diff options
Diffstat (limited to 'libtomcrypt/src/hashes/sha2')
-rw-r--r-- | libtomcrypt/src/hashes/sha2/sha224.c | 125 | ||||
-rw-r--r-- | libtomcrypt/src/hashes/sha2/sha256.c | 340 | ||||
-rw-r--r-- | libtomcrypt/src/hashes/sha2/sha384.c | 135 | ||||
-rw-r--r-- | libtomcrypt/src/hashes/sha2/sha512.c | 319 |
4 files changed, 919 insertions, 0 deletions
diff --git a/libtomcrypt/src/hashes/sha2/sha224.c b/libtomcrypt/src/hashes/sha2/sha224.c new file mode 100644 index 0000000..f085d50 --- /dev/null +++ b/libtomcrypt/src/hashes/sha2/sha224.c @@ -0,0 +1,125 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +/** + @param sha224.c + SHA-224 new NIST standard based off of SHA-256 truncated to 224 bits (Tom St Denis) +*/ + +const struct ltc_hash_descriptor sha224_desc = +{ + "sha224", + 10, + 28, + 64, + + /* OID */ + { 2, 16, 840, 1, 101, 3, 4, 2, 4, }, + 9, + + &sha224_init, + &sha256_process, + &sha224_done, + &sha224_test, + NULL +}; + +/* init the sha256 er... sha224 state ;-) */ +/** + Initialize the hash state + @param md The hash state you wish to initialize + @return CRYPT_OK if successful +*/ +int sha224_init(hash_state * md) +{ + LTC_ARGCHK(md != NULL); + + md->sha256.curlen = 0; + md->sha256.length = 0; + md->sha256.state[0] = 0xc1059ed8UL; + md->sha256.state[1] = 0x367cd507UL; + md->sha256.state[2] = 0x3070dd17UL; + md->sha256.state[3] = 0xf70e5939UL; + md->sha256.state[4] = 0xffc00b31UL; + md->sha256.state[5] = 0x68581511UL; + md->sha256.state[6] = 0x64f98fa7UL; + md->sha256.state[7] = 0xbefa4fa4UL; + return CRYPT_OK; +} + +/** + Terminate the hash to get the digest + @param md The hash state + @param out [out] The destination of the hash (28 bytes) + @return CRYPT_OK if successful +*/ +int sha224_done(hash_state * md, unsigned char *out) +{ + unsigned char buf[32]; + int err; + + LTC_ARGCHK(md != NULL); + LTC_ARGCHK(out != NULL); + + err = sha256_done(md, buf); + XMEMCPY(out, buf, 28); +#ifdef LTC_CLEAN_STACK + zeromem(buf, sizeof(buf)); +#endif + return err; +} + +/** + Self-test the hash + @return CRYPT_OK if successful, CRYPT_NOP if self-tests have been disabled +*/ +int sha224_test(void) +{ + #ifndef LTC_TEST + return CRYPT_NOP; + #else + static const struct { + char *msg; + unsigned char hash[28]; + } tests[] = { + { "abc", + { 0x23, 0x09, 0x7d, 0x22, 0x34, 0x05, 0xd8, + 0x22, 0x86, 0x42, 0xa4, 0x77, 0xbd, 0xa2, + 0x55, 0xb3, 0x2a, 0xad, 0xbc, 0xe4, 0xbd, + 0xa0, 0xb3, 0xf7, 0xe3, 0x6c, 0x9d, 0xa7 } + }, + { "abcdbcdecdefdefgefghfghighijhijkijkljklmklmnlmnomnopnopq", + { 0x75, 0x38, 0x8b, 0x16, 0x51, 0x27, 0x76, + 0xcc, 0x5d, 0xba, 0x5d, 0xa1, 0xfd, 0x89, + 0x01, 0x50, 0xb0, 0xc6, 0x45, 0x5c, 0xb4, + 0xf5, 0x8b, 0x19, 0x52, 0x52, 0x25, 0x25 } + }, + }; + + int i; + unsigned char tmp[28]; + hash_state md; + + for (i = 0; i < (int)(sizeof(tests) / sizeof(tests[0])); i++) { + sha224_init(&md); + sha224_process(&md, (unsigned char*)tests[i].msg, (unsigned long)strlen(tests[i].msg)); + sha224_done(&md, tmp); + if (XMEMCMP(tmp, tests[i].hash, 28) != 0) { + return CRYPT_FAIL_TESTVECTOR; + } + } + return CRYPT_OK; + #endif +} + + +/* $Source: /cvs/libtom/libtomcrypt/src/hashes/sha2/sha224.c,v $ */ +/* $Revision: 1.8 $ */ +/* $Date: 2006/11/01 09:28:17 $ */ diff --git a/libtomcrypt/src/hashes/sha2/sha256.c b/libtomcrypt/src/hashes/sha2/sha256.c new file mode 100644 index 0000000..2b42cb7 --- /dev/null +++ b/libtomcrypt/src/hashes/sha2/sha256.c @@ -0,0 +1,340 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @file sha256.c + SHA256 by Tom St Denis +*/ + +#ifdef SHA256 + +const struct ltc_hash_descriptor sha256_desc = +{ + "sha256", + 0, + 32, + 64, + + /* OID */ + { 2, 16, 840, 1, 101, 3, 4, 2, 1, }, + 9, + + &sha256_init, + &sha256_process, + &sha256_done, + &sha256_test, + NULL +}; + +#ifdef LTC_SMALL_CODE +/* the K array */ +static const ulong32 K[64] = { + 0x428a2f98UL, 0x71374491UL, 0xb5c0fbcfUL, 0xe9b5dba5UL, 0x3956c25bUL, + 0x59f111f1UL, 0x923f82a4UL, 0xab1c5ed5UL, 0xd807aa98UL, 0x12835b01UL, + 0x243185beUL, 0x550c7dc3UL, 0x72be5d74UL, 0x80deb1feUL, 0x9bdc06a7UL, + 0xc19bf174UL, 0xe49b69c1UL, 0xefbe4786UL, 0x0fc19dc6UL, 0x240ca1ccUL, + 0x2de92c6fUL, 0x4a7484aaUL, 0x5cb0a9dcUL, 0x76f988daUL, 0x983e5152UL, + 0xa831c66dUL, 0xb00327c8UL, 0xbf597fc7UL, 0xc6e00bf3UL, 0xd5a79147UL, + 0x06ca6351UL, 0x14292967UL, 0x27b70a85UL, 0x2e1b2138UL, 0x4d2c6dfcUL, + 0x53380d13UL, 0x650a7354UL, 0x766a0abbUL, 0x81c2c92eUL, 0x92722c85UL, + 0xa2bfe8a1UL, 0xa81a664bUL, 0xc24b8b70UL, 0xc76c51a3UL, 0xd192e819UL, + 0xd6990624UL, 0xf40e3585UL, 0x106aa070UL, 0x19a4c116UL, 0x1e376c08UL, + 0x2748774cUL, 0x34b0bcb5UL, 0x391c0cb3UL, 0x4ed8aa4aUL, 0x5b9cca4fUL, + 0x682e6ff3UL, 0x748f82eeUL, 0x78a5636fUL, 0x84c87814UL, 0x8cc70208UL, + 0x90befffaUL, 0xa4506cebUL, 0xbef9a3f7UL, 0xc67178f2UL +}; +#endif + +/* Various logical functions */ +#define Ch(x,y,z) (z ^ (x & (y ^ z))) +#define Maj(x,y,z) (((x | y) & z) | (x & y)) +#define S(x, n) RORc((x),(n)) +#define R(x, n) (((x)&0xFFFFFFFFUL)>>(n)) +#define Sigma0(x) (S(x, 2) ^ S(x, 13) ^ S(x, 22)) +#define Sigma1(x) (S(x, 6) ^ S(x, 11) ^ S(x, 25)) +#define Gamma0(x) (S(x, 7) ^ S(x, 18) ^ R(x, 3)) +#define Gamma1(x) (S(x, 17) ^ S(x, 19) ^ R(x, 10)) + +/* compress 512-bits */ +#ifdef LTC_CLEAN_STACK +static int _sha256_compress(hash_state * md, unsigned char *buf) +#else +static int sha256_compress(hash_state * md, unsigned char *buf) +#endif +{ + ulong32 S[8], W[64], t0, t1; +#ifdef LTC_SMALL_CODE + ulong32 t; +#endif + int i; + + /* copy state into S */ + for (i = 0; i < 8; i++) { + S[i] = md->sha256.state[i]; + } + + /* copy the state into 512-bits into W[0..15] */ + for (i = 0; i < 16; i++) { + LOAD32H(W[i], buf + (4*i)); + } + + /* fill W[16..63] */ + for (i = 16; i < 64; i++) { + W[i] = Gamma1(W[i - 2]) + W[i - 7] + Gamma0(W[i - 15]) + W[i - 16]; + } + + /* Compress */ +#ifdef LTC_SMALL_CODE +#define RND(a,b,c,d,e,f,g,h,i) \ + t0 = h + Sigma1(e) + Ch(e, f, g) + K[i] + W[i]; \ + t1 = Sigma0(a) + Maj(a, b, c); \ + d += t0; \ + h = t0 + t1; + + for (i = 0; i < 64; ++i) { + RND(S[0],S[1],S[2],S[3],S[4],S[5],S[6],S[7],i); + t = S[7]; S[7] = S[6]; S[6] = S[5]; S[5] = S[4]; + S[4] = S[3]; S[3] = S[2]; S[2] = S[1]; S[1] = S[0]; S[0] = t; + } +#else +#define RND(a,b,c,d,e,f,g,h,i,ki) \ + t0 = h + Sigma1(e) + Ch(e, f, g) + ki + W[i]; \ + t1 = Sigma0(a) + Maj(a, b, c); \ + d += t0; \ + h = t0 + t1; + + RND(S[0],S[1],S[2],S[3],S[4],S[5],S[6],S[7],0,0x428a2f98); + RND(S[7],S[0],S[1],S[2],S[3],S[4],S[5],S[6],1,0x71374491); + RND(S[6],S[7],S[0],S[1],S[2],S[3],S[4],S[5],2,0xb5c0fbcf); + RND(S[5],S[6],S[7],S[0],S[1],S[2],S[3],S[4],3,0xe9b5dba5); + RND(S[4],S[5],S[6],S[7],S[0],S[1],S[2],S[3],4,0x3956c25b); + RND(S[3],S[4],S[5],S[6],S[7],S[0],S[1],S[2],5,0x59f111f1); + RND(S[2],S[3],S[4],S[5],S[6],S[7],S[0],S[1],6,0x923f82a4); + RND(S[1],S[2],S[3],S[4],S[5],S[6],S[7],S[0],7,0xab1c5ed5); + RND(S[0],S[1],S[2],S[3],S[4],S[5],S[6],S[7],8,0xd807aa98); + RND(S[7],S[0],S[1],S[2],S[3],S[4],S[5],S[6],9,0x12835b01); + RND(S[6],S[7],S[0],S[1],S[2],S[3],S[4],S[5],10,0x243185be); + RND(S[5],S[6],S[7],S[0],S[1],S[2],S[3],S[4],11,0x550c7dc3); + RND(S[4],S[5],S[6],S[7],S[0],S[1],S[2],S[3],12,0x72be5d74); + RND(S[3],S[4],S[5],S[6],S[7],S[0],S[1],S[2],13,0x80deb1fe); + RND(S[2],S[3],S[4],S[5],S[6],S[7],S[0],S[1],14,0x9bdc06a7); + RND(S[1],S[2],S[3],S[4],S[5],S[6],S[7],S[0],15,0xc19bf174); + RND(S[0],S[1],S[2],S[3],S[4],S[5],S[6],S[7],16,0xe49b69c1); + RND(S[7],S[0],S[1],S[2],S[3],S[4],S[5],S[6],17,0xefbe4786); + RND(S[6],S[7],S[0],S[1],S[2],S[3],S[4],S[5],18,0x0fc19dc6); + RND(S[5],S[6],S[7],S[0],S[1],S[2],S[3],S[4],19,0x240ca1cc); + RND(S[4],S[5],S[6],S[7],S[0],S[1],S[2],S[3],20,0x2de92c6f); + RND(S[3],S[4],S[5],S[6],S[7],S[0],S[1],S[2],21,0x4a7484aa); + RND(S[2],S[3],S[4],S[5],S[6],S[7],S[0],S[1],22,0x5cb0a9dc); + RND(S[1],S[2],S[3],S[4],S[5],S[6],S[7],S[0],23,0x76f988da); + RND(S[0],S[1],S[2],S[3],S[4],S[5],S[6],S[7],24,0x983e5152); + RND(S[7],S[0],S[1],S[2],S[3],S[4],S[5],S[6],25,0xa831c66d); + RND(S[6],S[7],S[0],S[1],S[2],S[3],S[4],S[5],26,0xb00327c8); + RND(S[5],S[6],S[7],S[0],S[1],S[2],S[3],S[4],27,0xbf597fc7); + RND(S[4],S[5],S[6],S[7],S[0],S[1],S[2],S[3],28,0xc6e00bf3); + RND(S[3],S[4],S[5],S[6],S[7],S[0],S[1],S[2],29,0xd5a79147); + RND(S[2],S[3],S[4],S[5],S[6],S[7],S[0],S[1],30,0x06ca6351); + RND(S[1],S[2],S[3],S[4],S[5],S[6],S[7],S[0],31,0x14292967); + RND(S[0],S[1],S[2],S[3],S[4],S[5],S[6],S[7],32,0x27b70a85); + RND(S[7],S[0],S[1],S[2],S[3],S[4],S[5],S[6],33,0x2e1b2138); + RND(S[6],S[7],S[0],S[1],S[2],S[3],S[4],S[5],34,0x4d2c6dfc); + RND(S[5],S[6],S[7],S[0],S[1],S[2],S[3],S[4],35,0x53380d13); + RND(S[4],S[5],S[6],S[7],S[0],S[1],S[2],S[3],36,0x650a7354); + RND(S[3],S[4],S[5],S[6],S[7],S[0],S[1],S[2],37,0x766a0abb); + RND(S[2],S[3],S[4],S[5],S[6],S[7],S[0],S[1],38,0x81c2c92e); + RND(S[1],S[2],S[3],S[4],S[5],S[6],S[7],S[0],39,0x92722c85); + RND(S[0],S[1],S[2],S[3],S[4],S[5],S[6],S[7],40,0xa2bfe8a1); + RND(S[7],S[0],S[1],S[2],S[3],S[4],S[5],S[6],41,0xa81a664b); + RND(S[6],S[7],S[0],S[1],S[2],S[3],S[4],S[5],42,0xc24b8b70); + RND(S[5],S[6],S[7],S[0],S[1],S[2],S[3],S[4],43,0xc76c51a3); + RND(S[4],S[5],S[6],S[7],S[0],S[1],S[2],S[3],44,0xd192e819); + RND(S[3],S[4],S[5],S[6],S[7],S[0],S[1],S[2],45,0xd6990624); + RND(S[2],S[3],S[4],S[5],S[6],S[7],S[0],S[1],46,0xf40e3585); + RND(S[1],S[2],S[3],S[4],S[5],S[6],S[7],S[0],47,0x106aa070); + RND(S[0],S[1],S[2],S[3],S[4],S[5],S[6],S[7],48,0x19a4c116); + RND(S[7],S[0],S[1],S[2],S[3],S[4],S[5],S[6],49,0x1e376c08); + RND(S[6],S[7],S[0],S[1],S[2],S[3],S[4],S[5],50,0x2748774c); + RND(S[5],S[6],S[7],S[0],S[1],S[2],S[3],S[4],51,0x34b0bcb5); + RND(S[4],S[5],S[6],S[7],S[0],S[1],S[2],S[3],52,0x391c0cb3); + RND(S[3],S[4],S[5],S[6],S[7],S[0],S[1],S[2],53,0x4ed8aa4a); + RND(S[2],S[3],S[4],S[5],S[6],S[7],S[0],S[1],54,0x5b9cca4f); + RND(S[1],S[2],S[3],S[4],S[5],S[6],S[7],S[0],55,0x682e6ff3); + RND(S[0],S[1],S[2],S[3],S[4],S[5],S[6],S[7],56,0x748f82ee); + RND(S[7],S[0],S[1],S[2],S[3],S[4],S[5],S[6],57,0x78a5636f); + RND(S[6],S[7],S[0],S[1],S[2],S[3],S[4],S[5],58,0x84c87814); + RND(S[5],S[6],S[7],S[0],S[1],S[2],S[3],S[4],59,0x8cc70208); + RND(S[4],S[5],S[6],S[7],S[0],S[1],S[2],S[3],60,0x90befffa); + RND(S[3],S[4],S[5],S[6],S[7],S[0],S[1],S[2],61,0xa4506ceb); + RND(S[2],S[3],S[4],S[5],S[6],S[7],S[0],S[1],62,0xbef9a3f7); + RND(S[1],S[2],S[3],S[4],S[5],S[6],S[7],S[0],63,0xc67178f2); + +#undef