UL, s, + LTC_ASN1_EOL, 0UL, NULL); + goto errnokey; +error: + ecc_free(&pubkey); +errnokey: + mp_clear_multi(r, s, p, e, NULL); + return err; +} + +#endif +/* $Source: /cvs/libtom/libtomcrypt/src/pk/ecc/ecc_sign_hash.c,v $ */ +/* $Revision: 1.9 $ */ +/* $Date: 2006/12/04 02:50:11 $ */ + diff --git a/libtomcrypt/src/pk/ecc/ecc_sizes.c b/libtomcrypt/src/pk/ecc/ecc_sizes.c new file mode 100644 index 0000000..f4b2d82 --- /dev/null +++ b/libtomcrypt/src/pk/ecc/ecc_sizes.c @@ -0,0 +1,48 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ + +/* Implements ECC over Z/pZ for curve y^2 = x^3 - 3x + b + * + * All curves taken from NIST recommendation paper of July 1999 + * Available at http://csrc.nist.gov/cryptval/dss.htm + */ +#include "tomcrypt.h" + +/** + @file ecc_sizes.c + ECC Crypto, Tom St Denis +*/ + +#ifdef MECC + +void ecc_sizes(int *low, int *high) +{ + int i; + LTC_ARGCHKVD(low != NULL); + LTC_ARGCHKVD(high != NULL); + + *low = INT_MAX; + *high = 0; + for (i = 0; ltc_ecc_sets[i].size != 0; i++) { + if (ltc_ecc_sets[i].size < *low) { + *low = ltc_ecc_sets[i].size; + } + if (ltc_ecc_sets[i].size > *high) { + *high = ltc_ecc_sets[i].size; + } + } +} + +#endif +/* $Source: /cvs/libtom/libtomcrypt/src/pk/ecc/ecc_sizes.c,v $ */ +/* $Revision: 1.4 $ */ +/* $Date: 2006/06/09 01:38:14 $ */ + diff --git a/libtomcrypt/src/pk/ecc/ecc_test.c b/libtomcrypt/src/pk/ecc/ecc_test.c new file mode 100644 index 0000000..faa167c --- /dev/null +++ b/libtomcrypt/src/pk/ecc/ecc_test.c @@ -0,0 +1,95 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ + +/* Implements ECC over Z/pZ for curve y^2 = x^3 - 3x + b + * + * All curves taken from NIST recommendation paper of July 1999 + * Available at http://csrc.nist.gov/cryptval/dss.htm + */ +#include "tomcrypt.h" + +/** + @file ecc_test.c + ECC Crypto, Tom St Denis +*/ + +#ifdef MECC + +/** + Perform on the ECC system + @return CRYPT_OK if successful +*/ +int ecc_test(void) +{ + void *modulus, *order; + ecc_point *G, *GG; + int i, err, primality; + + if ((err = mp_init_multi(&modulus, &order, NULL)) != CRYPT_OK) { + return err; + } + + G = ltc_ecc_new_point(); + GG = ltc_ecc_new_point(); + if (G == NULL || GG == NULL) { + mp_clear_multi(modulus, order, NULL); + ltc_ecc_del_point(G); + ltc_ecc_del_point(GG); + return CRYPT_MEM; + } + + for (i = 0; ltc_ecc_sets[i].size; i++) { + #if 0 + printf("Testing %d\n", ltc_ecc_sets[i].size); + #endif + if ((err = mp_read_radix(modulus, (char *)ltc_ecc_sets[i].prime, 16)) != CRYPT_OK) { goto done; } + if ((err = mp_read_radix(order, (char *)ltc_ecc_sets[i].order, 16)) != CRYPT_OK) { goto done; } + + /* is prime actually prime? */ + if ((err = mp_prime_is_prime(modulus, 8, &primality)) != CRYPT_OK) { goto done; } + if (primality == 0) { + err = CRYPT_FAIL_TESTVECTOR; + goto done; + } + + /* is order prime ? */ + if ((err = mp_prime_is_prime(order, 8, &primality)) != CRYPT_OK) { goto done; } + if (primality == 0) { + err = CRYPT_FAIL_TESTVECTOR; + goto done; + } + + if ((err = mp_read_radix(G->x, (char *)ltc_ecc_sets[i].Gx, 16)) != CRYPT_OK) { goto done; } + if ((err = mp_read_radix(G->y, (char *)ltc_ecc_sets[i].Gy, 16)) != CRYPT_OK) { goto done; } + mp_set(G->z, 1); + + /* then we should have G == (order + 1)G */ + if ((err = mp_add_d(order, 1, order)) != CRYPT_OK) { goto done; } + if ((err = ltc_mp.ecc_ptmul(order, G, GG, modulus, 1)) != CRYPT_OK) { goto done; } + if (mp_cmp(G->x, GG->x) != LTC_MP_EQ || mp_cmp(G->y, GG->y) != LTC_MP_EQ) { + err = CRYPT_FAIL_TESTVECTOR; + goto done; + } + } + err = CRYPT_OK; +done: + ltc_ecc_del_point(GG); + ltc_ecc_del_point(G); + mp_clear_multi(order, modulus, NULL); + return err; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/pk/ecc/ecc_test.c,v $ */ +/* $Revision: 1.10 $ */ +/* $Date: 2006/12/04 02:19:48 $ */ + diff --git a/libtomcrypt/src/pk/ecc/ecc_verify_hash.c b/libtomcrypt/src/pk/ecc/ecc_verify_hash.c new file mode 100644 index 0000000..bd8a840 --- /dev/null +++ b/libtomcrypt/src/pk/ecc/ecc_verify_hash.c @@ -0,0 +1,165 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ + +/* Implements ECC over Z/pZ for curve y^2 = x^3 - 3x + b + * + * All curves taken from NIST recommendation paper of July 1999 + * Available at http://csrc.nist.gov/cryptval/dss.htm + */ +#include "tomcrypt.h" + +/** + @file ecc_verify_hash.c + ECC Crypto, Tom St Denis +*/ + +#ifdef MECC + +/* verify + * + * w = s^-1 mod n + * u1 = xw + * u2 = rw + * X = u1*G + u2*Q + * v = X_x1 mod n + * accept if v == r + */ + +/** + Verify an ECC signature + @param sig The signature to verify + @param siglen The length of the signature (octets) + @param hash The hash (message digest) that was signed + @param hashlen The length of the hash (octets) + @param stat Result of signature, 1==valid, 0==invalid + @param key The corresponding public ECC key + @return CRYPT_OK if successful (even if the signature is not valid) +*/ +int ecc_verify_hash(const unsigned char *sig, unsigned long siglen, + const unsigned char *hash, unsigned long hashlen, + int *stat, ecc_key *key) +{ + ecc_point *mG, *mQ; + void *r, *s, *v, *w, *u1, *u2, *e, *p, *m; + void *mp; + int err; + + LTC_ARGCHK(sig != NULL); + LTC_ARGCHK(hash != NULL); + LTC_ARGCHK(stat != NULL); + LTC_ARGCHK(key != NULL); + + /* default to invalid signature */ + *stat = 0; + mp = NULL; + + /* is the IDX valid ? */ + if (ltc_ecc_is_valid_idx(key->idx) != 1) { + return CRYPT_PK_INVALID_TYPE; + } + + /* allocate ints */ + if ((err = mp_init_multi(&r, &s, &v, &w, &u1, &u2, &p, &e, &m, NULL)) != CRYPT_OK) { + return CRYPT_MEM; + } + + /* allocate points */ + mG = ltc_ecc_new_point(); + mQ = ltc_ecc_new_point(); + if (mQ == NULL || mG == NULL) { + err = CRYPT_MEM; + goto error; + } + + /* parse header */ + if ((err = der_decode_sequence_multi(sig, siglen, + LTC_ASN1_INTEGER, 1UL, r, + LTC_ASN1_INTEGER, 1UL, s, + LTC_ASN1_EOL, 0UL, NULL)) != CRYPT_OK) { + goto error; + } + + /* get the order */ + if ((err = mp_read_radix(p, (char *)key->dp->order, 16)) != CRYPT_OK) { goto error; } + + /* get the modulus */ + if ((err = mp_read_radix(m, (char *)key->dp->prime, 16)) != CRYPT_OK) { goto error; } + + /* check for zero */ + if (mp_iszero(r) || mp_iszero(s) || mp_cmp(r, p) != LTC_MP_LT || mp_cmp(s, p) != LTC_MP_LT) { + err = CRYPT_INVALID_PACKET; + goto error; + } + + /* read hash */ + if ((err = mp_read_unsigned_bin(e, (unsigned char *)hash, (int)hashlen)) != CRYPT_OK) { goto error; } + + /* w = s^-1 mod n */ + if ((err = mp_invmod(s, p, w)) != CRYPT_OK) { goto error; } + + /* u1 = ew */ + if ((err = mp_mulmod(e, w, p, u1)) != CRYPT_OK) { goto error; } + + /* u2 = rw */ + if ((err = mp_mulmod(r, w, p, u2)) != CRYPT_OK) { goto error; } + + /* find mG and mQ */ + if ((err = mp_read_radix(mG->x, (char *)key->dp->Gx, 16)) != CRYPT_OK) { goto error; } + if ((err = mp_read_radix(mG->y, (char *)key->dp->Gy, 16)) != CRYPT_OK) { goto error; } + if ((err = mp_set(mG->z, 1)) != CRYPT_OK) { goto error; } + + if ((err = mp_copy(key->pubkey.x, mQ->x)) != CRYPT_OK) { goto error; } + if ((err = mp_copy(key->pubkey.y, mQ->y)) != CRYPT_OK) { goto error; } + if ((err = mp_copy(key->pubkey.z, mQ->z)) != CRYPT_OK) { goto error; } + + /* compute u1*mG + u2*mQ = mG */ + if (ltc_mp.ecc_mul2add == NULL) { + if ((err = ltc_mp.ecc_ptmul(u1, mG, mG, m, 0)) != CRYPT_OK) { goto error; } + if ((err = ltc_mp.ecc_ptmul(u2, mQ, mQ, m, 0)) != CRYPT_OK) { goto error; } + + /* find the montgomery mp */ + if ((err = mp_montgomery_setup(m, &mp)) != CRYPT_OK) { goto error; } + + /* add them */ + if ((err = ltc_mp.ecc_ptadd(mQ, mG, mG, m, mp)) != CRYPT_OK) { goto error; } + + /* reduce */ + if ((err = ltc_mp.ecc_map(mG, m, mp)) != CRYPT_OK) { goto error; } + } else { + /* use Shamir's trick to compute u1*mG + u2*mQ using half of the doubles */ + if ((err = ltc_mp.ecc_mul2add(mG, u1, mQ, u2, mG, m)) != CRYPT_OK) { goto error; } + } + + /* v = X_x1 mod n */ + if ((err = mp_mod(mG->x, p, v)) != CRYPT_OK) { goto error; } + + /* does v == r */ + if (mp_cmp(v, r) == LTC_MP_EQ) { + *stat = 1; + } + + /* clear up and return */ + err = CRYPT_OK; +error: + ltc_ecc_del_point(mG); + ltc_ecc_del_point(mQ); + mp_clear_multi(r, s, v, w, u1, u2, p, e, m, NULL); + if (mp != NULL) { + mp_montgomery_free(mp); + } + return err; +} + +#endif +/* $Source: /cvs/libtom/libtomcrypt/src/pk/ecc/ecc_verify_hash.c,v $ */ +/* $Revision: 1.12 $ */ +/* $Date: 2006/12/04 05:07:59 $ */ + diff --git a/libtomcrypt/src/pk/ecc/ltc_ecc_is_valid_idx.c b/libtomcrypt/src/pk/ecc/ltc_ecc_is_valid_idx.c new file mode 100644 index 0000000..cf81f24 --- /dev/null +++ b/libtomcrypt/src/pk/ecc/ltc_ecc_is_valid_idx.c @@ -0,0 +1,46 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ + +/* Implements ECC over Z/pZ for curve y^2 = x^3 - 3x + b + * + * All curves taken from NIST recommendation paper of July 1999 + * Available at http://csrc.nist.gov/cryptval/dss.htm + */ +#include "tomcrypt.h" + +/** + @file ltc_ecc_is_valid_idx.c + ECC Crypto, Tom St Denis +*/ + +#ifdef MECC + +/** Returns whether an ECC idx is valid or not + @param n The idx number to check + @return 1 if valid, 0 if not +*/ +int ltc_ecc_is_valid_idx(int n) +{ + int x; + + for (x = 0; ltc_ecc_sets[x].size != 0; x++); + /* -1 is a valid index --- indicating that the domain params were supplied by the user */ + if ((n >= -1) || (n < x)) { + return 1; + } + return 0; +} + +#endif +/* $Source: /cvs/libtom/libtomcrypt/src/pk/ecc/ltc_ecc_is_valid_idx.c,v $ */ +/* $Revision: 1.4 $ */ +/* $Date: 2006/11/21 00:10:18 $ */ + diff --git a/libtomcrypt/src/pk/ecc/ltc_ecc_map.c b/libtomcrypt/src/pk/ecc/ltc_ecc_map.c new file mode 100644 index 0000000..eec28b3 --- /dev/null +++ b/libtomcrypt/src/pk/ecc/ltc_ecc_map.c @@ -0,0 +1,76 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ + +/* Implements ECC over Z/pZ for curve y^2 = x^3 - 3x + b + * + * All curves taken from NIST recommendation paper of July 1999 + * Available at http://csrc.nist.gov/cryptval/dss.htm + */ +#include "tomcrypt.h" + +/** + @file ltc_ecc_map.c + ECC Crypto, Tom St Denis +*/ + +#ifdef MECC + +/** + Map a projective jacbobian point back to affine space + @param P [in/out] The point to map + @param modulus The modulus of the field the ECC curve is in + @param mp The "b" value from montgomery_setup() + @return CRYPT_OK on success +*/ +int ltc_ecc_map(ecc_point *P, void *modulus, void *mp) +{ + void *t1, *t2; + int err; + + LTC_ARGCHK(P != NULL); + LTC_ARGCHK(modulus != NULL); + LTC_ARGCHK(mp != NULL); + + if ((err = mp_init_multi(&t1, &t2, NULL)) != CRYPT_OK) { + return CRYPT_MEM; + } + + /* first map z back to normal */ + if ((err = mp_montgomery_reduce(P->z, modulus, mp)) != CRYPT_OK) { goto done; } + + /* get 1/z */ + if ((err = mp_invmod(P->z, modulus, t1)) != CRYPT_OK) { goto done; } + + /* get 1/z^2 and 1/z^3 */ + if ((err = mp_sqr(t1, t2)) != CRYPT_OK) { goto done; } + if ((err = mp_mod(t2, modulus, t2)) != CRYPT_OK) { goto done; } + if ((err = mp_mul(t1, t2, t1)) != CRYPT_OK) { goto done; } + if ((err = mp_mod(t1, modulus, t1)) != CRYPT_OK) { goto done; } + + /* multiply against x/y */ + if ((err = mp_mul(P->x, t2, P->x)) != CRYPT_OK) { goto done; } + if ((err = mp_montgomery_reduce(P->x, modulus, mp)) != CRYPT_OK) { goto done; } + if ((err = mp_mul(P->y, t1, P->y)) != CRYPT_OK) { goto done; } + if ((err = mp_montgomery_reduce(P->y, modulus, mp)) != CRYPT_OK) { goto done; } + if ((err = mp_set(P->z, 1)) != CRYPT_OK) { goto done; } + + err = CRYPT_OK; +done: + mp_clear_multi(t1, t2, NULL); + return err; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/pk/ecc/ltc_ecc_map.c,v $ */ +/* $Revision: 1.5 $ */ +/* $Date: 2006/12/04 02:50:11 $ */ + diff --git a/libtomcrypt/src/pk/ecc/ltc_ecc_mul2add.c b/libtomcrypt/src/pk/ecc/ltc_ecc_mul2add.c new file mode 100644 index 0000000..ac1c24f --- /dev/null +++ b/libtomcrypt/src/pk/ecc/ltc_ecc_mul2add.c @@ -0,0 +1,207 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ + +/* Implements ECC over Z/pZ for curve y^2 = x^3 - 3x + b + * + * All curves taken from NIST recommendation paper of July 1999 + * Available at http://csrc.nist.gov/cryptval/dss.htm + */ +#include "tomcrypt.h" + +/** + @file ltc_ecc_mul2add.c + ECC Crypto, Shamir's Trick, Tom St Denis +*/ + +#ifdef MECC + +#ifdef LTC_ECC_SHAMIR + +/** Computes kA*A + kB*B = C using Shamir's Trick + @param A First point to multiply + @param kA What to multiple A by + @param B Second point to multiply + @param kB What to multiple B by + @param C [out] Destination point (can overlap with A or B + @param modulus Modulus for curve + @return CRYPT_OK on success +*/ +int ltc_ecc_mul2add(ecc_point *A, void *kA, + ecc_point *B, void *kB, + ecc_point *C, + void *modulus) +{ + ecc_point *precomp[16]; + unsigned bitbufA, bitbufB, lenA, lenB, len, x, y, nA, nB, nibble; + unsigned char *tA, *tB; + int err, first; + void *mp, *mu; + + /* argchks */ + LTC_ARGCHK(A != NULL); + LTC_ARGCHK(B != NULL); + LTC_ARGCHK(C != NULL); + LTC_ARGCHK(kA != NULL); + LTC_ARGCHK(kB != NULL); + LTC_ARGCHK(modulus != NULL); + + /* allocate memory */ + tA = XCALLOC(1, ECC_BUF_SIZE); + if (tA == NULL) { + return CRYPT_MEM; + } + tB = XCALLOC(1, ECC_BUF_SIZE); + if (tB == NULL) { + XFREE(tA); + return CRYPT_MEM; + } + + /* get sizes */ + lenA = mp_unsigned_bin_size(kA); + lenB = mp_unsigned_bin_size(kB); + len = MAX(lenA, lenB); + + /* sanity check */ + if ((lenA > ECC_BUF_SIZE) || (lenB > ECC_BUF_SIZE)) { + err = CRYPT_INVALID_ARG; + goto ERR_T; + } + + /* extract and justify kA */ + mp_to_unsigned_bin(kA, (len - lenA) + tA); + + /* extract and justify kB */ + mp_to_unsigned_bin(kB, (len - lenB) + tB); + + /* allocate the table */ + for (x = 0; x < 16; x++) { + precomp[x] = ltc_ecc_new_point(); + if (precomp[x] == NULL) { + for (y = 0; y < x; ++y) { + ltc_ecc_del_point(precomp[y]); + } + err = CRYPT_MEM; + goto ERR_T; + } + } + + /* init montgomery reduction */ + if ((err = mp_montgomery_setup(modulus, &mp)) != CRYPT_OK) { + goto ERR_P; + } + if ((err = mp_init(&mu)) != CRYPT_OK) { + goto ERR_MP; + } + if ((err = mp_montgomery_normalization(mu, modulus)) != CRYPT_OK) { + goto ERR_MU; + } + + /* copy ones ... */ + if ((err = mp_mulmod(A->x, mu, modulus, precomp[1]->x)) != CRYPT_OK) { goto ERR_MU; } + if ((err = mp_mulmod(A->y, mu, modulus, precomp[1]->y)) != CRYPT_OK) { goto ERR_MU; } + if ((err = mp_mulmod(A->z, mu, modulus, precomp[1]->z)) != CRYPT_OK) { goto ERR_MU; } + + if ((err = mp_mulmod(B->x, mu, modulus, precomp[1<<2]->x)) != CRYPT_OK) { goto ERR_MU; } + if ((err = mp_mulmod(B->y, mu, modulus, precomp[1<<2]->y)) != CRYPT_OK) { goto ERR_MU; } + if ((err = mp_mulmod(B->z, mu, modulus, precomp[1<<2]->z)) != CRYPT_OK) { goto ERR_MU; } + + /* precomp [i,0](A + B) table */ + if ((err = ltc_mp.ecc_ptdbl(precomp[1], precomp[2], modulus, mp)) != CRYPT_OK) { goto ERR_MU; } + if ((err = ltc_mp.ecc_ptadd(precomp[1], precomp[2], precomp[3], modulus, mp)) != CRYPT_OK) { goto ERR_MU; } + + /* precomp [0,i](A + B) table */ + if ((err = ltc_mp.ecc_ptdbl(precomp[1<<2], precomp[2<<2], modulus, mp)) != CRYPT_OK) { goto ERR_MU; } + if ((err = ltc_mp.ecc_ptadd(precomp[1<<2], precomp[2<<2], precomp[3<<2], modulus, mp)) != CRYPT_OK) { goto ERR_MU; } + + /* precomp [i,j](A + B) table (i != 0, j != 0) */ + for (x = 1; x < 4; x++) { + for (y = 1; y < 4; y++) { + if ((err = ltc_mp.ecc_ptadd(precomp[x], precomp[(y<<2)], precomp[x+(y<<2)], modulus, mp)) != CRYPT_OK) { goto ERR_MU; } + } + } + + nibble = 3; + first = 1; + bitbufA = tA[0]; + bitbufB = tB[0]; + + /* for every byte of the multiplicands */ + for (x = -1;; ) { + /* grab a nibble */ + if (++nibble == 4) { + ++x; if (x == len) break; + bitbufA = tA[x]; + bitbufB = tB[x]; + nibble = 0; + } + + /* extract two bits from both, shift/update */ + nA = (bitbufA >> 6) & 0x03; + nB = (bitbufB >> 6) & 0x03; + bitbufA = (bitbufA << 2) & 0xFF; + bitbufB = (bitbufB << 2) & 0xFF; + + /* if both zero, if first, continue */ + if ((nA == 0) && (nB == 0) && (first == 1)) { + continue; + } + + /* double twice, only if this isn't the first */ + if (first == 0) { + /* double twice */ + if ((err = ltc_mp.ecc_ptdbl(C, C, modulus, mp)) != CRYPT_OK) { goto ERR_MU; } + if ((err = ltc_mp.ecc_ptdbl(C, C, modulus, mp)) != CRYPT_OK) { goto ERR_MU; } + } + + /* if not both zero */ + if ((nA != 0) || (nB != 0)) { + if (first == 1) { + /* if first, copy from table */ + first = 0; + if ((err = mp_copy(precomp[nA + (nB<<2)]->x, C->x)) != CRYPT_OK) { goto ERR_MU; } + if ((err = mp_copy(precomp[nA + (nB<<2)]->y, C->y)) != CRYPT_OK) { goto ERR_MU; } + if ((err = mp_copy(precomp[nA + (nB<<2)]->z, C->z)) != CRYPT_OK) { goto ERR_MU; } + } else { + /* if not first, add from table */ + if ((err = ltc_mp.ecc_ptadd(C, precomp[nA + (nB<<2)], C, modulus, mp)) != CRYPT_OK) { goto ERR_MU; } + } + } + } + + /* reduce to affine */ + err = ltc_ecc_map(C, modulus, mp); + + /* clean up */ +ERR_MU: + mp_clear(mu); +ERR_MP: + mp_montgomery_free(mp); +ERR_P: + for (x = 0; x < 16; x++) { + ltc_ecc_del_point(precomp[x]); + } +ERR_T: +#ifdef LTC_CLEAN_STACK + zeromem(tA, ECC_BUF_SIZE); + zeromem(tB, ECC_BUF_SIZE); +#endif + XFREE(tA); + XFREE(tB); + + return err; +} + +#endif +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/pk/ecc/ltc_ecc_mul2add.c,v $ */ +/* $Revision: 1.6 $ */ +/* $Date: 2006/12/04 05:07:59 $ */ diff --git a/libtomcrypt/src/pk/ecc/ltc_ecc_mulmod.c b/libtomcrypt/src/pk/ecc/ltc_ecc_mulmod.c new file mode 100644 index 0000000..0e4c92b --- /dev/null +++ b/libtomcrypt/src/pk/ecc/ltc_ecc_mulmod.c @@ -0,0 +1,222 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ + +/* Implements ECC over Z/pZ for curve y^2 = x^3 - 3x + b + * + * All curves taken from NIST recommendation paper of July 1999 + * Available at http://csrc.nist.gov/cryptval/dss.htm + */ +#include "tomcrypt.h" + +/** + @file ltc_ecc_mulmod.c + ECC Crypto, Tom St Denis +*/ + +#ifdef MECC +#ifndef LTC_ECC_TIMING_RESISTANT + +/* size of sliding window, don't change this! */ +#define WINSIZE 4 + +/** + Perform a point multiplication + @param k The scalar to multiply by + @param G The base point + @param R [out] Destination for kG + @param modulus The modulus of the field the ECC curve is in + @param map Boolean whether to map back to affine or not (1==map, 0 == leave in projective) + @return CRYPT_OK on success +*/ +int ltc_ecc_mulmod(void *k, ecc_point *G, ecc_point *R, void *modulus, int map) +{ + ecc_point *tG, *M[8]; + int i, j, err; + void *mu, *mp; + unsigned long buf; + int first, bitbuf, bitcpy, bitcnt, mode, digidx; + + LTC_ARGCHK(k != NULL); + LTC_ARGCHK(G != NULL); + LTC_ARGCHK(R != NULL); + LTC_ARGCHK(modulus != NULL); + + /* init montgomery reduction */ + if ((err = mp_montgomery_setup(modulus, &mp)) != CRYPT_OK) { + return err; + } + if ((err = mp_init(&mu)) != CRYPT_OK) { + mp_montgomery_free(mp); + return err; + } + if ((err = mp_montgomery_normalization(mu, modulus)) != CRYPT_OK) { + mp_montgomery_free(mp); + mp_clear(mu); + return err; + } + + /* alloc ram for window temps */ + for (i = 0; i < 8; i++) { + M[i] = ltc_ecc_new_point(); + if (M[i] == NULL) { + for (j = 0; j < i; j++) { + ltc_ecc_del_point(M[j]); + } + mp_montgomery_free(mp); + mp_clear(mu); + return CRYPT_MEM; + } + } + + /* make a copy of G incase R==G */ + tG = ltc_ecc_new_point(); + if (tG == NULL) { err = CRYPT_MEM; goto done; } + + /* tG = G and convert to montgomery */ + if (mp_cmp_d(mu, 1) == LTC_MP_EQ) { + if ((err = mp_copy(G->x, tG->x)) != CRYPT_OK) { goto done; } + if ((err = mp_copy(G->y, tG->y)) != CRYPT_OK) { goto done; } + if ((err = mp_copy(G->z, tG->z)) != CRYPT_OK) { goto done; } + } else { + if ((err = mp_mulmod(G->x, mu, modulus, tG->x)) != CRYPT_OK) { goto done; } + if ((err = mp_mulmod(G->y, mu, modulus, tG->y)) != CRYPT_OK) { goto done; } + if ((err = mp_mulmod(G->z, mu, modulus, tG->z)) != CRYPT_OK) { goto done; } + } + mp_clear(mu); + mu = NULL; + + /* calc the M tab, which holds kG for k==8..15 */ + /* M[0] == 8G */ + if ((err = ltc_mp.ecc_ptdbl(tG, M[0], modulus, mp)) != CRYPT_OK) { goto done; } + if ((err = ltc_mp.ecc_ptdbl(M[0], M[0], modulus, mp)) != CRYPT_OK) { goto done; } + if ((err = ltc_mp.ecc_ptdbl(M[0], M[0], modulus, mp)) != CRYPT_OK) { goto done; } + + /* now find (8+k)G for k=1..7 */ + for (j = 9; j < 16; j++) { + if ((err = ltc_mp.ecc_ptadd(M[j-9], tG, M[j-8], modulus, mp)) != CRYPT_OK) { goto done; } + } + + /* setup