summaryrefslogtreecommitdiffhomepage
diff options
context:
space:
mode:
-rw-r--r--CHANGES2
-rw-r--r--bignum.c16
-rw-r--r--bignum.h1
-rw-r--r--configure.ac86
-rw-r--r--curve25519-donna.c294
-rw-r--r--default_options.h9
-rw-r--r--default_options.h.in7
-rw-r--r--dropbearkey.c5
-rw-r--r--dss.c56
-rw-r--r--dss.h3
-rw-r--r--gensignkey.c21
-rw-r--r--gensignkey.h1
-rw-r--r--includes.h2
-rw-r--r--libtomcrypt/Doxyfile2
-rw-r--r--libtomcrypt/Makefile.in146
-rw-r--r--libtomcrypt/TODO14
-rw-r--r--libtomcrypt/changes19
-rw-r--r--libtomcrypt/crypt.lof12
-rw-r--r--libtomcrypt/crypt.tex95
-rw-r--r--libtomcrypt/demos/encrypt.c40
-rw-r--r--libtomcrypt/demos/hashsum.c32
-rw-r--r--libtomcrypt/demos/multi.c10
-rw-r--r--libtomcrypt/demos/small.c6
-rw-r--r--libtomcrypt/demos/test.c6
-rw-r--r--libtomcrypt/demos/timing.c6
-rw-r--r--libtomcrypt/demos/tv_gen.c84
-rw-r--r--libtomcrypt/makefile.icc117
-rw-r--r--libtomcrypt/makefile.msvc117
-rw-r--r--libtomcrypt/makefile.shared119
-rw-r--r--libtomcrypt/makefile.unix117
-rw-r--r--libtomcrypt/notes/etc/saferp_optimizer.c8
-rw-r--r--libtomcrypt/notes/etc/whirlgen.c6
-rw-r--r--libtomcrypt/notes/etc/whirltest.c6
-rw-r--r--libtomcrypt/notes/tech0005.txt2
-rw-r--r--libtomcrypt/src/ciphers/aes/aes.c10
-rw-r--r--libtomcrypt/src/ciphers/aes/aes_tab.c8
-rw-r--r--libtomcrypt/src/ciphers/anubis.c18
-rw-r--r--libtomcrypt/src/ciphers/blowfish.c10
-rw-r--r--libtomcrypt/src/ciphers/cast5.c20
-rw-r--r--libtomcrypt/src/ciphers/des.c26
-rw-r--r--libtomcrypt/src/ciphers/kasumi.c8
-rw-r--r--libtomcrypt/src/ciphers/khazad.c10
-rw-r--r--libtomcrypt/src/ciphers/kseed.c10
-rw-r--r--libtomcrypt/src/ciphers/multi2.c303
-rw-r--r--libtomcrypt/src/ciphers/noekeon.c10
-rw-r--r--libtomcrypt/src/ciphers/rc2.c20
-rw-r--r--libtomcrypt/src/ciphers/rc5.c20
-rw-r--r--libtomcrypt/src/ciphers/rc6.c22
-rw-r--r--libtomcrypt/src/ciphers/safer/safer.c80
-rw-r--r--libtomcrypt/src/ciphers/safer/safer_tab.c12
-rw-r--r--libtomcrypt/src/ciphers/safer/saferp.c22
-rw-r--r--libtomcrypt/src/ciphers/skipjack.c10
-rw-r--r--libtomcrypt/src/ciphers/twofish/twofish.c50
-rw-r--r--libtomcrypt/src/ciphers/twofish/twofish_tab.c14
-rw-r--r--libtomcrypt/src/ciphers/xtea.c18
-rw-r--r--libtomcrypt/src/encauth/ccm/ccm_memory.c10
-rw-r--r--libtomcrypt/src/encauth/ccm/ccm_test.c10
-rw-r--r--libtomcrypt/src/encauth/eax/eax_addheader.c10
-rw-r--r--libtomcrypt/src/encauth/eax/eax_decrypt.c10
-rw-r--r--libtomcrypt/src/encauth/eax/eax_decrypt_verify_memory.c10
-rw-r--r--libtomcrypt/src/encauth/eax/eax_done.c10
-rw-r--r--libtomcrypt/src/encauth/eax/eax_encrypt.c10
-rw-r--r--libtomcrypt/src/encauth/eax/eax_encrypt_authenticate_memory.c10
-rw-r--r--libtomcrypt/src/encauth/eax/eax_init.c16
-rw-r--r--libtomcrypt/src/encauth/eax/eax_test.c12
-rw-r--r--libtomcrypt/src/encauth/gcm/gcm_add_aad.c16
-rw-r--r--libtomcrypt/src/encauth/gcm/gcm_add_iv.c12
-rw-r--r--libtomcrypt/src/encauth/gcm/gcm_done.c12
-rw-r--r--libtomcrypt/src/encauth/gcm/gcm_gf_mult.c12
-rw-r--r--libtomcrypt/src/encauth/gcm/gcm_init.c16
-rw-r--r--libtomcrypt/src/encauth/gcm/gcm_memory.c14
-rw-r--r--libtomcrypt/src/encauth/gcm/gcm_mult_h.c16
-rw-r--r--libtomcrypt/src/encauth/gcm/gcm_process.c16
-rw-r--r--libtomcrypt/src/encauth/gcm/gcm_reset.c12
-rw-r--r--libtomcrypt/src/encauth/gcm/gcm_test.c10
-rw-r--r--libtomcrypt/src/encauth/ocb/ocb_decrypt.c10
-rw-r--r--libtomcrypt/src/encauth/ocb/ocb_decrypt_verify_memory.c10
-rw-r--r--libtomcrypt/src/encauth/ocb/ocb_done_decrypt.c10
-rw-r--r--libtomcrypt/src/encauth/ocb/ocb_done_encrypt.c10
-rw-r--r--libtomcrypt/src/encauth/ocb/ocb_encrypt.c10
-rw-r--r--libtomcrypt/src/encauth/ocb/ocb_encrypt_authenticate_memory.c10
-rw-r--r--libtomcrypt/src/encauth/ocb/ocb_init.c10
-rw-r--r--libtomcrypt/src/encauth/ocb/ocb_ntz.c10
-rw-r--r--libtomcrypt/src/encauth/ocb/ocb_shift_xor.c10
-rw-r--r--libtomcrypt/src/encauth/ocb/ocb_test.c12
-rw-r--r--libtomcrypt/src/encauth/ocb/s_ocb_done.c10
-rw-r--r--libtomcrypt/src/hashes/chc/chc.c10
-rw-r--r--libtomcrypt/src/hashes/helper/hash_file.c8
-rw-r--r--libtomcrypt/src/hashes/helper/hash_filehandle.c8
-rw-r--r--libtomcrypt/src/hashes/helper/hash_memory.c8
-rw-r--r--libtomcrypt/src/hashes/helper/hash_memory_multi.c8
-rw-r--r--libtomcrypt/src/hashes/md2.c14
-rw-r--r--libtomcrypt/src/hashes/md4.c12
-rw-r--r--libtomcrypt/src/hashes/md5.c12
-rw-r--r--libtomcrypt/src/hashes/rmd128.c12
-rw-r--r--libtomcrypt/src/hashes/rmd160.c12
-rw-r--r--libtomcrypt/src/hashes/rmd256.c8
-rw-r--r--libtomcrypt/src/hashes/rmd320.c6
-rw-r--r--libtomcrypt/src/hashes/sha1.c12
-rw-r--r--libtomcrypt/src/hashes/sha2/sha224.c10
-rw-r--r--libtomcrypt/src/hashes/sha2/sha256.c14
-rw-r--r--libtomcrypt/src/hashes/sha2/sha384.c10
-rw-r--r--libtomcrypt/src/hashes/sha2/sha512.c14
-rw-r--r--libtomcrypt/src/hashes/tiger.c10
-rw-r--r--libtomcrypt/src/hashes/whirl/whirl.c12
-rw-r--r--libtomcrypt/src/hashes/whirl/whirltab.c8
-rw-r--r--libtomcrypt/src/headers/tomcrypt.h10
-rw-r--r--libtomcrypt/src/headers/tomcrypt_argchk.h6
-rw-r--r--libtomcrypt/src/headers/tomcrypt_cfg.h6
-rw-r--r--libtomcrypt/src/headers/tomcrypt_cipher.h186
-rw-r--r--libtomcrypt/src/headers/tomcrypt_custom.h43
-rw-r--r--libtomcrypt/src/headers/tomcrypt_hash.h96
-rw-r--r--libtomcrypt/src/headers/tomcrypt_mac.h43
-rw-r--r--libtomcrypt/src/headers/tomcrypt_macros.h6
-rw-r--r--libtomcrypt/src/headers/tomcrypt_math.h10
-rw-r--r--libtomcrypt/src/headers/tomcrypt_misc.h10
-rw-r--r--libtomcrypt/src/headers/tomcrypt_pk.h54
-rw-r--r--libtomcrypt/src/headers/tomcrypt_pkcs.h30
-rw-r--r--libtomcrypt/src/headers/tomcrypt_prng.h34
-rw-r--r--libtomcrypt/src/mac/f9/f9_done.c8
-rw-r--r--libtomcrypt/src/mac/f9/f9_file.c8
-rw-r--r--libtomcrypt/src/mac/f9/f9_init.c8
-rw-r--r--libtomcrypt/src/mac/f9/f9_memory.c8
-rw-r--r--libtomcrypt/src/mac/f9/f9_memory_multi.c8
-rw-r--r--libtomcrypt/src/mac/f9/f9_process.c8
-rw-r--r--libtomcrypt/src/mac/f9/f9_test.c8
-rw-r--r--libtomcrypt/src/mac/hmac/hmac_done.c27
-rw-r--r--libtomcrypt/src/mac/hmac/hmac_file.c16
-rw-r--r--libtomcrypt/src/mac/hmac/hmac_init.c36
-rw-r--r--libtomcrypt/src/mac/hmac/hmac_memory.c16
-rw-r--r--libtomcrypt/src/mac/hmac/hmac_memory_multi.c18
-rw-r--r--libtomcrypt/src/mac/hmac/hmac_process.c16
-rw-r--r--libtomcrypt/src/mac/hmac/hmac_test.c26
-rw-r--r--libtomcrypt/src/mac/omac/omac_done.c14
-rw-r--r--libtomcrypt/src/mac/omac/omac_file.c14
-rw-r--r--libtomcrypt/src/mac/omac/omac_init.c14
-rw-r--r--libtomcrypt/src/mac/omac/omac_memory.c16
-rw-r--r--libtomcrypt/src/mac/omac/omac_memory_multi.c18
-rw-r--r--libtomcrypt/src/mac/omac/omac_process.c29
-rw-r--r--libtomcrypt/src/mac/omac/omac_test.c12
-rw-r--r--libtomcrypt/src/mac/pelican/pelican.c10
-rw-r--r--libtomcrypt/src/mac/pelican/pelican_memory.c10
-rw-r--r--libtomcrypt/src/mac/pelican/pelican_test.c10
-rw-r--r--libtomcrypt/src/mac/pmac/pmac_done.c8
-rw-r--r--libtomcrypt/src/mac/pmac/pmac_file.c8
-rw-r--r--libtomcrypt/src/mac/pmac/pmac_init.c8
-rw-r--r--libtomcrypt/src/mac/pmac/pmac_memory.c8
-rw-r--r--libtomcrypt/src/mac/pmac/pmac_memory_multi.c8
-rw-r--r--libtomcrypt/src/mac/pmac/pmac_ntz.c8
-rw-r--r--libtomcrypt/src/mac/pmac/pmac_process.c8
-rw-r--r--libtomcrypt/src/mac/pmac/pmac_shift_xor.c8
-rw-r--r--libtomcrypt/src/mac/pmac/pmac_test.c10
-rw-r--r--libtomcrypt/src/mac/xcbc/xcbc_done.c8
-rw-r--r--libtomcrypt/src/mac/xcbc/xcbc_file.c8
-rw-r--r--libtomcrypt/src/mac/xcbc/xcbc_init.c66
-rw-r--r--libtomcrypt/src/mac/xcbc/xcbc_memory.c8
-rw-r--r--libtomcrypt/src/mac/xcbc/xcbc_memory_multi.c8
-rw-r--r--libtomcrypt/src/mac/xcbc/xcbc_process.c8
-rw-r--r--libtomcrypt/src/mac/xcbc/xcbc_test.c8
-rw-r--r--libtomcrypt/src/math/fp/ltc_ecc_fp_mulmod.c359
-rw-r--r--libtomcrypt/src/math/gmp_desc.c22
-rw-r--r--libtomcrypt/src/math/ltm_desc.c20
-rw-r--r--libtomcrypt/src/math/multi.c8
-rw-r--r--libtomcrypt/src/math/rand_prime.c8
-rw-r--r--libtomcrypt/src/math/tfm_desc.c28
-rw-r--r--libtomcrypt/src/misc/base64/base64_decode.c10
-rw-r--r--libtomcrypt/src/misc/base64/base64_encode.c10
-rw-r--r--libtomcrypt/src/misc/burn_stack.c8
-rw-r--r--libtomcrypt/src/misc/crypt/crypt.c207
-rw-r--r--libtomcrypt/src/misc/crypt/crypt_argchk.c8
-rw-r--r--libtomcrypt/src/misc/crypt/crypt_cipher_descriptor.c8
-rw-r--r--libtomcrypt/src/misc/crypt/crypt_cipher_is_valid.c8
-rw-r--r--libtomcrypt/src/misc/crypt/crypt_find_cipher.c8
-rw-r--r--libtomcrypt/src/misc/crypt/crypt_find_cipher_any.c8
-rw-r--r--libtomcrypt/src/misc/crypt/crypt_find_cipher_id.c8
-rw-r--r--libtomcrypt/src/misc/crypt/crypt_find_hash.c8
-rw-r--r--libtomcrypt/src/misc/crypt/crypt_find_hash_any.c8
-rw-r--r--libtomcrypt/src/misc/crypt/crypt_find_hash_id.c8
-rw-r--r--libtomcrypt/src/misc/crypt/crypt_find_hash_oid.c8
-rw-r--r--libtomcrypt/src/misc/crypt/crypt_find_prng.c8
-rw-r--r--libtomcrypt/src/misc/crypt/crypt_fsa.c8
-rw-r--r--libtomcrypt/src/misc/crypt/crypt_hash_descriptor.c8
-rw-r--r--libtomcrypt/src/misc/crypt/crypt_hash_is_valid.c8
-rw-r--r--libtomcrypt/src/misc/crypt/crypt_ltc_mp_descriptor.c2
-rw-r--r--libtomcrypt/src/misc/crypt/crypt_prng_descriptor.c8
-rw-r--r--libtomcrypt/src/misc/crypt/crypt_prng_is_valid.c8
-rw-r--r--libtomcrypt/src/misc/crypt/crypt_register_cipher.c8
-rw-r--r--libtomcrypt/src/misc/crypt/crypt_register_hash.c8
-rw-r--r--libtomcrypt/src/misc/crypt/crypt_register_prng.c8
-rw-r--r--libtomcrypt/src/misc/crypt/crypt_unregister_cipher.c8
-rw-r--r--libtomcrypt/src/misc/crypt/crypt_unregister_hash.c8
-rw-r--r--libtomcrypt/src/misc/crypt/crypt_unregister_prng.c8
-rw-r--r--libtomcrypt/src/misc/error_to_string.c8
-rw-r--r--libtomcrypt/src/misc/pkcs5/pkcs_5_1.c16
-rw-r--r--libtomcrypt/src/misc/pkcs5/pkcs_5_2.c16
-rw-r--r--libtomcrypt/src/misc/zeromem.c8
-rw-r--r--libtomcrypt/src/modes/cbc/cbc_decrypt.c8
-rw-r--r--libtomcrypt/src/modes/cbc/cbc_done.c8
-rw-r--r--libtomcrypt/src/modes/cbc/cbc_encrypt.c8
-rw-r--r--libtomcrypt/src/modes/cbc/cbc_getiv.c8
-rw-r--r--libtomcrypt/src/modes/cbc/cbc_setiv.c8
-rw-r--r--libtomcrypt/src/modes/cbc/cbc_start.c8
-rw-r--r--libtomcrypt/src/modes/cfb/cfb_decrypt.c8
-rw-r--r--libtomcrypt/src/modes/cfb/cfb_done.c8
-rw-r--r--libtomcrypt/src/modes/cfb/cfb_encrypt.c8
-rw-r--r--libtomcrypt/src/modes/cfb/cfb_getiv.c8
-rw-r--r--libtomcrypt/src/modes/cfb/cfb_setiv.c8
-rw-r--r--libtomcrypt/src/modes/cfb/cfb_start.c8
-rw-r--r--libtomcrypt/src/modes/ctr/ctr_decrypt.c8
-rw-r--r--libtomcrypt/src/modes/ctr/ctr_done.c8
-rw-r--r--libtomcrypt/src/modes/ctr/ctr_encrypt.c12
-rw-r--r--libtomcrypt/src/modes/ctr/ctr_getiv.c8
-rw-r--r--libtomcrypt/src/modes/ctr/ctr_setiv.c8
-rw-r--r--libtomcrypt/src/modes/ctr/ctr_start.c24
-rw-r--r--libtomcrypt/src/modes/ctr/ctr_test.c8
-rw-r--r--libtomcrypt/src/modes/ecb/ecb_decrypt.c8
-rw-r--r--libtomcrypt/src/modes/ecb/ecb_done.c8
-rw-r--r--libtomcrypt/src/modes/ecb/ecb_encrypt.c8
-rw-r--r--libtomcrypt/src/modes/ecb/ecb_start.c8
-rw-r--r--libtomcrypt/src/modes/f8/f8_decrypt.c8
-rw-r--r--libtomcrypt/src/modes/f8/f8_done.c8
-rw-r--r--libtomcrypt/src/modes/f8/f8_encrypt.c8
-rw-r--r--libtomcrypt/src/modes/f8/f8_getiv.c8
-rw-r--r--libtomcrypt/src/modes/f8/f8_setiv.c8
-rw-r--r--libtomcrypt/src/modes/f8/f8_start.c8
-rw-r--r--libtomcrypt/src/modes/f8/f8_test_mode.c8
-rw-r--r--libtomcrypt/src/modes/lrw/lrw_decrypt.c8
-rw-r--r--libtomcrypt/src/modes/lrw/lrw_done.c8
-rw-r--r--libtomcrypt/src/modes/lrw/lrw_encrypt.c8
-rw-r--r--libtomcrypt/src/modes/lrw/lrw_getiv.c8
-rw-r--r--libtomcrypt/src/modes/lrw/lrw_process.c8
-rw-r--r--libtomcrypt/src/modes/lrw/lrw_setiv.c8
-rw-r--r--libtomcrypt/src/modes/lrw/lrw_start.c8
-rw-r--r--libtomcrypt/src/modes/lrw/lrw_test.c8
-rw-r--r--libtomcrypt/src/modes/ofb/ofb_decrypt.c8
-rw-r--r--libtomcrypt/src/modes/ofb/ofb_done.c8
-rw-r--r--libtomcrypt/src/modes/ofb/ofb_encrypt.c8
-rw-r--r--libtomcrypt/src/modes/ofb/ofb_getiv.c8
-rw-r--r--libtomcrypt/src/modes/ofb/ofb_setiv.c8
-rw-r--r--libtomcrypt/src/modes/ofb/ofb_start.c8
-rw-r--r--libtomcrypt/src/modes/xts/xts_decrypt.c141
-rw-r--r--libtomcrypt/src/modes/xts/xts_done.c34
-rw-r--r--libtomcrypt/src/modes/xts/xts_encrypt.c142
-rw-r--r--libtomcrypt/src/modes/xts/xts_init.c69
-rw-r--r--libtomcrypt/src/modes/xts/xts_mult_x.c42
-rw-r--r--libtomcrypt/src/modes/xts/xts_test.c199
-rw-r--r--libtomcrypt/src/pk/asn1/der/bit/der_decode_bit_string.c8
-rw-r--r--libtomcrypt/src/pk/asn1/der/bit/der_encode_bit_string.c8
-rw-r--r--libtomcrypt/src/pk/asn1/der/bit/der_length_bit_string.c8
-rw-r--r--libtomcrypt/src/pk/asn1/der/boolean/der_decode_boolean.c8
-rw-r--r--libtomcrypt/src/pk/asn1/der/boolean/der_encode_boolean.c8
-rw-r--r--libtomcrypt/src/pk/asn1/der/boolean/der_length_boolean.c8
-rw-r--r--libtomcrypt/src/pk/asn1/der/choice/der_decode_choice.c8
-rw-r--r--libtomcrypt/src/pk/asn1/der/ia5/der_decode_ia5_string.c8
-rw-r--r--libtomcrypt/src/pk/asn1/der/ia5/der_encode_ia5_string.c8
-rw-r--r--libtomcrypt/src/pk/asn1/der/ia5/der_length_ia5_string.c8
-rw-r--r--libtomcrypt/src/pk/asn1/der/integer/der_decode_integer.c8
-rw-r--r--libtomcrypt/src/pk/asn1/der/integer/der_encode_integer.c8
-rw-r--r--libtomcrypt/src/pk/asn1/der/integer/der_length_integer.c8
-rw-r--r--libtomcrypt/src/pk/asn1/der/object_identifier/der_decode_object_identifier.c8
-rw-r--r--libtomcrypt/src/pk/asn1/der/object_identifier/der_encode_object_identifier.c8
-rw-r--r--libtomcrypt/src/pk/asn1/der/object_identifier/der_length_object_identifier.c8
-rw-r--r--libtomcrypt/src/pk/asn1/der/octet/der_decode_octet_string.c8
-rw-r--r--libtomcrypt/src/pk/asn1/der/octet/der_encode_octet_string.c8
-rw-r--r--libtomcrypt/src/pk/asn1/der/octet/der_length_octet_string.c8
-rw-r--r--libtomcrypt/src/pk/asn1/der/printable_string/der_decode_printable_string.c8
-rw-r--r--libtomcrypt/src/pk/asn1/der/printable_string/der_encode_printable_string.c8
-rw-r--r--libtomcrypt/src/pk/asn1/der/printable_string/der_length_printable_string.c8
-rw-r--r--libtomcrypt/src/pk/asn1/der/sequence/der_decode_sequence_ex.c8
-rw-r--r--libtomcrypt/src/pk/asn1/der/sequence/der_decode_sequence_flexi.c8
-rw-r--r--libtomcrypt/src/pk/asn1/der/sequence/der_decode_sequence_multi.c8
-rw-r--r--libtomcrypt/src/pk/asn1/der/sequence/der_encode_sequence_ex.c2
-rw-r--r--libtomcrypt/src/pk/asn1/der/sequence/der_encode_sequence_multi.c8
-rw-r--r--libtomcrypt/src/pk/asn1/der/sequence/der_length_sequence.c8
-rw-r--r--libtomcrypt/src/pk/asn1/der/sequence/der_sequence_free.c8
-rw-r--r--libtomcrypt/src/pk/asn1/der/set/der_encode_set.c8
-rw-r--r--libtomcrypt/src/pk/asn1/der/set/der_encode_setof.c8
-rw-r--r--libtomcrypt/src/pk/asn1/der/short_integer/der_decode_short_integer.c8
-rw-r--r--libtomcrypt/src/pk/asn1/der/short_integer/der_encode_short_integer.c8
-rw-r--r--libtomcrypt/src/pk/asn1/der/short_integer/der_length_short_integer.c8
-rw-r--r--libtomcrypt/src/pk/asn1/der/utctime/der_decode_utctime.c8
-rw-r--r--libtomcrypt/src/pk/asn1/der/utctime/der_encode_utctime.c8
-rw-r--r--libtomcrypt/src/pk/asn1/der/utctime/der_length_utctime.c8
-rw-r--r--libtomcrypt/src/pk/asn1/der/utf8/der_decode_utf8_string.c8
-rw-r--r--libtomcrypt/src/pk/asn1/der/utf8/der_encode_utf8_string.c24
-rw-r--r--libtomcrypt/src/pk/asn1/der/utf8/der_length_utf8_string.c8
-rw-r--r--libtomcrypt/src/pk/dsa/dsa_decrypt_key.c10
-rw-r--r--libtomcrypt/src/pk/dsa/dsa_encrypt_key.c10
-rw-r--r--libtomcrypt/src/pk/dsa/dsa_export.c10
-rw-r--r--libtomcrypt/src/pk/dsa/dsa_free.c10
-rw-r--r--libtomcrypt/src/pk/dsa/dsa_import.c14
-rw-r--r--libtomcrypt/src/pk/dsa/dsa_make_key.c18
-rw-r--r--libtomcrypt/src/pk/dsa/dsa_shared_secret.c10
-rw-r--r--libtomcrypt/src/pk/dsa/dsa_sign_hash.c16
-rw-r--r--libtomcrypt/src/pk/dsa/dsa_verify_hash.c10
-rw-r--r--libtomcrypt/src/pk/dsa/dsa_verify_key.c10
-rw-r--r--libtomcrypt/src/pk/ecc/ecc.c10
-rw-r--r--libtomcrypt/src/pk/ecc/ecc_ansi_x963_export.c10
-rw-r--r--libtomcrypt/src/pk/ecc/ecc_ansi_x963_import.c10
-rw-r--r--libtomcrypt/src/pk/ecc/ecc_decrypt_key.c10
-rw-r--r--libtomcrypt/src/pk/ecc/ecc_encrypt_key.c10
-rw-r--r--libtomcrypt/src/pk/ecc/ecc_export.c10
-rw-r--r--libtomcrypt/src/pk/ecc/ecc_free.c10
-rw-r--r--libtomcrypt/src/pk/ecc/ecc_get_size.c10
-rw-r--r--libtomcrypt/src/pk/ecc/ecc_import.c10
-rw-r--r--libtomcrypt/src/pk/ecc/ecc_make_key.c21
-rw-r--r--libtomcrypt/src/pk/ecc/ecc_shared_secret.c10
-rw-r--r--libtomcrypt/src/pk/ecc/ecc_sign_hash.c10
-rw-r--r--libtomcrypt/src/pk/ecc/ecc_sizes.c10
-rw-r--r--libtomcrypt/src/pk/ecc/ecc_test.c10
-rw-r--r--libtomcrypt/src/pk/ecc/ecc_verify_hash.c10
-rw-r--r--libtomcrypt/src/pk/ecc/ltc_ecc_is_valid_idx.c12
-rw-r--r--libtomcrypt/src/pk/ecc/ltc_ecc_map.c10
-rw-r--r--libtomcrypt/src/pk/ecc/ltc_ecc_mul2add.c10
-rw-r--r--libtomcrypt/src/pk/ecc/ltc_ecc_mulmod.c10
-rw-r--r--libtomcrypt/src/pk/ecc/ltc_ecc_mulmod_timing.c10
-rw-r--r--libtomcrypt/src/pk/ecc/ltc_ecc_points.c10
-rw-r--r--libtomcrypt/src/pk/ecc/ltc_ecc_projective_add_point.c10
-rw-r--r--libtomcrypt/src/pk/ecc/ltc_ecc_projective_dbl_point.c10
-rw-r--r--libtomcrypt/src/pk/katja/katja_decrypt_key.c14
-rw-r--r--libtomcrypt/src/pk/katja/katja_encrypt_key.c14
-rw-r--r--libtomcrypt/src/pk/katja/katja_export.c12
-rw-r--r--libtomcrypt/src/pk/katja/katja_exptmod.c10
-rw-r--r--libtomcrypt/src/pk/katja/katja_free.c8
-rw-r--r--libtomcrypt/src/pk/katja/katja_import.c14
-rw-r--r--libtomcrypt/src/pk/katja/katja_make_key.c8
-rw-r--r--libtomcrypt/src/pk/pkcs1/pkcs_1_i2osp.c14
-rw-r--r--libtomcrypt/src/pk/pkcs1/pkcs_1_mgf1.c16
-rw-r--r--libtomcrypt/src/pk/pkcs1/pkcs_1_oaep_decode.c16
-rw-r--r--libtomcrypt/src/pk/pkcs1/pkcs_1_oaep_encode.c16
-rw-r--r--libtomcrypt/src/pk/pkcs1/pkcs_1_os2ip.c12
-rw-r--r--libtomcrypt/src/pk/pkcs1/pkcs_1_pss_decode.c16
-rw-r--r--libtomcrypt/src/pk/pkcs1/pkcs_1_pss_encode.c16
-rw-r--r--libtomcrypt/src/pk/pkcs1/pkcs_1_v1_5_decode.c18
-rw-r--r--libtomcrypt/src/pk/pkcs1/pkcs_1_v1_5_encode.c28
-rw-r--r--libtomcrypt/src/pk/rsa/rsa_decrypt_key.c30
-rw-r--r--libtomcrypt/src/pk/rsa/rsa_encrypt_key.c32
-rw-r--r--libtomcrypt/src/pk/rsa/rsa_export.c16
-rw-r--r--libtomcrypt/src/pk/rsa/rsa_exptmod.c12
-rw-r--r--libtomcrypt/src/pk/rsa/rsa_free.c10
-rw-r--r--libtomcrypt/src/pk/rsa/rsa_import.c18
-rw-r--r--libtomcrypt/src/pk/rsa/rsa_make_key.c10
-rw-r--r--libtomcrypt/src/pk/rsa/rsa_sign_hash.c28
-rw-r--r--libtomcrypt/src/pk/rsa/rsa_verify_hash.c30
-rw-r--r--libtomcrypt/src/prngs/fortuna.c54
-rw-r--r--libtomcrypt/src/prngs/rc4.c16
-rw-r--r--libtomcrypt/src/prngs/rng_get_bytes.c14
-rw-r--r--libtomcrypt/src/prngs/rng_make_prng.c8
-rw-r--r--libtomcrypt/src/prngs/sober128.c12
-rw-r--r--libtomcrypt/src/prngs/sober128tab.c10
-rw-r--r--libtomcrypt/src/prngs/sprng.c10
-rw-r--r--libtomcrypt/src/prngs/yarrow.c76
-rw-r--r--libtomcrypt/testprof/base64_test.c6
-rw-r--r--libtomcrypt/testprof/cipher_hash_test.c6
-rw-r--r--libtomcrypt/testprof/der_tests.c8
-rw-r--r--libtomcrypt/testprof/dsa_test.c8
-rw-r--r--libtomcrypt/testprof/ecc_test.c8
-rw-r--r--libtomcrypt/testprof/katja_test.c2
-rw-r--r--libtomcrypt/testprof/mac_test.c16
-rw-r--r--libtomcrypt/testprof/modes_test.c10
-rw-r--r--libtomcrypt/testprof/pkcs_1_test.c10
-rw-r--r--libtomcrypt/testprof/rsa_test.c24
-rw-r--r--libtomcrypt/testprof/store_test.c6
-rw-r--r--libtomcrypt/testprof/test_driver.c6
-rw-r--r--libtomcrypt/testprof/tomcrypt_test.h6
-rw-r--r--libtomcrypt/testprof/x86_prof.c105
-rw-r--r--libtommath/LICENSE29
-rw-r--r--libtommath/Makefile.in205
-rw-r--r--libtommath/README.md13
-rw-r--r--libtommath/bn.tex506
-rw-r--r--libtommath/bn_error.c14
-rw-r--r--libtommath/bn_fast_mp_invmod.c22
-rw-r--r--libtommath/bn_fast_mp_montgomery_reduce.c34
-rw-r--r--libtommath/bn_fast_s_mp_mul_digs.c18
-rw-r--r--libtommath/bn_fast_s_mp_mul_high_digs.c12
-rw-r--r--libtommath/bn_fast_s_mp_sqr.c12
-rw-r--r--libtommath/bn_mp_2expt.c14
-rw-r--r--libtommath/bn_mp_abs.c10
-rw-r--r--libtommath/bn_mp_add.c10
-rw-r--r--libtommath/bn_mp_add_d.c14
-rw-r--r--libtommath/bn_mp_addmod.c10
-rw-r--r--libtommath/bn_mp_and.c10
-rw-r--r--libtommath/bn_mp_clamp.c12
-rw-r--r--libtommath/bn_mp_clear.c10
-rw-r--r--libtommath/bn_mp_clear_multi.c10
-rw-r--r--libtommath/bn_mp_cmp.c10
-rw-r--r--libtommath/bn_mp_cmp_d.c10
-rw-r--r--libtommath/bn_mp_cmp_mag.c10
-rw-r--r--libtommath/bn_mp_cnt_lsb.c14
-rw-r--r--libtommath/bn_mp_copy.c12
-rw-r--r--libtommath/bn_mp_count_bits.c10
-rw-r--r--libtommath/bn_mp_div.c83
-rw-r--r--libtommath/bn_mp_div_2.c12
-rw-r--r--libtommath/bn_mp_div_2d.c12
-rw-r--r--libtommath/bn_mp_div_3.c10
-rw-r--r--libtommath/bn_mp_div_d.c19
-rw-r--r--libtommath/bn_mp_dr_is_modulus.c10
-rw-r--r--libtommath/bn_mp_dr_reduce.c18
-rw-r--r--libtommath/bn_mp_dr_setup.c10
-rw-r--r--libtommath/bn_mp_exch.c10
-rw-r--r--libtommath/bn_mp_export.c88
-rw-r--r--libtommath/bn_mp_expt_d.c45
-rw-r--r--libtommath/bn_mp_expt_d_ex.c83
-rw-r--r--libtommath/bn_mp_exptmod.c12
-rw-r--r--libtommath/bn_mp_exptmod_fast.c20
-rw-r--r--libtommath/bn_mp_exteuclid.c51
-rw-r--r--libtommath/bn_mp_fread.c10
-rw-r--r--libtommath/bn_mp_fwrite.c10
-rw-r--r--libtommath/bn_mp_gcd.c12
-rw-r--r--libtommath/bn_mp_get_int.c18
-rw-r--r--libtommath/bn_mp_get_long.c41
-rw-r--r--libtommath/bn_mp_get_long_long.c41
-rw-r--r--libtommath/bn_mp_grow.c10
-rw-r--r--libtommath/bn_mp_import.c73
-rw-r--r--libtommath/bn_mp_init.c10
-rw-r--r--libtommath/bn_mp_init_copy.c10
-rw-r--r--libtommath/bn_mp_init_multi.c12
-rw-r--r--libtommath/bn_mp_init_set.c10
-rw-r--r--libtommath/bn_mp_init_set_int.c10
-rw-r--r--libtommath/bn_mp_init_size.c10
-rw-r--r--libtommath/bn_mp_invmod.c18
-rw-r--r--libtommath/bn_mp_invmod_slow.c24
-rw-r--r--libtommath/bn_mp_is_square.c24
-rw-r--r--libtommath/bn_mp_jacobi.c46
-rw-r--r--libtommath/bn_mp_karatsuba_mul.c14
-rw-r--r--libtommath/bn_mp_karatsuba_sqr.c14
-rw-r--r--libtommath/bn_mp_lcm.c10
-rw-r--r--libtommath/bn_mp_lshd.c16
-rw-r--r--libtommath/bn_mp_mod.c18
-rw-r--r--libtommath/bn_mp_mod_2d.c12
-rw-r--r--libtommath/bn_mp_mod_d.c10
-rw-r--r--libtommath/bn_mp_montgomery_calc_normalization.c12
-rw-r--r--libtommath/bn_mp_montgomery_reduce.c30
-rw-r--r--libtommath/bn_mp_montgomery_setup.c20
-rw-r--r--libtommath/bn_mp_mul.c17
-rw-r--r--libtommath/bn_mp_mul_2.c14
-rw-r--r--libtommath/bn_mp_mul_2d.c18
-rw-r--r--libtommath/bn_mp_mul_d.c14
-rw-r--r--libtommath/bn_mp_mulmod.c10
-rw-r--r--libtommath/bn_mp_n_root.c120
-rw-r--r--libtommath/bn_mp_n_root_ex.c132
-rw-r--r--libtommath/bn_mp_neg.c10
-rw-r--r--libtommath/bn_mp_or.c10
-rw-r--r--libtommath/bn_mp_prime_fermat.c10
-rw-r--r--libtommath/bn_mp_prime_is_divisible.c10
-rw-r--r--libtommath/bn_mp_prime_is_prime.c12
-rw-r--r--libtommath/bn_mp_prime_miller_rabin.c14
-rw-r--r--libtommath/bn_mp_prime_next_prime.c20
-rw-r--r--libtommath/bn_mp_prime_rabin_miller_trials.c10
-rw-r--r--libtommath/bn_mp_prime_random_ex.c23
-rw-r--r--libtommath/bn_mp_radix_size.c24
-rw-r--r--libtommath/bn_mp_radix_smap.c10
-rw-r--r--libtommath/bn_mp_rand.c14
-rw-r--r--libtommath/bn_mp_read_radix.c20
-rw-r--r--libtommath/bn_mp_read_signed_bin.c10
-rw-r--r--libtommath/bn_mp_read_unsigned_bin.c20
-rw-r--r--libtommath/bn_mp_reduce.c24
-rw-r--r--libtommath/bn_mp_reduce_2k.c30
-rw-r--r--libtommath/bn_mp_reduce_2k_l.c32
-rw-r--r--libtommath/bn_mp_reduce_2k_setup.c10
-rw-r--r--libtommath/bn_mp_reduce_2k_setup_l.c10
-rw-r--r--libtommath/bn_mp_reduce_is_2k.c10
-rw-r--r--libtommath/bn_mp_reduce_is_2k_l.c10
-rw-r--r--libtommath/bn_mp_reduce_setup.c10
-rw-r--r--libtommath/bn_mp_rshd.c12
-rw-r--r--libtommath/bn_mp_set.c10
-rw-r--r--libtommath/bn_mp_set_int.c10
-rw-r--r--libtommath/bn_mp_set_long.c24
-rw-r--r--libtommath/bn_mp_set_long_long.c24
-rw-r--r--libtommath/bn_mp_shrink.c22
-rw-r--r--libtommath/bn_mp_signed_bin_size.c10
-rw-r--r--libtommath/bn_mp_sqr.c20
-rw-r--r--libtommath/bn_mp_sqrmod.c10
-rw-r--r--libtommath/bn_mp_sqrt.c10
-rw-r--r--libtommath/bn_mp_sqrtmod_prime.c124
-rw-r--r--libtommath/bn_mp_sub.c10
-rw-r--r--libtommath/bn_mp_sub_d.c18
-rw-r--r--libtommath/bn_mp_submod.c10
-rw-r--r--libtommath/bn_mp_to_signed_bin.c12
-rw-r--r--libtommath/bn_mp_to_signed_bin_n.c10
-rw-r--r--libtommath/bn_mp_to_unsigned_bin.c12
-rw-r--r--libtommath/bn_mp_to_unsigned_bin_n.c10
-rw-r--r--libtommath/bn_mp_toom_mul.c278
-rw-r--r--libtommath/bn_mp_toom_sqr.c214
-rw-r--r--libtommath/bn_mp_toradix.c16
-rw-r--r--libtommath/bn_mp_toradix_n.c14
-rw-r--r--libtommath/bn_mp_unsigned_bin_size.c12
-rw-r--r--libtommath/bn_mp_xor.c10
-rw-r--r--libtommath/bn_mp_zero.c10
-rw-r--r--libtommath/bn_prime_tab.c10
-rw-r--r--libtommath/bn_reverse.c10
-rw-r--r--libtommath/bn_s_mp_add.c16
-rw-r--r--libtommath/bn_s_mp_exptmod.c16
-rw-r--r--libtommath/bn_s_mp_mul_digs.c22
-rw-r--r--libtommath/bn_s_mp_mul_high_digs.c18
-rw-r--r--libtommath/bn_s_mp_sqr.c20
-rw-r--r--libtommath/bn_s_mp_sub.c20
-rw-r--r--libtommath/bncore.c10
-rw-r--r--libtommath/booker.pl68
-rw-r--r--libtommath/callgraph.txt13356
-rw-r--r--libtommath/changes.txt51
-rw-r--r--libtommath/demo/demo.c722
-rw-r--r--libtommath/demo/timing.c127
-rw-r--r--libtommath/dep.pl2
-rw-r--r--libtommath/etc/2kprime.c6
-rw-r--r--libtommath/etc/drprime.c6
-rw-r--r--libtommath/etc/mersenne.c6
-rw-r--r--libtommath/etc/mont.c6
-rw-r--r--libtommath/etc/pprime.c6
-rw-r--r--libtommath/etc/tune.c50
-rwxr-xr-xlibtommath/filter.pl34
-rw-r--r--libtommath/gen.pl4
-rwxr-xr-xlibtommath/genlist.sh8
-rw-r--r--libtommath/makefile.bcc56
-rw-r--r--libtommath/makefile.cygwin_dll58
-rw-r--r--libtommath/makefile.icc71
-rw-r--r--libtommath/makefile.include105
-rw-r--r--libtommath/makefile.msvc54
-rw-r--r--libtommath/makefile.shared137
-rw-r--r--libtommath/mtest/logtab.h6
-rw-r--r--libtommath/mtest/mpi-config.h8
-rw-r--r--libtommath/mtest/mpi-types.h6
-rw-r--r--libtommath/mtest/mpi.c178
-rw-r--r--libtommath/mtest/mpi.h10
-rw-r--r--libtommath/mtest/mtest.c102
-rwxr-xr-xlibtommath/parsenames.pl25
-rw-r--r--libtommath/pre_gen/mpi.c1484
-rwxr-xr-xlibtommath/testme.sh174
-rw-r--r--libtommath/tommath.h191
-rw-r--r--libtommath/tommath_class.h86
-rw-r--r--libtommath/tommath_private.h119
-rw-r--r--libtommath/tommath_superclass.h6
-rwxr-xr-xlibtommath/updatemakes.sh33
-rw-r--r--netio.c4
-rw-r--r--options.h2
-rw-r--r--rsa.c28
-rw-r--r--signkey.c24
-rw-r--r--svr-authpam.c6
-rw-r--r--svr-authpubkey.c208
-rw-r--r--sysoptions.h4
540 files changed, 22647 insertions, 6028 deletions
diff --git a/CHANGES b/CHANGES
index b48638e..4230b57 100644
--- a/CHANGES
+++ b/CHANGES
@@ -333,6 +333,8 @@ kernels, from Steve Dover
2013.61test - Thursday 14 November 2013
+- Default generated RSA key size changed from 1024 to 2048 bits
+
- ECC (elliptic curve) support. Supports ECDSA hostkeys (requires new keys to
be generated) and ECDH for setting up encryption keys (no intervention
required). This is significantly faster.
diff --git a/bignum.c b/bignum.c
index 3758052..b3e2b99 100644
--- a/bignum.c
+++ b/bignum.c
@@ -68,6 +68,22 @@ void m_mp_alloc_init_multi(mp_int **mp, ...)
va_end(args);
}
+void m_mp_free_multi(mp_int **mp, ...)
+{
+ mp_int** cur_arg = mp;
+ va_list args;
+
+ va_start(args, mp); /* init args to next argument from caller */
+ while (cur_arg != NULL) {
+ if (*cur_arg) {
+ mp_clear(*cur_arg);
+ }
+ m_free(*cur_arg);
+ cur_arg = va_arg(args, mp_int**);
+ }
+ va_end(args);
+}
+
void bytes_to_mp(mp_int *mp, const unsigned char* bytes, unsigned int len) {
if (mp_read_unsigned_bin(mp, (unsigned char*)bytes, len) != MP_OKAY) {
diff --git a/bignum.h b/bignum.h
index 59702c3..bab65ef 100644
--- a/bignum.h
+++ b/bignum.h
@@ -30,6 +30,7 @@
void m_mp_init(mp_int *mp);
void m_mp_init_multi(mp_int *mp, ...) ATTRIB_SENTINEL;
void m_mp_alloc_init_multi(mp_int **mp, ...) ATTRIB_SENTINEL;
+void m_mp_free_multi(mp_int **mp, ...) ATTRIB_SENTINEL;
void bytes_to_mp(mp_int *mp, const unsigned char* bytes, unsigned int len);
void hash_process_mp(const struct ltc_hash_descriptor *hash_desc,
hash_state *hs, mp_int *mp);
diff --git a/configure.ac b/configure.ac
index 767bd05..70ed1a7 100644
--- a/configure.ac
+++ b/configure.ac
@@ -9,7 +9,7 @@ AC_PREREQ(2.59)
AC_INIT
AC_CONFIG_SRCDIR(buffer.c)
-OLDCFLAGS=$CFLAGS
+OLDCFLAGS="$CFLAGS"
# Checks for programs.
AC_PROG_CC
AC_PROG_MAKE_SET
@@ -19,11 +19,89 @@ if test -z "$LD" ; then
fi
AC_SUBST(LD)
+# set compile flags prior to other tests
if test -z "$OLDCFLAGS" && test "$GCC" = "yes"; then
AC_MSG_NOTICE(No \$CFLAGS set... using "-Os -W -Wall" for GCC)
CFLAGS="-Os -W -Wall -Wno-pointer-sign"
fi
+AC_MSG_CHECKING([if compiler '$CC' supports -fno-strict-overflow])
+OLDCFLAGS="$CFLAGS"
+CFLAGS="$CFLAGS -fno-strict-overflow"
+AC_COMPILE_IFELSE([AC_LANG_PROGRAM([])],
+ [AC_MSG_RESULT(yes)],
+ [AC_MSG_RESULT(no); CFLAGS="$OLDCFLAGS" ]
+ )
+
+hardenbuild=1
+AC_ARG_ENABLE(harden,
+ [ --disable-harden Don't set hardened build flags],
+ [
+ if test "x$enableval" = "xno"; then
+ hardenbuild=0
+ AC_MSG_NOTICE(Disabling hardened build flags)
+ fi
+ ], [])
+
+if test "$hardenbuild" -eq 1; then
+ AC_MSG_NOTICE(Checking for available hardened build flags:)
+ # pie
+ OLDCFLAGS="$CFLAGS"
+ TESTFLAGS="-fPIE"
+ CFLAGS="$CFLAGS $TESTFLAGS"
+ AC_COMPILE_IFELSE([AC_LANG_PROGRAM([])],
+ [AC_MSG_NOTICE([Setting $TESTFLAGS])],
+ [AC_MSG_NOTICE([Not setting $TESTFLAGS]); CFLAGS="$OLDCFLAGS" ]
+ )
+ OLDLDFLAGS="$LDFLAGS"
+ TESTFLAGS="-Wl,-pie"
+ LDFLAGS="$LDFLAGS $TESTFLAGS"
+ AC_LINK_IFELSE([AC_LANG_PROGRAM([])],
+ [AC_MSG_NOTICE([Setting $TESTFLAGS])],
+ [
+ LDFLAGS="$OLDLDFLAGS"
+ TESTFLAGS="-pie"
+ LDFLAGS="$LDFLAGS $TESTFLAGS"
+ AC_LINK_IFELSE([AC_LANG_PROGRAM([])],
+ [AC_MSG_NOTICE([Setting $TESTFLAGS])],
+ [AC_MSG_NOTICE([Not setting $TESTFLAGS]); LDFLAGS="$OLDLDFLAGS" ]
+ )
+ ]
+ )
+ # readonly elf relocation sections (relro)
+ OLDLDFLAGS="$LDFLAGS"
+ TESTFLAGS="-Wl,-z,now -Wl,-z,relro"
+ LDFLAGS="$LDFLAGS $TESTFLAGS"
+ AC_LINK_IFELSE([AC_LANG_PROGRAM([])],
+ [AC_MSG_NOTICE([Setting $TESTFLAGS])],
+ [AC_MSG_NOTICE([Not setting $TESTFLAGS]); LDFLAGS="$OLDLDFLAGS" ]
+ )
+ # stack protector. -strong is good but only in gcc 4.9 or later
+ OLDCFLAGS="$CFLAGS"
+ TESTFLAGS="-fstack-protector-strong"
+ CFLAGS="$CFLAGS $TESTFLAGS"
+ AC_COMPILE_IFELSE([AC_LANG_PROGRAM([])],
+ [AC_MSG_NOTICE([Setting $TESTFLAGS])],
+ [
+ CFLAGS="$OLDCFLAGS"
+ TESTFLAGS="-fstack-protector --param=ssp-buffer-size=4"
+ CFLAGS="$CFLAGS $TESTFLAGS"
+ AC_COMPILE_IFELSE([AC_LANG_PROGRAM([])],
+ [AC_MSG_NOTICE([Setting $TESTFLAGS])],
+ [AC_MSG_NOTICE([Not setting $TESTFLAGS]); CFLAGS="$OLDCFLAGS" ]
+ )
+ ]
+ )
+ # FORTIFY_SOURCE
+ OLDCFLAGS="$CFLAGS"
+ TESTFLAGS="-D_FORTIFY_SOURCE=2"
+ CFLAGS="$CFLAGS $TESTFLAGS"
+ AC_COMPILE_IFELSE([AC_LANG_PROGRAM([])],
+ [AC_MSG_NOTICE([Setting $TESTFLAGS])],
+ [AC_MSG_NOTICE([Not setting $TESTFLAGS]); CFLAGS="$OLDCFLAGS" ]
+ )
+fi
+
# large file support is useful for scp
AC_SYS_LARGEFILE
@@ -222,7 +300,11 @@ AC_ARG_ENABLE(shadow,
# Checks for header files.
AC_HEADER_STDC
AC_HEADER_SYS_WAIT
-AC_CHECK_HEADERS([fcntl.h limits.h netinet/in.h netinet/tcp.h stdlib.h string.h sys/socket.h sys/time.h termios.h unistd.h crypt.h pty.h ioctl.h libutil.h libgen.h inttypes.h stropts.h utmp.h utmpx.h lastlog.h paths.h util.h netdb.h security/pam_appl.h pam/pam_appl.h netinet/in_systm.h sys/uio.h])
+AC_CHECK_HEADERS([fcntl.h limits.h netinet/in.h netinet/tcp.h stdlib.h \
+ string.h sys/socket.h sys/time.h termios.h unistd.h crypt.h \
+ pty.h ioctl.h libutil.h libgen.h inttypes.h stropts.h utmp.h \
+ utmpx.h lastlog.h paths.h util.h netdb.h security/pam_appl.h \
+ pam/pam_appl.h netinet/in_systm.h sys/uio.h linux/pkt_sched.h])
# Checks for typedefs, structures, and compiler characteristics.
AC_C_CONST
diff --git a/curve25519-donna.c b/curve25519-donna.c
index 3309610..ef0b6d1 100644
--- a/curve25519-donna.c
+++ b/curve25519-donna.c
@@ -43,8 +43,7 @@
*
* This is, almost, a clean room reimplementation from the curve25519 paper. It
* uses many of the tricks described therein. Only the crecip function is taken
- * from the sample implementation.
- */
+ * from the sample implementation. */
#include <string.h>
#include <stdint.h>
@@ -63,25 +62,23 @@ typedef int64_t limb;
* significant first. The value of the field element is:
* x[0] + 2^26·x[1] + x^51·x[2] + 2^102·x[3] + ...
*
- * i.e. the limbs are 26, 25, 26, 25, ... bits wide.
- */
+ * i.e. the limbs are 26, 25, 26, 25, ... bits wide. */
/* Sum two numbers: output += in */
static void fsum(limb *output, const limb *in) {
unsigned i;
for (i = 0; i < 10; i += 2) {
- output[0+i] = (output[0+i] + in[0+i]);
- output[1+i] = (output[1+i] + in[1+i]);
+ output[0+i] = output[0+i] + in[0+i];
+ output[1+i] = output[1+i] + in[1+i];
}
}
/* Find the difference of two numbers: output = in - output
- * (note the order of the arguments!)
- */
+ * (note the order of the arguments!). */
static void fdifference(limb *output, const limb *in) {
unsigned i;
for (i = 0; i < 10; ++i) {
- output[i] = (in[i] - output[i]);
+ output[i] = in[i] - output[i];
}
}
@@ -97,7 +94,8 @@ static void fscalar_product(limb *output, const limb *in, const limb scalar) {
*
* output must be distinct to both inputs. The inputs are reduced coefficient
* form, the output is not.
- */
+ *
+ * output[x] <= 14 * the largest product of the input limbs. */
static void fproduct(limb *output, const limb *in2, const limb *in) {
output[0] = ((limb) ((s32) in2[0])) * ((s32) in[0]);
output[1] = ((limb) ((s32) in2[0])) * ((s32) in[1]) +
@@ -201,9 +199,15 @@ static void fproduct(limb *output, const limb *in2, const limb *in) {
output[18] = 2 * ((limb) ((s32) in2[9])) * ((s32) in[9]);
}
-/* Reduce a long form to a short form by taking the input mod 2^255 - 19. */
+/* Reduce a long form to a short form by taking the input mod 2^255 - 19.
+ *
+ * On entry: |output[i]| < 14*2^54
+ * On exit: |output[0..8]| < 280*2^54 */
static void freduce_degree(limb *output) {
- /* Each of these shifts and adds ends up multiplying the value by 19. */
+ /* Each of these shifts and adds ends up multiplying the value by 19.
+ *
+ * For output[0..8], the absolute entry value is < 14*2^54 and we add, at
+ * most, 19*14*2^54 thus, on exit, |output[0..8]| < 280*2^54. */
output[8] += output[18] << 4;
output[8] += output[18] << 1;
output[8] += output[18];
@@ -237,11 +241,13 @@ static void freduce_degree(limb *output) {
#error "This code only works on a two's complement system"
#endif
-/* return v / 2^26, using only shifts and adds. */
+/* return v / 2^26, using only shifts and adds.
+ *
+ * On entry: v can take any value. */
static inline limb
div_by_2_26(const limb v)
{
- /* High word of v; no shift needed*/
+ /* High word of v; no shift needed. */
const uint32_t highword = (uint32_t) (((uint64_t) v) >> 32);
/* Set to all 1s if v was negative; else set to 0s. */
const int32_t sign = ((int32_t) highword) >> 31;
@@ -251,7 +257,9 @@ div_by_2_26(const limb v)
return (v + roundoff) >> 26;
}
-/* return v / (2^25), using only shifts and adds. */
+/* return v / (2^25), using only shifts and adds.
+ *
+ * On entry: v can take any value. */
static inline limb
div_by_2_25(const limb v)
{
@@ -265,17 +273,9 @@ div_by_2_25(const limb v)
return (v + roundoff) >> 25;
}
-static inline s32
-div_s32_by_2_25(const s32 v)
-{
- const s32 roundoff = ((uint32_t)(v >> 31)) >> 7;
- return (v + roundoff) >> 25;
-}
-
/* Reduce all coefficients of the short form input so that |x| < 2^26.
*
- * On entry: |output[i]| < 2^62
- */
+ * On entry: |output[i]| < 280*2^54 */
static void freduce_coefficients(limb *output) {
unsigned i;
@@ -283,56 +283,65 @@ static void freduce_coefficients(limb *output) {
for (i = 0; i < 10; i += 2) {
limb over = div_by_2_26(output[i]);
+ /* The entry condition (that |output[i]| < 280*2^54) means that over is, at
+ * most, 280*2^28 in the first iteration of this loop. This is added to the
+ * next limb and we can approximate the resulting bound of that limb by
+ * 281*2^54. */
output[i] -= over << 26;
output[i+1] += over;
+ /* For the first iteration, |output[i+1]| < 281*2^54, thus |over| <
+ * 281*2^29. When this is added to the next limb, the resulting bound can
+ * be approximated as 281*2^54.
+ *
+ * For subsequent iterations of the loop, 281*2^54 remains a conservative
+ * bound and no overflow occurs. */
over = div_by_2_25(output[i+1]);
output[i+1] -= over << 25;
output[i+2] += over;
}
- /* Now |output[10]| < 2 ^ 38 and all other coefficients are reduced. */
+ /* Now |output[10]| < 281*2^29 and all other coefficients are reduced. */
output[0] += output[10] << 4;
output[0] += output[10] << 1;
output[0] += output[10];
output[10] = 0;
- /* Now output[1..9] are reduced, and |output[0]| < 2^26 + 19 * 2^38
- * So |over| will be no more than 77825 */
+ /* Now output[1..9] are reduced, and |output[0]| < 2^26 + 19*281*2^29
+ * So |over| will be no more than 2^16. */
{
limb over = div_by_2_26(output[0]);
output[0] -= over << 26;
output[1] += over;
}
- /* Now output[0,2..9] are reduced, and |output[1]| < 2^25 + 77825
- * So |over| will be no more than 1. */
- {
- /* output[1] fits in 32 bits, so we can use div_s32_by_2_25 here. */
- s32 over32 = div_s32_by_2_25((s32) output[1]);
- output[1] -= over32 << 25;
- output[2] += over32;
- }
-
- /* Finally, output[0,1,3..9] are reduced, and output[2] is "nearly reduced":
- * we have |output[2]| <= 2^26. This is good enough for all of our math,
- * but it will require an extra freduce_coefficients before fcontract. */
+ /* Now output[0,2..9] are reduced, and |output[1]| < 2^25 + 2^16 < 2^26. The
+ * bound on |output[1]| is sufficient to meet our needs. */
}
/* A helpful wrapper around fproduct: output = in * in2.
*
- * output must be distinct to both inputs. The output is reduced degree and
- * reduced coefficient.
- */
+ * On entry: |in[i]| < 2^27 and |in2[i]| < 2^27.
+ *
+ * output must be distinct to both inputs. The output is reduced degree
+ * (indeed, one need only provide storage for 10 limbs) and |output[i]| < 2^26. */
static void
fmul(limb *output, const limb *in, const limb *in2) {
limb t[19];
fproduct(t, in, in2);
+ /* |t[i]| < 14*2^54 */
freduce_degree(t);
freduce_coefficients(t);
+ /* |t[i]| < 2^26 */
memcpy(output, t, sizeof(limb) * 10);
}
+/* Square a number: output = in**2
+ *
+ * output must be distinct from the input. The inputs are reduced coefficient
+ * form, the output is not.
+ *
+ * output[x] <= 14 * the largest product of the input limbs. */
static void fsquare_inner(limb *output, const limb *in) {
output[0] = ((limb) ((s32) in[0])) * ((s32) in[0]);
output[1] = 2 * ((limb) ((s32) in[0])) * ((s32) in[1]);
@@ -391,12 +400,23 @@ static void fsquare_inner(limb *output, const limb *in) {
output[18] = 2 * ((limb) ((s32) in[9])) * ((s32) in[9]);
}
+/* fsquare sets output = in^2.
+ *
+ * On entry: The |in| argument is in reduced coefficients form and |in[i]| <
+ * 2^27.
+ *
+ * On exit: The |output| argument is in reduced coefficients form (indeed, one
+ * need only provide storage for 10 limbs) and |out[i]| < 2^26. */
static void
fsquare(limb *output, const limb *in) {
limb t[19];
fsquare_inner(t, in);
+ /* |t[i]| < 14*2^54 because the largest product of two limbs will be <
+ * 2^(27+27) and fsquare_inner adds together, at most, 14 of those
+ * products. */
freduce_degree(t);
freduce_coefficients(t);
+ /* |t[i]| < 2^26 */
memcpy(output, t, sizeof(limb) * 10);
}
@@ -417,7 +437,7 @@ fexpand(limb *output, const u8 *input) {
F(6, 19, 1, 0x3ffffff);
F(7, 22, 3, 0x1ffffff);
F(8, 25, 4, 0x3ffffff);
- F(9, 28, 6, 0x3ffffff);
+ F(9, 28, 6, 0x1ffffff);
#undef F
}
@@ -425,60 +445,143 @@ fexpand(limb *output, const u8 *input) {
#error "This code only works when >> does sign-extension on negative numbers"
#endif
+/* s32_eq returns 0xffffffff iff a == b and zero otherwise. */
+static s32 s32_eq(s32 a, s32 b) {
+ a = ~(a ^ b);
+ a &= a << 16;
+ a &= a << 8;
+ a &= a << 4;
+ a &= a << 2;
+ a &= a << 1;
+ return a >> 31;
+}
+
+/* s32_gte returns 0xffffffff if a >= b and zero otherwise, where a and b are
+ * both non-negative. */
+static s32 s32_gte(s32 a, s32 b) {
+ a -= b;
+ /* a >= 0 iff a >= b. */
+ return ~(a >> 31);
+}
+
/* Take a fully reduced polynomial form number and contract it into a
- * little-endian, 32-byte array
- */
+ * little-endian, 32-byte array.
+ *
+ * On entry: |input_limbs[i]| < 2^26 */
static void
-fcontract(u8 *output, limb *input) {
+fcontract(u8 *output, limb *input_limbs) {
int i;
int j;
+ s32 input[10];
+ s32 mask;
+
+ /* |input_limbs[i]| < 2^26, so it's valid to convert to an s32. */
+ for (i = 0; i < 10; i++) {
+ input[i] = input_limbs[i];
+ }
for (j = 0; j < 2; ++j) {
for (i = 0; i < 9; ++i) {
if ((i & 1) == 1) {
- /* This calculation is a time-invariant way to make input[i] positive
- by borrowing from the next-larger limb.
- */
- const s32 mask = (s32)(input[i]) >> 31;
- const s32 carry = -(((s32)(input[i]) & mask) >> 25);
- input[i] = (s32)(input[i]) + (carry << 25);
- input[i+1] = (s32)(input[i+1]) - carry;
+ /* This calculation is a time-invariant way to make input[i]
+ * non-negative by borrowing from the next-larger limb. */
+ const s32 mask = input[i] >> 31;
+ const s32 carry = -((input[i] & mask) >> 25);
+ input[i] = input[i] + (carry << 25);
+ input[i+1] = input[i+1] - carry;
} else {
- const s32 mask = (s32)(input[i]) >> 31;
- const s32 carry = -(((s32)(input[i]) & mask) >> 26);
- input[i] = (s32)(input[i]) + (carry << 26);
- input[i+1] = (s32)(input[i+1]) - carry;
+ const s32 mask = input[i] >> 31;
+ const s32 carry = -((input[i] & mask) >> 26);
+ input[i] = input[i] + (carry << 26);
+ input[i+1] = input[i+1] - carry;
}
}
+
+ /* There's no greater limb for input[9] to borrow from, but we can multiply
+ * by 19 and borrow from input[0], which is valid mod 2^255-19. */
{
- const s32 mask = (s32)(input[9]) >> 31;
- const s32 carry = -(((s32)(input[9]) & mask) >> 25);
- input[9] = (s32)(input[9]) + (carry << 25);
- input[0] = (s32)(input[0]) - (carry * 19);
+ const s32 mask = input[9] >> 31;
+ const s32 carry = -((input[9] & mask) >> 25);
+ input[9] = input[9] + (carry << 25);
+ input[0] = input[0] - (carry * 19);
}
+
+ /* After the first iteration, input[1..9] are non-negative and fit within
+ * 25 or 26 bits, depending on position. However, input[0] may be
+ * negative. */
}
/* The first borrow-propagation pass above ended with every limb
except (possibly) input[0] non-negative.
- Since each input limb except input[0] is decreased by at most 1
- by a borrow-propagation pass, the second borrow-propagation pass
- could only have wrapped around to decrease input[0] again if the
- first pass left input[0] negative *and* input[1] through input[9]
- were all zero. In that case, input[1] is now 2^25 - 1, and this
- last borrow-propagation step will leave input[1] non-negative.
- */
+ If input[0] was negative after the first pass, then it was because of a
+ carry from input[9]. On entry, input[9] < 2^26 so the carry was, at most,
+ one, since (2**26-1) >> 25 = 1. Thus input[0] >= -19.
+
+ In the second pass, each limb is decreased by at most one. Thus the second
+ borrow-propagation pass could only have wrapped around to decrease
+ input[0] again if the first pass left input[0] negative *and* input[1]
+ through input[9] were all zero. In that case, input[1] is now 2^25 - 1,
+ and this last borrow-propagation step will leave input[1] non-negative. */
{
- const s32 mask = (s32)(input[0]) >> 31;
- const s32 carry = -(((s32)(input[0]) & mask) >> 26);
- input[0] = (s32)(input[0]) + (carry << 26);
- input[1] = (s32)(input[1]) - carry;
+ const s32 mask = input[0] >> 31;
+ const s32 carry = -((input[0] & mask) >> 26);
+ input[0] = input[0] + (carry << 26);
+ input[1] = input[1] - carry;
+ }
+
+ /* All input[i] are now non-negative. However, there might be values between
+ * 2^25 and 2^26 in a limb which is, nominally, 25 bits wide. */
+ for (j = 0; j < 2; j++) {
+ for (i = 0; i < 9; i++) {
+ if ((i & 1) == 1) {
+ const s32 carry = input[i] >> 25;
+ input[i] &= 0x1ffffff;
+ input[i+1] += carry;
+ } else {
+ const s32 carry = input[i] >> 26;
+ input[i] &= 0x3ffffff;
+ input[i+1] += carry;
+ }
+ }
+
+ {
+ const s32 carry = input[9] >> 25;
+ input[9] &= 0x1ffffff;
+ input[0] += 19*carry;
+ }
+ }
+
+ /* If the first carry-chain pass, just above, ended up with a carry from
+ * input[9], and that caused input[0] to be out-of-bounds, then input[0] was
+ * < 2^26 + 2*19, because the carry was, at most, two.
+ *
+ * If the second pass carried from input[9] again then input[0] is < 2*19 and
+ * the input[9] -> input[0] carry didn't push input[0] out of bounds. */
+
+ /* It still remains the case that input might be between 2^255-19 and 2^255.
+ * In this case, input[1..9] must take their maximum value and input[0] must
+ * be >= (2^255-19) & 0x3ffffff, which is 0x3ffffed. */
+ mask = s32_gte(input[0], 0x3ffffed);
+ for (i = 1; i < 10; i++) {
+ if ((i & 1) == 1) {
+ mask &= s32_eq(input[i], 0x1ffffff);
+ } else {
+ mask &= s32_eq(input[i], 0x3ffffff);
+ }
}
- /* Both passes through the above loop, plus the last 0-to-1 step, are
- necessary: if input[9] is -1 and input[0] through input[8] are 0,
- negative values will remain in the array until the end.
- */
+ /* mask is either 0xffffffff (if input >= 2^255-19) and zero otherwise. Thus
+ * this conditionally subtracts 2^255-19. */
+ input[0] -= mask & 0x3ffffed;
+
+ for (i = 1; i < 10; i++) {
+ if ((i & 1) == 1) {
+ input[i] -= mask & 0x1ffffff;
+ } else {
+ input[i] -= mask & 0x3ffffff;
+ }
+ }
input[1] <<= 2;
input[2] <<= 3;
@@ -516,7 +619,9 @@ fcontract(u8 *output, limb *input) {
* x z: short form, destroyed
* xprime zprime: short form, destroyed
* qmqp: short form, preserved
- */
+ *
+ * On entry and exit, the absolute value of the limbs of all inputs and outputs
+ * are < 2^26. */
static void fmonty(limb *x2, limb *z2, /* output 2Q */
limb *x3, limb *z3, /* output Q + Q' */
limb *x, limb *z, /* input Q */
@@ -527,43 +632,69 @@ static void fmonty(limb *x2, limb *z2, /* output 2Q */
memcpy(origx, x, 10 * sizeof(limb));
fsum(x, z);
+ /* |x[i]| < 2^27 */
fdifference(z, origx); /* does x - z */
+ /* |z[i]| < 2^27 */
memcpy(origxprime, xprime, sizeof(limb) * 10);
fsum(xprime, zprime);
+ /* |xprime[i]| < 2^27 */
fdifference(zprime, origxprime);
+ /* |zprime[i]| < 2^27 */
fproduct(xxprime, xprime, z);
+ /* |xxprime[i]| < 14*2^54: the largest product of two limbs will be <
+ * 2^(27+27) and fproduct adds together, at most, 14 of those products.
+ * (Approximating that to 2^58 doesn't work out.) */
fproduct(zzprime, x, zprime);
+ /* |zzprime[i]| < 14*2^54 */
freduce_degree(xxprime);
freduce_coefficients(xxprime);
+ /* |xxprime[i]| < 2^26 */
freduce_degree(zzprime);
freduce_coefficients(zzprime);
+ /* |zzprime[i]| < 2^26 */
memcpy(origxprime, xxprime, sizeof(limb) * 10);
fsum(xxprime, zzprime);
+ /* |xxprime[i]| < 2^27 */
fdifference(zzprime, origxprime);
+ /* |zzprime[i]| < 2^27 */
fsquare(xxxprime, xxprime);
+ /* |xxxprime[i]| < 2^26 */
fsquare(zzzprime, zzprime);
+ /* |zzzprime[i]| < 2^26 */
fproduct(zzprime, zzzprime, qmqp);
+ /* |zzprime[i]| < 14*2^52 */
freduce_degree(zzprime);
freduce_coefficients(zzprime);
+ /* |zzprime[i]| < 2^26 */
memcpy(x3, xxxprime, sizeof(limb) * 10);
memcpy(z3, zzprime, sizeof(limb) * 10);
fsquare(xx, x);
+ /* |xx[i]| < 2^26 */
fsquare(zz, z);
+ /* |zz[i]| < 2^26 */
fproduct(x2, xx, zz);
+ /* |x2[i]| < 14*2^52 */
freduce_degree(x2);
freduce_coefficients(x2);
+ /* |x2[i]| < 2^26 */
fdifference(zz, xx); /* does zz = xx - zz */
+ /* |zz[i]| < 2^27 */
memset(zzz + 10, 0, sizeof(limb) * 9);
fscalar_product(zzz, zz, 121665);
+ /* |zzz[i]| < 2^(27+17) */
/* No need to call freduce_degree here:
fscalar_product doesn't increase the degree of its input. */
freduce_coefficients(zzz);
+ /* |zzz[i]| < 2^26 */
fsum(zzz, xx);
+ /* |zzz[i]| < 2^27 */
fproduct(z2, zz, zzz);
+ /* |z2[i]| < 14*2^(26+27) */
freduce_degree(z2);
freduce_coefficients(z2);
+ /* |z2|i| < 2^26 */
}
/* Conditionally swap two reduced-form limb arrays if 'iswap' is 1, but leave
@@ -574,8 +705,7 @@ static void fmonty(limb *x2, limb *z2, /* output 2Q */
* wrong results. Also, the two limb arrays must be in reduced-coefficient,
* reduced-degree form: the values in a[10..19] or b[10..19] aren't swapped,
* and all all values in a[0..9],b[0..9] must have magnitude less than
- * INT32_MAX.
- */
+ * INT32_MAX. */
static void
swap_conditional(limb a[19], limb b[19], limb iswap) {
unsigned i;
@@ -592,8 +722,7 @@ swap_conditional(limb a[19], limb b[19], limb iswap) {
*
* resultx/resultz: the x coordinate of the resulting curve point (short form)
* n: a little endian, 32-byte number
- * q: a point of the curve (short form)
- */
+ * q: a point of the curve (short form) */
static void
cmult(limb *resultx, limb *resultz, const u8 *n, const limb *q) {
limb a[19] = {0}, b[19] = {1}, c[19] = {1}, d[19] = {0};
@@ -711,8 +840,6 @@ crecip(limb *out, const limb *z) {
/* 2^255 - 21 */ fmul(out,t1,z11);
}
-int curve25519_donna(u8 *, const u8 *, const u8 *);
-
int
curve25519_donna(u8 *mypublic, const u8 *secret, const u8 *basepoint) {
limb bp[10], x[10], z[11], zmone[10];
@@ -728,7 +855,6 @@ curve25519_donna(u8 *mypublic, const u8 *secret, const u8 *basepoint) {
cmult(x, z, e, bp);
crecip(zmone, z);
fmul(z, x, zmone);
- freduce_coefficients(z);
fcontract(mypublic, z);
return 0;
}
diff --git a/default_options.h b/default_options.h
index e59c338..e7fad80 100644
--- a/default_options.h
+++ b/default_options.h
@@ -10,7 +10,7 @@ Local customisation should be added to localoptions.h which is
used if it exists. Options defined there will override any options in this
file (#ifndef guards added by ifndef_wrapper.sh).
-Options can also be defined with -DDROPBEAR_XXX Makefile CFLAGS
+Options can also be defined with -DDROPBEAR_XXX in Makefile CFLAGS
IMPORTANT: Many options will require "make clean" after changes */
@@ -198,6 +198,13 @@ If you test it please contact the Dropbear author */
#define DROPBEAR_ECDSA 1
#endif
+/* RSA must be >=1024 */
+#ifndef DROPBEAR_DEFAULT_RSA_SIZE
+#define DROPBEAR_DEFAULT_RSA_SIZE 2048
+#endif
+/* DSS is always 1024 */
+/* ECDSA defaults to largest size configured, usually 521 */
+
/* Add runtime flag "-R" to generate hostkeys as-needed when the first
connection using that key type occurs.
This avoids the need to otherwise run "dropbearkey" and avoids some problems
diff --git a/default_options.h.in b/default_options.h.in
index e81eaae..3a55731 100644
--- a/default_options.h.in
+++ b/default_options.h.in
@@ -10,7 +10,7 @@ Local customisation should be added to localoptions.h which is
used if it exists. Options defined there will override any options in this
file (#ifndef guards added by ifndef_wrapper.sh).
-Options can also be defined with -DDROPBEAR_XXX Makefile CFLAGS
+Options can also be defined with -DDROPBEAR_XXX in Makefile CFLAGS
IMPORTANT: Many options will require "make clean" after changes */
@@ -130,6 +130,11 @@ If you test it please contact the Dropbear author */
* on x86-64 */
#define DROPBEAR_ECDSA 1
+/* RSA must be >=1024 */
+#define DROPBEAR_DEFAULT_RSA_SIZE 2048
+/* DSS is always 1024 */
+/* ECDSA defaults to largest size configured, usually 521 */
+
/* Add runtime flag "-R" to generate hostkeys as-needed when the first
connection using that key type occurs.
This avoids the need to otherwise run "dropbearkey" and avoids some problems
diff --git a/dropbearkey.c b/dropbearkey.c
index 5cb12ef..316d27e 100644
--- a/dropbearkey.c
+++ b/dropbearkey.c
@@ -139,7 +139,7 @@ int main(int argc, char ** argv) {
enum signkey_type keytype = DROPBEAR_SIGNKEY_NONE;
char * typetext = NULL;
char * sizetext = NULL;
- unsigned int bits = 0;
+ unsigned int bits = 0, genbits;
int printpub = 0;
crypto_init();
@@ -240,7 +240,8 @@ int main(int argc, char ** argv) {
check_signkey_bits(keytype, bits);;
}
- fprintf(stderr, "Generating key, this may take a while...\n");
+ genbits = signkey_generate_get_bits(keytype, bits);
+ fprintf(stderr, "Generating %d bit %s key, this may take a while...\n", genbits, typetext);
if (signkey_generate(keytype, bits, filename, 0) == DROPBEAR_FAILURE)
{
dropbear_exit("Failed to generate key.\n");
diff --git a/dss.c b/dss.c
index 7754107..9024b80 100644
--- a/dss.c
+++ b/dss.c
@@ -44,6 +44,7 @@
* These should be freed with dss_key_free.
* Returns DROPBEAR_SUCCESS or DROPBEAR_FAILURE */
int buf_get_dss_pub_key(buffer* buf, dropbear_dss_key *key) {
+ int ret = DROPBEAR_FAILURE;
TRACE(("enter buf_get_dss_pub_key"))
dropbear_assert(key != NULL);
@@ -56,17 +57,29 @@ int buf_get_dss_pub_key(buffer* buf, dropbear_dss_key *key) {
|| buf_getmpint(buf, key->g) == DROPBEAR_FAILURE
|| buf_getmpint(buf, key->y) == DROPBEAR_FAILURE) {
TRACE(("leave buf_get_dss_pub_key: failed reading mpints"))
- return DROPBEAR_FAILURE;
+ ret = DROPBEAR_FAILURE;
+ goto out;
}
- if (mp_count_bits(key->p) < MIN_DSS_KEYLEN) {
- dropbear_log(LOG_WARNING, "DSS key too short");
- TRACE(("leave buf_get_dss_pub_key: short key"))
- return DROPBEAR_FAILURE;
+ if (mp_count_bits(key->p) != DSS_P_BITS) {
+ dropbear_log(LOG_WARNING, "Bad DSS p");
+ ret = DROPBEAR_FAILURE;
+ goto out;
}
+ if (mp_count_bits(key->q) != DSS_Q_BITS) {
+ dropbear_log(LOG_WARNING, "Bad DSS q");
+ ret = DROPBEAR_FAILURE;
+ goto out;
+ }
+
+ ret = DROPBEAR_SUCCESS;
TRACE(("leave buf_get_dss_pub_key: success"))
- return DROPBEAR_SUCCESS;
+out:
+ if (ret == DROPBEAR_FAILURE) {
+ m_mp_free_multi(&key->p, &key->q, &key->g, &key->y, NULL);
+ }
+ return ret;
}
/* Same as buf_get_dss_pub_key, but reads a private "x" key at the end.
@@ -86,7 +99,7 @@ int buf_get_dss_priv_key(buffer* buf, dropbear_dss_key *key) {
m_mp_alloc_init_multi(&key->x, NULL);
ret = buf_getmpint(buf, key->x);
if (ret == DROPBEAR_FAILURE) {
- m_free(key->x);
+ m_mp_free_multi(&key->x, NULL);
}
return ret;
@@ -101,26 +114,7 @@ void dss_key_free(dropbear_dss_key *key) {
TRACE2(("enter dsa_key_free: key == NULL"))
return;
}
- if (key->p) {
- mp_clear(key->p);
- m_free(key->p);
- }
- if (key->q) {
- mp_clear(key->q);
- m_free(key->q);
- }
- if (key->g) {
- mp_clear(key->g);
- m_free(key->g);
- }
- if (key->y) {
- mp_clear(key->y);
- m_free(key->y);
- }
- if (key->x) {
- mp_clear(key->x);
- m_free(key->x);
- }
+ m_mp_free_multi(&key->p, &key->q, &key->g, &key->y, &key->x, NULL);
m_free(key);
TRACE2(("leave dsa_key_free"))
}
@@ -192,6 +186,10 @@ int buf_dss_verify(buffer* buf, dropbear_dss_key *key, buffer *data_buf) {
TRACE(("verify failed, s' >= q"))
goto out;
}
+ if (mp_cmp_d(&val1, 0) != MP_GT) {
+ TRACE(("verify failed, s' <= 0"))
+ goto out;
+ }
/* let val2 = w = (s')^-1 mod q*/
if (mp_invmod(&val1, key->q, &val2) != MP_OKAY) {
goto out;
@@ -213,6 +211,10 @@ int buf_dss_verify(buffer* buf, dropbear_dss_key *key, buffer *data_buf) {
TRACE(("verify failed, r' >= q"))
goto out;
}
+ if (mp_cmp_d(&val1, 0) != MP_GT) {
+ TRACE(("verify failed, r' <= 0"))
+ goto out;
+ }
/* let val4 = u2 = ((r')w) mod q */
if (mp_mulmod(&val1, &val2, key->q, &val4) != MP_OKAY) {
goto out;
diff --git a/dss.h b/dss.h
index adf2d55..4d11c0a 100644
--- a/dss.h
+++ b/dss.h
@@ -41,6 +41,9 @@ typedef struct {
} dropbear_dss_key;
+#define DSS_P_BITS 1024
+#define DSS_Q_BITS 160
+
void buf_put_dss_sign(buffer* buf, dropbear_dss_key *key, buffer *data_buf);
#if DROPBEAR_SIGNKEY_VERIFY
int buf_dss_verify(buffer* buf, dropbear_dss_key *key, buffer *data_buf);
diff --git a/gensignkey.c b/gensignkey.c
index 4691de0..8317fea 100644
--- a/gensignkey.c
+++ b/gensignkey.c
@@ -7,9 +7,6 @@
#include "signkey.h"
#include "dbrandom.h"
-#define RSA_DEFAULT_SIZE 2048
-#define DSS_DEFAULT_SIZE 1024
-
/* Returns DROPBEAR_SUCCESS or DROPBEAR_FAILURE */
static int buf_writefile(buffer * buf, const char * filename) {
int ret = DROPBEAR_FAILURE;
@@ -55,11 +52,12 @@ static int get_default_bits(enum signkey_type keytype)
switch (keytype) {
#if DROPBEAR_RSA
case DROPBEAR_SIGNKEY_RSA:
- return RSA_DEFAULT_SIZE;
+ return DROPBEAR_DEFAULT_RSA_SIZE;
#endif
#if DROPBEAR_DSS
case DROPBEAR_SIGNKEY_DSS:
- return DSS_DEFAULT_SIZE;
+ /* DSS for SSH only defines 1024 bits */
+ return 1024;
#endif
#if DROPBEAR_ECDSA
case DROPBEAR_SIGNKEY_ECDSA_KEYGEN:
@@ -76,6 +74,14 @@ static int get_default_bits(enum signkey_type keytype)
}
}
+int signkey_generate_get_bits(enum signkey_type keytype, int bits) {
+ if (bits == 0)
+ {
+ bits = get_default_bits(keytype);
+ }
+ return bits;
+}
+
/* if skip_exist is set it will silently return if the key file exists */
int signkey_generate(enum signkey_type keytype, int bits, const char* filename, int skip_exist)
{
@@ -83,10 +89,7 @@ int signkey_generate(enum signkey_type keytype, int bits, const char* filename,
buffer *buf = NULL;
char *fn_temp = NULL;
int ret = DROPBEAR_FAILURE;
- if (bits == 0)
- {
- bits = get_default_bits(keytype);
- }
+ bits = signkey_generate_get_bits(keytype, bits);
/* now we can generate the key */
key = new_sign_key();
diff --git a/gensignkey.h b/gensignkey.h
index 1cba8d3..73b9c3c 100644
--- a/gensignkey.h
+++ b/gensignkey.h
@@ -4,5 +4,6 @@
#include "signkey.h"
int signkey_generate(enum signkey_type type, int bits, const char* filename, int skip_exist);
+int signkey_generate_get_bits(enum signkey_type keytype, int bits);
#endif
diff --git a/includes.h b/includes.h
index f91a2c2..766f58f 100644
--- a/includes.h
+++ b/includes.h
@@ -156,7 +156,7 @@ typedef unsigned int u_int32_t;
typedef u_int32_t uint32_t;
#endif /* HAVE_UINT32_T */
-#ifdef SO_PRIORITY
+#ifdef HAVE_LINUX_PKT_SCHED_H
#include <linux/types.h>
#include <linux/pkt_sched.h>
#endif
diff --git a/libtomcrypt/Doxyfile b/libtomcrypt/Doxyfile
index b4a01c7..f07c339 100644
--- a/libtomcrypt/Doxyfile
+++ b/libtomcrypt/Doxyfile
@@ -23,7 +23,7 @@ PROJECT_NAME = LibTomCrypt
# This could be handy for archiving the generated documentation or
# if some version control system is used.
-PROJECT_NUMBER = 1.16
+PROJECT_NUMBER = 1.17
# The OUTPUT_DIRECTORY tag is used to specify the (relative or absolute)
# base path where the generated documentation will be put.
diff --git a/libtomcrypt/Makefile.in b/libtomcrypt/Makefile.in
index 7970700..d9b3668 100644
--- a/libtomcrypt/Makefile.in
+++ b/libtomcrypt/Makefile.in
@@ -4,10 +4,12 @@
# Modified by Clay Culver
# The version
-VERSION=1.16
+VERSION=1.17
-VPATH=@srcdir@
-srcdir=@srcdir@
+PLATFORM := $(shell uname | sed -e 's/_.*//')
+
+
+srcdir=.
# Compiler and Linker Names
#CC=gcc
@@ -17,6 +19,19 @@ srcdir=@srcdir@
#AR=ar
#ARFLAGS=r
+ifndef MAKE
+ MAKE=make
+endif
+
+# ranlib tools
+ifndef RANLIB
+ifeq ($(PLATFORM), Darwin)
+RANLIB=ranlib -c
+else
+RANLIB=ranlib
+endif
+endif
+
# Compilation flags. Note the += does not write over the user's CFLAGS!
# The rest of the flags come from the parent Dropbear makefile
CFLAGS += -c -Isrc/headers/ -I$(srcdir)/src/headers/ -I../ -I$(srcdir)/../ -DLTC_SOURCE -I../libtommath/ -I$(srcdir)/../libtommath/
@@ -99,27 +114,28 @@ endif
#START_INS
OBJECTS=src/ciphers/aes/aes_enc.o src/ciphers/aes/aes.o src/ciphers/anubis.o src/ciphers/blowfish.o \
src/ciphers/cast5.o src/ciphers/des.o src/ciphers/kasumi.o src/ciphers/khazad.o src/ciphers/kseed.o \
-src/ciphers/noekeon.o src/ciphers/rc2.o src/ciphers/rc5.o src/ciphers/rc6.o src/ciphers/safer/safer.o \
-src/ciphers/safer/safer_tab.o src/ciphers/safer/saferp.o src/ciphers/skipjack.o \
-src/ciphers/twofish/twofish.o src/ciphers/xtea.o src/encauth/ccm/ccm_memory.o \
+src/ciphers/multi2.o src/ciphers/noekeon.o src/ciphers/rc2.o src/ciphers/rc5.o src/ciphers/rc6.o \
+src/ciphers/safer/safer.o src/ciphers/safer/saferp.o src/ciphers/safer/safer_tab.o \
+src/ciphers/skipjack.o src/ciphers/twofish/twofish.o src/ciphers/xtea.o src/encauth/ccm/ccm_memory.o \
src/encauth/ccm/ccm_test.o src/encauth/eax/eax_addheader.o src/encauth/eax/eax_decrypt.o \
-src/encauth/eax/eax_decrypt_verify_memory.o src/encauth/eax/eax_done.o src/encauth/eax/eax_encrypt.o \
-src/encauth/eax/eax_encrypt_authenticate_memory.o src/encauth/eax/eax_init.o \
-src/encauth/eax/eax_test.o src/encauth/gcm/gcm_add_aad.o src/encauth/gcm/gcm_add_iv.o \
-src/encauth/gcm/gcm_done.o src/encauth/gcm/gcm_gf_mult.o src/encauth/gcm/gcm_init.o \
-src/encauth/gcm/gcm_memory.o src/encauth/gcm/gcm_mult_h.o src/encauth/gcm/gcm_process.o \
-src/encauth/gcm/gcm_reset.o src/encauth/gcm/gcm_test.o src/encauth/ocb/ocb_decrypt.o \
-src/encauth/ocb/ocb_decrypt_verify_memory.o src/encauth/ocb/ocb_done_decrypt.o \
-src/encauth/ocb/ocb_done_encrypt.o src/encauth/ocb/ocb_encrypt.o \
-src/encauth/ocb/ocb_encrypt_authenticate_memory.o src/encauth/ocb/ocb_init.o src/encauth/ocb/ocb_ntz.o \
-src/encauth/ocb/ocb_shift_xor.o src/encauth/ocb/ocb_test.o src/encauth/ocb/s_ocb_done.o \
-src/hashes/chc/chc.o src/hashes/helper/hash_file.o src/hashes/helper/hash_filehandle.o \
-src/hashes/helper/hash_memory.o src/hashes/helper/hash_memory_multi.o src/hashes/md2.o src/hashes/md4.o \
-src/hashes/md5.o src/hashes/rmd128.o src/hashes/rmd160.o src/hashes/rmd256.o src/hashes/rmd320.o \
-src/hashes/sha1.o src/hashes/sha2/sha256.o src/hashes/sha2/sha512.o src/hashes/tiger.o \
-src/hashes/whirl/whirl.o src/mac/f9/f9_done.o src/mac/f9/f9_file.o src/mac/f9/f9_init.o \
-src/mac/f9/f9_memory.o src/mac/f9/f9_memory_multi.o src/mac/f9/f9_process.o src/mac/f9/f9_test.o \
-src/mac/hmac/hmac_done.o src/mac/hmac/hmac_file.o src/mac/hmac/hmac_init.o src/mac/hmac/hmac_memory.o \
+src/encauth/eax/eax_decrypt_verify_memory.o src/encauth/eax/eax_done.o \
+src/encauth/eax/eax_encrypt_authenticate_memory.o src/encauth/eax/eax_encrypt.o \
+src/encauth/eax/eax_init.o src/encauth/eax/eax_test.o src/encauth/gcm/gcm_add_aad.o \
+src/encauth/gcm/gcm_add_iv.o src/encauth/gcm/gcm_done.o src/encauth/gcm/gcm_gf_mult.o \
+src/encauth/gcm/gcm_init.o src/encauth/gcm/gcm_memory.o src/encauth/gcm/gcm_mult_h.o \
+src/encauth/gcm/gcm_process.o src/encauth/gcm/gcm_reset.o src/encauth/gcm/gcm_test.o \
+src/encauth/ocb/ocb_decrypt.o src/encauth/ocb/ocb_decrypt_verify_memory.o \
+src/encauth/ocb/ocb_done_decrypt.o src/encauth/ocb/ocb_done_encrypt.o \
+src/encauth/ocb/ocb_encrypt_authenticate_memory.o src/encauth/ocb/ocb_encrypt.o \
+src/encauth/ocb/ocb_init.o src/encauth/ocb/ocb_ntz.o src/encauth/ocb/ocb_shift_xor.o \
+src/encauth/ocb/ocb_test.o src/encauth/ocb/s_ocb_done.o src/hashes/chc/chc.o \
+src/hashes/helper/hash_file.o src/hashes/helper/hash_filehandle.o src/hashes/helper/hash_memory.o \
+src/hashes/helper/hash_memory_multi.o src/hashes/md2.o src/hashes/md4.o src/hashes/md5.o \
+src/hashes/rmd128.o src/hashes/rmd160.o src/hashes/rmd256.o src/hashes/rmd320.o src/hashes/sha1.o \
+src/hashes/sha2/sha256.o src/hashes/sha2/sha512.o src/hashes/tiger.o src/hashes/whirl/whirl.o \
+src/mac/f9/f9_done.o src/mac/f9/f9_file.o src/mac/f9/f9_init.o src/mac/f9/f9_memory.o \
+src/mac/f9/f9_memory_multi.o src/mac/f9/f9_process.o src/mac/f9/f9_test.o src/mac/hmac/hmac_done.o \
+src/mac/hmac/hmac_file.o src/mac/hmac/hmac_init.o src/mac/hmac/hmac_memory.o \
src/mac/hmac/hmac_memory_multi.o src/mac/hmac/hmac_process.o src/mac/hmac/hmac_test.o \
src/mac/omac/omac_done.o src/mac/omac/omac_file.o src/mac/omac/omac_init.o src/mac/omac/omac_memory.o \
src/mac/omac/omac_memory_multi.o src/mac/omac/omac_process.o src/mac/omac/omac_test.o \
@@ -131,39 +147,41 @@ src/mac/xcbc/xcbc_file.o src/mac/xcbc/xcbc_init.o src/mac/xcbc/xcbc_memory.o \
src/mac/xcbc/xcbc_memory_multi.o src/mac/xcbc/xcbc_process.o src/mac/xcbc/xcbc_test.o \
src/math/fp/ltc_ecc_fp_mulmod.o src/math/gmp_desc.o src/math/ltm_desc.o src/math/multi.o \
src/math/rand_prime.o src/math/tfm_desc.o src/misc/base64/base64_decode.o \
-src/misc/base64/base64_encode.o src/misc/burn_stack.o src/misc/crypt/crypt.o \
-src/misc/crypt/crypt_argchk.o src/misc/crypt/crypt_cipher_descriptor.o \
-src/misc/crypt/crypt_cipher_is_valid.o src/misc/crypt/crypt_find_cipher.o \
-src/misc/crypt/crypt_find_cipher_any.o src/misc/crypt/crypt_find_cipher_id.o \
-src/misc/crypt/crypt_find_hash.o src/misc/crypt/crypt_find_hash_any.o \
-src/misc/crypt/crypt_find_hash_id.o src/misc/crypt/crypt_find_hash_oid.o \
-src/misc/crypt/crypt_find_prng.o src/misc/crypt/crypt_fsa.o src/misc/crypt/crypt_hash_descriptor.o \
-src/misc/crypt/crypt_hash_is_valid.o src/misc/crypt/crypt_ltc_mp_descriptor.o \
-src/misc/crypt/crypt_prng_descriptor.o src/misc/crypt/crypt_prng_is_valid.o \
-src/misc/crypt/crypt_register_cipher.o src/misc/crypt/crypt_register_hash.o \
-src/misc/crypt/crypt_register_prng.o src/misc/crypt/crypt_unregister_cipher.o \
-src/misc/crypt/crypt_unregister_hash.o src/misc/crypt/crypt_unregister_prng.o \
-src/misc/error_to_string.o src/misc/pkcs5/pkcs_5_1.o src/misc/pkcs5/pkcs_5_2.o src/misc/zeromem.o \
-src/modes/cbc/cbc_decrypt.o src/modes/cbc/cbc_done.o src/modes/cbc/cbc_encrypt.o \
-src/modes/cbc/cbc_getiv.o src/modes/cbc/cbc_setiv.o src/modes/cbc/cbc_start.o \
-src/modes/cfb/cfb_decrypt.o src/modes/cfb/cfb_done.o src/modes/cfb/cfb_encrypt.o \
-src/modes/cfb/cfb_getiv.o src/modes/cfb/cfb_setiv.o src/modes/cfb/cfb_start.o \
-src/modes/ctr/ctr_decrypt.o src/modes/ctr/ctr_done.o src/modes/ctr/ctr_encrypt.o \
-src/modes/ctr/ctr_getiv.o src/modes/ctr/ctr_setiv.o src/modes/ctr/ctr_start.o src/modes/ctr/ctr_test.o \
-src/modes/ecb/ecb_decrypt.o src/modes/ecb/ecb_done.o src/modes/ecb/ecb_encrypt.o \
-src/modes/ecb/ecb_start.o src/modes/f8/f8_decrypt.o src/modes/f8/f8_done.o src/modes/f8/f8_encrypt.o \
-src/modes/f8/f8_getiv.o src/modes/f8/f8_setiv.o src/modes/f8/f8_start.o src/modes/f8/f8_test_mode.o \
-src/modes/lrw/lrw_decrypt.o src/modes/lrw/lrw_done.o src/modes/lrw/lrw_encrypt.o \
-src/modes/lrw/lrw_getiv.o src/modes/lrw/lrw_process.o src/modes/lrw/lrw_setiv.o \
-src/modes/lrw/lrw_start.o src/modes/lrw/lrw_test.o src/modes/ofb/ofb_decrypt.o src/modes/ofb/ofb_done.o \
-src/modes/ofb/ofb_encrypt.o src/modes/ofb/ofb_getiv.o src/modes/ofb/ofb_setiv.o \
-src/modes/ofb/ofb_start.o src/pk/asn1/der/bit/der_decode_bit_string.o \
-src/pk/asn1/der/bit/der_encode_bit_string.o src/pk/asn1/der/bit/der_length_bit_string.o \
-src/pk/asn1/der/boolean/der_decode_boolean.o src/pk/asn1/der/boolean/der_encode_boolean.o \
-src/pk/asn1/der/boolean/der_length_boolean.o src/pk/asn1/der/choice/der_decode_choice.o \
-src/pk/asn1/der/ia5/der_decode_ia5_string.o src/pk/asn1/der/ia5/der_encode_ia5_string.o \
-src/pk/asn1/der/ia5/der_length_ia5_string.o src/pk/asn1/der/integer/der_decode_integer.o \
-src/pk/asn1/der/integer/der_encode_integer.o src/pk/asn1/der/integer/der_length_integer.o \
+src/misc/base64/base64_encode.o src/misc/burn_stack.o src/misc/crypt/crypt_argchk.o \
+src/misc/crypt/crypt.o src/misc/crypt/crypt_cipher_descriptor.o src/misc/crypt/crypt_cipher_is_valid.o \
+src/misc/crypt/crypt_find_cipher_any.o src/misc/crypt/crypt_find_cipher.o \
+src/misc/crypt/crypt_find_cipher_id.o src/misc/crypt/crypt_find_hash_any.o \
+src/misc/crypt/crypt_find_hash.o src/misc/crypt/crypt_find_hash_id.o \
+src/misc/crypt/crypt_find_hash_oid.o src/misc/crypt/crypt_find_prng.o src/misc/crypt/crypt_fsa.o \
+src/misc/crypt/crypt_hash_descriptor.o src/misc/crypt/crypt_hash_is_valid.o \
+src/misc/crypt/crypt_ltc_mp_descriptor.o src/misc/crypt/crypt_prng_descriptor.o \
+src/misc/crypt/crypt_prng_is_valid.o src/misc/crypt/crypt_register_cipher.o \
+src/misc/crypt/crypt_register_hash.o src/misc/crypt/crypt_register_prng.o \
+src/misc/crypt/crypt_unregister_cipher.o src/misc/crypt/crypt_unregister_hash.o \
+src/misc/crypt/crypt_unregister_prng.o src/misc/error_to_string.o src/misc/pkcs5/pkcs_5_1.o \
+src/misc/pkcs5/pkcs_5_2.o src/misc/zeromem.o src/modes/cbc/cbc_decrypt.o src/modes/cbc/cbc_done.o \
+src/modes/cbc/cbc_encrypt.o src/modes/cbc/cbc_getiv.o src/modes/cbc/cbc_setiv.o \
+src/modes/cbc/cbc_start.o src/modes/cfb/cfb_decrypt.o src/modes/cfb/cfb_done.o \
+src/modes/cfb/cfb_encrypt.o src/modes/cfb/cfb_getiv.o src/modes/cfb/cfb_setiv.o \
+src/modes/cfb/cfb_start.o src/modes/ctr/ctr_decrypt.o src/modes/ctr/ctr_done.o \
+src/modes/ctr/ctr_encrypt.o src/modes/ctr/ctr_getiv.o src/modes/ctr/ctr_setiv.o \
+src/modes/ctr/ctr_start.o src/modes/ctr/ctr_test.o src/modes/ecb/ecb_decrypt.o src/modes/ecb/ecb_done.o \
+src/modes/ecb/ecb_encrypt.o src/modes/ecb/ecb_start.o src/modes/f8/f8_decrypt.o src/modes/f8/f8_done.o \
+src/modes/f8/f8_encrypt.o src/modes/f8/f8_getiv.o src/modes/f8/f8_setiv.o src/modes/f8/f8_start.o \
+src/modes/f8/f8_test_mode.o src/modes/lrw/lrw_decrypt.o src/modes/lrw/lrw_done.o \
+src/modes/lrw/lrw_encrypt.o src/modes/lrw/lrw_getiv.o src/modes/lrw/lrw_process.o \
+src/modes/lrw/lrw_setiv.o src/modes/lrw/lrw_start.o src/modes/lrw/lrw_test.o \
+src/modes/ofb/ofb_decrypt.o src/modes/ofb/ofb_done.o src/modes/ofb/ofb_encrypt.o \
+src/modes/ofb/ofb_getiv.o src/modes/ofb/ofb_setiv.o src/modes/ofb/ofb_start.o \
+src/modes/xts/xts_decrypt.o src/modes/xts/xts_done.o src/modes/xts/xts_encrypt.o \
+src/modes/xts/xts_init.o src/modes/xts/xts_mult_x.o src/modes/xts/xts_test.o \
+src/pk/asn1/der/bit/der_decode_bit_string.o src/pk/asn1/der/bit/der_encode_bit_string.o \
+src/pk/asn1/der/bit/der_length_bit_string.o src/pk/asn1/der/boolean/der_decode_boolean.o \
+src/pk/asn1/der/boolean/der_encode_boolean.o src/pk/asn1/der/boolean/der_length_boolean.o \
+src/pk/asn1/der/choice/der_decode_choice.o src/pk/asn1/der/ia5/der_decode_ia5_string.o \
+src/pk/asn1/der/ia5/der_encode_ia5_string.o src/pk/asn1/der/ia5/der_length_ia5_string.o \
+src/pk/asn1/der/integer/der_decode_integer.o src/pk/asn1/der/integer/der_encode_integer.o \
+src/pk/asn1/der/integer/der_length_integer.o \
src/pk/asn1/der/object_identifier/der_decode_object_identifier.o \
src/pk/asn1/der/object_identifier/der_encode_object_identifier.o \
src/pk/asn1/der/object_identifier/der_length_object_identifier.o \
@@ -186,8 +204,8 @@ src/pk/asn1/der/utf8/der_decode_utf8_string.o src/pk/asn1/der/utf8/der_encode_ut
src/pk/asn1/der/utf8/der_length_utf8_string.o src/pk/dsa/dsa_decrypt_key.o \
src/pk/dsa/dsa_encrypt_key.o src/pk/dsa/dsa_export.o src/pk/dsa/dsa_free.o src/pk/dsa/dsa_import.o \
src/pk/dsa/dsa_make_key.o src/pk/dsa/dsa_shared_secret.o src/pk/dsa/dsa_sign_hash.o \
-src/pk/dsa/dsa_verify_hash.o src/pk/dsa/dsa_verify_key.o src/pk/ecc/ecc.o \
-src/pk/ecc/ecc_ansi_x963_export.o src/pk/ecc/ecc_ansi_x963_import.o src/pk/ecc/ecc_decrypt_key.o \
+src/pk/dsa/dsa_verify_hash.o src/pk/dsa/dsa_verify_key.o src/pk/ecc/ecc_ansi_x963_export.o \
+src/pk/ecc/ecc_ansi_x963_import.o src/pk/ecc/ecc.o src/pk/ecc/ecc_decrypt_key.o \
src/pk/ecc/ecc_encrypt_key.o src/pk/ecc/ecc_export.o src/pk/ecc/ecc_free.o src/pk/ecc/ecc_get_size.o \
src/pk/ecc/ecc_import.o src/pk/ecc/ecc_make_key.o src/pk/ecc/ecc_shared_secret.o \
src/pk/ecc/ecc_sign_hash.o src/pk/ecc/ecc_sizes.o src/pk/ecc/ecc_test.o src/pk/ecc/ecc_verify_hash.o \
@@ -245,6 +263,8 @@ src/hashes/sha2/sha256.o: src/hashes/sha2/sha256.c src/hashes/sha2/sha224.c
#This rule makes the libtomcrypt library.
library: $(LIBNAME)
+$(OBJECTS): $(HEADERS)
+
testprof/$(LIBTEST):
cd testprof ; CFLAGS="$(CFLAGS)" LIBTEST_S=$(LIBTEST_S) $(MAKE)
@@ -263,7 +283,7 @@ crypt: library $(CRYPTOBJECTS)
#makes the small program
small: library $(SMALLOBJECTS)
$(CC) $(SMALLOBJECTS) $(LIBNAME) $(EXTRALIBS) -o $(SMALL) $(WARN)
-
+
tv_gen: library $(TVS)
$(CC) $(LDFLAGS) $(TVS) $(LIBNAME) $(EXTRALIBS) -o $(TV)
@@ -316,7 +336,7 @@ doxy:
doxygen
cd doc/doxygen/latex ; ${MAKE} ; mv -f refman.pdf ../../.
echo The huge doxygen PDF should be available as doc/refman.pdf
-
+
#This builds the crypt.pdf file. Note that the rm -f *.pdf has been removed
#from the clean command! This is because most people would like to keep the
#nice pre-compiled crypt.pdf that comes with libtomcrypt! We only need to
@@ -358,6 +378,6 @@ zipup: no_oops docs
mv -fv crypt* ~ ; rm -rf libtomcrypt-$(VERSION)
-# $Source: /cvs/libtom/libtomcrypt/makefile,v $
-# $Revision: 1.145 $
-# $Date: 2006/12/02 19:23:21 $
+# $Source$ */
+# $Revision$ */
+# $Date$ */
diff --git a/libtomcrypt/TODO b/libtomcrypt/TODO
index 226ec8a..30c6e4f 100644
--- a/libtomcrypt/TODO
+++ b/libtomcrypt/TODO
@@ -1,11 +1,3 @@
-stopped at ch12
--- needs examples for ecc/dsa!!! (and for asn.1)
-
-must have for v1.16
-- document PK build flags
-- document makefile flags [INSTALL_* for instance]
-- prepare manual for printing (both soft and hard cover)
-
-Nice to have [in order of precedence]
-- add X9.63 IES
-- add CPP macros like OpenSSL has for ASN1 (e.g. encode/decode functions, etc) shameless ripoff :-)
+for 1.18
+- document new ECC functions
+- add test for new functions
diff --git a/libtomcrypt/changes b/libtomcrypt/changes
index b2c7014..85a9c69 100644
--- a/libtomcrypt/changes
+++ b/libtomcrypt/changes
@@ -1,3 +1,18 @@
+May 12th, 2007
+v1.17 -- Cryptography Research Inc. contributed another small volley of patches, one to fix __WCHAR_DEFINED__ for BSD platforms,
+ another to silence MSVC warnings.
+ -- Added LTC_XCBC_PURE to XCBC mode which lets you use it in three-key mode.
+ -- [CRI] Added libtomcrypt.dsp for Visual C++ users.
+ -- [CRI] Added more functions for manipulating the ECC fixed point cache (including saving and loading)
+ -- [CRI] Modified ecc_make_key() to always produce keys smaller than base point order, for standards-compliance
+ -- Elliptic Semiconductor contributed XTS chaining mode to the cipher suite (subsequently optimized it)
+ -- Fixed xcbc_init() keylen when using single key mode.
+ -- Bruce Fortune pointed out a typo in the hmac_process() description in the manual. Fixed.
+ -- Added variable width counter support to CTR mode
+ -- Fixed CMAC (aka OMAC) when using 64-bit block ciphers and LTC_FAST ... my bad.
+ -- Fixed bug in ecc_is_valid() that would basically always return true
+ -- renamed a lot of macros to add the LTC_ prefix [e.g. RIJNDAEL => LTC_RIJNDAEL]
+
December 16th, 2006
v1.16 -- Brian Gladman pointed out that a recent change to GCM broke how the IV was handled. Currently the code complies against his test vectors
so the code should be considered frozen now.
@@ -1551,6 +1566,6 @@ v0.02 -- Changed RC5 to only allow 12 to 24 rounds
v0.01 -- We will call this the first version.
/* $Source: /cvs/libtom/libtomcrypt/changes,v $ */
-/* $Revision: 1.274 $ */
-/* $Date: 2006/12/16 19:08:17 $ */
+/* $Revision: 1.288 $ */
+/* $Date: 2007/05/12 14:37:41 $ */
diff --git a/libtomcrypt/crypt.lof b/libtomcrypt/crypt.lof
index 0f1a2fb..ba16c2d 100644
--- a/libtomcrypt/crypt.lof
+++ b/libtomcrypt/crypt.lof
@@ -6,19 +6,19 @@
\contentsline {figure}{\numberline {3.1}{\ignorespaces Built--In Software Ciphers}}{19}{figure.3.1}
\contentsline {figure}{\numberline {3.2}{\ignorespaces Twofish Build Options}}{21}{figure.3.2}
\addvspace {10\p@ }
-\contentsline {figure}{\numberline {4.1}{\ignorespaces Built--In Software Hashes}}{57}{figure.4.1}
+\contentsline {figure}{\numberline {4.1}{\ignorespaces Built--In Software Hashes}}{59}{figure.4.1}
\addvspace {10\p@ }
\addvspace {10\p@ }
-\contentsline {figure}{\numberline {6.1}{\ignorespaces List of Provided PRNGs}}{82}{figure.6.1}
+\contentsline {figure}{\numberline {6.1}{\ignorespaces List of Provided PRNGs}}{84}{figure.6.1}
\addvspace {10\p@ }
\addvspace {10\p@ }
\addvspace {10\p@ }
-\contentsline {figure}{\numberline {9.1}{\ignorespaces DSA Key Sizes}}{119}{figure.9.1}
+\contentsline {figure}{\numberline {9.1}{\ignorespaces DSA Key Sizes}}{121}{figure.9.1}
\addvspace {10\p@ }
-\contentsline {figure}{\numberline {10.1}{\ignorespaces List of ASN.1 Supported Types}}{127}{figure.10.1}
+\contentsline {figure}{\numberline {10.1}{\ignorespaces List of ASN.1 Supported Types}}{129}{figure.10.1}
\addvspace {10\p@ }
\addvspace {10\p@ }
-\contentsline {figure}{\numberline {12.1}{\ignorespaces RSA/DH Key Strength}}{149}{figure.12.1}
-\contentsline {figure}{\numberline {12.2}{\ignorespaces ECC Key Strength}}{149}{figure.12.2}
+\contentsline {figure}{\numberline {12.1}{\ignorespaces RSA/DH Key Strength}}{151}{figure.12.1}
+\contentsline {figure}{\numberline {12.2}{\ignorespaces ECC Key Strength}}{151}{figure.12.2}
\addvspace {10\p@ }
\addvspace {10\p@ }
diff --git a/libtomcrypt/crypt.tex b/libtomcrypt/crypt.tex
index 0d374f7..31bf399 100644
--- a/libtomcrypt/crypt.tex
+++ b/libtomcrypt/crypt.tex
@@ -190,7 +190,7 @@ The project is hereby released as public domain.
\mysection{Patent Disclosure}
The author (Tom St Denis) is not a patent lawyer so this section is not to be treated as legal advice. To the best
-of the authors knowledge the only patent related issues within the library are the RC5 and RC6 symmetric block ciphers.
+of the author's knowledge the only patent related issues within the library are the RC5 and RC6 symmetric block ciphers.
They can be removed from a build by simply commenting out the two appropriate lines in \textit{tomcrypt\_custom.h}. The rest
of the ciphers and hashes are patent free or under patents that have since expired.
@@ -616,8 +616,8 @@ As of this release the current cipher\_descriptors elements are the following:
\hline AES & aes\_desc & 16 & 16, 24, 32 & 10, 12, 14 \\
& aes\_enc\_desc & 16 & 16, 24, 32 & 10, 12, 14 \\
\hline Twofish & twofish\_desc & 16 & 16, 24, 32 & 16 \\
- \hline DES & des\_desc & 8 & 7 & 16 \\
- \hline 3DES (EDE mode) & des3\_desc & 8 & 21 & 16 \\
+ \hline DES & des\_desc & 8 & 8 & 16 \\
+ \hline 3DES (EDE mode) & des3\_desc & 8 & 24 & 16 \\
\hline CAST5 (CAST-128) & cast5\_desc & 8 & 5 $\ldots$ 16 & 12, 16 \\
\hline Noekeon & noekeon\_desc & 16 & 16 & 16 \\
\hline Skipjack & skipjack\_desc & 8 & 10 & 32 \\
@@ -879,14 +879,37 @@ of the cipher you choose. It is important that the IV be random for each uniqu
parameters \textit{key}, \textit{keylen} and \textit{num\_rounds} are the same as in the XXX\_setup() function call. The final parameter
is a pointer to the structure you want to hold the information for the mode of operation.
+The routines return {\bf CRYPT\_OK} if the cipher initialized correctly, otherwise, they return an error code.
+\subsubsection{CTR Mode}
In the case of CTR mode there is an additional parameter \textit{ctr\_mode} which specifies the mode that the counter is to be used in.
If \textbf{CTR\_COUNTER\_ LITTLE\_ENDIAN} was specified then the counter will be treated as a little endian value. Otherwise, if
\textbf{CTR\_COUNTER\_BIG\_ENDIAN} was specified the counter will be treated as a big endian value. As of v1.15 the RFC 3686 style of
increment then encrypt is also supported. By OR'ing \textbf{LTC\_CTR\_RFC3686} with the CTR \textit{mode} value, ctr\_start() will increment
the counter before encrypting it for the first time.
-The routines return {\bf CRYPT\_OK} if the cipher initialized correctly, otherwise, they return an error code.
+As of V1.17, the library supports variable length counters for CTR mode. The (optional) counter length is specified by OR'ing the octet
+length of the counter against the \textit{ctr\_mode} parameter. The default, zero, indicates that a full block length counter will be used. This also
+ensures backwards compatibility with software that uses older versions of the library.
+
+\begin{small}
+\begin{verbatim}
+symmetric_CTR ctr;
+int err;
+unsigned char IV[16], key[16];
+
+/* use a 32-bit little endian counter */
+if ((err = ctr_start(find_cipher("aes"),
+ IV, key, 16, 0,
+ CTR_COUNTER_LITTLE_ENDIAN | 4,
+ &ctr)) != CRYPT_OK) {
+ handle_error(err);
+}
+\end{verbatim}
+\end{small}
+
+Changing the counter size has little (really no) effect on the performance of the CTR chaining mode. It is provided for compatibility
+with other software (and hardware) which have smaller fixed sized counters.
\subsection{Encryption and Decryption}
To actually encrypt or decrypt the following routines are provided:
@@ -1093,6 +1116,55 @@ To terminate the LRW state use the following:
int lrw_done(symmetric_LRW *lrw);
\end{verbatim}
+\subsection{XTS Mode}
+As of v1.17, LibTomCrypt supports XTS mode with code donated by Elliptic Semiconductor Inc.\footnote{www.ellipticsemi.com}.
+XTS is a chaining mode for 128--bit block ciphers, recommended by IEEE (P1619)
+for disk encryption. It is meant to be an encryption mode with random access to the message data without compromising privacy. It requires two private keys (of equal
+length) to perform the encryption process. Each encryption invocation includes a sector number or unique identifier specified as a 128--bit string.
+
+To initialize XTS mode use the following function call:
+
+\index{xts\_start()}
+\begin{verbatim}
+int xts_start( int cipher,
+ const unsigned char *key1,
+ const unsigned char *key2,
+ unsigned long keylen,
+ int num_rounds,
+ symmetric_xts *xts)
+\end{verbatim}
+This will start the XTS mode with the two keys pointed to by \textit{key1} and \textit{key2} of length \textit{keylen} octets each.
+
+To encrypt or decrypt a sector use the following calls:
+
+\index{xts\_encrypt()} \index{xts\_decrypt()}
+\begin{verbatim}
+int xts_encrypt(
+ const unsigned char *pt, unsigned long ptlen,
+ unsigned char *ct,
+ const unsigned char *tweak,
+ symmetric_xts *xts);
+
+int xts_decrypt(
+ const unsigned char *ct, unsigned long ptlen,
+ unsigned char *pt,
+ const unsigned char *tweak,
+ symmetric_xts *xts);
+\end{verbatim}
+The first will encrypt the plaintext pointed to by \textit{pt} of length \textit{ptlen} octets, and store the ciphertext in the array pointed to by
+\textit{ct}. It uses the 128--bit tweak pointed to by \textit{tweak} to encrypt the block. The decrypt function performs the opposite operation. Both
+functions support ciphertext stealing (blocks that are not multiples of 16 bytes).
+
+The P1619 specification states the tweak for sector number shall be represented as a 128--bit little endian string.
+
+To terminate the XTS state call the following function:
+
+\index{xts\_done()}
+\begin{verbatim}
+void xts_done(symmetric_xts *xts);
+\end{verbatim}
+
+
\subsection{F8 Mode}
\index{F8 Mode}
The F8 Chaining mode (see RFC 3711 for instance) is yet another chaining mode for block ciphers. It behaves much like CTR mode in that it XORs a keystream
@@ -2098,8 +2170,8 @@ int hmac_process( hmac_state *hmac,
const unsigned char *in,
unsigned long inlen);
\end{verbatim}
-\textit{hmac} is the HMAC state you are working with. \textit{buf} is the array of octets to send into the HMAC process. \textit{len} is the
-number of octets to process. Like the hash process routines you can send the data in arbitrarily sized chunks. When you
+\textit{hmac} is the HMAC state you are working with. \textit{in} is the array of octets to send into the HMAC process. \textit{inlen} is the
+number of octets to process. Like the hash process routines, you can send the data in arbitrarily sized chunks. When you
are finished with the HMAC process you must call the following function to get the HMAC code:
\index{hmac\_done()}
\begin{verbatim}
@@ -2511,6 +2583,13 @@ int xcbc_init( xcbc_state *xcbc,
This will initialize the XCBC--MAC state \textit{xcbc}, with the key specified in \textit{key} of length \textit{keylen} octets. The cipher indicated
by the \textit{cipher} index can be either a 64 or 128--bit block cipher. This will return \textbf{CRYPT\_OK} on success.
+\index{LTC\_XCBC\_PURE}
+It is possible to use XCBC in a three key mode by OR'ing the value \textbf{LTC\_XCBC\_PURE} against the \textit{keylen} parameter. In this mode, the key is
+interpretted as three keys. If the cipher has a block size of $n$ octets, the first key is then $keylen - 2n$ octets and is the encryption key. The next
+$2n$ octets are the $K_1$ and $K_2$ padding keys (used on the last block). For example, to use AES--192 \textit{keylen} should be $24 + 2 \cdot 16 = 56$ octets.
+The three keys are interpretted as if they were concatenated in the \textit{key} buffer.