RND + +#endif + + /* feedback */ + for (i = 0; i < 8; i++) { + md->sha256.state[i] = md->sha256.state[i] + S[i]; + } + return CRYPT_OK; +} + +#ifdef LTC_CLEAN_STACK +static int sha256_compress(hash_state * md, unsigned char *buf) +{ + int err; + err = _sha256_compress(md, buf); + burn_stack(sizeof(ulong32) * 74); + return err; +} +#endif + +/** + Initialize the hash state + @param md The hash state you wish to initialize + @return CRYPT_OK if successful +*/ +int sha256_init(hash_state * md) +{ + LTC_ARGCHK(md != NULL); + + md->sha256.curlen = 0; + md->sha256.length = 0; + md->sha256.state[0] = 0x6A09E667UL; + md->sha256.state[1] = 0xBB67AE85UL; + md->sha256.state[2] = 0x3C6EF372UL; + md->sha256.state[3] = 0xA54FF53AUL; + md->sha256.state[4] = 0x510E527FUL; + md->sha256.state[5] = 0x9B05688CUL; + md->sha256.state[6] = 0x1F83D9ABUL; + md->sha256.state[7] = 0x5BE0CD19UL; + return CRYPT_OK; +} + +/** + Process a block of memory though the hash + @param md The hash state + @param in The data to hash + @param inlen The length of the data (octets) + @return CRYPT_OK if successful +*/ +HASH_PROCESS(sha256_process, sha256_compress, sha256, 64) + +/** + Terminate the hash to get the digest + @param md The hash state + @param out [out] The destination of the hash (32 bytes) + @return CRYPT_OK if successful +*/ +int sha256_done(hash_state * md, unsigned char *out) +{ + int i; + + LTC_ARGCHK(md != NULL); + LTC_ARGCHK(out != NULL); + + if (md->sha256.curlen >= sizeof(md->sha256.buf)) { + return CRYPT_INVALID_ARG; + } + + + /* increase the length of the message */ + md->sha256.length += md->sha256.curlen * 8; + + /* append the '1' bit */ + md->sha256.buf[md->sha256.curlen++] = (unsigned char)0x80; + + /* if the length is currently above 56 bytes we append zeros + * then compress. Then we can fall back to padding zeros and length + * encoding like normal. + */ + if (md->sha256.curlen > 56) { + while (md->sha256.curlen < 64) { + md->sha256.buf[md->sha256.curlen++] = (unsigned char)0; + } + sha256_compress(md, md->sha256.buf); + md->sha256.curlen = 0; + } + + /* pad upto 56 bytes of zeroes */ + while (md->sha256.curlen < 56) { + md->sha256.buf[md->sha256.curlen++] = (unsigned char)0; + } + + /* store length */ + STORE64H(md->sha256.length, md->sha256.buf+56); + sha256_compress(md, md->sha256.buf); + + /* copy output */ + for (i = 0; i < 8; i++) { + STORE32H(md->sha256.state[i], out+(4*i)); + } +#ifdef LTC_CLEAN_STACK + zeromem(md, sizeof(hash_state)); +#endif + return CRYPT_OK; +} + +/** + Self-test the hash + @return CRYPT_OK if successful, CRYPT_NOP if self-tests have been disabled +*/ +int sha256_test(void) +{ + #ifndef LTC_TEST + return CRYPT_NOP; + #else + static const struct { + char *msg; + unsigned char hash[32]; + } tests[] = { + { "abc", + { 0xba, 0x78, 0x16, 0xbf, 0x8f, 0x01, 0xcf, 0xea, + 0x41, 0x41, 0x40, 0xde, 0x5d, 0xae, 0x22, 0x23, + 0xb0, 0x03, 0x61, 0xa3, 0x96, 0x17, 0x7a, 0x9c, + 0xb4, 0x10, 0xff, 0x61, 0xf2, 0x00, 0x15, 0xad } + }, + { "abcdbcdecdefdefgefghfghighijhijkijkljklmklmnlmnomnopnopq", + { 0x24, 0x8d, 0x6a, 0x61, 0xd2, 0x06, 0x38, 0xb8, + 0xe5, 0xc0, 0x26, 0x93, 0x0c, 0x3e, 0x60, 0x39, + 0xa3, 0x3c, 0xe4, 0x59, 0x64, 0xff, 0x21, 0x67, + 0xf6, 0xec, 0xed, 0xd4, 0x19, 0xdb, 0x06, 0xc1 } + }, + }; + + int i; + unsigned char