sliding window */ + mode = 0; + bitcnt = 1; + buf = 0; + digidx = mp_get_digit_count(k) - 1; + bitcpy = bitbuf = 0; + first = 1; + + /* perform ops */ + for (;;) { + /* grab next digit as required */ + if (--bitcnt == 0) { + if (digidx == -1) { + break; + } + buf = mp_get_digit(k, digidx); + bitcnt = (int) ltc_mp.bits_per_digit; + --digidx; + } + + /* grab the next msb from the ltiplicand */ + i = (buf >> (ltc_mp.bits_per_digit - 1)) & 1; + buf <<= 1; + + /* skip leading zero bits */ + if (mode == 0 && i == 0) { + continue; + } + + /* if the bit is zero and mode == 1 then we double */ + if (mode == 1 && i == 0) { + if ((err = ltc_mp.ecc_ptdbl(R, R, modulus, mp)) != CRYPT_OK) { goto done; } + continue; + } + + /* else we add it to the window */ + bitbuf |= (i << (WINSIZE - ++bitcpy)); + mode = 2; + + if (bitcpy == WINSIZE) { + /* if this is the first window we do a simple copy */ + if (first == 1) { + /* R = kG [k = first window] */ + if ((err = mp_copy(M[bitbuf-8]->x, R->x)) != CRYPT_OK) { goto done; } + if ((err = mp_copy(M[bitbuf-8]->y, R->y)) != CRYPT_OK) { goto done; } + if ((err = mp_copy(M[bitbuf-8]->z, R->z)) != CRYPT_OK) { goto done; } + first = 0; + } else { + /* normal window */ + /* ok window is filled so double as required and add */ + /* double first */ + for (j = 0; j < WINSIZE; j++) { + if ((err = ltc_mp.ecc_ptdbl(R, R, modulus, mp)) != CRYPT_OK) { goto done; } + } + + /* then add, bitbuf will be 8..15 [8..2^WINSIZE] guaranteed */ + if ((err = ltc_mp.ecc_ptadd(R, M[bitbuf-8], R, modulus, mp)) != CRYPT_OK) { goto done; } + } + /* empty window and reset */ + bitcpy = bitbuf = 0; + mode = 1; + } + } + + /* if bits remain then double/add */ + if (mode == 2 && bitcpy > 0) { + /* double then add */ + for (j = 0; j < bitcpy; j++) { + /* only double if we have had at least one add first */ + if (first == 0) { + if ((err = ltc_mp.ecc_ptdbl(R, R, modulus, mp)) != CRYPT_OK) { goto done; } + } + + bitbuf <<= 1; + if ((bitbuf & (1 << WINSIZE)) != 0) { + if (first == 1){ + /* first add, so copy */ + if ((err = mp_copy(tG->x, R->x)) != CRYPT_OK) { goto done; } + if ((err = mp_copy(tG->y, R->y)) != CRYPT_OK) { goto done; } + if ((err = mp_copy(tG->z, R->z)) != CRYPT_OK) { goto done; } + first = 0; + } else { + /* then add */ + if ((err = ltc_mp.ecc_ptadd(R, tG, R, modulus, mp)) != CRYPT_OK) { goto done; } + } + } + } + } + + /* map R back from projective space */ + if (map) { + err = ltc_ecc_map(R, modulus, mp); + } else { + err = CRYPT_OK; + } +done: + if (mu != NULL) { + mp_clear(mu); + } + mp_montgomery_free(mp); + ltc_ecc_del_point(tG); + for (i = 0; i < 8; i++) { + ltc_ecc_del_point(M[i]); + } + return err; +} + +#endif + +#undef WINSIZE + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/pk/ecc/ltc_ecc_mulmod.c,v $ */ +/* $Revision: 1.24 $ */ +/* $Date: 2006/12/04 05:07:59 $ */ diff --git a/libtomcrypt/src/pk/ecc/ltc_ecc_mulmod_timing.c b/libtomcrypt/src/pk/ecc/ltc_ecc_mulmod_timing.c new file mode 100644 index 0000000..b94a50c --- /dev/null +++ b/libtomcrypt/src/pk/ecc/ltc_ecc_mulmod_timing.c @@ -0,0 +1,167 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ + +/* Implements ECC over Z/pZ for curve y^2 = x^3 - 3x + b + * + * All curves taken from NIST recommendation paper of July 1999 + * Available at http://csrc.nist.gov/cryptval/dss.htm + */ +#include "tomcrypt.h" + +/** + @file ltc_ecc_mulmod_timing.c + ECC Crypto, Tom St Denis +*/ + +#ifdef MECC + +#ifdef LTC_ECC_TIMING_RESISTANT + +/** + Perform a point multiplication (timing resistant) + @param k The scalar to multiply by + @param G The base point + @param R [out] Destination for kG + @param modulus The modulus of the field the ECC curve is in + @param map Boolean whether to map back to affine or not (1==map, 0 == leave in projective) + @return CRYPT_OK on success +*/ +int ltc_ecc_mulmod(void *k, ecc_point *G, ecc_point *R, void *modulus, int map) +{ + ecc_point *tG, *M[3]; + int i, j, err; + void *mu, *mp; + unsigned long buf; + int first, bitbuf, bitcpy, bitcnt, mode, digidx; + + LTC_ARGCHK(k != NULL); + LTC_ARGCHK(G != NULL); + LTC_ARGCHK(R != NULL); + LTC_ARGCHK(modulus != NULL); + + /* init montgomery reduction */ + if ((err = mp_montgomery_setup(modulus, &mp)) != CRYPT_OK) { + return err; + } + if ((err = mp_init(&mu)) != CRYPT_OK) { + mp_montgomery_free(mp); + return err; + } + if ((err = mp_montgomery_normalization(mu, modulus)) != CRYPT_OK) { + mp_clear(mu); + mp_montgomery_free(mp); + return err; + } + + /* alloc ram for window temps */ + for (i = 0; i < 3; i++) { + M[i] = ltc_ecc_new_point(); + if (M[i] == NULL) { + for (j = 0; j < i; j++) { + ltc_ecc_del_point(M[j]); + } + mp_clear(mu); + mp_montgomery_free(mp); + return CRYPT_MEM; + } + } + + /* make a copy of G incase R==G */ + tG = ltc_ecc_new_point(); + if (tG == NULL) { err = CRYPT_MEM; goto done; } + + /* tG = G and convert to montgomery */ + if ((err = mp_mulmod(G->x, mu, modulus, tG->x)) != CRYPT_OK) { goto done; } + if ((err = mp_mulmod(G->y, mu, modulus, tG->y)) != CRYPT_OK) { goto done; } + if ((err = mp_mulmod(G->z, mu, modulus, tG->z)) != CRYPT_OK) { goto done; } + mp_clear(mu); + mu = NULL; + + /* calc the M tab */ + /* M[0] == G */ + if ((err = mp_copy(tG->x, M[0]->x)) != CRYPT_OK) { goto done; } + if ((err = mp_copy(tG->y, M[0]->y)) != CRYPT_OK) { goto done; } + if ((err = mp_copy(tG->z, M[0]->z)) != CRYPT_OK) { goto done; } + /* M[1] == 2G */ + if ((err = ltc_mp.ecc_ptdbl(tG, M[1], modulus, mp)) != CRYPT_OK) { goto done; } + + /* setup sliding window */ + mode = 0; + bitcnt = 1; + buf = 0; + digidx = mp_get_digit_count(k) - 1; + bitcpy = bitbuf = 0; + first = 1; + + /* perform ops */ + for (;;) { + /* grab next digit as required */ + if (--bitcnt == 0) { + if (digidx == -1) { + break; + } + buf = mp_get_digit(k, digidx); + bitcnt = (int) MP_DIGIT_BIT; + --digidx; + } + + /* grab the next msb from the ltiplicand */ + i = (buf >> (MP_DIGIT_BIT - 1)) & 1; + buf <<= 1; + + if (mode == 0 && i == 0) { + /* dummy operations */ + if ((err = ltc_mp.ecc_ptadd(M[0], M[1], M[2], modulus, mp)) != CRYPT_OK) { goto done; } + if ((err = ltc_mp.ecc_ptdbl(M[1], M[2], modulus, mp)) != CRYPT_OK) { goto done; } + continue; + } + + if (mode == 0 && i == 1) { + mode = 1; + /* dummy operations */ + if ((err = ltc_mp.ecc_ptadd(M[0], M[1], M[2], modulus, mp)) != CRYPT_OK) { goto done; } + if ((err = ltc_mp.ecc_ptdbl(M[1], M[2], modulus, mp)) != CRYPT_OK) { goto done; } + continue; + } + + if ((err = ltc_mp.ecc_ptadd(M[0], M[1], M[i^1], modulus, mp)) != CRYPT_OK) { goto done; } + if ((err = ltc_mp.ecc_ptdbl(M[i], M[i], modulus, mp)) != CRYPT_OK) { goto done; } + } + + /* copy result out */ + if ((err = mp_copy(M[0]->x, R->x)) != CRYPT_OK) { goto done; } + if ((err = mp_copy(M[0]->y, R->y)) != CRYPT_OK) { goto done; } + if ((err = mp_copy(M[0]->z, R->z)) != CRYPT_OK) { goto done; } + + /* map R back from projective space */ + if (map) { + err = ltc_ecc_map(R, modulus, mp); + } else { + err = CRYPT_OK; + } +done: + if (mu != NULL) { + mp_clear(mu); + } + mp_montgomery_free(mp); + ltc_ecc_del_point(tG); + for (i = 0; i < 3; i++) { + ltc_ecc_del_point(M[i]); + } + return err; +} + +#endif +#endif +/* $Source: /cvs/libtom/libtomcrypt/src/pk/ecc/ltc_ecc_mulmod_timing.c,v $ */ +/* $Revision: 1.11 $ */ +/* $Date: 2006/12/04 22:17:46 $ */ + diff --git a/libtomcrypt/src/pk/ecc/ltc_ecc_points.c b/libtomcrypt/src/pk/ecc/ltc_ecc_points.c new file mode 100644 index 0000000..39f1321 --- /dev/null +++ b/libtomcrypt/src/pk/ecc/ltc_ecc_points.c @@ -0,0 +1,60 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ + +/* Implements ECC over Z/pZ for curve y^2 = x^3 - 3x + b + * + * All curves taken from NIST recommendation paper of July 1999 + * Available at http://csrc.nist.gov/cryptval/dss.htm + */ +#include "tomcrypt.h" + +/** + @file ltc_ecc_points.c + ECC Crypto, Tom St Denis +*/ + +#ifdef MECC + +/** + Allocate a new ECC point + @return A newly allocated point or NULL on error +*/ +ecc_point *ltc_ecc_new_point(void) +{ + ecc_point *p; + p = XCALLOC(1, sizeof(*p)); + if (p == NULL) { + return NULL; + } + if (mp_init_multi(&p->x, &p->y, &p->z, NULL) != CRYPT_OK) { + XFREE(p); + return NULL; + } + return p; +} + +/** Free an ECC point from memory + @param p The point to free +*/ +void ltc_ecc_del_point(ecc_point *p) +{ + /* prevents free'ing null arguments */ + if (p != NULL) { + mp_clear_multi(p->x, p->y, p->z, NULL); /* note: p->z may be NULL but that's ok with this function anyways */ + XFREE(p); + } +} + +#endif +/* $Source: /cvs/libtom/libtomcrypt/src/pk/ecc/ltc_ecc_points.c,v $ */ +/* $Revision: 1.5 $ */ +/* $Date: 2006/12/04 02:19:48 $ */ + diff --git a/libtomcrypt/src/pk/ecc/ltc_ecc_projective_add_point.c b/libtomcrypt/src/pk/ecc/ltc_ecc_projective_add_point.c new file mode 100644 index 0000000..c8e359f --- /dev/null +++ b/libtomcrypt/src/pk/ecc/ltc_ecc_projective_add_point.c @@ -0,0 +1,196 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ + +/* Implements ECC over Z/pZ for curve y^2 = x^3 - 3x + b + * + * All curves taken from NIST recommendation paper of July 1999 + * Available at http://csrc.nist.gov/cryptval/dss.htm + */ +#include "tomcrypt.h" + +/** + @file ltc_ecc_projective_add_point.c + ECC Crypto, Tom St Denis +*/ + +#if defined(MECC) && (!defined(MECC_ACCEL) || defined(LTM_DESC)) + +/** + Add two ECC points + @param P The point to add + @param Q The point to add + @param R [out] The destination of the double + @param modulus The modulus of the field the ECC curve is in + @param mp The "b" value from montgomery_setup() + @return CRYPT_OK on success +*/ +int ltc_ecc_projective_add_point(ecc_point *P, ecc_point *Q, ecc_point *R, void *modulus, void *mp) +{ + void *t1, *t2, *x, *y, *z; + int err; + + LTC_ARGCHK(P != NULL); + LTC_ARGCHK(Q != NULL); + LTC_ARGCHK(R != NULL); + LTC_ARGCHK(modulus != NULL); + LTC_ARGCHK(mp != NULL); + + if ((err = mp_init_multi(&t1, &t2, &x, &y, &z, NULL)) != CRYPT_OK) { + return err; + } + + /* should we dbl instead? */ + if ((err = mp_sub(modulus, Q->y, t1)) != CRYPT_OK) { goto done; } + + if ( (mp_cmp(P->x, Q->x) == LTC_MP_EQ) && + (Q->z != NULL && mp_cmp(P->z, Q->z) == LTC_MP_EQ) && + (mp_cmp(P->y, Q->y) == LTC_MP_EQ || mp_cmp(P->y, t1) == LTC_MP_EQ)) { + mp_clear_multi(t1, t2, x, y, z, NULL); + return ltc_ecc_projective_dbl_point(P, R, modulus, mp); + } + + if ((err = mp_copy(P->x, x)) != CRYPT_OK) { goto done; } + if ((err = mp_copy(P->y, y)) != CRYPT_OK) { goto done; } + if ((err = mp_copy(P->z, z)) != CRYPT_OK) { goto done; } + + /* if Z is one then these are no-operations */ + if (Q->z != NULL) { + /* T1 = Z' * Z' */ + if ((err = mp_sqr(Q->z, t1)) != CRYPT_OK) { goto done; } + if ((err = mp_montgomery_reduce(t1, modulus, mp)) != CRYPT_OK) { goto done; } + /* X = X * T1 */ + if ((err = mp_mul(t1, x, x)) != CRYPT_OK) { goto done; } + if ((err = mp_montgomery_reduce(x, modulus, mp)) != CRYPT_OK) { goto done; } + /* T1 = Z' * T1 */ + if ((err = mp_mul(Q->z, t1, t1)) != CRYPT_OK) { goto done; } + if ((err = mp_montgomery_reduce(t1, modulus, mp)) != CRYPT_OK) { goto done; } + /* Y = Y * T1 */ + if ((err = mp_mul(t1, y, y)) != CRYPT_OK) { goto done; } + if ((err = mp_montgomery_reduce(y, modulus, mp)) != CRYPT_OK) { goto done; } + } + + /* T1 = Z*Z */ + if ((err = mp_sqr(z, t1)) != CRYPT_OK) { goto done; } + if ((err = mp_montgomery_reduce(t1, modulus, mp)) != CRYPT_OK) { goto done; } + /* T2 = X' * T1 */ + if ((err = mp_mul(Q->x, t1, t2)) != CRYPT_OK) { goto done; } + if ((err = mp_montgomery_reduce(t2, modulus, mp)) != CRYPT_OK) { goto done; } + /* T1 = Z * T1 */ + if ((err = mp_mul(z, t1, t1)) != CRYPT_OK) { goto done; } + if ((err = mp_montgomery_reduce(t1, modulus, mp)) != CRYPT_OK) { goto done; } + /* T1 = Y' * T1 */ + if ((err = mp_mul(Q->y, t1, t1)) != CRYPT_OK) { goto done; } + if ((err = mp_montgomery_reduce(t1, modulus, mp)) != CRYPT_OK) { goto done; } + + /* Y = Y - T1 */ + if ((err = mp_sub(y, t1, y)) != CRYPT_OK) { goto done; } + if (mp_cmp_d(y, 0) == LTC_MP_LT) { + if ((err = mp_add(y, modulus, y)) != CRYPT_OK) { goto done; } + } + /* T1 = 2T1 */ + if ((err = mp_add(t1, t1, t1)) != CRYPT_OK) { goto done; } + if (mp_cmp(t1, modulus) != LTC_MP_LT) { + if ((err = mp_sub(t1, modulus, t1)) != CRYPT_OK) { goto done; } + } + /* T1 = Y + T1 */ + if ((err = mp_add(t1, y, t1)) != CRYPT_OK) { goto done; } + if (mp_cmp(t1, modulus) != LTC_MP_LT) { + if ((err = mp_sub(t1, modulus, t1)) != CRYPT_OK) { goto done; } + } + /* X = X - T2 */ + if ((err = mp_sub(x, t2, x)) != CRYPT_OK) { goto done; } + if (mp_cmp_d(x, 0) == LTC_MP_LT) { + if ((err = mp_add(x, modulus, x)) != CRYPT_OK) { goto done; } + } + /* T2 = 2T2 */ + if ((err = mp_add(t2, t2, t2)) != CRYPT_OK) { goto done; } + if (mp_cmp(t2, modulus) != LTC_MP_LT) { + if ((err = mp_sub(t2, modulus, t2)) != CRYPT_OK) { goto done; } + } + /* T2 = X + T2 */ + if ((err = mp_add(t2, x, t2)) != CRYPT_OK) { goto done; } + if (mp_cmp(t2, modulus) != LTC_MP_LT) { + if ((err = mp_sub(t2, modulus, t2)) != CRYPT_OK) { goto done; } + } + + /* if Z' != 1 */ + if (Q->z != NULL) { + /* Z = Z * Z' */ + if ((err = mp_mul(z, Q->z, z)) != CRYPT_OK) { goto done; } + if ((err = mp_montgomery_reduce(z, modulus, mp)) != CRYPT_OK) { goto done; } + } + + /* Z = Z * X */ + if ((err = mp_mul(z, x, z)) != CRYPT_OK) { goto done; } + if ((err = mp_montgomery_reduce(z, modulus, mp)) != CRYPT_OK) { goto done; } + + /* T1 = T1 * X */ + if ((err = mp_mul(t1, x, t1)) != CRYPT_OK) { goto done; } + if ((err = mp_montgomery_reduce(t1, modulus, mp)) != CRYPT_OK) { goto done; } + /* X = X * X */ + if ((err = mp_sqr(x, x)) != CRYPT_OK) { goto done; } + if ((err = mp_montgomery_reduce(x, modulus, mp)) != CRYPT_OK) { goto done; } + /* T2 = T2 * x */ + if ((err = mp_mul(t2, x, t2)) != CRYPT_OK) { goto done; } + if ((err = mp_montgomery_reduce(t2, modulus, mp)) != CRYPT_OK) { goto done; } + /* T1 = T1 * X */ + if ((err = mp_mul(t1, x, t1)) != CRYPT_OK) { goto done; } + if ((err = mp_montgomery_reduce(t1, modulus, mp)) != CRYPT_OK) { goto done; } + + /* X = Y*Y */ + if ((err = mp_sqr(y, x)) != CRYPT_OK) { goto done; } + if ((err = mp_montgomery_reduce(x, modulus, mp)) != CRYPT_OK) { goto done; } + /* X = X - T2 */ + if ((err = mp_sub(x, t2, x)) != CRYPT_OK) { goto done; } + if (mp_cmp_d(x, 0) == LTC_MP_LT) { + if ((err = mp_add(x, modulus, x)) != CRYPT_OK) { goto done; } + } + + /* T2 = T2 - X */ + if ((err = mp_sub(t2, x, t2)) != CRYPT_OK) { goto done; } + if (mp_cmp_d(t2, 0) == LTC_MP_LT) { + if ((err = mp_add(t2, modulus, t2)) != CRYPT_OK) { goto done; } + } + /* T2 = T2 - X */ + if ((err = mp_sub(t2, x, t2)) != CRYPT_OK) { goto done; } + if (mp_cmp_d(t2, 0) == LTC_MP_LT) { + if ((err = mp_add(t2, modulus, t2)) != CRYPT_OK) { goto done; } + } + /* T2 = T2 * Y */ + if ((err = mp_mul(t2, y, t2)) != CRYPT_OK) { goto done; } + if ((err = mp_montgomery_reduce(t2, modulus, mp)) != CRYPT_OK) { goto done; } + /* Y = T2 - T1 */ + if ((err = mp_sub(t2, t1, y)) != CRYPT_OK) { goto done; } + if (mp_cmp_d(y, 0) == LTC_MP_LT) { + if ((err = mp_add(y, modulus, y)) != CRYPT_OK) { goto done; } + } + /* Y = Y/2 */ + if (mp_isodd(y)) { + if ((err = mp_add(y, modulus, y)) != CRYPT_OK) { goto done; } + } + if ((err = mp_div_2(y, y)) != CRYPT_OK) { goto done; } + + if ((err = mp_copy(x, R->x)) != CRYPT_OK) { goto done; } + if ((err = mp_copy(y, R->y)) != CRYPT_OK) { goto done; } + if ((err = mp_copy(z, R->z)) != CRYPT_OK) { goto done; } + + err = CRYPT_OK; +done: + mp_clear_multi(t1, t2, x, y, z, NULL); + return err; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/pk/ecc/ltc_ecc_projective_add_point.c,v $ */ +/* $Revision: 1.13 $ */ +/* $Date: 2006/12/04 05:07:59 $ */ + diff --git a/libtomcrypt/src/pk/ecc/ltc_ecc_projective_dbl_point.c b/libtomcrypt/src/pk/ecc/ltc_ecc_projective_dbl_point.c new file mode 100644 index 0000000..f0b3e1d --- /dev/null +++ b/libtomcrypt/src/pk/ecc/ltc_ecc_projective_dbl_point.c @@ -0,0 +1,147 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ + +/* Implements ECC over Z/pZ for curve y^2 = x^3 - 3x + b + * + * All curves taken from NIST recommendation paper of July 1999 + * Available at http://csrc.nist.gov/cryptval/dss.htm + */ +#include "tomcrypt.h" + +/** + @file ltc_ecc_projective_dbl_point.c + ECC Crypto, Tom St Denis +*/ + +#if defined(MECC) && (!defined(MECC_ACCEL) || defined(LTM_DESC)) + +/** + Double an ECC point + @param P The point to double + @param R [out] The destination of the double + @param modulus The modulus of the field the ECC curve is in + @param mp The "b" value from montgomery_setup() + @return CRYPT_OK on success +*/ +int ltc_ecc_projective_dbl_point(ecc_point *P, ecc_point *R, void *modulus, void *mp) +{ + void *t1, *t2; + int err; + + LTC_ARGCHK(P != NULL); + LTC_ARGCHK(R != NULL); + LTC_ARGCHK(modulus != NULL); + LTC_ARGCHK(mp != NULL); + + if ((err = mp_init_multi(&t1, &t2, NULL)) != CRYPT_OK) { + return err; + } + + if (P != R) { + if ((err = mp_copy(P->x, R->x)) != CRYPT_OK) { goto done; } + if ((err = mp_copy(P->y, R->y)) != CRYPT_OK) { goto done; } + if ((err = mp_copy(P->z, R->z)) != CRYPT_OK) { goto done; } + } + + /* t1 = Z * Z */ + if ((err = mp_sqr(R->z, t1)) != CRYPT_OK) { goto done; } + if ((err = mp_montgomery_reduce(t1, modulus, mp)) != CRYPT_OK) { goto done; } + /* Z = Y * Z */ + if ((err = mp_mul(R->z, R->y, R->z)) != CRYPT_OK) { goto done; } + if ((err = mp_montgomery_reduce(R->z, modulus, mp)) != CRYPT_OK) { goto done; } + /* Z = 2Z */ + if ((err = mp_add(R->z, R->z, R->z)) != CRYPT_OK) { goto done; } + if (mp_cmp(R->z, modulus) != LTC_MP_LT) { + if ((err = mp_sub(R->z, modulus, R->z)) != CRYPT_OK) { goto done; } + } + + /* T2 = X - T1 */ + if ((err = mp_sub(R->x, t1, t2)) != CRYPT_OK) { goto done; } + if (mp_cmp_d(t2, 0) == LTC_MP_LT) { + if ((err = mp_add(t2, modulus, t2)) != CRYPT_OK) { goto done; } + } + /* T1 = X + T1 */ + if ((err = mp_add(t1, R->x, t1)) != CRYPT_OK) { goto done; } + if (mp_cmp(t1, modulus) != LTC_MP_LT) { + if ((err = mp_sub(t1, modulus, t1)) != CRYPT_OK) { goto done; } + } + /* T2 = T1 * T2 */ + if ((err = mp_mul(t1, t2, t2)) != CRYPT_OK) { goto done; } + if ((err = mp_montgomery_reduce(t2, modulus, mp)) != CRYPT_OK) { goto done; } + /* T1 = 2T2 */ + if ((err = mp_add(t2, t2, t1)) != CRYPT_OK) { goto done; } + if (mp_cmp(t1, modulus) != LTC_MP_LT) { + if ((err = mp_sub(t1, modulus, t1)) != CRYPT_OK) { goto done; } + } + /* T1 = T1 + T2 */ + if ((err = mp_add(t1, t2, t1)) != CRYPT_OK) { goto done; } + if (mp_cmp(t1, modulus) != LTC_MP_LT) { + if ((err = mp_sub(t1, modulus, t1)) != CRYPT_OK) { goto done; } + } + + /* Y = 2Y */ + if ((err = mp_add(R->y, R->y, R->y)) != CRYPT_OK) { goto done; } + if (mp_cmp(R->y, modulus) != LTC_MP_LT) { + if ((err = mp_sub(R->y, modulus, R->y)) != CRYPT_OK) { goto done; } + } + /* Y = Y * Y */ + if ((err = mp_sqr(R->y, R->y)) != CRYPT_OK) { goto done; } + if ((err = mp_montgomery_reduce(R->y, modulus, mp)) != CRYPT_OK) { goto done; } + /* T2 = Y * Y */ + if ((err = mp_sqr(R->y, t2)) != CRYPT_OK) { goto done; } + if ((err = mp_montgomery_reduce(t2, modulus, mp)) != CRYPT_OK) { goto done; } + /* T2 = T2/2 */ + if (mp_isodd(t2)) { + if ((err = mp_add(t2, modulus, t2)) != CRYPT_OK) { goto done; } + } + if ((err = mp_div_2(t2, t2)) != CRYPT_OK) { goto done; } + /* Y = Y * X */ + if ((err = mp_mul(R->y, R->x, R->y)) != CRYPT_OK) { goto done; } + if ((err = mp_montgomery_reduce(R->y, modulus, mp)) != CRYPT_OK) { goto done; } + + /* X = T1 * T1 */ + if ((err = mp_sqr(t1, R->x)) != CRYPT_OK) { goto done; } + if ((err = mp_montgomery_reduce(R->x, modulus, mp)) != CRYPT_OK) { goto done; } + /* X = X - Y */ + if ((err = mp_sub(R->x, R->y, R->x)) != CRYPT_OK) { goto done; } + if (mp_cmp_d(R->x, 0) == LTC_MP_LT) { + if ((err = mp_add(R->x, modulus, R->x)) != CRYPT_OK) { goto done; } + } + /* X = X - Y */ + if ((err = mp_sub(R->x, R->y, R->x)) != CRYPT_OK) { goto done; } + if (mp_cmp_d(R->x, 0) == LTC_MP_LT) { + if ((err = mp_add(R->x, modulus, R->x)) != CRYPT_OK) { goto done; } + } + + /* Y = Y - X */ + if ((err = mp_sub(R->y, R->x, R->y)) != CRYPT_OK) { goto done; } + if (mp_cmp_d(R->y, 0) == LTC_MP_LT) { + if ((err = mp_add(R->y, modulus, R->y)) != CRYPT_OK) { goto done; } + } + /* Y = Y * T1 */ + if ((err = mp_mul(R->y, t1, R->y)) != CRYPT_OK) { goto done; } + if ((err = mp_montgomery_reduce(R->y, modulus, mp)) != CRYPT_OK) { goto