+
+
To process data through XCBC--MAC use the following function:
\index{xcbc\_process()}
@@ -6485,5 +6564,5 @@ Since the function is given the entire RSA key (for private keys only) CRT is po
\end{document}
% $Source: /cvs/libtom/libtomcrypt/crypt.tex,v $
-% $Revision: 1.123 $
-% $Date: 2006/12/16 19:08:17 $
+% $Revision: 1.128 $
+% $Date: 2007/03/10 23:59:54 $
diff --git a/libtomcrypt/demos/encrypt.c b/libtomcrypt/demos/encrypt.c
index f38440d..12b2346 100644
--- a/libtomcrypt/demos/encrypt.c
+++ b/libtomcrypt/demos/encrypt.c
@@ -26,58 +26,58 @@ void register_algs(void)
{
int x;
-#ifdef RIJNDAEL
+#ifdef LTC_RIJNDAEL
register_cipher (&aes_desc);
#endif
-#ifdef BLOWFISH
+#ifdef LTC_BLOWFISH
register_cipher (&blowfish_desc);
#endif
-#ifdef XTEA
+#ifdef LTC_XTEA
register_cipher (&xtea_desc);
#endif
-#ifdef RC5
+#ifdef LTC_RC5
register_cipher (&rc5_desc);
#endif
-#ifdef RC6
+#ifdef LTC_RC6
register_cipher (&rc6_desc);
#endif
-#ifdef SAFERP
+#ifdef LTC_SAFERP
register_cipher (&saferp_desc);
#endif
-#ifdef TWOFISH
+#ifdef LTC_TWOFISH
register_cipher (&twofish_desc);
#endif
-#ifdef SAFER
+#ifdef LTC_SAFER
register_cipher (&safer_k64_desc);
register_cipher (&safer_sk64_desc);
register_cipher (&safer_k128_desc);
register_cipher (&safer_sk128_desc);
#endif
-#ifdef RC2
+#ifdef LTC_RC2
register_cipher (&rc2_desc);
#endif
-#ifdef DES
+#ifdef LTC_DES
register_cipher (&des_desc);
register_cipher (&des3_desc);
#endif
-#ifdef CAST5
+#ifdef LTC_CAST5
register_cipher (&cast5_desc);
#endif
-#ifdef NOEKEON
+#ifdef LTC_NOEKEON
register_cipher (&noekeon_desc);
#endif
-#ifdef SKIPJACK
+#ifdef LTC_SKIPJACK
register_cipher (&skipjack_desc);
#endif
-#ifdef KHAZAD
+#ifdef LTC_KHAZAD
register_cipher (&khazad_desc);
#endif
-#ifdef ANUBIS
+#ifdef LTC_ANUBIS
register_cipher (&anubis_desc);
#endif
if (register_hash(&sha256_desc) == -1) {
- printf("Error registering SHA256\n");
+ printf("Error registering LTC_SHA256\n");
exit(-1);
}
@@ -144,7 +144,7 @@ int main(int argc, char *argv[])
hash_idx = find_hash("sha256");
if (hash_idx == -1) {
- printf("SHA256 not found...?\n");
+ printf("LTC_SHA256 not found...?\n");
exit(-1);
}
@@ -236,6 +236,6 @@ int main(int argc, char *argv[])
return 0;
}
-/* $Source: /cvs/libtom/libtomcrypt/demos/encrypt.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2005/08/04 20:43:50 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/demos/hashsum.c b/libtomcrypt/demos/hashsum.c
index 653b6ef..4e31501 100644
--- a/libtomcrypt/demos/hashsum.c
+++ b/libtomcrypt/demos/hashsum.c
@@ -68,43 +68,43 @@ void register_algs(void)
{
int err;
-#ifdef TIGER
+#ifdef LTC_TIGER
register_hash (&tiger_desc);
#endif
-#ifdef MD2
+#ifdef LTC_MD2
register_hash (&md2_desc);
#endif
-#ifdef MD4
+#ifdef LTC_MD4
register_hash (&md4_desc);
#endif
-#ifdef MD5
+#ifdef LTC_MD5
register_hash (&md5_desc);
#endif
-#ifdef SHA1
+#ifdef LTC_SHA1
register_hash (&sha1_desc);
#endif
-#ifdef SHA224
+#ifdef LTC_SHA224
register_hash (&sha224_desc);
#endif
-#ifdef SHA256
+#ifdef LTC_SHA256
register_hash (&sha256_desc);
#endif
-#ifdef SHA384
+#ifdef LTC_SHA384
register_hash (&sha384_desc);
#endif
-#ifdef SHA512
+#ifdef LTC_SHA512
register_hash (&sha512_desc);
#endif
-#ifdef RIPEMD128
+#ifdef LTC_RIPEMD128
register_hash (&rmd128_desc);
#endif
-#ifdef RIPEMD160
+#ifdef LTC_RIPEMD160
register_hash (&rmd160_desc);
#endif
-#ifdef WHIRLPOOL
+#ifdef LTC_WHIRLPOOL
register_hash (&whirlpool_desc);
#endif
-#ifdef CHC_HASH
+#ifdef LTC_CHC_HASH
register_hash(&chc_desc);
if ((err = chc_register(register_cipher(&aes_enc_desc))) != CRYPT_OK) {
printf("chc_register error: %s\n", error_to_string(err));
@@ -114,6 +114,6 @@ void register_algs(void)
}
-/* $Source: /cvs/libtom/libtomcrypt/demos/hashsum.c,v $ */
-/* $Revision: 1.2 $ */
-/* $Date: 2005/05/05 14:35:56 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/demos/multi.c b/libtomcrypt/demos/multi.c
index 2520de9..82d543f 100644
--- a/libtomcrypt/demos/multi.c
+++ b/libtomcrypt/demos/multi.c
@@ -33,7 +33,7 @@ int main(void)
return EXIT_FAILURE;
}
-/* HMAC */
+/* LTC_HMAC */
len = sizeof(buf[0]);
hmac_memory(find_hash("sha256"), key, 16, (unsigned char*)"hello", 5, buf[0], &len);
len2 = sizeof(buf[0]);
@@ -55,7 +55,7 @@ int main(void)
return EXIT_FAILURE;
}
-/* OMAC */
+/* LTC_OMAC */
len = sizeof(buf[0]);
omac_memory(find_cipher("aes"), key, 16, (unsigned char*)"hello", 5, buf[0], &len);
len2 = sizeof(buf[0]);
@@ -105,6 +105,6 @@ int main(void)
}
-/* $Source: /cvs/libtom/libtomcrypt/demos/multi.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/06/07 22:25:09 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/demos/small.c b/libtomcrypt/demos/small.c
index 3019745..8d43821 100644
--- a/libtomcrypt/demos/small.c
+++ b/libtomcrypt/demos/small.c
@@ -9,6 +9,6 @@ int main(void)
return 0;
}
-/* $Source: /cvs/libtom/libtomcrypt/demos/small.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/06/07 22:25:09 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/demos/test.c b/libtomcrypt/demos/test.c
index 16a2110..54de890 100644
--- a/libtomcrypt/demos/test.c
+++ b/libtomcrypt/demos/test.c
@@ -31,6 +31,6 @@ int main(void)
return EXIT_SUCCESS;
}
-/* $Source: /cvs/libtom/libtomcrypt/demos/test.c,v $ */
-/* $Revision: 1.28 $ */
-/* $Date: 2006/05/25 10:50:08 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/demos/timing.c b/libtomcrypt/demos/timing.c
index becc7c0..76fd8cd 100644
--- a/libtomcrypt/demos/timing.c
+++ b/libtomcrypt/demos/timing.c
@@ -37,6 +37,6 @@ return EXIT_SUCCESS;
}
-/* $Source: /cvs/libtom/libtomcrypt/demos/timing.c,v $ */
-/* $Revision: 1.61 $ */
-/* $Date: 2006/12/03 03:08:35 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/demos/tv_gen.c b/libtomcrypt/demos/tv_gen.c
index 97c61a8..4518ebd 100644
--- a/libtomcrypt/demos/tv_gen.c
+++ b/libtomcrypt/demos/tv_gen.c
@@ -4,93 +4,93 @@ void reg_algs(void)
{
int err;
-#ifdef RIJNDAEL
+#ifdef LTC_RIJNDAEL
register_cipher (&aes_desc);
#endif
-#ifdef BLOWFISH
+#ifdef LTC_BLOWFISH
register_cipher (&blowfish_desc);
#endif
-#ifdef XTEA
+#ifdef LTC_XTEA
register_cipher (&xtea_desc);
#endif
-#ifdef RC5
+#ifdef LTC_RC5
register_cipher (&rc5_desc);
#endif
-#ifdef RC6
+#ifdef LTC_RC6
register_cipher (&rc6_desc);
#endif
-#ifdef SAFERP
+#ifdef LTC_SAFERP
register_cipher (&saferp_desc);
#endif
-#ifdef TWOFISH
+#ifdef LTC_TWOFISH
register_cipher (&twofish_desc);
#endif
-#ifdef SAFER
+#ifdef LTC_SAFER
register_cipher (&safer_k64_desc);
register_cipher (&safer_sk64_desc);
register_cipher (&safer_k128_desc);
register_cipher (&safer_sk128_desc);
#endif
-#ifdef RC2
+#ifdef LTC_RC2
register_cipher (&rc2_desc);
#endif
-#ifdef DES
+#ifdef LTC_DES
register_cipher (&des_desc);
register_cipher (&des3_desc);
#endif
-#ifdef CAST5
+#ifdef LTC_CAST5
register_cipher (&cast5_desc);
#endif
-#ifdef NOEKEON
+#ifdef LTC_NOEKEON
register_cipher (&noekeon_desc);
#endif
-#ifdef SKIPJACK
+#ifdef LTC_SKIPJACK
register_cipher (&skipjack_desc);
#endif
-#ifdef ANUBIS
+#ifdef LTC_ANUBIS
register_cipher (&anubis_desc);
#endif
-#ifdef KHAZAD
+#ifdef LTC_KHAZAD
register_cipher (&khazad_desc);
#endif
-#ifdef TIGER
+#ifdef LTC_TIGER
register_hash (&tiger_desc);
#endif
-#ifdef MD2
+#ifdef LTC_MD2
register_hash (&md2_desc);
#endif
-#ifdef MD4
+#ifdef LTC_MD4
register_hash (&md4_desc);
#endif
-#ifdef MD5
+#ifdef LTC_MD5
register_hash (&md5_desc);
#endif
-#ifdef SHA1
+#ifdef LTC_SHA1
register_hash (&sha1_desc);
#endif
-#ifdef SHA224
+#ifdef LTC_SHA224
register_hash (&sha224_desc);
#endif
-#ifdef SHA256
+#ifdef LTC_SHA256
register_hash (&sha256_desc);
#endif
-#ifdef SHA384
+#ifdef LTC_SHA384
register_hash (&sha384_desc);
#endif
-#ifdef SHA512
+#ifdef LTC_SHA512
register_hash (&sha512_desc);
#endif
-#ifdef RIPEMD128
+#ifdef LTC_RIPEMD128
register_hash (&rmd128_desc);
#endif
-#ifdef RIPEMD160
+#ifdef LTC_RIPEMD160
register_hash (&rmd160_desc);
#endif
-#ifdef WHIRLPOOL
+#ifdef LTC_WHIRLPOOL
register_hash (&whirlpool_desc);
#endif
-#ifdef CHC_HASH
+#ifdef LTC_CHC_HASH
register_hash(&chc_desc);
if ((err = chc_register(register_cipher(&aes_desc))) != CRYPT_OK) {
printf("chc_register error: %s\n", error_to_string(err));
@@ -238,12 +238,12 @@ void hmac_gen(void)
out = fopen("hmac_tv.txt", "w");
fprintf(out,
-"HMAC Tests. In these tests messages of N bytes long (00,01,02,...,NN-1) are HMACed. The initial key is\n"
-"of the same format (the same length as the HASH output size). The HMAC key in step N+1 is the HMAC output of\n"
+"LTC_HMAC Tests. In these tests messages of N bytes long (00,01,02,...,NN-1) are LTC_HMACed. The initial key is\n"
+"of the same format (the same length as the HASH output size). The LTC_HMAC key in step N+1 is the LTC_HMAC output of\n"
"step N.\n\n");
for (x = 0; hash_descriptor[x].name != NULL; x++) {
- fprintf(out, "HMAC-%s\n", hash_descriptor[x].name);
+ fprintf(out, "LTC_HMAC-%s\n", hash_descriptor[x].name);
/* initial key */
for (y = 0; y < (int)hash_descriptor[x].hashsize; y++) {
@@ -290,8 +290,8 @@ void omac_gen(void)
out = fopen("omac_tv.txt", "w");
fprintf(out,
-"OMAC Tests. In these tests messages of N bytes long (00,01,02,...,NN-1) are OMAC'ed. The initial key is\n"
-"of the same format (length specified per cipher). The OMAC key in step N+1 is the OMAC output of\n"
+"LTC_OMAC Tests. In these tests messages of N bytes long (00,01,02,...,NN-1) are LTC_OMAC'ed. The initial key is\n"
+"of the same format (length specified per cipher). The LTC_OMAC key in step N+1 is the LTC_OMAC output of\n"
"step N (repeated as required to fill the array).\n\n");
for (x = 0; cipher_descriptor[x].name != NULL; x++) {
@@ -303,7 +303,7 @@ void omac_gen(void)
if (cipher_descriptor[x].keysize(&kl) != CRYPT_OK) {
kl = cipher_descriptor[x].max_key_length;
}
- fprintf(out, "OMAC-%s (%d byte key)\n", cipher_descriptor[x].name, kl);
+ fprintf(out, "LTC_OMAC-%s (%d byte key)\n", cipher_descriptor[x].name, kl);
/* initial key/block */
for (y = 0; y < kl; y++) {
@@ -345,8 +345,8 @@ void pmac_gen(void)
out = fopen("pmac_tv.txt", "w");
fprintf(out,
-"PMAC Tests. In these tests messages of N bytes long (00,01,02,...,NN-1) are OMAC'ed. The initial key is\n"
-"of the same format (length specified per cipher). The OMAC key in step N+1 is the OMAC output of\n"
+"PMAC Tests. In these tests messages of N bytes long (00,01,02,...,NN-1) are LTC_OMAC'ed. The initial key is\n"
+"of the same format (length specified per cipher). The LTC_OMAC key in step N+1 is the LTC_OMAC output of\n"
"step N (repeated as required to fill the array).\n\n");
for (x = 0; cipher_descriptor[x].name != NULL; x++) {
@@ -767,20 +767,20 @@ int main(void)
reg_algs();
printf("Generating hash vectors..."); fflush(stdout); hash_gen(); printf("done\n");
printf("Generating cipher vectors..."); fflush(stdout); cipher_gen(); printf("done\n");
- printf("Generating HMAC vectors..."); fflush(stdout); hmac_gen(); printf("done\n");
- printf("Generating OMAC vectors..."); fflush(stdout); omac_gen(); printf("done\n");
+ printf("Generating LTC_HMAC vectors..."); fflush(stdout); hmac_gen(); printf("done\n");
+ printf("Generating LTC_OMAC vectors..."); fflush(stdout); omac_gen(); printf("done\n");
printf("Generating PMAC vectors..."); fflush(stdout); pmac_gen(); printf("done\n");
printf("Generating EAX vectors..."); fflush(stdout); eax_gen(); printf("done\n");
printf("Generating OCB vectors..."); fflush(stdout); ocb_gen(); printf("done\n");
printf("Generating CCM vectors..."); fflush(stdout); ccm_gen(); printf("done\n");
printf("Generating GCM vectors..."); fflush(stdout); gcm_gen(); printf("done\n");
- printf("Generating BASE64 vectors..."); fflush(stdout); base64_gen(); printf("done\n");
+ printf("Generating LTC_BASE64 vectors..."); fflush(stdout); base64_gen(); printf("done\n");
printf("Generating MATH vectors..."); fflush(stdout); math_gen(); printf("done\n");
printf("Generating ECC vectors..."); fflush(stdout); ecc_gen(); printf("done\n");
printf("Generating LRW vectors..."); fflush(stdout); lrw_gen(); printf("done\n");
return 0;
}
-/* $Source: /cvs/libtom/libtomcrypt/demos/tv_gen.c,v $ */
-/* $Revision: 1.15 $ */
-/* $Date: 2006/06/09 22:10:27 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/makefile.icc b/libtomcrypt/makefile.icc
index 3fafcf1..c1ff163 100644
--- a/libtomcrypt/makefile.icc
+++ b/libtomcrypt/makefile.icc
@@ -96,27 +96,28 @@ endif
#START_INS
OBJECTS=src/ciphers/aes/aes_enc.o src/ciphers/aes/aes.o src/ciphers/anubis.o src/ciphers/blowfish.o \
src/ciphers/cast5.o src/ciphers/des.o src/ciphers/kasumi.o src/ciphers/khazad.o src/ciphers/kseed.o \
-src/ciphers/noekeon.o src/ciphers/rc2.o src/ciphers/rc5.o src/ciphers/rc6.o src/ciphers/safer/safer.o \
-src/ciphers/safer/safer_tab.o src/ciphers/safer/saferp.o src/ciphers/skipjack.o \
-src/ciphers/twofish/twofish.o src/ciphers/xtea.o src/encauth/ccm/ccm_memory.o \
+src/ciphers/multi2.o src/ciphers/noekeon.o src/ciphers/rc2.o src/ciphers/rc5.o src/ciphers/rc6.o \
+src/ciphers/safer/safer.o src/ciphers/safer/saferp.o src/ciphers/safer/safer_tab.o \
+src/ciphers/skipjack.o src/ciphers/twofish/twofish.o src/ciphers/xtea.o src/encauth/ccm/ccm_memory.o \
src/encauth/ccm/ccm_test.o src/encauth/eax/eax_addheader.o src/encauth/eax/eax_decrypt.o \
-src/encauth/eax/eax_decrypt_verify_memory.o src/encauth/eax/eax_done.o src/encauth/eax/eax_encrypt.o \
-src/encauth/eax/eax_encrypt_authenticate_memory.o src/encauth/eax/eax_init.o \
-src/encauth/eax/eax_test.o src/encauth/gcm/gcm_add_aad.o src/encauth/gcm/gcm_add_iv.o \
-src/encauth/gcm/gcm_done.o src/encauth/gcm/gcm_gf_mult.o src/encauth/gcm/gcm_init.o \
-src/encauth/gcm/gcm_memory.o src/encauth/gcm/gcm_mult_h.o src/encauth/gcm/gcm_process.o \
-src/encauth/gcm/gcm_reset.o src/encauth/gcm/gcm_test.o src/encauth/ocb/ocb_decrypt.o \
-src/encauth/ocb/ocb_decrypt_verify_memory.o src/encauth/ocb/ocb_done_decrypt.o \
-src/encauth/ocb/ocb_done_encrypt.o src/encauth/ocb/ocb_encrypt.o \
-src/encauth/ocb/ocb_encrypt_authenticate_memory.o src/encauth/ocb/ocb_init.o src/encauth/ocb/ocb_ntz.o \
-src/encauth/ocb/ocb_shift_xor.o src/encauth/ocb/ocb_test.o src/encauth/ocb/s_ocb_done.o \
-src/hashes/chc/chc.o src/hashes/helper/hash_file.o src/hashes/helper/hash_filehandle.o \
-src/hashes/helper/hash_memory.o src/hashes/helper/hash_memory_multi.o src/hashes/md2.o src/hashes/md4.o \
-src/hashes/md5.o src/hashes/rmd128.o src/hashes/rmd160.o src/hashes/rmd256.o src/hashes/rmd320.o \
-src/hashes/sha1.o src/hashes/sha2/sha256.o src/hashes/sha2/sha512.o src/hashes/tiger.o \
-src/hashes/whirl/whirl.o src/mac/f9/f9_done.o src/mac/f9/f9_file.o src/mac/f9/f9_init.o \
-src/mac/f9/f9_memory.o src/mac/f9/f9_memory_multi.o src/mac/f9/f9_process.o src/mac/f9/f9_test.o \
-src/mac/hmac/hmac_done.o src/mac/hmac/hmac_file.o src/mac/hmac/hmac_init.o src/mac/hmac/hmac_memory.o \
+src/encauth/eax/eax_decrypt_verify_memory.o src/encauth/eax/eax_done.o \
+src/encauth/eax/eax_encrypt_authenticate_memory.o src/encauth/eax/eax_encrypt.o \
+src/encauth/eax/eax_init.o src/encauth/eax/eax_test.o src/encauth/gcm/gcm_add_aad.o \
+src/encauth/gcm/gcm_add_iv.o src/encauth/gcm/gcm_done.o src/encauth/gcm/gcm_gf_mult.o \
+src/encauth/gcm/gcm_init.o src/encauth/gcm/gcm_memory.o src/encauth/gcm/gcm_mult_h.o \
+src/encauth/gcm/gcm_process.o src/encauth/gcm/gcm_reset.o src/encauth/gcm/gcm_test.o \
+src/encauth/ocb/ocb_decrypt.o src/encauth/ocb/ocb_decrypt_verify_memory.o \
+src/encauth/ocb/ocb_done_decrypt.o src/encauth/ocb/ocb_done_encrypt.o \
+src/encauth/ocb/ocb_encrypt_authenticate_memory.o src/encauth/ocb/ocb_encrypt.o \
+src/encauth/ocb/ocb_init.o src/encauth/ocb/ocb_ntz.o src/encauth/ocb/ocb_shift_xor.o \
+src/encauth/ocb/ocb_test.o src/encauth/ocb/s_ocb_done.o src/hashes/chc/chc.o \
+src/hashes/helper/hash_file.o src/hashes/helper/hash_filehandle.o src/hashes/helper/hash_memory.o \
+src/hashes/helper/hash_memory_multi.o src/hashes/md2.o src/hashes/md4.o src/hashes/md5.o \
+src/hashes/rmd128.o src/hashes/rmd160.o src/hashes/rmd256.o src/hashes/rmd320.o src/hashes/sha1.o \
+src/hashes/sha2/sha256.o src/hashes/sha2/sha512.o src/hashes/tiger.o src/hashes/whirl/whirl.o \
+src/mac/f9/f9_done.o src/mac/f9/f9_file.o src/mac/f9/f9_init.o src/mac/f9/f9_memory.o \
+src/mac/f9/f9_memory_multi.o src/mac/f9/f9_process.o src/mac/f9/f9_test.o src/mac/hmac/hmac_done.o \
+src/mac/hmac/hmac_file.o src/mac/hmac/hmac_init.o src/mac/hmac/hmac_memory.o \
src/mac/hmac/hmac_memory_multi.o src/mac/hmac/hmac_process.o src/mac/hmac/hmac_test.o \
src/mac/omac/omac_done.o src/mac/omac/omac_file.o src/mac/omac/omac_init.o src/mac/omac/omac_memory.o \
src/mac/omac/omac_memory_multi.o src/mac/omac/omac_process.o src/mac/omac/omac_test.o \
@@ -128,39 +129,41 @@ src/mac/xcbc/xcbc_file.o src/mac/xcbc/xcbc_init.o src/mac/xcbc/xcbc_memory.o \
src/mac/xcbc/xcbc_memory_multi.o src/mac/xcbc/xcbc_process.o src/mac/xcbc/xcbc_test.o \
src/math/fp/ltc_ecc_fp_mulmod.o src/math/gmp_desc.o src/math/ltm_desc.o src/math/multi.o \
src/math/rand_prime.o src/math/tfm_desc.o src/misc/base64/base64_decode.o \
-src/misc/base64/base64_encode.o src/misc/burn_stack.o src/misc/crypt/crypt.o \
-src/misc/crypt/crypt_argchk.o src/misc/crypt/crypt_cipher_descriptor.o \
-src/misc/crypt/crypt_cipher_is_valid.o src/misc/crypt/crypt_find_cipher.o \
-src/misc/crypt/crypt_find_cipher_any.o src/misc/crypt/crypt_find_cipher_id.o \
-src/misc/crypt/crypt_find_hash.o src/misc/crypt/crypt_find_hash_any.o \
-src/misc/crypt/crypt_find_hash_id.o src/misc/crypt/crypt_find_hash_oid.o \
-src/misc/crypt/crypt_find_prng.o src/misc/crypt/crypt_fsa.o src/misc/crypt/crypt_hash_descriptor.o \
-src/misc/crypt/crypt_hash_is_valid.o src/misc/crypt/crypt_ltc_mp_descriptor.o \
-src/misc/crypt/crypt_prng_descriptor.o src/misc/crypt/crypt_prng_is_valid.o \
-src/misc/crypt/crypt_register_cipher.o src/misc/crypt/crypt_register_hash.o \
-src/misc/crypt/crypt_register_prng.o src/misc/crypt/crypt_unregister_cipher.o \
-src/misc/crypt/crypt_unregister_hash.o src/misc/crypt/crypt_unregister_prng.o \
-src/misc/error_to_string.o src/misc/pkcs5/pkcs_5_1.o src/misc/pkcs5/pkcs_5_2.o src/misc/zeromem.o \
-src/modes/cbc/cbc_decrypt.o src/modes/cbc/cbc_done.o src/modes/cbc/cbc_encrypt.o \
-src/modes/cbc/cbc_getiv.o src/modes/cbc/cbc_setiv.o src/modes/cbc/cbc_start.o \
-src/modes/cfb/cfb_decrypt.o src/modes/cfb/cfb_done.o src/modes/cfb/cfb_encrypt.o \
-src/modes/cfb/cfb_getiv.o src/modes/cfb/cfb_setiv.o src/modes/cfb/cfb_start.o \
-src/modes/ctr/ctr_decrypt.o src/modes/ctr/ctr_done.o src/modes/ctr/ctr_encrypt.o \
-src/modes/ctr/ctr_getiv.o src/modes/ctr/ctr_setiv.o src/modes/ctr/ctr_start.o src/modes/ctr/ctr_test.o \
-src/modes/ecb/ecb_decrypt.o src/modes/ecb/ecb_done.o src/modes/ecb/ecb_encrypt.o \
-src/modes/ecb/ecb_start.o src/modes/f8/f8_decrypt.o src/modes/f8/f8_done.o src/modes/f8/f8_encrypt.o \
-src/modes/f8/f8_getiv.o src/modes/f8/f8_setiv.o src/modes/f8/f8_start.o src/modes/f8/f8_test_mode.o \
-src/modes/lrw/lrw_decrypt.o src/modes/lrw/lrw_done.o src/modes/lrw/lrw_encrypt.o \
-src/modes/lrw/lrw_getiv.o src/modes/lrw/lrw_process.o src/modes/lrw/lrw_setiv.o \
-src/modes/lrw/lrw_start.o src/modes/lrw/lrw_test.o src/modes/ofb/ofb_decrypt.o src/modes/ofb/ofb_done.o \
-src/modes/ofb/ofb_encrypt.o src/modes/ofb/ofb_getiv.o src/modes/ofb/ofb_setiv.o \
-src/modes/ofb/ofb_start.o src/pk/asn1/der/bit/der_decode_bit_string.o \
-src/pk/asn1/der/bit/der_encode_bit_string.o src/pk/asn1/der/bit/der_length_bit_string.o \
-src/pk/asn1/der/boolean/der_decode_boolean.o src/pk/asn1/der/boolean/der_encode_boolean.o \
-src/pk/asn1/der/boolean/der_length_boolean.o src/pk/asn1/der/choice/der_decode_choice.o \
-src/pk/asn1/der/ia5/der_decode_ia5_string.o src/pk/asn1/der/ia5/der_encode_ia5_string.o \
-src/pk/asn1/der/ia5/der_length_ia5_string.o src/pk/asn1/der/integer/der_decode_integer.o \
-src/pk/asn1/der/integer/der_encode_integer.o src/pk/asn1/der/integer/der_length_integer.o \
+src/misc/base64/base64_encode.o src/misc/burn_stack.o src/misc/crypt/crypt_argchk.o \
+src/misc/crypt/crypt.o src/misc/crypt/crypt_cipher_descriptor.o src/misc/crypt/crypt_cipher_is_valid.o \
+src/misc/crypt/crypt_find_cipher_any.o src/misc/crypt/crypt_find_cipher.o \
+src/misc/crypt/crypt_find_cipher_id.o src/misc/crypt/crypt_find_hash_any.o \
+src/misc/crypt/crypt_find_hash.o src/misc/crypt/crypt_find_hash_id.o \
+src/misc/crypt/crypt_find_hash_oid.o src/misc/crypt/crypt_find_prng.o src/misc/crypt/crypt_fsa.o \
+src/misc/crypt/crypt_hash_descriptor.o src/misc/crypt/crypt_hash_is_valid.o \
+src/misc/crypt/crypt_ltc_mp_descriptor.o src/misc/crypt/crypt_prng_descriptor.o \
+src/misc/crypt/crypt_prng_is_valid.o src/misc/crypt/crypt_register_cipher.o \
+src/misc/crypt/crypt_register_hash.o src/misc/crypt/crypt_register_prng.o \
+src/misc/crypt/crypt_unregister_cipher.o src/misc/crypt/crypt_unregister_hash.o \
+src/misc/crypt/crypt_unregister_prng.o src/misc/error_to_string.o src/misc/pkcs5/pkcs_5_1.o \
+src/misc/pkcs5/pkcs_5_2.o src/misc/zeromem.o src/modes/cbc/cbc_decrypt.o src/modes/cbc/cbc_done.o \
+src/modes/cbc/cbc_encrypt.o src/modes/cbc/cbc_getiv.o src/modes/cbc/cbc_setiv.o \
+src/modes/cbc/cbc_start.o src/modes/cfb/cfb_decrypt.o src/modes/cfb/cfb_done.o \
+src/modes/cfb/cfb_encrypt.o src/modes/cfb/cfb_getiv.o src/modes/cfb/cfb_setiv.o \
+src/modes/cfb/cfb_start.o src/modes/ctr/ctr_decrypt.o src/modes/ctr/ctr_done.o \
+src/modes/ctr/ctr_encrypt.o src/modes/ctr/ctr_getiv.o src/modes/ctr/ctr_setiv.o \
+src/modes/ctr/ctr_start.o src/modes/ctr/ctr_test.o src/modes/ecb/ecb_decrypt.o src/modes/ecb/ecb_done.o \
+src/modes/ecb/ecb_encrypt.o src/modes/ecb/ecb_start.o src/modes/f8/f8_decrypt.o src/modes/f8/f8_done.o \
+src/modes/f8/f8_encrypt.o src/modes/f8/f8_getiv.o src/modes/f8/f8_setiv.o src/modes/f8/f8_start.o \
+src/modes/f8/f8_test_mode.o src/modes/lrw/lrw_decrypt.o src/modes/lrw/lrw_done.o \
+src/modes/lrw/lrw_encrypt.o src/modes/lrw/lrw_getiv.o src/modes/lrw/lrw_process.o \
+src/modes/lrw/lrw_setiv.o src/modes/lrw/lrw_start.o src/modes/lrw/lrw_test.o \
+src/modes/ofb/ofb_decrypt.o src/modes/ofb/ofb_done.o src/modes/ofb/ofb_encrypt.o \
+src/modes/ofb/ofb_getiv.o src/modes/ofb/ofb_setiv.o src/modes/ofb/ofb_start.o \
+src/modes/xts/xts_decrypt.o src/modes/xts/xts_done.o src/modes/xts/xts_encrypt.o \
+src/modes/xts/xts_init.o src/modes/xts/xts_mult_x.o src/modes/xts/xts_test.o \
+src/pk/asn1/der/bit/der_decode_bit_string.o src/pk/asn1/der/bit/der_encode_bit_string.o \
+src/pk/asn1/der/bit/der_length_bit_string.o src/pk/asn1/der/boolean/der_decode_boolean.o \
+src/pk/asn1/der/boolean/der_encode_boolean.o src/pk/asn1/der/boolean/der_length_boolean.o \
+src/pk/asn1/der/choice/der_decode_choice.o src/pk/asn1/der/ia5/der_decode_ia5_string.o \
+src/pk/asn1/der/ia5/der_encode_ia5_string.o src/pk/asn1/der/ia5/der_length_ia5_string.o \
+src/pk/asn1/der/integer/der_decode_integer.o src/pk/asn1/der/integer/der_encode_integer.o \
+src/pk/asn1/der/integer/der_length_integer.o \
src/pk/asn1/der/object_identifier/der_decode_object_identifier.o \
src/pk/asn1/der/object_identifier/der_encode_object_identifier.o \
src/pk/asn1/der/object_identifier/der_length_object_identifier.o \
@@ -183,8 +186,8 @@ src/pk/asn1/der/utf8/der_decode_utf8_string.o src/pk/asn1/der/utf8/der_encode_ut
src/pk/asn1/der/utf8/der_length_utf8_string.o src/pk/dsa/dsa_decrypt_key.o \
src/pk/dsa/dsa_encrypt_key.o src/pk/dsa/dsa_export.o src/pk/dsa/dsa_free.o src/pk/dsa/dsa_import.o \
src/pk/dsa/dsa_make_key.o src/pk/dsa/dsa_shared_secret.o src/pk/dsa/dsa_sign_hash.o \
-src/pk/dsa/dsa_verify_hash.o src/pk/dsa/dsa_verify_key.o src/pk/ecc/ecc.o \
-src/pk/ecc/ecc_ansi_x963_export.o src/pk/ecc/ecc_ansi_x963_import.o src/pk/ecc/ecc_decrypt_key.o \
+src/pk/dsa/dsa_verify_hash.o src/pk/dsa/dsa_verify_key.o src/pk/ecc/ecc_ansi_x963_export.o \
+src/pk/ecc/ecc_ansi_x963_import.o src/pk/ecc/ecc.o src/pk/ecc/ecc_decrypt_key.o \
src/pk/ecc/ecc_encrypt_key.o src/pk/ecc/ecc_export.o src/pk/ecc/ecc_free.o src/pk/ecc/ecc_get_size.o \
src/pk/ecc/ecc_import.o src/pk/ecc/ecc_make_key.o src/pk/ecc/ecc_shared_secret.o \
src/pk/ecc/ecc_sign_hash.o src/pk/ecc/ecc_sizes.o src/pk/ecc/ecc_test.o src/pk/ecc/ecc_verify_hash.o \
@@ -287,6 +290,6 @@ install: library
install -g $(GROUP) -o $(USER) $(HEADERS) $(DESTDIR)$(INCPATH)
# $Source: /cvs/libtom/libtomcrypt/makefile.icc,v $
-# $Revision: 1.73 $
-# $Date: 2006/12/02 19:23:21 $
+# $Revision: 1.76 $
+# $Date: 2007/02/16 16:36:25 $
diff --git a/libtomcrypt/makefile.msvc b/libtomcrypt/makefile.msvc
index 2d408df..7f41ad9 100644
--- a/libtomcrypt/makefile.msvc
+++ b/libtomcrypt/makefile.msvc
@@ -6,27 +6,28 @@ CFLAGS = /Isrc/headers/ /Itestprof/ /Ox /DWIN32 /DLTC_SOURCE /W3 /Fo$@ $(CF)
#START_INS
OBJECTS=src/ciphers/aes/aes_enc.obj src/ciphers/aes/aes.obj src/ciphers/anubis.obj src/ciphers/blowfish.obj \
src/ciphers/cast5.obj src/ciphers/des.obj src/ciphers/kasumi.obj src/ciphers/khazad.obj src/ciphers/kseed.obj \
-src/ciphers/noekeon.obj src/ciphers/rc2.obj src/ciphers/rc5.obj src/ciphers/rc6.obj src/ciphers/safer/safer.obj \
-src/ciphers/safer/safer_tab.obj src/ciphers/safer/saferp.obj src/ciphers/skipjack.obj \
-src/ciphers/twofish/twofish.obj src/ciphers/xtea.obj src/encauth/ccm/ccm_memory.obj \
+src/ciphers/multi2.obj src/ciphers/noekeon.obj src/ciphers/rc2.obj src/ciphers/rc5.obj src/ciphers/rc6.obj \
+src/ciphers/safer/safer.obj src/ciphers/safer/saferp.obj src/ciphers/safer/safer_tab.obj \
+src/ciphers/skipjack.obj src/ciphers/twofish/twofish.obj src/ciphers/xtea.obj src/encauth/ccm/ccm_memory.obj \
src/encauth/ccm/ccm_test.obj src/encauth/eax/eax_addheader.obj src/encauth/eax/eax_decrypt.obj \
-src/encauth/eax/eax_decrypt_verify_memory.obj src/encauth/eax/eax_done.obj src/encauth/eax/eax_encrypt.obj \
-src/encauth/eax/eax_encrypt_authenticate_memory.obj src/encauth/eax/eax_init.obj \
-src/encauth/eax/eax_test.obj src/encauth/gcm/gcm_add_aad.obj src/encauth/gcm/gcm_add_iv.obj \
-src/encauth/gcm/gcm_done.obj src/encauth/gcm/gcm_gf_mult.obj src/encauth/gcm/gcm_init.obj \
-src/encauth/gcm/gcm_memory.obj src/encauth/gcm/gcm_mult_h.obj src/encauth/gcm/gcm_process.obj \
-src/encauth/gcm/gcm_reset.obj src/encauth/gcm/gcm_test.obj src/encauth/ocb/ocb_decrypt.obj \
-src/encauth/ocb/ocb_decrypt_verify_memory.obj src/encauth/ocb/ocb_done_decrypt.obj \
-src/encauth/ocb/ocb_done_encrypt.obj src/encauth/ocb/ocb_encrypt.obj \
-src/encauth/ocb/ocb_encrypt_authenticate_memory.obj src/encauth/ocb/ocb_init.obj src/encauth/ocb/ocb_ntz.obj \
-src/encauth/ocb/ocb_shift_xor.obj src/encauth/ocb/ocb_test.obj src/encauth/ocb/s_ocb_done.obj \
-src/hashes/chc/chc.obj src/hashes/helper/hash_file.obj src/hashes/helper/hash_filehandle.obj \
-src/hashes/helper/hash_memory.obj src/hashes/helper/hash_memory_multi.obj src/hashes/md2.obj src/hashes/md4.obj \
-src/hashes/md5.obj src/hashes/rmd128.obj src/hashes/rmd160.obj src/hashes/rmd256.obj src/hashes/rmd320.obj \
-src/hashes/sha1.obj src/hashes/sha2/sha256.obj src/hashes/sha2/sha512.obj src/hashes/tiger.obj \
-src/hashes/whirl/whirl.obj src/mac/f9/f9_done.obj src/mac/f9/f9_file.obj src/mac/f9/f9_init.obj \
-src/mac/f9/f9_memory.obj src/mac/f9/f9_memory_multi.obj src/mac/f9/f9_process.obj src/mac/f9/f9_test.obj \
-src/mac/hmac/hmac_done.obj src/mac/hmac/hmac_file.obj src/mac/hmac/hmac_init.obj src/mac/hmac/hmac_memory.obj \
+src/encauth/eax/eax_decrypt_verify_memory.obj src/encauth/eax/eax_done.obj \
+src/encauth/eax/eax_encrypt_authenticate_memory.obj src/encauth/eax/eax_encrypt.obj \
+src/encauth/eax/eax_init.obj src/encauth/eax/eax_test.obj src/encauth/gcm/gcm_add_aad.obj \
+src/encauth/gcm/gcm_add_iv.obj src/encauth/gcm/gcm_done.obj src/encauth/gcm/gcm_gf_mult.obj \
+src/encauth/gcm/gcm_init.obj src/encauth/gcm/gcm_memory.obj src/encauth/gcm/gcm_mult_h.obj \
+src/encauth/gcm/gcm_process.obj src/encauth/gcm/gcm_reset.obj src/encauth/gcm/gcm_test.obj \
+src/encauth/ocb/ocb_decrypt.obj src/encauth/ocb/ocb_decrypt_verify_memory.obj \
+src/encauth/ocb/ocb_done_decrypt.obj src/encauth/ocb/ocb_done_encrypt.obj \
+src/encauth/ocb/ocb_encrypt_authenticate_memory.obj src/encauth/ocb/ocb_encrypt.obj \
+src/encauth/ocb/ocb_init.obj src/encauth/ocb/ocb_ntz.obj src/encauth/ocb/ocb_shift_xor.obj \
+src/encauth/ocb/ocb_test.obj src/encauth/ocb/s_ocb_done.obj src/hashes/chc/chc.obj \
+src/hashes/helper/hash_file.obj src/hashes/helper/hash_filehandle.obj src/hashes/helper/hash_memory.obj \
+src/hashes/helper/hash_memory_multi.obj src/hashes/md2.obj src/hashes/md4.obj src/hashes/md5.obj \
+src/hashes/rmd128.obj src/hashes/rmd160.obj src/hashes/rmd256.obj src/hashes/rmd320.obj src/hashes/sha1.obj \
+src/hashes/sha2/sha256.obj src/hashes/sha2/sha512.obj src/hashes/tiger.obj src/hashes/whirl/whirl.obj \
+src/mac/f9/f9_done.obj src/mac/f9/f9_file.obj src/mac/f9/f9_init.obj src/mac/f9/f9_memory.obj \
+src/mac/f9/f9_memory_multi.obj src/mac/f9/f9_process.obj src/mac/f9/f9_test.obj src/mac/hmac/hmac_done.obj \
+src/mac/hmac/hmac_file.obj src/mac/hmac/hmac_init.obj src/mac/hmac/hmac_memory.obj \
src/mac/hmac/hmac_memory_multi.obj src/mac/hmac/hmac_process.obj src/mac/hmac/hmac_test.obj \
src/mac/omac/omac_done.obj src/mac/omac/omac_file.obj src/mac/omac/omac_init.obj src/mac/omac/omac_memory.obj \
src/mac/omac/omac_memory_multi.obj src/mac/omac/omac_process.obj src/mac/omac/omac_test.obj \
@@ -38,39 +39,41 @@ src/mac/xcbc/xcbc_file.obj src/mac/xcbc/xcbc_init.obj src/mac/xcbc/xcbc_memory.o
src/mac/xcbc/xcbc_memory_multi.obj src/mac/xcbc/xcbc_process.obj src/mac/xcbc/xcbc_test.obj \
src/math/fp/ltc_ecc_fp_mulmod.obj src/math/gmp_desc.obj src/math/ltm_desc.obj src/math/multi.obj \
src/math/rand_prime.obj src/math/tfm_desc.obj src/misc/base64/base64_decode.obj \
-src/misc/base64/base64_encode.obj src/misc/burn_stack.obj src/misc/crypt/crypt.obj \
-src/misc/crypt/crypt_argchk.obj src/misc/crypt/crypt_cipher_descriptor.obj \
-src/misc/crypt/crypt_cipher_is_valid.obj src/misc/crypt/crypt_find_cipher.obj \
-src/misc/crypt/crypt_find_cipher_any.obj src/misc/crypt/crypt_find_cipher_id.obj \
-src/misc/crypt/crypt_find_hash.obj src/misc/crypt/crypt_find_hash_any.obj \
-src/misc/crypt/crypt_find_hash_id.obj src/misc/crypt/crypt_find_hash_oid.obj \
-src/misc/crypt/crypt_find_prng.obj src/misc/crypt/crypt_fsa.obj src/misc/crypt/crypt_hash_descriptor.obj \
-src/misc/crypt/crypt_hash_is_valid.obj src/misc/crypt/crypt_ltc_mp_descriptor.obj \
-src/misc/crypt/crypt_prng_descriptor.obj src/misc/crypt/crypt_prng_is_valid.obj \
-src/misc/crypt/crypt_register_cipher.obj src/misc/crypt/crypt_register_hash.obj \
-src/misc/crypt/crypt_register_prng.obj src/misc/crypt/crypt_unregister_cipher.obj \
-src/misc/crypt/crypt_unregister_hash.obj src/misc/crypt/crypt_unregister_prng.obj \
-src/misc/error_to_string.obj src/misc/pkcs5/pkcs_5_1.obj src/misc/pkcs5/pkcs_5_2.obj src/misc/zeromem.obj \
-src/modes/cbc/cbc_decrypt.obj src/modes/cbc/cbc_done.obj src/modes/cbc/cbc_encrypt.obj \
-src/modes/cbc/cbc_getiv.obj src/modes/cbc/cbc_setiv.obj src/modes/cbc/cbc_start.obj \
-src/modes/cfb/cfb_decrypt.obj src/modes/cfb/cfb_done.obj src/modes/cfb/cfb_encrypt.obj \
-src/modes/cfb/cfb_getiv.obj src/modes/cfb/cfb_setiv.obj src/modes/cfb/cfb_start.obj \
-src/modes/ctr/ctr_decrypt.obj src/modes/ctr/ctr_done.obj src/modes/ctr/ctr_encrypt.obj \
-src/modes/ctr/ctr_getiv.obj src/modes/ctr/ctr_setiv.obj src/modes/ctr/ctr_start.obj src/modes/ctr/ctr_test.obj \
-src/modes/ecb/ecb_decrypt.obj src/modes/ecb/ecb_done.obj src/modes/ecb/ecb_encrypt.obj \
-src/modes/ecb/ecb_start.obj src/modes/f8/f8_decrypt.obj src/modes/f8/f8_done.obj src/modes/f8/f8_encrypt.obj \
-src/modes/f8/f8_getiv.obj src/modes/f8/f8_setiv.obj src/modes/f8/f8_start.obj src/modes/f8/f8_test_mode.obj \
-src/modes/lrw/lrw_decrypt.obj src/modes/lrw/lrw_done.obj src/modes/lrw/lrw_encrypt.obj \
-src/modes/lrw/lrw_getiv.obj src/modes/lrw/lrw_process.obj src/modes/lrw/lrw_setiv.obj \
-src/modes/lrw/lrw_start.obj src/modes/lrw/lrw_test.obj src/modes/ofb/ofb_decrypt.obj src/modes/ofb/ofb_done.obj \
-src/modes/ofb/ofb_encrypt.obj src/modes/ofb/ofb_getiv.obj src/modes/ofb/ofb_setiv.obj \
-src/modes/ofb/ofb_start.obj src/pk/asn1/der/bit/der_decode_bit_string.obj \
-src/pk/asn1/der/bit/der_encode_bit_string.obj src/pk/asn1/der/bit/der_length_bit_string.obj \
-src/pk/asn1/der/boolean/der_decode_boolean.obj src/pk/asn1/der/boolean/der_encode_boolean.obj \
-src/pk/asn1/der/boolean/der_length_boolean.obj src/pk/asn1/der/choice/der_decode_choice.obj \
-src/pk/asn1/der/ia5/der_decode_ia5_string.obj src/pk/asn1/der/ia5/der_encode_ia5_string.obj \
-src/pk/asn1/der/ia5/der_length_ia5_string.obj src/pk/asn1/der/integer/der_decode_integer.obj \
-src/pk/asn1/der/integer/der_encode_integer.obj src/pk/asn1/der/integer/der_length_integer.obj \
+src/misc/base64/base64_encode.obj src/misc/burn_stack.obj src/misc/crypt/crypt_argchk.obj \
+src/misc/crypt/crypt.obj src/misc/crypt/crypt_cipher_descriptor.obj src/misc/crypt/crypt_cipher_is_valid.obj \
+src/misc/crypt/crypt_find_cipher_any.obj src/misc/crypt/crypt_find_cipher.obj \
+src/misc/crypt/crypt_find_cipher_id.obj src/misc/crypt/crypt_find_hash_any.obj \
+src/misc/crypt/crypt_find_hash.obj src/misc/crypt/crypt_find_hash_id.obj \
+src/misc/crypt/crypt_find_hash_oid.obj src/misc/crypt/crypt_find_prng.obj src/misc/crypt/crypt_fsa.obj \
+src/misc/crypt/crypt_hash_descriptor.obj src/misc/crypt/crypt_hash_is_valid.obj \
+src/misc/crypt/crypt_ltc_mp_descriptor.obj src/misc/crypt/crypt_prng_descriptor.obj \
+src/misc/crypt/crypt_prng_is_valid.obj src/misc/crypt/crypt_register_cipher.obj \
+src/misc/crypt/crypt_register_hash.obj src/misc/crypt/crypt_register_prng.obj \
+src/misc/crypt/crypt_unregister_cipher.obj src/misc/crypt/crypt_unregister_hash.obj \
+src/misc/crypt/crypt_unregister_prng.obj src/misc/error_to_string.obj src/misc/pkcs5/pkcs_5_1.obj \
+src/misc/pkcs5/pkcs_5_2.obj src/misc/zeromem.obj src/modes/cbc/cbc_decrypt.obj src/modes/cbc/cbc_done.obj \
+src/modes/cbc/cbc_encrypt.obj src/modes/cbc/cbc_getiv.obj src/modes/cbc/cbc_setiv.obj \
+src/modes/cbc/cbc_start.obj src/modes/cfb/cfb_decrypt.obj src/modes/cfb/cfb_done.obj \
+src/modes/cfb/cfb_encrypt.obj src/modes/cfb/cfb_getiv.obj src/modes/cfb/cfb_setiv.obj \
+src/modes/cfb/cfb_start.obj src/modes/ctr/ctr_decrypt.obj src/modes/ctr/ctr_done.obj \
+src/modes/ctr/ctr_encrypt.obj src/modes/ctr/ctr_getiv.obj src/modes/ctr/ctr_setiv.obj \
+src/modes/ctr/ctr_start.obj src/modes/ctr/ctr_test.obj src/modes/ecb/ecb_decrypt.obj src/modes/ecb/ecb_done.obj \
+src/modes/ecb/ecb_encrypt.obj src/modes/ecb/ecb_start.obj src/modes/f8/f8_decrypt.obj src/modes/f8/f8_done.obj \
+src/modes/f8/f8_encrypt.obj src/modes/f8/f8_getiv.obj src/modes/f8/f8_setiv.obj src/modes/f8/f8_start.obj \
+src/modes/f8/f8_test_mode.obj src/modes/lrw/lrw_decrypt.obj src/modes/lrw/lrw_done.obj \
+src/modes/lrw/lrw_encrypt.obj src/modes/lrw/lrw_getiv.obj src/modes/lrw/lrw_process.obj \
+src/modes/lrw/lrw_setiv.obj src/modes/lrw/lrw_start.obj src/modes/lrw/lrw_test.obj \
+src/modes/ofb/ofb_decrypt.obj src/modes/ofb/ofb_done.obj src/modes/ofb/ofb_encrypt.obj \
+src/modes/ofb/ofb_getiv.obj src/modes/ofb/ofb_setiv.obj src/modes/ofb/ofb_start.obj \
+src/modes/xts/xts_decrypt.obj src/modes/xts/xts_done.obj src/modes/xts/xts_encrypt.obj \
+src/modes/xts/xts_init.obj src/modes/xts/xts_mult_x.obj src/modes/xts/xts_test.obj \
+src/pk/asn1/der/bit/der_decode_bit_string.obj src/pk/asn1/der/bit/der_encode_bit_string.obj \
+src/pk/asn1/der/bit/der_length_bit_string.obj src/pk/asn1/der/boolean/der_decode_boolean.obj \
+src/pk/asn1/der/boolean/der_encode_boolean.obj src/pk/asn1/der/boolean/der_length_boolean.obj \
+src/pk/asn1/der/choice/der_decode_choice.obj src/pk/asn1/der/ia5/der_decode_ia5_string.obj \
+src/pk/asn1/der/ia5/der_encode_ia5_string.obj src/pk/asn1/der/ia5/der_length_ia5_string.obj \
+src/pk/asn1/der/integer/der_decode_integer.obj src/pk/asn1/der/integer/der_encode_integer.obj \
+src/pk/asn1/der/integer/der_length_integer.obj \
src/pk/asn1/der/object_identifier/der_decode_object_identifier.obj \
src/pk/asn1/der/object_identifier/der_encode_object_identifier.obj \
src/pk/asn1/der/object_identifier/der_length_object_identifier.obj \
@@ -93,8 +96,8 @@ src/pk/asn1/der/utf8/der_decode_utf8_string.obj src/pk/asn1/der/utf8/der_encode_
src/pk/asn1/der/utf8/der_length_utf8_string.obj src/pk/dsa/dsa_decrypt_key.obj \
src/pk/dsa/dsa_encrypt_key.obj src/pk/dsa/dsa_export.obj src/pk/dsa/dsa_free.obj src/pk/dsa/dsa_import.obj \
src/pk/dsa/dsa_make_key.obj src/pk/dsa/dsa_shared_secret.obj src/pk/dsa/dsa_sign_hash.obj \
-src/pk/dsa/dsa_verify_hash.obj src/pk/dsa/dsa_verify_key.obj src/pk/ecc/ecc.obj \
-src/pk/ecc/ecc_ansi_x963_export.obj src/pk/ecc/ecc_ansi_x963_import.obj src/pk/ecc/ecc_decrypt_key.obj \
+src/pk/dsa/dsa_verify_hash.obj src/pk/dsa/dsa_verify_key.obj src/pk/ecc/ecc_ansi_x963_export.obj \
+src/pk/ecc/ecc_ansi_x963_import.obj src/pk/ecc/ecc.obj src/pk/ecc/ecc_decrypt_key.obj \
src/pk/ecc/ecc_encrypt_key.obj src/pk/ecc/ecc_export.obj src/pk/ecc/ecc_free.obj src/pk/ecc/ecc_get_size.obj \
src/pk/ecc/ecc_import.obj src/pk/ecc/ecc_make_key.obj src/pk/ecc/ecc_shared_secret.obj \
src/pk/ecc/ecc_sign_hash.obj src/pk/ecc/ecc_sizes.obj src/pk/ecc/ecc_test.obj src/pk/ecc/ecc_verify_hash.obj \
@@ -145,5 +148,5 @@ timing: demos/timing.c library
cl $(CFLAGS) demos/timing.c testprof/tomcrypt_prof.lib tomcrypt.lib advapi32.lib $(EXTRALIBS)
# $Source: /cvs/libtom/libtomcrypt/makefile.msvc,v $
-# $Revision: 1.51 $
-# $Date: 2006/12/02 19:23:21 $
+# $Revision: 1.54 $
+# $Date: 2007/02/16 16:36:25 $
diff --git a/libtomcrypt/makefile.shared b/libtomcrypt/makefile.shared
index a66ab1f..dd575d9 100644
--- a/libtomcrypt/makefile.shared
+++ b/libtomcrypt/makefile.shared
@@ -6,7 +6,7 @@
# Tom St Denis
# The version
-VERSION=0:116
+VERSION=0:117
# Compiler and Linker Names
CC=libtool --mode=compile --tag=CC gcc
@@ -101,27 +101,28 @@ endif
#START_INS
OBJECTS=src/ciphers/aes/aes_enc.o src/ciphers/aes/aes.o src/ciphers/anubis.o src/ciphers/blowfish.o \
src/ciphers/cast5.o src/ciphers/des.o src/ciphers/kasumi.o src/ciphers/khazad.o src/ciphers/kseed.o \
-src/ciphers/noekeon.o src/ciphers/rc2.o src/ciphers/rc5.o src/ciphers/rc6.o src/ciphers/safer/safer.o \
-src/ciphers/safer/safer_tab.o src/ciphers/safer/saferp.o src/ciphers/skipjack.o \
-src/ciphers/twofish/twofish.o src/ciphers/xtea.o src/encauth/ccm/ccm_memory.o \
+src/ciphers/multi2.o src/ciphers/noekeon.o src/ciphers/rc2.o src/ciphers/rc5.o src/ciphers/rc6.o \
+src/ciphers/safer/safer.o src/ciphers/safer/saferp.o src/ciphers/safer/safer_tab.o \
+src/ciphers/skipjack.o src/ciphers/twofish/twofish.o src/ciphers/xtea.o src/encauth/ccm/ccm_memory.o \
src/encauth/ccm/ccm_test.o src/encauth/eax/eax_addheader.o src/encauth/eax/eax_decrypt.o \
-src/encauth/eax/eax_decrypt_verify_memory.o src/encauth/eax/eax_done.o src/encauth/eax/eax_encrypt.o \
-src/encauth/eax/eax_encrypt_authenticate_memory.o src/encauth/eax/eax_init.o \
-src/encauth/eax/eax_test.o src/encauth/gcm/gcm_add_aad.o src/encauth/gcm/gcm_add_iv.o \
-src/encauth/gcm/gcm_done.o src/encauth/gcm/gcm_gf_mult.o src/encauth/gcm/gcm_init.o \
-src/encauth/gcm/gcm_memory.o src/encauth/gcm/gcm_mult_h.o src/encauth/gcm/gcm_process.o \
-src/encauth/gcm/gcm_reset.o src/encauth/gcm/gcm_test.o src/encauth/ocb/ocb_decrypt.o \
-src/encauth/ocb/ocb_decrypt_verify_memory.o src/encauth/ocb/ocb_done_decrypt.o \
-src/encauth/ocb/ocb_done_encrypt.o src/encauth/ocb/ocb_encrypt.o \
-src/encauth/ocb/ocb_encrypt_authenticate_memory.o src/encauth/ocb/ocb_init.o src/encauth/ocb/ocb_ntz.o \
-src/encauth/ocb/ocb_shift_xor.o src/encauth/ocb/ocb_test.o src/encauth/ocb/s_ocb_done.o \
-src/hashes/chc/chc.o src/hashes/helper/hash_file.o src/hashes/helper/hash_filehandle.o \
-src/hashes/helper/hash_memory.o src/hashes/helper/hash_memory_multi.o src/hashes/md2.o src/hashes/md4.o \
-src/hashes/md5.o src/hashes/rmd128.o src/hashes/rmd160.o src/hashes/rmd256.o src/hashes/rmd320.o \
-src/hashes/sha1.o src/hashes/sha2/sha256.o src/hashes/sha2/sha512.o src/hashes/tiger.o \
-src/hashes/whirl/whirl.o src/mac/f9/f9_done.o src/mac/f9/f9_file.o src/mac/f9/f9_init.o \
-src/mac/f9/f9_memory.o src/mac/f9/f9_memory_multi.o src/mac/f9/f9_process.o src/mac/f9/f9_test.o \
-src/mac/hmac/hmac_done.o src/mac/hmac/hmac_file.o src/mac/hmac/hmac_init.o src/mac/hmac/hmac_memory.o \
+src/encauth/eax/eax_decrypt_verify_memory.o src/encauth/eax/eax_done.o \
+src/encauth/eax/eax_encrypt_authenticate_memory.o src/encauth/eax/eax_encrypt.o \
+src/encauth/eax/eax_init.o src/encauth/eax/eax_test.o src/encauth/gcm/gcm_add_aad.o \
+src/encauth/gcm/gcm_add_iv.o src/encauth/gcm/gcm_done.o src/encauth/gcm/gcm_gf_mult.o \
+src/encauth/gcm/gcm_init.o src/encauth/gcm/gcm_memory.o src/encauth/gcm/gcm_mult_h.o \
+src/encauth/gcm/gcm_process.o src/encauth/gcm/gcm_reset.o src/encauth/gcm/gcm_test.o \
+src/encauth/ocb/ocb_decrypt.o src/encauth/ocb/ocb_decrypt_verify_memory.o \
+src/encauth/ocb/ocb_done_decrypt.o src/encauth/ocb/ocb_done_encrypt.o \
+src/encauth/ocb/ocb_encrypt_authenticate_memory.o src/encauth/ocb/ocb_encrypt.o \
+src/encauth/ocb/ocb_init.o src/encauth/ocb/ocb_ntz.o src/encauth/ocb/ocb_shift_xor.o \
+src/encauth/ocb/ocb_test.o src/encauth/ocb/s_ocb_done.o src/hashes/chc/chc.o \
+src/hashes/helper/hash_file.o src/hashes/helper/hash_filehandle.o src/hashes/helper/hash_memory.o \
+src/hashes/helper/hash_memory_multi.o src/hashes/md2.o src/hashes/md4.o src/hashes/md5.o \
+src/hashes/rmd128.o src/hashes/rmd160.o src/hashes/rmd256.o src/hashes/rmd320.o src/hashes/sha1.o \
+src/hashes/sha2/sha256.o src/hashes/sha2/sha512.o src/hashes/tiger.o src/hashes/whirl/whirl.o \
+src/mac/f9/f9_done.o src/mac/f9/f9_file.o src/mac/f9/f9_init.o src/mac/f9/f9_memory.o \
+src/mac/f9/f9_memory_multi.o src/mac/f9/f9_process.o src/mac/f9/f9_test.o src/mac/hmac/hmac_done.o \
+src/mac/hmac/hmac_file.o src/mac/hmac/hmac_init.o src/mac/hmac/hmac_memory.o \
src/mac/hmac/hmac_memory_multi.o src/mac/hmac/hmac_process.o src/mac/hmac/hmac_test.o \
src/mac/omac/omac_done.o src/mac/omac/omac_file.o src/mac/omac/omac_init.o src/mac/omac/omac_memory.o \
src/mac/omac/omac_memory_multi.o src/mac/omac/omac_process.o src/mac/omac/omac_test.o \
@@ -133,39 +134,41 @@ src/mac/xcbc/xcbc_file.o src/mac/xcbc/xcbc_init.o src/mac/xcbc/xcbc_memory.o \
src/mac/xcbc/xcbc_memory_multi.o src/mac/xcbc/xcbc_process.o src/mac/xcbc/xcbc_test.o \
src/math/fp/ltc_ecc_fp_mulmod.o src/math/gmp_desc.o src/math/ltm_desc.o src/math/multi.o \
src/math/rand_prime.o src/math/tfm_desc.o src/misc/base64/base64_decode.o \
-src/misc/base64/base64_encode.o src/misc/burn_stack.o src/misc/crypt/crypt.o \
-src/misc/crypt/crypt_argchk.o src/misc/crypt/crypt_cipher_descriptor.o \
-src/misc/crypt/crypt_cipher_is_valid.o src/misc/crypt/crypt_find_cipher.o \
-src/misc/crypt/crypt_find_cipher_any.o src/misc/crypt/crypt_find_cipher_id.o \
-src/misc/crypt/crypt_find_hash.o src/misc/crypt/crypt_find_hash_any.o \
-src/misc/crypt/crypt_find_hash_id.o src/misc/crypt/crypt_find_hash_oid.o \
-src/misc/crypt/crypt_find_prng.o src/misc/crypt/crypt_fsa.o src/misc/crypt/crypt_hash_descriptor.o \
-src/misc/crypt/crypt_hash_is_valid.o src/misc/crypt/crypt_ltc_mp_descriptor.o \
-src/misc/crypt/crypt_prng_descriptor.o src/misc/crypt/crypt_prng_is_valid.o \
-src/misc/crypt/crypt_register_cipher.o src/misc/crypt/crypt_register_hash.o \
-src/misc/crypt/crypt_register_prng.o src/misc/crypt/crypt_unregister_cipher.o \
-src/misc/crypt/crypt_unregister_hash.o src/misc/crypt/crypt_unregister_prng.o \
-src/misc/error_to_string.o src/misc/pkcs5/pkcs_5_1.o src/misc/pkcs5/pkcs_5_2.o src/misc/zeromem.o \
-src/modes/cbc/cbc_decrypt.o src/modes/cbc/cbc_done.o src/modes/cbc/cbc_encrypt.o \
-src/modes/cbc/cbc_getiv.o src/modes/cbc/cbc_setiv.o src/modes/cbc/cbc_start.o \
-src/modes/cfb/cfb_decrypt.o src/modes/cfb/cfb_done.o src/modes/cfb/cfb_encrypt.o \
-src/modes/cfb/cfb_getiv.o src/modes/cfb/cfb_setiv.o src/modes/cfb/cfb_start.o \
-src/modes/ctr/ctr_decrypt.o src/modes/ctr/ctr_done.o src/modes/ctr/ctr_encrypt.o \
-src/modes/ctr/ctr_getiv.o src/modes/ctr/ctr_setiv.o src/modes/ctr/ctr_start.o src/modes/ctr/ctr_test.o \
-src/modes/ecb/ecb_decrypt.o src/modes/ecb/ecb_done.o src/modes/ecb/ecb_encrypt.o \
-src/modes/ecb/ecb_start.o src/modes/f8/f8_decrypt.o src/modes/f8/f8_done.o src/modes/f8/f8_encrypt.o \
-src/modes/f8/f8_getiv.o src/modes/f8/f8_setiv.o src/modes/f8/f8_start.o src/modes/f8/f8_test_mode.o \
-src/modes/lrw/lrw_decrypt.o src/modes/lrw/lrw_done.o src/modes/lrw/lrw_encrypt.o \
-src/modes/lrw/lrw_getiv.o src/modes/lrw/lrw_process.o src/modes/lrw/lrw_setiv.o \
-src/modes/lrw/lrw_start.o src/modes/lrw/lrw_test.o src/modes/ofb/ofb_decrypt.o src/modes/ofb/ofb_done.o \
-src/modes/ofb/ofb_encrypt.o src/modes/ofb/ofb_getiv.o src/modes/ofb/ofb_setiv.o \
-src/modes/ofb/ofb_start.o src/pk/asn1/der/bit/der_decode_bit_string.o \
-src/pk/asn1/der/bit/der_encode_bit_string.o src/pk/asn1/der/bit/der_length_bit_string.o \
-src/pk/asn1/der/boolean/der_decode_boolean.o src/pk/asn1/der/boolean/der_encode_boolean.o \
-src/pk/asn1/der/boolean/der_length_boolean.o src/pk/asn1/der/choice/der_decode_choice.o \
-src/pk/asn1/der/ia5/der_decode_ia5_string.o src/pk/asn1/der/ia5/der_encode_ia5_string.o \
-src/pk/asn1/der/ia5/der_length_ia5_string.o src/pk/asn1/der/integer/der_decode_integer.o \
-src/pk/asn1/der/integer/der_encode_integer.o src/pk/asn1/der/integer/der_length_integer.o \
+src/misc/base64/base64_encode.o src/misc/burn_stack.o src/misc/crypt/crypt_argchk.o \
+src/misc/crypt/crypt.o src/misc/crypt/crypt_cipher_descriptor.o src/misc/crypt/crypt_cipher_is_valid.o \
+src/misc/crypt/crypt_find_cipher_any.o src/misc/crypt/crypt_find_cipher.o \
+src/misc/crypt/crypt_find_cipher_id.o src/misc/crypt/crypt_find_hash_any.o \
+src/misc/crypt/crypt_find_hash.o src/misc/crypt/crypt_find_hash_id.o \
+src/misc/crypt/crypt_find_hash_oid.o src/misc/crypt/crypt_find_prng.o src/misc/crypt/crypt_fsa.o \
+src/misc/crypt/crypt_hash_descriptor.o src/misc/crypt/crypt_hash_is_valid.o \
+src/misc/crypt/crypt_ltc_mp_descriptor.o src/misc/crypt/crypt_prng_descriptor.o \
+src/misc/crypt/crypt_prng_is_valid.o src/misc/crypt/crypt_register_cipher.o \
+src/misc/crypt/crypt_register_hash.o src/misc/crypt/crypt_register_prng.o \
+src/misc/crypt/crypt_unregister_cipher.o src/misc/crypt/crypt_unregister_hash.o \
+src/misc/crypt/crypt_unregister_prng.o src/misc/error_to_string.o src/misc/pkcs5/pkcs_5_1.o \
+src/misc/pkcs5/pkcs_5_2.o src/misc/zeromem.o src/modes/cbc/cbc_decrypt.o src/modes/cbc/cbc_done.o \
+src/modes/cbc/cbc_encrypt.o src/modes/cbc/cbc_getiv.o src/modes/cbc/cbc_setiv.o \
+src/modes/cbc/cbc_start.o src/modes/cfb/cfb_decrypt.o src/modes/cfb/cfb_done.o \
+src/modes/cfb/cfb_encrypt.o src/modes/cfb/cfb_getiv.o src/modes/cfb/cfb_setiv.o \
+src/modes/cfb/cfb_start.o src/modes/ctr/ctr_decrypt.o src/modes/ctr/ctr_done.o \
+src/modes/ctr/ctr_encrypt.o src/modes/ctr/ctr_getiv.o src/modes/ctr/ctr_setiv.o \
+src/modes/ctr/ctr_start.o src/modes/ctr/ctr_test.o src/modes/ecb/ecb_decrypt.o src/modes/ecb/ecb_done.o \
+src/modes/ecb/ecb_encrypt.o src/modes/ecb/ecb_start.o src/modes/f8/f8_decrypt.o src/modes/f8/f8_done.o \
+src/modes/f8/f8_encrypt.o src/modes/f8/f8_getiv.o src/modes/f8/f8_setiv.o src/modes/f8/f8_start.o \
+src/modes/f8/f8_test_mode.o src/modes/lrw/lrw_decrypt.o src/modes/lrw/lrw_done.o \
+src/modes/lrw/lrw_encrypt.o src/modes/lrw/lrw_getiv.o src/modes/lrw/lrw_process.o \
+src/modes/lrw/lrw_setiv.o src/modes/lrw/lrw_start.o src/modes/lrw/lrw_test.o \
+src/modes/ofb/ofb_decrypt.o src/modes/ofb/ofb_done.o src/modes/ofb/ofb_encrypt.o \
+src/modes/ofb/ofb_getiv.o src/modes/ofb/ofb_setiv.o src/modes/ofb/ofb_start.o \
+src/modes/xts/xts_decrypt.o src/modes/xts/xts_done.o src/modes/xts/xts_encrypt.o \
+src/modes/xts/xts_init.o src/modes/xts/xts_mult_x.o src/modes/xts/xts_test.o \
+src/pk/asn1/der/bit/der_decode_bit_string.o src/pk/asn1/der/bit/der_encode_bit_string.o \
+src/pk/asn1/der/bit/der_length_bit_string.o src/pk/asn1/der/boolean/der_decode_boolean.o \
+src/pk/asn1/der/boolean/der_encode_boolean.o src/pk/asn1/der/boolean/der_length_boolean.o \
+src/pk/asn1/der/choice/der_decode_choice.o src/pk/asn1/der/ia5/der_decode_ia5_string.o \
+src/pk/asn1/der/ia5/der_encode_ia5_string.o src/pk/asn1/der/ia5/der_length_ia5_string.o \
+src/pk/asn1/der/integer/der_decode_integer.o src/pk/asn1/der/integer/der_encode_integer.o \
+src/pk/asn1/der/integer/der_length_integer.o \
src/pk/asn1/der/object_identifier/der_decode_object_identifier.o \
src/pk/asn1/der/object_identifier/der_encode_object_identifier.o \
src/pk/asn1/der/object_identifier/der_length_object_identifier.o \
@@ -188,8 +191,8 @@ src/pk/asn1/der/utf8/der_decode_utf8_string.o src/pk/asn1/der/utf8/der_encode_ut
src/pk/asn1/der/utf8/der_length_utf8_string.o src/pk/dsa/dsa_decrypt_key.o \
src/pk/dsa/dsa_encrypt_key.o src/pk/dsa/dsa_export.o src/pk/dsa/dsa_free.o src/pk/dsa/dsa_import.o \
src/pk/dsa/dsa_make_key.o src/pk/dsa/dsa_shared_secret.o src/pk/dsa/dsa_sign_hash.o \
-src/pk/dsa/dsa_verify_hash.o src/pk/dsa/dsa_verify_key.o src/pk/ecc/ecc.o \
-src/pk/ecc/ecc_ansi_x963_export.o src/pk/ecc/ecc_ansi_x963_import.o src/pk/ecc/ecc_decrypt_key.o \
+src/pk/dsa/dsa_verify_hash.o src/pk/dsa/dsa_verify_key.o src/pk/ecc/ecc_ansi_x963_export.o \
+src/pk/ecc/ecc_ansi_x963_import.o src/pk/ecc/ecc.o src/pk/ecc/ecc_decrypt_key.o \
src/pk/ecc/ecc_encrypt_key.o src/pk/ecc/ecc_export.o src/pk/ecc/ecc_free.o src/pk/ecc/ecc_get_size.o \
src/pk/ecc/ecc_import.o src/pk/ecc/ecc_make_key.o src/pk/ecc/ecc_shared_secret.o \
src/pk/ecc/ecc_sign_hash.o src/pk/ecc/ecc_sizes.o src/pk/ecc/ecc_test.o src/pk/ecc/ecc_verify_hash.o \
@@ -275,5 +278,5 @@ timing: library testprof/$(LIBTEST) $(TIMINGS)
gcc -o $(TIMING) $(TIMINGS) -ltomcrypt_prof -ltomcrypt $(EXTRALIBS)
# $Source: /cvs/libtom/libtomcrypt/makefile.shared,v $
-# $Revision: 1.76 $
-# $Date: 2006/12/02 19:23:21 $
+# $Revision: 1.80 $
+# $Date: 2007/02/16 16:36:25 $
diff --git a/libtomcrypt/makefile.unix b/libtomcrypt/makefile.unix
index a4e0ff0..bb8f29c 100644
--- a/libtomcrypt/makefile.unix
+++ b/libtomcrypt/makefile.unix
@@ -42,27 +42,28 @@ GROUP=wheel
#START_INS
OBJECTS=src/ciphers/aes/aes_enc.o src/ciphers/aes/aes.o src/ciphers/anubis.o src/ciphers/blowfish.o \
src/ciphers/cast5.o src/ciphers/des.o src/ciphers/kasumi.o src/ciphers/khazad.o src/ciphers/kseed.o \
-src/ciphers/noekeon.o src/ciphers/rc2.o src/ciphers/rc5.o src/ciphers/rc6.o src/ciphers/safer/safer.o \
-src/ciphers/safer/safer_tab.o src/ciphers/safer/saferp.o src/ciphers/skipjack.o \
-src/ciphers/twofish/twofish.o src/ciphers/xtea.o src/encauth/ccm/ccm_memory.o \
+src/ciphers/multi2.o src/ciphers/noekeon.o src/ciphers/rc2.o src/ciphers/rc5.o src/ciphers/rc6.o \
+src/ciphers/safer/safer.o src/ciphers/safer/saferp.o src/ciphers/safer/safer_tab.o \
+src/ciphers/skipjack.o src/ciphers/twofish/twofish.o src/ciphers/xtea.o src/encauth/ccm/ccm_memory.o \
src/encauth/ccm/ccm_test.o src/encauth/eax/eax_addheader.o src/encauth/eax/eax_decrypt.o \
-src/encauth/eax/eax_decrypt_verify_memory.o src/encauth/eax/eax_done.o src/encauth/eax/eax_encrypt.o \
-src/encauth/eax/eax_encrypt_authenticate_memory.o src/encauth/eax/eax_init.o \
-src/encauth/eax/eax_test.o src/encauth/gcm/gcm_add_aad.o src/encauth/gcm/gcm_add_iv.o \
-src/encauth/gcm/gcm_done.o src/encauth/gcm/gcm_gf_mult.o src/encauth/gcm/gcm_init.o \
-src/encauth/gcm/gcm_memory.o src/encauth/gcm/gcm_mult_h.o src/encauth/gcm/gcm_process.o \
-src/encauth/gcm/gcm_reset.o src/encauth/gcm/gcm_test.o src/encauth/ocb/ocb_decrypt.o \
-src/encauth/ocb/ocb_decrypt_verify_memory.o src/encauth/ocb/ocb_done_decrypt.o \
-src/encauth/ocb/ocb_done_encrypt.o src/encauth/ocb/ocb_encrypt.o \
-src/encauth/ocb/ocb_encrypt_authenticate_memory.o src/encauth/ocb/ocb_init.o src/encauth/ocb/ocb_ntz.o \
-src/encauth/ocb/ocb_shift_xor.o src/encauth/ocb/ocb_test.o src/encauth/ocb/s_ocb_done.o \
-src/hashes/chc/chc.o src/hashes/helper/hash_file.o src/hashes/helper/hash_filehandle.o \
-src/hashes/helper/hash_memory.o src/hashes/helper/hash_memory_multi.o src/hashes/md2.o src/hashes/md4.o \
-src/hashes/md5.o src/hashes/rmd128.o src/hashes/rmd160.o src/hashes/rmd256.o src/hashes/rmd320.o \
-src/hashes/sha1.o src/hashes/sha2/sha256.o src/hashes/sha2/sha512.o src/hashes/tiger.o \
-src/hashes/whirl/whirl.o src/mac/f9/f9_done.o src/mac/f9/f9_file.o src/mac/f9/f9_init.o \
-src/mac/f9/f9_memory.o src/mac/f9/f9_memory_multi.o src/mac/f9/f9_process.o src/mac/f9/f9_test.o \
-src/mac/hmac/hmac_done.o src/mac/hmac/hmac_file.o src/mac/hmac/hmac_init.o src/mac/hmac/hmac_memory.o \
+src/encauth/eax/eax_decrypt_verify_memory.o src/encauth/eax/eax_done.o \
+src/encauth/eax/eax_encrypt_authenticate_memory.o src/encauth/eax/eax_encrypt.o \
+src/encauth/eax/eax_init.o src/encauth/eax/eax_test.o src/encauth/gcm/gcm_add_aad.o \
+src/encauth/gcm/gcm_add_iv.o src/encauth/gcm/gcm_done.o src/encauth/gcm/gcm_gf_mult.o \
+src/encauth/gcm/gcm_init.o src/encauth/gcm/gcm_memory.o src/encauth/gcm/gcm_mult_h.o \
+src/encauth/gcm/gcm_process.o src/encauth/gcm/gcm_reset.o src/encauth/gcm/gcm_test.o \
+src/encauth/ocb/ocb_decrypt.o src/encauth/ocb/ocb_decrypt_verify_memory.o \
+src/encauth/ocb/ocb_done_decrypt.o src/encauth/ocb/ocb_done_encrypt.o \
+src/encauth/ocb/ocb_encrypt_authenticate_memory.o src/encauth/ocb/ocb_encrypt.o \
+src/encauth/ocb/ocb_init.o src/encauth/ocb/ocb_ntz.o src/encauth/ocb/ocb_shift_xor.o \
+src/encauth/ocb/ocb_test.o src/encauth/ocb/s_ocb_done.o src/hashes/chc/chc.o \
+src/hashes/helper/hash_file.o src/hashes/helper/hash_filehandle.o src/hashes/helper/hash_memory.o \
+src/hashes/helper/hash_memory_multi.o src/hashes/md2.o src/hashes/md4.o src/hashes/md5.o \
+src/hashes/rmd128.o src/hashes/rmd160.o src/hashes/rmd256.o src/hashes/rmd320.o src/hashes/sha1.o \
+src/hashes/sha2/sha256.o src/hashes/sha2/sha512.o src/hashes/tiger.o src/hashes/whirl/whirl.o \
+src/mac/f9/f9_done.o src/mac/f9/f9_file.o src/mac/f9/f9_init.o src/mac/f9/f9_memory.o \
+src/mac/f9/f9_memory_multi.o src/mac/f9/f9_process.o src/mac/f9/f9_test.o src/mac/hmac/hmac_done.o \
+src/mac/hmac/hmac_file.o src/mac/hmac/hmac_init.o src/mac/hmac/hmac_memory.o \
src/mac/hmac/hmac_memory_multi.o src/mac/hmac/hmac_process.o src/mac/hmac/hmac_test.o \
src/mac/omac/omac_done.o src/mac/omac/omac_file.o src/mac/omac/omac_init.o src/mac/omac/omac_memory.o \
src/mac/omac/omac_memory_multi.o src/mac/omac/omac_process.o src/mac/omac/omac_test.o \
@@ -74,39 +75,41 @@ src/mac/xcbc/xcbc_file.o src/mac/xcbc/xcbc_init.o src/mac/xcbc/xcbc_memory.o \
src/mac/xcbc/xcbc_memory_multi.o src/mac/xcbc/xcbc_process.o src/mac/xcbc/xcbc_test.o \
src/math/fp/ltc_ecc_fp_mulmod.o src/math/gmp_desc.o src/math/ltm_desc.o src/math/multi.o \
src/math/rand_prime.o src/math/tfm_desc.o src/misc/base64/base64_decode.o \
-src/misc/base64/base64_encode.o src/misc/burn_stack.o src/misc/crypt/crypt.o \
-src/misc/crypt/crypt_argchk.o src/misc/crypt/crypt_cipher_descriptor.o \
-src/misc/crypt/crypt_cipher_is_valid.o src/misc/crypt/crypt_find_cipher.o \
-src/misc/crypt/crypt_find_cipher_any.o src/misc/crypt/crypt_find_cipher_id.o \
-src/misc/crypt/crypt_find_hash.o src/misc/crypt/crypt_find_hash_any.o \
-src/misc/crypt/crypt_find_hash_id.o src/misc/crypt/crypt_find_hash_oid.o \
-src/misc/crypt/crypt_find_prng.o src/misc/crypt/crypt_fsa.o src/misc/crypt/crypt_hash_descriptor.o \
-src/misc/crypt/crypt_hash_is_valid.o src/misc/crypt/crypt_ltc_mp_descriptor.o \
-src/misc/crypt/crypt_prng_descriptor.o src/misc/crypt/crypt_prng_is_valid.o \
-src/misc/crypt/crypt_register_cipher.o src/misc/crypt/crypt_register_hash.o \
-src/misc/crypt/crypt_register_prng.o src/misc/crypt/crypt_unregister_cipher.o \
-src/misc/crypt/crypt_unregister_hash.o src/misc/crypt/crypt_unregister_prng.o \
-src/misc/error_to_string.o src/misc/pkcs5/pkcs_5_1.o src/misc/pkcs5/pkcs_5_2.o src/misc/zeromem.o \
-src/modes/cbc/cbc_decrypt.o src/modes/cbc/cbc_done.o src/modes/cbc/cbc_encrypt.o \
-src/modes/cbc/cbc_getiv.o src/modes/cbc/cbc_setiv.o src/modes/cbc/cbc_start.o \
-src/modes/cfb/cfb_decrypt.o src/modes/cfb/cfb_done.o src/modes/cfb/cfb_encrypt.o \
-src/modes/cfb/cfb_getiv.o src/modes/cfb/cfb_setiv.o src/modes/cfb/cfb_start.o \
-src/modes/ctr/ctr_decrypt.o src/modes/ctr/ctr_done.o src/modes/ctr/ctr_encrypt.o \
-src/modes/ctr/ctr_getiv.o src/modes/ctr/ctr_setiv.o src/modes/ctr/ctr_start.o src/modes/ctr/ctr_test.o \
-src/modes/ecb/ecb_decrypt.o src/modes/ecb/ecb_done.o src/modes/ecb/ecb_encrypt.o \
-src/modes/ecb/ecb_start.o src/modes/f8/f8_decrypt.o src/modes/f8/f8_done.o src/modes/f8/f8_encrypt.o \
-src/modes/f8/f8_getiv.o src/modes/f8/f8_setiv.o src/modes/f8/f8_start.o src/modes/f8/f8_test_mode.o \
-src/modes/lrw/lrw_decrypt.o src/modes/lrw/lrw_done.o src/modes/lrw/lrw_encrypt.o \
-src/modes/lrw/lrw_getiv.o src/modes/lrw/lrw_process.o src/modes/lrw/lrw_setiv.o \
-src/modes/lrw/lrw_start.o src/modes/lrw/lrw_test.o src/modes/ofb/ofb_decrypt.o src/modes/ofb/ofb_done.o \
-src/modes/ofb/ofb_encrypt.o src/modes/ofb/ofb_getiv.o src/modes/ofb/ofb_setiv.o \
-src/modes/ofb/ofb_start.o src/pk/asn1/der/bit/der_decode_bit_string.o \
-src/pk/asn1/der/bit/der_encode_bit_string.o src/pk/asn1/der/bit/der_length_bit_string.o \
-src/pk/asn1/der/boolean/der_decode_boolean.o src/pk/asn1/der/boolean/der_encode_boolean.o \
-src/pk/asn1/der/boolean/der_length_boolean.o src/pk/asn1/der/choice/der_decode_choice.o \
-src/pk/asn1/der/ia5/der_decode_ia5_string.o src/pk/asn1/der/ia5/der_encode_ia5_string.o \
-src/pk/asn1/der/ia5/der_length_ia5_string.o src/pk/asn1/der/integer/der_decode_integer.o \
-src/pk/asn1/der/integer/der_encode_integer.o src/pk/asn1/der/integer/der_length_integer.o \
+src/misc/base64/base64_encode.o src/misc/burn_stack.o src/misc/crypt/crypt_argchk.o \
+src/misc/crypt/crypt.o src/misc/crypt/crypt_cipher_descriptor.o src/misc/crypt/crypt_cipher_is_valid.o \
+src/misc/crypt/crypt_find_cipher_any.o src/misc/crypt/crypt_find_cipher.o \
+src/misc/crypt/crypt_find_cipher_id.o src/misc/crypt/crypt_find_hash_any.o \
+src/misc/crypt/crypt_find_hash.o src/misc/crypt/crypt_find_hash_id.o \
+src/misc/crypt/crypt_find_hash_oid.o src/misc/crypt/crypt_find_prng.o src/misc/crypt/crypt_fsa.o \
+src/misc/crypt/crypt_hash_descriptor.o src/misc/crypt/crypt_hash_is_valid.o \
+src/misc/crypt/crypt_ltc_mp_descriptor.o src/misc/crypt/crypt_prng_descriptor.o \
+src/misc/crypt/crypt_prng_is_valid.o src/misc/crypt/crypt_register_cipher.o \
+src/misc/crypt/crypt_register_hash.o src/misc/crypt/crypt_register_prng.o \
+src/misc/crypt/crypt_unregister_cipher.o src/misc/crypt/crypt_unregister_hash.o \
+src/misc/crypt/crypt_unregister_prng.o src/misc/error_to_string.o src/misc/pkcs5/pkcs_5_1.o \
+src/misc/pkcs5/pkcs_5_2.o src/misc/zeromem.o src/modes/cbc/cbc_decrypt.o src/modes/cbc/cbc_done.o \
+src/modes/cbc/cbc_encrypt.o src/modes/cbc/cbc_getiv.o src/modes/cbc/cbc_setiv.o \
+src/modes/cbc/cbc_start.o src/modes/cfb/cfb_decrypt.o src/modes/cfb/cfb_done.o \
+src/modes/cfb/cfb_encrypt.o src/modes/cfb/cfb_getiv.o src/modes/cfb/cfb_setiv.o \
+src/modes/cfb/cfb_start.o src/modes/ctr/ctr_decrypt.o src/modes/ctr/ctr_done.o \
+src/modes/ctr/ctr_encrypt.o src/modes/ctr/ctr_getiv.o src/modes/ctr/ctr_setiv.o \
+src/modes/ctr/ctr_start.o src/modes/ctr/ctr_test.o src/modes/ecb/ecb_decrypt.o src/modes/ecb/ecb_done.o \
+src/modes/ecb/ecb_encrypt.o src/modes/ecb/ecb_start.o src/modes/f8/f8_decrypt.o src/modes/f8/f8_done.o \
+src/modes/f8/f8_encrypt.o src/modes/f8/f8_getiv.o src/modes/f8/f8_setiv.o src/modes/f8/f8_start.o \
+src/modes/f8/f8_test_mode.o src/modes/lrw/lrw_decrypt.o src/modes/lrw/lrw_done.o \
+src/modes/lrw/lrw_encrypt.o src/modes/lrw/lrw_getiv.o src/modes/lrw/lrw_process.o \
+src/modes/lrw/lrw_setiv.o src/modes/lrw/lrw_start.o src/modes/lrw/lrw_test.o \
+src/modes/ofb/ofb_decrypt.o src/modes/ofb/ofb_done.o src/modes/ofb/ofb_encrypt.o \
+src/modes/ofb/ofb_getiv.o src/modes/ofb/ofb_setiv.o src/modes/ofb/ofb_start.o \
+src/modes/xts/xts_decrypt.o src/modes/xts/xts_done.o src/modes/xts/xts_encrypt.o \
+src/modes/xts/xts_init.o src/modes/xts/xts_mult_x.o src/modes/xts/xts_test.o \
+src/pk/asn1/der/bit/der_decode_bit_string.o src/pk/asn1/der/bit/der_encode_bit_string.o \
+src/pk/asn1/der/bit/der_length_bit_string.o src/pk/asn1/der/boolean/der_decode_boolean.o \
+src/pk/asn1/der/boolean/der_encode_boolean.o src/pk/asn1/der/boolean/der_length_boolean.o \
+src/pk/asn1/der/choice/der_decode_choice.o src/pk/asn1/der/ia5/der_decode_ia5_string.o \
+src/pk/asn1/der/ia5/der_encode_ia5_string.o src/pk/asn1/der/ia5/der_length_ia5_string.o \
+src/pk/asn1/der/integer/der_decode_integer.o src/pk/asn1/der/integer/der_encode_integer.o \
+src/pk/asn1/der/integer/der_length_integer.o \
src/pk/asn1/der/object_identifier/der_decode_object_identifier.o \
src/pk/asn1/der/object_identifier/der_encode_object_identifier.o \
src/pk/asn1/der/object_identifier/der_length_object_identifier.o \
@@ -129,8 +132,8 @@ src/pk/asn1/der/utf8/der_decode_utf8_string.o src/pk/asn1/der/utf8/der_encode_ut
src/pk/asn1/der/utf8/der_length_utf8_string.o src/pk/dsa/dsa_decrypt_key.o \
src/pk/dsa/dsa_encrypt_key.o src/pk/dsa/dsa_export.o src/pk/dsa/dsa_free.o src/pk/dsa/dsa_import.o \
src/pk/dsa/dsa_make_key.o src/pk/dsa/dsa_shared_secret.o src/pk/dsa/dsa_sign_hash.o \
-src/pk/dsa/dsa_verify_hash.o src/pk/dsa/dsa_verify_key.o src/pk/ecc/ecc.o \
-src/pk/ecc/ecc_ansi_x963_export.o src/pk/ecc/ecc_ansi_x963_import.o src/pk/ecc/ecc_decrypt_key.o \
+src/pk/dsa/dsa_verify_hash.o src/pk/dsa/dsa_verify_key.o src/pk/ecc/ecc_ansi_x963_export.o \
+src/pk/ecc/ecc_ansi_x963_import.o src/pk/ecc/ecc.o src/pk/ecc/ecc_decrypt_key.o \
src/pk/ecc/ecc_encrypt_key.o src/pk/ecc/ecc_export.o src/pk/ecc/ecc_free.o src/pk/ecc/ecc_get_size.o \
src/pk/ecc/ecc_import.o src/pk/ecc/ecc_make_key.o src/pk/ecc/ecc_shared_secret.o \
src/pk/ecc/ecc_sign_hash.o src/pk/ecc/ecc_sizes.o src/pk/ecc/ecc_test.o src/pk/ecc/ecc_verify_hash.o \
@@ -235,5 +238,5 @@ install_test: testprof/$(LIBTEST)
install -g $(GROUP) -o $(USER) testprof/$(LIBTEST) $(DESTDIR)$(LIBPATH)
# $Source: /cvs/libtom/libtomcrypt/makefile.unix,v $
-# $Revision: 1.4 $
-# $Date: 2006/12/02 19:23:21 $
+# $Revision: 1.7 $
+# $Date: 2007/02/16 16:36:25 $
diff --git a/libtomcrypt/notes/etc/saferp_optimizer.c b/libtomcrypt/notes/etc/saferp_optimizer.c
index 32de878..b2ae718 100644
--- a/libtomcrypt/notes/etc/saferp_optimizer.c
+++ b/libtomcrypt/notes/etc/saferp_optimizer.c
@@ -1,4 +1,4 @@
-/* emits an optimized version of SAFER+ ... only does encrypt so far... */
+/* emits an optimized version of LTC_SAFER+ ... only does encrypt so far... */
#include <stdio.h>
#include <string.h>
@@ -172,6 +172,6 @@ printf(" }\n}\n\n");
}
-/* $Source: /cvs/libtom/libtomcrypt/notes/etc/saferp_optimizer.c,v $ */
-/* $Revision: 1.2 $ */
-/* $Date: 2005/05/05 14:35:58 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/notes/etc/whirlgen.c b/libtomcrypt/notes/etc/whirlgen.c
index c06687e..f64650b 100644
--- a/libtomcrypt/notes/etc/whirlgen.c
+++ b/libtomcrypt/notes/etc/whirlgen.c
@@ -90,6 +90,6 @@ int main(void)
-/* $Source: /cvs/libtom/libtomcrypt/notes/etc/whirlgen.c,v $ */
-/* $Revision: 1.2 $ */
-/* $Date: 2005/05/05 14:35:58 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/notes/etc/whirltest.c b/libtomcrypt/notes/etc/whirltest.c
index 226e012..cf2e87c 100644
--- a/libtomcrypt/notes/etc/whirltest.c
+++ b/libtomcrypt/notes/etc/whirltest.c
@@ -14,6 +14,6 @@ int main(void)
}
-/* $Source: /cvs/libtom/libtomcrypt/notes/etc/whirltest.c,v $ */
-/* $Revision: 1.2 $ */
-/* $Date: 2005/05/05 14:35:58 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/notes/tech0005.txt b/libtomcrypt/notes/tech0005.txt
index ef10a43..c250220 100644
--- a/libtomcrypt/notes/tech0005.txt
+++ b/libtomcrypt/notes/tech0005.txt
@@ -12,7 +12,7 @@ You can disable whole classes of algorithms on the command line with the LTC_NO_
The following build with GCC 3.4.4 on an AMD64 box gets you AES, CTR mode, SHA-256, HMAC, Yarrow, full RSA PKCS #1, PKCS #5 and ASN.1 DER in
roughly 40KB of code (49KB on the ARMv4) (both excluding the math library).
-CFLAGS="-DLTC_NO_CIPHERS -DLTC_NO_HASHES -DLTC_NO_PRNGS -DLTC_NO_MACS -DLTC_NO_MODES -DLTC_NO_PK -DRIJNDAEL -DLTC_CTR_MODE -DSHA256 \
+CFLAGS="-DLTC_NO_CIPHERS -DLTC_NO_HASHES -DLTC_NO_PRNGS -DLTC_NO_MACS -DLTC_NO_MODES -DLTC_NO_PK -DLTC_RIJNDAEL -DLTC_CTR_MODE -DSHA256 \
-DLTC_HMAC -DYARROW -DMRSA -DMPI -DTFM_DESC -DARGTYPE=3 -Os -DLTC_SMALL_CODE -fomit-frame-pointer" make IGNORE_SPEED=1
Obviously this won't get you performance but if you need to pack a crypto lib in a device with limited means it's more than enough...
diff --git a/libtomcrypt/src/ciphers/aes/aes.c b/libtomcrypt/src/ciphers/aes/aes.c
index 55f6333..3481fe2 100644
--- a/libtomcrypt/src/ciphers/aes/aes.c
+++ b/libtomcrypt/src/ciphers/aes/aes.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/* AES implementation by Tom St Denis
@@ -32,7 +32,7 @@
#include "tomcrypt.h"
-#ifdef RIJNDAEL
+#ifdef LTC_RIJNDAEL
#ifndef ENCRYPT_ONLY
@@ -765,6 +765,6 @@ int ECB_KS(int *keysize)
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/ciphers/aes/aes.c,v $ */
-/* $Revision: 1.14 $ */
-/* $Date: 2006/11/08 23:01:06 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/ciphers/aes/aes_tab.c b/libtomcrypt/src/ciphers/aes/aes_tab.c
index 0ef9731..ca7008d 100644
--- a/libtomcrypt/src/ciphers/aes/aes_tab.c
+++ b/libtomcrypt/src/ciphers/aes/aes_tab.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/* The precomputed tables for AES */
/*
@@ -1023,6 +1023,6 @@ static const ulong32 rcon[] = {
0x1B000000UL, 0x36000000UL, /* for 128-bit blocks, Rijndael never uses more than 10 rcon values */
};
-/* $Source: /cvs/libtom/libtomcrypt/src/ciphers/aes/aes_tab.c,v $ */
-/* $Revision: 1.5 $ */
-/* $Date: 2006/04/02 13:19:09 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/ciphers/anubis.c b/libtomcrypt/src/ciphers/anubis.c
index 9a0722c..229d5e8 100644
--- a/libtomcrypt/src/ciphers/anubis.c
+++ b/libtomcrypt/src/ciphers/anubis.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/**
@@ -17,7 +17,7 @@
#include "tomcrypt.h"
-#ifdef ANUBIS
+#ifdef LTC_ANUBIS
const struct ltc_cipher_descriptor anubis_desc = {
"anubis",
@@ -48,7 +48,7 @@ const struct ltc_cipher_descriptor anubis_desc = {
* (but little-endian notation would be equally suitable if consistently
* employed).
*/
-#if defined(ANUBIS_TWEAK)
+#if defined(LTC_ANUBIS_TWEAK)
static const ulong32 T0[256] = {
0xba69d2bbU, 0x54a84de5U, 0x2f5ebce2U, 0x74e8cd25U,
@@ -1174,8 +1174,8 @@ int anubis_test(void)
int keylen;
unsigned char pt[16], ct[16], key[40];
} tests[] = {
-#ifndef ANUBIS_TWEAK
- /**** ORIGINAL ANUBIS ****/
+#ifndef LTC_ANUBIS_TWEAK
+ /**** ORIGINAL LTC_ANUBIS ****/
/* 128 bit keys */
{
16,
@@ -1333,7 +1333,7 @@ int anubis_test(void)
0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x01 }
}
#else
- /**** Tweaked ANUBIS ****/
+ /**** Tweaked LTC_ANUBIS ****/
/* 128 bit keys */
{
16,
@@ -1553,6 +1553,6 @@ int anubis_keysize(int *keysize)
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/ciphers/anubis.c,v $ */
-/* $Revision: 1.15 $ */
-/* $Date: 2006/11/15 12:41:28 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/ciphers/blowfish.c b/libtomcrypt/src/ciphers/blowfish.c
index ae8945f..6a55abc 100644
--- a/libtomcrypt/src/ciphers/blowfish.c
+++ b/libtomcrypt/src/ciphers/blowfish.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/**
@file blowfish.c
@@ -14,7 +14,7 @@
*/
#include "tomcrypt.h"
-#ifdef BLOWFISH
+#ifdef LTC_BLOWFISH
const struct ltc_cipher_descriptor blowfish_desc =
{
@@ -589,6 +589,6 @@ int blowfish_keysize(int *keysize)
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/ciphers/blowfish.c,v $ */
-/* $Revision: 1.12 $ */
-/* $Date: 2006/11/08 23:01:06 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/ciphers/cast5.c b/libtomcrypt/src/ciphers/cast5.c
index eba39da..ffc2f28 100644
--- a/libtomcrypt/src/ciphers/cast5.c
+++ b/libtomcrypt/src/ciphers/cast5.c
@@ -6,16 +6,16 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/**
@file cast5.c
- Implementation of CAST5 (RFC 2144) by Tom St Denis
+ Implementation of LTC_CAST5 (RFC 2144) by Tom St Denis
*/
#include "tomcrypt.h"
-#ifdef CAST5
+#ifdef LTC_CAST5
const struct ltc_cipher_descriptor cast5_desc = {
"cast5",
@@ -398,7 +398,7 @@ static const ulong32 S8[256] = {
#endif
/**
- Initialize the CAST5 block cipher
+ Initialize the LTC_CAST5 block cipher
@param key The symmetric key you wish to pass
@param keylen The key length in bytes
@param num_rounds The number of rounds desired (0 for default)
@@ -530,7 +530,7 @@ INLINE static ulong32 FIII(ulong32 R, ulong32 Km, ulong32 Kr)
}
/**
- Encrypts a block of text with CAST5
+ Encrypts a block of text with LTC_CAST5
@param pt The input plaintext (8 bytes)
@param ct The output ciphertext (8 bytes)
@param skey The key as scheduled
@@ -583,7 +583,7 @@ int cast5_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key
#endif
/**
- Decrypts a block of text with CAST5
+ Decrypts a block of text with LTC_CAST5
@param ct The input ciphertext (8 bytes)
@param pt The output plaintext (8 bytes)
@param skey The key as scheduled
@@ -636,7 +636,7 @@ int cast5_ecb_decrypt(const unsigned char *ct, unsigned char *pt, symmetric_key
#endif
/**
- Performs a self-test of the CAST5 block cipher
+ Performs a self-test of the LTC_CAST5 block cipher
@return CRYPT_OK if functional, CRYPT_NOP if self-test has been disabled
*/
int cast5_test(void)
@@ -715,6 +715,6 @@ int cast5_keysize(int *keysize)
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/ciphers/cast5.c,v $ */
-/* $Revision: 1.12 $ */
-/* $Date: 2006/11/08 23:01:06 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/ciphers/des.c b/libtomcrypt/src/ciphers/des.c
index 6005e84..338dcc2 100644
--- a/libtomcrypt/src/ciphers/des.c
+++ b/libtomcrypt/src/ciphers/des.c
@@ -6,16 +6,16 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
/**
@file des.c
- DES code submitted by Dobes Vandermeer
+ LTC_DES code submitted by Dobes Vandermeer
*/
-#ifdef DES
+#ifdef LTC_DES
#define EN0 0
#define DE1 1
@@ -1522,7 +1522,7 @@ static void desfunc(ulong32 *block, const ulong32 *keys)
#if 0
/**
- Initialize the DES block cipher
+ Initialize the LTC_DES block cipher
@param key The symmetric key you wish to pass
@param keylen The key length in bytes
@param num_rounds The number of rounds desired (0 for default)
@@ -1550,7 +1550,7 @@ int des_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_ke
#endif
/**
- Initialize the 3DES-EDE block cipher
+ Initialize the 3LTC_DES-EDE block cipher
@param key The symmetric key you wish to pass
@param keylen The key length in bytes
@param num_rounds The number of rounds desired (0 for default)
@@ -1583,7 +1583,7 @@ int des3_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_k
#if 0
/**
- Encrypts a block of text with DES
+ Encrypts a block of text with LTC_DES
@param pt The input plaintext (8 bytes)
@param ct The output ciphertext (8 bytes)
@param skey The key as scheduled
@@ -1604,7 +1604,7 @@ int des_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key *s
}
/**
- Decrypts a block of text with DES
+ Decrypts a block of text with LTC_DES
@param ct The input ciphertext (8 bytes)
@param pt The output plaintext (8 bytes)
@param skey The key as scheduled
@@ -1626,7 +1626,7 @@ int des_ecb_decrypt(const unsigned char *ct, unsigned char *pt, symmetric_key *s
#endif
/**
- Encrypts a block of text with 3DES-EDE
+ Encrypts a block of text with 3LTC_DES-EDE
@param pt The input plaintext (8 bytes)
@param ct The output ciphertext (8 bytes)
@param skey The key as scheduled
@@ -1650,7 +1650,7 @@ int des3_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key *
}
/**
- Decrypts a block of text with 3DES-EDE
+ Decrypts a block of text with 3LTC_DES-EDE
@param ct The input ciphertext (8 bytes)
@param pt The output plaintext (8 bytes)
@param skey The key as scheduled
@@ -1674,7 +1674,7 @@ int des3_ecb_decrypt(const unsigned char *ct, unsigned char *pt, symmetric_key *
#if 0
/**
- Performs a self-test of the DES block cipher
+ Performs a self-test of the LTC_DES block cipher
@return CRYPT_OK if functional, CRYPT_NOP if self-test has been disabled
*/
int des_test(void)
@@ -1910,6 +1910,6 @@ int des3_keysize(int *keysize)
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/ciphers/des.c,v $ */
-/* $Revision: 1.13 $ */
-/* $Date: 2006/11/08 23:01:06 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/ciphers/kasumi.c b/libtomcrypt/src/ciphers/kasumi.c
index 4a075b1..3b765d0 100644
--- a/libtomcrypt/src/ciphers/kasumi.c
+++ b/libtomcrypt/src/ciphers/kasumi.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/**
@@ -313,6 +313,6 @@ int kasumi_test(void)
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/ciphers/kasumi.c,v $ */
-/* $Revision: 1.7 $ */
-/* $Date: 2006/11/09 03:05:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/ciphers/khazad.c b/libtomcrypt/src/ciphers/khazad.c
index 8490950..a3c67d5 100644
--- a/libtomcrypt/src/ciphers/khazad.c
+++ b/libtomcrypt/src/ciphers/khazad.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -16,7 +16,7 @@
Authors: Paulo S.L.M. Barreto and Vincent Rijmen.
*/
-#ifdef KHAZAD
+#ifdef LTC_KHAZAD
const struct ltc_cipher_descriptor khazad_desc = {
"khazad",
@@ -850,6 +850,6 @@ int khazad_keysize(int *keysize)
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/ciphers/khazad.c,v $ */
-/* $Revision: 1.12 $ */
-/* $Date: 2006/11/08 23:01:06 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/ciphers/kseed.c b/libtomcrypt/src/ciphers/kseed.c
index 4281ac5..a163c95 100644
--- a/libtomcrypt/src/ciphers/kseed.c
+++ b/libtomcrypt/src/ciphers/kseed.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/**
@@ -17,7 +17,7 @@
#include "tomcrypt.h"
-#ifdef KSEED
+#ifdef LTC_KSEED
const struct ltc_cipher_descriptor kseed_desc = {
"seed",
@@ -371,6 +371,6 @@ int kseed_keysize(int *keysize)
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/ciphers/kseed.c,v $ */
-/* $Revision: 1.8 $ */
-/* $Date: 2006/11/08 23:01:06 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/ciphers/multi2.c b/libtomcrypt/src/ciphers/multi2.c
new file mode 100644
index 0000000..db0b3ba
--- /dev/null
+++ b/libtomcrypt/src/ciphers/multi2.c
@@ -0,0 +1,303 @@
+/* LibTomCrypt, modular cryptographic library -- Tom St Denis
+ *
+ * LibTomCrypt is a library that provides various cryptographic
+ * algorithms in a highly modular and flexible manner.
+ *
+ * The library is free for all purposes without any express
+ * guarantee it works.
+ *
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
+ */
+
+/**
+ @file multi2.c
+ Multi-2 implementation (not public domain, hence the default disable)
+*/
+#include "tomcrypt.h"
+
+#ifdef LTC_MULTI2
+
+static void pi1(ulong32 *p)
+{
+ p[1] ^= p[0];
+}
+
+static void pi2(ulong32 *p, ulong32 *k)
+{
+ ulong32 t;
+ t = (p[1] + k[0]) & 0xFFFFFFFFUL;
+ t = (ROL(t, 1) + t - 1) & 0xFFFFFFFFUL;
+ t = (ROL(t, 4) ^ t) & 0xFFFFFFFFUL;
+ p[0] ^= t;
+}
+
+static void pi3(ulong32 *p, ulong32 *k)
+{
+ ulong32 t;
+ t = p[0] + k[1];
+ t = (ROL(t, 2) + t + 1) & 0xFFFFFFFFUL;
+ t = (ROL(t, 8) ^ t) & 0xFFFFFFFFUL;
+ t = (t + k[2]) & 0xFFFFFFFFUL;
+ t = (ROL(t, 1) - t) & 0xFFFFFFFFUL;
+ t = ROL(t, 16) ^ (p[0] | t);
+ p[1] ^= t;
+}
+
+static void pi4(ulong32 *p, ulong32 *k)
+{
+ ulong32 t;
+ t = (p[1] + k[3]) & 0xFFFFFFFFUL;
+ t = (ROL(t, 2) + t + 1) & 0xFFFFFFFFUL;
+ p[0] ^= t;
+}
+
+static void setup(ulong32 *dk, ulong32 *k, ulong32 *uk)
+{
+ int n, t;
+ ulong32 p[2];
+
+ p[0] = dk[0]; p[1] = dk[1];
+
+ t = 4;
+ n = 0;
+ pi1(p);
+ pi2(p, k);
+ uk[n++] = p[0];
+ pi3(p, k);
+ uk[n++] = p[1];
+ pi4(p, k);
+ uk[n++] = p[0];
+ pi1(p);
+ uk[n++] = p[1];
+ pi2(p, k+t);
+ uk[n++] = p[0];
+ pi3(p, k+t);
+ uk[n++] = p[1];
+ pi4(p, k+t);
+ uk[n++] = p[0];
+ pi1(p);
+ uk[n++] = p[1];
+}
+
+static void encrypt(ulong32 *p, int N, ulong32 *uk)
+{
+ int n, t;
+ for (t = n = 0; ; ) {
+ pi1(p); if (++n == N) break;
+ pi2(p, uk+t); if (++n == N) break;
+ pi3(p, uk+t); if (++n == N) break;
+ pi4(p, uk+t); if (++n == N) break;
+ t ^= 4;
+ }
+}
+
+static void decrypt(ulong32 *p, int N, ulong32 *uk)
+{
+ int n, t;
+ for (t = 4*((N&1)^1), n = N; ; ) {
+ switch (n >= 4 ? 4 : 0) {
+ case 4: pi4(p, uk+t); --n;
+ case 3: pi3(p, uk+t); --n;
+ case 2: pi2(p, uk+t); --n;
+ case 1: pi1(p); --n; break;
+ case 0: return;
+ }
+ t ^= 4;
+ }
+}
+
+const struct ltc_cipher_descriptor multi2_desc = {
+ "multi2",
+ 22,
+ 40, 40, 8, 128,
+ &multi2_setup,
+ &multi2_ecb_encrypt,
+ &multi2_ecb_decrypt,
+ &multi2_test,
+ &multi2_done,
+ &multi2_keysize,
+ NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL, NULL
+};
+
+int multi2_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey)
+{
+ ulong32 sk[8], dk[2];
+ int x;
+
+ LTC_ARGCHK(key != NULL);
+ LTC_ARGCHK(skey != NULL);
+
+ if (keylen != 40) return CRYPT_INVALID_KEYSIZE;
+ if (num_rounds == 0) num_rounds = 128;
+
+ skey->multi2.N = num_rounds;
+ for (x = 0; x < 8; x++) {
+ LOAD32H(sk[x], key + x*4);
+ }
+ LOAD32H(dk[0], key + 32);
+ LOAD32H(dk[1], key + 36);
+ setup(dk, sk, skey->multi2.uk);
+
+ zeromem(sk, sizeof(sk));
+ zeromem(dk, sizeof(dk));
+ return CRYPT_OK;
+}
+
+/**
+ Encrypts a block of text with multi2
+ @param pt The input plaintext (8 bytes)
+ @param ct The output ciphertext (8 bytes)
+ @param skey The key as scheduled
+ @return CRYPT_OK if successful
+*/
+int multi2_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key *skey)
+{
+ ulong32 p[2];
+ LTC_ARGCHK(pt != NULL);
+ LTC_ARGCHK(ct != NULL);
+ LTC_ARGCHK(skey != NULL);
+ LOAD32H(p[0], pt);
+ LOAD32H(p[1], pt+4);
+ encrypt(p, skey->multi2.N, skey->multi2.uk);
+ STORE32H(p[0], ct);
+ STORE32H(p[1], ct+4);
+ return CRYPT_OK;
+}
+
+/**
+ Decrypts a block of text with multi2
+ @param ct The input ciphertext (8 bytes)
+ @param pt The output plaintext (8 bytes)
+ @param skey The key as scheduled
+ @return CRYPT_OK if successful
+*/
+int multi2_ecb_decrypt(const unsigned char *ct, unsigned char *pt, symmetric_key *skey)
+{
+ ulong32 p[2];
+ LTC_ARGCHK(pt != NULL);
+ LTC_ARGCHK(ct != NULL);
+ LTC_ARGCHK(skey != NULL);
+ LOAD32H(p[0], ct);
+ LOAD32H(p[1], ct+4);
+ decrypt(p, skey->multi2.N, skey->multi2.uk);
+ STORE32H(p[0], pt);
+ STORE32H(p[1], pt+4);
+ return CRYPT_OK;
+}
+
+/**
+ Performs a self-test of the multi2 block cipher
+ @return CRYPT_OK if functional, CRYPT_NOP if self-test has been disabled
+*/
+int multi2_test(void)
+{
+ static const struct {
+ unsigned char key[40];
+ unsigned char pt[8], ct[8];
+ int rounds;
+ } tests[] = {
+{
+ {
+ 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00,
+
+ 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00,
+
+ 0x01, 0x23, 0x45, 0x67,
+ 0x89, 0xAB, 0xCD, 0xEF
+ },
+ {
+ 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x01,
+ },
+ {
+ 0xf8, 0x94, 0x40, 0x84,
+ 0x5e, 0x11, 0xcf, 0x89
+ },
+ 128,
+},
+{
+ {
+ 0x35, 0x91, 0x9d, 0x96,
+ 0x07, 0x02, 0xe2, 0xce,
+ 0x8d, 0x0b, 0x58, 0x3c,
+ 0xc9, 0xc8, 0x9d, 0x59,
+ 0xa2, 0xae, 0x96, 0x4e,
+ 0x87, 0x82, 0x45, 0xed,
+ 0x3f, 0x2e, 0x62, 0xd6,
+ 0x36, 0x35, 0xd0, 0x67,
+
+ 0xb1, 0x27, 0xb9, 0x06,
+ 0xe7, 0x56, 0x22, 0x38,
+ },
+ {
+ 0x1f, 0xb4, 0x60, 0x60,
+ 0xd0, 0xb3, 0x4f, 0xa5
+ },
+ {
+ 0xca, 0x84, 0xa9, 0x34,
+ 0x75, 0xc8, 0x60, 0xe5
+ },
+ 216,
+}
+};
+ unsigned char buf[8];
+ symmetric_key skey;
+ int err, x;
+
+ for (x = 1; x < (int)(sizeof(tests)/sizeof(tests[0])); x++) {
+ if ((err = multi2_setup(tests[x].key, 40, tests[x].rounds, &skey)) != CRYPT_OK) {
+ return err;
+ }
+ if ((err = multi2_ecb_encrypt(tests[x].pt, buf, &skey)) != CRYPT_OK) {
+ return err;
+ }
+
+ if (XMEMCMP(buf, tests[x].ct, 8)) {
+ return CRYPT_FAIL_TESTVECTOR;
+ }
+
+ if ((err = multi2_ecb_decrypt(buf, buf, &skey)) != CRYPT_OK) {
+ return err;
+ }
+ if (XMEMCMP(buf, tests[x].pt, 8)) {
+ return CRYPT_FAIL_TESTVECTOR;
+ }
+ }
+
+ return CRYPT_OK;
+}
+
+/** Terminate the context
+ @param skey The scheduled key
+*/
+void multi2_done(symmetric_key *skey)
+{
+}
+
+/**
+ Gets suitable key size
+ @param keysize [in/out] The length of the recommended key (in bytes). This function will store the suitable size back in this variable.
+ @return CRYPT_OK if the input key size is acceptable.
+*/
+int multi2_keysize(int *keysize)
+{
+ LTC_ARGCHK(keysize != NULL);
+ if (*keysize >= 40) {
+ *keysize = 40;
+ } else {
+ return CRYPT_INVALID_KEYSIZE;
+ }
+ return CRYPT_OK;
+}
+
+#endif
+
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/ciphers/noekeon.c b/libtomcrypt/src/ciphers/noekeon.c
index f467ff2..bdbcb2a 100644
--- a/libtomcrypt/src/ciphers/noekeon.c
+++ b/libtomcrypt/src/ciphers/noekeon.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/**
@file noekeon.c
@@ -14,7 +14,7 @@
*/
#include "tomcrypt.h"
-#ifdef NOEKEON
+#ifdef LTC_NOEKEON
const struct ltc_cipher_descriptor noekeon_desc =
{
@@ -298,6 +298,6 @@ int noekeon_keysize(int *keysize)
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/ciphers/noekeon.c,v $ */
-/* $Revision: 1.12 $ */
-/* $Date: 2006/11/08 23:01:06 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/ciphers/rc2.c b/libtomcrypt/src/ciphers/rc2.c
index de62cda..256f074 100644
--- a/libtomcrypt/src/ciphers/rc2.c
+++ b/libtomcrypt/src/ciphers/rc2.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/**********************************************************************\
* To commemorate the 1996 RSA Data Security Conference, the following *
@@ -22,10 +22,10 @@
/**
@file rc2.c
- Implementation of RC2
+ Implementation of LTC_RC2
*/
-#ifdef RC2
+#ifdef LTC_RC2
const struct ltc_cipher_descriptor rc2_desc = {
"rc2",
@@ -60,7 +60,7 @@ static const unsigned char permute[256] = {
};
/**
- Initialize the RC2 block cipher
+ Initialize the LTC_RC2 block cipher
@param key The symmetric key you wish to pass
@param keylen The key length in bytes
@param num_rounds The number of rounds desired (0 for default)
@@ -121,7 +121,7 @@ int rc2_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_ke
* Encrypt an 8-byte block of plaintext using the given key. *
\**********************************************************************/
/**
- Encrypts a block of text with RC2
+ Encrypts a block of text with LTC_RC2
@param pt The input plaintext (8 bytes)
@param ct The output ciphertext (8 bytes)
@param skey The key as scheduled
@@ -199,7 +199,7 @@ int rc2_ecb_encrypt( const unsigned char *pt,
* Decrypt an 8-byte block of ciphertext using the given key. *
\**********************************************************************/
/**
- Decrypts a block of text with RC2
+ Decrypts a block of text with LTC_RC2
@param ct The input ciphertext (8 bytes)
@param pt The output plaintext (8 bytes)
@param skey The key as scheduled
@@ -275,7 +275,7 @@ int rc2_ecb_decrypt( const unsigned char *ct,
#endif
/**
- Performs a self-test of the RC2 block cipher
+ Performs a self-test of the LTC_RC2 block cipher
@return CRYPT_OK if functional, CRYPT_NOP if self-test has been disabled
*/
int rc2_test(void)
@@ -357,6 +357,6 @@ int rc2_keysize(int *keysize)
-/* $Source: /cvs/libtom/libtomcrypt/src/ciphers/rc2.c,v $ */
-/* $Revision: 1.12 $ */
-/* $Date: 2006/11/08 23:01:06 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/ciphers/rc5.c b/libtomcrypt/src/ciphers/rc5.c
index 2d5fdb8..ac56451 100644
--- a/libtomcrypt/src/ciphers/rc5.c
+++ b/libtomcrypt/src/ciphers/rc5.c
@@ -6,17 +6,17 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/**
@file rc5.c
- RC5 code by Tom St Denis
+ LTC_RC5 code by Tom St Denis
*/
#include "tomcrypt.h"
-#ifdef RC5
+#ifdef LTC_RC5
const struct ltc_cipher_descriptor rc5_desc =
{
@@ -43,7 +43,7 @@ static const ulong32 stab[50] = {
};
/**
- Initialize the RC5 block cipher
+ Initialize the LTC_RC5 block cipher
@param key The symmetric key you wish to pass
@param keylen The key length in bytes
@param num_rounds The number of rounds desired (0 for default)
@@ -119,7 +119,7 @@ int rc5_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_ke
#endif
/**
- Encrypts a block of text with RC5
+ Encrypts a block of text with LTC_RC5
@param pt The input plaintext (8 bytes)
@param ct The output ciphertext (8 bytes)
@param skey The key as scheduled
@@ -174,7 +174,7 @@ int rc5_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key *s
#endif
/**
- Decrypts a block of text with RC5
+ Decrypts a block of text with LTC_RC5
@param ct The input ciphertext (8 bytes)
@param pt The output plaintext (8 bytes)
@param skey The key as scheduled
@@ -230,7 +230,7 @@ int rc5_ecb_decrypt(const unsigned char *ct, unsigned char *pt, symmetric_key *s
#endif
/**
- Performs a self-test of the RC5 block cipher
+ Performs a self-test of the LTC_RC5 block cipher
@return CRYPT_OK if functional, CRYPT_NOP if self-test has been disabled
*/
int rc5_test(void)
@@ -317,6 +317,6 @@ int rc5_keysize(int *keysize)
-/* $Source: /cvs/libtom/libtomcrypt/src/ciphers/rc5.c,v $ */
-/* $Revision: 1.12 $ */
-/* $Date: 2006/11/08 23:01:06 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/ciphers/rc6.c b/libtomcrypt/src/ciphers/rc6.c
index 8afa033..88639b8 100644
--- a/libtomcrypt/src/ciphers/rc6.c
+++ b/libtomcrypt/src/ciphers/rc6.c
@@ -6,16 +6,16 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/**
@file rc6.c
- RC6 code by Tom St Denis
+ LTC_RC6 code by Tom St Denis
*/
#include "tomcrypt.h"
-#ifdef RC6
+#ifdef LTC_RC6
const struct ltc_cipher_descriptor rc6_desc =
{
@@ -40,7 +40,7 @@ static const ulong32 stab[44] = {
0x708c564bUL, 0x0ec3d004UL, 0xacfb49bdUL, 0x4b32c376UL };
/**
- Initialize the RC6 block cipher
+ Initialize the LTC_RC6 block cipher
@param key The symmetric key you wish to pass
@param keylen The key length in bytes
@param num_rounds The number of rounds desired (0 for default)
@@ -114,7 +114,7 @@ int rc6_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_ke
#endif
/**
- Encrypts a block of text with RC6
+ Encrypts a block of text with LTC_RC6
@param pt The input plaintext (16 bytes)
@param ct The output ciphertext (16 bytes)
@param skey The key as scheduled
@@ -168,7 +168,7 @@ int rc6_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key *s
#endif
/**
- Decrypts a block of text with RC6
+ Decrypts a block of text with LTC_RC6
@param ct The input ciphertext (16 bytes)
@param pt The output plaintext (16 bytes)
@param skey The key as scheduled
@@ -224,7 +224,7 @@ int rc6_ecb_decrypt(const unsigned char *ct, unsigned char *pt, symmetric_key *s
#endif
/**
- Performs a self-test of the RC6 block cipher
+ Performs a self-test of the LTC_RC6 block cipher
@return CRYPT_OK if functional, CRYPT_NOP if self-test has been disabled
*/
int rc6_test(void)
@@ -339,10 +339,10 @@ int rc6_keysize(int *keysize)
return CRYPT_OK;
}
-#endif /*RC6*/
+#endif /*LTC_RC6*/
-/* $Source: /cvs/libtom/libtomcrypt/src/ciphers/rc6.c,v $ */
-/* $Revision: 1.12 $ */
-/* $Date: 2006/11/08 23:01:06 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/ciphers/safer/safer.c b/libtomcrypt/src/ciphers/safer/safer.c
index 9fdaf37..5189c2f 100644
--- a/libtomcrypt/src/ciphers/safer/safer.c
+++ b/libtomcrypt/src/ciphers/safer/safer.c
@@ -6,16 +6,16 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/*******************************************************************************
*
* FILE: safer.c
*
-* DESCRIPTION: block-cipher algorithm SAFER (Secure And Fast Encryption
-* Routine) in its four versions: SAFER K-64, SAFER K-128,
-* SAFER SK-64 and SAFER SK-128.
+* LTC_DESCRIPTION: block-cipher algorithm LTC_SAFER (Secure And Fast Encryption
+* Routine) in its four versions: LTC_SAFER K-64, LTC_SAFER K-128,
+* LTC_SAFER SK-64 and LTC_SAFER SK-128.
*
* AUTHOR: Richard De Moliner (demoliner@isi.ee.ethz.ch)
* Signal and Information Processing Laboratory
@@ -30,12 +30,12 @@
#include <tomcrypt.h>
-#ifdef SAFER
+#ifdef LTC_SAFER
const struct ltc_cipher_descriptor
safer_k64_desc = {
"safer-k64",
- 8, 8, 8, 8, SAFER_K64_DEFAULT_NOF_ROUNDS,
+ 8, 8, 8, 8, LTC_SAFER_K64_DEFAULT_NOF_ROUNDS,
&safer_k64_setup,
&safer_ecb_encrypt,
&safer_ecb_decrypt,
@@ -47,7 +47,7 @@ const struct ltc_cipher_descriptor
safer_sk64_desc = {
"safer-sk64",
- 9, 8, 8, 8, SAFER_SK64_DEFAULT_NOF_ROUNDS,
+ 9, 8, 8, 8, LTC_SAFER_SK64_DEFAULT_NOF_ROUNDS,
&safer_sk64_setup,
&safer_ecb_encrypt,
&safer_ecb_decrypt,
@@ -59,7 +59,7 @@ const struct ltc_cipher_descriptor
safer_k128_desc = {
"safer-k128",
- 10, 16, 16, 8, SAFER_K128_DEFAULT_NOF_ROUNDS,
+ 10, 16, 16, 8, LTC_SAFER_K128_DEFAULT_NOF_ROUNDS,
&safer_k128_setup,
&safer_ecb_encrypt,
&safer_ecb_decrypt,
@@ -71,7 +71,7 @@ const struct ltc_cipher_descriptor
safer_sk128_desc = {
"safer-sk128",
- 11, 16, 16, 8, SAFER_SK128_DEFAULT_NOF_ROUNDS,
+ 11, 16, 16, 8, LTC_SAFER_SK128_DEFAULT_NOF_ROUNDS,
&safer_sk128_setup,
&safer_ecb_encrypt,
&safer_ecb_decrypt,
@@ -111,48 +111,48 @@ static void Safer_Expand_Userkey(const unsigned char *userkey_1,
safer_key_t key)
#endif
{ unsigned int i, j, k;
- unsigned char ka[SAFER_BLOCK_LEN + 1];
- unsigned char kb[SAFER_BLOCK_LEN + 1];
+ unsigned char ka[LTC_SAFER_BLOCK_LEN + 1];
+ unsigned char kb[LTC_SAFER_BLOCK_LEN + 1];
- if (SAFER_MAX_NOF_ROUNDS < nof_rounds)
- nof_rounds = SAFER_MAX_NOF_ROUNDS;
+ if (LTC_SAFER_MAX_NOF_ROUNDS < nof_rounds)
+ nof_rounds = LTC_SAFER_MAX_NOF_ROUNDS;
*key++ = (unsigned char)nof_rounds;
- ka[SAFER_BLOCK_LEN] = (unsigned char)0;
- kb[SAFER_BLOCK_LEN] = (unsigned char)0;
+ ka[LTC_SAFER_BLOCK_LEN] = (unsigned char)0;
+ kb[LTC_SAFER_BLOCK_LEN] = (unsigned char)0;
k = 0;
- for (j = 0; j < SAFER_BLOCK_LEN; j++) {
+ for (j = 0; j < LTC_SAFER_BLOCK_LEN; j++) {
ka[j] = ROL8(userkey_1[j], 5);
- ka[SAFER_BLOCK_LEN] ^= ka[j];
+ ka[LTC_SAFER_BLOCK_LEN] ^= ka[j];
kb[j] = *key++ = userkey_2[j];
- kb[SAFER_BLOCK_LEN] ^= kb[j];
+ kb[LTC_SAFER_BLOCK_LEN] ^= kb[j];
}
for (i = 1; i <= nof_rounds; i++) {
- for (j = 0; j < SAFER_BLOCK_LEN + 1; j++) {
+ for (j = 0; j < LTC_SAFER_BLOCK_LEN + 1; j++) {
ka[j] = ROL8(ka[j], 6);
kb[j] = ROL8(kb[j], 6);
}
if (strengthened) {
k = 2 * i - 1;
- while (k >= (SAFER_BLOCK_LEN + 1)) { k -= SAFER_BLOCK_LEN + 1; }
+ while (k >= (LTC_SAFER_BLOCK_LEN + 1)) { k -= LTC_SAFER_BLOCK_LEN + 1; }
}
- for (j = 0; j < SAFER_BLOCK_LEN; j++) {
+ for (j = 0; j < LTC_SAFER_BLOCK_LEN; j++) {
if (strengthened) {
*key++ = (ka[k]
+ safer_ebox[(int)safer_ebox[(int)((18 * i + j + 1)&0xFF)]]) & 0xFF;
- if (++k == (SAFER_BLOCK_LEN + 1)) { k = 0; }
+ if (++k == (LTC_SAFER_BLOCK_LEN + 1)) { k = 0; }
} else {
*key++ = (ka[j] + safer_ebox[(int)safer_ebox[(int)((18 * i + j + 1)&0xFF)]]) & 0xFF;
}
}
if (strengthened) {
k = 2 * i;
- while (k >= (SAFER_BLOCK_LEN + 1)) { k -= SAFER_BLOCK_LEN + 1; }
+ while (k >= (LTC_SAFER_BLOCK_LEN + 1)) { k -= LTC_SAFER_BLOCK_LEN + 1; }
}
- for (j = 0; j < SAFER_BLOCK_LEN; j++) {
+ for (j = 0; j < LTC_SAFER_BLOCK_LEN; j++) {
if (strengthened) {
*key++ = (kb[k]
+ safer_ebox[(int)safer_ebox[(int)((18 * i + j + 10)&0xFF)]]) & 0xFF;
- if (++k == (SAFER_BLOCK_LEN + 1)) { k = 0; }
+ if (++k == (LTC_SAFER_BLOCK_LEN + 1)) { k = 0; }
} else {
*key++ = (kb[j] + safer_ebox[(int)safer_ebox[(int)((18 * i + j + 10)&0xFF)]]) & 0xFF;
}
@@ -173,7 +173,7 @@ static void Safer_Expand_Userkey(const unsigned char *userkey_1,
safer_key_t key)
{
_Safer_Expand_Userkey(userkey_1, userkey_2, nof_rounds, strengthened, key);
- burn_stack(sizeof(unsigned char) * (2 * (SAFER_BLOCK_LEN + 1)) + sizeof(unsigned int)*2);
+ burn_stack(sizeof(unsigned char) * (2 * (LTC_SAFER_BLOCK_LEN + 1)) + sizeof(unsigned int)*2);
}
#endif
@@ -182,7 +182,7 @@ int safer_k64_setup(const unsigned char *key, int keylen, int numrounds, symmetr
LTC_ARGCHK(key != NULL);
LTC_ARGCHK(skey != NULL);
- if (numrounds != 0 && (numrounds < 6 || numrounds > SAFER_MAX_NOF_ROUNDS)) {
+ if (numrounds != 0 && (numrounds < 6 || numrounds > LTC_SAFER_MAX_NOF_ROUNDS)) {
return CRYPT_INVALID_ROUNDS;
}
@@ -190,7 +190,7 @@ int safer_k64_setup(const unsigned char *key, int keylen, int numrounds, symmetr
return CRYPT_INVALID_KEYSIZE;
}
- Safer_Expand_Userkey(key, key, (unsigned int)(numrounds != 0 ?numrounds:SAFER_K64_DEFAULT_NOF_ROUNDS), 0, skey->safer.key);
+ Safer_Expand_Userkey(key, key, (unsigned int)(numrounds != 0 ?numrounds:LTC_SAFER_K64_DEFAULT_NOF_ROUNDS), 0, skey->safer.key);
return CRYPT_OK;
}
@@ -199,7 +199,7 @@ int safer_sk64_setup(const unsigned char *key, int keylen, int numrounds, symmet
LTC_ARGCHK(key != NULL);
LTC_ARGCHK(skey != NULL);
- if (numrounds != 0 && (numrounds < 6 || numrounds > SAFER_MAX_NOF_ROUNDS)) {
+ if (numrounds != 0 && (numrounds < 6 || numrounds > LTC_SAFER_MAX_NOF_ROUNDS)) {
return CRYPT_INVALID_ROUNDS;
}
@@ -207,7 +207,7 @@ int safer_sk64_setup(const unsigned char *key, int keylen, int numrounds, symmet
return CRYPT_INVALID_KEYSIZE;
}
- Safer_Expand_Userkey(key, key, (unsigned int)(numrounds != 0 ?numrounds:SAFER_SK64_DEFAULT_NOF_ROUNDS), 1, skey->safer.key);
+ Safer_Expand_Userkey(key, key, (unsigned int)(numrounds != 0 ?numrounds:LTC_SAFER_SK64_DEFAULT_NOF_ROUNDS), 1, skey->safer.key);
return CRYPT_OK;
}
@@ -216,7 +216,7 @@ int safer_k128_setup(const unsigned char *key, int keylen, int numrounds, symmet
LTC_ARGCHK(key != NULL);
LTC_ARGCHK(skey != NULL);
- if (numrounds != 0 && (numrounds < 6 || numrounds > SAFER_MAX_NOF_ROUNDS)) {
+ if (numrounds != 0 && (numrounds < 6 || numrounds > LTC_SAFER_MAX_NOF_ROUNDS)) {
return CRYPT_INVALID_ROUNDS;
}
@@ -224,7 +224,7 @@ int safer_k128_setup(const unsigned char *key, int keylen, int numrounds, symmet
return CRYPT_INVALID_KEYSIZE;
}
- Safer_Expand_Userkey(key, key+8, (unsigned int)(numrounds != 0 ?numrounds:SAFER_K128_DEFAULT_NOF_ROUNDS), 0, skey->safer.key);
+ Safer_Expand_Userkey(key, key+8, (unsigned int)(numrounds != 0 ?numrounds:LTC_SAFER_K128_DEFAULT_NOF_ROUNDS), 0, skey->safer.key);
return CRYPT_OK;
}
@@ -233,7 +233,7 @@ int safer_sk128_setup(const unsigned char *key, int keylen, int numrounds, symme
LTC_ARGCHK(key != NULL);
LTC_ARGCHK(skey != NULL);
- if (numrounds != 0 && (numrounds < 6 || numrounds > SAFER_MAX_NOF_ROUNDS)) {
+ if (numrounds != 0 && (numrounds < 6 || numrounds > LTC_SAFER_MAX_NOF_ROUNDS)) {
return CRYPT_INVALID_ROUNDS;
}
@@ -241,7 +241,7 @@ int safer_sk128_setup(const unsigned char *key, int keylen, int numrounds, symme
return CRYPT_INVALID_KEYSIZE;
}
- Safer_Expand_Userkey(key, key+8, (unsigned int)(numrounds != 0?numrounds:SAFER_SK128_DEFAULT_NOF_ROUNDS), 1, skey->safer.key);
+ Safer_Expand_Userkey(key, key+8, (unsigned int)(numrounds != 0?numrounds:LTC_SAFER_SK128_DEFAULT_NOF_ROUNDS), 1, skey->safer.key);
return CRYPT_OK;
}
@@ -265,7 +265,7 @@ int safer_ecb_encrypt(const unsigned char *block_in,
key = skey->safer.key;
a = block_in[0]; b = block_in[1]; c = block_in[2]; d = block_in[3];
e = block_in[4]; f = block_in[5]; g = block_in[6]; h = block_in[7];
- if (SAFER_MAX_NOF_ROUNDS < (round = *key)) round = SAFER_MAX_NOF_ROUNDS;
+ if (LTC_SAFER_MAX_NOF_ROUNDS < (round = *key)) round = LTC_SAFER_MAX_NOF_ROUNDS;
while(round-- > 0)
{
a ^= *++key; b += *++key; c += *++key; d ^= *++key;
@@ -319,8 +319,8 @@ int safer_ecb_decrypt(const unsigned char *block_in,
key = skey->safer.key;
a = block_in[0]; b = block_in[1]; c = block_in[2]; d = block_in[3];
e = block_in[4]; f = block_in[5]; g = block_in[6]; h = block_in[7];
- if (SAFER_MAX_NOF_ROUNDS < (round = *key)) round = SAFER_MAX_NOF_ROUNDS;
- key += SAFER_BLOCK_LEN * (1 + 2 * round);
+ if (LTC_SAFER_MAX_NOF_ROUNDS < (round = *key)) round = LTC_SAFER_MAX_NOF_ROUNDS;
+ key += LTC_SAFER_BLOCK_LEN * (1 + 2 * round);
h ^= *key; g -= *--key; f -= *--key; e ^= *--key;
d ^= *--key; c -= *--key; b -= *--key; a ^= *--key;
while (round--)
@@ -486,6 +486,6 @@ int safer_sk128_test(void)
-/* $Source: /cvs/libtom/libtomcrypt/src/ciphers/safer/safer.c,v $ */
-/* $Revision: 1.13 $ */
-/* $Date: 2006/11/08 23:01:06 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/ciphers/safer/safer_tab.c b/libtomcrypt/src/ciphers/safer/safer_tab.c
index a542768..9a515ff 100644
--- a/libtomcrypt/src/ciphers/safer/safer_tab.c
+++ b/libtomcrypt/src/ciphers/safer/safer_tab.c
@@ -6,17 +6,17 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/**
@file safer_tab.c
- Tables for SAFER block ciphers
+ Tables for LTC_SAFER block ciphers
*/
#include "tomcrypt.h"
-#if defined(SAFERP) || defined(SAFER)
+#if defined(LTC_SAFERP) || defined(LTC_SAFER)
/* This is the box defined by ebox[x] = 45^x mod 257.
* Its assumed that the value "256" corresponds to zero. */
@@ -63,6 +63,6 @@ const unsigned char safer_lbox[256] = {
-/* $Source: /cvs/libtom/libtomcrypt/src/ciphers/safer/safer_tab.c,v $ */
-/* $Revision: 1.4 $ */
-/* $Date: 2006/03/31 14:15:35 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/ciphers/safer/saferp.c b/libtomcrypt/src/ciphers/safer/saferp.c
index dff4ee9..8cecab0 100644
--- a/libtomcrypt/src/ciphers/safer/saferp.c
+++ b/libtomcrypt/src/ciphers/safer/saferp.c
@@ -6,16 +6,16 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/**
@file saferp.c
- SAFER+ Implementation by Tom St Denis
+ LTC_SAFER+ Implementation by Tom St Denis
*/
#include "tomcrypt.h"
-#ifdef SAFERP
+#ifdef LTC_SAFERP
const struct ltc_cipher_descriptor saferp_desc =
{
@@ -37,7 +37,7 @@ const struct ltc_cipher_descriptor saferp_desc =
* key addition, substitution, key addition. The safer_ebox and safer_lbox
* are the exponentiation box and logarithm boxes respectively.
* The value of 'i' is the current round number which allows this
- * function to be unrolled massively. Most of SAFER+'s speed
+ * function to be unrolled massively. Most of LTC_SAFER+'s speed
* comes from not having to compute indirect accesses into the
* array of 16 bytes b[0..15] which is the block of data
*/
@@ -206,7 +206,7 @@ static const unsigned char safer_bias[33][16] = {
{ 62, 220, 134, 119, 215, 166, 17, 251, 244, 186, 146, 145, 100, 131, 241, 51}};
/**
- Initialize the SAFER+ block cipher
+ Initialize the LTC_SAFER+ block cipher
@param key The symmetric key you wish to pass
@param keylen The key length in bytes
@param num_rounds The number of rounds desired (0 for default)
@@ -325,7 +325,7 @@ int saferp_setup(const unsigned char *key, int keylen, int num_rounds, symmetric
}
/**
- Encrypts a block of text with SAFER+
+ Encrypts a block of text with LTC_SAFER+
@param pt The input plaintext (16 bytes)
@param ct The output ciphertext (16 bytes)
@param skey The key as scheduled
@@ -389,7 +389,7 @@ int saferp_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key
}
/**
- Decrypts a block of text with SAFER+
+ Decrypts a block of text with LTC_SAFER+
@param ct The input ciphertext (16 bytes)
@param pt The output plaintext (16 bytes)
@param skey The key as scheduled
@@ -453,7 +453,7 @@ int saferp_ecb_decrypt(const unsigned char *ct, unsigned char *pt, symmetric_key
}
/**
- Performs a self-test of the SAFER+ block cipher
+ Performs a self-test of the LTC_SAFER+ block cipher
@return CRYPT_OK if functional, CRYPT_NOP if self-test has been disabled
*/
int saferp_test(void)
@@ -554,6 +554,6 @@ int saferp_keysize(int *keysize)
-/* $Source: /cvs/libtom/libtomcrypt/src/ciphers/safer/saferp.c,v $ */
-/* $Revision: 1.12 $ */
-/* $Date: 2006/11/08 23:01:06 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/ciphers/skipjack.c b/libtomcrypt/src/ciphers/skipjack.c
index 3e0b576..89e9a56 100644
--- a/libtomcrypt/src/ciphers/skipjack.c
+++ b/libtomcrypt/src/ciphers/skipjack.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/**
@@ -15,7 +15,7 @@
*/
#include "tomcrypt.h"
-#ifdef SKIPJACK
+#ifdef LTC_SKIPJACK
const struct ltc_cipher_descriptor skipjack_desc =
{
@@ -338,6 +338,6 @@ int skipjack_keysize(int *keysize)
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/ciphers/skipjack.c,v $ */
-/* $Revision: 1.12 $ */
-/* $Date: 2006/11/08 23:01:06 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/ciphers/twofish/twofish.c b/libtomcrypt/src/ciphers/twofish/twofish.c
index 8f81bdd..624dadf 100644
--- a/libtomcrypt/src/ciphers/twofish/twofish.c
+++ b/libtomcrypt/src/ciphers/twofish/twofish.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/**
@@ -15,12 +15,12 @@
*/
#include "tomcrypt.h"
-#ifdef TWOFISH
+#ifdef LTC_TWOFISH
-/* first TWOFISH_ALL_TABLES must ensure TWOFISH_TABLES is defined */
-#ifdef TWOFISH_ALL_TABLES
-#ifndef TWOFISH_TABLES
-#define TWOFISH_TABLES
+/* first LTC_TWOFISH_ALL_TABLES must ensure LTC_TWOFISH_TABLES is defined */
+#ifdef LTC_TWOFISH_ALL_TABLES
+#ifndef LTC_TWOFISH_TABLES
+#define LTC_TWOFISH_TABLES
#endif
#endif
@@ -68,7 +68,7 @@ static const unsigned char qord[4][5] = {
{ 1, 0, 1, 1, 0 }
};
-#ifdef TWOFISH_TABLES
+#ifdef LTC_TWOFISH_TABLES
#include "twofish_tab.c"
@@ -142,7 +142,7 @@ static ulong32 sbox(int i, ulong32 x)
}
#endif /* LTC_CLEAN_STACK */
-#endif /* TWOFISH_TABLES */
+#endif /* LTC_TWOFISH_TABLES */
/* computes ab mod p */
static ulong32 gf_mult(ulong32 a, ulong32 b, ulong32 p)
@@ -167,7 +167,7 @@ static ulong32 gf_mult(ulong32 a, ulong32 b, ulong32 p)
}
/* computes [y0 y1 y2 y3] = MDS . [x0] */
-#ifndef TWOFISH_TABLES
+#ifndef LTC_TWOFISH_TABLES
static ulong32 mds_column_mult(unsigned char in, int col)
{
ulong32 x01, x5B, xEF;
@@ -202,11 +202,11 @@ static ulong32 mds_column_mult(unsigned char in, int col)
return 0;
}
-#else /* !TWOFISH_TABLES */
+#else /* !LTC_TWOFISH_TABLES */
#define mds_column_mult(x, i) mds_tab[i][x]
-#endif /* TWOFISH_TABLES */
+#endif /* LTC_TWOFISH_TABLES */
/* Computes [y0 y1 y2 y3] = MDS . [x0 x1 x2 x3] */
static void mds_mult(const unsigned char *in, unsigned char *out)
@@ -219,7 +219,7 @@ static void mds_mult(const unsigned char *in, unsigned char *out)
STORE32L(tmp, out);
}
-#ifdef TWOFISH_ALL_TABLES
+#ifdef LTC_TWOFISH_ALL_TABLES
/* computes [y0 y1 y2 y3] = RS . [x0 x1 x2 x3 x4 x5 x6 x7] */
static void rs_mult(const unsigned char *in, unsigned char *out)
{
@@ -229,7 +229,7 @@ static void rs_mult(const unsigned char *in, unsigned char *out)
STORE32L(tmp, out);
}
-#else /* !TWOFISH_ALL_TABLES */
+#else /* !LTC_TWOFISH_ALL_TABLES */
/* computes [y0 y1 y2 y3] = RS . [x0 x1 x2 x3 x4 x5 x6 x7] */
static void rs_mult(const unsigned char *in, unsigned char *out)
@@ -273,7 +273,7 @@ static void h_func(const unsigned char *in, unsigned char *out, unsigned char *M
mds_mult(y, out);
}
-#ifndef TWOFISH_SMALL
+#ifndef LTC_TWOFISH_SMALL
/* for GCC we don't use pointer aliases */
#if defined(__GNUC__)
@@ -332,7 +332,7 @@ static ulong32 g_func(ulong32 x, symmetric_key *key)
}
#endif /* LTC_CLEAN_STACK */
-#endif /* TWOFISH_SMALL */
+#endif /* LTC_TWOFISH_SMALL */
/**
Initialize the Twofish block cipher
@@ -348,7 +348,7 @@ static int _twofish_setup(const unsigned char *key, int keylen, int num_rounds,
int twofish_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey)
#endif
{
-#ifndef TWOFISH_SMALL
+#ifndef LTC_TWOFISH_SMALL
unsigned char S[4*4], tmpx0, tmpx1;
#endif
int k, x, y;
@@ -376,7 +376,7 @@ int twofish_setup(const unsigned char *key, int keylen, int num_rounds, symmetri
}
/* create the S[..] words */
-#ifndef TWOFISH_SMALL
+#ifndef LTC_TWOFISH_SMALL
for (x = 0; x < k; x++) {
rs_mult(M+(x*8), S+(x*4));
}
@@ -410,7 +410,7 @@ int twofish_setup(const unsigned char *key, int keylen, int num_rounds, symmetri
skey->twofish.K[x+x+1] = ROLc(B + B + A, 9);
}
-#ifndef TWOFISH_SMALL
+#ifndef LTC_TWOFISH_SMALL
/* make the sboxes (large ram variant) */
if (k == 2) {
for (x = 0; x < 256; x++) {
@@ -477,7 +477,7 @@ int twofish_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_ke
{
ulong32 a,b,c,d,ta,tb,tc,td,t1,t2, *k;
int r;
-#if !defined(TWOFISH_SMALL) && !defined(__GNUC__)
+#if !defined(LTC_TWOFISH_SMALL) && !defined(__GNUC__)
ulong32 *S1, *S2, *S3, *S4;
#endif
@@ -485,7 +485,7 @@ int twofish_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_ke
LTC_ARGCHK(ct != NULL);
LTC_ARGCHK(skey != NULL);
-#if !defined(TWOFISH_SMALL) && !defined(__GNUC__)
+#if !defined(LTC_TWOFISH_SMALL) && !defined(__GNUC__)
S1 = skey->twofish.S[0];
S2 = skey->twofish.S[1];
S3 = skey->twofish.S[2];
@@ -550,7 +550,7 @@ int twofish_ecb_decrypt(const unsigned char *ct, unsigned char *pt, symmetric_ke
{
ulong32 a,b,c,d,ta,tb,tc,td,t1,t2, *k;
int r;
-#if !defined(TWOFISH_SMALL) && !defined(__GNUC__)
+#if !defined(LTC_TWOFISH_SMALL) && !defined(__GNUC__)
ulong32 *S1, *S2, *S3, *S4;
#endif
@@ -558,7 +558,7 @@ int twofish_ecb_decrypt(const unsigned char *ct, unsigned char *pt, symmetric_ke
LTC_ARGCHK(ct != NULL);
LTC_ARGCHK(skey != NULL);
-#if !defined(TWOFISH_SMALL) && !defined(__GNUC__)
+#if !defined(LTC_TWOFISH_SMALL) && !defined(__GNUC__)
S1 = skey->twofish.S[0];
S2 = skey->twofish.S[1];
S3 = skey->twofish.S[2];
@@ -714,6 +714,6 @@ int twofish_keysize(int *keysize)
-/* $Source: /cvs/libtom/libtomcrypt/src/ciphers/twofish/twofish.c,v $ */
-/* $Revision: 1.14 $ */
-/* $Date: 2006/12/04 21:34:03 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/ciphers/twofish/twofish_tab.c b/libtomcrypt/src/ciphers/twofish/twofish_tab.c
index f8a373f..ea3eb21 100644
--- a/libtomcrypt/src/ciphers/twofish/twofish_tab.c
+++ b/libtomcrypt/src/ciphers/twofish/twofish_tab.c
@@ -6,14 +6,14 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/**
@file twofish_tab.c
Twofish tables, Tom St Denis
*/
-#ifdef TWOFISH_TABLES
+#ifdef LTC_TWOFISH_TABLES
/* pre generated 8x8 tables from the four 4x4s */
static const unsigned char SBOX[2][256] = {
@@ -212,7 +212,7 @@ static const ulong32 mds_tab[4][256] = {
0xc6baf8c6UL, 0x9d55f99dUL, 0x700dfa70UL, 0x2be2fb2bUL, 0xc3bdfcc3UL, 0x9852fd98UL, 0x750afe75UL, 0x2ee5ff2eUL
}};
-#ifdef TWOFISH_ALL_TABLES
+#ifdef LTC_TWOFISH_ALL_TABLES
/* the 4x8 RS transform */
static const ulong32 rs_tab0[256] = {
@@ -487,10 +487,10 @@ static const ulong32 rs_tab7[256] = {
0x5d8218b2LU, 0x5e9bfd2cLU, 0x5bb09fc3LU, 0x58a97a5dLU, 0x51e65b50LU, 0x52ffbeceLU, 0x57d4dc21LU, 0x54cd39bfLU,
0x454a9e3bLU, 0x46537ba5LU, 0x4378194aLU, 0x4061fcd4LU, 0x492eddd9LU, 0x4a373847LU, 0x4f1c5aa8LU, 0x4c05bf36LU };
-#endif /* TWOFISH_ALL_TABLES */
+#endif /* LTC_TWOFISH_ALL_TABLES */
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/ciphers/twofish/twofish_tab.c,v $ */
-/* $Revision: 1.4 $ */
-/* $Date: 2006/03/31 14:15:35 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/ciphers/xtea.c b/libtomcrypt/src/ciphers/xtea.c
index ac73400..d907e54 100644
--- a/libtomcrypt/src/ciphers/xtea.c
+++ b/libtomcrypt/src/ciphers/xtea.c
@@ -6,16 +6,16 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/**
@file xtea.c
- Implementation of XTEA, Tom St Denis
+ Implementation of LTC_XTEA, Tom St Denis
*/
#include "tomcrypt.h"
-#ifdef XTEA
+#ifdef LTC_XTEA
const struct ltc_cipher_descriptor xtea_desc =
{
@@ -67,7 +67,7 @@ int xtea_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_k
}
/**
- Encrypts a block of text with XTEA
+ Encrypts a block of text with LTC_XTEA
@param pt The input plaintext (8 bytes)
@param ct The output ciphertext (8 bytes)
@param skey The key as scheduled
@@ -103,7 +103,7 @@ int xtea_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key *
}
/**
- Decrypts a block of text with XTEA
+ Decrypts a block of text with LTC_XTEA
@param ct The input ciphertext (8 bytes)
@param pt The output plaintext (8 bytes)
@param skey The key as scheduled
@@ -139,7 +139,7 @@ int xtea_ecb_decrypt(const unsigned char *ct, unsigned char *pt, symmetric_key *
}
/**
- Performs a self-test of the XTEA block cipher
+ Performs a self-test of the LTC_XTEA block cipher
@return CRYPT_OK if functional, CRYPT_NOP if self-test has been disabled
*/
int xtea_test(void)
@@ -206,6 +206,6 @@ int xtea_keysize(int *keysize)
-/* $Source: /cvs/libtom/libtomcrypt/src/ciphers/xtea.c,v $ */
-/* $Revision: 1.12 $ */
-/* $Date: 2006/11/08 23:01:06 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/encauth/ccm/ccm_memory.c b/libtomcrypt/src/encauth/ccm/ccm_memory.c
index c5eee18..abd8653 100644
--- a/libtomcrypt/src/encauth/ccm/ccm_memory.c
+++ b/libtomcrypt/src/encauth/ccm/ccm_memory.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -15,7 +15,7 @@
CCM support, process a block of memory, Tom St Denis
*/
-#ifdef CCM_MODE
+#ifdef LTC_CCM_MODE
/**
CCM encrypt/decrypt and produce an authentication tag
@@ -346,6 +346,6 @@ error:
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/encauth/ccm/ccm_memory.c,v $ */
-/* $Revision: 1.18 $ */
-/* $Date: 2006/12/04 21:34:03 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/encauth/ccm/ccm_test.c b/libtomcrypt/src/encauth/ccm/ccm_test.c
index 3a45bfb..9b63ffc 100644
--- a/libtomcrypt/src/encauth/ccm/ccm_test.c
+++ b/libtomcrypt/src/encauth/ccm/ccm_test.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -15,7 +15,7 @@
CCM support, process a block of memory, Tom St Denis
*/
-#ifdef CCM_MODE
+#ifdef LTC_CCM_MODE
int ccm_test(void)
{
@@ -175,6 +175,6 @@ int ccm_test(void)
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/encauth/ccm/ccm_test.c,v $ */
-/* $Revision: 1.8 $ */
-/* $Date: 2006/11/21 00:18:23 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/encauth/eax/eax_addheader.c b/libtomcrypt/src/encauth/eax/eax_addheader.c
index b1054e5..d06e921 100644
--- a/libtomcrypt/src/encauth/eax/eax_addheader.c
+++ b/libtomcrypt/src/encauth/eax/eax_addheader.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/**
@file eax_addheader.c
@@ -14,7 +14,7 @@
*/
#include "tomcrypt.h"
-#ifdef EAX_MODE
+#ifdef LTC_EAX_MODE
/**
add header (metadata) to the stream
@@ -33,6 +33,6 @@ int eax_addheader(eax_state *eax, const unsigned char *header,
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/encauth/eax/eax_addheader.c,v $ */
-/* $Revision: 1.4 $ */
-/* $Date: 2006/03/31 14:15:35 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/encauth/eax/eax_decrypt.c b/libtomcrypt/src/encauth/eax/eax_decrypt.c
index 22a66ab..185330f 100644
--- a/libtomcrypt/src/encauth/eax/eax_decrypt.c
+++ b/libtomcrypt/src/encauth/eax/eax_decrypt.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/**
@@ -15,7 +15,7 @@
*/
#include "tomcrypt.h"
-#ifdef EAX_MODE
+#ifdef LTC_EAX_MODE
/**
Decrypt data with the EAX protocol
@@ -45,6 +45,6 @@ int eax_decrypt(eax_state *eax, const unsigned char *ct, unsigned char *pt,
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/encauth/eax/eax_decrypt.c,v $ */
-/* $Revision: 1.4 $ */
-/* $Date: 2006/03/31 14:15:35 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/encauth/eax/eax_decrypt_verify_memory.c b/libtomcrypt/src/encauth/eax/eax_decrypt_verify_memory.c
index 693ddfa..7956142 100644
--- a/libtomcrypt/src/encauth/eax/eax_decrypt_verify_memory.c
+++ b/libtomcrypt/src/encauth/eax/eax_decrypt_verify_memory.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/**
@@ -15,7 +15,7 @@
*/
#include "tomcrypt.h"
-#ifdef EAX_MODE
+#ifdef LTC_EAX_MODE
/**
Decrypt a block of memory and verify the provided MAC tag with EAX
@@ -103,6 +103,6 @@ LBL_ERR:
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/encauth/eax/eax_decrypt_verify_memory.c,v $ */
-/* $Revision: 1.5 $ */
-/* $Date: 2006/11/01 09:28:17 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/encauth/eax/eax_done.c b/libtomcrypt/src/encauth/eax/eax_done.c
index 1e02939..0bb0b33 100644
--- a/libtomcrypt/src/encauth/eax/eax_done.c
+++ b/libtomcrypt/src/encauth/eax/eax_done.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/**
@@ -15,7 +15,7 @@
*/
#include "tomcrypt.h"
-#ifdef EAX_MODE
+#ifdef LTC_EAX_MODE
/**
Terminate an EAX session and get the tag.