tmp[32]; + hash_state md; + + for (i = 0; i < (int)(sizeof(tests) / sizeof(tests[0])); i++) { + sha256_init(&md); + sha256_process(&md, (unsigned char*)tests[i].msg, (unsigned long)strlen(tests[i].msg)); + sha256_done(&md, tmp); + if (XMEMCMP(tmp, tests[i].hash, 32) != 0) { + return CRYPT_FAIL_TESTVECTOR; + } + } + return CRYPT_OK; + #endif +} + +#ifdef SHA224 +#include "sha224.c" +#endif + +#endif + + + +/* $Source: /cvs/libtom/libtomcrypt/src/hashes/sha2/sha256.c,v $ */ +/* $Revision: 1.9 $ */ +/* $Date: 2006/11/01 09:28:17 $ */ diff --git a/libtomcrypt/src/hashes/sha2/sha384.c b/libtomcrypt/src/hashes/sha2/sha384.c new file mode 100644 index 0000000..ac7709c --- /dev/null +++ b/libtomcrypt/src/hashes/sha2/sha384.c @@ -0,0 +1,135 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +/** + @param sha384.c + SHA384 hash included in sha512.c, Tom St Denis +*/ + +const struct ltc_hash_descriptor sha384_desc = +{ + "sha384", + 4, + 48, + 128, + + /* OID */ + { 2, 16, 840, 1, 101, 3, 4, 2, 2, }, + 9, + + &sha384_init, + &sha512_process, + &sha384_done, + &sha384_test, + NULL +}; + +/** + Initialize the hash state + @param md The hash state you wish to initialize + @return CRYPT_OK if successful +*/ +int sha384_init(hash_state * md) +{ + LTC_ARGCHK(md != NULL); + + md->sha512.curlen = 0; + md->sha512.length = 0; + md->sha512.state[0] = CONST64(0xcbbb9d5dc1059ed8); + md->sha512.state[1] = CONST64(0x629a292a367cd507); + md->sha512.state[2] = CONST64(0x9159015a3070dd17); + md->sha512.state[3] = CONST64(0x152fecd8f70e5939); + md->sha512.state[4] = CONST64(0x67332667ffc00b31); + md->sha512.state[5] = CONST64(0x8eb44a8768581511); + md->sha512.state[6] = CONST64(0xdb0c2e0d64f98fa7); + md->sha512.state[7] = CONST64(0x47b5481dbefa4fa4); + return CRYPT_OK; +} + +/** + Terminate the hash to get the digest + @param md The hash state + @param out [out] The destination of the hash (48 bytes) + @return CRYPT_OK if successful +*/ +int sha384_done(hash_state * md, unsigned char *out) +{ + unsigned char buf[64]; + + LTC_ARGCHK(md != NULL); + LTC_ARGCHK(out != NULL); + + if (md->sha512.curlen >= sizeof(md->sha512.buf)) { + return CRYPT_INVALID_ARG; + } + + sha512_done(md, buf); + XMEMCPY(out, buf, 48); +#ifdef LTC_CLEAN_STACK + zeromem(buf, sizeof(buf)); +#endif + return CRYPT_OK; +} + +/** + Self-test the hash + @return CRYPT_OK if successful, CRYPT_NOP if self-tests have been disabled +*/ +int sha384_test(void) +{ + #ifndef LTC_TEST + return CRYPT_NOP; + #else + static const struct { + char *msg; + unsigned char hash[48]; + } tests[] = { + { "abc", + { 0xcb, 0x00, 0x75, 0x3f, 0x45, 0xa3, 0x5e, 0x8b, + 0xb5, 0xa0, 0x3d, 0x69, 0x9a, 0xc6, 0x50, 0x07, + 0x27, 0x2c, 0x32, 0xab, 0x0e, 0xde, 0xd1, 0x63, + 0x1a, 0x8b, 0x60, 0x5a, 0x43, 0xff, 0x5b, 0xed, + 0x80, 0x86, 0x07, 0x2b, 0xa1, 0xe7, 0xcc, 0x23, + 0x58, 0xba, 0xec, 0xa1, 0x34, 0xc8, 0x25, 0xa7 } + }, + { "abcdefghbcdefghicdefghijdefghijkefghijklfghijklmghijklmnhijklmnoijklmnopjklmnopqklmnopqrlmnopqrsmnopqrstnopqrstu", + { 0x09, 0x33, 0x0c, 0x33, 0xf7, 0x11, 0x47, 0xe8, + 0x3d, 0x19, 0x2f, 0xc7, 0x82, 0xcd, 0x1b, 0x47, + 0x53, 0x11, 0x1b, 0x17, 0x3b, 0x3b, 0x05, 0xd2, + 0x2f, 0xa0, 0x80, 0x86, 0xe3, 0xb0, 0xf7, 0x12, + 0xfc, 0xc7, 0xc7, 0x1a, 0x55, 0x7e, 0x2d, 0xb9, + 0x66, 0xc3, 0xe9, 0xfa, 0x91, 0x74, 0x60, 0x39 } + }, + }; + + int i; + unsigned char tmp[48]; + hash_state md; + + for (i = 0; i < (int)(sizeof(tests) / sizeof(tests[0])); i++) { + sha384_init(&md); + sha384_process(&md, (unsigned char*)tests[i].msg, (unsigned long)strlen(tests[i].msg)); + sha384_done(&md, tmp); + if (XMEMCMP(tmp, tests[i].hash, 48) != 0) { + return CRYPT_FAIL_TESTVECTOR; + } + } + return CRYPT_OK; + #endif +} + + + + + + +/* $Source: /cvs/libtom/libtomcrypt/src/hashes/sha2/sha384.c,v $ */ +/* $Revision: 1.8 $ */ +/* $Date: 2006/11/01 09:28:17 $ */ diff --git a/libtomcrypt/src/hashes/sha2/sha512.c b/libtomcrypt/src/hashes/sha2/sha512.c new file mode 100644 index 0000000..08c95ef --- /dev/null +++ b/libtomcrypt/src/hashes/sha2/sha512.c @@ -0,0 +1,319 @@ +/* LibTomCrypt, modular cryptographic library -- Tom St Denis + * + * LibTomCrypt is a library that provides various cryptographic + * algorithms in a highly modular and flexible manner. + * + * The library is free for all purposes without any express + * guarantee it works. + * + * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com + */ +#include "tomcrypt.h" + +/** + @param sha512.c + SHA512 by Tom St Denis +*/ + +#ifdef SHA512 + +const struct ltc_hash_descriptor sha512_desc = +{ + "sha512", + 5, + 64, + 128, + + /* OID */ + { 2, 16, 840, 1, 101, 3, 4, 2, 3, }, + 9, + + &sha512_init, + &sha512_process, + &sha512_done, + &sha512_test, + NULL +}; + +/* the K array */ +static const ulong64 K[80] = { +CONST64(0x428a2f98d728ae22), CONST64(0x7137449123ef65cd), +CONST64(0xb5c0fbcfec4d3b2f), CONST64(0xe9b5dba58189dbbc), +CONST64(0x3956c25bf348b538), CONST64(0x59f111f1b605d019), +CONST64(0x923f82a4af194f9b), CONST64(0xab1c5ed5da6d8118), +CONST64(0xd807aa98a3030242), CONST64(0x12835b0145706fbe), +CONST64(0x243185be4ee4b28c), CONST64(0x550c7dc3d5ffb4e2), +CONST64(0x72be5d74f27b896f), CONST64(0x80deb1fe3b1696b1), +CONST64(0x9bdc06a725c71235), CONST64(0xc19bf174cf692694), +CONST64(0xe49b69c19ef14ad2), CONST64(0xefbe4786384f25e3), +CONST64(0x0fc19dc68b8cd5b5), CONST64(0x240ca1cc77ac9c65), +CONST64(0x2de92c6f592b0275), CONST64(0x4a7484aa6ea6e483), +CONST64(0x5cb0a9dcbd41fbd4), CONST64(0x76f988da831153b5), +CONST64(0x983e5152ee66dfab), CONST64(0xa831c66d2db43210), +CONST64(0xb00327c898fb213f), CONST64(0xbf597fc7beef0ee4), +CONST64(0xc6e00bf33da88fc2), CONST64(0xd5a79147930aa725), +CONST64(0x06ca6351e003826f), CONST64(0x142929670a0e6e70), +CONST64(0x27b70a8546d22ffc), CONST64(0x2e1b21385c26c926), +CONST64(0x4d2c6dfc5ac42aed), CONST64(0x53380d139d95b3df), +CONST64(0x650a73548baf63de), CONST64(0x766a0abb3c77b2a8), +CONST64(0x81c2c92e47edaee6), CONST64(0x92722c851482353b), +CONST64(0xa2bfe8a14cf10364), CONST64(0xa81a664bbc423001), +CONST64(0xc24b8b70d0f89791), CONST64(0xc76c51a30654be30), +CONST64(0xd192e819d6ef5218), CONST64(0xd69906245565a910), +CONST64(0xf40e35855771202a), CONST64(0x106aa07032bbd1b8), +CONST64(0x19a4c116b8d2d0c8), CONST64(0x1e376c085141ab53), +CONST64(0x2748774cdf8eeb99), CONST64(0x34b0bcb5e19b48a8), +CONST64(0x391c0cb3c5c95a63), CONST64(0x4ed8aa4ae3418acb), +CONST64(0x5b9cca4f7763e373), CONST64(0x682e6ff3d6b2b8a3), +CONST64(0x748f82ee5defb2fc), CONST64(0x78a5636f43172f60), +CONST64(0x84c87814a1f0ab72), CONST64(0x8cc702081a6439ec), +CONST64(0x90befffa23631e28), CONST64(0xa4506cebde82bde9), +CONST64(0xbef9a3f7b2c67915), CONST64(0xc67178f2e372532b), +CONST64(0xca273eceea26619c), CONST64(0xd186b8c721c0c207), +CONST64(0xeada7dd6cde0eb1e), CONST64(0xf57d4f7fee6ed178), +CONST64(0x06f067aa72176fba), CONST64(0x0a637dc5a2c898a6), +CONST64(0x113f9804bef90dae), CONST64(0x1b710b35131c471b), +CONST64(0x28db77f523047d84), CONST64(0x32caab7b40c72493), +CONST64(0x3c9ebe0a15c9bebc), CONST64(0x431d67c49c100d4c), +CONST64(0x4cc5d4becb3e42b6), CONST64(0x597f299cfc657e2a), +CONST64(0x5fcb6fab3ad6faec), CONST64(0x6c44198c4a475817) +}; + +/* Various