done; } + /* Y = Y - T2 */ + if ((err = mp_sub(R->y, t2, R->y)) != CRYPT_OK) { goto done; } + if (mp_cmp_d(R->y, 0) == LTC_MP_LT) { + if ((err = mp_add(R->y, modulus, R->y)) != CRYPT_OK) { goto done; } + } + + err = CRYPT_OK; +done: + mp_clear_multi(t1, t2, NULL); + return err; +} +#endif +/* $Source: /cvs/libtom/libtomcrypt/src/pk/ecc/ltc_ecc_projective_dbl_point.c,v $ */ +/* $Revision: 1.8 $ */ +/* $Date: 2006/12/04 05:07:59 $ */ + diff --git a/libtomcrypt/src/pk/katja/katja_decrypt_key.c b/libtomcrypt/src/pk/katja/katja_decrypt_key.c new file mode 100644 index 0000000..1e10d6c --- /dev/null +++ b/libtomcrypt/src/pk/katja/katja_decrypt_key.c @@ -0,0 +1,105 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file katja_decrypt_key.c + Katja PKCS #1 OAEP Decryption, Tom St Denis +*/ + +#ifdef MKAT + +/** + (PKCS #1 v2.0) decrypt then OAEP depad + @param in The ciphertext + @param inlen The length of the ciphertext (octets) + @param out [out] The plaintext + @param outlen [in/out] The max size and resulting size of the plaintext (octets) + @param lparam The system "lparam" value + @param lparamlen The length of the lparam value (octets) + @param hash_idx The index of the hash desired + @param stat [out] Result of the decryption, 1==valid, 0==invalid + @param key The corresponding private Katja key + @return CRYPT_OK if succcessul (even if invalid) +*/ +int katja_decrypt_key(const unsigned char *in, unsigned long inlen, + unsigned char *out, unsigned long *outlen, + const unsigned char *lparam, unsigned long lparamlen, + int hash_idx, int *stat, + katja_key *key) +{ + unsigned long modulus_bitlen, modulus_bytelen, x; + int err; + unsigned char *tmp; + + LTC_ARGCHK(out != NULL); + LTC_ARGCHK(outlen != NULL); + LTC_ARGCHK(key != NULL); + LTC_ARGCHK(stat != NULL); + + /* default to invalid */ + *stat = 0; + + /* valid hash ? */ + if ((err = hash_is_valid(hash_idx)) != CRYPT_OK) { + return err; + } + + /* get modulus len in bits */ + modulus_bitlen = mp_count_bits( (key->N)); + + /* payload is upto pq, so we know q is 1/3rd the size of N and therefore pq is 2/3th the size */ + modulus_bitlen = ((modulus_bitlen << 1) / 3); + + /* round down to next byte */ + modulus_bitlen -= (modulus_bitlen & 7) + 8; + + /* outlen must be at least the size of the modulus */ + modulus_bytelen = mp_unsigned_bin_size( (key->N)); + if (modulus_bytelen != inlen) { + return CRYPT_INVALID_PACKET; + } + + /* allocate ram */ + tmp = XMALLOC(inlen); + if (tmp == NULL) { + return CRYPT_MEM; + } + + /* rsa decode the packet */ + x = inlen; + if ((err = katja_exptmod(in, inlen, tmp, &x, PK_PRIVATE, key)) != CRYPT_OK) { + XFREE(tmp); + return err; + } + + /* shift right by modulus_bytelen - modulus_bitlen/8 bytes */ + for (x = 0; x < (modulus_bitlen >> 3); x++) { + tmp[x] = tmp[x+(modulus_bytelen-(modulus_bitlen>>3))]; + } + + /* now OAEP decode the packet */ + err = pkcs_1_oaep_decode(tmp, x, lparam, lparamlen, modulus_bitlen, hash_idx, + out, outlen, stat); + + XFREE(tmp); + return err; +} + +#endif /* MRSA */ + + + + + +/* $Source: /cvs/libtom/libtomcrypt/src/pk/katja/katja_decrypt_key.c,v $ */ +/* $Revision: 1.4 $ */ +/* $Date: 2006/03/31 14:15:35 $ */ diff --git a/libtomcrypt/src/pk/katja/katja_encrypt_key.c b/libtomcrypt/src/pk/katja/katja_encrypt_key.c new file mode 100644 index 0000000..ce93356 --- /dev/null +++ b/libtomcrypt/src/pk/katja/katja_encrypt_key.c @@ -0,0 +1,87 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file katja_encrypt_key.c + Katja PKCS-style OAEP encryption, Tom St Denis +*/ + +#ifdef MKAT + +/** + (PKCS #1 v2.0) OAEP pad then encrypt + @param in The plaintext + @param inlen The length of the plaintext (octets) + @param out [out] The ciphertext + @param outlen [in/out] The max size and resulting size of the ciphertext + @param lparam The system "lparam" for the encryption + @param lparamlen The length of lparam (octets) + @param prng An active PRNG + @param prng_idx The index of the desired prng + @param hash_idx The index of the desired hash + @param key The Katja key to encrypt to + @return CRYPT_OK if successful +*/ +int katja_encrypt_key(const unsigned char *in, unsigned long inlen, + unsigned char *out, unsigned long *outlen, + const unsigned char *lparam, unsigned long lparamlen, + prng_state *prng, int prng_idx, int hash_idx, katja_key *key) +{ + unsigned long modulus_bitlen, modulus_bytelen, x; + int err; + + LTC_ARGCHK(in != NULL); + LTC_ARGCHK(out != NULL); + LTC_ARGCHK(outlen != NULL); + LTC_ARGCHK(key != NULL); + + /* valid prng and hash ? */ + if ((err = prng_is_valid(prng_idx)) != CRYPT_OK) { + return err; + } + if ((err = hash_is_valid(hash_idx)) != CRYPT_OK) { + return err; + } + + /* get modulus len in bits */ + modulus_bitlen = mp_count_bits((key->N)); + + /* payload is upto pq, so we know q is 1/3rd the size of N and therefore pq is 2/3th the size */ + modulus_bitlen = ((modulus_bitlen << 1) / 3); + + /* round down to next byte */ + modulus_bitlen -= (modulus_bitlen & 7) + 8; + + /* outlen must be at least the size of the modulus */ + modulus_bytelen = mp_unsigned_bin_size((key->N)); + if (modulus_bytelen > *outlen) { + *outlen = modulus_bytelen; + return CRYPT_BUFFER_OVERFLOW; + } + + /* OAEP pad the key */ + x = *outlen; + if ((err = pkcs_1_oaep_encode(in, inlen, lparam, + lparamlen, modulus_bitlen, prng, prng_idx, hash_idx, + out, &x)) != CRYPT_OK) { + return err; + } + + /* Katja exptmod the OAEP pad */ + return katja_exptmod(out, x, out, outlen, PK_PUBLIC, key); +} + +#endif /* MRSA */ + +/* $Source: /cvs/libtom/libtomcrypt/src/pk/katja/katja_encrypt_key.c,v $ */ +/* $Revision: 1.5 $ */ +/* $Date: 2006/06/16 21:53:41 $ */ diff --git a/libtomcrypt/src/pk/katja/katja_export.c b/libtomcrypt/src/pk/katja/katja_export.c new file mode 100644 index 0000000..9e55654 --- /dev/null +++ b/libtomcrypt/src/pk/katja/katja_export.c @@ -0,0 +1,75 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file katja_export.c + Export Katja PKCS-style keys, Tom St Denis +*/ + +#ifdef MKAT + +/** + This will export either an KatjaPublicKey or KatjaPrivateKey + @param out [out] Destination of the packet + @param outlen [in/out] The max size and resulting size of the packet + @param type The type of exported key (PK_PRIVATE or PK_PUBLIC) + @param key The Katja key to export + @return CRYPT_OK if successful +*/ +int katja_export(unsigned char *out, unsigned long *outlen, int type, katja_key *key) +{ + int err; + unsigned long zero=0; + + LTC_ARGCHK(out != NULL); + LTC_ARGCHK(outlen != NULL); + LTC_ARGCHK(key != NULL); + + /* type valid? */ + if (!(key->type == PK_PRIVATE) && (type == PK_PRIVATE)) { + return CRYPT_PK_INVALID_TYPE; + } + + if (type == PK_PRIVATE) { + /* private key */ + /* output is + Version, n, d, p, q, d mod (p-1), d mod (q - 1), 1/q mod p, pq + */ + if ((err = der_encode_sequence_multi(out, outlen, + LTC_ASN1_SHORT_INTEGER, 1UL, &zero, + LTC_ASN1_INTEGER, 1UL, key->N, + LTC_ASN1_INTEGER, 1UL, key->d, + LTC_ASN1_INTEGER, 1UL, key->p, + LTC_ASN1_INTEGER, 1UL, key->q, + LTC_ASN1_INTEGER, 1UL, key->dP, + LTC_ASN1_INTEGER, 1UL, key->dQ, + LTC_ASN1_INTEGER, 1UL, key->qP, + LTC_ASN1_INTEGER, 1UL, key->pq, + LTC_ASN1_EOL, 0UL, NULL)) != CRYPT_OK) { + return err; + } + + /* clear zero and return */ + return CRYPT_OK; + } else { + /* public key */ + return der_encode_sequence_multi(out, outlen, + LTC_ASN1_INTEGER, 1UL, key->N, + LTC_ASN1_EOL, 0UL, NULL); + } +} + +#endif /* MRSA */ + +/* $Source: /cvs/libtom/libtomcrypt/src/pk/katja/katja_export.c,v $ */ +/* $Revision: 1.2 $ */ +/* $Date: 2006/03/31 14:15:35 $ */ diff --git a/libtomcrypt/src/pk/katja/katja_exptmod.c b/libtomcrypt/src/pk/katja/katja_exptmod.c new file mode 100644 index 0000000..8cc47d8 --- /dev/null +++ b/libtomcrypt/src/pk/katja/katja_exptmod.c @@ -0,0 +1,115 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file katja_exptmod.c + Katja PKCS-style exptmod, Tom St Denis +*/ + +#ifdef MKAT + +/** + Compute an RSA modular exponentiation + @param in The input data to send into RSA + @param inlen The length of the input (octets) + @param out [out] The destination + @param outlen [in/out] The max size and resulting size of the output + @param which Which exponent to use, e.g. PK_PRIVATE or PK_PUBLIC + @param key The RSA key to use + @return CRYPT_OK if successful +*/ +int katja_exptmod(const unsigned char *in, unsigned long inlen, + unsigned char *out, unsigned long *outlen, int which, + katja_key *key) +{ + void *tmp, *tmpa, *tmpb; + unsigned long x; + int err; + + LTC_ARGCHK(in != NULL); + LTC_ARGCHK(out != NULL); + LTC_ARGCHK(outlen != NULL); + LTC_ARGCHK(key != NULL); + + /* is the key of the right type for the operation? */ + if (which == PK_PRIVATE && (key->type != PK_PRIVATE)) { + return CRYPT_PK_NOT_PRIVATE; + } + + /* must be a private or public operation */ + if (which != PK_PRIVATE && which != PK_PUBLIC) { + return CRYPT_PK_INVALID_TYPE; + } + + /* init and copy into tmp */ + if ((err = mp_init_multi(&tmp, &tmpa, &tmpb, NULL)) != CRYPT_OK) { return err; } + if ((err = mp_read_unsigned_bin(tmp, (unsigned char *)in, (int)inlen)) != CRYPT_OK) { goto error; } + + /* sanity check on the input */ + if (mp_cmp(key->N, tmp) == LTC_MP_LT) { + err = CRYPT_PK_INVALID_SIZE; + goto done; + } + + /* are we using the private exponent and is the key optimized? */ + if (which == PK_PRIVATE) { + /* tmpa = tmp^dP mod p */ + if ((err = mp_exptmod(tmp, key->dP, key->p, tmpa)) != CRYPT_OK) { goto error; } + + /* tmpb = tmp^dQ mod q */ + if ((err = mp_exptmod(tmp, key->dQ, key->q, tmpb)) != CRYPT_OK) { goto error; } + + /* tmp = (tmpa - tmpb) * qInv (mod p) */ + if ((err = mp_sub(tmpa, tmpb, tmp)) != CRYPT_OK) { goto error; } + if ((err = mp_mulmod(tmp, key->qP, key->p, tmp)) != CRYPT_OK) { goto error; } + + /* tmp = tmpb + q * tmp */ + if ((err = mp_mul(tmp, key->q, tmp)) != CRYPT_OK) { goto error; } + if ((err = mp_add(tmp, tmpb, tmp)) != CRYPT_OK) { goto error; } + } else { + /* exptmod it */ + if ((err = mp_exptmod(tmp, key->N, key->N, tmp)) != CRYPT_OK) { goto error; } + } + + /* read it back */ + x = (unsigned long)mp_unsigned_bin_size(key->N); + if (x > *outlen) { + *outlen = x; + err = CRYPT_BUFFER_OVERFLOW; + goto done; + } + + /* this should never happen ... */ + if (mp_unsigned_bin_size(tmp) > mp_unsigned_bin_size(key->N)) { + err = CRYPT_ERROR; + goto done; + } + *outlen = x; + + /* convert it */ + zeromem(out, x); + if ((err = mp_to_unsigned_bin(tmp, out+(x-mp_unsigned_bin_size(tmp)))) != CRYPT_OK) { goto error; } + + /* clean up and return */ + err = CRYPT_OK; + goto done; +error: +done: + mp_clear_multi(tmp, tmpa, tmpb, NULL); + return err; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/pk/katja/katja_exptmod.c,v $ */ +/* $Revision: 1.5 $ */ +/* $Date: 2006/06/16 21:53:41 $ */ diff --git a/libtomcrypt/src/pk/katja/katja_free.c b/libtomcrypt/src/pk/katja/katja_free.c new file mode 100644 index 0000000..8aed3fb --- /dev/null +++ b/libtomcrypt/src/pk/katja/katja_free.c @@ -0,0 +1,35 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file katja_free.c + Free an Katja key, Tom St Denis +*/ + +#ifdef MKAT + +/** + Free an Katja key from memory + @param key The RSA key to free +*/ +void katja_free(katja_key *key) +{ + LTC_ARGCHK(key != NULL); + mp_clear_multi( key->d, key->N, key->dQ, key->dP, + key->qP, key->p, key->q, key->pq, NULL); +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/pk/katja/katja_free.c,v $ */ +/* $Revision: 1.2 $ */ +/* $Date: 2006/03/31 14:15:35 $ */ diff --git a/libtomcrypt/src/pk/katja/katja_import.c b/libtomcrypt/src/pk/katja/katja_import.c new file mode 100644 index 0000000..efdbe07 --- /dev/null +++ b/libtomcrypt/src/pk/katja/katja_import.c @@ -0,0 +1,81 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file katja_import.c + Import a PKCS-style Katja key, Tom St Denis +*/ + +#ifdef MKAT + +/** + Import an KatjaPublicKey or KatjaPrivateKey [two-prime only, only support >= 1024-bit keys, defined in PKCS #1 v2.1] + @param in The packet to import from + @param inlen It's length (octets) + @param key [out] Destination for newly imported key + @return CRYPT_OK if successful, upon error allocated memory is freed +*/ +int katja_import(const unsigned char *in, unsigned long inlen, katja_key *key) +{ + int err; + void *zero; + + LTC_ARGCHK(in != NULL); + LTC_ARGCHK(key != NULL); + LTC_ARGCHK(ltc_mp.name != NULL); + + /* init key */ + if ((err = mp_init_multi(&zero, &key->d, &key->N, &key->dQ, + &key->dP, &key->qP, &key->p, &key->q, &key->pq, NULL)) != CRYPT_OK) { + return err; + } + + if ((err = der_decode_sequence_multi(in, inlen, + LTC_ASN1_INTEGER, 1UL, key->N, + LTC_ASN1_EOL, 0UL, NULL)) != CRYPT_OK) { + goto LBL_ERR; + } + + if (mp_cmp_d(key->N, 0) == LTC_MP_EQ) { + /* it's a private key */ + if ((err = der_decode_sequence_multi(in, inlen, + LTC_ASN1_INTEGER, 1UL, zero, + LTC_ASN1_INTEGER, 1UL, key->N, + LTC_ASN1_INTEGER, 1UL, key->d, + LTC_ASN1_INTEGER, 1UL, key->p, + LTC_ASN1_INTEGER, 1UL, key->q, + LTC_ASN1_INTEGER, 1UL, key->dP, + LTC_ASN1_INTEGER, 1UL, key->dQ, + LTC_ASN1_INTEGER, 1UL, key->qP, + LTC_ASN1_INTEGER, 1UL, key->pq, + LTC_ASN1_EOL, 0UL, NULL)) != CRYPT_OK) { + goto LBL_ERR; + } + key->type = PK_PRIVATE; + } else { + /* public we have N */ + key->type = PK_PUBLIC; + } + mp_clear(zero); + return CRYPT_OK; +LBL_ERR: + mp_clear_multi(zero, key->d, key->N, key->dQ, key->dP, + key->qP, key->p, key->q, key->pq, NULL); + return err; +} + +#endif /* MRSA */ + + +/* $Source: /cvs/libtom/libtomcrypt/src/pk/katja/katja_import.c,v $ */ +/* $Revision: 1.3 $ */ +/* $Date: 2006/03/31 14:15:35 $ */ diff --git a/libtomcrypt/src/pk/katja/katja_make_key.c b/libtomcrypt/src/pk/katja/katja_make_key.c new file mode 100644 index 0000000..08016c8 --- /dev/null +++ b/libtomcrypt/src/pk/katja/katja_make_key.c @@ -0,0 +1,101 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file katja_make_key.c + Katja key generation, Tom St Denis +*/ + +#ifdef MKAT + +/** + Create a Katja key + @param prng An active PRNG state + @param wprng The index of the PRNG desired + @param size The size of the modulus (key size) desired (octets) + @param key [out] Destination of a newly created private key pair + @return CRYPT_OK if successful, upon error all allocated ram is freed +*/ +int katja_make_key(prng_state *prng, int wprng, int size, katja_key *key) +{ + void *p, *q, *tmp1, *tmp2; + int err; + + LTC_ARGCHK(key != NULL); + LTC_ARGCHK(ltc_mp.name != NULL); + + if ((size < (MIN_KAT_SIZE/8)) || (size > (MAX_KAT_SIZE/8))) { + return CRYPT_INVALID_KEYSIZE; + } + + if ((err = prng_is_valid(wprng)) != CRYPT_OK) { + return err; + } + + if ((err = mp_init_multi(&p, &q, &tmp1, &tmp2, NULL)) != CRYPT_OK) { + return err; + } + + /* divide size by three */ + size = (((size << 3) / 3) + 7) >> 3; + + /* make prime "q" (we negate size to make q == 3 mod 4) */ + if ((err = rand_prime(q, -size, prng, wprng)) != CRYPT_OK) { goto done; } + if ((err = mp_sub_d(q, 1, tmp1)) != CRYPT_OK) { goto done; } + + /* make prime "p" */ + do { + if ((err = rand_prime(p, size+1, prng, wprng)) != CRYPT_OK) { goto done; } + if ((err = mp_gcd(p, tmp1, tmp2)) != CRYPT_OK) { goto done; } + } while (mp_cmp_d(tmp2, 1) != LTC_MP_EQ); + + /* make key */ + if ((err = mp_init_multi(&key->d, &key->N, &key->dQ, &key->dP, + &key->qP, &key->p, &key->q, &key->pq, NULL)) != CRYPT_OK) { + goto error; + } + + /* n=p^2q and 1/n mod pq */ + if ((err = mp_copy( p, key->p)) != CRYPT_OK) { goto error2; } + if ((err = mp_copy( q, key->q)) != CRYPT_OK) { goto error2; } + if ((err = mp_mul(key->p, key->q, key->pq)) != CRYPT_OK) { goto error2; } /* tmp1 = pq */ + if ((err = mp_mul(key->pq, key->p, key->N)) != CRYPT_OK) { goto error2; } /* N = p^2q */ + if ((err = mp_sub_d( p, 1, tmp1)) != CRYPT_OK) { goto error2; } /* tmp1 = q-1 */ + if ((err = mp_sub_d( q, 1, tmp2)) != CRYPT_OK) { goto error2; } /* tmp2 = p-1 */ + if ((err = mp_lcm(tmp1, tmp2, key->d)) != CRYPT_OK) { goto error2; } /* tmp1 = lcd(p-1,q-1) */ + if ((err = mp_invmod( key->N, key->d, key->d)) != CRYPT_OK) { goto error2; } /* key->d = 1/N mod pq */ + + /* optimize for CRT now */ + /* find d mod q-1 and d mod p-1 */ + if ((err = mp_mod( key->d, tmp1, key->dP)) != CRYPT_OK) { goto error2; } /* dP = d mod p-1 */ + if ((err = mp_mod( key->d, tmp2, key->dQ)) != CRYPT_OK) { goto error2; } /* dQ = d mod q-1 */ + if ((err = mp_invmod( q, p, key->qP)) != CRYPT_OK) { goto error2; } /* qP = 1/q mod p */ + + /* set key type (in this case it's CRT optimized) */ + key->type = PK_PRIVATE; + + /* return ok and free temps */ + err = CRYPT_OK; + goto done; +error2: + mp_clear_multi( key->d, key->N, key->dQ, key->dP, key->qP, key->p, key->q, key->pq, NULL); +error: +done: + mp_clear_multi( tmp2, tmp1, p, q, NULL); + return err; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/pk/katja/katja_make_key.c,v $ */ +/* $Revision: 1.10 $ */ +/* $Date: 2006/03/31 14:15:35 $ */ diff --git a/libtomcrypt/src/pk/pkcs1/pkcs_1_i2osp.c b/libtomcrypt/src/pk/pkcs1/pkcs_1_i2osp.c new file mode 100644 index 0000000..4a39bd5 --- /dev/null +++ b/libtomcrypt/src/pk/pkcs1/pkcs_1_i2osp.c @@ -0,0 +1,51 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file pkcs_1_i2osp.c + Integer to Octet I2OSP, Tom St Denis +*/ + +#ifdef PKCS_1 + +/* always stores the same # of bytes, pads with leading zero bytes + as required + */ + +/** + PKCS #1 Integer to binary + @param n The integer to store + @param modulus_len The length of the RSA modulus + @param out [out] The destination for the integer + @return CRYPT_OK if successful +*/ +int pkcs_1_i2osp(void *n, unsigned long modulus_len, unsigned char *out) +{ + unsigned long size; + + size = mp_unsigned_bin_size(n); + + if (size > modulus_len) { + return CRYPT_BUFFER_OVERFLOW; + } + + /* store it */ + zeromem(out, modulus_len); + return mp_to_unsigned_bin(n, out+(modulus_len-size)); +} + +#endif /* PKCS_1 */ + + +/* $Source: /cvs/libtom/libtomcrypt/src/pk/pkcs1/pkcs_1_i2osp.c,v $ */ +/* $Revision: 1.5 $ */ +/* $Date: 2006/03/31 14:15:35 $ */ diff --git a/libtomcrypt/src/pk/pkcs1/pkcs_1_mgf1.c b/libtomcrypt/src/pk/pkcs1/pkcs_1_mgf1.c new file mode 100644 index 0000000..bfc80bd --- /dev/null +++ b/libtomcrypt/src/pk/pkcs1/pkcs_1_mgf1.c @@ -0,0 +1,108 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file pkcs_1_mgf1.c + The Mask Generation Function (MGF1) for PKCS #1, Tom St Denis +*/ + +#ifdef PKCS_1 + +/** + Perform PKCS #1 MGF1 (internal) + @param seed The seed for MGF1 + @param seedlen The length of the seed + @param hash_idx The index of the hash desired + @param mask [out] The destination + @param masklen The length of the mask desired + @return CRYPT_OK if successful +*/ +int pkcs_1_mgf1(int hash_idx, + const unsigned char *seed, unsigned long seedlen, + unsigned char *mask, unsigned long masklen) +{ + unsigned long hLen, x; + ulong32 counter; + int err; + hash_state *md; + unsigned char *buf; + + LTC_ARGCHK(seed != NULL); + LTC_ARGCHK(mask != NULL); + + /* ensure valid hash */ + if ((err = hash_is_valid(hash_idx)) != CRYPT_OK) { + return err; + } + + /* get hash output size */ + hLen = hash_descriptor[hash_idx].hashsize; + + /* allocate memory */ + md = XMALLOC(sizeof(hash_state)); + buf = XMALLOC(hLen); + if (md == NULL || buf == NULL) { + if (md != NULL) { + XFREE(md); + } + if (buf != NULL) { + XFREE(buf); + } + return CRYPT_MEM; + } + + /* start counter */ + counter = 0; + + while (masklen > 0) { + /* handle counter */ + STORE32H(counter, buf); + ++counter; + + /* get hash of seed || counter */ + if ((err = hash_descriptor[hash_idx].init(md)) != CRYPT_OK) { + goto LBL_ERR; + } + if ((err = hash_descriptor[hash_idx].process(md, seed, seedlen)) != CRYPT_OK) { + goto LBL_ERR; + } + if ((err = hash_descriptor[hash_idx].process(md, buf, 4)) != CRYPT_OK) { + goto LBL_ERR; + } + if ((err = hash_descriptor[hash_idx].done(md, buf)) != CRYPT_OK) { + goto LBL_ERR; + } + + /* store it */ + for (x = 0; x < hLen && masklen > 0; x++, masklen--) { + *mask++ = buf[x]; + } + } + + err = CRYPT_OK; +LBL_ERR: +#ifdef LTC_CLEAN_STACK + zeromem(buf, hLen); + zeromem(md, sizeof(hash_state)); +#endif + + XFREE(buf); + XFREE(md); + + return err; +} + +#endif /* PKCS_1 */ + +/* $Source: /cvs/libtom/libtomcrypt/src/pk/pkcs1/pkcs_1_mgf1.c,v $ */ +/* $Revision: 1.6 $ */ +/* $Date: 2006/03/31 14:15:35 $ */ diff --git a/libtomcrypt/src/pk/pkcs1/pkcs_1_oaep_decode.c b/libtomcrypt/src/pk/pkcs1/pkcs_1_oaep_decode.c new file mode 100644 index 0000000..e70a016 --- /dev/null +++ b/libtomcrypt/src/pk/pkcs1/pkcs_1_oaep_decode.c @@ -0,0 +1,189 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file pkcs_1_oaep_decode.c + OAEP Padding for PKCS #1, Tom St Denis +*/ + +#ifdef PKCS_1 + +/** + PKCS #1 v2.00 OAEP decode + @param msg The encoded data to decode + @param msglen The length of the encoded data (octets) + @param lparam The session or system data (can be NULL) + @param lparamlen The length of the lparam + @param modulus_bitlen The bit length of the RSA modulus + @param hash_idx The index of the hash desired + @param out [out] Destination of decoding + @param outlen [in/out] The max size and resulting size of the decoding + @param res [out] Result of decoding, 1==valid, 0==invalid + @return CRYPT_OK if successful (even if invalid) +*/ +int pkcs_1_oaep_decode(const unsigned char *msg, unsigned long msglen, + const unsigned char *lparam, unsigned long lparamlen, + unsigned long modulus_bitlen, int hash_idx, + unsigned char *out, unsigned long *outlen, + int *res) +{ + unsigned char *DB, *seed, *mask; + unsigned long hLen, x, y, modulus_len; + int err; + + LTC_ARGCHK(msg != NULL); + LTC_ARGCHK(out != NULL); + LTC_ARGCHK(outlen != NULL); + LTC_ARGCHK(res != NULL); + + /* default to invalid packet */ + *res = 0; + + /* test valid hash */ + if ((err = hash_is_valid(hash_idx)) != CRYPT_OK) { + return err; + } + hLen = hash_descriptor[hash_idx].hashsize; + modulus_len = (modulus_bitlen >> 3) + (modulus_bitlen & 7 ? 