@@ -89,6 +89,6 @@ LBL_ERR:
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/encauth/eax/eax_done.c,v $ */
-/* $Revision: 1.5 $ */
-/* $Date: 2006/03/31 14:15:35 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/encauth/eax/eax_encrypt.c b/libtomcrypt/src/encauth/eax/eax_encrypt.c
index dc8bc3d..79f9dc5 100644
--- a/libtomcrypt/src/encauth/eax/eax_encrypt.c
+++ b/libtomcrypt/src/encauth/eax/eax_encrypt.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/**
@@ -15,7 +15,7 @@
*/
#include "tomcrypt.h"
-#ifdef EAX_MODE
+#ifdef LTC_EAX_MODE
/**
Encrypt with EAX a block of data.
@@ -46,6 +46,6 @@ int eax_encrypt(eax_state *eax, const unsigned char *pt, unsigned char *ct,
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/encauth/eax/eax_encrypt.c,v $ */
-/* $Revision: 1.4 $ */
-/* $Date: 2006/03/31 14:15:35 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/encauth/eax/eax_encrypt_authenticate_memory.c b/libtomcrypt/src/encauth/eax/eax_encrypt_authenticate_memory.c
index e9e52d0..fc58ce6 100644
--- a/libtomcrypt/src/encauth/eax/eax_encrypt_authenticate_memory.c
+++ b/libtomcrypt/src/encauth/eax/eax_encrypt_authenticate_memory.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/**
@@ -15,7 +15,7 @@
*/
#include "tomcrypt.h"
-#ifdef EAX_MODE
+#ifdef LTC_EAX_MODE
/**
EAX encrypt and produce an authentication tag
@@ -77,6 +77,6 @@ LBL_ERR:
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/encauth/eax/eax_encrypt_authenticate_memory.c,v $ */
-/* $Revision: 1.4 $ */
-/* $Date: 2006/03/31 14:15:35 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/encauth/eax/eax_init.c b/libtomcrypt/src/encauth/eax/eax_init.c
index 48512b5..563eabf 100644
--- a/libtomcrypt/src/encauth/eax/eax_init.c
+++ b/libtomcrypt/src/encauth/eax/eax_init.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/**
@@ -15,7 +15,7 @@
*/
#include "tomcrypt.h"
-#ifdef EAX_MODE
+#ifdef LTC_EAX_MODE
/**
Initialized an EAX state
@@ -66,7 +66,7 @@ int eax_init(eax_state *eax, int cipher,
return CRYPT_MEM;
}
- /* N = OMAC_0K(nonce) */
+ /* N = LTC_OMAC_0K(nonce) */
zeromem(buf, MAXBLOCKSIZE);
if ((err = omac_init(omac, cipher, key, keylen)) != CRYPT_OK) {
goto LBL_ERR;
@@ -86,7 +86,7 @@ int eax_init(eax_state *eax, int cipher,
goto LBL_ERR;
}
- /* H = OMAC_1K(header) */
+ /* H = LTC_OMAC_1K(header) */
zeromem(buf, MAXBLOCKSIZE);
buf[blklen - 1] = 1;
@@ -112,7 +112,7 @@ int eax_init(eax_state *eax, int cipher,
goto LBL_ERR;
}
- /* setup the OMAC for the ciphertext */
+ /* setup the LTC_OMAC for the ciphertext */
if ((err = omac_init(&eax->ctomac, cipher, key, keylen)) != CRYPT_OK) {
goto LBL_ERR;
}
@@ -139,6 +139,6 @@ LBL_ERR:
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/encauth/eax/eax_init.c,v $ */
-/* $Revision: 1.5 $ */
-/* $Date: 2006/03/31 14:15:35 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/encauth/eax/eax_test.c b/libtomcrypt/src/encauth/eax/eax_test.c
index d154271..5babef2 100644
--- a/libtomcrypt/src/encauth/eax/eax_test.c
+++ b/libtomcrypt/src/encauth/eax/eax_test.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/**
@@ -15,7 +15,7 @@
*/
#include "tomcrypt.h"
-#ifdef EAX_MODE
+#ifdef LTC_EAX_MODE
/**
Test the EAX implementation
@@ -275,8 +275,8 @@ int eax_test(void)
#endif /* LTC_TEST */
}
-#endif /* EAX_MODE */
+#endif /* LTC_EAX_MODE */
-/* $Source: /cvs/libtom/libtomcrypt/src/encauth/eax/eax_test.c,v $ */
-/* $Revision: 1.5 $ */
-/* $Date: 2006/11/01 09:28:17 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/encauth/gcm/gcm_add_aad.c b/libtomcrypt/src/encauth/gcm/gcm_add_aad.c
index 6037c6c..26e47f6 100644
--- a/libtomcrypt/src/encauth/gcm/gcm_add_aad.c
+++ b/libtomcrypt/src/encauth/gcm/gcm_add_aad.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/**
@@ -15,7 +15,7 @@
*/
#include "tomcrypt.h"
-#ifdef GCM_MODE
+#ifdef LTC_GCM_MODE
/**
Add AAD to the GCM state
@@ -47,7 +47,7 @@ int gcm_add_aad(gcm_state *gcm,
}
/* in IV mode? */
- if (gcm->mode == GCM_MODE_IV) {
+ if (gcm->mode == LTC_GCM_MODE_IV) {
/* let's process the IV */
if (gcm->ivmode || gcm->buflen != 12) {
for (x = 0; x < (unsigned long)gcm->buflen; x++) {
@@ -80,10 +80,10 @@ int gcm_add_aad(gcm_state *gcm,
zeromem(gcm->buf, 16);
gcm->buflen = 0;
gcm->totlen = 0;
- gcm->mode = GCM_MODE_AAD;
+ gcm->mode = LTC_GCM_MODE_AAD;
}
- if (gcm->mode != GCM_MODE_AAD || gcm->buflen >= 16) {
+ if (gcm->mode != LTC_GCM_MODE_AAD || gcm->buflen >= 16) {
return CRYPT_INVALID_ARG;
}
@@ -119,6 +119,6 @@ int gcm_add_aad(gcm_state *gcm,
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/encauth/gcm/gcm_add_aad.c,v $ */
-/* $Revision: 1.16 $ */
-/* $Date: 2006/09/23 19:24:21 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/encauth/gcm/gcm_add_iv.c b/libtomcrypt/src/encauth/gcm/gcm_add_iv.c
index 44e3167..0ac79b6 100644
--- a/libtomcrypt/src/encauth/gcm/gcm_add_iv.c
+++ b/libtomcrypt/src/encauth/gcm/gcm_add_iv.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/**
@@ -15,7 +15,7 @@
*/
#include "tomcrypt.h"
-#ifdef GCM_MODE
+#ifdef LTC_GCM_MODE
/**
Add IV data to the GCM state
@@ -36,7 +36,7 @@ int gcm_add_iv(gcm_state *gcm,
}
/* must be in IV mode */
- if (gcm->mode != GCM_MODE_IV) {
+ if (gcm->mode != LTC_GCM_MODE_IV) {
return CRYPT_INVALID_ARG;
}
@@ -89,6 +89,6 @@ int gcm_add_iv(gcm_state *gcm,
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/encauth/gcm/gcm_add_iv.c,v $ */
-/* $Revision: 1.7 $ */
-/* $Date: 2006/03/31 14:15:35 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/encauth/gcm/gcm_done.c b/libtomcrypt/src/encauth/gcm/gcm_done.c
index 4cbd09f..bbc9bbe 100644
--- a/libtomcrypt/src/encauth/gcm/gcm_done.c
+++ b/libtomcrypt/src/encauth/gcm/gcm_done.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/**
@@ -15,7 +15,7 @@
*/
#include "tomcrypt.h"
-#ifdef GCM_MODE
+#ifdef LTC_GCM_MODE
/**
Terminate a GCM stream
@@ -43,7 +43,7 @@ int gcm_done(gcm_state *gcm,
}
- if (gcm->mode != GCM_MODE_TEXT) {
+ if (gcm->mode != LTC_GCM_MODE_TEXT) {
return CRYPT_INVALID_ARG;
}
@@ -78,6 +78,6 @@ int gcm_done(gcm_state *gcm,
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/encauth/gcm/gcm_done.c,v $ */
-/* $Revision: 1.9 $ */
-/* $Date: 2006/03/31 14:15:35 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/encauth/gcm/gcm_gf_mult.c b/libtomcrypt/src/encauth/gcm/gcm_gf_mult.c
index 52e82dd..72e0624 100644
--- a/libtomcrypt/src/encauth/gcm/gcm_gf_mult.c
+++ b/libtomcrypt/src/encauth/gcm/gcm_gf_mult.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/**
@@ -15,7 +15,7 @@
*/
#include "tomcrypt.h"
-#if defined(GCM_TABLES) || defined(LRW_TABLES) || ((defined(GCM_MODE) || defined(GCM_MODE)) && defined(LTC_FAST))
+#if defined(LTC_GCM_TABLES) || defined(LRW_TABLES) || ((defined(LTC_GCM_MODE) || defined(LTC_GCM_MODE)) && defined(LTC_FAST))
/* this is x*2^128 mod p(x) ... the results are 16 bytes each stored in a packed format. Since only the
* lower 16 bits are not zero'ed I removed the upper 14 bytes */
@@ -56,7 +56,7 @@ const unsigned char gcm_shift_table[256*2] = {
#endif
-#if defined(GCM_MODE) || defined(LRW_MODE)
+#if defined(LTC_GCM_MODE) || defined(LRW_MODE)
#ifndef LTC_FAST
/* right shift */
@@ -215,7 +215,7 @@ void gcm_gf_mult(const unsigned char *a, const unsigned char *b, unsigned char *
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/encauth/gcm/gcm_gf_mult.c,v $ */
-/* $Revision: 1.23 $ */
-/* $Date: 2006/03/31 14:15:35 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/encauth/gcm/gcm_init.c b/libtomcrypt/src/encauth/gcm/gcm_init.c
index c0f7a5a..8e1c496 100644
--- a/libtomcrypt/src/encauth/gcm/gcm_init.c
+++ b/libtomcrypt/src/encauth/gcm/gcm_init.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/**
@@ -15,7 +15,7 @@
*/
#include "tomcrypt.h"
-#ifdef GCM_MODE
+#ifdef LTC_GCM_MODE
/**
Initialize a GCM state
@@ -30,7 +30,7 @@ int gcm_init(gcm_state *gcm, int cipher,
{
int err;
unsigned char B[16];
-#ifdef GCM_TABLES
+#ifdef LTC_GCM_TABLES
int x, y, z, t;
#endif
@@ -66,13 +66,13 @@ int gcm_init(gcm_state *gcm, int cipher,
zeromem(gcm->buf, sizeof(gcm->buf));
zeromem(gcm->X, sizeof(gcm->X));
gcm->cipher = cipher;
- gcm->mode = GCM_MODE_IV;
+ gcm->mode = LTC_GCM_MODE_IV;
gcm->ivmode = 0;
gcm->buflen = 0;
gcm->totlen = 0;
gcm->pttotlen = 0;
-#ifdef GCM_TABLES
+#ifdef LTC_GCM_TABLES
/* setup tables */
/* generate the first table as it has no shifting (from which we make the other tables) */
@@ -102,6 +102,6 @@ int gcm_init(gcm_state *gcm, int cipher,
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/encauth/gcm/gcm_init.c,v $ */
-/* $Revision: 1.18 $ */
-/* $Date: 2006/03/31 14:15:35 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/encauth/gcm/gcm_memory.c b/libtomcrypt/src/encauth/gcm/gcm_memory.c
index ddec010..451e3fa 100644
--- a/libtomcrypt/src/encauth/gcm/gcm_memory.c
+++ b/libtomcrypt/src/encauth/gcm/gcm_memory.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/**
@@ -15,7 +15,7 @@
*/
#include "tomcrypt.h"
-#ifdef GCM_MODE
+#ifdef LTC_GCM_MODE
/**
Process an entire GCM packet in one call.
@@ -65,7 +65,7 @@ int gcm_memory( int cipher,
-#ifndef GCM_TABLES_SSE2
+#ifndef LTC_GCM_TABLES_SSE2
orig = gcm = XMALLOC(sizeof(*gcm));
#else
orig = gcm = XMALLOC(sizeof(*gcm) + 16);
@@ -78,7 +78,7 @@ int gcm_memory( int cipher,
* note that we only modify gcm and keep orig intact. This code is not portable
* but again it's only for SSE2 anyways, so who cares?
*/
-#ifdef GCM_TABLES_SSE2
+#ifdef LTC_GCM_TABLES_SSE2
if ((unsigned long)gcm & 15) {
gcm = (gcm_state *)((unsigned long)gcm + (16 - ((unsigned long)gcm & 15)));
}
@@ -104,6 +104,6 @@ LTC_ERR:
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/encauth/gcm/gcm_memory.c,v $ */
-/* $Revision: 1.23 $ */
-/* $Date: 2006/09/07 10:00:57 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/encauth/gcm/gcm_mult_h.c b/libtomcrypt/src/encauth/gcm/gcm_mult_h.c
index 8391e00..2cda6a4 100644
--- a/libtomcrypt/src/encauth/gcm/gcm_mult_h.c
+++ b/libtomcrypt/src/encauth/gcm/gcm_mult_h.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/**
@@ -15,7 +15,7 @@
*/
#include "tomcrypt.h"
-#if defined(GCM_MODE)
+#if defined(LTC_GCM_MODE)
/**
GCM multiply by H
@param gcm The GCM state which holds the H value
@@ -24,9 +24,9 @@
void gcm_mult_h(gcm_state *gcm, unsigned char *I)
{
unsigned char T[16];
-#ifdef GCM_TABLES
+#ifdef LTC_GCM_TABLES
int x, y;
-#ifdef GCM_TABLES_SSE2
+#ifdef LTC_GCM_TABLES_SSE2
asm("movdqa (%0),%%xmm0"::"r"(&gcm->PC[0][I[0]][0]));
for (x = 1; x < 16; x++) {
asm("pxor (%0),%%xmm0"::"r"(&gcm->PC[x][I[x]][0]));
@@ -45,7 +45,7 @@ void gcm_mult_h(gcm_state *gcm, unsigned char *I)
}
#endif /* LTC_FAST */
}
-#endif /* GCM_TABLES_SSE2 */
+#endif /* LTC_GCM_TABLES_SSE2 */
#else
gcm_gf_mult(gcm->H, I, T);
#endif
@@ -53,6 +53,6 @@ void gcm_mult_h(gcm_state *gcm, unsigned char *I)
}
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/encauth/gcm/gcm_mult_h.c,v $ */
-/* $Revision: 1.4 $ */
-/* $Date: 2006/08/23 20:40:23 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/encauth/gcm/gcm_process.c b/libtomcrypt/src/encauth/gcm/gcm_process.c
index f4d21d3..af0444d 100644
--- a/libtomcrypt/src/encauth/gcm/gcm_process.c
+++ b/libtomcrypt/src/encauth/gcm/gcm_process.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/**
@@ -15,7 +15,7 @@
*/
#include "tomcrypt.h"
-#ifdef GCM_MODE
+#ifdef LTC_GCM_MODE
/**
Process plaintext/ciphertext through GCM
@@ -50,7 +50,7 @@ int gcm_process(gcm_state *gcm,
}
/* in AAD mode? */
- if (gcm->mode == GCM_MODE_AAD) {
+ if (gcm->mode == LTC_GCM_MODE_AAD) {
/* let's process the AAD */
if (gcm->buflen) {
gcm->totlen += gcm->buflen * CONST64(8);
@@ -67,10 +67,10 @@ int gcm_process(gcm_state *gcm,
}
gcm->buflen = 0;
- gcm->mode = GCM_MODE_TEXT;
+ gcm->mode = LTC_GCM_MODE_TEXT;
}
- if (gcm->mode != GCM_MODE_TEXT) {
+ if (gcm->mode != LTC_GCM_MODE_TEXT) {
return CRYPT_INVALID_ARG;
}
@@ -147,6 +147,6 @@ int gcm_process(gcm_state *gcm,
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/encauth/gcm/gcm_process.c,v $ */
-/* $Revision: 1.14 $ */
-/* $Date: 2006/11/19 19:33:36 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/encauth/gcm/gcm_reset.c b/libtomcrypt/src/encauth/gcm/gcm_reset.c
index a6a8522..c9e13d9 100644
--- a/libtomcrypt/src/encauth/gcm/gcm_reset.c
+++ b/libtomcrypt/src/encauth/gcm/gcm_reset.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/**
@@ -15,7 +15,7 @@
*/
#include "tomcrypt.h"
-#ifdef GCM_MODE
+#ifdef LTC_GCM_MODE
/**
Reset a GCM state to as if you just called gcm_init(). This saves the initialization time.
@@ -28,7 +28,7 @@ int gcm_reset(gcm_state *gcm)
zeromem(gcm->buf, sizeof(gcm->buf));
zeromem(gcm->X, sizeof(gcm->X));
- gcm->mode = GCM_MODE_IV;
+ gcm->mode = LTC_GCM_MODE_IV;
gcm->ivmode = 0;
gcm->buflen = 0;
gcm->totlen = 0;
@@ -39,6 +39,6 @@ int gcm_reset(gcm_state *gcm)
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/encauth/gcm/gcm_reset.c,v $ */
-/* $Revision: 1.4 $ */
-/* $Date: 2006/03/31 14:15:35 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/encauth/gcm/gcm_test.c b/libtomcrypt/src/encauth/gcm/gcm_test.c
index 2f8539b..7380c81 100644
--- a/libtomcrypt/src/encauth/gcm/gcm_test.c
+++ b/libtomcrypt/src/encauth/gcm/gcm_test.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/**
@@ -15,7 +15,7 @@
*/
#include "tomcrypt.h"
-#ifdef GCM_MODE
+#ifdef LTC_GCM_MODE
/**
Test the GCM code
@@ -408,6 +408,6 @@ int gcm_test(void)
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/encauth/gcm/gcm_test.c,v $ */
-/* $Revision: 1.20 $ */
-/* $Date: 2006/12/03 17:25:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/encauth/ocb/ocb_decrypt.c b/libtomcrypt/src/encauth/ocb/ocb_decrypt.c
index 58f3825..61003db 100644
--- a/libtomcrypt/src/encauth/ocb/ocb_decrypt.c
+++ b/libtomcrypt/src/encauth/ocb/ocb_decrypt.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/**
@@ -15,7 +15,7 @@
*/
#include "tomcrypt.h"
-#ifdef OCB_MODE
+#ifdef LTC_OCB_MODE
/**
Decrypt a block with OCB.
@@ -74,6 +74,6 @@ int ocb_decrypt(ocb_state *ocb, const unsigned char *ct, unsigned char *pt)
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/encauth/ocb/ocb_decrypt.c,v $ */
-/* $Revision: 1.5 $ */
-/* $Date: 2006/03/31 14:15:35 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/encauth/ocb/ocb_decrypt_verify_memory.c b/libtomcrypt/src/encauth/ocb/ocb_decrypt_verify_memory.c
index b7b8840..6644618 100644
--- a/libtomcrypt/src/encauth/ocb/ocb_decrypt_verify_memory.c
+++ b/libtomcrypt/src/encauth/ocb/ocb_decrypt_verify_memory.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/**
@@ -15,7 +15,7 @@
*/
#include "tomcrypt.h"
-#ifdef OCB_MODE
+#ifdef LTC_OCB_MODE
/**
Decrypt and compare the tag with OCB.
@@ -81,6 +81,6 @@ LBL_ERR:
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/encauth/ocb/ocb_decrypt_verify_memory.c,v $ */
-/* $Revision: 1.4 $ */
-/* $Date: 2006/03/31 14:15:35 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/encauth/ocb/ocb_done_decrypt.c b/libtomcrypt/src/encauth/ocb/ocb_done_decrypt.c
index 2a3ae39..d604b36 100644
--- a/libtomcrypt/src/encauth/ocb/ocb_done_decrypt.c
+++ b/libtomcrypt/src/encauth/ocb/ocb_done_decrypt.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/**
@@ -15,7 +15,7 @@
*/
#include "tomcrypt.h"
-#ifdef OCB_MODE
+#ifdef LTC_OCB_MODE
/**
Terminate a decrypting OCB state
@@ -75,6 +75,6 @@ LBL_ERR:
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/encauth/ocb/ocb_done_decrypt.c,v $ */
-/* $Revision: 1.5 $ */
-/* $Date: 2006/11/01 09:28:17 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/encauth/ocb/ocb_done_encrypt.c b/libtomcrypt/src/encauth/ocb/ocb_done_encrypt.c
index 5948d82..276d50e 100644
--- a/libtomcrypt/src/encauth/ocb/ocb_done_encrypt.c
+++ b/libtomcrypt/src/encauth/ocb/ocb_done_encrypt.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/**
@@ -15,7 +15,7 @@
*/
#include "tomcrypt.h"
-#ifdef OCB_MODE
+#ifdef LTC_OCB_MODE
/**
Terminate an encryption OCB state
@@ -41,6 +41,6 @@ int ocb_done_encrypt(ocb_state *ocb, const unsigned char *pt, unsigned long ptle
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/encauth/ocb/ocb_done_encrypt.c,v $ */
-/* $Revision: 1.4 $ */
-/* $Date: 2006/03/31 14:15:35 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/encauth/ocb/ocb_encrypt.c b/libtomcrypt/src/encauth/ocb/ocb_encrypt.c
index 3c4991c..84afa66 100644
--- a/libtomcrypt/src/encauth/ocb/ocb_encrypt.c
+++ b/libtomcrypt/src/encauth/ocb/ocb_encrypt.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/**
@@ -15,7 +15,7 @@
*/
#include "tomcrypt.h"
-#ifdef OCB_MODE
+#ifdef LTC_OCB_MODE
/**
Encrypt a block of data with OCB.
@@ -67,6 +67,6 @@ int ocb_encrypt(ocb_state *ocb, const unsigned char *pt, unsigned char *ct)
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/encauth/ocb/ocb_encrypt.c,v $ */
-/* $Revision: 1.5 $ */
-/* $Date: 2006/03/31 14:15:35 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/encauth/ocb/ocb_encrypt_authenticate_memory.c b/libtomcrypt/src/encauth/ocb/ocb_encrypt_authenticate_memory.c
index e58975e..f81cc4b 100644
--- a/libtomcrypt/src/encauth/ocb/ocb_encrypt_authenticate_memory.c
+++ b/libtomcrypt/src/encauth/ocb/ocb_encrypt_authenticate_memory.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/**
@@ -15,7 +15,7 @@
*/
#include "tomcrypt.h"
-#ifdef OCB_MODE
+#ifdef LTC_OCB_MODE
/**
Encrypt and generate an authentication code for a buffer of memory
@@ -79,6 +79,6 @@ LBL_ERR:
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/encauth/ocb/ocb_encrypt_authenticate_memory.c,v $ */
-/* $Revision: 1.4 $ */
-/* $Date: 2006/03/31 14:15:35 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/encauth/ocb/ocb_init.c b/libtomcrypt/src/encauth/ocb/ocb_init.c
index 536af87..604ae0e 100644
--- a/libtomcrypt/src/encauth/ocb/ocb_init.c
+++ b/libtomcrypt/src/encauth/ocb/ocb_init.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/**
@@ -15,7 +15,7 @@
*/
#include "tomcrypt.h"
-#ifdef OCB_MODE
+#ifdef LTC_OCB_MODE
static const struct {
int len;
@@ -132,6 +132,6 @@ int ocb_init(ocb_state *ocb, int cipher,
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/encauth/ocb/ocb_init.c,v $ */
-/* $Revision: 1.5 $ */
-/* $Date: 2006/03/31 14:15:35 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/encauth/ocb/ocb_ntz.c b/libtomcrypt/src/encauth/ocb/ocb_ntz.c
index 8100ec0..c3e42f1 100644
--- a/libtomcrypt/src/encauth/ocb/ocb_ntz.c
+++ b/libtomcrypt/src/encauth/ocb/ocb_ntz.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/**
@@ -16,7 +16,7 @@
#include "tomcrypt.h"
-#ifdef OCB_MODE
+#ifdef LTC_OCB_MODE
/**
Returns the number of leading zero bits [from lsb up]
@@ -37,6 +37,6 @@ int ocb_ntz(unsigned long x)
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/encauth/ocb/ocb_ntz.c,v $ */
-/* $Revision: 1.4 $ */
-/* $Date: 2006/03/31 14:15:35 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/encauth/ocb/ocb_shift_xor.c b/libtomcrypt/src/encauth/ocb/ocb_shift_xor.c
index dea43ee..145f4c4 100644
--- a/libtomcrypt/src/encauth/ocb/ocb_shift_xor.c
+++ b/libtomcrypt/src/encauth/ocb/ocb_shift_xor.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/**
@@ -15,7 +15,7 @@
*/
#include "tomcrypt.h"
-#ifdef OCB_MODE
+#ifdef LTC_OCB_MODE
/**
Compute the shift/xor for OCB (internal function)
@@ -34,6 +34,6 @@ void ocb_shift_xor(ocb_state *ocb, unsigned char *Z)
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/encauth/ocb/ocb_shift_xor.c,v $ */
-/* $Revision: 1.4 $ */
-/* $Date: 2006/03/31 14:15:35 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/encauth/ocb/ocb_test.c b/libtomcrypt/src/encauth/ocb/ocb_test.c
index 4d7ed78..8de1a57 100644
--- a/libtomcrypt/src/encauth/ocb/ocb_test.c
+++ b/libtomcrypt/src/encauth/ocb/ocb_test.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/**
@@ -15,7 +15,7 @@
*/
#include "tomcrypt.h"
-#ifdef OCB_MODE
+#ifdef LTC_OCB_MODE
/**
Test the OCB protocol
@@ -222,7 +222,7 @@ int ocb_test(void)
#endif /* LTC_TEST */
}
-#endif /* OCB_MODE */
+#endif /* LTC_OCB_MODE */
/* some comments
@@ -232,6 +232,6 @@ int ocb_test(void)
-- The setup is somewhat complicated...
*/
-/* $Source: /cvs/libtom/libtomcrypt/src/encauth/ocb/ocb_test.c,v $ */
-/* $Revision: 1.5 $ */
-/* $Date: 2006/11/01 09:28:17 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/encauth/ocb/s_ocb_done.c b/libtomcrypt/src/encauth/ocb/s_ocb_done.c
index 7688a42..37a7cb7 100644
--- a/libtomcrypt/src/encauth/ocb/s_ocb_done.c
+++ b/libtomcrypt/src/encauth/ocb/s_ocb_done.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/**
@@ -15,7 +15,7 @@
*/
#include "tomcrypt.h"
-#ifdef OCB_MODE
+#ifdef LTC_OCB_MODE
/* Since the last block is encrypted in CTR mode the same code can
* be used to finish a decrypt or encrypt stream. The only difference
@@ -143,6 +143,6 @@ error:
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/encauth/ocb/s_ocb_done.c,v $ */
-/* $Revision: 1.6 $ */
-/* $Date: 2006/03/31 14:15:35 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/hashes/chc/chc.c b/libtomcrypt/src/hashes/chc/chc.c
index 3f86270..2c061e3 100644
--- a/libtomcrypt/src/hashes/chc/chc.c
+++ b/libtomcrypt/src/hashes/chc/chc.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -16,7 +16,7 @@
CHC support. (Tom St Denis)
*/
-#ifdef CHC_HASH
+#ifdef LTC_CHC_HASH
#define UNDEFED_HASH -17
@@ -293,6 +293,6 @@ int chc_test(void)
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/hashes/chc/chc.c,v $ */
-/* $Revision: 1.6 $ */
-/* $Date: 2006/11/01 09:28:17 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/hashes/helper/hash_file.c b/libtomcrypt/src/hashes/helper/hash_file.c
index df31606..e40c147 100644
--- a/libtomcrypt/src/hashes/helper/hash_file.c
+++ b/libtomcrypt/src/hashes/helper/hash_file.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -53,6 +53,6 @@ int hash_file(int hash, const char *fname, unsigned char *out, unsigned long *ou
}
-/* $Source: /cvs/libtom/libtomcrypt/src/hashes/helper/hash_file.c,v $ */
-/* $Revision: 1.4 $ */
-/* $Date: 2006/03/31 14:15:35 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/hashes/helper/hash_filehandle.c b/libtomcrypt/src/hashes/helper/hash_filehandle.c
index 03155ea..af8164a 100644
--- a/libtomcrypt/src/hashes/helper/hash_filehandle.c
+++ b/libtomcrypt/src/hashes/helper/hash_filehandle.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -67,6 +67,6 @@ int hash_filehandle(int hash, FILE *in, unsigned char *out, unsigned long *outle
}
-/* $Source: /cvs/libtom/libtomcrypt/src/hashes/helper/hash_filehandle.c,v $ */
-/* $Revision: 1.5 $ */
-/* $Date: 2006/06/16 21:53:41 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/hashes/helper/hash_memory.c b/libtomcrypt/src/hashes/helper/hash_memory.c
index def9fa7..853183a 100644
--- a/libtomcrypt/src/hashes/helper/hash_memory.c
+++ b/libtomcrypt/src/hashes/helper/hash_memory.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -64,6 +64,6 @@ LBL_ERR:
return err;
}
-/* $Source: /cvs/libtom/libtomcrypt/src/hashes/helper/hash_memory.c,v $ */
-/* $Revision: 1.5 $ */
-/* $Date: 2006/06/16 21:53:41 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/hashes/helper/hash_memory_multi.c b/libtomcrypt/src/hashes/helper/hash_memory_multi.c
index 91f2d0c..ef39646 100644
--- a/libtomcrypt/src/hashes/helper/hash_memory_multi.c
+++ b/libtomcrypt/src/hashes/helper/hash_memory_multi.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
#include <stdarg.h>
@@ -82,6 +82,6 @@ LBL_ERR:
return err;
}
-/* $Source: /cvs/libtom/libtomcrypt/src/hashes/helper/hash_memory_multi.c,v $ */
-/* $Revision: 1.5 $ */
-/* $Date: 2006/06/16 21:53:41 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/hashes/md2.c b/libtomcrypt/src/hashes/md2.c
index b917213..5a65d7e 100644
--- a/libtomcrypt/src/hashes/md2.c
+++ b/libtomcrypt/src/hashes/md2.c
@@ -6,16 +6,16 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
/**
@param md2.c
- MD2 (RFC 1319) hash function implementation by Tom St Denis
+ LTC_MD2 (RFC 1319) hash function implementation by Tom St Denis
*/
-#ifdef MD2
+#ifdef LTC_MD2
const struct ltc_hash_descriptor md2_desc =
{
@@ -102,7 +102,7 @@ int md2_init(hash_state *md)
{
LTC_ARGCHK(md != NULL);
- /* MD2 uses a zero'ed state... */
+ /* LTC_MD2 uses a zero'ed state... */
zeromem(md->md2.X, sizeof(md->md2.X));
zeromem(md->md2.chksum, sizeof(md->md2.chksum));
zeromem(md->md2.buf, sizeof(md->md2.buf));
@@ -246,6 +246,6 @@ int md2_test(void)
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/hashes/md2.c,v $ */
-/* $Revision: 1.8 $ */
-/* $Date: 2006/11/01 09:28:17 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/hashes/md4.c b/libtomcrypt/src/hashes/md4.c
index 42645ef..adf916b 100644
--- a/libtomcrypt/src/hashes/md4.c
+++ b/libtomcrypt/src/hashes/md4.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -15,7 +15,7 @@
Submitted by Dobes Vandermeer (dobes@smartt.com)
*/
-#ifdef MD4
+#ifdef LTC_MD4
const struct ltc_hash_descriptor md4_desc =
{
@@ -48,7 +48,7 @@ const struct ltc_hash_descriptor md4_desc =
#define S33 11
#define S34 15
-/* F, G and H are basic MD4 functions. */
+/* F, G and H are basic LTC_MD4 functions. */
#define F(x, y, z) (z ^ (x & (y ^ z)))
#define G(x, y, z) ((x & y) | (z & (x | y)))
#define H(x, y, z) ((x) ^ (y) ^ (z))
@@ -302,6 +302,6 @@ int md4_test(void)
-/* $Source: /cvs/libtom/libtomcrypt/src/hashes/md4.c,v $ */
-/* $Revision: 1.8 $ */
-/* $Date: 2006/11/01 09:28:17 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/hashes/md5.c b/libtomcrypt/src/hashes/md5.c
index f6274f9..4fa1e9e 100644
--- a/libtomcrypt/src/hashes/md5.c
+++ b/libtomcrypt/src/hashes/md5.c
@@ -6,17 +6,17 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
/**
@file md5.c
- MD5 hash function by Tom St Denis
+ LTC_MD5 hash function by Tom St Denis
*/
-#ifdef MD5
+#ifdef LTC_MD5
const struct ltc_hash_descriptor md5_desc =
{
@@ -363,6 +363,6 @@ int md5_test(void)
-/* $Source: /cvs/libtom/libtomcrypt/src/hashes/md5.c,v $ */
-/* $Revision: 1.8 $ */
-/* $Date: 2006/11/01 09:28:17 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/hashes/rmd128.c b/libtomcrypt/src/hashes/rmd128.c
index d294626..58ae927 100644
--- a/libtomcrypt/src/hashes/rmd128.c
+++ b/libtomcrypt/src/hashes/rmd128.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -15,13 +15,13 @@
RMD128 Hash function
*/
-/* Implementation of RIPEMD-128 based on the source by Antoon Bosselaers, ESAT-COSIC
+/* Implementation of LTC_RIPEMD-128 based on the source by Antoon Bosselaers, ESAT-COSIC
*
* This source has been radically overhauled to be portable and work within
* the LibTomCrypt API by Tom St Denis
*/
-#ifdef RIPEMD128
+#ifdef LTC_RIPEMD128
const struct ltc_hash_descriptor rmd128_desc =
{
@@ -405,6 +405,6 @@ int rmd128_test(void)
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/hashes/rmd128.c,v $ */
-/* $Revision: 1.9 $ */
-/* $Date: 2006/11/01 09:28:17 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/hashes/rmd160.c b/libtomcrypt/src/hashes/rmd160.c
index a1c090a..1313e41 100644
--- a/libtomcrypt/src/hashes/rmd160.c
+++ b/libtomcrypt/src/hashes/rmd160.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -15,13 +15,13 @@
RMD160 hash function
*/
-/* Implementation of RIPEMD-160 based on the source by Antoon Bosselaers, ESAT-COSIC
+/* Implementation of LTC_RIPEMD-160 based on the source by Antoon Bosselaers, ESAT-COSIC
*
* This source has been radically overhauled to be portable and work within
* the LibTomCrypt API by Tom St Denis
*/
-#ifdef RIPEMD160
+#ifdef LTC_RIPEMD160
const struct ltc_hash_descriptor rmd160_desc =
{
@@ -464,6 +464,6 @@ int rmd160_test(void)
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/hashes/rmd160.c,v $ */
-/* $Revision: 1.8 $ */
-/* $Date: 2006/11/01 09:28:17 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/hashes/rmd256.c b/libtomcrypt/src/hashes/rmd256.c
index 4540ef9..0188bf7 100644
--- a/libtomcrypt/src/hashes/rmd256.c
+++ b/libtomcrypt/src/hashes/rmd256.c
@@ -6,22 +6,22 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
/**
@param rmd256.c
- RMD256 Hash function
+ RLTC_MD256 Hash function
*/
-#ifdef RIPEMD256
+#ifdef LTC_RIPEMD256
const struct ltc_hash_descriptor rmd256_desc =
{
"rmd256",
8,
- 16,
+ 32,
64,
/* OID */
diff --git a/libtomcrypt/src/hashes/rmd320.c b/libtomcrypt/src/hashes/rmd320.c
index a11fca4..858d7bb 100644
--- a/libtomcrypt/src/hashes/rmd320.c
+++ b/libtomcrypt/src/hashes/rmd320.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -15,13 +15,13 @@
RMD320 hash function
*/
-#ifdef RIPEMD320
+#ifdef LTC_RIPEMD320
const struct ltc_hash_descriptor rmd320_desc =
{
"rmd320",
9,
- 20,
+ 40,
64,
/* OID */
diff --git a/libtomcrypt/src/hashes/sha1.c b/libtomcrypt/src/hashes/sha1.c
index 8cc6855..8c846b0 100644
--- a/libtomcrypt/src/hashes/sha1.c
+++ b/libtomcrypt/src/hashes/sha1.c
@@ -6,17 +6,17 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
/**
@file sha1.c
- SHA1 code by Tom St Denis
+ LTC_SHA1 code by Tom St Denis
*/
-#ifdef SHA1
+#ifdef LTC_SHA1
const struct ltc_hash_descriptor sha1_desc =
{
@@ -283,6 +283,6 @@ int sha1_test(void)
-/* $Source: /cvs/libtom/libtomcrypt/src/hashes/sha1.c,v $ */
-/* $Revision: 1.8 $ */
-/* $Date: 2006/11/01 09:28:17 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/hashes/sha2/sha224.c b/libtomcrypt/src/hashes/sha2/sha224.c
index f085d50..5d7dfb2 100644
--- a/libtomcrypt/src/hashes/sha2/sha224.c
+++ b/libtomcrypt/src/hashes/sha2/sha224.c
@@ -6,11 +6,11 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/**
@param sha224.c
- SHA-224 new NIST standard based off of SHA-256 truncated to 224 bits (Tom St Denis)
+ LTC_SHA-224 new NIST standard based off of LTC_SHA-256 truncated to 224 bits (Tom St Denis)
*/
const struct ltc_hash_descriptor sha224_desc =
@@ -120,6 +120,6 @@ int sha224_test(void)
}
-/* $Source: /cvs/libtom/libtomcrypt/src/hashes/sha2/sha224.c,v $ */
-/* $Revision: 1.8 $ */
-/* $Date: 2006/11/01 09:28:17 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/hashes/sha2/sha256.c b/libtomcrypt/src/hashes/sha2/sha256.c
index 2b42cb7..ad1386a 100644
--- a/libtomcrypt/src/hashes/sha2/sha256.c
+++ b/libtomcrypt/src/hashes/sha2/sha256.c
@@ -6,16 +6,16 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
/**
@file sha256.c
- SHA256 by Tom St Denis
+ LTC_SHA256 by Tom St Denis
*/
-#ifdef SHA256
+#ifdef LTC_SHA256
const struct ltc_hash_descriptor sha256_desc =
{
@@ -327,7 +327,7 @@ int sha256_test(void)
#endif
}
-#ifdef SHA224
+#ifdef LTC_SHA224
#include "sha224.c"
#endif
@@ -335,6 +335,6 @@ int sha256_test(void)
-/* $Source: /cvs/libtom/libtomcrypt/src/hashes/sha2/sha256.c,v $ */
-/* $Revision: 1.9 $ */
-/* $Date: 2006/11/01 09:28:17 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/hashes/sha2/sha384.c b/libtomcrypt/src/hashes/sha2/sha384.c
index ac7709c..cf4d7dc 100644
--- a/libtomcrypt/src/hashes/sha2/sha384.c
+++ b/libtomcrypt/src/hashes/sha2/sha384.c
@@ -6,11 +6,11 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/**
@param sha384.c
- SHA384 hash included in sha512.c, Tom St Denis
+ LTC_SHA384 hash included in sha512.c, Tom St Denis
*/
const struct ltc_hash_descriptor sha384_desc =
@@ -130,6 +130,6 @@ int sha384_test(void)
-/* $Source: /cvs/libtom/libtomcrypt/src/hashes/sha2/sha384.c,v $ */
-/* $Revision: 1.8 $ */
-/* $Date: 2006/11/01 09:28:17 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/hashes/sha2/sha512.c b/libtomcrypt/src/hashes/sha2/sha512.c
index 08c95ef..4b7e761 100644
--- a/libtomcrypt/src/hashes/sha2/sha512.c
+++ b/libtomcrypt/src/hashes/sha2/sha512.c
@@ -6,16 +6,16 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
/**
@param sha512.c
- SHA512 by Tom St Denis
+ LTC_SHA512 by Tom St Denis
*/
-#ifdef SHA512
+#ifdef LTC_SHA512
const struct ltc_hash_descriptor sha512_desc =
{
@@ -305,7 +305,7 @@ int sha512_test(void)
#endif
}
-#ifdef SHA384
+#ifdef LTC_SHA384
#include "sha384.c"
#endif
@@ -314,6 +314,6 @@ int sha512_test(void)
-/* $Source: /cvs/libtom/libtomcrypt/src/hashes/sha2/sha512.c,v $ */
-/* $Revision: 1.8 $ */
-/* $Date: 2006/11/01 09:28:17 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/hashes/tiger.c b/libtomcrypt/src/hashes/tiger.c
index 9a4052c..4d8c659 100644
--- a/libtomcrypt/src/hashes/tiger.c
+++ b/libtomcrypt/src/hashes/tiger.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -16,7 +16,7 @@
Tiger hash function, Tom St Denis
*/
-#ifdef TIGER
+#ifdef LTC_TIGER
const struct ltc_hash_descriptor tiger_desc =
{
@@ -809,6 +809,6 @@ Hash of "ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+-ABCDEFG
-/* $Source: /cvs/libtom/libtomcrypt/src/hashes/tiger.c,v $ */
-/* $Revision: 1.8 $ */
-/* $Date: 2006/11/01 09:28:17 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/hashes/whirl/whirl.c b/libtomcrypt/src/hashes/whirl/whirl.c
index 65e38a7..102d6f1 100644
--- a/libtomcrypt/src/hashes/whirl/whirl.c
+++ b/libtomcrypt/src/hashes/whirl/whirl.c
@@ -6,17 +6,17 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/**
@file whirl.c
- WHIRLPOOL (using their new sbox) hash function by Tom St Denis
+ LTC_WHIRLPOOL (using their new sbox) hash function by Tom St Denis
*/
#include "tomcrypt.h"
-#ifdef WHIRLPOOL
+#ifdef LTC_WHIRLPOOL
const struct ltc_hash_descriptor whirlpool_desc =
{
@@ -309,6 +309,6 @@ int whirlpool_test(void)
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/hashes/whirl/whirl.c,v $ */
-/* $Revision: 1.8 $ */
-/* $Date: 2006/11/01 09:28:17 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/hashes/whirl/whirltab.c b/libtomcrypt/src/hashes/whirl/whirltab.c
index c83d0b2..85ba312 100644
--- a/libtomcrypt/src/hashes/whirl/whirltab.c
+++ b/libtomcrypt/src/hashes/whirl/whirltab.c
@@ -1,6 +1,6 @@
/**
@file whirltab.c
- WHIRLPOOL tables, Tom St Denis
+ LTC_WHIRLPOOL tables, Tom St Denis
*/
static const ulong64 sbox0[] = {
CONST64(0x18186018c07830d8), CONST64(0x23238c2305af4626), CONST64(0xc6c63fc67ef991b8), CONST64(0xe8e887e8136fcdfb),
@@ -578,6 +578,6 @@ CONST64(0x6302aa71c81949d9),
};
-/* $Source: /cvs/libtom/libtomcrypt/src/hashes/whirl/whirltab.c,v $ */
-/* $Revision: 1.2 $ */
-/* $Date: 2005/05/05 14:35:58 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/headers/tomcrypt.h b/libtomcrypt/src/headers/tomcrypt.h
index ba9f181..ad4b7ec 100644
--- a/libtomcrypt/src/headers/tomcrypt.h
+++ b/libtomcrypt/src/headers/tomcrypt.h
@@ -16,8 +16,8 @@ extern "C" {
#endif
/* version */
-#define CRYPT 0x0116
-#define SCRYPT "1.16"
+#define CRYPT 0x0117
+#define SCRYPT "1.17"
/* max size of either a cipher/hash block or symmetric key [largest of the two] */
#define MAXBLOCKSIZE 128
@@ -83,6 +83,6 @@ enum {
#endif /* TOMCRYPT_H_ */
-/* $Source: /cvs/libtom/libtomcrypt/src/headers/tomcrypt.h,v $ */
-/* $Revision: 1.20 $ */
-/* $Date: 2006/11/26 01:45:14 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/headers/tomcrypt_argchk.h b/libtomcrypt/src/headers/tomcrypt_argchk.h
index 38e1bdd..63a6ef0 100644
--- a/libtomcrypt/src/headers/tomcrypt_argchk.h
+++ b/libtomcrypt/src/headers/tomcrypt_argchk.h
@@ -41,6 +41,6 @@ void crypt_argchk(char *v, char *s, int d) ATTRIB_NORETURN;
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/headers/tomcrypt_argchk.h,v $ */
-/* $Revision: 1.5 $ */
-/* $Date: 2006/08/27 20:50:21 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/headers/tomcrypt_cfg.h b/libtomcrypt/src/headers/tomcrypt_cfg.h
index 7feae6e..f7ad3cc 100644
--- a/libtomcrypt/src/headers/tomcrypt_cfg.h
+++ b/libtomcrypt/src/headers/tomcrypt_cfg.h
@@ -131,6 +131,6 @@ LTC_EXPORT int LTC_CALL XSTRCMP(const char *s1, const char *s2);
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/headers/tomcrypt_cfg.h,v $ */
-/* $Revision: 1.19 $ */
-/* $Date: 2006/12/04 02:19:48 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/headers/tomcrypt_cipher.h b/libtomcrypt/src/headers/tomcrypt_cipher.h
index 62a26c7..f23fd97 100644
--- a/libtomcrypt/src/headers/tomcrypt_cipher.h
+++ b/libtomcrypt/src/headers/tomcrypt_cipher.h
@@ -3,41 +3,41 @@
* We put each of the ciphers scheduled keys in their own structs then we put all of
* the key formats in one union. This makes the function prototypes easier to use.
*/
-#ifdef BLOWFISH
+#ifdef LTC_BLOWFISH
struct blowfish_key {
ulong32 S[4][256];
ulong32 K[18];
};
#endif
-#ifdef RC5
+#ifdef LTC_RC5
struct rc5_key {
int rounds;
ulong32 K[50];
};
#endif
-#ifdef RC6
+#ifdef LTC_RC6
struct rc6_key {
ulong32 K[44];
};
#endif
-#ifdef SAFERP
+#ifdef LTC_SAFERP
struct saferp_key {
unsigned char K[33][16];
long rounds;
};
#endif
-#ifdef RIJNDAEL
+#ifdef LTC_RIJNDAEL
struct rijndael_key {
ulong32 eK[60], dK[60];
int Nr;
};
#endif
-#ifdef KSEED
+#ifdef LTC_KSEED
struct kseed_key {
ulong32 K[32], dK[32];
};
@@ -51,14 +51,14 @@ struct kasumi_key {
};
#endif
-#ifdef XTEA
+#ifdef LTC_XTEA
struct xtea_key {
unsigned long A[32], B[32];
};
#endif
-#ifdef TWOFISH
-#ifndef TWOFISH_SMALL
+#ifdef LTC_TWOFISH
+#ifndef LTC_TWOFISH_SMALL
struct twofish_key {
ulong32 S[4][256], K[40];
};
@@ -70,24 +70,24 @@ struct xtea_key {
#endif
#endif
-#ifdef SAFER
-#define SAFER_K64_DEFAULT_NOF_ROUNDS 6
-#define SAFER_K128_DEFAULT_NOF_ROUNDS 10
-#define SAFER_SK64_DEFAULT_NOF_ROUNDS 8
-#define SAFER_SK128_DEFAULT_NOF_ROUNDS 10
-#define SAFER_MAX_NOF_ROUNDS 13
-#define SAFER_BLOCK_LEN 8
-#define SAFER_KEY_LEN (1 + SAFER_BLOCK_LEN * (1 + 2 * SAFER_MAX_NOF_ROUNDS))
-typedef unsigned char safer_block_t[SAFER_BLOCK_LEN];
-typedef unsigned char safer_key_t[SAFER_KEY_LEN];
+#ifdef LTC_SAFER
+#define LTC_SAFER_K64_DEFAULT_NOF_ROUNDS 6
+#define LTC_SAFER_K128_DEFAULT_NOF_ROUNDS 10
+#define LTC_SAFER_SK64_DEFAULT_NOF_ROUNDS 8
+#define LTC_SAFER_SK128_DEFAULT_NOF_ROUNDS 10
+#define LTC_SAFER_MAX_NOF_ROUNDS 13
+#define LTC_SAFER_BLOCK_LEN 8
+#define LTC_SAFER_KEY_LEN (1 + LTC_SAFER_BLOCK_LEN * (1 + 2 * LTC_SAFER_MAX_NOF_ROUNDS))
+typedef unsigned char safer_block_t[LTC_SAFER_BLOCK_LEN];
+typedef unsigned char safer_key_t[LTC_SAFER_KEY_LEN];
struct safer_key { safer_key_t key; };
#endif
-#ifdef RC2
+#ifdef LTC_RC2
struct rc2_key { unsigned xkey[64]; };
#endif
-#ifdef DES
+#ifdef LTC_DES
struct des_key {
ulong32 ek[32], dk[32];
};
@@ -97,32 +97,32 @@ struct des3_key {
};
#endif
-#ifdef CAST5
+#ifdef LTC_CAST5
struct cast5_key {
ulong32 K[32], keylen;
};
#endif
-#ifdef NOEKEON
+#ifdef LTC_NOEKEON
struct noekeon_key {
ulong32 K[4], dK[4];
};
#endif
-#ifdef SKIPJACK
+#ifdef LTC_SKIPJACK
struct skipjack_key {
unsigned char key[10];
};
#endif
-#ifdef KHAZAD
+#ifdef LTC_KHAZAD
struct khazad_key {
ulong64 roundKeyEnc[8 + 1];
ulong64 roundKeyDec[8 + 1];
};
#endif
-#ifdef ANUBIS
+#ifdef LTC_ANUBIS
struct anubis_key {
int keyBits;
int R;
@@ -131,59 +131,69 @@ struct anubis_key {
};
#endif
+#ifdef LTC_MULTI2
+struct multi2_key {
+ int N;
+ ulong32 uk[8];
+};
+#endif
+
typedef union Symmetric_key {
-#ifdef DES
+#ifdef LTC_DES
struct des_key des;
struct des3_key des3;
#endif
-#ifdef RC2
+#ifdef LTC_RC2
struct rc2_key rc2;
#endif
-#ifdef SAFER
+#ifdef LTC_SAFER
struct safer_key safer;
#endif
-#ifdef TWOFISH
+#ifdef LTC_TWOFISH
struct twofish_key twofish;
#endif
-#ifdef BLOWFISH
+#ifdef LTC_BLOWFISH
struct blowfish_key blowfish;
#endif
-#ifdef RC5
+#ifdef LTC_RC5
struct rc5_key rc5;
#endif
-#ifdef RC6
+#ifdef LTC_RC6
struct rc6_key rc6;
#endif
-#ifdef SAFERP
+#ifdef LTC_SAFERP
struct saferp_key saferp;
#endif
-#ifdef RIJNDAEL
+#ifdef LTC_RIJNDAEL
struct rijndael_key rijndael;
#endif
-#ifdef XTEA
+#ifdef LTC_XTEA
struct xtea_key xtea;
#endif
-#ifdef CAST5
+#ifdef LTC_CAST5
struct cast5_key cast5;
#endif
-#ifdef NOEKEON
+#ifdef LTC_NOEKEON
struct noekeon_key noekeon;
#endif
-#ifdef SKIPJACK
+#ifdef LTC_SKIPJACK
struct skipjack_key skipjack;
#endif
-#ifdef KHAZAD
+#ifdef LTC_KHAZAD
struct khazad_key khazad;
#endif
-#ifdef ANUBIS
+#ifdef LTC_ANUBIS
struct anubis_key anubis;
#endif
-#ifdef KSEED
+#ifdef LTC_KSEED
struct kseed_key kseed;
#endif
#ifdef LTC_KASUMI
struct kasumi_key kasumi;
#endif
+#ifdef LTC_MULTI2
+ struct multi2_key multi2;
+#endif
void *data;
} symmetric_key;
@@ -257,8 +267,11 @@ typedef struct {
blocklen,
/** The padding offset */
padlen,
- /** The mode (endianess) of the CTR, 0==little, 1==big */
- mode;
+ /** The mode (endianess) of the CTR, 0==little, 1==big */
+ mode,
+ /** counter width */
+ ctrlen;
+
/** The counter */
unsigned char ctr[MAXBLOCKSIZE],
/** The pad used to encrypt/decrypt */
@@ -488,7 +501,7 @@ extern struct ltc_cipher_descriptor {
unsigned char *tag, unsigned long *taglen,
int direction);
- /** Accelerated one shot OMAC
+ /** Accelerated one shot LTC_OMAC
@param key The secret key
@param keylen The key length (octets)
@param in The message
@@ -532,7 +545,7 @@ extern struct ltc_cipher_descriptor {
unsigned char *out, unsigned long *outlen);
} cipher_descriptor[];
-#ifdef BLOWFISH
+#ifdef LTC_BLOWFISH
int blowfish_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey);
int blowfish_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key *skey);
int blowfish_ecb_decrypt(const unsigned char *ct, unsigned char *pt, symmetric_key *skey);
@@ -542,7 +555,7 @@ int blowfish_keysize(int *keysize);
extern const struct ltc_cipher_descriptor blowfish_desc;
#endif
-#ifdef RC5
+#ifdef LTC_RC5
int rc5_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey);
int rc5_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key *skey);
int rc5_ecb_decrypt(const unsigned char *ct, unsigned char *pt, symmetric_key *skey);
@@ -552,7 +565,7 @@ int rc5_keysize(int *keysize);
extern const struct ltc_cipher_descriptor rc5_desc;
#endif
-#ifdef RC6
+#ifdef LTC_RC6
int rc6_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey);
int rc6_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key *skey);
int rc6_ecb_decrypt(const unsigned char *ct, unsigned char *pt, symmetric_key *skey);
@@ -562,7 +575,7 @@ int rc6_keysize(int *keysize);
extern const struct ltc_cipher_descriptor rc6_desc;
#endif
-#ifdef RC2
+#ifdef LTC_RC2
int rc2_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey);
int rc2_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key *skey);
int rc2_ecb_decrypt(const unsigned char *ct, unsigned char *pt, symmetric_key *skey);
@@ -572,7 +585,7 @@ int rc2_keysize(int *keysize);
extern const struct ltc_cipher_descriptor rc2_desc;
#endif
-#ifdef SAFERP
+#ifdef LTC_SAFERP
int saferp_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey);
int saferp_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key *skey);
int saferp_ecb_decrypt(const unsigned char *ct, unsigned char *pt, symmetric_key *skey);
@@ -582,7 +595,7 @@ int saferp_keysize(int *keysize);
extern const struct ltc_cipher_descriptor saferp_desc;
#endif
-#ifdef SAFER
+#ifdef LTC_SAFER
int safer_k64_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey);
int safer_sk64_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey);
int safer_k128_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey);
@@ -598,7 +611,7 @@ int safer_128_keysize(int *keysize);
extern const struct ltc_cipher_descriptor safer_k64_desc, safer_k128_desc, safer_sk64_desc, safer_sk128_desc;
#endif
-#ifdef RIJNDAEL
+#ifdef LTC_RIJNDAEL
/* make aes an alias */
#define aes_setup rijndael_setup
@@ -626,7 +639,7 @@ extern const struct ltc_cipher_descriptor rijndael_desc, aes_desc;
extern const struct ltc_cipher_descriptor rijndael_enc_desc, aes_enc_desc;
#endif
-#ifdef XTEA
+#ifdef LTC_XTEA
int xtea_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey);
int xtea_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key *skey);
int xtea_ecb_decrypt(const unsigned char *ct, unsigned char *pt, symmetric_key *skey);
@@ -636,7 +649,7 @@ int xtea_keysize(int *keysize);
extern const struct ltc_cipher_descriptor xtea_desc;
#endif
-#ifdef TWOFISH
+#ifdef LTC_TWOFISH
int twofish_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey);
int twofish_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key *skey);
int twofish_ecb_decrypt(const unsigned char *ct, unsigned char *pt, symmetric_key *skey);
@@ -646,7 +659,7 @@ int twofish_keysize(int *keysize);
extern const struct ltc_cipher_descriptor twofish_desc;
#endif
-#ifdef DES
+#ifdef LTC_DES
int des_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey);
int des_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key *skey);
int des_ecb_decrypt(const unsigned char *ct, unsigned char *pt, symmetric_key *skey);
@@ -662,7 +675,7 @@ int des3_keysize(int *keysize);
extern const struct ltc_cipher_descriptor des_desc, des3_desc;
#endif
-#ifdef CAST5
+#ifdef LTC_CAST5
int cast5_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey);
int cast5_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key *skey);
int cast5_ecb_decrypt(const unsigned char *ct, unsigned char *pt, symmetric_key *skey);
@@ -672,7 +685,7 @@ int cast5_keysize(int *keysize);
extern const struct ltc_cipher_descriptor cast5_desc;
#endif
-#ifdef NOEKEON
+#ifdef LTC_NOEKEON
int noekeon_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey);
int noekeon_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key *skey);
int noekeon_ecb_decrypt(const unsigned char *ct, unsigned char *pt, symmetric_key *skey);
@@ -682,7 +695,7 @@ int noekeon_keysize(int *keysize);
extern const struct ltc_cipher_descriptor noekeon_desc;
#endif
-#ifdef SKIPJACK
+#ifdef LTC_SKIPJACK
int skipjack_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey);
int skipjack_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key *skey);
int skipjack_ecb_decrypt(const unsigned char *ct, unsigned char *pt, symmetric_key *skey);
@@ -692,7 +705,7 @@ int skipjack_keysize(int *keysize);
extern const struct ltc_cipher_descriptor skipjack_desc;
#endif
-#ifdef KHAZAD
+#ifdef LTC_KHAZAD
int khazad_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey);
int khazad_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key *skey);
int khazad_ecb_decrypt(const unsigned char *ct, unsigned char *pt, symmetric_key *skey);
@@ -702,7 +715,7 @@ int khazad_keysize(int *keysize);
extern const struct ltc_cipher_descriptor khazad_desc;
#endif
-#ifdef ANUBIS
+#ifdef LTC_ANUBIS
int anubis_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey);
int anubis_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key *skey);
int anubis_ecb_decrypt(const unsigned char *ct, unsigned char *pt, symmetric_key *skey);
@@ -712,7 +725,7 @@ int anubis_keysize(int *keysize);
extern const struct ltc_cipher_descriptor anubis_desc;
#endif
-#ifdef KSEED
+#ifdef LTC_KSEED
int kseed_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey);
int kseed_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key *skey);
int kseed_ecb_decrypt(const unsigned char *ct, unsigned char *pt, symmetric_key *skey);
@@ -732,6 +745,17 @@ int kasumi_keysize(int *keysize);
extern const struct ltc_cipher_descriptor kasumi_desc;
#endif
+
+#ifdef LTC_MULTI2
+int multi2_setup(const unsigned char *key, int keylen, int num_rounds, symmetric_key *skey);
+int multi2_ecb_encrypt(const unsigned char *pt, unsigned char *ct, symmetric_key *skey);
+int multi2_ecb_decrypt(const unsigned char *ct, unsigned char *pt, symmetric_key *skey);
+int multi2_test(void);
+void multi2_done(symmetric_key *skey);
+int multi2_keysize(int *keysize);
+extern const struct ltc_cipher_descriptor multi2_desc;
+#endif
+
#ifdef LTC_ECB_MODE
int ecb_start(int cipher, const unsigned char *key,
int keylen, int num_rounds, symmetric_ECB *ecb);
@@ -772,9 +796,9 @@ int cbc_done(symmetric_CBC *cbc);
#ifdef LTC_CTR_MODE
-#define CTR_COUNTER_LITTLE_ENDIAN 0
-#define CTR_COUNTER_BIG_ENDIAN 1
-#define LTC_CTR_RFC3686 2
+#define CTR_COUNTER_LITTLE_ENDIAN 0x0000
+#define CTR_COUNTER_BIG_ENDIAN 0x1000
+#define LTC_CTR_RFC3686 0x2000
int ctr_start( int cipher,
const unsigned char *IV,
@@ -824,6 +848,34 @@ int f8_done(symmetric_F8 *f8);
int f8_test_mode(void);
#endif
+#ifdef LTC_XTS_MODE
+typedef struct {
+ symmetric_key key1, key2;
+ int cipher;
+} symmetric_xts;
+
+int xts_start( int cipher,
+ const unsigned char *key1,
+ const unsigned char *key2,
+ unsigned long keylen,
+ int num_rounds,
+ symmetric_xts *xts);
+
+int xts_encrypt(
+ const unsigned char *pt, unsigned long ptlen,
+ unsigned char *ct,
+ const unsigned char *tweak,
+ symmetric_xts *xts);
+int xts_decrypt(
+ const unsigned char *ct, unsigned long ptlen,
+ unsigned char *pt,
+ const unsigned char *tweak,
+ symmetric_xts *xts);
+
+void xts_done(symmetric_xts *xts);
+int xts_test(void);
+void xts_mult_x(unsigned char *I);
+#endif
int find_cipher(const char *name);
int find_cipher_any(const char *name, int blocklen, int keylen);
@@ -834,6 +886,6 @@ int cipher_is_valid(int idx);
LTC_MUTEX_PROTO(ltc_cipher_mutex)
-/* $Source: /cvs/libtom/libtomcrypt/src/headers/tomcrypt_cipher.h,v $ */
-/* $Revision: 1.46 $ */
-/* $Date: 2006/11/13 23:09:38 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/headers/tomcrypt_custom.h b/libtomcrypt/src/headers/tomcrypt_custom.h
index 82cb26e..b6f4f1f 100644
--- a/libtomcrypt/src/headers/tomcrypt_custom.h
+++ b/libtomcrypt/src/headers/tomcrypt_custom.h
@@ -69,6 +69,13 @@
#endif
/* These spit out warnings etc */
#define LTC_NO_ROLC
+#ifndef XQSORT
+ #ifdef qsort
+ #define LTC_NO_PROTOTYPES
+ #endif
+#define XQSORT qsort
+#endif
+
/* Enable self-test test vector checking */
/* Not for dropbear */
@@ -91,25 +98,27 @@
#ifdef DROPBEAR_BLOWFISH
-#define BLOWFISH
+#define LTC_BLOWFISH
#endif
#ifdef DROPBEAR_AES
-#define RIJNDAEL
+#define LTC_RIJNDAEL
#endif
#ifdef DROPBEAR_TWOFISH
-#define TWOFISH
+#define LTC_TWOFISH
+/* _TABLES tells it to use tables during setup, _SMALL means to use the smaller scheduled key format
+ * (saves 4KB of ram), _ALL_TABLES enables all tables during setup */
/* enabling just TWOFISH_SMALL will make the binary ~1kB smaller, turning on
* TWOFISH_TABLES will make it a few kB bigger, but perhaps reduces runtime
* memory usage? */
-#define TWOFISH_SMALL
-/*#define TWOFISH_TABLES*/
+#define LTC_TWOFISH_SMALL
+/*#define LTC_TWOFISH_TABLES*/
#endif
#ifdef DROPBEAR_3DES
-#define DES
+#define LTC_DES
#endif
#define LTC_CBC_MODE
@@ -118,26 +127,26 @@
#define LTC_CTR_MODE
#endif
-#define SHA1
+#define LTC_SHA1
#ifdef DROPBEAR_MD5
-#define MD5
+#define LTC_MD5
#endif
#ifdef DROPBEAR_SHA256
-#define SHA256
+#define LTC_SHA256
#endif
#ifdef DROPBEAR_SHA384
-#define SHA384
+#define LTC_SHA384
#endif
#ifdef DROPBEAR_SHA512
-#define SHA512
+#define LTC_SHA512
#endif
#define LTC_HMAC
#ifdef DROPBEAR_ECC
-#define MECC
+#define LTC_MECC
#define LTC_ECC_SHAMIR
#define LTC_ECC_TIMING_RESISTANT
#define MPI
@@ -154,7 +163,7 @@
#endif
/* Various tidbits of modern neatoness */
-#define BASE64
+#define LTC_BASE64
/* default no pthread functions */
#define LTC_MUTEX_GLOBAL(x)
@@ -167,13 +176,13 @@
/* Debuggers */
-/* define this if you use Valgrind, note: it CHANGES the way SOBER-128 and RC4 work (see the code) */
+/* define this if you use Valgrind, note: it CHANGES the way SOBER-128 and LTC_RC4 work (see the code) */
/* #define LTC_VALGRIND */
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/headers/tomcrypt_custom.h,v $ */
-/* $Revision: 1.66 $ */
-/* $Date: 2006/12/04 02:50:11 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/headers/tomcrypt_hash.h b/libtomcrypt/src/headers/tomcrypt_hash.h
index d9916ac..56b272a 100644
--- a/libtomcrypt/src/headers/tomcrypt_hash.h
+++ b/libtomcrypt/src/headers/tomcrypt_hash.h
@@ -1,5 +1,5 @@
/* ---- HASH FUNCTIONS ---- */
-#ifdef SHA512
+#ifdef LTC_SHA512
struct sha512_state {
ulong64 length, state[8];
unsigned long curlen;
@@ -7,7 +7,7 @@ struct sha512_state {
};
#endif
-#ifdef SHA256
+#ifdef LTC_SHA256
struct sha256_state {
ulong64 length;
ulong32 state[8], curlen;
@@ -15,7 +15,7 @@ struct sha256_state {
};
#endif
-#ifdef SHA1
+#ifdef LTC_SHA1
struct sha1_state {
ulong64 length;
ulong32 state[5], curlen;
@@ -23,7 +23,7 @@ struct sha1_state {
};
#endif
-#ifdef MD5
+#ifdef LTC_MD5
struct md5_state {
ulong64 length;
ulong32 state[4], curlen;
@@ -31,7 +31,7 @@ struct md5_state {
};
#endif
-#ifdef MD4
+#ifdef LTC_MD4
struct md4_state {
ulong64 length;
ulong32 state[4], curlen;
@@ -39,7 +39,7 @@ struct md4_state {
};
#endif
-#ifdef TIGER
+#ifdef LTC_TIGER
struct tiger_state {
ulong64 state[3], length;
unsigned long curlen;
@@ -47,14 +47,14 @@ struct tiger_state {
};
#endif
-#ifdef MD2
+#ifdef LTC_MD2
struct md2_state {
unsigned char chksum[16], X[48], buf[16];
unsigned long curlen;
};
#endif
-#ifdef RIPEMD128
+#ifdef LTC_RIPEMD128
struct rmd128_state {
ulong64 length;
unsigned char buf[64];
@@ -62,7 +62,7 @@ struct rmd128_state {
};
#endif
-#ifdef RIPEMD160
+#ifdef LTC_RIPEMD160
struct rmd160_state {
ulong64 length;
unsigned char buf[64];
@@ -70,7 +70,7 @@ struct rmd160_state {
};
#endif
-#ifdef RIPEMD256
+#ifdef LTC_RIPEMD256
struct rmd256_state {
ulong64 length;
unsigned char buf[64];
@@ -78,7 +78,7 @@ struct rmd256_state {
};
#endif
-#ifdef RIPEMD320
+#ifdef LTC_RIPEMD320
struct rmd320_state {
ulong64 length;
unsigned char buf[64];
@@ -86,7 +86,7 @@ struct rmd320_state {
};
#endif
-#ifdef WHIRLPOOL
+#ifdef LTC_WHIRLPOOL
struct whirlpool_state {
ulong64 length, state[8];
unsigned char buf[64];
@@ -94,7 +94,7 @@ struct whirlpool_state {
};
#endif
-#ifdef CHC_HASH
+#ifdef LTC_CHC_HASH
struct chc_state {
ulong64 length;
unsigned char state[MAXBLOCKSIZE], buf[MAXBLOCKSIZE];
@@ -104,43 +104,43 @@ struct chc_state {
typedef union Hash_state {
char dummy[1];
-#ifdef CHC_HASH
+#ifdef LTC_CHC_HASH
struct chc_state chc;
#endif
-#ifdef WHIRLPOOL
+#ifdef LTC_WHIRLPOOL
struct whirlpool_state whirlpool;
#endif
-#ifdef SHA512
+#ifdef LTC_SHA512
struct sha512_state sha512;
#endif
-#ifdef SHA256
+#ifdef LTC_SHA256
struct sha256_state sha256;
#endif
-#ifdef SHA1
+#ifdef LTC_SHA1
struct sha1_state sha1;
#endif
-#ifdef MD5
+#ifdef LTC_MD5
struct md5_state md5;
#endif
-#ifdef MD4
+#ifdef LTC_MD4
struct md4_state md4;
#endif
-#ifdef MD2
+#ifdef LTC_MD2
struct md2_state md2;
#endif
-#ifdef TIGER
+#ifdef LTC_TIGER
struct tiger_state tiger;
#endif
-#ifdef RIPEMD128
+#ifdef LTC_RIPEMD128
struct rmd128_state rmd128;
#endif
-#ifdef RIPEMD160
+#ifdef LTC_RIPEMD160
struct rmd160_state rmd160;
#endif
-#ifdef RIPEMD256
+#ifdef LTC_RIPEMD256
struct rmd256_state rmd256;
#endif
-#ifdef RIPEMD320
+#ifdef LTC_RIPEMD320
struct rmd320_state rmd320;
#endif
void *data;
@@ -191,7 +191,7 @@ extern struct ltc_hash_descriptor {
} hash_descriptor[];
-#ifdef CHC_HASH
+#ifdef LTC_CHC_HASH
int chc_register(int cipher);
int chc_init(hash_state * md);
int chc_process(hash_state * md, const unsigned char *in, unsigned long inlen);
@@ -200,7 +200,7 @@ int chc_test(void);
extern const struct ltc_hash_descriptor chc_desc;
#endif
-#ifdef WHIRLPOOL
+#ifdef LTC_WHIRLPOOL
int whirlpool_init(hash_state * md);
int whirlpool_process(hash_state * md, const unsigned char *in, unsigned long inlen);
int whirlpool_done(hash_state * md, unsigned char *hash);
@@ -208,7 +208,7 @@ int whirlpool_test(void);
extern const struct ltc_hash_descriptor whirlpool_desc;
#endif
-#ifdef SHA512
+#ifdef LTC_SHA512
int sha512_init(hash_state * md);
int sha512_process(hash_state * md, const unsigned char *in, unsigned long inlen);
int sha512_done(hash_state * md, unsigned char *hash);
@@ -216,9 +216,9 @@ int sha512_test(void);
extern const struct ltc_hash_descriptor sha512_desc;
#endif
-#ifdef SHA384
-#ifndef SHA512
- #error SHA512 is required for SHA384
+#ifdef LTC_SHA384
+#ifndef LTC_SHA512
+ #error LTC_SHA512 is required for LTC_SHA384
#endif
int sha384_init(hash_state * md);
#define sha384_process sha512_process
@@ -227,16 +227,16 @@ int sha384_test(void);
extern const struct ltc_hash_descriptor sha384_desc;
#endif
-#ifdef SHA256
+#ifdef LTC_SHA256
int sha256_init(hash_state * md);
int sha256_process(hash_state * md, const unsigned char *in, unsigned long inlen);
int sha256_done(hash_state * md, unsigned char *hash);
int sha256_test(void);
extern const struct ltc_hash_descriptor sha256_desc;
-#ifdef SHA224
-#ifndef SHA256
- #error SHA256 is required for SHA224
+#ifdef LTC_SHA224
+#ifndef LTC_SHA256
+ #error LTC_SHA256 is required for LTC_SHA224
#endif
int sha224_init(hash_state * md);
#define sha224_process sha256_process
@@ -246,7 +246,7 @@ extern const struct ltc_hash_descriptor sha224_desc;
#endif
#endif
-#ifdef SHA1
+#ifdef LTC_SHA1
int sha1_init(hash_state * md);
int sha1_process(hash_state * md, const unsigned char *in, unsigned long inlen);
int sha1_done(hash_state * md, unsigned char *hash);
@@ -254,7 +254,7 @@ int sha1_test(void);
extern const struct ltc_hash_descriptor sha1_desc;
#endif
-#ifdef MD5
+#ifdef LTC_MD5
int md5_init(hash_state * md);
int md5_process(hash_state * md, const unsigned char *in, unsigned long inlen);
int md5_done(hash_state * md, unsigned char *hash);
@@ -262,7 +262,7 @@ int md5_test(void);
extern const struct ltc_hash_descriptor md5_desc;
#endif
-#ifdef MD4
+#ifdef LTC_MD4
int md4_init(hash_state * md);
int md4_process(hash_state * md, const unsigned char *in, unsigned long inlen);
int md4_done(hash_state * md, unsigned char *hash);
@@ -270,7 +270,7 @@ int md4_test(void);
extern const struct ltc_hash_descriptor md4_desc;
#endif
-#ifdef MD2
+#ifdef LTC_MD2
int md2_init(hash_state * md);
int md2_process(hash_state * md, const unsigned char *in, unsigned long inlen);
int md2_done(hash_state * md, unsigned char *hash);
@@ -278,7 +278,7 @@ int md2_test(void);
extern const struct ltc_hash_descriptor md2_desc;
#endif
-#ifdef TIGER
+#ifdef LTC_TIGER
int tiger_init(hash_state * md);
int tiger_process(hash_state * md, const unsigned char *in, unsigned long inlen);
int tiger_done(hash_state * md, unsigned char *hash);
@@ -286,7 +286,7 @@ int tiger_test(void);
extern const struct ltc_hash_descriptor tiger_desc;
#endif
-#ifdef RIPEMD128
+#ifdef LTC_RIPEMD128
int rmd128_init(hash_state * md);
int rmd128_process(hash_state * md, const unsigned char *in, unsigned long inlen);
int rmd128_done(hash_state * md, unsigned char *hash);
@@ -294,7 +294,7 @@ int rmd128_test(void);
extern const struct ltc_hash_descriptor rmd128_desc;
#endif
-#ifdef RIPEMD160
+#ifdef LTC_RIPEMD160
int rmd160_init(hash_state * md);
int rmd160_process(hash_state * md, const unsigned char *in, unsigned long inlen);
int rmd160_done(hash_state * md, unsigned char *hash);
@@ -302,7 +302,7 @@ int rmd160_test(void);
extern const struct ltc_hash_descriptor rmd160_desc;
#endif
-#ifdef RIPEMD256
+#ifdef LTC_RIPEMD256
int rmd256_init(hash_state * md);
int rmd256_process(hash_state * md, const unsigned char *in, unsigned long inlen);
int rmd256_done(hash_state * md, unsigned char *hash);
@@ -310,7 +310,7 @@ int rmd256_test(void);
extern const struct ltc_hash_descriptor rmd256_desc;
#endif
-#ifdef RIPEMD320
+#ifdef LTC_RIPEMD320
int rmd320_init(hash_state * md);
int rmd320_process(hash_state * md, const unsigned char *in, unsigned long inlen);
int rmd320_done(hash_state * md, unsigned char *hash);
@@ -374,6 +374,6 @@ int func_name (hash_state * md, const unsigned char *in, unsigned long inlen)
return CRYPT_OK; \
}
-/* $Source: /cvs/libtom/libtomcrypt/src/headers/tomcrypt_hash.h,v $ */
-/* $Revision: 1.19 $ */
-/* $Date: 2006/11/05 01:36:43 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/headers/tomcrypt_mac.h b/libtomcrypt/src/headers/tomcrypt_mac.h
index 42bf680..d030d73 100644
--- a/libtomcrypt/src/headers/tomcrypt_mac.h
+++ b/libtomcrypt/src/headers/tomcrypt_mac.h
@@ -51,7 +51,7 @@ int omac_file(int cipher,
const char *filename,
unsigned char *out, unsigned long *outlen);
int omac_test(void);
-#endif /* OMAC */
+#endif /* LTC_OMAC */
#ifdef LTC_PMAC
@@ -96,10 +96,10 @@ void pmac_shift_xor(pmac_state *pmac);
#endif /* PMAC */
-#ifdef EAX_MODE
+#ifdef LTC_EAX_MODE
#if !(defined(LTC_OMAC) && defined(LTC_CTR_MODE))
- #error EAX_MODE requires OMAC and CTR
+ #error LTC_EAX_MODE requires LTC_OMAC and CTR
#endif
typedef struct {
@@ -137,7 +137,7 @@ int eax_decrypt_verify_memory(int cipher,
int eax_test(void);
#endif /* EAX MODE */
-#ifdef OCB_MODE
+#ifdef LTC_OCB_MODE
typedef struct {
unsigned char L[MAXBLOCKSIZE], /* L value */
Ls[32][MAXBLOCKSIZE], /* L shifted by i bits to the left */
@@ -191,9 +191,9 @@ int ocb_ntz(unsigned long x);
int s_ocb_done(ocb_state *ocb, const unsigned char *pt, unsigned long ptlen,
unsigned char *ct, unsigned char *tag, unsigned long *taglen, int mode);
-#endif /* OCB_MODE */
+#endif /* LTC_OCB_MODE */
-#ifdef CCM_MODE
+#ifdef LTC_CCM_MODE
#define CCM_ENCRYPT 0
#define CCM_DECRYPT 1
@@ -210,26 +210,26 @@ int ccm_memory(int cipher,
int ccm_test(void);
-#endif /* CCM_MODE */
+#endif /* LTC_CCM_MODE */
-#if defined(LRW_MODE) || defined(GCM_MODE)
+#if defined(LRW_MODE) || defined(LTC_GCM_MODE)
void gcm_gf_mult(const unsigned char *a, const unsigned char *b, unsigned char *c);
#endif
/* table shared between GCM and LRW */
-#if defined(GCM_TABLES) || defined(LRW_TABLES) || ((defined(GCM_MODE) || defined(GCM_MODE)) && defined(LTC_FAST))
+#if defined(LTC_GCM_TABLES) || defined(LRW_TABLES) || ((defined(LTC_GCM_MODE) || defined(LTC_GCM_MODE)) && defined(LTC_FAST))
extern const unsigned char gcm_shift_table[];
#endif
-#ifdef GCM_MODE
+#ifdef LTC_GCM_MODE
#define GCM_ENCRYPT 0
#define GCM_DECRYPT 1
-#define GCM_MODE_IV 0
-#define GCM_MODE_AAD 1
-#define GCM_MODE_TEXT 2
+#define LTC_GCM_MODE_IV 0
+#define LTC_GCM_MODE_AAD 1
+#define LTC_GCM_MODE_TEXT 2
typedef struct {
symmetric_key K;
@@ -247,9 +247,9 @@ typedef struct {
ulong64 totlen, /* 64-bit counter used for IV and AAD */
pttotlen; /* 64-bit counter for the PT */
-#ifdef GCM_TABLES
+#ifdef LTC_GCM_TABLES
unsigned char PC[16][256][16] /* 16 tables of 8x128 */
-#ifdef GCM_TABLES_SSE2
+#ifdef LTC_GCM_TABLES_SSE2
__attribute__ ((aligned (16)))
#endif
;
@@ -287,9 +287,9 @@ int gcm_memory( int cipher,
int direction);
int gcm_test(void);
-#endif /* GCM_MODE */
+#endif /* LTC_GCM_MODE */
-#ifdef PELICAN
+#ifdef LTC_PELICAN
typedef struct pelican_state
{
@@ -311,6 +311,9 @@ int pelican_memory(const unsigned char *key, unsigned long keylen,
#ifdef LTC_XCBC
+/* add this to "keylen" to xcbc_init to use a pure three-key XCBC MAC */
+#define LTC_XCBC_PURE 0x8000UL
+
typedef struct {
unsigned char K[3][MAXBLOCKSIZE],
IV[MAXBLOCKSIZE];
@@ -376,6 +379,6 @@ int f9_test(void);
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/headers/tomcrypt_mac.h,v $ */
-/* $Revision: 1.20 $ */
-/* $Date: 2006/11/08 21:57:04 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/headers/tomcrypt_macros.h b/libtomcrypt/src/headers/tomcrypt_macros.h
index 53bda9b..6e4d757 100644
--- a/libtomcrypt/src/headers/tomcrypt_macros.h
+++ b/libtomcrypt/src/headers/tomcrypt_macros.h
@@ -419,6 +419,6 @@ static inline unsigned long ROR64c(unsigned long word, const int i)
#define byte(x, n) (((x) >> (8 * (n))) & 255)
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/headers/tomcrypt_macros.h,v $ */
-/* $Revision: 1.15 $ */
-/* $Date: 2006/11/29 23:43:57 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/headers/tomcrypt_math.h b/libtomcrypt/src/headers/tomcrypt_math.h
index c996e41..aee6105 100644
--- a/libtomcrypt/src/headers/tomcrypt_math.h
+++ b/libtomcrypt/src/headers/tomcrypt_math.h
@@ -7,11 +7,11 @@
#define LTC_MP_NO 0
#define LTC_MP_YES 1
-#ifndef MECC
+#ifndef LTC_MECC
typedef void ecc_point;
#endif
-#ifndef MRSA
+#ifndef LTC_MRSA
typedef void rsa_key;
#endif
@@ -495,6 +495,6 @@ extern const ltc_math_descriptor gmp_desc;
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/headers/tomcrypt_math.h,v $ */
-/* $Revision: 1.43 $ */
-/* $Date: 2006/12/02 19:23:13 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/headers/tomcrypt_misc.h b/libtomcrypt/src/headers/tomcrypt_misc.h
index 0b444f8..239ad77 100644
--- a/libtomcrypt/src/headers/tomcrypt_misc.h
+++ b/libtomcrypt/src/headers/tomcrypt_misc.h
@@ -1,5 +1,5 @@
-/* ---- BASE64 Routines ---- */
-#ifdef BASE64
+/* ---- LTC_BASE64 Routines ---- */
+#ifdef LTC_BASE64
int base64_encode(const unsigned char *in, unsigned long len,
unsigned char *out, unsigned long *outlen);
@@ -18,6 +18,6 @@ extern const char *crypt_build_settings;
/* ---- HMM ---- */
int crypt_fsa(void *mp, ...);
-/* $Source: /cvs/libtom/libtomcrypt/src/headers/tomcrypt_misc.h,v $ */
-/* $Revision: 1.4 $ */
-/* $Date: 2006/11/06 03:03:01 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/headers/tomcrypt_pk.h b/libtomcrypt/src/headers/tomcrypt_pk.h
index 3a0d7ab..cc05f6c 100644
--- a/libtomcrypt/src/headers/tomcrypt_pk.h
+++ b/libtomcrypt/src/headers/tomcrypt_pk.h
@@ -8,13 +8,13 @@ enum {
int rand_prime(void *N, long len, prng_state *prng, int wprng);
/* ---- RSA ---- */
-#ifdef MRSA
+#ifdef LTC_MRSA
/* Min and Max RSA key sizes (in bits) */
#define MIN_RSA_SIZE 1024
#define MAX_RSA_SIZE 4096
-/** RSA PKCS style key */
+/** RSA LTC_PKCS style key */
typedef struct Rsa_key {
/** Type of key, PK_PRIVATE or PK_PUBLIC */
int type;
@@ -44,20 +44,20 @@ int rsa_exptmod(const unsigned char *in, unsigned long inlen,
void rsa_free(rsa_key *key);
-/* These use PKCS #1 v2.0 padding */
+/* These use LTC_PKCS #1 v2.0 padding */
#define rsa_encrypt_key(_in, _inlen, _out, _outlen, _lparam, _lparamlen, _prng, _prng_idx, _hash_idx, _key) \
- rsa_encrypt_key_ex(_in, _inlen, _out, _outlen, _lparam, _lparamlen, _prng, _prng_idx, _hash_idx, LTC_PKCS_1_OAEP, _key)
+ rsa_encrypt_key_ex(_in, _inlen, _out, _outlen, _lparam, _lparamlen, _prng, _prng_idx, _hash_idx, LTC_LTC_PKCS_1_OAEP, _key)
#define rsa_decrypt_key(_in, _inlen, _out, _outlen, _lparam, _lparamlen, _hash_idx, _stat, _key) \
- rsa_decrypt_key_ex(_in, _inlen, _out, _outlen, _lparam, _lparamlen, _hash_idx, LTC_PKCS_1_OAEP, _stat, _key)
+ rsa_decrypt_key_ex(_in, _inlen, _out, _outlen, _lparam, _lparamlen, _hash_idx, LTC_LTC_PKCS_1_OAEP, _stat, _key)
#define rsa_sign_hash(_in, _inlen, _out, _outlen, _prng, _prng_idx, _hash_idx, _saltlen, _key) \
- rsa_sign_hash_ex(_in, _inlen, _out, _outlen, LTC_PKCS_1_PSS, _prng, _prng_idx, _hash_idx, _saltlen, _key)
+ rsa_sign_hash_ex(_in, _inlen, _out, _outlen, LTC_LTC_PKCS_1_PSS, _prng, _prng_idx, _hash_idx, _saltlen, _key)
#define rsa_verify_hash(_sig, _siglen, _hash, _hashlen, _hash_idx, _saltlen, _stat, _key) \
- rsa_verify_hash_ex(_sig, _siglen, _hash, _hashlen, LTC_PKCS_1_PSS, _hash_idx, _saltlen, _stat, _key)
+ rsa_verify_hash_ex(_sig, _siglen, _hash, _hashlen, LTC_LTC_PKCS_1_PSS, _hash_idx, _saltlen, _stat, _key)
-/* These can be switched between PKCS #1 v2.x and PKCS #1 v1.5 paddings */
+/* These can be switched between LTC_PKCS #1 v2.x and LTC_PKCS #1 v1.5 paddings */
int rsa_encrypt_key_ex(const unsigned char *in, unsigned long inlen,
unsigned char *out, unsigned long *outlen,
const unsigned char *lparam, unsigned long lparamlen,
@@ -82,7 +82,7 @@ int rsa_verify_hash_ex(const unsigned char *sig, unsigned long siglen,
int hash_idx, unsigned long saltlen,
int *stat, rsa_key *key);
-/* PKCS #1 import/export */
+/* LTC_PKCS #1 import/export */
int rsa_export(unsigned char *out, unsigned long *outlen, int type, rsa_key *key);
int rsa_import(const unsigned char *in, unsigned long inlen, rsa_key *key);
@@ -95,7 +95,7 @@ int rsa_import(const unsigned char *in, unsigned long inlen, rsa_key *key);
#define MIN_KAT_SIZE 1024
#define MAX_KAT_SIZE 4096
-/** Katja PKCS style key */
+/** Katja LTC_PKCS style key */
typedef struct KAT_key {
/** Type of key, PK_PRIVATE or PK_PUBLIC */
int type;
@@ -125,7 +125,7 @@ int katja_exptmod(const unsigned char *in, unsigned long inlen,
void katja_free(katja_key *key);
-/* These use PKCS #1 v2.0 padding */
+/* These use LTC_PKCS #1 v2.0 padding */
int katja_encrypt_key(const unsigned char *in, unsigned long inlen,
unsigned char *out, unsigned long *outlen,
const unsigned char *lparam, unsigned long lparamlen,
@@ -137,14 +137,14 @@ int katja_decrypt_key(const unsigned char *in, unsigned long inlen,
int hash_idx, int *stat,
katja_key *key);
-/* PKCS #1 import/export */
+/* LTC_PKCS #1 import/export */
int katja_export(unsigned char *out, unsigned long *outlen, int type, katja_key *key);
int katja_import(const unsigned char *in, unsigned long inlen, katja_key *key);
#endif
/* ---- ECC Routines ---- */
-#ifdef MECC
+#ifdef LTC_MECC
/* size of our temp buffers for exported keys */
#define ECC_BUF_SIZE 256
@@ -251,7 +251,7 @@ void ltc_ecc_del_point(ecc_point *p);
int ltc_ecc_is_valid_idx(int n);
/* point ops (mp == montgomery digit) */
-#if !defined(MECC_ACCEL) || defined(LTM_DESC) || defined(GMP_DESC)
+#if !defined(LTC_MECC_ACCEL) || defined(LTM_LTC_DESC) || defined(GMP_LTC_DESC)
/* R = 2P */
int ltc_ecc_projective_dbl_point(ecc_point *P, ecc_point *R, void *modulus, void *mp);
@@ -259,11 +259,18 @@ int ltc_ecc_projective_dbl_point(ecc_point *P, ecc_point *R, void *modulus, void
int ltc_ecc_projective_add_point(ecc_point *P, ecc_point *Q, ecc_point *R, void *modulus, void *mp);
#endif
-#if defined(MECC_FP)
+#if defined(LTC_MECC_FP)
+/* optimized point multiplication using fixed point cache (HAC algorithm 14.117) */
int ltc_ecc_fp_mulmod(void *k, ecc_point *G, ecc_point *R, void *modulus, int map);
+
+/* functions for saving/loading/freeing/adding to fixed point cache */
int ltc_ecc_fp_save_state(unsigned char **out, unsigned long *outlen);
int ltc_ecc_fp_restore_state(unsigned char *in, unsigned long inlen);
void ltc_ecc_fp_free(void);
+int ltc_ecc_fp_add_point(ecc_point *g, void *modulus, int lock);
+
+/* lock/unlock all points currently in fixed point cache */
+void ltc_ecc_fp_tablelock(int lock);
#endif
/* R = kG */
@@ -276,7 +283,8 @@ int ltc_ecc_mul2add(ecc_point *A, void *kA,
ecc_point *C,
void *modulus);
-#ifdef MECC_FP
+#ifdef LTC_MECC_FP
+/* Shamir's trick with optimized point multiplication using fixed point cache */
int ltc_ecc_fp_mul2add(ecc_point *A, void *kA,
ecc_point *B, void *kB,
ecc_point *C, void *modulus);
@@ -290,13 +298,13 @@ int ltc_ecc_map(ecc_point *P, void *modulus, void *mp);
#endif
-#ifdef MDSA
+#ifdef LTC_MDSA
/* Max diff between group and modulus size in bytes */
-#define MDSA_DELTA 512
+#define LTC_MDSA_DELTA 512
/* Max DSA group size in bytes (default allows 4k-bit groups) */
-#define MDSA_MAX_GROUP 512
+#define LTC_MDSA_MAX_GROUP 512
/** DSA key structure */
typedef struct {
@@ -496,7 +504,7 @@ int der_printable_char_encode(int c);
int der_printable_value_decode(int v);
/* UTF-8 */
-#if (defined(SIZE_MAX) || __STDC_VERSION__ >= 199901L || defined(WCHAR_MAX) || defined(_WCHAR_T) || defined(_WCHAR_T_DEFINED)) && !defined(LTC_NO_WCHAR)
+#if (defined(SIZE_MAX) || __STDC_VERSION__ >= 199901L || defined(WCHAR_MAX) || defined(_WCHAR_T) || defined(_WCHAR_T_DEFINED) || defined (__WCHAR_TYPE__)) && !defined(LTC_NO_WCHAR)
#include <wchar.h>
#else
typedef ulong32 wchar_t;
@@ -539,6 +547,6 @@ int der_length_utctime(ltc_utctime *utctime, unsigned long *outlen);
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/headers/tomcrypt_pk.h,v $ */
-/* $Revision: 1.77 $ */
-/* $Date: 2006/12/03 00:39:56 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/headers/tomcrypt_pkcs.h b/libtomcrypt/src/headers/tomcrypt_pkcs.h
index 71bcdb9..8c8c7e4 100644
--- a/libtomcrypt/src/headers/tomcrypt_pkcs.h
+++ b/libtomcrypt/src/headers/tomcrypt_pkcs.h
@@ -1,19 +1,19 @@
-/* PKCS Header Info */
+/* LTC_PKCS Header Info */
-/* ===> PKCS #1 -- RSA Cryptography <=== */
-#ifdef PKCS_1
+/* ===> LTC_PKCS #1 -- RSA Cryptography <=== */
+#ifdef LTC_PKCS_1
enum ltc_pkcs_1_v1_5_blocks
{
- LTC_PKCS_1_EMSA = 1, /* Block type 1 (PKCS #1 v1.5 signature padding) */
- LTC_PKCS_1_EME = 2 /* Block type 2 (PKCS #1 v1.5 encryption padding) */
+ LTC_LTC_PKCS_1_EMSA = 1, /* Block type 1 (LTC_PKCS #1 v1.5 signature padding) */
+ LTC_LTC_PKCS_1_EME = 2 /* Block type 2 (LTC_PKCS #1 v1.5 encryption padding) */
};
enum ltc_pkcs_1_paddings
{
- LTC_PKCS_1_V1_5 = 1, /* PKCS #1 v1.5 padding (\sa ltc_pkcs_1_v1_5_blocks) */
- LTC_PKCS_1_OAEP = 2, /* PKCS #1 v2.0 encryption padding */
- LTC_PKCS_1_PSS = 3 /* PKCS #1 v2.1 signature padding */
+ LTC_LTC_PKCS_1_V1_5 = 1, /* LTC_PKCS #1 v1.5 padding (\sa ltc_pkcs_1_v1_5_blocks) */
+ LTC_LTC_PKCS_1_OAEP = 2, /* LTC_PKCS #1 v2.0 encryption padding */
+ LTC_LTC_PKCS_1_PSS = 3 /* LTC_PKCS #1 v2.1 signature padding */
};
int pkcs_1_mgf1( int hash_idx,
@@ -65,10 +65,10 @@ int pkcs_1_pss_decode(const unsigned char *msghash, unsigned long msghashlen,
unsigned long saltlen, int hash_idx,
unsigned long modulus_bitlen, int *res);
-#endif /* PKCS_1 */
+#endif /* LTC_PKCS_1 */
-/* ===> PKCS #5 -- Password Based Cryptography <=== */
-#ifdef PKCS_5
+/* ===> LTC_PKCS #5 -- Password Based Cryptography <=== */
+#ifdef LTC_PKCS_5
/* Algorithm #1 (old) */
int pkcs_5_alg1(const unsigned char *password, unsigned long password_len,
@@ -82,8 +82,8 @@ int pkcs_5_alg2(const unsigned char *password, unsigned long password_len,
int iteration_count, int hash_idx,
unsigned char *out, unsigned long *outlen);
-#endif /* PKCS_5 */
+#endif /* LTC_PKCS_5 */
-/* $Source: /cvs/libtom/libtomcrypt/src/headers/tomcrypt_pkcs.h,v $ */
-/* $Revision: 1.7 $ */
-/* $Date: 2006/11/15 12:44:59 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/headers/tomcrypt_prng.h b/libtomcrypt/src/headers/tomcrypt_prng.h
index dd640c9..508159d 100644
--- a/libtomcrypt/src/headers/tomcrypt_prng.h
+++ b/libtomcrypt/src/headers/tomcrypt_prng.h
@@ -1,5 +1,5 @@
/* ---- PRNG Stuff ---- */
-#ifdef YARROW
+#ifdef LTC_YARROW
struct yarrow_prng {
int cipher, hash;
unsigned char pool[MAXBLOCKSIZE];
@@ -8,16 +8,16 @@ struct yarrow_prng {
};
#endif
-#ifdef RC4
+#ifdef LTC_RC4
struct rc4_prng {
int x, y;
unsigned char buf[256];
};
#endif
-#ifdef FORTUNA
+#ifdef LTC_FORTUNA
struct fortuna_prng {
- hash_state pool[FORTUNA_POOLS]; /* the pools */
+ hash_state pool[LTC_FORTUNA_POOLS]; /* the pools */
symmetric_key skey;
@@ -33,7 +33,7 @@ struct fortuna_prng {
};
#endif
-#ifdef SOBER128
+#ifdef LTC_SOBER128
struct sober128_prng {
ulong32 R[17], /* Working storage for the shift register */
initR[17], /* saved register contents */
@@ -49,16 +49,16 @@ struct sober128_prng {
typedef union Prng_state {
char dummy[1];
-#ifdef YARROW
+#ifdef LTC_YARROW
struct yarrow_prng yarrow;
#endif
-#ifdef RC4
+#ifdef LTC_RC4
struct rc4_prng rc4;
#endif
-#ifdef FORTUNA
+#ifdef LTC_FORTUNA
struct fortuna_prng fortuna;
#endif
-#ifdef SOBER128
+#ifdef LTC_SOBER128
struct sober128_prng sober128;
#endif
} prng_state;
@@ -118,7 +118,7 @@ extern struct ltc_prng_descriptor {
int (*test)(void);
} prng_descriptor[];
-#ifdef YARROW
+#ifdef LTC_YARROW
int yarrow_start(prng_state *prng);
int yarrow_add_entropy(const unsigned char *in, unsigned long inlen, prng_state *prng);
int yarrow_ready(prng_state *prng);
@@ -130,7 +130,7 @@ int yarrow_test(void);
extern const struct ltc_prng_descriptor yarrow_desc;
#endif
-#ifdef FORTUNA
+#ifdef LTC_FORTUNA
int fortuna_start(prng_state *prng);
int fortuna_add_entropy(const unsigned char *in, unsigned long inlen, prng_state *prng);
int fortuna_ready(prng_state *prng);
@@ -142,7 +142,7 @@ int fortuna_test(void);
extern const struct ltc_prng_descriptor fortuna_desc;
#endif
-#ifdef RC4
+#ifdef LTC_RC4
int rc4_start(prng_state *prng);
int rc4_add_entropy(const unsigned char *in, unsigned long inlen, prng_state *prng);
int rc4_ready(prng_state *prng);
@@ -154,7 +154,7 @@ int rc4_test(void);
extern const struct ltc_prng_descriptor rc4_desc;
#endif
-#ifdef SPRNG
+#ifdef LTC_SPRNG
int sprng_start(prng_state *prng);
int sprng_add_entropy(const unsigned char *in, unsigned long inlen, prng_state *prng);
int sprng_ready(prng_state *prng);
@@ -166,7 +166,7 @@ int sprng_test(void);
extern const struct ltc_prng_descriptor sprng_desc;
#endif
-#ifdef SOBER128
+#ifdef LTC_SOBER128
int sober128_start(prng_state *prng);
int sober128_add_entropy(const unsigned char *in, unsigned long inlen, prng_state *prng);
int sober128_ready(prng_state *prng);
@@ -194,6 +194,6 @@ unsigned long rng_get_bytes(unsigned char *out,
int rng_make_prng(int bits, int wprng, prng_state *prng, void (*callback)(void));
-/* $Source: /cvs/libtom/libtomcrypt/src/headers/tomcrypt_prng.h,v $ */
-/* $Revision: 1.8 $ */
-/* $Date: 2006/11/05 01:36:43 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/mac/f9/f9_done.c b/libtomcrypt/src/mac/f9/f9_done.c
index 1794ecc..8da4c73 100644
--- a/libtomcrypt/src/mac/f9/f9_done.c
+++ b/libtomcrypt/src/mac/f9/f9_done.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -71,7 +71,7 @@ int f9_done(f9_state *f9, unsigned char *out, unsigned long *outlen)
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/mac/f9/f9_done.c,v $ */
-/* $Revision: 1.5 $ */
-/* $Date: 2006/11/09 01:53:32 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/mac/f9/f9_file.c b/libtomcrypt/src/mac/f9/f9_file.c
index 4c53e76..88216a9 100644
--- a/libtomcrypt/src/mac/f9/f9_file.c
+++ b/libtomcrypt/src/mac/f9/f9_file.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -78,6 +78,6 @@ int f9_file(int cipher,
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/mac/f9/f9_file.c,v $ */
-/* $Revision: 1.4 $ */
-/* $Date: 2006/11/21 00:18:23 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/mac/f9/f9_init.c b/libtomcrypt/src/mac/f9/f9_init.c
index aefd8a7..b6b878f 100644
--- a/libtomcrypt/src/mac/f9/f9_init.c
+++ b/libtomcrypt/src/mac/f9/f9_init.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -64,7 +64,7 @@ done:
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/mac/f9/f9_init.c,v $ */
-/* $Revision: 1.4 $ */
-/* $Date: 2006/11/08 22:54:18 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/mac/f9/f9_memory.c b/libtomcrypt/src/mac/f9/f9_memory.c
index 2b3901a..0850dc3 100644
--- a/libtomcrypt/src/mac/f9/f9_memory.c
+++ b/libtomcrypt/src/mac/f9/f9_memory.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -66,6 +66,6 @@ done:
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/mac/f9/f9_memory.c,v $ */
-/* $Revision: 1.4 $ */
-/* $Date: 2006/11/21 23:02:42 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/mac/f9/f9_memory_multi.c b/libtomcrypt/src/mac/f9/f9_memory_multi.c
index 5b315f5..7a13ff9 100644
--- a/libtomcrypt/src/mac/f9/f9_memory_multi.c
+++ b/libtomcrypt/src/mac/f9/f9_memory_multi.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
#include <stdarg.h>
@@ -85,6 +85,6 @@ LBL_ERR:
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/mac/f9/f9_memory_multi.c,v $ */
-/* $Revision: 1.2 $ */
-/* $Date: 2006/11/08 21:50:13 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/mac/f9/f9_process.c b/libtomcrypt/src/mac/f9/f9_process.c
index e8bd88b..bf54d71 100644
--- a/libtomcrypt/src/mac/f9/f9_process.c
+++ b/libtomcrypt/src/mac/f9/f9_process.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -72,7 +72,7 @@ int f9_process(f9_state *f9, const unsigned char *in, unsigned long inlen)
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/mac/f9/f9_process.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/12/16 17:41:21 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/mac/f9/f9_test.c b/libtomcrypt/src/mac/f9/f9_test.c
index 4cddfe6..b92c630 100644
--- a/libtomcrypt/src/mac/f9/f9_test.c
+++ b/libtomcrypt/src/mac/f9/f9_test.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -72,7 +72,7 @@ int f9_test(void)
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/mac/f9/f9_test.c,v $ */
-/* $Revision: 1.8 $ */
-/* $Date: 2006/11/21 23:02:42 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/mac/hmac/hmac_done.c b/libtomcrypt/src/mac/hmac/hmac_done.c
index f48d672..9046110 100644
--- a/libtomcrypt/src/mac/hmac/hmac_done.c
+++ b/libtomcrypt/src/mac/hmac/hmac_done.c
@@ -6,24 +6,24 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
/**
@file hmac_done.c
- HMAC support, terminate stream, Tom St Denis/Dobes Vandermeer
+ LTC_HMAC support, terminate stream, Tom St Denis/Dobes Vandermeer
*/
#ifdef LTC_HMAC
-#define HMAC_BLOCKSIZE hash_descriptor[hash].blocksize
+#define LTC_HMAC_BLOCKSIZE hash_descriptor[hash].blocksize
/**
- Terminate an HMAC session
- @param hmac The HMAC state
- @param out [out] The destination of the HMAC authentication tag
- @param outlen [in/out] The max size and resulting size of the HMAC authentication tag
+ Terminate an LTC_HMAC session
+ @param hmac The LTC_HMAC state
+ @param out [out] The destination of the LTC_HMAC authentication tag
+ @param outlen [in/out] The max size and resulting size of the LTC_HMAC authentication tag
@return CRYPT_OK if successful
*/
int hmac_done(hmac_state *hmac, unsigned char *out, unsigned long *outlen)
@@ -44,13 +44,12 @@ int hmac_done(hmac_state *hmac, unsigned char *out, unsigned long *outlen)
/* get the hash message digest size */
hashsize = hash_descriptor[hash].hashsize;
- /* Get the hash of the first HMAC vector plus the data */
if ((err = hash_descriptor[hash].done(&hmac->md, isha)) != CRYPT_OK) {
goto LBL_ERR;
}
- /* Create the second HMAC vector vector for step (3) */
- for(i=0; i < HMAC_BLOCKSIZE; i++) {
+ /* Create the second LTC_HMAC vector vector for step (3) */
+ for(i=0; i < LTC_HMAC_BLOCKSIZE; i++) {
buf[i] = hmac->key[i] ^ 0x5C;
}
@@ -58,7 +57,7 @@ int hmac_done(hmac_state *hmac, unsigned char *out, unsigned long *outlen)
if ((err = hash_descriptor[hash].init(&hmac->md)) != CRYPT_OK) {
goto LBL_ERR;
}
- if ((err = hash_descriptor[hash].process(&hmac->md, buf, HMAC_BLOCKSIZE)) != CRYPT_OK) {
+ if ((err = hash_descriptor[hash].process(&hmac->md, buf, LTC_HMAC_BLOCKSIZE)) != CRYPT_OK) {
goto LBL_ERR;
}
if ((err = hash_descriptor[hash].process(&hmac->md, isha, hashsize)) != CRYPT_OK) {
@@ -88,6 +87,6 @@ LBL_ERR:
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/mac/hmac/hmac_done.c,v $ */
-/* $Revision: 1.5 $ */
-/* $Date: 2006/11/03 00:39:49 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/mac/hmac/hmac_file.c b/libtomcrypt/src/mac/hmac/hmac_file.c
index d7c40b1..d9841bd 100644
--- a/libtomcrypt/src/mac/hmac/hmac_file.c
+++ b/libtomcrypt/src/mac/hmac/hmac_file.c
@@ -6,24 +6,24 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
/**
@file hmac_file.c
- HMAC support, process a file, Tom St Denis/Dobes Vandermeer
+ LTC_HMAC support, process a file, Tom St Denis/Dobes Vandermeer
*/
#ifdef LTC_HMAC
/**
- HMAC a file
+ LTC_HMAC a file
@param hash The index of the hash you wish to use
- @param fname The name of the file you wish to HMAC
+ @param fname The name of the file you wish to LTC_HMAC
@param key The secret key
@param keylen The length of the secret key
- @param out [out] The HMAC authentication tag
+ @param out [out] The LTC_HMAC authentication tag
@param outlen [in/out] The max size and resulting size of the authentication tag
@return CRYPT_OK if successful, CRYPT_NOP if file support has been disabled
*/
@@ -89,6 +89,6 @@ int hmac_file(int hash, const char *fname,
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/mac/hmac/hmac_file.c,v $ */
-/* $Revision: 1.5 $ */
-/* $Date: 2006/11/03 00:39:49 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/mac/hmac/hmac_init.c b/libtomcrypt/src/mac/hmac/hmac_init.c
index a4a4377..262002e 100644
--- a/libtomcrypt/src/mac/hmac/hmac_init.c
+++ b/libtomcrypt/src/mac/hmac/hmac_init.c
@@ -6,22 +6,22 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
/**
@file hmac_init.c
- HMAC support, initialize state, Tom St Denis/Dobes Vandermeer
+ LTC_HMAC support, initialize state, Tom St Denis/Dobes Vandermeer
*/
#ifdef LTC_HMAC
-#define HMAC_BLOCKSIZE hash_descriptor[hash].blocksize
+#define LTC_HMAC_BLOCKSIZE hash_descriptor[hash].blocksize
/**
- Initialize an HMAC context.
- @param hmac The HMAC state
+ Initialize an LTC_HMAC context.
+ @param hmac The LTC_HMAC state
@param hash The index of the hash you want to use
@param key The secret key
@param keylen The length of the secret key (octets)
@@ -50,30 +50,30 @@ int hmac_init(hmac_state *hmac, int hash, const unsigned char *key, unsigned lon
}
/* allocate memory for key */
- hmac->key = XMALLOC(HMAC_BLOCKSIZE);
+ hmac->key = XMALLOC(LTC_HMAC_BLOCKSIZE);
if (hmac->key == NULL) {
return CRYPT_MEM;
}
/* (1) make sure we have a large enough key */
- if(keylen > HMAC_BLOCKSIZE) {
- z = HMAC_BLOCKSIZE;
+ if(keylen > LTC_HMAC_BLOCKSIZE) {
+ z = LTC_HMAC_BLOCKSIZE;
if ((err = hash_memory(hash, key, keylen, hmac->key, &z)) != CRYPT_OK) {
goto LBL_ERR;
}
- if(hashsize < HMAC_BLOCKSIZE) {
- zeromem((hmac->key) + hashsize, (size_t)(HMAC_BLOCKSIZE - hashsize));
+ if(hashsize < LTC_HMAC_BLOCKSIZE) {
+ zeromem((hmac->key) + hashsize, (size_t)(LTC_HMAC_BLOCKSIZE - hashsize));
}
keylen = hashsize;
} else {
XMEMCPY(hmac->key, key, (size_t)keylen);
- if(keylen < HMAC_BLOCKSIZE) {
- zeromem((hmac->key) + keylen, (size_t)(HMAC_BLOCKSIZE - keylen));
+ if(keylen < LTC_HMAC_BLOCKSIZE) {
+ zeromem((hmac->key) + keylen, (size_t)(LTC_HMAC_BLOCKSIZE - keylen));
}
}
/* Create the initial vector for step (3) */
- for(i=0; i < HMAC_BLOCKSIZE; i++) {
+ for(i=0; i < LTC_HMAC_BLOCKSIZE; i++) {
buf[i] = hmac->key[i] ^ 0x36;
}
@@ -82,7 +82,7 @@ int hmac_init(hmac_state *hmac, int hash, const unsigned char *key, unsigned lon
goto LBL_ERR;
}
- if ((err = hash_descriptor[hash].process(&hmac->md, buf, HMAC_BLOCKSIZE)) != CRYPT_OK) {
+ if ((err = hash_descriptor[hash].process(&hmac->md, buf, LTC_HMAC_BLOCKSIZE)) != CRYPT_OK) {
goto LBL_ERR;
}
goto done;
@@ -91,7 +91,7 @@ LBL_ERR:
XFREE(hmac->key);
done:
#ifdef LTC_CLEAN_STACK
- zeromem(buf, HMAC_BLOCKSIZE);
+ zeromem(buf, LTC_HMAC_BLOCKSIZE);
#endif
return err;
@@ -99,6 +99,6 @@ done:
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/mac/hmac/hmac_init.c,v $ */
-/* $Revision: 1.5 $ */
-/* $Date: 2006/11/03 00:39:49 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/mac/hmac/hmac_memory.c b/libtomcrypt/src/mac/hmac/hmac_memory.c
index 7dc364a..9df80ea 100644
--- a/libtomcrypt/src/mac/hmac/hmac_memory.c
+++ b/libtomcrypt/src/mac/hmac/hmac_memory.c
@@ -6,24 +6,24 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
/**
@file hmac_memory.c
- HMAC support, process a block of memory, Tom St Denis/Dobes Vandermeer
+ LTC_HMAC support, process a block of memory, Tom St Denis/Dobes Vandermeer
*/
#ifdef LTC_HMAC
/**
- HMAC a block of memory to produce the authentication tag
+ LTC_HMAC a block of memory to produce the authentication tag
@param hash The index of the hash to use
@param key The secret key
@param keylen The length of the secret key (octets)
- @param in The data to HMAC
- @param inlen The length of the data to HMAC (octets)
+ @param in The data to LTC_HMAC
+ @param inlen The length of the data to LTC_HMAC (octets)
@param out [out] Destination of the authentication tag
@param outlen [in/out] Max size and resulting size of authentication tag
@return CRYPT_OK if successful
@@ -83,6 +83,6 @@ LBL_ERR:
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/mac/hmac/hmac_memory.c,v $ */
-/* $Revision: 1.6 $ */
-/* $Date: 2006/11/03 00:39:49 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/mac/hmac/hmac_memory_multi.c b/libtomcrypt/src/mac/hmac/hmac_memory_multi.c
index 2382502..c3d461b 100644
--- a/libtomcrypt/src/mac/hmac/hmac_memory_multi.c
+++ b/libtomcrypt/src/mac/hmac/hmac_memory_multi.c
@@ -6,28 +6,28 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
#include <stdarg.h>
/**
@file hmac_memory_multi.c
- HMAC support, process multiple blocks of memory, Tom St Denis/Dobes Vandermeer
+ LTC_HMAC support, process multiple blocks of memory, Tom St Denis/Dobes Vandermeer
*/
#ifdef LTC_HMAC
/**
- HMAC multiple blocks of memory to produce the authentication tag
+ LTC_HMAC multiple blocks of memory to produce the authentication tag
@param hash The index of the hash to use
@param key The secret key
@param keylen The length of the secret key (octets)
@param out [out] Destination of the authentication tag
@param outlen [in/out] Max size and resulting size of authentication tag
- @param in The data to HMAC
- @param inlen The length of the data to HMAC (octets)
- @param ... tuples of (data,len) pairs to HMAC, terminated with a (NULL,x) (x=don't care)
+ @param in The data to LTC_HMAC
+ @param inlen The length of the data to LTC_HMAC (octets)
+ @param ... tuples of (data,len) pairs to LTC_HMAC, terminated with a (NULL,x) (x=don't care)
@return CRYPT_OK if successful
*/
int hmac_memory_multi(int hash,
@@ -87,6 +87,6 @@ LBL_ERR:
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/mac/hmac/hmac_memory_multi.c,v $ */
-/* $Revision: 1.5 $ */
-/* $Date: 2006/11/03 00:39:49 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/mac/hmac/hmac_process.c b/libtomcrypt/src/mac/hmac/hmac_process.c
index 04b5ee2..802de1f 100644
--- a/libtomcrypt/src/mac/hmac/hmac_process.c
+++ b/libtomcrypt/src/mac/hmac/hmac_process.c
@@ -6,22 +6,22 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
/**
@file hmac_process.c
- HMAC support, process data, Tom St Denis/Dobes Vandermeer
+ LTC_HMAC support, process data, Tom St Denis/Dobes Vandermeer
*/
#ifdef LTC_HMAC
/**
- Process data through HMAC
+ Process data through LTC_HMAC
@param hmac The hmac state
- @param in The data to send through HMAC
- @param inlen The length of the data to HMAC (octets)
+ @param in The data to send through LTC_HMAC
+ @param inlen The length of the data to LTC_HMAC (octets)
@return CRYPT_OK if successful
*/
int hmac_process(hmac_state *hmac, const unsigned char *in, unsigned long inlen)
@@ -38,6 +38,6 @@ int hmac_process(hmac_state *hmac, const unsigned char *in, unsigned long inlen)
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/mac/hmac/hmac_process.c,v $ */
-/* $Revision: 1.5 $ */
-/* $Date: 2006/11/03 00:39:49 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/mac/hmac/hmac_test.c b/libtomcrypt/src/mac/hmac/hmac_test.c
index 4a03f87..af43da6 100644
--- a/libtomcrypt/src/mac/hmac/hmac_test.c
+++ b/libtomcrypt/src/mac/hmac/hmac_test.c
@@ -6,18 +6,18 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
/**
@file hmac_test.c
- HMAC support, self-test, Tom St Denis/Dobes Vandermeer
+ LTC_HMAC support, self-test, Tom St Denis/Dobes Vandermeer
*/
#ifdef LTC_HMAC
-#define HMAC_BLOCKSIZE hash_descriptor[hash].blocksize
+#define LTC_HMAC_BLOCKSIZE hash_descriptor[hash].blocksize
/*
TEST CASES SOURCE:
@@ -27,11 +27,11 @@ Request for Comments: 2202 IBM
Category: Informational R. Glenn
NIST
September 1997
- Test Cases for HMAC-MD5 and HMAC-SHA-1
+ Test Cases for LTC_HMAC-LTC_MD5 and LTC_HMAC-LTC_SHA-1
*/
/**
- HMAC self-test
+ LTC_HMAC self-test
@return CRYPT_OK if successful, CRYPT_NOP if tests have been disabled.