logical functions */ +#define Ch(x,y,z) (z ^ (x & (y ^ z))) +#define Maj(x,y,z) (((x | y) & z) | (x & y)) +#define S(x, n) ROR64c(x, n) +#define R(x, n) (((x)&CONST64(0xFFFFFFFFFFFFFFFF))>>((ulong64)n)) +#define Sigma0(x) (S(x, 28) ^ S(x, 34) ^ S(x, 39)) +#define Sigma1(x) (S(x, 14) ^ S(x, 18) ^ S(x, 41)) +#define Gamma0(x) (S(x, 1) ^ S(x, 8) ^ R(x, 7)) +#define Gamma1(x) (S(x, 19) ^ S(x, 61) ^ R(x, 6)) + +/* compress 1024-bits */ +#ifdef LTC_CLEAN_STACK +static int _sha512_compress(hash_state * md, unsigned char *buf) +#else +static int sha512_compress(hash_state * md, unsigned char *buf) +#endif +{ + ulong64 S[8], W[80], t0, t1; + int i; + + /* copy state into S */ + for (i = 0; i < 8; i++) { + S[i] = md->sha512.state[i]; + } + + /* copy the state into 1024-bits into W[0..15] */ + for (i = 0; i < 16; i++) { + LOAD64H(W[i], buf + (8*i)); + } + + /* fill W[16..79] */ + for (i = 16; i < 80; i++) { + W[i] = Gamma1(W[i - 2]) + W[i - 7] + Gamma0(W[i - 15]) + W[i - 16]; + } + + /* Compress */ +#ifdef LTC_SMALL_CODE + for (i = 0; i < 80; i++) { + t0 = S[7] + Sigma1(S[4]) + Ch(S[4], S[5], S[6]) + K[i] + W[i]; + t1 = Sigma0(S[0]) + Maj(S[0], S[1], S[2]); + S[7] = S[6]; + S[6] = S[5]; + S[5] = S[4]; + S[4] = S[3] + t0; + S[3] = S[2]; + S[2] = S[1]; + S[1] = S[0]; + S[0] = t0 + t1; + } +#else +#define RND(a,b,c,d,e,f,g,h,i) \ + t0 = h + Sigma1(e) + Ch(e, f, g) + K[i] + W[i]; \ + t1 = Sigma0(a) + Maj(a, b, c); \ + d += t0; \ + h = t0 + t1; + + for (i = 0; i < 80; i += 8) { + RND(S[0],S[1],S[2],S[3],S[4],S[5],S[6],S[7],i+0); + RND(S[7],S[0],S[1],S[2],S[3],S[4],S[5],S[6],i+1); + RND(S[6],S[7],S[0],S[1],S[2],S[3],S[4],S[5],i+2); + RND(S[5],S[6],S[7],S[0],S[1],S[2],S[3],S[4],i+3); + RND(S[4],S[5],S[6],S[7],S[0],S[1],S[2],S[3],i+4); + RND(S[3],S[4],S[5],S[6],S[7],S[0],S[1],S[2],i+5); + RND(S[2],S[3],S[4],S[5],S[6],S[7],S[0],S[1],i+6); + RND(S[1],S[2],S[3],S[4],S[5],S[6],S[7],S[0],i+7); + } +#endif + + + /* feedback */ + for (i = 0; i < 8; i++) { + md->sha512.state[i] = md->sha512.state[i] + S[i]; + } + + return CRYPT_OK; +} + +/* compress 1024-bits */ +#ifdef LTC_CLEAN_STACK +static int sha512_compress(hash_state * md, unsigned char *buf) +{ + int err; + err = _sha512_compress(md, buf); + burn_stack(sizeof(ulong64) * 90 + sizeof(int)); + return err; +} +#endif + +/** + Initialize the hash state + @param md The hash state you wish to initialize + @return CRYPT_OK if successful +*/ +int sha512_init(hash_state * md) +{ + LTC_ARGCHK(md != NULL); + md->sha512.curlen = 0; + md->sha512.length = 0; + md->sha512.state[0] = CONST64(0x6a09e667f3bcc908); + md->sha512.state[1] = CONST64(0xbb67ae8584caa73b); + md->sha512.state[2] = CONST64(0x3c6ef372fe94f82b); + md->sha512.state[3] = CONST64(0xa54ff53a5f1d36f1); + md->sha512.state[4] = CONST64(0x510e527fade682d1); + md->sha512.state[5] = CONST64(0x9b05688c2b3e6c1f); + md->sha512.state[6] = CONST64(0x1f83d9abfb41bd6b); + md->sha512.state[7] = CONST64(0x5be0cd19137e2179); + return CRYPT_OK; +} + +/** + Process a block of memory though the hash + @param md The hash state + @param in The data to hash + @param inlen