1 : 0); + + /* test hash/message size */ + if ((2*hLen >= (modulus_len - 2)) || (msglen != modulus_len)) { + return CRYPT_PK_INVALID_SIZE; + } + + /* allocate ram for DB/mask/salt of size modulus_len */ + DB = XMALLOC(modulus_len); + mask = XMALLOC(modulus_len); + seed = XMALLOC(hLen); + if (DB == NULL || mask == NULL || seed == NULL) { + if (DB != NULL) { + XFREE(DB); + } + if (mask != NULL) { + XFREE(mask); + } + if (seed != NULL) { + XFREE(seed); + } + return CRYPT_MEM; + } + + /* ok so it's now in the form + + 0x00 || maskedseed || maskedDB + + 1 || hLen || modulus_len - hLen - 1 + + */ + + /* must have leading 0x00 byte */ + if (msg[0] != 0x00) { + err = CRYPT_OK; + goto LBL_ERR; + } + + /* now read the masked seed */ + x = 1; + XMEMCPY(seed, msg + x, hLen); + x += hLen; + + /* now read the masked DB */ + XMEMCPY(DB, msg + x, modulus_len - hLen - 1); + x += modulus_len - hLen - 1; + + /* compute MGF1 of maskedDB (hLen) */ + if ((err = pkcs_1_mgf1(hash_idx, DB, modulus_len - hLen - 1, mask, hLen)) != CRYPT_OK) { + goto LBL_ERR; + } + + /* XOR against seed */ + for (y = 0; y < hLen; y++) { + seed[y] ^= mask[y]; + } + + /* compute MGF1 of seed (k - hlen - 1) */ + if ((err = pkcs_1_mgf1(hash_idx, seed, hLen, mask, modulus_len - hLen - 1)) != CRYPT_OK) { + goto LBL_ERR; + } + + /* xor against DB */ + for (y = 0; y < (modulus_len - hLen - 1); y++) { + DB[y] ^= mask[y]; + } + + /* now DB == lhash || PS || 0x01 || M, PS == k - mlen - 2hlen - 2 zeroes */ + + /* compute lhash and store it in seed [reuse temps!] */ + x = modulus_len; + if (lparam != NULL) { + if ((err = hash_memory(hash_idx, lparam, lparamlen, seed, &x)) != CRYPT_OK) { + goto LBL_ERR; + } + } else { + /* can't pass hash_memory a NULL so use DB with zero length */ + if ((err = hash_memory(hash_idx, DB, 0, seed, &x)) != CRYPT_OK) { + goto LBL_ERR; + } + } + + /* compare the lhash'es */ + if (XMEMCMP(seed, DB, hLen) != 0) { + err = CRYPT_OK; + goto LBL_ERR; + } + + /* now zeroes before a 0x01 */ + for (x = hLen; x < (modulus_len - hLen - 1) && DB[x] == 0x00; x++) { + /* step... */ + } + + /* error out if wasn't 0x01 */ + if (x == (modulus_len - hLen - 1) || DB[x] != 0x01) { + err = CRYPT_INVALID_PACKET; + goto LBL_ERR; + } + + /* rest is the message (and skip 0x01) */ + if ((modulus_len - hLen - 1 - ++x) > *outlen) { + *outlen = modulus_len - hLen - 1 - x; + err = CRYPT_BUFFER_OVERFLOW; + goto LBL_ERR; + } + + /* copy message */ + *outlen = modulus_len - hLen - 1 - x; + XMEMCPY(out, DB + x, modulus_len - hLen - 1 - x); + x += modulus_len - hLen - 1; + + /* valid packet */ + *res = 1; + + err = CRYPT_OK; +LBL_ERR: +#ifdef LTC_CLEAN_STACK + zeromem(DB, modulus_len); + zeromem(seed, hLen); + zeromem(mask, modulus_len); +#endif + + XFREE(seed); + XFREE(mask); + XFREE(DB); + + return err; +} + +#endif /* PKCS_1 */ + +/* $Source: /cvs/libtom/libtomcrypt/src/pk/pkcs1/pkcs_1_oaep_decode.c,v $ */ +/* $Revision: 1.11 $ */ +/* $Date: 2006/11/01 09:28:17 $ */ diff --git a/libtomcrypt/src/pk/pkcs1/pkcs_1_oaep_encode.c b/libtomcrypt/src/pk/pkcs1/pkcs_1_oaep_encode.c new file mode 100644 index 0000000..99e1ac6 --- /dev/null +++ b/libtomcrypt/src/pk/pkcs1/pkcs_1_oaep_encode.c @@ -0,0 +1,173 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file pkcs_1_oaep_encode.c + OAEP Padding for PKCS #1, Tom St Denis +*/ + +#ifdef PKCS_1 + +/** + PKCS #1 v2.00 OAEP encode + @param msg The data to encode + @param msglen The length of the data to encode (octets) + @param lparam A session or system parameter (can be NULL) + @param lparamlen The length of the lparam data + @param modulus_bitlen The bit length of the RSA modulus + @param prng An active PRNG state + @param prng_idx The index of the PRNG desired + @param hash_idx The index of the hash desired + @param out [out] The destination for the encoded data + @param outlen [in/out] The max size and resulting size of the encoded data + @return CRYPT_OK if successful +*/ +int pkcs_1_oaep_encode(const unsigned char *msg, unsigned long msglen, + const unsigned char *lparam, unsigned long lparamlen, + unsigned long modulus_bitlen, prng_state *prng, + int prng_idx, int hash_idx, + unsigned char *out, unsigned long *outlen) +{ + unsigned char *DB, *seed, *mask; + unsigned long hLen, x, y, modulus_len; + int err; + + LTC_ARGCHK(msg != NULL); + LTC_ARGCHK(out != NULL); + LTC_ARGCHK(outlen != NULL); + + /* test valid hash */ + if ((err = hash_is_valid(hash_idx)) != CRYPT_OK) { + return err; + } + + /* valid prng */ + if ((err = prng_is_valid(prng_idx)) != CRYPT_OK) { + return err; + } + + hLen = hash_descriptor[hash_idx].hashsize; + modulus_len = (modulus_bitlen >> 3) + (modulus_bitlen & 7 ? 1 : 0); + + /* test message size */ + if ((2*hLen >= (modulus_len - 2)) || (msglen > (modulus_len - 2*hLen - 2))) { + return CRYPT_PK_INVALID_SIZE; + } + + /* allocate ram for DB/mask/salt of size modulus_len */ + DB = XMALLOC(modulus_len); + mask = XMALLOC(modulus_len); + seed = XMALLOC(hLen); + if (DB == NULL || mask == NULL || seed == NULL) { + if (DB != NULL) { + XFREE(DB); + } + if (mask != NULL) { + XFREE(mask); + } + if (seed != NULL) { + XFREE(seed); + } + return CRYPT_MEM; + } + + /* get lhash */ + /* DB == lhash || PS || 0x01 || M, PS == k - mlen - 2hlen - 2 zeroes */ + x = modulus_len; + if (lparam != NULL) { + if ((err = hash_memory(hash_idx, lparam, lparamlen, DB, &x)) != CRYPT_OK) { + goto LBL_ERR; + } + } else { + /* can't pass hash_memory a NULL so use DB with zero length */ + if ((err = hash_memory(hash_idx, DB, 0, DB, &x)) != CRYPT_OK) { + goto LBL_ERR; + } + } + + /* append PS then 0x01 (to lhash) */ + x = hLen; + y = modulus_len - msglen - 2*hLen - 2; + XMEMSET(DB+x, 0, y); + x += y; + + /* 0x01 byte */ + DB[x++] = 0x01; + + /* message (length = msglen) */ + XMEMCPY(DB+x, msg, msglen); + x += msglen; + + /* now choose a random seed */ + if (prng_descriptor[prng_idx].read(seed, hLen, prng) != hLen) { + err = CRYPT_ERROR_READPRNG; + goto LBL_ERR; + } + + /* compute MGF1 of seed (k - hlen - 1) */ + if ((err = pkcs_1_mgf1(hash_idx, seed, hLen, mask, modulus_len - hLen - 1)) != CRYPT_OK) { + goto LBL_ERR; + } + + /* xor against DB */ + for (y = 0; y < (modulus_len - hLen - 1); y++) { + DB[y] ^= mask[y]; + } + + /* compute MGF1 of maskedDB (hLen) */ + if ((err = pkcs_1_mgf1(hash_idx, DB, modulus_len - hLen - 1, mask, hLen)) != CRYPT_OK) { + goto LBL_ERR; + } + + /* XOR against seed */ + for (y = 0; y < hLen; y++) { + seed[y] ^= mask[y]; + } + + /* create string of length modulus_len */ + if (*outlen < modulus_len) { + *outlen = modulus_len; + err = CRYPT_BUFFER_OVERFLOW; + goto LBL_ERR; + } + + /* start output which is 0x00 || maskedSeed || maskedDB */ + x = 0; + out[x++] = 0x00; + XMEMCPY(out+x, seed, hLen); + x += hLen; + XMEMCPY(out+x, DB, modulus_len - hLen - 1); + x += modulus_len - hLen - 1; + + *outlen = x; + + err = CRYPT_OK; +LBL_ERR: +#ifdef LTC_CLEAN_STACK + zeromem(DB, modulus_len); + zeromem(seed, hLen); + zeromem(mask, modulus_len); +#endif + + XFREE(seed); + XFREE(mask); + XFREE(DB); + + return err; +} + +#endif /* PKCS_1 */ + + +/* $Source: /cvs/libtom/libtomcrypt/src/pk/pkcs1/pkcs_1_oaep_encode.c,v $ */ +/* $Revision: 1.7 $ */ +/* $Date: 2006/06/16 21:53:41 $ */ diff --git a/libtomcrypt/src/pk/pkcs1/pkcs_1_os2ip.c b/libtomcrypt/src/pk/pkcs1/pkcs_1_os2ip.c new file mode 100644 index 0000000..563ae8d --- /dev/null +++ b/libtomcrypt/src/pk/pkcs1/pkcs_1_os2ip.c @@ -0,0 +1,36 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file pkcs_1_os2ip.c + Octet to Integer OS2IP, Tom St Denis +*/ +#ifdef PKCS_1 + +/** + Read a binary string into an mp_int + @param n [out] The mp_int destination + @param in The binary string to read + @param inlen The length of the binary string + @return CRYPT_OK if successful +*/ +int pkcs_1_os2ip(void *n, unsigned char *in, unsigned long inlen) +{ + return mp_read_unsigned_bin(n, in, inlen); +} + +#endif /* PKCS_1 */ + + +/* $Source: /cvs/libtom/libtomcrypt/src/pk/pkcs1/pkcs_1_os2ip.c,v $ */ +/* $Revision: 1.5 $ */ +/* $Date: 2006/03/31 14:15:35 $ */ diff --git a/libtomcrypt/src/pk/pkcs1/pkcs_1_pss_decode.c b/libtomcrypt/src/pk/pkcs1/pkcs_1_pss_decode.c new file mode 100644 index 0000000..2c16d50 --- /dev/null +++ b/libtomcrypt/src/pk/pkcs1/pkcs_1_pss_decode.c @@ -0,0 +1,177 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file pkcs_1_pss_decode.c + PKCS #1 PSS Signature Padding, Tom St Denis +*/ + +#ifdef PKCS_1 + +/** + PKCS #1 v2.00 PSS decode + @param msghash The hash to verify + @param msghashlen The length of the hash (octets) + @param sig The signature data (encoded data) + @param siglen The length of the signature data (octets) + @param saltlen The length of the salt used (octets) + @param hash_idx The index of the hash desired + @param modulus_bitlen The bit length of the RSA modulus + @param res [out] The result of the comparison, 1==valid, 0==invalid + @return CRYPT_OK if successful (even if the comparison failed) +*/ +int pkcs_1_pss_decode(const unsigned char *msghash, unsigned long msghashlen, + const unsigned char *sig, unsigned long siglen, + unsigned long saltlen, int hash_idx, + unsigned long modulus_bitlen, int *res) +{ + unsigned char *DB, *mask, *salt, *hash; + unsigned long x, y, hLen, modulus_len; + int err; + hash_state md; + + LTC_ARGCHK(msghash != NULL); + LTC_ARGCHK(res != NULL); + + /* default to invalid */ + *res = 0; + + /* ensure hash is valid */ + if ((err = hash_is_valid(hash_idx)) != CRYPT_OK) { + return err; + } + + hLen = hash_descriptor[hash_idx].hashsize; + modulus_len = (modulus_bitlen>>3) + (modulus_bitlen & 7 ? 1 : 0); + + /* check sizes */ + if ((saltlen > modulus_len) || + (modulus_len < hLen + saltlen + 2) || (siglen != modulus_len)) { + return CRYPT_PK_INVALID_SIZE; + } + + /* allocate ram for DB/mask/salt/hash of size modulus_len */ + DB = XMALLOC(modulus_len); + mask = XMALLOC(modulus_len); + salt = XMALLOC(modulus_len); + hash = XMALLOC(modulus_len); + if (DB == NULL || mask == NULL || salt == NULL || hash == NULL) { + if (DB != NULL) { + XFREE(DB); + } + if (mask != NULL) { + XFREE(mask); + } + if (salt != NULL) { + XFREE(salt); + } + if (hash != NULL) { + XFREE(hash); + } + return CRYPT_MEM; + } + + /* ensure the 0xBC byte */ + if (sig[siglen-1] != 0xBC) { + err = CRYPT_INVALID_PACKET; + goto LBL_ERR; + } + + /* copy out the DB */ + x = 0; + XMEMCPY(DB, sig + x, modulus_len - hLen - 1); + x += modulus_len - hLen - 1; + + /* copy out the hash */ + XMEMCPY(hash, sig + x, hLen); + x += hLen; + + /* check the MSB */ + if ((sig[0] & ~(0xFF >> ((modulus_len<<3) - (modulus_bitlen-1)))) != 0) { + err = CRYPT_INVALID_PACKET; + goto LBL_ERR; + } + + /* generate mask of length modulus_len - hLen - 1 from hash */ + if ((err = pkcs_1_mgf1(hash_idx, hash, hLen, mask, modulus_len - hLen - 1)) != CRYPT_OK) { + goto LBL_ERR; + } + + /* xor against DB */ + for (y = 0; y < (modulus_len - hLen - 1); y++) { + DB[y] ^= mask[y]; + } + + /* now clear the first byte [make sure smaller than modulus] */ + DB[0] &= 0xFF >> ((modulus_len<<3) - (modulus_bitlen-1)); + + /* DB = PS || 0x01 || salt, PS == modulus_len - saltlen - hLen - 2 zero bytes */ + + /* check for zeroes and 0x01 */ + for (x = 0; x < modulus_len - saltlen - hLen - 2; x++) { + if (DB[x] != 0x00) { + err = CRYPT_INVALID_PACKET; + goto LBL_ERR; + } + } + + /* check for the 0x01 */ + if (DB[x++] != 0x01) { + err = CRYPT_INVALID_PACKET; + goto LBL_ERR; + } + + /* M = (eight) 0x00 || msghash || salt, mask = H(M) */ + if ((err = hash_descriptor[hash_idx].init(&md)) != CRYPT_OK) { + goto LBL_ERR; + } + zeromem(mask, 8); + if ((err = hash_descriptor[hash_idx].process(&md, mask, 8)) != CRYPT_OK) { + goto LBL_ERR; + } + if ((err = hash_descriptor[hash_idx].process(&md, msghash, msghashlen)) != CRYPT_OK) { + goto LBL_ERR; + } + if ((err = hash_descriptor[hash_idx].process(&md, DB+x, saltlen)) != CRYPT_OK) { + goto LBL_ERR; + } + if ((err = hash_descriptor[hash_idx].done(&md, mask)) != CRYPT_OK) { + goto LBL_ERR; + } + + /* mask == hash means valid signature */ + if (XMEMCMP(mask, hash, hLen) == 0) { + *res = 1; + } + + err = CRYPT_OK; +LBL_ERR: +#ifdef LTC_CLEAN_STACK + zeromem(DB, modulus_len); + zeromem(mask, modulus_len); + zeromem(salt, modulus_len); + zeromem(hash, modulus_len); +#endif + + XFREE(hash); + XFREE(salt); + XFREE(mask); + XFREE(DB); + + return err; +} + +#endif /* PKCS_1 */ + +/* $Source: /cvs/libtom/libtomcrypt/src/pk/pkcs1/pkcs_1_pss_decode.c,v $ */ +/* $Revision: 1.9 $ */ +/* $Date: 2006/11/30 02:37:21 $ */ diff --git a/libtomcrypt/src/pk/pkcs1/pkcs_1_pss_encode.c b/libtomcrypt/src/pk/pkcs1/pkcs_1_pss_encode.c new file mode 100644 index 0000000..64bd312 --- /dev/null +++ b/libtomcrypt/src/pk/pkcs1/pkcs_1_pss_encode.c @@ -0,0 +1,175 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file pkcs_1_pss_encode.c + PKCS #1 PSS Signature Padding, Tom St Denis +*/ + +#ifdef PKCS_1 + +/** + PKCS #1 v2.00 Signature Encoding + @param msghash The hash to encode + @param msghashlen The length of the hash (octets) + @param saltlen The length of the salt desired (octets) + @param prng An active PRNG context + @param prng_idx The index of the PRNG desired + @param hash_idx The index of the hash desired + @param modulus_bitlen The bit length of the RSA modulus + @param out [out] The destination of the encoding + @param outlen [in/out] The max size and resulting size of the encoded data + @return CRYPT_OK if successful +*/ +int pkcs_1_pss_encode(const unsigned char *msghash, unsigned long msghashlen, + unsigned long saltlen, prng_state *prng, + int prng_idx, int hash_idx, + unsigned long modulus_bitlen, + unsigned char *out, unsigned long *outlen) +{ + unsigned char *DB, *mask, *salt, *hash; + unsigned long x, y, hLen, modulus_len; + int err; + hash_state md; + + LTC_ARGCHK(msghash != NULL); + LTC_ARGCHK(out != NULL); + LTC_ARGCHK(outlen != NULL); + + /* ensure hash and PRNG are valid */ + if ((err = hash_is_valid(hash_idx)) != CRYPT_OK) { + return err; + } + if ((err = prng_is_valid(prng_idx)) != CRYPT_OK) { + return err; + } + + hLen = hash_descriptor[hash_idx].hashsize; + modulus_len = (modulus_bitlen>>3) + (modulus_bitlen & 7 ? 1 : 0); + + /* check sizes */ + if ((saltlen > modulus_len) || (modulus_len < hLen + saltlen + 2)) { + return CRYPT_PK_INVALID_SIZE; + } + + /* allocate ram for DB/mask/salt/hash of size modulus_len */ + DB = XMALLOC(modulus_len); + mask = XMALLOC(modulus_len); + salt = XMALLOC(modulus_len); + hash = XMALLOC(modulus_len); + if (DB == NULL || mask == NULL || salt == NULL || hash == NULL) { + if (DB != NULL) { + XFREE(DB); + } + if (mask != NULL) { + XFREE(mask); + } + if (salt != NULL) { + XFREE(salt); + } + if (hash != NULL) { + XFREE(hash); + } + return CRYPT_MEM; + } + + + /* generate random salt */ + if (saltlen > 0) { + if (prng_descriptor[prng_idx].read(salt, saltlen, prng) != saltlen) { + err = CRYPT_ERROR_READPRNG; + goto LBL_ERR; + } + } + + /* M = (eight) 0x00 || msghash || salt, hash = H(M) */ + if ((err = hash_descriptor[hash_idx].init(&md)) != CRYPT_OK) { + goto LBL_ERR; + } + zeromem(DB, 8); + if ((err = hash_descriptor[hash_idx].process(&md, DB, 8)) != CRYPT_OK) { + goto LBL_ERR; + } + if ((err = hash_descriptor[hash_idx].process(&md, msghash, msghashlen)) != CRYPT_OK) { + goto LBL_ERR; + } + if ((err = hash_descriptor[hash_idx].process(&md, salt, saltlen)) != CRYPT_OK) { + goto LBL_ERR; + } + if ((err = hash_descriptor[hash_idx].done(&md, hash)) != CRYPT_OK) { + goto LBL_ERR; + } + + /* generate DB = PS || 0x01 || salt, PS == modulus_len - saltlen - hLen - 2 zero bytes */ + x = 0; + XMEMSET(DB + x, 0, modulus_len - saltlen - hLen - 2); + x += modulus_len - saltlen - hLen - 2; + DB[x++] = 0x01; + XMEMCPY(DB + x, salt, saltlen); + x += saltlen; + + /* generate mask of length modulus_len - hLen - 1 from hash */ + if ((err = pkcs_1_mgf1(hash_idx, hash, hLen, mask, modulus_len - hLen - 1)) != CRYPT_OK) { + goto LBL_ERR; + } + + /* xor against DB */ + for (y = 0; y < (modulus_len - hLen - 1); y++) { + DB[y] ^= mask[y]; + } + + /* output is DB || hash || 0xBC */ + if (*outlen < modulus_len) { + *outlen = modulus_len; + err = CRYPT_BUFFER_OVERFLOW; + goto LBL_ERR; + } + + /* DB len = modulus_len - hLen - 1 */ + y = 0; + XMEMCPY(out + y, DB, modulus_len - hLen - 1); + y += modulus_len - hLen - 1; + + /* hash */ + XMEMCPY(out + y, hash, hLen); + y += hLen; + + /* 0xBC */ + out[y] = 0xBC; + + /* now clear the 8*modulus_len - modulus_bitlen most significant bits */ + out[0] &= 0xFF >> ((modulus_len<<3) - (modulus_bitlen-1)); + + /* store output size */ + *outlen = modulus_len; + err = CRYPT_OK; +LBL_ERR: +#ifdef LTC_CLEAN_STACK + zeromem(DB, modulus_len); + zeromem(mask, modulus_len); + zeromem(salt, modulus_len); + zeromem(hash, modulus_len); +#endif + + XFREE(hash); + XFREE(salt); + XFREE(mask); + XFREE(DB); + + return err; +} + +#endif /* PKCS_1 */ + +/* $Source: /cvs/libtom/libtomcrypt/src/pk/pkcs1/pkcs_1_pss_encode.c,v $ */ +/* $Revision: 1.7 $ */ +/* $Date: 2006/06/16 21:53:41 $ */ diff --git a/libtomcrypt/src/pk/pkcs1/pkcs_1_v1_5_decode.c b/libtomcrypt/src/pk/pkcs1/pkcs_1_v1_5_decode.c new file mode 100644 index 0000000..b0a7c2d --- /dev/null +++ b/libtomcrypt/src/pk/pkcs1/pkcs_1_v1_5_decode.c @@ -0,0 +1,110 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** @file pkcs_1_v1_5_decode.c + * + * PKCS #1 v1.5 Padding. (Andreas Lange) + */ + +#ifdef PKCS_1 + +/** @brief PKCS #1 v1.5 decode. + * + * @param msg The encoded data to decode + * @param msglen The length of the encoded data (octets) + * @param block_type Block type to use in padding (\sa ltc_pkcs_1_v1_5_blocks) + * @param modulus_bitlen The bit length of the RSA modulus + * @param out [out] Destination of decoding + * @param outlen [in/out] The max size and resulting size of the decoding + * @param is_valid [out] Boolean whether the padding was valid + * + * @return CRYPT_OK if successful (even if invalid) + */ +int pkcs_1_v1_5_decode(const unsigned char *msg, + unsigned long msglen, + int block_type, + unsigned long modulus_bitlen, + unsigned char *out, + unsigned long *outlen, + int *is_valid) +{ + unsigned long modulus_len, ps_len, i; + int result; + + /* default to invalid packet */ + *is_valid = 0; + + modulus_len = (modulus_bitlen >> 3) + (modulus_bitlen & 7 ? 