*/
int hmac_test(void)
@@ -52,7 +52,7 @@ int hmac_test(void)
unsigned char digest[MAXBLOCKSIZE];
} cases[] = {
/*
- 3. Test Cases for HMAC-SHA-1
+ 3. Test Cases for LTC_HMAC-LTC_SHA-1
test_case = 1
key = 0x0c0c0c0c0c0c0c0c0c0c0c0c0c0c0c0c0c0c0c0c
@@ -118,7 +118,7 @@ int hmac_test(void)
0x6b, 0xba, 0xa7, 0x96, 0x5c, 0x78, 0x08, 0xbb, 0xff, 0x1a, 0x91} },
/*
- 2. Test Cases for HMAC-MD5
+ 2. Test Cases for LTC_HMAC-LTC_MD5
test_case = 1
key = 0x0b 0b 0b 0b
@@ -272,7 +272,7 @@ Key First"
outlen = sizeof(digest);
if((err = hmac_memory(hash, cases[i].key, cases[i].keylen, cases[i].data, cases[i].datalen, digest, &outlen)) != CRYPT_OK) {
#if 0
- printf("HMAC-%s test #%d, %s\n", cases[i].algo, cases[i].num, error_to_string(err));
+ printf("LTC_HMAC-%s test #%d, %s\n", cases[i].algo, cases[i].num, error_to_string(err));
#endif
return err;
}
@@ -281,7 +281,7 @@ Key First"
failed++;
#if 0
unsigned int j;
- printf("\nHMAC-%s test #%d:\n", cases[i].algo, cases[i].num);
+ printf("\nLTC_HMAC-%s test #%d:\n", cases[i].algo, cases[i].num);
printf( "Result: 0x");
for(j=0; j < hash_descriptor[hash].hashsize; j++) {
printf("%2x ", digest[j]);
@@ -294,7 +294,7 @@ Key First"
return CRYPT_ERROR;
#endif
} else {
- /* printf("HMAC-%s test #%d: Passed\n", cases[i].algo, cases[i].num); */
+ /* printf("LTC_HMAC-%s test #%d: Passed\n", cases[i].algo, cases[i].num); */
}
}
@@ -311,6 +311,6 @@ Key First"
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/mac/hmac/hmac_test.c,v $ */
-/* $Revision: 1.7 $ */
-/* $Date: 2006/11/03 00:39:49 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/mac/omac/omac_done.c b/libtomcrypt/src/mac/omac/omac_done.c
index 7a0453b..796bdf9 100644
--- a/libtomcrypt/src/mac/omac/omac_done.c
+++ b/libtomcrypt/src/mac/omac/omac_done.c
@@ -6,20 +6,20 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
/**
@file omac_done.c
- OMAC1 support, terminate a stream, Tom St Denis
+ LTC_OMAC1 support, terminate a stream, Tom St Denis
*/
#ifdef LTC_OMAC
/**
- Terminate an OMAC stream
- @param omac The OMAC state
+ Terminate an LTC_OMAC stream
+ @param omac The LTC_OMAC state
@param out [out] Destination for the authentication tag
@param outlen [in/out] The max size and resulting size of the authentication tag
@return CRYPT_OK if successful
@@ -81,6 +81,6 @@ int omac_done(omac_state *omac, unsigned char *out, unsigned long *outlen)
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/mac/omac/omac_done.c,v $ */
-/* $Revision: 1.7 $ */
-/* $Date: 2006/11/03 00:39:49 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/mac/omac/omac_file.c b/libtomcrypt/src/mac/omac/omac_file.c
index 7117ae3..54871e0 100644
--- a/libtomcrypt/src/mac/omac/omac_file.c
+++ b/libtomcrypt/src/mac/omac/omac_file.c
@@ -6,23 +6,23 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
/**
@file omac_file.c
- OMAC1 support, process a file, Tom St Denis
+ LTC_OMAC1 support, process a file, Tom St Denis
*/
#ifdef LTC_OMAC
/**
- OMAC a file
+ LTC_OMAC a file
@param cipher The index of the cipher desired
@param key The secret key
@param keylen The length of the secret key (octets)
- @param filename The name of the file you wish to OMAC
+ @param filename The name of the file you wish to LTC_OMAC
@param out [out] Where the authentication tag is to be stored
@param outlen [in/out] The max size and resulting size of the authentication tag
@return CRYPT_OK if successful, CRYPT_NOP if file support has been disabled
@@ -78,6 +78,6 @@ int omac_file(int cipher,
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/mac/omac/omac_file.c,v $ */
-/* $Revision: 1.5 $ */
-/* $Date: 2006/11/03 00:39:49 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/mac/omac/omac_init.c b/libtomcrypt/src/mac/omac/omac_init.c
index cbf26a2..36a4a3d 100644
--- a/libtomcrypt/src/mac/omac/omac_init.c
+++ b/libtomcrypt/src/mac/omac/omac_init.c
@@ -6,21 +6,21 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
/**
@file omac_init.c
- OMAC1 support, initialize state, by Tom St Denis
+ LTC_OMAC1 support, initialize state, by Tom St Denis
*/
#ifdef LTC_OMAC
/**
- Initialize an OMAC state
- @param omac The OMAC state to initialize
+ Initialize an LTC_OMAC state
+ @param omac The LTC_OMAC state to initialize
@param cipher The index of the desired cipher
@param key The secret key
@param keylen The length of the secret key (octets)
@@ -96,6 +96,6 @@ int omac_init(omac_state *omac, int cipher, const unsigned char *key, unsigned l
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/mac/omac/omac_init.c,v $ */
-/* $Revision: 1.10 $ */
-/* $Date: 2006/11/03 00:39:49 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/mac/omac/omac_memory.c b/libtomcrypt/src/mac/omac/omac_memory.c
index 50b2db0..c9f3392 100644
--- a/libtomcrypt/src/mac/omac/omac_memory.c
+++ b/libtomcrypt/src/mac/omac/omac_memory.c
@@ -6,24 +6,24 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
/**
@file omac_memory.c
- OMAC1 support, process a block of memory, Tom St Denis
+ LTC_OMAC1 support, process a block of memory, Tom St Denis
*/
#ifdef LTC_OMAC
/**
- OMAC a block of memory
+ LTC_OMAC a block of memory
@param cipher The index of the desired cipher
@param key The secret key
@param keylen The length of the secret key (octets)
- @param in The data to send through OMAC
- @param inlen The length of the data to send through OMAC (octets)
+ @param in The data to send through LTC_OMAC
+ @param inlen The length of the data to send through LTC_OMAC (octets)
@param out [out] The destination of the authentication tag
@param outlen [in/out] The max size and resulting size of the authentication tag (octets)
@return CRYPT_OK if successful
@@ -80,6 +80,6 @@ LBL_ERR:
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/mac/omac/omac_memory.c,v $ */
-/* $Revision: 1.6 $ */
-/* $Date: 2006/11/08 23:01:06 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/mac/omac/omac_memory_multi.c b/libtomcrypt/src/mac/omac/omac_memory_multi.c
index 4445ca2..3db8270 100644
--- a/libtomcrypt/src/mac/omac/omac_memory_multi.c
+++ b/libtomcrypt/src/mac/omac/omac_memory_multi.c
@@ -6,28 +6,28 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
#include <stdarg.h>
/**
@file omac_memory_multi.c
- OMAC1 support, process multiple blocks of memory, Tom St Denis
+ LTC_OMAC1 support, process multiple blocks of memory, Tom St Denis
*/
#ifdef LTC_OMAC
/**
- OMAC multiple blocks of memory
+ LTC_OMAC multiple blocks of memory
@param cipher The index of the desired cipher
@param key The secret key
@param keylen The length of the secret key (octets)
@param out [out] The destination of the authentication tag
@param outlen [in/out] The max size and resulting size of the authentication tag (octets)
- @param in The data to send through OMAC
- @param inlen The length of the data to send through OMAC (octets)
- @param ... tuples of (data,len) pairs to OMAC, terminated with a (NULL,x) (x=don't care)
+ @param in The data to send through LTC_OMAC
+ @param inlen The length of the data to send through LTC_OMAC (octets)
+ @param ... tuples of (data,len) pairs to LTC_OMAC, terminated with a (NULL,x) (x=don't care)
@return CRYPT_OK if successful
*/
int omac_memory_multi(int cipher,
@@ -85,6 +85,6 @@ LBL_ERR:
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/mac/omac/omac_memory_multi.c,v $ */
-/* $Revision: 1.5 $ */
-/* $Date: 2006/11/03 00:39:49 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/mac/omac/omac_process.c b/libtomcrypt/src/mac/omac/omac_process.c
index f4b96f5..a70b179 100644
--- a/libtomcrypt/src/mac/omac/omac_process.c
+++ b/libtomcrypt/src/mac/omac/omac_process.c
@@ -6,28 +6,28 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
/**
@file omac_process.c
- OMAC1 support, process data, Tom St Denis
+ LTC_OMAC1 support, process data, Tom St Denis
*/
#ifdef LTC_OMAC
/**
- Process data through OMAC
- @param omac The OMAC state
- @param in The input data to send through OMAC
+ Process data through LTC_OMAC
+ @param omac The LTC_OMAC state
+ @param in The input data to send through LTC_OMAC
@param inlen The length of the input (octets)
@return CRYPT_OK if successful
*/
int omac_process(omac_state *omac, const unsigned char *in, unsigned long inlen)
{
- unsigned long n, x;
+ unsigned long n, x, blklen;
int err;
LTC_ARGCHK(omac != NULL);
@@ -42,13 +42,14 @@ int omac_process(omac_state *omac, const unsigned char *in, unsigned long inlen)
}
#ifdef LTC_FAST
- if (omac->buflen == 0 && inlen > 16) {
- int y;
- for (x = 0; x < (inlen - 16); x += 16) {
- for (y = 0; y < 16; y += sizeof(LTC_FAST_TYPE)) {
+ blklen = cipher_descriptor[omac->cipher_idx].block_length;
+ if (omac->buflen == 0 && inlen > blklen) {
+ unsigned long y;
+ for (x = 0; x < (inlen - blklen); x += blklen) {
+ for (y = 0; y < blklen; y += sizeof(LTC_FAST_TYPE)) {
*((LTC_FAST_TYPE*)(&omac->prev[y])) ^= *((LTC_FAST_TYPE*)(&in[y]));
}
- in += 16;
+ in += blklen;
if ((err = cipher_descriptor[omac->cipher_idx].ecb_encrypt(omac->prev, omac->prev, &omac->key)) != CRYPT_OK) {
return err;
}
@@ -83,6 +84,6 @@ int omac_process(omac_state *omac, const unsigned char *in, unsigned long inlen)
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/mac/omac/omac_process.c,v $ */
-/* $Revision: 1.9 $ */
-/* $Date: 2006/11/03 00:39:49 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/mac/omac/omac_test.c b/libtomcrypt/src/mac/omac/omac_test.c
index 3230a8c..10f5725 100644
--- a/libtomcrypt/src/mac/omac/omac_test.c
+++ b/libtomcrypt/src/mac/omac/omac_test.c
@@ -6,19 +6,19 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
/**
@file omac_test.c
- OMAC1 support, self-test, by Tom St Denis
+ LTC_OMAC1 support, self-test, by Tom St Denis
*/
#ifdef LTC_OMAC
/**
- Test the OMAC setup
+ Test the LTC_OMAC setup
@return CRYPT_OK if successful, CRYPT_NOP if tests have been disabled
*/
int omac_test(void)
@@ -105,6 +105,6 @@ int omac_test(void)
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/mac/omac/omac_test.c,v $ */
-/* $Revision: 1.6 $ */
-/* $Date: 2006/11/03 00:39:49 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/mac/pelican/pelican.c b/libtomcrypt/src/mac/pelican/pelican.c
index 734cd38..47640a3 100644
--- a/libtomcrypt/src/mac/pelican/pelican.c
+++ b/libtomcrypt/src/mac/pelican/pelican.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -15,7 +15,7 @@
Pelican MAC, initialize state, by Tom St Denis
*/
-#ifdef PELICAN
+#ifdef LTC_PELICAN
#define ENCRYPT_ONLY
#define PELI_TAB
@@ -160,6 +160,6 @@ int pelican_done(pelican_state *pelmac, unsigned char *out)
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/mac/pelican/pelican.c,v $ */
-/* $Revision: 1.18 $ */
-/* $Date: 2006/04/02 13:19:10 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/mac/pelican/pelican_memory.c b/libtomcrypt/src/mac/pelican/pelican_memory.c
index 7dde843..6eabaa1 100644
--- a/libtomcrypt/src/mac/pelican/pelican_memory.c
+++ b/libtomcrypt/src/mac/pelican/pelican_memory.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -15,7 +15,7 @@
Pelican MAC, MAC a block of memory, by Tom St Denis
*/
-#ifdef PELICAN
+#ifdef LTC_PELICAN
/**
Pelican block of memory
@@ -54,6 +54,6 @@ int pelican_memory(const unsigned char *key, unsigned long keylen,
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/mac/pelican/pelican_memory.c,v $ */
-/* $Revision: 1.6 $ */
-/* $Date: 2006/03/31 14:15:35 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/mac/pelican/pelican_test.c b/libtomcrypt/src/mac/pelican/pelican_test.c
index 3cff8ec..e743faa 100644
--- a/libtomcrypt/src/mac/pelican/pelican_test.c
+++ b/libtomcrypt/src/mac/pelican/pelican_test.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -15,7 +15,7 @@
Pelican MAC, test, by Tom St Denis
*/
-#ifdef PELICAN
+#ifdef LTC_PELICAN
int pelican_test(void)
{
@@ -115,6 +115,6 @@ int pelican_test(void)
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/mac/pelican/pelican_test.c,v $ */
-/* $Revision: 1.12 $ */
-/* $Date: 2006/11/21 00:18:23 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/mac/pmac/pmac_done.c b/libtomcrypt/src/mac/pmac/pmac_done.c
index 005f94f..88076c6 100644
--- a/libtomcrypt/src/mac/pmac/pmac_done.c
+++ b/libtomcrypt/src/mac/pmac/pmac_done.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -69,6 +69,6 @@ int pmac_done(pmac_state *state, unsigned char *out, unsigned long *outlen)
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/mac/pmac/pmac_done.c,v $ */
-/* $Revision: 1.8 $ */
-/* $Date: 2006/11/03 00:39:49 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/mac/pmac/pmac_file.c b/libtomcrypt/src/mac/pmac/pmac_file.c
index f8809e8..c7a9f74 100644
--- a/libtomcrypt/src/mac/pmac/pmac_file.c
+++ b/libtomcrypt/src/mac/pmac/pmac_file.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -79,6 +79,6 @@ int pmac_file(int cipher,
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/mac/pmac/pmac_file.c,v $ */
-/* $Revision: 1.5 $ */
-/* $Date: 2006/11/03 00:39:49 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/mac/pmac/pmac_init.c b/libtomcrypt/src/mac/pmac/pmac_init.c
index c842160..e4cf571 100644
--- a/libtomcrypt/src/mac/pmac/pmac_init.c
+++ b/libtomcrypt/src/mac/pmac/pmac_init.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -142,6 +142,6 @@ error:
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/mac/pmac/pmac_init.c,v $ */
-/* $Revision: 1.7 $ */
-/* $Date: 2006/11/03 00:39:49 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/mac/pmac/pmac_memory.c b/libtomcrypt/src/mac/pmac/pmac_memory.c
index ca15e63..70b9616 100644
--- a/libtomcrypt/src/mac/pmac/pmac_memory.c
+++ b/libtomcrypt/src/mac/pmac/pmac_memory.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -69,6 +69,6 @@ LBL_ERR:
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/mac/pmac/pmac_memory.c,v $ */
-/* $Revision: 1.5 $ */
-/* $Date: 2006/11/03 00:39:49 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/mac/pmac/pmac_memory_multi.c b/libtomcrypt/src/mac/pmac/pmac_memory_multi.c
index 70e2398..36783d3 100644
--- a/libtomcrypt/src/mac/pmac/pmac_memory_multi.c
+++ b/libtomcrypt/src/mac/pmac/pmac_memory_multi.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
#include <stdarg.h>
@@ -84,6 +84,6 @@ LBL_ERR:
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/mac/pmac/pmac_memory_multi.c,v $ */
-/* $Revision: 1.6 $ */
-/* $Date: 2006/11/03 00:39:49 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/mac/pmac/pmac_ntz.c b/libtomcrypt/src/mac/pmac/pmac_ntz.c
index 8322563..b5137da 100644
--- a/libtomcrypt/src/mac/pmac/pmac_ntz.c
+++ b/libtomcrypt/src/mac/pmac/pmac_ntz.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -34,6 +34,6 @@ int pmac_ntz(unsigned long x)
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/mac/pmac/pmac_ntz.c,v $ */
-/* $Revision: 1.5 $ */
-/* $Date: 2006/11/03 00:39:49 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/mac/pmac/pmac_process.c b/libtomcrypt/src/mac/pmac/pmac_process.c
index a191812..e32e65f 100644
--- a/libtomcrypt/src/mac/pmac/pmac_process.c
+++ b/libtomcrypt/src/mac/pmac/pmac_process.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -95,6 +95,6 @@ int pmac_process(pmac_state *pmac, const unsigned char *in, unsigned long inlen)
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/mac/pmac/pmac_process.c,v $ */
-/* $Revision: 1.8 $ */
-/* $Date: 2006/11/03 00:39:49 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/mac/pmac/pmac_shift_xor.c b/libtomcrypt/src/mac/pmac/pmac_shift_xor.c
index 694a423..122cadb 100644
--- a/libtomcrypt/src/mac/pmac/pmac_shift_xor.c
+++ b/libtomcrypt/src/mac/pmac/pmac_shift_xor.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -39,6 +39,6 @@ void pmac_shift_xor(pmac_state *pmac)
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/mac/pmac/pmac_shift_xor.c,v $ */
-/* $Revision: 1.6 $ */
-/* $Date: 2006/11/03 00:39:49 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/mac/pmac/pmac_test.c b/libtomcrypt/src/mac/pmac/pmac_test.c
index a635e15..5d2e42a 100644
--- a/libtomcrypt/src/mac/pmac/pmac_test.c
+++ b/libtomcrypt/src/mac/pmac/pmac_test.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -19,7 +19,7 @@
#ifdef LTC_PMAC
/**
- Test the OMAC implementation
+ Test the LTC_OMAC implementation
@return CRYPT_OK if successful, CRYPT_NOP if testing has been disabled
*/
int pmac_test(void)
@@ -160,6 +160,6 @@ int pmac_test(void)
-/* $Source: /cvs/libtom/libtomcrypt/src/mac/pmac/pmac_test.c,v $ */
-/* $Revision: 1.6 $ */
-/* $Date: 2006/11/03 00:39:49 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/mac/xcbc/xcbc_done.c b/libtomcrypt/src/mac/xcbc/xcbc_done.c
index 687c24d..6640eeb 100644
--- a/libtomcrypt/src/mac/xcbc/xcbc_done.c
+++ b/libtomcrypt/src/mac/xcbc/xcbc_done.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -71,7 +71,7 @@ int xcbc_done(xcbc_state *xcbc, unsigned char *out, unsigned long *outlen)
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/mac/xcbc/xcbc_done.c,v $ */
-/* $Revision: 1.4 $ */
-/* $Date: 2006/11/07 03:23:46 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/mac/xcbc/xcbc_file.c b/libtomcrypt/src/mac/xcbc/xcbc_file.c
index 4a8f7af..3d75b4e 100644
--- a/libtomcrypt/src/mac/xcbc/xcbc_file.c
+++ b/libtomcrypt/src/mac/xcbc/xcbc_file.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -78,6 +78,6 @@ int xcbc_file(int cipher,
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/mac/xcbc/xcbc_file.c,v $ */
-/* $Revision: 1.1 $ */
-/* $Date: 2006/11/03 01:56:41 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/mac/xcbc/xcbc_init.c b/libtomcrypt/src/mac/xcbc/xcbc_init.c
index 3a0dcaf..94c9d79 100644
--- a/libtomcrypt/src/mac/xcbc/xcbc_init.c
+++ b/libtomcrypt/src/mac/xcbc/xcbc_init.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -28,6 +28,7 @@ int xcbc_init(xcbc_state *xcbc, int cipher, const unsigned char *key, unsigned l
{
int x, y, err;
symmetric_key *skey;
+ unsigned long k1;
LTC_ARGCHK(xcbc != NULL);
LTC_ARGCHK(key != NULL);
@@ -43,26 +44,45 @@ int xcbc_init(xcbc_state *xcbc, int cipher, const unsigned char *key, unsigned l
}
#endif
- /* schedule the user key */
- skey = XCALLOC(1, sizeof(*skey));
- if (skey == NULL) {
- return CRYPT_MEM;
- }
+ skey = NULL;
- if ((err = cipher_descriptor[cipher].setup(key, keylen, 0, skey)) != CRYPT_OK) {
- goto done;
- }
+ /* are we in pure XCBC mode with three keys? */
+ if (keylen & LTC_XCBC_PURE) {
+ keylen &= ~LTC_XCBC_PURE;
+
+ if (keylen < 2UL*cipher_descriptor[cipher].block_length) {
+ return CRYPT_INVALID_ARG;
+ }
+
+ k1 = keylen - 2*cipher_descriptor[cipher].block_length;
+ XMEMCPY(xcbc->K[0], key, k1);
+ XMEMCPY(xcbc->K[1], key+k1, cipher_descriptor[cipher].block_length);
+ XMEMCPY(xcbc->K[2], key+k1 + cipher_descriptor[cipher].block_length, cipher_descriptor[cipher].block_length);
+ } else {
+ /* use the key expansion */
+ k1 = cipher_descriptor[cipher].block_length;
+
+ /* schedule the user key */
+ skey = XCALLOC(1, sizeof(*skey));
+ if (skey == NULL) {
+ return CRYPT_MEM;
+ }
+
+ if ((err = cipher_descriptor[cipher].setup(key, keylen, 0, skey)) != CRYPT_OK) {
+ goto done;
+ }
- /* make the three keys */
- for (y = 0; y < 3; y++) {
- for (x = 0; x < cipher_descriptor[cipher].block_length; x++) {
- xcbc->K[y][x] = y + 1;
- }
- cipher_descriptor[cipher].ecb_encrypt(xcbc->K[y], xcbc->K[y], skey);
+ /* make the three keys */
+ for (y = 0; y < 3; y++) {
+ for (x = 0; x < cipher_descriptor[cipher].block_length; x++) {
+ xcbc->K[y][x] = y + 1;
+ }
+ cipher_descriptor[cipher].ecb_encrypt(xcbc->K[y], xcbc->K[y], skey);
+ }
}
-
+
/* setup K1 */
- err = cipher_descriptor[cipher].setup(xcbc->K[0], cipher_descriptor[cipher].block_length, 0, &xcbc->key);
+ err = cipher_descriptor[cipher].setup(xcbc->K[0], k1, 0, &xcbc->key);
/* setup struct */
zeromem(xcbc->IV, cipher_descriptor[cipher].block_length);
@@ -71,16 +91,18 @@ int xcbc_init(xcbc_state *xcbc, int cipher, const unsigned char *key, unsigned l
xcbc->buflen = 0;
done:
cipher_descriptor[cipher].done(skey);
+ if (skey != NULL) {
#ifdef LTC_CLEAN_STACK
- zeromem(skey, sizeof(*skey));
+ zeromem(skey, sizeof(*skey));
#endif
- XFREE(skey);
+ XFREE(skey);
+ }
return err;
}
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/mac/xcbc/xcbc_init.c,v $ */
-/* $Revision: 1.4 $ */
-/* $Date: 2006/11/07 03:23:46 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/mac/xcbc/xcbc_memory.c b/libtomcrypt/src/mac/xcbc/xcbc_memory.c
index 1826b6b..124817a 100644
--- a/libtomcrypt/src/mac/xcbc/xcbc_memory.c
+++ b/libtomcrypt/src/mac/xcbc/xcbc_memory.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -66,6 +66,6 @@ done:
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/mac/xcbc/xcbc_memory.c,v $ */
-/* $Revision: 1.4 $ */
-/* $Date: 2006/11/21 23:02:42 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/mac/xcbc/xcbc_memory_multi.c b/libtomcrypt/src/mac/xcbc/xcbc_memory_multi.c
index ccae9de..a237907 100644
--- a/libtomcrypt/src/mac/xcbc/xcbc_memory_multi.c
+++ b/libtomcrypt/src/mac/xcbc/xcbc_memory_multi.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
#include <stdarg.h>
@@ -85,6 +85,6 @@ LBL_ERR:
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/mac/xcbc/xcbc_memory_multi.c,v $ */
-/* $Revision: 1.1 $ */
-/* $Date: 2006/11/03 01:53:25 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/mac/xcbc/xcbc_process.c b/libtomcrypt/src/mac/xcbc/xcbc_process.c
index 4dd63b5..46ab4a0 100644
--- a/libtomcrypt/src/mac/xcbc/xcbc_process.c
+++ b/libtomcrypt/src/mac/xcbc/xcbc_process.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -69,7 +69,7 @@ int xcbc_process(xcbc_state *xcbc, const unsigned char *in, unsigned long inlen)
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/mac/xcbc/xcbc_process.c,v $ */
-/* $Revision: 1.9 $ */
-/* $Date: 2006/11/09 22:43:52 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/mac/xcbc/xcbc_test.c b/libtomcrypt/src/mac/xcbc/xcbc_test.c
index 2c56c0a..1bd5840 100644
--- a/libtomcrypt/src/mac/xcbc/xcbc_test.c
+++ b/libtomcrypt/src/mac/xcbc/xcbc_test.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -122,7 +122,7 @@ int xcbc_test(void)
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/mac/xcbc/xcbc_test.c,v $ */
-/* $Revision: 1.5 $ */
-/* $Date: 2006/11/21 23:02:42 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/math/fp/ltc_ecc_fp_mulmod.c b/libtomcrypt/src/math/fp/ltc_ecc_fp_mulmod.c
index d3c02c3..b9819e3 100644
--- a/libtomcrypt/src/math/fp/ltc_ecc_fp_mulmod.c
+++ b/libtomcrypt/src/math/fp/ltc_ecc_fp_mulmod.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -15,7 +15,7 @@
ECC Crypto, Tom St Denis
*/
-#if defined(MECC) && defined(MECC_FP)
+#if defined(LTC_MECC) && defined(LTC_MECC_FP)
#include <limits.h>
/* number of entries in the cache */
@@ -38,6 +38,7 @@ static struct {
*LUT[1U<<FP_LUT]; /* fixed point lookup */
void *mu; /* copy of the montgomery constant */
int lru_count; /* amount of times this entry has been used */
+ int lock; /* flag to indicate cache eviction permitted (0) or not (1) */
} fp_cache[FP_ENTRIES];
LTC_MUTEX_GLOBAL(ltc_ecc_fp_lock)
@@ -572,13 +573,13 @@ static const struct {
#endif
};
-/* find a hole and free as required */
+/* find a hole and free as required, return -1 if no hole found */
static int find_hole(void)
{
unsigned x;
int y, z;
- for (z = 0, y = INT_MAX, x = 0; x < FP_ENTRIES; x++) {
- if (fp_cache[x].lru_count < y) {
+ for (z = -1, y = INT_MAX, x = 0; x < FP_ENTRIES; x++) {
+ if (fp_cache[x].lru_count < y && fp_cache[x].lock == 0) {
z = x;
y = fp_cache[x].lru_count;
}
@@ -592,7 +593,7 @@ static int find_hole(void)
}
/* free entry z */
- if (fp_cache[z].g) {
+ if (z >= 0 && fp_cache[z].g) {
if (fp_cache[z].mu != NULL) {
mp_clear(fp_cache[z].mu);
fp_cache[z].mu = NULL;
@@ -1100,13 +1101,15 @@ static int accel_fp_mul2add(int idx1, int idx2,
}
/** ECC Fixed Point mulmod global
- @param k The multiplicand
- @param G Base point to multiply
- @param R [out] Destination of product
- @param modulus The modulus for the curve
- @param map [boolean] If non-zero maps the point back to affine co-ordinates, otherwise it's left in jacobian-montgomery form
- @return CRYPT_OK if successful
-*/
+ Computes kA*A + kB*B = C using Shamir's Trick
+ @param A First point to multiply
+ @param kA What to multiple A by
+ @param B Second point to multiply
+ @param kB What to multiple B by
+ @param C [out] Destination point (can overlap with A or B)
+ @param modulus Modulus for curve
+ @return CRYPT_OK on success
+*/
int ltc_ecc_fp_mul2add(ecc_point *A, void *kA,
ecc_point *B, void *kB,
ecc_point *C, void *modulus)
@@ -1123,34 +1126,36 @@ int ltc_ecc_fp_mul2add(ecc_point *A, void *kA,
/* no entry? */
if (idx1 == -1) {
/* find hole and add it */
- idx1 = find_hole();
-
- if ((err = add_entry(idx1, A)) != CRYPT_OK) {
- goto LBL_ERR;
+ if ((idx1 = find_hole()) >= 0) {
+ if ((err = add_entry(idx1, A)) != CRYPT_OK) {
+ goto LBL_ERR;
+ }
}
}
+ if (idx1 != -1) {
+ /* increment LRU */
+ ++(fp_cache[idx1].lru_count);
+ }
- /* increment LRU */
- ++(fp_cache[idx1].lru_count);
-
/* find point */
idx2 = find_base(B);
/* no entry? */
if (idx2 == -1) {
/* find hole and add it */
- idx2 = find_hole();
-
- if ((err = add_entry(idx2, B)) != CRYPT_OK) {
- goto LBL_ERR;
+ if ((idx2 = find_hole()) >= 0) {
+ if ((err = add_entry(idx2, B)) != CRYPT_OK) {
+ goto LBL_ERR;
+ }
}
}
-
- /* increment LRU */
- ++(fp_cache[idx2].lru_count);
+ if (idx2 != -1) {
+ /* increment LRU */
+ ++(fp_cache[idx2].lru_count);
+ }
/* if it's 2 build the LUT, if it's higher just use the LUT */
- if (fp_cache[idx1].lru_count == 2) {
+ if (idx1 >= 0 && fp_cache[idx1].lru_count == 2) {
/* compute mp */
if ((err = mp_montgomery_setup(modulus, &mp)) != CRYPT_OK) { goto LBL_ERR; }
@@ -1169,7 +1174,7 @@ int ltc_ecc_fp_mul2add(ecc_point *A, void *kA,
}
/* if it's 2 build the LUT, if it's higher just use the LUT */
- if (fp_cache[idx2].lru_count == 2) {
+ if (idx2 >= 0 && fp_cache[idx2].lru_count == 2) {
if (mp == NULL) {
/* compute mp */
if ((err = mp_montgomery_setup(modulus, &mp)) != CRYPT_OK) { goto LBL_ERR; }
@@ -1190,7 +1195,7 @@ int ltc_ecc_fp_mul2add(ecc_point *A, void *kA,
}
- if (fp_cache[idx1].lru_count >= 2 && fp_cache[idx2].lru_count >= 2) {
+ if (idx1 >=0 && idx2 >= 0 && fp_cache[idx1].lru_count >= 2 && fp_cache[idx2].lru_count >= 2) {
if (mp == NULL) {
/* compute mp */
if ((err = mp_montgomery_setup(modulus, &mp)) != CRYPT_OK) { goto LBL_ERR; }
@@ -1235,16 +1240,20 @@ int ltc_ecc_fp_mulmod(void *k, ecc_point *G, ecc_point *R, void *modulus, int ma
/* find hole and add it */
idx = find_hole();
- if ((err = add_entry(idx, G)) != CRYPT_OK) {
- goto LBL_ERR;
+ if (idx >= 0) {
+ if ((err = add_entry(idx, G)) != CRYPT_OK) {
+ goto LBL_ERR;
+ }
}
}
+ if (idx != -1) {
+ /* increment LRU */
+ ++(fp_cache[idx].lru_count);
+ }
- /* increment LRU */
- ++(fp_cache[idx].lru_count);
/* if it's 2 build the LUT, if it's higher just use the LUT */
- if (fp_cache[idx].lru_count == 2) {
+ if (idx >= 0 && fp_cache[idx].lru_count == 2) {
/* compute mp */
if ((err = mp_montgomery_setup(modulus, &mp)) != CRYPT_OK) { goto LBL_ERR; }
@@ -1262,7 +1271,7 @@ int ltc_ecc_fp_mulmod(void *k, ecc_point *G, ecc_point *R, void *modulus, int ma
}
}
- if (fp_cache[idx].lru_count >= 2) {
+ if (idx >= 0 && fp_cache[idx].lru_count >= 2) {
if (mp == NULL) {
/* compute mp */
if ((err = mp_montgomery_setup(modulus, &mp)) != CRYPT_OK) { goto LBL_ERR; }
@@ -1282,11 +1291,10 @@ LBL_ERR:
return err;
}
-/** Free the Fixed Point tables */
-void ltc_ecc_fp_free(void)
+/* helper function for freeing the cache ... must be called with the cache mutex locked */
+static void ltc_ecc_fp_free_cache(void)
{
unsigned x, y;
- LTC_MUTEX_LOCK(&ltc_ecc_fp_lock);
for (x = 0; x < FP_ENTRIES; x++) {
if (fp_cache[x].g != NULL) {
for (y = 0; y < (1U<<FP_LUT); y++) {
@@ -1300,15 +1308,280 @@ void ltc_ecc_fp_free(void)
fp_cache[x].mu = NULL;
}
fp_cache[x].lru_count = 0;
+ fp_cache[x].lock = 0;
}
}
- LTC_MUTEX_UNLOCK(&ltc_ecc_fp_lock);
}
+/** Free the Fixed Point cache */
+void ltc_ecc_fp_free(void)
+{
+ LTC_MUTEX_LOCK(&ltc_ecc_fp_lock);
+ ltc_ecc_fp_free_cache();
+ LTC_MUTEX_UNLOCK(&ltc_ecc_fp_lock);
+}
+
+/** Add a point to the cache and initialize the LUT
+ @param g The point to add
+ @param modulus Modulus for curve
+ @param lock Flag to indicate if this entry should be locked into the cache or not
+ @return CRYPT_OK on success
+*/
+int
+ltc_ecc_fp_add_point(ecc_point *g, void *modulus, int lock)
+{
+ int idx;
+ int err;
+ void *mp = NULL;
+ void *mu = NULL;
+
+ LTC_MUTEX_LOCK(&ltc_ecc_fp_lock);
+ if ((idx = find_base(g)) >= 0) {
+ /* it is already in the cache ... just check that the LUT is initialized */
+ if(fp_cache[idx].lru_count >= 2) {
+ LTC_MUTEX_UNLOCK(&ltc_ecc_fp_lock);
+ return CRYPT_OK;
+ }
+ }
+
+ if(idx == -1 && (idx = find_hole()) == -1) {
+ err = CRYPT_BUFFER_OVERFLOW;
+ goto LBL_ERR;
+ }
+ if ((err = add_entry(idx, g)) != CRYPT_OK) {
+ goto LBL_ERR;
+ }
+ /* compute mp */
+ if ((err = mp_montgomery_setup(modulus, &mp)) != CRYPT_OK) {
+ goto LBL_ERR;
+ }
+
+ /* compute mu */
+ if ((err = mp_init(&mu)) != CRYPT_OK) {
+ goto LBL_ERR;
+ }
+ if ((err = mp_montgomery_normalization(mu, modulus)) != CRYPT_OK) {
+ goto LBL_ERR;
+ }
+
+ /* build the LUT */
+ if ((err = build_lut(idx, modulus, mp, mu)) != CRYPT_OK) {
+ goto LBL_ERR;
+ }
+ fp_cache[idx].lru_count = 2;
+ fp_cache[idx].lock = lock;
+LBL_ERR:
+ LTC_MUTEX_UNLOCK(&ltc_ecc_fp_lock);
+ if (mp != NULL) {
+ mp_montgomery_free(mp);
+ }
+ if (mu != NULL) {
+ mp_clear(mu);
+ }
+ return err;
+}
+
+/** Prevent/permit the FP cache from being updated
+ @param flag If flag is 0, remove cache lock (unlock), otherwise lock it
+*/
+void ltc_ecc_fp_tablelock(int lock)
+{
+ int i;
+
+ LTC_MUTEX_LOCK(&ltc_ecc_fp_lock);
+ for (i = 0; i < FP_ENTRIES; i++) {
+ fp_cache[i].lock = lock;
+ }
+ LTC_MUTEX_UNLOCK(&ltc_ecc_fp_lock);
+}
+
+/** Export the current cache as a binary packet
+ @param out [out] pointer to malloc'ed space containing the packet
+ @param outlen [out] size of exported packet
+ @return CRYPT_OK if successful
+*/
+int ltc_ecc_fp_save_state(unsigned char **out, unsigned long *outlen)
+{
+ ltc_asn1_list *cache_entry;
+ unsigned int i, j, k;
+ unsigned long fp_entries, fp_lut, num_entries;
+ int err;
+
+ LTC_ARGCHK(out != NULL);
+ LTC_ARGCHK(outlen != NULL);
+
+ fp_entries = FP_ENTRIES;
+ fp_lut = FP_LUT;
+ num_entries = 0;
+
+ LTC_MUTEX_LOCK(&ltc_ecc_fp_lock);
+ /*
+ * build the list;
+ Cache DEFINITIONS ::=
+ BEGIN
+ CacheDump ::= SEQUENCE {
+ numEntries SHORTINTEGER,
+ maxEntries SHORTINTEGER,
+ numLUT SHORTINTEGER,
+ cache SEQUENCE OF INTEGER
+ }
+ END
+ *
+ */
+ /*
+ * The cache itself is a point (3 INTEGERS),
+ * the LUT as pairs of INTEGERS (2 * 1<<FP_LUT),
+ * and the mu INTEGER
+ */
+ cache_entry = XCALLOC(FP_ENTRIES*(2*(1U<<FP_LUT)+4)+3, sizeof(ltc_asn1_list));
+ if (cache_entry == NULL)
+ return CRYPT_MEM;
+ j = 1; /* handle the zero'th element later */
+
+ LTC_SET_ASN1(cache_entry, j++, LTC_ASN1_SHORT_INTEGER, &fp_entries, 1);
+ LTC_SET_ASN1(cache_entry, j++, LTC_ASN1_SHORT_INTEGER, &fp_lut, 1);
+
+ for (i = 0; i < FP_ENTRIES; i++) {
+ /*
+ * do not save empty entries, or entries that have not yet had the lut built
+ */
+ if (fp_cache[i].g == NULL || fp_cache[i].lru_count < 2) {
+ continue;
+ }
+ num_entries++;
+ LTC_SET_ASN1(cache_entry, j++, LTC_ASN1_INTEGER, fp_cache[i].g->x, 1);
+ LTC_SET_ASN1(cache_entry, j++, LTC_ASN1_INTEGER, fp_cache[i].g->y, 1);
+ LTC_SET_ASN1(cache_entry, j++, LTC_ASN1_INTEGER, fp_cache[i].g->z, 1);
+ for (k = 0; k < (1U<<FP_LUT); k++) {
+ LTC_SET_ASN1(cache_entry, j++, LTC_ASN1_INTEGER, fp_cache[i].LUT[k]->x, 1);
+ LTC_SET_ASN1(cache_entry, j++, LTC_ASN1_INTEGER, fp_cache[i].LUT[k]->y, 1);
+ }
+ LTC_SET_ASN1(cache_entry, j++, LTC_ASN1_INTEGER, fp_cache[i].mu, 1);
+ }
+ LTC_SET_ASN1(cache_entry, j++, LTC_ASN1_EOL, 0, 0);
+
+ LTC_SET_ASN1(cache_entry, 0, LTC_ASN1_SHORT_INTEGER, &num_entries, 1);
+
+ if ((err = der_length_sequence(cache_entry, j, outlen)) != CRYPT_OK) {
+ goto save_err;
+ }
+ if ((*out = XMALLOC(*outlen)) == NULL) {
+ err = CRYPT_MEM;
+ goto save_err;
+ }
+ err = der_encode_sequence(cache_entry, j, *out, outlen);
+save_err:
+ XFREE(cache_entry);
+ LTC_MUTEX_UNLOCK(&ltc_ecc_fp_lock);
+ return err;
+}
+
+/** Import a binary packet into the current cache
+ @param in [in] pointer to packet
+ @param inlen [in] size of packet (bytes)
+ @return CRYPT_OK if successful
+*/
+int ltc_ecc_fp_restore_state(unsigned char *in, unsigned long inlen)
+{
+ int err;
+ ltc_asn1_list *asn1_list;
+ unsigned long num_entries, fp_entries, fp_lut;
+ unsigned long i, j;
+ unsigned int x;
+
+ LTC_ARGCHK(in != NULL);
+ if (inlen == 0) {
+ return CRYPT_INVALID_ARG;
+ }
+
+ /* zero indecies */
+ i = 0;
+ j = 0;
+ asn1_list = NULL;
+
+ LTC_MUTEX_LOCK(&ltc_ecc_fp_lock);
+ /*
+ * start with an empty cache
+ */
+ ltc_ecc_fp_free_cache();
+
+ /*
+ * decode the input packet: It consists of a sequence with a few
+ * integers (including the FP_ENTRIES and FP_LUT sizes), followed by a
+ * SEQUENCE which is the cache itself.
+ *
+ * use standard decoding for the first part, then flexible for the second
+ */
+ if((err = der_decode_sequence_multi(in, inlen,
+ LTC_ASN1_SHORT_INTEGER, 1, &num_entries,
+ LTC_ASN1_SHORT_INTEGER, 1, &fp_entries,
+ LTC_ASN1_SHORT_INTEGER, 1, &fp_lut,
+ LTC_ASN1_EOL, 0, 0)) != CRYPT_OK) {
+ goto ERR_OUT;
+ }
+ if (fp_entries != FP_ENTRIES || fp_lut != FP_LUT || num_entries > fp_entries) {
+ err = CRYPT_INVALID_PACKET;
+ goto ERR_OUT;
+ }
+ if ((asn1_list = XCALLOC(3+num_entries*(4+2*(1<<FP_LUT))+1, sizeof(ltc_asn1_list))) == NULL) {
+ err = CRYPT_MEM;
+ goto ERR_OUT;
+ }
+ j = 0;
+ LTC_SET_ASN1(asn1_list, j++, LTC_ASN1_SHORT_INTEGER, &num_entries, 1);
+ LTC_SET_ASN1(asn1_list, j++, LTC_ASN1_SHORT_INTEGER, &fp_entries, 1);
+ LTC_SET_ASN1(asn1_list, j++, LTC_ASN1_SHORT_INTEGER, &fp_lut, 1);
+ for (i = 0; i < num_entries; i++) {
+ if((fp_cache[i].g = ltc_ecc_new_point()) == NULL) {
+ err = CRYPT_MEM;
+ goto ERR_OUT;
+ }
+ LTC_SET_ASN1(asn1_list, j++, LTC_ASN1_INTEGER, fp_cache[i].g->x, 1);
+ LTC_SET_ASN1(asn1_list, j++, LTC_ASN1_INTEGER, fp_cache[i].g->y, 1);
+ LTC_SET_ASN1(asn1_list, j++, LTC_ASN1_INTEGER, fp_cache[i].g->z, 1);
+ for (x = 0; x < (1U<<FP_LUT); x++) {
+ /* since we don't store z in the cache, don't use ltc_ecc_new_point()
+ * (which allocates space for z, only to have to free it later) */
+ ecc_point *p = XCALLOC(1, sizeof(*p));
+
+ if (p == NULL) {
+ err = CRYPT_MEM;
+ goto ERR_OUT;
+ }
+ fp_cache[i].LUT[x] = p;
+ if ((err = mp_init_multi(&p->x, &p->y, NULL)) != CRYPT_OK) {
+ goto ERR_OUT;
+ }
+ p->z = NULL;
+ LTC_SET_ASN1(asn1_list, j++, LTC_ASN1_INTEGER, p->x, 1);
+ LTC_SET_ASN1(asn1_list, j++, LTC_ASN1_INTEGER, p->y, 1);
+ }
+ if((err = mp_init(&fp_cache[i].mu)) != CRYPT_OK) {
+ goto ERR_OUT;
+ }
+ LTC_SET_ASN1(asn1_list, j++, LTC_ASN1_INTEGER, fp_cache[i].mu, 1);
+ fp_cache[i].lru_count = 3;
+ fp_cache[i].lock = 1;
+ }
+
+ if ((err = der_decode_sequence(in, inlen, asn1_list, j)) != CRYPT_OK) {
+ goto ERR_OUT;
+ }
+ XFREE(asn1_list);
+ LTC_MUTEX_UNLOCK(&ltc_ecc_fp_lock);
+ return CRYPT_OK;
+ERR_OUT:
+ if(asn1_list)
+ XFREE(asn1_list);
+ ltc_ecc_fp_free_cache();
+ LTC_MUTEX_UNLOCK(&ltc_ecc_fp_lock);
+ return err;
+}
+
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/math/fp/ltc_ecc_fp_mulmod.c,v $ */
-/* $Revision: 1.27 $ */
-/* $Date: 2006/12/03 00:39:56 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/math/gmp_desc.c b/libtomcrypt/src/math/gmp_desc.c
index 66c279e..c61bafe 100644
--- a/libtomcrypt/src/math/gmp_desc.c
+++ b/libtomcrypt/src/math/gmp_desc.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#define DESC_DEF_ONLY
@@ -439,29 +439,29 @@ const ltc_math_descriptor gmp_desc = {
&exptmod,
&isprime,
-#ifdef MECC
-#ifdef MECC_FP
+#ifdef LTC_MECC
+#ifdef LTC_MECC_FP
&ltc_ecc_fp_mulmod,
#else
&ltc_ecc_mulmod,
-#endif /* MECC_FP */
+#endif /* LTC_MECC_FP */
&ltc_ecc_projective_add_point,
&ltc_ecc_projective_dbl_point,
&ltc_ecc_map,
#ifdef LTC_ECC_SHAMIR
-#ifdef MECC_FP
+#ifdef LTC_MECC_FP
&ltc_ecc_fp_mul2add,
#else
&ltc_ecc_mul2add,
-#endif /* MECC_FP */
+#endif /* LTC_MECC_FP */
#else
NULL,
#endif /* LTC_ECC_SHAMIR */
#else
NULL, NULL, NULL, NULL, NULL
-#endif /* MECC */
+#endif /* LTC_MECC */
-#ifdef MRSA
+#ifdef LTC_MRSA
&rsa_make_key,
&rsa_exptmod,
#else
@@ -473,6 +473,6 @@ const ltc_math_descriptor gmp_desc = {
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/math/gmp_desc.c,v $ */
-/* $Revision: 1.14 $ */
-/* $Date: 2006/12/03 00:39:56 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/math/ltm_desc.c b/libtomcrypt/src/math/ltm_desc.c
index 07fdd5a..de0d898 100644
--- a/libtomcrypt/src/math/ltm_desc.c
+++ b/libtomcrypt/src/math/ltm_desc.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#define DESC_DEF_ONLY
@@ -445,8 +445,8 @@ const ltc_math_descriptor ltm_desc = {
&exptmod,
&isprime,
-#ifdef MECC
-#ifdef MECC_FP
+#ifdef LTC_MECC
+#ifdef LTC_MECC_FP
&ltc_ecc_fp_mulmod,
#else
&ltc_ecc_mulmod,
@@ -455,19 +455,19 @@ const ltc_math_descriptor ltm_desc = {
&ltc_ecc_projective_dbl_point,
&ltc_ecc_map,
#ifdef LTC_ECC_SHAMIR
-#ifdef MECC_FP
+#ifdef LTC_MECC_FP
&ltc_ecc_fp_mul2add,
#else
&ltc_ecc_mul2add,
-#endif /* MECC_FP */
+#endif /* LTC_MECC_FP */
#else
NULL,
#endif /* LTC_ECC_SHAMIR */
#else
NULL, NULL, NULL, NULL, NULL,
-#endif /* MECC */
+#endif /* LTC_MECC */
-#ifdef MRSA
+#ifdef LTC_MRSA
&rsa_make_key,
&rsa_exptmod,
#else
@@ -478,6 +478,6 @@ const ltc_math_descriptor ltm_desc = {
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/math/ltm_desc.c,v $ */
-/* $Revision: 1.29 $ */
-/* $Date: 2006/12/03 00:39:56 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/math/multi.c b/libtomcrypt/src/math/multi.c
index 8ee4d79..593f353 100644
--- a/libtomcrypt/src/math/multi.c
+++ b/libtomcrypt/src/math/multi.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -56,6 +56,6 @@ void ltc_deinit_multi(void *a, ...)
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/math/multi.c,v $ */
-/* $Revision: 1.5 $ */
-/* $Date: 2006/03/31 14:15:35 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/math/rand_prime.c b/libtomcrypt/src/math/rand_prime.c
index 05477fe..f228429 100644
--- a/libtomcrypt/src/math/rand_prime.c
+++ b/libtomcrypt/src/math/rand_prime.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -82,6 +82,6 @@ int rand_prime(void *N, long len, prng_state *prng, int wprng)
-/* $Source: /cvs/libtom/libtomcrypt/src/math/rand_prime.c,v $ */
-/* $Revision: 1.6 $ */
-/* $Date: 2006/03/31 14:15:35 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/math/tfm_desc.c b/libtomcrypt/src/math/tfm_desc.c
index 023756d..f568044 100644
--- a/libtomcrypt/src/math/tfm_desc.c
+++ b/libtomcrypt/src/math/tfm_desc.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#define DESC_DEF_ONLY
@@ -403,7 +403,7 @@ static int isprime(void *a, int *b)
return CRYPT_OK;
}
-#if defined(MECC) && defined(MECC_ACCEL)
+#if defined(LTC_MECC) && defined(LTC_MECC_ACCEL)
static int tfm_ecc_projective_dbl_point(ecc_point *P, ecc_point *R, void *modulus, void *Mp)
{
@@ -733,34 +733,34 @@ const ltc_math_descriptor tfm_desc = {
&exptmod,
&isprime,
-#ifdef MECC
-#ifdef MECC_FP
+#ifdef LTC_MECC
+#ifdef LTC_MECC_FP
&ltc_ecc_fp_mulmod,
#else
&ltc_ecc_mulmod,
-#endif /* MECC_FP */
-#ifdef MECC_ACCEL
+#endif /* LTC_MECC_FP */
+#ifdef LTC_MECC_ACCEL
&tfm_ecc_projective_add_point,
&tfm_ecc_projective_dbl_point,
#else
&ltc_ecc_projective_add_point,
&ltc_ecc_projective_dbl_point,
-#endif /* MECC_ACCEL */
+#endif /* LTC_MECC_ACCEL */
&ltc_ecc_map,
#ifdef LTC_ECC_SHAMIR
-#ifdef MECC_FP
+#ifdef LTC_MECC_FP
&ltc_ecc_fp_mul2add,
#else
&ltc_ecc_mul2add,
-#endif /* MECC_FP */
+#endif /* LTC_MECC_FP */
#else
NULL,
#endif /* LTC_ECC_SHAMIR */
#else
NULL, NULL, NULL, NULL, NULL,
-#endif /* MECC */
+#endif /* LTC_MECC */
-#ifdef MRSA
+#ifdef LTC_MRSA
&rsa_make_key,
&rsa_exptmod,
#else
@@ -772,6 +772,6 @@ const ltc_math_descriptor tfm_desc = {
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/math/tfm_desc.c,v $ */
-/* $Revision: 1.26 $ */
-/* $Date: 2006/12/03 00:39:56 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/misc/base64/base64_decode.c b/libtomcrypt/src/misc/base64/base64_decode.c
index 6a39baf..6fd0ba2 100644
--- a/libtomcrypt/src/misc/base64/base64_decode.c
+++ b/libtomcrypt/src/misc/base64/base64_decode.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -16,7 +16,7 @@
*/
-#ifdef BASE64
+#ifdef LTC_BASE64
static const unsigned char map[256] = {
255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255, 255,
@@ -99,6 +99,6 @@ int base64_decode(const unsigned char *in, unsigned long inlen,
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/misc/base64/base64_decode.c,v $ */
-/* $Revision: 1.4 $ */
-/* $Date: 2006/03/31 14:15:35 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/misc/base64/base64_encode.c b/libtomcrypt/src/misc/base64/base64_encode.c
index ac4df35..58a82df 100644
--- a/libtomcrypt/src/misc/base64/base64_encode.c
+++ b/libtomcrypt/src/misc/base64/base64_encode.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -16,7 +16,7 @@
*/
-#ifdef BASE64
+#ifdef LTC_BASE64
static const char *codes =
"ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/";
@@ -76,6 +76,6 @@ int base64_encode(const unsigned char *in, unsigned long inlen,
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/misc/base64/base64_encode.c,v $ */
-/* $Revision: 1.5 $ */
-/* $Date: 2006/06/16 21:53:41 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/misc/burn_stack.c b/libtomcrypt/src/misc/burn_stack.c
index 0beee92..2610c06 100644
--- a/libtomcrypt/src/misc/burn_stack.c
+++ b/libtomcrypt/src/misc/burn_stack.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -29,6 +29,6 @@ void burn_stack(unsigned long len)
-/* $Source: /cvs/libtom/libtomcrypt/src/misc/burn_stack.c,v $ */
-/* $Revision: 1.4 $ */
-/* $Date: 2006/03/31 14:15:35 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/misc/crypt/crypt.c b/libtomcrypt/src/misc/crypt/crypt.c
index 8603943..054f4b7 100644
--- a/libtomcrypt/src/misc/crypt/crypt.c
+++ b/libtomcrypt/src/misc/crypt/crypt.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -45,118 +45,124 @@ const char *crypt_build_settings =
"disabled\n"
#endif
"Ciphers built-in:\n"
-#if defined(BLOWFISH)
+#if defined(LTC_BLOWFISH)
" Blowfish\n"
#endif
-#if defined(RC2)
- " RC2\n"
+#if defined(LTC_RC2)
+ " LTC_RC2\n"
#endif
-#if defined(RC5)
- " RC5\n"
+#if defined(LTC_RC5)
+ " LTC_RC5\n"
#endif
-#if defined(RC6)
- " RC6\n"
+#if defined(LTC_RC6)
+ " LTC_RC6\n"
#endif
-#if defined(SAFERP)
+#if defined(LTC_SAFERP)
" Safer+\n"
#endif
-#if defined(SAFER)
+#if defined(LTC_SAFER)
" Safer\n"
#endif
-#if defined(RIJNDAEL)
+#if defined(LTC_RIJNDAEL)
" Rijndael\n"
#endif
-#if defined(XTEA)
- " XTEA\n"
+#if defined(LTC_XTEA)
+ " LTC_XTEA\n"
#endif
-#if defined(TWOFISH)
+#if defined(LTC_TWOFISH)
" Twofish "
- #if defined(TWOFISH_SMALL) && defined(TWOFISH_TABLES) && defined(TWOFISH_ALL_TABLES)
+ #if defined(LTC_TWOFISH_SMALL) && defined(LTC_TWOFISH_TABLES) && defined(LTC_TWOFISH_ALL_TABLES)
"(small, tables, all_tables)\n"
- #elif defined(TWOFISH_SMALL) && defined(TWOFISH_TABLES)
+ #elif defined(LTC_TWOFISH_SMALL) && defined(LTC_TWOFISH_TABLES)
"(small, tables)\n"
- #elif defined(TWOFISH_SMALL) && defined(TWOFISH_ALL_TABLES)
+ #elif defined(LTC_TWOFISH_SMALL) && defined(LTC_TWOFISH_ALL_TABLES)
"(small, all_tables)\n"
- #elif defined(TWOFISH_TABLES) && defined(TWOFISH_ALL_TABLES)
+ #elif defined(LTC_TWOFISH_TABLES) && defined(LTC_TWOFISH_ALL_TABLES)
"(tables, all_tables)\n"
- #elif defined(TWOFISH_SMALL)
+ #elif defined(LTC_TWOFISH_SMALL)
"(small)\n"
- #elif defined(TWOFISH_TABLES)
+ #elif defined(LTC_TWOFISH_TABLES)
"(tables)\n"
- #elif defined(TWOFISH_ALL_TABLES)
+ #elif defined(LTC_TWOFISH_ALL_TABLES)
"(all_tables)\n"
#else
"\n"
#endif
#endif
-#if defined(DES)
- " DES\n"
+#if defined(LTC_DES)
+ " LTC_DES\n"
#endif
-#if defined(CAST5)
- " CAST5\n"
+#if defined(LTC_CAST5)
+ " LTC_CAST5\n"
#endif
-#if defined(NOEKEON)
+#if defined(LTC_NOEKEON)
" Noekeon\n"
#endif
-#if defined(SKIPJACK)
+#if defined(LTC_SKIPJACK)
" Skipjack\n"
#endif
-#if defined(KHAZAD)
+#if defined(LTC_KHAZAD)
" Khazad\n"
#endif
-#if defined(ANUBIS)
+#if defined(LTC_ANUBIS)
" Anubis "
#endif
-#if defined(ANUBIS_TWEAK)
+#if defined(LTC_ANUBIS_TWEAK)
" (tweaked)"
#endif
"\n"
-#if defined(KSEED)
- " KSEED\n"
+#if defined(LTC_KSEED)
+ " LTC_KSEED\n"
#endif
#if defined(LTC_KASUMI)
" KASUMI\n"
#endif
"\nHashes built-in:\n"
-#if defined(SHA512)
- " SHA-512\n"
+#if defined(LTC_SHA512)
+ " LTC_SHA-512\n"
#endif
-#if defined(SHA384)
- " SHA-384\n"
+#if defined(LTC_SHA384)
+ " LTC_SHA-384\n"
#endif
-#if defined(SHA256)
- " SHA-256\n"
+#if defined(LTC_SHA256)
+ " LTC_SHA-256\n"
#endif
-#if defined(SHA224)
- " SHA-224\n"
+#if defined(LTC_SHA224)
+ " LTC_SHA-224\n"
#endif
-#if defined(TIGER)
- " TIGER\n"
+#if defined(LTC_TIGER)
+ " LTC_TIGER\n"
#endif
-#if defined(SHA1)
- " SHA1\n"
+#if defined(LTC_SHA1)
+ " LTC_SHA1\n"
#endif
-#if defined(MD5)
- " MD5\n"
+#if defined(LTC_MD5)
+ " LTC_MD5\n"
#endif
-#if defined(MD4)
- " MD4\n"
+#if defined(LTC_MD4)
+ " LTC_MD4\n"
#endif
-#if defined(MD2)
- " MD2\n"
+#if defined(LTC_MD2)
+ " LTC_MD2\n"
#endif
-#if defined(RIPEMD128)
- " RIPEMD128\n"
+#if defined(LTC_RIPEMD128)
+ " LTC_RIPEMD128\n"
#endif
-#if defined(RIPEMD160)
- " RIPEMD160\n"
+#if defined(LTC_RIPEMD160)
+ " LTC_RIPEMD160\n"
#endif
-#if defined(WHIRLPOOL)
- " WHIRLPOOL\n"
+#if defined(LTC_RIPEMD256)
+ " LTC_RIPEMD256\n"
#endif
-#if defined(CHC_HASH)
- " CHC_HASH \n"
+#if defined(LTC_RIPEMD320)
+ " LTC_RIPEMD320\n"
+#endif
+#if defined(LTC_WHIRLPOOL)
+ " LTC_WHIRLPOOL\n"
+#endif
+#if defined(LTC_CHC_HASH)
+ " LTC_CHC_HASH \n"
#endif
"\nBlock Chaining Modes:\n"
@@ -189,19 +195,22 @@ const char *crypt_build_settings =
#if defined(LTC_F8_MODE)
" F8 MODE\n"
#endif
+#if defined(LTC_XTS_MODE)
+ " LTC_XTS_MODE\n"
+#endif
"\nMACs:\n"
#if defined(LTC_HMAC)
- " HMAC\n"
+ " LTC_HMAC\n"
#endif
#if defined(LTC_OMAC)
- " OMAC\n"
+ " LTC_OMAC\n"
#endif
#if defined(LTC_PMAC)
" PMAC\n"
#endif
-#if defined(PELICAN)
- " PELICAN\n"
+#if defined(LTC_PELICAN)
+ " LTC_PELICAN\n"
#endif
#if defined(LTC_XCBC)
" XCBC-MAC\n"
@@ -211,48 +220,48 @@ const char *crypt_build_settings =
#endif
"\nENC + AUTH modes:\n"
-#if defined(EAX_MODE)
- " EAX_MODE\n"
+#if defined(LTC_EAX_MODE)
+ " LTC_EAX_MODE\n"
#endif
-#if defined(OCB_MODE)
- " OCB_MODE\n"
+#if defined(LTC_OCB_MODE)
+ " LTC_OCB_MODE\n"
#endif
-#if defined(CCM_MODE)
- " CCM_MODE\n"
+#if defined(LTC_CCM_MODE)
+ " LTC_CCM_MODE\n"
#endif
-#if defined(GCM_MODE)
- " GCM_MODE "
+#if defined(LTC_GCM_MODE)
+ " LTC_GCM_MODE "
#endif
-#if defined(GCM_TABLES)
- " (GCM_TABLES) "
+#if defined(LTC_GCM_TABLES)
+ " (LTC_GCM_TABLES) "
#endif
"\n"
"\nPRNG:\n"
-#if defined(YARROW)
+#if defined(LTC_YARROW)
" Yarrow\n"
#endif
-#if defined(SPRNG)
- " SPRNG\n"
+#if defined(LTC_SPRNG)
+ " LTC_SPRNG\n"
#endif
-#if defined(RC4)
- " RC4\n"
+#if defined(LTC_RC4)
+ " LTC_RC4\n"
#endif
-#if defined(FORTUNA)
+#if defined(LTC_FORTUNA)
" Fortuna\n"
#endif
-#if defined(SOBER128)
- " SOBER128\n"
+#if defined(LTC_SOBER128)
+ " LTC_SOBER128\n"
#endif
"\nPK Algs:\n"
-#if defined(MRSA)
+#if defined(LTC_MRSA)
" RSA \n"
#endif
-#if defined(MECC)
+#if defined(LTC_MECC)
" ECC\n"
#endif
-#if defined(MDSA)
+#if defined(LTC_MDSA)
" DSA\n"
#endif
#if defined(MKAT)
@@ -286,8 +295,8 @@ const char *crypt_build_settings =
#endif
"\nVarious others: "
-#if defined(BASE64)
- " BASE64 "
+#if defined(LTC_BASE64)
+ " LTC_BASE64 "
#endif
#if defined(MPI)
" MPI "
@@ -298,11 +307,11 @@ const char *crypt_build_settings =
#if defined(LTC_TEST)
" LTC_TEST "
#endif
-#if defined(PKCS_1)
- " PKCS#1 "
+#if defined(LTC_PKCS_1)
+ " LTC_PKCS#1 "
#endif
-#if defined(PKCS_5)
- " PKCS#5 "
+#if defined(LTC_PKCS_5)
+ " LTC_PKCS#5 "
#endif
#if defined(LTC_SMALL_CODE)
" LTC_SMALL_CODE "
@@ -334,23 +343,23 @@ const char *crypt_build_settings =
#if defined(LTC_PTHREAD)
" LTC_PTHREAD "
#endif
-#if defined(LTM_DESC)
+#if defined(LTM_LTC_DESC)
" LTM_DESC "
#endif
-#if defined(TFM_DESC)
+#if defined(TFM_LTC_DESC)
" TFM_DESC "
#endif
-#if defined(MECC_ACCEL)
- " MECC_ACCEL "
+#if defined(LTC_MECC_ACCEL)
+ " LTC_MECC_ACCEL "
#endif
-#if defined(GMP_DESC)
+#if defined(GMP_LTC_DESC)
" GMP_DESC "
#endif
#if defined(LTC_EASY)
" (easy) "
#endif
-#if defined(MECC_FP)
- " MECC_FP "
+#if defined(LTC_MECC_FP)
+ " LTC_MECC_FP "
#endif
#if defined(LTC_ECC_SHAMIR)
" LTC_ECC_SHAMIR "
@@ -361,6 +370,6 @@ const char *crypt_build_settings =
*/
-/* $Source: /cvs/libtom/libtomcrypt/src/misc/crypt/crypt.c,v $ */
-/* $Revision: 1.27 $ */
-/* $Date: 2006/12/03 03:50:45 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/misc/crypt/crypt_argchk.c b/libtomcrypt/src/misc/crypt/crypt_argchk.c
index a6d2a48..2f2faa7 100644
--- a/libtomcrypt/src/misc/crypt/crypt_argchk.c
+++ b/libtomcrypt/src/misc/crypt/crypt_argchk.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
#include <signal.h>
@@ -25,6 +25,6 @@ void crypt_argchk(char *v, char *s, int d)
}
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/misc/crypt/crypt_argchk.c,v $ */
-/* $Revision: 1.4 $ */
-/* $Date: 2006/03/31 14:15:35 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/misc/crypt/crypt_cipher_descriptor.c b/libtomcrypt/src/misc/crypt/crypt_cipher_descriptor.c
index 880c149..20aac57 100644
--- a/libtomcrypt/src/misc/crypt/crypt_cipher_descriptor.c
+++ b/libtomcrypt/src/misc/crypt/crypt_cipher_descriptor.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -22,6 +22,6 @@ struct ltc_cipher_descriptor cipher_descriptor[TAB_SIZE] = {
LTC_MUTEX_GLOBAL(ltc_cipher_mutex)
-/* $Source: /cvs/libtom/libtomcrypt/src/misc/crypt/crypt_cipher_descriptor.c,v $ */
-/* $Revision: 1.12 $ */
-/* $Date: 2006/11/08 23:01:06 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/misc/crypt/crypt_cipher_is_valid.c b/libtomcrypt/src/misc/crypt/crypt_cipher_is_valid.c
index 0f8202b..35f1ace 100644
--- a/libtomcrypt/src/misc/crypt/crypt_cipher_is_valid.c
+++ b/libtomcrypt/src/misc/crypt/crypt_cipher_is_valid.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -31,6 +31,6 @@ int cipher_is_valid(int idx)
return CRYPT_OK;
}
-/* $Source: /cvs/libtom/libtomcrypt/src/misc/crypt/crypt_cipher_is_valid.c,v $ */
-/* $Revision: 1.5 $ */
-/* $Date: 2006/03/31 14:15:35 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/misc/crypt/crypt_find_cipher.c b/libtomcrypt/src/misc/crypt/crypt_find_cipher.c
index 27c59eb..0c563b0 100644
--- a/libtomcrypt/src/misc/crypt/crypt_find_cipher.c
+++ b/libtomcrypt/src/misc/crypt/crypt_find_cipher.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -36,6 +36,6 @@ int find_cipher(const char *name)
}
-/* $Source: /cvs/libtom/libtomcrypt/src/misc/crypt/crypt_find_cipher.c,v $ */
-/* $Revision: 1.6 $ */
-/* $Date: 2006/11/29 23:43:57 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/misc/crypt/crypt_find_cipher_any.c b/libtomcrypt/src/misc/crypt/crypt_find_cipher_any.c
index 393eded..c528e6e 100644
--- a/libtomcrypt/src/misc/crypt/crypt_find_cipher_any.c
+++ b/libtomcrypt/src/misc/crypt/crypt_find_cipher_any.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -45,6 +45,6 @@ int find_cipher_any(const char *name, int blocklen, int keylen)
return -1;
}
-/* $Source: /cvs/libtom/libtomcrypt/src/misc/crypt/crypt_find_cipher_any.c,v $ */
-/* $Revision: 1.5 $ */
-/* $Date: 2006/03/31 14:15:35 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/misc/crypt/crypt_find_cipher_id.c b/libtomcrypt/src/misc/crypt/crypt_find_cipher_id.c
index 8de73c6..be4e0fa 100644
--- a/libtomcrypt/src/misc/crypt/crypt_find_cipher_id.c
+++ b/libtomcrypt/src/misc/crypt/crypt_find_cipher_id.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -35,6 +35,6 @@ int find_cipher_id(unsigned char ID)
return -1;
}
-/* $Source: /cvs/libtom/libtomcrypt/src/misc/crypt/crypt_find_cipher_id.c,v $ */
-/* $Revision: 1.5 $ */
-/* $Date: 2006/03/31 14:15:35 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/misc/crypt/crypt_find_hash.c b/libtomcrypt/src/misc/crypt/crypt_find_hash.c
index cd60413..12ef320 100644
--- a/libtomcrypt/src/misc/crypt/crypt_find_hash.c
+++ b/libtomcrypt/src/misc/crypt/crypt_find_hash.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -35,6 +35,6 @@ int find_hash(const char *name)
return -1;
}
-/* $Source: /cvs/libtom/libtomcrypt/src/misc/crypt/crypt_find_hash.c,v $ */
-/* $Revision: 1.6 $ */
-/* $Date: 2006/11/29 23:43:57 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/misc/crypt/crypt_find_hash_any.c b/libtomcrypt/src/misc/crypt/crypt_find_hash_any.c
index b2cfccd..65ecce7 100644
--- a/libtomcrypt/src/misc/crypt/crypt_find_hash_any.c
+++ b/libtomcrypt/src/misc/crypt/crypt_find_hash_any.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -44,6 +44,6 @@
return z;
}
-/* $Source: /cvs/libtom/libtomcrypt/src/misc/crypt/crypt_find_hash_any.c,v $ */
-/* $Revision: 1.5 $ */
-/* $Date: 2006/03/31 14:15:35 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/misc/crypt/crypt_find_hash_id.c b/libtomcrypt/src/misc/crypt/crypt_find_hash_id.c
index e59ca00..f8e75fc 100644
--- a/libtomcrypt/src/misc/crypt/crypt_find_hash_id.c
+++ b/libtomcrypt/src/misc/crypt/crypt_find_hash_id.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -35,6 +35,6 @@ int find_hash_id(unsigned char ID)
return -1;
}
-/* $Source: /cvs/libtom/libtomcrypt/src/misc/crypt/crypt_find_hash_id.c,v $ */
-/* $Revision: 1.6 $ */
-/* $Date: 2006/03/31 14:15:35 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/misc/crypt/crypt_find_hash_oid.c b/libtomcrypt/src/misc/crypt/crypt_find_hash_oid.c
index d04f80c..19aece7 100644
--- a/libtomcrypt/src/misc/crypt/crypt_find_hash_oid.c
+++ b/libtomcrypt/src/misc/crypt/crypt_find_hash_oid.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -30,6 +30,6 @@ int find_hash_oid(const unsigned long *ID, unsigned long IDlen)
return -1;
}
-/* $Source: /cvs/libtom/libtomcrypt/src/misc/crypt/crypt_find_hash_oid.c,v $ */
-/* $Revision: 1.4 $ */
-/* $Date: 2006/11/01 09:28:17 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/misc/crypt/crypt_find_prng.c b/libtomcrypt/src/misc/crypt/crypt_find_prng.c
index 4b3bc5a..af3f7b6 100644
--- a/libtomcrypt/src/misc/crypt/crypt_find_prng.c
+++ b/libtomcrypt/src/misc/crypt/crypt_find_prng.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -36,6 +36,6 @@ int find_prng(const char *name)
}
-/* $Source: /cvs/libtom/libtomcrypt/src/misc/crypt/crypt_find_prng.c,v $ */
-/* $Revision: 1.6 $ */
-/* $Date: 2006/11/29 23:43:57 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/misc/crypt/crypt_fsa.c b/libtomcrypt/src/misc/crypt/crypt_fsa.c
index a9569b7..3d6d86d 100644
--- a/libtomcrypt/src/misc/crypt/crypt_fsa.c
+++ b/libtomcrypt/src/misc/crypt/crypt_fsa.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
#include <stdarg.h>
@@ -54,6 +54,6 @@ int crypt_fsa(void *mp, ...)
}
-/* $Source: /cvs/libtom/libtomcrypt/src/misc/crypt/crypt_fsa.c,v $ */
-/* $Revision: 1.4 $ */
-/* $Date: 2006/11/13 23:14:33 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/misc/crypt/crypt_hash_descriptor.c b/libtomcrypt/src/misc/crypt/crypt_hash_descriptor.c
index 5fa59f1..a0c3c1a 100644
--- a/libtomcrypt/src/misc/crypt/crypt_hash_descriptor.c
+++ b/libtomcrypt/src/misc/crypt/crypt_hash_descriptor.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -22,6 +22,6 @@ struct ltc_hash_descriptor hash_descriptor[TAB_SIZE] = {
LTC_MUTEX_GLOBAL(ltc_hash_mutex)
-/* $Source: /cvs/libtom/libtomcrypt/src/misc/crypt/crypt_hash_descriptor.c,v $ */
-/* $Revision: 1.9 $ */
-/* $Date: 2006/03/31 14:15:35 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/misc/crypt/crypt_hash_is_valid.c b/libtomcrypt/src/misc/crypt/crypt_hash_is_valid.c
index 54a91eb..011f829 100644
--- a/libtomcrypt/src/misc/crypt/crypt_hash_is_valid.c
+++ b/libtomcrypt/src/misc/crypt/crypt_hash_is_valid.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -31,6 +31,6 @@ int hash_is_valid(int idx)
return CRYPT_OK;
}
-/* $Source: /cvs/libtom/libtomcrypt/src/misc/crypt/crypt_hash_is_valid.c,v $ */
-/* $Revision: 1.5 $ */
-/* $Date: 2006/03/31 14:15:35 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/misc/crypt/crypt_ltc_mp_descriptor.c b/libtomcrypt/src/misc/crypt/crypt_ltc_mp_descriptor.c
index e042910..8e565d2 100644
--- a/libtomcrypt/src/misc/crypt/crypt_ltc_mp_descriptor.c
+++ b/libtomcrypt/src/misc/crypt/crypt_ltc_mp_descriptor.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
diff --git a/libtomcrypt/src/misc/crypt/crypt_prng_descriptor.c b/libtomcrypt/src/misc/crypt/crypt_prng_descriptor.c
index a2b5f0e..3af9df5 100644
--- a/libtomcrypt/src/misc/crypt/crypt_prng_descriptor.c
+++ b/libtomcrypt/src/misc/crypt/crypt_prng_descriptor.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -21,6 +21,6 @@ struct ltc_prng_descriptor prng_descriptor[TAB_SIZE] = {
LTC_MUTEX_GLOBAL(ltc_prng_mutex)
-/* $Source: /cvs/libtom/libtomcrypt/src/misc/crypt/crypt_prng_descriptor.c,v $ */
-/* $Revision: 1.7 $ */
-/* $Date: 2006/03/31 14:15:35 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/misc/crypt/crypt_prng_is_valid.c b/libtomcrypt/src/misc/crypt/crypt_prng_is_valid.c
index 6af0a3c..ccc6e04 100644
--- a/libtomcrypt/src/misc/crypt/crypt_prng_is_valid.c
+++ b/libtomcrypt/src/misc/crypt/crypt_prng_is_valid.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -31,6 +31,6 @@ int prng_is_valid(int idx)
return CRYPT_OK;
}
-/* $Source: /cvs/libtom/libtomcrypt/src/misc/crypt/crypt_prng_is_valid.c,v $ */
-/* $Revision: 1.5 $ */
-/* $Date: 2006/03/31 14:15:35 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/misc/crypt/crypt_register_cipher.c b/libtomcrypt/src/misc/crypt/crypt_register_cipher.c
index 8d74cc5..d7feedf 100644
--- a/libtomcrypt/src/misc/crypt/crypt_register_cipher.c
+++ b/libtomcrypt/src/misc/crypt/crypt_register_cipher.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -49,6 +49,6 @@ int register_cipher(const struct ltc_cipher_descriptor *cipher)
return -1;
}
-/* $Source: /cvs/libtom/libtomcrypt/src/misc/crypt/crypt_register_cipher.c,v $ */
-/* $Revision: 1.5 $ */
-/* $Date: 2006/03/31 14:15:35 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/misc/crypt/crypt_register_hash.c b/libtomcrypt/src/misc/crypt/crypt_register_hash.c
index 45d0e85..10ccee4 100644
--- a/libtomcrypt/src/misc/crypt/crypt_register_hash.c
+++ b/libtomcrypt/src/misc/crypt/crypt_register_hash.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -49,6 +49,6 @@ int register_hash(const struct ltc_hash_descriptor *hash)
return -1;
}
-/* $Source: /cvs/libtom/libtomcrypt/src/misc/crypt/crypt_register_hash.c,v $ */
-/* $Revision: 1.6 $ */
-/* $Date: 2006/11/01 09:28:17 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/misc/crypt/crypt_register_prng.c b/libtomcrypt/src/misc/crypt/crypt_register_prng.c
index a834c47..1724df0 100644
--- a/libtomcrypt/src/misc/crypt/crypt_register_prng.c
+++ b/libtomcrypt/src/misc/crypt/crypt_register_prng.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -49,6 +49,6 @@ int register_prng(const struct ltc_prng_descriptor *prng)
return -1;
}
-/* $Source: /cvs/libtom/libtomcrypt/src/misc/crypt/crypt_register_prng.c,v $ */
-/* $Revision: 1.7 $ */
-/* $Date: 2006/11/01 09:28:17 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/misc/crypt/crypt_unregister_cipher.c b/libtomcrypt/src/misc/crypt/crypt_unregister_cipher.c
index 3cb46c4..b75785f 100644
--- a/libtomcrypt/src/misc/crypt/crypt_unregister_cipher.c
+++ b/libtomcrypt/src/misc/crypt/crypt_unregister_cipher.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -40,6 +40,6 @@ int unregister_cipher(const struct ltc_cipher_descriptor *cipher)
return CRYPT_ERROR;
}
-/* $Source: /cvs/libtom/libtomcrypt/src/misc/crypt/crypt_unregister_cipher.c,v $ */
-/* $Revision: 1.6 $ */
-/* $Date: 2006/11/01 09:28:17 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/misc/crypt/crypt_unregister_hash.c b/libtomcrypt/src/misc/crypt/crypt_unregister_hash.c
index a87a399..ac95d2d 100644
--- a/libtomcrypt/src/misc/crypt/crypt_unregister_hash.c
+++ b/libtomcrypt/src/misc/crypt/crypt_unregister_hash.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -39,6 +39,6 @@ int unregister_hash(const struct ltc_hash_descriptor *hash)
return CRYPT_ERROR;
}
-/* $Source: /cvs/libtom/libtomcrypt/src/misc/crypt/crypt_unregister_hash.c,v $ */
-/* $Revision: 1.6 $ */
-/* $Date: 2006/11/01 09:28:17 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/misc/crypt/crypt_unregister_prng.c b/libtomcrypt/src/misc/crypt/crypt_unregister_prng.c
index 694cbcf..bb34501 100644
--- a/libtomcrypt/src/misc/crypt/crypt_unregister_prng.c
+++ b/libtomcrypt/src/misc/crypt/crypt_unregister_prng.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -39,6 +39,6 @@ int unregister_prng(const struct ltc_prng_descriptor *prng)
return CRYPT_ERROR;
}
-/* $Source: /cvs/libtom/libtomcrypt/src/misc/crypt/crypt_unregister_prng.c,v $ */
-/* $Revision: 1.6 $ */
-/* $Date: 2006/11/01 09:28:17 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/misc/error_to_string.c b/libtomcrypt/src/misc/error_to_string.c
index 1da2597..034cd18 100644
--- a/libtomcrypt/src/misc/error_to_string.c
+++ b/libtomcrypt/src/misc/error_to_string.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -69,6 +69,6 @@ const char *error_to_string(int err)
}
-/* $Source: /cvs/libtom/libtomcrypt/src/misc/error_to_string.c,v $ */
-/* $Revision: 1.4 $ */
-/* $Date: 2006/03/31 14:15:35 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/misc/pkcs5/pkcs_5_1.c b/libtomcrypt/src/misc/pkcs5/pkcs_5_1.c
index e6f7b0c..519e7aa 100644
--- a/libtomcrypt/src/misc/pkcs5/pkcs_5_1.c
+++ b/libtomcrypt/src/misc/pkcs5/pkcs_5_1.c
@@ -6,21 +6,21 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include <tomcrypt.h>
/**
@file pkcs_5_1.c
- PKCS #5, Algorithm #1, Tom St Denis
+ LTC_PKCS #5, Algorithm #1, Tom St Denis
*/
-#ifdef PKCS_5
+#ifdef LTC_PKCS_5
/**
- Execute PKCS #5 v1
+ Execute LTC_PKCS #5 v1
@param password The password (or key)
@param password_len The length of the password (octet)
@param salt The salt (or nonce) which is 8 octets long
- @param iteration_count The PKCS #5 v1 iteration count
+ @param iteration_count The LTC_PKCS #5 v1 iteration count
@param hash_idx The index of the hash desired
@param out [out] The destination for this algorithm
@param outlen [in/out] The max size and resulting size of the algorithm output
@@ -101,6 +101,6 @@ LBL_ERR:
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/misc/pkcs5/pkcs_5_1.c,v $ */
-/* $Revision: 1.5 $ */
-/* $Date: 2006/03/31 14:15:35 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/misc/pkcs5/pkcs_5_2.c b/libtomcrypt/src/misc/pkcs5/pkcs_5_2.c
index 6e8d161..0d76d62 100644
--- a/libtomcrypt/src/misc/pkcs5/pkcs_5_2.c
+++ b/libtomcrypt/src/misc/pkcs5/pkcs_5_2.c
@@ -6,23 +6,23 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include <tomcrypt.h>
/**
@file pkcs_5_2.c
- PKCS #5, Algorithm #2, Tom St Denis
+ LTC_PKCS #5, Algorithm #2, Tom St Denis
*/
-#ifdef PKCS_5
+#ifdef LTC_PKCS_5
/**
- Execute PKCS #5 v2
+ Execute LTC_PKCS #5 v2
@param password The input password (or key)
@param password_len The length of the password (octets)
@param salt The salt (or nonce)
@param salt_len The length of the salt (octets)
- @param iteration_count # of iterations desired for PKCS #5 v2 [read specs for more]
+ @param iteration_count # of iterations desired for LTC_PKCS #5 v2 [read specs for more]
@param hash_idx The index of the hash desired
@param out [out] The destination for this algorithm
@param outlen [in/out] The max size and resulting size of the algorithm output
@@ -124,6 +124,6 @@ LBL_ERR:
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/misc/pkcs5/pkcs_5_2.c,v $ */
-/* $Revision: 1.5 $ */
-/* $Date: 2006/03/31 14:15:35 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/misc/zeromem.c b/libtomcrypt/src/misc/zeromem.c
index 9f6ba9b..2ddead8 100644
--- a/libtomcrypt/src/misc/zeromem.c
+++ b/libtomcrypt/src/misc/zeromem.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
#include "dbhelpers.h"
@@ -26,6 +26,6 @@ void zeromem(void *out, size_t outlen)
m_burn(out, outlen);
}
-/* $Source: /cvs/libtom/libtomcrypt/src/misc/zeromem.c,v $ */
-/* $Revision: 1.6 $ */
-/* $Date: 2006/06/09 01:38:13 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/modes/cbc/cbc_decrypt.c b/libtomcrypt/src/modes/cbc/cbc_decrypt.c
index d768d88..3751f14 100644
--- a/libtomcrypt/src/modes/cbc/cbc_decrypt.c
+++ b/libtomcrypt/src/modes/cbc/cbc_decrypt.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -92,6 +92,6 @@ int cbc_decrypt(const unsigned char *ct, unsigned char *pt, unsigned long len, s
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/modes/cbc/cbc_decrypt.c,v $ */
-/* $Revision: 1.15 $ */
-/* $Date: 2006/11/21 00:18:23 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/modes/cbc/cbc_done.c b/libtomcrypt/src/modes/cbc/cbc_done.c
index 99b035e..75b9742 100644
--- a/libtomcrypt/src/modes/cbc/cbc_done.c
+++ b/libtomcrypt/src/modes/cbc/cbc_done.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -37,6 +37,6 @@ int cbc_done(symmetric_CBC *cbc)
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/modes/cbc/cbc_done.c,v $ */
-/* $Revision: 1.6 $ */
-/* $Date: 2006/06/29 01:46:46 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/modes/cbc/cbc_encrypt.c b/libtomcrypt/src/modes/cbc/cbc_encrypt.c
index bbfd1c4..1f28204 100644
--- a/libtomcrypt/src/modes/cbc/cbc_encrypt.c
+++ b/libtomcrypt/src/modes/cbc/cbc_encrypt.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -93,6 +93,6 @@ int cbc_encrypt(const unsigned char *pt, unsigned char *ct, unsigned long len, s
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/modes/cbc/cbc_encrypt.c,v $ */
-/* $Revision: 1.13 $ */
-/* $Date: 2006/11/21 00:18:23 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/modes/cbc/cbc_getiv.c b/libtomcrypt/src/modes/cbc/cbc_getiv.c
index c54d558..6587743 100644
--- a/libtomcrypt/src/modes/cbc/cbc_getiv.c
+++ b/libtomcrypt/src/modes/cbc/cbc_getiv.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -41,6 +41,6 @@ int cbc_getiv(unsigned char *IV, unsigned long *len, symmetric_CBC *cbc)
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/modes/cbc/cbc_getiv.c,v $ */
-/* $Revision: 1.6 $ */
-/* $Date: 2006/06/29 01:46:46 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/modes/cbc/cbc_setiv.c b/libtomcrypt/src/modes/cbc/cbc_setiv.c
index 6fb70ca..cd2e32e 100644
--- a/libtomcrypt/src/modes/cbc/cbc_setiv.c
+++ b/libtomcrypt/src/modes/cbc/cbc_setiv.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -39,6 +39,6 @@ int cbc_setiv(const unsigned char *IV, unsigned long len, symmetric_CBC *cbc)
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/modes/cbc/cbc_setiv.c,v $ */
-/* $Revision: 1.5 $ */
-/* $Date: 2006/06/29 01:46:46 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/modes/cbc/cbc_start.c b/libtomcrypt/src/modes/cbc/cbc_start.c
index 86ec7b9..832e77a 100644
--- a/libtomcrypt/src/modes/cbc/cbc_start.c
+++ b/libtomcrypt/src/modes/cbc/cbc_start.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -57,6 +57,6 @@ int cbc_start(int cipher, const unsigned char *IV, const unsigned char *key,
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/modes/cbc/cbc_start.c,v $ */
-/* $Revision: 1.5 $ */
-/* $Date: 2006/06/29 01:46:46 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/modes/cfb/cfb_decrypt.c b/libtomcrypt/src/modes/cfb/cfb_decrypt.c
index 76a4de1..13ac5a6 100644
--- a/libtomcrypt/src/modes/cfb/cfb_decrypt.c
+++ b/libtomcrypt/src/modes/cfb/cfb_decrypt.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -62,6 +62,6 @@ int cfb_decrypt(const unsigned char *ct, unsigned char *pt, unsigned long len, s
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/modes/cfb/cfb_decrypt.c,v $ */
-/* $Revision: 1.7 $ */
-/* $Date: 2006/11/26 01:45:14 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/modes/cfb/cfb_done.c b/libtomcrypt/src/modes/cfb/cfb_done.c
index 4ee9d50..1ee9a98 100644
--- a/libtomcrypt/src/modes/cfb/cfb_done.c
+++ b/libtomcrypt/src/modes/cfb/cfb_done.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -37,6 +37,6 @@ int cfb_done(symmetric_CFB *cfb)
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/modes/cfb/cfb_done.c,v $ */
-/* $Revision: 1.6 $ */
-/* $Date: 2006/06/29 01:51:34 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/modes/cfb/cfb_encrypt.c b/libtomcrypt/src/modes/cfb/cfb_encrypt.c
index b619682..8ac5f5c 100644
--- a/libtomcrypt/src/modes/cfb/cfb_encrypt.c
+++ b/libtomcrypt/src/modes/cfb/cfb_encrypt.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -60,6 +60,6 @@ int cfb_encrypt(const unsigned char *pt, unsigned char *ct, unsigned long len, s
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/modes/cfb/cfb_encrypt.c,v $ */
-/* $Revision: 1.7 $ */
-/* $Date: 2006/11/26 01:45:14 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/modes/cfb/cfb_getiv.c b/libtomcrypt/src/modes/cfb/cfb_getiv.c
index 1689a75..b6786e1 100644
--- a/libtomcrypt/src/modes/cfb/cfb_getiv.c
+++ b/libtomcrypt/src/modes/cfb/cfb_getiv.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -41,6 +41,6 @@ int cfb_getiv(unsigned char *IV, unsigned long *len, symmetric_CFB *cfb)
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/modes/cfb/cfb_getiv.c,v $ */
-/* $Revision: 1.6 $ */
-/* $Date: 2006/06/29 01:51:34 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/modes/cfb/cfb_setiv.c b/libtomcrypt/src/modes/cfb/cfb_setiv.c
index efb848b..0fc8757 100644
--- a/libtomcrypt/src/modes/cfb/cfb_setiv.c
+++ b/libtomcrypt/src/modes/cfb/cfb_setiv.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -47,6 +47,6 @@ int cfb_setiv(const unsigned char *IV, unsigned long len, symmetric_CFB *cfb)
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/modes/cfb/cfb_setiv.c,v $ */
-/* $Revision: 1.6 $ */
-/* $Date: 2006/06/29 01:51:34 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/modes/cfb/cfb_start.c b/libtomcrypt/src/modes/cfb/cfb_start.c
index e70d635..a8e5b8b 100644
--- a/libtomcrypt/src/modes/cfb/cfb_start.c
+++ b/libtomcrypt/src/modes/cfb/cfb_start.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -60,6 +60,6 @@ int cfb_start(int cipher, const unsigned char *IV, const unsigned char *key,
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/modes/cfb/cfb_start.c,v $ */
-/* $Revision: 1.6 $ */
-/* $Date: 2006/06/29 01:51:34 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/modes/ctr/ctr_decrypt.c b/libtomcrypt/src/modes/ctr/ctr_decrypt.c
index f32821f..9537249 100644
--- a/libtomcrypt/src/modes/ctr/ctr_decrypt.c
+++ b/libtomcrypt/src/modes/ctr/ctr_decrypt.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -37,6 +37,6 @@ int ctr_decrypt(const unsigned char *ct, unsigned char *pt, unsigned long len, s
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/modes/ctr/ctr_decrypt.c,v $ */
-/* $Revision: 1.5 $ */
-/* $Date: 2006/06/29 01:46:46 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/modes/ctr/ctr_done.c b/libtomcrypt/src/modes/ctr/ctr_done.c
index 074c8b6..26391fd 100644
--- a/libtomcrypt/src/modes/ctr/ctr_done.c
+++ b/libtomcrypt/src/modes/ctr/ctr_done.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -37,6 +37,6 @@ int ctr_done(symmetric_CTR *ctr)
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/modes/ctr/ctr_done.c,v $ */
-/* $Revision: 1.6 $ */
-/* $Date: 2006/06/29 01:46:46 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/modes/ctr/ctr_encrypt.c b/libtomcrypt/src/modes/ctr/ctr_encrypt.c
index 84dd65b..0b08359 100644
--- a/libtomcrypt/src/modes/ctr/ctr_encrypt.c
+++ b/libtomcrypt/src/modes/ctr/ctr_encrypt.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -64,7 +64,7 @@ int ctr_encrypt(const unsigned char *pt, unsigned char *ct, unsigned long len, s
/* increment counter */
if (ctr->mode == CTR_COUNTER_LITTLE_ENDIAN) {
/* little-endian */
- for (x = 0; x < ctr->blocklen; x++) {
+ for (x = 0; x < ctr->ctrlen; x++) {
ctr->ctr[x] = (ctr->ctr[x] + (unsigned char)1) & (unsigned char)255;
if (ctr->ctr[x] != (unsigned char)0) {
break;
@@ -72,7 +72,7 @@ int ctr_encrypt(const unsigned char *pt, unsigned char *ct, unsigned long len, s
}
} else {
/* big-endian */
- for (x = ctr->blocklen-1; x >= 0; x--) {
+ for (x = ctr->blocklen-1; x >= ctr->ctrlen; x--) {
ctr->ctr[x] = (ctr->ctr[x] + (unsigned char)1) & (unsigned char)255;
if (ctr->ctr[x] != (unsigned char)0) {
break;
@@ -107,6 +107,6 @@ int ctr_encrypt(const unsigned char *pt, unsigned char *ct, unsigned long len, s
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/modes/ctr/ctr_encrypt.c,v $ */
-/* $Revision: 1.20 $ */
-/* $Date: 2006/11/21 00:18:23 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/modes/ctr/ctr_getiv.c b/libtomcrypt/src/modes/ctr/ctr_getiv.c
index 2fbf888..6242323 100644
--- a/libtomcrypt/src/modes/ctr/ctr_getiv.c
+++ b/libtomcrypt/src/modes/ctr/ctr_getiv.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -41,6 +41,6 @@ int ctr_getiv(unsigned char *IV, unsigned long *len, symmetric_CTR *ctr)
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/modes/ctr/ctr_getiv.c,v $ */
-/* $Revision: 1.6 $ */
-/* $Date: 2006/06/29 01:46:46 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/modes/ctr/ctr_setiv.c b/libtomcrypt/src/modes/ctr/ctr_setiv.c
index 8e8649f..56a3c97 100644
--- a/libtomcrypt/src/modes/ctr/ctr_setiv.c
+++ b/libtomcrypt/src/modes/ctr/ctr_setiv.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -51,6 +51,6 @@ int ctr_setiv(const unsigned char *IV, unsigned long len, symmetric_CTR *ctr)
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/modes/ctr/ctr_setiv.c,v $ */
-/* $Revision: 1.6 $ */
-/* $Date: 2006/06/29 01:46:46 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/modes/ctr/ctr_start.c b/libtomcrypt/src/modes/ctr/ctr_start.c
index 895c8a4..b27bed0 100644
--- a/libtomcrypt/src/modes/ctr/ctr_start.c
+++ b/libtomcrypt/src/modes/ctr/ctr_start.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -46,6 +46,16 @@ int ctr_start( int cipher,
return err;
}
+ /* ctrlen == counter width */
+ ctr->ctrlen = (ctr_mode & 255) ? (ctr_mode & 255) : cipher_descriptor[cipher].block_length;
+ if (ctr->ctrlen > cipher_descriptor[cipher].block_length) {
+ return CRYPT_INVALID_ARG;
+ }
+
+ if ((ctr_mode & 0x1000) == CTR_COUNTER_BIG_ENDIAN) {
+ ctr->ctrlen = cipher_descriptor[cipher].block_length - ctr->ctrlen;
+ }
+
/* setup cipher */
if ((err = cipher_descriptor[cipher].setup(key, keylen, num_rounds, &ctr->key)) != CRYPT_OK) {
return err;
@@ -55,7 +65,7 @@ int ctr_start( int cipher,
ctr->blocklen = cipher_descriptor[cipher].block_length;
ctr->cipher = cipher;
ctr->padlen = 0;
- ctr->mode = ctr_mode & 1;
+ ctr->mode = ctr_mode & 0x1000;
for (x = 0; x < ctr->blocklen; x++) {
ctr->ctr[x] = IV[x];
}
@@ -64,7 +74,7 @@ int ctr_start( int cipher,
/* increment the IV as per RFC 3686 */
if (ctr->mode == CTR_COUNTER_LITTLE_ENDIAN) {
/* little-endian */
- for (x = 0; x < ctr->blocklen; x++) {
+ for (x = 0; x < ctr->ctrlen; x++) {
ctr->ctr[x] = (ctr->ctr[x] + (unsigned char)1) & (unsigned char)255;
if (ctr->ctr[x] != (unsigned char)0) {
break;
@@ -72,7 +82,7 @@ int ctr_start( int cipher,
}
} else {
/* big-endian */
- for (x = ctr->blocklen-1; x >= 0; x--) {
+ for (x = ctr->blocklen-1; x >= ctr->ctrlen; x--) {
ctr->ctr[x] = (ctr->ctr[x] + (unsigned char)1) & (unsigned char)255;
if (ctr->ctr[x] != (unsigned char)0) {
break;
@@ -86,6 +96,6 @@ int ctr_start( int cipher,
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/modes/ctr/ctr_start.c,v $ */
-/* $Revision: 1.11 $ */
-/* $Date: 2006/11/05 01:46:35 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/modes/ctr/ctr_test.c b/libtomcrypt/src/modes/ctr/ctr_test.c
index ad20778..9962afd 100644
--- a/libtomcrypt/src/modes/ctr/ctr_test.c
+++ b/libtomcrypt/src/modes/ctr/ctr_test.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -77,9 +77,9 @@ int ctr_test(void)
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/modes/ctr/ctr_test.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/11/05 02:06:49 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/modes/ecb/ecb_decrypt.c b/libtomcrypt/src/modes/ecb/ecb_decrypt.c
index c16fce0..84842c2 100644
--- a/libtomcrypt/src/modes/ecb/ecb_decrypt.c
+++ b/libtomcrypt/src/modes/ecb/ecb_decrypt.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -56,6 +56,6 @@ int ecb_decrypt(const unsigned char *ct, unsigned char *pt, unsigned long len, s
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/modes/ecb/ecb_decrypt.c,v $ */
-/* $Revision: 1.9 $ */
-/* $Date: 2006/06/29 01:51:34 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/modes/ecb/ecb_done.c b/libtomcrypt/src/modes/ecb/ecb_done.c
index 2af3a83..961ec97 100644
--- a/libtomcrypt/src/modes/ecb/ecb_done.c
+++ b/libtomcrypt/src/modes/ecb/ecb_done.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -37,6 +37,6 @@ int ecb_done(symmetric_ECB *ecb)
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/modes/ecb/ecb_done.c,v $ */
-/* $Revision: 1.7 $ */
-/* $Date: 2006/06/29 01:51:34 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/modes/ecb/ecb_encrypt.c b/libtomcrypt/src/modes/ecb/ecb_encrypt.c
index f6910c6..801e0fd 100644
--- a/libtomcrypt/src/modes/ecb/ecb_encrypt.c
+++ b/libtomcrypt/src/modes/ecb/ecb_encrypt.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -56,6 +56,6 @@ int ecb_encrypt(const unsigned char *pt, unsigned char *ct, unsigned long len, s
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/modes/ecb/ecb_encrypt.c,v $ */
-/* $Revision: 1.9 $ */
-/* $Date: 2006/06/29 01:51:34 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/modes/ecb/ecb_start.c b/libtomcrypt/src/modes/ecb/ecb_start.c
index cc84579..cec583a 100644
--- a/libtomcrypt/src/modes/ecb/ecb_start.c
+++ b/libtomcrypt/src/modes/ecb/ecb_start.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -43,6 +43,6 @@ int ecb_start(int cipher, const unsigned char *key, int keylen, int num_rounds,
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/modes/ecb/ecb_start.c,v $ */
-/* $Revision: 1.5 $ */
-/* $Date: 2006/06/29 01:51:34 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/modes/f8/f8_decrypt.c b/libtomcrypt/src/modes/f8/f8_decrypt.c
index fc8f61a..9c4525d 100644
--- a/libtomcrypt/src/modes/f8/f8_decrypt.c
+++ b/libtomcrypt/src/modes/f8/f8_decrypt.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -38,6 +38,6 @@ int f8_decrypt(const unsigned char *ct, unsigned char *pt, unsigned long len, sy
-/* $Source: /cvs/libtom/libtomcrypt/src/modes/f8/f8_decrypt.c,v $ */
-/* $Revision: 1.2 $ */
-/* $Date: 2006/06/16 22:49:25 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/modes/f8/f8_done.c b/libtomcrypt/src/modes/f8/f8_done.c
index c864767..867d603 100644
--- a/libtomcrypt/src/modes/f8/f8_done.c
+++ b/libtomcrypt/src/modes/f8/f8_done.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -37,6 +37,6 @@ int f8_done(symmetric_F8 *f8)
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/modes/f8/f8_done.c,v $ */
-/* $Revision: 1.2 $ */
-/* $Date: 2006/06/16 22:49:25 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/modes/f8/f8_encrypt.c b/libtomcrypt/src/modes/f8/f8_encrypt.c
index fc33be9..d1a96df 100644
--- a/libtomcrypt/src/modes/f8/f8_encrypt.c
+++ b/libtomcrypt/src/modes/f8/f8_encrypt.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -98,6 +98,6 @@ int f8_encrypt(const unsigned char *pt, unsigned char *ct, unsigned long len, sy
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/modes/f8/f8_encrypt.c,v $ */
-/* $Revision: 1.6 $ */
-/* $Date: 2006/11/05 04:16:32 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/modes/f8/f8_getiv.c b/libtomcrypt/src/modes/f8/f8_getiv.c
index 2c5d92f..ff7cb91 100644
--- a/libtomcrypt/src/modes/f8/f8_getiv.c
+++ b/libtomcrypt/src/modes/f8/f8_getiv.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -41,6 +41,6 @@ int f8_getiv(unsigned char *IV, unsigned long *len, symmetric_F8 *f8)
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/modes/f8/f8_getiv.c,v $ */
-/* $Revision: 1.2 $ */
-/* $Date: 2006/06/16 22:49:25 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/modes/f8/f8_setiv.c b/libtomcrypt/src/modes/f8/f8_setiv.c
index 469cc15..d1cafcf 100644
--- a/libtomcrypt/src/modes/f8/f8_setiv.c
+++ b/libtomcrypt/src/modes/f8/f8_setiv.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -47,6 +47,6 @@ int f8_setiv(const unsigned char *IV, unsigned long len, symmetric_F8 *f8)
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/modes/f8/f8_setiv.c,v $ */
-/* $Revision: 1.2 $ */
-/* $Date: 2006/06/16 22:49:25 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/modes/f8/f8_start.c b/libtomcrypt/src/modes/f8/f8_start.c
index bb05c16..4cd58de 100644
--- a/libtomcrypt/src/modes/f8/f8_start.c
+++ b/libtomcrypt/src/modes/f8/f8_start.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -93,6 +93,6 @@ int f8_start( int cipher, const unsigned char *IV,
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/modes/f8/f8_start.c,v $ */
-/* $Revision: 1.7 $ */
-/* $Date: 2006/11/05 01:36:43 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/modes/f8/f8_test_mode.c b/libtomcrypt/src/modes/f8/f8_test_mode.c
index 68160ea..5cc391b 100644
--- a/libtomcrypt/src/modes/f8/f8_test_mode.c
+++ b/libtomcrypt/src/modes/f8/f8_test_mode.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -71,6 +71,6 @@ int f8_test_mode(void)
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/modes/f8/f8_test_mode.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/11/13 11:55:25 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/modes/lrw/lrw_decrypt.c b/libtomcrypt/src/modes/lrw/lrw_decrypt.c
index 24eece8..e2858c0 100644
--- a/libtomcrypt/src/modes/lrw/lrw_decrypt.c
+++ b/libtomcrypt/src/modes/lrw/lrw_decrypt.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -46,6 +46,6 @@ int lrw_decrypt(const unsigned char *ct, unsigned char *pt, unsigned long len, s
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/modes/lrw/lrw_decrypt.c,v $ */
-/* $Revision: 1.8 $ */
-/* $Date: 2006/06/29 01:53:13 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/modes/lrw/lrw_done.c b/libtomcrypt/src/modes/lrw/lrw_done.c
index 4ae75c3..e123d28 100644
--- a/libtomcrypt/src/modes/lrw/lrw_done.c
+++ b/libtomcrypt/src/modes/lrw/lrw_done.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -37,6 +37,6 @@ int lrw_done(symmetric_LRW *lrw)
}
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/modes/lrw/lrw_done.c,v $ */
-/* $Revision: 1.6 $ */
-/* $Date: 2006/06/29 01:53:13 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/modes/lrw/lrw_encrypt.c b/libtomcrypt/src/modes/lrw/lrw_encrypt.c
index 5ed11c9..d84cbdd 100644
--- a/libtomcrypt/src/modes/lrw/lrw_encrypt.c
+++ b/libtomcrypt/src/modes/lrw/lrw_encrypt.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -45,6 +45,6 @@ int lrw_encrypt(const unsigned char *pt, unsigned char *ct, unsigned long len, s
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/modes/lrw/lrw_encrypt.c,v $ */
-/* $Revision: 1.9 $ */
-/* $Date: 2006/06/29 01:53:13 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/modes/lrw/lrw_getiv.c b/libtomcrypt/src/modes/lrw/lrw_getiv.c
index 00159ce..575e322 100644
--- a/libtomcrypt/src/modes/lrw/lrw_getiv.c
+++ b/libtomcrypt/src/modes/lrw/lrw_getiv.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -40,6 +40,6 @@ int lrw_getiv(unsigned char *IV, unsigned long *len, symmetric_LRW *lrw)
}
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/modes/lrw/lrw_getiv.c,v $ */
-/* $Revision: 1.9 $ */
-/* $Date: 2006/06/29 01:53:13 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/modes/lrw/lrw_process.c b/libtomcrypt/src/modes/lrw/lrw_process.c
index 451d4ce..25661e7 100644
--- a/libtomcrypt/src/modes/lrw/lrw_process.c
+++ b/libtomcrypt/src/modes/lrw/lrw_process.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -115,6 +115,6 @@ int lrw_process(const unsigned char *pt, unsigned char *ct, unsigned long len, i
}
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/modes/lrw/lrw_process.c,v $ */
-/* $Revision: 1.10 $ */
-/* $Date: 2006/06/29 01:53:13 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/modes/lrw/lrw_setiv.c b/libtomcrypt/src/modes/lrw/lrw_setiv.c
index bb3c0aa..2ff9a80 100644
--- a/libtomcrypt/src/modes/lrw/lrw_setiv.c
+++ b/libtomcrypt/src/modes/lrw/lrw_setiv.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -74,6 +74,6 @@ int lrw_setiv(const unsigned char *IV, unsigned long len, symmetric_LRW *lrw)
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/modes/lrw/lrw_setiv.c,v $ */
-/* $Revision: 1.12 $ */
-/* $Date: 2006/06/29 01:53:13 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/modes/lrw/lrw_start.c b/libtomcrypt/src/modes/lrw/lrw_start.c
index a9f24b5..f378789 100644
--- a/libtomcrypt/src/modes/lrw/lrw_start.c
+++ b/libtomcrypt/src/modes/lrw/lrw_start.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -98,6 +98,6 @@ int lrw_start( int cipher,
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/modes/lrw/lrw_start.c,v $ */
-/* $Revision: 1.11 $ */
-/* $Date: 2006/06/29 01:53:13 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/modes/lrw/lrw_test.c b/libtomcrypt/src/modes/lrw/lrw_test.c
index fe33845..63e014a 100644
--- a/libtomcrypt/src/modes/lrw/lrw_test.c
+++ b/libtomcrypt/src/modes/lrw/lrw_test.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -131,6 +131,6 @@ int lrw_test(void)
-/* $Source: /cvs/libtom/libtomcrypt/src/modes/lrw/lrw_test.c,v $ */
-/* $Revision: 1.11 $ */
-/* $Date: 2006/06/29 01:53:13 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/modes/ofb/ofb_decrypt.c b/libtomcrypt/src/modes/ofb/ofb_decrypt.c
index 1ada1ed..2c8780e 100644
--- a/libtomcrypt/src/modes/ofb/ofb_decrypt.c
+++ b/libtomcrypt/src/modes/ofb/ofb_decrypt.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -38,6 +38,6 @@ int ofb_decrypt(const unsigned char *ct, unsigned char *pt, unsigned long len, s
-/* $Source: /cvs/libtom/libtomcrypt/src/modes/ofb/ofb_decrypt.c,v $ */
-/* $Revision: 1.5 $ */
-/* $Date: 2006/06/29 01:51:34 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/modes/ofb/ofb_done.c b/libtomcrypt/src/modes/ofb/ofb_done.c
index 50a9de2..10506b3 100644
--- a/libtomcrypt/src/modes/ofb/ofb_done.c
+++ b/libtomcrypt/src/modes/ofb/ofb_done.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -37,6 +37,6 @@ int ofb_done(symmetric_OFB *ofb)
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/modes/ofb/ofb_done.c,v $ */
-/* $Revision: 1.6 $ */
-/* $Date: 2006/06/29 01:51:34 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/modes/ofb/ofb_encrypt.c b/libtomcrypt/src/modes/ofb/ofb_encrypt.c
index 2c19f1d..8c97a4d 100644
--- a/libtomcrypt/src/modes/ofb/ofb_encrypt.c
+++ b/libtomcrypt/src/modes/ofb/ofb_encrypt.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -55,6 +55,6 @@ int ofb_encrypt(const unsigned char *pt, unsigned char *ct, unsigned long len, s
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/modes/ofb/ofb_encrypt.c,v $ */
-/* $Revision: 1.7 $ */
-/* $Date: 2006/11/26 01:45:14 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/modes/ofb/ofb_getiv.c b/libtomcrypt/src/modes/ofb/ofb_getiv.c
index 641d14b..c009e33 100644
--- a/libtomcrypt/src/modes/ofb/ofb_getiv.c
+++ b/libtomcrypt/src/modes/ofb/ofb_getiv.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -41,6 +41,6 @@ int ofb_getiv(unsigned char *IV, unsigned long *len, symmetric_OFB *ofb)
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/modes/ofb/ofb_getiv.c,v $ */
-/* $Revision: 1.6 $ */
-/* $Date: 2006/06/29 01:51:34 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/modes/ofb/ofb_setiv.c b/libtomcrypt/src/modes/ofb/ofb_setiv.c
index 35a84e9..826caa9 100644
--- a/libtomcrypt/src/modes/ofb/ofb_setiv.c
+++ b/libtomcrypt/src/modes/ofb/ofb_setiv.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -47,6 +47,6 @@ int ofb_setiv(const unsigned char *IV, unsigned long len, symmetric_OFB *ofb)
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/modes/ofb/ofb_setiv.c,v $ */
-/* $Revision: 1.6 $ */
-/* $Date: 2006/06/29 01:51:34 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/modes/ofb/ofb_start.c b/libtomcrypt/src/modes/ofb/ofb_start.c
index 1f0f65a..cf87545 100644
--- a/libtomcrypt/src/modes/ofb/ofb_start.c
+++ b/libtomcrypt/src/modes/ofb/ofb_start.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -55,6 +55,6 @@ int ofb_start(int cipher, const unsigned char *IV, const unsigned char *key,
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/modes/ofb/ofb_start.c,v $ */
-/* $Revision: 1.5 $ */
-/* $Date: 2006/06/29 01:51:34 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/modes/xts/xts_decrypt.c b/libtomcrypt/src/modes/xts/xts_decrypt.c
new file mode 100644
index 0000000..3e46c53
--- /dev/null
+++ b/libtomcrypt/src/modes/xts/xts_decrypt.c
@@ -0,0 +1,141 @@
+/* LibTomCrypt, modular cryptographic library -- Tom St Denis
+ *
+ * LibTomCrypt is a library that provides various cryptographic
+ * algorithms in a highly modular and flexible manner.
+ *
+ * The library is free for all purposes without any express
+ * guarantee it works.
+ *
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
+ */
+#include "tomcrypt.h"
+
+/**
+ Source donated by Elliptic Semiconductor Inc (www.ellipticsemi.com) to the LibTom Projects
+*/
+
+#ifdef LTC_XTS_MODE
+
+static int tweak_uncrypt(const unsigned char *C, unsigned char *P, unsigned char *T, symmetric_xts *xts)
+{
+ unsigned long x;
+ int err;
+
+ /* tweak encrypt block i */
+#ifdef LTC_FAST
+ for (x = 0; x < 16; x += sizeof(LTC_FAST_TYPE)) {
+ *((LTC_FAST_TYPE*)&P[x]) = *((LTC_FAST_TYPE*)&C[x]) ^ *((LTC_FAST_TYPE*)&T[x]);
+ }
+#else
+ for (x = 0; x < 16; x++) {
+ P[x] = C[x] ^ T[x];
+ }
+#endif
+
+ err = cipher_descriptor[xts->cipher].ecb_decrypt(P, P, &xts->key1);
+
+#ifdef LTC_FAST
+ for (x = 0; x < 16; x += sizeof(LTC_FAST_TYPE)) {
+ *((LTC_FAST_TYPE*)&P[x]) ^= *((LTC_FAST_TYPE*)&T[x]);
+ }
+#else
+ for (x = 0; x < 16; x++) {
+ P[x] = P[x] ^ T[x];
+ }
+#endif
+
+ /* LFSR the tweak */
+ xts_mult_x(T);
+
+ return err;
+}
+
+/** XTS Decryption
+ @param ct [in] Ciphertext
+ @param ptlen Length of plaintext (and ciphertext)
+ @param pt [out] Plaintext
+ @param tweak [in] The 128--bit encryption tweak (e.g. sector number)
+ @param xts The XTS structure
+ Returns CRYPT_OK upon success
+*/int xts_decrypt(
+ const unsigned char *ct, unsigned long ptlen,
+ unsigned char *pt,
+ const unsigned char *tweak,
+ symmetric_xts *xts)
+{
+ unsigned char PP[16], CC[16], T[16];
+ unsigned long i, m, mo, lim;
+ int err;
+
+ /* check inputs */
+ LTC_ARGCHK(pt != NULL);
+ LTC_ARGCHK(ct != NULL);
+ LTC_ARGCHK(tweak != NULL);
+ LTC_ARGCHK(xts != NULL);
+
+ /* check if valid */
+ if ((err = cipher_is_valid(xts->cipher)) != CRYPT_OK) {
+ return err;
+ }
+
+ /* get number of blocks */
+ m = ptlen >> 4;
+ mo = ptlen & 15;
+
+ /* must have at least one full block */
+ if (m == 0) {
+ return CRYPT_INVALID_ARG;
+ }
+
+ /* encrypt the tweak */
+ if ((err = cipher_descriptor[xts->cipher].ecb_encrypt(tweak, T, &xts->key2)) != CRYPT_OK) {
+ return err;
+ }
+
+ /* for i = 0 to m-2 do */
+ if (mo == 0) {
+ lim = m;
+ } else {
+ lim = m - 1;
+ }
+
+ for (i = 0; i < lim; i++) {
+ err = tweak_uncrypt(ct, pt, T, xts);
+ ct += 16;
+ pt += 16;
+ }
+
+ /* if ptlen not divide 16 then */
+ if (mo > 0) {
+ XMEMCPY(CC, T, 16);
+ xts_mult_x(CC);
+
+ /* PP = tweak decrypt block m-1 */
+ if ((err = tweak_uncrypt(ct, PP, CC, xts)) != CRYPT_OK) {
+ return err;
+ }
+
+ /* Pm = first ptlen % 16 bytes of PP */
+ for (i = 0; i < mo; i++) {
+ CC[i] = ct[16+i];
+ pt[16+i] = PP[i];
+ }
+ for (; i < 16; i++) {
+ CC[i] = PP[i];
+ }
+
+ /* Pm-1 = Tweak uncrypt CC */
+ if ((err = tweak_uncrypt(CC, pt, T, xts)) != CRYPT_OK) {
+ return err;
+ }
+ }
+
+ return CRYPT_OK;
+}
+
+#endif
+
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
+
diff --git a/libtomcrypt/src/modes/xts/xts_done.c b/libtomcrypt/src/modes/xts/xts_done.c
new file mode 100644
index 0000000..7c04277
--- /dev/null
+++ b/libtomcrypt/src/modes/xts/xts_done.c
@@ -0,0 +1,34 @@
+/* LibTomCrypt, modular cryptographic library -- Tom St Denis
+ *
+ * LibTomCrypt is a library that provides various cryptographic
+ * algorithms in a highly modular and flexible manner.
+ *
+ * The library is free for all purposes without any express
+ * guarantee it works.
+ *
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
+ */
+#include "tomcrypt.h"
+
+/**
+ Source donated by Elliptic Semiconductor Inc (www.ellipticsemi.com) to the LibTom Projects
+*/
+
+#ifdef LTC_XTS_MODE
+
+/** Terminate XTS state
+ @param XTS The state to terminate
+*/
+void xts_done(symmetric_xts *xts)
+{
+ LTC_ARGCHKVD(xts != NULL);
+ cipher_descriptor[xts->cipher].done(&xts->key1);
+ cipher_descriptor[xts->cipher].done(&xts->key2);
+}
+
+#endif
+
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
+
diff --git a/libtomcrypt/src/modes/xts/xts_encrypt.c b/libtomcrypt/src/modes/xts/xts_encrypt.c
new file mode 100644
index 0000000..ab53d3c
--- /dev/null
+++ b/libtomcrypt/src/modes/xts/xts_encrypt.c
@@ -0,0 +1,142 @@
+/* LibTomCrypt, modular cryptographic library -- Tom St Denis
+ *
+ * LibTomCrypt is a library that provides various cryptographic
+ * algorithms in a highly modular and flexible manner.
+ *
+ * The library is free for all purposes without any express
+ * guarantee it works.
+ *
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
+ */
+#include "tomcrypt.h"
+
+/**
+ Source donated by Elliptic Semiconductor Inc (www.ellipticsemi.com) to the LibTom Projects
+*/
+
+#ifdef LTC_XTS_MODE
+
+static int tweak_crypt(const unsigned char *P, unsigned char *C, unsigned char *T, symmetric_xts *xts)
+{
+ unsigned long x;
+ int err;
+
+ /* tweak encrypt block i */
+#ifdef LTC_FAST
+ for (x = 0; x < 16; x += sizeof(LTC_FAST_TYPE)) {
+ *((LTC_FAST_TYPE*)&C[x]) = *((LTC_FAST_TYPE*)&P[x]) ^ *((LTC_FAST_TYPE*)&T[x]);
+ }
+#else
+ for (x = 0; x < 16; x++) {
+ C[x] = P[x] ^ T[x];
+ }
+#endif
+
+ if ((err = cipher_descriptor[xts->cipher].ecb_encrypt(C, C, &xts->key1)) != CRYPT_OK) {
+ return err;
+ }
+
+#ifdef LTC_FAST
+ for (x = 0; x < 16; x += sizeof(LTC_FAST_TYPE)) {
+ *((LTC_FAST_TYPE*)&C[x]) ^= *((LTC_FAST_TYPE*)&T[x]);
+ }
+#else
+ for (x = 0; x < 16; x++) {
+ C[x] = C[x] ^ T[x];
+ }
+#endif
+
+ /* LFSR the tweak */
+ xts_mult_x(T);
+
+ return CRYPT_OK;
+}
+
+/** XTS Encryption
+ @param pt [in] Plaintext
+ @param ptlen Length of plaintext (and ciphertext)
+ @param ct [out] Ciphertext
+ @param tweak [in] The 128--bit encryption tweak (e.g. sector number)
+ @param xts The XTS structure
+ Returns CRYPT_OK upon success
+*/
+int xts_encrypt(
+ const unsigned char *pt, unsigned long ptlen,
+ unsigned char *ct,
+ const unsigned char *tweak,
+ symmetric_xts *xts)
+{
+ unsigned char PP[16], CC[16], T[16];
+ unsigned long i, m, mo, lim;
+ int err;
+
+ /* check inputs */
+ LTC_ARGCHK(pt != NULL);
+ LTC_ARGCHK(ct != NULL);
+ LTC_ARGCHK(tweak != NULL);
+ LTC_ARGCHK(xts != NULL);
+
+ /* check if valid */
+ if ((err = cipher_is_valid(xts->cipher)) != CRYPT_OK) {
+ return err;
+ }
+
+ /* get number of blocks */
+ m = ptlen >> 4;
+ mo = ptlen & 15;
+
+ /* must have at least one full block */
+ if (m == 0) {
+ return CRYPT_INVALID_ARG;
+ }
+
+ /* encrypt the tweak */
+ if ((err = cipher_descriptor[xts->cipher].ecb_encrypt(tweak, T, &xts->key2)) != CRYPT_OK) {
+ return err;
+ }
+
+ /* for i = 0 to m-2 do */
+ if (mo == 0) {
+ lim = m;
+ } else {
+ lim = m - 1;
+ }
+
+ for (i = 0; i < lim; i++) {
+ err = tweak_crypt(pt, ct, T, xts);
+ ct += 16;
+ pt += 16;
+ }
+
+ /* if ptlen not divide 16 then */
+ if (mo > 0) {
+ /* CC = tweak encrypt block m-1 */
+ if ((err = tweak_crypt(pt, CC, T, xts)) != CRYPT_OK) {
+ return err;
+ }
+
+ /* Cm = first ptlen % 16 bytes of CC */
+ for (i = 0; i < mo; i++) {
+ PP[i] = pt[16+i];
+ ct[16+i] = CC[i];
+ }
+
+ for (; i < 16; i++) {
+ PP[i] = CC[i];
+ }
+
+ /* Cm-1 = Tweak encrypt PP */
+ if ((err = tweak_crypt(PP, ct, T, xts)) != CRYPT_OK) {
+ return err;
+ }
+ }
+
+ return err;
+}
+
+#endif
+
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
+
diff --git a/libtomcrypt/src/modes/xts/xts_init.c b/libtomcrypt/src/modes/xts/xts_init.c
new file mode 100644
index 0000000..f38c01e
--- /dev/null
+++ b/libtomcrypt/src/modes/xts/xts_init.c
@@ -0,0 +1,69 @@
+/* LibTomCrypt, modular cryptographic library -- Tom St Denis
+ *
+ * LibTomCrypt is a library that provides various cryptographic
+ * algorithms in a highly modular and flexible manner.
+ *
+ * The library is free for all purposes without any express
+ * guarantee it works.
+ *
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
+ */
+#include "tomcrypt.h"
+
+/**
+ Source donated by Elliptic Semiconductor Inc (www.ellipticsemi.com) to the LibTom Projects
+*/
+
+#ifdef LTC_XTS_MODE
+
+
+/** Start XTS mode
+ @param cipher The index of the cipher to use
+ @param key1 The encrypt key
+ @param key2 The tweak encrypt key
+ @param keylen The length of the keys (each) in octets
+ @param num_rounds The number of rounds for the cipher (0 == default)
+ @param xts [out] XTS structure
+ Returns CRYPT_OK upon success.
+*/
+int xts_start( int cipher,
+ const unsigned char *key1,
+ const unsigned char *key2,
+ unsigned long keylen,
+ int num_rounds,
+ symmetric_xts *xts)
+{
+ int err;
+
+ /* check inputs */
+ LTC_ARGCHK(key1 != NULL);
+ LTC_ARGCHK(key2 != NULL);
+ LTC_ARGCHK(xts != NULL);
+
+ /* check if valid */
+ if ((err = cipher_is_valid(cipher)) != CRYPT_OK) {
+ return err;
+ }
+
+ if (cipher_descriptor[cipher].block_length != 16) {
+ return CRYPT_INVALID_ARG;
+ }
+
+ /* schedule the two ciphers */
+ if ((err = cipher_descriptor[cipher].setup(key1, keylen, num_rounds, &xts->key1)) != CRYPT_OK) {
+ return err;
+ }
+ if ((err = cipher_descriptor[cipher].setup(key2, keylen, num_rounds, &xts->key2)) != CRYPT_OK) {
+ return err;
+ }
+ xts->cipher = cipher;
+
+ return err;
+}
+
+#endif
+
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
+
diff --git a/libtomcrypt/src/modes/xts/xts_mult_x.c b/libtomcrypt/src/modes/xts/xts_mult_x.c
new file mode 100644
index 0000000..e5b7c11
--- /dev/null
+++ b/libtomcrypt/src/modes/xts/xts_mult_x.c
@@ -0,0 +1,42 @@
+/* LibTomCrypt, modular cryptographic library -- Tom St Denis
+ *
+ * LibTomCrypt is a library that provides various cryptographic
+ * algorithms in a highly modular and flexible manner.
+ *
+ * The library is free for all purposes without any express
+ * guarantee it works.
+ *
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
+ */
+#include "tomcrypt.h"
+
+/**
+ Source donated by Elliptic Semiconductor Inc (www.ellipticsemi.com) to the LibTom Projects
+*/
+
+#ifdef LTC_XTS_MODE
+
+/** multiply by x
+ @param I The value to multiply by x (LFSR shift)
+*/
+void xts_mult_x(unsigned char *I)
+{
+ int x;
+ unsigned char t, tt;
+
+ for (x = t = 0; x < 16; x++) {
+ tt = I[x] >> 7;
+ I[x] = ((I[x] << 1) | t) & 0xFF;
+ t = tt;
+ }
+ if (tt) {
+ I[0] ^= 0x87;
+ }
+}
+
+#endif
+
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
+
diff --git a/libtomcrypt/src/modes/xts/xts_test.c b/libtomcrypt/src/modes/xts/xts_test.c
new file mode 100644
index 0000000..b91e0f4
--- /dev/null
+++ b/libtomcrypt/src/modes/xts/xts_test.c
@@ -0,0 +1,199 @@
+/* LibTomCrypt, modular cryptographic library -- Tom St Denis
+ *
+ * LibTomCrypt is a library that provides various cryptographic
+ * algorithms in a highly modular and flexible manner.
+ *
+ * The library is free for all purposes without any express
+ * guarantee it works.
+ *
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
+ */
+#include "tomcrypt.h"
+
+#ifdef LTC_XTS_MODE
+
+/**
+ Source donated by Elliptic Semiconductor Inc (www.ellipticsemi.com) to the LibTom Projects
+ Returns CRYPT_OK upon success.