The length of the data (octets) + @return CRYPT_OK if successful +*/ +HASH_PROCESS(sha512_process, sha512_compress, sha512, 128) + +/** + Terminate the hash to get the digest + @param md The hash state + @param out [out] The destination of the hash (64 bytes) + @return CRYPT_OK if successful +*/ +int sha512_done(hash_state * md, unsigned char *out) +{ + int i; + + LTC_ARGCHK(md != NULL); + LTC_ARGCHK(out != NULL); + + if (md->sha512.curlen >= sizeof(md->sha512.buf)) { + return CRYPT_INVALID_ARG; + } + + /* increase the length of the message */ + md->sha512.length += md->sha512.curlen * CONST64(8); + + /* append the '1' bit */ + md->sha512.buf[md->sha512.curlen++] = (unsigned char)0x80; + + /* if the length is currently above 112 bytes we append zeros + * then compress. Then we can fall back to padding zeros and length + * encoding like normal. + */ + if (md->sha512.curlen > 112) { + while (md->sha512.curlen < 128) { + md->sha512.buf[md->sha512.curlen++] = (unsigned char)0; + } + sha512_compress(md, md->sha512.buf); + md->sha512.curlen = 0; + } + + /* pad upto 120 bytes of zeroes + * note: that from 112 to 120 is the 64 MSB of the length. We assume that you won't hash + * > 2^64 bits of data... :-) + */ + while (md->sha512.curlen < 120) { + md->sha512.buf[md->sha512.curlen++] = (unsigned char)0; + } + + /* store length */ + STORE64H(md->sha512.length, md->sha512.buf+120); + sha512_compress(md, md->sha512.buf); + + /* copy output */ + for (i = 0; i < 8; i++) { + STORE64H(md->sha512.state[i], out+(8*i)); + } +#ifdef LTC_CLEAN_STACK + zeromem(md, sizeof(hash_state)); +#endif + return CRYPT_OK; +} + +/** + Self-test the hash + @return CRYPT_OK if successful, CRYPT_NOP if self-tests have been disabled +*/ +int sha512_test(void) +{ + #ifndef LTC_TEST + return CRYPT_NOP; + #else + static const struct { + char *msg; + unsigned char hash[64]; + } tests[] = { + { "abc", + { 0xdd, 0xaf, 0x35, 0xa1, 0x93, 0x61, 0x7a, 0xba, + 0xcc, 0x41, 0x73, 0x49, 0xae, 0x20, 0x41, 0x31, + 0x12, 0xe6, 0xfa, 0x4e, 0x89, 0xa9, 0x7e, 0xa2, + 0x0a, 0x9e, 0xee, 0xe6, 0x4b, 0x55, 0xd3, 0x9a, + 0x21, 0x92, 0x99, 0x2a, 0x27, 0x4f, 0xc1, 0xa8, + 0x36, 0xba, 0x3c, 0x23, 0xa3, 0xfe, 0xeb, 0xbd, + 0x45, 0x4d, 0x44, 0x23, 0x64, 0x3c, 0xe8, 0x0e, + 0x2a, 0x9a, 0xc9, 0x4f, 0xa5, 0x4c, 0xa4, 0x9f } + }, + { "abcdefghbcdefghicdefghijdefghijkefghijklfghijklmghijklmnhijklmnoijklmnopjklmnopqklmnopqrlmnopqrsmnopqrstnopqrstu", + { 0x8e, 0x95, 0x9b, 0x75, 0xda, 0xe3, 0x13, 0xda, + 0x8c, 0xf4, 0xf7, 0x28, 0x14, 0xfc, 0x14, 0x3f, + 0x8f, 0x77, 0x79, 0xc6, 0xeb, 0x9f, 0x7f, 0xa1, + 0x72, 0x99, 0xae, 0xad, 0xb6, 0x88, 0x90, 0x18, + 0x50, 0x1d, 0x28, 0x9e, 0x49, 0x00, 0xf7, 0xe4, + 0x33, 0x1b, 0x99, 0xde, 0xc4, 0xb5, 0x43, 0x3a, + 0xc7, 0xd3, 0x29, 0xee, 0xb6, 0xdd, 0x26, 0x54, + 0x5e, 0x96, 0xe5, 0x5b, 0x87, 0x4b, 0xe9, 0x09 } + }, + }; + + int i; + unsigned char tmp[64]; + hash_state md; + + for (i = 0; i < (int)(sizeof(tests) / sizeof(tests[0])); i++) { + sha512_init(&md); + sha512_process(&md, (unsigned char *)tests[i].msg, (unsigned long)strlen(tests[i].msg)); + sha512_done(&md, tmp); + if (XMEMCMP(tmp, tests[i].hash, 64) != 0) { + return CRYPT_FAIL_TESTVECTOR; + } + } + return CRYPT_OK; + #endif +} + +#ifdef SHA384 + #include "sha384.c" +#endif + +#endif + + + + +/* $Source: /cvs/libtom/libtomcrypt/src/hashes/sha2/sha512.c,v $ */ +/* $Revision: 1.8 $ */ +/* $Date: 2006/11/01 09:28:17 $ */ |