1 : 0); + + /* test message size */ + + if ((msglen > modulus_len) || (modulus_len < 11)) { + return CRYPT_PK_INVALID_SIZE; + } + + /* separate encoded message */ + + if ((msg[0] != 0x00) || (msg[1] != (unsigned char)block_type)) { + result = CRYPT_INVALID_PACKET; + goto bail; + } + + if (block_type == LTC_PKCS_1_EME) { + for (i = 2; i < modulus_len; i++) { + /* separator */ + if (msg[i] == 0x00) { break; } + } + ps_len = i++ - 2; + + if ((i >= modulus_len) || (ps_len < 8)) { + /* There was no octet with hexadecimal value 0x00 to separate ps from m, + * or the length of ps is less than 8 octets. + */ + result = CRYPT_INVALID_PACKET; + goto bail; + } + } else { + for (i = 2; i < modulus_len - 1; i++) { + if (msg[i] != 0xFF) { break; } + } + + /* separator check */ + if (msg[i] != 0) { + /* There was no octet with hexadecimal value 0x00 to separate ps from m. */ + result = CRYPT_INVALID_PACKET; + goto bail; + } + + ps_len = i - 2; + } + + if (*outlen < (msglen - (2 + ps_len + 1))) { + *outlen = msglen - (2 + ps_len + 1); + result = CRYPT_BUFFER_OVERFLOW; + goto bail; + } + + *outlen = (msglen - (2 + ps_len + 1)); + XMEMCPY(out, &msg[2 + ps_len + 1], *outlen); + + /* valid packet */ + *is_valid = 1; + result = CRYPT_OK; +bail: + return result; +} /* pkcs_1_v1_5_decode */ + +#endif /* #ifdef PKCS_1 */ + +/* $Source: /cvs/libtom/libtomcrypt/src/pk/pkcs1/pkcs_1_v1_5_decode.c,v $ */ +/* $Revision: 1.5 $ */ +/* $Date: 2006/12/16 17:41:21 $ */ diff --git a/libtomcrypt/src/pk/pkcs1/pkcs_1_v1_5_encode.c b/libtomcrypt/src/pk/pkcs1/pkcs_1_v1_5_encode.c new file mode 100644 index 0000000..7edd1e6 --- /dev/null +++ b/libtomcrypt/src/pk/pkcs1/pkcs_1_v1_5_encode.c @@ -0,0 +1,111 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/*! \file pkcs_1_v1_5_encode.c + * + * PKCS #1 v1.5 Padding (Andreas Lange) + */ + +#ifdef PKCS_1 + +/*! \brief PKCS #1 v1.5 encode. + * + * \param msg The data to encode + * \param msglen The length of the data to encode (octets) + * \param block_type Block type to use in padding (\sa ltc_pkcs_1_v1_5_blocks) + * \param modulus_bitlen The bit length of the RSA modulus + * \param prng An active PRNG state (only for LTC_PKCS_1_EME) + * \param prng_idx The index of the PRNG desired (only for LTC_PKCS_1_EME) + * \param out [out] The destination for the encoded data + * \param outlen [in/out] The max size and resulting size of the encoded data + * + * \return CRYPT_OK if successful + */ +int pkcs_1_v1_5_encode(const unsigned char *msg, + unsigned long msglen, + int block_type, + unsigned long modulus_bitlen, + prng_state *prng, + int prng_idx, + unsigned char *out, + unsigned long *outlen) +{ + unsigned long modulus_len, ps_len, i; + unsigned char *ps; + int result; + + /* valid block_type? */ + if ((block_type != LTC_PKCS_1_EMSA) && + (block_type != LTC_PKCS_1_EME)) { + return CRYPT_PK_INVALID_PADDING; + } + + if (block_type == LTC_PKCS_1_EME) { /* encryption padding, we need a valid PRNG */ + if ((result = prng_is_valid(prng_idx)) != CRYPT_OK) { + return result; + } + } + + modulus_len = (modulus_bitlen >> 3) + (modulus_bitlen & 7 ? 1 : 0); + + /* test message size */ + if ((msglen + 11) > modulus_len) { + return CRYPT_PK_INVALID_SIZE; + } + + if (*outlen < modulus_len) { + *outlen = modulus_len; + result = CRYPT_BUFFER_OVERFLOW; + goto bail; + } + + /* generate an octets string PS */ + ps = &out[2]; + ps_len = modulus_len - msglen - 3; + + if (block_type == LTC_PKCS_1_EME) { + /* now choose a random ps */ + if (prng_descriptor[prng_idx].read(ps, ps_len, prng) != ps_len) { + result = CRYPT_ERROR_READPRNG; + goto bail; + } + + /* transform zero bytes (if any) to non-zero random bytes */ + for (i = 0; i < ps_len; i++) { + while (ps[i] == 0) { + if (prng_descriptor[prng_idx].read(&ps[i], 1, prng) != 1) { + result = CRYPT_ERROR_READPRNG; + goto bail; + } + } + } + } else { + XMEMSET(ps, 0xFF, ps_len); + } + + /* create string of length modulus_len */ + out[0] = 0x00; + out[1] = (unsigned char)block_type; /* block_type 1 or 2 */ + out[2 + ps_len] = 0x00; + XMEMCPY(&out[2 + ps_len + 1], msg, msglen); + *outlen = modulus_len; + + result = CRYPT_OK; +bail: + return result; +} /* pkcs_1_v1_5_encode */ + +#endif /* #ifdef PKCS_1 */ + +/* $Source: /cvs/libtom/libtomcrypt/src/pk/pkcs1/pkcs_1_v1_5_encode.c,v $ */ +/* $Revision: 1.2 $ */ +/* $Date: 2006/11/01 09:12:06 $ */ diff --git a/libtomcrypt/src/pk/rsa/rsa_decrypt_key.c b/libtomcrypt/src/pk/rsa/rsa_decrypt_key.c new file mode 100644 index 0000000..3dce20f --- /dev/null +++ b/libtomcrypt/src/pk/rsa/rsa_decrypt_key.c @@ -0,0 +1,105 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file rsa_decrypt_key.c + RSA PKCS #1 Decryption, Tom St Denis and Andreas Lange +*/ + +#ifdef MRSA + +/** + PKCS #1 decrypt then v1.5 or OAEP depad + @param in The ciphertext + @param inlen The length of the ciphertext (octets) + @param out [out] The plaintext + @param outlen [in/out] The max size and resulting size of the plaintext (octets) + @param lparam The system "lparam" value + @param lparamlen The length of the lparam value (octets) + @param hash_idx The index of the hash desired + @param padding Type of padding (LTC_PKCS_1_OAEP or LTC_PKCS_1_V1_5) + @param stat [out] Result of the decryption, 1==valid, 0==invalid + @param key The corresponding private RSA key + @return CRYPT_OK if succcessul (even if invalid) +*/ +int rsa_decrypt_key_ex(const unsigned char *in, unsigned long inlen, + unsigned char *out, unsigned long *outlen, + const unsigned char *lparam, unsigned long lparamlen, + int hash_idx, int padding, + int *stat, rsa_key *key) +{ + unsigned long modulus_bitlen, modulus_bytelen, x; + int err; + unsigned char *tmp; + + LTC_ARGCHK(out != NULL); + LTC_ARGCHK(outlen != NULL); + LTC_ARGCHK(key != NULL); + LTC_ARGCHK(stat != NULL); + + /* default to invalid */ + *stat = 0; + + /* valid padding? */ + + if ((padding != LTC_PKCS_1_V1_5) && + (padding != LTC_PKCS_1_OAEP)) { + return CRYPT_PK_INVALID_PADDING; + } + + if (padding == LTC_PKCS_1_OAEP) { + /* valid hash ? */ + if ((err = hash_is_valid(hash_idx)) != CRYPT_OK) { + return err; + } + } + + /* get modulus len in bits */ + modulus_bitlen = mp_count_bits( (key->N)); + + /* outlen must be at least the size of the modulus */ + modulus_bytelen = mp_unsigned_bin_size( (key->N)); + if (modulus_bytelen != inlen) { + return CRYPT_INVALID_PACKET; + } + + /* allocate ram */ + tmp = XMALLOC(inlen); + if (tmp == NULL) { + return CRYPT_MEM; + } + + /* rsa decode the packet */ + x = inlen; + if ((err = ltc_mp.rsa_me(in, inlen, tmp, &x, PK_PRIVATE, key)) != CRYPT_OK) { + XFREE(tmp); + return err; + } + + if (padding == LTC_PKCS_1_OAEP) { + /* now OAEP decode the packet */ + err = pkcs_1_oaep_decode(tmp, x, lparam, lparamlen, modulus_bitlen, hash_idx, + out, outlen, stat); + } else { + /* now PKCS #1 v1.5 depad the packet */ + err = pkcs_1_v1_5_decode(tmp, x, LTC_PKCS_1_EME, modulus_bitlen, out, outlen, stat); + } + + XFREE(tmp); + return err; +} + +#endif /* MRSA */ + +/* $Source: /cvs/libtom/libtomcrypt/src/pk/rsa/rsa_decrypt_key.c,v $ */ +/* $Revision: 1.8 $ */ +/* $Date: 2006/11/01 09:18:22 $ */ diff --git a/libtomcrypt/src/pk/rsa/rsa_encrypt_key.c b/libtomcrypt/src/pk/rsa/rsa_encrypt_key.c new file mode 100644 index 0000000..8d2c228 --- /dev/null +++ b/libtomcrypt/src/pk/rsa/rsa_encrypt_key.c @@ -0,0 +1,102 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file rsa_encrypt_key.c + RSA PKCS #1 encryption, Tom St Denis and Andreas Lange +*/ + +#ifdef MRSA + +/** + (PKCS #1 v2.0) OAEP pad then encrypt + @param in The plaintext + @param inlen The length of the plaintext (octets) + @param out [out] The ciphertext + @param outlen [in/out] The max size and resulting size of the ciphertext + @param lparam The system "lparam" for the encryption + @param lparamlen The length of lparam (octets) + @param prng An active PRNG + @param prng_idx The index of the desired prng + @param hash_idx The index of the desired hash + @param padding Type of padding (LTC_PKCS_1_OAEP or LTC_PKCS_1_V1_5) + @param key The RSA key to encrypt to + @return CRYPT_OK if successful +*/ +int rsa_encrypt_key_ex(const unsigned char *in, unsigned long inlen, + unsigned char *out, unsigned long *outlen, + const unsigned char *lparam, unsigned long lparamlen, + prng_state *prng, int prng_idx, int hash_idx, int padding, rsa_key *key) +{ + unsigned long modulus_bitlen, modulus_bytelen, x; + int err; + + LTC_ARGCHK(in != NULL); + LTC_ARGCHK(out != NULL); + LTC_ARGCHK(outlen != NULL); + LTC_ARGCHK(key != NULL); + + /* valid padding? */ + if ((padding != LTC_PKCS_1_V1_5) && + (padding != LTC_PKCS_1_OAEP)) { + return CRYPT_PK_INVALID_PADDING; + } + + /* valid prng? */ + if ((err = prng_is_valid(prng_idx)) != CRYPT_OK) { + return err; + } + + if (padding == LTC_PKCS_1_OAEP) { + /* valid hash? */ + if ((err = hash_is_valid(hash_idx)) != CRYPT_OK) { + return err; + } + } + + /* get modulus len in bits */ + modulus_bitlen = mp_count_bits( (key->N)); + + /* outlen must be at least the size of the modulus */ + modulus_bytelen = mp_unsigned_bin_size( (key->N)); + if (modulus_bytelen > *outlen) { + *outlen = modulus_bytelen; + return CRYPT_BUFFER_OVERFLOW; + } + + if (padding == LTC_PKCS_1_OAEP) { + /* OAEP pad the key */ + x = *outlen; + if ((err = pkcs_1_oaep_encode(in, inlen, lparam, + lparamlen, modulus_bitlen, prng, prng_idx, hash_idx, + out, &x)) != CRYPT_OK) { + return err; + } + } else { + /* PKCS #1 v1.5 pad the key */ + x = *outlen; + if ((err = pkcs_1_v1_5_encode(in, inlen, LTC_PKCS_1_EME, + modulus_bitlen, prng, prng_idx, + out, &x)) != CRYPT_OK) { + return err; + } + } + + /* rsa exptmod the OAEP or PKCS #1 v1.5 pad */ + return ltc_mp.rsa_me(out, x, out, outlen, PK_PUBLIC, key); +} + +#endif /* MRSA */ + +/* $Source: /cvs/libtom/libtomcrypt/src/pk/rsa/rsa_encrypt_key.c,v $ */ +/* $Revision: 1.8 $ */ +/* $Date: 2006/11/01 09:18:22 $ */ diff --git a/libtomcrypt/src/pk/rsa/rsa_export.c b/libtomcrypt/src/pk/rsa/rsa_export.c new file mode 100644 index 0000000..5b389ec --- /dev/null +++ b/libtomcrypt/src/pk/rsa/rsa_export.c @@ -0,0 +1,69 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file rsa_export.c + Export RSA PKCS keys, Tom St Denis +*/ + +#ifdef MRSA + +/** + This will export either an RSAPublicKey or RSAPrivateKey [defined in PKCS #1 v2.1] + @param out [out] Destination of the packet + @param outlen [in/out] The max size and resulting size of the packet + @param type The type of exported key (PK_PRIVATE or PK_PUBLIC) + @param key The RSA key to export + @return CRYPT_OK if successful +*/ +int rsa_export(unsigned char *out, unsigned long *outlen, int type, rsa_key *key) +{ + unsigned long zero=0; + LTC_ARGCHK(out != NULL); + LTC_ARGCHK(outlen != NULL); + LTC_ARGCHK(key != NULL); + + /* type valid? */ + if (!(key->type == PK_PRIVATE) && (type == PK_PRIVATE)) { + return CRYPT_PK_INVALID_TYPE; + } + + if (type == PK_PRIVATE) { + /* private key */ + /* output is + Version, n, e, d, p, q, d mod (p-1), d mod (q - 1), 1/q mod p + */ + return der_encode_sequence_multi(out, outlen, + LTC_ASN1_SHORT_INTEGER, 1UL, &zero, + LTC_ASN1_INTEGER, 1UL, key->N, + LTC_ASN1_INTEGER, 1UL, key->e, + LTC_ASN1_INTEGER, 1UL, key->d, + LTC_ASN1_INTEGER, 1UL, key->p, + LTC_ASN1_INTEGER, 1UL, key->q, + LTC_ASN1_INTEGER, 1UL, key->dP, + LTC_ASN1_INTEGER, 1UL, key->dQ, + LTC_ASN1_INTEGER, 1UL, key->qP, + LTC_ASN1_EOL, 0UL, NULL); + } else { + /* public key */ + return der_encode_sequence_multi(out, outlen, + LTC_ASN1_INTEGER, 1UL, key->N, + LTC_ASN1_INTEGER, 1UL, key->e, + LTC_ASN1_EOL, 0UL, NULL); + } +} + +#endif /* MRSA */ + +/* $Source: /cvs/libtom/libtomcrypt/src/pk/rsa/rsa_export.c,v $ */ +/* $Revision: 1.15 $ */ +/* $Date: 2006/03/31 14:15:35 $ */ diff --git a/libtomcrypt/src/pk/rsa/rsa_exptmod.c b/libtomcrypt/src/pk/rsa/rsa_exptmod.c new file mode 100644 index 0000000..53dbf6b --- /dev/null +++ b/libtomcrypt/src/pk/rsa/rsa_exptmod.c @@ -0,0 +1,113 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file rsa_exptmod.c + RSA PKCS exptmod, Tom St Denis +*/ + +#ifdef MRSA + +/** + Compute an RSA modular exponentiation + @param in The input data to send into RSA + @param inlen The length of the input (octets) + @param out [out] The destination + @param outlen [in/out] The max size and resulting size of the output + @param which Which exponent to use, e.g. PK_PRIVATE or PK_PUBLIC + @param key The RSA key to use + @return CRYPT_OK if successful +*/ +int rsa_exptmod(const unsigned char *in, unsigned long inlen, + unsigned char *out, unsigned long *outlen, int which, + rsa_key *key) +{ + void *tmp, *tmpa, *tmpb; + unsigned long x; + int err; + + LTC_ARGCHK(in != NULL); + LTC_ARGCHK(out != NULL); + LTC_ARGCHK(outlen != NULL); + LTC_ARGCHK(key != NULL); + + /* is the key of the right type for the operation? */ + if (which == PK_PRIVATE && (key->type != PK_PRIVATE)) { + return CRYPT_PK_NOT_PRIVATE; + } + + /* must be a private or public operation */ + if (which != PK_PRIVATE && which != PK_PUBLIC) { + return CRYPT_PK_INVALID_TYPE; + } + + /* init and copy into tmp */ + if ((err = mp_init_multi(&tmp, &tmpa, &tmpb, NULL)) != CRYPT_OK) { return err; } + if ((err = mp_read_unsigned_bin(tmp, (unsigned char *)in, (int)inlen)) != CRYPT_OK) { goto error; } + + /* sanity check on the input */ + if (mp_cmp(key->N, tmp) == LTC_MP_LT) { + err = CRYPT_PK_INVALID_SIZE; + goto error; + } + + /* are we using the private exponent and is the key optimized? */ + if (which == PK_PRIVATE) { + /* tmpa = tmp^dP mod p */ + if ((err = mp_exptmod(tmp, key->dP, key->p, tmpa)) != CRYPT_OK) { goto error; } + + /* tmpb = tmp^dQ mod q */ + if ((err = mp_exptmod(tmp, key->dQ, key->q, tmpb)) != CRYPT_OK) { goto error; } + + /* tmp = (tmpa - tmpb) * qInv (mod p) */ + if ((err = mp_sub(tmpa, tmpb, tmp)) != CRYPT_OK) { goto error; } + if ((err = mp_mulmod(tmp, key->qP, key->p, tmp)) != CRYPT_OK) { goto error; } + + /* tmp = tmpb + q * tmp */ + if ((err = mp_mul(tmp, key->q, tmp)) != CRYPT_OK) { goto error; } + if ((err = mp_add(tmp, tmpb, tmp)) != CRYPT_OK) { goto error; } + } else { + /* exptmod it */ + if ((err = mp_exptmod(tmp, key->e, key->N, tmp)) != CRYPT_OK) { goto error; } + } + + /* read it back */ + x = (unsigned long)mp_unsigned_bin_size(key->N); + if (x > *outlen) { + *outlen = x; + err = CRYPT_BUFFER_OVERFLOW; + goto error; + } + + /* this should never happen ... */ + if (mp_unsigned_bin_size(tmp) > mp_unsigned_bin_size(key->N)) { + err = CRYPT_ERROR; + goto error; + } + *outlen = x; + + /* convert it */ + zeromem(out, x); + if ((err = mp_to_unsigned_bin(tmp, out+(x-mp_unsigned_bin_size(tmp)))) != CRYPT_OK) { goto error; } + + /* clean up and return */ + err = CRYPT_OK; +error: + mp_clear_multi(tmp, tmpa, tmpb, NULL); + return err; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/pk/rsa/rsa_exptmod.c,v $ */ +/* $Revision: 1.16 $ */ +/* $Date: 2006/12/04 03:09:28 $ */ diff --git a/libtomcrypt/src/pk/rsa/rsa_free.c b/libtomcrypt/src/pk/rsa/rsa_free.c new file mode 100644 index 0000000..f48976a --- /dev/null +++ b/libtomcrypt/src/pk/rsa/rsa_free.c @@ -0,0 +1,34 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file rsa_free.c + Free an RSA key, Tom St Denis +*/ + +#ifdef MRSA + +/** + Free an RSA key from memory + @param key The RSA key to free +*/ +void rsa_free(rsa_key *key) +{ + LTC_ARGCHKVD(key != NULL); + mp_clear_multi(key->e, key->d, key->N, key->dQ, key->dP, key->qP, key->p, key->q, NULL); +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/pk/rsa/rsa_free.c,v $ */ +/* $Revision: 1.8 $ */ +/* $Date: 2006/12/04 22:23:27 $ */ diff --git a/libtomcrypt/src/pk/rsa/rsa_import.c b/libtomcrypt/src/pk/rsa/rsa_import.c new file mode 100644 index 0000000..7b12fd9 --- /dev/null +++ b/libtomcrypt/src/pk/rsa/rsa_import.c @@ -0,0 +1,143 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file rsa_import.c + Import a PKCS RSA key, Tom St Denis +*/ + +#ifdef MRSA + +/** + Import an RSAPublicKey or RSAPrivateKey [two-prime only, only support >= 1024-bit keys, defined in PKCS #1 v2.1] + @param in The packet to import from + @param inlen It's length (octets) + @param key [out] Destination for newly imported key + @return CRYPT_OK if successful, upon error allocated memory is freed +*/ +int rsa_import(const unsigned char *in, unsigned long inlen, rsa_key *key) +{ + int err; + void *zero; + unsigned char *tmpbuf; + unsigned long t, x, y, z, tmpoid[16]; + ltc_asn1_list ssl_pubkey_hashoid[2]; + ltc_asn1_list ssl_pubkey[2]; + + LTC_ARGCHK(in != NULL); + LTC_ARGCHK(key != NULL); + LTC_ARGCHK(ltc_mp.name != NULL); + + /* init key */ + if ((err = mp_init_multi(&key->e, &key->d, &key->N, &key->dQ, + &key->dP, &key->qP, &key->p, &key->q, NULL)) != CRYPT_OK) { + return err; + } + + /* see if the OpenSSL DER format RSA public key will work */ + tmpbuf = XCALLOC(1, MAX_RSA_SIZE*8); + if (tmpbuf == NULL) { + err = CRYPT_MEM; + goto LBL_ERR; + } + + /* this includes the internal hash ID and optional params (NULL in this case) */ + LTC_SET_ASN1(ssl_pubkey_hashoid, 0, LTC_ASN1_OBJECT_IDENTIFIER, tmpoid, sizeof(tmpoid)/sizeof(tmpoid[0])); + LTC_SET_ASN1(ssl_pubkey_hashoid, 1, LTC_ASN1_NULL, NULL, 0); + + /* the actual format of the SSL DER key is odd, it stores a RSAPublicKey in a **BIT** string ... so we have to extract it + then proceed to convert bit to octet + */ + LTC_SET_ASN1(ssl_pubkey, 0, LTC_ASN1_SEQUENCE, &ssl_pubkey_hashoid, 2); + LTC_SET_ASN1(ssl_pubkey, 1, LTC_ASN1_BIT_STRING, tmpbuf, MAX_RSA_SIZE*8); + + if (der_decode_sequence(in, inlen, + ssl_pubkey, 2UL) == CRYPT_OK) { + + /* ok now we have to reassemble the BIT STRING to an OCTET STRING. Thanks OpenSSL... */ + for (t = y = z = x = 0; x < ssl_pubkey[1].size; x++) { + y = (y << 1) | tmpbuf[x]; + if (++z == 8) { + tmpbuf[t++] = (unsigned char)y; + y = 0; + z = 0; + } + } + + /* now it should be SEQUENCE { INTEGER, INTEGER } */ + if ((err = der_decode_sequence_multi(tmpbuf, t, + LTC_ASN1_INTEGER, 1UL, key->N, + LTC_ASN1_INTEGER, 1UL, key->e, + LTC_ASN1_EOL, 0UL, NULL)) != CRYPT_OK) { + XFREE(tmpbuf); + goto LBL_ERR; + } + XFREE(tmpbuf); + key->type = PK_PUBLIC; + return CRYPT_OK; + } + XFREE(tmpbuf); + + /* not SSL public key, try to match against PKCS #1 standards */ + if ((err = der_decode_sequence_multi(in, inlen, + LTC_ASN1_INTEGER, 1UL, key->N, + LTC_ASN1_EOL, 0UL, NULL)) != CRYPT_OK) { + goto LBL_ERR; + } + + if (mp_cmp_d(key->N, 0) == LTC_MP_EQ) { + if ((err = mp_init(&zero)) != CRYPT_OK) { + goto LBL_ERR; + } + /* it's a private key */ + if ((err = der_decode_sequence_multi(in, inlen, + LTC_ASN1_INTEGER, 1UL, zero, + LTC_ASN1_INTEGER, 1UL, key->N, + LTC_ASN1_INTEGER, 1UL, key->e, + LTC_ASN1_INTEGER, 1UL, key->d, + LTC_ASN1_INTEGER, 1UL, key->p, + LTC_ASN1_INTEGER, 1UL, key->q, + LTC_ASN1_INTEGER, 1UL, key->dP, + LTC_ASN1_INTEGER, 1UL, key->dQ, + LTC_ASN1_INTEGER, 1UL, key->qP, + LTC_ASN1_EOL, 0UL, NULL)) != CRYPT_OK) { + mp_clear(zero); + goto LBL_ERR; + } + mp_clear(zero); + key->type = PK_PRIVATE; + } else if (mp_cmp_d(key->N, 1) == LTC_MP_EQ) { + /* we don't support multi-prime RSA */ + err = CRYPT_PK_INVALID_TYPE; + goto LBL_ERR; + } else { + /* it's a public key and we lack e */ + if ((err = der_decode_sequence_multi(in, inlen, + LTC_ASN1_INTEGER, 1UL, key->N, + LTC_ASN1_INTEGER, 1UL, key->e, + LTC_ASN1_EOL, 0UL, NULL)) != CRYPT_OK) { + goto LBL_ERR; + } + key->type = PK_PUBLIC; + } + return CRYPT_OK; +LBL_ERR: + mp_clear_multi(key->d, key->e, key->N, key->dQ, key->dP, key->qP, key->p, key->q, NULL); + return err; +} + +#endif /* MRSA */ + + +/* $Source: /cvs/libtom/libtomcrypt/src/pk/rsa/rsa_import.c,v $ */ +/* $Revision: 1.21 $ */ +/* $Date: 2006/12/04 22:23:27 $ */ diff --git a/libtomcrypt/src/pk/rsa/rsa_make_key.c b/libtomcrypt/src/pk/rsa/rsa_make_key.c new file mode 100644 index 0000000..bd2a29b --- /dev/null +++ b/libtomcrypt/src/pk/rsa/rsa_make_key.c @@ -0,0 +1,112 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file rsa_make_key.c + RSA key generation, Tom St Denis +*/ + +#ifdef MRSA + +/** + Create an RSA key + @param prng An active PRNG state + @param wprng The index of the PRNG desired + @param size The size of the modulus (key size) desired (octets) + @param e The "e" value (public key). e==65537 is a good choice + @param key [out] Destination of a newly created private key pair + @return CRYPT_OK if successful, upon error all allocated ram is freed +*/ +int rsa_make_key(prng_state *prng, int wprng, int size, long e, rsa_key *key) +{ + void *p, *q, *tmp1, *tmp2, *tmp3; + int err; + + LTC_ARGCHK(ltc_mp.name != NULL); + LTC_ARGCHK(key != NULL); + + if ((size < (MIN_RSA_SIZE/8)) || (size > (MAX_RSA_SIZE/8))) { + return CRYPT_INVALID_KEYSIZE; + } + + if ((e < 3) || ((e & 1) == 0)) { + return CRYPT_INVALID_ARG; + } + + if ((err = prng_is_valid(wprng)) != CRYPT_OK) { + return err; + } + + if ((err = mp_init_multi(&p, &q, &tmp1, &tmp2, &tmp3, NULL)) != CRYPT_OK) { + return err; + } + + /* make primes p and q (optimization provided by Wayne Scott) */ + if ((err = mp_set_int(tmp3, e)) != CRYPT_OK) { goto errkey; } /* tmp3 = e */ + + /* make prime "p" */ + do { + if ((err = rand_prime( p, size/2, prng, wprng)) != CRYPT_OK) { goto errkey; } + if ((err = mp_sub_d( p, 1, tmp1)) != CRYPT_OK) { goto errkey; } /* tmp1 = p-1 */ + if ((err = mp_gcd( tmp1, tmp3, tmp2)) != CRYPT_OK) { goto errkey; } /* tmp2 = gcd(p-1, e) */ + } while (mp_cmp_d( tmp2, 1) != 0); /* while e divides p-1 */ + + /* make prime "q" */ + do { + if ((err = rand_prime( q, size/2, prng, wprng)) != CRYPT_OK) { goto errkey; } + if ((err = mp_sub_d( q, 1, tmp1)) != CRYPT_OK) { goto errkey; } /* tmp1 = q-1 */ + if ((err = mp_gcd( tmp1, tmp3, tmp2)) != CRYPT_OK) { goto errkey; } /* tmp2 = gcd(q-1, e) */ + } while (mp_cmp_d( tmp2, 1) != 0); /* while e divides q-1 */ + + /* tmp1 = lcm(p-1, q-1) */ + if ((err = mp_sub_d( p, 1, tmp2)) != CRYPT_OK) { goto errkey; } /* tmp2 = p-1 */ + /* tmp1 = q-1 (previous do/while loop) */ + if ((err = mp_lcm( tmp1, tmp2, tmp1)) != CRYPT_OK) { goto errkey; } /* tmp1 = lcm(p-1, q-1) */ + + /* make key */ + if ((err = mp_init_multi(&key->e, &key->d, &key->N, &key->dQ, &key->dP, &key->qP, &key->p, &key->q, NULL)) != CRYPT_OK) { + goto errkey; + } + + if ((err = mp_set_int( key->e, e)) != CRYPT_OK) { goto errkey; } /* key->e = e */ + if ((err = mp_invmod( key->e, tmp1, key->d)) != CRYPT_OK) { goto errkey; } /* key->d = 1/e mod lcm(p-1,q-1) */ + if ((err = mp_mul( p, q, key->N)) != CRYPT_OK) { goto errkey; } /* key->N = pq */ + + /* optimize for CRT now */ + /* find d mod q-1 and d mod p-1 */ + if ((err = mp_sub_d( p, 1, tmp1)) != CRYPT_OK) { goto errkey; } /* tmp1 = q-1 */ + if ((err = mp_sub_d( q, 1, tmp2)) != CRYPT_OK) { goto errkey; } /* tmp2 = p-1 */ + if ((err = mp_mod( key->d, tmp1, key->dP)) != CRYPT_OK) { goto errkey; } /* dP = d mod p-1 */ + if ((err = mp_mod( key->d, tmp2, key->dQ)) != CRYPT_OK) { goto errkey; } /* dQ = d mod q-1 */ + if ((err = mp_invmod( q, p, key->qP)) != CRYPT_OK) { goto errkey; } /* qP = 1/q mod p */ + + if ((err = mp_copy( p, key->p)) != CRYPT_OK) { goto errkey; } + if ((err = mp_copy( q, key->q)) != CRYPT_OK) { goto errkey; } + + /* set key type (in this case it's CRT optimized) */ + key->type = PK_PRIVATE; + + /* return ok and free temps */ + err = CRYPT_OK; + goto cleanup; +errkey: + mp_clear_multi(key->d, key->e, key->N, key->dQ, key->dP, key->qP, key->p, key->q, NULL); +cleanup: + mp_clear_multi(tmp3, tmp2, tmp1, p, q, NULL); + return err; +} + +#endif + +/* $Source: /cvs/libtom/libtomcrypt/src/pk/rsa/rsa_make_key.c,v $ */ +/* $Revision: 1.14 $ */ +/* $Date: 2006/12/04 22:23:27 $ */ diff --git a/libtomcrypt/src/pk/rsa/rsa_sign_hash.c b/libtomcrypt/src/pk/rsa/rsa_sign_hash.c new file mode 100644 index 0000000..f10a97a --- /dev/null +++ b/libtomcrypt/src/pk/rsa/rsa_sign_hash.c @@ -0,0 +1,134 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file rsa_sign_hash.c + RSA PKCS #1 v1.5 and v2 PSS sign hash, Tom St Denis and Andreas Lange +*/ + +#ifdef MRSA + +/** + PKCS #1 pad then sign + @param in The hash to sign + @param inlen The length of the hash to sign (octets) + @param out [out] The signature + @param outlen [in/out] The max size and resulting size of the signature + @param padding Type of padding (LTC_PKCS_1_PSS or LTC_PKCS_1_V1_5) + @param prng An active PRNG state + @param prng_idx The index of the PRNG desired + @param hash_idx The index of the hash desired + @param saltlen The length of the salt desired (octets) + @param key The private RSA key to use + @return CRYPT_OK if successful +*/ +int rsa_sign_hash_ex(const unsigned char *in, unsigned long inlen, + unsigned char *out, unsigned long *outlen, + int padding, + prng_state *prng, int prng_idx, + int hash_idx, unsigned long saltlen, + rsa_key *key) +{ + unsigned long modulus_bitlen, modulus_bytelen, x, y; + int err; + + LTC_ARGCHK(in != NULL); + LTC_ARGCHK(out != NULL); + LTC_ARGCHK(outlen != NULL); + LTC_ARGCHK(key != NULL); + + /* valid padding? */ + if ((padding != LTC_PKCS_1_V1_5) && (padding != LTC_PKCS_1_PSS)) { + return CRYPT_PK_INVALID_PADDING; + } + + if (padding == LTC_PKCS_1_PSS) { + /* valid prng and hash ? */ + if ((err = prng_is_valid(prng_idx)) != CRYPT_OK) { + return err; + } + if ((err = hash_is_valid(hash_idx)) != CRYPT_OK) { + return err; + } + } + + /* get modulus len in bits */ + modulus_bitlen = mp_count_bits((key->N)); + + /* outlen must be at least the size of the modulus */ + modulus_bytelen = mp_unsigned_bin_size((key->N)); + if (modulus_bytelen > *outlen) { + *outlen = modulus_bytelen; + return CRYPT_BUFFER_OVERFLOW; + } + + if (padding == LTC_PKCS_1_PSS) { + /* PSS pad the key */ + x = *outlen; + if ((err = pkcs_1_pss_encode(in, inlen, saltlen, prng, prng_idx, + hash_idx, modulus_bitlen, out, &x)) != CRYPT_OK) { + return err; + } + } else { + /* PKCS #1 v1.5 pad the hash */ + unsigned char *tmpin; + ltc_asn1_list digestinfo[2], siginfo[2]; + + /* not all hashes have OIDs... so sad */ + if (hash_descriptor[hash_idx].OIDlen == 0) { + return CRYPT_INVALID_ARG; + } + + /* construct the SEQUENCE + SEQUENCE { + SEQUENCE {hashoid OID + blah NULL + } + hash OCTET STRING + } + */ + LTC_SET_ASN1(digestinfo, 0, LTC_ASN1_OBJECT_IDENTIFIER, hash_descriptor[hash_idx].OID, hash_descriptor[hash_idx].OIDlen); + LTC_SET_ASN1(digestinfo, 1, LTC_ASN1_NULL, NULL, 0); + LTC_SET_ASN1(siginfo, 0, LTC_ASN1_SEQUENCE, digestinfo, 2); + LTC_SET_ASN1(siginfo, 1, LTC_ASN1_OCTET_STRING, in, inlen); + + /* allocate memory for the encoding */ + y = mp_unsigned_bin_size(key->N); + tmpin = XMALLOC(y); + if (tmpin == NULL) { + return CRYPT_MEM; + } + + if ((err = der_encode_sequence(siginfo, 2, tmpin, &y)) != CRYPT_OK) { + XFREE(tmpin); + return err; + } + + x = *outlen; + if ((err = pkcs_1_v1_5_encode(tmpin, y, LTC_PKCS_1_EMSA, + modulus_bitlen, NULL, 0, + out, &x)) != CRYPT_OK) { + XFREE(tmpin); + return err; + } + XFREE(tmpin); + } + + /* RSA encode it */ + return ltc_mp.rsa_me(out, x, out, outlen, PK_PRIVATE, key); +} + +#endif /* MRSA */ + +/* $Source: /cvs/libtom/libtomcrypt/src/pk/rsa/rsa_sign_hash.c,v $ */ +/* $Revision: 1.9 $ */ +/* $Date: 2006/11/09 23:15:39 $ */ diff --git a/libtomcrypt/src/pk/rsa/rsa_verify_hash.c b/libtomcrypt/src/pk/rsa/rsa_verify_hash.c new file mode 100644 index 0000000..4b61029 --- /dev/null +++ b/libtomcrypt/src/pk/rsa/rsa_verify_hash.c @@ -0,0 +1,167 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file rsa_verify_hash.c + RSA PKCS #1 v1.5 or v2 PSS signature verification, Tom St Denis and Andreas Lange +*/ + +#ifdef MRSA + +/** + PKCS #1 de-sign then v1.5 or PSS depad + @param sig The signature data + @param siglen The length of the signature data (octets) + @param hash The hash of the message that was signed + @param hashlen The length of the hash of the message that was signed (octets) + @param padding Type of padding (LTC_PKCS_1_PSS or LTC_PKCS_1_V1_5) + @param hash_idx The index of the desired hash + @param saltlen The length of the salt used during signature + @param stat [out] The result of the signature comparison, 1==valid, 0==invalid + @param key The public RSA key corresponding to the key that performed the signature + @return CRYPT_OK on success (even if the signature is invalid) +*/ +int rsa_verify_hash_ex(const unsigned char *sig, unsigned long siglen, + const unsigned char *hash, unsigned long hashlen, + int padding, + int hash_idx, unsigned long saltlen, + int *stat, rsa_key *key) +{ + unsigned long modulus_bitlen, modulus_bytelen, x; + int err; + unsigned char *tmpbuf; + + LTC_ARGCHK(hash != NULL); + LTC_ARGCHK(sig != NULL); + LTC_ARGCHK(stat != NULL); + LTC_ARGCHK(key != NULL); + + /* default to invalid */ + *stat = 0; + + /* valid padding? */ + + if ((padding != LTC_PKCS_1_V1_5) && + (padding != LTC_PKCS_1_PSS)) { + return CRYPT_PK_INVALID_PADDING; + } + + if (padding == LTC_PKCS_1_PSS) { + /* valid hash ? */ + if ((err = hash_is_valid(hash_idx)) != CRYPT_OK) { + return err; + } + } + + /* get modulus len in bits */ + modulus_bitlen = mp_count_bits( (key->N)); + + /* outlen must be at least the size of the modulus */ + modulus_bytelen = mp_unsigned_bin_size( (key->N)); + if (modulus_bytelen != siglen) { + return CRYPT_INVALID_PACKET; + } + + /* allocate temp buffer for decoded sig */ + tmpbuf = XMALLOC(siglen); + if (tmpbuf == NULL) { + return CRYPT_MEM; + } + + /* RSA decode it */ + x = siglen; + if ((err = ltc_mp.rsa_me(sig, siglen, tmpbuf, &x, PK_PUBLIC, key)) != CRYPT_OK) { + XFREE(tmpbuf); + return err; + } + + /* make sure the output is the right size */ + if (x != siglen) { + XFREE(tmpbuf); + return CRYPT_INVALID_PACKET; + } + + if (padding == LTC_PKCS_1_PSS) { + /* PSS decode and verify it */ + err = pkcs_1_pss_decode(hash, hashlen, tmpbuf, x, saltlen, hash_idx, modulus_bitlen, stat); + } else { + /* PKCS #1 v1.5 decode it */ + unsigned char *out; + unsigned long outlen, loid[16]; + int decoded; + ltc_asn1_list digestinfo[2], siginfo[2]; + + /* not all hashes have OIDs... so sad */ + if (hash_descriptor[hash_idx].OIDlen == 0) { + err = CRYPT_INVALID_ARG; + goto bail_2; + } + + /* allocate temp buffer for decoded hash */ + outlen = ((modulus_bitlen >> 3) + (modulus_bitlen & 7 ? 1 : 0)) - 3; + out = XMALLOC(outlen); + if (out == NULL) { + err = CRYPT_MEM; + goto bail_2; + } + + if ((err = pkcs_1_v1_5_decode(tmpbuf, x, LTC_PKCS_1_EMSA, modulus_bitlen, out, &outlen, &decoded)) != CRYPT_OK) { + XFREE(out); + goto bail_2; + } + + /* now we must decode out[0...outlen-1] using ASN.1, test the OID and then test the hash */ + /* construct the SEQUENCE + SEQUENCE { + SEQUENCE {hashoid OID + blah NULL + } + hash OCTET STRING + } + */ + LTC_SET_ASN1(digestinfo, 0, LTC_ASN1_OBJECT_IDENTIFIER, loid, sizeof(loid)/sizeof(loid[0])); + LTC_SET_ASN1(digestinfo, 1, LTC_ASN1_NULL, NULL, 0); + LTC_SET_ASN1(siginfo, 0, LTC_ASN1_SEQUENCE, digestinfo, 2); + LTC_SET_ASN1(siginfo, 1, LTC_ASN1_OCTET_STRING, tmpbuf, siglen); + + if ((err = der_decode_sequence(out, outlen, siginfo, 2)) != CRYPT_OK) { + XFREE(out); + goto bail_2; + } + + /* test OID */ + if ((digestinfo[0].size == hash_descriptor[hash_idx].OIDlen) && + (XMEMCMP(digestinfo[0].data, hash_descriptor[hash_idx].OID, sizeof(unsigned long) * hash_descriptor[hash_idx].OIDlen) == 0) && + (siginfo[1].size == hashlen) && + (XMEMCMP(siginfo[1].data, hash, hashlen) == 0)) { + *stat = 1; + } + +#ifdef LTC_CLEAN_STACK + zeromem(out, outlen); +#endif + XFREE(out); + } + +bail_2: +#ifdef LTC_CLEAN_STACK + zeromem(tmpbuf, siglen); +#endif + XFREE(tmpbuf); + return err; +} + +#endif /* MRSA */ + +/* $Source: /cvs/libtom/libtomcrypt/src/pk/rsa/rsa_verify_hash.c,v $ */ +/* $Revision: 1.11 $ */ +/* $Date: 2006/12/04 03:09:28 $ */ diff --git a/libtomcrypt/src/prngs/fortuna.c b/libtomcrypt/src/prngs/fortuna.c new file mode 100644 index 0000000..159db52 --- /dev/null +++ b/libtomcrypt/src/prngs/fortuna.c @@ -0,0 +1,427 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file fortuna.c + Fortuna PRNG, Tom St Denis +*/ + +/* Implementation of Fortuna by Tom St Denis + +We deviate slightly here for reasons of simplicity [and to fit in the API]. First all "sources" +in the AddEntropy function are fixed to 0. Second since no reliable timer is provided +we reseed automatically when len(pool0) >= 64 or every FORTUNA_WD calls to the read function */ + +#ifdef FORTUNA + +/* requries SHA256 and AES */ +#if !(defined(RIJNDAEL) && defined(SHA256)) + #error FORTUNA requires SHA256 and RIJNDAEL (AES) +#endif + +#ifndef FORTUNA_POOLS + #warning FORTUNA_POOLS was not previously defined (old headers?) + #define FORTUNA_POOLS 32 +#endif + +#if FORTUNA_POOLS < 4 || FORTUNA_POOLS > 32 + #error FORTUNA_POOLS must be in [4..32] +#endif + +const struct ltc_prng_descriptor fortuna_desc = { + "fortuna", 1024, + &fortuna_start, + &fortuna_add_entropy, + &fortuna_ready, + &fortuna_read, + &fortuna_done, + &fortuna_export, + &fortuna_import, + &fortuna_test +}; + +/* update the IV */ +static void fortuna_update_iv(prng_state *prng) +{ + int x; + unsigned char *IV; + /* update IV */ + IV = prng->fortuna.IV; + for (x = 0; x < 16; x++) { + IV[x] = (IV[x] + 1) & 255; + if (IV[x] != 0) break; + } +} + +/* reseed the PRNG */ +static int fortuna_reseed(prng_state *prng) +{ + unsigned char tmp[MAXBLOCKSIZE]; + hash_state md; + int err, x; + + ++prng->fortuna.reset_cnt; + + /* new K == SHA256(K || s) where s == SHA256(P0) || SHA256(P1) ... */ + sha256_init(&md); + if ((err = sha256_process(&md, prng->fortuna.K, 32)) != CRYPT_OK) { + sha256_done(&md, tmp); + return err; + } + + for (x = 0; x < FORTUNA_POOLS; x++) { + if (x == 0 || ((prng->fortuna.reset_cnt >> (x-1)) & 1) == 0) { + /* terminate this hash */ + if ((err = sha256_done(&prng->fortuna.pool[x], tmp)) != CRYPT_OK) { + sha256_done(&md, tmp); + return err; + } + /* add it to the string */ + if ((err = sha256_process(&md, tmp, 32)) != CRYPT_OK) { + sha256_done(&md, tmp); + return err; + } + /* reset this pool */ + if ((err = sha256_init(&prng->fortuna.pool[x])) != CRYPT_OK) { + sha256_done(&md, tmp); + return err; + } + } else { + break; + } + } + + /* finish key */ + if ((err = sha256_done(&md, prng->fortuna.K)) != CRYPT_OK) { + return err; + } + if ((err = rijndael_setup(prng->fortuna.K, 32, 0, &prng->fortuna.skey)) != CRYPT_OK) { + return err; + } + fortuna_update_iv(prng); + + /* reset pool len */ + prng->fortuna.pool0_len = 0; + prng->fortuna.wd = 0; + + +#ifdef LTC_CLEAN_STACK + zeromem(&md, sizeof(md)); + zeromem(tmp, sizeof(tmp)); +#endif + + return CRYPT_OK; +} + +/** + Start the PRNG + @param prng [out] The PRNG state to initialize + @return CRYPT_OK if successful +*/ +int fortuna_start(prng_state *prng) +{ + int err, x, y; + unsigned char tmp[MAXBLOCKSIZE]; + + LTC_ARGCHK(prng != NULL); + + /* initialize the pools */ + for (x = 0; x < FORTUNA_POOLS; x++) { + if ((err = sha256_init(&prng->fortuna.pool[x])) != CRYPT_OK) { + for (y = 0; y < x; y++) { + sha256_done(&prng->fortuna.pool[y], tmp); + } + return err; + } + } + prng->fortuna.pool_idx = prng->fortuna.pool0_len = prng->fortuna.wd = 0; + prng->fortuna.reset_cnt = 0; + + /* reset bufs */ + zeromem(prng->fortuna.K, 32); + if ((err = rijndael_setup(prng->fortuna.K, 32, 0, &prng->fortuna.skey)) != CRYPT_OK) { + for (x = 0; x < FORTUNA_POOLS; x++) { + sha256_done(&prng->fortuna.pool[x], tmp); + } + return err; + } + zeromem(prng->fortuna.IV, 16); + + LTC_MUTEX_INIT(&prng->fortuna.prng_lock) + + return CRYPT_OK; +} + +/** + Add entropy to the PRNG state + @param in The data to add + @param inlen Length of the data to add + @param prng PRNG state to update + @return CRYPT_OK if successful +*/ +int fortuna_add_entropy(const unsigned char *in, unsigned long inlen, prng_state *prng) +{ + unsigned char tmp[2]; + int err; + + LTC_ARGCHK(in != NULL); + LTC_ARGCHK(prng != NULL); + + LTC_MUTEX_LOCK(&prng->fortuna.prng_lock); + + /* ensure inlen <= 32 */ + if (inlen > 32) { + LTC_MUTEX_UNLOCK(&prng->fortuna.prng_lock); + return CRYPT_INVALID_ARG; + } + + /* add s || length(in) || in to pool[pool_idx] */ + tmp[0] = 0; + tmp[1] = (unsigned char)inlen; + if ((err = sha256_process(&prng->fortuna.pool[prng->fortuna.pool_idx], tmp, 2)) != CRYPT_OK) { + LTC_MUTEX_UNLOCK(&prng->fortuna.prng_lock); + return err; + } + if ((err = sha256_process(&prng->fortuna.pool[prng->fortuna.pool_idx], in, inlen)) != CRYPT_OK) { + LTC_MUTEX_UNLOCK(&prng->fortuna.prng_lock); + return err; + } + if (prng->fortuna.pool_idx == 0) { + prng->fortuna.pool0_len += inlen; + } + if (++(prng->fortuna.pool_idx) == FORTUNA_POOLS) { + prng->fortuna.pool_idx = 0; + } + + LTC_MUTEX_UNLOCK(&prng->fortuna.prng_lock); + return CRYPT_OK; +} + +/** + Make the PRNG ready to read from + @param prng The PRNG to make active + @return CRYPT_OK if successful +*/ +int fortuna_ready(prng_state *prng) +{ + return fortuna_reseed(prng); +} + +/** + Read from the PRNG + @param out Destination + @param outlen Length of output + @param prng The active PRNG to read from + @return Number of octets read +*/ +unsigned long fortuna_read(unsigned char *out, unsigned long outlen, prng_state *prng) +{ + unsigned char tmp[16]; + int err; + unsigned long tlen; + + LTC_ARGCHK(out != NULL); + LTC_ARGCHK(prng != NULL); + + LTC_MUTEX_LOCK(&prng->fortuna.prng_lock); + + /* do we have to reseed? */ + if (++prng->fortuna.wd == FORTUNA_WD || prng->fortuna.pool0_len >= 64) { + if ((err = fortuna_reseed(prng)) != CRYPT_OK) { + LTC_MUTEX_UNLOCK(&prng->fortuna.prng_lock); + return 0; + } + } + + /* now generate the blocks required */ + tlen = outlen; + + /* handle whole blocks without the extra XMEMCPY */ + while (outlen >= 16) { + /* encrypt the IV and store it */ + rijndael_ecb_encrypt(prng->fortuna.IV, out, &prng->fortuna.skey); + out += 16; + outlen -= 16; + fortuna_update_iv(prng); + } + + /* left over bytes? */ + if (outlen > 0) { + rijndael_ecb_encrypt(prng->fortuna.IV, tmp, &prng->fortuna.skey); + XMEMCPY(out, tmp, outlen); + fortuna_update_iv(prng); + } + + /* generate new key */ + rijndael_ecb_encrypt(prng->fortuna.IV, prng->fortuna.K , &prng->fortuna.skey); fortuna_update_iv(prng); + rijndael_ecb_encrypt(prng->fortuna.IV, prng->fortuna.K+16, &prng->fortuna.skey); fortuna_update_iv(prng); + if ((err = rijndael_setup(prng->fortuna.K, 32, 0, &prng->fortuna.skey)) != CRYPT_OK) { + LTC_MUTEX_UNLOCK(&prng->fortuna.prng_lock); + return 0; + } + +#ifdef LTC_CLEAN_STACK + zeromem(tmp, sizeof(tmp)); +#endif + LTC_MUTEX_UNLOCK(&prng->fortuna.prng_lock); + return tlen; +} + +/** + Terminate the PRNG + @param prng The PRNG to terminate + @return CRYPT_OK if successful +*/ +int fortuna_done(prng_state *prng) +{ + int err, x; + unsigned char tmp[32]; + + LTC_ARGCHK(prng != NULL); + LTC_MUTEX_LOCK(&prng->fortuna.prng_lock); + + /* terminate all the hashes */ + for (x = 0; x < FORTUNA_POOLS; x++) { + if ((err = sha256_done(&(prng->fortuna.pool[x]), tmp)) != CRYPT_OK) { + LTC_MUTEX_UNLOCK(&prng->fortuna.prng_lock); + return err; + } + } + /* call cipher done when we invent one ;-) */ + +#ifdef LTC_CLEAN_STACK + zeromem(tmp, sizeof(tmp)); +#endif + + LTC_MUTEX_UNLOCK(&prng->fortuna.prng_lock); + return CRYPT_OK; +} + +/** + Export the PRNG state + @param out [out] Destination + @param outlen [in/out] Max size and resulting size of the state + @param prng The PRNG to export + @return CRYPT_OK if successful +*/ +int fortuna_export(unsigned char *out, unsigned long *outlen, prng_state *prng) +{ + int x, err; + hash_state *md; + + LTC_ARGCHK(out != NULL); + LTC_ARGCHK(outlen != NULL); + LTC_ARGCHK(prng != NULL); + + LTC_MUTEX_LOCK(&prng->fortuna.prng_lock); + + /* we'll write bytes for s&g's */ + if (*outlen < 32*FORTUNA_POOLS) { + LTC_MUTEX_UNLOCK(&prng->fortuna.prng_lock); + *outlen = 32*FORTUNA_POOLS; + return CRYPT_BUFFER_OVERFLOW; + } + + md = XMALLOC(sizeof(hash_state)); + if (md == NULL) { + LTC_MUTEX_UNLOCK(&prng->fortuna.prng_lock); + return CRYPT_MEM; + } + + /* to emit the state we copy each pool, terminate it then hash it again so + * an attacker who sees the state can't determine the current state of the PRNG + */ + for (x = 0; x < FORTUNA_POOLS; x++) { + /* copy the PRNG */ + XMEMCPY(md, &(prng->fortuna.pool[x]), sizeof(*md)); + + /* terminate it */ + if ((err = sha256_done(md, out+x*32)) != CRYPT_OK) { + goto LBL_ERR; + } + + /* now hash it */ + if ((err = sha256_init(md)) != CRYPT_OK) { + goto LBL_ERR; + } + if ((err = sha256_process(md, out+x*32, 32)) != CRYPT_OK) { + goto LBL_ERR; + } + if ((err = sha256_done(md, out+x*32)) != CRYPT_OK) { + goto LBL_ERR; + } + } + *outlen = 32*FORTUNA_POOLS; + err = CRYPT_OK; + +LBL_ERR: +#ifdef LTC_CLEAN_STACK + zeromem(md, sizeof(*md)); +#endif + XFREE(md); + LTC_MUTEX_UNLOCK(&prng->fortuna.prng_lock); + return err; +} + +/** + Import a PRNG state + @param in The PRNG state + @param inlen Size of the state + @param prng The PRNG to import + @return CRYPT_OK if successful +*/ +int fortuna_import(const unsigned char *in, unsigned long inlen, prng_state *prng) +{ + int err, x; + + LTC_ARGCHK(in != NULL); + LTC_ARGCHK(prng != NULL); + + if (inlen != 32*FORTUNA_POOLS) { + return CRYPT_INVALID_ARG; + } + + if ((err = fortuna_start(prng)) != CRYPT_OK) { + return