+*/
+int xts_test(void)
+{
+#ifdef LTC_NO_TEST
+ return CRYPT_NOP;
+#else
+ static const struct {
+ int keylen;
+ unsigned char key1[32];
+ unsigned char key2[32];
+ ulong64 seqnum;
+ unsigned long PTLEN;
+ unsigned char PTX[512], CTX[512];
+ } tests[] = {
+
+/* #1 32 byte key, 32 byte PTX */
+{
+ 32,
+ { 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00 },
+ { 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00 },
+ 0,
+ 32,
+ { 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00 },
+ { 0x91,0x7c,0xf6,0x9e,0xbd,0x68,0xb2,0xec,0x9b,0x9f,0xe9,0xa3,0xea,0xdd,0xa6,0x92,0xcd,0x43,0xd2,0xf5,0x95,0x98,0xed,0x85,0x8c,0x02,0xc2,0x65,0x2f,0xbf,0x92,0x2e },
+},
+
+/* #2, 32 byte key, 32 byte PTX */
+{
+ 32,
+ { 0x11,0x11,0x11,0x11,0x11,0x11,0x11,0x11,0x11,0x11,0x11,0x11,0x11,0x11,0x11,0x11 },
+ { 0x22,0x22,0x22,0x22,0x22,0x22,0x22,0x22,0x22,0x22,0x22,0x22,0x22,0x22,0x22,0x22 },
+ CONST64(0x3333333333),
+ 32,
+ { 0x44,0x44,0x44,0x44,0x44,0x44,0x44,0x44,0x44,0x44,0x44,0x44,0x44,0x44,0x44,0x44,0x44,0x44,0x44,0x44,0x44,0x44,0x44,0x44,0x44,0x44,0x44,0x44,0x44,0x44,0x44,0x44 },
+ { 0xc4,0x54,0x18,0x5e,0x6a,0x16,0x93,0x6e,0x39,0x33,0x40,0x38,0xac,0xef,0x83,0x8b,0xfb,0x18,0x6f,0xff,0x74,0x80,0xad,0xc4,0x28,0x93,0x82,0xec,0xd6,0xd3,0x94,0xf0 },
+},
+
+/* #5 from xts.7, 32 byte key, 32 byte PTX */
+{
+ 32,
+ { 0xff,0xfe,0xfd,0xfc,0xfb,0xfa,0xf9,0xf8,0xf7,0xf6,0xf5,0xf4,0xf3,0xf2,0xf1,0xf0 },
+ { 0xbf,0xbe,0xbd,0xbc,0xbb,0xba,0xb9,0xb8,0xb7,0xb6,0xb5,0xb4,0xb3,0xb2,0xb1,0xb0 },
+ CONST64(0x123456789a),
+ 32,
+ { 0x44,0x44,0x44,0x44,0x44,0x44,0x44,0x44,0x44,0x44,0x44,0x44,0x44,0x44,0x44,0x44,0x44,0x44,0x44,0x44,0x44,0x44,0x44,0x44,0x44,0x44,0x44,0x44,0x44,0x44,0x44,0x44 },
+ { 0xb0,0x1f,0x86,0xf8,0xed,0xc1,0x86,0x37,0x06,0xfa,0x8a,0x42,0x53,0xe3,0x4f,0x28,0xaf,0x31,0x9d,0xe3,0x83,0x34,0x87,0x0f,0x4d,0xd1,0xf9,0x4c,0xbe,0x98,0x32,0xf1 },
+},
+
+/* #4, 32 byte key, 512 byte PTX */
+{
+ 32,
+ { 0x27,0x18,0x28,0x18,0x28,0x45,0x90,0x45,0x23,0x53,0x60,0x28,0x74,0x71,0x35,0x26 },
+ { 0x31,0x41,0x59,0x26,0x53,0x58,0x97,0x93,0x23,0x84,0x62,0x64,0x33,0x83,0x27,0x95 },
+ 0,
+ 512,
+ {
+0x00,0x01,0x02,0x03,0x04,0x05,0x06,0x07,0x08,0x09,0x0a,0x0b,0x0c,0x0d,0x0e,0x0f,0x10,0x11,0x12,0x13,0x14,0x15,0x16,0x17,0x18,0x19,0x1a,0x1b,0x1c,0x1d,0x1e,0x1f,
+0x20,0x21,0x22,0x23,0x24,0x25,0x26,0x27,0x28,0x29,0x2a,0x2b,0x2c,0x2d,0x2e,0x2f,0x30,0x31,0x32,0x33,0x34,0x35,0x36,0x37,0x38,0x39,0x3a,0x3b,0x3c,0x3d,0x3e,0x3f,
+0x40,0x41,0x42,0x43,0x44,0x45,0x46,0x47,0x48,0x49,0x4a,0x4b,0x4c,0x4d,0x4e,0x4f,0x50,0x51,0x52,0x53,0x54,0x55,0x56,0x57,0x58,0x59,0x5a,0x5b,0x5c,0x5d,0x5e,0x5f,
+0x60,0x61,0x62,0x63,0x64,0x65,0x66,0x67,0x68,0x69,0x6a,0x6b,0x6c,0x6d,0x6e,0x6f,0x70,0x71,0x72,0x73,0x74,0x75,0x76,0x77,0x78,0x79,0x7a,0x7b,0x7c,0x7d,0x7e,0x7f,
+0x80,0x81,0x82,0x83,0x84,0x85,0x86,0x87,0x88,0x89,0x8a,0x8b,0x8c,0x8d,0x8e,0x8f,0x90,0x91,0x92,0x93,0x94,0x95,0x96,0x97,0x98,0x99,0x9a,0x9b,0x9c,0x9d,0x9e,0x9f,
+0xa0,0xa1,0xa2,0xa3,0xa4,0xa5,0xa6,0xa7,0xa8,0xa9,0xaa,0xab,0xac,0xad,0xae,0xaf,0xb0,0xb1,0xb2,0xb3,0xb4,0xb5,0xb6,0xb7,0xb8,0xb9,0xba,0xbb,0xbc,0xbd,0xbe,0xbf,
+0xc0,0xc1,0xc2,0xc3,0xc4,0xc5,0xc6,0xc7,0xc8,0xc9,0xca,0xcb,0xcc,0xcd,0xce,0xcf,0xd0,0xd1,0xd2,0xd3,0xd4,0xd5,0xd6,0xd7,0xd8,0xd9,0xda,0xdb,0xdc,0xdd,0xde,0xdf,
+0xe0,0xe1,0xe2,0xe3,0xe4,0xe5,0xe6,0xe7,0xe8,0xe9,0xea,0xeb,0xec,0xed,0xee,0xef,0xf0,0xf1,0xf2,0xf3,0xf4,0xf5,0xf6,0xf7,0xf8,0xf9,0xfa,0xfb,0xfc,0xfd,0xfe,0xff,
+0x00,0x01,0x02,0x03,0x04,0x05,0x06,0x07,0x08,0x09,0x0a,0x0b,0x0c,0x0d,0x0e,0x0f,0x10,0x11,0x12,0x13,0x14,0x15,0x16,0x17,0x18,0x19,0x1a,0x1b,0x1c,0x1d,0x1e,0x1f,
+0x20,0x21,0x22,0x23,0x24,0x25,0x26,0x27,0x28,0x29,0x2a,0x2b,0x2c,0x2d,0x2e,0x2f,0x30,0x31,0x32,0x33,0x34,0x35,0x36,0x37,0x38,0x39,0x3a,0x3b,0x3c,0x3d,0x3e,0x3f,
+0x40,0x41,0x42,0x43,0x44,0x45,0x46,0x47,0x48,0x49,0x4a,0x4b,0x4c,0x4d,0x4e,0x4f,0x50,0x51,0x52,0x53,0x54,0x55,0x56,0x57,0x58,0x59,0x5a,0x5b,0x5c,0x5d,0x5e,0x5f,
+0x60,0x61,0x62,0x63,0x64,0x65,0x66,0x67,0x68,0x69,0x6a,0x6b,0x6c,0x6d,0x6e,0x6f,0x70,0x71,0x72,0x73,0x74,0x75,0x76,0x77,0x78,0x79,0x7a,0x7b,0x7c,0x7d,0x7e,0x7f,
+0x80,0x81,0x82,0x83,0x84,0x85,0x86,0x87,0x88,0x89,0x8a,0x8b,0x8c,0x8d,0x8e,0x8f,0x90,0x91,0x92,0x93,0x94,0x95,0x96,0x97,0x98,0x99,0x9a,0x9b,0x9c,0x9d,0x9e,0x9f,
+0xa0,0xa1,0xa2,0xa3,0xa4,0xa5,0xa6,0xa7,0xa8,0xa9,0xaa,0xab,0xac,0xad,0xae,0xaf,0xb0,0xb1,0xb2,0xb3,0xb4,0xb5,0xb6,0xb7,0xb8,0xb9,0xba,0xbb,0xbc,0xbd,0xbe,0xbf,
+0xc0,0xc1,0xc2,0xc3,0xc4,0xc5,0xc6,0xc7,0xc8,0xc9,0xca,0xcb,0xcc,0xcd,0xce,0xcf,0xd0,0xd1,0xd2,0xd3,0xd4,0xd5,0xd6,0xd7,0xd8,0xd9,0xda,0xdb,0xdc,0xdd,0xde,0xdf,
+0xe0,0xe1,0xe2,0xe3,0xe4,0xe5,0xe6,0xe7,0xe8,0xe9,0xea,0xeb,0xec,0xed,0xee,0xef,0xf0,0xf1,0xf2,0xf3,0xf4,0xf5,0xf6,0xf7,0xf8,0xf9,0xfa,0xfb,0xfc,0xfd,0xfe,0xff,
+ },
+ {
+0x27,0xa7,0x47,0x9b,0xef,0xa1,0xd4,0x76,0x48,0x9f,0x30,0x8c,0xd4,0xcf,0xa6,0xe2,0xa9,0x6e,0x4b,0xbe,0x32,0x08,0xff,0x25,0x28,0x7d,0xd3,0x81,0x96,0x16,0xe8,0x9c,
+0xc7,0x8c,0xf7,0xf5,0xe5,0x43,0x44,0x5f,0x83,0x33,0xd8,0xfa,0x7f,0x56,0x00,0x00,0x05,0x27,0x9f,0xa5,0xd8,0xb5,0xe4,0xad,0x40,0xe7,0x36,0xdd,0xb4,0xd3,0x54,0x12,
+0x32,0x80,0x63,0xfd,0x2a,0xab,0x53,0xe5,0xea,0x1e,0x0a,0x9f,0x33,0x25,0x00,0xa5,0xdf,0x94,0x87,0xd0,0x7a,0x5c,0x92,0xcc,0x51,0x2c,0x88,0x66,0xc7,0xe8,0x60,0xce,
+0x93,0xfd,0xf1,0x66,0xa2,0x49,0x12,0xb4,0x22,0x97,0x61,0x46,0xae,0x20,0xce,0x84,0x6b,0xb7,0xdc,0x9b,0xa9,0x4a,0x76,0x7a,0xae,0xf2,0x0c,0x0d,0x61,0xad,0x02,0x65,
+0x5e,0xa9,0x2d,0xc4,0xc4,0xe4,0x1a,0x89,0x52,0xc6,0x51,0xd3,0x31,0x74,0xbe,0x51,0xa1,0x0c,0x42,0x11,0x10,0xe6,0xd8,0x15,0x88,0xed,0xe8,0x21,0x03,0xa2,0x52,0xd8,
+0xa7,0x50,0xe8,0x76,0x8d,0xef,0xff,0xed,0x91,0x22,0x81,0x0a,0xae,0xb9,0x9f,0x91,0x72,0xaf,0x82,0xb6,0x04,0xdc,0x4b,0x8e,0x51,0xbc,0xb0,0x82,0x35,0xa6,0xf4,0x34,
+0x13,0x32,0xe4,0xca,0x60,0x48,0x2a,0x4b,0xa1,0xa0,0x3b,0x3e,0x65,0x00,0x8f,0xc5,0xda,0x76,0xb7,0x0b,0xf1,0x69,0x0d,0xb4,0xea,0xe2,0x9c,0x5f,0x1b,0xad,0xd0,0x3c,
+0x5c,0xcf,0x2a,0x55,0xd7,0x05,0xdd,0xcd,0x86,0xd4,0x49,0x51,0x1c,0xeb,0x7e,0xc3,0x0b,0xf1,0x2b,0x1f,0xa3,0x5b,0x91,0x3f,0x9f,0x74,0x7a,0x8a,0xfd,0x1b,0x13,0x0e,
+0x94,0xbf,0xf9,0x4e,0xff,0xd0,0x1a,0x91,0x73,0x5c,0xa1,0x72,0x6a,0xcd,0x0b,0x19,0x7c,0x4e,0x5b,0x03,0x39,0x36,0x97,0xe1,0x26,0x82,0x6f,0xb6,0xbb,0xde,0x8e,0xcc,
+0x1e,0x08,0x29,0x85,0x16,0xe2,0xc9,0xed,0x03,0xff,0x3c,0x1b,0x78,0x60,0xf6,0xde,0x76,0xd4,0xce,0xcd,0x94,0xc8,0x11,0x98,0x55,0xef,0x52,0x97,0xca,0x67,0xe9,0xf3,
+0xe7,0xff,0x72,0xb1,0xe9,0x97,0x85,0xca,0x0a,0x7e,0x77,0x20,0xc5,0xb3,0x6d,0xc6,0xd7,0x2c,0xac,0x95,0x74,0xc8,0xcb,0xbc,0x2f,0x80,0x1e,0x23,0xe5,0x6f,0xd3,0x44,
+0xb0,0x7f,0x22,0x15,0x4b,0xeb,0xa0,0xf0,0x8c,0xe8,0x89,0x1e,0x64,0x3e,0xd9,0x95,0xc9,0x4d,0x9a,0x69,0xc9,0xf1,0xb5,0xf4,0x99,0x02,0x7a,0x78,0x57,0x2a,0xee,0xbd,
+0x74,0xd2,0x0c,0xc3,0x98,0x81,0xc2,0x13,0xee,0x77,0x0b,0x10,0x10,0xe4,0xbe,0xa7,0x18,0x84,0x69,0x77,0xae,0x11,0x9f,0x7a,0x02,0x3a,0xb5,0x8c,0xca,0x0a,0xd7,0x52,
+0xaf,0xe6,0x56,0xbb,0x3c,0x17,0x25,0x6a,0x9f,0x6e,0x9b,0xf1,0x9f,0xdd,0x5a,0x38,0xfc,0x82,0xbb,0xe8,0x72,0xc5,0x53,0x9e,0xdb,0x60,0x9e,0xf4,0xf7,0x9c,0x20,0x3e,
+0xbb,0x14,0x0f,0x2e,0x58,0x3c,0xb2,0xad,0x15,0xb4,0xaa,0x5b,0x65,0x50,0x16,0xa8,0x44,0x92,0x77,0xdb,0xd4,0x77,0xef,0x2c,0x8d,0x6c,0x01,0x7d,0xb7,0x38,0xb1,0x8d,
+0xeb,0x4a,0x42,0x7d,0x19,0x23,0xce,0x3f,0xf2,0x62,0x73,0x57,0x79,0xa4,0x18,0xf2,0x0a,0x28,0x2d,0xf9,0x20,0x14,0x7b,0xea,0xbe,0x42,0x1e,0xe5,0x31,0x9d,0x05,0x68,
+ }
+},
+
+/* #7, 32 byte key, 17 byte PTX */
+{
+ 32,
+ { 0xff,0xfe,0xfd,0xfc,0xfb,0xfa,0xf9,0xf8,0xf7,0xf6,0xf5,0xf4,0xf3,0xf2,0xf1,0xf0 },
+ { 0xbf,0xbe,0xbd,0xbc,0xbb,0xba,0xb9,0xb8,0xb7,0xb6,0xb5,0xb4,0xb3,0xb2,0xb1,0xb0 },
+ CONST64(0x123456789a),
+ 17,
+ { 0x00,0x01,0x02,0x03,0x04,0x05,0x06,0x07,0x08,0x09,0x0a,0x0b,0x0c,0x0d,0x0e,0x0f,0x10 },
+ { 0x6c,0x16,0x25,0xdb,0x46,0x71,0x52,0x2d,0x3d,0x75,0x99,0x60,0x1d,0xe7,0xca,0x09,0xed },
+},
+
+/* #15, 32 byte key, 25 byte PTX */
+{
+ 32,
+ { 0xff,0xfe,0xfd,0xfc,0xfb,0xfa,0xf9,0xf8,0xf7,0xf6,0xf5,0xf4,0xf3,0xf2,0xf1,0xf0 },
+ { 0xbf,0xbe,0xbd,0xbc,0xbb,0xba,0xb9,0xb8,0xb7,0xb6,0xb5,0xb4,0xb3,0xb2,0xb1,0xb0 },
+ CONST64(0x123456789a),
+ 25,
+ { 0x00,0x01,0x02,0x03,0x04,0x05,0x06,0x07,0x08,0x09,0x0a,0x0b,0x0c,0x0d,0x0e,0x0f,0x10,0x11,0x12,0x13,0x14,0x15,0x16,0x17,0x18 },
+ { 0x8f,0x4d,0xcb,0xad,0x55,0x55,0x8d,0x7b,0x4e,0x01,0xd9,0x37,0x9c,0xd4,0xea,0x22,0xed,0xbf,0x9d,0xac,0xe4,0x5d,0x6f,0x6a,0x73 },
+},
+
+/* #21, 32 byte key, 31 byte PTX */
+{
+ 32,
+ { 0xff,0xfe,0xfd,0xfc,0xfb,0xfa,0xf9,0xf8,0xf7,0xf6,0xf5,0xf4,0xf3,0xf2,0xf1,0xf0 },
+ { 0xbf,0xbe,0xbd,0xbc,0xbb,0xba,0xb9,0xb8,0xb7,0xb6,0xb5,0xb4,0xb3,0xb2,0xb1,0xb0 },
+ CONST64(0x123456789a),
+ 31,
+ { 0x00,0x01,0x02,0x03,0x04,0x05,0x06,0x07,0x08,0x09,0x0a,0x0b,0x0c,0x0d,0x0e,0x0f,0x10,0x11,0x12,0x13,0x14,0x15,0x16,0x17,0x18,0x19,0x1a,0x1b,0x1c,0x1d,0x1e },
+ { 0xd0,0x5b,0xc0,0x90,0xa8,0xe0,0x4f,0x1b,0x3d,0x3e,0xcd,0xd5,0xba,0xec,0x0f,0xd4,0xed,0xbf,0x9d,0xac,0xe4,0x5d,0x6f,0x6a,0x73,0x06,0xe6,0x4b,0xe5,0xdd,0x82 },
+},
+
+};
+ unsigned char OUT[512], T[16];
+ ulong64 seq;
+ symmetric_xts xts;
+ int i, err, idx;
+
+ /* AES can be under rijndael or aes... try to find it */
+ if ((idx = find_cipher("aes")) == -1) {
+ if ((idx = find_cipher("rijndael")) == -1) {
+ return CRYPT_NOP;
+ }
+ }
+
+ for (i = 0; i < (int)(sizeof(tests)/sizeof(tests[0])); i++) {
+ err = xts_start(idx, tests[i].key1, tests[i].key2, tests[i].keylen/2, 0, &xts);
+ if (err != CRYPT_OK) {
+ return err;
+ }
+
+ seq = tests[i].seqnum;
+ STORE64L(seq,T);
+ XMEMSET(T+8, 0, 8);
+
+ err = xts_encrypt(tests[i].PTX, tests[i].PTLEN, OUT, T, &xts);
+ if (err != CRYPT_OK) {
+ xts_done(&xts);
+ return err;
+ }
+
+ if (XMEMCMP(OUT, tests[i].CTX, tests[i].PTLEN)) {
+ xts_done(&xts);
+ return CRYPT_FAIL_TESTVECTOR;
+ }
+
+ err = xts_decrypt(tests[i].CTX, tests[i].PTLEN, OUT, T, &xts);
+ if (err != CRYPT_OK) {
+ xts_done(&xts);
+ return err;
+ }
+
+ if (XMEMCMP(OUT, tests[i].PTX, tests[i].PTLEN)) {
+ xts_done(&xts);
+ return CRYPT_FAIL_TESTVECTOR;
+ }
+ xts_done(&xts);
+ }
+ return CRYPT_OK;
+#endif
+}
+
+#endif
+
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
+
diff --git a/libtomcrypt/src/pk/asn1/der/bit/der_decode_bit_string.c b/libtomcrypt/src/pk/asn1/der/bit/der_decode_bit_string.c
index 1d3569c..bace8c8 100644
--- a/libtomcrypt/src/pk/asn1/der/bit/der_decode_bit_string.c
+++ b/libtomcrypt/src/pk/asn1/der/bit/der_decode_bit_string.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -97,6 +97,6 @@ int der_decode_bit_string(const unsigned char *in, unsigned long inlen,
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/pk/asn1/der/bit/der_decode_bit_string.c,v $ */
-/* $Revision: 1.4 $ */
-/* $Date: 2006/06/16 21:53:41 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/pk/asn1/der/bit/der_encode_bit_string.c b/libtomcrypt/src/pk/asn1/der/bit/der_encode_bit_string.c
index 757963c..e64bd1f 100644
--- a/libtomcrypt/src/pk/asn1/der/bit/der_encode_bit_string.c
+++ b/libtomcrypt/src/pk/asn1/der/bit/der_encode_bit_string.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -84,6 +84,6 @@ int der_encode_bit_string(const unsigned char *in, unsigned long inlen,
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/pk/asn1/der/bit/der_encode_bit_string.c,v $ */
-/* $Revision: 1.4 $ */
-/* $Date: 2006/12/04 21:34:03 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/pk/asn1/der/bit/der_length_bit_string.c b/libtomcrypt/src/pk/asn1/der/bit/der_length_bit_string.c
index 3dc2abf..3ec5f58 100644
--- a/libtomcrypt/src/pk/asn1/der/bit/der_length_bit_string.c
+++ b/libtomcrypt/src/pk/asn1/der/bit/der_length_bit_string.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -49,6 +49,6 @@ int der_length_bit_string(unsigned long nbits, unsigned long *outlen)
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/pk/asn1/der/bit/der_length_bit_string.c,v $ */
-/* $Revision: 1.2 $ */
-/* $Date: 2006/03/31 14:15:35 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/pk/asn1/der/boolean/der_decode_boolean.c b/libtomcrypt/src/pk/asn1/der/boolean/der_decode_boolean.c
index 7259e51..e7c5699 100644
--- a/libtomcrypt/src/pk/asn1/der/boolean/der_decode_boolean.c
+++ b/libtomcrypt/src/pk/asn1/der/boolean/der_decode_boolean.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -42,6 +42,6 @@ int der_decode_boolean(const unsigned char *in, unsigned long inlen,
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/pk/asn1/der/boolean/der_decode_boolean.c,v $ */
-/* $Revision: 1.1 $ */
-/* $Date: 2006/04/22 17:01:59 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/pk/asn1/der/boolean/der_encode_boolean.c b/libtomcrypt/src/pk/asn1/der/boolean/der_encode_boolean.c
index 9344a79..b40fae6 100644
--- a/libtomcrypt/src/pk/asn1/der/boolean/der_encode_boolean.c
+++ b/libtomcrypt/src/pk/asn1/der/boolean/der_encode_boolean.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -46,6 +46,6 @@ int der_encode_boolean(int in,
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/pk/asn1/der/boolean/der_encode_boolean.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/06/16 21:53:41 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/pk/asn1/der/boolean/der_length_boolean.c b/libtomcrypt/src/pk/asn1/der/boolean/der_length_boolean.c
index cd5bf2d..5437031 100644
--- a/libtomcrypt/src/pk/asn1/der/boolean/der_length_boolean.c
+++ b/libtomcrypt/src/pk/asn1/der/boolean/der_length_boolean.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -30,6 +30,6 @@ int der_length_boolean(unsigned long *outlen)
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/pk/asn1/der/boolean/der_length_boolean.c,v $ */
-/* $Revision: 1.2 $ */
-/* $Date: 2006/04/22 17:28:38 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/pk/asn1/der/choice/der_decode_choice.c b/libtomcrypt/src/pk/asn1/der/choice/der_decode_choice.c
index 4ff6f17..1220b37 100644
--- a/libtomcrypt/src/pk/asn1/der/choice/der_decode_choice.c
+++ b/libtomcrypt/src/pk/asn1/der/choice/der_decode_choice.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -177,6 +177,6 @@ int der_decode_choice(const unsigned char *in, unsigned long *inlen,
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/pk/asn1/der/choice/der_decode_choice.c,v $ */
-/* $Revision: 1.8 $ */
-/* $Date: 2006/12/06 02:23:49 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/pk/asn1/der/ia5/der_decode_ia5_string.c b/libtomcrypt/src/pk/asn1/der/ia5/der_decode_ia5_string.c
index 2514b77..1880ada 100644
--- a/libtomcrypt/src/pk/asn1/der/ia5/der_decode_ia5_string.c
+++ b/libtomcrypt/src/pk/asn1/der/ia5/der_decode_ia5_string.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -91,6 +91,6 @@ int der_decode_ia5_string(const unsigned char *in, unsigned long inlen,
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/pk/asn1/der/ia5/der_decode_ia5_string.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/06/16 21:53:41 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/pk/asn1/der/ia5/der_encode_ia5_string.c b/libtomcrypt/src/pk/asn1/der/ia5/der_encode_ia5_string.c
index aff3392..6009dbc 100644
--- a/libtomcrypt/src/pk/asn1/der/ia5/der_encode_ia5_string.c
+++ b/libtomcrypt/src/pk/asn1/der/ia5/der_encode_ia5_string.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -80,6 +80,6 @@ int der_encode_ia5_string(const unsigned char *in, unsigned long inlen,
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/pk/asn1/der/ia5/der_encode_ia5_string.c,v $ */
-/* $Revision: 1.4 $ */
-/* $Date: 2006/12/04 21:34:03 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/pk/asn1/der/ia5/der_length_ia5_string.c b/libtomcrypt/src/pk/asn1/der/ia5/der_length_ia5_string.c
index 6278dd2..f10c1b8 100644
--- a/libtomcrypt/src/pk/asn1/der/ia5/der_length_ia5_string.c
+++ b/libtomcrypt/src/pk/asn1/der/ia5/der_length_ia5_string.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -189,6 +189,6 @@ int der_length_ia5_string(const unsigned char *octets, unsigned long noctets, un
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/pk/asn1/der/ia5/der_length_ia5_string.c,v $ */
-/* $Revision: 1.2 $ */
-/* $Date: 2006/03/31 14:15:35 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/pk/asn1/der/integer/der_decode_integer.c b/libtomcrypt/src/pk/asn1/der/integer/der_decode_integer.c
index aef87a3..0ed8ad7 100644
--- a/libtomcrypt/src/pk/asn1/der/integer/der_decode_integer.c
+++ b/libtomcrypt/src/pk/asn1/der/integer/der_decode_integer.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -105,6 +105,6 @@ int der_decode_integer(const unsigned char *in, unsigned long inlen, void *num)
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/pk/asn1/der/integer/der_decode_integer.c,v $ */
-/* $Revision: 1.4 $ */
-/* $Date: 2006/03/31 14:15:35 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/pk/asn1/der/integer/der_encode_integer.c b/libtomcrypt/src/pk/asn1/der/integer/der_encode_integer.c
index ff4fce6..e80bb3c 100644
--- a/libtomcrypt/src/pk/asn1/der/integer/der_encode_integer.c
+++ b/libtomcrypt/src/pk/asn1/der/integer/der_encode_integer.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -125,6 +125,6 @@ int der_encode_integer(void *num, unsigned char *out, unsigned long *outlen)
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/pk/asn1/der/integer/der_encode_integer.c,v $ */
-/* $Revision: 1.8 $ */
-/* $Date: 2006/12/04 21:34:03 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/pk/asn1/der/integer/der_length_integer.c b/libtomcrypt/src/pk/asn1/der/integer/der_length_integer.c
index bcc331d..9d49683 100644
--- a/libtomcrypt/src/pk/asn1/der/integer/der_length_integer.c
+++ b/libtomcrypt/src/pk/asn1/der/integer/der_length_integer.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -77,6 +77,6 @@ int der_length_integer(void *num, unsigned long *outlen)
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/pk/asn1/der/integer/der_length_integer.c,v $ */
-/* $Revision: 1.4 $ */
-/* $Date: 2006/04/22 01:22:55 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/pk/asn1/der/object_identifier/der_decode_object_identifier.c b/libtomcrypt/src/pk/asn1/der/object_identifier/der_decode_object_identifier.c
index 1fa87d8..406acdc 100644
--- a/libtomcrypt/src/pk/asn1/der/object_identifier/der_decode_object_identifier.c
+++ b/libtomcrypt/src/pk/asn1/der/object_identifier/der_decode_object_identifier.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -94,6 +94,6 @@ int der_decode_object_identifier(const unsigned char *in, unsigned long inle
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/pk/asn1/der/object_identifier/der_decode_object_identifier.c,v $ */
-/* $Revision: 1.5 $ */
-/* $Date: 2006/11/21 00:18:23 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/pk/asn1/der/object_identifier/der_encode_object_identifier.c b/libtomcrypt/src/pk/asn1/der/object_identifier/der_encode_object_identifier.c
index b343aaa..f018ba9 100644
--- a/libtomcrypt/src/pk/asn1/der/object_identifier/der_encode_object_identifier.c
+++ b/libtomcrypt/src/pk/asn1/der/object_identifier/der_encode_object_identifier.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -106,6 +106,6 @@ int der_encode_object_identifier(unsigned long *words, unsigned long nwords,
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/pk/asn1/der/object_identifier/der_encode_object_identifier.c,v $ */
-/* $Revision: 1.6 $ */
-/* $Date: 2006/12/04 21:34:03 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/pk/asn1/der/object_identifier/der_length_object_identifier.c b/libtomcrypt/src/pk/asn1/der/object_identifier/der_length_object_identifier.c
index a4cf53f..ccb1e6d 100644
--- a/libtomcrypt/src/pk/asn1/der/object_identifier/der_length_object_identifier.c
+++ b/libtomcrypt/src/pk/asn1/der/object_identifier/der_length_object_identifier.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -84,6 +84,6 @@ int der_length_object_identifier(unsigned long *words, unsigned long nwords, uns
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/pk/asn1/der/object_identifier/der_length_object_identifier.c,v $ */
-/* $Revision: 1.4 $ */
-/* $Date: 2006/04/16 20:17:42 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/pk/asn1/der/octet/der_decode_octet_string.c b/libtomcrypt/src/pk/asn1/der/octet/der_decode_octet_string.c
index b937e63..952d739 100644
--- a/libtomcrypt/src/pk/asn1/der/octet/der_decode_octet_string.c
+++ b/libtomcrypt/src/pk/asn1/der/octet/der_decode_octet_string.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -86,6 +86,6 @@ int der_decode_octet_string(const unsigned char *in, unsigned long inlen,
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/pk/asn1/der/octet/der_decode_octet_string.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/06/16 21:53:41 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/pk/asn1/der/octet/der_encode_octet_string.c b/libtomcrypt/src/pk/asn1/der/octet/der_encode_octet_string.c
index fe0f163..9a16c3b 100644
--- a/libtomcrypt/src/pk/asn1/der/octet/der_encode_octet_string.c
+++ b/libtomcrypt/src/pk/asn1/der/octet/der_encode_octet_string.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -81,6 +81,6 @@ int der_encode_octet_string(const unsigned char *in, unsigned long inlen,
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/pk/asn1/der/octet/der_encode_octet_string.c,v $ */
-/* $Revision: 1.4 $ */
-/* $Date: 2006/12/04 21:34:03 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/pk/asn1/der/octet/der_length_octet_string.c b/libtomcrypt/src/pk/asn1/der/octet/der_length_octet_string.c
index 3caf352..07da058 100644
--- a/libtomcrypt/src/pk/asn1/der/octet/der_length_octet_string.c
+++ b/libtomcrypt/src/pk/asn1/der/octet/der_length_octet_string.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -48,6 +48,6 @@ int der_length_octet_string(unsigned long noctets, unsigned long *outlen)
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/pk/asn1/der/octet/der_length_octet_string.c,v $ */
-/* $Revision: 1.2 $ */
-/* $Date: 2006/03/31 14:15:35 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/pk/asn1/der/printable_string/der_decode_printable_string.c b/libtomcrypt/src/pk/asn1/der/printable_string/der_decode_printable_string.c
index cae96d8..56bf376 100644
--- a/libtomcrypt/src/pk/asn1/der/printable_string/der_decode_printable_string.c
+++ b/libtomcrypt/src/pk/asn1/der/printable_string/der_decode_printable_string.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -91,6 +91,6 @@ int der_decode_printable_string(const unsigned char *in, unsigned long inlen,
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/pk/asn1/der/printable_string/der_decode_printable_string.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/06/16 21:53:41 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/pk/asn1/der/printable_string/der_encode_printable_string.c b/libtomcrypt/src/pk/asn1/der/printable_string/der_encode_printable_string.c
index 9061b1f..7d7cfd2 100644
--- a/libtomcrypt/src/pk/asn1/der/printable_string/der_encode_printable_string.c
+++ b/libtomcrypt/src/pk/asn1/der/printable_string/der_encode_printable_string.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -80,6 +80,6 @@ int der_encode_printable_string(const unsigned char *in, unsigned long inlen,
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/pk/asn1/der/printable_string/der_encode_printable_string.c,v $ */
-/* $Revision: 1.4 $ */
-/* $Date: 2006/12/04 21:34:03 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/pk/asn1/der/printable_string/der_length_printable_string.c b/libtomcrypt/src/pk/asn1/der/printable_string/der_length_printable_string.c
index 799b6b6..9f78f20 100644
--- a/libtomcrypt/src/pk/asn1/der/printable_string/der_length_printable_string.c
+++ b/libtomcrypt/src/pk/asn1/der/printable_string/der_length_printable_string.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -161,6 +161,6 @@ int der_length_printable_string(const unsigned char *octets, unsigned long nocte
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/pk/asn1/der/printable_string/der_length_printable_string.c,v $ */
-/* $Revision: 1.2 $ */
-/* $Date: 2006/03/31 14:15:35 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/pk/asn1/der/sequence/der_decode_sequence_ex.c b/libtomcrypt/src/pk/asn1/der/sequence/der_decode_sequence_ex.c
index 1f65602..5042b18 100644
--- a/libtomcrypt/src/pk/asn1/der/sequence/der_decode_sequence_ex.c
+++ b/libtomcrypt/src/pk/asn1/der/sequence/der_decode_sequence_ex.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
#include <stdarg.h>
@@ -282,6 +282,6 @@ LBL_ERR:
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/pk/asn1/der/sequence/der_decode_sequence_ex.c,v $ */
-/* $Revision: 1.15 $ */
-/* $Date: 2006/11/26 02:25:18 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/pk/asn1/der/sequence/der_decode_sequence_flexi.c b/libtomcrypt/src/pk/asn1/der/sequence/der_decode_sequence_flexi.c
index 19d8c86..4fd3aaa 100644
--- a/libtomcrypt/src/pk/asn1/der/sequence/der_decode_sequence_flexi.c
+++ b/libtomcrypt/src/pk/asn1/der/sequence/der_decode_sequence_flexi.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -381,6 +381,6 @@ error:
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/pk/asn1/der/sequence/der_decode_sequence_flexi.c,v $ */
-/* $Revision: 1.25 $ */
-/* $Date: 2006/11/26 02:25:18 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/pk/asn1/der/sequence/der_decode_sequence_multi.c b/libtomcrypt/src/pk/asn1/der/sequence/der_decode_sequence_multi.c
index a15c182..4202eb3 100644
--- a/libtomcrypt/src/pk/asn1/der/sequence/der_decode_sequence_multi.c
+++ b/libtomcrypt/src/pk/asn1/der/sequence/der_decode_sequence_multi.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
#include <stdarg.h>
@@ -134,6 +134,6 @@ LBL_ERR:
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/pk/asn1/der/sequence/der_decode_sequence_multi.c,v $ */
-/* $Revision: 1.12 $ */
-/* $Date: 2006/11/26 02:25:18 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/pk/asn1/der/sequence/der_encode_sequence_ex.c b/libtomcrypt/src/pk/asn1/der/sequence/der_encode_sequence_ex.c
index cdb4f1e..e92f7c3 100644
--- a/libtomcrypt/src/pk/asn1/der/sequence/der_encode_sequence_ex.c
+++ b/libtomcrypt/src/pk/asn1/der/sequence/der_encode_sequence_ex.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
#include <stdarg.h>
diff --git a/libtomcrypt/src/pk/asn1/der/sequence/der_encode_sequence_multi.c b/libtomcrypt/src/pk/asn1/der/sequence/der_encode_sequence_multi.c
index da34c64..659f029 100644
--- a/libtomcrypt/src/pk/asn1/der/sequence/der_encode_sequence_multi.c
+++ b/libtomcrypt/src/pk/asn1/der/sequence/der_encode_sequence_multi.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
#include <stdarg.h>
@@ -133,6 +133,6 @@ LBL_ERR:
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/pk/asn1/der/sequence/der_encode_sequence_multi.c,v $ */
-/* $Revision: 1.11 $ */
-/* $Date: 2006/11/26 02:25:18 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/pk/asn1/der/sequence/der_length_sequence.c b/libtomcrypt/src/pk/asn1/der/sequence/der_length_sequence.c
index 36f4a2a..7221f99 100644
--- a/libtomcrypt/src/pk/asn1/der/sequence/der_length_sequence.c
+++ b/libtomcrypt/src/pk/asn1/der/sequence/der_length_sequence.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -164,6 +164,6 @@ LBL_ERR:
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/pk/asn1/der/sequence/der_length_sequence.c,v $ */
-/* $Revision: 1.13 $ */
-/* $Date: 2006/11/26 02:25:18 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/pk/asn1/der/sequence/der_sequence_free.c b/libtomcrypt/src/pk/asn1/der/sequence/der_sequence_free.c
index dc826e3..c933f58 100644
--- a/libtomcrypt/src/pk/asn1/der/sequence/der_sequence_free.c
+++ b/libtomcrypt/src/pk/asn1/der/sequence/der_sequence_free.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -60,6 +60,6 @@ void der_sequence_free(ltc_asn1_list *in)
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/pk/asn1/der/sequence/der_sequence_free.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:15:35 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/pk/asn1/der/set/der_encode_set.c b/libtomcrypt/src/pk/asn1/der/set/der_encode_set.c
index a08d2b0..a2d0128 100644
--- a/libtomcrypt/src/pk/asn1/der/set/der_encode_set.c
+++ b/libtomcrypt/src/pk/asn1/der/set/der_encode_set.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -98,6 +98,6 @@ int der_encode_set(ltc_asn1_list *list, unsigned long inlen,
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/pk/asn1/der/set/der_encode_set.c,v $ */
-/* $Revision: 1.11 $ */
-/* $Date: 2006/11/26 02:27:37 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/pk/asn1/der/set/der_encode_setof.c b/libtomcrypt/src/pk/asn1/der/set/der_encode_setof.c
index 6c12eb4..8e87f84 100644
--- a/libtomcrypt/src/pk/asn1/der/set/der_encode_setof.c
+++ b/libtomcrypt/src/pk/asn1/der/set/der_encode_setof.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -157,6 +157,6 @@ int der_encode_setof(ltc_asn1_list *list, unsigned long inlen,
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/pk/asn1/der/set/der_encode_setof.c,v $ */
-/* $Revision: 1.11 $ */
-/* $Date: 2006/03/31 14:15:35 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/pk/asn1/der/short_integer/der_decode_short_integer.c b/libtomcrypt/src/pk/asn1/der/short_integer/der_decode_short_integer.c
index 1407e9a..a174740 100644
--- a/libtomcrypt/src/pk/asn1/der/short_integer/der_decode_short_integer.c
+++ b/libtomcrypt/src/pk/asn1/der/short_integer/der_decode_short_integer.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -63,6 +63,6 @@ int der_decode_short_integer(const unsigned char *in, unsigned long inlen, unsig
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/pk/asn1/der/short_integer/der_decode_short_integer.c,v $ */
-/* $Revision: 1.6 $ */
-/* $Date: 2006/03/31 14:15:35 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/pk/asn1/der/short_integer/der_encode_short_integer.c b/libtomcrypt/src/pk/asn1/der/short_integer/der_encode_short_integer.c
index 95da2fa..903ceb4 100644
--- a/libtomcrypt/src/pk/asn1/der/short_integer/der_encode_short_integer.c
+++ b/libtomcrypt/src/pk/asn1/der/short_integer/der_encode_short_integer.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -92,6 +92,6 @@ int der_encode_short_integer(unsigned long num, unsigned char *out, unsigned lon
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/pk/asn1/der/short_integer/der_encode_short_integer.c,v $ */
-/* $Revision: 1.7 $ */
-/* $Date: 2006/12/04 21:34:03 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/pk/asn1/der/short_integer/der_length_short_integer.c b/libtomcrypt/src/pk/asn1/der/short_integer/der_length_short_integer.c
index 073e294..0b8fdcf 100644
--- a/libtomcrypt/src/pk/asn1/der/short_integer/der_length_short_integer.c
+++ b/libtomcrypt/src/pk/asn1/der/short_integer/der_length_short_integer.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -65,6 +65,6 @@ int der_length_short_integer(unsigned long num, unsigned long *outlen)
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/pk/asn1/der/short_integer/der_length_short_integer.c,v $ */
-/* $Revision: 1.5 $ */
-/* $Date: 2006/03/31 14:15:35 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/pk/asn1/der/utctime/der_decode_utctime.c b/libtomcrypt/src/pk/asn1/der/utctime/der_decode_utctime.c
index 8a1f5fb..c86bc75 100644
--- a/libtomcrypt/src/pk/asn1/der/utctime/der_decode_utctime.c
+++ b/libtomcrypt/src/pk/asn1/der/utctime/der_decode_utctime.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -122,6 +122,6 @@ YYMMDDhhmmss-hh'mm'
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/pk/asn1/der/utctime/der_decode_utctime.c,v $ */
-/* $Revision: 1.8 $ */
-/* $Date: 2006/03/31 14:15:35 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/pk/asn1/der/utctime/der_encode_utctime.c b/libtomcrypt/src/pk/asn1/der/utctime/der_encode_utctime.c
index ae2ccbe..f8d0c56 100644
--- a/libtomcrypt/src/pk/asn1/der/utctime/der_encode_utctime.c
+++ b/libtomcrypt/src/pk/asn1/der/utctime/der_encode_utctime.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -78,6 +78,6 @@ int der_encode_utctime(ltc_utctime *utctime,
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/pk/asn1/der/utctime/der_encode_utctime.c,v $ */
-/* $Revision: 1.9 $ */
-/* $Date: 2006/12/04 21:34:03 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/pk/asn1/der/utctime/der_length_utctime.c b/libtomcrypt/src/pk/asn1/der/utctime/der_length_utctime.c
index 60f09de..e33c4f3 100644
--- a/libtomcrypt/src/pk/asn1/der/utctime/der_length_utctime.c
+++ b/libtomcrypt/src/pk/asn1/der/utctime/der_length_utctime.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -41,6 +41,6 @@ int der_length_utctime(ltc_utctime *utctime, unsigned long *outlen)
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/pk/asn1/der/utctime/der_length_utctime.c,v $ */
-/* $Revision: 1.4 $ */
-/* $Date: 2006/03/31 14:15:35 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/pk/asn1/der/utf8/der_decode_utf8_string.c b/libtomcrypt/src/pk/asn1/der/utf8/der_decode_utf8_string.c
index 28b5520..d9cbdaf 100644
--- a/libtomcrypt/src/pk/asn1/der/utf8/der_decode_utf8_string.c
+++ b/libtomcrypt/src/pk/asn1/der/utf8/der_decode_utf8_string.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -106,6 +106,6 @@ int der_decode_utf8_string(const unsigned char *in, unsigned long inlen,
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/pk/asn1/der/utf8/der_decode_utf8_string.c,v $ */
-/* $Revision: 1.7 $ */
-/* $Date: 2006/11/26 02:27:37 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/pk/asn1/der/utf8/der_encode_utf8_string.c b/libtomcrypt/src/pk/asn1/der/utf8/der_encode_utf8_string.c
index 2dd6081..847a726 100644
--- a/libtomcrypt/src/pk/asn1/der/utf8/der_encode_utf8_string.c
+++ b/libtomcrypt/src/pk/asn1/der/utf8/der_encode_utf8_string.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -65,19 +65,19 @@ int der_encode_utf8_string(const wchar_t *in, unsigned long inlen,
x = 0;
out[x++] = 0x0C;
if (len < 128) {
- out[x++] = len;
+ out[x++] = (unsigned char)len;
} else if (len < 256) {
out[x++] = 0x81;
- out[x++] = len;
+ out[x++] = (unsigned char)len;
} else if (len < 65536UL) {
out[x++] = 0x82;
- out[x++] = (len>>8)&255;
- out[x++] = len&255;
+ out[x++] = (unsigned char)((len>>8)&255);
+ out[x++] = (unsigned char)(len&255);
} else if (len < 16777216UL) {
out[x++] = 0x83;
- out[x++] = (len>>16)&255;
- out[x++] = (len>>8)&255;
- out[x++] = len&255;
+ out[x++] = (unsigned char)((len>>16)&255);
+ out[x++] = (unsigned char)((len>>8)&255);
+ out[x++] = (unsigned char)(len&255);
} else {
return CRYPT_INVALID_ARG;
}
@@ -85,7 +85,7 @@ int der_encode_utf8_string(const wchar_t *in, unsigned long inlen,
/* store UTF8 */
for (y = 0; y < inlen; y++) {
switch (der_utf8_charsize(in[y])) {
- case 1: out[x++] = in[y]; break;
+ case 1: out[x++] = (unsigned char)in[y]; break;
case 2: out[x++] = 0xC0 | ((in[y] >> 6) & 0x1F); out[x++] = 0x80 | (in[y] & 0x3F); break;
case 3: out[x++] = 0xE0 | ((in[y] >> 12) & 0x0F); out[x++] = 0x80 | ((in[y] >> 6) & 0x3F); out[x++] = 0x80 | (in[y] & 0x3F); break;
case 4: out[x++] = 0xF0 | ((in[y] >> 18) & 0x07); out[x++] = 0x80 | ((in[y] >> 12) & 0x3F); out[x++] = 0x80 | ((in[y] >> 6) & 0x3F); out[x++] = 0x80 | (in[y] & 0x3F); break;
@@ -100,6 +100,6 @@ int der_encode_utf8_string(const wchar_t *in, unsigned long inlen,
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/pk/asn1/der/utf8/der_encode_utf8_string.c,v $ */
-/* $Revision: 1.7 $ */
-/* $Date: 2006/12/16 17:41:21 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/pk/asn1/der/utf8/der_length_utf8_string.c b/libtomcrypt/src/pk/asn1/der/utf8/der_length_utf8_string.c
index b5b2bc6..3321f94 100644
--- a/libtomcrypt/src/pk/asn1/der/utf8/der_length_utf8_string.c
+++ b/libtomcrypt/src/pk/asn1/der/utf8/der_length_utf8_string.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -78,6 +78,6 @@ int der_length_utf8_string(const wchar_t *in, unsigned long noctets, unsigned lo
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/pk/asn1/der/utf8/der_length_utf8_string.c,v $ */
-/* $Revision: 1.5 $ */
-/* $Date: 2006/12/16 17:41:21 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/pk/dsa/dsa_decrypt_key.c b/libtomcrypt/src/pk/dsa/dsa_decrypt_key.c
index 5cbedc6..c622c78 100644
--- a/libtomcrypt/src/pk/dsa/dsa_decrypt_key.c
+++ b/libtomcrypt/src/pk/dsa/dsa_decrypt_key.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -15,7 +15,7 @@
DSA Crypto, Tom St Denis
*/
-#ifdef MDSA
+#ifdef LTC_MDSA
/**
Decrypt an DSA encrypted key
@@ -133,7 +133,7 @@ LBL_ERR:
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/pk/dsa/dsa_decrypt_key.c,v $ */
-/* $Revision: 1.9 $ */
-/* $Date: 2006/12/04 03:18:43 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/pk/dsa/dsa_encrypt_key.c b/libtomcrypt/src/pk/dsa/dsa_encrypt_key.c
index cefa4de..a082969 100644
--- a/libtomcrypt/src/pk/dsa/dsa_encrypt_key.c
+++ b/libtomcrypt/src/pk/dsa/dsa_encrypt_key.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -15,7 +15,7 @@
DSA Crypto, Tom St Denis
*/
-#ifdef MDSA
+#ifdef LTC_MDSA
/**
Encrypt a symmetric key with DSA
@@ -129,7 +129,7 @@ LBL_ERR:
}
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/pk/dsa/dsa_encrypt_key.c,v $ */
-/* $Revision: 1.7 $ */
-/* $Date: 2006/12/04 03:18:43 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/pk/dsa/dsa_export.c b/libtomcrypt/src/pk/dsa/dsa_export.c
index d882779..e4c4508 100644
--- a/libtomcrypt/src/pk/dsa/dsa_export.c
+++ b/libtomcrypt/src/pk/dsa/dsa_export.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -15,7 +15,7 @@
DSA implementation, export key, Tom St Denis
*/
-#ifdef MDSA
+#ifdef LTC_MDSA
/**
Export a DSA key to a binary packet
@@ -67,6 +67,6 @@ int dsa_export(unsigned char *out, unsigned long *outlen, int type, dsa_key *key
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/pk/dsa/dsa_export.c,v $ */
-/* $Revision: 1.8 $ */
-/* $Date: 2006/03/31 14:15:35 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/pk/dsa/dsa_free.c b/libtomcrypt/src/pk/dsa/dsa_free.c
index 92a1eb7..5f5ce72 100644
--- a/libtomcrypt/src/pk/dsa/dsa_free.c
+++ b/libtomcrypt/src/pk/dsa/dsa_free.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -15,7 +15,7 @@
DSA implementation, free a DSA key, Tom St Denis
*/
-#ifdef MDSA
+#ifdef LTC_MDSA
/**
Free a DSA key
@@ -29,6 +29,6 @@ void dsa_free(dsa_key *key)
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/pk/dsa/dsa_free.c,v $ */
-/* $Revision: 1.6 $ */
-/* $Date: 2006/06/09 01:38:13 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/pk/dsa/dsa_import.c b/libtomcrypt/src/pk/dsa/dsa_import.c
index bb2272a..47a68ca 100644
--- a/libtomcrypt/src/pk/dsa/dsa_import.c
+++ b/libtomcrypt/src/pk/dsa/dsa_import.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -15,7 +15,7 @@
DSA implementation, import a DSA key, Tom St Denis
*/
-#ifdef MDSA
+#ifdef LTC_MDSA
/**
Import a DSA key
@@ -71,8 +71,8 @@ int dsa_import(const unsigned char *in, unsigned long inlen, dsa_key *key)
}
key->qord = mp_unsigned_bin_size(key->q);
- if (key->qord >= MDSA_MAX_GROUP || key->qord <= 15 ||
- (unsigned long)key->qord >= mp_unsigned_bin_size(key->p) || (mp_unsigned_bin_size(key->p) - key->qord) >= MDSA_DELTA) {
+ if (key->qord >= LTC_MDSA_MAX_GROUP || key->qord <= 15 ||
+ (unsigned long)key->qord >= mp_unsigned_bin_size(key->p) || (mp_unsigned_bin_size(key->p) - key->qord) >= LTC_MDSA_DELTA) {
err = CRYPT_INVALID_PACKET;
goto error;
}
@@ -85,6 +85,6 @@ error:
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/pk/dsa/dsa_import.c,v $ */
-/* $Revision: 1.12 $ */
-/* $Date: 2006/03/31 14:15:35 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/pk/dsa/dsa_make_key.c b/libtomcrypt/src/pk/dsa/dsa_make_key.c
index 293e814..1c16d03 100644
--- a/libtomcrypt/src/pk/dsa/dsa_make_key.c
+++ b/libtomcrypt/src/pk/dsa/dsa_make_key.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -15,7 +15,7 @@
DSA implementation, generate a DSA key, Tom St Denis
*/
-#ifdef MDSA
+#ifdef LTC_MDSA
/**
Create a DSA key
@@ -41,13 +41,13 @@ int dsa_make_key(prng_state *prng, int wprng, int group_size, int modulus_size,
}
/* check size */
- if (group_size >= MDSA_MAX_GROUP || group_size <= 15 ||
- group_size >= modulus_size || (modulus_size - group_size) >= MDSA_DELTA) {
+ if (group_size >= LTC_MDSA_MAX_GROUP || group_size <= 15 ||
+ group_size >= modulus_size || (modulus_size - group_size) >= LTC_MDSA_DELTA) {
return CRYPT_INVALID_ARG;
}
/* allocate ram */
- buf = XMALLOC(MDSA_DELTA);
+ buf = XMALLOC(LTC_MDSA_DELTA);
if (buf == NULL) {
return CRYPT_MEM;
}
@@ -117,7 +117,7 @@ int dsa_make_key(prng_state *prng, int wprng, int group_size, int modulus_size,
key->qord = group_size;
#ifdef LTC_CLEAN_STACK
- zeromem(buf, MDSA_DELTA);
+ zeromem(buf, LTC_MDSA_DELTA);
#endif
err = CRYPT_OK;
@@ -132,6 +132,6 @@ done:
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/pk/dsa/dsa_make_key.c,v $ */
-/* $Revision: 1.10 $ */
-/* $Date: 2006/12/04 03:18:43 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/pk/dsa/dsa_shared_secret.c b/libtomcrypt/src/pk/dsa/dsa_shared_secret.c
index 570d637..5adaa5f 100644
--- a/libtomcrypt/src/pk/dsa/dsa_shared_secret.c
+++ b/libtomcrypt/src/pk/dsa/dsa_shared_secret.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -15,7 +15,7 @@
DSA Crypto, Tom St Denis
*/
-#ifdef MDSA
+#ifdef LTC_MDSA
/**
Create a DSA shared secret between two keys
@@ -66,7 +66,7 @@ done:
}
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/pk/dsa/dsa_shared_secret.c,v $ */
-/* $Revision: 1.7 $ */
-/* $Date: 2006/12/04 03:18:43 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/pk/dsa/dsa_sign_hash.c b/libtomcrypt/src/pk/dsa/dsa_sign_hash.c
index f84dd28..3fc7e99 100644
--- a/libtomcrypt/src/pk/dsa/dsa_sign_hash.c
+++ b/libtomcrypt/src/pk/dsa/dsa_sign_hash.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -15,7 +15,7 @@
DSA implementation, sign a hash, Tom St Denis
*/
-#ifdef MDSA
+#ifdef LTC_MDSA
/**
Sign a hash with DSA
@@ -49,11 +49,11 @@ int dsa_sign_hash_raw(const unsigned char *in, unsigned long inlen,
}
/* check group order size */
- if (key->qord >= MDSA_MAX_GROUP) {
+ if (key->qord >= LTC_MDSA_MAX_GROUP) {
return CRYPT_INVALID_ARG;
}
- buf = XMALLOC(MDSA_MAX_GROUP);
+ buf = XMALLOC(LTC_MDSA_MAX_GROUP);
if (buf == NULL) {
return CRYPT_MEM;
}
@@ -102,7 +102,7 @@ error:
mp_clear_multi(k, kinv, tmp, NULL);
ERRBUF:
#ifdef LTC_CLEAN_STACK
- zeromem(buf, MDSA_MAX_GROUP);
+ zeromem(buf, LTC_MDSA_MAX_GROUP);
#endif
XFREE(buf);
return err;
@@ -151,6 +151,6 @@ error:
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/pk/dsa/dsa_sign_hash.c,v $ */
-/* $Revision: 1.12 $ */
-/* $Date: 2006/12/04 22:27:56 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/pk/dsa/dsa_verify_hash.c b/libtomcrypt/src/pk/dsa/dsa_verify_hash.c
index 0e8ff22..59beec2 100644
--- a/libtomcrypt/src/pk/dsa/dsa_verify_hash.c
+++ b/libtomcrypt/src/pk/dsa/dsa_verify_hash.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -16,7 +16,7 @@
*/
-#ifdef MDSA
+#ifdef LTC_MDSA
/**
Verify a DSA signature
@@ -121,6 +121,6 @@ LBL_ERR:
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/pk/dsa/dsa_verify_hash.c,v $ */
-/* $Revision: 1.13 $ */
-/* $Date: 2006/12/04 03:18:43 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/pk/dsa/dsa_verify_key.c b/libtomcrypt/src/pk/dsa/dsa_verify_key.c
index 27054d6..fa839ef 100644
--- a/libtomcrypt/src/pk/dsa/dsa_verify_key.c
+++ b/libtomcrypt/src/pk/dsa/dsa_verify_key.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -15,7 +15,7 @@
DSA implementation, verify a key, Tom St Denis
*/
-#ifdef MDSA
+#ifdef LTC_MDSA
/**
Verify a DSA key for validity
@@ -95,6 +95,6 @@ error:
}
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/pk/dsa/dsa_verify_key.c,v $ */
-/* $Revision: 1.6 $ */
-/* $Date: 2006/12/04 03:18:43 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/pk/ecc/ecc.c b/libtomcrypt/src/pk/ecc/ecc.c
index 90bbed4..56ed526 100644
--- a/libtomcrypt/src/pk/ecc/ecc.c
+++ b/libtomcrypt/src/pk/ecc/ecc.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/* Implements ECC over Z/pZ for curve y^2 = x^3 - 3x + b
@@ -21,7 +21,7 @@
ECC Crypto, Tom St Denis
*/
-#ifdef MECC
+#ifdef LTC_MECC
/* This holds the key settings. ***MUST*** be organized by size from smallest to largest. */
const ltc_ecc_set_type ltc_ecc_sets[] = {
@@ -121,7 +121,7 @@ const ltc_ecc_set_type ltc_ecc_sets[] = {
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/pk/ecc/ecc.c,v $ */
-/* $Revision: 1.38 $ */
-/* $Date: 2006/11/07 23:14:28 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/pk/ecc/ecc_ansi_x963_export.c b/libtomcrypt/src/pk/ecc/ecc_ansi_x963_export.c
index 2a32912..09dae07 100644
--- a/libtomcrypt/src/pk/ecc/ecc_ansi_x963_export.c
+++ b/libtomcrypt/src/pk/ecc/ecc_ansi_x963_export.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/* Implements ECC over Z/pZ for curve y^2 = x^3 - 3x + b
@@ -21,7 +21,7 @@
ECC Crypto, Tom St Denis
*/
-#ifdef MECC
+#ifdef LTC_MECC
/** ECC X9.63 (Sec. 4.3.6) uncompressed export
@param key Key to export
@@ -67,6 +67,6 @@ int ecc_ansi_x963_export(ecc_key *key, unsigned char *out, unsigned long *outlen
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/pk/ecc/ecc_ansi_x963_export.c,v $ */
-/* $Revision: 1.4 $ */
-/* $Date: 2006/12/04 02:50:11 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/pk/ecc/ecc_ansi_x963_import.c b/libtomcrypt/src/pk/ecc/ecc_ansi_x963_import.c
index e92f5f4..ec34245 100644
--- a/libtomcrypt/src/pk/ecc/ecc_ansi_x963_import.c
+++ b/libtomcrypt/src/pk/ecc/ecc_ansi_x963_import.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/* Implements ECC over Z/pZ for curve y^2 = x^3 - 3x + b
@@ -21,7 +21,7 @@
ECC Crypto, Tom St Denis
*/
-#ifdef MECC
+#ifdef LTC_MECC
/** Import an ANSI X9.63 format public key
@param in The input data to read
@@ -99,6 +99,6 @@ error:
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/pk/ecc/ecc_ansi_x963_import.c,v $ */
-/* $Revision: 1.9 $ */
-/* $Date: 2006/12/04 22:17:46 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/pk/ecc/ecc_decrypt_key.c b/libtomcrypt/src/pk/ecc/ecc_decrypt_key.c
index 97039d0..49df8e8 100644
--- a/libtomcrypt/src/pk/ecc/ecc_decrypt_key.c
+++ b/libtomcrypt/src/pk/ecc/ecc_decrypt_key.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/* Implements ECC over Z/pZ for curve y^2 = x^3 - 3x + b
@@ -21,7 +21,7 @@
ECC Crypto, Tom St Denis
*/
-#if defined(MECC) && defined(LTC_DER)
+#if defined(LTC_MECC) && defined(LTC_DER)
/**
Decrypt an ECC encrypted key
@@ -144,7 +144,7 @@ LBL_ERR:
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/pk/ecc/ecc_decrypt_key.c,v $ */
-/* $Revision: 1.5 $ */
-/* $Date: 2006/06/16 21:53:41 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/pk/ecc/ecc_encrypt_key.c b/libtomcrypt/src/pk/ecc/ecc_encrypt_key.c
index d11ffe4..e97e737 100644
--- a/libtomcrypt/src/pk/ecc/ecc_encrypt_key.c
+++ b/libtomcrypt/src/pk/ecc/ecc_encrypt_key.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/* Implements ECC over Z/pZ for curve y^2 = x^3 - 3x + b
@@ -21,7 +21,7 @@
ECC Crypto, Tom St Denis
*/
-#if defined(MECC) && defined(LTC_DER)
+#if defined(LTC_MECC) && defined(LTC_DER)
/**
Encrypt a symmetric key with ECC
@@ -130,7 +130,7 @@ LBL_ERR:
}
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/pk/ecc/ecc_encrypt_key.c,v $ */
-/* $Revision: 1.4 $ */
-/* $Date: 2006/11/21 00:10:18 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/pk/ecc/ecc_export.c b/libtomcrypt/src/pk/ecc/ecc_export.c
index 08c8d31..6a712fd 100644
--- a/libtomcrypt/src/pk/ecc/ecc_export.c
+++ b/libtomcrypt/src/pk/ecc/ecc_export.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/* Implements ECC over Z/pZ for curve y^2 = x^3 - 3x + b
@@ -21,7 +21,7 @@
ECC Crypto, Tom St Denis
*/
-#if defined(MECC) && defined(LTC_DER)
+#if defined(LTC_MECC) && defined(LTC_DER)
/**
Export an ECC key as a binary packet
@@ -76,7 +76,7 @@ int ecc_export(unsigned char *out, unsigned long *outlen, int type, ecc_key *key
}
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/pk/ecc/ecc_export.c,v $ */
-/* $Revision: 1.4 $ */
-/* $Date: 2006/11/21 00:10:18 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/pk/ecc/ecc_free.c b/libtomcrypt/src/pk/ecc/ecc_free.c
index 039178d..c9e5d6c 100644
--- a/libtomcrypt/src/pk/ecc/ecc_free.c
+++ b/libtomcrypt/src/pk/ecc/ecc_free.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/* Implements ECC over Z/pZ for curve y^2 = x^3 - 3x + b
@@ -21,7 +21,7 @@
ECC Crypto, Tom St Denis
*/
-#ifdef MECC
+#ifdef LTC_MECC
/**
Free an ECC key from memory
@@ -34,7 +34,7 @@ void ecc_free(ecc_key *key)
}
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/pk/ecc/ecc_free.c,v $ */
-/* $Revision: 1.4 $ */
-/* $Date: 2006/06/09 01:38:14 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/pk/ecc/ecc_get_size.c b/libtomcrypt/src/pk/ecc/ecc_get_size.c
index 9eafdeb..a824aa4 100644
--- a/libtomcrypt/src/pk/ecc/ecc_get_size.c
+++ b/libtomcrypt/src/pk/ecc/ecc_get_size.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/* Implements ECC over Z/pZ for curve y^2 = x^3 - 3x + b
@@ -21,7 +21,7 @@
ECC Crypto, Tom St Denis
*/
-#ifdef MECC
+#ifdef LTC_MECC
/**
Get the size of an ECC key
@@ -38,7 +38,7 @@ int ecc_get_size(ecc_key *key)
}
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/pk/ecc/ecc_get_size.c,v $ */
-/* $Revision: 1.4 $ */
-/* $Date: 2006/11/21 00:10:18 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/pk/ecc/ecc_import.c b/libtomcrypt/src/pk/ecc/ecc_import.c
index 97eaa7d..9506076 100644
--- a/libtomcrypt/src/pk/ecc/ecc_import.c
+++ b/libtomcrypt/src/pk/ecc/ecc_import.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/* Implements ECC over Z/pZ for curve y^2 = x^3 - 3x + b
@@ -21,7 +21,7 @@
ECC Crypto, Tom St Denis
*/
-#if defined(MECC) && defined(LTC_DER)
+#if defined(LTC_MECC) && defined(LTC_DER)
static int is_point(ecc_key *key)
{
@@ -166,7 +166,7 @@ done:
return err;
}
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/pk/ecc/ecc_import.c,v $ */
-/* $Revision: 1.11 $ */
-/* $Date: 2006/12/04 02:19:48 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/pk/ecc/ecc_make_key.c b/libtomcrypt/src/pk/ecc/ecc_make_key.c
index 796b674..9bbeb44 100644
--- a/libtomcrypt/src/pk/ecc/ecc_make_key.c
+++ b/libtomcrypt/src/pk/ecc/ecc_make_key.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/* Implements ECC over Z/pZ for curve y^2 = x^3 - 3x + b
@@ -21,7 +21,7 @@
ECC Crypto, Tom St Denis
*/
-#ifdef MECC
+#ifdef LTC_MECC
/**
Make a new ECC key
@@ -51,7 +51,7 @@ int ecc_make_key_ex(prng_state *prng, int wprng, ecc_key *key, const ltc_ecc_set
{
int err;
ecc_point *base;
- void *prime;
+ void *prime, *order;
unsigned char *buf;
int keysize;
@@ -82,7 +82,7 @@ int ecc_make_key_ex(prng_state *prng, int wprng, ecc_key *key, const ltc_ecc_set
}
/* setup the key variables */
- if ((err = mp_init_multi(&key->pubkey.x, &key->pubkey.y, &key->pubkey.z, &key->k, &prime, NULL)) != CRYPT_OK) {
+ if ((err = mp_init_multi(&key->pubkey.x, &key->pubkey.y, &key->pubkey.z, &key->k, &prime, &order, NULL)) != CRYPT_OK) {
goto ERR_BUF;
}
base = ltc_ecc_new_point();
@@ -93,11 +93,16 @@ int ecc_make_key_ex(prng_state *prng, int wprng, ecc_key *key, const ltc_ecc_set
/* read in the specs for this key */
if ((err = mp_read_radix(prime, (char *)key->dp->prime, 16)) != CRYPT_OK) { goto errkey; }
+ if ((err = mp_read_radix(order, (char *)key->dp->order, 16)) != CRYPT_OK) { goto errkey; }
if ((err = mp_read_radix(base->x, (char *)key->dp->Gx, 16)) != CRYPT_OK) { goto errkey; }
if ((err = mp_read_radix(base->y, (char *)key->dp->Gy, 16)) != CRYPT_OK) { goto errkey; }
if ((err = mp_set(base->z, 1)) != CRYPT_OK) { goto errkey; }
if ((err = mp_read_unsigned_bin(key->k, (unsigned char *)buf, keysize)) != CRYPT_OK) { goto errkey; }
+ /* the key should be smaller than the order of base point */
+ if (mp_cmp(key->k, order) != LTC_MP_LT) {
+ if((err = mp_mod(key->k, order, key->k)) != CRYPT_OK) { goto errkey; }
+ }
/* make the public key */
if ((err = ltc_mp.ecc_ptmul(key->k, base, &key->pubkey, prime, 1)) != CRYPT_OK) { goto errkey; }
key->type = PK_PRIVATE;
@@ -109,7 +114,7 @@ errkey:
mp_clear_multi(key->pubkey.x, key->pubkey.y, key->pubkey.z, key->k, NULL);
cleanup:
ltc_ecc_del_point(base);
- mp_clear(prime);
+ mp_clear_multi(prime, order, NULL);
ERR_BUF:
#ifdef LTC_CLEAN_STACK
zeromem(buf, ECC_MAXSIZE);
@@ -119,7 +124,7 @@ ERR_BUF:
}
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/pk/ecc/ecc_make_key.c,v $ */
-/* $Revision: 1.9 $ */
-/* $Date: 2006/12/04 02:50:11 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/pk/ecc/ecc_shared_secret.c b/libtomcrypt/src/pk/ecc/ecc_shared_secret.c
index ddef847..5aece5e 100644
--- a/libtomcrypt/src/pk/ecc/ecc_shared_secret.c
+++ b/libtomcrypt/src/pk/ecc/ecc_shared_secret.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/* Implements ECC over Z/pZ for curve y^2 = x^3 - 3x + b
@@ -21,7 +21,7 @@
ECC Crypto, Tom St Denis
*/
-#ifdef MECC
+#ifdef LTC_MECC
/**
Create an ECC shared secret between two keys
@@ -89,7 +89,7 @@ done:
}
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/pk/ecc/ecc_shared_secret.c,v $ */
-/* $Revision: 1.8 $ */
-/* $Date: 2006/12/04 02:19:48 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/pk/ecc/ecc_sign_hash.c b/libtomcrypt/src/pk/ecc/ecc_sign_hash.c
index 34c5893..0ef7e2b 100644
--- a/libtomcrypt/src/pk/ecc/ecc_sign_hash.c
+++ b/libtomcrypt/src/pk/ecc/ecc_sign_hash.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/* Implements ECC over Z/pZ for curve y^2 = x^3 - 3x + b
@@ -21,7 +21,7 @@
ECC Crypto, Tom St Denis
*/
-#if defined(MECC) && defined(LTC_DER)
+#if defined(LTC_MECC) && defined(LTC_DER)
/**
Sign a message digest
@@ -108,7 +108,7 @@ errnokey:
}
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/pk/ecc/ecc_sign_hash.c,v $ */
-/* $Revision: 1.9 $ */
-/* $Date: 2006/12/04 02:50:11 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/pk/ecc/ecc_sizes.c b/libtomcrypt/src/pk/ecc/ecc_sizes.c
index f4b2d82..b02a9f9 100644
--- a/libtomcrypt/src/pk/ecc/ecc_sizes.c
+++ b/libtomcrypt/src/pk/ecc/ecc_sizes.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/* Implements ECC over Z/pZ for curve y^2 = x^3 - 3x + b
@@ -21,7 +21,7 @@
ECC Crypto, Tom St Denis
*/
-#ifdef MECC
+#ifdef LTC_MECC
void ecc_sizes(int *low, int *high)
{
@@ -42,7 +42,7 @@ void ecc_sizes(int *low, int *high)
}
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/pk/ecc/ecc_sizes.c,v $ */
-/* $Revision: 1.4 $ */
-/* $Date: 2006/06/09 01:38:14 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/pk/ecc/ecc_test.c b/libtomcrypt/src/pk/ecc/ecc_test.c
index faa167c..873e70b 100644
--- a/libtomcrypt/src/pk/ecc/ecc_test.c
+++ b/libtomcrypt/src/pk/ecc/ecc_test.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/* Implements ECC over Z/pZ for curve y^2 = x^3 - 3x + b
@@ -21,7 +21,7 @@
ECC Crypto, Tom St Denis
*/
-#ifdef MECC
+#ifdef LTC_MECC
/**
Perform on the ECC system
@@ -89,7 +89,7 @@ done:
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/pk/ecc/ecc_test.c,v $ */
-/* $Revision: 1.10 $ */
-/* $Date: 2006/12/04 02:19:48 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/pk/ecc/ecc_verify_hash.c b/libtomcrypt/src/pk/ecc/ecc_verify_hash.c
index 65a96e6..c10076b 100644
--- a/libtomcrypt/src/pk/ecc/ecc_verify_hash.c
+++ b/libtomcrypt/src/pk/ecc/ecc_verify_hash.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/* Implements ECC over Z/pZ for curve y^2 = x^3 - 3x + b
@@ -21,7 +21,7 @@
ECC Crypto, Tom St Denis
*/
-#if defined(MECC) && defined(LTC_DER)
+#if defined(LTC_MECC) && defined(LTC_DER)
/* verify
*
@@ -159,7 +159,7 @@ error:
}
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/pk/ecc/ecc_verify_hash.c,v $ */
-/* $Revision: 1.12 $ */
-/* $Date: 2006/12/04 05:07:59 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/pk/ecc/ltc_ecc_is_valid_idx.c b/libtomcrypt/src/pk/ecc/ltc_ecc_is_valid_idx.c
index cf81f24..4a02068 100644
--- a/libtomcrypt/src/pk/ecc/ltc_ecc_is_valid_idx.c
+++ b/libtomcrypt/src/pk/ecc/ltc_ecc_is_valid_idx.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/* Implements ECC over Z/pZ for curve y^2 = x^3 - 3x + b
@@ -21,7 +21,7 @@
ECC Crypto, Tom St Denis
*/
-#ifdef MECC
+#ifdef LTC_MECC
/** Returns whether an ECC idx is valid or not
@param n The idx number to check
@@ -33,14 +33,14 @@ int ltc_ecc_is_valid_idx(int n)
for (x = 0; ltc_ecc_sets[x].size != 0; x++);
/* -1 is a valid index --- indicating that the domain params were supplied by the user */
- if ((n >= -1) || (n < x)) {
+ if ((n >= -1) && (n < x)) {
return 1;
}
return 0;
}
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/pk/ecc/ltc_ecc_is_valid_idx.c,v $ */
-/* $Revision: 1.4 $ */
-/* $Date: 2006/11/21 00:10:18 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/pk/ecc/ltc_ecc_map.c b/libtomcrypt/src/pk/ecc/ltc_ecc_map.c
index eec28b3..4f3ec09 100644
--- a/libtomcrypt/src/pk/ecc/ltc_ecc_map.c
+++ b/libtomcrypt/src/pk/ecc/ltc_ecc_map.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/* Implements ECC over Z/pZ for curve y^2 = x^3 - 3x + b
@@ -21,7 +21,7 @@
ECC Crypto, Tom St Denis
*/
-#ifdef MECC
+#ifdef LTC_MECC
/**
Map a projective jacbobian point back to affine space
@@ -70,7 +70,7 @@ done:
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/pk/ecc/ltc_ecc_map.c,v $ */
-/* $Revision: 1.5 $ */
-/* $Date: 2006/12/04 02:50:11 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/pk/ecc/ltc_ecc_mul2add.c b/libtomcrypt/src/pk/ecc/ltc_ecc_mul2add.c
index ac1c24f..a6d1aab 100644
--- a/libtomcrypt/src/pk/ecc/ltc_ecc_mul2add.c
+++ b/libtomcrypt/src/pk/ecc/ltc_ecc_mul2add.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/* Implements ECC over Z/pZ for curve y^2 = x^3 - 3x + b
@@ -21,7 +21,7 @@
ECC Crypto, Shamir's Trick, Tom St Denis
*/
-#ifdef MECC
+#ifdef LTC_MECC
#ifdef LTC_ECC_SHAMIR
@@ -202,6 +202,6 @@ ERR_T:
#endif
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/pk/ecc/ltc_ecc_mul2add.c,v $ */
-/* $Revision: 1.6 $ */
-/* $Date: 2006/12/04 05:07:59 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/pk/ecc/ltc_ecc_mulmod.c b/libtomcrypt/src/pk/ecc/ltc_ecc_mulmod.c
index 0e4c92b..4b11392 100644
--- a/libtomcrypt/src/pk/ecc/ltc_ecc_mulmod.c
+++ b/libtomcrypt/src/pk/ecc/ltc_ecc_mulmod.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/* Implements ECC over Z/pZ for curve y^2 = x^3 - 3x + b
@@ -21,7 +21,7 @@
ECC Crypto, Tom St Denis
*/
-#ifdef MECC
+#ifdef LTC_MECC
#ifndef LTC_ECC_TIMING_RESISTANT
/* size of sliding window, don't change this! */
@@ -217,6 +217,6 @@ done:
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/pk/ecc/ltc_ecc_mulmod.c,v $ */
-/* $Revision: 1.24 $ */
-/* $Date: 2006/12/04 05:07:59 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/pk/ecc/ltc_ecc_mulmod_timing.c b/libtomcrypt/src/pk/ecc/ltc_ecc_mulmod_timing.c
index 8cbcdf3..25dcf0a 100644
--- a/libtomcrypt/src/pk/ecc/ltc_ecc_mulmod_timing.c
+++ b/libtomcrypt/src/pk/ecc/ltc_ecc_mulmod_timing.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/* Implements ECC over Z/pZ for curve y^2 = x^3 - 3x + b
@@ -21,7 +21,7 @@
ECC Crypto, Tom St Denis
*/
-#ifdef MECC
+#ifdef LTC_MECC
#ifdef LTC_ECC_TIMING_RESISTANT
@@ -159,7 +159,7 @@ done:
#endif
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/pk/ecc/ltc_ecc_mulmod_timing.c,v $ */
-/* $Revision: 1.11 $ */
-/* $Date: 2006/12/04 22:17:46 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/pk/ecc/ltc_ecc_points.c b/libtomcrypt/src/pk/ecc/ltc_ecc_points.c
index 39f1321..9be9eff 100644
--- a/libtomcrypt/src/pk/ecc/ltc_ecc_points.c
+++ b/libtomcrypt/src/pk/ecc/ltc_ecc_points.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/* Implements ECC over Z/pZ for curve y^2 = x^3 - 3x + b
@@ -21,7 +21,7 @@
ECC Crypto, Tom St Denis
*/
-#ifdef MECC
+#ifdef LTC_MECC
/**
Allocate a new ECC point
@@ -54,7 +54,7 @@ void ltc_ecc_del_point(ecc_point *p)
}
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/pk/ecc/ltc_ecc_points.c,v $ */
-/* $Revision: 1.5 $ */
-/* $Date: 2006/12/04 02:19:48 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/pk/ecc/ltc_ecc_projective_add_point.c b/libtomcrypt/src/pk/ecc/ltc_ecc_projective_add_point.c
index c8e359f..c45a47b 100644
--- a/libtomcrypt/src/pk/ecc/ltc_ecc_projective_add_point.c
+++ b/libtomcrypt/src/pk/ecc/ltc_ecc_projective_add_point.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/* Implements ECC over Z/pZ for curve y^2 = x^3 - 3x + b
@@ -21,7 +21,7 @@
ECC Crypto, Tom St Denis
*/
-#if defined(MECC) && (!defined(MECC_ACCEL) || defined(LTM_DESC))
+#if defined(LTC_MECC) && (!defined(LTC_MECC_ACCEL) || defined(LTM_LTC_DESC))
/**
Add two ECC points
@@ -190,7 +190,7 @@ done:
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/pk/ecc/ltc_ecc_projective_add_point.c,v $ */
-/* $Revision: 1.13 $ */
-/* $Date: 2006/12/04 05:07:59 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/pk/ecc/ltc_ecc_projective_dbl_point.c b/libtomcrypt/src/pk/ecc/ltc_ecc_projective_dbl_point.c
index f0b3e1d..ce31ccc 100644
--- a/libtomcrypt/src/pk/ecc/ltc_ecc_projective_dbl_point.c
+++ b/libtomcrypt/src/pk/ecc/ltc_ecc_projective_dbl_point.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/* Implements ECC over Z/pZ for curve y^2 = x^3 - 3x + b
@@ -21,7 +21,7 @@
ECC Crypto, Tom St Denis
*/
-#if defined(MECC) && (!defined(MECC_ACCEL) || defined(LTM_DESC))
+#if defined(LTC_MECC) && (!defined(LTC_MECC_ACCEL) || defined(LTM_LTC_DESC))
/**
Double an ECC point
@@ -141,7 +141,7 @@ done:
return err;
}
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/pk/ecc/ltc_ecc_projective_dbl_point.c,v $ */
-/* $Revision: 1.8 $ */
-/* $Date: 2006/12/04 05:07:59 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/pk/katja/katja_decrypt_key.c b/libtomcrypt/src/pk/katja/katja_decrypt_key.c
index 1e10d6c..e8819d9 100644
--- a/libtomcrypt/src/pk/katja/katja_decrypt_key.c
+++ b/libtomcrypt/src/pk/katja/katja_decrypt_key.c
@@ -6,19 +6,19 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
/**
@file katja_decrypt_key.c
- Katja PKCS #1 OAEP Decryption, Tom St Denis
+ Katja LTC_PKCS #1 OAEP Decryption, Tom St Denis
*/
#ifdef MKAT
/**
- (PKCS #1 v2.0) decrypt then OAEP depad
+ (LTC_PKCS #1 v2.0) decrypt then OAEP depad
@param in The ciphertext
@param inlen The length of the ciphertext (octets)
@param out [out] The plaintext
@@ -94,12 +94,12 @@ int katja_decrypt_key(const unsigned char *in, unsigned long inlen,
return err;
}
-#endif /* MRSA */
+#endif /* LTC_MRSA */
-/* $Source: /cvs/libtom/libtomcrypt/src/pk/katja/katja_decrypt_key.c,v $ */
-/* $Revision: 1.4 $ */
-/* $Date: 2006/03/31 14:15:35 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/pk/katja/katja_encrypt_key.c b/libtomcrypt/src/pk/katja/katja_encrypt_key.c
index ce93356..ef59e92 100644
--- a/libtomcrypt/src/pk/katja/katja_encrypt_key.c
+++ b/libtomcrypt/src/pk/katja/katja_encrypt_key.c
@@ -6,19 +6,19 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
/**
@file katja_encrypt_key.c
- Katja PKCS-style OAEP encryption, Tom St Denis
+ Katja LTC_PKCS-style OAEP encryption, Tom St Denis
*/
#ifdef MKAT
/**
- (PKCS #1 v2.0) OAEP pad then encrypt
+ (LTC_PKCS #1 v2.0) OAEP pad then encrypt
@param in The plaintext
@param inlen The length of the plaintext (octets)
@param out [out] The ciphertext
@@ -80,8 +80,8 @@ int katja_encrypt_key(const unsigned char *in, unsigned long inlen,
return katja_exptmod(out, x, out, outlen, PK_PUBLIC, key);
}
-#endif /* MRSA */
+#endif /* LTC_MRSA */
-/* $Source: /cvs/libtom/libtomcrypt/src/pk/katja/katja_encrypt_key.c,v $ */
-/* $Revision: 1.5 $ */
-/* $Date: 2006/06/16 21:53:41 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/pk/katja/katja_export.c b/libtomcrypt/src/pk/katja/katja_export.c
index 9e55654..5f4d327 100644
--- a/libtomcrypt/src/pk/katja/katja_export.c
+++ b/libtomcrypt/src/pk/katja/katja_export.c
@@ -6,13 +6,13 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
/**
@file katja_export.c
- Export Katja PKCS-style keys, Tom St Denis
+ Export Katja LTC_PKCS-style keys, Tom St Denis
*/
#ifdef MKAT
@@ -68,8 +68,8 @@ int katja_export(unsigned char *out, unsigned long *outlen, int type, katja_key
}
}
-#endif /* MRSA */
+#endif /* LTC_MRSA */
-/* $Source: /cvs/libtom/libtomcrypt/src/pk/katja/katja_export.c,v $ */
-/* $Revision: 1.2 $ */
-/* $Date: 2006/03/31 14:15:35 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/pk/katja/katja_exptmod.c b/libtomcrypt/src/pk/katja/katja_exptmod.c
index 8cc47d8..5df8908 100644
--- a/libtomcrypt/src/pk/katja/katja_exptmod.c
+++ b/libtomcrypt/src/pk/katja/katja_exptmod.c
@@ -6,13 +6,13 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
/**
@file katja_exptmod.c
- Katja PKCS-style exptmod, Tom St Denis
+ Katja LTC_PKCS-style exptmod, Tom St Denis
*/
#ifdef MKAT
@@ -110,6 +110,6 @@ done:
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/pk/katja/katja_exptmod.c,v $ */
-/* $Revision: 1.5 $ */
-/* $Date: 2006/06/16 21:53:41 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/pk/katja/katja_free.c b/libtomcrypt/src/pk/katja/katja_free.c
index 8aed3fb..c5a46af 100644
--- a/libtomcrypt/src/pk/katja/katja_free.c
+++ b/libtomcrypt/src/pk/katja/katja_free.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -30,6 +30,6 @@ void katja_free(katja_key *key)
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/pk/katja/katja_free.c,v $ */
-/* $Revision: 1.2 $ */
-/* $Date: 2006/03/31 14:15:35 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/pk/katja/katja_import.c b/libtomcrypt/src/pk/katja/katja_import.c
index efdbe07..425f498 100644
--- a/libtomcrypt/src/pk/katja/katja_import.c
+++ b/libtomcrypt/src/pk/katja/katja_import.c
@@ -6,19 +6,19 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
/**
@file katja_import.c
- Import a PKCS-style Katja key, Tom St Denis
+ Import a LTC_PKCS-style Katja key, Tom St Denis
*/
#ifdef MKAT
/**
- Import an KatjaPublicKey or KatjaPrivateKey [two-prime only, only support >= 1024-bit keys, defined in PKCS #1 v2.1]
+ Import an KatjaPublicKey or KatjaPrivateKey [two-prime only, only support >= 1024-bit keys, defined in LTC_PKCS #1 v2.1]
@param in The packet to import from
@param inlen It's length (octets)
@param key [out] Destination for newly imported key
@@ -73,9 +73,9 @@ LBL_ERR:
return err;
}
-#endif /* MRSA */
+#endif /* LTC_MRSA */
-/* $Source: /cvs/libtom/libtomcrypt/src/pk/katja/katja_import.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:15:35 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/pk/katja/katja_make_key.c b/libtomcrypt/src/pk/katja/katja_make_key.c
index 08016c8..eec8e98 100644
--- a/libtomcrypt/src/pk/katja/katja_make_key.c
+++ b/libtomcrypt/src/pk/katja/katja_make_key.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -96,6 +96,6 @@ done:
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/pk/katja/katja_make_key.c,v $ */
-/* $Revision: 1.10 $ */
-/* $Date: 2006/03/31 14:15:35 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/pk/pkcs1/pkcs_1_i2osp.c b/libtomcrypt/src/pk/pkcs1/pkcs_1_i2osp.c
index 4a39bd5..2d9df75 100644
--- a/libtomcrypt/src/pk/pkcs1/pkcs_1_i2osp.c
+++ b/libtomcrypt/src/pk/pkcs1/pkcs_1_i2osp.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -15,14 +15,14 @@
Integer to Octet I2OSP, Tom St Denis
*/
-#ifdef PKCS_1
+#ifdef LTC_PKCS_1
/* always stores the same # of bytes, pads with leading zero bytes
as required
*/
/**
- PKCS #1 Integer to binary
+ LTC_PKCS #1 Integer to binary
@param n The integer to store
@param modulus_len The length of the RSA modulus
@param out [out] The destination for the integer
@@ -43,9 +43,9 @@ int pkcs_1_i2osp(void *n, unsigned long modulus_len, unsigned char *out)
return mp_to_unsigned_bin(n, out+(modulus_len-size));
}
-#endif /* PKCS_1 */
+#endif /* LTC_PKCS_1 */
-/* $Source: /cvs/libtom/libtomcrypt/src/pk/pkcs1/pkcs_1_i2osp.c,v $ */
-/* $Revision: 1.5 $ */
-/* $Date: 2006/03/31 14:15:35 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/pk/pkcs1/pkcs_1_mgf1.c b/libtomcrypt/src/pk/pkcs1/pkcs_1_mgf1.c
index bfc80bd..af8f7e2 100644
--- a/libtomcrypt/src/pk/pkcs1/pkcs_1_mgf1.c
+++ b/libtomcrypt/src/pk/pkcs1/pkcs_1_mgf1.c
@@ -6,19 +6,19 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
/**
@file pkcs_1_mgf1.c
- The Mask Generation Function (MGF1) for PKCS #1, Tom St Denis
+ The Mask Generation Function (MGF1) for LTC_PKCS #1, Tom St Denis
*/
-#ifdef PKCS_1
+#ifdef LTC_PKCS_1
/**
- Perform PKCS #1 MGF1 (internal)
+ Perform LTC_PKCS #1 MGF1 (internal)
@param seed The seed for MGF1
@param seedlen The length of the seed
@param hash_idx The index of the hash desired
@@ -101,8 +101,8 @@ LBL_ERR:
return err;
}
-#endif /* PKCS_1 */
+#endif /* LTC_PKCS_1 */
-/* $Source: /cvs/libtom/libtomcrypt/src/pk/pkcs1/pkcs_1_mgf1.c,v $ */
-/* $Revision: 1.6 $ */
-/* $Date: 2006/03/31 14:15:35 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/pk/pkcs1/pkcs_1_oaep_decode.c b/libtomcrypt/src/pk/pkcs1/pkcs_1_oaep_decode.c
index e70a016..9ac9976 100644
--- a/libtomcrypt/src/pk/pkcs1/pkcs_1_oaep_decode.c
+++ b/libtomcrypt/src/pk/pkcs1/pkcs_1_oaep_decode.c
@@ -6,19 +6,19 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
/**
@file pkcs_1_oaep_decode.c
- OAEP Padding for PKCS #1, Tom St Denis
+ OAEP Padding for LTC_PKCS #1, Tom St Denis
*/
-#ifdef PKCS_1
+#ifdef LTC_PKCS_1
/**
- PKCS #1 v2.00 OAEP decode
+ LTC_PKCS #1 v2.00 OAEP decode
@param msg The encoded data to decode
@param msglen The length of the encoded data (octets)
@param lparam The session or system data (can be NULL)
@@ -182,8 +182,8 @@ LBL_ERR:
return err;
}
-#endif /* PKCS_1 */
+#endif /* LTC_PKCS_1 */
-/* $Source: /cvs/libtom/libtomcrypt/src/pk/pkcs1/pkcs_1_oaep_decode.c,v $ */
-/* $Revision: 1.11 $ */
-/* $Date: 2006/11/01 09:28:17 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/pk/pkcs1/pkcs_1_oaep_encode.c b/libtomcrypt/src/pk/pkcs1/pkcs_1_oaep_encode.c
index 99e1ac6..4403477 100644
--- a/libtomcrypt/src/pk/pkcs1/pkcs_1_oaep_encode.c
+++ b/libtomcrypt/src/pk/pkcs1/pkcs_1_oaep_encode.c
@@ -6,19 +6,19 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
/**
@file pkcs_1_oaep_encode.c
- OAEP Padding for PKCS #1, Tom St Denis
+ OAEP Padding for LTC_PKCS #1, Tom St Denis
*/
-#ifdef PKCS_1
+#ifdef LTC_PKCS_1
/**
- PKCS #1 v2.00 OAEP encode
+ LTC_PKCS #1 v2.00 OAEP encode
@param msg The data to encode
@param msglen The length of the data to encode (octets)
@param lparam A session or system parameter (can be NULL)
@@ -165,9 +165,9 @@ LBL_ERR:
return err;
}
-#endif /* PKCS_1 */
+#endif /* LTC_PKCS_1 */
-/* $Source: /cvs/libtom/libtomcrypt/src/pk/pkcs1/pkcs_1_oaep_encode.c,v $ */
-/* $Revision: 1.7 $ */
-/* $Date: 2006/06/16 21:53:41 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/pk/pkcs1/pkcs_1_os2ip.c b/libtomcrypt/src/pk/pkcs1/pkcs_1_os2ip.c
index 563ae8d..2df7574 100644
--- a/libtomcrypt/src/pk/pkcs1/pkcs_1_os2ip.c
+++ b/libtomcrypt/src/pk/pkcs1/pkcs_1_os2ip.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -14,7 +14,7 @@
@file pkcs_1_os2ip.c
Octet to Integer OS2IP, Tom St Denis
*/
-#ifdef PKCS_1
+#ifdef LTC_PKCS_1
/**
Read a binary string into an mp_int
@@ -28,9 +28,9 @@ int pkcs_1_os2ip(void *n, unsigned char *in, unsigned long inlen)
return mp_read_unsigned_bin(n, in, inlen);
}
-#endif /* PKCS_1 */
+#endif /* LTC_PKCS_1 */
-/* $Source: /cvs/libtom/libtomcrypt/src/pk/pkcs1/pkcs_1_os2ip.c,v $ */
-/* $Revision: 1.5 $ */
-/* $Date: 2006/03/31 14:15:35 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/pk/pkcs1/pkcs_1_pss_decode.c b/libtomcrypt/src/pk/pkcs1/pkcs_1_pss_decode.c
index 2c16d50..222048c 100644
--- a/libtomcrypt/src/pk/pkcs1/pkcs_1_pss_decode.c
+++ b/libtomcrypt/src/pk/pkcs1/pkcs_1_pss_decode.c
@@ -6,19 +6,19 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
/**
@file pkcs_1_pss_decode.c
- PKCS #1 PSS Signature Padding, Tom St Denis
+ LTC_PKCS #1 PSS Signature Padding, Tom St Denis
*/
-#ifdef PKCS_1
+#ifdef LTC_PKCS_1
/**
- PKCS #1 v2.00 PSS decode
+ LTC_PKCS #1 v2.00 PSS decode
@param msghash The hash to verify
@param msghashlen The length of the hash (octets)
@param sig The signature data (encoded data)
@@ -170,8 +170,8 @@ LBL_ERR:
return err;
}
-#endif /* PKCS_1 */
+#endif /* LTC_PKCS_1 */
-/* $Source: /cvs/libtom/libtomcrypt/src/pk/pkcs1/pkcs_1_pss_decode.c,v $ */
-/* $Revision: 1.9 $ */
-/* $Date: 2006/11/30 02:37:21 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/pk/pkcs1/pkcs_1_pss_encode.c b/libtomcrypt/src/pk/pkcs1/pkcs_1_pss_encode.c
index 64bd312..b22a99f 100644
--- a/libtomcrypt/src/pk/pkcs1/pkcs_1_pss_encode.c
+++ b/libtomcrypt/src/pk/pkcs1/pkcs_1_pss_encode.c
@@ -6,19 +6,19 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
/**
@file pkcs_1_pss_encode.c
- PKCS #1 PSS Signature Padding, Tom St Denis
+ LTC_PKCS #1 PSS Signature Padding, Tom St Denis
*/
-#ifdef PKCS_1
+#ifdef LTC_PKCS_1
/**
- PKCS #1 v2.00 Signature Encoding
+ LTC_PKCS #1 v2.00 Signature Encoding
@param msghash The hash to encode
@param msghashlen The length of the hash (octets)
@param saltlen The length of the salt desired (octets)
@@ -168,8 +168,8 @@ LBL_ERR:
return err;
}
-#endif /* PKCS_1 */
+#endif /* LTC_PKCS_1 */
-/* $Source: /cvs/libtom/libtomcrypt/src/pk/pkcs1/pkcs_1_pss_encode.c,v $ */
-/* $Revision: 1.7 $ */
-/* $Date: 2006/06/16 21:53:41 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/pk/pkcs1/pkcs_1_v1_5_decode.c b/libtomcrypt/src/pk/pkcs1/pkcs_1_v1_5_decode.c
index b0a7c2d..8345601 100644
--- a/libtomcrypt/src/pk/pkcs1/pkcs_1_v1_5_decode.c
+++ b/libtomcrypt/src/pk/pkcs1/pkcs_1_v1_5_decode.c
@@ -6,18 +6,18 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
/** @file pkcs_1_v1_5_decode.c
*
- * PKCS #1 v1.5 Padding. (Andreas Lange)
+ * LTC_PKCS #1 v1.5 Padding. (Andreas Lange)
*/
-#ifdef PKCS_1
+#ifdef LTC_PKCS_1
-/** @brief PKCS #1 v1.5 decode.
+/** @brief LTC_PKCS #1 v1.5 decode.
*
* @param msg The encoded data to decode
* @param msglen The length of the encoded data (octets)
@@ -58,7 +58,7 @@ int pkcs_1_v1_5_decode(const unsigned char *msg,
goto bail;
}
- if (block_type == LTC_PKCS_1_EME) {
+ if (block_type == LTC_LTC_PKCS_1_EME) {
for (i = 2; i < modulus_len; i++) {
/* separator */
if (msg[i] == 0x00) { break; }
@@ -103,8 +103,8 @@ bail:
return result;
} /* pkcs_1_v1_5_decode */
-#endif /* #ifdef PKCS_1 */
+#endif /* #ifdef LTC_PKCS_1 */
-/* $Source: /cvs/libtom/libtomcrypt/src/pk/pkcs1/pkcs_1_v1_5_decode.c,v $ */
-/* $Revision: 1.5 $ */
-/* $Date: 2006/12/16 17:41:21 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/pk/pkcs1/pkcs_1_v1_5_encode.c b/libtomcrypt/src/pk/pkcs1/pkcs_1_v1_5_encode.c
index 7edd1e6..1c35069 100644
--- a/libtomcrypt/src/pk/pkcs1/pkcs_1_v1_5_encode.c
+++ b/libtomcrypt/src/pk/pkcs1/pkcs_1_v1_5_encode.c
@@ -6,25 +6,25 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
/*! \file pkcs_1_v1_5_encode.c
*
- * PKCS #1 v1.5 Padding (Andreas Lange)
+ * LTC_PKCS #1 v1.5 Padding (Andreas Lange)
*/
-#ifdef PKCS_1
+#ifdef LTC_PKCS_1
-/*! \brief PKCS #1 v1.5 encode.
+/*! \brief LTC_PKCS #1 v1.5 encode.
*
* \param msg The data to encode
* \param msglen The length of the data to encode (octets)
* \param block_type Block type to use in padding (\sa ltc_pkcs_1_v1_5_blocks)
* \param modulus_bitlen The bit length of the RSA modulus
- * \param prng An active PRNG state (only for LTC_PKCS_1_EME)
- * \param prng_idx The index of the PRNG desired (only for LTC_PKCS_1_EME)
+ * \param prng An active PRNG state (only for LTC_LTC_PKCS_1_EME)
+ * \param prng_idx The index of the PRNG desired (only for LTC_LTC_PKCS_1_EME)
* \param out [out] The destination for the encoded data
* \param outlen [in/out] The max size and resulting size of the encoded data
*
@@ -44,12 +44,12 @@ int pkcs_1_v1_5_encode(const unsigned char *msg,
int result;
/* valid block_type? */
- if ((block_type != LTC_PKCS_1_EMSA) &&
- (block_type != LTC_PKCS_1_EME)) {
+ if ((block_type != LTC_LTC_PKCS_1_EMSA) &&
+ (block_type != LTC_LTC_PKCS_1_EME)) {
return CRYPT_PK_INVALID_PADDING;
}
- if (block_type == LTC_PKCS_1_EME) { /* encryption padding, we need a valid PRNG */
+ if (block_type == LTC_LTC_PKCS_1_EME) { /* encryption padding, we need a valid PRNG */
if ((result = prng_is_valid(prng_idx)) != CRYPT_OK) {
return result;
}
@@ -72,7 +72,7 @@ int pkcs_1_v1_5_encode(const unsigned char *msg,
ps = &out[2];
ps_len = modulus_len - msglen - 3;
- if (block_type == LTC_PKCS_1_EME) {
+ if (block_type == LTC_LTC_PKCS_1_EME) {
/* now choose a random ps */
if (prng_descriptor[prng_idx].read(ps, ps_len, prng) != ps_len) {
result = CRYPT_ERROR_READPRNG;
@@ -104,8 +104,8 @@ bail:
return result;
} /* pkcs_1_v1_5_encode */
-#endif /* #ifdef PKCS_1 */
+#endif /* #ifdef LTC_PKCS_1 */
-/* $Source: /cvs/libtom/libtomcrypt/src/pk/pkcs1/pkcs_1_v1_5_encode.c,v $ */
-/* $Revision: 1.2 $ */
-/* $Date: 2006/11/01 09:12:06 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/pk/rsa/rsa_decrypt_key.c b/libtomcrypt/src/pk/rsa/rsa_decrypt_key.c
index 3dce20f..31d841f 100644
--- a/libtomcrypt/src/pk/rsa/rsa_decrypt_key.c
+++ b/libtomcrypt/src/pk/rsa/rsa_decrypt_key.c
@@ -6,19 +6,19 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
/**
@file rsa_decrypt_key.c
- RSA PKCS #1 Decryption, Tom St Denis and Andreas Lange
+ RSA LTC_PKCS #1 Decryption, Tom St Denis and Andreas Lange
*/
-#ifdef MRSA
+#ifdef LTC_MRSA
/**
- PKCS #1 decrypt then v1.5 or OAEP depad
+ LTC_PKCS #1 decrypt then v1.5 or OAEP depad
@param in The ciphertext
@param inlen The length of the ciphertext (octets)
@param out [out] The plaintext
@@ -26,7 +26,7 @@
@param lparam The system "lparam" value
@param lparamlen The length of the lparam value (octets)
@param hash_idx The index of the hash desired
- @param padding Type of padding (LTC_PKCS_1_OAEP or LTC_PKCS_1_V1_5)
+ @param padding Type of padding (LTC_LTC_PKCS_1_OAEP or LTC_LTC_PKCS_1_V1_5)
@param stat [out] Result of the decryption, 1==valid, 0==invalid
@param key The corresponding private RSA key
@return CRYPT_OK if succcessul (even if invalid)
@@ -51,12 +51,12 @@ int rsa_decrypt_key_ex(const unsigned char *in, unsigned long inlen,
/* valid padding? */
- if ((padding != LTC_PKCS_1_V1_5) &&
- (padding != LTC_PKCS_1_OAEP)) {
+ if ((padding != LTC_LTC_PKCS_1_V1_5) &&
+ (padding != LTC_LTC_PKCS_1_OAEP)) {
return CRYPT_PK_INVALID_PADDING;
}
- if (padding == LTC_PKCS_1_OAEP) {
+ if (padding == LTC_LTC_PKCS_1_OAEP) {
/* valid hash ? */
if ((err = hash_is_valid(hash_idx)) != CRYPT_OK) {
return err;
@@ -85,21 +85,21 @@ int rsa_decrypt_key_ex(const unsigned char *in, unsigned long inlen,
return err;
}
- if (padding == LTC_PKCS_1_OAEP) {
+ if (padding == LTC_LTC_PKCS_1_OAEP) {
/* now OAEP decode the packet */
err = pkcs_1_oaep_decode(tmp, x, lparam, lparamlen, modulus_bitlen, hash_idx,
out, outlen, stat);
} else {
- /* now PKCS #1 v1.5 depad the packet */
- err = pkcs_1_v1_5_decode(tmp, x, LTC_PKCS_1_EME, modulus_bitlen, out, outlen, stat);
+ /* now LTC_PKCS #1 v1.5 depad the packet */
+ err = pkcs_1_v1_5_decode(tmp, x, LTC_LTC_PKCS_1_EME, modulus_bitlen, out, outlen, stat);
}
XFREE(tmp);
return err;
}
-#endif /* MRSA */
+#endif /* LTC_MRSA */
-/* $Source: /cvs/libtom/libtomcrypt/src/pk/rsa/rsa_decrypt_key.c,v $ */
-/* $Revision: 1.8 $ */
-/* $Date: 2006/11/01 09:18:22 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/pk/rsa/rsa_encrypt_key.c b/libtomcrypt/src/pk/rsa/rsa_encrypt_key.c
index 8d2c228..edb7e65 100644
--- a/libtomcrypt/src/pk/rsa/rsa_encrypt_key.c
+++ b/libtomcrypt/src/pk/rsa/rsa_encrypt_key.c
@@ -6,19 +6,19 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
/**
@file rsa_encrypt_key.c
- RSA PKCS #1 encryption, Tom St Denis and Andreas Lange
+ RSA LTC_PKCS #1 encryption, Tom St Denis and Andreas Lange
*/
-#ifdef MRSA
+#ifdef LTC_MRSA
/**
- (PKCS #1 v2.0) OAEP pad then encrypt
+ (LTC_PKCS #1 v2.0) OAEP pad then encrypt
@param in The plaintext
@param inlen The length of the plaintext (octets)
@param out [out] The ciphertext
@@ -28,7 +28,7 @@
@param prng An active PRNG
@param prng_idx The index of the desired prng
@param hash_idx The index of the desired hash
- @param padding Type of padding (LTC_PKCS_1_OAEP or LTC_PKCS_1_V1_5)
+ @param padding Type of padding (LTC_LTC_PKCS_1_OAEP or LTC_LTC_PKCS_1_V1_5)
@param key The RSA key to encrypt to
@return CRYPT_OK if successful
*/
@@ -46,8 +46,8 @@ int rsa_encrypt_key_ex(const unsigned char *in, unsigned long inlen,
LTC_ARGCHK(key != NULL);
/* valid padding? */
- if ((padding != LTC_PKCS_1_V1_5) &&
- (padding != LTC_PKCS_1_OAEP)) {
+ if ((padding != LTC_LTC_PKCS_1_V1_5) &&
+ (padding != LTC_LTC_PKCS_1_OAEP)) {
return CRYPT_PK_INVALID_PADDING;
}
@@ -56,7 +56,7 @@ int rsa_encrypt_key_ex(const unsigned char *in, unsigned long inlen,
return err;
}
- if (padding == LTC_PKCS_1_OAEP) {
+ if (padding == LTC_LTC_PKCS_1_OAEP) {
/* valid hash? */
if ((err = hash_is_valid(hash_idx)) != CRYPT_OK) {
return err;
@@ -73,7 +73,7 @@ int rsa_encrypt_key_ex(const unsigned char *in, unsigned long inlen,
return CRYPT_BUFFER_OVERFLOW;
}
- if (padding == LTC_PKCS_1_OAEP) {
+ if (padding == LTC_LTC_PKCS_1_OAEP) {
/* OAEP pad the key */
x = *outlen;
if ((err = pkcs_1_oaep_encode(in, inlen, lparam,
@@ -82,21 +82,21 @@ int rsa_encrypt_key_ex(const unsigned char *in, unsigned long inlen,
return err;
}
} else {
- /* PKCS #1 v1.5 pad the key */
+ /* LTC_PKCS #1 v1.5 pad the key */
x = *outlen;
- if ((err = pkcs_1_v1_5_encode(in, inlen, LTC_PKCS_1_EME,
+ if ((err = pkcs_1_v1_5_encode(in, inlen, LTC_LTC_PKCS_1_EME,
modulus_bitlen, prng, prng_idx,
out, &x)) != CRYPT_OK) {
return err;
}
}
- /* rsa exptmod the OAEP or PKCS #1 v1.5 pad */
+ /* rsa exptmod the OAEP or LTC_PKCS #1 v1.5 pad */
return ltc_mp.rsa_me(out, x, out, outlen, PK_PUBLIC, key);
}
-#endif /* MRSA */
+#endif /* LTC_MRSA */
-/* $Source: /cvs/libtom/libtomcrypt/src/pk/rsa/rsa_encrypt_key.c,v $ */
-/* $Revision: 1.8 $ */
-/* $Date: 2006/11/01 09:18:22 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/pk/rsa/rsa_export.c b/libtomcrypt/src/pk/rsa/rsa_export.c
index 5b389ec..40cb066 100644
--- a/libtomcrypt/src/pk/rsa/rsa_export.c
+++ b/libtomcrypt/src/pk/rsa/rsa_export.c
@@ -6,19 +6,19 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
/**
@file rsa_export.c
- Export RSA PKCS keys, Tom St Denis
+ Export RSA LTC_PKCS keys, Tom St Denis
*/
-#ifdef MRSA
+#ifdef LTC_MRSA
/**
- This will export either an RSAPublicKey or RSAPrivateKey [defined in PKCS #1 v2.1]
+ This will export either an RSAPublicKey or RSAPrivateKey [defined in LTC_PKCS #1 v2.1]
@param out [out] Destination of the packet
@param outlen [in/out] The max size and resulting size of the packet
@param type The type of exported key (PK_PRIVATE or PK_PUBLIC)
@@ -62,8 +62,8 @@ int rsa_export(unsigned char *out, unsigned long *outlen, int type, rsa_key *key
}
}
-#endif /* MRSA */
+#endif /* LTC_MRSA */
-/* $Source: /cvs/libtom/libtomcrypt/src/pk/rsa/rsa_export.c,v $ */
-/* $Revision: 1.15 $ */
-/* $Date: 2006/03/31 14:15:35 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/pk/rsa/rsa_exptmod.c b/libtomcrypt/src/pk/rsa/rsa_exptmod.c
index 53dbf6b..101a766 100644
--- a/libtomcrypt/src/pk/rsa/rsa_exptmod.c
+++ b/libtomcrypt/src/pk/rsa/rsa_exptmod.c
@@ -6,16 +6,16 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
/**
@file rsa_exptmod.c
- RSA PKCS exptmod, Tom St Denis
+ RSA LTC_PKCS exptmod, Tom St Denis
*/
-#ifdef MRSA
+#ifdef LTC_MRSA
/**
Compute an RSA modular exponentiation
@@ -108,6 +108,6 @@ error:
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/pk/rsa/rsa_exptmod.c,v $ */
-/* $Revision: 1.16 $ */
-/* $Date: 2006/12/04 03:09:28 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/pk/rsa/rsa_free.c b/libtomcrypt/src/pk/rsa/rsa_free.c
index f48976a..bb6daef 100644
--- a/libtomcrypt/src/pk/rsa/rsa_free.c
+++ b/libtomcrypt/src/pk/rsa/rsa_free.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -15,7 +15,7 @@
Free an RSA key, Tom St Denis
*/
-#ifdef MRSA
+#ifdef LTC_MRSA
/**
Free an RSA key from memory
@@ -29,6 +29,6 @@ void rsa_free(rsa_key *key)
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/pk/rsa/rsa_free.c,v $ */
-/* $Revision: 1.8 $ */
-/* $Date: 2006/12/04 22:23:27 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/pk/rsa/rsa_import.c b/libtomcrypt/src/pk/rsa/rsa_import.c
index 7b12fd9..85c676b 100644
--- a/libtomcrypt/src/pk/rsa/rsa_import.c
+++ b/libtomcrypt/src/pk/rsa/rsa_import.c
@@ -6,19 +6,19 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
/**
@file rsa_import.c
- Import a PKCS RSA key, Tom St Denis
+ Import a LTC_PKCS RSA key, Tom St Denis
*/
-#ifdef MRSA
+#ifdef LTC_MRSA
/**
- Import an RSAPublicKey or RSAPrivateKey [two-prime only, only support >= 1024-bit keys, defined in PKCS #1 v2.1]
+ Import an RSAPublicKey or RSAPrivateKey [two-prime only, only support >= 1024-bit keys, defined in LTC_PKCS #1 v2.1]
@param in The packet to import from
@param inlen It's length (octets)
@param key [out] Destination for newly imported key
@@ -87,7 +87,7 @@ int rsa_import(const unsigned char *in, unsigned long inlen, rsa_key *key)
}
XFREE(tmpbuf);
- /* not SSL public key, try to match against PKCS #1 standards */
+ /* not SSL public key, try to match against LTC_PKCS #1 standards */
if ((err = der_decode_sequence_multi(in, inlen,
LTC_ASN1_INTEGER, 1UL, key->N,
LTC_ASN1_EOL, 0UL, NULL)) != CRYPT_OK) {
@@ -135,9 +135,9 @@ LBL_ERR:
return err;
}
-#endif /* MRSA */
+#endif /* LTC_MRSA */
-/* $Source: /cvs/libtom/libtomcrypt/src/pk/rsa/rsa_import.c,v $ */
-/* $Revision: 1.21 $ */
-/* $Date: 2006/12/04 22:23:27 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/pk/rsa/rsa_make_key.c b/libtomcrypt/src/pk/rsa/rsa_make_key.c
index bd2a29b..d62e37e 100644
--- a/libtomcrypt/src/pk/rsa/rsa_make_key.c
+++ b/libtomcrypt/src/pk/rsa/rsa_make_key.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -15,7 +15,7 @@
RSA key generation, Tom St Denis
*/
-#ifdef MRSA
+#ifdef LTC_MRSA
/**
Create an RSA key
@@ -107,6 +107,6 @@ cleanup:
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/pk/rsa/rsa_make_key.c,v $ */
-/* $Revision: 1.14 $ */
-/* $Date: 2006/12/04 22:23:27 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/pk/rsa/rsa_sign_hash.c b/libtomcrypt/src/pk/rsa/rsa_sign_hash.c
index f10a97a..3b64095 100644
--- a/libtomcrypt/src/pk/rsa/rsa_sign_hash.c
+++ b/libtomcrypt/src/pk/rsa/rsa_sign_hash.c
@@ -6,24 +6,24 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
/**
@file rsa_sign_hash.c
- RSA PKCS #1 v1.5 and v2 PSS sign hash, Tom St Denis and Andreas Lange
+ RSA LTC_PKCS #1 v1.5 and v2 PSS sign hash, Tom St Denis and Andreas Lange
*/
-#ifdef MRSA
+#ifdef LTC_MRSA
/**
- PKCS #1 pad then sign
+ LTC_PKCS #1 pad then sign
@param in The hash to sign
@param inlen The length of the hash to sign (octets)
@param out [out] The signature
@param outlen [in/out] The max size and resulting size of the signature
- @param padding Type of padding (LTC_PKCS_1_PSS or LTC_PKCS_1_V1_5)
+ @param padding Type of padding (LTC_LTC_PKCS_1_PSS or LTC_LTC_PKCS_1_V1_5)
@param prng An active PRNG state
@param prng_idx The index of the PRNG desired
@param hash_idx The index of the hash desired
@@ -47,11 +47,11 @@ int rsa_sign_hash_ex(const unsigned char *in, unsigned long inlen,
LTC_ARGCHK(key != NULL);
/* valid padding? */
- if ((padding != LTC_PKCS_1_V1_5) && (padding != LTC_PKCS_1_PSS)) {
+ if ((padding != LTC_LTC_PKCS_1_V1_5) && (padding != LTC_LTC_PKCS_1_PSS)) {
return CRYPT_PK_INVALID_PADDING;
}
- if (padding == LTC_PKCS_1_PSS) {
+ if (padding == LTC_LTC_PKCS_1_PSS) {
/* valid prng and hash ? */
if ((err = prng_is_valid(prng_idx)) != CRYPT_OK) {
return err;
@@ -71,7 +71,7 @@ int rsa_sign_hash_ex(const unsigned char *in, unsigned long inlen,
return CRYPT_BUFFER_OVERFLOW;
}
- if (padding == LTC_PKCS_1_PSS) {
+ if (padding == LTC_LTC_PKCS_1_PSS) {
/* PSS pad the key */
x = *outlen;
if ((err = pkcs_1_pss_encode(in, inlen, saltlen, prng, prng_idx,
@@ -79,7 +79,7 @@ int rsa_sign_hash_ex(const unsigned char *in, unsigned long inlen,
return err;
}
} else {
- /* PKCS #1 v1.5 pad the hash */
+ /* LTC_PKCS #1 v1.5 pad the hash */
unsigned char *tmpin;
ltc_asn1_list digestinfo[2], siginfo[2];
@@ -114,7 +114,7 @@ int rsa_sign_hash_ex(const unsigned char *in, unsigned long inlen,
}
x = *outlen;
- if ((err = pkcs_1_v1_5_encode(tmpin, y, LTC_PKCS_1_EMSA,
+ if ((err = pkcs_1_v1_5_encode(tmpin, y, LTC_LTC_PKCS_1_EMSA,
modulus_bitlen, NULL, 0,
out, &x)) != CRYPT_OK) {
XFREE(tmpin);
@@ -127,8 +127,8 @@ int rsa_sign_hash_ex(const unsigned char *in, unsigned long inlen,
return ltc_mp.rsa_me(out, x, out, outlen, PK_PRIVATE, key);
}
-#endif /* MRSA */
+#endif /* LTC_MRSA */
-/* $Source: /cvs/libtom/libtomcrypt/src/pk/rsa/rsa_sign_hash.c,v $ */
-/* $Revision: 1.9 $ */
-/* $Date: 2006/11/09 23:15:39 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/pk/rsa/rsa_verify_hash.c b/libtomcrypt/src/pk/rsa/rsa_verify_hash.c
index 4b61029..fe83690 100644
--- a/libtomcrypt/src/pk/rsa/rsa_verify_hash.c
+++ b/libtomcrypt/src/pk/rsa/rsa_verify_hash.c
@@ -6,24 +6,24 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
/**
@file rsa_verify_hash.c
- RSA PKCS #1 v1.5 or v2 PSS signature verification, Tom St Denis and Andreas Lange
+ RSA LTC_PKCS #1 v1.5 or v2 PSS signature verification, Tom St Denis and Andreas Lange
*/
-#ifdef MRSA
+#ifdef LTC_MRSA
/**
- PKCS #1 de-sign then v1.5 or PSS depad
+ LTC_PKCS #1 de-sign then v1.5 or PSS depad
@param sig The signature data
@param siglen The length of the signature data (octets)
@param hash The hash of the message that was signed
@param hashlen The length of the hash of the message that was signed (octets)
- @param padding Type of padding (LTC_PKCS_1_PSS or LTC_PKCS_1_V1_5)
+ @param padding Type of padding (LTC_LTC_PKCS_1_PSS or LTC_LTC_PKCS_1_V1_5)
@param hash_idx The index of the desired hash
@param saltlen The length of the salt used during signature
@param stat [out] The result of the signature comparison, 1==valid, 0==invalid
@@ -50,12 +50,12 @@ int rsa_verify_hash_ex(const unsigned char *sig, unsigned long siglen,
/* valid padding? */
- if ((padding != LTC_PKCS_1_V1_5) &&
- (padding != LTC_PKCS_1_PSS)) {
+ if ((padding != LTC_LTC_PKCS_1_V1_5) &&
+ (padding != LTC_LTC_PKCS_1_PSS)) {
return CRYPT_PK_INVALID_PADDING;
}
- if (padding == LTC_PKCS_1_PSS) {
+ if (padding == LTC_LTC_PKCS_1_PSS) {
/* valid hash ? */
if ((err = hash_is_valid(hash_idx)) != CRYPT_OK) {
return err;
@@ -90,11 +90,11 @@ int rsa_verify_hash_ex(const unsigned char *sig, unsigned long siglen,
return CRYPT_INVALID_PACKET;
}
- if (padding == LTC_PKCS_1_PSS) {
+ if (padding == LTC_LTC_PKCS_1_PSS) {
/* PSS decode and verify it */
err = pkcs_1_pss_decode(hash, hashlen, tmpbuf, x, saltlen, hash_idx, modulus_bitlen, stat);
} else {
- /* PKCS #1 v1.5 decode it */
+ /* LTC_PKCS #1 v1.5 decode it */
unsigned char *out;
unsigned long outlen, loid[16];
int decoded;
@@ -114,7 +114,7 @@ int rsa_verify_hash_ex(const unsigned char *sig, unsigned long siglen,
goto bail_2;
}
- if ((err = pkcs_1_v1_5_decode(tmpbuf, x, LTC_PKCS_1_EMSA, modulus_bitlen, out, &outlen, &decoded)) != CRYPT_OK) {
+ if ((err = pkcs_1_v1_5_decode(tmpbuf, x, LTC_LTC_PKCS_1_EMSA, modulus_bitlen, out, &outlen, &decoded)) != CRYPT_OK) {
XFREE(out);
goto bail_2;
}
@@ -160,8 +160,8 @@ bail_2:
return err;
}
-#endif /* MRSA */
+#endif /* LTC_MRSA */
-/* $Source: /cvs/libtom/libtomcrypt/src/pk/rsa/rsa_verify_hash.c,v $ */
-/* $Revision: 1.11 $ */
-/* $Date: 2006/12/04 03:09:28 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/prngs/fortuna.c b/libtomcrypt/src/prngs/fortuna.c
index 159db52..d262a0b 100644
--- a/libtomcrypt/src/prngs/fortuna.c
+++ b/libtomcrypt/src/prngs/fortuna.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -19,22 +19,22 @@
We deviate slightly here for reasons of simplicity [and to fit in the API]. First all "sources"
in the AddEntropy function are fixed to 0. Second since no reliable timer is provided
-we reseed automatically when len(pool0) >= 64 or every FORTUNA_WD calls to the read function */
+we reseed automatically when len(pool0) >= 64 or every LTC_FORTUNA_WD calls to the read function */
-#ifdef FORTUNA
+#ifdef LTC_FORTUNA
-/* requries SHA256 and AES */
-#if !(defined(RIJNDAEL) && defined(SHA256))
- #error FORTUNA requires SHA256 and RIJNDAEL (AES)
+/* requries LTC_SHA256 and AES */
+#if !(defined(LTC_RIJNDAEL) && defined(LTC_SHA256))
+ #error LTC_FORTUNA requires LTC_SHA256 and LTC_RIJNDAEL (AES)
#endif
-#ifndef FORTUNA_POOLS
- #warning FORTUNA_POOLS was not previously defined (old headers?)
- #define FORTUNA_POOLS 32
+#ifndef LTC_FORTUNA_POOLS
+ #warning LTC_FORTUNA_POOLS was not previously defined (old headers?)
+ #define LTC_FORTUNA_POOLS 32
#endif
-#if FORTUNA_POOLS < 4 || FORTUNA_POOLS > 32
- #error FORTUNA_POOLS must be in [4..32]
+#if LTC_FORTUNA_POOLS < 4 || LTC_FORTUNA_POOLS > 32
+ #error LTC_FORTUNA_POOLS must be in [4..32]
#endif
const struct ltc_prng_descriptor fortuna_desc = {
@@ -71,14 +71,14 @@ static int fortuna_reseed(prng_state *prng)
++prng->fortuna.reset_cnt;
- /* new K == SHA256(K || s) where s == SHA256(P0) || SHA256(P1) ... */
+ /* new K == LTC_SHA256(K || s) where s == LTC_SHA256(P0) || LTC_SHA256(P1) ... */
sha256_init(&md);
if ((err = sha256_process(&md, prng->fortuna.K, 32)) != CRYPT_OK) {
sha256_done(&md, tmp);
return err;
}
- for (x = 0; x < FORTUNA_POOLS; x++) {
+ for (x = 0; x < LTC_FORTUNA_POOLS; x++) {
if (x == 0 || ((prng->fortuna.reset_cnt >> (x-1)) & 1) == 0) {
/* terminate this hash */
if ((err = sha256_done(&prng->fortuna.pool[x], tmp)) != CRYPT_OK) {
@@ -135,7 +135,7 @@ int fortuna_start(prng_state *prng)
LTC_ARGCHK(prng != NULL);
/* initialize the pools */
- for (x = 0; x < FORTUNA_POOLS; x++) {
+ for (x = 0; x < LTC_FORTUNA_POOLS; x++) {
if ((err = sha256_init(&prng->fortuna.pool[x])) != CRYPT_OK) {
for (y = 0; y < x; y++) {
sha256_done(&prng->fortuna.pool[y], tmp);
@@ -149,7 +149,7 @@ int fortuna_start(prng_state *prng)
/* reset bufs */
zeromem(prng->fortuna.K, 32);
if ((err = rijndael_setup(prng->fortuna.K, 32, 0, &prng->fortuna.skey)) != CRYPT_OK) {
- for (x = 0; x < FORTUNA_POOLS; x++) {
+ for (x = 0; x < LTC_FORTUNA_POOLS; x++) {
sha256_done(&prng->fortuna.pool[x], tmp);
}
return err;
@@ -198,7 +198,7 @@ int fortuna_add_entropy(const unsigned char *in, unsigned long inlen, prng_state
if (prng->fortuna.pool_idx == 0) {
prng->fortuna.pool0_len += inlen;
}
- if (++(prng->fortuna.pool_idx) == FORTUNA_POOLS) {
+ if (++(prng->fortuna.pool_idx) == LTC_FORTUNA_POOLS) {
prng->fortuna.pool_idx = 0;
}
@@ -235,7 +235,7 @@ unsigned long fortuna_read(unsigned char *out, unsigned long outlen, prng_state
LTC_MUTEX_LOCK(&prng->fortuna.prng_lock);
/* do we have to reseed? */
- if (++prng->fortuna.wd == FORTUNA_WD || prng->fortuna.pool0_len >= 64) {
+ if (++prng->fortuna.wd == LTC_FORTUNA_WD || prng->fortuna.pool0_len >= 64) {
if ((err = fortuna_reseed(prng)) != CRYPT_OK) {
LTC_MUTEX_UNLOCK(&prng->fortuna.prng_lock);
return 0;
@@ -290,7 +290,7 @@ int fortuna_done(prng_state *prng)
LTC_MUTEX_LOCK(&prng->fortuna.prng_lock);
/* terminate all the hashes */
- for (x = 0; x < FORTUNA_POOLS; x++) {
+ for (x = 0; x < LTC_FORTUNA_POOLS; x++) {
if ((err = sha256_done(&(prng->fortuna.pool[x]), tmp)) != CRYPT_OK) {
LTC_MUTEX_UNLOCK(&prng->fortuna.prng_lock);
return err;
@@ -325,9 +325,9 @@ int fortuna_export(unsigned char *out, unsigned long *outlen, prng_state *prng)
LTC_MUTEX_LOCK(&prng->fortuna.prng_lock);
/* we'll write bytes for s&g's */
- if (*outlen < 32*FORTUNA_POOLS) {
+ if (*outlen < 32*LTC_FORTUNA_POOLS) {
LTC_MUTEX_UNLOCK(&prng->fortuna.prng_lock);
- *outlen = 32*FORTUNA_POOLS;
+ *outlen = 32*LTC_FORTUNA_POOLS;
return CRYPT_BUFFER_OVERFLOW;
}
@@ -340,7 +340,7 @@ int fortuna_export(unsigned char *out, unsigned long *outlen, prng_state *prng)
/* to emit the state we copy each pool, terminate it then hash it again so
* an attacker who sees the state can't determine the current state of the PRNG
*/
- for (x = 0; x < FORTUNA_POOLS; x++) {
+ for (x = 0; x < LTC_FORTUNA_POOLS; x++) {
/* copy the PRNG */
XMEMCPY(md, &(prng->fortuna.pool[x]), sizeof(*md));
@@ -360,7 +360,7 @@ int fortuna_export(unsigned char *out, unsigned long *outlen, prng_state *prng)
goto LBL_ERR;
}
}
- *outlen = 32*FORTUNA_POOLS;
+ *outlen = 32*LTC_FORTUNA_POOLS;
err = CRYPT_OK;
LBL_ERR:
@@ -386,14 +386,14 @@ int fortuna_import(const unsigned char *in, unsigned long inlen, prng_state *prn
LTC_ARGCHK(in != NULL);
LTC_ARGCHK(prng != NULL);
- if (inlen != 32*FORTUNA_POOLS) {
+ if (inlen != 32*LTC_FORTUNA_POOLS) {
return CRYPT_INVALID_ARG;
}
if ((err = fortuna_start(prng)) != CRYPT_OK) {
return err;
}
- for (x = 0; x < FORTUNA_POOLS; x++) {
+ for (x = 0; x < LTC_FORTUNA_POOLS; x++) {
if ((err = fortuna_add_entropy(in+x*32, 32, prng)) != CRYPT_OK) {
return err;
}
@@ -422,6 +422,6 @@ int fortuna_test(void)
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/prngs/fortuna.c,v $ */
-/* $Revision: 1.12 $ */
-/* $Date: 2006/12/04 21:34:03 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/prngs/rc4.c b/libtomcrypt/src/prngs/rc4.c
index cf118ad..15c74e3 100644
--- a/libtomcrypt/src/prngs/rc4.c
+++ b/libtomcrypt/src/prngs/rc4.c
@@ -6,16 +6,16 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
/**
@file rc4.c
- RC4 PRNG, Tom St Denis
+ LTC_RC4 PRNG, Tom St Denis
*/
-#ifdef RC4
+#ifdef LTC_RC4
const struct ltc_prng_descriptor rc4_desc =
{
@@ -93,7 +93,7 @@ int rc4_ready(prng_state *prng)
XMEMCPY(key, s, 256);
keylen = prng->rc4.x;
- /* make RC4 perm and shuffle */
+ /* make LTC_RC4 perm and shuffle */
for (x = 0; x < 256; x++) {
s[x] = x;
}
@@ -250,7 +250,7 @@ int rc4_test(void)
if (XMEMCMP(dst, tests[x].ct, 8)) {
#if 0
int y;
- printf("\n\nRC4 failed, I got:\n");
+ printf("\n\nLTC_RC4 failed, I got:\n");
for (y = 0; y < 8; y++) printf("%02x ", dst[y]);
printf("\n");
#endif
@@ -264,6 +264,6 @@ int rc4_test(void)
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/prngs/rc4.c,v $ */
-/* $Revision: 1.9 $ */
-/* $Date: 2006/11/16 00:32:18 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/prngs/rng_get_bytes.c b/libtomcrypt/src/prngs/rng_get_bytes.c
index 7d332b5..b8cc6f5 100644
--- a/libtomcrypt/src/prngs/rng_get_bytes.c
+++ b/libtomcrypt/src/prngs/rng_get_bytes.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -15,7 +15,7 @@
portable way to get secure random bits to feed a PRNG (Tom St Denis)
*/
-#ifdef DEVRANDOM
+#ifdef LTC_DEVRANDOM
/* on *NIX read /dev/random */
static unsigned long rng_nix(unsigned char *buf, unsigned long len,
void (*callback)(void))
@@ -47,7 +47,7 @@ static unsigned long rng_nix(unsigned char *buf, unsigned long len,
#endif /* LTC_NO_FILE */
}
-#endif /* DEVRANDOM */
+#endif /* LTC_DEVRANDOM */
/* on ANSI C platforms with 100 < CLOCKS_PER_SEC < 10000 */
#if defined(CLOCKS_PER_SEC) && !defined(WINCE)
@@ -131,7 +131,7 @@ unsigned long rng_get_bytes(unsigned char *out, unsigned long outlen,
LTC_ARGCHK(out != NULL);
-#if defined(DEVRANDOM)
+#if defined(LTC_DEVRANDOM)
x = rng_nix(out, outlen, callback); if (x != 0) { return x; }
#endif
#ifdef WIN32
@@ -143,6 +143,6 @@ unsigned long rng_get_bytes(unsigned char *out, unsigned long outlen,
return 0;
}
-/* $Source: /cvs/libtom/libtomcrypt/src/prngs/rng_get_bytes.c,v $ */
-/* $Revision: 1.5 $ */
-/* $Date: 2006/12/06 02:01:29 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/prngs/rng_make_prng.c b/libtomcrypt/src/prngs/rng_make_prng.c
index 35631ab..6ba2cbe 100644
--- a/libtomcrypt/src/prngs/rng_make_prng.c
+++ b/libtomcrypt/src/prngs/rng_make_prng.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -64,6 +64,6 @@ int rng_make_prng(int bits, int wprng, prng_state *prng,
}
-/* $Source: /cvs/libtom/libtomcrypt/src/prngs/rng_make_prng.c,v $ */
-/* $Revision: 1.4 $ */
-/* $Date: 2006/03/31 14:15:35 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/prngs/sober128.c b/libtomcrypt/src/prngs/sober128.c
index 0361387..9bc7727 100644
--- a/libtomcrypt/src/prngs/sober128.c
+++ b/libtomcrypt/src/prngs/sober128.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -16,7 +16,7 @@
Based on s128fast.c reference code supplied by Greg Rose of QUALCOMM.
*/
-#ifdef SOBER128
+#ifdef LTC_SOBER128
#include "sober128tab.c"
@@ -481,7 +481,7 @@ int sober128_test(void)
sober128_done(&prng);
if (XMEMCMP(dst, tests[x].out, tests[x].len)) {
#if 0
- printf("\n\nSOBER128 failed, I got:\n");
+ printf("\n\nLTC_SOBER128 failed, I got:\n");
for (y = 0; y < tests[x].len; y++) printf("%02x ", dst[y]);
printf("\n");
#endif
@@ -495,6 +495,6 @@ int sober128_test(void)
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/prngs/sober128.c,v $ */
-/* $Revision: 1.8 $ */
-/* $Date: 2006/11/05 00:11:36 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/prngs/sober128tab.c b/libtomcrypt/src/prngs/sober128tab.c
index b50c77b..a5754c7 100644
--- a/libtomcrypt/src/prngs/sober128tab.c
+++ b/libtomcrypt/src/prngs/sober128tab.c
@@ -2,7 +2,7 @@
@file sober128tab.c
SOBER-128 Tables
*/
-/* $Id: sober128tab.c,v 1.2 2005/05/05 14:35:59 tom Exp $ */
+/* $ID$ */
/* @(#)TuringMultab.h 1.3 (QUALCOMM) 02/09/03 */
/* Multiplication table for Turing using 0xD02B4367 */
static const ulong32 Multab[256] = {
@@ -72,7 +72,7 @@ static const ulong32 Multab[256] = {
0xEF72A3F1, 0x3F59E096, 0x0224253F, 0xD20F6658,
};
-/* $Id: sober128tab.c,v 1.2 2005/05/05 14:35:59 tom Exp $ */
+/* $ID$ */
/* Sbox for SOBER-128 */
/*
* This is really the combination of two SBoxes; the least significant
@@ -157,6 +157,6 @@ static const ulong32 Sbox[256] = {
0xf9e6053f, 0xa4b0d300, 0xd499cbcc, 0xb95e3d40,
};
-/* $Source: /cvs/libtom/libtomcrypt/src/prngs/sober128tab.c,v $ */
-/* $Revision: 1.2 $ */
-/* $Date: 2005/05/05 14:35:59 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/prngs/sprng.c b/libtomcrypt/src/prngs/sprng.c
index 190e33d..d86b081 100644
--- a/libtomcrypt/src/prngs/sprng.c
+++ b/libtomcrypt/src/prngs/sprng.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -20,7 +20,7 @@
* in the various other functions.
*/
-#ifdef SPRNG
+#ifdef LTC_SPRNG
const struct ltc_prng_descriptor sprng_desc =
{
@@ -131,6 +131,6 @@ int sprng_test(void)
-/* $Source: /cvs/libtom/libtomcrypt/src/prngs/sprng.c,v $ */
-/* $Revision: 1.4 $ */
-/* $Date: 2006/03/31 14:15:35 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/src/prngs/yarrow.c b/libtomcrypt/src/prngs/yarrow.c
index 9fbd4f6..c94671f 100644
--- a/libtomcrypt/src/prngs/yarrow.c
+++ b/libtomcrypt/src/prngs/yarrow.c
@@ -6,7 +6,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include "tomcrypt.h"
@@ -15,7 +15,7 @@
Yarrow PRNG, Tom St Denis
*/
-#ifdef YARROW
+#ifdef LTC_YARROW
const struct ltc_prng_descriptor yarrow_desc =
{
@@ -42,77 +42,77 @@ int yarrow_start(prng_state *prng)
LTC_ARGCHK(prng != NULL);
/* these are the default hash/cipher combo used */
-#ifdef RIJNDAEL
-#if YARROW_AES==0
+#ifdef LTC_RIJNDAEL
+#if LTC_YARROW_AES==0
prng->yarrow.cipher = register_cipher(&rijndael_enc_desc);
-#elif YARROW_AES==1
+#elif LTC_YARROW_AES==1
prng->yarrow.cipher = register_cipher(&aes_enc_desc);
-#elif YARROW_AES==2
+#elif LTC_YARROW_AES==2
prng->yarrow.cipher = register_cipher(&rijndael_desc);
-#elif YARROW_AES==3
+#elif LTC_YARROW_AES==3
prng->yarrow.cipher = register_cipher(&aes_desc);
#endif
-#elif defined(BLOWFISH)
+#elif defined(LTC_BLOWFISH)
prng->yarrow.cipher = register_cipher(&blowfish_desc);
-#elif defined(TWOFISH)
+#elif defined(LTC_TWOFISH)
prng->yarrow.cipher = register_cipher(&twofish_desc);
-#elif defined(RC6)
+#elif defined(LTC_RC6)
prng->yarrow.cipher = register_cipher(&rc6_desc);
-#elif defined(RC5)
+#elif defined(LTC_RC5)
prng->yarrow.cipher = register_cipher(&rc5_desc);
-#elif defined(SAFERP)
+#elif defined(LTC_SAFERP)
prng->yarrow.cipher = register_cipher(&saferp_desc);
-#elif defined(RC2)
+#elif defined(LTC_RC2)
prng->yarrow.cipher = register_cipher(&rc2_desc);
-#elif defined(NOEKEON)
+#elif defined(LTC_NOEKEON)
prng->yarrow.cipher = register_cipher(&noekeon_desc);
-#elif defined(ANUBIS)
+#elif defined(LTC_ANUBIS)
prng->yarrow.cipher = register_cipher(&anubis_desc);
-#elif defined(KSEED)
+#elif defined(LTC_KSEED)
prng->yarrow.cipher = register_cipher(&kseed_desc);
-#elif defined(KHAZAD)
+#elif defined(LTC_KHAZAD)
prng->yarrow.cipher = register_cipher(&khazad_desc);
-#elif defined(CAST5)
+#elif defined(LTC_CAST5)
prng->yarrow.cipher = register_cipher(&cast5_desc);
-#elif defined(XTEA)
+#elif defined(LTC_XTEA)
prng->yarrow.cipher = register_cipher(&xtea_desc);
-#elif defined(SAFER)
+#elif defined(LTC_SAFER)
prng->yarrow.cipher = register_cipher(&safer_sk128_desc);
-#elif defined(DES)
+#elif defined(LTC_DES)
prng->yarrow.cipher = register_cipher(&des3_desc);
#else
- #error YARROW needs at least one CIPHER
+ #error LTC_YARROW needs at least one CIPHER
#endif
if ((err = cipher_is_valid(prng->yarrow.cipher)) != CRYPT_OK) {
return err;
}
-#ifdef SHA256
+#ifdef LTC_SHA256
prng->yarrow.hash = register_hash(&sha256_desc);
-#elif defined(SHA512)
+#elif defined(LTC_SHA512)
prng->yarrow.hash = register_hash(&sha512_desc);
-#elif defined(TIGER)
+#elif defined(LTC_TIGER)
prng->yarrow.hash = register_hash(&tiger_desc);
-#elif defined(SHA1)
+#elif defined(LTC_SHA1)
prng->yarrow.hash = register_hash(&sha1_desc);
-#elif defined(RIPEMD320)
+#elif defined(LTC_RIPEMD320)
prng->yarrow.hash = register_hash(&rmd320_desc);
-#elif defined(RIPEMD256)
+#elif defined(LTC_RIPEMD256)
prng->yarrow.hash = register_hash(&rmd256_desc);
-#elif defined(RIPEMD160)
+#elif defined(LTC_RIPEMD160)
prng->yarrow.hash = register_hash(&rmd160_desc);
-#elif defined(RIPEMD128)
+#elif defined(LTC_RIPEMD128)
prng->yarrow.hash = register_hash(&rmd128_desc);
-#elif defined(MD5)
+#elif defined(LTC_MD5)
prng->yarrow.hash = register_hash(&md5_desc);
-#elif defined(MD4)
+#elif defined(LTC_MD4)
prng->yarrow.hash = register_hash(&md4_desc);
-#elif defined(MD2)
+#elif defined(LTC_MD2)
prng->yarrow.hash = register_hash(&md2_desc);
-#elif defined(WHIRLPOOL)
+#elif defined(LTC_WHIRLPOOL)
prng->yarrow.hash = register_hash(&whirlpool_desc);
#else
- #error YARROW needs at least one HASH
+ #error LTC_YARROW needs at least one HASH
#endif
if ((err = hash_is_valid(prng->yarrow.hash)) != CRYPT_OK) {
return err;
@@ -357,6 +357,6 @@ int yarrow_test(void)
#endif
-/* $Source: /cvs/libtom/libtomcrypt/src/prngs/yarrow.c,v $ */
-/* $Revision: 1.10 $ */
-/* $Date: 2006/11/14 04:21:17 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/testprof/base64_test.c b/libtomcrypt/testprof/base64_test.c
index af20a67..5ce55dd 100644
--- a/libtomcrypt/testprof/base64_test.c
+++ b/libtomcrypt/testprof/base64_test.c
@@ -19,6 +19,6 @@ int base64_test(void)
return 0;
}
-/* $Source: /cvs/libtom/libtomcrypt/testprof/base64_test.c,v $ */
-/* $Revision: 1.5 $ */
-/* $Date: 2005/05/21 12:51:25 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/testprof/cipher_hash_test.c b/libtomcrypt/testprof/cipher_hash_test.c
index 27232e2..666d913 100644
--- a/libtomcrypt/testprof/cipher_hash_test.c
+++ b/libtomcrypt/testprof/cipher_hash_test.c
@@ -40,6 +40,6 @@ int cipher_hash_test(void)
return 0;
}
-/* $Source: /cvs/libtom/libtomcrypt/testprof/cipher_hash_test.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2005/05/05 14:35:59 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/testprof/der_tests.c b/libtomcrypt/testprof/der_tests.c
index 2881886..2778d50 100644
--- a/libtomcrypt/testprof/der_tests.c
+++ b/libtomcrypt/testprof/der_tests.c
@@ -1,5 +1,5 @@
#include <tomcrypt_test.h>
-#if defined(GMP_DESC) || defined(USE_GMP)
+#if defined(GMP_LTC_DESC) || defined(USE_GMP)
#include <gmp.h>
#endif
@@ -848,6 +848,6 @@ tmp_time.off_hh);
#endif
-/* $Source: /cvs/libtom/libtomcrypt/testprof/der_tests.c,v $ */
-/* $Revision: 1.49 $ */
-/* $Date: 2006/11/26 02:10:21 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/testprof/dsa_test.c b/libtomcrypt/testprof/dsa_test.c
index f623092..2398ba2 100644
--- a/libtomcrypt/testprof/dsa_test.c
+++ b/libtomcrypt/testprof/dsa_test.c
@@ -1,6 +1,6 @@
#include <tomcrypt_test.h>
-#ifdef MDSA
+#ifdef LTC_MDSA
int dsa_test(void)
{
@@ -77,6 +77,6 @@ int dsa_test(void)
#endif
-/* $Source: /cvs/libtom/libtomcrypt/testprof/dsa_test.c,v $ */
-/* $Revision: 1.9 $ */
-/* $Date: 2005/10/30 18:49:14 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/testprof/ecc_test.c b/libtomcrypt/testprof/ecc_test.c
index ccfabe2..d623af3 100644
--- a/libtomcrypt/testprof/ecc_test.c
+++ b/libtomcrypt/testprof/ecc_test.c
@@ -1,6 +1,6 @@
#include <tomcrypt_test.h>
-#ifdef MECC
+#ifdef LTC_MECC
static int sizes[] = {
#ifdef ECC112
@@ -247,6 +247,6 @@ int ecc_tests(void)
#endif
-/* $Source: /cvs/libtom/libtomcrypt/testprof/ecc_test.c,v $ */
-/* $Revision: 1.21 $ */
-/* $Date: 2006/12/04 03:21:03 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/testprof/katja_test.c b/libtomcrypt/testprof/katja_test.c
index 47d01fe..86fe6b0 100644
--- a/libtomcrypt/testprof/katja_test.c
+++ b/libtomcrypt/testprof/katja_test.c
@@ -13,7 +13,7 @@ int katja_test(void)
hash_idx = find_hash("sha1");
prng_idx = find_prng("yarrow");
if (hash_idx == -1 || prng_idx == -1) {
- fprintf(stderr, "katja_test requires SHA1 and yarrow");
+ fprintf(stderr, "katja_test requires LTC_SHA1 and yarrow");
return 1;
}
diff --git a/libtomcrypt/testprof/mac_test.c b/libtomcrypt/testprof/mac_test.c
index 410e4b5..c09bb1d 100644
--- a/libtomcrypt/testprof/mac_test.c
+++ b/libtomcrypt/testprof/mac_test.c
@@ -18,24 +18,24 @@ int mac_test(void)
#ifdef LTC_F9_MODE
DO(f9_test());
#endif
-#ifdef EAX_MODE
+#ifdef LTC_EAX_MODE
DO(eax_test());
#endif
-#ifdef OCB_MODE
+#ifdef LTC_OCB_MODE
DO(ocb_test());
#endif
-#ifdef CCM_MODE
+#ifdef LTC_CCM_MODE
DO(ccm_test());
#endif
-#ifdef GCM_MODE
+#ifdef LTC_GCM_MODE
DO(gcm_test());
#endif
-#ifdef PELICAN
+#ifdef LTC_PELICAN
DO(pelican_test());
#endif
return 0;
}
-/* $Source: /cvs/libtom/libtomcrypt/testprof/mac_test.c,v $ */
-/* $Revision: 1.5 $ */
-/* $Date: 2006/11/08 21:57:04 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/testprof/modes_test.c b/libtomcrypt/testprof/modes_test.c
index 8999c0d..c1cd1c4 100644
--- a/libtomcrypt/testprof/modes_test.c
+++ b/libtomcrypt/testprof/modes_test.c
@@ -106,10 +106,14 @@ int modes_test(void)
#ifdef LTC_CTR_MODE
DO(ctr_test());
#endif
+
+#ifdef LTC_XTS_MODE
+ DO(xts_test());
+#endif
return 0;
}
-/* $Source: /cvs/libtom/libtomcrypt/testprof/modes_test.c,v $ */
-/* $Revision: 1.14 $ */
-/* $Date: 2006/11/13 11:55:25 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/testprof/pkcs_1_test.c b/libtomcrypt/testprof/pkcs_1_test.c
index da725fc..6f59ce9 100644
--- a/libtomcrypt/testprof/pkcs_1_test.c
+++ b/libtomcrypt/testprof/pkcs_1_test.c
@@ -1,6 +1,6 @@
#include <tomcrypt_test.h>
-#ifdef PKCS_1
+#ifdef LTC_PKCS_1
int pkcs_1_test(void)
{
@@ -33,7 +33,7 @@ int pkcs_1_test(void)
/* pick a random saltlen 0..16 */
saltlen = abs(rand()) % 17;
- /* PKCS #1 v2.0 supports modlens not multiple of 8 */
+ /* LTC_PKCS #1 v2.0 supports modlens not multiple of 8 */
modlen = 800 + (abs(rand()) % 224);
/* encode it */
@@ -88,6 +88,6 @@ int pkcs_1_test(void)
#endif
-/* $Source: /cvs/libtom/libtomcrypt/testprof/pkcs_1_test.c,v $ */
-/* $Revision: 1.7 $ */
-/* $Date: 2006/11/30 03:30:45 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/testprof/rsa_test.c b/libtomcrypt/testprof/rsa_test.c
index 4868d6b..2d5c063 100644
--- a/libtomcrypt/testprof/rsa_test.c
+++ b/libtomcrypt/testprof/rsa_test.c
@@ -1,6 +1,6 @@
#include <tomcrypt_test.h>
-#ifdef MRSA
+#ifdef LTC_MRSA
#define RSA_MSGSIZE 78
@@ -137,7 +137,7 @@ int rsa_test(void)
hash_idx = find_hash("sha1");
prng_idx = find_prng("yarrow");
if (hash_idx == -1 || prng_idx == -1) {
- fprintf(stderr, "rsa_test requires SHA1 and yarrow");
+ fprintf(stderr, "rsa_test requires LTC_SHA1 and yarrow");
return 1;
}
@@ -257,14 +257,14 @@ for (cnt = 0; cnt < len; ) {
}
}
- /* encrypt the key PKCS #1 v1.5 (payload from 1 to 117 bytes) */
+ /* encrypt the key LTC_PKCS #1 v1.5 (payload from 1 to 117 bytes) */
for (rsa_msgsize = 1; rsa_msgsize <= 117; rsa_msgsize++) {
len = sizeof(out);
len2 = rsa_msgsize;
- DO(rsa_encrypt_key_ex(in, rsa_msgsize, out, &len, NULL, 0, &yarrow_prng, prng_idx, 0, LTC_PKCS_1_V1_5, &key));
+ DO(rsa_encrypt_key_ex(in, rsa_msgsize, out, &len, NULL, 0, &yarrow_prng, prng_idx, 0, LTC_LTC_PKCS_1_V1_5, &key));
len2 = rsa_msgsize;
- DO(rsa_decrypt_key_ex(out, len, tmp, &len2, NULL, 0, 0, LTC_PKCS_1_V1_5, &stat, &key));
+ DO(rsa_decrypt_key_ex(out, len, tmp, &len2, NULL, 0, 0, LTC_LTC_PKCS_1_V1_5, &stat, &key));
if (!(stat == 1 && stat2 == 0)) {
fprintf(stderr, "rsa_decrypt_key_ex failed, %d, %d", stat, stat2);
return 1;
@@ -349,13 +349,13 @@ for (cnt = 0; cnt < len; ) {
return 1;
}
- /* sign a message with PKCS #1 v1.5 */
+ /* sign a message with LTC_PKCS #1 v1.5 */
len = sizeof(out);
- DO(rsa_sign_hash_ex(in, 20, out, &len, LTC_PKCS_1_V1_5, &yarrow_prng, prng_idx, hash_idx, 8, &privKey));
- DO(rsa_verify_hash_ex(out, len, in, 20, LTC_PKCS_1_V1_5, hash_idx, 8, &stat, &pubKey));
+ DO(rsa_sign_hash_ex(in, 20, out, &len, LTC_LTC_PKCS_1_V1_5, &yarrow_prng, prng_idx, hash_idx, 8, &privKey));
+ DO(rsa_verify_hash_ex(out, len, in, 20, LTC_LTC_PKCS_1_V1_5, hash_idx, 8, &stat, &pubKey));
/* change a byte */
in[0] ^= 1;
- DO(rsa_verify_hash_ex(out, len, in, 20, LTC_PKCS_1_V1_5, hash_idx, 8, &stat2, &pubKey));
+ DO(rsa_verify_hash_ex(out, len, in, 20, LTC_LTC_PKCS_1_V1_5, hash_idx, 8, &stat2, &pubKey));
if (!(stat == 1 && stat2 == 0)) {
fprintf(stderr, "rsa_verify_hash_ex failed, %d, %d", stat, stat2);
@@ -382,6 +382,6 @@ int rsa_test(void)
#endif
-/* $Source: /cvs/libtom/libtomcrypt/testprof/rsa_test.c,v $ */
-/* $Revision: 1.18 $ */
-/* $Date: 2006/11/21 00:10:18 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/testprof/store_test.c b/libtomcrypt/testprof/store_test.c
index 5a38d65..71666ba 100644
--- a/libtomcrypt/testprof/store_test.c
+++ b/libtomcrypt/testprof/store_test.c
@@ -73,6 +73,6 @@ int store_test(void)
return 0;
}
-/* $Source: /cvs/libtom/libtomcrypt/testprof/store_test.c,v $ */
-/* $Revision: 1.6 $ */
-/* $Date: 2005/05/05 14:35:59 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/testprof/test_driver.c b/libtomcrypt/testprof/test_driver.c
index 25740a0..6e54668 100644
--- a/libtomcrypt/testprof/test_driver.c
+++ b/libtomcrypt/testprof/test_driver.c
@@ -10,6 +10,6 @@ void run_cmd(int res, int line, char *file, char *cmd)
}
}
-/* $Source: /cvs/libtom/libtomcrypt/testprof/test_driver.c,v $ */
-/* $Revision: 1.2 $ */
-/* $Date: 2006/11/13 23:14:33 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/testprof/tomcrypt_test.h b/libtomcrypt/testprof/tomcrypt_test.h
index b4396fb..4ac0a97 100644
--- a/libtomcrypt/testprof/tomcrypt_test.h
+++ b/libtomcrypt/testprof/tomcrypt_test.h
@@ -78,6 +78,6 @@ void time_encmacs(void);
#endif
-/* $Source: /cvs/libtom/libtomcrypt/testprof/tomcrypt_test.h,v $ */
-/* $Revision: 1.14 $ */
-/* $Date: 2006/10/18 03:36:34 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtomcrypt/testprof/x86_prof.c b/libtomcrypt/testprof/x86_prof.c
index 96667a2..a9a8985 100644
--- a/libtomcrypt/testprof/x86_prof.c
+++ b/libtomcrypt/testprof/x86_prof.c
@@ -124,105 +124,108 @@ void init_timer(void)
void reg_algs(void)
{
int err;
-#ifdef RIJNDAEL
+#ifdef LTC_RIJNDAEL
register_cipher (&aes_desc);
#endif
-#ifdef BLOWFISH
+#ifdef LTC_BLOWFISH
register_cipher (&blowfish_desc);
#endif
-#ifdef XTEA
+#ifdef LTC_XTEA
register_cipher (&xtea_desc);
#endif
-#ifdef RC5
+#ifdef LTC_RC5
register_cipher (&rc5_desc);
#endif
-#ifdef RC6
+#ifdef LTC_RC6
register_cipher (&rc6_desc);
#endif
-#ifdef SAFERP
+#ifdef LTC_SAFERP
register_cipher (&saferp_desc);
#endif
-#ifdef TWOFISH
+#ifdef LTC_TWOFISH
register_cipher (&twofish_desc);
#endif
-#ifdef SAFER
+#ifdef LTC_SAFER
register_cipher (&safer_k64_desc);
register_cipher (&safer_sk64_desc);
register_cipher (&safer_k128_desc);
register_cipher (&safer_sk128_desc);
#endif
-#ifdef RC2
+#ifdef LTC_RC2
register_cipher (&rc2_desc);
#endif
-#ifdef DES
+#ifdef LTC_DES
register_cipher (&des_desc);
register_cipher (&des3_desc);
#endif
-#ifdef CAST5
+#ifdef LTC_CAST5
register_cipher (&cast5_desc);
#endif
-#ifdef NOEKEON
+#ifdef LTC_NOEKEON
register_cipher (&noekeon_desc);
#endif
-#ifdef SKIPJACK
+#ifdef LTC_SKIPJACK
register_cipher (&skipjack_desc);
#endif
-#ifdef KHAZAD
+#ifdef LTC_KHAZAD
register_cipher (&khazad_desc);
#endif
-#ifdef ANUBIS
+#ifdef LTC_ANUBIS
register_cipher (&anubis_desc);
#endif
-#ifdef KSEED
+#ifdef LTC_KSEED
register_cipher (&kseed_desc);
#endif
#ifdef LTC_KASUMI
register_cipher (&kasumi_desc);
#endif
+#ifdef LTC_MULTI2
+ register_cipher (&multi2_desc);
+#endif
-#ifdef TIGER
+#ifdef LTC_TIGER
register_hash (&tiger_desc);
#endif
-#ifdef MD2
+#ifdef LTC_MD2
register_hash (&md2_desc);
#endif
-#ifdef MD4
+#ifdef LTC_MD4
register_hash (&md4_desc);
#endif
-#ifdef MD5
+#ifdef LTC_MD5
register_hash (&md5_desc);
#endif
-#ifdef SHA1
+#ifdef LTC_SHA1
register_hash (&sha1_desc);
#endif
-#ifdef SHA224
+#ifdef LTC_SHA224
register_hash (&sha224_desc);
#endif
-#ifdef SHA256
+#ifdef LTC_SHA256
register_hash (&sha256_desc);
#endif
-#ifdef SHA384
+#ifdef LTC_SHA384
register_hash (&sha384_desc);
#endif
-#ifdef SHA512
+#ifdef LTC_SHA512
register_hash (&sha512_desc);
#endif
-#ifdef RIPEMD128
+#ifdef LTC_RIPEMD128
register_hash (&rmd128_desc);
#endif
-#ifdef RIPEMD160
+#ifdef LTC_RIPEMD160
register_hash (&rmd160_desc);
#endif
-#ifdef RIPEMD256
+#ifdef LTC_RIPEMD256
register_hash (&rmd256_desc);
#endif
-#ifdef RIPEMD320
+#ifdef LTC_RIPEMD320
register_hash (&rmd320_desc);
#endif
-#ifdef WHIRLPOOL
+#ifdef LTC_WHIRLPOOL
register_hash (&whirlpool_desc);
#endif
-#ifdef CHC_HASH
+#ifdef LTC_CHC_HASH
register_hash(&chc_desc);
if ((err = chc_register(register_cipher(&aes_desc))) != CRYPT_OK) {
fprintf(stderr, "chc_register error: %s\n", error_to_string(err));
@@ -231,17 +234,17 @@ void reg_algs(void)
#endif
-#ifndef YARROW
+#ifndef LTC_YARROW
#error This demo requires Yarrow.
#endif
register_prng(&yarrow_desc);
-#ifdef FORTUNA
+#ifdef LTC_FORTUNA
register_prng(&fortuna_desc);
#endif
-#ifdef RC4
+#ifdef LTC_RC4
register_prng(&rc4_desc);
#endif
-#ifdef SOBER128
+#ifdef LTC_SOBER128
register_prng(&sober128_desc);
#endif
@@ -759,7 +762,7 @@ void time_prng(void)
}
}
-#ifdef MDSA
+#ifdef LTC_MDSA
/* time various DSA operations */
void time_dsa(void)
{
@@ -804,7 +807,7 @@ static const struct {
#endif
-#ifdef MRSA
+#ifdef LTC_MRSA
/* time various RSA operations */
void time_rsa(void)
{
@@ -998,7 +1001,7 @@ void time_katja(void)
void time_katja(void) { fprintf(stderr, "NO Katja\n"); }
#endif
-#ifdef MECC
+#ifdef LTC_MECC
/* time various ECC operations */
void time_ecc(void)
{
@@ -1166,7 +1169,7 @@ void time_macs_(unsigned long MAC_SIZE)
hash_idx = find_hash("sha1");
if (cipher_idx == -1 || hash_idx == -1) {
- fprintf(stderr, "Warning the MAC tests requires AES and SHA1 to operate... so sorry\n");
+ fprintf(stderr, "Warning the MAC tests requires AES and LTC_SHA1 to operate... so sorry\n");
return;
}
@@ -1186,7 +1189,7 @@ void time_macs_(unsigned long MAC_SIZE)
t1 = t_read() - t1;
if (t1 < t2) t2 = t1;
}
- fprintf(stderr, "OMAC-%s\t\t%9llu\n", cipher_descriptor[cipher_idx].name, t2/(ulong64)(MAC_SIZE*1024));
+ fprintf(stderr, "LTC_OMAC-%s\t\t%9llu\n", cipher_descriptor[cipher_idx].name, t2/(ulong64)(MAC_SIZE*1024));
#endif
#ifdef LTC_XCBC
@@ -1237,7 +1240,7 @@ void time_macs_(unsigned long MAC_SIZE)
fprintf(stderr, "PMAC-AES\t\t%9llu\n", t2/(ulong64)(MAC_SIZE*1024));
#endif
-#ifdef PELICAN
+#ifdef LTC_PELICAN
t2 = -1;
for (x = 0; x < 10000; x++) {
t_start();
@@ -1250,7 +1253,7 @@ void time_macs_(unsigned long MAC_SIZE)
t1 = t_read() - t1;
if (t1 < t2) t2 = t1;
}
- fprintf(stderr, "PELICAN \t\t%9llu\n", t2/(ulong64)(MAC_SIZE*1024));
+ fprintf(stderr, "LTC_PELICAN \t\t%9llu\n", t2/(ulong64)(MAC_SIZE*1024));
#endif
#ifdef LTC_HMAC
@@ -1266,7 +1269,7 @@ void time_macs_(unsigned long MAC_SIZE)
t1 = t_read() - t1;
if (t1 < t2) t2 = t1;
}
- fprintf(stderr, "HMAC-%s\t\t%9llu\n", hash_descriptor[hash_idx].name, t2/(ulong64)(MAC_SIZE*1024));
+ fprintf(stderr, "LTC_HMAC-%s\t\t%9llu\n", hash_descriptor[hash_idx].name, t2/(ulong64)(MAC_SIZE*1024));
#endif
XFREE(buf);
@@ -1301,7 +1304,7 @@ void time_encmacs_(unsigned long MAC_SIZE)
yarrow_read(key, 16, &yarrow_prng);
yarrow_read(IV, 16, &yarrow_prng);
-#ifdef EAX_MODE
+#ifdef LTC_EAX_MODE
t2 = -1;
for (x = 0; x < 10000; x++) {
t_start();
@@ -1317,7 +1320,7 @@ void time_encmacs_(unsigned long MAC_SIZE)
fprintf(stderr, "EAX \t\t\t%9llu\n", t2/(ulong64)(MAC_SIZE*1024));
#endif
-#ifdef OCB_MODE
+#ifdef LTC_OCB_MODE
t2 = -1;
for (x = 0; x < 10000; x++) {
t_start();
@@ -1333,7 +1336,7 @@ void time_encmacs_(unsigned long MAC_SIZE)
fprintf(stderr, "OCB \t\t\t%9llu\n", t2/(ulong64)(MAC_SIZE*1024));
#endif
-#ifdef CCM_MODE
+#ifdef LTC_CCM_MODE
t2 = -1;
for (x = 0; x < 10000; x++) {
t_start();
@@ -1365,7 +1368,7 @@ void time_encmacs_(unsigned long MAC_SIZE)
cipher_descriptor[cipher_idx].done(&skey);
#endif
-#ifdef GCM_MODE
+#ifdef LTC_GCM_MODE
t2 = -1;
for (x = 0; x < 100; x++) {
t_start();
@@ -1382,7 +1385,7 @@ void time_encmacs_(unsigned long MAC_SIZE)
{
gcm_state gcm
-#ifdef GCM_TABLES_SSE2
+#ifdef LTC_GCM_TABLES_SSE2
__attribute__ ((aligned (16)))
#endif
;
@@ -1431,6 +1434,6 @@ void time_encmacs(void)
time_encmacs_(32);
}
-/* $Source: /cvs/libtom/libtomcrypt/testprof/x86_prof.c,v $ */
-/* $Revision: 1.51 $ */
-/* $Date: 2006/11/21 00:10:18 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtommath/LICENSE b/libtommath/LICENSE
index 5baa792..04d6d1d 100644
--- a/libtommath/LICENSE
+++ b/libtommath/LICENSE
@@ -1,4 +1,29 @@
-LibTomMath is hereby released into the Public Domain.
+LibTomMath is licensed under DUAL licensing terms.
--- Tom St Denis
+Choose and use the license of your needs.
+[LICENSE #1]
+
+LibTomMath is public domain. As should all quality software be.
+
+Tom St Denis
+
+[/LICENSE #1]
+
+[LICENSE #2]
+
+ DO WHAT THE FUCK YOU WANT TO PUBLIC LICENSE
+ Version 2, December 2004
+
+ Copyright (C) 2004 Sam Hocevar <sam@hocevar.net>
+
+ Everyone is permitted to copy and distribute verbatim or modified
+ copies of this license document, and changing it is allowed as long
+ as the name is changed.
+
+ DO WHAT THE FUCK YOU WANT TO PUBLIC LICENSE
+ TERMS AND CONDITIONS FOR COPYING, DISTRIBUTION AND MODIFICATION
+
+ 0. You just DO WHAT THE FUCK YOU WANT TO.
+
+[/LICENSE #2]
diff --git a/libtommath/Makefile.in b/libtommath/Makefile.in
index 019c50b..dbcd2a0 100644
--- a/libtommath/Makefile.in
+++ b/libtommath/Makefile.in
@@ -2,88 +2,61 @@
#
#Tom St Denis
-#version of library
-VERSION=0.40
-
-VPATH=@srcdir@
-srcdir=@srcdir@
+srcdir=.
# So that libtommath can include Dropbear headers for options and m_burn()
-CFLAGS += -I. -I$(srcdir) -I../libtomcrypt/src/headers/ -I$(srcdir)/../libtomcrypt/src/headers/ -I../ -I$(srcdir)/../
-
-ifndef IGNORE_SPEED
-
-#for speed
-#CFLAGS += -O3 -funroll-all-loops
-
-#for size
-#CFLAGS += -Os
-
-#x86 optimizations [should be valid for any GCC install though]
-#CFLAGS += -fomit-frame-pointer
-
-#debug
-#CFLAGS += -g3
-
-endif
+CFLAGS += -I$(srcdir) -I../libtomcrypt/src/headers/ -I$(srcdir)/../libtomcrypt/src/headers/ -I../ -I$(srcdir)/../
-#install as this user
-ifndef INSTALL_GROUP
- GROUP=wheel
+ifeq ($V,1)
+silent=
else
- GROUP=$(INSTALL_GROUP)
+silent=@
endif
-ifndef INSTALL_USER
- USER=root
-else
- USER=$(INSTALL_USER)
+%.o: %.c
+ifneq ($V,1)
+ @echo " * ${CC} $@"
endif
+ ${silent} ${CC} -c ${CFLAGS} $^ -o $@
#default files to install
ifndef LIBNAME
LIBNAME=libtommath.a
endif
-default: ${LIBNAME}
-
-HEADERS=tommath.h tommath_class.h tommath_superclass.h
-
-#LIBPATH-The directory for libtommath to be installed to.
-#INCPATH-The directory to install the header files for libtommath.
-#DATAPATH-The directory to install the pdf docs.
-DESTDIR=
-LIBPATH=/usr/lib
-INCPATH=/usr/include
-DATAPATH=/usr/share/doc/libtommath/pdf
-
-OBJECTS=bncore.o bn_mp_init.o bn_mp_clear.o bn_mp_exch.o bn_mp_grow.o bn_mp_shrink.o \
-bn_mp_clamp.o bn_mp_zero.o bn_mp_set.o bn_mp_set_int.o bn_mp_init_size.o bn_mp_copy.o \
-bn_mp_init_copy.o bn_mp_abs.o bn_mp_neg.o bn_mp_cmp_mag.o bn_mp_cmp.o bn_mp_cmp_d.o \
-bn_mp_rshd.o bn_mp_lshd.o bn_mp_mod_2d.o bn_mp_div_2d.o bn_mp_mul_2d.o bn_mp_div_2.o \
-bn_mp_mul_2.o bn_s_mp_add.o bn_s_mp_sub.o bn_fast_s_mp_mul_digs.o bn_s_mp_mul_digs.o \
-bn_fast_s_mp_mul_high_digs.o bn_s_mp_mul_high_digs.o bn_fast_s_mp_sqr.o bn_s_mp_sqr.o \
-bn_mp_add.o bn_mp_sub.o bn_mp_karatsuba_mul.o bn_mp_mul.o bn_mp_karatsuba_sqr.o \
-bn_mp_sqr.o bn_mp_div.o bn_mp_mod.o bn_mp_add_d.o bn_mp_sub_d.o bn_mp_mul_d.o \
-bn_mp_div_d.o bn_mp_mod_d.o bn_mp_expt_d.o bn_mp_addmod.o bn_mp_submod.o \
-bn_mp_mulmod.o bn_mp_sqrmod.o bn_mp_gcd.o bn_mp_lcm.o bn_fast_mp_invmod.o bn_mp_invmod.o \
-bn_mp_reduce.o bn_mp_montgomery_setup.o bn_fast_mp_montgomery_reduce.o bn_mp_montgomery_reduce.o \
-bn_mp_exptmod_fast.o bn_mp_exptmod.o bn_mp_2expt.o bn_mp_n_root.o bn_mp_jacobi.o bn_reverse.o \
-bn_mp_count_bits.o bn_mp_read_unsigned_bin.o bn_mp_read_signed_bin.o bn_mp_to_unsigned_bin.o \
-bn_mp_to_signed_bin.o bn_mp_unsigned_bin_size.o bn_mp_signed_bin_size.o \
-bn_mp_xor.o bn_mp_and.o bn_mp_or.o bn_mp_rand.o bn_mp_montgomery_calc_normalization.o \
-bn_mp_prime_is_divisible.o bn_prime_tab.o bn_mp_prime_fermat.o bn_mp_prime_miller_rabin.o \
-bn_mp_prime_is_prime.o bn_mp_prime_next_prime.o bn_mp_dr_reduce.o \
-bn_mp_dr_is_modulus.o bn_mp_dr_setup.o bn_mp_reduce_setup.o \
-bn_mp_toom_mul.o bn_mp_toom_sqr.o bn_mp_div_3.o bn_s_mp_exptmod.o \
-bn_mp_reduce_2k.o bn_mp_reduce_is_2k.o bn_mp_reduce_2k_setup.o \
-bn_mp_reduce_2k_l.o bn_mp_reduce_is_2k_l.o bn_mp_reduce_2k_setup_l.o \
-bn_mp_radix_smap.o bn_mp_read_radix.o bn_mp_toradix.o bn_mp_radix_size.o \
-bn_mp_fread.o bn_mp_fwrite.o bn_mp_cnt_lsb.o bn_error.o \
-bn_mp_init_multi.o bn_mp_clear_multi.o bn_mp_exteuclid.o bn_mp_toradix_n.o \
-bn_mp_prime_random_ex.o bn_mp_get_int.o bn_mp_sqrt.o bn_mp_is_square.o bn_mp_init_set.o \
-bn_mp_init_set_int.o bn_mp_invmod_slow.o bn_mp_prime_rabin_miller_trials.o \
-bn_mp_to_signed_bin_n.o bn_mp_to_unsigned_bin_n.o
+coverage: LIBNAME:=-Wl,--whole-archive $(LIBNAME) -Wl,--no-whole-archive
+
+include makefile.include
+
+LCOV_ARGS=--directory .
+
+#START_INS
+OBJECTS=bncore.o bn_error.o bn_fast_mp_invmod.o bn_fast_mp_montgomery_reduce.o bn_fast_s_mp_mul_digs.o \
+bn_fast_s_mp_mul_high_digs.o bn_fast_s_mp_sqr.o bn_mp_2expt.o bn_mp_abs.o bn_mp_add.o bn_mp_add_d.o \
+bn_mp_addmod.o bn_mp_and.o bn_mp_clamp.o bn_mp_clear.o bn_mp_clear_multi.o bn_mp_cmp.o bn_mp_cmp_d.o \
+bn_mp_cmp_mag.o bn_mp_cnt_lsb.o bn_mp_copy.o bn_mp_count_bits.o bn_mp_div_2.o bn_mp_div_2d.o bn_mp_div_3.o \
+bn_mp_div.o bn_mp_div_d.o bn_mp_dr_is_modulus.o bn_mp_dr_reduce.o bn_mp_dr_setup.o bn_mp_exch.o \
+bn_mp_export.o bn_mp_expt_d.o bn_mp_expt_d_ex.o bn_mp_exptmod.o bn_mp_exptmod_fast.o bn_mp_exteuclid.o \
+bn_mp_fread.o bn_mp_fwrite.o bn_mp_gcd.o bn_mp_get_int.o bn_mp_get_long.o bn_mp_get_long_long.o \
+bn_mp_grow.o bn_mp_import.o bn_mp_init.o bn_mp_init_copy.o bn_mp_init_multi.o bn_mp_init_set.o \
+bn_mp_init_set_int.o bn_mp_init_size.o bn_mp_invmod.o bn_mp_invmod_slow.o bn_mp_is_square.o \
+bn_mp_jacobi.o bn_mp_karatsuba_mul.o bn_mp_karatsuba_sqr.o bn_mp_lcm.o bn_mp_lshd.o bn_mp_mod_2d.o \
+bn_mp_mod.o bn_mp_mod_d.o bn_mp_montgomery_calc_normalization.o bn_mp_montgomery_reduce.o \
+bn_mp_montgomery_setup.o bn_mp_mul_2.o bn_mp_mul_2d.o bn_mp_mul.o bn_mp_mul_d.o bn_mp_mulmod.o bn_mp_neg.o \
+bn_mp_n_root.o bn_mp_n_root_ex.o bn_mp_or.o bn_mp_prime_fermat.o bn_mp_prime_is_divisible.o \
+bn_mp_prime_is_prime.o bn_mp_prime_miller_rabin.o bn_mp_prime_next_prime.o \
+bn_mp_prime_rabin_miller_trials.o bn_mp_prime_random_ex.o bn_mp_radix_size.o bn_mp_radix_smap.o \
+bn_mp_rand.o bn_mp_read_radix.o bn_mp_read_signed_bin.o bn_mp_read_unsigned_bin.o bn_mp_reduce_2k.o \
+bn_mp_reduce_2k_l.o bn_mp_reduce_2k_setup.o bn_mp_reduce_2k_setup_l.o bn_mp_reduce.o \
+bn_mp_reduce_is_2k.o bn_mp_reduce_is_2k_l.o bn_mp_reduce_setup.o bn_mp_rshd.o bn_mp_set.o bn_mp_set_int.o \
+bn_mp_set_long.o bn_mp_set_long_long.o bn_mp_shrink.o bn_mp_signed_bin_size.o bn_mp_sqr.o bn_mp_sqrmod.o \
+bn_mp_sqrt.o bn_mp_sqrtmod_prime.o bn_mp_sub.o bn_mp_sub_d.o bn_mp_submod.o bn_mp_toom_mul.o \
+bn_mp_toom_sqr.o bn_mp_toradix.o bn_mp_toradix_n.o bn_mp_to_signed_bin.o bn_mp_to_signed_bin_n.o \
+bn_mp_to_unsigned_bin.o bn_mp_to_unsigned_bin_n.o bn_mp_unsigned_bin_size.o bn_mp_xor.o bn_mp_zero.o \
+bn_prime_tab.o bn_reverse.o bn_s_mp_add.o bn_s_mp_exptmod.o bn_s_mp_mul_digs.o bn_s_mp_mul_high_digs.o \
+bn_s_mp_sqr.o bn_s_mp_sub.o
+
+#END_INS
$(LIBNAME): $(OBJECTS)
$(AR) $(ARFLAGS) $@ $(OBJECTS)
@@ -93,7 +66,7 @@ $(LIBNAME): $(OBJECTS)
#
# This will build the library with profile generation
# then run the test demo and rebuild the library.
-#
+#
# So far I've seen improvements in the MP math
profiled:
make CFLAGS="$(CFLAGS) -fprofile-arcs -DTESTING" timing
@@ -101,11 +74,11 @@ profiled:
rm -f *.a *.o ltmtest
make CFLAGS="$(CFLAGS) -fbranch-probabilities"
-#make a single object profiled library
+#make a single object profiled library
profiled_single:
perl gen.pl
$(CC) $(CFLAGS) -fprofile-arcs -DTESTING -c mpi.c -o mpi.o
- $(CC) $(CFLAGS) -DTESTING -DTIMER demo/timing.c mpi.o -o ltmtest
+ $(CC) $(CFLAGS) -DTESTING -DTIMER demo/timing.c mpi.o -lgcov -o ltmtest
./ltmtest
rm -f *.o ltmtest
$(CC) $(CFLAGS) -fbranch-probabilities -DTESTING -c mpi.c -o mpi.o
@@ -113,23 +86,30 @@ profiled_single:
$(RANLIB) $(LIBNAME)
install: $(LIBNAME)
- install -d -g $(GROUP) -o $(USER) $(DESTDIR)$(LIBPATH)
- install -d -g $(GROUP) -o $(USER) $(DESTDIR)$(INCPATH)
- install -g $(GROUP) -o $(USER) $(LIBNAME) $(DESTDIR)$(LIBPATH)
- install -g $(GROUP) -o $(USER) $(HEADERS) $(DESTDIR)$(INCPATH)
+ install -d $(DESTDIR)$(LIBPATH)
+ install -d $(DESTDIR)$(INCPATH)
+ install -m 644 $(LIBNAME) $(DESTDIR)$(LIBPATH)
+ install -m 644 $(HEADERS_PUB) $(DESTDIR)$(INCPATH)
test: $(LIBNAME) demo/demo.o
- $(CC) $(CFLAGS) demo/demo.o $(LIBNAME) -o test
-
-mtest: test
- cd mtest ; $(CC) $(CFLAGS) mtest.c -o mtest
-
+ $(CC) $(CFLAGS) demo/demo.o $(LIBNAME) $(LFLAGS) -o test
+
+test_standalone: $(LIBNAME) demo/demo.o
+ $(CC) $(CFLAGS) demo/demo.o $(LIBNAME) $(LFLAGS) -o test
+
+.PHONY: mtest
+mtest:
+ cd mtest ; $(CC) $(CFLAGS) -O0 mtest.c $(LFLAGS) -o mtest
+
timing: $(LIBNAME)
- $(CC) $(CFLAGS) -DTIMER demo/timing.c $(LIBNAME) -o ltmtest
+ $(CC) $(CFLAGS) -DTIMER demo/timing.c $(LIBNAME) $(LFLAGS) -o ltmtest
+
+coveralls: coverage
+ cpp-coveralls
# makes the LTM book DVI file, requires tetex, perl and makeindex [part of tetex I think]
docdvi: tommath.src
- cd pics ; MAKE=${MAKE} ${MAKE}
+ cd pics ; MAKE=${MAKE} ${MAKE}
echo "hello" > tommath.ind
perl booker.pl
latex tommath > /dev/null
@@ -139,17 +119,37 @@ docdvi: tommath.src
# poster, makes the single page PDF poster
poster: poster.tex
+ cp poster.tex poster.bak
+ touch --reference=poster.tex poster.bak
+ (printf "%s" "\def\fixedpdfdate{"; date +'D:%Y%m%d%H%M%S%:z' -d @$$(stat --format=%Y poster.tex) | sed "s/:\([0-9][0-9]\)$$/'\1'}/g") > poster-deterministic.tex
+ printf "%s\n" "\pdfinfo{" >> poster-deterministic.tex
+ printf "%s\n" " /CreationDate (\fixedpdfdate)" >> poster-deterministic.tex
+ printf "%s\n}\n" " /ModDate (\fixedpdfdate)" >> poster-deterministic.tex
+ cat poster.tex >> poster-deterministic.tex
+ mv poster-deterministic.tex poster.tex
+ touch --reference=poster.bak poster.tex
pdflatex poster
- rm -f poster.aux poster.log
+ sed -b -i 's,^/ID \[.*\]$$,/ID [<0> <0>],g' poster.pdf
+ mv poster.bak poster.tex
+ rm -f poster.aux poster.log poster.out
# makes the LTM book PDF file, requires tetex, cleans up the LaTeX temp files
docs: docdvi
dvipdf tommath
rm -f tommath.log tommath.aux tommath.dvi tommath.idx tommath.toc tommath.lof tommath.ind tommath.ilg
cd pics ; MAKE=${MAKE} ${MAKE} clean
-
+
#LTM user manual
mandvi: bn.tex
+ cp bn.tex bn.bak
+ touch --reference=bn.tex bn.bak
+ (printf "%s" "\def\fixedpdfdate{"; date +'D:%Y%m%d%H%M%S%:z' -d @$$(stat --format=%Y bn.tex) | sed "s/:\([0-9][0-9]\)$$/'\1'}/g") > bn-deterministic.tex
+ printf "%s\n" "\pdfinfo{" >> bn-deterministic.tex
+ printf "%s\n" " /CreationDate (\fixedpdfdate)" >> bn-deterministic.tex
+ printf "%s\n}\n" " /ModDate (\fixedpdfdate)" >> bn-deterministic.tex
+ cat bn.tex >> bn-deterministic.tex
+ mv bn-deterministic.tex bn.tex
+ touch --reference=bn.bak bn.tex
echo "hello" > bn.ind
latex bn > /dev/null
latex bn > /dev/null
@@ -159,9 +159,11 @@ mandvi: bn.tex
#LTM user manual [pdf]
manual: mandvi
pdflatex bn >/dev/null
+ sed -b -i 's,^/ID \[.*\]$$,/ID [<0> <0>],g' bn.pdf
+ mv bn.bak bn.tex
rm -f bn.aux bn.dvi bn.log bn.idx bn.lof bn.out bn.toc
-pretty:
+pretty:
perl pretty.build
clean:
@@ -171,16 +173,29 @@ clean:
-cd etc && MAKE=${MAKE} ${MAKE} clean
-cd pics && MAKE=${MAKE} ${MAKE} clean
-#zipup the project (take that!)
+#\zipup the project (take that!)
no_oops: clean
- cd .. ; cvs commit
+ cd .. ; cvs commit
echo Scanning for scratch/dirty files
find . -type f | grep -v CVS | xargs -n 1 bash mess.sh
-zipup: clean manual poster docs
- perl gen.pl ; mv mpi.c pre_gen/ ; \
- cd .. ; rm -rf ltm* libtommath-$(VERSION) ; mkdir libtommath-$(VERSION) ; \
- cp -R ./libtommath/* ./libtommath-$(VERSION)/ ; \
- tar -c libtommath-$(VERSION)/* | bzip2 -9vvc > ltm-$(VERSION).tar.bz2 ; \
- zip -9 -r ltm-$(VERSION).zip libtommath-$(VERSION)/* ; \
- mv -f ltm* ~ ; rm -rf libtommath-$(VERSION)
+.PHONY: pre_gen
+pre_gen:
+ perl gen.pl
+ sed -e 's/[[:blank:]]*$$//' mpi.c > pre_gen/mpi.c
+ rm mpi.c
+
+zipup:
+ rm -rf ../libtommath-$(VERSION) \
+ && rm -f ../ltm-$(VERSION).zip ../ltm-$(VERSION).zip.asc ../ltm-$(VERSION).tar.xz ../ltm-$(VERSION).tar.xz.asc
+ git archive HEAD --prefix=libtommath-$(VERSION)/ > ../libtommath-$(VERSION).tar
+ cd .. ; tar xf libtommath-$(VERSION).tar
+ MAKE=${MAKE} ${MAKE} -C ../libtommath-$(VERSION) clean manual poster docs
+ tar -c ../libtommath-$(VERSION)/* | xz -9 > ../ltm-$(VERSION).tar.xz
+ find ../libtommath-$(VERSION)/ -type f -exec unix2dos -q {} \;
+ cd .. ; zip -9r ltm-$(VERSION).zip libtommath-$(VERSION)
+ gpg -b -a ../ltm-$(VERSION).tar.xz && gpg -b -a ../ltm-$(VERSION).zip
+
+new_file:
+ bash updatemakes.sh
+ perl dep.pl
diff --git a/libtommath/README.md b/libtommath/README.md
new file mode 100644
index 0000000..866f024
--- /dev/null
+++ b/libtommath/README.md
@@ -0,0 +1,13 @@
+[![Build Status](https://travis-ci.org/libtom/libtommath.png?branch=develop)](https://travis-ci.org/libtom/libtommath)
+
+This is the git repository for [LibTomMath](http://www.libtom.org/), a free open source portable number theoretic multiple-precision integer (MPI) library written entirely in C.
+
+The `develop` branch contains the in-development version. Stable releases are tagged.
+
+Documentation is built from the LaTeX file `bn.tex`. There is also limited documentation in `tommath.h`. There is also a document, `tommath.pdf`, which describes the goals of the project and many of the algorithms used.
+
+The project can be build by using `make`. Along with the usual `make`, `make clean` and `make install`, there are several other build targets, see the makefile for details. There are also makefiles for certain specific platforms.
+
+Tests are located in `demo/` and can be built in two flavors.
+* `make test` creates a test binary that is intended to be run against `mtest`. `mtest` can be built with `make mtest` and test execution is done like `./mtest/mtest | ./test`. `mtest` is creating test vectors using an alternative MPI library and `test` is consuming these vectors to verify correct behavior of ltm
+* `make test_standalone` creates a stand-alone test binary that executes several test routines.
diff --git a/libtommath/bn.tex b/libtommath/bn.tex
index 38ece04..5804318 100644
--- a/libtommath/bn.tex
+++ b/libtommath/bn.tex
@@ -49,10 +49,10 @@
\begin{document}
\frontmatter
\pagestyle{empty}
-\title{LibTomMath User Manual \\ v0.40}
-\author{Tom St Denis \\ tomstdenis@gmail.com}
+\title{LibTomMath User Manual \\ v1.0}
+\author{Tom St Denis \\ tstdenis82@gmail.com}
\maketitle
-This text, the library and the accompanying textbook are all hereby placed in the public domain. This book has been
+This text, the library and the accompanying textbook are all hereby placed in the public domain. This book has been
formatted for B5 [176x250] paper using the \LaTeX{} {\em book} macro package.
\vspace{10cm}
@@ -74,12 +74,12 @@ Ontario, Canada
\section{What is LibTomMath?}
LibTomMath is a library of source code which provides a series of efficient and carefully written functions for manipulating
large integer numbers. It was written in portable ISO C source code so that it will build on any platform with a conforming
-C compiler.
+C compiler.
In a nutshell the library was written from scratch with verbose comments to help instruct computer science students how
-to implement ``bignum'' math. However, the resulting code has proven to be very useful. It has been used by numerous
+to implement ``bignum'' math. However, the resulting code has proven to be very useful. It has been used by numerous
universities, commercial and open source software developers. It has been used on a variety of platforms ranging from
-Linux and Windows based x86 to ARM based Gameboys and PPC based MacOS machines.
+Linux and Windows based x86 to ARM based Gameboys and PPC based MacOS machines.
\section{License}
As of the v0.25 the library source code has been placed in the public domain with every new release. As of the v0.28
@@ -87,14 +87,14 @@ release the textbook ``Implementing Multiple Precision Arithmetic'' has been pla
release as well. This textbook is meant to compliment the project by providing a more solid walkthrough of the development
algorithms used in the library.
-Since both\footnote{Note that the MPI files under mtest/ are copyrighted by Michael Fromberger. They are not required to use LibTomMath.} are in the
+Since both\footnote{Note that the MPI files under mtest/ are copyrighted by Michael Fromberger. They are not required to use LibTomMath.} are in the
public domain everyone is entitled to do with them as they see fit.
\section{Building LibTomMath}
LibTomMath is meant to be very ``GCC friendly'' as it comes with a makefile well suited for GCC. However, the library will
also build in MSVC, Borland C out of the box. For any other ISO C compiler a makefile will have to be made by the end
-developer.
+developer.
\subsection{Static Libraries}
To build as a static library for GCC issue the following
@@ -102,14 +102,14 @@ To build as a static library for GCC issue the following
make
\end{alltt}
-command. This will build the library and archive the object files in ``libtommath.a''. Now you link against
+command. This will build the library and archive the object files in ``libtommath.a''. Now you link against
that and include ``tommath.h'' within your programs. Alternatively to build with MSVC issue the following
\begin{alltt}
nmake -f makefile.msvc
\end{alltt}
-This will build the library and archive the object files in ``tommath.lib''. This has been tested with MSVC
-version 6.00 with service pack 5.
+This will build the library and archive the object files in ``tommath.lib''. This has been tested with MSVC
+version 6.00 with service pack 5.
\subsection{Shared Libraries}
To build as a shared library for GCC issue the following
@@ -117,12 +117,12 @@ To build as a shared library for GCC issue the following
make -f makefile.shared
\end{alltt}
This requires the ``libtool'' package (common on most Linux/BSD systems). It will build LibTomMath as both shared
-and static then install (by default) into /usr/lib as well as install the header files in /usr/include. The shared
-library (resource) will be called ``libtommath.la'' while the static library called ``libtommath.a''. Generally
-you use libtool to link your application against the shared object.
+and static then install (by default) into /usr/lib as well as install the header files in /usr/include. The shared
+library (resource) will be called ``libtommath.la'' while the static library called ``libtommath.a''. Generally
+you use libtool to link your application against the shared object.
-There is limited support for making a ``DLL'' in windows via the ``makefile.cygwin\_dll'' makefile. It requires
-Cygwin to work with since it requires the auto-export/import functionality. The resulting DLL and import library
+There is limited support for making a ``DLL'' in windows via the ``makefile.cygwin\_dll'' makefile. It requires
+Cygwin to work with since it requires the auto-export/import functionality. The resulting DLL and import library
``libtommath.dll.a'' can be used to link LibTomMath dynamically to any Windows program using Cygwin.
\subsection{Testing}
@@ -140,7 +140,7 @@ is included in the package}. Simply pipe mtest into test using
mtest/mtest | test
\end{alltt}
-If you do not have a ``/dev/urandom'' style RNG source you will have to write your own PRNG and simply pipe that into
+If you do not have a ``/dev/urandom'' style RNG source you will have to write your own PRNG and simply pipe that into
mtest. For example, if your PRNG program is called ``myprng'' simply invoke
\begin{alltt}
@@ -152,17 +152,17 @@ that is being performed. The numbers represent how many times the test was invo
will exit with a dump of the relevent numbers it was working with.
\section{Build Configuration}
-LibTomMath can configured at build time in three phases we shall call ``depends'', ``tweaks'' and ``trims''.
-Each phase changes how the library is built and they are applied one after another respectively.
+LibTomMath can configured at build time in three phases we shall call ``depends'', ``tweaks'' and ``trims''.
+Each phase changes how the library is built and they are applied one after another respectively.
To make the system more powerful you can tweak the build process. Classes are defined in the file
-``tommath\_superclass.h''. By default, the symbol ``LTM\_ALL'' shall be defined which simply
-instructs the system to build all of the functions. This is how LibTomMath used to be packaged. This will give you
+``tommath\_superclass.h''. By default, the symbol ``LTM\_ALL'' shall be defined which simply
+instructs the system to build all of the functions. This is how LibTomMath used to be packaged. This will give you
access to every function LibTomMath offers.
-However, there are cases where such a build is not optional. For instance, you want to perform RSA operations. You
-don't need the vast majority of the library to perform these operations. Aside from LTM\_ALL there is
-another pre--defined class ``SC\_RSA\_1'' which works in conjunction with the RSA from LibTomCrypt. Additional
+However, there are cases where such a build is not optional. For instance, you want to perform RSA operations. You
+don't need the vast majority of the library to perform these operations. Aside from LTM\_ALL there is
+another pre--defined class ``SC\_RSA\_1'' which works in conjunction with the RSA from LibTomCrypt. Additional
classes can be defined base on the need of the user.
\subsection{Build Depends}
@@ -172,8 +172,8 @@ file. For instance, BN\_MP\_ADD\_C represents the file ``bn\_mp\_add.c''. When
function in the respective file will be compiled and linked into the library. Accordingly when the define
is absent the file will not be compiled and not contribute any size to the library.
-You will also note that the header tommath\_class.h is actually recursively included (it includes itself twice).
-This is to help resolve as many dependencies as possible. In the last pass the symbol LTM\_LAST will be defined.
+You will also note that the header tommath\_class.h is actually recursively included (it includes itself twice).
+This is to help resolve as many dependencies as possible. In the last pass the symbol LTM\_LAST will be defined.
This is useful for ``trims''.
\subsection{Build Tweaks}
@@ -193,7 +193,7 @@ They can be enabled at any pass of the configuration phase.
\subsection{Build Trims}
A trim is a manner of removing functionality from a function that is not required. For instance, to perform
-RSA cryptography you only require exponentiation with odd moduli so even moduli support can be safely removed.
+RSA cryptography you only require exponentiation with odd moduli so even moduli support can be safely removed.
Build trims are meant to be defined on the last pass of the configuration which means they are to be defined
only if LTM\_LAST has been defined.
@@ -232,7 +232,7 @@ only if LTM\_LAST has been defined.
& BN\_S\_MP\_SQR\_C \\
\hline Polynomial Schmolynomial & BN\_MP\_KARATSUBA\_MUL\_C \\
& BN\_MP\_KARATSUBA\_SQR\_C \\
- & BN\_MP\_TOOM\_MUL\_C \\
+ & BN\_MP\_TOOM\_MUL\_C \\
& BN\_MP\_TOOM\_SQR\_C \\
\hline
@@ -242,11 +242,11 @@ only if LTM\_LAST has been defined.
\section{Purpose of LibTomMath}
-Unlike GNU MP (GMP) Library, LIP, OpenSSL or various other commercial kits (Miracl), LibTomMath was not written with
-bleeding edge performance in mind. First and foremost LibTomMath was written to be entirely open. Not only is the
+Unlike GNU MP (GMP) Library, LIP, OpenSSL or various other commercial kits (Miracl), LibTomMath was not written with
+bleeding edge performance in mind. First and foremost LibTomMath was written to be entirely open. Not only is the
source code public domain (unlike various other GPL/etc licensed code), not only is the code freely downloadable but the
source code is also accessible for computer science students attempting to learn ``BigNum'' or multiple precision
-arithmetic techniques.
+arithmetic techniques.
LibTomMath was written to be an instructive collection of source code. This is why there are many comments, only one
function per source file and often I use a ``middle-road'' approach where I don't cut corners for an extra 2\% speed
@@ -277,9 +277,9 @@ are the pros and cons of LibTomMath by comparing it to the math routines from Gn
\caption{LibTomMath Valuation}
\end{figure}
-It may seem odd to compare LibTomMath to GnuPG since the math in GnuPG is only a small portion of the entire application.
+It may seem odd to compare LibTomMath to GnuPG since the math in GnuPG is only a small portion of the entire application.
However, LibTomMath was written with cryptography in mind. It provides essentially all of the functions a cryptosystem
-would require when working with large integers.
+would require when working with large integers.
So it may feel tempting to just rip the math code out of GnuPG (or GnuMP where it was taken from originally) in your
own application but I think there are reasons not to. While LibTomMath is slower than libraries such as GnuMP it is
@@ -289,11 +289,11 @@ exponentiations. It depends largely on the processor, compiler and the moduli b
Essentially the only time you wouldn't use LibTomMath is when blazing speed is the primary concern. However,
on the other side of the coin LibTomMath offers you a totally free (public domain) well structured math library
that is very flexible, complete and performs well in resource contrained environments. Fast RSA for example can
-be performed with as little as 8KB of ram for data (again depending on build options).
+be performed with as little as 8KB of ram for data (again depending on build options).
\chapter{Getting Started with LibTomMath}
\section{Building Programs}
-In order to use LibTomMath you must include ``tommath.h'' and link against the appropriate library file (typically
+In order to use LibTomMath you must include ``tommath.h'' and link against the appropriate library file (typically
libtommath.a). There is no library initialization required and the entire library is thread safe.
\section{Return Codes}
@@ -327,8 +327,8 @@ to a string use the following function.
char *mp_error_to_string(int code);
\end{alltt}
-This will return a pointer to a string which describes the given error code. It will not work for the return codes
-MP\_YES and MP\_NO.
+This will return a pointer to a string which describes the given error code. It will not work for the return codes
+MP\_YES and MP\_NO.
\section{Data Types}
The basic ``multiple precision integer'' type is known as the ``mp\_int'' within LibTomMath. This data type is used to
@@ -345,7 +345,7 @@ typedef struct \{
Where ``mp\_digit'' is a data type that represents individual digits of the integer. By default, an mp\_digit is the
ISO C ``unsigned long'' data type and each digit is $28-$bits long. The mp\_digit type can be configured to suit other
-platforms by defining the appropriate macros.
+platforms by defining the appropriate macros.
All LTM functions that use the mp\_int type will expect a pointer to mp\_int structure. You must allocate memory to
hold the structure itself by yourself (whether off stack or heap it doesn't matter). The very first thing that must be
@@ -374,7 +374,7 @@ This allows operands to be re-used which can make programming simpler.
\section{Initialization}
\subsection{Single Initialization}
-A single mp\_int can be initialized with the ``mp\_init'' function.
+A single mp\_int can be initialized with the ``mp\_init'' function.
\index{mp\_init}
\begin{alltt}
@@ -392,11 +392,11 @@ int main(void)
int result;
if ((result = mp_init(&number)) != MP_OKAY) \{
- printf("Error initializing the number. \%s",
+ printf("Error initializing the number. \%s",
mp_error_to_string(result));
return EXIT_FAILURE;
\}
-
+
/* use the number */
return EXIT_SUCCESS;
@@ -404,7 +404,7 @@ int main(void)
\end{alltt} \end{small}
\subsection{Single Free}
-When you are finished with an mp\_int it is ideal to return the heap it used back to the system. The following function
+When you are finished with an mp\_int it is ideal to return the heap it used back to the system. The following function
provides this functionality.
\index{mp\_clear}
@@ -412,9 +412,9 @@ provides this functionality.
void mp_clear (mp_int * a);
\end{alltt}
-The function expects a pointer to a previously initialized mp\_int structure and frees the heap it uses. It sets the
-pointer\footnote{The ``dp'' member.} within the mp\_int to \textbf{NULL} which is used to prevent double free situations.
-Is is legal to call mp\_clear() twice on the same mp\_int in a row.
+The function expects a pointer to a previously initialized mp\_int structure and frees the heap it uses. It sets the
+pointer\footnote{The ``dp'' member.} within the mp\_int to \textbf{NULL} which is used to prevent double free situations.
+Is is legal to call mp\_clear() twice on the same mp\_int in a row.
\begin{small} \begin{alltt}
int main(void)
@@ -423,11 +423,11 @@ int main(void)
int result;
if ((result = mp_init(&number)) != MP_OKAY) \{
- printf("Error initializing the number. \%s",
+ printf("Error initializing the number. \%s",
mp_error_to_string(result));
return EXIT_FAILURE;
\}
-
+
/* use the number */
/* We're done with it. */
@@ -451,8 +451,8 @@ int mp_init_multi(mp_int *mp, ...);
It accepts a \textbf{NULL} terminated list of pointers to mp\_int structures. It will attempt to initialize them all
at once. If the function returns MP\_OKAY then all of the mp\_int variables are ready to use, otherwise none of them
-are available for use. A complementary mp\_clear\_multi() function allows multiple mp\_int variables to be free'd
-from the heap at the same time.
+are available for use. A complementary mp\_clear\_multi() function allows multiple mp\_int variables to be free'd
+from the heap at the same time.
\begin{small} \begin{alltt}
int main(void)
@@ -460,14 +460,14 @@ int main(void)
mp_int num1, num2, num3;
int result;
- if ((result = mp_init_multi(&num1,
+ if ((result = mp_init_multi(&num1,
&num2,
- &num3, NULL)) != MP\_OKAY) \{
- printf("Error initializing the numbers. \%s",
+ &num3, NULL)) != MP\_OKAY) \{
+ printf("Error initializing the numbers. \%s",
mp_error_to_string(result));
return EXIT_FAILURE;
\}
-
+
/* use the numbers */
/* We're done with them. */
@@ -478,7 +478,7 @@ int main(void)
\end{alltt} \end{small}
\subsection{Other Initializers}
-To initialized and make a copy of an mp\_int the mp\_init\_copy() function has been provided.
+To initialized and make a copy of an mp\_int the mp\_init\_copy() function has been provided.
\index{mp\_init\_copy}
\begin{alltt}
@@ -497,11 +497,11 @@ int main(void)
/* We want a copy of num1 in num2 now */
if ((result = mp_init_copy(&num2, &num1)) != MP_OKAY) \{
- printf("Error initializing the copy. \%s",
+ printf("Error initializing the copy. \%s",
mp_error_to_string(result));
return EXIT_FAILURE;
\}
-
+
/* now num2 is ready and contains a copy of num1 */
/* We're done with them. */
@@ -521,7 +521,7 @@ int mp_init_size (mp_int * a, int size);
\end{alltt}
The $size$ parameter must be greater than zero. If the function succeeds the mp\_int $a$ will be initialized
-to have $size$ digits (which are all initially zero).
+to have $size$ digits (which are all initially zero).
\begin{small} \begin{alltt}
int main(void)
@@ -531,11 +531,11 @@ int main(void)
/* we need a 60-digit number */
if ((result = mp_init_size(&number, 60)) != MP_OKAY) \{
- printf("Error initializing the number. \%s",
+ printf("Error initializing the number. \%s",
mp_error_to_string(result));
return EXIT_FAILURE;
\}
-
+
/* use the number */
return EXIT_SUCCESS;
@@ -556,7 +556,7 @@ int mp_shrink (mp_int * a);
This will remove excess digits of the mp\_int $a$. If the operation fails the mp\_int should be intact without the
excess digits being removed. Note that you can use a shrunk mp\_int in further computations, however, such operations
will require heap operations which can be slow. It is not ideal to shrink mp\_int variables that you will further
-modify in the system (unless you are seriously low on memory).
+modify in the system (unless you are seriously low on memory).
\begin{small} \begin{alltt}
int main(void)
@@ -565,16 +565,16 @@ int main(void)
int result;
if ((result = mp_init(&number)) != MP_OKAY) \{
- printf("Error initializing the number. \%s",
+ printf("Error initializing the number. \%s",
mp_error_to_string(result));
return EXIT_FAILURE;
\}
-
+
/* use the number [e.g. pre-computation] */
/* We're done with it for now. */
if ((result = mp_shrink(&number)) != MP_OKAY) \{
- printf("Error shrinking the number. \%s",
+ printf("Error shrinking the number. \%s",
mp_error_to_string(result));
return EXIT_FAILURE;
\}
@@ -582,7 +582,7 @@ int main(void)
/* use it .... */
- /* we're done with it. */
+ /* we're done with it. */
mp_clear(&number);
return EXIT_SUCCESS;
@@ -595,7 +595,7 @@ Within the mp\_int structure are two parameters which control the limitations of
the integer the mp\_int is meant to equal. The \textit{used} parameter dictates how many digits are significant, that is,
contribute to the value of the mp\_int. The \textit{alloc} parameter dictates how many digits are currently available in
the array. If you need to perform an operation that requires more digits you will have to mp\_grow() the mp\_int to
-your desired size.
+your desired size.
\index{mp\_grow}
\begin{alltt}
@@ -612,16 +612,16 @@ int main(void)
int result;
if ((result = mp_init(&number)) != MP_OKAY) \{
- printf("Error initializing the number. \%s",
+ printf("Error initializing the number. \%s",
mp_error_to_string(result));
return EXIT_FAILURE;
\}
-
+
/* use the number */
/* We need to add 20 digits to the number */
if ((result = mp_grow(&number, number.alloc + 20)) != MP_OKAY) \{
- printf("Error growing the number. \%s",
+ printf("Error growing the number. \%s",
mp_error_to_string(result));
return EXIT_FAILURE;
\}
@@ -629,7 +629,7 @@ int main(void)
/* use the number */
- /* we're done with it. */
+ /* we're done with it. */
mp_clear(&number);
return EXIT_SUCCESS;
@@ -641,7 +641,7 @@ int main(void)
Setting mp\_ints to small constants is a relatively common operation. To accomodate these instances there are two
small constant assignment functions. The first function is used to set a single digit constant while the second sets
an ISO C style ``unsigned long'' constant. The reason for both functions is efficiency. Setting a single digit is quick but the
-domain of a digit can change (it's always at least $0 \ldots 127$).
+domain of a digit can change (it's always at least $0 \ldots 127$).
\subsection{Single Digit}
@@ -663,15 +663,15 @@ int main(void)
int result;
if ((result = mp_init(&number)) != MP_OKAY) \{
- printf("Error initializing the number. \%s",
+ printf("Error initializing the number. \%s",
mp_error_to_string(result));
return EXIT_FAILURE;
\}
-
+
/* set the number to 5 */
mp_set(&number, 5);
- /* we're done with it. */
+ /* we're done with it. */
mp_clear(&number);
return EXIT_SUCCESS;
@@ -680,7 +680,7 @@ int main(void)
\subsection{Long Constants}
-To set a constant that is the size of an ISO C ``unsigned long'' and larger than a single digit the following function
+To set a constant that is the size of an ISO C ``unsigned long'' and larger than a single digit the following function
can be used.
\index{mp\_set\_int}
@@ -689,7 +689,7 @@ int mp_set_int (mp_int * a, unsigned long b);
\end{alltt}
This will assign the value of the 32-bit variable $b$ to the mp\_int $a$. Unlike mp\_set() this function will always
-accept a 32-bit input regardless of the size of a single digit. However, since the value may span several digits
+accept a 32-bit input regardless of the size of a single digit. However, since the value may span several digits
this function can fail if it runs out of heap memory.
To get the ``unsigned long'' copy of an mp\_int the following function can be used.
@@ -699,7 +699,7 @@ To get the ``unsigned long'' copy of an mp\_int the following function can be us
unsigned long mp_get_int (mp_int * a);
\end{alltt}
-This will return the 32 least significant bits of the mp\_int $a$.
+This will return the 32 least significant bits of the mp\_int $a$.
\begin{small} \begin{alltt}
int main(void)
@@ -708,21 +708,21 @@ int main(void)
int result;
if ((result = mp_init(&number)) != MP_OKAY) \{
- printf("Error initializing the number. \%s",
+ printf("Error initializing the number. \%s",
mp_error_to_string(result));
return EXIT_FAILURE;
\}
-
+
/* set the number to 654321 (note this is bigger than 127) */
if ((result = mp_set_int(&number, 654321)) != MP_OKAY) \{
- printf("Error setting the value of the number. \%s",
+ printf("Error setting the value of the number. \%s",
mp_error_to_string(result));
return EXIT_FAILURE;
\}
printf("number == \%lu", mp_get_int(&number));
- /* we're done with it. */
+ /* we're done with it. */
mp_clear(&number);
return EXIT_SUCCESS;
@@ -735,6 +735,42 @@ This should output the following if the program succeeds.
number == 654321
\end{alltt}
+\subsection{Long Constants - platform dependant}
+
+\index{mp\_set\_long}
+\begin{alltt}
+int mp_set_long (mp_int * a, unsigned long b);
+\end{alltt}
+
+This will assign the value of the platform-dependant sized variable $b$ to the mp\_int $a$.
+
+To get the ``unsigned long'' copy of an mp\_int the following function can be used.
+
+\index{mp\_get\_long}
+\begin{alltt}
+unsigned long mp_get_long (mp_int * a);
+\end{alltt}
+
+This will return the least significant bits of the mp\_int $a$ that fit into an ``unsigned long''.
+
+\subsection{Long Long Constants}
+
+\index{mp\_set\_long\_long}
+\begin{alltt}
+int mp_set_long_long (mp_int * a, unsigned long long b);
+\end{alltt}
+
+This will assign the value of the 64-bit variable $b$ to the mp\_int $a$.
+
+To get the ``unsigned long long'' copy of an mp\_int the following function can be used.
+
+\index{mp\_get\_long\_long}
+\begin{alltt}
+unsigned long long mp_get_long_long (mp_int * a);
+\end{alltt}
+
+This will return the 64 least significant bits of the mp\_int $a$.
+
\subsection{Initialize and Setting Constants}
To both initialize and set small constants the following two functions are available.
\index{mp\_init\_set} \index{mp\_init\_set\_int}
@@ -743,7 +779,7 @@ int mp_init_set (mp_int * a, mp_digit b);
int mp_init_set_int (mp_int * a, unsigned long b);
\end{alltt}
-Both functions work like the previous counterparts except they first mp\_init $a$ before setting the values.
+Both functions work like the previous counterparts except they first mp\_init $a$ before setting the values.
\begin{alltt}
int main(void)
@@ -753,14 +789,14 @@ int main(void)
/* initialize and set a single digit */
if ((result = mp_init_set(&number1, 100)) != MP_OKAY) \{
- printf("Error setting number1: \%s",
+ printf("Error setting number1: \%s",
mp_error_to_string(result));
return EXIT_FAILURE;
- \}
+ \}
/* initialize and set a long */
if ((result = mp_init_set_int(&number2, 1023)) != MP_OKAY) \{
- printf("Error setting number2: \%s",
+ printf("Error setting number2: \%s",
mp_error_to_string(result));
return EXIT_FAILURE;
\}
@@ -801,14 +837,14 @@ for any comparison.
\label{fig:CMP}
\end{figure}
-In figure \ref{fig:CMP} two integers $a$ and $b$ are being compared. In this case $a$ is said to be ``to the left'' of
-$b$.
+In figure \ref{fig:CMP} two integers $a$ and $b$ are being compared. In this case $a$ is said to be ``to the left'' of
+$b$.
\subsection{Unsigned comparison}
-An unsigned comparison considers only the digits themselves and not the associated \textit{sign} flag of the
+An unsigned comparison considers only the digits themselves and not the associated \textit{sign} flag of the
mp\_int structures. This is analogous to an absolute comparison. The function mp\_cmp\_mag() will compare two
-mp\_int variables based on their digits only.
+mp\_int variables based on their digits only.
\index{mp\_cmp\_mag}
\begin{alltt}
@@ -824,18 +860,18 @@ int main(void)
int result;
if ((result = mp_init_multi(&number1, &number2, NULL)) != MP_OKAY) \{
- printf("Error initializing the numbers. \%s",
+ printf("Error initializing the numbers. \%s",
mp_error_to_string(result));
return EXIT_FAILURE;
\}
-
+
/* set the number1 to 5 */
mp_set(&number1, 5);
-
+
/* set the number2 to -6 */
mp_set(&number2, 6);
if ((result = mp_neg(&number2, &number2)) != MP_OKAY) \{
- printf("Error negating number2. \%s",
+ printf("Error negating number2. \%s",
mp_error_to_string(result));
return EXIT_FAILURE;
\}
@@ -846,14 +882,14 @@ int main(void)
case MP_LT: printf("|number1| < |number2|"); break;
\}
- /* we're done with it. */
+ /* we're done with it. */
mp_clear_multi(&number1, &number2, NULL);
return EXIT_SUCCESS;
\}
\end{alltt} \end{small}
-If this program\footnote{This function uses the mp\_neg() function which is discussed in section \ref{sec:NEG}.} completes
+If this program\footnote{This function uses the mp\_neg() function which is discussed in section \ref{sec:NEG}.} completes
successfully it should print the following.
\begin{alltt}
@@ -882,18 +918,18 @@ int main(void)
int result;
if ((result = mp_init_multi(&number1, &number2, NULL)) != MP_OKAY) \{
- printf("Error initializing the numbers. \%s",
+ printf("Error initializing the numbers. \%s",
mp_error_to_string(result));
return EXIT_FAILURE;
\}
-
+
/* set the number1 to 5 */
mp_set(&number1, 5);
-
+
/* set the number2 to -6 */
mp_set(&number2, 6);
if ((result = mp_neg(&number2, &number2)) != MP_OKAY) \{
- printf("Error negating number2. \%s",
+ printf("Error negating number2. \%s",
mp_error_to_string(result));
return EXIT_FAILURE;
\}
@@ -904,14 +940,14 @@ int main(void)
case MP_LT: printf("number1 < number2"); break;
\}
- /* we're done with it. */
+ /* we're done with it. */
mp_clear_multi(&number1, &number2, NULL);
return EXIT_SUCCESS;
\}
\end{alltt} \end{small}
-If this program\footnote{This function uses the mp\_neg() function which is discussed in section \ref{sec:NEG}.} completes
+If this program\footnote{This function uses the mp\_neg() function which is discussed in section \ref{sec:NEG}.} completes
successfully it should print the following.
\begin{alltt}
@@ -927,7 +963,7 @@ To compare a single digit against an mp\_int the following function has been pro
int mp_cmp_d(mp_int * a, mp_digit b);
\end{alltt}
-This will compare $a$ to the left of $b$ using a signed comparison. Note that it will always treat $b$ as
+This will compare $a$ to the left of $b$ using a signed comparison. Note that it will always treat $b$ as
positive. This function is rather handy when you have to compare against small values such as $1$ (which often
comes up in cryptography). The function cannot fail and will return one of the tree compare condition codes
listed in figure \ref{fig:CMP}.
@@ -940,11 +976,11 @@ int main(void)
int result;
if ((result = mp_init(&number)) != MP_OKAY) \{
- printf("Error initializing the number. \%s",
+ printf("Error initializing the number. \%s",
mp_error_to_string(result));
return EXIT_FAILURE;
\}
-
+
/* set the number to 5 */
mp_set(&number, 5);
@@ -954,7 +990,7 @@ int main(void)
case MP_LT: printf("number < 7"); break;
\}
- /* we're done with it. */
+ /* we're done with it. */
mp_clear(&number);
return EXIT_SUCCESS;
@@ -975,7 +1011,7 @@ AND, XOR and OR directly. These operations are very quick.
\subsection{Multiplication by two}
Multiplications and divisions by any power of two can be performed with quick logical shifts either left or
-right depending on the operation.
+right depending on the operation.
When multiplying or dividing by two a special case routine can be used which are as follows.
\index{mp\_mul\_2} \index{mp\_div\_2}
@@ -994,17 +1030,17 @@ int main(void)
int result;
if ((result = mp_init(&number)) != MP_OKAY) \{
- printf("Error initializing the number. \%s",
+ printf("Error initializing the number. \%s",
mp_error_to_string(result));
return EXIT_FAILURE;
\}
-
+
/* set the number to 5 */
mp_set(&number, 5);
/* multiply by two */
if ((result = mp\_mul\_2(&number, &number)) != MP_OKAY) \{
- printf("Error multiplying the number. \%s",
+ printf("Error multiplying the number. \%s",
mp_error_to_string(result));
return EXIT_FAILURE;
\}
@@ -1016,7 +1052,7 @@ int main(void)
/* now divide by two */
if ((result = mp\_div\_2(&number, &number)) != MP_OKAY) \{
- printf("Error dividing the number. \%s",
+ printf("Error dividing the number. \%s",
mp_error_to_string(result));
return EXIT_FAILURE;
\}
@@ -1026,7 +1062,7 @@ int main(void)
case MP_LT: printf("2*number/2 < 7"); break;
\}
- /* we're done with it. */
+ /* we're done with it. */
mp_clear(&number);
return EXIT_SUCCESS;
@@ -1040,15 +1076,18 @@ If this program is successful it will print out the following text.
2*number/2 < 7
\end{alltt}
-Since $10 > 7$ and $5 < 7$. To multiply by a power of two the following function can be used.
+Since $10 > 7$ and $5 < 7$.
+
+To multiply by a power of two the following function can be used.
\index{mp\_mul\_2d}
\begin{alltt}
int mp_mul_2d(mp_int * a, int b, mp_int * c);
\end{alltt}
-This will multiply $a$ by $2^b$ and store the result in ``c''. If the value of $b$ is less than or equal to
-zero the function will copy $a$ to ``c'' without performing any further actions.
+This will multiply $a$ by $2^b$ and store the result in ``c''. If the value of $b$ is less than or equal to
+zero the function will copy $a$ to ``c'' without performing any further actions. The multiplication itself
+is implemented as a right-shift operation of $a$ by $b$ bits.
To divide by a power of two use the following.
@@ -1058,14 +1097,15 @@ int mp_div_2d (mp_int * a, int b, mp_int * c, mp_int * d);
\end{alltt}
Which will divide $a$ by $2^b$, store the quotient in ``c'' and the remainder in ``d'. If $b \le 0$ then the
function simply copies $a$ over to ``c'' and zeroes $d$. The variable $d$ may be passed as a \textbf{NULL}
-value to signal that the remainder is not desired.
+value to signal that the remainder is not desired. The division itself is implemented as a left-shift
+operation of $a$ by $b$ bits.
\subsection{Polynomial Basis Operations}
-Strictly speaking the organization of the integers within the mp\_int structures is what is known as a
+Strictly speaking the organization of the integers within the mp\_int structures is what is known as a
``polynomial basis''. This simply means a field element is stored by divisions of a radix. For example, if
-$f(x) = \sum_{i=0}^{k} y_ix^k$ for any vector $\vec y$ then the array of digits in $\vec y$ are said to be
-the polynomial basis representation of $z$ if $f(\beta) = z$ for a given radix $\beta$.
+$f(x) = \sum_{i=0}^{k} y_ix^k$ for any vector $\vec y$ then the array of digits in $\vec y$ are said to be
+the polynomial basis representation of $z$ if $f(\beta) = z$ for a given radix $\beta$.
To multiply by the polynomial $g(x) = x$ all you have todo is shift the digits of the basis left one place. The
following function provides this operation.
@@ -1097,7 +1137,7 @@ int mp_and (mp_int * a, mp_int * b, mp_int * c);
int mp_xor (mp_int * a, mp_int * b, mp_int * c);
\end{alltt}
-Which compute $c = a \odot b$ where $\odot$ is one of OR, AND or XOR.
+Which compute $c = a \odot b$ where $\odot$ is one of OR, AND or XOR.
\section{Addition and Subtraction}
@@ -1122,7 +1162,7 @@ Simple integer negation can be performed with the following.
int mp_neg (mp_int * a, mp_int * b);
\end{alltt}
-Which assigns $-a$ to $b$.
+Which assigns $-a$ to $b$.
\subsection{Absolute}
Simple integer absolutes can be performed with the following.
@@ -1132,7 +1172,7 @@ Simple integer absolutes can be performed with the following.
int mp_abs (mp_int * a, mp_int * b);
\end{alltt}
-Which assigns $\vert a \vert$ to $b$.
+Which assigns $\vert a \vert$ to $b$.
\section{Integer Division and Remainder}
To perform a complete and general integer division with remainder use the following function.
@@ -1141,10 +1181,10 @@ To perform a complete and general integer division with remainder use the follow
\begin{alltt}
int mp_div (mp_int * a, mp_int * b, mp_int * c, mp_int * d);
\end{alltt}
-
-This divides $a$ by $b$ and stores the quotient in $c$ and $d$. The signed quotient is computed such that
-$bc + d = a$. Note that either of $c$ or $d$ can be set to \textbf{NULL} if their value is not required. If
-$b$ is zero the function returns \textbf{MP\_VAL}.
+
+This divides $a$ by $b$ and stores the quotient in $c$ and $d$. The signed quotient is computed such that
+$bc + d = a$. Note that either of $c$ or $d$ can be set to \textbf{NULL} if their value is not required. If
+$b$ is zero the function returns \textbf{MP\_VAL}.
\chapter{Multiplication and Squaring}
@@ -1154,7 +1194,7 @@ A full signed integer multiplication can be performed with the following.
\begin{alltt}
int mp_mul (mp_int * a, mp_int * b, mp_int * c);
\end{alltt}
-Which assigns the full signed product $ab$ to $c$. This function actually breaks into one of four cases which are
+Which assigns the full signed product $ab$ to $c$. This function actually breaks into one of four cases which are
specific multiplication routines optimized for given parameters. First there are the Toom-Cook multiplications which
should only be used with very large inputs. This is followed by the Karatsuba multiplications which are for moderate
sized inputs. Then followed by the Comba and baseline multipliers.
@@ -1169,22 +1209,22 @@ int main(void)
int result;
/* Initialize the numbers */
- if ((result = mp_init_multi(&number1,
+ if ((result = mp_init_multi(&number1,
&number2, NULL)) != MP_OKAY) \{
- printf("Error initializing the numbers. \%s",
+ printf("Error initializing the numbers. \%s",
mp_error_to_string(result));
return EXIT_FAILURE;
\}
/* set the terms */
if ((result = mp_set_int(&number, 257)) != MP_OKAY) \{
- printf("Error setting number1. \%s",
+ printf("Error setting number1. \%s",
mp_error_to_string(result));
return EXIT_FAILURE;
\}
-
+
if ((result = mp_set_int(&number2, 1023)) != MP_OKAY) \{
- printf("Error setting number2. \%s",
+ printf("Error setting number2. \%s",
mp_error_to_string(result));
return EXIT_FAILURE;
\}
@@ -1192,7 +1232,7 @@ int main(void)
/* multiply them */
if ((result = mp_mul(&number1, &number2,
&number1)) != MP_OKAY) \{
- printf("Error multiplying terms. \%s",
+ printf("Error multiplying terms. \%s",
mp_error_to_string(result));
return EXIT_FAILURE;
\}
@@ -1205,7 +1245,7 @@ int main(void)
return EXIT_SUCCESS;
\}
-\end{alltt}
+\end{alltt}
If this program succeeds it shall output the following.
@@ -1224,22 +1264,22 @@ int mp_sqr (mp_int * a, mp_int * b);
Will square $a$ and store it in $b$. Like the case of multiplication there are four different squaring
algorithms all which can be called from mp\_sqr(). It is ideal to use mp\_sqr over mp\_mul when squaring terms because
-of the speed difference.
+of the speed difference.
\section{Tuning Polynomial Basis Routines}
Both of the Toom-Cook and Karatsuba multiplication algorithms are faster than the traditional $O(n^2)$ approach that
-the Comba and baseline algorithms use. At $O(n^{1.464973})$ and $O(n^{1.584962})$ running times respectively they require
+the Comba and baseline algorithms use. At $O(n^{1.464973})$ and $O(n^{1.584962})$ running times respectively they require
considerably less work. For example, a 10000-digit multiplication would take roughly 724,000 single precision
multiplications with Toom-Cook or 100,000,000 single precision multiplications with the standard Comba (a factor
of 138).
So why not always use Karatsuba or Toom-Cook? The simple answer is that they have so much overhead that they're not
-actually faster than Comba until you hit distinct ``cutoff'' points. For Karatsuba with the default configuration,
-GCC 3.3.1 and an Athlon XP processor the cutoff point is roughly 110 digits (about 70 for the Intel P4). That is, at
+actually faster than Comba until you hit distinct ``cutoff'' points. For Karatsuba with the default configuration,
+GCC 3.3.1 and an Athlon XP processor the cutoff point is roughly 110 digits (about 70 for the Intel P4). That is, at
110 digits Karatsuba and Comba multiplications just about break even and for 110+ digits Karatsuba is faster.
-Toom-Cook has incredible overhead and is probably only useful for very large inputs. So far no known cutoff points
+Toom-Cook has incredible overhead and is probably only useful for very large inputs. So far no known cutoff points
exist and for the most part I just set the cutoff points very high to make sure they're not called.
A demo program in the ``etc/'' directory of the project called ``tune.c'' can be used to find the cutoff points. This
@@ -1273,19 +1313,19 @@ tuning takes a very long time as the cutoff points are likely to be very high.
\chapter{Modular Reduction}
-Modular reduction is process of taking the remainder of one quantity divided by another. Expressed
-as (\ref{eqn:mod}) the modular reduction is equivalent to the remainder of $b$ divided by $c$.
+Modular reduction is process of taking the remainder of one quantity divided by another. Expressed
+as (\ref{eqn:mod}) the modular reduction is equivalent to the remainder of $b$ divided by $c$.
\begin{equation}
a \equiv b \mbox{ (mod }c\mbox{)}
\label{eqn:mod}
\end{equation}
-Of particular interest to cryptography are reductions where $b$ is limited to the range $0 \le b < c^2$ since particularly
-fast reduction algorithms can be written for the limited range.
+Of particular interest to cryptography are reductions where $b$ is limited to the range $0 \le b < c^2$ since particularly
+fast reduction algorithms can be written for the limited range.
Note that one of the four optimized reduction algorithms are automatically chosen in the modular exponentiation
-algorithm mp\_exptmod when an appropriate modulus is detected.
+algorithm mp\_exptmod when an appropriate modulus is detected.
\section{Straight Division}
In order to effect an arbitrary modular reduction the following algorithm is provided.
@@ -1295,7 +1335,7 @@ In order to effect an arbitrary modular reduction the following algorithm is pro
int mp_mod(mp_int *a, mp_int *b, mp_int *c);
\end{alltt}
-This reduces $a$ modulo $b$ and stores the result in $c$. The sign of $c$ shall agree with the sign
+This reduces $a$ modulo $b$ and stores the result in $c$. The sign of $c$ shall agree with the sign
of $b$. This algorithm accepts an input $a$ of any range and is not limited by $0 \le a < b^2$.
\section{Barrett Reduction}
@@ -1325,52 +1365,52 @@ int main(void)
mp_int a, b, c, mu;
int result;
- /* initialize a,b to desired values, mp_init mu,
- * c and set c to 1...we want to compute a^3 mod b
+ /* initialize a,b to desired values, mp_init mu,
+ * c and set c to 1...we want to compute a^3 mod b
*/
/* get mu value */
if ((result = mp_reduce_setup(&mu, b)) != MP_OKAY) \{
- printf("Error getting mu. \%s",
+ printf("Error getting mu. \%s",
mp_error_to_string(result));
return EXIT_FAILURE;
\}
/* square a to get c = a^2 */
if ((result = mp_sqr(&a, &c)) != MP_OKAY) \{
- printf("Error squaring. \%s",
+ printf("Error squaring. \%s",
mp_error_to_string(result));
return EXIT_FAILURE;
\}
/* now reduce `c' modulo b */
if ((result = mp_reduce(&c, &b, &mu)) != MP_OKAY) \{
- printf("Error reducing. \%s",
+ printf("Error reducing. \%s",
mp_error_to_string(result));
return EXIT_FAILURE;
\}
-
+
/* multiply a to get c = a^3 */
if ((result = mp_mul(&a, &c, &c)) != MP_OKAY) \{
- printf("Error reducing. \%s",
+ printf("Error reducing. \%s",
mp_error_to_string(result));
return EXIT_FAILURE;
\}
/* now reduce `c' modulo b */
if ((result = mp_reduce(&c, &b, &mu)) != MP_OKAY) \{
- printf("Error reducing. \%s",
+ printf("Error reducing. \%s",
mp_error_to_string(result));
return EXIT_FAILURE;
\}
-
+
/* c now equals a^3 mod b */
return EXIT_SUCCESS;
\}
-\end{alltt}
+\end{alltt}
-This program will calculate $a^3 \mbox{ mod }b$ if all the functions succeed.
+This program will calculate $a^3 \mbox{ mod }b$ if all the functions succeed.
\section{Montgomery Reduction}
@@ -1382,7 +1422,7 @@ step is required. This is accomplished with the following.
int mp_montgomery_setup(mp_int *a, mp_digit *mp);
\end{alltt}
-For the given odd moduli $a$ the precomputation value is placed in $mp$. The reduction is computed with the
+For the given odd moduli $a$ the precomputation value is placed in $mp$. The reduction is computed with the
following.
\index{mp\_montgomery\_reduce}
@@ -1394,10 +1434,10 @@ $0 \le a < b^2$.
Montgomery reduction is faster than Barrett reduction for moduli smaller than the ``comba'' limit. With the default
setup for instance, the limit is $127$ digits ($3556$--bits). Note that this function is not limited to
-$127$ digits just that it falls back to a baseline algorithm after that point.
+$127$ digits just that it falls back to a baseline algorithm after that point.
-An important observation is that this reduction does not return $a \mbox{ mod }m$ but $aR^{-1} \mbox{ mod }m$
-where $R = \beta^n$, $n$ is the n number of digits in $m$ and $\beta$ is radix used (default is $2^{28}$).
+An important observation is that this reduction does not return $a \mbox{ mod }m$ but $aR^{-1} \mbox{ mod }m$
+where $R = \beta^n$, $n$ is the n number of digits in $m$ and $\beta$ is radix used (default is $2^{28}$).
To quickly calculate $R$ the following function was provided.
@@ -1405,7 +1445,7 @@ To quickly calculate $R$ the following function was provided.
\begin{alltt}
int mp_montgomery_calc_normalization(mp_int *a, mp_int *b);
\end{alltt}
-Which calculates $a = R$ for the odd moduli $b$ without using multiplication or division.
+Which calculates $a = R$ for the odd moduli $b$ without using multiplication or division.
The normal modus operandi for Montgomery reductions is to normalize the integers before entering the system. For
example, to calculate $a^3 \mbox { mod }b$ using Montgomery reduction the value of $a$ can be normalized by
@@ -1418,62 +1458,62 @@ int main(void)
mp_digit mp;
int result;
- /* initialize a,b to desired values,
- * mp_init R, c and set c to 1....
+ /* initialize a,b to desired values,
+ * mp_init R, c and set c to 1....
*/
/* get normalization */
if ((result = mp_montgomery_calc_normalization(&R, b)) != MP_OKAY) \{
- printf("Error getting norm. \%s",
+ printf("Error getting norm. \%s",
mp_error_to_string(result));
return EXIT_FAILURE;
\}
/* get mp value */
if ((result = mp_montgomery_setup(&c, &mp)) != MP_OKAY) \{
- printf("Error setting up montgomery. \%s",
+ printf("Error setting up montgomery. \%s",
mp_error_to_string(result));
return EXIT_FAILURE;
\}
/* normalize `a' so now a is equal to aR */
if ((result = mp_mulmod(&a, &R, &b, &a)) != MP_OKAY) \{
- printf("Error computing aR. \%s",
+ printf("Error computing aR. \%s",
mp_error_to_string(result));
return EXIT_FAILURE;
\}
/* square a to get c = a^2R^2 */
if ((result = mp_sqr(&a, &c)) != MP_OKAY) \{
- printf("Error squaring. \%s",
+ printf("Error squaring. \%s",
mp_error_to_string(result));
return EXIT_FAILURE;
\}
/* now reduce `c' back down to c = a^2R^2 * R^-1 == a^2R */
if ((result = mp_montgomery_reduce(&c, &b, mp)) != MP_OKAY) \{
- printf("Error reducing. \%s",
+ printf("Error reducing. \%s",
mp_error_to_string(result));
return EXIT_FAILURE;
\}
-
+
/* multiply a to get c = a^3R^2 */
if ((result = mp_mul(&a, &c, &c)) != MP_OKAY) \{
- printf("Error reducing. \%s",
+ printf("Error reducing. \%s",
mp_error_to_string(result));
return EXIT_FAILURE;
\}
/* now reduce `c' back down to c = a^3R^2 * R^-1 == a^3R */
if ((result = mp_montgomery_reduce(&c, &b, mp)) != MP_OKAY) \{
- printf("Error reducing. \%s",
+ printf("Error reducing. \%s",
mp_error_to_string(result));
return EXIT_FAILURE;
\}
-
+
/* now reduce (again) `c' back down to c = a^3R * R^-1 == a^3 */
if ((result = mp_montgomery_reduce(&c, &b, mp)) != MP_OKAY) \{
- printf("Error reducing. \%s",
+ printf("Error reducing. \%s",
mp_error_to_string(result));
return EXIT_FAILURE;
\}
@@ -1482,9 +1522,9 @@ int main(void)
return EXIT_SUCCESS;
\}
-\end{alltt}
+\end{alltt}
-This particular example does not look too efficient but it demonstrates the point of the algorithm. By
+This particular example does not look too efficient but it demonstrates the point of the algorithm. By
normalizing the inputs the reduced results are always of the form $aR$ for some variable $a$. This allows
a single final reduction to correct for the normalization and the fast reduction used within the algorithm.
@@ -1494,7 +1534,7 @@ For more details consider examining the file \textit{bn\_mp\_exptmod\_fast.c}.
``Dimminished Radix'' reduction refers to reduction with respect to moduli that are ameniable to simple
digit shifting and small multiplications. In this case the ``restricted'' variant refers to moduli of the
-form $\beta^k - p$ for some $k \ge 0$ and $0 < p < \beta$ where $\beta$ is the radix (default to $2^{28}$).
+form $\beta^k - p$ for some $k \ge 0$ and $0 < p < \beta$ where $\beta$ is the radix (default to $2^{28}$).
As in the case of Montgomery reduction there is a pre--computation phase required for a given modulus.
@@ -1513,45 +1553,62 @@ int mp_dr_reduce(mp_int *a, mp_int *b, mp_digit mp);
\end{alltt}
This reduces $a$ in place modulo $b$ with the pre--computed value $mp$. $b$ must be of a restricted
-dimminished radix form and $a$ must be in the range $0 \le a < b^2$. Dimminished radix reductions are
-much faster than both Barrett and Montgomery reductions as they have a much lower asymtotic running time.
+dimminished radix form and $a$ must be in the range $0 \le a < b^2$. Dimminished radix reductions are
+much faster than both Barrett and Montgomery reductions as they have a much lower asymtotic running time.
Since the moduli are restricted this algorithm is not particularly useful for something like Rabin, RSA or
BBS cryptographic purposes. This reduction algorithm is useful for Diffie-Hellman and ECC where fixed
-primes are acceptable.
+primes are acceptable.
Note that unlike Montgomery reduction there is no normalization process. The result of this function is
equal to the correct residue.
\section{Unrestricted Dimminshed Radix}
-Unrestricted reductions work much like the restricted counterparts except in this case the moduli is of the
-form $2^k - p$ for $0 < p < \beta$. In this sense the unrestricted reductions are more flexible as they
-can be applied to a wider range of numbers.
+Unrestricted reductions work much like the restricted counterparts except in this case the moduli is of the
+form $2^k - p$ for $0 < p < \beta$. In this sense the unrestricted reductions are more flexible as they
+can be applied to a wider range of numbers.
\index{mp\_reduce\_2k\_setup}
\begin{alltt}
int mp_reduce_2k_setup(mp_int *a, mp_digit *d);
\end{alltt}
-This will compute the required $d$ value for the given moduli $a$.
+This will compute the required $d$ value for the given moduli $a$.
\index{mp\_reduce\_2k}
\begin{alltt}
int mp_reduce_2k(mp_int *a, mp_int *n, mp_digit d);
\end{alltt}
-This will reduce $a$ in place modulo $n$ with the pre--computed value $d$. From my experience this routine is
-slower than mp\_dr\_reduce but faster for most moduli sizes than the Montgomery reduction.
+This will reduce $a$ in place modulo $n$ with the pre--computed value $d$. From my experience this routine is
+slower than mp\_dr\_reduce but faster for most moduli sizes than the Montgomery reduction.
\chapter{Exponentiation}
\section{Single Digit Exponentiation}
+\index{mp\_expt\_d\_ex}
+\begin{alltt}
+int mp_expt_d_ex (mp_int * a, mp_digit b, mp_int * c, int fast)
+\end{alltt}
+This function computes $c = a^b$.
+
+With parameter \textit{fast} set to $0$ the old version of the algorithm is used,
+when \textit{fast} is $1$, a faster but not statically timed version of the algorithm is used.
+
+The old version uses a simple binary left-to-right algorithm.
+It is faster than repeated multiplications by $a$ for all values of $b$ greater than three.
+
+The new version uses a binary right-to-left algorithm.
+
+The difference between the old and the new version is that the old version always
+executes $DIGIT\_BIT$ iterations. The new algorithm executes only $n$ iterations
+where $n$ is equal to the position of the highest bit that is set in $b$.
+
\index{mp\_expt\_d}
\begin{alltt}
int mp_expt_d (mp_int * a, mp_digit b, mp_int * c)
\end{alltt}
-This computes $c = a^b$ using a simple binary left-to-right algorithm. It is faster than repeated multiplications by
-$a$ for all values of $b$ greater than three.
+mp\_expt\_d(a, b, c) is a wrapper function to mp\_expt\_d\_ex(a, b, c, 0).
\section{Modular Exponentiation}
\index{mp\_exptmod}
@@ -1559,8 +1616,8 @@ $a$ for all values of $b$ greater than three.
int mp_exptmod (mp_int * G, mp_int * X, mp_int * P, mp_int * Y)
\end{alltt}
This computes $Y \equiv G^X \mbox{ (mod }P\mbox{)}$ using a variable width sliding window algorithm. This function
-will automatically detect the fastest modular reduction technique to use during the operation. For negative values of
-$X$ the operation is performed as $Y \equiv (G^{-1} \mbox{ mod }P)^{\vert X \vert} \mbox{ (mod }P\mbox{)}$ provided that
+will automatically detect the fastest modular reduction technique to use during the operation. For negative values of
+$X$ the operation is performed as $Y \equiv (G^{-1} \mbox{ mod }P)^{\vert X \vert} \mbox{ (mod }P\mbox{)}$ provided that
$gcd(G, P) = 1$.
This function is actually a shell around the two internal exponentiation functions. This routine will automatically
@@ -1573,16 +1630,16 @@ and the other two algorithms.
\begin{alltt}
int mp_n_root (mp_int * a, mp_digit b, mp_int * c)
\end{alltt}
-This computes $c = a^{1/b}$ such that $c^b \le a$ and $(c+1)^b > a$. The implementation of this function is not
+This computes $c = a^{1/b}$ such that $c^b \le a$ and $(c+1)^b > a$. The implementation of this function is not
ideal for values of $b$ greater than three. It will work but become very slow. So unless you are working with very small
numbers (less than 1000 bits) I'd avoid $b > 3$ situations. Will return a positive root only for even roots and return
-a root with the sign of the input for odd roots. For example, performing $4^{1/2}$ will return $2$ whereas $(-8)^{1/3}$
-will return $-2$.
+a root with the sign of the input for odd roots. For example, performing $4^{1/2}$ will return $2$ whereas $(-8)^{1/3}$
+will return $-2$.
This algorithm uses the ``Newton Approximation'' method and will converge on the correct root fairly quickly. Since
the algorithm requires raising $a$ to the power of $b$ it is not ideal to attempt to find roots for large
values of $b$. If particularly large roots are required then a factor method could be used instead. For example,
-$a^{1/16}$ is equivalent to $\left (a^{1/4} \right)^{1/4}$ or simply
+$a^{1/16}$ is equivalent to $\left (a^{1/4} \right)^{1/4}$ or simply
$\left ( \left ( \left ( a^{1/2} \right )^{1/2} \right )^{1/2} \right )^{1/2}$
\chapter{Prime Numbers}
@@ -1591,8 +1648,8 @@ $\left ( \left ( \left ( a^{1/2} \right )^{1/2} \right )^{1/2} \right )^{1/2}$
\begin{alltt}
int mp_prime_is_divisible (mp_int * a, int *result)
\end{alltt}
-This will attempt to evenly divide $a$ by a list of primes\footnote{Default is the first 256 primes.} and store the
-outcome in ``result''. That is if $result = 0$ then $a$ is not divisible by the primes, otherwise it is. Note that
+This will attempt to evenly divide $a$ by a list of primes\footnote{Default is the first 256 primes.} and store the
+outcome in ``result''. That is if $result = 0$ then $a$ is not divisible by the primes, otherwise it is. Note that
if the function does not return \textbf{MP\_OKAY} the value in ``result'' should be considered undefined\footnote{Currently
the default is to set it to zero first.}.
@@ -1611,10 +1668,10 @@ is set to zero.
int mp_prime_miller_rabin (mp_int * a, mp_int * b, int *result)
\end{alltt}
Performs a Miller-Rabin test to the base $b$ of $a$. This test is much stronger than the Fermat test and is very hard to
-fool (besides with Carmichael numbers). If $a$ passes the test (therefore is probably prime) $result$ is set to one.
-Otherwise $result$ is set to zero.
+fool (besides with Carmichael numbers). If $a$ passes the test (therefore is probably prime) $result$ is set to one.
+Otherwise $result$ is set to zero.
-Note that is suggested that you use the Miller-Rabin test instead of the Fermat test since all of the failures of
+Note that is suggested that you use the Miller-Rabin test instead of the Fermat test since all of the failures of
Miller-Rabin are a subset of the failures of the Fermat test.
\subsection{Required Number of Tests}
@@ -1628,7 +1685,7 @@ int mp_prime_rabin_miller_trials(int size)
\end{alltt}
This returns the number of trials required for a $2^{-96}$ (or lower) probability of failure for a given ``size'' expressed
in bits. This comes in handy specially since larger numbers are slower to test. For example, a 512-bit number would
-require ten tests whereas a 1024-bit number would only require four tests.
+require ten tests whereas a 1024-bit number would only require four tests.
You should always still perform a trial division before a Miller-Rabin test though.
@@ -1637,8 +1694,8 @@ You should always still perform a trial division before a Miller-Rabin test thou
\begin{alltt}
int mp_prime_is_prime (mp_int * a, int t, int *result)
\end{alltt}
-This will perform a trial division followed by $t$ rounds of Miller-Rabin tests on $a$ and store the result in $result$.
-If $a$ passes all of the tests $result$ is set to one, otherwise it is set to zero. Note that $t$ is bounded by
+This will perform a trial division followed by $t$ rounds of Miller-Rabin tests on $a$ and store the result in $result$.
+If $a$ passes all of the tests $result$ is set to one, otherwise it is set to zero. Note that $t$ is bounded by
$1 \le t < PRIME\_SIZE$ where $PRIME\_SIZE$ is the number of primes in the prime number table (by default this is $256$).
\section{Next Prime}
@@ -1646,25 +1703,25 @@ $1 \le t < PRIME\_SIZE$ where $PRIME\_SIZE$ is the number of primes in the prime
\begin{alltt}
int mp_prime_next_prime(mp_int *a, int t, int bbs_style)
\end{alltt}
-This finds the next prime after $a$ that passes mp\_prime\_is\_prime() with $t$ tests. Set $bbs\_style$ to one if you
-want only the next prime congruent to $3 \mbox{ mod } 4$, otherwise set it to zero to find any next prime.
+This finds the next prime after $a$ that passes mp\_prime\_is\_prime() with $t$ tests. Set $bbs\_style$ to one if you
+want only the next prime congruent to $3 \mbox{ mod } 4$, otherwise set it to zero to find any next prime.
\section{Random Primes}
\index{mp\_prime\_random}
\begin{alltt}
-int mp_prime_random(mp_int *a, int t, int size, int bbs,
+int mp_prime_random(mp_int *a, int t, int size, int bbs,
ltm_prime_callback cb, void *dat)
\end{alltt}
This will find a prime greater than $256^{size}$ which can be ``bbs\_style'' or not depending on $bbs$ and must pass
-$t$ rounds of tests. The ``ltm\_prime\_callback'' is a typedef for
+$t$ rounds of tests. The ``ltm\_prime\_callback'' is a typedef for
\begin{alltt}
typedef int ltm_prime_callback(unsigned char *dst, int len, void *dat);
\end{alltt}
Which is a function that must read $len$ bytes (and return the amount stored) into $dst$. The $dat$ variable is simply
-copied from the original input. It can be used to pass RNG context data to the callback. The function
-mp\_prime\_random() is more suitable for generating primes which must be secret (as in the case of RSA) since there
+copied from the original input. It can be used to pass RNG context data to the callback. The function
+mp\_prime\_random() is more suitable for generating primes which must be secret (as in the case of RSA) since there
is no skew on the least significant bits.
\textit{Note:} As of v0.30 of the LibTomMath library this function has been deprecated. It is still available
@@ -1673,13 +1730,13 @@ but users are encouraged to use the new mp\_prime\_random\_ex() function instead
\subsection{Extended Generation}
\index{mp\_prime\_random\_ex}
\begin{alltt}
-int mp_prime_random_ex(mp_int *a, int t,
- int size, int flags,
+int mp_prime_random_ex(mp_int *a, int t,
+ int size, int flags,
ltm_prime_callback cb, void *dat);
\end{alltt}
This will generate a prime in $a$ using $t$ tests of the primality testing algorithms. The variable $size$
specifies the bit length of the prime desired. The variable $flags$ specifies one of several options available
-(see fig. \ref{fig:primeopts}) which can be OR'ed together. The callback parameters are used as in
+(see fig. \ref{fig:primeopts}) which can be OR'ed together. The callback parameters are used as in
mp\_prime\_random().
\begin{figure}[here]
@@ -1717,8 +1774,8 @@ by the conversion before storing any data use the following function.
\begin{alltt}
int mp_radix_size (mp_int * a, int radix, int *size)
\end{alltt}
-This stores in ``size'' the number of characters (including space for the NUL terminator) required. Upon error this
-function returns an error code and ``size'' will be zero.
+This stores in ``size'' the number of characters (including space for the NUL terminator) required. Upon error this
+function returns an error code and ``size'' will be zero.
\subsection{From ASCII}
\index{mp\_read\_radix}
@@ -1764,13 +1821,13 @@ int mp_to_signed_bin(mp_int *a, unsigned char *b);
\end{alltt}
They operate essentially the same as the unsigned copies except they prefix the data with zero or non--zero
byte depending on the sign. If the sign is zpos (e.g. not negative) the prefix is zero, otherwise the prefix
-is non--zero.
+is non--zero.
\chapter{Algebraic Functions}
\section{Extended Euclidean Algorithm}
\index{mp\_exteuclid}
\begin{alltt}
-int mp_exteuclid(mp_int *a, mp_int *b,
+int mp_exteuclid(mp_int *a, mp_int *b,
mp_int *U1, mp_int *U2, mp_int *U3);
\end{alltt}
@@ -1780,7 +1837,7 @@ This finds the triple U1/U2/U3 using the Extended Euclidean algorithm such that
a \cdot U1 + b \cdot U2 = U3
\end{equation}
-Any of the U1/U2/U3 paramters can be set to \textbf{NULL} if they are not desired.
+Any of the U1/U2/U3 paramters can be set to \textbf{NULL} if they are not desired.
\section{Greatest Common Divisor}
\index{mp\_gcd}
@@ -1804,7 +1861,28 @@ int mp_jacobi (mp_int * a, mp_int * p, int *c)
This will compute the Jacobi symbol for $a$ with respect to $p$. If $p$ is prime this essentially computes the Legendre
symbol. The result is stored in $c$ and can take on one of three values $\lbrace -1, 0, 1 \rbrace$. If $p$ is prime
then the result will be $-1$ when $a$ is not a quadratic residue modulo $p$. The result will be $0$ if $a$ divides $p$
-and the result will be $1$ if $a$ is a quadratic residue modulo $p$.
+and the result will be $1$ if $a$ is a quadratic residue modulo $p$.
+
+\section{Modular square root}
+\index{mp\_sqrtmod\_prime}
+\begin{alltt}
+int mp_sqrtmod_prime(mp_int *n, mp_int *p, mp_int *r)
+\end{alltt}
+
+This will solve the modular equatioon $r^2 = n \mod p$ where $p$ is a prime number greater than 2 (odd prime).
+The result is returned in the third argument $r$, the function returns \textbf{MP\_OKAY} on success,
+other return values indicate failure.
+
+The implementation is split for two different cases:
+
+1. if $p \mod 4 == 3$ we apply \href{http://cacr.uwaterloo.ca/hac/}{Handbook of Applied Cryptography algorithm 3.36} and compute $r$ directly as
+$r = n^{(p+1)/4} \mod p$
+
+2. otherwise we use \href{https://en.wikipedia.org/wiki/Tonelli-Shanks_algorithm}{Tonelli-Shanks algorithm}
+
+The function does not check the primality of parameter $p$ thus it is up to the caller to assure that this parameter
+is a prime number. When $p$ is a composite the function behaviour is undefined, it may even return a false-positive
+\textbf{MP\_OKAY}.
\section{Modular Inverse}
\index{mp\_invmod}
diff --git a/libtommath/bn_error.c b/libtommath/bn_error.c
index 1ae6430..3abf1a7 100644
--- a/libtommath/bn_error.c
+++ b/libtommath/bn_error.c
@@ -1,4 +1,4 @@
-#include <tommath.h>
+#include <tommath_private.h>
#ifdef BN_ERROR_C
/* LibTomMath, multiple-precision integer library -- Tom St Denis
*
@@ -12,12 +12,12 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tstdenis82@gmail.com, http://libtom.org
*/
static const struct {
int code;
- char *msg;
+ const char *msg;
} msgs[] = {
{ MP_OKAY, "Successful" },
{ MP_MEM, "Out of heap" },
@@ -25,7 +25,7 @@ static const struct {
};
/* return a char * string for a given code */
-char *mp_error_to_string(int code)
+const char *mp_error_to_string(int code)
{
int x;
@@ -42,6 +42,6 @@ char *mp_error_to_string(int code)
#endif
-/* $Source: /cvs/libtom/libtommath/bn_error.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtommath/bn_fast_mp_invmod.c b/libtommath/bn_fast_mp_invmod.c
index 1974145..aa41098 100644
--- a/libtommath/bn_fast_mp_invmod.c
+++ b/libtommath/bn_fast_mp_invmod.c
@@ -1,4 +1,4 @@
-#include <tommath.h>
+#include <tommath_private.h>
#ifdef BN_FAST_MP_INVMOD_C
/* LibTomMath, multiple-precision integer library -- Tom St Denis
*
@@ -12,7 +12,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tstdenis82@gmail.com, http://libtom.org
*/
/* computes the modular inverse via binary extended euclidean algorithm,
@@ -27,7 +27,7 @@ int fast_mp_invmod (mp_int * a, mp_int * b, mp_int * c)
int res, neg;
/* 2. [modified] b must be odd */
- if (mp_iseven (b) == 1) {
+ if (mp_iseven (b) == MP_YES) {
return MP_VAL;
}
@@ -57,13 +57,13 @@ int fast_mp_invmod (mp_int * a, mp_int * b, mp_int * c)
top:
/* 4. while u is even do */
- while (mp_iseven (&u) == 1) {
+ while (mp_iseven (&u) == MP_YES) {
/* 4.1 u = u/2 */
if ((res = mp_div_2 (&u, &u)) != MP_OKAY) {
goto LBL_ERR;
}
/* 4.2 if B is odd then */
- if (mp_isodd (&B) == 1) {
+ if (mp_isodd (&B) == MP_YES) {
if ((res = mp_sub (&B, &x, &B)) != MP_OKAY) {
goto LBL_ERR;
}
@@ -75,13 +75,13 @@ top:
}
/* 5. while v is even do */
- while (mp_iseven (&v) == 1) {
+ while (mp_iseven (&v) == MP_YES) {
/* 5.1 v = v/2 */
if ((res = mp_div_2 (&v, &v)) != MP_OKAY) {
goto LBL_ERR;
}
/* 5.2 if D is odd then */
- if (mp_isodd (&D) == 1) {
+ if (mp_isodd (&D) == MP_YES) {
/* D = (D-x)/2 */
if ((res = mp_sub (&D, &x, &D)) != MP_OKAY) {
goto LBL_ERR;
@@ -115,7 +115,7 @@ top:
}
/* if not zero goto step 4 */
- if (mp_iszero (&u) == 0) {
+ if (mp_iszero (&u) == MP_NO) {
goto top;
}
@@ -143,6 +143,6 @@ LBL_ERR:mp_clear_multi (&x, &y, &u, &v, &B, &D, NULL);
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_fast_mp_invmod.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtommath/bn_fast_mp_montgomery_reduce.c b/libtommath/bn_fast_mp_montgomery_reduce.c
index 13538c8..a63839d 100644
--- a/libtommath/bn_fast_mp_montgomery_reduce.c
+++ b/libtommath/bn_fast_mp_montgomery_reduce.c
@@ -1,4 +1,4 @@
-#include <tommath.h>
+#include <tommath_private.h>
#ifdef BN_FAST_MP_MONTGOMERY_REDUCE_C
/* LibTomMath, multiple-precision integer library -- Tom St Denis
*
@@ -12,7 +12,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tstdenis82@gmail.com, http://libtom.org
*/
/* computes xR**-1 == x (mod N) via Montgomery Reduction
@@ -32,7 +32,7 @@ int fast_mp_montgomery_reduce (mp_int * x, mp_int * n, mp_digit rho)
olduse = x->used;
/* grow a as required */
- if (x->alloc < n->used + 1) {
+ if (x->alloc < (n->used + 1)) {
if ((res = mp_grow (x, n->used + 1)) != MP_OKAY) {
return res;
}
@@ -42,8 +42,8 @@ int fast_mp_montgomery_reduce (mp_int * x, mp_int * n, mp_digit rho)
* an array of double precision words W[...]
*/
{
- register mp_word *_W;
- register mp_digit *tmpx;
+ mp_word *_W;
+ mp_digit *tmpx;
/* alias for the W[] array */
_W = W;
@@ -57,7 +57,7 @@ int fast_mp_montgomery_reduce (mp_int * x, mp_int * n, mp_digit rho)
}
/* zero the high words of W[a->used..m->used*2] */
- for (; ix < n->used * 2 + 1; ix++) {
+ for (; ix < ((n->used * 2) + 1); ix++) {
*_W++ = 0;
}
}
@@ -72,7 +72,7 @@ int fast_mp_montgomery_reduce (mp_int * x, mp_int * n, mp_digit rho)
* by casting the value down to a mp_digit. Note this requires
* that W[ix-1] have the carry cleared (see after the inner loop)
*/
- register mp_digit mu;
+ mp_digit mu;
mu = (mp_digit) (((W[ix] & MP_MASK) * rho) & MP_MASK);
/* a = a + mu * m * b**i
@@ -90,9 +90,9 @@ int fast_mp_montgomery_reduce (mp_int * x, mp_int * n, mp_digit rho)
* first m->used words of W[] have the carries fixed
*/
{
- register int iy;
- register mp_digit *tmpn;
- register mp_word *_W;
+ int iy;
+ mp_digit *tmpn;
+ mp_word *_W;
/* alias for the digits of the modulus */
tmpn = n->dp;
@@ -115,8 +115,8 @@ int fast_mp_montgomery_reduce (mp_int * x, mp_int * n, mp_digit rho)
* significant digits we zeroed].
*/
{
- register mp_digit *tmpx;
- register mp_word *_W, *_W1;
+ mp_digit *tmpx;
+ mp_word *_W, *_W1;
/* nox fix rest of carries */
@@ -126,7 +126,7 @@ int fast_mp_montgomery_reduce (mp_int * x, mp_int * n, mp_digit rho)
/* alias for next word, where the carry goes */
_W = W + ++ix;
- for (; ix <= n->used * 2 + 1; ix++) {
+ for (; ix <= ((n->used * 2) + 1); ix++) {
*_W++ += *_W1++ >> ((mp_word) DIGIT_BIT);
}
@@ -143,7 +143,7 @@ int fast_mp_montgomery_reduce (mp_int * x, mp_int * n, mp_digit rho)
/* alias for shifted double precision result */
_W = W + n->used;
- for (ix = 0; ix < n->used + 1; ix++) {
+ for (ix = 0; ix < (n->used + 1); ix++) {
*tmpx++ = (mp_digit)(*_W++ & ((mp_word) MP_MASK));
}
@@ -167,6 +167,6 @@ int fast_mp_montgomery_reduce (mp_int * x, mp_int * n, mp_digit rho)
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_fast_mp_montgomery_reduce.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtommath/bn_fast_s_mp_mul_digs.c b/libtommath/bn_fast_s_mp_mul_digs.c
index 8e2e069..acd13b4 100644
--- a/libtommath/bn_fast_s_mp_mul_digs.c
+++ b/libtommath/bn_fast_s_mp_mul_digs.c
@@ -1,4 +1,4 @@
-#include <tommath.h>
+#include <tommath_private.h>
#ifdef BN_FAST_S_MP_MUL_DIGS_C
/* LibTomMath, multiple-precision integer library -- Tom St Denis
*
@@ -12,7 +12,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tstdenis82@gmail.com, http://libtom.org
*/
/* Fast (comba) multiplier
@@ -35,7 +35,7 @@ int fast_s_mp_mul_digs (mp_int * a, mp_int * b, mp_int * c, int digs)
{
int olduse, res, pa, ix, iz;
mp_digit W[MP_WARRAY];
- register mp_word _W;
+ mp_word _W;
/* grow the destination as required */
if (c->alloc < digs) {
@@ -78,16 +78,16 @@ int fast_s_mp_mul_digs (mp_int * a, mp_int * b, mp_int * c, int digs)
/* make next carry */
_W = _W >> ((mp_word)DIGIT_BIT);
- }
+ }
/* setup dest */
olduse = c->used;
c->used = pa;
{
- register mp_digit *tmpc;
+ mp_digit *tmpc;
tmpc = c->dp;
- for (ix = 0; ix < pa+1; ix++) {
+ for (ix = 0; ix < (pa + 1); ix++) {
/* now extract the previous digit [below the carry] */
*tmpc++ = W[ix];
}
@@ -102,6 +102,6 @@ int fast_s_mp_mul_digs (mp_int * a, mp_int * b, mp_int * c, int digs)
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_fast_s_mp_mul_digs.c,v $ */
-/* $Revision: 1.7 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtommath/bn_fast_s_mp_mul_high_digs.c b/libtommath/bn_fast_s_mp_mul_high_digs.c
index 4778b2f..b96cf60 100644
--- a/libtommath/bn_fast_s_mp_mul_high_digs.c
+++ b/libtommath/bn_fast_s_mp_mul_high_digs.c
@@ -1,4 +1,4 @@
-#include <tommath.h>
+#include <tommath_private.h>
#ifdef BN_FAST_S_MP_MUL_HIGH_DIGS_C
/* LibTomMath, multiple-precision integer library -- Tom St Denis
*
@@ -12,7 +12,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tstdenis82@gmail.com, http://libtom.org
*/
/* this is a modified version of fast_s_mul_digs that only produces
@@ -75,7 +75,7 @@ int fast_s_mp_mul_high_digs (mp_int * a, mp_int * b, mp_int * c, int digs)
c->used = pa;
{
- register mp_digit *tmpc;
+ mp_digit *tmpc;
tmpc = c->dp + digs;
for (ix = digs; ix < pa; ix++) {
@@ -93,6 +93,6 @@ int fast_s_mp_mul_high_digs (mp_int * a, mp_int * b, mp_int * c, int digs)
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_fast_s_mp_mul_high_digs.c,v $ */
-/* $Revision: 1.5 $ */
-/* $Date: 2006/11/14 03:46:25 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtommath/bn_fast_s_mp_sqr.c b/libtommath/bn_fast_s_mp_sqr.c
index bb5974c..775c76f 100644
--- a/libtommath/bn_fast_s_mp_sqr.c
+++ b/libtommath/bn_fast_s_mp_sqr.c
@@ -1,4 +1,4 @@
-#include <tommath.h>
+#include <tommath_private.h>
#ifdef BN_FAST_S_MP_SQR_C
/* LibTomMath, multiple-precision integer library -- Tom St Denis
*
@@ -12,7 +12,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tstdenis82@gmail.com, http://libtom.org
*/
/* the jist of squaring...
@@ -66,7 +66,7 @@ int fast_s_mp_sqr (mp_int * a, mp_int * b)
* we halve the distance since they approach at a rate of 2x
* and we have to round because odd cases need to be executed
*/
- iy = MIN(iy, (ty-tx+1)>>1);
+ iy = MIN(iy, ((ty-tx)+1)>>1);
/* execute loop */
for (iz = 0; iz < iy; iz++) {
@@ -109,6 +109,6 @@ int fast_s_mp_sqr (mp_int * a, mp_int * b)
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_fast_s_mp_sqr.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtommath/bn_mp_2expt.c b/libtommath/bn_mp_2expt.c
index 9e5f32e..2845814 100644
--- a/libtommath/bn_mp_2expt.c
+++ b/libtommath/bn_mp_2expt.c
@@ -1,4 +1,4 @@
-#include <tommath.h>
+#include <tommath_private.h>
#ifdef BN_MP_2EXPT_C
/* LibTomMath, multiple-precision integer library -- Tom St Denis
*
@@ -12,7 +12,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tstdenis82@gmail.com, http://libtom.org
*/
/* computes a = 2**b
@@ -29,12 +29,12 @@ mp_2expt (mp_int * a, int b)
mp_zero (a);
/* grow a to accomodate the single bit */
- if ((res = mp_grow (a, b / DIGIT_BIT + 1)) != MP_OKAY) {
+ if ((res = mp_grow (a, (b / DIGIT_BIT) + 1)) != MP_OKAY) {
return res;
}
/* set the used count of where the bit will go */
- a->used = b / DIGIT_BIT + 1;
+ a->used = (b / DIGIT_BIT) + 1;
/* put the single bit in its place */
a->dp[b / DIGIT_BIT] = ((mp_digit)1) << (b % DIGIT_BIT);
@@ -43,6 +43,6 @@ mp_2expt (mp_int * a, int b)
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_2expt.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtommath/bn_mp_abs.c b/libtommath/bn_mp_abs.c
index 9643c5e..cc9c3db 100644
--- a/libtommath/bn_mp_abs.c
+++ b/libtommath/bn_mp_abs.c
@@ -1,4 +1,4 @@
-#include <tommath.h>
+#include <tommath_private.h>
#ifdef BN_MP_ABS_C
/* LibTomMath, multiple-precision integer library -- Tom St Denis
*
@@ -12,7 +12,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tstdenis82@gmail.com, http://libtom.org
*/
/* b = |a|
@@ -38,6 +38,6 @@ mp_abs (mp_int * a, mp_int * b)
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_abs.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtommath/bn_mp_add.c b/libtommath/bn_mp_add.c
index a90eef6..236fc75 100644
--- a/libtommath/bn_mp_add.c
+++ b/libtommath/bn_mp_add.c
@@ -1,4 +1,4 @@
-#include <tommath.h>
+#include <tommath_private.h>
#ifdef BN_MP_ADD_C
/* LibTomMath, multiple-precision integer library -- Tom St Denis
*
@@ -12,7 +12,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tstdenis82@gmail.com, http://libtom.org
*/
/* high level addition (handles signs) */
@@ -48,6 +48,6 @@ int mp_add (mp_int * a, mp_int * b, mp_int * c)
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_add.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtommath/bn_mp_add_d.c b/libtommath/bn_mp_add_d.c
index 5af5aa9..4d4e1df 100644
--- a/libtommath/bn_mp_add_d.c
+++ b/libtommath/bn_mp_add_d.c
@@ -1,4 +1,4 @@
-#include <tommath.h>
+#include <tommath_private.h>
#ifdef BN_MP_ADD_D_C
/* LibTomMath, multiple-precision integer library -- Tom St Denis
*
@@ -12,7 +12,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tstdenis82@gmail.com, http://libtom.org
*/
/* single digit addition */
@@ -23,14 +23,14 @@ mp_add_d (mp_int * a, mp_digit b, mp_int * c)
mp_digit *tmpa, *tmpc, mu;
/* grow c as required */
- if (c->alloc < a->used + 1) {
+ if (c->alloc < (a->used + 1)) {
if ((res = mp_grow(c, a->used + 1)) != MP_OKAY) {
return res;
}
}
/* if a is negative and |a| >= b, call c = |a| - b */
- if (a->sign == MP_NEG && (a->used > 1 || a->dp[0] >= b)) {
+ if ((a->sign == MP_NEG) && ((a->used > 1) || (a->dp[0] >= b))) {
/* temporarily fix sign of a */
a->sign = MP_ZPOS;
@@ -107,6 +107,6 @@ mp_add_d (mp_int * a, mp_digit b, mp_int * c)
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_add_d.c,v $ */
-/* $Revision: 1.4 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtommath/bn_mp_addmod.c b/libtommath/bn_mp_addmod.c
index d3b3ac4..825c928 100644
--- a/libtommath/bn_mp_addmod.c
+++ b/libtommath/bn_mp_addmod.c
@@ -1,4 +1,4 @@
-#include <tommath.h>
+#include <tommath_private.h>
#ifdef BN_MP_ADDMOD_C
/* LibTomMath, multiple-precision integer library -- Tom St Denis
*
@@ -12,7 +12,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tstdenis82@gmail.com, http://libtom.org
*/
/* d = a + b (mod c) */
@@ -36,6 +36,6 @@ mp_addmod (mp_int * a, mp_int * b, mp_int * c, mp_int * d)
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_addmod.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtommath/bn_mp_and.c b/libtommath/bn_mp_and.c
index 9a2c0ee..3b6b03e 100644
--- a/libtommath/bn_mp_and.c
+++ b/libtommath/bn_mp_and.c
@@ -1,4 +1,4 @@
-#include <tommath.h>
+#include <tommath_private.h>
#ifdef BN_MP_AND_C
/* LibTomMath, multiple-precision integer library -- Tom St Denis
*
@@ -12,7 +12,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tstdenis82@gmail.com, http://libtom.org
*/
/* AND two ints together */
@@ -52,6 +52,6 @@ mp_and (mp_int * a, mp_int * b, mp_int * c)
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_and.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtommath/bn_mp_clamp.c b/libtommath/bn_mp_clamp.c
index da4e1ef..d4fb70d 100644
--- a/libtommath/bn_mp_clamp.c
+++ b/libtommath/bn_mp_clamp.c
@@ -1,4 +1,4 @@
-#include <tommath.h>
+#include <tommath_private.h>
#ifdef BN_MP_CLAMP_C
/* LibTomMath, multiple-precision integer library -- Tom St Denis
*
@@ -12,7 +12,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tstdenis82@gmail.com, http://libtom.org
*/
/* trim unused digits
@@ -28,7 +28,7 @@ mp_clamp (mp_int * a)
/* decrease used while the most significant digit is
* zero.
*/
- while (a->used > 0 && a->dp[a->used - 1] == 0) {
+ while ((a->used > 0) && (a->dp[a->used - 1] == 0)) {
--(a->used);
}
@@ -39,6 +39,6 @@ mp_clamp (mp_int * a)
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_clamp.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtommath/bn_mp_clear.c b/libtommath/bn_mp_clear.c
index 16f7982..3d5a7f8 100644
--- a/libtommath/bn_mp_clear.c
+++ b/libtommath/bn_mp_clear.c
@@ -1,4 +1,4 @@
-#include <tommath.h>
+#include <tommath_private.h>
#include "dbhelpers.h"
#ifdef BN_MP_CLEAR_C
/* LibTomMath, multiple-precision integer library -- Tom St Denis
@@ -13,7 +13,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tstdenis82@gmail.com, http://libtom.org
*/
/* clear one (frees) */
@@ -36,6 +36,6 @@ mp_clear (mp_int * a)
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_clear.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtommath/bn_mp_clear_multi.c b/libtommath/bn_mp_clear_multi.c
index e1859be..441a200 100644
--- a/libtommath/bn_mp_clear_multi.c
+++ b/libtommath/bn_mp_clear_multi.c
@@ -1,4 +1,4 @@
-#include <tommath.h>
+#include <tommath_private.h>
#ifdef BN_MP_CLEAR_MULTI_C
/* LibTomMath, multiple-precision integer library -- Tom St Denis
*
@@ -12,7 +12,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tstdenis82@gmail.com, http://libtom.org
*/
#include <stdarg.h>
@@ -29,6 +29,6 @@ void mp_clear_multi(mp_int *mp, ...)
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_clear_multi.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtommath/bn_mp_cmp.c b/libtommath/bn_mp_cmp.c
index f4e2af7..74a98fe 100644
--- a/libtommath/bn_mp_cmp.c
+++ b/libtommath/bn_mp_cmp.c
@@ -1,4 +1,4 @@
-#include <tommath.h>
+#include <tommath_private.h>
#ifdef BN_MP_CMP_C
/* LibTomMath, multiple-precision integer library -- Tom St Denis
*
@@ -12,7 +12,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tstdenis82@gmail.com, http://libtom.org
*/
/* compare two ints (signed)*/
@@ -38,6 +38,6 @@ mp_cmp (mp_int * a, mp_int * b)
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_cmp.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtommath/bn_mp_cmp_d.c b/libtommath/bn_mp_cmp_d.c
index 20a19bc..28a53ce 100644
--- a/libtommath/bn_mp_cmp_d.c
+++ b/libtommath/bn_mp_cmp_d.c
@@ -1,4 +1,4 @@
-#include <tommath.h>
+#include <tommath_private.h>
#ifdef BN_MP_CMP_D_C
/* LibTomMath, multiple-precision integer library -- Tom St Denis
*
@@ -12,7 +12,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tstdenis82@gmail.com, http://libtom.org
*/
/* compare a digit */
@@ -39,6 +39,6 @@ int mp_cmp_d(mp_int * a, mp_digit b)
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_cmp_d.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtommath/bn_mp_cmp_mag.c b/libtommath/bn_mp_cmp_mag.c
index 5dc7a3f..f72830f 100644
--- a/libtommath/bn_mp_cmp_mag.c
+++ b/libtommath/bn_mp_cmp_mag.c
@@ -1,4 +1,4 @@
-#include <tommath.h>
+#include <tommath_private.h>
#ifdef BN_MP_CMP_MAG_C
/* LibTomMath, multiple-precision integer library -- Tom St Denis
*
@@ -12,7 +12,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tstdenis82@gmail.com, http://libtom.org
*/
/* compare maginitude of two ints (unsigned) */
@@ -50,6 +50,6 @@ int mp_cmp_mag (mp_int * a, mp_int * b)
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_cmp_mag.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtommath/bn_mp_cnt_lsb.c b/libtommath/bn_mp_cnt_lsb.c
index 017b990..9d7eef8 100644
--- a/libtommath/bn_mp_cnt_lsb.c
+++ b/libtommath/bn_mp_cnt_lsb.c
@@ -1,4 +1,4 @@
-#include <tommath.h>
+#include <tommath_private.h>
#ifdef BN_MP_CNT_LSB_C
/* LibTomMath, multiple-precision integer library -- Tom St Denis
*
@@ -12,7 +12,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tstdenis82@gmail.com, http://libtom.org
*/
static const int lnz[16] = {
@@ -26,12 +26,12 @@ int mp_cnt_lsb(mp_int *a)
mp_digit q, qq;
/* easy out */
- if (mp_iszero(a) == 1) {
+ if (mp_iszero(a) == MP_YES) {
return 0;
}
/* scan lower digits until non-zero */
- for (x = 0; x < a->used && a->dp[x] == 0; x++);
+ for (x = 0; (x < a->used) && (a->dp[x] == 0); x++) {}
q = a->dp[x];
x *= DIGIT_BIT;
@@ -48,6 +48,6 @@ int mp_cnt_lsb(mp_int *a)
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_cnt_lsb.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtommath/bn_mp_copy.c b/libtommath/bn_mp_copy.c
index d820397..69e9464 100644
--- a/libtommath/bn_mp_copy.c
+++ b/libtommath/bn_mp_copy.c
@@ -1,4 +1,4 @@
-#include <tommath.h>
+#include <tommath_private.h>
#ifdef BN_MP_COPY_C
/* LibTomMath, multiple-precision integer library -- Tom St Denis
*
@@ -12,7 +12,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tstdenis82@gmail.com, http://libtom.org
*/
/* copy, b = a */
@@ -35,7 +35,7 @@ mp_copy (mp_int * a, mp_int * b)
/* zero b and copy the parameters over */
{
- register mp_digit *tmpa, *tmpb;
+ mp_digit *tmpa, *tmpb;
/* pointer aliases */
@@ -63,6 +63,6 @@ mp_copy (mp_int * a, mp_int * b)
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_copy.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtommath/bn_mp_count_bits.c b/libtommath/bn_mp_count_bits.c
index ff4db22..74b59b6 100644
--- a/libtommath/bn_mp_count_bits.c
+++ b/libtommath/bn_mp_count_bits.c
@@ -1,4 +1,4 @@
-#include <tommath.h>
+#include <tommath_private.h>
#ifdef BN_MP_COUNT_BITS_C
/* LibTomMath, multiple-precision integer library -- Tom St Denis
*
@@ -12,7 +12,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tstdenis82@gmail.com, http://libtom.org
*/
/* returns the number of bits in an int */
@@ -40,6 +40,6 @@ mp_count_bits (mp_int * a)
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_count_bits.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtommath/bn_mp_div.c b/libtommath/bn_mp_div.c
index f4aa1aa..3ca5d7f 100644
--- a/libtommath/bn_mp_div.c
+++ b/libtommath/bn_mp_div.c
@@ -1,4 +1,4 @@
-#include <tommath.h>
+#include <tommath_private.h>
#ifdef BN_MP_DIV_C
/* LibTomMath, multiple-precision integer library -- Tom St Denis
*
@@ -12,7 +12,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tstdenis82@gmail.com, http://libtom.org
*/
#ifdef BN_MP_DIV_SMALL
@@ -24,7 +24,7 @@ int mp_div(mp_int * a, mp_int * b, mp_int * c, mp_int * d)
int res, n, n2;
/* is divisor zero ? */
- if (mp_iszero (b) == 1) {
+ if (mp_iszero (b) == MP_YES) {
return MP_VAL;
}
@@ -40,9 +40,9 @@ int mp_div(mp_int * a, mp_int * b, mp_int * c, mp_int * d)
}
return res;
}
-
+
/* init our temps */
- if ((res = mp_init_multi(&ta, &tb, &tq, &q, NULL) != MP_OKAY)) {
+ if ((res = mp_init_multi(&ta, &tb, &tq, &q, NULL)) != MP_OKAY) {
return res;
}
@@ -50,7 +50,7 @@ int mp_div(mp_int * a, mp_int * b, mp_int * c, mp_int * d)
mp_set(&tq, 1);
n = mp_count_bits(a) - mp_count_bits(b);
if (((res = mp_abs(a, &ta)) != MP_OKAY) ||
- ((res = mp_abs(b, &tb)) != MP_OKAY) ||
+ ((res = mp_abs(b, &tb)) != MP_OKAY) ||
((res = mp_mul_2d(&tb, n, &tb)) != MP_OKAY) ||
((res = mp_mul_2d(&tq, n, &tq)) != MP_OKAY)) {
goto LBL_ERR;
@@ -71,7 +71,7 @@ int mp_div(mp_int * a, mp_int * b, mp_int * c, mp_int * d)
/* now q == quotient and ta == remainder */
n = a->sign;
- n2 = (a->sign == b->sign ? MP_ZPOS : MP_NEG);
+ n2 = (a->sign == b->sign) ? MP_ZPOS : MP_NEG;
if (c != NULL) {
mp_exch(c, &q);
c->sign = (mp_iszero(c) == MP_YES) ? MP_ZPOS : n2;
@@ -87,17 +87,17 @@ LBL_ERR:
#else
-/* integer signed division.
+/* integer signed division.
* c*b + d == a [e.g. a/b, c=quotient, d=remainder]
* HAC pp.598 Algorithm 14.20
*
- * Note that the description in HAC is horribly
- * incomplete. For example, it doesn't consider
- * the case where digits are removed from 'x' in
- * the inner loop. It also doesn't consider the
+ * Note that the description in HAC is horribly
+ * incomplete. For example, it doesn't consider
+ * the case where digits are removed from 'x' in
+ * the inner loop. It also doesn't consider the
* case that y has fewer than three digits, etc..
*
- * The overall algorithm is as described as
+ * The overall algorithm is as described as
* 14.20 from HAC but fixed to treat these cases.
*/
int mp_div (mp_int * a, mp_int * b, mp_int * c, mp_int * d)
@@ -106,7 +106,7 @@ int mp_div (mp_int * a, mp_int * b, mp_int * c, mp_int * d)
int res, n, t, i, norm, neg;
/* is divisor zero ? */
- if (mp_iszero (b) == 1) {
+ if (mp_iszero (b) == MP_YES) {
return MP_VAL;
}
@@ -187,51 +187,52 @@ int mp_div (mp_int * a, mp_int * b, mp_int * c, mp_int * d)
continue;
}
- /* step 3.1 if xi == yt then set q{i-t-1} to b-1,
+ /* step 3.1 if xi == yt then set q{i-t-1} to b-1,
* otherwise set q{i-t-1} to (xi*b + x{i-1})/yt */
if (x.dp[i] == y.dp[t]) {
- q.dp[i - t - 1] = ((((mp_digit)1) << DIGIT_BIT) - 1);
+ q.dp[(i - t) - 1] = ((((mp_digit)1) << DIGIT_BIT) - 1);
} else {
mp_word tmp;
tmp = ((mp_word) x.dp[i]) << ((mp_word) DIGIT_BIT);
tmp |= ((mp_word) x.dp[i - 1]);
tmp /= ((mp_word) y.dp[t]);
- if (tmp > (mp_word) MP_MASK)
+ if (tmp > (mp_word) MP_MASK) {
tmp = MP_MASK;
- q.dp[i - t - 1] = (mp_digit) (tmp & (mp_word) (MP_MASK));
+ }
+ q.dp[(i - t) - 1] = (mp_digit) (tmp & (mp_word) (MP_MASK));
}
- /* while (q{i-t-1} * (yt * b + y{t-1})) >
- xi * b**2 + xi-1 * b + xi-2
-
- do q{i-t-1} -= 1;
+ /* while (q{i-t-1} * (yt * b + y{t-1})) >
+ xi * b**2 + xi-1 * b + xi-2
+
+ do q{i-t-1} -= 1;
*/
- q.dp[i - t - 1] = (q.dp[i - t - 1] + 1) & MP_MASK;
+ q.dp[(i - t) - 1] = (q.dp[(i - t) - 1] + 1) & MP_MASK;
do {
- q.dp[i - t - 1] = (q.dp[i - t - 1] - 1) & MP_MASK;
+ q.dp[(i - t) - 1] = (q.dp[(i - t) - 1] - 1) & MP_MASK;
/* find left hand */
mp_zero (&t1);
- t1.dp[0] = (t - 1 < 0) ? 0 : y.dp[t - 1];
+ t1.dp[0] = ((t - 1) < 0) ? 0 : y.dp[t - 1];
t1.dp[1] = y.dp[t];
t1.used = 2;
- if ((res = mp_mul_d (&t1, q.dp[i - t - 1], &t1)) != MP_OKAY) {
+ if ((res = mp_mul_d (&t1, q.dp[(i - t) - 1], &t1)) != MP_OKAY) {
goto LBL_Y;
}
/* find right hand */
- t2.dp[0] = (i - 2 < 0) ? 0 : x.dp[i - 2];
- t2.dp[1] = (i - 1 < 0) ? 0 : x.dp[i - 1];
+ t2.dp[0] = ((i - 2) < 0) ? 0 : x.dp[i - 2];
+ t2.dp[1] = ((i - 1) < 0) ? 0 : x.dp[i - 1];
t2.dp[2] = x.dp[i];
t2.used = 3;
} while (mp_cmp_mag(&t1, &t2) == MP_GT);
/* step 3.3 x = x - q{i-t-1} * y * b**{i-t-1} */
- if ((res = mp_mul_d (&y, q.dp[i - t - 1], &t1)) != MP_OKAY) {
+ if ((res = mp_mul_d (&y, q.dp[(i - t) - 1], &t1)) != MP_OKAY) {
goto LBL_Y;
}
- if ((res = mp_lshd (&t1, i - t - 1)) != MP_OKAY) {
+ if ((res = mp_lshd (&t1, (i - t) - 1)) != MP_OKAY) {
goto LBL_Y;
}
@@ -244,23 +245,23 @@ int mp_div (mp_int * a, mp_int * b, mp_int * c, mp_int * d)
if ((res = mp_copy (&y, &t1)) != MP_OKAY) {
goto LBL_Y;
}
- if ((res = mp_lshd (&t1, i - t - 1)) != MP_OKAY) {
+ if ((res = mp_lshd (&t1, (i - t) - 1)) != MP_OKAY) {
goto LBL_Y;
}
if ((res = mp_add (&x, &t1, &x)) != MP_OKAY) {
goto LBL_Y;
}
- q.dp[i - t - 1] = (q.dp[i - t - 1] - 1UL) & MP_MASK;
+ q.dp[(i - t) - 1] = (q.dp[(i - t) - 1] - 1UL) & MP_MASK;
}
}
- /* now q is the quotient and x is the remainder
- * [which we have to normalize]
+ /* now q is the quotient and x is the remainder
+ * [which we have to normalize]
*/
-
+
/* get sign before writing to c */
- x.sign = x.used == 0 ? MP_ZPOS : a->sign;
+ x.sign = (x.used == 0) ? MP_ZPOS : a->sign;
if (c != NULL) {
mp_clamp (&q);
@@ -270,8 +271,8 @@ int mp_div (mp_int * a, mp_int * b, mp_int * c, mp_int * d)
if (d != NULL) {
if ((res = mp_div_2d (&x, norm, &x, NULL)) != MP_OKAY) {
- goto LBL_Y;
- }
+ goto LBL_Y;
+ }
mp_exch (&x, d);
}
@@ -289,6 +290,6 @@ LBL_Q:mp_clear (&q);
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_div.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtommath/bn_mp_div_2.c b/libtommath/bn_mp_div_2.c
index 0035e56..d2a213f 100644
--- a/libtommath/bn_mp_div_2.c
+++ b/libtommath/bn_mp_div_2.c
@@ -1,4 +1,4 @@
-#include <tommath.h>
+#include <tommath_private.h>
#ifdef BN_MP_DIV_2_C
/* LibTomMath, multiple-precision integer library -- Tom St Denis
*
@@ -12,7 +12,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tstdenis82@gmail.com, http://libtom.org
*/
/* b = a/2 */
@@ -30,7 +30,7 @@ int mp_div_2(mp_int * a, mp_int * b)
oldused = b->used;
b->used = a->used;
{
- register mp_digit r, rr, *tmpa, *tmpb;
+ mp_digit r, rr, *tmpa, *tmpb;
/* source alias */
tmpa = a->dp + b->used - 1;
@@ -63,6 +63,6 @@ int mp_div_2(mp_int * a, mp_int * b)
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_div_2.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtommath/bn_mp_div_2d.c b/libtommath/bn_mp_div_2d.c
index 6c18d80..5b9fb48 100644
--- a/libtommath/bn_mp_div_2d.c
+++ b/libtommath/bn_mp_div_2d.c
@@ -1,4 +1,4 @@
-#include <tommath.h>
+#include <tommath_private.h>
#ifdef BN_MP_DIV_2D_C
/* LibTomMath, multiple-precision integer library -- Tom St Denis
*
@@ -12,7 +12,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tstdenis82@gmail.com, http://libtom.org
*/
/* shift right by a certain bit count (store quotient in c, optional remainder in d) */
@@ -58,7 +58,7 @@ int mp_div_2d (mp_int * a, int b, mp_int * c, mp_int * d)
/* shift any bit count < DIGIT_BIT */
D = (mp_digit) (b % DIGIT_BIT);
if (D != 0) {
- register mp_digit *tmpc, mask, shift;
+ mp_digit *tmpc, mask, shift;
/* mask */
mask = (((mp_digit)1) << D) - 1;
@@ -92,6 +92,6 @@ int mp_div_2d (mp_int * a, int b, mp_int * c, mp_int * d)
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_div_2d.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtommath/bn_mp_div_3.c b/libtommath/bn_mp_div_3.c
index c6090f4..c2b76fb 100644
--- a/libtommath/bn_mp_div_3.c
+++ b/libtommath/bn_mp_div_3.c
@@ -1,4 +1,4 @@
-#include <tommath.h>
+#include <tommath_private.h>
#ifdef BN_MP_DIV_3_C
/* LibTomMath, multiple-precision integer library -- Tom St Denis
*
@@ -12,7 +12,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tstdenis82@gmail.com, http://libtom.org
*/
/* divide by three (based on routine from MPI and the GMP manual) */
@@ -74,6 +74,6 @@ mp_div_3 (mp_int * a, mp_int *c, mp_digit * d)
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_div_3.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtommath/bn_mp_div_d.c b/libtommath/bn_mp_div_d.c
index 771aa6a..4df1d36 100644
--- a/libtommath/bn_mp_div_d.c
+++ b/libtommath/bn_mp_div_d.c
@@ -1,4 +1,4 @@
-#include <tommath.h>
+#include <tommath_private.h>
#ifdef BN_MP_DIV_D_C
/* LibTomMath, multiple-precision integer library -- Tom St Denis
*
@@ -12,14 +12,19 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tstdenis82@gmail.com, http://libtom.org
*/
static int s_is_power_of_two(mp_digit b, int *p)
{
int x;
- for (x = 1; x < DIGIT_BIT; x++) {
+ /* fast return if no power of two */
+ if ((b == 0) || ((b & (b-1)) != 0)) {
+ return 0;
+ }
+
+ for (x = 0; x < DIGIT_BIT; x++) {
if (b == (((mp_digit)1)<<x)) {
*p = x;
return 1;
@@ -42,7 +47,7 @@ int mp_div_d (mp_int * a, mp_digit b, mp_int * c, mp_digit * d)
}
/* quick outs */
- if (b == 1 || mp_iszero(a) == 1) {
+ if ((b == 1) || (mp_iszero(a) == MP_YES)) {
if (d != NULL) {
*d = 0;
}
@@ -105,6 +110,6 @@ int mp_div_d (mp_int * a, mp_digit b, mp_int * c, mp_digit * d)
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_div_d.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtommath/bn_mp_dr_is_modulus.c b/libtommath/bn_mp_dr_is_modulus.c
index e9223f3..599d929 100644
--- a/libtommath/bn_mp_dr_is_modulus.c
+++ b/libtommath/bn_mp_dr_is_modulus.c
@@ -1,4 +1,4 @@
-#include <tommath.h>
+#include <tommath_private.h>
#ifdef BN_MP_DR_IS_MODULUS_C
/* LibTomMath, multiple-precision integer library -- Tom St Denis
*
@@ -12,7 +12,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tstdenis82@gmail.com, http://libtom.org
*/
/* determines if a number is a valid DR modulus */
@@ -38,6 +38,6 @@ int mp_dr_is_modulus(mp_int *a)
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_dr_is_modulus.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtommath/bn_mp_dr_reduce.c b/libtommath/bn_mp_dr_reduce.c
index d2ef18f..2273c79 100644
--- a/libtommath/bn_mp_dr_reduce.c
+++ b/libtommath/bn_mp_dr_reduce.c
@@ -1,4 +1,4 @@
-#include <tommath.h>
+#include <tommath_private.h>
#ifdef BN_MP_DR_REDUCE_C
/* LibTomMath, multiple-precision integer library -- Tom St Denis
*
@@ -12,7 +12,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tstdenis82@gmail.com, http://libtom.org
*/
/* reduce "x" in place modulo "n" using the Diminished Radix algorithm.
@@ -40,7 +40,7 @@ mp_dr_reduce (mp_int * x, mp_int * n, mp_digit k)
m = n->used;
/* ensure that "x" has at least 2m digits */
- if (x->alloc < m + m) {
+ if (x->alloc < (m + m)) {
if ((err = mp_grow (x, m + m)) != MP_OKAY) {
return err;
}
@@ -62,7 +62,7 @@ top:
/* compute (x mod B**m) + k * [x/B**m] inline and inplace */
for (i = 0; i < m; i++) {
- r = ((mp_word)*tmpx2++) * ((mp_word)k) + *tmpx1 + mu;
+ r = (((mp_word)*tmpx2++) * (mp_word)k) + *tmpx1 + mu;
*tmpx1++ = (mp_digit)(r & MP_MASK);
mu = (mp_digit)(r >> ((mp_word)DIGIT_BIT));
}
@@ -82,13 +82,15 @@ top:
* Each successive "recursion" makes the input smaller and smaller.
*/
if (mp_cmp_mag (x, n) != MP_LT) {
- s_mp_sub(x, n, x);
+ if ((err = s_mp_sub(x, n, x)) != MP_OKAY) {
+ return err;
+ }
goto top;
}
return MP_OKAY;
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_dr_reduce.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtommath/bn_mp_dr_setup.c b/libtommath/bn_mp_dr_setup.c
index 3e82c9b..1bccb2b 100644
--- a/libtommath/bn_mp_dr_setup.c
+++ b/libtommath/bn_mp_dr_setup.c
@@ -1,4 +1,4 @@
-#include <tommath.h>
+#include <tommath_private.h>
#ifdef BN_MP_DR_SETUP_C
/* LibTomMath, multiple-precision integer library -- Tom St Denis
*
@@ -12,7 +12,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tstdenis82@gmail.com, http://libtom.org
*/
/* determines the setup value */
@@ -27,6 +27,6 @@ void mp_dr_setup(mp_int *a, mp_digit *d)
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_dr_setup.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtommath/bn_mp_exch.c b/libtommath/bn_mp_exch.c
index 81a42ac..634193b 100644
--- a/libtommath/bn_mp_exch.c
+++ b/libtommath/bn_mp_exch.c
@@ -1,4 +1,4 @@
-#include <tommath.h>
+#include <tommath_private.h>
#ifdef BN_MP_EXCH_C
/* LibTomMath, multiple-precision integer library -- Tom St Denis
*
@@ -12,7 +12,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tstdenis82@gmail.com, http://libtom.org
*/
/* swap the elements of two integers, for cases where you can't simply swap the
@@ -29,6 +29,6 @@ mp_exch (mp_int * a, mp_int * b)
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_exch.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtommath/bn_mp_export.c b/libtommath/bn_mp_export.c
new file mode 100644
index 0000000..2455fc5
--- /dev/null
+++ b/libtommath/bn_mp_export.c
@@ -0,0 +1,88 @@
+#include <tommath_private.h>
+#ifdef BN_MP_EXPORT_C
+/* LibTomMath, multiple-precision integer library -- Tom St Denis
+ *
+ * LibTomMath is a library that provides multiple-precision
+ * integer arithmetic as well as number theoretic functionality.
+ *
+ * The library was designed directly after the MPI library by
+ * Michael Fromberger but has been written from scratch with
+ * additional optimizations in place.
+ *
+ * The library is free for all purposes without any express
+ * guarantee it works.
+ *
+ * Tom St Denis, tstdenis82@gmail.com, http://libtom.org
+ */
+
+/* based on gmp's mpz_export.