err; + } + for (x = 0; x < FORTUNA_POOLS; x++) { + if ((err = fortuna_add_entropy(in+x*32, 32, prng)) != CRYPT_OK) { + return err; + } + } + return err; +} + +/** + PRNG self-test + @return CRYPT_OK if successful, CRYPT_NOP if self-testing has been disabled +*/ +int fortuna_test(void) +{ +#ifndef LTC_TEST + return CRYPT_NOP; +#else + int err; + + if ((err = sha256_test()) != CRYPT_OK) { + return err; + } + return rijndael_test(); +#endif +} + +#endif + + +/* $Source: /cvs/libtom/libtomcrypt/src/prngs/fortuna.c,v $ */ +/* $Revision: 1.12 $ */ +/* $Date: 2006/12/04 21:34:03 $ */ diff --git a/libtomcrypt/src/prngs/rc4.c b/libtomcrypt/src/prngs/rc4.c new file mode 100644 index 0000000..cf118ad --- /dev/null +++ b/libtomcrypt/src/prngs/rc4.c @@ -0,0 +1,269 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file rc4.c + RC4 PRNG, Tom St Denis +*/ + +#ifdef RC4 + +const struct ltc_prng_descriptor rc4_desc = +{ + "rc4", 32, + &rc4_start, + &rc4_add_entropy, + &rc4_ready, + &rc4_read, + &rc4_done, + &rc4_export, + &rc4_import, + &rc4_test +}; + +/** + Start the PRNG + @param prng [out] The PRNG state to initialize + @return CRYPT_OK if successful +*/ +int rc4_start(prng_state *prng) +{ + LTC_ARGCHK(prng != NULL); + + /* set keysize to zero */ + prng->rc4.x = 0; + + return CRYPT_OK; +} + +/** + Add entropy to the PRNG state + @param in The data to add + @param inlen Length of the data to add + @param prng PRNG state to update + @return CRYPT_OK if successful +*/ +int rc4_add_entropy(const unsigned char *in, unsigned long inlen, prng_state *prng) +{ + LTC_ARGCHK(in != NULL); + LTC_ARGCHK(prng != NULL); + + /* trim as required */ + if (prng->rc4.x + inlen > 256) { + if (prng->rc4.x == 256) { + /* I can't possibly accept another byte, ok maybe a mint wafer... */ + return CRYPT_OK; + } else { + /* only accept part of it */ + inlen = 256 - prng->rc4.x; + } + } + + while (inlen--) { + prng->rc4.buf[prng->rc4.x++] = *in++; + } + + return CRYPT_OK; + +} + +/** + Make the PRNG ready to read from + @param prng The PRNG to make active + @return CRYPT_OK if successful +*/ +int rc4_ready(prng_state *prng) +{ + unsigned char key[256], tmp, *s; + int keylen, x, y, j; + + LTC_ARGCHK(prng != NULL); + + /* extract the key */ + s = prng->rc4.buf; + XMEMCPY(key, s, 256); + keylen = prng->rc4.x; + + /* make RC4 perm and shuffle */ + for (x = 0; x < 256; x++) { + s[x] = x; + } + + for (j = x = y = 0; x < 256; x++) { + y = (y + prng->rc4.buf[x] + key[j++]) & 255; + if (j == keylen) { + j = 0; + } + tmp = s[x]; s[x] = s[y]; s[y] = tmp; + } + prng->rc4.x = 0; + prng->rc4.y = 0; + +#ifdef LTC_CLEAN_STACK + zeromem(key, sizeof(key)); +#endif + + return CRYPT_OK; +} + +/** + Read from the PRNG + @param out Destination + @param outlen Length of output + @param prng The active PRNG to read from + @return Number of octets read +*/ +unsigned long rc4_read(unsigned char *out, unsigned long outlen, prng_state *prng) +{ + unsigned char x, y, *s, tmp; + unsigned long n; + + LTC_ARGCHK(out != NULL); + LTC_ARGCHK(prng != NULL); + +#ifdef LTC_VALGRIND + zeromem(out, outlen); +#endif + + n = outlen; + x = prng->rc4.x; + y = prng->rc4.y; + s = prng->rc4.buf; + while (outlen--) { + x = (x + 1) & 255; + y = (y + s[x]) & 255; + tmp = s[x]; s[x] = s[y]; s[y] = tmp; + tmp = (s[x] + s[y]) & 255; + *out++ ^= s[tmp]; + } + prng->rc4.x = x; + prng->rc4.y = y; + return n; +} + +/** + Terminate the PRNG + @param prng The PRNG to terminate + @return CRYPT_OK if successful +*/ +int rc4_done(prng_state *prng) +{ + LTC_ARGCHK(prng != NULL); + return CRYPT_OK; +} + +/** + Export the PRNG state + @param out [out] Destination + @param outlen [in/out] Max size and resulting size of the state + @param prng The PRNG to export + @return CRYPT_OK if successful +*/ +int rc4_export(unsigned char *out, unsigned long *outlen, prng_state *prng) +{ + LTC_ARGCHK(outlen != NULL); + LTC_ARGCHK(out != NULL); + LTC_ARGCHK(prng != NULL); + + if (*outlen < 32) { + *outlen = 32; + return CRYPT_BUFFER_OVERFLOW; + } + + if (rc4_read(out, 32, prng) != 32) { + return CRYPT_ERROR_READPRNG; + } + *outlen = 32; + + return CRYPT_OK; +} + +/** + Import a PRNG state + @param in The PRNG state + @param inlen Size of the state + @param prng The PRNG to import + @return CRYPT_OK if successful +*/ +int rc4_import(const unsigned char *in, unsigned long inlen, prng_state *prng) +{ + int err; + LTC_ARGCHK(in != NULL); + LTC_ARGCHK(prng != NULL); + + if (inlen != 32) { + return CRYPT_INVALID_ARG; + } + + if ((err = rc4_start(prng)) != CRYPT_OK) { + return err; + } + return rc4_add_entropy(in, 32, prng); +} + +/** + PRNG self-test + @return CRYPT_OK if successful, CRYPT_NOP if self-testing has been disabled +*/ +int rc4_test(void) +{ +#if !defined(LTC_TEST) || defined(LTC_VALGRIND) + return CRYPT_NOP; +#else + static const struct { + unsigned char key[8], pt[8], ct[8]; + } tests[] = { +{ + { 0x01, 0x23, 0x45, 0x67, 0x89, 0xab, 0xcd, 0xef }, + { 0x01, 0x23, 0x45, 0x67, 0x89, 0xab, 0xcd, 0xef }, + { 0x75, 0xb7, 0x87, 0x80, 0x99, 0xe0, 0xc5, 0x96 } +} +}; + prng_state prng; + unsigned char dst[8]; + int err, x; + + for (x = 0; x < (int)(sizeof(tests)/sizeof(tests[0])); x++) { + if ((err = rc4_start(&prng)) != CRYPT_OK) { + return err; + } + if ((err = rc4_add_entropy(tests[x].key, 8, &prng)) != CRYPT_OK) { + return err; + } + if ((err = rc4_ready(&prng)) != CRYPT_OK) { + return err; + } + XMEMCPY(dst, tests[x].pt, 8); + if (rc4_read(dst, 8, &prng) != 8) { + return CRYPT_ERROR_READPRNG; + } + rc4_done(&prng); + if (XMEMCMP(dst, tests[x].ct, 8)) { +#if 0 + int y; + printf("\n\nRC4 failed, I got:\n"); + for (y = 0; y < 8; y++) printf("%02x ", dst[y]); + printf("\n"); +#endif + return CRYPT_FAIL_TESTVECTOR; + } + } + return CRYPT_OK; +#endif +} + +#endif + + +/* $Source: /cvs/libtom/libtomcrypt/src/prngs/rc4.c,v $ */ +/* $Revision: 1.9 $ */ +/* $Date: 2006/11/16 00:32:18 $ */ diff --git a/libtomcrypt/src/prngs/rng_get_bytes.c b/libtomcrypt/src/prngs/rng_get_bytes.c new file mode 100644 index 0000000..7d332b5 --- /dev/null +++ b/libtomcrypt/src/prngs/rng_get_bytes.c @@ -0,0 +1,148 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file rng_get_bytes.c + portable way to get secure random bits to feed a PRNG (Tom St Denis) +*/ + +#ifdef DEVRANDOM +/* on *NIX read /dev/random */ +static unsigned long rng_nix(unsigned char *buf, unsigned long len, + void (*callback)(void)) +{ +#ifdef LTC_NO_FILE + return 0; +#else + FILE *f; + unsigned long x; +#ifdef TRY_URANDOM_FIRST + f = fopen("/dev/urandom", "rb"); + if (f == NULL) +#endif /* TRY_URANDOM_FIRST */ + f = fopen("/dev/random", "rb"); + + if (f == NULL) { + return 0; + } + + /* disable buffering */ + if (setvbuf(f, NULL, _IONBF, 0) != 0) { + fclose(f); + return 0; + } + + x = (unsigned long)fread(buf, 1, (size_t)len, f); + fclose(f); + return x; +#endif /* LTC_NO_FILE */ +} + +#endif /* DEVRANDOM */ + +/* on ANSI C platforms with 100 < CLOCKS_PER_SEC < 10000 */ +#if defined(CLOCKS_PER_SEC) && !defined(WINCE) + +#define ANSI_RNG + +static unsigned long rng_ansic(unsigned char *buf, unsigned long len, + void (*callback)(void)) +{ + clock_t t1; + int l, acc, bits, a, b; + + if (XCLOCKS_PER_SEC < 100 || XCLOCKS_PER_SEC > 10000) { + return 0; + } + + l = len; + bits = 8; + acc = a = b = 0; + while (len--) { + if (callback != NULL) callback(); + while (bits--) { + do { + t1 = XCLOCK(); while (t1 == XCLOCK()) a ^= 1; + t1 = XCLOCK(); while (t1 == XCLOCK()) b ^= 1; + } while (a == b); + acc = (acc << 1) | a; + } + *buf++ = acc; + acc = 0; + bits = 8; + } + acc = bits = a = b = 0; + return l; +} + +#endif + +/* Try the Microsoft CSP */ +#if defined(WIN32) || defined(WINCE) +#define _WIN32_WINNT 0x0400 +#ifdef WINCE + #define UNDER_CE + #define ARM +#endif +#include <windows.h> +#include <wincrypt.h> + +static unsigned long rng_win32(unsigned char *buf, unsigned long len, + void (*callback)(void)) +{ + HCRYPTPROV hProv = 0; + if (!CryptAcquireContext(&hProv, NULL, MS_DEF_PROV, PROV_RSA_FULL, + (CRYPT_VERIFYCONTEXT | CRYPT_MACHINE_KEYSET)) && + !CryptAcquireContext (&hProv, NULL, MS_DEF_PROV, PROV_RSA_FULL, + CRYPT_VERIFYCONTEXT | CRYPT_MACHINE_KEYSET | CRYPT_NEWKEYSET)) + return 0; + + if (CryptGenRandom(hProv, len, buf) == TRUE) { + CryptReleaseContext(hProv, 0); + return len; + } else { + CryptReleaseContext(hProv, 0); + return 0; + } +} + +#endif /* WIN32 */ + +/** + Read the system RNG + @param out Destination + @param outlen Length desired (octets) + @param callback Pointer to void function to act as "callback" when RNG is slow. This can be NULL + @return Number of octets read +*/ +unsigned long rng_get_bytes(unsigned char *out, unsigned long outlen, + void (*callback)(void)) +{ + unsigned long x; + + LTC_ARGCHK(out != NULL); + +#if defined(DEVRANDOM) + x = rng_nix(out, outlen, callback); if (x != 0) { return x; } +#endif +#ifdef WIN32 + x = rng_win32(out, outlen, callback); if (x != 0) { return x; } +#endif +#ifdef ANSI_RNG + x = rng_ansic(out, outlen, callback); if (x != 0) { return x; } +#endif + return 0; +} + +/* $Source: /cvs/libtom/libtomcrypt/src/prngs/rng_get_bytes.c,v $ */ +/* $Revision: 1.5 $ */ +/* $Date: 2006/12/06 02:01:29 $ */ diff --git a/libtomcrypt/src/prngs/rng_make_prng.c b/libtomcrypt/src/prngs/rng_make_prng.c new file mode 100644 index 0000000..35631ab --- /dev/null +++ b/libtomcrypt/src/prngs/rng_make_prng.c @@ -0,0 +1,69 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file rng_make_prng.c + portable way to get secure random bits to feed a PRNG (Tom St Denis) +*/ + +/** + Create a PRNG from a RNG + @param bits Number of bits of entropy desired (64 ... 1024) + @param wprng Index of which PRNG to setup + @param prng [out] PRNG state to initialize + @param callback A pointer to a void function for when the RNG is slow, this can be NULL + @return CRYPT_OK if successful +*/ +int rng_make_prng(int bits, int wprng, prng_state *prng, + void (*callback)(void)) +{ + unsigned char buf[256]; + int err; + + LTC_ARGCHK(prng != NULL); + + /* check parameter */ + if ((err = prng_is_valid(wprng)) != CRYPT_OK) { + return err; + } + + if (bits < 64 || bits > 1024) { + return CRYPT_INVALID_PRNGSIZE; + } + + if ((err = prng_descriptor[wprng].start(prng)) != CRYPT_OK) { + return err; + } + + bits = ((bits/8)+((bits&7)!=0?1:0)) * 2; + if (rng_get_bytes(buf, (unsigned long)bits, callback) != (unsigned long)bits) { + return CRYPT_ERROR_READPRNG; + } + + if ((err = prng_descriptor[wprng].add_entropy(buf, (unsigned long)bits, prng)) != CRYPT_OK) { + return err; + } + + if ((err = prng_descriptor[wprng].ready(prng)) != CRYPT_OK) { + return err; + } + + #ifdef LTC_CLEAN_STACK + zeromem(buf, sizeof(buf)); + #endif + return CRYPT_OK; +} + + +/* $Source: /cvs/libtom/libtomcrypt/src/prngs/rng_make_prng.c,v $ */ +/* $Revision: 1.4 $ */ +/* $Date: 2006/03/31 14:15:35 $ */ diff --git a/libtomcrypt/src/prngs/sober128.c b/libtomcrypt/src/prngs/sober128.c new file mode 100644 index 0000000..0361387 --- /dev/null +++ b/libtomcrypt/src/prngs/sober128.c @@ -0,0 +1,500 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file sober128.c + Implementation of SOBER-128 by Tom St Denis. + Based on s128fast.c reference code supplied by Greg Rose of QUALCOMM. +*/ + +#ifdef SOBER128 + +#include "sober128tab.c" + +const struct ltc_prng_descriptor sober128_desc = +{ + "sober128", 64, + &sober128_start, + &sober128_add_entropy, + &sober128_ready, + &sober128_read, + &sober128_done, + &sober128_export, + &sober128_import, + &sober128_test +}; + +/* don't change these... */ +#define N 17 +#define FOLD N /* how many iterations of folding to do */ +#define INITKONST 0x6996c53a /* value of KONST to use during key loading */ +#define KEYP 15 /* where to insert key words */ +#define FOLDP 4 /* where to insert non-linear feedback */ + +#define B(x,i) ((unsigned char)(((x) >> (8*i)) & 0xFF)) + +static ulong32 BYTE2WORD(unsigned char *b) +{ + ulong32 t; + LOAD32L(t, b); + return t; +} + +#define WORD2BYTE(w, b) STORE32L(b, w) + +static void XORWORD(ulong32 w, unsigned char *b) +{ + ulong32 t; + LOAD32L(t, b); + t ^= w; + STORE32L(t, b); +} + +/* give correct offset for the current position of the register, + * where logically R[0] is at position "zero". + */ +#define OFF(zero, i) (((zero)+(i)) % N) + +/* step the LFSR */ +/* After stepping, "zero" moves right one place */ +#define STEP(R,z) \ + R[OFF(z,0)] = R[OFF(z,15)] ^ R[OFF(z,4)] ^ (R[OFF(z,0)] << 8) ^ Multab[(R[OFF(z,0)] >> 24) & 0xFF]; + +static void cycle(ulong32 *R) +{ + ulong32 t; + int i; + + STEP(R,0); + t = R[0]; + for (i = 1; i < N; ++i) { + R[i-1] = R[i]; + } + R[N-1] = t; +} + +/* Return a non-linear function of some parts of the register. + */ +#define NLFUNC(c,z) \ +{ \ + t = c->R[OFF(z,0)] + c->R[OFF(z,16)]; \ + t ^= Sbox[(t >> 24) & 0xFF]; \ + t = RORc(t, 8); \ + t = ((t + c->R[OFF(z,1)]) ^ c->konst) + c->R[OFF(z,6)]; \ + t ^= Sbox[(t >> 24) & 0xFF]; \ + t = t + c->R[OFF(z,13)]; \ +} + +static ulong32 nltap(struct sober128_prng *c) +{ + ulong32 t; + NLFUNC(c, 0); + return t; +} + +/** + Start the PRNG + @param prng [out] The PRNG state to initialize + @return CRYPT_OK if successful +*/ +int sober128_start(prng_state *prng) +{ + int i; + struct sober128_prng *c; + + LTC_ARGCHK(prng != NULL); + + c = &(prng->sober128); + + /* Register initialised to Fibonacci numbers */ + c->R[0] = 1; + c->R[1] = 1; + for (i = 2; i < N; ++i) { + c->R[i] = c->R[i-1] + c->R[i-2]; + } + c->konst = INITKONST; + + /* next add_entropy will be the key */ + c->flag = 1; + c->set = 0; + + return CRYPT_OK; +} + +/* Save the current register state + */ +static void s128_savestate(struct sober128_prng *c) +{ + int i; + for (i = 0; i < N; ++i) { + c->initR[i] = c->R[i]; + } +} + +/* initialise to previously saved register state + */ +static void s128_reloadstate(struct sober128_prng *c) +{ + int i; + + for (i = 0; i < N; ++i) { + c->R[i] = c->initR[i]; + } +} + +/* Initialise "konst" + */ +static void s128_genkonst(struct sober128_prng *c) +{ + ulong32 newkonst; + + do { + cycle(c->R); + newkonst = nltap(c); + } while ((newkonst & 0xFF000000) == 0); + c->konst = newkonst; +} + +/* Load key material into the register + */ +#define ADDKEY(k) \ + c->R[KEYP] += (k); + +#define XORNL(nl) \ + c->R[FOLDP] ^= (nl); + +/* nonlinear diffusion of register for key */ +#define DROUND(z) STEP(c->R,z); NLFUNC(c,(z+1)); c->R[OFF((z+1),FOLDP)] ^= t; +static void s128_diffuse(struct sober128_prng *c) +{ + ulong32 t; + /* relies on FOLD == N == 17! */ + DROUND(0); + DROUND(1); + DROUND(2); + DROUND(3); + DROUND(4); + DROUND(5); + DROUND(6); + DROUND(7); + DROUND(8); + DROUND(9); + DROUND(10); + DROUND(11); + DROUND(12); + DROUND(13); + DROUND(14); + DROUND(15); + DROUND(16); +} + +/** + Add entropy to the PRNG state + @param in The data to add + @param inlen Length of the data to add + @param prng PRNG state to update + @return CRYPT_OK if successful +*/ +int sober128_add_entropy(const unsigned char *in, unsigned long inlen, prng_state *prng) +{ + struct sober128_prng *c; + ulong32 i, k; + + LTC_ARGCHK(in != NULL); + LTC_ARGCHK(prng != NULL); + c = &(prng->sober128); + + if (c->flag == 1) { + /* this is the first call to the add_entropy so this input is the key */ + /* inlen must be multiple of 4 bytes */ + if ((inlen & 3) != 0) { + return CRYPT_INVALID_KEYSIZE; + } + + for (i = 0; i < inlen; i += 4) { + k = BYTE2WORD((unsigned char *)&in[i]); + ADDKEY(k); + cycle(c->R); + XORNL(nltap(c)); + } + + /* also fold in the length of the key */ + ADDKEY(inlen); + + /* now diffuse */ + s128_diffuse(c); + + s128_genkonst(c); + s128_savestate(c); + c->nbuf = 0; + c->flag = 0; + c->set = 1; + } else { + /* ok we are adding an IV then... */ + s128_reloadstate(c); + + /* inlen must be multiple of 4 bytes */ + if ((inlen & 3) != 0) { + return CRYPT_INVALID_KEYSIZE; + } + + for (i = 0; i < inlen; i += 4) { + k = BYTE2WORD((unsigned char *)&in[i]); + ADDKEY(k); + cycle(c->R); + XORNL(nltap(c)); + } + + /* also fold in the length of the key */ + ADDKEY(inlen); + + /* now diffuse */ + s128_diffuse(c); + c->nbuf = 0; + } + + return CRYPT_OK; +} + +/** + Make the PRNG ready to read from + @param prng The PRNG to make active + @return CRYPT_OK if successful +*/ +int sober128_ready(prng_state *prng) +{ + return prng->sober128.set == 1 ? CRYPT_OK : CRYPT_ERROR; +} + +/* XOR pseudo-random bytes into buffer + */ +#define SROUND(z) STEP(c->R,z); NLFUNC(c,(z+1)); XORWORD(t, out+(z*4)); + +/** + Read from the PRNG + @param out Destination + @param outlen Length of output + @param prng The active PRNG to read from + @return Number of octets read +*/ +unsigned long sober128_read(unsigned char *out, unsigned long outlen, prng_state *prng) +{ + struct sober128_prng *c; + ulong32 t, tlen; + + LTC_ARGCHK(out != NULL); + LTC_ARGCHK(prng != NULL); + +#ifdef LTC_VALGRIND + zeromem(out, outlen); +#endif + + c = &(prng->sober128); + t = 0; + tlen = outlen; + + /* handle any previously buffered bytes */ + while (c->nbuf != 0 && outlen != 0) { + *out++ ^= c->sbuf & 0xFF; + c->sbuf >>= 8; + c->nbuf -= 8; + --outlen; + } + +#ifndef LTC_SMALL_CODE + /* do lots at a time, if there's enough to do */ + while (outlen >= N*4) { + SROUND(0); + SROUND(1); + SROUND(2); + SROUND(3); + SROUND(4); + SROUND(5); + SROUND(6); + SROUND(7); + SROUND(8); + SROUND(9); + SROUND(10); + SROUND(11); + SROUND(12); + SROUND(13); + SROUND(14); + SROUND(15); + SROUND(16); + out += 4*N; + outlen -= 4*N; + } +#endif + + /* do small or odd size buffers the slow way */ + while (4 <= outlen) { + cycle(c->R); + t = nltap(c); + XORWORD(t, out); + out += 4; + outlen -= 4; + } + + /* handle any trailing bytes */ + if (outlen != 0) { + cycle(c->R); + c->sbuf = nltap(c); + c->nbuf = 32; + while (c->nbuf != 0 && outlen != 0) { + *out++ ^= c->sbuf & 0xFF; + c->sbuf >>= 8; + c->nbuf -= 8; + --outlen; + } + } + + return tlen; +} + +/** + Terminate the PRNG + @param prng The PRNG to terminate + @return CRYPT_OK if successful +*/ +int sober128_done(prng_state *prng) +{ + LTC_ARGCHK(prng != NULL); + return CRYPT_OK; +} + +/** + Export the PRNG state + @param out [out] Destination + @param outlen [in/out] Max size and resulting size of the state + @param prng The PRNG to export + @return CRYPT_OK if successful +*/ +int sober128_export(unsigned char *out, unsigned long *outlen, prng_state *prng) +{ + LTC_ARGCHK(outlen != NULL); + LTC_ARGCHK(out != NULL); + LTC_ARGCHK(prng != NULL); + + if (*outlen < 64) { + *outlen = 64; + return CRYPT_BUFFER_OVERFLOW; + } + + if (sober128_read(out, 64, prng) != 64) { + return CRYPT_ERROR_READPRNG; + } + *outlen = 64; + + return CRYPT_OK; +} + +/** + Import a PRNG state + @param in The PRNG state + @param inlen Size of the state + @param prng The PRNG to import + @return CRYPT_OK if successful +*/ +int sober128_import(const unsigned char *in, unsigned long inlen, prng_state *prng) +{ + int err; + LTC_ARGCHK(in != NULL); + LTC_ARGCHK(prng != NULL); + + if (inlen != 64) { + return CRYPT_INVALID_ARG; + } + + if ((err = sober128_start(prng)) != CRYPT_OK) { + return err; + } + if ((err = sober128_add_entropy(in, 64, prng)) != CRYPT_OK) { + return err; + } + return sober128_ready(prng); +} + +/** + PRNG self-test + @return CRYPT_OK if successful, CRYPT_NOP if self-testing has been disabled +*/ +int sober128_test(void) +{ +#ifndef LTC_TEST + return CRYPT_NOP; +#else + static const struct { + int keylen, ivlen, len; + unsigned char key[16], iv[4], out[20]; + } tests[] = { + +{ + 16, 4, 20, + + /* key */ + { 0x74, 0x65, 0x73, 0x74, 0x20, 0x6b, 0x65, 0x79, + 0x20, 0x31, 0x32, 0x38, 0x62, 0x69, 0x74, 0x73 }, + + /* IV */ + { 0x00, 0x00, 0x00, 0x00 }, + + /* expected output */ + { 0x43, 0x50, 0x0c, 0xcf, 0x89, 0x91, 0x9f, 0x1d, + 0xaa, 0x37, 0x74, 0x95, 0xf4, 0xb4, 0x58, 0xc2, + 0x40, 0x37, 0x8b, 0xbb } +} + +}; + prng_state prng; + unsigned char dst[20]; + int err, x; + + for (x = 0; x < (int)(sizeof(tests)/sizeof(tests[0])); x++) { + if ((err = sober128_start(&prng)) != CRYPT_OK) { + return err; + } + if ((err = sober128_add_entropy(tests[x].key, tests[x].keylen, &prng)) != CRYPT_OK) { + return err; + } + /* add IV */ + if ((err = sober128_add_entropy(tests[x].iv, tests[x].ivlen, &prng)) != CRYPT_OK) { + return err; + } + + /* ready up */ + if ((err = sober128_ready(&prng)) != CRYPT_OK) { + return err; + } + XMEMSET(dst, 