+ * see http://gmplib.org/manual/Integer-Import-and-Export.html
+ */
+int mp_export(void* rop, size_t* countp, int order, size_t size,
+ int endian, size_t nails, mp_int* op) {
+ int result;
+ size_t odd_nails, nail_bytes, i, j, bits, count;
+ unsigned char odd_nail_mask;
+
+ mp_int t;
+
+ if ((result = mp_init_copy(&t, op)) != MP_OKAY) {
+ return result;
+ }
+
+ if (endian == 0) {
+ union {
+ unsigned int i;
+ char c[4];
+ } lint;
+ lint.i = 0x01020304;
+
+ endian = (lint.c[0] == 4) ? -1 : 1;
+ }
+
+ odd_nails = (nails % 8);
+ odd_nail_mask = 0xff;
+ for (i = 0; i < odd_nails; ++i) {
+ odd_nail_mask ^= (1 << (7 - i));
+ }
+ nail_bytes = nails / 8;
+
+ bits = mp_count_bits(&t);
+ count = (bits / ((size * 8) - nails)) + (((bits % ((size * 8) - nails)) != 0) ? 1 : 0);
+
+ for (i = 0; i < count; ++i) {
+ for (j = 0; j < size; ++j) {
+ unsigned char* byte = (
+ (unsigned char*)rop +
+ (((order == -1) ? i : ((count - 1) - i)) * size) +
+ ((endian == -1) ? j : ((size - 1) - j))
+ );
+
+ if (j >= (size - nail_bytes)) {
+ *byte = 0;
+ continue;
+ }
+
+ *byte = (unsigned char)((j == ((size - nail_bytes) - 1)) ? (t.dp[0] & odd_nail_mask) : (t.dp[0] & 0xFF));
+
+ if ((result = mp_div_2d(&t, ((j == ((size - nail_bytes) - 1)) ? (8 - odd_nails) : 8), &t, NULL)) != MP_OKAY) {
+ mp_clear(&t);
+ return result;
+ }
+ }
+ }
+
+ mp_clear(&t);
+
+ if (countp != NULL) {
+ *countp = count;
+ }
+
+ return MP_OKAY;
+}
+
+#endif
+
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtommath/bn_mp_expt_d.c b/libtommath/bn_mp_expt_d.c
index 656cf68..61c5a1d 100644
--- a/libtommath/bn_mp_expt_d.c
+++ b/libtommath/bn_mp_expt_d.c
@@ -1,4 +1,4 @@
-#include <tommath.h>
+#include <tommath_private.h>
#ifdef BN_MP_EXPT_D_C
/* LibTomMath, multiple-precision integer library -- Tom St Denis
*
@@ -12,46 +12,17 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tstdenis82@gmail.com, http://libtom.org
*/
-/* calculate c = a**b using a square-multiply algorithm */
+/* wrapper function for mp_expt_d_ex() */
int mp_expt_d (mp_int * a, mp_digit b, mp_int * c)
{
- int res, x;
- mp_int g;
-
- if ((res = mp_init_copy (&g, a)) != MP_OKAY) {
- return res;
- }
-
- /* set initial result */
- mp_set (c, 1);
-
- for (x = 0; x < (int) DIGIT_BIT; x++) {
- /* square */
- if ((res = mp_sqr (c, c)) != MP_OKAY) {
- mp_clear (&g);
- return res;
- }
-
- /* if the bit is set multiply */
- if ((b & (mp_digit) (((mp_digit)1) << (DIGIT_BIT - 1))) != 0) {
- if ((res = mp_mul (c, &g, c)) != MP_OKAY) {
- mp_clear (&g);
- return res;
- }
- }
-
- /* shift to next bit */
- b <<= 1;
- }
-
- mp_clear (&g);
- return MP_OKAY;
+ return mp_expt_d_ex(a, b, c, 0);
}
+
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_expt_d.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtommath/bn_mp_expt_d_ex.c b/libtommath/bn_mp_expt_d_ex.c
new file mode 100644
index 0000000..649d224
--- /dev/null
+++ b/libtommath/bn_mp_expt_d_ex.c
@@ -0,0 +1,83 @@
+#include <tommath_private.h>
+#ifdef BN_MP_EXPT_D_EX_C
+/* LibTomMath, multiple-precision integer library -- Tom St Denis
+ *
+ * LibTomMath is a library that provides multiple-precision
+ * integer arithmetic as well as number theoretic functionality.
+ *
+ * The library was designed directly after the MPI library by
+ * Michael Fromberger but has been written from scratch with
+ * additional optimizations in place.
+ *
+ * The library is free for all purposes without any express
+ * guarantee it works.
+ *
+ * Tom St Denis, tstdenis82@gmail.com, http://libtom.org
+ */
+
+/* calculate c = a**b using a square-multiply algorithm */
+int mp_expt_d_ex (mp_int * a, mp_digit b, mp_int * c, int fast)
+{
+ int res;
+ unsigned int x;
+
+ mp_int g;
+
+ if ((res = mp_init_copy (&g, a)) != MP_OKAY) {
+ return res;
+ }
+
+ /* set initial result */
+ mp_set (c, 1);
+
+ if (fast != 0) {
+ while (b > 0) {
+ /* if the bit is set multiply */
+ if ((b & 1) != 0) {
+ if ((res = mp_mul (c, &g, c)) != MP_OKAY) {
+ mp_clear (&g);
+ return res;
+ }
+ }
+
+ /* square */
+ if (b > 1) {
+ if ((res = mp_sqr (&g, &g)) != MP_OKAY) {
+ mp_clear (&g);
+ return res;
+ }
+ }
+
+ /* shift to next bit */
+ b >>= 1;
+ }
+ }
+ else {
+ for (x = 0; x < DIGIT_BIT; x++) {
+ /* square */
+ if ((res = mp_sqr (c, c)) != MP_OKAY) {
+ mp_clear (&g);
+ return res;
+ }
+
+ /* if the bit is set multiply */
+ if ((b & (mp_digit) (((mp_digit)1) << (DIGIT_BIT - 1))) != 0) {
+ if ((res = mp_mul (c, &g, c)) != MP_OKAY) {
+ mp_clear (&g);
+ return res;
+ }
+ }
+
+ /* shift to next bit */
+ b <<= 1;
+ }
+ } /* if ... else */
+
+ mp_clear (&g);
+ return MP_OKAY;
+}
+#endif
+
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtommath/bn_mp_exptmod.c b/libtommath/bn_mp_exptmod.c
index d72ab20..0973e44 100644
--- a/libtommath/bn_mp_exptmod.c
+++ b/libtommath/bn_mp_exptmod.c
@@ -1,4 +1,4 @@
-#include <tommath.h>
+#include <tommath_private.h>
#ifdef BN_MP_EXPTMOD_C
/* LibTomMath, multiple-precision integer library -- Tom St Denis
*
@@ -12,7 +12,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tstdenis82@gmail.com, http://libtom.org
*/
@@ -89,7 +89,7 @@ int mp_exptmod (mp_int * G, mp_int * X, mp_int * P, mp_int * Y)
/* if the modulus is odd or dr != 0 use the montgomery method */
#ifdef BN_MP_EXPTMOD_FAST_C
- if (mp_isodd (P) == 1 || dr != 0) {
+ if ((mp_isodd (P) == MP_YES) || (dr != 0)) {
return mp_exptmod_fast (G, X, P, Y, dr);
} else {
#endif
@@ -107,6 +107,6 @@ int mp_exptmod (mp_int * G, mp_int * X, mp_int * P, mp_int * Y)
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_exptmod.c,v $ */
-/* $Revision: 1.4 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtommath/bn_mp_exptmod_fast.c b/libtommath/bn_mp_exptmod_fast.c
index 47669f9..dad3d23 100644
--- a/libtommath/bn_mp_exptmod_fast.c
+++ b/libtommath/bn_mp_exptmod_fast.c
@@ -1,4 +1,4 @@
-#include <tommath.h>
+#include <tommath_private.h>
#ifdef BN_MP_EXPTMOD_FAST_C
/* LibTomMath, multiple-precision integer library -- Tom St Denis
*
@@ -12,7 +12,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tstdenis82@gmail.com, http://libtom.org
*/
/* computes Y == G**X mod P, HAC pp.616, Algorithm 14.85
@@ -96,8 +96,8 @@ int mp_exptmod_fast (mp_int * G, mp_int * X, mp_int * P, mp_int * Y, int redmode
/* automatically pick the comba one if available (saves quite a few calls/ifs) */
#ifdef BN_FAST_MP_MONTGOMERY_REDUCE_C
- if (((P->used * 2 + 1) < MP_WARRAY) &&
- P->used < (1 << ((CHAR_BIT * sizeof (mp_word)) - (2 * DIGIT_BIT)))) {
+ if ((((P->used * 2) + 1) < MP_WARRAY) &&
+ (P->used < (1 << ((CHAR_BIT * sizeof(mp_word)) - (2 * DIGIT_BIT))))) {
redux = fast_mp_montgomery_reduce;
} else
#endif
@@ -219,12 +219,12 @@ int mp_exptmod_fast (mp_int * G, mp_int * X, mp_int * P, mp_int * Y, int redmode
* in the exponent. Technically this opt is not required but it
* does lower the # of trivial squaring/reductions used
*/
- if (mode == 0 && y == 0) {
+ if ((mode == 0) && (y == 0)) {
continue;
}
/* if the bit is zero and mode == 1 then we square */
- if (mode == 1 && y == 0) {
+ if ((mode == 1) && (y == 0)) {
if ((err = mp_sqr (&res, &res)) != MP_OKAY) {
goto LBL_RES;
}
@@ -266,7 +266,7 @@ int mp_exptmod_fast (mp_int * G, mp_int * X, mp_int * P, mp_int * Y, int redmode
}
/* if bits remain then square/multiply */
- if (mode == 2 && bitcpy > 0) {
+ if ((mode == 2) && (bitcpy > 0)) {
/* square then multiply if the bit is set */
for (x = 0; x < bitcpy; x++) {
if ((err = mp_sqr (&res, &res)) != MP_OKAY) {
@@ -316,6 +316,6 @@ LBL_M:
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_exptmod_fast.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtommath/bn_mp_exteuclid.c b/libtommath/bn_mp_exteuclid.c
index f4f1c7b..fbbd92c 100644
--- a/libtommath/bn_mp_exteuclid.c
+++ b/libtommath/bn_mp_exteuclid.c
@@ -1,4 +1,4 @@
-#include <tommath.h>
+#include <tommath_private.h>
#ifdef BN_MP_EXTEUCLID_C
/* LibTomMath, multiple-precision integer library -- Tom St Denis
*
@@ -12,10 +12,10 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tstdenis82@gmail.com, http://libtom.org
*/
-/* Extended euclidean algorithm of (a, b) produces
+/* Extended euclidean algorithm of (a, b) produces
a*u1 + b*u2 = u3
*/
int mp_exteuclid(mp_int *a, mp_int *b, mp_int *U1, mp_int *U2, mp_int *U3)
@@ -29,41 +29,41 @@ int mp_exteuclid(mp_int *a, mp_int *b, mp_int *U1, mp_int *U2, mp_int *U3)
/* initialize, (u1,u2,u3) = (1,0,a) */
mp_set(&u1, 1);
- if ((err = mp_copy(a, &u3)) != MP_OKAY) { goto LBL_ERR; }
+ if ((err = mp_copy(a, &u3)) != MP_OKAY) { goto _ERR; }
/* initialize, (v1,v2,v3) = (0,1,b) */
mp_set(&v2, 1);
- if ((err = mp_copy(b, &v3)) != MP_OKAY) { goto LBL_ERR; }
+ if ((err = mp_copy(b, &v3)) != MP_OKAY) { goto _ERR; }
/* loop while v3 != 0 */
while (mp_iszero(&v3) == MP_NO) {
/* q = u3/v3 */
- if ((err = mp_div(&u3, &v3, &q, NULL)) != MP_OKAY) { goto LBL_ERR; }
+ if ((err = mp_div(&u3, &v3, &q, NULL)) != MP_OKAY) { goto _ERR; }
/* (t1,t2,t3) = (u1,u2,u3) - (v1,v2,v3)q */
- if ((err = mp_mul(&v1, &q, &tmp)) != MP_OKAY) { goto LBL_ERR; }
- if ((err = mp_sub(&u1, &tmp, &t1)) != MP_OKAY) { goto LBL_ERR; }
- if ((err = mp_mul(&v2, &q, &tmp)) != MP_OKAY) { goto LBL_ERR; }
- if ((err = mp_sub(&u2, &tmp, &t2)) != MP_OKAY) { goto LBL_ERR; }
- if ((err = mp_mul(&v3, &q, &tmp)) != MP_OKAY) { goto LBL_ERR; }
- if ((err = mp_sub(&u3, &tmp, &t3)) != MP_OKAY) { goto LBL_ERR; }
+ if ((err = mp_mul(&v1, &q, &tmp)) != MP_OKAY) { goto _ERR; }
+ if ((err = mp_sub(&u1, &tmp, &t1)) != MP_OKAY) { goto _ERR; }
+ if ((err = mp_mul(&v2, &q, &tmp)) != MP_OKAY) { goto _ERR; }
+ if ((err = mp_sub(&u2, &tmp, &t2)) != MP_OKAY) { goto _ERR; }
+ if ((err = mp_mul(&v3, &q, &tmp)) != MP_OKAY) { goto _ERR; }
+ if ((err = mp_sub(&u3, &tmp, &t3)) != MP_OKAY) { goto _ERR; }
/* (u1,u2,u3) = (v1,v2,v3) */
- if ((err = mp_copy(&v1, &u1)) != MP_OKAY) { goto LBL_ERR; }
- if ((err = mp_copy(&v2, &u2)) != MP_OKAY) { goto LBL_ERR; }
- if ((err = mp_copy(&v3, &u3)) != MP_OKAY) { goto LBL_ERR; }
+ if ((err = mp_copy(&v1, &u1)) != MP_OKAY) { goto _ERR; }
+ if ((err = mp_copy(&v2, &u2)) != MP_OKAY) { goto _ERR; }
+ if ((err = mp_copy(&v3, &u3)) != MP_OKAY) { goto _ERR; }
/* (v1,v2,v3) = (t1,t2,t3) */
- if ((err = mp_copy(&t1, &v1)) != MP_OKAY) { goto LBL_ERR; }
- if ((err = mp_copy(&t2, &v2)) != MP_OKAY) { goto LBL_ERR; }
- if ((err = mp_copy(&t3, &v3)) != MP_OKAY) { goto LBL_ERR; }
+ if ((err = mp_copy(&t1, &v1)) != MP_OKAY) { goto _ERR; }
+ if ((err = mp_copy(&t2, &v2)) != MP_OKAY) { goto _ERR; }
+ if ((err = mp_copy(&t3, &v3)) != MP_OKAY) { goto _ERR; }
}
/* make sure U3 >= 0 */
if (u3.sign == MP_NEG) {
- mp_neg(&u1, &u1);
- mp_neg(&u2, &u2);
- mp_neg(&u3, &u3);
+ if ((err = mp_neg(&u1, &u1)) != MP_OKAY) { goto _ERR; }
+ if ((err = mp_neg(&u2, &u2)) != MP_OKAY) { goto _ERR; }
+ if ((err = mp_neg(&u3, &u3)) != MP_OKAY) { goto _ERR; }
}
/* copy result out */
@@ -72,12 +72,11 @@ int mp_exteuclid(mp_int *a, mp_int *b, mp_int *U1, mp_int *U2, mp_int *U3)
if (U3 != NULL) { mp_exch(U3, &u3); }
err = MP_OKAY;
-LBL_ERR:
- mp_clear_multi(&u1, &u2, &u3, &v1, &v2, &v3, &t1, &t2, &t3, &q, &tmp, NULL);
+_ERR: mp_clear_multi(&u1, &u2, &u3, &v1, &v2, &v3, &t1, &t2, &t3, &q, &tmp, NULL);
return err;
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_exteuclid.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtommath/bn_mp_fread.c b/libtommath/bn_mp_fread.c
index c3bd08d..a4fa8c9 100644
--- a/libtommath/bn_mp_fread.c
+++ b/libtommath/bn_mp_fread.c
@@ -1,4 +1,4 @@
-#include <tommath.h>
+#include <tommath_private.h>
#ifdef BN_MP_FREAD_C
/* LibTomMath, multiple-precision integer library -- Tom St Denis
*
@@ -12,7 +12,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tstdenis82@gmail.com, http://libtom.org
*/
/* read a bigint from a file stream in ASCII */
@@ -62,6 +62,6 @@ int mp_fread(mp_int *a, int radix, FILE *stream)
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_fread.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtommath/bn_mp_fwrite.c b/libtommath/bn_mp_fwrite.c
index 006f923..90f1fc5 100644
--- a/libtommath/bn_mp_fwrite.c
+++ b/libtommath/bn_mp_fwrite.c
@@ -1,4 +1,4 @@
-#include <tommath.h>
+#include <tommath_private.h>
#ifdef BN_MP_FWRITE_C
/* LibTomMath, multiple-precision integer library -- Tom St Denis
*
@@ -12,7 +12,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tstdenis82@gmail.com, http://libtom.org
*/
int mp_fwrite(mp_int *a, int radix, FILE *stream)
@@ -47,6 +47,6 @@ int mp_fwrite(mp_int *a, int radix, FILE *stream)
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_fwrite.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtommath/bn_mp_gcd.c b/libtommath/bn_mp_gcd.c
index 23f6b02..16acfd9 100644
--- a/libtommath/bn_mp_gcd.c
+++ b/libtommath/bn_mp_gcd.c
@@ -1,4 +1,4 @@
-#include <tommath.h>
+#include <tommath_private.h>
#ifdef BN_MP_GCD_C
/* LibTomMath, multiple-precision integer library -- Tom St Denis
*
@@ -12,7 +12,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tstdenis82@gmail.com, http://libtom.org
*/
/* Greatest Common Divisor using the binary method */
@@ -70,7 +70,7 @@ int mp_gcd (mp_int * a, mp_int * b, mp_int * c)
}
}
- while (mp_iszero(&v) == 0) {
+ while (mp_iszero(&v) == MP_NO) {
/* make sure v is the largest */
if (mp_cmp_mag(&u, &v) == MP_GT) {
/* swap u and v to make sure v is >= u */
@@ -100,6 +100,6 @@ LBL_U:mp_clear (&v);
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_gcd.c,v $ */
-/* $Revision: 1.4 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtommath/bn_mp_get_int.c b/libtommath/bn_mp_get_int.c
index 7948d46..99fb850 100644
--- a/libtommath/bn_mp_get_int.c
+++ b/libtommath/bn_mp_get_int.c
@@ -1,4 +1,4 @@
-#include <tommath.h>
+#include <tommath_private.h>
#ifdef BN_MP_GET_INT_C
/* LibTomMath, multiple-precision integer library -- Tom St Denis
*
@@ -12,25 +12,25 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tstdenis82@gmail.com, http://libtom.org
*/
/* get the lower 32-bits of an mp_int */
-unsigned long mp_get_int(mp_int * a)
+unsigned long mp_get_int(mp_int * a)
{
int i;
- unsigned long res;
+ mp_min_u32 res;
if (a->used == 0) {
return 0;
}
/* get number of digits of the lsb we have to read */
- i = MIN(a->used,(int)((sizeof(unsigned long)*CHAR_BIT+DIGIT_BIT-1)/DIGIT_BIT))-1;
+ i = MIN(a->used,(int)(((sizeof(unsigned long) * CHAR_BIT) + DIGIT_BIT - 1) / DIGIT_BIT)) - 1;
/* get most significant digit of result */
res = DIGIT(a,i);
-
+
while (--i >= 0) {
res = (res << DIGIT_BIT) | DIGIT(a,i);
}
@@ -40,6 +40,6 @@ unsigned long mp_get_int(mp_int * a)
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_get_int.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtommath/bn_mp_get_long.c b/libtommath/bn_mp_get_long.c
new file mode 100644
index 0000000..7c3d0fe
--- /dev/null
+++ b/libtommath/bn_mp_get_long.c
@@ -0,0 +1,41 @@
+#include <tommath_private.h>
+#ifdef BN_MP_GET_LONG_C
+/* LibTomMath, multiple-precision integer library -- Tom St Denis
+ *
+ * LibTomMath is a library that provides multiple-precision
+ * integer arithmetic as well as number theoretic functionality.
+ *
+ * The library was designed directly after the MPI library by
+ * Michael Fromberger but has been written from scratch with
+ * additional optimizations in place.
+ *
+ * The library is free for all purposes without any express
+ * guarantee it works.
+ *
+ * Tom St Denis, tstdenis82@gmail.com, http://libtom.org
+ */
+
+/* get the lower unsigned long of an mp_int, platform dependent */
+unsigned long mp_get_long(mp_int * a)
+{
+ int i;
+ unsigned long res;
+
+ if (a->used == 0) {
+ return 0;
+ }
+
+ /* get number of digits of the lsb we have to read */
+ i = MIN(a->used,(int)(((sizeof(unsigned long) * CHAR_BIT) + DIGIT_BIT - 1) / DIGIT_BIT)) - 1;
+
+ /* get most significant digit of result */
+ res = DIGIT(a,i);
+
+#if (ULONG_MAX != 0xffffffffuL) || (DIGIT_BIT < 32)
+ while (--i >= 0) {
+ res = (res << DIGIT_BIT) | DIGIT(a,i);
+ }
+#endif
+ return res;
+}
+#endif
diff --git a/libtommath/bn_mp_get_long_long.c b/libtommath/bn_mp_get_long_long.c
new file mode 100644
index 0000000..4b959e6
--- /dev/null
+++ b/libtommath/bn_mp_get_long_long.c
@@ -0,0 +1,41 @@
+#include <tommath_private.h>
+#ifdef BN_MP_GET_LONG_LONG_C
+/* LibTomMath, multiple-precision integer library -- Tom St Denis
+ *
+ * LibTomMath is a library that provides multiple-precision
+ * integer arithmetic as well as number theoretic functionality.
+ *
+ * The library was designed directly after the MPI library by
+ * Michael Fromberger but has been written from scratch with
+ * additional optimizations in place.
+ *
+ * The library is free for all purposes without any express
+ * guarantee it works.
+ *
+ * Tom St Denis, tstdenis82@gmail.com, http://libtom.org
+ */
+
+/* get the lower unsigned long long of an mp_int, platform dependent */
+unsigned long long mp_get_long_long (mp_int * a)
+{
+ int i;
+ unsigned long long res;
+
+ if (a->used == 0) {
+ return 0;
+ }
+
+ /* get number of digits of the lsb we have to read */
+ i = MIN(a->used,(int)(((sizeof(unsigned long long) * CHAR_BIT) + DIGIT_BIT - 1) / DIGIT_BIT)) - 1;
+
+ /* get most significant digit of result */
+ res = DIGIT(a,i);
+
+#if DIGIT_BIT < 64
+ while (--i >= 0) {
+ res = (res << DIGIT_BIT) | DIGIT(a,i);
+ }
+#endif
+ return res;
+}
+#endif
diff --git a/libtommath/bn_mp_grow.c b/libtommath/bn_mp_grow.c
index 2d50058..cbdcfed 100644
--- a/libtommath/bn_mp_grow.c
+++ b/libtommath/bn_mp_grow.c
@@ -1,4 +1,4 @@
-#include <tommath.h>
+#include <tommath_private.h>
#ifdef BN_MP_GROW_C
/* LibTomMath, multiple-precision integer library -- Tom St Denis
*
@@ -12,7 +12,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tstdenis82@gmail.com, http://libtom.org
*/
/* grow as required */
@@ -52,6 +52,6 @@ int mp_grow (mp_int * a, int size)
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_grow.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtommath/bn_mp_import.c b/libtommath/bn_mp_import.c
new file mode 100644
index 0000000..ca2a5e9
--- /dev/null
+++ b/libtommath/bn_mp_import.c
@@ -0,0 +1,73 @@
+#include <tommath_private.h>
+#ifdef BN_MP_IMPORT_C
+/* LibTomMath, multiple-precision integer library -- Tom St Denis
+ *
+ * LibTomMath is a library that provides multiple-precision
+ * integer arithmetic as well as number theoretic functionality.
+ *
+ * The library was designed directly after the MPI library by
+ * Michael Fromberger but has been written from scratch with
+ * additional optimizations in place.
+ *
+ * The library is free for all purposes without any express
+ * guarantee it works.
+ *
+ * Tom St Denis, tstdenis82@gmail.com, http://libtom.org
+ */
+
+/* based on gmp's mpz_import.
+ * see http://gmplib.org/manual/Integer-Import-and-Export.html
+ */
+int mp_import(mp_int* rop, size_t count, int order, size_t size,
+ int endian, size_t nails, const void* op) {
+ int result;
+ size_t odd_nails, nail_bytes, i, j;
+ unsigned char odd_nail_mask;
+
+ mp_zero(rop);
+
+ if (endian == 0) {
+ union {
+ unsigned int i;
+ char c[4];
+ } lint;
+ lint.i = 0x01020304;
+
+ endian = (lint.c[0] == 4) ? -1 : 1;
+ }
+
+ odd_nails = (nails % 8);
+ odd_nail_mask = 0xff;
+ for (i = 0; i < odd_nails; ++i) {
+ odd_nail_mask ^= (1 << (7 - i));
+ }
+ nail_bytes = nails / 8;
+
+ for (i = 0; i < count; ++i) {
+ for (j = 0; j < (size - nail_bytes); ++j) {
+ unsigned char byte = *(
+ (unsigned char*)op +
+ (((order == 1) ? i : ((count - 1) - i)) * size) +
+ ((endian == 1) ? (j + nail_bytes) : (((size - 1) - j) - nail_bytes))
+ );
+
+ if (
+ (result = mp_mul_2d(rop, ((j == 0) ? (8 - odd_nails) : 8), rop)) != MP_OKAY) {
+ return result;
+ }
+
+ rop->dp[0] |= (j == 0) ? (byte & odd_nail_mask) : byte;
+ rop->used += 1;
+ }
+ }
+
+ mp_clamp(rop);
+
+ return MP_OKAY;
+}
+
+#endif
+
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtommath/bn_mp_init.c b/libtommath/bn_mp_init.c
index 565ea47..7a57730 100644
--- a/libtommath/bn_mp_init.c
+++ b/libtommath/bn_mp_init.c
@@ -1,4 +1,4 @@
-#include <tommath.h>
+#include <tommath_private.h>
#ifdef BN_MP_INIT_C
/* LibTomMath, multiple-precision integer library -- Tom St Denis
*
@@ -12,7 +12,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tstdenis82@gmail.com, http://libtom.org
*/
/* init a new mp_int */
@@ -41,6 +41,6 @@ int mp_init (mp_int * a)
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_init.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtommath/bn_mp_init_copy.c b/libtommath/bn_mp_init_copy.c
index 1fca6a1..9e15f36 100644
--- a/libtommath/bn_mp_init_copy.c
+++ b/libtommath/bn_mp_init_copy.c
@@ -1,4 +1,4 @@
-#include <tommath.h>
+#include <tommath_private.h>
#ifdef BN_MP_INIT_COPY_C
/* LibTomMath, multiple-precision integer library -- Tom St Denis
*
@@ -12,7 +12,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tstdenis82@gmail.com, http://libtom.org
*/
/* creates "a" then copies b into it */
@@ -27,6 +27,6 @@ int mp_init_copy (mp_int * a, mp_int * b)
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_init_copy.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtommath/bn_mp_init_multi.c b/libtommath/bn_mp_init_multi.c
index d592f43..52220a3 100644
--- a/libtommath/bn_mp_init_multi.c
+++ b/libtommath/bn_mp_init_multi.c
@@ -1,4 +1,4 @@
-#include <tommath.h>
+#include <tommath_private.h>
#ifdef BN_MP_INIT_MULTI_C
/* LibTomMath, multiple-precision integer library -- Tom St Denis
*
@@ -12,7 +12,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tstdenis82@gmail.com, http://libtom.org
*/
#include <stdarg.h>
@@ -37,7 +37,7 @@ int mp_init_multi(mp_int *mp, ...)
/* now start cleaning up */
cur_arg = mp;
va_start(clean_args, mp);
- while (n--) {
+ while (n-- != 0) {
mp_clear(cur_arg);
cur_arg = va_arg(clean_args, mp_int*);
}
@@ -54,6 +54,6 @@ int mp_init_multi(mp_int *mp, ...)
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_init_multi.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtommath/bn_mp_init_set.c b/libtommath/bn_mp_init_set.c
index a7ee8f7..c337e50 100644
--- a/libtommath/bn_mp_init_set.c
+++ b/libtommath/bn_mp_init_set.c
@@ -1,4 +1,4 @@
-#include <tommath.h>
+#include <tommath_private.h>
#ifdef BN_MP_INIT_SET_C
/* LibTomMath, multiple-precision integer library -- Tom St Denis
*
@@ -12,7 +12,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tstdenis82@gmail.com, http://libtom.org
*/
/* initialize and set a digit */
@@ -27,6 +27,6 @@ int mp_init_set (mp_int * a, mp_digit b)
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_init_set.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtommath/bn_mp_init_set_int.c b/libtommath/bn_mp_init_set_int.c
index 7c9dd46..c88f14e 100644
--- a/libtommath/bn_mp_init_set_int.c
+++ b/libtommath/bn_mp_init_set_int.c
@@ -1,4 +1,4 @@
-#include <tommath.h>
+#include <tommath_private.h>
#ifdef BN_MP_INIT_SET_INT_C
/* LibTomMath, multiple-precision integer library -- Tom St Denis
*
@@ -12,7 +12,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tstdenis82@gmail.com, http://libtom.org
*/
/* initialize and set a digit */
@@ -26,6 +26,6 @@ int mp_init_set_int (mp_int * a, unsigned long b)
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_init_set_int.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtommath/bn_mp_init_size.c b/libtommath/bn_mp_init_size.c
index 4aebd1f..e1d1b51 100644
--- a/libtommath/bn_mp_init_size.c
+++ b/libtommath/bn_mp_init_size.c
@@ -1,4 +1,4 @@
-#include <tommath.h>
+#include <tommath_private.h>
#ifdef BN_MP_INIT_SIZE_C
/* LibTomMath, multiple-precision integer library -- Tom St Denis
*
@@ -12,7 +12,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tstdenis82@gmail.com, http://libtom.org
*/
/* init an mp_init for a given size */
@@ -43,6 +43,6 @@ int mp_init_size (mp_int * a, int size)
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_init_size.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtommath/bn_mp_invmod.c b/libtommath/bn_mp_invmod.c
index 3f5791f..44951e5 100644
--- a/libtommath/bn_mp_invmod.c
+++ b/libtommath/bn_mp_invmod.c
@@ -1,4 +1,4 @@
-#include <tommath.h>
+#include <tommath_private.h>
#ifdef BN_MP_INVMOD_C
/* LibTomMath, multiple-precision integer library -- Tom St Denis
*
@@ -12,32 +12,32 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tstdenis82@gmail.com, http://libtom.org
*/
/* hac 14.61, pp608 */
int mp_invmod (mp_int * a, mp_int * b, mp_int * c)
{
/* b cannot be negative */
- if (b->sign == MP_NEG || mp_iszero(b) == 1) {
+ if ((b->sign == MP_NEG) || (mp_iszero(b) == MP_YES)) {
return MP_VAL;
}
#ifdef BN_FAST_MP_INVMOD_C
/* if the modulus is odd we can use a faster routine instead */
- if (mp_isodd (b) == 1) {
+ if (mp_isodd (b) == MP_YES) {
return fast_mp_invmod (a, b, c);
}
#endif
#ifdef BN_MP_INVMOD_SLOW_C
return mp_invmod_slow(a, b, c);
-#endif
-
+#else
return MP_VAL;
+#endif
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_invmod.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtommath/bn_mp_invmod_slow.c b/libtommath/bn_mp_invmod_slow.c
index a4e4fbc..a21f947 100644
--- a/libtommath/bn_mp_invmod_slow.c
+++ b/libtommath/bn_mp_invmod_slow.c
@@ -1,4 +1,4 @@
-#include <tommath.h>
+#include <tommath_private.h>
#ifdef BN_MP_INVMOD_SLOW_C
/* LibTomMath, multiple-precision integer library -- Tom St Denis
*
@@ -12,7 +12,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tstdenis82@gmail.com, http://libtom.org
*/
/* hac 14.61, pp608 */
@@ -22,7 +22,7 @@ int mp_invmod_slow (mp_int * a, mp_int * b, mp_int * c)
int res;
/* b cannot be negative */
- if (b->sign == MP_NEG || mp_iszero(b) == 1) {
+ if ((b->sign == MP_NEG) || (mp_iszero(b) == MP_YES)) {
return MP_VAL;
}
@@ -41,7 +41,7 @@ int mp_invmod_slow (mp_int * a, mp_int * b, mp_int * c)
}
/* 2. [modified] if x,y are both even then return an error! */
- if (mp_iseven (&x) == 1 && mp_iseven (&y) == 1) {
+ if ((mp_iseven (&x) == MP_YES) && (mp_iseven (&y) == MP_YES)) {
res = MP_VAL;
goto LBL_ERR;
}
@@ -58,13 +58,13 @@ int mp_invmod_slow (mp_int * a, mp_int * b, mp_int * c)
top:
/* 4. while u is even do */
- while (mp_iseven (&u) == 1) {
+ while (mp_iseven (&u) == MP_YES) {
/* 4.1 u = u/2 */
if ((res = mp_div_2 (&u, &u)) != MP_OKAY) {
goto LBL_ERR;
}
/* 4.2 if A or B is odd then */
- if (mp_isodd (&A) == 1 || mp_isodd (&B) == 1) {
+ if ((mp_isodd (&A) == MP_YES) || (mp_isodd (&B) == MP_YES)) {
/* A = (A+y)/2, B = (B-x)/2 */
if ((res = mp_add (&A, &y, &A)) != MP_OKAY) {
goto LBL_ERR;
@@ -83,13 +83,13 @@ top:
}
/* 5. while v is even do */
- while (mp_iseven (&v) == 1) {
+ while (mp_iseven (&v) == MP_YES) {
/* 5.1 v = v/2 */
if ((res = mp_div_2 (&v, &v)) != MP_OKAY) {
goto LBL_ERR;
}
/* 5.2 if C or D is odd then */
- if (mp_isodd (&C) == 1 || mp_isodd (&D) == 1) {
+ if ((mp_isodd (&C) == MP_YES) || (mp_isodd (&D) == MP_YES)) {
/* C = (C+y)/2, D = (D-x)/2 */
if ((res = mp_add (&C, &y, &C)) != MP_OKAY) {
goto LBL_ERR;
@@ -137,7 +137,7 @@ top:
}
/* if not zero goto step 4 */
- if (mp_iszero (&u) == 0)
+ if (mp_iszero (&u) == MP_NO)
goto top;
/* now a = C, b = D, gcd == g*v */
@@ -170,6 +170,6 @@ LBL_ERR:mp_clear_multi (&x, &y, &u, &v, &A, &B, &C, &D, NULL);
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_invmod_slow.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtommath/bn_mp_is_square.c b/libtommath/bn_mp_is_square.c
index a235d97..9f065ef 100644
--- a/libtommath/bn_mp_is_square.c
+++ b/libtommath/bn_mp_is_square.c
@@ -1,4 +1,4 @@
-#include <tommath.h>
+#include <tommath_private.h>
#ifdef BN_MP_IS_SQUARE_C
/* LibTomMath, multiple-precision integer library -- Tom St Denis
*
@@ -12,7 +12,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tstdenis82@gmail.com, http://libtom.org
*/
/* Check if remainders are possible squares - fast exclude non-squares */
@@ -82,13 +82,13 @@ int mp_is_square(mp_int *arg,int *ret)
* free "t" so the easiest way is to goto ERR. We know that res
* is already equal to MP_OKAY from the mp_mod call
*/
- if ( (1L<<(r%11)) & 0x5C4L ) goto ERR;
- if ( (1L<<(r%13)) & 0x9E4L ) goto ERR;
- if ( (1L<<(r%17)) & 0x5CE8L ) goto ERR;
- if ( (1L<<(r%19)) & 0x4F50CL ) goto ERR;
- if ( (1L<<(r%23)) & 0x7ACCA0L ) goto ERR;
- if ( (1L<<(r%29)) & 0xC2EDD0CL ) goto ERR;
- if ( (1L<<(r%31)) & 0x6DE2B848L ) goto ERR;
+ if (((1L<<(r%11)) & 0x5C4L) != 0L) goto ERR;
+ if (((1L<<(r%13)) & 0x9E4L) != 0L) goto ERR;
+ if (((1L<<(r%17)) & 0x5CE8L) != 0L) goto ERR;
+ if (((1L<<(r%19)) & 0x4F50CL) != 0L) goto ERR;
+ if (((1L<<(r%23)) & 0x7ACCA0L) != 0L) goto ERR;
+ if (((1L<<(r%29)) & 0xC2EDD0CL) != 0L) goto ERR;
+ if (((1L<<(r%31)) & 0x6DE2B848L) != 0L) goto ERR;
/* Final check - is sqr(sqrt(arg)) == arg ? */
if ((res = mp_sqrt(arg,&t)) != MP_OKAY) {
@@ -104,6 +104,6 @@ ERR:mp_clear(&t);
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_is_square.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtommath/bn_mp_jacobi.c b/libtommath/bn_mp_jacobi.c
index 2e88fd4..3c114e3 100644
--- a/libtommath/bn_mp_jacobi.c
+++ b/libtommath/bn_mp_jacobi.c
@@ -1,4 +1,4 @@
-#include <tommath.h>
+#include <tommath_private.h>
#ifdef BN_MP_JACOBI_C
/* LibTomMath, multiple-precision integer library -- Tom St Denis
*
@@ -12,27 +12,39 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tstdenis82@gmail.com, http://libtom.org
*/
/* computes the jacobi c = (a | n) (or Legendre if n is prime)
* HAC pp. 73 Algorithm 2.149
+ * HAC is wrong here, as the special case of (0 | 1) is not
+ * handled correctly.
*/
-int mp_jacobi (mp_int * a, mp_int * p, int *c)
+int mp_jacobi (mp_int * a, mp_int * n, int *c)
{
mp_int a1, p1;
int k, s, r, res;
mp_digit residue;
- /* if p <= 0 return MP_VAL */
- if (mp_cmp_d(p, 0) != MP_GT) {
+ /* if a < 0 return MP_VAL */
+ if (mp_isneg(a) == MP_YES) {
return MP_VAL;
}
- /* step 1. if a == 0, return 0 */
- if (mp_iszero (a) == 1) {
- *c = 0;
- return MP_OKAY;
+ /* if n <= 0 return MP_VAL */
+ if (mp_cmp_d(n, 0) != MP_GT) {
+ return MP_VAL;
+ }
+
+ /* step 1. handle case of a == 0 */
+ if (mp_iszero (a) == MP_YES) {
+ /* special case of a == 0 and n == 1 */
+ if (mp_cmp_d (n, 1) == MP_EQ) {
+ *c = 1;
+ } else {
+ *c = 0;
+ }
+ return MP_OKAY;
}
/* step 2. if a == 1, return 1 */
@@ -64,17 +76,17 @@ int mp_jacobi (mp_int * a, mp_int * p, int *c)
s = 1;
} else {
/* else set s=1 if p = 1/7 (mod 8) or s=-1 if p = 3/5 (mod 8) */
- residue = p->dp[0] & 7;
+ residue = n->dp[0] & 7;
- if (residue == 1 || residue == 7) {
+ if ((residue == 1) || (residue == 7)) {
s = 1;
- } else if (residue == 3 || residue == 5) {
+ } else if ((residue == 3) || (residue == 5)) {
s = -1;
}
}
/* step 5. if p == 3 (mod 4) *and* a1 == 3 (mod 4) then s = -s */
- if ( ((p->dp[0] & 3) == 3) && ((a1.dp[0] & 3) == 3)) {
+ if ( ((n->dp[0] & 3) == 3) && ((a1.dp[0] & 3) == 3)) {
s = -s;
}
@@ -83,7 +95,7 @@ int mp_jacobi (mp_int * a, mp_int * p, int *c)
*c = s;
} else {
/* n1 = n mod a1 */
- if ((res = mp_mod (p, &a1, &p1)) != MP_OKAY) {
+ if ((res = mp_mod (n, &a1, &p1)) != MP_OKAY) {
goto LBL_P1;
}
if ((res = mp_jacobi (&p1, &a1, &r)) != MP_OKAY) {
@@ -100,6 +112,6 @@ LBL_A1:mp_clear (&a1);
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_jacobi.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtommath/bn_mp_karatsuba_mul.c b/libtommath/bn_mp_karatsuba_mul.c
index 35dc9a4..d65e37e 100644
--- a/libtommath/bn_mp_karatsuba_mul.c
+++ b/libtommath/bn_mp_karatsuba_mul.c
@@ -1,4 +1,4 @@
-#include <tommath.h>
+#include <tommath_private.h>
#ifdef BN_MP_KARATSUBA_MUL_C
/* LibTomMath, multiple-precision integer library -- Tom St Denis
*
@@ -12,7 +12,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tstdenis82@gmail.com, http://libtom.org
*/
/* c = |a| * |b| using Karatsuba Multiplication using
@@ -82,8 +82,8 @@ int mp_karatsuba_mul (mp_int * a, mp_int * b, mp_int * c)
y1.used = b->used - B;
{
- register int x;
- register mp_digit *tmpa, *tmpb, *tmpx, *tmpy;
+ int x;
+ mp_digit *tmpa, *tmpb, *tmpx, *tmpy;
/* we copy the digits directly instead of using higher level functions
* since we also need to shift the digits
@@ -162,6 +162,6 @@ ERR:
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_karatsuba_mul.c,v $ */
-/* $Revision: 1.5 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtommath/bn_mp_karatsuba_sqr.c b/libtommath/bn_mp_karatsuba_sqr.c
index 6d8ad6e..739840d 100644
--- a/libtommath/bn_mp_karatsuba_sqr.c
+++ b/libtommath/bn_mp_karatsuba_sqr.c
@@ -1,4 +1,4 @@
-#include <tommath.h>
+#include <tommath_private.h>
#ifdef BN_MP_KARATSUBA_SQR_C
/* LibTomMath, multiple-precision integer library -- Tom St Denis
*
@@ -12,7 +12,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tstdenis82@gmail.com, http://libtom.org
*/
/* Karatsuba squaring, computes b = a*a using three
@@ -52,8 +52,8 @@ int mp_karatsuba_sqr (mp_int * a, mp_int * b)
goto X0X0;
{
- register int x;
- register mp_digit *dst, *src;
+ int x;
+ mp_digit *dst, *src;
src = a->dp;
@@ -116,6 +116,6 @@ ERR:
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_karatsuba_sqr.c,v $ */
-/* $Revision: 1.5 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtommath/bn_mp_lcm.c b/libtommath/bn_mp_lcm.c
index 48b2b63..3bff571 100644
--- a/libtommath/bn_mp_lcm.c
+++ b/libtommath/bn_mp_lcm.c
@@ -1,4 +1,4 @@
-#include <tommath.h>
+#include <tommath_private.h>
#ifdef BN_MP_LCM_C
/* LibTomMath, multiple-precision integer library -- Tom St Denis
*
@@ -12,7 +12,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tstdenis82@gmail.com, http://libtom.org
*/
/* computes least common multiple as |a*b|/(a, b) */
@@ -55,6 +55,6 @@ LBL_T:
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_lcm.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtommath/bn_mp_lshd.c b/libtommath/bn_mp_lshd.c
index ca9b853..f6f800f 100644
--- a/libtommath/bn_mp_lshd.c
+++ b/libtommath/bn_mp_lshd.c
@@ -1,4 +1,4 @@
-#include <tommath.h>
+#include <tommath_private.h>
#ifdef BN_MP_LSHD_C
/* LibTomMath, multiple-precision integer library -- Tom St Denis
*
@@ -12,7 +12,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tstdenis82@gmail.com, http://libtom.org
*/
/* shift left a certain amount of digits */
@@ -26,14 +26,14 @@ int mp_lshd (mp_int * a, int b)
}
/* grow to fit the new digits */
- if (a->alloc < a->used + b) {
+ if (a->alloc < (a->used + b)) {
if ((res = mp_grow (a, a->used + b)) != MP_OKAY) {
return res;
}
}
{
- register mp_digit *top, *bottom;
+ mp_digit *top, *bottom;
/* increment the used by the shift amount then copy upwards */
a->used += b;
@@ -42,7 +42,7 @@ int mp_lshd (mp_int * a, int b)
top = a->dp + a->used - 1;
/* base */
- bottom = a->dp + a->used - 1 - b;
+ bottom = (a->dp + a->used - 1) - b;
/* much like mp_rshd this is implemented using a sliding window
* except the window goes the otherway around. Copying from
@@ -62,6 +62,6 @@ int mp_lshd (mp_int * a, int b)
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_lshd.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtommath/bn_mp_mod.c b/libtommath/bn_mp_mod.c
index 87c8b0a..67b6796 100644
--- a/libtommath/bn_mp_mod.c
+++ b/libtommath/bn_mp_mod.c
@@ -1,4 +1,4 @@
-#include <tommath.h>
+#include <tommath_private.h>
#ifdef BN_MP_MOD_C
/* LibTomMath, multiple-precision integer library -- Tom St Denis
*
@@ -12,10 +12,10 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tstdenis82@gmail.com, http://libtom.org
*/
-/* c = a mod b, 0 <= c < b */
+/* c = a mod b, 0 <= c < b if b > 0, b < c <= 0 if b < 0 */
int
mp_mod (mp_int * a, mp_int * b, mp_int * c)
{
@@ -31,11 +31,11 @@ mp_mod (mp_int * a, mp_int * b, mp_int * c)
return res;
}
- if (t.sign != b->sign) {
- res = mp_add (b, &t, c);
- } else {
+ if ((mp_iszero(&t) != MP_NO) || (t.sign == b->sign)) {
res = MP_OKAY;
mp_exch (&t, c);
+ } else {
+ res = mp_add (b, &t, c);
}
mp_clear (&t);
@@ -43,6 +43,6 @@ mp_mod (mp_int * a, mp_int * b, mp_int * c)
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_mod.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtommath/bn_mp_mod_2d.c b/libtommath/bn_mp_mod_2d.c
index 461b1b2..926f810 100644
--- a/libtommath/bn_mp_mod_2d.c
+++ b/libtommath/bn_mp_mod_2d.c
@@ -1,4 +1,4 @@
-#include <tommath.h>
+#include <tommath_private.h>
#ifdef BN_MP_MOD_2D_C
/* LibTomMath, multiple-precision integer library -- Tom St Denis
*
@@ -12,7 +12,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tstdenis82@gmail.com, http://libtom.org
*/
/* calc a value mod 2**b */
@@ -39,7 +39,7 @@ mp_mod_2d (mp_int * a, int b, mp_int * c)
}
/* zero digits above the last digit of the modulus */
- for (x = (b / DIGIT_BIT) + ((b % DIGIT_BIT) == 0 ? 0 : 1); x < c->used; x++) {
+ for (x = (b / DIGIT_BIT) + (((b % DIGIT_BIT) == 0) ? 0 : 1); x < c->used; x++) {
c->dp[x] = 0;
}
/* clear the digit that is not completely outside/inside the modulus */
@@ -50,6 +50,6 @@ mp_mod_2d (mp_int * a, int b, mp_int * c)
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_mod_2d.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtommath/bn_mp_mod_d.c b/libtommath/bn_mp_mod_d.c
index 8bc499b..d8722f0 100644
--- a/libtommath/bn_mp_mod_d.c
+++ b/libtommath/bn_mp_mod_d.c
@@ -1,4 +1,4 @@
-#include <tommath.h>
+#include <tommath_private.h>
#ifdef BN_MP_MOD_D_C
/* LibTomMath, multiple-precision integer library -- Tom St Denis
*
@@ -12,7 +12,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tstdenis82@gmail.com, http://libtom.org
*/
int
@@ -22,6 +22,6 @@ mp_mod_d (mp_int * a, mp_digit b, mp_digit * c)
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_mod_d.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtommath/bn_mp_montgomery_calc_normalization.c b/libtommath/bn_mp_montgomery_calc_normalization.c
index 91eb5fe..ea87cbd 100644
--- a/libtommath/bn_mp_montgomery_calc_normalization.c
+++ b/libtommath/bn_mp_montgomery_calc_normalization.c
@@ -1,4 +1,4 @@
-#include <tommath.h>
+#include <tommath_private.h>
#ifdef BN_MP_MONTGOMERY_CALC_NORMALIZATION_C
/* LibTomMath, multiple-precision integer library -- Tom St Denis
*
@@ -12,7 +12,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tstdenis82@gmail.com, http://libtom.org
*/
/*
@@ -29,7 +29,7 @@ int mp_montgomery_calc_normalization (mp_int * a, mp_int * b)
bits = mp_count_bits (b) % DIGIT_BIT;
if (b->used > 1) {
- if ((res = mp_2expt (a, (b->used - 1) * DIGIT_BIT + bits - 1)) != MP_OKAY) {
+ if ((res = mp_2expt (a, ((b->used - 1) * DIGIT_BIT) + bits - 1)) != MP_OKAY) {
return res;
}
} else {
@@ -54,6 +54,6 @@ int mp_montgomery_calc_normalization (mp_int * a, mp_int * b)
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_montgomery_calc_normalization.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtommath/bn_mp_montgomery_reduce.c b/libtommath/bn_mp_montgomery_reduce.c
index a121d2a..af2cc58 100644
--- a/libtommath/bn_mp_montgomery_reduce.c
+++ b/libtommath/bn_mp_montgomery_reduce.c
@@ -1,4 +1,4 @@
-#include <tommath.h>
+#include <tommath_private.h>
#ifdef BN_MP_MONTGOMERY_REDUCE_C
/* LibTomMath, multiple-precision integer library -- Tom St Denis
*
@@ -12,7 +12,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tstdenis82@gmail.com, http://libtom.org
*/
/* computes xR**-1 == x (mod N) via Montgomery Reduction */
@@ -28,10 +28,10 @@ mp_montgomery_reduce (mp_int * x, mp_int * n, mp_digit rho)
* than the available columns [255 per default] since carries
* are fixed up in the inner loop.
*/
- digs = n->used * 2 + 1;
+ digs = (n->used * 2) + 1;
if ((digs < MP_WARRAY) &&
- n->used <
- (1 << ((CHAR_BIT * sizeof (mp_word)) - (2 * DIGIT_BIT)))) {
+ (n->used <
+ (1 << ((CHAR_BIT * sizeof(mp_word)) - (2 * DIGIT_BIT))))) {
return fast_mp_montgomery_reduce (x, n, rho);
}
@@ -52,13 +52,13 @@ mp_montgomery_reduce (mp_int * x, mp_int * n, mp_digit rho)
* following inner loop to reduce the
* input one digit at a time
*/
- mu = (mp_digit) (((mp_word)x->dp[ix]) * ((mp_word)rho) & MP_MASK);
+ mu = (mp_digit) (((mp_word)x->dp[ix] * (mp_word)rho) & MP_MASK);
/* a = a + mu * m * b**i */
{
- register int iy;
- register mp_digit *tmpn, *tmpx, u;
- register mp_word r;
+ int iy;
+ mp_digit *tmpn, *tmpx, u;
+ mp_word r;
/* alias for digits of the modulus */
tmpn = n->dp;
@@ -72,8 +72,8 @@ mp_montgomery_reduce (mp_int * x, mp_int * n, mp_digit rho)
/* Multiply and add in place */
for (iy = 0; iy < n->used; iy++) {
/* compute product and sum */
- r = ((mp_word)mu) * ((mp_word)*tmpn++) +
- ((mp_word) u) + ((mp_word) * tmpx);
+ r = ((mp_word)mu * (mp_word)*tmpn++) +
+ (mp_word) u + (mp_word) *tmpx;
/* get carry */
u = (mp_digit)(r >> ((mp_word) DIGIT_BIT));
@@ -85,7 +85,7 @@ mp_montgomery_reduce (mp_int * x, mp_int * n, mp_digit rho)
/* propagate carries upwards as required*/
- while (u) {
+ while (u != 0) {
*tmpx += u;
u = *tmpx >> DIGIT_BIT;
*tmpx++ &= MP_MASK;
@@ -113,6 +113,6 @@ mp_montgomery_reduce (mp_int * x, mp_int * n, mp_digit rho)
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_montgomery_reduce.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtommath/bn_mp_montgomery_setup.c b/libtommath/bn_mp_montgomery_setup.c
index 0dc800e..264a2bd 100644
--- a/libtommath/bn_mp_montgomery_setup.c
+++ b/libtommath/bn_mp_montgomery_setup.c
@@ -1,4 +1,4 @@
-#include <tommath.h>
+#include <tommath_private.h>
#ifdef BN_MP_MONTGOMERY_SETUP_C
/* LibTomMath, multiple-precision integer library -- Tom St Denis
*
@@ -12,7 +12,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tstdenis82@gmail.com, http://libtom.org
*/
/* setups the montgomery reduction stuff */
@@ -36,24 +36,24 @@ mp_montgomery_setup (mp_int * n, mp_digit * rho)
}
x = (((b + 2) & 4) << 1) + b; /* here x*a==1 mod 2**4 */
- x *= 2 - b * x; /* here x*a==1 mod 2**8 */
+ x *= 2 - (b * x); /* here x*a==1 mod 2**8 */
#if !defined(MP_8BIT)
- x *= 2 - b * x; /* here x*a==1 mod 2**16 */
+ x *= 2 - (b * x); /* here x*a==1 mod 2**16 */
#endif
#if defined(MP_64BIT) || !(defined(MP_8BIT) || defined(MP_16BIT))
- x *= 2 - b * x; /* here x*a==1 mod 2**32 */
+ x *= 2 - (b * x); /* here x*a==1 mod 2**32 */
#endif
#ifdef MP_64BIT
- x *= 2 - b * x; /* here x*a==1 mod 2**64 */
+ x *= 2 - (b * x); /* here x*a==1 mod 2**64 */
#endif
/* rho = -1/m mod b */
- *rho = (unsigned long)(((mp_word)1 << ((mp_word) DIGIT_BIT)) - x) & MP_MASK;
+ *rho = (mp_digit)(((mp_word)1 << ((mp_word) DIGIT_BIT)) - x) & MP_MASK;
return MP_OKAY;
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_montgomery_setup.c,v $ */
-/* $Revision: 1.4 $ */
-/* $Date: 2006/12/04 21:34:03 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtommath/bn_mp_mul.c b/libtommath/bn_mp_mul.c
index f941a1a..ea53d5e 100644
--- a/libtommath/bn_mp_mul.c
+++ b/libtommath/bn_mp_mul.c
@@ -1,4 +1,4 @@
-#include <tommath.h>
+#include <tommath_private.h>
#ifdef BN_MP_MUL_C
/* LibTomMath, multiple-precision integer library -- Tom St Denis
*
@@ -12,7 +12,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tstdenis82@gmail.com, http://libtom.org
*/
/* high level multiplication (handles sign) */
@@ -44,23 +44,24 @@ int mp_mul (mp_int * a, mp_int * b, mp_int * c)
#ifdef BN_FAST_S_MP_MUL_DIGS_C
if ((digs < MP_WARRAY) &&
- MIN(a->used, b->used) <=
- (1 << ((CHAR_BIT * sizeof (mp_word)) - (2 * DIGIT_BIT)))) {
+ (MIN(a->used, b->used) <=
+ (1 << ((CHAR_BIT * sizeof(mp_word)) - (2 * DIGIT_BIT))))) {
res = fast_s_mp_mul_digs (a, b, c, digs);
} else
#endif
+ {
#ifdef BN_S_MP_MUL_DIGS_C
res = s_mp_mul (a, b, c); /* uses s_mp_mul_digs */
#else
res = MP_VAL;
#endif
-
+ }
}
c->sign = (c->used > 0) ? neg : MP_ZPOS;
return res;
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_mul.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtommath/bn_mp_mul_2.c b/libtommath/bn_mp_mul_2.c
index 0d27a9d..9c72c7f 100644
--- a/libtommath/bn_mp_mul_2.c
+++ b/libtommath/bn_mp_mul_2.c
@@ -1,4 +1,4 @@
-#include <tommath.h>
+#include <tommath_private.h>
#ifdef BN_MP_MUL_2_C
/* LibTomMath, multiple-precision integer library -- Tom St Denis
*
@@ -12,7 +12,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tstdenis82@gmail.com, http://libtom.org
*/
/* b = a*2 */
@@ -21,7 +21,7 @@ int mp_mul_2(mp_int * a, mp_int * b)
int x, res, oldused;
/* grow to accomodate result */
- if (b->alloc < a->used + 1) {
+ if (b->alloc < (a->used + 1)) {
if ((res = mp_grow (b, a->used + 1)) != MP_OKAY) {
return res;
}
@@ -31,7 +31,7 @@ int mp_mul_2(mp_int * a, mp_int * b)
b->used = a->used;
{
- register mp_digit r, rr, *tmpa, *tmpb;
+ mp_digit r, rr, *tmpa, *tmpb;
/* alias for source */
tmpa = a->dp;
@@ -77,6 +77,6 @@ int mp_mul_2(mp_int * a, mp_int * b)
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_mul_2.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtommath/bn_mp_mul_2d.c b/libtommath/bn_mp_mul_2d.c
index d803bf4..9967e46 100644
--- a/libtommath/bn_mp_mul_2d.c
+++ b/libtommath/bn_mp_mul_2d.c
@@ -1,4 +1,4 @@
-#include <tommath.h>
+#include <tommath_private.h>
#ifdef BN_MP_MUL_2D_C
/* LibTomMath, multiple-precision integer library -- Tom St Denis
*
@@ -12,7 +12,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tstdenis82@gmail.com, http://libtom.org
*/
/* shift left by a certain bit count */
@@ -28,8 +28,8 @@ int mp_mul_2d (mp_int * a, int b, mp_int * c)
}
}
- if (c->alloc < (int)(c->used + b/DIGIT_BIT + 1)) {
- if ((res = mp_grow (c, c->used + b / DIGIT_BIT + 1)) != MP_OKAY) {
+ if (c->alloc < (int)(c->used + (b / DIGIT_BIT) + 1)) {
+ if ((res = mp_grow (c, c->used + (b / DIGIT_BIT) + 1)) != MP_OKAY) {
return res;
}
}
@@ -44,8 +44,8 @@ int mp_mul_2d (mp_int * a, int b, mp_int * c)
/* shift any bit count < DIGIT_BIT */
d = (mp_digit) (b % DIGIT_BIT);
if (d != 0) {
- register mp_digit *tmpc, shift, mask, r, rr;
- register int x;
+ mp_digit *tmpc, shift, mask, r, rr;
+ int x;
/* bitmask for carries */
mask = (((mp_digit)1) << d) - 1;
@@ -80,6 +80,6 @@ int mp_mul_2d (mp_int * a, int b, mp_int * c)
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_mul_2d.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtommath/bn_mp_mul_d.c b/libtommath/bn_mp_mul_d.c
index a6324aa..e77da5d 100644
--- a/libtommath/bn_mp_mul_d.c
+++ b/libtommath/bn_mp_mul_d.c
@@ -1,4 +1,4 @@
-#include <tommath.h>
+#include <tommath_private.h>
#ifdef BN_MP_MUL_D_C
/* LibTomMath, multiple-precision integer library -- Tom St Denis
*
@@ -12,7 +12,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tstdenis82@gmail.com, http://libtom.org
*/
/* multiply by a digit */
@@ -24,7 +24,7 @@ mp_mul_d (mp_int * a, mp_digit b, mp_int * c)
int ix, res, olduse;
/* make sure c is big enough to hold a*b */
- if (c->alloc < a->used + 1) {
+ if (c->alloc < (a->used + 1)) {
if ((res = mp_grow (c, a->used + 1)) != MP_OKAY) {
return res;
}
@@ -48,7 +48,7 @@ mp_mul_d (mp_int * a, mp_digit b, mp_int * c)
/* compute columns */
for (ix = 0; ix < a->used; ix++) {
/* compute product and carry sum for this term */
- r = ((mp_word) u) + ((mp_word)*tmpa++) * ((mp_word)b);
+ r = (mp_word)u + ((mp_word)*tmpa++ * (mp_word)b);
/* mask off higher bits to get a single digit */
*tmpc++ = (mp_digit) (r & ((mp_word) MP_MASK));
@@ -74,6 +74,6 @@ mp_mul_d (mp_int * a, mp_digit b, mp_int * c)
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_mul_d.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtommath/bn_mp_mulmod.c b/libtommath/bn_mp_mulmod.c
index 24c9749..edd8fcb 100644
--- a/libtommath/bn_mp_mulmod.c
+++ b/libtommath/bn_mp_mulmod.c
@@ -1,4 +1,4 @@
-#include <tommath.h>
+#include <tommath_private.h>
#ifdef BN_MP_MULMOD_C
/* LibTomMath, multiple-precision integer library -- Tom St Denis
*
@@ -12,7 +12,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tstdenis82@gmail.com, http://libtom.org
*/
/* d = a * b (mod c) */
@@ -35,6 +35,6 @@ int mp_mulmod (mp_int * a, mp_int * b, mp_int * c, mp_int * d)
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_mulmod.c,v $ */
-/* $Revision: 1.4 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtommath/bn_mp_n_root.c b/libtommath/bn_mp_n_root.c
index c154016..a14ee67 100644
--- a/libtommath/bn_mp_n_root.c
+++ b/libtommath/bn_mp_n_root.c
@@ -1,4 +1,4 @@
-#include <tommath.h>
+#include <tommath_private.h>
#ifdef BN_MP_N_ROOT_C
/* LibTomMath, multiple-precision integer library -- Tom St Denis
*
@@ -12,121 +12,19 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tstdenis82@gmail.com, http://libtom.org
*/
-/* find the n'th root of an integer
- *
- * Result found such that (c)**b <= a and (c+1)**b > a
- *
- * This algorithm uses Newton's approximation
- * x[i+1] = x[i] - f(x[i])/f'(x[i])
- * which will find the root in log(N) time where
- * each step involves a fair bit. This is not meant to
- * find huge roots [square and cube, etc].
+/* wrapper function for mp_n_root_ex()
+ * computes c = (a)**(1/b) such that (c)**b <= a and (c+1)**b > a
*/
int mp_n_root (mp_int * a, mp_digit b, mp_int * c)
{
- mp_int t1, t2, t3;
- int res, neg;
-
- /* input must be positive if b is even */
- if ((b & 1) == 0 && a->sign == MP_NEG) {
- return MP_VAL;
- }
-
- if ((res = mp_init (&t1)) != MP_OKAY) {
- return res;
- }
-
- if ((res = mp_init (&t2)) != MP_OKAY) {
- goto LBL_T1;
- }
-
- if ((res = mp_init (&t3)) != MP_OKAY) {
- goto LBL_T2;
- }
-
- /* if a is negative fudge the sign but keep track */
- neg = a->sign;
- a->sign = MP_ZPOS;
-
- /* t2 = 2 */
- mp_set (&t2, 2);
-
- do {
- /* t1 = t2 */
- if ((res = mp_copy (&t2, &t1)) != MP_OKAY) {
- goto LBL_T3;
- }
-
- /* t2 = t1 - ((t1**b - a) / (b * t1**(b-1))) */
-
- /* t3 = t1**(b-1) */
- if ((res = mp_expt_d (&t1, b - 1, &t3)) != MP_OKAY) {
- goto LBL_T3;
- }
-
- /* numerator */
- /* t2 = t1**b */
- if ((res = mp_mul (&t3, &t1, &t2)) != MP_OKAY) {
- goto LBL_T3;
- }
-
- /* t2 = t1**b - a */
- if ((res = mp_sub (&t2, a, &t2)) != MP_OKAY) {
- goto LBL_T3;
- }
-
- /* denominator */
- /* t3 = t1**(b-1) * b */
- if ((res = mp_mul_d (&t3, b, &t3)) != MP_OKAY) {
- goto LBL_T3;
- }
-
- /* t3 = (t1**b - a)/(b * t1**(b-1)) */
- if ((res = mp_div (&t2, &t3, &t3, NULL)) != MP_OKAY) {
- goto LBL_T3;
- }
-
- if ((res = mp_sub (&t1, &t3, &t2)) != MP_OKAY) {
- goto LBL_T3;
- }
- } while (mp_cmp (&t1, &t2) != MP_EQ);
-
- /* result can be off by a few so check */
- for (;;) {
- if ((res = mp_expt_d (&t1, b, &t2)) != MP_OKAY) {
- goto LBL_T3;
- }
-
- if (mp_cmp (&t2, a) == MP_GT) {
- if ((res = mp_sub_d (&t1, 1, &t1)) != MP_OKAY) {
- goto LBL_T3;
- }
- } else {
- break;
- }
- }
-
- /* reset the sign of a first */
- a->sign = neg;
-
- /* set the result */
- mp_exch (&t1, c);
-
- /* set the sign of the result */
- c->sign = neg;
-
- res = MP_OKAY;
-
-LBL_T3:mp_clear (&t3);
-LBL_T2:mp_clear (&t2);
-LBL_T1:mp_clear (&t1);
- return res;
+ return mp_n_root_ex(a, b, c, 0);
}
+
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_n_root.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtommath/bn_mp_n_root_ex.c b/libtommath/bn_mp_n_root_ex.c
new file mode 100644
index 0000000..79d1dfb
--- /dev/null
+++ b/libtommath/bn_mp_n_root_ex.c
@@ -0,0 +1,132 @@
+#include <tommath_private.h>
+#ifdef BN_MP_N_ROOT_EX_C
+/* LibTomMath, multiple-precision integer library -- Tom St Denis
+ *
+ * LibTomMath is a library that provides multiple-precision
+ * integer arithmetic as well as number theoretic functionality.
+ *
+ * The library was designed directly after the MPI library by
+ * Michael Fromberger but has been written from scratch with
+ * additional optimizations in place.
+ *
+ * The library is free for all purposes without any express
+ * guarantee it works.
+ *
+ * Tom St Denis, tstdenis82@gmail.com, http://libtom.org
+ */
+
+/* find the n'th root of an integer
+ *
+ * Result found such that (c)**b <= a and (c+1)**b > a
+ *
+ * This algorithm uses Newton's approximation
+ * x[i+1] = x[i] - f(x[i])/f'(x[i])
+ * which will find the root in log(N) time where
+ * each step involves a fair bit. This is not meant to
+ * find huge roots [square and cube, etc].
+ */
+int mp_n_root_ex (mp_int * a, mp_digit b, mp_int * c, int fast)
+{
+ mp_int t1, t2, t3;
+ int res, neg;
+
+ /* input must be positive if b is even */
+ if (((b & 1) == 0) && (a->sign == MP_NEG)) {
+ return MP_VAL;
+ }
+
+ if ((res = mp_init (&t1)) != MP_OKAY) {
+ return res;
+ }
+
+ if ((res = mp_init (&t2)) != MP_OKAY) {
+ goto LBL_T1;
+ }
+
+ if ((res = mp_init (&t3)) != MP_OKAY) {
+ goto LBL_T2;
+ }
+
+ /* if a is negative fudge the sign but keep track */
+ neg = a->sign;
+ a->sign = MP_ZPOS;
+
+ /* t2 = 2 */
+ mp_set (&t2, 2);
+
+ do {
+ /* t1 = t2 */
+ if ((res = mp_copy (&t2, &t1)) != MP_OKAY) {
+ goto LBL_T3;
+ }
+
+ /* t2 = t1 - ((t1**b - a) / (b * t1**(b-1))) */
+
+ /* t3 = t1**(b-1) */
+ if ((res = mp_expt_d_ex (&t1, b - 1, &t3, fast)) != MP_OKAY) {
+ goto LBL_T3;
+ }
+
+ /* numerator */
+ /* t2 = t1**b */
+ if ((res = mp_mul (&t3, &t1, &t2)) != MP_OKAY) {
+ goto LBL_T3;
+ }
+
+ /* t2 = t1**b - a */
+ if ((res = mp_sub (&t2, a, &t2)) != MP_OKAY) {
+ goto LBL_T3;
+ }
+
+ /* denominator */
+ /* t3 = t1**(b-1) * b */
+ if ((res = mp_mul_d (&t3, b, &t3)) != MP_OKAY) {
+ goto LBL_T3;
+ }
+
+ /* t3 = (t1**b - a)/(b * t1**(b-1)) */
+ if ((res = mp_div (&t2, &t3, &t3, NULL)) != MP_OKAY) {
+ goto LBL_T3;
+ }
+
+ if ((res = mp_sub (&t1, &t3, &t2)) != MP_OKAY) {
+ goto LBL_T3;
+ }
+ } while (mp_cmp (&t1, &t2) != MP_EQ);
+
+ /* result can be off by a few so check */
+ for (;;) {
+ if ((res = mp_expt_d_ex (&t1, b, &t2, fast)) != MP_OKAY) {
+ goto LBL_T3;
+ }
+
+ if (mp_cmp (&t2, a) == MP_GT) {
+ if ((res = mp_sub_d (&t1, 1, &t1)) != MP_OKAY) {
+ goto LBL_T3;
+ }
+ } else {
+ break;
+ }
+ }
+
+ /* reset the sign of a first */
+ a->sign = neg;
+
+ /* set the result */
+ mp_exch (&t1, c);
+
+ /* set the sign of the result */
+ c->sign = neg;
+
+ res = MP_OKAY;
+
+LBL_T3:mp_clear (&t3);
+LBL_T2:mp_clear (&t2);
+LBL_T1:mp_clear (&t1);
+ return res;
+}
+#endif
+
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtommath/bn_mp_neg.c b/libtommath/bn_mp_neg.c
index 0db9b40..ea32e46 100644
--- a/libtommath/bn_mp_neg.c
+++ b/libtommath/bn_mp_neg.c
@@ -1,4 +1,4 @@
-#include <tommath.h>
+#include <tommath_private.h>
#ifdef BN_MP_NEG_C
/* LibTomMath, multiple-precision integer library -- Tom St Denis
*
@@ -12,7 +12,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tstdenis82@gmail.com, http://libtom.org
*/
/* b = -a */
@@ -35,6 +35,6 @@ int mp_neg (mp_int * a, mp_int * b)
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_neg.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtommath/bn_mp_or.c b/libtommath/bn_mp_or.c
index a9fc74a..b7f2e4f 100644
--- a/libtommath/bn_mp_or.c
+++ b/libtommath/bn_mp_or.c
@@ -1,4 +1,4 @@
-#include <tommath.h>
+#include <tommath_private.h>
#ifdef BN_MP_OR_C
/* LibTomMath, multiple-precision integer library -- Tom St Denis
*
@@ -12,7 +12,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tstdenis82@gmail.com, http://libtom.org
*/
/* OR two ints together */
@@ -45,6 +45,6 @@ int mp_or (mp_int * a, mp_int * b, mp_int * c)
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_or.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtommath/bn_mp_prime_fermat.c b/libtommath/bn_mp_prime_fermat.c
index 1869867..9dc9e85 100644
--- a/libtommath/bn_mp_prime_fermat.c
+++ b/libtommath/bn_mp_prime_fermat.c
@@ -1,4 +1,4 @@
-#include <tommath.h>
+#include <tommath_private.h>
#ifdef BN_MP_PRIME_FERMAT_C
/* LibTomMath, multiple-precision integer library -- Tom St Denis
*
@@ -12,7 +12,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tstdenis82@gmail.com, http://libtom.org
*/
/* performs one Fermat test.
@@ -57,6 +57,6 @@ LBL_T:mp_clear (&t);
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_prime_fermat.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtommath/bn_mp_prime_is_divisible.c b/libtommath/bn_mp_prime_is_divisible.c
index d065451..5854f08 100644
--- a/libtommath/bn_mp_prime_is_divisible.c
+++ b/libtommath/bn_mp_prime_is_divisible.c
@@ -1,4 +1,4 @@
-#include <tommath.h>
+#include <tommath_private.h>
#ifdef BN_MP_PRIME_IS_DIVISIBLE_C
/* LibTomMath, multiple-precision integer library -- Tom St Denis
*
@@ -12,7 +12,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tstdenis82@gmail.com, http://libtom.org
*/
/* determines if an integers is divisible by one
@@ -45,6 +45,6 @@ int mp_prime_is_divisible (mp_int * a, int *result)
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_prime_is_divisible.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtommath/bn_mp_prime_is_prime.c b/libtommath/bn_mp_prime_is_prime.c
index d93d46a..be5ebe4 100644
--- a/libtommath/bn_mp_prime_is_prime.c
+++ b/libtommath/bn_mp_prime_is_prime.c
@@ -1,4 +1,4 @@
-#include <tommath.h>
+#include <tommath_private.h>
#ifdef BN_MP_PRIME_IS_PRIME_C
/* LibTomMath, multiple-precision integer library -- Tom St Denis
*
@@ -12,7 +12,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tstdenis82@gmail.com, http://libtom.org
*/
/* performs a variable number of rounds of Miller-Rabin
@@ -31,7 +31,7 @@ int mp_prime_is_prime (mp_int * a, int t, int *result)
*result = MP_NO;
/* valid value of t? */
- if (t <= 0 || t > PRIME_SIZE) {
+ if ((t <= 0) || (t > PRIME_SIZE)) {
return MP_VAL;
}
@@ -78,6 +78,6 @@ LBL_B:mp_clear (&b);
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_prime_is_prime.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtommath/bn_mp_prime_miller_rabin.c b/libtommath/bn_mp_prime_miller_rabin.c
index 9bd6ba1..7b5c8d2 100644
--- a/libtommath/bn_mp_prime_miller_rabin.c
+++ b/libtommath/bn_mp_prime_miller_rabin.c
@@ -1,4 +1,4 @@
-#include <tommath.h>
+#include <tommath_private.h>
#ifdef BN_MP_PRIME_MILLER_RABIN_C
/* LibTomMath, multiple-precision integer library -- Tom St Denis
*
@@ -12,7 +12,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tstdenis82@gmail.com, http://libtom.org
*/
/* Miller-Rabin test of "a" to the base of "b" as described in
@@ -67,10 +67,10 @@ int mp_prime_miller_rabin (mp_int * a, mp_int * b, int *result)
}
/* if y != 1 and y != n1 do */
- if (mp_cmp_d (&y, 1) != MP_EQ && mp_cmp (&y, &n1) != MP_EQ) {
+ if ((mp_cmp_d (&y, 1) != MP_EQ) && (mp_cmp (&y, &n1) != MP_EQ)) {
j = 1;
/* while j <= s-1 and y != n1 */
- while ((j <= (s - 1)) && mp_cmp (&y, &n1) != MP_EQ) {
+ while ((j <= (s - 1)) && (mp_cmp (&y, &n1) != MP_EQ)) {
if ((err = mp_sqrmod (&y, a, &y)) != MP_OKAY) {
goto LBL_Y;
}
@@ -98,6 +98,6 @@ LBL_N1:mp_clear (&n1);
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_prime_miller_rabin.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtommath/bn_mp_prime_next_prime.c b/libtommath/bn_mp_prime_next_prime.c
index b2efadd..9951dc3 100644
--- a/libtommath/bn_mp_prime_next_prime.c
+++ b/libtommath/bn_mp_prime_next_prime.c
@@ -1,4 +1,4 @@
-#include <tommath.h>
+#include <tommath_private.h>
#ifdef BN_MP_PRIME_NEXT_PRIME_C
/* LibTomMath, multiple-precision integer library -- Tom St Denis
*
@@ -12,7 +12,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tstdenis82@gmail.com, http://libtom.org
*/
/* finds the next prime after the number "a" using "t" trials
@@ -22,12 +22,12 @@
*/
int mp_prime_next_prime(mp_int *a, int t, int bbs_style)
{
- int err, res, x, y;
+ int err, res = MP_NO, x, y;
mp_digit res_tab[PRIME_SIZE], step, kstep;
mp_int b;
/* ensure t is valid */
- if (t <= 0 || t > PRIME_SIZE) {
+ if ((t <= 0) || (t > PRIME_SIZE)) {
return MP_VAL;
}
@@ -84,7 +84,7 @@ int mp_prime_next_prime(mp_int *a, int t, int bbs_style)
if ((err = mp_sub_d(a, (a->dp[0] & 3) + 1, a)) != MP_OKAY) { return err; };
}
} else {
- if (mp_iseven(a) == 1) {
+ if (mp_iseven(a) == MP_YES) {
/* force odd */
if ((err = mp_sub_d(a, 1, a)) != MP_OKAY) {
return err;
@@ -129,7 +129,7 @@ int mp_prime_next_prime(mp_int *a, int t, int bbs_style)
y = 1;
}
}
- } while (y == 1 && step < ((((mp_digit)1)<<DIGIT_BIT) - kstep));
+ } while ((y == 1) && (step < ((((mp_digit)1) << DIGIT_BIT) - kstep)));
/* add the step */
if ((err = mp_add_d(a, step, a)) != MP_OKAY) {
@@ -137,7 +137,7 @@ int mp_prime_next_prime(mp_int *a, int t, int bbs_style)
}
/* if didn't pass sieve and step == MAX then skip test */
- if (y == 1 && step >= ((((mp_digit)1)<<DIGIT_BIT) - kstep)) {
+ if ((y == 1) && (step >= ((((mp_digit)1) << DIGIT_BIT) - kstep))) {
continue;
}
@@ -165,6 +165,6 @@ LBL_ERR:
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_prime_next_prime.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtommath/bn_mp_prime_rabin_miller_trials.c b/libtommath/bn_mp_prime_rabin_miller_trials.c
index 140b254..bca4229 100644
--- a/libtommath/bn_mp_prime_rabin_miller_trials.c
+++ b/libtommath/bn_mp_prime_rabin_miller_trials.c
@@ -1,4 +1,4 @@
-#include <tommath.h>
+#include <tommath_private.h>
#ifdef BN_MP_PRIME_RABIN_MILLER_TRIALS_C
/* LibTomMath, multiple-precision integer library -- Tom St Denis
*
@@ -12,7 +12,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tstdenis82@gmail.com, http://libtom.org
*/
@@ -47,6 +47,6 @@ int mp_prime_rabin_miller_trials(int size)
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_prime_rabin_miller_trials.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtommath/bn_mp_prime_random_ex.c b/libtommath/bn_mp_prime_random_ex.c
index cde7a38..1efc4fc 100644
--- a/libtommath/bn_mp_prime_random_ex.c
+++ b/libtommath/bn_mp_prime_random_ex.c
@@ -1,4 +1,4 @@
-#include <tommath.h>
+#include <tommath_private.h>
#ifdef BN_MP_PRIME_RANDOM_EX_C
/* LibTomMath, multiple-precision integer library -- Tom St Denis
*
@@ -12,7 +12,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tstdenis82@gmail.com, http://libtom.org
*/
/* makes a truly random prime of a given size (bits),
@@ -21,7 +21,6 @@
*
* LTM_PRIME_BBS - make prime congruent to 3 mod 4
* LTM_PRIME_SAFE - make sure (p-1)/2 is prime as well (implies LTM_PRIME_BBS)
- * LTM_PRIME_2MSB_OFF - make the 2nd highest bit zero
* LTM_PRIME_2MSB_ON - make the 2nd highest bit one
*
* You have to supply a callback which fills in a buffer with random bytes. "dat" is a parameter you can
@@ -37,12 +36,12 @@ int mp_prime_random_ex(mp_int *a, int t, int size, int flags, ltm_prime_callback
int res, err, bsize, maskOR_msb_offset;
/* sanity check the input */
- if (size <= 1 || t <= 0) {
+ if ((size <= 1) || (t <= 0)) {
return MP_VAL;
}
/* LTM_PRIME_SAFE implies LTM_PRIME_BBS */
- if (flags & LTM_PRIME_SAFE) {
+ if ((flags & LTM_PRIME_SAFE) != 0) {
flags |= LTM_PRIME_BBS;
}
@@ -61,13 +60,13 @@ int mp_prime_random_ex(mp_int *a, int t, int size, int flags, ltm_prime_callback
/* calc the maskOR_msb */
maskOR_msb = 0;
maskOR_msb_offset = ((size & 7) == 1) ? 1 : 0;
- if (flags & LTM_PRIME_2MSB_ON) {
+ if ((flags & LTM_PRIME_2MSB_ON) != 0) {
maskOR_msb |= 0x80 >> ((9 - size) & 7);
}
/* get the maskOR_lsb */
maskOR_lsb = 1;
- if (flags & LTM_PRIME_BBS) {
+ if ((flags & LTM_PRIME_BBS) != 0) {
maskOR_lsb |= 3;
}
@@ -95,7 +94,7 @@ int mp_prime_random_ex(mp_int *a, int t, int size, int flags, ltm_prime_callback
continue;
}
- if (flags & LTM_PRIME_SAFE) {
+ if ((flags & LTM_PRIME_SAFE) != 0) {
/* see if (a-1)/2 is prime */
if ((err = mp_sub_d(a, 1, a)) != MP_OKAY) { goto error; }
if ((err = mp_div_2(a, a)) != MP_OKAY) { goto error; }
@@ -105,7 +104,7 @@ int mp_prime_random_ex(mp_int *a, int t, int size, int flags, ltm_prime_callback
}
} while (res == MP_NO);
- if (flags & LTM_PRIME_SAFE) {
+ if ((flags & LTM_PRIME_SAFE) != 0) {
/* restore a to the original value */
if ((err = mp_mul_2(a, a)) != MP_OKAY) { goto error; }
if ((err = mp_add_d(a, 1, a)) != MP_OKAY) { goto error; }
@@ -120,6 +119,6 @@ error:
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_prime_random_ex.c,v $ */
-/* $Revision: 1.4 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtommath/bn_mp_radix_size.c b/libtommath/bn_mp_radix_size.c
index c9e8822..e5d7772 100644
--- a/libtommath/bn_mp_radix_size.c
+++ b/libtommath/bn_mp_radix_size.c
@@ -1,4 +1,4 @@
-#include <tommath.h>
+#include <tommath_private.h>
#ifdef BN_MP_RADIX_SIZE_C
/* LibTomMath, multiple-precision integer library -- Tom St Denis
*
@@ -12,7 +12,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tstdenis82@gmail.com, http://libtom.org
*/
/* returns size of ASCII reprensentation */
@@ -24,14 +24,8 @@ int mp_radix_size (mp_int * a, int radix, int *size)
*size = 0;
- /* special case for binary */
- if (radix == 2) {
- *size = mp_count_bits (a) + (a->sign == MP_NEG ? 1 : 0) + 1;
- return MP_OKAY;
- }
-
/* make sure the radix is in range */
- if (radix < 2 || radix > 64) {
+ if ((radix < 2) || (radix > 64)) {
return MP_VAL;
}
@@ -40,6 +34,12 @@ int mp_radix_size (mp_int * a, int radix, int *size)
return MP_OKAY;
}
+ /* special case for binary */
+ if (radix == 2) {
+ *size = mp_count_bits (a) + ((a->sign == MP_NEG) ? 1 : 0) + 1;
+ return MP_OKAY;
+ }
+
/* digs is the digit count */
digs = 0;
@@ -73,6 +73,6 @@ int mp_radix_size (mp_int * a, int radix, int *size)
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_radix_size.c,v $ */
-/* $Revision: 1.4 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtommath/bn_mp_radix_smap.c b/libtommath/bn_mp_radix_smap.c
index 58c3a5e..d1c75ad 100644
--- a/libtommath/bn_mp_radix_smap.c
+++ b/libtommath/bn_mp_radix_smap.c
@@ -1,4 +1,4 @@
-#include <tommath.h>
+#include <tommath_private.h>
#ifdef BN_MP_RADIX_SMAP_C
/* LibTomMath, multiple-precision integer library -- Tom St Denis
*
@@ -12,13 +12,13 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tstdenis82@gmail.com, http://libtom.org
*/
/* chars used in radix conversions */
const char *mp_s_rmap = "0123456789ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz+/";
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_radix_smap.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtommath/bn_mp_rand.c b/libtommath/bn_mp_rand.c
index 6c8f3b3..4c9610d 100644
--- a/libtommath/bn_mp_rand.c
+++ b/libtommath/bn_mp_rand.c
@@ -1,4 +1,4 @@
-#include <tommath.h>
+#include <tommath_private.h>
#ifdef BN_MP_RAND_C
/* LibTomMath, multiple-precision integer library -- Tom St Denis
*
@@ -12,7 +12,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tstdenis82@gmail.com, http://libtom.org
*/
/* makes a pseudo-random int of a given size */
@@ -29,7 +29,7 @@ mp_rand (mp_int * a, int digits)
/* first place a random non-zero digit */
do {
- d = ((mp_digit) abs (rand ())) & MP_MASK;
+ d = ((mp_digit) abs (MP_GEN_RANDOM())) & MP_MASK;
} while (d == 0);
if ((res = mp_add_d (a, d, a)) != MP_OKAY) {
@@ -41,7 +41,7 @@ mp_rand (mp_int * a, int digits)
return res;
}
- if ((res = mp_add_d (a, ((mp_digit) abs (rand ())), a)) != MP_OKAY) {
+ if ((res = mp_add_d (a, ((mp_digit) abs (MP_GEN_RANDOM())), a)) != MP_OKAY) {
return res;
}
}
@@ -50,6 +50,6 @@ mp_rand (mp_int * a, int digits)
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_rand.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtommath/bn_mp_read_radix.c b/libtommath/bn_mp_read_radix.c
index d2119c1..5c9eb5e 100644
--- a/libtommath/bn_mp_read_radix.c
+++ b/libtommath/bn_mp_read_radix.c
@@ -1,4 +1,4 @@
-#include <tommath.h>
+#include <tommath_private.h>
#ifdef BN_MP_READ_RADIX_C
/* LibTomMath, multiple-precision integer library -- Tom St Denis
*
@@ -12,7 +12,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tstdenis82@gmail.com, http://libtom.org
*/
/* read a string [ASCII] in a given radix */
@@ -25,7 +25,7 @@ int mp_read_radix (mp_int * a, const char *str, int radix)
mp_zero(a);
/* make sure the radix is ok */
- if (radix < 2 || radix > 64) {
+ if ((radix < 2) || (radix > 64)) {
return MP_VAL;
}
@@ -43,12 +43,12 @@ int mp_read_radix (mp_int * a, const char *str, int radix)
mp_zero (a);
/* process each digit of the string */
- while (*str) {
- /* if the radix < 36 the conversion is case insensitive
+ while (*str != '\0') {
+ /* if the radix <= 36 the conversion is case insensitive
* this allows numbers like 1AB and 1ab to represent the same value
* [e.g. in hex]
*/
- ch = (char) ((radix < 36) ? toupper (*str) : *str);
+ ch = (radix <= 36) ? (char)toupper((int)*str) : *str;
for (y = 0; y < 64; y++) {
if (ch == mp_s_rmap[y]) {
break;
@@ -73,13 +73,13 @@ int mp_read_radix (mp_int * a, const char *str, int radix)
}
/* set the sign only if a != 0 */
- if (mp_iszero(a) != 1) {
+ if (mp_iszero(a) != MP_YES) {
a->sign = neg;
}
return MP_OKAY;
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_read_radix.c,v $ */
-/* $Revision: 1.4 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtommath/bn_mp_read_signed_bin.c b/libtommath/bn_mp_read_signed_bin.c
index e3df3c3..a4d4760 100644
--- a/libtommath/bn_mp_read_signed_bin.c
+++ b/libtommath/bn_mp_read_signed_bin.c
@@ -1,4 +1,4 @@
-#include <tommath.h>
+#include <tommath_private.h>
#ifdef BN_MP_READ_SIGNED_BIN_C
/* LibTomMath, multiple-precision integer library -- Tom St Denis
*
@@ -12,7 +12,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tstdenis82@gmail.com, http://libtom.org
*/
/* read signed bin, big endian, first byte is 0==positive or 1==negative */
@@ -36,6 +36,6 @@ int mp_read_signed_bin (mp_int * a, const unsigned char *b, int c)
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_read_signed_bin.c,v $ */
-/* $Revision: 1.4 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtommath/bn_mp_read_unsigned_bin.c b/libtommath/bn_mp_read_unsigned_bin.c
index 0c471ed..e8e5df8 100644
--- a/libtommath/bn_mp_read_unsigned_bin.c
+++ b/libtommath/bn_mp_read_unsigned_bin.c
@@ -1,4 +1,4 @@
-#include <tommath.h>
+#include <tommath_private.h>
#ifdef BN_MP_READ_UNSIGNED_BIN_C
/* LibTomMath, multiple-precision integer library -- Tom St Denis
*
@@ -12,7 +12,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tstdenis82@gmail.com, http://libtom.org
*/
/* reads a unsigned char array, assumes the msb is stored first [big endian] */
@@ -37,12 +37,12 @@ int mp_read_unsigned_bin (mp_int * a, const unsigned char *b, int c)
}
#ifndef MP_8BIT
- a->dp[0] |= *b++;
- a->used += 1;
+ a->dp[0] |= *b++;
+ a->used += 1;
#else
- a->dp[0] = (*b & MP_MASK);
- a->dp[1] |= ((*b++ >> 7U) & 1);
- a->used += 2;
+ a->dp[0] = (*b & MP_MASK);
+ a->dp[1] |= ((*b++ >> 7U) & 1);
+ a->used += 2;
#endif
}
mp_clamp (a);
@@ -50,6 +50,6 @@ int mp_read_unsigned_bin (mp_int * a, const unsigned char *b, int c)
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_read_unsigned_bin.c,v $ */
-/* $Revision: 1.4 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtommath/bn_mp_reduce.c b/libtommath/bn_mp_reduce.c
index 3f7284a..e2c3a58 100644
--- a/libtommath/bn_mp_reduce.c
+++ b/libtommath/bn_mp_reduce.c
@@ -1,4 +1,4 @@
-#include <tommath.h>
+#include <tommath_private.h>
#ifdef BN_MP_REDUCE_C
/* LibTomMath, multiple-precision integer library -- Tom St Denis
*
@@ -12,10 +12,10 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tstdenis82@gmail.com, http://libtom.org
*/
-/* reduces x mod m, assumes 0 < x < m**2, mu is
+/* reduces x mod m, assumes 0 < x < m**2, mu is
* precomputed via mp_reduce_setup.
* From HAC pp.604 Algorithm 14.42
*/
@@ -30,10 +30,10 @@ int mp_reduce (mp_int * x, mp_int * m, mp_int * mu)
}
/* q1 = x / b**(k-1) */
- mp_rshd (&q, um - 1);
+ mp_rshd (&q, um - 1);
/* according to HAC this optimization is ok */
- if (((unsigned long) um) > (((mp_digit)1) << (DIGIT_BIT - 1))) {
+ if (((mp_digit) um) > (((mp_digit)1) << (DIGIT_BIT - 1))) {
if ((res = mp_mul (&q, mu, &q)) != MP_OKAY) {
goto CLEANUP;
}
@@ -46,8 +46,8 @@ int mp_reduce (mp_int * x, mp_int * m, mp_int * mu)
if ((res = fast_s_mp_mul_high_digs (&q, mu, &q, um)) != MP_OKAY) {
goto CLEANUP;
}
-#else
- {
+#else
+ {
res = MP_VAL;
goto CLEANUP;
}
@@ -55,7 +55,7 @@ int mp_reduce (mp_int * x, mp_int * m, mp_int * mu)
}
/* q3 = q2 / b**(k+1) */
- mp_rshd (&q, um + 1);
+ mp_rshd (&q, um + 1);
/* x = x mod b**(k+1), quick (no division) */
if ((res = mp_mod_2d (x, DIGIT_BIT * (um + 1), x)) != MP_OKAY) {
@@ -87,7 +87,7 @@ int mp_reduce (mp_int * x, mp_int * m, mp_int * mu)
goto CLEANUP;
}
}
-
+
CLEANUP:
mp_clear (&q);
@@ -95,6 +95,6 @@ CLEANUP:
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_reduce.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtommath/bn_mp_reduce_2k.c b/libtommath/bn_mp_reduce_2k.c
index 5810696..2876a75 100644
--- a/libtommath/bn_mp_reduce_2k.c
+++ b/libtommath/bn_mp_reduce_2k.c
@@ -1,4 +1,4 @@
-#include <tommath.h>
+#include <tommath_private.h>
#ifdef BN_MP_REDUCE_2K_C
/* LibTomMath, multiple-precision integer library -- Tom St Denis
*
@@ -12,7 +12,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tstdenis82@gmail.com, http://libtom.org
*/
/* reduces a modulo n where n is of the form 2**p - d */
@@ -20,35 +20,37 @@ int mp_reduce_2k(mp_int *a, mp_int *n, mp_digit d)
{
mp_int q;
int p, res;
-
+
if ((res = mp_init(&q)) != MP_OKAY) {
return res;
}
-
- p = mp_count_bits(n);
+
+ p = mp_count_bits(n);
top:
/* q = a/2**p, a = a mod 2**p */
if ((res = mp_div_2d(a, p, &q, a)) != MP_OKAY) {
goto ERR;
}
-
+
if (d != 1) {
/* q = q * d */
- if ((res = mp_mul_d(&q, d, &q)) != MP_OKAY) {
+ if ((res = mp_mul_d(&q, d, &q)) != MP_OKAY) {
goto ERR;
}
}
-
+
/* a = a + q */
if ((res = s_mp_add(a, &q, a)) != MP_OKAY) {
goto ERR;
}
-
+
if (mp_cmp_mag(a, n) != MP_LT) {
- s_mp_sub(a, n, a);
+ if ((res = s_mp_sub(a, n, a)) != MP_OKAY) {
+ goto ERR;
+ }
goto top;
}
-
+
ERR:
mp_clear(&q);
return res;
@@ -56,6 +58,6 @@ ERR:
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_reduce_2k.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtommath/bn_mp_reduce_2k_l.c b/libtommath/bn_mp_reduce_2k_l.c
index 53b435f..3225214 100644
--- a/libtommath/bn_mp_reduce_2k_l.c
+++ b/libtommath/bn_mp_reduce_2k_l.c
@@ -1,4 +1,4 @@
-#include <tommath.h>
+#include <tommath_private.h>
#ifdef BN_MP_REDUCE_2K_L_C
/* LibTomMath, multiple-precision integer library -- Tom St Denis
*
@@ -12,10 +12,10 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tstdenis82@gmail.com, http://libtom.org
*/
-/* reduces a modulo n where n is of the form 2**p - d
+/* reduces a modulo n where n is of the form 2**p - d
This differs from reduce_2k since "d" can be larger
than a single digit.
*/
@@ -23,33 +23,35 @@ int mp_reduce_2k_l(mp_int *a, mp_int *n, mp_int *d)
{
mp_int q;
int p, res;
-
+
if ((res = mp_init(&q)) != MP_OKAY) {
return res;
}
-
- p = mp_count_bits(n);
+
+ p = mp_count_bits(n);
top:
/* q = a/2**p, a = a mod 2**p */
if ((res = mp_div_2d(a, p, &q, a)) != MP_OKAY) {
goto ERR;
}
-
+
/* q = q * d */
- if ((res = mp_mul(&q, d, &q)) != MP_OKAY) {
+ if ((res = mp_mul(&q, d, &q)) != MP_OKAY) {
goto ERR;
}
-
+
/* a = a + q */
if ((res = s_mp_add(a, &q, a)) != MP_OKAY) {
goto ERR;
}
-
+
if (mp_cmp_mag(a, n) != MP_LT) {
- s_mp_sub(a, n, a);
+ if ((res = s_mp_sub(a, n, a)) != MP_OKAY) {
+ goto ERR;
+ }
goto top;
}
-
+
ERR:
mp_clear(&q);
return res;
@@ -57,6 +59,6 @@ ERR:
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_reduce_2k_l.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtommath/bn_mp_reduce_2k_setup.c b/libtommath/bn_mp_reduce_2k_setup.c
index 07de0ec..545051e 100644
--- a/libtommath/bn_mp_reduce_2k_setup.c
+++ b/libtommath/bn_mp_reduce_2k_setup.c
@@ -1,4 +1,4 @@
-#include <tommath.h>
+#include <tommath_private.h>
#ifdef BN_MP_REDUCE_2K_SETUP_C
/* LibTomMath, multiple-precision integer library -- Tom St Denis
*
@@ -12,7 +12,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tstdenis82@gmail.com, http://libtom.org
*/
/* determines the setup value */
@@ -42,6 +42,6 @@ int mp_reduce_2k_setup(mp_int *a, mp_digit *d)
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_reduce_2k_setup.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtommath/bn_mp_reduce_2k_setup_l.c b/libtommath/bn_mp_reduce_2k_setup_l.c
index 05f0385..59132dd 100644
--- a/libtommath/bn_mp_reduce_2k_setup_l.c
+++ b/libtommath/bn_mp_reduce_2k_setup_l.c
@@ -1,4 +1,4 @@
-#include <tommath.h>
+#include <tommath_private.h>
#ifdef BN_MP_REDUCE_2K_SETUP_L_C
/* LibTomMath, multiple-precision integer library -- Tom St Denis
*
@@ -12,7 +12,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tstdenis82@gmail.com, http://libtom.org
*/
/* determines the setup value */
@@ -39,6 +39,6 @@ ERR:
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_reduce_2k_setup_l.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtommath/bn_mp_reduce_is_2k.c b/libtommath/bn_mp_reduce_is_2k.c
index 0897b0a..784947b 100644
--- a/libtommath/bn_mp_reduce_is_2k.c
+++ b/libtommath/bn_mp_reduce_is_2k.c
@@ -1,4 +1,4 @@
-#include <tommath.h>
+#include <tommath_private.h>
#ifdef BN_MP_REDUCE_IS_2K_C
/* LibTomMath, multiple-precision integer library -- Tom St Denis
*
@@ -12,7 +12,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tstdenis82@gmail.com, http://libtom.org
*/
/* determines if mp_reduce_2k can be used */
@@ -47,6 +47,6 @@ int mp_reduce_is_2k(mp_int *a)
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_reduce_is_2k.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtommath/bn_mp_reduce_is_2k_l.c b/libtommath/bn_mp_reduce_is_2k_l.c
index c4b42c9..c193f39 100644
--- a/libtommath/bn_mp_reduce_is_2k_l.c
+++ b/libtommath/bn_mp_reduce_is_2k_l.c
@@ -1,4 +1,4 @@
-#include <tommath.h>
+#include <tommath_private.h>
#ifdef BN_MP_REDUCE_IS_2K_L_C
/* LibTomMath, multiple-precision integer library -- Tom St Denis
*
@@ -12,7 +12,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tstdenis82@gmail.com, http://libtom.org
*/
/* determines if reduce_2k_l can be used */
@@ -39,6 +39,6 @@ int mp_reduce_is_2k_l(mp_int *a)
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_reduce_is_2k_l.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtommath/bn_mp_reduce_setup.c b/libtommath/bn_mp_reduce_setup.c
index 5085af0..f97eed5 100644
--- a/libtommath/bn_mp_reduce_setup.c
+++ b/libtommath/bn_mp_reduce_setup.c
@@ -1,4 +1,4 @@
-#include <tommath.h>
+#include <tommath_private.h>
#ifdef BN_MP_REDUCE_SETUP_C
/* LibTomMath, multiple-precision integer library -- Tom St Denis
*
@@ -12,7 +12,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tstdenis82@gmail.com, http://libtom.org
*/
/* pre-calculate the value required for Barrett reduction
@@ -29,6 +29,6 @@ int mp_reduce_setup (mp_int * a, mp_int * b)
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_reduce_setup.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtommath/bn_mp_rshd.c b/libtommath/bn_mp_rshd.c
index 534bd4d..77b0f6c 100644
--- a/libtommath/bn_mp_rshd.c
+++ b/libtommath/bn_mp_rshd.c
@@ -1,4 +1,4 @@
-#include <tommath.h>
+#include <tommath_private.h>
#ifdef BN_MP_RSHD_C
/* LibTomMath, multiple-precision integer library -- Tom St Denis
*
@@ -12,7 +12,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tstdenis82@gmail.com, http://libtom.org
*/
/* shift right a certain amount of digits */
@@ -32,7 +32,7 @@ void mp_rshd (mp_int * a, int b)
}
{
- register mp_digit *bottom, *top;
+ mp_digit *bottom, *top;
/* shift the digits down */
@@ -67,6 +67,6 @@ void mp_rshd (mp_int * a, int b)
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_rshd.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtommath/bn_mp_set.c b/libtommath/bn_mp_set.c
index a1ebadb..cac48ea 100644
--- a/libtommath/bn_mp_set.c
+++ b/libtommath/bn_mp_set.c
@@ -1,4 +1,4 @@
-#include <tommath.h>
+#include <tommath_private.h>
#ifdef BN_MP_SET_C
/* LibTomMath, multiple-precision integer library -- Tom St Denis
*
@@ -12,7 +12,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tstdenis82@gmail.com, http://libtom.org
*/
/* set to a digit */
@@ -24,6 +24,6 @@ void mp_set (mp_int * a, mp_digit b)
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_set.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtommath/bn_mp_set_int.c b/libtommath/bn_mp_set_int.c
index 35e844f..5aa59d5 100644
--- a/libtommath/bn_mp_set_int.c
+++ b/libtommath/bn_mp_set_int.c
@@ -1,4 +1,4 @@
-#include <tommath.h>
+#include <tommath_private.h>
#ifdef BN_MP_SET_INT_C
/* LibTomMath, multiple-precision integer library -- Tom St Denis
*
@@ -12,7 +12,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tstdenis82@gmail.com, http://libtom.org
*/
/* set a 32-bit const */
@@ -43,6 +43,6 @@ int mp_set_int (mp_int * a, unsigned long b)
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_set_int.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtommath/bn_mp_set_long.c b/libtommath/bn_mp_set_long.c
new file mode 100644
index 0000000..281fce7
--- /dev/null
+++ b/libtommath/bn_mp_set_long.c
@@ -0,0 +1,24 @@
+#include <tommath_private.h>
+#ifdef BN_MP_SET_LONG_C
+/* LibTomMath, multiple-precision integer library -- Tom St Denis
+ *
+ * LibTomMath is a library that provides multiple-precision
+ * integer arithmetic as well as number theoretic functionality.
+ *
+ * The library was designed directly after the MPI library by
+ * Michael Fromberger but has been written from scratch with
+ * additional optimizations in place.
+ *
+ * The library is free for all purposes without any express
+ * guarantee it works.
+ *
+ * Tom St Denis, tstdenis82@gmail.com, http://libtom.org
+ */
+
+/* set a platform dependent unsigned long int */
+MP_SET_XLONG(mp_set_long, unsigned long)
+#endif
+
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtommath/bn_mp_set_long_long.c b/libtommath/bn_mp_set_long_long.c
new file mode 100644
index 0000000..3c4b01a
--- /dev/null
+++ b/libtommath/bn_mp_set_long_long.c
@@ -0,0 +1,24 @@
+#include <tommath_private.h>
+#ifdef BN_MP_SET_LONG_LONG_C
+/* LibTomMath, multiple-precision integer library -- Tom St Denis
+ *
+ * LibTomMath is a library that provides multiple-precision
+ * integer arithmetic as well as number theoretic functionality.
+ *
+ * The library was designed directly after the MPI library by
+ * Michael Fromberger but has been written from scratch with
+ * additional optimizations in place.
+ *
+ * The library is free for all purposes without any express
+ * guarantee it works.
+ *
+ * Tom St Denis, tstdenis82@gmail.com, http://libtom.org
+ */
+
+/* set a platform dependent unsigned long long int */
+MP_SET_XLONG(mp_set_long_long, unsigned long long)
+#endif
+
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtommath/bn_mp_shrink.c b/libtommath/bn_mp_shrink.c
index e676068..1ad2ede 100644
--- a/libtommath/bn_mp_shrink.c
+++ b/libtommath/bn_mp_shrink.c
@@ -1,4 +1,4 @@
-#include <tommath.h>
+#include <tommath_private.h>
#ifdef BN_MP_SHRINK_C
/* LibTomMath, multiple-precision integer library -- Tom St Denis
*
@@ -12,24 +12,30 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tstdenis82@gmail.com, http://libtom.org
*/
/* shrink a bignum */
int mp_shrink (mp_int * a)
{
mp_digit *tmp;
- if (a->alloc != a->used && a->used > 0) {
- if ((tmp = OPT_CAST(mp_digit) XREALLOC (a->dp, sizeof (mp_digit) * a->used)) == NULL) {
+ int used = 1;
+
+ if(a->used > 0) {
+ used = a->used;
+ }
+
+ if (a->alloc != used) {
+ if ((tmp = OPT_CAST(mp_digit) XREALLOC (a->dp, sizeof (mp_digit) * used)) == NULL) {
return MP_MEM;
}
a->dp = tmp;
- a->alloc = a->used;
+ a->alloc = used;
}
return MP_OKAY;
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_shrink.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtommath/bn_mp_signed_bin_size.c b/libtommath/bn_mp_signed_bin_size.c
index 8df0b78..0e760a6 100644
--- a/libtommath/bn_mp_signed_bin_size.c
+++ b/libtommath/bn_mp_signed_bin_size.c
@@ -1,4 +1,4 @@
-#include <tommath.h>
+#include <tommath_private.h>
#ifdef BN_MP_SIGNED_BIN_SIZE_C
/* LibTomMath, multiple-precision integer library -- Tom St Denis
*
@@ -12,7 +12,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tstdenis82@gmail.com, http://libtom.org
*/
/* get the size for an signed equivalent */
@@ -22,6 +22,6 @@ int mp_signed_bin_size (mp_int * a)
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_signed_bin_size.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtommath/bn_mp_sqr.c b/libtommath/bn_mp_sqr.c
index bff8a7d..ad2099b 100644
--- a/libtommath/bn_mp_sqr.c
+++ b/libtommath/bn_mp_sqr.c
@@ -1,4 +1,4 @@
-#include <tommath.h>
+#include <tommath_private.h>
#ifdef BN_MP_SQR_C
/* LibTomMath, multiple-precision integer library -- Tom St Denis
*
@@ -12,7 +12,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tstdenis82@gmail.com, http://libtom.org
*/
/* computes b = a*a */
@@ -29,30 +29,32 @@ mp_sqr (mp_int * a, mp_int * b)
} else
#endif
#ifdef BN_MP_KARATSUBA_SQR_C
-if (a->used >= KARATSUBA_SQR_CUTOFF) {
+ if (a->used >= KARATSUBA_SQR_CUTOFF) {
res = mp_karatsuba_sqr (a, b);
} else
#endif
{
#ifdef BN_FAST_S_MP_SQR_C
/* can we use the fast comba multiplier? */
- if ((a->used * 2 + 1) < MP_WARRAY &&
- a->used <
- (1 << (sizeof(mp_word) * CHAR_BIT - 2*DIGIT_BIT - 1))) {
+ if ((((a->used * 2) + 1) < MP_WARRAY) &&
+ (a->used <
+ (1 << (((sizeof(mp_word) * CHAR_BIT) - (2 * DIGIT_BIT)) - 1)))) {
res = fast_s_mp_sqr (a, b);
} else
#endif
+ {
#ifdef BN_S_MP_SQR_C
res = s_mp_sqr (a, b);
#else
res = MP_VAL;
#endif
+ }
}
b->sign = MP_ZPOS;
return res;
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_sqr.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtommath/bn_mp_sqrmod.c b/libtommath/bn_mp_sqrmod.c
index 38cbc92..2f9463d 100644
--- a/libtommath/bn_mp_sqrmod.c
+++ b/libtommath/bn_mp_sqrmod.c
@@ -1,4 +1,4 @@
-#include <tommath.h>
+#include <tommath_private.h>
#ifdef BN_MP_SQRMOD_C
/* LibTomMath, multiple-precision integer library -- Tom St Denis
*
@@ -12,7 +12,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tstdenis82@gmail.com, http://libtom.org
*/
/* c = a * a (mod b) */
@@ -36,6 +36,6 @@ mp_sqrmod (mp_int * a, mp_int * b, mp_int * c)
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_sqrmod.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtommath/bn_mp_sqrt.c b/libtommath/bn_mp_sqrt.c
index 4449625..4a52f5e 100644
--- a/libtommath/bn_mp_sqrt.c
+++ b/libtommath/bn_mp_sqrt.c
@@ -1,4 +1,4 @@
-#include <tommath.h>
+#include <tommath_private.h>
#ifdef BN_MP_SQRT_C
/* LibTomMath, multiple-precision integer library -- Tom St Denis
*
@@ -12,7 +12,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tstdenis82@gmail.com, http://libtom.org
*/
/* this function is less generic than mp_n_root, simpler and faster */
@@ -76,6 +76,6 @@ E2: mp_clear(&t1);
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_sqrt.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtommath/bn_mp_sqrtmod_prime.c b/libtommath/bn_mp_sqrtmod_prime.c
new file mode 100644
index 0000000..968729e
--- /dev/null
+++ b/libtommath/bn_mp_sqrtmod_prime.c
@@ -0,0 +1,124 @@
+#include <tommath_private.h>
+#ifdef BN_MP_SQRTMOD_PRIME_C
+/* LibTomMath, multiple-precision integer library -- Tom St Denis
+ *
+ * LibTomMath is a library that provides multiple-precision
+ * integer arithmetic as well as number theoretic functionality.
+ *
+ * The library is free for all purposes without any express
+ * guarantee it works.
+ */
+
+/* Tonelli-Shanks algorithm
+ * https://en.wikipedia.org/wiki/Tonelli%E2%80%93Shanks_algorithm
+ * https://gmplib.org/list-archives/gmp-discuss/2013-April/005300.html
+ *
+ */
+
+int mp_sqrtmod_prime(mp_int *n, mp_int *prime, mp_int *ret)
+{
+ int res, legendre;
+ mp_int t1, C, Q, S, Z, M, T, R, two;
+ mp_digit i;
+
+ /* first handle the simple cases */
+ if (mp_cmp_d(n, 0) == MP_EQ) {
+ mp_zero(ret);
+ return MP_OKAY;
+ }
+ if (mp_cmp_d(prime, 2) == MP_EQ) return MP_VAL; /* prime must be odd */
+ if ((res = mp_jacobi(n, prime, &legendre)) != MP_OKAY) return res;
+ if (legendre == -1) return MP_VAL; /* quadratic non-residue mod prime */
+
+ if ((res = mp_init_multi(&t1, &C, &Q, &S, &Z, &M, &T, &R, &two, NULL)) != MP_OKAY) {
+ return res;
+ }
+
+ /* SPECIAL CASE: if prime mod 4 == 3
+ * compute directly: res = n^(prime+1)/4 mod prime
+ * Handbook of Applied Cryptography algorithm 3.36
+ */
+ if ((res = mp_mod_d(prime, 4, &i)) != MP_OKAY) goto cleanup;
+ if (i == 3) {
+ if ((res = mp_add_d(prime, 1, &t1)) != MP_OKAY) goto cleanup;
+ if ((res = mp_div_2(&t1, &t1)) != MP_OKAY) goto cleanup;
+ if ((res = mp_div_2(&t1, &t1)) != MP_OKAY) goto cleanup;
+ if ((res = mp_exptmod(n, &t1, prime, ret)) != MP_OKAY) goto cleanup;
+ res = MP_OKAY;
+ goto cleanup;
+ }
+
+ /* NOW: Tonelli-Shanks algorithm */
+
+ /* factor out powers of 2 from prime-1, defining Q and S as: prime-1 = Q*2^S */
+ if ((res = mp_copy(prime, &Q)) != MP_OKAY) goto cleanup;
+ if ((res = mp_sub_d(&Q, 1, &Q)) != MP_OKAY) goto cleanup;
+ /* Q = prime - 1 */
+ mp_zero(&S);
+ /* S = 0 */
+ while (mp_iseven(&Q) != MP_NO) {
+ if ((res = mp_div_2(&Q, &Q)) != MP_OKAY) goto cleanup;
+ /* Q = Q / 2 */
+ if ((res = mp_add_d(&S, 1, &S)) != MP_OKAY) goto cleanup;
+ /* S = S + 1 */
+ }
+
+ /* find a Z such that the Legendre symbol (Z|prime) == -1 */
+ if ((res = mp_set_int(&Z, 2)) != MP_OKAY) goto cleanup;
+ /* Z = 2 */
+ while(1) {
+ if ((res = mp_jacobi(&Z, prime, &legendre)) != MP_OKAY) goto cleanup;
+ if (legendre == -1) break;
+ if ((res = mp_add_d(&Z, 1, &Z)) != MP_OKAY) goto cleanup;
+ /* Z = Z + 1 */
+ }
+
+ if ((res = mp_exptmod(&Z, &Q, prime, &C)) != MP_OKAY) goto cleanup;
+ /* C = Z ^ Q mod prime */
+ if ((res = mp_add_d(&Q, 1, &t1)) != MP_OKAY) goto cleanup;
+ if ((res = mp_div_2(&t1, &t1)) != MP_OKAY) goto cleanup;
+ /* t1 = (Q + 1) / 2 */
+ if ((res = mp_exptmod(n, &t1, prime, &R)) != MP_OKAY) goto cleanup;
+ /* R = n ^ ((Q + 1) / 2) mod prime */
+ if ((res = mp_exptmod(n, &Q, prime, &T)) != MP_OKAY) goto cleanup;
+ /* T = n ^ Q mod prime */
+ if ((res = mp_copy(&S, &M)) != MP_OKAY) goto cleanup;
+ /* M = S */
+ if ((res = mp_set_int(&two, 2)) != MP_OKAY) goto cleanup;
+
+ res = MP_VAL;
+ while (1) {
+ if ((res = mp_copy(&T, &t1)) != MP_OKAY) goto cleanup;
+ i = 0;
+ while (1) {
+ if (mp_cmp_d(&t1, 1) == MP_EQ) break;
+ if ((res = mp_exptmod(&t1, &two, prime, &t1)) != MP_OKAY) goto cleanup;
+ i++;
+ }
+ if (i == 0) {
+ if ((res = mp_copy(&R, ret)) != MP_OKAY) goto cleanup;
+ res = MP_OKAY;
+ goto cleanup;
+ }
+ if ((res = mp_sub_d(&M, i, &t1)) != MP_OKAY) goto cleanup;
+ if ((res = mp_sub_d(&t1, 1, &t1)) != MP_OKAY) goto cleanup;
+ if ((res = mp_exptmod(&two, &t1, prime, &t1)) != MP_OKAY) goto cleanup;
+ /* t1 = 2 ^ (M - i - 1) */
+ if ((res = mp_exptmod(&C, &t1, prime, &t1)) != MP_OKAY) goto cleanup;
+ /* t1 = C ^ (2 ^ (M - i - 1)) mod prime */
+ if ((res = mp_sqrmod(&t1, prime, &C)) != MP_OKAY) goto cleanup;
+ /* C = (t1 * t1) mod prime */
+ if ((res = mp_mulmod(&R, &t1, prime, &R)) != MP_OKAY) goto cleanup;
+ /* R = (R * t1) mod prime */
+ if ((res = mp_mulmod(&T, &C, prime, &T)) != MP_OKAY) goto cleanup;
+ /* T = (T * C) mod prime */
+ mp_set(&M, i);
+ /* M = i */
+ }
+
+cleanup:
+ mp_clear_multi(&t1, &C, &Q, &S, &Z, &M, &T, &R, &two, NULL);
+ return res;
+}
+
+#endif
diff --git a/libtommath/bn_mp_sub.c b/libtommath/bn_mp_sub.c
index a69d032..0d616c2 100644
--- a/libtommath/bn_mp_sub.c
+++ b/libtommath/bn_mp_sub.c
@@ -1,4 +1,4 @@
-#include <tommath.h>
+#include <tommath_private.h>
#ifdef BN_MP_SUB_C
/* LibTomMath, multiple-precision integer library -- Tom St Denis
*
@@ -12,7 +12,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tstdenis82@gmail.com, http://libtom.org
*/
/* high level subtraction (handles signs) */
@@ -54,6 +54,6 @@ mp_sub (mp_int * a, mp_int * b, mp_int * c)
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_sub.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtommath/bn_mp_sub_d.c b/libtommath/bn_mp_sub_d.c
index ee77a5a..f5a932f 100644
--- a/libtommath/bn_mp_sub_d.c
+++ b/libtommath/bn_mp_sub_d.c
@@ -1,4 +1,4 @@
-#include <tommath.h>
+#include <tommath_private.h>
#ifdef BN_MP_SUB_D_C
/* LibTomMath, multiple-precision integer library -- Tom St Denis
*
@@ -12,7 +12,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tstdenis82@gmail.com, http://libtom.org
*/
/* single digit subtraction */
@@ -23,7 +23,7 @@ mp_sub_d (mp_int * a, mp_digit b, mp_int * c)
int res, ix, oldused;
/* grow c as required */
- if (c->alloc < a->used + 1) {
+ if (c->alloc < (a->used + 1)) {
if ((res = mp_grow(c, a->used + 1)) != MP_OKAY) {
return res;
}
@@ -49,7 +49,7 @@ mp_sub_d (mp_int * a, mp_digit b, mp_int * c)
tmpc = c->dp;
/* if a <= b simply fix the single digit */
- if ((a->used == 1 && a->dp[0] <= b) || a->used == 0) {
+ if (((a->used == 1) && (a->dp[0] <= b)) || (a->used == 0)) {
if (a->used == 1) {
*tmpc++ = b - *tmpa;
} else {
@@ -67,13 +67,13 @@ mp_sub_d (mp_int * a, mp_digit b, mp_int * c)
/* subtract first digit */
*tmpc = *tmpa++ - b;
- mu = *tmpc >> (sizeof(mp_digit) * CHAR_BIT - 1);
+ mu = *tmpc >> ((sizeof(mp_digit) * CHAR_BIT) - 1);
*tmpc++ &= MP_MASK;
/* handle rest of the digits */
for (ix = 1; ix < a->used; ix++) {
*tmpc = *tmpa++ - mu;
- mu = *tmpc >> (sizeof(mp_digit) * CHAR_BIT - 1);
+ mu = *tmpc >> ((sizeof(mp_digit) * CHAR_BIT) - 1);
*tmpc++ &= MP_MASK;
}
}
@@ -88,6 +88,6 @@ mp_sub_d (mp_int * a, mp_digit b, mp_int * c)
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_sub_d.c,v $ */
-/* $Revision: 1.5 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtommath/bn_mp_submod.c b/libtommath/bn_mp_submod.c
index bd24f25..87e0889 100644
--- a/libtommath/bn_mp_submod.c
+++ b/libtommath/bn_mp_submod.c
@@ -1,4 +1,4 @@
-#include <tommath.h>
+#include <tommath_private.h>
#ifdef BN_MP_SUBMOD_C
/* LibTomMath, multiple-precision integer library -- Tom St Denis
*
@@ -12,7 +12,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tstdenis82@gmail.com, http://libtom.org
*/
/* d = a - b (mod c) */
@@ -37,6 +37,6 @@ mp_submod (mp_int * a, mp_int * b, mp_int * c, mp_int * d)
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_submod.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtommath/bn_mp_to_signed_bin.c b/libtommath/bn_mp_to_signed_bin.c
index 9125d07..e9289ea 100644
--- a/libtommath/bn_mp_to_signed_bin.c
+++ b/libtommath/bn_mp_to_signed_bin.c
@@ -1,4 +1,4 @@
-#include <tommath.h>
+#include <tommath_private.h>
#ifdef BN_MP_TO_SIGNED_BIN_C
/* LibTomMath, multiple-precision integer library -- Tom St Denis
*
@@ -12,7 +12,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tstdenis82@gmail.com, http://libtom.org
*/
/* store in signed [big endian] format */
@@ -23,11 +23,11 @@ int mp_to_signed_bin (mp_int * a, unsigned char *b)
if ((res = mp_to_unsigned_bin (a, b + 1)) != MP_OKAY) {
return res;
}
- b[0] = (unsigned char) ((a->sign == MP_ZPOS) ? 0 : 1);
+ b[0] = (a->sign == MP_ZPOS) ? (unsigned char)0 : (unsigned char)1;
return MP_OKAY;
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_to_signed_bin.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtommath/bn_mp_to_signed_bin_n.c b/libtommath/bn_mp_to_signed_bin_n.c
index 4e9d217..d4fe6e6 100644
--- a/libtommath/bn_mp_to_signed_bin_n.c
+++ b/libtommath/bn_mp_to_signed_bin_n.c
@@ -1,4 +1,4 @@
-#include <tommath.h>
+#include <tommath_private.h>
#ifdef BN_MP_TO_SIGNED_BIN_N_C
/* LibTomMath, multiple-precision integer library -- Tom St Denis
*
@@ -12,7 +12,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tstdenis82@gmail.com, http://libtom.org
*/
/* store in signed [big endian] format */
@@ -26,6 +26,6 @@ int mp_to_signed_bin_n (mp_int * a, unsigned char *b, unsigned long *outlen)
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_to_signed_bin_n.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtommath/bn_mp_to_unsigned_bin.c b/libtommath/bn_mp_to_unsigned_bin.c
index b25935d..d3ef46f 100644
--- a/libtommath/bn_mp_to_unsigned_bin.c
+++ b/libtommath/bn_mp_to_unsigned_bin.c
@@ -1,4 +1,4 @@
-#include <tommath.h>
+#include <tommath_private.h>
#ifdef BN_MP_TO_UNSIGNED_BIN_C
/* LibTomMath, multiple-precision integer library -- Tom St Denis
*
@@ -12,7 +12,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tstdenis82@gmail.com, http://libtom.org
*/
/* store in unsigned [big endian] format */
@@ -26,7 +26,7 @@ int mp_to_unsigned_bin (mp_int * a, unsigned char *b)
}
x = 0;
- while (mp_iszero (&t) == 0) {
+ while (mp_iszero (&t) == MP_NO) {
#ifndef MP_8BIT
b[x++] = (unsigned char) (t.dp[0] & 255);
#else
@@ -43,6 +43,6 @@ int mp_to_unsigned_bin (mp_int * a, unsigned char *b)
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_to_unsigned_bin.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtommath/bn_mp_to_unsigned_bin_n.c b/libtommath/bn_mp_to_unsigned_bin_n.c
index 4abf4e1..2da13cc 100644
--- a/libtommath/bn_mp_to_unsigned_bin_n.c
+++ b/libtommath/bn_mp_to_unsigned_bin_n.c
@@ -1,4 +1,4 @@
-#include <tommath.h>
+#include <tommath_private.h>
#ifdef BN_MP_TO_UNSIGNED_BIN_N_C
/* LibTomMath, multiple-precision integer library -- Tom St Denis
*
@@ -12,7 +12,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tstdenis82@gmail.com, http://libtom.org
*/
/* store in unsigned [big endian] format */
@@ -26,6 +26,6 @@ int mp_to_unsigned_bin_n (mp_int * a, unsigned char *b, unsigned long *outlen)
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_to_unsigned_bin_n.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtommath/bn_mp_toom_mul.c b/libtommath/bn_mp_toom_mul.c
index fa29078..4731f8f 100644
--- a/libtommath/bn_mp_toom_mul.c
+++ b/libtommath/bn_mp_toom_mul.c
@@ -1,4 +1,4 @@
-#include <tommath.h>
+#include <tommath_private.h>
#ifdef BN_MP_TOOM_MUL_C
/* LibTomMath, multiple-precision integer library -- Tom St Denis
*
@@ -12,31 +12,31 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tstdenis82@gmail.com, http://libtom.org
*/
-/* multiplication using the Toom-Cook 3-way algorithm
+/* multiplication using the Toom-Cook 3-way algorithm
*
- * Much more complicated than Karatsuba but has a lower
- * asymptotic running time of O(N**1.464). This algorithm is
- * only particularly useful on VERY large inputs
+ * Much more complicated than Karatsuba but has a lower
+ * asymptotic running time of O(N**1.464). This algorithm is
+ * only particularly useful on VERY large inputs
* (we're talking 1000s of digits here...).
*/
int mp_toom_mul(mp_int *a, mp_int *b, mp_int *c)
{
mp_int w0, w1, w2, w3, w4, tmp1, tmp2, a0, a1, a2, b0, b1, b2;
int res, B;
-
+
/* init temps */
- if ((res = mp_init_multi(&w0, &w1, &w2, &w3, &w4,
- &a0, &a1, &a2, &b0, &b1,
+ if ((res = mp_init_multi(&w0, &w1, &w2, &w3, &w4,
+ &a0, &a1, &a2, &b0, &b1,
&b2, &tmp1, &tmp2, NULL)) != MP_OKAY) {
return res;
}
-
+
/* B */
B = MIN(a->used, b->used) / 3;
-
+
/* a = a2 * B**2 + a1 * B + a0 */
if ((res = mp_mod_2d(a, DIGIT_BIT * B, &a0)) != MP_OKAY) {
goto ERR;
@@ -46,13 +46,15 @@ int mp_toom_mul(mp_int *a, mp_int *b, mp_int *c)
goto ERR;
}
mp_rshd(&a1, B);
- mp_mod_2d(&a1, DIGIT_BIT * B, &a1);
+ if ((res = mp_mod_2d(&a1, DIGIT_BIT * B, &a1)) != MP_OKAY) {
+ goto ERR;
+ }
if ((res = mp_copy(a, &a2)) != MP_OKAY) {
goto ERR;
}
mp_rshd(&a2, B*2);
-
+
/* b = b2 * B**2 + b1 * B + b0 */
if ((res = mp_mod_2d(b, DIGIT_BIT * B, &b0)) != MP_OKAY) {
goto ERR;
@@ -62,23 +64,23 @@ int mp_toom_mul(mp_int *a, mp_int *b, mp_int *c)
goto ERR;
}
mp_rshd(&b1, B);
- mp_mod_2d(&b1, DIGIT_BIT * B, &b1);
+ (void)mp_mod_2d(&b1, DIGIT_BIT * B, &b1);
if ((res = mp_copy(b, &b2)) != MP_OKAY) {
goto ERR;
}
mp_rshd(&b2, B*2);
-
+
/* w0 = a0*b0 */
if ((res = mp_mul(&a0, &b0, &w0)) != MP_OKAY) {
goto ERR;
}
-
+
/* w4 = a2 * b2 */
if ((res = mp_mul(&a2, &b2, &w4)) != MP_OKAY) {
goto ERR;
}
-
+
/* w1 = (a2 + 2(a1 + 2a0))(b2 + 2(b1 + 2b0)) */
if ((res = mp_mul_2(&a0, &tmp1)) != MP_OKAY) {
goto ERR;
@@ -92,7 +94,7 @@ int mp_toom_mul(mp_int *a, mp_int *b, mp_int *c)
if ((res = mp_add(&tmp1, &a2, &tmp1)) != MP_OKAY) {
goto ERR;
}
-
+
if ((res = mp_mul_2(&b0, &tmp2)) != MP_OKAY) {
goto ERR;
}
@@ -105,11 +107,11 @@ int mp_toom_mul(mp_int *a, mp_int *b, mp_int *c)
if ((res = mp_add(&tmp2, &b2, &tmp2)) != MP_OKAY) {
goto ERR;
}
-
+
if ((res = mp_mul(&tmp1, &tmp2, &w1)) != MP_OKAY) {
goto ERR;
}
-
+
/* w3 = (a0 + 2(a1 + 2a2))(b0 + 2(b1 + 2b2)) */
if ((res = mp_mul_2(&a2, &tmp1)) != MP_OKAY) {
goto ERR;
@@ -123,7 +125,7 @@ int mp_toom_mul(mp_int *a, mp_int *b, mp_int *c)
if ((res = mp_add(&tmp1, &a0, &tmp1)) != MP_OKAY) {
goto ERR;
}
-
+
if ((res = mp_mul_2(&b2, &tmp2)) != MP_OKAY) {
goto ERR;
}
@@ -136,11 +138,11 @@ int mp_toom_mul(mp_int *a, mp_int *b, mp_int *c)
if ((res = mp_add(&tmp2, &b0, &tmp2)) != MP_OKAY) {
goto ERR;
}
-
+
if ((res = mp_mul(&tmp1, &tmp2, &w3)) != MP_OKAY) {
goto ERR;
}
-
+
/* w2 = (a2 + a1 + a0)(b2 + b1 + b0) */
if ((res = mp_add(&a2, &a1, &tmp1)) != MP_OKAY) {
@@ -158,127 +160,127 @@ int mp_toom_mul(mp_int *a, mp_int *b, mp_int *c)
if ((res = mp_mul(&tmp1, &tmp2, &w2)) != MP_OKAY) {
goto ERR;
}
-
- /* now solve the matrix
-
+
+ /* now solve the matrix
+
0 0 0 0 1
1 2 4 8 16
1 1 1 1 1
16 8 4 2 1
1 0 0 0 0
-
- using 12 subtractions, 4 shifts,
- 2 small divisions and 1 small multiplication
+
+ using 12 subtractions, 4 shifts,
+ 2 small divisions and 1 small multiplication
*/
-
- /* r1 - r4 */
- if ((res = mp_sub(&w1, &w4, &w1)) != MP_OKAY) {
- goto ERR;
- }
- /* r3 - r0 */
- if ((res = mp_sub(&w3, &w0, &w3)) != MP_OKAY) {
- goto ERR;
- }
- /* r1/2 */
- if ((res = mp_div_2(&w1, &w1)) != MP_OKAY) {
- goto ERR;
- }
- /* r3/2 */
- if ((res = mp_div_2(&w3, &w3)) != MP_OKAY) {
- goto ERR;
- }
- /* r2 - r0 - r4 */
- if ((res = mp_sub(&w2, &w0, &w2)) != MP_OKAY) {
- goto ERR;
- }
- if ((res = mp_sub(&w2, &w4, &w2)) != MP_OKAY) {
- goto ERR;
- }
- /* r1 - r2 */
- if ((res = mp_sub(&w1, &w2, &w1)) != MP_OKAY) {
- goto ERR;
- }
- /* r3 - r2 */
- if ((res = mp_sub(&w3, &w2, &w3)) != MP_OKAY) {
- goto ERR;
- }
- /* r1 - 8r0 */
- if ((res = mp_mul_2d(&w0, 3, &tmp1)) != MP_OKAY) {
- goto ERR;
- }
- if ((res = mp_sub(&w1, &tmp1, &w1)) != MP_OKAY) {
- goto ERR;
- }
- /* r3 - 8r4 */
- if ((res = mp_mul_2d(&w4, 3, &tmp1)) != MP_OKAY) {
- goto ERR;
- }
- if ((res = mp_sub(&w3, &tmp1, &w3)) != MP_OKAY) {
- goto ERR;
- }
- /* 3r2 - r1 - r3 */
- if ((res = mp_mul_d(&w2, 3, &w2)) != MP_OKAY) {
- goto ERR;
- }
- if ((res = mp_sub(&w2, &w1, &w2)) != MP_OKAY) {
- goto ERR;
- }
- if ((res = mp_sub(&w2, &w3, &w2)) != MP_OKAY) {
- goto ERR;
- }
- /* r1 - r2 */
- if ((res = mp_sub(&w1, &w2, &w1)) != MP_OKAY) {
- goto ERR;
- }
- /* r3 - r2 */
- if ((res = mp_sub(&w3, &w2, &w3)) != MP_OKAY) {
- goto ERR;
- }
- /* r1/3 */
- if ((res = mp_div_3(&w1, &w1, NULL)) != MP_OKAY) {
- goto ERR;
- }
- /* r3/3 */
- if ((res = mp_div_3(&w3, &w3, NULL)) != MP_OKAY) {
- goto ERR;
- }
-
- /* at this point shift W[n] by B*n */
- if ((res = mp_lshd(&w1, 1*B)) != MP_OKAY) {
- goto ERR;
- }
- if ((res = mp_lshd(&w2, 2*B)) != MP_OKAY) {
- goto ERR;
- }
- if ((res = mp_lshd(&w3, 3*B)) != MP_OKAY) {
- goto ERR;
- }
- if ((res = mp_lshd(&w4, 4*B)) != MP_OKAY) {
- goto ERR;
- }
-
- if ((res = mp_add(&w0, &w1, c)) != MP_OKAY) {
- goto ERR;
- }
- if ((res = mp_add(&w2, &w3, &tmp1)) != MP_OKAY) {
- goto ERR;
- }
- if ((res = mp_add(&w4, &tmp1, &tmp1)) != MP_OKAY) {
- goto ERR;
- }
- if ((res = mp_add(&tmp1, c, c)) != MP_OKAY) {
- goto ERR;
- }
-
+
+ /* r1 - r4 */
+ if ((res = mp_sub(&w1, &w4, &w1)) != MP_OKAY) {
+ goto ERR;
+ }
+ /* r3 - r0 */
+ if ((res = mp_sub(&w3, &w0, &w3)) != MP_OKAY) {
+ goto ERR;
+ }
+ /* r1/2 */
+ if ((res = mp_div_2(&w1, &w1)) != MP_OKAY) {
+ goto ERR;
+ }
+ /* r3/2 */
+ if ((res = mp_div_2(&w3, &w3)) != MP_OKAY) {
+ goto ERR;
+ }
+ /* r2 - r0 - r4 */
+ if ((res = mp_sub(&w2, &w0, &w2)) != MP_OKAY) {
+ goto ERR;
+ }
+ if ((res = mp_sub(&w2, &w4, &w2)) != MP_OKAY) {
+ goto ERR;
+ }
+ /* r1 - r2 */
+ if ((res = mp_sub(&w1, &w2, &w1)) != MP_OKAY) {
+ goto ERR;
+ }
+ /* r3 - r2 */
+ if ((res = mp_sub(&w3, &w2, &w3)) != MP_OKAY) {
+ goto ERR;
+ }
+ /* r1 - 8r0 */
+ if ((res = mp_mul_2d(&w0, 3, &tmp1)) != MP_OKAY) {
+ goto ERR;
+ }
+ if ((res = mp_sub(&w1, &tmp1, &w1)) != MP_OKAY) {
+ goto ERR;
+ }
+ /* r3 - 8r4 */
+ if ((res = mp_mul_2d(&w4, 3, &tmp1)) != MP_OKAY) {
+ goto ERR;
+ }
+ if ((res = mp_sub(&w3, &tmp1, &w3)) != MP_OKAY) {
+ goto ERR;
+ }
+ /* 3r2 - r1 - r3 */
+ if ((res = mp_mul_d(&w2, 3, &w2)) != MP_OKAY) {
+ goto ERR;
+ }
+ if ((res = mp_sub(&w2, &w1, &w2)) != MP_OKAY) {
+ goto ERR;
+ }
+ if ((res = mp_sub(&w2, &w3, &w2)) != MP_OKAY) {
+ goto ERR;
+ }
+ /* r1 - r2 */
+ if ((res = mp_sub(&w1, &w2, &w1)) != MP_OKAY) {
+ goto ERR;
+ }
+ /* r3 - r2 */
+ if ((res = mp_sub(&w3, &w2, &w3)) != MP_OKAY) {
+ goto ERR;
+ }
+ /* r1/3 */
+ if ((res = mp_div_3(&w1, &w1, NULL)) != MP_OKAY) {
+ goto ERR;
+ }
+ /* r3/3 */
+ if ((res = mp_div_3(&w3, &w3, NULL)) != MP_OKAY) {
+ goto ERR;
+ }
+
+ /* at this point shift W[n] by B*n */
+ if ((res = mp_lshd(&w1, 1*B)) != MP_OKAY) {
+ goto ERR;
+ }
+ if ((res = mp_lshd(&w2, 2*B)) != MP_OKAY) {
+ goto ERR;
+ }
+ if ((res = mp_lshd(&w3, 3*B)) != MP_OKAY) {
+ goto ERR;
+ }
+ if ((res = mp_lshd(&w4, 4*B)) != MP_OKAY) {
+ goto ERR;
+ }
+
+ if ((res = mp_add(&w0, &w1, c)) != MP_OKAY) {
+ goto ERR;
+ }
+ if ((res = mp_add(&w2, &w3, &tmp1)) != MP_OKAY) {
+ goto ERR;
+ }
+ if ((res = mp_add(&w4, &tmp1, &tmp1)) != MP_OKAY) {
+ goto ERR;
+ }
+ if ((res = mp_add(&tmp1, c, c)) != MP_OKAY) {
+ goto ERR;
+ }
+
ERR:
- mp_clear_multi(&w0, &w1, &w2, &w3, &w4,
- &a0, &a1, &a2, &b0, &b1,
- &b2, &tmp1, &tmp2, NULL);
- return res;
-}
-
+ mp_clear_multi(&w0, &w1, &w2, &w3, &w4,
+ &a0, &a1, &a2, &b0, &b1,
+ &b2, &tmp1, &tmp2, NULL);
+ return res;
+}
+
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_toom_mul.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtommath/bn_mp_toom_sqr.c b/libtommath/bn_mp_toom_sqr.c
index 093181a..69b69d4 100644
--- a/libtommath/bn_mp_toom_sqr.c
+++ b/libtommath/bn_mp_toom_sqr.c
@@ -1,4 +1,4 @@
-#include <tommath.h>
+#include <tommath_private.h>
#ifdef BN_MP_TOOM_SQR_C
/* LibTomMath, multiple-precision integer library -- Tom St Denis
*
@@ -12,7 +12,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tstdenis82@gmail.com, http://libtom.org
*/
/* squaring using Toom-Cook 3-way algorithm */
@@ -39,7 +39,9 @@ mp_toom_sqr(mp_int *a, mp_int *b)
goto ERR;
}
mp_rshd(&a1, B);
- mp_mod_2d(&a1, DIGIT_BIT * B, &a1);
+ if ((res = mp_mod_2d(&a1, DIGIT_BIT * B, &a1)) != MP_OKAY) {
+ goto ERR;
+ }
if ((res = mp_copy(a, &a2)) != MP_OKAY) {
goto ERR;
@@ -115,112 +117,112 @@ mp_toom_sqr(mp_int *a, mp_int *b)
using 12 subtractions, 4 shifts, 2 small divisions and 1 small multiplication.