0, tests[x].len); + if (sober128_read(dst, tests[x].len, &prng) != (unsigned long)tests[x].len) { + return CRYPT_ERROR_READPRNG; + } + sober128_done(&prng); + if (XMEMCMP(dst, tests[x].out, tests[x].len)) { +#if 0 + printf("\n\nSOBER128 failed, I got:\n"); + for (y = 0; y < tests[x].len; y++) printf("%02x ", dst[y]); + printf("\n"); +#endif + return CRYPT_FAIL_TESTVECTOR; + } + } + return CRYPT_OK; +#endif +} + +#endif + + +/* $Source: /cvs/libtom/libtomcrypt/src/prngs/sober128.c,v $ */ +/* $Revision: 1.8 $ */ +/* $Date: 2006/11/05 00:11:36 $ */ diff --git a/libtomcrypt/src/prngs/sober128tab.c b/libtomcrypt/src/prngs/sober128tab.c new file mode 100644 index 0000000..b50c77b --- /dev/null +++ b/libtomcrypt/src/prngs/sober128tab.c @@ -0,0 +1,162 @@ +/** + @file sober128tab.c + SOBER-128 Tables +*/ +/* $Id: sober128tab.c,v 1.2 2005/05/05 14:35:59 tom Exp $ */ +/* @(#)TuringMultab.h 1.3 (QUALCOMM) 02/09/03 */ +/* Multiplication table for Turing using 0xD02B4367 */ +static const ulong32 Multab[256] = { + 0x00000000, 0xD02B4367, 0xED5686CE, 0x3D7DC5A9, + 0x97AC41D1, 0x478702B6, 0x7AFAC71F, 0xAAD18478, + 0x631582EF, 0xB33EC188, 0x8E430421, 0x5E684746, + 0xF4B9C33E, 0x24928059, 0x19EF45F0, 0xC9C40697, + 0xC62A4993, 0x16010AF4, 0x2B7CCF5D, 0xFB578C3A, + 0x51860842, 0x81AD4B25, 0xBCD08E8C, 0x6CFBCDEB, + 0xA53FCB7C, 0x7514881B, 0x48694DB2, 0x98420ED5, + 0x32938AAD, 0xE2B8C9CA, 0xDFC50C63, 0x0FEE4F04, + 0xC154926B, 0x117FD10C, 0x2C0214A5, 0xFC2957C2, + 0x56F8D3BA, 0x86D390DD, 0xBBAE5574, 0x6B851613, + 0xA2411084, 0x726A53E3, 0x4F17964A, 0x9F3CD52D, + 0x35ED5155, 0xE5C61232, 0xD8BBD79B, 0x089094FC, + 0x077EDBF8, 0xD755989F, 0xEA285D36, 0x3A031E51, + 0x90D29A29, 0x40F9D94E, 0x7D841CE7, 0xADAF5F80, + 0x646B5917, 0xB4401A70, 0x893DDFD9, 0x59169CBE, + 0xF3C718C6, 0x23EC5BA1, 0x1E919E08, 0xCEBADD6F, + 0xCFA869D6, 0x1F832AB1, 0x22FEEF18, 0xF2D5AC7F, + 0x58042807, 0x882F6B60, 0xB552AEC9, 0x6579EDAE, + 0xACBDEB39, 0x7C96A85E, 0x41EB6DF7, 0x91C02E90, + 0x3B11AAE8, 0xEB3AE98F, 0xD6472C26, 0x066C6F41, + 0x09822045, 0xD9A96322, 0xE4D4A68B, 0x34FFE5EC, + 0x9E2E6194, 0x4E0522F3, 0x7378E75A, 0xA353A43D, + 0x6A97A2AA, 0xBABCE1CD, 0x87C12464, 0x57EA6703, + 0xFD3BE37B, 0x2D10A01C, 0x106D65B5, 0xC04626D2, + 0x0EFCFBBD, 0xDED7B8DA, 0xE3AA7D73, 0x33813E14, + 0x9950BA6C, 0x497BF90B, 0x74063CA2, 0xA42D7FC5, + 0x6DE97952, 0xBDC23A35, 0x80BFFF9C, 0x5094BCFB, + 0xFA453883, 0x2A6E7BE4, 0x1713BE4D, 0xC738FD2A, + 0xC8D6B22E, 0x18FDF149, 0x258034E0, 0xF5AB7787, + 0x5F7AF3FF, 0x8F51B098, 0xB22C7531, 0x62073656, + 0xABC330C1, 0x7BE873A6, 0x4695B60F, 0x96BEF568, + 0x3C6F7110, 0xEC443277, 0xD139F7DE, 0x0112B4B9, + 0xD31DD2E1, 0x03369186, 0x3E4B542F, 0xEE601748, + 0x44B19330, 0x949AD057, 0xA9E715FE, 0x79CC5699, + 0xB008500E, 0x60231369, 0x5D5ED6C0, 0x8D7595A7, + 0x27A411DF, 0xF78F52B8, 0xCAF29711, 0x1AD9D476, + 0x15379B72, 0xC51CD815, 0xF8611DBC, 0x284A5EDB, + 0x829BDAA3, 0x52B099C4, 0x6FCD5C6D, 0xBFE61F0A, + 0x7622199D, 0xA6095AFA, 0x9B749F53, 0x4B5FDC34, + 0xE18E584C, 0x31A51B2B, 0x0CD8DE82, 0xDCF39DE5, + 0x1249408A, 0xC26203ED, 0xFF1FC644, 0x2F348523, + 0x85E5015B, 0x55CE423C, 0x68B38795, 0xB898C4F2, + 0x715CC265, 0xA1778102, 0x9C0A44AB, 0x4C2107CC, + 0xE6F083B4, 0x36DBC0D3, 0x0BA6057A, 0xDB8D461D, + 0xD4630919, 0x04484A7E, 0x39358FD7, 0xE91ECCB0, + 0x43CF48C8, 0x93E40BAF, 0xAE99CE06, 0x7EB28D61, + 0xB7768BF6, 0x675DC891, 0x5A200D38, 0x8A0B4E5F, + 0x20DACA27, 0xF0F18940, 0xCD8C4CE9, 0x1DA70F8E, + 0x1CB5BB37, 0xCC9EF850, 0xF1E33DF9, 0x21C87E9E, + 0x8B19FAE6, 0x5B32B981, 0x664F7C28, 0xB6643F4F, + 0x7FA039D8, 0xAF8B7ABF, 0x92F6BF16, 0x42DDFC71, + 0xE80C7809, 0x38273B6E, 0x055AFEC7, 0xD571BDA0, + 0xDA9FF2A4, 0x0AB4B1C3, 0x37C9746A, 0xE7E2370D, + 0x4D33B375, 0x9D18F012, 0xA06535BB, 0x704E76DC, + 0xB98A704B, 0x69A1332C, 0x54DCF685, 0x84F7B5E2, + 0x2E26319A, 0xFE0D72FD, 0xC370B754, 0x135BF433, + 0xDDE1295C, 0x0DCA6A3B, 0x30B7AF92, 0xE09CECF5, + 0x4A4D688D, 0x9A662BEA, 0xA71BEE43, 0x7730AD24, + 0xBEF4ABB3, 0x6EDFE8D4, 0x53A22D7D, 0x83896E1A, + 0x2958EA62, 0xF973A905, 0xC40E6CAC, 0x14252FCB, + 0x1BCB60CF, 0xCBE023A8, 0xF69DE601, 0x26B6A566, + 0x8C67211E, 0x5C4C6279, 0x6131A7D0, 0xB11AE4B7, + 0x78DEE220, 0xA8F5A147, 0x958864EE, 0x45A32789, + 0xEF72A3F1, 0x3F59E096, 0x0224253F, 0xD20F6658, +}; + +/* $Id: sober128tab.c,v 1.2 2005/05/05 14:35:59 tom Exp $ */ +/* Sbox for SOBER-128 */ +/* + * This is really the combination of two SBoxes; the least significant + * 24 bits comes from: + * 8->32 Sbox generated by Millan et. al. at Queensland University of + * Technology. See: E. Dawson, W. Millan, L. Burnett, G. Carter, + * "On the Design of 8*32 S-boxes". Unpublished report, by the + * Information Systems Research Centre, + * Queensland University of Technology, 1999. + * + * The most significant 8 bits are the Skipjack "F table", which can be + * found at http://csrc.nist.gov/CryptoToolkit/skipjack/skipjack.pdf . + * In this optimised table, though, the intent is to XOR the word from + * the table selected by the high byte with the input word. Thus, the + * high byte is actually the Skipjack F-table entry XORED with its + * table index. + */ +static const ulong32 Sbox[256] = { + 0xa3aa1887, 0xd65e435c, 0x0b65c042, 0x800e6ef4, + 0xfc57ee20, 0x4d84fed3, 0xf066c502, 0xf354e8ae, + 0xbb2ee9d9, 0x281f38d4, 0x1f829b5d, 0x735cdf3c, + 0x95864249, 0xbc2e3963, 0xa1f4429f, 0xf6432c35, + 0xf7f40325, 0x3cc0dd70, 0x5f973ded, 0x9902dc5e, + 0xda175b42, 0x590012bf, 0xdc94d78c, 0x39aab26b, + 0x4ac11b9a, 0x8c168146, 0xc3ea8ec5, 0x058ac28f, + 0x52ed5c0f, 0x25b4101c, 0x5a2db082, 0x370929e1, + 0x2a1843de, 0xfe8299fc, 0x202fbc4b, 0x833915dd, + 0x33a803fa, 0xd446b2de, 0x46233342, 0x4fcee7c3, + 0x3ad607ef, 0x9e97ebab, 0x507f859b, 0xe81f2e2f, + 0xc55b71da, 0xd7e2269a, 0x1339c3d1, 0x7ca56b36, + 0xa6c9def2, 0xb5c9fc5f, 0x5927b3a3, 0x89a56ddf, + 0xc625b510, 0x560f85a7, 0xace82e71, 0x2ecb8816, + 0x44951e2a, 0x97f5f6af, 0xdfcbc2b3, 0xce4ff55d, + 0xcb6b6214, 0x2b0b83e3, 0x549ea6f5, 0x9de041af, + 0x792f1f17, 0xf73b99ee, 0x39a65ec0, 0x4c7016c6, + 0x857709a4, 0xd6326e01, 0xc7b280d9, 0x5cfb1418, + 0xa6aff227, 0xfd548203, 0x506b9d96, 0xa117a8c0, + 0x9cd5bf6e, 0xdcee7888, 0x61fcfe64, 0xf7a193cd, + 0x050d0184, 0xe8ae4930, 0x88014f36, 0xd6a87088, + 0x6bad6c2a, 0x1422c678, 0xe9204de7, 0xb7c2e759, + 0x0200248e, 0x013b446b, 0xda0d9fc2, 0x0414a895, + 0x3a6cc3a1, 0x56fef170, 0x86c19155, 0xcf7b8a66, + 0x551b5e69, 0xb4a8623e, 0xa2bdfa35, 0xc4f068cc, + 0x573a6acd, 0x6355e936, 0x03602db9, 0x0edf13c1, + 0x2d0bb16d, 0x6980b83c, 0xfeb23763, 0x3dd8a911, + 0x01b6bc13, 0xf55579d7, 0xf55c2fa8, 0x19f4196e, + 0xe7db5476, 0x8d64a866, 0xc06e16ad, 0xb17fc515, + 0xc46feb3c, 0x8bc8a306, 0xad6799d9, 0x571a9133, + 0x992466dd, 0x92eb5dcd, 0xac118f50, 0x9fafb226, + 0xa1b9cef3, 0x3ab36189, 0x347a19b1, 0x62c73084, + 0xc27ded5c, 0x6c8bc58f, 0x1cdde421, 0xed1e47fb, + 0xcdcc715e, 0xb9c0ff99, 0x4b122f0f, 0xc4d25184, + 0xaf7a5e6c, 0x5bbf18bc, 0x8dd7c6e0, 0x5fb7e420, + 0x521f523f, 0x4ad9b8a2, 0xe9da1a6b, 0x97888c02, + 0x19d1e354, 0x5aba7d79, 0xa2cc7753, 0x8c2d9655, + 0x19829da1, 0x531590a7, 0x19c1c149, 0x3d537f1c, + 0x50779b69, 0xed71f2b7, 0x463c58fa, 0x52dc4418, + 0xc18c8c76, 0xc120d9f0, 0xafa80d4d, 0x3b74c473, + 0xd09410e9, 0x290e4211, 0xc3c8082b, 0x8f6b334a, + 0x3bf68ed2, 0xa843cc1b, 0x8d3c0ff3, 0x20e564a0, + 0xf8f55a4f, 0x2b40f8e7, 0xfea7f15f, 0xcf00fe21, + 0x8a6d37d6, 0xd0d506f1, 0xade00973, 0xefbbde36, + 0x84670fa8, 0xfa31ab9e, 0xaedab618, 0xc01f52f5, + 0x6558eb4f, 0x71b9e343, 0x4b8d77dd, 0x8cb93da6, + 0x740fd52d, 0x425412f8, 0xc5a63360, 0x10e53ad0, + 0x5a700f1c, 0x8324ed0b, 0xe53dc1ec, 0x1a366795, + 0x6d549d15, 0xc5ce46d7, 0xe17abe76, 0x5f48e0a0, + 0xd0f07c02, 0x941249b7, 0xe49ed6ba, 0x37a47f78, + 0xe1cfffbd, 0xb007ca84, 0xbb65f4da, 0xb59f35da, + 0x33d2aa44, 0x417452ac, 0xc0d674a7, 0x2d61a46a, + 0xdc63152a, 0x3e12b7aa, 0x6e615927, 0xa14fb118, + 0xa151758d, 0xba81687b, 0xe152f0b3, 0x764254ed, + 0x34c77271, 0x0a31acab, 0x54f94aec, 0xb9e994cd, + 0x574d9e81, 0x5b623730, 0xce8a21e8, 0x37917f0b, + 0xe8a9b5d6, 0x9697adf8, 0xf3d30431, 0x5dcac921, + 0x76b35d46, 0xaa430a36, 0xc2194022, 0x22bca65e, + 0xdaec70ba, 0xdfaea8cc, 0x777bae8b, 0x242924d5, + 0x1f098a5a, 0x4b396b81, 0x55de2522, 0x435c1cb8, + 0xaeb8fe1d, 0x9db3c697, 0x5b164f83, 0xe0c16376, + 0xa319224c, 0xd0203b35, 0x433ac0fe, 0x1466a19a, + 0x45f0b24f, 0x51fda998, 0xc0d52d71, 0xfa0896a8, + 0xf9e6053f, 0xa4b0d300, 0xd499cbcc, 0xb95e3d40, +}; + +/* $Source: /cvs/libtom/libtomcrypt/src/prngs/sober128tab.c,v $ */ +/* $Revision: 1.2 $ */ +/* $Date: 2005/05/05 14:35:59 $ */ diff --git a/libtomcrypt/src/prngs/sprng.c b/libtomcrypt/src/prngs/sprng.c new file mode 100644 index 0000000..190e33d --- /dev/null +++ b/libtomcrypt/src/prngs/sprng.c @@ -0,0 +1,136 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file sprng.c + Secure PRNG, Tom St Denis +*/ + +/* A secure PRNG using the RNG functions. Basically this is a + * wrapper that allows you to use a secure RNG as a PRNG + * in the various other functions. + */ + +#ifdef SPRNG + +const struct ltc_prng_descriptor sprng_desc = +{ + "sprng", 0, + &sprng_start, + &sprng_add_entropy, + &sprng_ready, + &sprng_read, + &sprng_done, + &sprng_export, + &sprng_import, + &sprng_test +}; + +/** + Start the PRNG + @param prng [out] The PRNG state to initialize + @return CRYPT_OK if successful +*/ +int sprng_start(prng_state *prng) +{ + return CRYPT_OK; +} + +/** + Add entropy to the PRNG state + @param in The data to add + @param inlen Length of the data to add + @param prng PRNG state to update + @return CRYPT_OK if successful +*/ +int sprng_add_entropy(const unsigned char *in, unsigned long inlen, prng_state *prng) +{ + return CRYPT_OK; +} + +/** + Make the PRNG ready to read from + @param prng The PRNG to make active + @return CRYPT_OK if successful +*/ +int sprng_ready(prng_state *prng) +{ + return CRYPT_OK; +} + +/** + Read from the PRNG + @param out Destination + @param outlen Length of output + @param prng The active PRNG to read from + @return Number of octets read +*/ +unsigned long sprng_read(unsigned char *out, unsigned long outlen, prng_state *prng) +{ + LTC_ARGCHK(out != NULL); + return rng_get_bytes(out, outlen, NULL); +} + +/** + Terminate the PRNG + @param prng The PRNG to terminate + @return CRYPT_OK if successful +*/ +int sprng_done(prng_state *prng) +{ + return CRYPT_OK; +} + +/** + Export the PRNG state + @param out [out] Destination + @param outlen [in/out] Max size and resulting size of the state + @param prng The PRNG to export + @return CRYPT_OK if successful +*/ +int sprng_export(unsigned char *out, unsigned long *outlen, prng_state *prng) +{ + LTC_ARGCHK(outlen != NULL); + + *outlen = 0; + return CRYPT_OK; +} + +/** + Import a PRNG state + @param in The PRNG state + @param inlen Size of the state + @param prng The PRNG to import + @return CRYPT_OK if successful +*/ +int sprng_import(const unsigned char *in, unsigned long inlen, prng_state *prng) +{ + return CRYPT_OK; +} + +/** + PRNG self-test + @return CRYPT_OK if successful, CRYPT_NOP if self-testing has been disabled +*/ +int sprng_test(void) +{ + return CRYPT_OK; +} + +#endif + + + + +/* $Source: /cvs/libtom/libtomcrypt/src/prngs/sprng.c,v $ */ +/* $Revision: 1.4 $ */ +/* $Date: 2006/03/31 14:15:35 $ */ diff --git a/libtomcrypt/src/prngs/yarrow.c b/libtomcrypt/src/prngs/yarrow.c new file mode 100644 index 0000000..9fbd4f6 --- /dev/null +++ b/libtomcrypt/src/prngs/yarrow.c @@ -0,0 +1,362 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file yarrow.c + Yarrow PRNG, Tom St Denis +*/ + +#ifdef YARROW + +const struct ltc_prng_descriptor yarrow_desc = +{ + "yarrow", 64, + &yarrow_start, + &yarrow_add_entropy, + &yarrow_ready, + &yarrow_read, + &yarrow_done, + &yarrow_export, + &yarrow_import, + &yarrow_test +}; + +/** + Start the PRNG + @param prng [out] The PRNG state to initialize + @return CRYPT_OK if successful +*/ +int yarrow_start(prng_state *prng) +{ + int err; + + LTC_ARGCHK(prng != NULL); + + /* these are the default hash/cipher combo used */ +#ifdef RIJNDAEL +#if YARROW_AES==0 + prng->yarrow.cipher = register_cipher(&rijndael_enc_desc); +#elif YARROW_AES==1 + prng->yarrow.cipher = register_cipher(&aes_enc_desc); +#elif YARROW_AES==2 + prng->yarrow.cipher = register_cipher(&rijndael_desc); +#elif YARROW_AES==3 + prng->yarrow.cipher = register_cipher(&aes_desc); +#endif +#elif defined(BLOWFISH) + prng->yarrow.cipher = register_cipher(&blowfish_desc); +#elif defined(TWOFISH) + prng->yarrow.cipher = register_cipher(&twofish_desc); +#elif defined(RC6) + prng->yarrow.cipher = register_cipher(&rc6_desc); +#elif defined(RC5) + prng->yarrow.cipher = register_cipher(&rc5_desc); +#elif defined(SAFERP) + prng->yarrow.cipher = register_cipher(&saferp_desc); +#elif defined(RC2) + prng->yarrow.cipher = register_cipher(&rc2_desc); +#elif defined(NOEKEON) + prng->yarrow.cipher = register_cipher(&noekeon_desc); +#elif defined(ANUBIS) + prng->yarrow.cipher = register_cipher(&anubis_desc); +#elif defined(KSEED) + prng->yarrow.cipher = register_cipher(&kseed_desc); +#elif defined(KHAZAD) + prng->yarrow.cipher = register_cipher(&khazad_desc); +#elif defined(CAST5) + prng->yarrow.cipher = register_cipher(&cast5_desc); +#elif defined(XTEA) + prng->yarrow.cipher = register_cipher(&xtea_desc); +#elif defined(SAFER) + prng->yarrow.cipher = register_cipher(&safer_sk128_desc); +#elif defined(DES) + prng->yarrow.cipher = register_cipher(&des3_desc); +#else + #error YARROW needs at least one CIPHER +#endif + if ((err = cipher_is_valid(prng->yarrow.cipher)) != CRYPT_OK) { + return err; + } + +#ifdef SHA256 + prng->yarrow.hash = register_hash(&sha256_desc); +#elif defined(SHA512) + prng->yarrow.hash = register_hash(&sha512_desc); +#elif defined(TIGER) + prng->yarrow.hash = register_hash(&tiger_desc); +#elif defined(SHA1) + prng->yarrow.hash = register_hash(&sha1_desc); +#elif defined(RIPEMD320) + prng->yarrow.hash = register_hash(&rmd320_desc); +#elif defined(RIPEMD256) + prng->yarrow.hash = register_hash(&rmd256_desc); +#elif defined(RIPEMD160) + prng->yarrow.hash = register_hash(&rmd160_desc); +#elif defined(RIPEMD128) + prng->yarrow.hash = register_hash(&rmd128_desc); +#elif defined(MD5) + prng->yarrow.hash = register_hash(&md5_desc); +#elif defined(MD4) + prng->yarrow.hash = register_hash(&md4_desc); +#elif defined(MD2) + prng->yarrow.hash = register_hash(&md2_desc); +#elif defined(WHIRLPOOL) + prng->yarrow.hash = register_hash(&whirlpool_desc); +#else + #error YARROW needs at least one HASH +#endif + if ((err = hash_is_valid(prng->yarrow.hash)) != CRYPT_OK) { + return err; + } + + /* zero the memory used */ + zeromem(prng->yarrow.pool, sizeof(prng->yarrow.pool)); + LTC_MUTEX_INIT(&prng->yarrow.prng_lock) + + return CRYPT_OK; +} + +/** + Add entropy to the PRNG state + @param in The data to add + @param inlen Length of the data to add + @param prng PRNG state to update + @return CRYPT_OK if successful +*/ +int yarrow_add_entropy(const unsigned char *in, unsigned long inlen, prng_state *prng) +{ + hash_state md; + int err; + + LTC_ARGCHK(in != NULL); + LTC_ARGCHK(prng != NULL); + + LTC_MUTEX_LOCK(&prng->yarrow.prng_lock); + + if ((err = hash_is_valid(prng->yarrow.hash)) != CRYPT_OK) { + LTC_MUTEX_UNLOCK(&prng->yarrow.prng_lock); + return err; + } + + /* start the hash */ + if ((err = hash_descriptor[prng->yarrow.hash].init(&md)) != CRYPT_OK) { + LTC_MUTEX_UNLOCK(&prng->yarrow.prng_lock); + return err; + } + + /* hash the current pool */ + if ((err = hash_descriptor[prng->yarrow.hash].process(&md, prng->yarrow.pool, + hash_descriptor[prng->yarrow.hash].hashsize)) != CRYPT_OK) { + LTC_MUTEX_UNLOCK(&prng->yarrow.prng_lock); + return err; + } + + /* add the new entropy */ + if ((err = hash_descriptor[prng->yarrow.hash].process(&md, in, inlen)) != CRYPT_OK) { + LTC_MUTEX_UNLOCK(&prng->yarrow.prng_lock); + return err; + } + + /* store result */ + if ((err = hash_descriptor[prng->yarrow.hash].done(&md, prng->yarrow.pool)) != CRYPT_OK) { + LTC_MUTEX_UNLOCK(&prng->yarrow.prng_lock); + return err; + } + + LTC_MUTEX_UNLOCK(&prng->yarrow.prng_lock); + return CRYPT_OK; +} + +/** + Make the PRNG ready to read from + @param prng The PRNG to make active + @return CRYPT_OK if successful +*/ +int yarrow_ready(prng_state *prng) +{ + int ks, err; + + LTC_ARGCHK(prng != NULL); + LTC_MUTEX_LOCK(&prng->yarrow.prng_lock); + + if ((err = hash_is_valid(prng->yarrow.hash)) != CRYPT_OK) { + LTC_MUTEX_UNLOCK(&prng->yarrow.prng_lock); + return err; + } + + if ((err = cipher_is_valid(prng->yarrow.cipher)) != CRYPT_OK) { + LTC_MUTEX_UNLOCK(&prng->yarrow.prng_lock); + return err; + } + + /* setup CTR mode using the "pool" as the key */ + ks = (int)hash_descriptor[prng->yarrow.hash].hashsize; + if ((err = cipher_descriptor[prng->yarrow.cipher].keysize(&ks)) != CRYPT_OK) { + LTC_MUTEX_UNLOCK(&prng->yarrow.prng_lock); + return err; + } + + if ((err = ctr_start(prng->yarrow.cipher, /* what cipher to use */ + prng->yarrow.pool, /* IV */ + prng->yarrow.pool, ks, /* KEY and key size */ + 0, /* number of rounds */ + CTR_COUNTER_LITTLE_ENDIAN, /* little endian counter */ + &prng->yarrow.ctr)) != CRYPT_OK) { + LTC_MUTEX_UNLOCK(&prng->yarrow.prng_lock); + return err; + } + LTC_MUTEX_UNLOCK(&prng->yarrow.prng_lock); + return CRYPT_OK; +} + +/** + Read from the PRNG + @param out Destination + @param outlen Length of output + @param prng The active PRNG to read from + @return Number of octets read +*/ +unsigned long yarrow_read(unsigned char *out, unsigned long outlen, prng_state *prng) +{ + LTC_ARGCHK(out != NULL); + LTC_ARGCHK(prng != NULL); + + LTC_MUTEX_LOCK(&prng->yarrow.prng_lock); + + /* put out in predictable state first */ + zeromem(out, outlen); + + /* now randomize it */ + if (ctr_encrypt(out, out, outlen, &prng->yarrow.ctr) != CRYPT_OK) { + LTC_MUTEX_UNLOCK(&prng->yarrow.prng_lock); + return 0; + } + LTC_MUTEX_UNLOCK(&prng->yarrow.prng_lock); + return outlen; +} + +/** + Terminate the PRNG + @param prng The PRNG to terminate + @return CRYPT_OK if successful +*/ +int yarrow_done(prng_state *prng) +{ + int err; + LTC_ARGCHK(prng != NULL); + + LTC_MUTEX_LOCK(&prng->yarrow.prng_lock); + + /* call cipher done when we invent one ;-) */ + + /* we invented one */ + err = ctr_done(&prng->yarrow.ctr); + + LTC_MUTEX_UNLOCK(&prng->yarrow.prng_lock); + return err; +} + +/** + Export the PRNG state + @param out [out] Destination + @param outlen [in/out] Max size and resulting size of the state + @param prng The PRNG to export + @return CRYPT_OK if successful +*/ +int yarrow_export(unsigned char *out, unsigned long *outlen, prng_state *prng) +{ + LTC_ARGCHK(out != NULL); + LTC_ARGCHK(outlen != NULL); + LTC_ARGCHK(prng != NULL); + + LTC_MUTEX_LOCK(&prng->yarrow.prng_lock); + + /* we'll write 64 bytes for s&g's */ + if (*outlen < 64) { + LTC_MUTEX_UNLOCK(&prng->yarrow.prng_lock); + *outlen = 64; + return CRYPT_BUFFER_OVERFLOW; + } + + if (yarrow_read(out, 64, prng) != 64) { + LTC_MUTEX_UNLOCK(&prng->yarrow.prng_lock); + return CRYPT_ERROR_READPRNG; + } + *outlen = 64; + + return CRYPT_OK; +} + +/** + Import a PRNG state + @param in The PRNG state + @param inlen Size of the state + @param prng The PRNG to import + @return CRYPT_OK if successful +*/ +int yarrow_import(const unsigned char *in, unsigned long inlen, prng_state *prng) +{ + int err; + + LTC_ARGCHK(in != NULL); + LTC_ARGCHK(prng != NULL); + + LTC_MUTEX_LOCK(&prng->yarrow.prng_lock); + + if (inlen != 64) { + LTC_MUTEX_UNLOCK(&prng->yarrow.prng_lock); + return CRYPT_INVALID_ARG; + } + + if ((err = yarrow_start(prng)) != CRYPT_OK) { + LTC_MUTEX_UNLOCK(&prng->yarrow.prng_lock); + return err; + } + err = yarrow_add_entropy(in, 64, prng); + LTC_MUTEX_UNLOCK(&prng->yarrow.prng_lock); + return err; +} + +/** + PRNG self-test + @return CRYPT_OK if successful, CRYPT_NOP if self-testing has been disabled +*/ +int yarrow_test(void) +{ +#ifndef LTC_TEST + return CRYPT_NOP; +#else + int err; + prng_state prng; + + if ((err = yarrow_start(&prng)) != CRYPT_OK) { + return err; + } + + /* now let's test the hash/cipher that was chosen */ + if ((err = cipher_descriptor[prng.yarrow.cipher].test()) != CRYPT_OK) { + return err; + } + if ((err = hash_descriptor[prng.yarrow.hash].test()) != CRYPT_OK) { + return err; + } + + return CRYPT_OK; +#endif +} + +#endif + + +/* $Source: /cvs/libtom/libtomcrypt/src/prngs/yarrow.c,v $ */ +/* $Revision: 1.10 $ */ +/* $Date: 2006/11/14 04:21:17 $ */ |