*/
- /* r1 - r4 */
- if ((res = mp_sub(&w1, &w4, &w1)) != MP_OKAY) {
- goto ERR;
- }
- /* r3 - r0 */
- if ((res = mp_sub(&w3, &w0, &w3)) != MP_OKAY) {
- goto ERR;
- }
- /* r1/2 */
- if ((res = mp_div_2(&w1, &w1)) != MP_OKAY) {
- goto ERR;
- }
- /* r3/2 */
- if ((res = mp_div_2(&w3, &w3)) != MP_OKAY) {
- goto ERR;
- }
- /* r2 - r0 - r4 */
- if ((res = mp_sub(&w2, &w0, &w2)) != MP_OKAY) {
- goto ERR;
- }
- if ((res = mp_sub(&w2, &w4, &w2)) != MP_OKAY) {
- goto ERR;
- }
- /* r1 - r2 */
- if ((res = mp_sub(&w1, &w2, &w1)) != MP_OKAY) {
- goto ERR;
- }
- /* r3 - r2 */
- if ((res = mp_sub(&w3, &w2, &w3)) != MP_OKAY) {
- goto ERR;
- }
- /* r1 - 8r0 */
- if ((res = mp_mul_2d(&w0, 3, &tmp1)) != MP_OKAY) {
- goto ERR;
- }
- if ((res = mp_sub(&w1, &tmp1, &w1)) != MP_OKAY) {
- goto ERR;
- }
- /* r3 - 8r4 */
- if ((res = mp_mul_2d(&w4, 3, &tmp1)) != MP_OKAY) {
- goto ERR;
- }
- if ((res = mp_sub(&w3, &tmp1, &w3)) != MP_OKAY) {
- goto ERR;
- }
- /* 3r2 - r1 - r3 */
- if ((res = mp_mul_d(&w2, 3, &w2)) != MP_OKAY) {
- goto ERR;
- }
- if ((res = mp_sub(&w2, &w1, &w2)) != MP_OKAY) {
- goto ERR;
- }
- if ((res = mp_sub(&w2, &w3, &w2)) != MP_OKAY) {
- goto ERR;
- }
- /* r1 - r2 */
- if ((res = mp_sub(&w1, &w2, &w1)) != MP_OKAY) {
- goto ERR;
- }
- /* r3 - r2 */
- if ((res = mp_sub(&w3, &w2, &w3)) != MP_OKAY) {
- goto ERR;
- }
- /* r1/3 */
- if ((res = mp_div_3(&w1, &w1, NULL)) != MP_OKAY) {
- goto ERR;
- }
- /* r3/3 */
- if ((res = mp_div_3(&w3, &w3, NULL)) != MP_OKAY) {
- goto ERR;
- }
-
- /* at this point shift W[n] by B*n */
- if ((res = mp_lshd(&w1, 1*B)) != MP_OKAY) {
- goto ERR;
- }
- if ((res = mp_lshd(&w2, 2*B)) != MP_OKAY) {
- goto ERR;
- }
- if ((res = mp_lshd(&w3, 3*B)) != MP_OKAY) {
- goto ERR;
- }
- if ((res = mp_lshd(&w4, 4*B)) != MP_OKAY) {
- goto ERR;
- }
-
- if ((res = mp_add(&w0, &w1, b)) != MP_OKAY) {
- goto ERR;
- }
- if ((res = mp_add(&w2, &w3, &tmp1)) != MP_OKAY) {
- goto ERR;
- }
- if ((res = mp_add(&w4, &tmp1, &tmp1)) != MP_OKAY) {
- goto ERR;
- }
- if ((res = mp_add(&tmp1, b, b)) != MP_OKAY) {
- goto ERR;
- }
+ /* r1 - r4 */
+ if ((res = mp_sub(&w1, &w4, &w1)) != MP_OKAY) {
+ goto ERR;
+ }
+ /* r3 - r0 */
+ if ((res = mp_sub(&w3, &w0, &w3)) != MP_OKAY) {
+ goto ERR;
+ }
+ /* r1/2 */
+ if ((res = mp_div_2(&w1, &w1)) != MP_OKAY) {
+ goto ERR;
+ }
+ /* r3/2 */
+ if ((res = mp_div_2(&w3, &w3)) != MP_OKAY) {
+ goto ERR;
+ }
+ /* r2 - r0 - r4 */
+ if ((res = mp_sub(&w2, &w0, &w2)) != MP_OKAY) {
+ goto ERR;
+ }
+ if ((res = mp_sub(&w2, &w4, &w2)) != MP_OKAY) {
+ goto ERR;
+ }
+ /* r1 - r2 */
+ if ((res = mp_sub(&w1, &w2, &w1)) != MP_OKAY) {
+ goto ERR;
+ }
+ /* r3 - r2 */
+ if ((res = mp_sub(&w3, &w2, &w3)) != MP_OKAY) {
+ goto ERR;
+ }
+ /* r1 - 8r0 */
+ if ((res = mp_mul_2d(&w0, 3, &tmp1)) != MP_OKAY) {
+ goto ERR;
+ }
+ if ((res = mp_sub(&w1, &tmp1, &w1)) != MP_OKAY) {
+ goto ERR;
+ }
+ /* r3 - 8r4 */
+ if ((res = mp_mul_2d(&w4, 3, &tmp1)) != MP_OKAY) {
+ goto ERR;
+ }
+ if ((res = mp_sub(&w3, &tmp1, &w3)) != MP_OKAY) {
+ goto ERR;
+ }
+ /* 3r2 - r1 - r3 */
+ if ((res = mp_mul_d(&w2, 3, &w2)) != MP_OKAY) {
+ goto ERR;
+ }
+ if ((res = mp_sub(&w2, &w1, &w2)) != MP_OKAY) {
+ goto ERR;
+ }
+ if ((res = mp_sub(&w2, &w3, &w2)) != MP_OKAY) {
+ goto ERR;
+ }
+ /* r1 - r2 */
+ if ((res = mp_sub(&w1, &w2, &w1)) != MP_OKAY) {
+ goto ERR;
+ }
+ /* r3 - r2 */
+ if ((res = mp_sub(&w3, &w2, &w3)) != MP_OKAY) {
+ goto ERR;
+ }
+ /* r1/3 */
+ if ((res = mp_div_3(&w1, &w1, NULL)) != MP_OKAY) {
+ goto ERR;
+ }
+ /* r3/3 */
+ if ((res = mp_div_3(&w3, &w3, NULL)) != MP_OKAY) {
+ goto ERR;
+ }
+
+ /* at this point shift W[n] by B*n */
+ if ((res = mp_lshd(&w1, 1*B)) != MP_OKAY) {
+ goto ERR;
+ }
+ if ((res = mp_lshd(&w2, 2*B)) != MP_OKAY) {
+ goto ERR;
+ }
+ if ((res = mp_lshd(&w3, 3*B)) != MP_OKAY) {
+ goto ERR;
+ }
+ if ((res = mp_lshd(&w4, 4*B)) != MP_OKAY) {
+ goto ERR;
+ }
+
+ if ((res = mp_add(&w0, &w1, b)) != MP_OKAY) {
+ goto ERR;
+ }
+ if ((res = mp_add(&w2, &w3, &tmp1)) != MP_OKAY) {
+ goto ERR;
+ }
+ if ((res = mp_add(&w4, &tmp1, &tmp1)) != MP_OKAY) {
+ goto ERR;
+ }
+ if ((res = mp_add(&tmp1, b, b)) != MP_OKAY) {
+ goto ERR;
+ }
ERR:
- mp_clear_multi(&w0, &w1, &w2, &w3, &w4, &a0, &a1, &a2, &tmp1, NULL);
- return res;
+ mp_clear_multi(&w0, &w1, &w2, &w3, &w4, &a0, &a1, &a2, &tmp1, NULL);
+ return res;
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_toom_sqr.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtommath/bn_mp_toradix.c b/libtommath/bn_mp_toradix.c
index c500832..f04352d 100644
--- a/libtommath/bn_mp_toradix.c
+++ b/libtommath/bn_mp_toradix.c
@@ -1,4 +1,4 @@
-#include <tommath.h>
+#include <tommath_private.h>
#ifdef BN_MP_TORADIX_C
/* LibTomMath, multiple-precision integer library -- Tom St Denis
*
@@ -12,7 +12,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tstdenis82@gmail.com, http://libtom.org
*/
/* stores a bignum as a ASCII string in a given radix (2..64) */
@@ -24,12 +24,12 @@ int mp_toradix (mp_int * a, char *str, int radix)
char *_s = str;
/* check range of the radix */
- if (radix < 2 || radix > 64) {
+ if ((radix < 2) || (radix > 64)) {
return MP_VAL;
}
/* quick out if its zero */
- if (mp_iszero(a) == 1) {
+ if (mp_iszero(a) == MP_YES) {
*str++ = '0';
*str = '\0';
return MP_OKAY;
@@ -47,7 +47,7 @@ int mp_toradix (mp_int * a, char *str, int radix)
}
digs = 0;
- while (mp_iszero (&t) == 0) {
+ while (mp_iszero (&t) == MP_NO) {
if ((res = mp_div_d (&t, (mp_digit) radix, &t, &d)) != MP_OKAY) {
mp_clear (&t);
return res;
@@ -70,6 +70,6 @@ int mp_toradix (mp_int * a, char *str, int radix)
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_toradix.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtommath/bn_mp_toradix_n.c b/libtommath/bn_mp_toradix_n.c
index 7c0f3bc..19b61d7 100644
--- a/libtommath/bn_mp_toradix_n.c
+++ b/libtommath/bn_mp_toradix_n.c
@@ -1,4 +1,4 @@
-#include <tommath.h>
+#include <tommath_private.h>
#ifdef BN_MP_TORADIX_N_C
/* LibTomMath, multiple-precision integer library -- Tom St Denis
*
@@ -12,7 +12,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tstdenis82@gmail.com, http://libtom.org
*/
/* stores a bignum as a ASCII string in a given radix (2..64)
@@ -27,7 +27,7 @@ int mp_toradix_n(mp_int * a, char *str, int radix, int maxlen)
char *_s = str;
/* check range of the maxlen, radix */
- if (maxlen < 2 || radix < 2 || radix > 64) {
+ if ((maxlen < 2) || (radix < 2) || (radix > 64)) {
return MP_VAL;
}
@@ -56,7 +56,7 @@ int mp_toradix_n(mp_int * a, char *str, int radix, int maxlen)
}
digs = 0;
- while (mp_iszero (&t) == 0) {
+ while (mp_iszero (&t) == MP_NO) {
if (--maxlen < 1) {
/* no more room */
break;
@@ -83,6 +83,6 @@ int mp_toradix_n(mp_int * a, char *str, int radix, int maxlen)
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_toradix_n.c,v $ */
-/* $Revision: 1.4 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtommath/bn_mp_unsigned_bin_size.c b/libtommath/bn_mp_unsigned_bin_size.c
index 00d6aa0..0312625 100644
--- a/libtommath/bn_mp_unsigned_bin_size.c
+++ b/libtommath/bn_mp_unsigned_bin_size.c
@@ -1,4 +1,4 @@
-#include <tommath.h>
+#include <tommath_private.h>
#ifdef BN_MP_UNSIGNED_BIN_SIZE_C
/* LibTomMath, multiple-precision integer library -- Tom St Denis
*
@@ -12,17 +12,17 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tstdenis82@gmail.com, http://libtom.org
*/
/* get the size for an unsigned equivalent */
int mp_unsigned_bin_size (mp_int * a)
{
int size = mp_count_bits (a);
- return (size / 8 + ((size & 7) != 0 ? 1 : 0));
+ return (size / 8) + (((size & 7) != 0) ? 1 : 0);
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_unsigned_bin_size.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtommath/bn_mp_xor.c b/libtommath/bn_mp_xor.c
index 508c1a0..3c2ba9e 100644
--- a/libtommath/bn_mp_xor.c
+++ b/libtommath/bn_mp_xor.c
@@ -1,4 +1,4 @@
-#include <tommath.h>
+#include <tommath_private.h>
#ifdef BN_MP_XOR_C
/* LibTomMath, multiple-precision integer library -- Tom St Denis
*
@@ -12,7 +12,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tstdenis82@gmail.com, http://libtom.org
*/
/* XOR two ints together */
@@ -46,6 +46,6 @@ mp_xor (mp_int * a, mp_int * b, mp_int * c)
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_xor.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtommath/bn_mp_zero.c b/libtommath/bn_mp_zero.c
index d8fd536..21365ed 100644
--- a/libtommath/bn_mp_zero.c
+++ b/libtommath/bn_mp_zero.c
@@ -1,4 +1,4 @@
-#include <tommath.h>
+#include <tommath_private.h>
#ifdef BN_MP_ZERO_C
/* LibTomMath, multiple-precision integer library -- Tom St Denis
*
@@ -12,7 +12,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tstdenis82@gmail.com, http://libtom.org
*/
/* set to zero */
@@ -31,6 +31,6 @@ void mp_zero (mp_int * a)
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_zero.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtommath/bn_prime_tab.c b/libtommath/bn_prime_tab.c
index 522d428..ae727a4 100644
--- a/libtommath/bn_prime_tab.c
+++ b/libtommath/bn_prime_tab.c
@@ -1,4 +1,4 @@
-#include <tommath.h>
+#include <tommath_private.h>
#ifdef BN_PRIME_TAB_C
/* LibTomMath, multiple-precision integer library -- Tom St Denis
*
@@ -12,7 +12,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tstdenis82@gmail.com, http://libtom.org
*/
const mp_digit ltm_prime_tab[] = {
0x0002, 0x0003, 0x0005, 0x0007, 0x000B, 0x000D, 0x0011, 0x0013,
@@ -56,6 +56,6 @@ const mp_digit ltm_prime_tab[] = {
};
#endif
-/* $Source: /cvs/libtom/libtommath/bn_prime_tab.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtommath/bn_reverse.c b/libtommath/bn_reverse.c
index ed19627..fc6eb2d 100644
--- a/libtommath/bn_reverse.c
+++ b/libtommath/bn_reverse.c
@@ -1,4 +1,4 @@
-#include <tommath.h>
+#include <tommath_private.h>
#ifdef BN_REVERSE_C
/* LibTomMath, multiple-precision integer library -- Tom St Denis
*
@@ -12,7 +12,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tstdenis82@gmail.com, http://libtom.org
*/
/* reverse an array, used for radix code */
@@ -34,6 +34,6 @@ bn_reverse (unsigned char *s, int len)
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_reverse.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtommath/bn_s_mp_add.c b/libtommath/bn_s_mp_add.c
index 5d17f12..c2ad649 100644
--- a/libtommath/bn_s_mp_add.c
+++ b/libtommath/bn_s_mp_add.c
@@ -1,4 +1,4 @@
-#include <tommath.h>
+#include <tommath_private.h>
#ifdef BN_S_MP_ADD_C
/* LibTomMath, multiple-precision integer library -- Tom St Denis
*
@@ -12,7 +12,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tstdenis82@gmail.com, http://libtom.org
*/
/* low level addition, based on HAC pp.594, Algorithm 14.7 */
@@ -36,7 +36,7 @@ s_mp_add (mp_int * a, mp_int * b, mp_int * c)
}
/* init result */
- if (c->alloc < max + 1) {
+ if (c->alloc < (max + 1)) {
if ((res = mp_grow (c, max + 1)) != MP_OKAY) {
return res;
}
@@ -47,8 +47,8 @@ s_mp_add (mp_int * a, mp_int * b, mp_int * c)
c->used = max + 1;
{
- register mp_digit u, *tmpa, *tmpb, *tmpc;
- register int i;
+ mp_digit u, *tmpa, *tmpb, *tmpc;
+ int i;
/* alias for digit pointers */
@@ -104,6 +104,6 @@ s_mp_add (mp_int * a, mp_int * b, mp_int * c)
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_s_mp_add.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtommath/bn_s_mp_exptmod.c b/libtommath/bn_s_mp_exptmod.c
index 189197c..63e1b1e 100644
--- a/libtommath/bn_s_mp_exptmod.c
+++ b/libtommath/bn_s_mp_exptmod.c
@@ -1,4 +1,4 @@
-#include <tommath.h>
+#include <tommath_private.h>
#ifdef BN_S_MP_EXPTMOD_C
/* LibTomMath, multiple-precision integer library -- Tom St Denis
*
@@ -12,7 +12,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tstdenis82@gmail.com, http://libtom.org
*/
#ifdef MP_LOW_MEM
#define TAB_SIZE 32
@@ -164,12 +164,12 @@ int s_mp_exptmod (mp_int * G, mp_int * X, mp_int * P, mp_int * Y, int redmode)
* in the exponent. Technically this opt is not required but it
* does lower the # of trivial squaring/reductions used
*/
- if (mode == 0 && y == 0) {
+ if ((mode == 0) && (y == 0)) {
continue;
}
/* if the bit is zero and mode == 1 then we square */
- if (mode == 1 && y == 0) {
+ if ((mode == 1) && (y == 0)) {
if ((err = mp_sqr (&res, &res)) != MP_OKAY) {
goto LBL_RES;
}
@@ -211,7 +211,7 @@ int s_mp_exptmod (mp_int * G, mp_int * X, mp_int * P, mp_int * Y, int redmode)
}
/* if bits remain then square/multiply */
- if (mode == 2 && bitcpy > 0) {
+ if ((mode == 2) && (bitcpy > 0)) {
/* square then multiply if the bit is set */
for (x = 0; x < bitcpy; x++) {
if ((err = mp_sqr (&res, &res)) != MP_OKAY) {
@@ -247,6 +247,6 @@ LBL_M:
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_s_mp_exptmod.c,v $ */
-/* $Revision: 1.4 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtommath/bn_s_mp_mul_digs.c b/libtommath/bn_s_mp_mul_digs.c
index 7d55b81..bd8553d 100644
--- a/libtommath/bn_s_mp_mul_digs.c
+++ b/libtommath/bn_s_mp_mul_digs.c
@@ -1,4 +1,4 @@
-#include <tommath.h>
+#include <tommath_private.h>
#ifdef BN_S_MP_MUL_DIGS_C
/* LibTomMath, multiple-precision integer library -- Tom St Denis
*
@@ -12,7 +12,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tstdenis82@gmail.com, http://libtom.org
*/
/* multiplies |a| * |b| and only computes upto digs digits of result
@@ -29,8 +29,8 @@ int s_mp_mul_digs (mp_int * a, mp_int * b, mp_int * c, int digs)
/* can we use the fast multiplier? */
if (((digs) < MP_WARRAY) &&
- MIN (a->used, b->used) <
- (1 << ((CHAR_BIT * sizeof (mp_word)) - (2 * DIGIT_BIT)))) {
+ (MIN (a->used, b->used) <
+ (1 << ((CHAR_BIT * sizeof(mp_word)) - (2 * DIGIT_BIT))))) {
return fast_s_mp_mul_digs (a, b, c, digs);
}
@@ -61,9 +61,9 @@ int s_mp_mul_digs (mp_int * a, mp_int * b, mp_int * c, int digs)
/* compute the columns of the output and propagate the carry */
for (iy = 0; iy < pb; iy++) {
/* compute the column as a mp_word */
- r = ((mp_word)*tmpt) +
- ((mp_word)tmpx) * ((mp_word)*tmpy++) +
- ((mp_word) u);
+ r = (mp_word)*tmpt +
+ ((mp_word)tmpx * (mp_word)*tmpy++) +
+ (mp_word)u;
/* the new column is the lower part of the result */
*tmpt++ = (mp_digit) (r & ((mp_word) MP_MASK));
@@ -72,7 +72,7 @@ int s_mp_mul_digs (mp_int * a, mp_int * b, mp_int * c, int digs)
u = (mp_digit) (r >> ((mp_word) DIGIT_BIT));
}
/* set carry if it is placed below digs */
- if (ix + iy < digs) {
+ if ((ix + iy) < digs) {
*tmpt = u;
}
}
@@ -85,6 +85,6 @@ int s_mp_mul_digs (mp_int * a, mp_int * b, mp_int * c, int digs)
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_s_mp_mul_digs.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtommath/bn_s_mp_mul_high_digs.c b/libtommath/bn_s_mp_mul_high_digs.c
index 1c0aae4..153cea4 100644
--- a/libtommath/bn_s_mp_mul_high_digs.c
+++ b/libtommath/bn_s_mp_mul_high_digs.c
@@ -1,4 +1,4 @@
-#include <tommath.h>
+#include <tommath_private.h>
#ifdef BN_S_MP_MUL_HIGH_DIGS_C
/* LibTomMath, multiple-precision integer library -- Tom St Denis
*
@@ -12,7 +12,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tstdenis82@gmail.com, http://libtom.org
*/
/* multiplies |a| * |b| and does not compute the lower digs digits
@@ -30,7 +30,7 @@ s_mp_mul_high_digs (mp_int * a, mp_int * b, mp_int * c, int digs)
/* can we use the fast multiplier? */
#ifdef BN_FAST_S_MP_MUL_HIGH_DIGS_C
if (((a->used + b->used + 1) < MP_WARRAY)
- && MIN (a->used, b->used) < (1 << ((CHAR_BIT * sizeof (mp_word)) - (2 * DIGIT_BIT)))) {
+ && (MIN (a->used, b->used) < (1 << ((CHAR_BIT * sizeof(mp_word)) - (2 * DIGIT_BIT))))) {
return fast_s_mp_mul_high_digs (a, b, c, digs);
}
#endif
@@ -57,9 +57,9 @@ s_mp_mul_high_digs (mp_int * a, mp_int * b, mp_int * c, int digs)
for (iy = digs - ix; iy < pb; iy++) {
/* calculate the double precision result */
- r = ((mp_word)*tmpt) +
- ((mp_word)tmpx) * ((mp_word)*tmpy++) +
- ((mp_word) u);
+ r = (mp_word)*tmpt +
+ ((mp_word)tmpx * (mp_word)*tmpy++) +
+ (mp_word)u;
/* get the lower part */
*tmpt++ = (mp_digit) (r & ((mp_word) MP_MASK));
@@ -76,6 +76,6 @@ s_mp_mul_high_digs (mp_int * a, mp_int * b, mp_int * c, int digs)
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_s_mp_mul_high_digs.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtommath/bn_s_mp_sqr.c b/libtommath/bn_s_mp_sqr.c
index b0063bc..68c95bc 100644
--- a/libtommath/bn_s_mp_sqr.c
+++ b/libtommath/bn_s_mp_sqr.c
@@ -1,4 +1,4 @@
-#include <tommath.h>
+#include <tommath_private.h>
#ifdef BN_S_MP_SQR_C
/* LibTomMath, multiple-precision integer library -- Tom St Denis
*
@@ -12,7 +12,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tstdenis82@gmail.com, http://libtom.org
*/
/* low level squaring, b = a*a, HAC pp.596-597, Algorithm 14.16 */
@@ -24,18 +24,18 @@ int s_mp_sqr (mp_int * a, mp_int * b)
mp_digit u, tmpx, *tmpt;
pa = a->used;
- if ((res = mp_init_size (&t, 2*pa + 1)) != MP_OKAY) {
+ if ((res = mp_init_size (&t, (2 * pa) + 1)) != MP_OKAY) {
return res;
}
/* default used is maximum possible size */
- t.used = 2*pa + 1;
+ t.used = (2 * pa) + 1;
for (ix = 0; ix < pa; ix++) {
/* first calculate the digit at 2*ix */
/* calculate double precision result */
- r = ((mp_word) t.dp[2*ix]) +
- ((mp_word)a->dp[ix])*((mp_word)a->dp[ix]);
+ r = (mp_word)t.dp[2*ix] +
+ ((mp_word)a->dp[ix] * (mp_word)a->dp[ix]);
/* store lower part in result */
t.dp[ix+ix] = (mp_digit) (r & ((mp_word) MP_MASK));
@@ -47,7 +47,7 @@ int s_mp_sqr (mp_int * a, mp_int * b)
tmpx = a->dp[ix];
/* alias for where to store the results */
- tmpt = t.dp + (2*ix + 1);
+ tmpt = t.dp + ((2 * ix) + 1);
for (iy = ix + 1; iy < pa; iy++) {
/* first calculate the product */
@@ -79,6 +79,6 @@ int s_mp_sqr (mp_int * a, mp_int * b)
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_s_mp_sqr.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtommath/bn_s_mp_sub.c b/libtommath/bn_s_mp_sub.c
index f5949f5..c0ea556 100644
--- a/libtommath/bn_s_mp_sub.c
+++ b/libtommath/bn_s_mp_sub.c
@@ -1,4 +1,4 @@
-#include <tommath.h>
+#include <tommath_private.h>
#ifdef BN_S_MP_SUB_C
/* LibTomMath, multiple-precision integer library -- Tom St Denis
*
@@ -12,7 +12,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tstdenis82@gmail.com, http://libtom.org
*/
/* low level subtraction (assumes |a| > |b|), HAC pp.595 Algorithm 14.9 */
@@ -35,8 +35,8 @@ s_mp_sub (mp_int * a, mp_int * b, mp_int * c)
c->used = max;
{
- register mp_digit u, *tmpa, *tmpb, *tmpc;
- register int i;
+ mp_digit u, *tmpa, *tmpb, *tmpc;
+ int i;
/* alias for digit pointers */
tmpa = a->dp;
@@ -47,14 +47,14 @@ s_mp_sub (mp_int * a, mp_int * b, mp_int * c)
u = 0;
for (i = 0; i < min; i++) {
/* T[i] = A[i] - B[i] - U */
- *tmpc = *tmpa++ - *tmpb++ - u;
+ *tmpc = (*tmpa++ - *tmpb++) - u;
/* U = carry bit of T[i]
* Note this saves performing an AND operation since
* if a carry does occur it will propagate all the way to the
* MSB. As a result a single shift is enough to get the carry
*/
- u = *tmpc >> ((mp_digit)(CHAR_BIT * sizeof (mp_digit) - 1));
+ u = *tmpc >> ((mp_digit)((CHAR_BIT * sizeof(mp_digit)) - 1));
/* Clear carry from T[i] */
*tmpc++ &= MP_MASK;
@@ -66,7 +66,7 @@ s_mp_sub (mp_int * a, mp_int * b, mp_int * c)
*tmpc = *tmpa++ - u;
/* U = carry bit of T[i] */
- u = *tmpc >> ((mp_digit)(CHAR_BIT * sizeof (mp_digit) - 1));
+ u = *tmpc >> ((mp_digit)((CHAR_BIT * sizeof(mp_digit)) - 1));
/* Clear carry from T[i] */
*tmpc++ &= MP_MASK;
@@ -84,6 +84,6 @@ s_mp_sub (mp_int * a, mp_int * b, mp_int * c)
#endif
-/* $Source: /cvs/libtom/libtommath/bn_s_mp_sub.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtommath/bncore.c b/libtommath/bncore.c
index 989a1dd..9552714 100644
--- a/libtommath/bncore.c
+++ b/libtommath/bncore.c
@@ -1,4 +1,4 @@
-#include <tommath.h>
+#include <tommath_private.h>
#ifdef BNCORE_C
/* LibTomMath, multiple-precision integer library -- Tom St Denis
*
@@ -12,7 +12,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tstdenis82@gmail.com, http://libtom.org
*/
/* Known optimal configurations
@@ -31,6 +31,6 @@ int KARATSUBA_MUL_CUTOFF = 80, /* Min. number of digits before Karatsub
TOOM_SQR_CUTOFF = 400;
#endif
-/* $Source: /cvs/libtom/libtommath/bncore.c,v $ */
-/* $Revision: 1.4 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtommath/booker.pl b/libtommath/booker.pl
index 49f1889..c2abae6 100644
--- a/libtommath/booker.pl
+++ b/libtommath/booker.pl
@@ -15,7 +15,7 @@ if (shift =~ /PDF/) {
$graph = "";
} else {
$graph = ".ps";
-}
+}
open(IN,"<tommath.src") or die "Can't open source file";
open(OUT,">tommath.tex") or die "Can't open destination file";
@@ -26,18 +26,18 @@ $x = 0;
while (<IN>) {
print ".";
if (!(++$x % 80)) { print "\n"; }
- #update the headings
+ #update the headings
if (~($_ =~ /\*/)) {
- if ($_ =~ /\\chapter{.+}/) {
+ if ($_ =~ /\\chapter\{.+}/) {
++$chapter;
$section = $subsection = 0;
- } elsif ($_ =~ /\\section{.+}/) {
+ } elsif ($_ =~ /\\section\{.+}/) {
++$section;
$subsection = 0;
- } elsif ($_ =~ /\\subsection{.+}/) {
+ } elsif ($_ =~ /\\subsection\{.+}/) {
++$subsection;
}
- }
+ }
if ($_ =~ m/MARK/) {
@m = split(",",$_);
@@ -56,7 +56,7 @@ $srcline = 0;
while (<IN>) {
++$readline;
++$srcline;
-
+
if ($_ =~ m/MARK/) {
} elsif ($_ =~ m/EXAM/ || $_ =~ m/LIST/) {
if ($_ =~ m/EXAM/) {
@@ -64,29 +64,29 @@ while (<IN>) {
} else {
$skipheader = 0;
}
-
+
# EXAM,file
chomp($_);
@m = split(",",$_);
open(SRC,"<$m[1]") or die "Error:$srcline:Can't open source file $m[1]";
-
+
print "$srcline:Inserting $m[1]:";
-
+
$line = 0;
$tmp = $m[1];
$tmp =~ s/_/"\\_"/ge;
print OUT "\\vspace{+3mm}\\begin{small}\n\\hspace{-5.1mm}{\\bf File}: $tmp\n\\vspace{-3mm}\n\\begin{alltt}\n";
$wroteline += 5;
-
+
if ($skipheader == 1) {
- # scan till next end of comment, e.g. skip license
+ # scan till next end of comment, e.g. skip license
while (<SRC>) {
$text[$line++] = $_;
- last if ($_ =~ /math\.libtomcrypt\.com/);
+ last if ($_ =~ /libtom\.org/);
}
- <SRC>;
+ <SRC>;
}
-
+
$inline = 0;
while (<SRC>) {
next if ($_ =~ /\$Source/);
@@ -100,11 +100,11 @@ while (<IN>) {
$_ =~ s/}/"^}"/ge;
$_ =~ s/\\/'\symbol{92}'/ge;
$_ =~ s/\^/"\\"/ge;
-
+
printf OUT ("%03d ", $line);
for ($x = 0; $x < length($_); $x++) {
print OUT chr(vec($_, $x, 8));
- if ($x == 75) {
+ if ($x == 75) {
print OUT "\n ";
++$wroteline;
}
@@ -123,9 +123,9 @@ while (<IN>) {
$txt = $_;
while ($txt =~ m/@\d+,.+@/) {
@m = split("@",$txt); # splits into text, one, two
- @parms = split(",",$m[1]); # splits one,two into two elements
-
- # now search from $parms[0] down for $parms[1]
+ @parms = split(",",$m[1]); # splits one,two into two elements
+
+ # now search from $parms[0] down for $parms[1]
$found1 = 0;
$found2 = 0;
for ($i = $parms[0]; $i < $totlines && $found1 == 0; $i++) {
@@ -134,7 +134,7 @@ while (<IN>) {
$found1 = 1;
}
}
-
+
# now search backwards
for ($i = $parms[0] - 1; $i >= 0 && $found2 == 0; $i--) {
if ($text[$i] =~ m/\Q$parms[1]\E/) {
@@ -142,7 +142,7 @@ while (<IN>) {
$found2 = 1;
}
}
-
+
# now use the closest match or the first if tied
if ($found1 == 1 && $found2 == 0) {
$found = 1;
@@ -160,8 +160,8 @@ while (<IN>) {
} else {
$found = 0;
}
-
- # if found replace
+
+ # if found replace
if ($found == 1) {
$delta = $parms[0] - $foundline;
print "Found replacement tag for \"$parms[1]\" on line $srcline which refers to line $foundline (delta $delta)\n";
@@ -169,8 +169,8 @@ while (<IN>) {
} else {
print "ERROR: The tag \"$parms[1]\" on line $srcline was not found in the most recently parsed source!\n";
}
-
- # remake the rest of the line
+
+ # remake the rest of the line
$cnt = @m;
$txt = "";
for ($i = 2; $i < $cnt; $i++) {
@@ -184,13 +184,13 @@ while (<IN>) {
$txt = $_;
while ($txt =~ /~.+~/) {
@m = split("~", $txt);
-
+
# word is the second position
$word = @m[1];
$a = $index1{$word};
$b = $index2{$word};
$c = $index3{$word};
-
+
# if chapter (a) is zero it wasn't found
if ($a == 0) {
print "ERROR: the tag \"$word\" on line $srcline was not found previously marked.\n";
@@ -199,7 +199,7 @@ while (<IN>) {
$str = $a;
$str = $str . ".$b" if ($b != 0);
$str = $str . ".$c" if ($c != 0);
-
+
if ($b == 0 && $c == 0) {
# its a chapter
if ($a <= 10) {
@@ -228,16 +228,16 @@ while (<IN>) {
$str = "chapter " . $str;
}
} else {
- $str = "section " . $str if ($b != 0 && $c == 0);
+ $str = "section " . $str if ($b != 0 && $c == 0);
$str = "sub-section " . $str if ($b != 0 && $c != 0);
}
-
+
#substitute
$_ =~ s/~\Q$word\E~/$str/;
-
+
print "Found replacement tag for marker \"$word\" on line $srcline which refers to $str\n";
}
-
+
# remake rest of the line
$cnt = @m;
$txt = "";
@@ -263,3 +263,5 @@ print "Read $readline lines, wrote $wroteline lines\n";
close (OUT);
close (IN);
+
+system('perl -pli -e "s/\s*$//" tommath.tex');
diff --git a/libtommath/callgraph.txt b/libtommath/callgraph.txt
new file mode 100644
index 0000000..e98a910
--- /dev/null
+++ b/libtommath/callgraph.txt
@@ -0,0 +1,13356 @@
+BN_MP_KARATSUBA_MUL_C
++--->BN_MP_MUL_C
+| +--->BN_MP_TOOM_MUL_C
+| | +--->BN_MP_INIT_MULTI_C
+| | | +--->BN_MP_INIT_C
+| | | +--->BN_MP_CLEAR_C
+| | +--->BN_MP_MOD_2D_C
+| | | +--->BN_MP_ZERO_C
+| | | +--->BN_MP_COPY_C
+| | | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_COPY_C
+| | | +--->BN_MP_GROW_C
+| | +--->BN_MP_RSHD_C
+| | | +--->BN_MP_ZERO_C
+| | +--->BN_MP_MUL_2_C
+| | | +--->BN_MP_GROW_C
+| | +--->BN_MP_ADD_C
+| | | +--->BN_S_MP_ADD_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_CMP_MAG_C
+| | | +--->BN_S_MP_SUB_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_SUB_C
+| | | +--->BN_S_MP_ADD_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_CMP_MAG_C
+| | | +--->BN_S_MP_SUB_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_DIV_2_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_MUL_2D_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_LSHD_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_MUL_D_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_DIV_3_C
+| | | +--->BN_MP_INIT_SIZE_C
+| | | | +--->BN_MP_INIT_C
+| | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_EXCH_C
+| | | +--->BN_MP_CLEAR_C
+| | +--->BN_MP_LSHD_C
+| | | +--->BN_MP_GROW_C
+| | +--->BN_MP_CLEAR_MULTI_C
+| | | +--->BN_MP_CLEAR_C
+| +--->BN_FAST_S_MP_MUL_DIGS_C
+| | +--->BN_MP_GROW_C
+| | +--->BN_MP_CLAMP_C
+| +--->BN_S_MP_MUL_DIGS_C
+| | +--->BN_MP_INIT_SIZE_C
+| | | +--->BN_MP_INIT_C
+| | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_EXCH_C
+| | +--->BN_MP_CLEAR_C
++--->BN_MP_INIT_SIZE_C
+| +--->BN_MP_INIT_C
++--->BN_MP_CLAMP_C
++--->BN_S_MP_ADD_C
+| +--->BN_MP_GROW_C
++--->BN_MP_ADD_C
+| +--->BN_MP_CMP_MAG_C
+| +--->BN_S_MP_SUB_C
+| | +--->BN_MP_GROW_C
++--->BN_S_MP_SUB_C
+| +--->BN_MP_GROW_C
++--->BN_MP_LSHD_C
+| +--->BN_MP_GROW_C
+| +--->BN_MP_RSHD_C
+| | +--->BN_MP_ZERO_C
++--->BN_MP_CLEAR_C
+
+
+BN_MP_ZERO_C
+
+
+BN_MP_SET_C
++--->BN_MP_ZERO_C
+
+
+BN_MP_TO_SIGNED_BIN_C
++--->BN_MP_TO_UNSIGNED_BIN_C
+| +--->BN_MP_INIT_COPY_C
+| | +--->BN_MP_INIT_SIZE_C
+| | +--->BN_MP_COPY_C
+| | | +--->BN_MP_GROW_C
+| +--->BN_MP_DIV_2D_C
+| | +--->BN_MP_COPY_C
+| | | +--->BN_MP_GROW_C
+| | +--->BN_MP_ZERO_C
+| | +--->BN_MP_MOD_2D_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_CLEAR_C
+| | +--->BN_MP_RSHD_C
+| | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_EXCH_C
+| +--->BN_MP_CLEAR_C
+
+
+BN_S_MP_SUB_C
++--->BN_MP_GROW_C
++--->BN_MP_CLAMP_C
+
+
+BN_MP_JACOBI_C
++--->BN_MP_CMP_D_C
++--->BN_MP_INIT_COPY_C
+| +--->BN_MP_INIT_SIZE_C
+| +--->BN_MP_COPY_C
+| | +--->BN_MP_GROW_C
++--->BN_MP_CNT_LSB_C
++--->BN_MP_DIV_2D_C
+| +--->BN_MP_COPY_C
+| | +--->BN_MP_GROW_C
+| +--->BN_MP_ZERO_C
+| +--->BN_MP_MOD_2D_C
+| | +--->BN_MP_CLAMP_C
+| +--->BN_MP_CLEAR_C
+| +--->BN_MP_RSHD_C
+| +--->BN_MP_CLAMP_C
+| +--->BN_MP_EXCH_C
++--->BN_MP_MOD_C
+| +--->BN_MP_DIV_C
+| | +--->BN_MP_CMP_MAG_C
+| | +--->BN_MP_COPY_C
+| | | +--->BN_MP_GROW_C
+| | +--->BN_MP_ZERO_C
+| | +--->BN_MP_INIT_MULTI_C
+| | | +--->BN_MP_CLEAR_C
+| | +--->BN_MP_SET_C
+| | +--->BN_MP_COUNT_BITS_C
+| | +--->BN_MP_ABS_C
+| | +--->BN_MP_MUL_2D_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_LSHD_C
+| | | | +--->BN_MP_RSHD_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_CMP_C
+| | +--->BN_MP_SUB_C
+| | | +--->BN_S_MP_ADD_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_S_MP_SUB_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_ADD_C
+| | | +--->BN_S_MP_ADD_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_S_MP_SUB_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_EXCH_C
+| | +--->BN_MP_CLEAR_MULTI_C
+| | | +--->BN_MP_CLEAR_C
+| | +--->BN_MP_INIT_SIZE_C
+| | +--->BN_MP_LSHD_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_RSHD_C
+| | +--->BN_MP_RSHD_C
+| | +--->BN_MP_MUL_D_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_CLEAR_C
+| +--->BN_MP_CLEAR_C
+| +--->BN_MP_EXCH_C
+| +--->BN_MP_ADD_C
+| | +--->BN_S_MP_ADD_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_CMP_MAG_C
+| | +--->BN_S_MP_SUB_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLAMP_C
++--->BN_MP_CLEAR_C
+
+
+BN_MP_INIT_COPY_C
++--->BN_MP_INIT_SIZE_C
++--->BN_MP_COPY_C
+| +--->BN_MP_GROW_C
+
+
+BN_MP_ABS_C
++--->BN_MP_COPY_C
+| +--->BN_MP_GROW_C
+
+
+BN_MP_RADIX_SMAP_C
+
+
+BN_MP_EXCH_C
+
+
+BN_MP_EXPORT_C
++--->BN_MP_INIT_COPY_C
+| +--->BN_MP_INIT_SIZE_C
+| +--->BN_MP_COPY_C
+| | +--->BN_MP_GROW_C
++--->BN_MP_COUNT_BITS_C
++--->BN_MP_DIV_2D_C
+| +--->BN_MP_COPY_C
+| | +--->BN_MP_GROW_C
+| +--->BN_MP_ZERO_C
+| +--->BN_MP_MOD_2D_C
+| | +--->BN_MP_CLAMP_C
+| +--->BN_MP_CLEAR_C
+| +--->BN_MP_RSHD_C
+| +--->BN_MP_CLAMP_C
+| +--->BN_MP_EXCH_C
++--->BN_MP_CLEAR_C
+
+
+BN_MP_TO_UNSIGNED_BIN_N_C
++--->BN_MP_UNSIGNED_BIN_SIZE_C
+| +--->BN_MP_COUNT_BITS_C
++--->BN_MP_TO_UNSIGNED_BIN_C
+| +--->BN_MP_INIT_COPY_C
+| | +--->BN_MP_INIT_SIZE_C
+| | +--->BN_MP_COPY_C
+| | | +--->BN_MP_GROW_C
+| +--->BN_MP_DIV_2D_C
+| | +--->BN_MP_COPY_C
+| | | +--->BN_MP_GROW_C
+| | +--->BN_MP_ZERO_C
+| | +--->BN_MP_MOD_2D_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_CLEAR_C
+| | +--->BN_MP_RSHD_C
+| | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_EXCH_C
+| +--->BN_MP_CLEAR_C
+
+
+BN_MP_TO_SIGNED_BIN_N_C
++--->BN_MP_SIGNED_BIN_SIZE_C
+| +--->BN_MP_UNSIGNED_BIN_SIZE_C
+| | +--->BN_MP_COUNT_BITS_C
++--->BN_MP_TO_SIGNED_BIN_C
+| +--->BN_MP_TO_UNSIGNED_BIN_C
+| | +--->BN_MP_INIT_COPY_C
+| | | +--->BN_MP_INIT_SIZE_C
+| | | +--->BN_MP_COPY_C
+| | | | +--->BN_MP_GROW_C
+| | +--->BN_MP_DIV_2D_C
+| | | +--->BN_MP_COPY_C
+| | | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_ZERO_C
+| | | +--->BN_MP_MOD_2D_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_CLEAR_C
+| | | +--->BN_MP_RSHD_C
+| | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_EXCH_C
+| | +--->BN_MP_CLEAR_C
+
+
+BN_MP_LCM_C
++--->BN_MP_INIT_MULTI_C
+| +--->BN_MP_INIT_C
+| +--->BN_MP_CLEAR_C
++--->BN_MP_GCD_C
+| +--->BN_MP_ABS_C
+| | +--->BN_MP_COPY_C
+| | | +--->BN_MP_GROW_C
+| +--->BN_MP_INIT_COPY_C
+| | +--->BN_MP_INIT_SIZE_C
+| | +--->BN_MP_COPY_C
+| | | +--->BN_MP_GROW_C
+| +--->BN_MP_CNT_LSB_C
+| +--->BN_MP_DIV_2D_C
+| | +--->BN_MP_COPY_C
+| | | +--->BN_MP_GROW_C
+| | +--->BN_MP_ZERO_C
+| | +--->BN_MP_MOD_2D_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_CLEAR_C
+| | +--->BN_MP_RSHD_C
+| | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_EXCH_C
+| +--->BN_MP_CMP_MAG_C
+| +--->BN_MP_EXCH_C
+| +--->BN_S_MP_SUB_C
+| | +--->BN_MP_GROW_C
+| | +--->BN_MP_CLAMP_C
+| +--->BN_MP_MUL_2D_C
+| | +--->BN_MP_COPY_C
+| | | +--->BN_MP_GROW_C
+| | +--->BN_MP_GROW_C
+| | +--->BN_MP_LSHD_C
+| | | +--->BN_MP_RSHD_C
+| | | | +--->BN_MP_ZERO_C
+| | +--->BN_MP_CLAMP_C
+| +--->BN_MP_CLEAR_C
++--->BN_MP_CMP_MAG_C
++--->BN_MP_DIV_C
+| +--->BN_MP_COPY_C
+| | +--->BN_MP_GROW_C
+| +--->BN_MP_ZERO_C
+| +--->BN_MP_SET_C
+| +--->BN_MP_COUNT_BITS_C
+| +--->BN_MP_ABS_C
+| +--->BN_MP_MUL_2D_C
+| | +--->BN_MP_GROW_C
+| | +--->BN_MP_LSHD_C
+| | | +--->BN_MP_RSHD_C
+| | +--->BN_MP_CLAMP_C
+| +--->BN_MP_CMP_C
+| +--->BN_MP_SUB_C
+| | +--->BN_S_MP_ADD_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_S_MP_SUB_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLAMP_C
+| +--->BN_MP_ADD_C
+| | +--->BN_S_MP_ADD_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_S_MP_SUB_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLAMP_C
+| +--->BN_MP_DIV_2D_C
+| | +--->BN_MP_INIT_C
+| | +--->BN_MP_MOD_2D_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_CLEAR_C
+| | +--->BN_MP_RSHD_C
+| | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_EXCH_C
+| +--->BN_MP_EXCH_C
+| +--->BN_MP_CLEAR_MULTI_C
+| | +--->BN_MP_CLEAR_C
+| +--->BN_MP_INIT_SIZE_C
+| | +--->BN_MP_INIT_C
+| +--->BN_MP_INIT_C
+| +--->BN_MP_INIT_COPY_C
+| +--->BN_MP_LSHD_C
+| | +--->BN_MP_GROW_C
+| | +--->BN_MP_RSHD_C
+| +--->BN_MP_RSHD_C
+| +--->BN_MP_MUL_D_C
+| | +--->BN_MP_GROW_C
+| | +--->BN_MP_CLAMP_C
+| +--->BN_MP_CLAMP_C
+| +--->BN_MP_CLEAR_C
++--->BN_MP_MUL_C
+| +--->BN_MP_TOOM_MUL_C
+| | +--->BN_MP_MOD_2D_C
+| | | +--->BN_MP_ZERO_C
+| | | +--->BN_MP_COPY_C
+| | | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_COPY_C
+| | | +--->BN_MP_GROW_C
+| | +--->BN_MP_RSHD_C
+| | | +--->BN_MP_ZERO_C
+| | +--->BN_MP_MUL_2_C
+| | | +--->BN_MP_GROW_C
+| | +--->BN_MP_ADD_C
+| | | +--->BN_S_MP_ADD_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_S_MP_SUB_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_SUB_C
+| | | +--->BN_S_MP_ADD_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_S_MP_SUB_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_DIV_2_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_MUL_2D_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_LSHD_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_MUL_D_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_DIV_3_C
+| | | +--->BN_MP_INIT_SIZE_C
+| | | | +--->BN_MP_INIT_C
+| | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_EXCH_C
+| | | +--->BN_MP_CLEAR_C
+| | +--->BN_MP_LSHD_C
+| | | +--->BN_MP_GROW_C
+| | +--->BN_MP_CLEAR_MULTI_C
+| | | +--->BN_MP_CLEAR_C
+| +--->BN_MP_KARATSUBA_MUL_C
+| | +--->BN_MP_INIT_SIZE_C
+| | | +--->BN_MP_INIT_C
+| | +--->BN_MP_CLAMP_C
+| | +--->BN_S_MP_ADD_C
+| | | +--->BN_MP_GROW_C
+| | +--->BN_MP_ADD_C
+| | | +--->BN_S_MP_SUB_C
+| | | | +--->BN_MP_GROW_C
+| | +--->BN_S_MP_SUB_C
+| | | +--->BN_MP_GROW_C
+| | +--->BN_MP_LSHD_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_RSHD_C
+| | | | +--->BN_MP_ZERO_C
+| | +--->BN_MP_CLEAR_C
+| +--->BN_FAST_S_MP_MUL_DIGS_C
+| | +--->BN_MP_GROW_C
+| | +--->BN_MP_CLAMP_C
+| +--->BN_S_MP_MUL_DIGS_C
+| | +--->BN_MP_INIT_SIZE_C
+| | | +--->BN_MP_INIT_C
+| | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_EXCH_C
+| | +--->BN_MP_CLEAR_C
++--->BN_MP_CLEAR_MULTI_C
+| +--->BN_MP_CLEAR_C
+
+
+BN_MP_CMP_MAG_C
+
+
+BN_MP_PRIME_RABIN_MILLER_TRIALS_C
+
+
+BN_MP_MUL_2D_C
++--->BN_MP_COPY_C
+| +--->BN_MP_GROW_C
++--->BN_MP_GROW_C
++--->BN_MP_LSHD_C
+| +--->BN_MP_RSHD_C
+| | +--->BN_MP_ZERO_C
++--->BN_MP_CLAMP_C
+
+
+BN_MP_MUL_C
++--->BN_MP_TOOM_MUL_C
+| +--->BN_MP_INIT_MULTI_C
+| | +--->BN_MP_INIT_C
+| | +--->BN_MP_CLEAR_C
+| +--->BN_MP_MOD_2D_C
+| | +--->BN_MP_ZERO_C
+| | +--->BN_MP_COPY_C
+| | | +--->BN_MP_GROW_C
+| | +--->BN_MP_CLAMP_C
+| +--->BN_MP_COPY_C
+| | +--->BN_MP_GROW_C
+| +--->BN_MP_RSHD_C
+| | +--->BN_MP_ZERO_C
+| +--->BN_MP_MUL_2_C
+| | +--->BN_MP_GROW_C
+| +--->BN_MP_ADD_C
+| | +--->BN_S_MP_ADD_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_CMP_MAG_C
+| | +--->BN_S_MP_SUB_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLAMP_C
+| +--->BN_MP_SUB_C
+| | +--->BN_S_MP_ADD_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_CMP_MAG_C
+| | +--->BN_S_MP_SUB_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLAMP_C
+| +--->BN_MP_DIV_2_C
+| | +--->BN_MP_GROW_C
+| | +--->BN_MP_CLAMP_C
+| +--->BN_MP_MUL_2D_C
+| | +--->BN_MP_GROW_C
+| | +--->BN_MP_LSHD_C
+| | +--->BN_MP_CLAMP_C
+| +--->BN_MP_MUL_D_C
+| | +--->BN_MP_GROW_C
+| | +--->BN_MP_CLAMP_C
+| +--->BN_MP_DIV_3_C
+| | +--->BN_MP_INIT_SIZE_C
+| | | +--->BN_MP_INIT_C
+| | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_EXCH_C
+| | +--->BN_MP_CLEAR_C
+| +--->BN_MP_LSHD_C
+| | +--->BN_MP_GROW_C
+| +--->BN_MP_CLEAR_MULTI_C
+| | +--->BN_MP_CLEAR_C
++--->BN_MP_KARATSUBA_MUL_C
+| +--->BN_MP_INIT_SIZE_C
+| | +--->BN_MP_INIT_C
+| +--->BN_MP_CLAMP_C
+| +--->BN_S_MP_ADD_C
+| | +--->BN_MP_GROW_C
+| +--->BN_MP_ADD_C
+| | +--->BN_MP_CMP_MAG_C
+| | +--->BN_S_MP_SUB_C
+| | | +--->BN_MP_GROW_C
+| +--->BN_S_MP_SUB_C
+| | +--->BN_MP_GROW_C
+| +--->BN_MP_LSHD_C
+| | +--->BN_MP_GROW_C
+| | +--->BN_MP_RSHD_C
+| | | +--->BN_MP_ZERO_C
+| +--->BN_MP_CLEAR_C
++--->BN_FAST_S_MP_MUL_DIGS_C
+| +--->BN_MP_GROW_C
+| +--->BN_MP_CLAMP_C
++--->BN_S_MP_MUL_DIGS_C
+| +--->BN_MP_INIT_SIZE_C
+| | +--->BN_MP_INIT_C
+| +--->BN_MP_CLAMP_C
+| +--->BN_MP_EXCH_C
+| +--->BN_MP_CLEAR_C
+
+
+BN_MP_SQR_C
++--->BN_MP_TOOM_SQR_C
+| +--->BN_MP_INIT_MULTI_C
+| | +--->BN_MP_INIT_C
+| | +--->BN_MP_CLEAR_C
+| +--->BN_MP_MOD_2D_C
+| | +--->BN_MP_ZERO_C
+| | +--->BN_MP_COPY_C
+| | | +--->BN_MP_GROW_C
+| | +--->BN_MP_CLAMP_C
+| +--->BN_MP_COPY_C
+| | +--->BN_MP_GROW_C
+| +--->BN_MP_RSHD_C
+| | +--->BN_MP_ZERO_C
+| +--->BN_MP_MUL_2_C
+| | +--->BN_MP_GROW_C
+| +--->BN_MP_ADD_C
+| | +--->BN_S_MP_ADD_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_CMP_MAG_C
+| | +--->BN_S_MP_SUB_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLAMP_C
+| +--->BN_MP_SUB_C
+| | +--->BN_S_MP_ADD_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_CMP_MAG_C
+| | +--->BN_S_MP_SUB_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLAMP_C
+| +--->BN_MP_DIV_2_C
+| | +--->BN_MP_GROW_C
+| | +--->BN_MP_CLAMP_C
+| +--->BN_MP_MUL_2D_C
+| | +--->BN_MP_GROW_C
+| | +--->BN_MP_LSHD_C
+| | +--->BN_MP_CLAMP_C
+| +--->BN_MP_MUL_D_C
+| | +--->BN_MP_GROW_C
+| | +--->BN_MP_CLAMP_C
+| +--->BN_MP_DIV_3_C
+| | +--->BN_MP_INIT_SIZE_C
+| | | +--->BN_MP_INIT_C
+| | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_EXCH_C
+| | +--->BN_MP_CLEAR_C
+| +--->BN_MP_LSHD_C
+| | +--->BN_MP_GROW_C
+| +--->BN_MP_CLEAR_MULTI_C
+| | +--->BN_MP_CLEAR_C
++--->BN_MP_KARATSUBA_SQR_C
+| +--->BN_MP_INIT_SIZE_C
+| | +--->BN_MP_INIT_C
+| +--->BN_MP_CLAMP_C
+| +--->BN_S_MP_ADD_C
+| | +--->BN_MP_GROW_C
+| +--->BN_S_MP_SUB_C
+| | +--->BN_MP_GROW_C
+| +--->BN_MP_LSHD_C
+| | +--->BN_MP_GROW_C
+| | +--->BN_MP_RSHD_C
+| | | +--->BN_MP_ZERO_C
+| +--->BN_MP_ADD_C
+| | +--->BN_MP_CMP_MAG_C
+| +--->BN_MP_CLEAR_C
++--->BN_FAST_S_MP_SQR_C
+| +--->BN_MP_GROW_C
+| +--->BN_MP_CLAMP_C
++--->BN_S_MP_SQR_C
+| +--->BN_MP_INIT_SIZE_C
+| | +--->BN_MP_INIT_C
+| +--->BN_MP_CLAMP_C
+| +--->BN_MP_EXCH_C
+| +--->BN_MP_CLEAR_C
+
+
+BN_MP_INIT_C
+
+
+BN_MP_2EXPT_C
++--->BN_MP_ZERO_C
++--->BN_MP_GROW_C
+
+
+BN_MP_SIGNED_BIN_SIZE_C
++--->BN_MP_UNSIGNED_BIN_SIZE_C
+| +--->BN_MP_COUNT_BITS_C
+
+
+BN_MP_OR_C
++--->BN_MP_INIT_COPY_C
+| +--->BN_MP_INIT_SIZE_C
+| +--->BN_MP_COPY_C
+| | +--->BN_MP_GROW_C
++--->BN_MP_CLAMP_C
++--->BN_MP_EXCH_C
++--->BN_MP_CLEAR_C
+
+
+BN_MP_MOD_C
++--->BN_MP_INIT_C
++--->BN_MP_DIV_C
+| +--->BN_MP_CMP_MAG_C
+| +--->BN_MP_COPY_C
+| | +--->BN_MP_GROW_C
+| +--->BN_MP_ZERO_C
+| +--->BN_MP_INIT_MULTI_C
+| | +--->BN_MP_CLEAR_C
+| +--->BN_MP_SET_C
+| +--->BN_MP_COUNT_BITS_C
+| +--->BN_MP_ABS_C
+| +--->BN_MP_MUL_2D_C
+| | +--->BN_MP_GROW_C
+| | +--->BN_MP_LSHD_C
+| | | +--->BN_MP_RSHD_C
+| | +--->BN_MP_CLAMP_C
+| +--->BN_MP_CMP_C
+| +--->BN_MP_SUB_C
+| | +--->BN_S_MP_ADD_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_S_MP_SUB_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLAMP_C
+| +--->BN_MP_ADD_C
+| | +--->BN_S_MP_ADD_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_S_MP_SUB_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLAMP_C
+| +--->BN_MP_DIV_2D_C
+| | +--->BN_MP_MOD_2D_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_CLEAR_C
+| | +--->BN_MP_RSHD_C
+| | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_EXCH_C
+| +--->BN_MP_EXCH_C
+| +--->BN_MP_CLEAR_MULTI_C
+| | +--->BN_MP_CLEAR_C
+| +--->BN_MP_INIT_SIZE_C
+| +--->BN_MP_INIT_COPY_C
+| +--->BN_MP_LSHD_C
+| | +--->BN_MP_GROW_C
+| | +--->BN_MP_RSHD_C
+| +--->BN_MP_RSHD_C
+| +--->BN_MP_MUL_D_C
+| | +--->BN_MP_GROW_C
+| | +--->BN_MP_CLAMP_C
+| +--->BN_MP_CLAMP_C
+| +--->BN_MP_CLEAR_C
++--->BN_MP_CLEAR_C
++--->BN_MP_EXCH_C
++--->BN_MP_ADD_C
+| +--->BN_S_MP_ADD_C
+| | +--->BN_MP_GROW_C
+| | +--->BN_MP_CLAMP_C
+| +--->BN_MP_CMP_MAG_C
+| +--->BN_S_MP_SUB_C
+| | +--->BN_MP_GROW_C
+| | +--->BN_MP_CLAMP_C
+
+
+BN_MP_DIV_C
++--->BN_MP_CMP_MAG_C
++--->BN_MP_COPY_C
+| +--->BN_MP_GROW_C
++--->BN_MP_ZERO_C
++--->BN_MP_INIT_MULTI_C
+| +--->BN_MP_INIT_C
+| +--->BN_MP_CLEAR_C
++--->BN_MP_SET_C
++--->BN_MP_COUNT_BITS_C
++--->BN_MP_ABS_C
++--->BN_MP_MUL_2D_C
+| +--->BN_MP_GROW_C
+| +--->BN_MP_LSHD_C
+| | +--->BN_MP_RSHD_C
+| +--->BN_MP_CLAMP_C
++--->BN_MP_CMP_C
++--->BN_MP_SUB_C
+| +--->BN_S_MP_ADD_C
+| | +--->BN_MP_GROW_C
+| | +--->BN_MP_CLAMP_C
+| +--->BN_S_MP_SUB_C
+| | +--->BN_MP_GROW_C
+| | +--->BN_MP_CLAMP_C
++--->BN_MP_ADD_C
+| +--->BN_S_MP_ADD_C
+| | +--->BN_MP_GROW_C
+| | +--->BN_MP_CLAMP_C
+| +--->BN_S_MP_SUB_C
+| | +--->BN_MP_GROW_C
+| | +--->BN_MP_CLAMP_C
++--->BN_MP_DIV_2D_C
+| +--->BN_MP_INIT_C
+| +--->BN_MP_MOD_2D_C
+| | +--->BN_MP_CLAMP_C
+| +--->BN_MP_CLEAR_C
+| +--->BN_MP_RSHD_C
+| +--->BN_MP_CLAMP_C
+| +--->BN_MP_EXCH_C
++--->BN_MP_EXCH_C
++--->BN_MP_CLEAR_MULTI_C
+| +--->BN_MP_CLEAR_C
++--->BN_MP_INIT_SIZE_C
+| +--->BN_MP_INIT_C
++--->BN_MP_INIT_C
++--->BN_MP_INIT_COPY_C
++--->BN_MP_LSHD_C
+| +--->BN_MP_GROW_C
+| +--->BN_MP_RSHD_C
++--->BN_MP_RSHD_C
++--->BN_MP_MUL_D_C
+| +--->BN_MP_GROW_C
+| +--->BN_MP_CLAMP_C
++--->BN_MP_CLAMP_C
++--->BN_MP_CLEAR_C
+
+
+BN_MP_INIT_SET_C
++--->BN_MP_INIT_C
++--->BN_MP_SET_C
+| +--->BN_MP_ZERO_C
+
+
+BN_MP_PRIME_IS_PRIME_C
++--->BN_MP_CMP_D_C
++--->BN_MP_PRIME_IS_DIVISIBLE_C
+| +--->BN_MP_MOD_D_C
+| | +--->BN_MP_DIV_D_C
+| | | +--->BN_MP_COPY_C
+| | | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_DIV_2D_C
+| | | | +--->BN_MP_ZERO_C
+| | | | +--->BN_MP_INIT_C
+| | | | +--->BN_MP_MOD_2D_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_CLEAR_C
+| | | | +--->BN_MP_RSHD_C
+| | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_EXCH_C
+| | | +--->BN_MP_DIV_3_C
+| | | | +--->BN_MP_INIT_SIZE_C
+| | | | | +--->BN_MP_INIT_C
+| | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_EXCH_C
+| | | | +--->BN_MP_CLEAR_C
+| | | +--->BN_MP_INIT_SIZE_C
+| | | | +--->BN_MP_INIT_C
+| | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_EXCH_C
+| | | +--->BN_MP_CLEAR_C
++--->BN_MP_INIT_C
++--->BN_MP_SET_C
+| +--->BN_MP_ZERO_C
++--->BN_MP_PRIME_MILLER_RABIN_C
+| +--->BN_MP_INIT_COPY_C
+| | +--->BN_MP_INIT_SIZE_C
+| | +--->BN_MP_COPY_C
+| | | +--->BN_MP_GROW_C
+| +--->BN_MP_SUB_D_C
+| | +--->BN_MP_GROW_C
+| | +--->BN_MP_ADD_D_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_CLAMP_C
+| +--->BN_MP_CNT_LSB_C
+| +--->BN_MP_DIV_2D_C
+| | +--->BN_MP_COPY_C
+| | | +--->BN_MP_GROW_C
+| | +--->BN_MP_ZERO_C
+| | +--->BN_MP_MOD_2D_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_CLEAR_C
+| | +--->BN_MP_RSHD_C
+| | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_EXCH_C
+| +--->BN_MP_EXPTMOD_C
+| | +--->BN_MP_INVMOD_C
+| | | +--->BN_FAST_MP_INVMOD_C
+| | | | +--->BN_MP_INIT_MULTI_C
+| | | | | +--->BN_MP_CLEAR_C
+| | | | +--->BN_MP_COPY_C
+| | | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_MOD_C
+| | | | | +--->BN_MP_DIV_C
+| | | | | | +--->BN_MP_CMP_MAG_C
+| | | | | | +--->BN_MP_ZERO_C
+| | | | | | +--->BN_MP_COUNT_BITS_C
+| | | | | | +--->BN_MP_ABS_C
+| | | | | | +--->BN_MP_MUL_2D_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_LSHD_C
+| | | | | | | | +--->BN_MP_RSHD_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_CMP_C
+| | | | | | +--->BN_MP_SUB_C
+| | | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_ADD_C
+| | | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_EXCH_C
+| | | | | | +--->BN_MP_CLEAR_MULTI_C
+| | | | | | | +--->BN_MP_CLEAR_C
+| | | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | | +--->BN_MP_LSHD_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_RSHD_C
+| | | | | | +--->BN_MP_RSHD_C
+| | | | | | +--->BN_MP_MUL_D_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_CLEAR_C
+| | | | | +--->BN_MP_CLEAR_C
+| | | | | +--->BN_MP_EXCH_C
+| | | | | +--->BN_MP_ADD_C
+| | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_CMP_MAG_C
+| | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_DIV_2_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_SUB_C
+| | | | | +--->BN_S_MP_ADD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_CMP_MAG_C
+| | | | | +--->BN_S_MP_SUB_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_CMP_C
+| | | | | +--->BN_MP_CMP_MAG_C
+| | | | +--->BN_MP_ADD_C
+| | | | | +--->BN_S_MP_ADD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_CMP_MAG_C
+| | | | | +--->BN_S_MP_SUB_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_EXCH_C
+| | | | +--->BN_MP_CLEAR_MULTI_C
+| | | | | +--->BN_MP_CLEAR_C
+| | | +--->BN_MP_INVMOD_SLOW_C
+| | | | +--->BN_MP_INIT_MULTI_C
+| | | | | +--->BN_MP_CLEAR_C
+| | | | +--->BN_MP_MOD_C
+| | | | | +--->BN_MP_DIV_C
+| | | | | | +--->BN_MP_CMP_MAG_C
+| | | | | | +--->BN_MP_COPY_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_ZERO_C
+| | | | | | +--->BN_MP_COUNT_BITS_C
+| | | | | | +--->BN_MP_ABS_C
+| | | | | | +--->BN_MP_MUL_2D_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_LSHD_C
+| | | | | | | | +--->BN_MP_RSHD_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_CMP_C
+| | | | | | +--->BN_MP_SUB_C
+| | | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_ADD_C
+| | | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_EXCH_C
+| | | | | | +--->BN_MP_CLEAR_MULTI_C
+| | | | | | | +--->BN_MP_CLEAR_C
+| | | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | | +--->BN_MP_LSHD_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_RSHD_C
+| | | | | | +--->BN_MP_RSHD_C
+| | | | | | +--->BN_MP_MUL_D_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_CLEAR_C
+| | | | | +--->BN_MP_CLEAR_C
+| | | | | +--->BN_MP_EXCH_C
+| | | | | +--->BN_MP_ADD_C
+| | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_CMP_MAG_C
+| | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_COPY_C
+| | | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_DIV_2_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_ADD_C
+| | | | | +--->BN_S_MP_ADD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_CMP_MAG_C
+| | | | | +--->BN_S_MP_SUB_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_SUB_C
+| | | | | +--->BN_S_MP_ADD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_CMP_MAG_C
+| | | | | +--->BN_S_MP_SUB_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_CMP_C
+| | | | | +--->BN_MP_CMP_MAG_C
+| | | | +--->BN_MP_CMP_MAG_C
+| | | | +--->BN_MP_EXCH_C
+| | | | +--->BN_MP_CLEAR_MULTI_C
+| | | | | +--->BN_MP_CLEAR_C
+| | +--->BN_MP_CLEAR_C
+| | +--->BN_MP_ABS_C
+| | | +--->BN_MP_COPY_C
+| | | | +--->BN_MP_GROW_C
+| | +--->BN_MP_CLEAR_MULTI_C
+| | +--->BN_MP_REDUCE_IS_2K_L_C
+| | +--->BN_S_MP_EXPTMOD_C
+| | | +--->BN_MP_COUNT_BITS_C
+| | | +--->BN_MP_REDUCE_SETUP_C
+| | | | +--->BN_MP_2EXPT_C
+| | | | | +--->BN_MP_ZERO_C
+| | | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_DIV_C
+| | | | | +--->BN_MP_CMP_MAG_C
+| | | | | +--->BN_MP_COPY_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_ZERO_C
+| | | | | +--->BN_MP_INIT_MULTI_C
+| | | | | +--->BN_MP_MUL_2D_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_LSHD_C
+| | | | | | | +--->BN_MP_RSHD_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_CMP_C
+| | | | | +--->BN_MP_SUB_C
+| | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_ADD_C
+| | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_EXCH_C
+| | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | +--->BN_MP_LSHD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_RSHD_C
+| | | | | +--->BN_MP_RSHD_C
+| | | | | +--->BN_MP_MUL_D_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_REDUCE_C
+| | | | +--->BN_MP_RSHD_C
+| | | | | +--->BN_MP_ZERO_C
+| | | | +--->BN_MP_MUL_C
+| | | | | +--->BN_MP_TOOM_MUL_C
+| | | | | | +--->BN_MP_INIT_MULTI_C
+| | | | | | +--->BN_MP_MOD_2D_C
+| | | | | | | +--->BN_MP_ZERO_C
+| | | | | | | +--->BN_MP_COPY_C
+| | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_COPY_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_MUL_2_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_ADD_C
+| | | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | | +--->BN_MP_CMP_MAG_C
+| | | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_SUB_C
+| | | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | | +--->BN_MP_CMP_MAG_C
+| | | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_DIV_2_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_MUL_2D_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_LSHD_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_MUL_D_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_DIV_3_C
+| | | | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | | +--->BN_MP_EXCH_C
+| | | | | | +--->BN_MP_LSHD_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_KARATSUBA_MUL_C
+| | | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_ADD_C
+| | | | | | | +--->BN_MP_CMP_MAG_C
+| | | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_LSHD_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_FAST_S_MP_MUL_DIGS_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_S_MP_MUL_DIGS_C
+| | | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_EXCH_C
+| | | | +--->BN_S_MP_MUL_HIGH_DIGS_C
+| | | | | +--->BN_FAST_S_MP_MUL_HIGH_DIGS_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_EXCH_C
+| | | | +--->BN_FAST_S_MP_MUL_HIGH_DIGS_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_MOD_2D_C
+| | | | | +--->BN_MP_ZERO_C
+| | | | | +--->BN_MP_COPY_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_S_MP_MUL_DIGS_C
+| | | | | +--->BN_FAST_S_MP_MUL_DIGS_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_EXCH_C
+| | | | +--->BN_MP_SUB_C
+| | | | | +--->BN_S_MP_ADD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_CMP_MAG_C
+| | | | | +--->BN_S_MP_SUB_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_LSHD_C
+| | | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_ADD_C
+| | | | | +--->BN_S_MP_ADD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_CMP_MAG_C
+| | | | | +--->BN_S_MP_SUB_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_CMP_C
+| | | | | +--->BN_MP_CMP_MAG_C
+| | | | +--->BN_S_MP_SUB_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_REDUCE_2K_SETUP_L_C
+| | | | +--->BN_MP_2EXPT_C
+| | | | | +--->BN_MP_ZERO_C
+| | | | | +--->BN_MP_GROW_C
+| | | | +--->BN_S_MP_SUB_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_REDUCE_2K_L_C
+| | | | +--->BN_MP_MUL_C
+| | | | | +--->BN_MP_TOOM_MUL_C
+| | | | | | +--->BN_MP_INIT_MULTI_C
+| | | | | | +--->BN_MP_MOD_2D_C
+| | | | | | | +--->BN_MP_ZERO_C
+| | | | | | | +--->BN_MP_COPY_C
+| | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_COPY_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_RSHD_C
+| | | | | | | +--->BN_MP_ZERO_C
+| | | | | | +--->BN_MP_MUL_2_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_ADD_C
+| | | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | | +--->BN_MP_CMP_MAG_C
+| | | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_SUB_C
+| | | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | | +--->BN_MP_CMP_MAG_C
+| | | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_DIV_2_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_MUL_2D_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_LSHD_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_MUL_D_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_DIV_3_C
+| | | | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | | +--->BN_MP_EXCH_C
+| | | | | | +--->BN_MP_LSHD_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_KARATSUBA_MUL_C
+| | | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_ADD_C
+| | | | | | | +--->BN_MP_CMP_MAG_C
+| | | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_LSHD_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_RSHD_C
+| | | | | | | | +--->BN_MP_ZERO_C
+| | | | | +--->BN_FAST_S_MP_MUL_DIGS_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_S_MP_MUL_DIGS_C
+| | | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_EXCH_C
+| | | | +--->BN_S_MP_ADD_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_CMP_MAG_C
+| | | | +--->BN_S_MP_SUB_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_MOD_C
+| | | | +--->BN_MP_DIV_C
+| | | | | +--->BN_MP_CMP_MAG_C
+| | | | | +--->BN_MP_COPY_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_ZERO_C
+| | | | | +--->BN_MP_INIT_MULTI_C
+| | | | | +--->BN_MP_MUL_2D_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_LSHD_C
+| | | | | | | +--->BN_MP_RSHD_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_CMP_C
+| | | | | +--->BN_MP_SUB_C
+| | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_ADD_C
+| | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_EXCH_C
+| | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | +--->BN_MP_LSHD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_RSHD_C
+| | | | | +--->BN_MP_RSHD_C
+| | | | | +--->BN_MP_MUL_D_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_EXCH_C
+| | | | +--->BN_MP_ADD_C
+| | | | | +--->BN_S_MP_ADD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_CMP_MAG_C
+| | | | | +--->BN_S_MP_SUB_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_COPY_C
+| | | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_SQR_C
+| | | | +--->BN_MP_TOOM_SQR_C
+| | | | | +--->BN_MP_INIT_MULTI_C
+| | | | | +--->BN_MP_MOD_2D_C
+| | | | | | +--->BN_MP_ZERO_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_RSHD_C
+| | | | | | +--->BN_MP_ZERO_C
+| | | | | +--->BN_MP_MUL_2_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_ADD_C
+| | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_CMP_MAG_C
+| | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_SUB_C
+| | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_CMP_MAG_C
+| | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_DIV_2_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_MUL_2D_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_LSHD_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_MUL_D_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_DIV_3_C
+| | | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_EXCH_C
+| | | | | +--->BN_MP_LSHD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_KARATSUBA_SQR_C
+| | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_S_MP_ADD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_S_MP_SUB_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_LSHD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_RSHD_C
+| | | | | | | +--->BN_MP_ZERO_C
+| | | | | +--->BN_MP_ADD_C
+| | | | | | +--->BN_MP_CMP_MAG_C
+| | | | +--->BN_FAST_S_MP_SQR_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_S_MP_SQR_C
+| | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_EXCH_C
+| | | +--->BN_MP_MUL_C
+| | | | +--->BN_MP_TOOM_MUL_C
+| | | | | +--->BN_MP_INIT_MULTI_C
+| | | | | +--->BN_MP_MOD_2D_C
+| | | | | | +--->BN_MP_ZERO_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_RSHD_C
+| | | | | | +--->BN_MP_ZERO_C
+| | | | | +--->BN_MP_MUL_2_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_ADD_C
+| | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_CMP_MAG_C
+| | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_SUB_C
+| | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_CMP_MAG_C
+| | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_DIV_2_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_MUL_2D_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_LSHD_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_MUL_D_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_DIV_3_C
+| | | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_EXCH_C
+| | | | | +--->BN_MP_LSHD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_KARATSUBA_MUL_C
+| | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_S_MP_ADD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_ADD_C
+| | | | | | +--->BN_MP_CMP_MAG_C
+| | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_S_MP_SUB_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_LSHD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_RSHD_C
+| | | | | | | +--->BN_MP_ZERO_C
+| | | | +--->BN_FAST_S_MP_MUL_DIGS_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_S_MP_MUL_DIGS_C
+| | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_EXCH_C
+| | | +--->BN_MP_EXCH_C
+| | +--->BN_MP_DR_IS_MODULUS_C
+| | +--->BN_MP_REDUCE_IS_2K_C
+| | | +--->BN_MP_REDUCE_2K_C
+| | | | +--->BN_MP_COUNT_BITS_C
+| | | | +--->BN_MP_MUL_D_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_S_MP_ADD_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_CMP_MAG_C
+| | | | +--->BN_S_MP_SUB_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_COUNT_BITS_C
+| | +--->BN_MP_EXPTMOD_FAST_C
+| | | +--->BN_MP_COUNT_BITS_C
+| | | +--->BN_MP_MONTGOMERY_SETUP_C
+| | | +--->BN_FAST_MP_MONTGOMERY_REDUCE_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_RSHD_C
+| | | | | +--->BN_MP_ZERO_C
+| | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_CMP_MAG_C
+| | | | +--->BN_S_MP_SUB_C
+| | | +--->BN_MP_MONTGOMERY_REDUCE_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_RSHD_C
+| | | | | +--->BN_MP_ZERO_C
+| | | | +--->BN_MP_CMP_MAG_C
+| | | | +--->BN_S_MP_SUB_C
+| | | +--->BN_MP_DR_SETUP_C
+| | | +--->BN_MP_DR_REDUCE_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_CMP_MAG_C
+| | | | +--->BN_S_MP_SUB_C
+| | | +--->BN_MP_REDUCE_2K_SETUP_C
+| | | | +--->BN_MP_2EXPT_C
+| | | | | +--->BN_MP_ZERO_C
+| | | | | +--->BN_MP_GROW_C
+| | | | +--->BN_S_MP_SUB_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_REDUCE_2K_C
+| | | | +--->BN_MP_MUL_D_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_S_MP_ADD_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_CMP_MAG_C
+| | | | +--->BN_S_MP_SUB_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_MONTGOMERY_CALC_NORMALIZATION_C
+| | | | +--->BN_MP_2EXPT_C
+| | | | | +--->BN_MP_ZERO_C
+| | | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_MUL_2_C
+| | | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CMP_MAG_C
+| | | | +--->BN_S_MP_SUB_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_MULMOD_C
+| | | | +--->BN_MP_MUL_C
+| | | | | +--->BN_MP_TOOM_MUL_C
+| | | | | | +--->BN_MP_INIT_MULTI_C
+| | | | | | +--->BN_MP_MOD_2D_C
+| | | | | | | +--->BN_MP_ZERO_C
+| | | | | | | +--->BN_MP_COPY_C
+| | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_COPY_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_RSHD_C
+| | | | | | | +--->BN_MP_ZERO_C
+| | | | | | +--->BN_MP_MUL_2_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_ADD_C
+| | | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | | +--->BN_MP_CMP_MAG_C
+| | | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_SUB_C
+| | | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | | +--->BN_MP_CMP_MAG_C
+| | | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_DIV_2_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_MUL_2D_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_LSHD_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_MUL_D_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_DIV_3_C
+| | | | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | | +--->BN_MP_EXCH_C
+| | | | | | +--->BN_MP_LSHD_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_KARATSUBA_MUL_C
+| | | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_ADD_C
+| | | | | | | +--->BN_MP_CMP_MAG_C
+| | | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_LSHD_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_RSHD_C
+| | | | | | | | +--->BN_MP_ZERO_C
+| | | | | +--->BN_FAST_S_MP_MUL_DIGS_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_S_MP_MUL_DIGS_C
+| | | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_EXCH_C
+| | | | +--->BN_MP_MOD_C
+| | | | | +--->BN_MP_DIV_C
+| | | | | | +--->BN_MP_CMP_MAG_C
+| | | | | | +--->BN_MP_COPY_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_ZERO_C
+| | | | | | +--->BN_MP_INIT_MULTI_C
+| | | | | | +--->BN_MP_MUL_2D_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_LSHD_C
+| | | | | | | | +--->BN_MP_RSHD_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_CMP_C
+| | | | | | +--->BN_MP_SUB_C
+| | | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_ADD_C
+| | | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_EXCH_C
+| | | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | | +--->BN_MP_LSHD_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_RSHD_C
+| | | | | | +--->BN_MP_RSHD_C
+| | | | | | +--->BN_MP_MUL_D_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_EXCH_C
+| | | | | +--->BN_MP_ADD_C
+| | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_CMP_MAG_C
+| | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_MOD_C
+| | | | +--->BN_MP_DIV_C
+| | | | | +--->BN_MP_CMP_MAG_C
+| | | | | +--->BN_MP_COPY_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_ZERO_C
+| | | | | +--->BN_MP_INIT_MULTI_C
+| | | | | +--->BN_MP_MUL_2D_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_LSHD_C
+| | | | | | | +--->BN_MP_RSHD_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_CMP_C
+| | | | | +--->BN_MP_SUB_C
+| | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_ADD_C
+| | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_EXCH_C
+| | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | +--->BN_MP_LSHD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_RSHD_C
+| | | | | +--->BN_MP_RSHD_C
+| | | | | +--->BN_MP_MUL_D_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_EXCH_C
+| | | | +--->BN_MP_ADD_C
+| | | | | +--->BN_S_MP_ADD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_CMP_MAG_C
+| | | | | +--->BN_S_MP_SUB_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_COPY_C
+| | | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_SQR_C
+| | | | +--->BN_MP_TOOM_SQR_C
+| | | | | +--->BN_MP_INIT_MULTI_C
+| | | | | +--->BN_MP_MOD_2D_C
+| | | | | | +--->BN_MP_ZERO_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_RSHD_C
+| | | | | | +--->BN_MP_ZERO_C
+| | | | | +--->BN_MP_MUL_2_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_ADD_C
+| | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_CMP_MAG_C
+| | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_SUB_C
+| | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_CMP_MAG_C
+| | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_DIV_2_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_MUL_2D_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_LSHD_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_MUL_D_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_DIV_3_C
+| | | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_EXCH_C
+| | | | | +--->BN_MP_LSHD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_KARATSUBA_SQR_C
+| | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_S_MP_ADD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_S_MP_SUB_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_LSHD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_RSHD_C
+| | | | | | | +--->BN_MP_ZERO_C
+| | | | | +--->BN_MP_ADD_C
+| | | | | | +--->BN_MP_CMP_MAG_C
+| | | | +--->BN_FAST_S_MP_SQR_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_S_MP_SQR_C
+| | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_EXCH_C
+| | | +--->BN_MP_MUL_C
+| | | | +--->BN_MP_TOOM_MUL_C
+| | | | | +--->BN_MP_INIT_MULTI_C
+| | | | | +--->BN_MP_MOD_2D_C
+| | | | | | +--->BN_MP_ZERO_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_RSHD_C
+| | | | | | +--->BN_MP_ZERO_C
+| | | | | +--->BN_MP_MUL_2_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_ADD_C
+| | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_CMP_MAG_C
+| | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_SUB_C
+| | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_CMP_MAG_C
+| | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_DIV_2_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_MUL_2D_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_LSHD_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_MUL_D_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_DIV_3_C
+| | | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_EXCH_C
+| | | | | +--->BN_MP_LSHD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_KARATSUBA_MUL_C
+| | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_S_MP_ADD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_ADD_C
+| | | | | | +--->BN_MP_CMP_MAG_C
+| | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_S_MP_SUB_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_LSHD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_RSHD_C
+| | | | | | | +--->BN_MP_ZERO_C
+| | | | +--->BN_FAST_S_MP_MUL_DIGS_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_S_MP_MUL_DIGS_C
+| | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_EXCH_C
+| | | +--->BN_MP_EXCH_C
+| +--->BN_MP_CMP_C
+| | +--->BN_MP_CMP_MAG_C
+| +--->BN_MP_SQRMOD_C
+| | +--->BN_MP_SQR_C
+| | | +--->BN_MP_TOOM_SQR_C
+| | | | +--->BN_MP_INIT_MULTI_C
+| | | | | +--->BN_MP_CLEAR_C
+| | | | +--->BN_MP_MOD_2D_C
+| | | | | +--->BN_MP_ZERO_C
+| | | | | +--->BN_MP_COPY_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_COPY_C
+| | | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_RSHD_C
+| | | | | +--->BN_MP_ZERO_C
+| | | | +--->BN_MP_MUL_2_C
+| | | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_ADD_C
+| | | | | +--->BN_S_MP_ADD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_CMP_MAG_C
+| | | | | +--->BN_S_MP_SUB_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_SUB_C
+| | | | | +--->BN_S_MP_ADD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_CMP_MAG_C
+| | | | | +--->BN_S_MP_SUB_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_DIV_2_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_MUL_2D_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_LSHD_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_MUL_D_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_DIV_3_C
+| | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_EXCH_C
+| | | | | +--->BN_MP_CLEAR_C
+| | | | +--->BN_MP_LSHD_C
+| | | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLEAR_MULTI_C
+| | | | | +--->BN_MP_CLEAR_C
+| | | +--->BN_MP_KARATSUBA_SQR_C
+| | | | +--->BN_MP_INIT_SIZE_C
+| | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_S_MP_ADD_C
+| | | | | +--->BN_MP_GROW_C
+| | | | +--->BN_S_MP_SUB_C
+| | | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_LSHD_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_RSHD_C
+| | | | | | +--->BN_MP_ZERO_C
+| | | | +--->BN_MP_ADD_C
+| | | | | +--->BN_MP_CMP_MAG_C
+| | | | +--->BN_MP_CLEAR_C
+| | | +--->BN_FAST_S_MP_SQR_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_S_MP_SQR_C
+| | | | +--->BN_MP_INIT_SIZE_C
+| | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_EXCH_C
+| | | | +--->BN_MP_CLEAR_C
+| | +--->BN_MP_CLEAR_C
+| | +--->BN_MP_MOD_C
+| | | +--->BN_MP_DIV_C
+| | | | +--->BN_MP_CMP_MAG_C
+| | | | +--->BN_MP_COPY_C
+| | | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_ZERO_C
+| | | | +--->BN_MP_INIT_MULTI_C
+| | | | +--->BN_MP_COUNT_BITS_C
+| | | | +--->BN_MP_ABS_C
+| | | | +--->BN_MP_MUL_2D_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_LSHD_C
+| | | | | | +--->BN_MP_RSHD_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_SUB_C
+| | | | | +--->BN_S_MP_ADD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_S_MP_SUB_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_ADD_C
+| | | | | +--->BN_S_MP_ADD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_S_MP_SUB_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_EXCH_C
+| | | | +--->BN_MP_CLEAR_MULTI_C
+| | | | +--->BN_MP_INIT_SIZE_C
+| | | | +--->BN_MP_LSHD_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_RSHD_C
+| | | | +--->BN_MP_RSHD_C
+| | | | +--->BN_MP_MUL_D_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_EXCH_C
+| | | +--->BN_MP_ADD_C
+| | | | +--->BN_S_MP_ADD_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_CMP_MAG_C
+| | | | +--->BN_S_MP_SUB_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| +--->BN_MP_CLEAR_C
++--->BN_MP_CLEAR_C
+
+
+BN_FAST_S_MP_SQR_C
++--->BN_MP_GROW_C
++--->BN_MP_CLAMP_C
+
+
+BN_MP_UNSIGNED_BIN_SIZE_C
++--->BN_MP_COUNT_BITS_C
+
+
+BN_MP_INIT_SIZE_C
++--->BN_MP_INIT_C
+
+
+BN_FAST_S_MP_MUL_DIGS_C
++--->BN_MP_GROW_C
++--->BN_MP_CLAMP_C
+
+
+BN_MP_REDUCE_IS_2K_L_C
+
+
+BN_MP_REDUCE_IS_2K_C
++--->BN_MP_REDUCE_2K_C
+| +--->BN_MP_INIT_C
+| +--->BN_MP_COUNT_BITS_C
+| +--->BN_MP_DIV_2D_C
+| | +--->BN_MP_COPY_C
+| | | +--->BN_MP_GROW_C
+| | +--->BN_MP_ZERO_C
+| | +--->BN_MP_MOD_2D_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_CLEAR_C
+| | +--->BN_MP_RSHD_C
+| | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_EXCH_C
+| +--->BN_MP_MUL_D_C
+| | +--->BN_MP_GROW_C
+| | +--->BN_MP_CLAMP_C
+| +--->BN_S_MP_ADD_C
+| | +--->BN_MP_GROW_C
+| | +--->BN_MP_CLAMP_C
+| +--->BN_MP_CMP_MAG_C
+| +--->BN_S_MP_SUB_C
+| | +--->BN_MP_GROW_C
+| | +--->BN_MP_CLAMP_C
+| +--->BN_MP_CLEAR_C
++--->BN_MP_COUNT_BITS_C
+
+
+BN_MP_SUB_C
++--->BN_S_MP_ADD_C
+| +--->BN_MP_GROW_C
+| +--->BN_MP_CLAMP_C
++--->BN_MP_CMP_MAG_C
++--->BN_S_MP_SUB_C
+| +--->BN_MP_GROW_C
+| +--->BN_MP_CLAMP_C
+
+
+BN_MP_REDUCE_2K_SETUP_C
++--->BN_MP_INIT_C
++--->BN_MP_COUNT_BITS_C
++--->BN_MP_2EXPT_C
+| +--->BN_MP_ZERO_C
+| +--->BN_MP_GROW_C
++--->BN_MP_CLEAR_C
++--->BN_S_MP_SUB_C
+| +--->BN_MP_GROW_C
+| +--->BN_MP_CLAMP_C
+
+
+BN_MP_DIV_2D_C
++--->BN_MP_COPY_C
+| +--->BN_MP_GROW_C
++--->BN_MP_ZERO_C
++--->BN_MP_INIT_C
++--->BN_MP_MOD_2D_C
+| +--->BN_MP_CLAMP_C
++--->BN_MP_CLEAR_C
++--->BN_MP_RSHD_C
++--->BN_MP_CLAMP_C
++--->BN_MP_EXCH_C
+
+
+BN_MP_DR_REDUCE_C
++--->BN_MP_GROW_C
++--->BN_MP_CLAMP_C
++--->BN_MP_CMP_MAG_C
++--->BN_S_MP_SUB_C
+
+
+BN_MP_SQRT_C
++--->BN_MP_N_ROOT_C
+| +--->BN_MP_N_ROOT_EX_C
+| | +--->BN_MP_INIT_C
+| | +--->BN_MP_SET_C
+| | | +--->BN_MP_ZERO_C
+| | +--->BN_MP_COPY_C
+| | | +--->BN_MP_GROW_C
+| | +--->BN_MP_EXPT_D_EX_C
+| | | +--->BN_MP_INIT_COPY_C
+| | | | +--->BN_MP_INIT_SIZE_C
+| | | +--->BN_MP_MUL_C
+| | | | +--->BN_MP_TOOM_MUL_C
+| | | | | +--->BN_MP_INIT_MULTI_C
+| | | | | | +--->BN_MP_CLEAR_C
+| | | | | +--->BN_MP_MOD_2D_C
+| | | | | | +--->BN_MP_ZERO_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_RSHD_C
+| | | | | | +--->BN_MP_ZERO_C
+| | | | | +--->BN_MP_MUL_2_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_ADD_C
+| | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_CMP_MAG_C
+| | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_SUB_C
+| | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_CMP_MAG_C
+| | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_DIV_2_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_MUL_2D_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_LSHD_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_MUL_D_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_DIV_3_C
+| | | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_EXCH_C
+| | | | | | +--->BN_MP_CLEAR_C
+| | | | | +--->BN_MP_LSHD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLEAR_MULTI_C
+| | | | | | +--->BN_MP_CLEAR_C
+| | | | +--->BN_MP_KARATSUBA_MUL_C
+| | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_S_MP_ADD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_ADD_C
+| | | | | | +--->BN_MP_CMP_MAG_C
+| | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_S_MP_SUB_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_LSHD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_RSHD_C
+| | | | | | | +--->BN_MP_ZERO_C
+| | | | | +--->BN_MP_CLEAR_C
+| | | | +--->BN_FAST_S_MP_MUL_DIGS_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_S_MP_MUL_DIGS_C
+| | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_EXCH_C
+| | | | | +--->BN_MP_CLEAR_C
+| | | +--->BN_MP_CLEAR_C
+| | | +--->BN_MP_SQR_C
+| | | | +--->BN_MP_TOOM_SQR_C
+| | | | | +--->BN_MP_INIT_MULTI_C
+| | | | | +--->BN_MP_MOD_2D_C
+| | | | | | +--->BN_MP_ZERO_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_RSHD_C
+| | | | | | +--->BN_MP_ZERO_C
+| | | | | +--->BN_MP_MUL_2_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_ADD_C
+| | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_CMP_MAG_C
+| | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_SUB_C
+| | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_CMP_MAG_C
+| | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_DIV_2_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_MUL_2D_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_LSHD_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_MUL_D_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_DIV_3_C
+| | | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_EXCH_C
+| | | | | +--->BN_MP_LSHD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLEAR_MULTI_C
+| | | | +--->BN_MP_KARATSUBA_SQR_C
+| | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_S_MP_ADD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_S_MP_SUB_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_LSHD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_RSHD_C
+| | | | | | | +--->BN_MP_ZERO_C
+| | | | | +--->BN_MP_ADD_C
+| | | | | | +--->BN_MP_CMP_MAG_C
+| | | | +--->BN_FAST_S_MP_SQR_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_S_MP_SQR_C
+| | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_EXCH_C
+| | +--->BN_MP_MUL_C
+| | | +--->BN_MP_TOOM_MUL_C
+| | | | +--->BN_MP_INIT_MULTI_C
+| | | | | +--->BN_MP_CLEAR_C
+| | | | +--->BN_MP_MOD_2D_C
+| | | | | +--->BN_MP_ZERO_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_RSHD_C
+| | | | | +--->BN_MP_ZERO_C
+| | | | +--->BN_MP_MUL_2_C
+| | | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_ADD_C
+| | | | | +--->BN_S_MP_ADD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_CMP_MAG_C
+| | | | | +--->BN_S_MP_SUB_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_SUB_C
+| | | | | +--->BN_S_MP_ADD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_CMP_MAG_C
+| | | | | +--->BN_S_MP_SUB_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_DIV_2_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_MUL_2D_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_LSHD_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_MUL_D_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_DIV_3_C
+| | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_EXCH_C
+| | | | | +--->BN_MP_CLEAR_C
+| | | | +--->BN_MP_LSHD_C
+| | | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLEAR_MULTI_C
+| | | | | +--->BN_MP_CLEAR_C
+| | | +--->BN_MP_KARATSUBA_MUL_C
+| | | | +--->BN_MP_INIT_SIZE_C
+| | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_S_MP_ADD_C
+| | | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_ADD_C
+| | | | | +--->BN_MP_CMP_MAG_C
+| | | | | +--->BN_S_MP_SUB_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | +--->BN_S_MP_SUB_C
+| | | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_LSHD_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_RSHD_C
+| | | | | | +--->BN_MP_ZERO_C
+| | | | +--->BN_MP_CLEAR_C
+| | | +--->BN_FAST_S_MP_MUL_DIGS_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_S_MP_MUL_DIGS_C
+| | | | +--->BN_MP_INIT_SIZE_C
+| | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_EXCH_C
+| | | | +--->BN_MP_CLEAR_C
+| | +--->BN_MP_SUB_C
+| | | +--->BN_S_MP_ADD_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_CMP_MAG_C
+| | | +--->BN_S_MP_SUB_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_MUL_D_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_DIV_C
+| | | +--->BN_MP_CMP_MAG_C
+| | | +--->BN_MP_ZERO_C
+| | | +--->BN_MP_INIT_MULTI_C
+| | | | +--->BN_MP_CLEAR_C
+| | | +--->BN_MP_COUNT_BITS_C
+| | | +--->BN_MP_ABS_C
+| | | +--->BN_MP_MUL_2D_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_LSHD_C
+| | | | | +--->BN_MP_RSHD_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_CMP_C
+| | | +--->BN_MP_ADD_C
+| | | | +--->BN_S_MP_ADD_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_S_MP_SUB_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_DIV_2D_C
+| | | | +--->BN_MP_MOD_2D_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_CLEAR_C
+| | | | +--->BN_MP_RSHD_C
+| | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_EXCH_C
+| | | +--->BN_MP_EXCH_C
+| | | +--->BN_MP_CLEAR_MULTI_C
+| | | | +--->BN_MP_CLEAR_C
+| | | +--->BN_MP_INIT_SIZE_C
+| | | +--->BN_MP_INIT_COPY_C
+| | | +--->BN_MP_LSHD_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_RSHD_C
+| | | +--->BN_MP_RSHD_C
+| | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_CLEAR_C
+| | +--->BN_MP_CMP_C
+| | | +--->BN_MP_CMP_MAG_C
+| | +--->BN_MP_SUB_D_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_ADD_D_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_EXCH_C
+| | +--->BN_MP_CLEAR_C
++--->BN_MP_ZERO_C
++--->BN_MP_INIT_COPY_C
+| +--->BN_MP_INIT_SIZE_C
+| +--->BN_MP_COPY_C
+| | +--->BN_MP_GROW_C
++--->BN_MP_RSHD_C
++--->BN_MP_DIV_C
+| +--->BN_MP_CMP_MAG_C
+| +--->BN_MP_COPY_C
+| | +--->BN_MP_GROW_C
+| +--->BN_MP_INIT_MULTI_C
+| | +--->BN_MP_CLEAR_C
+| +--->BN_MP_SET_C
+| +--->BN_MP_COUNT_BITS_C
+| +--->BN_MP_ABS_C
+| +--->BN_MP_MUL_2D_C
+| | +--->BN_MP_GROW_C
+| | +--->BN_MP_LSHD_C
+| | +--->BN_MP_CLAMP_C
+| +--->BN_MP_CMP_C
+| +--->BN_MP_SUB_C
+| | +--->BN_S_MP_ADD_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_S_MP_SUB_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLAMP_C
+| +--->BN_MP_ADD_C
+| | +--->BN_S_MP_ADD_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_S_MP_SUB_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLAMP_C
+| +--->BN_MP_DIV_2D_C
+| | +--->BN_MP_MOD_2D_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_CLEAR_C
+| | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_EXCH_C
+| +--->BN_MP_EXCH_C
+| +--->BN_MP_CLEAR_MULTI_C
+| | +--->BN_MP_CLEAR_C
+| +--->BN_MP_INIT_SIZE_C
+| +--->BN_MP_LSHD_C
+| | +--->BN_MP_GROW_C
+| +--->BN_MP_MUL_D_C
+| | +--->BN_MP_GROW_C
+| | +--->BN_MP_CLAMP_C
+| +--->BN_MP_CLAMP_C
+| +--->BN_MP_CLEAR_C
++--->BN_MP_ADD_C
+| +--->BN_S_MP_ADD_C
+| | +--->BN_MP_GROW_C
+| | +--->BN_MP_CLAMP_C
+| +--->BN_MP_CMP_MAG_C
+| +--->BN_S_MP_SUB_C
+| | +--->BN_MP_GROW_C
+| | +--->BN_MP_CLAMP_C
++--->BN_MP_DIV_2_C
+| +--->BN_MP_GROW_C
+| +--->BN_MP_CLAMP_C
++--->BN_MP_CMP_MAG_C
++--->BN_MP_EXCH_C
++--->BN_MP_CLEAR_C
+
+
+BN_MP_MULMOD_C
++--->BN_MP_INIT_C
++--->BN_MP_MUL_C
+| +--->BN_MP_TOOM_MUL_C
+| | +--->BN_MP_INIT_MULTI_C
+| | | +--->BN_MP_CLEAR_C
+| | +--->BN_MP_MOD_2D_C
+| | | +--->BN_MP_ZERO_C
+| | | +--->BN_MP_COPY_C
+| | | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_COPY_C
+| | | +--->BN_MP_GROW_C
+| | +--->BN_MP_RSHD_C
+| | | +--->BN_MP_ZERO_C
+| | +--->BN_MP_MUL_2_C
+| | | +--->BN_MP_GROW_C
+| | +--->BN_MP_ADD_C
+| | | +--->BN_S_MP_ADD_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_CMP_MAG_C
+| | | +--->BN_S_MP_SUB_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_SUB_C
+| | | +--->BN_S_MP_ADD_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_CMP_MAG_C
+| | | +--->BN_S_MP_SUB_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_DIV_2_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_MUL_2D_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_LSHD_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_MUL_D_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_DIV_3_C
+| | | +--->BN_MP_INIT_SIZE_C
+| | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_EXCH_C
+| | | +--->BN_MP_CLEAR_C
+| | +--->BN_MP_LSHD_C
+| | | +--->BN_MP_GROW_C
+| | +--->BN_MP_CLEAR_MULTI_C
+| | | +--->BN_MP_CLEAR_C
+| +--->BN_MP_KARATSUBA_MUL_C
+| | +--->BN_MP_INIT_SIZE_C
+| | +--->BN_MP_CLAMP_C
+| | +--->BN_S_MP_ADD_C
+| | | +--->BN_MP_GROW_C
+| | +--->BN_MP_ADD_C
+| | | +--->BN_MP_CMP_MAG_C
+| | | +--->BN_S_MP_SUB_C
+| | | | +--->BN_MP_GROW_C
+| | +--->BN_S_MP_SUB_C
+| | | +--->BN_MP_GROW_C
+| | +--->BN_MP_LSHD_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_RSHD_C
+| | | | +--->BN_MP_ZERO_C
+| | +--->BN_MP_CLEAR_C
+| +--->BN_FAST_S_MP_MUL_DIGS_C
+| | +--->BN_MP_GROW_C
+| | +--->BN_MP_CLAMP_C
+| +--->BN_S_MP_MUL_DIGS_C
+| | +--->BN_MP_INIT_SIZE_C
+| | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_EXCH_C
+| | +--->BN_MP_CLEAR_C
++--->BN_MP_CLEAR_C
++--->BN_MP_MOD_C
+| +--->BN_MP_DIV_C
+| | +--->BN_MP_CMP_MAG_C
+| | +--->BN_MP_COPY_C
+| | | +--->BN_MP_GROW_C
+| | +--->BN_MP_ZERO_C
+| | +--->BN_MP_INIT_MULTI_C
+| | +--->BN_MP_SET_C
+| | +--->BN_MP_COUNT_BITS_C
+| | +--->BN_MP_ABS_C
+| | +--->BN_MP_MUL_2D_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_LSHD_C
+| | | | +--->BN_MP_RSHD_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_CMP_C
+| | +--->BN_MP_SUB_C
+| | | +--->BN_S_MP_ADD_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_S_MP_SUB_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_ADD_C
+| | | +--->BN_S_MP_ADD_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_S_MP_SUB_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_DIV_2D_C
+| | | +--->BN_MP_MOD_2D_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_RSHD_C
+| | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_EXCH_C
+| | +--->BN_MP_EXCH_C
+| | +--->BN_MP_CLEAR_MULTI_C
+| | +--->BN_MP_INIT_SIZE_C
+| | +--->BN_MP_INIT_COPY_C
+| | +--->BN_MP_LSHD_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_RSHD_C
+| | +--->BN_MP_RSHD_C
+| | +--->BN_MP_MUL_D_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_CLAMP_C
+| +--->BN_MP_EXCH_C
+| +--->BN_MP_ADD_C
+| | +--->BN_S_MP_ADD_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_CMP_MAG_C
+| | +--->BN_S_MP_SUB_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLAMP_C
+
+
+BN_MP_INVMOD_C
++--->BN_FAST_MP_INVMOD_C
+| +--->BN_MP_INIT_MULTI_C
+| | +--->BN_MP_INIT_C
+| | +--->BN_MP_CLEAR_C
+| +--->BN_MP_COPY_C
+| | +--->BN_MP_GROW_C
+| +--->BN_MP_MOD_C
+| | +--->BN_MP_INIT_C
+| | +--->BN_MP_DIV_C
+| | | +--->BN_MP_CMP_MAG_C
+| | | +--->BN_MP_ZERO_C
+| | | +--->BN_MP_SET_C
+| | | +--->BN_MP_COUNT_BITS_C
+| | | +--->BN_MP_ABS_C
+| | | +--->BN_MP_MUL_2D_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_LSHD_C
+| | | | | +--->BN_MP_RSHD_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_CMP_C
+| | | +--->BN_MP_SUB_C
+| | | | +--->BN_S_MP_ADD_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_S_MP_SUB_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_ADD_C
+| | | | +--->BN_S_MP_ADD_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_S_MP_SUB_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_DIV_2D_C
+| | | | +--->BN_MP_MOD_2D_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_CLEAR_C
+| | | | +--->BN_MP_RSHD_C
+| | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_EXCH_C
+| | | +--->BN_MP_EXCH_C
+| | | +--->BN_MP_CLEAR_MULTI_C
+| | | | +--->BN_MP_CLEAR_C
+| | | +--->BN_MP_INIT_SIZE_C
+| | | +--->BN_MP_INIT_COPY_C
+| | | +--->BN_MP_LSHD_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_RSHD_C
+| | | +--->BN_MP_RSHD_C
+| | | +--->BN_MP_MUL_D_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_CLEAR_C
+| | +--->BN_MP_CLEAR_C
+| | +--->BN_MP_EXCH_C
+| | +--->BN_MP_ADD_C
+| | | +--->BN_S_MP_ADD_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_CMP_MAG_C
+| | | +--->BN_S_MP_SUB_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| +--->BN_MP_SET_C
+| | +--->BN_MP_ZERO_C
+| +--->BN_MP_DIV_2_C
+| | +--->BN_MP_GROW_C
+| | +--->BN_MP_CLAMP_C
+| +--->BN_MP_SUB_C
+| | +--->BN_S_MP_ADD_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_CMP_MAG_C
+| | +--->BN_S_MP_SUB_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLAMP_C
+| +--->BN_MP_CMP_C
+| | +--->BN_MP_CMP_MAG_C
+| +--->BN_MP_CMP_D_C
+| +--->BN_MP_ADD_C
+| | +--->BN_S_MP_ADD_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_CMP_MAG_C
+| | +--->BN_S_MP_SUB_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLAMP_C
+| +--->BN_MP_EXCH_C
+| +--->BN_MP_CLEAR_MULTI_C
+| | +--->BN_MP_CLEAR_C
++--->BN_MP_INVMOD_SLOW_C
+| +--->BN_MP_INIT_MULTI_C
+| | +--->BN_MP_INIT_C
+| | +--->BN_MP_CLEAR_C
+| +--->BN_MP_MOD_C
+| | +--->BN_MP_INIT_C
+| | +--->BN_MP_DIV_C
+| | | +--->BN_MP_CMP_MAG_C
+| | | +--->BN_MP_COPY_C
+| | | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_ZERO_C
+| | | +--->BN_MP_SET_C
+| | | +--->BN_MP_COUNT_BITS_C
+| | | +--->BN_MP_ABS_C
+| | | +--->BN_MP_MUL_2D_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_LSHD_C
+| | | | | +--->BN_MP_RSHD_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_CMP_C
+| | | +--->BN_MP_SUB_C
+| | | | +--->BN_S_MP_ADD_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_S_MP_SUB_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_ADD_C
+| | | | +--->BN_S_MP_ADD_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_S_MP_SUB_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_DIV_2D_C
+| | | | +--->BN_MP_MOD_2D_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_CLEAR_C
+| | | | +--->BN_MP_RSHD_C
+| | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_EXCH_C
+| | | +--->BN_MP_EXCH_C
+| | | +--->BN_MP_CLEAR_MULTI_C
+| | | | +--->BN_MP_CLEAR_C
+| | | +--->BN_MP_INIT_SIZE_C
+| | | +--->BN_MP_INIT_COPY_C
+| | | +--->BN_MP_LSHD_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_RSHD_C
+| | | +--->BN_MP_RSHD_C
+| | | +--->BN_MP_MUL_D_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_CLEAR_C
+| | +--->BN_MP_CLEAR_C
+| | +--->BN_MP_EXCH_C
+| | +--->BN_MP_ADD_C
+| | | +--->BN_S_MP_ADD_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_CMP_MAG_C
+| | | +--->BN_S_MP_SUB_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| +--->BN_MP_COPY_C
+| | +--->BN_MP_GROW_C
+| +--->BN_MP_SET_C
+| | +--->BN_MP_ZERO_C
+| +--->BN_MP_DIV_2_C
+| | +--->BN_MP_GROW_C
+| | +--->BN_MP_CLAMP_C
+| +--->BN_MP_ADD_C
+| | +--->BN_S_MP_ADD_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_CMP_MAG_C
+| | +--->BN_S_MP_SUB_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLAMP_C
+| +--->BN_MP_SUB_C
+| | +--->BN_S_MP_ADD_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_CMP_MAG_C
+| | +--->BN_S_MP_SUB_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLAMP_C
+| +--->BN_MP_CMP_C
+| | +--->BN_MP_CMP_MAG_C
+| +--->BN_MP_CMP_D_C
+| +--->BN_MP_CMP_MAG_C
+| +--->BN_MP_EXCH_C
+| +--->BN_MP_CLEAR_MULTI_C
+| | +--->BN_MP_CLEAR_C
+
+
+BN_MP_PRIME_MILLER_RABIN_C
++--->BN_MP_CMP_D_C
++--->BN_MP_INIT_COPY_C
+| +--->BN_MP_INIT_SIZE_C
+| +--->BN_MP_COPY_C
+| | +--->BN_MP_GROW_C
++--->BN_MP_SUB_D_C
+| +--->BN_MP_GROW_C
+| +--->BN_MP_ADD_D_C
+| | +--->BN_MP_CLAMP_C
+| +--->BN_MP_CLAMP_C
++--->BN_MP_CNT_LSB_C
++--->BN_MP_DIV_2D_C
+| +--->BN_MP_COPY_C
+| | +--->BN_MP_GROW_C
+| +--->BN_MP_ZERO_C
+| +--->BN_MP_MOD_2D_C
+| | +--->BN_MP_CLAMP_C
+| +--->BN_MP_CLEAR_C
+| +--->BN_MP_RSHD_C
+| +--->BN_MP_CLAMP_C
+| +--->BN_MP_EXCH_C
++--->BN_MP_EXPTMOD_C
+| +--->BN_MP_INVMOD_C
+| | +--->BN_FAST_MP_INVMOD_C
+| | | +--->BN_MP_INIT_MULTI_C
+| | | | +--->BN_MP_CLEAR_C
+| | | +--->BN_MP_COPY_C
+| | | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_MOD_C
+| | | | +--->BN_MP_DIV_C
+| | | | | +--->BN_MP_CMP_MAG_C
+| | | | | +--->BN_MP_ZERO_C
+| | | | | +--->BN_MP_SET_C
+| | | | | +--->BN_MP_COUNT_BITS_C
+| | | | | +--->BN_MP_ABS_C
+| | | | | +--->BN_MP_MUL_2D_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_LSHD_C
+| | | | | | | +--->BN_MP_RSHD_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_CMP_C
+| | | | | +--->BN_MP_SUB_C
+| | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_ADD_C
+| | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_EXCH_C
+| | | | | +--->BN_MP_CLEAR_MULTI_C
+| | | | | | +--->BN_MP_CLEAR_C
+| | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | +--->BN_MP_LSHD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_RSHD_C
+| | | | | +--->BN_MP_RSHD_C
+| | | | | +--->BN_MP_MUL_D_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_CLEAR_C
+| | | | +--->BN_MP_CLEAR_C
+| | | | +--->BN_MP_EXCH_C
+| | | | +--->BN_MP_ADD_C
+| | | | | +--->BN_S_MP_ADD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_CMP_MAG_C
+| | | | | +--->BN_S_MP_SUB_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_SET_C
+| | | | +--->BN_MP_ZERO_C
+| | | +--->BN_MP_DIV_2_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_SUB_C
+| | | | +--->BN_S_MP_ADD_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_CMP_MAG_C
+| | | | +--->BN_S_MP_SUB_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_CMP_C
+| | | | +--->BN_MP_CMP_MAG_C
+| | | +--->BN_MP_ADD_C
+| | | | +--->BN_S_MP_ADD_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_CMP_MAG_C
+| | | | +--->BN_S_MP_SUB_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_EXCH_C
+| | | +--->BN_MP_CLEAR_MULTI_C
+| | | | +--->BN_MP_CLEAR_C
+| | +--->BN_MP_INVMOD_SLOW_C
+| | | +--->BN_MP_INIT_MULTI_C
+| | | | +--->BN_MP_CLEAR_C
+| | | +--->BN_MP_MOD_C
+| | | | +--->BN_MP_DIV_C
+| | | | | +--->BN_MP_CMP_MAG_C
+| | | | | +--->BN_MP_COPY_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_ZERO_C
+| | | | | +--->BN_MP_SET_C
+| | | | | +--->BN_MP_COUNT_BITS_C
+| | | | | +--->BN_MP_ABS_C
+| | | | | +--->BN_MP_MUL_2D_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_LSHD_C
+| | | | | | | +--->BN_MP_RSHD_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_CMP_C
+| | | | | +--->BN_MP_SUB_C
+| | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_ADD_C
+| | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_EXCH_C
+| | | | | +--->BN_MP_CLEAR_MULTI_C
+| | | | | | +--->BN_MP_CLEAR_C
+| | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | +--->BN_MP_LSHD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_RSHD_C
+| | | | | +--->BN_MP_RSHD_C
+| | | | | +--->BN_MP_MUL_D_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_CLEAR_C
+| | | | +--->BN_MP_CLEAR_C
+| | | | +--->BN_MP_EXCH_C
+| | | | +--->BN_MP_ADD_C
+| | | | | +--->BN_S_MP_ADD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_CMP_MAG_C
+| | | | | +--->BN_S_MP_SUB_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_COPY_C
+| | | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_SET_C
+| | | | +--->BN_MP_ZERO_C
+| | | +--->BN_MP_DIV_2_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_ADD_C
+| | | | +--->BN_S_MP_ADD_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_CMP_MAG_C
+| | | | +--->BN_S_MP_SUB_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_SUB_C
+| | | | +--->BN_S_MP_ADD_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_CMP_MAG_C
+| | | | +--->BN_S_MP_SUB_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_CMP_C
+| | | | +--->BN_MP_CMP_MAG_C
+| | | +--->BN_MP_CMP_MAG_C
+| | | +--->BN_MP_EXCH_C
+| | | +--->BN_MP_CLEAR_MULTI_C
+| | | | +--->BN_MP_CLEAR_C
+| +--->BN_MP_CLEAR_C
+| +--->BN_MP_ABS_C
+| | +--->BN_MP_COPY_C
+| | | +--->BN_MP_GROW_C
+| +--->BN_MP_CLEAR_MULTI_C
+| +--->BN_MP_REDUCE_IS_2K_L_C
+| +--->BN_S_MP_EXPTMOD_C
+| | +--->BN_MP_COUNT_BITS_C
+| | +--->BN_MP_REDUCE_SETUP_C
+| | | +--->BN_MP_2EXPT_C
+| | | | +--->BN_MP_ZERO_C
+| | | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_DIV_C
+| | | | +--->BN_MP_CMP_MAG_C
+| | | | +--->BN_MP_COPY_C
+| | | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_ZERO_C
+| | | | +--->BN_MP_INIT_MULTI_C
+| | | | +--->BN_MP_SET_C
+| | | | +--->BN_MP_MUL_2D_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_LSHD_C
+| | | | | | +--->BN_MP_RSHD_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_CMP_C
+| | | | +--->BN_MP_SUB_C
+| | | | | +--->BN_S_MP_ADD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_S_MP_SUB_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_ADD_C
+| | | | | +--->BN_S_MP_ADD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_S_MP_SUB_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_EXCH_C
+| | | | +--->BN_MP_INIT_SIZE_C
+| | | | +--->BN_MP_LSHD_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_RSHD_C
+| | | | +--->BN_MP_RSHD_C
+| | | | +--->BN_MP_MUL_D_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_REDUCE_C
+| | | +--->BN_MP_RSHD_C
+| | | | +--->BN_MP_ZERO_C
+| | | +--->BN_MP_MUL_C
+| | | | +--->BN_MP_TOOM_MUL_C
+| | | | | +--->BN_MP_INIT_MULTI_C
+| | | | | +--->BN_MP_MOD_2D_C
+| | | | | | +--->BN_MP_ZERO_C
+| | | | | | +--->BN_MP_COPY_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_COPY_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_MUL_2_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_ADD_C
+| | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_CMP_MAG_C
+| | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_SUB_C
+| | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_CMP_MAG_C
+| | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_DIV_2_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_MUL_2D_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_LSHD_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_MUL_D_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_DIV_3_C
+| | | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_EXCH_C
+| | | | | +--->BN_MP_LSHD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_KARATSUBA_MUL_C
+| | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_S_MP_ADD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_ADD_C
+| | | | | | +--->BN_MP_CMP_MAG_C
+| | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_S_MP_SUB_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_LSHD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | +--->BN_FAST_S_MP_MUL_DIGS_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_S_MP_MUL_DIGS_C
+| | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_EXCH_C
+| | | +--->BN_S_MP_MUL_HIGH_DIGS_C
+| | | | +--->BN_FAST_S_MP_MUL_HIGH_DIGS_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_INIT_SIZE_C
+| | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_EXCH_C
+| | | +--->BN_FAST_S_MP_MUL_HIGH_DIGS_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_MOD_2D_C
+| | | | +--->BN_MP_ZERO_C
+| | | | +--->BN_MP_COPY_C
+| | | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_S_MP_MUL_DIGS_C
+| | | | +--->BN_FAST_S_MP_MUL_DIGS_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_INIT_SIZE_C
+| | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_EXCH_C
+| | | +--->BN_MP_SUB_C
+| | | | +--->BN_S_MP_ADD_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_CMP_MAG_C
+| | | | +--->BN_S_MP_SUB_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_SET_C
+| | | | +--->BN_MP_ZERO_C
+| | | +--->BN_MP_LSHD_C
+| | | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_ADD_C
+| | | | +--->BN_S_MP_ADD_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_CMP_MAG_C
+| | | | +--->BN_S_MP_SUB_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_CMP_C
+| | | | +--->BN_MP_CMP_MAG_C
+| | | +--->BN_S_MP_SUB_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_REDUCE_2K_SETUP_L_C
+| | | +--->BN_MP_2EXPT_C
+| | | | +--->BN_MP_ZERO_C
+| | | | +--->BN_MP_GROW_C
+| | | +--->BN_S_MP_SUB_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_REDUCE_2K_L_C
+| | | +--->BN_MP_MUL_C
+| | | | +--->BN_MP_TOOM_MUL_C
+| | | | | +--->BN_MP_INIT_MULTI_C
+| | | | | +--->BN_MP_MOD_2D_C
+| | | | | | +--->BN_MP_ZERO_C
+| | | | | | +--->BN_MP_COPY_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_COPY_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_RSHD_C
+| | | | | | +--->BN_MP_ZERO_C
+| | | | | +--->BN_MP_MUL_2_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_ADD_C
+| | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_CMP_MAG_C
+| | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_SUB_C
+| | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_CMP_MAG_C
+| | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_DIV_2_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_MUL_2D_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_LSHD_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_MUL_D_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_DIV_3_C
+| | | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_EXCH_C
+| | | | | +--->BN_MP_LSHD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_KARATSUBA_MUL_C
+| | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_S_MP_ADD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_ADD_C
+| | | | | | +--->BN_MP_CMP_MAG_C
+| | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_S_MP_SUB_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_LSHD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_RSHD_C
+| | | | | | | +--->BN_MP_ZERO_C
+| | | | +--->BN_FAST_S_MP_MUL_DIGS_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_S_MP_MUL_DIGS_C
+| | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_EXCH_C
+| | | +--->BN_S_MP_ADD_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_CMP_MAG_C
+| | | +--->BN_S_MP_SUB_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_MOD_C
+| | | +--->BN_MP_DIV_C
+| | | | +--->BN_MP_CMP_MAG_C
+| | | | +--->BN_MP_COPY_C
+| | | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_ZERO_C
+| | | | +--->BN_MP_INIT_MULTI_C
+| | | | +--->BN_MP_SET_C
+| | | | +--->BN_MP_MUL_2D_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_LSHD_C
+| | | | | | +--->BN_MP_RSHD_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_CMP_C
+| | | | +--->BN_MP_SUB_C
+| | | | | +--->BN_S_MP_ADD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_S_MP_SUB_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_ADD_C
+| | | | | +--->BN_S_MP_ADD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_S_MP_SUB_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_EXCH_C
+| | | | +--->BN_MP_INIT_SIZE_C
+| | | | +--->BN_MP_LSHD_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_RSHD_C
+| | | | +--->BN_MP_RSHD_C
+| | | | +--->BN_MP_MUL_D_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_EXCH_C
+| | | +--->BN_MP_ADD_C
+| | | | +--->BN_S_MP_ADD_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_CMP_MAG_C
+| | | | +--->BN_S_MP_SUB_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_COPY_C
+| | | +--->BN_MP_GROW_C
+| | +--->BN_MP_SQR_C
+| | | +--->BN_MP_TOOM_SQR_C
+| | | | +--->BN_MP_INIT_MULTI_C
+| | | | +--->BN_MP_MOD_2D_C
+| | | | | +--->BN_MP_ZERO_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_RSHD_C
+| | | | | +--->BN_MP_ZERO_C
+| | | | +--->BN_MP_MUL_2_C
+| | | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_ADD_C
+| | | | | +--->BN_S_MP_ADD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_CMP_MAG_C
+| | | | | +--->BN_S_MP_SUB_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_SUB_C
+| | | | | +--->BN_S_MP_ADD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_CMP_MAG_C
+| | | | | +--->BN_S_MP_SUB_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_DIV_2_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_MUL_2D_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_LSHD_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_MUL_D_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_DIV_3_C
+| | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_EXCH_C
+| | | | +--->BN_MP_LSHD_C
+| | | | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_KARATSUBA_SQR_C
+| | | | +--->BN_MP_INIT_SIZE_C
+| | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_S_MP_ADD_C
+| | | | | +--->BN_MP_GROW_C
+| | | | +--->BN_S_MP_SUB_C
+| | | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_LSHD_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_RSHD_C
+| | | | | | +--->BN_MP_ZERO_C
+| | | | +--->BN_MP_ADD_C
+| | | | | +--->BN_MP_CMP_MAG_C
+| | | +--->BN_FAST_S_MP_SQR_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_S_MP_SQR_C
+| | | | +--->BN_MP_INIT_SIZE_C
+| | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_EXCH_C
+| | +--->BN_MP_MUL_C
+| | | +--->BN_MP_TOOM_MUL_C
+| | | | +--->BN_MP_INIT_MULTI_C
+| | | | +--->BN_MP_MOD_2D_C
+| | | | | +--->BN_MP_ZERO_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_RSHD_C
+| | | | | +--->BN_MP_ZERO_C
+| | | | +--->BN_MP_MUL_2_C
+| | | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_ADD_C
+| | | | | +--->BN_S_MP_ADD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_CMP_MAG_C
+| | | | | +--->BN_S_MP_SUB_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_SUB_C
+| | | | | +--->BN_S_MP_ADD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_CMP_MAG_C
+| | | | | +--->BN_S_MP_SUB_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_DIV_2_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_MUL_2D_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_LSHD_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_MUL_D_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_DIV_3_C
+| | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_EXCH_C
+| | | | +--->BN_MP_LSHD_C
+| | | | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_KARATSUBA_MUL_C
+| | | | +--->BN_MP_INIT_SIZE_C
+| | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_S_MP_ADD_C
+| | | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_ADD_C
+| | | | | +--->BN_MP_CMP_MAG_C
+| | | | | +--->BN_S_MP_SUB_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | +--->BN_S_MP_SUB_C
+| | | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_LSHD_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_RSHD_C
+| | | | | | +--->BN_MP_ZERO_C
+| | | +--->BN_FAST_S_MP_MUL_DIGS_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_S_MP_MUL_DIGS_C
+| | | | +--->BN_MP_INIT_SIZE_C
+| | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_EXCH_C
+| | +--->BN_MP_SET_C
+| | | +--->BN_MP_ZERO_C
+| | +--->BN_MP_EXCH_C
+| +--->BN_MP_DR_IS_MODULUS_C
+| +--->BN_MP_REDUCE_IS_2K_C
+| | +--->BN_MP_REDUCE_2K_C
+| | | +--->BN_MP_COUNT_BITS_C
+| | | +--->BN_MP_MUL_D_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_S_MP_ADD_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_CMP_MAG_C
+| | | +--->BN_S_MP_SUB_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_COUNT_BITS_C
+| +--->BN_MP_EXPTMOD_FAST_C
+| | +--->BN_MP_COUNT_BITS_C
+| | +--->BN_MP_MONTGOMERY_SETUP_C
+| | +--->BN_FAST_MP_MONTGOMERY_REDUCE_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_RSHD_C
+| | | | +--->BN_MP_ZERO_C
+| | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_CMP_MAG_C
+| | | +--->BN_S_MP_SUB_C
+| | +--->BN_MP_MONTGOMERY_REDUCE_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_RSHD_C
+| | | | +--->BN_MP_ZERO_C
+| | | +--->BN_MP_CMP_MAG_C
+| | | +--->BN_S_MP_SUB_C
+| | +--->BN_MP_DR_SETUP_C
+| | +--->BN_MP_DR_REDUCE_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_CMP_MAG_C
+| | | +--->BN_S_MP_SUB_C
+| | +--->BN_MP_REDUCE_2K_SETUP_C
+| | | +--->BN_MP_2EXPT_C
+| | | | +--->BN_MP_ZERO_C
+| | | | +--->BN_MP_GROW_C
+| | | +--->BN_S_MP_SUB_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_REDUCE_2K_C
+| | | +--->BN_MP_MUL_D_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_S_MP_ADD_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_CMP_MAG_C
+| | | +--->BN_S_MP_SUB_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_MONTGOMERY_CALC_NORMALIZATION_C
+| | | +--->BN_MP_2EXPT_C
+| | | | +--->BN_MP_ZERO_C
+| | | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_SET_C
+| | | | +--->BN_MP_ZERO_C
+| | | +--->BN_MP_MUL_2_C
+| | | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CMP_MAG_C
+| | | +--->BN_S_MP_SUB_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_MULMOD_C
+| | | +--->BN_MP_MUL_C
+| | | | +--->BN_MP_TOOM_MUL_C
+| | | | | +--->BN_MP_INIT_MULTI_C
+| | | | | +--->BN_MP_MOD_2D_C
+| | | | | | +--->BN_MP_ZERO_C
+| | | | | | +--->BN_MP_COPY_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_COPY_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_RSHD_C
+| | | | | | +--->BN_MP_ZERO_C
+| | | | | +--->BN_MP_MUL_2_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_ADD_C
+| | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_CMP_MAG_C
+| | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_SUB_C
+| | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_CMP_MAG_C
+| | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_DIV_2_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_MUL_2D_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_LSHD_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_MUL_D_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_DIV_3_C
+| | | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_EXCH_C
+| | | | | +--->BN_MP_LSHD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_KARATSUBA_MUL_C
+| | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_S_MP_ADD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_ADD_C
+| | | | | | +--->BN_MP_CMP_MAG_C
+| | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_S_MP_SUB_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_LSHD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_RSHD_C
+| | | | | | | +--->BN_MP_ZERO_C
+| | | | +--->BN_FAST_S_MP_MUL_DIGS_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_S_MP_MUL_DIGS_C
+| | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_EXCH_C
+| | | +--->BN_MP_MOD_C
+| | | | +--->BN_MP_DIV_C
+| | | | | +--->BN_MP_CMP_MAG_C
+| | | | | +--->BN_MP_COPY_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_ZERO_C
+| | | | | +--->BN_MP_INIT_MULTI_C
+| | | | | +--->BN_MP_SET_C
+| | | | | +--->BN_MP_MUL_2D_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_LSHD_C
+| | | | | | | +--->BN_MP_RSHD_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_CMP_C
+| | | | | +--->BN_MP_SUB_C
+| | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_ADD_C
+| | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_EXCH_C
+| | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | +--->BN_MP_LSHD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_RSHD_C
+| | | | | +--->BN_MP_RSHD_C
+| | | | | +--->BN_MP_MUL_D_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_EXCH_C
+| | | | +--->BN_MP_ADD_C
+| | | | | +--->BN_S_MP_ADD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_CMP_MAG_C
+| | | | | +--->BN_S_MP_SUB_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_SET_C
+| | | +--->BN_MP_ZERO_C
+| | +--->BN_MP_MOD_C
+| | | +--->BN_MP_DIV_C
+| | | | +--->BN_MP_CMP_MAG_C
+| | | | +--->BN_MP_COPY_C
+| | | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_ZERO_C
+| | | | +--->BN_MP_INIT_MULTI_C
+| | | | +--->BN_MP_MUL_2D_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_LSHD_C
+| | | | | | +--->BN_MP_RSHD_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_CMP_C
+| | | | +--->BN_MP_SUB_C
+| | | | | +--->BN_S_MP_ADD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_S_MP_SUB_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_ADD_C
+| | | | | +--->BN_S_MP_ADD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_S_MP_SUB_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_EXCH_C
+| | | | +--->BN_MP_INIT_SIZE_C
+| | | | +--->BN_MP_LSHD_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_RSHD_C
+| | | | +--->BN_MP_RSHD_C
+| | | | +--->BN_MP_MUL_D_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_EXCH_C
+| | | +--->BN_MP_ADD_C
+| | | | +--->BN_S_MP_ADD_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_CMP_MAG_C
+| | | | +--->BN_S_MP_SUB_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_COPY_C
+| | | +--->BN_MP_GROW_C
+| | +--->BN_MP_SQR_C
+| | | +--->BN_MP_TOOM_SQR_C
+| | | | +--->BN_MP_INIT_MULTI_C
+| | | | +--->BN_MP_MOD_2D_C
+| | | | | +--->BN_MP_ZERO_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_RSHD_C
+| | | | | +--->BN_MP_ZERO_C
+| | | | +--->BN_MP_MUL_2_C
+| | | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_ADD_C
+| | | | | +--->BN_S_MP_ADD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_CMP_MAG_C
+| | | | | +--->BN_S_MP_SUB_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_SUB_C
+| | | | | +--->BN_S_MP_ADD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_CMP_MAG_C
+| | | | | +--->BN_S_MP_SUB_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_DIV_2_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_MUL_2D_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_LSHD_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_MUL_D_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_DIV_3_C
+| | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_EXCH_C
+| | | | +--->BN_MP_LSHD_C
+| | | | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_KARATSUBA_SQR_C
+| | | | +--->BN_MP_INIT_SIZE_C
+| | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_S_MP_ADD_C
+| | | | | +--->BN_MP_GROW_C
+| | | | +--->BN_S_MP_SUB_C
+| | | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_LSHD_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_RSHD_C
+| | | | | | +--->BN_MP_ZERO_C
+| | | | +--->BN_MP_ADD_C
+| | | | | +--->BN_MP_CMP_MAG_C
+| | | +--->BN_FAST_S_MP_SQR_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_S_MP_SQR_C
+| | | | +--->BN_MP_INIT_SIZE_C
+| | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_EXCH_C
+| | +--->BN_MP_MUL_C
+| | | +--->BN_MP_TOOM_MUL_C
+| | | | +--->BN_MP_INIT_MULTI_C
+| | | | +--->BN_MP_MOD_2D_C
+| | | | | +--->BN_MP_ZERO_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_RSHD_C
+| | | | | +--->BN_MP_ZERO_C
+| | | | +--->BN_MP_MUL_2_C
+| | | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_ADD_C
+| | | | | +--->BN_S_MP_ADD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_CMP_MAG_C
+| | | | | +--->BN_S_MP_SUB_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_SUB_C
+| | | | | +--->BN_S_MP_ADD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_CMP_MAG_C
+| | | | | +--->BN_S_MP_SUB_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_DIV_2_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_MUL_2D_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_LSHD_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_MUL_D_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_DIV_3_C
+| | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_EXCH_C
+| | | | +--->BN_MP_LSHD_C
+| | | | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_KARATSUBA_MUL_C
+| | | | +--->BN_MP_INIT_SIZE_C
+| | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_S_MP_ADD_C
+| | | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_ADD_C
+| | | | | +--->BN_MP_CMP_MAG_C
+| | | | | +--->BN_S_MP_SUB_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | +--->BN_S_MP_SUB_C
+| | | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_LSHD_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_RSHD_C
+| | | | | | +--->BN_MP_ZERO_C
+| | | +--->BN_FAST_S_MP_MUL_DIGS_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_S_MP_MUL_DIGS_C
+| | | | +--->BN_MP_INIT_SIZE_C
+| | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_EXCH_C
+| | +--->BN_MP_EXCH_C
++--->BN_MP_CMP_C
+| +--->BN_MP_CMP_MAG_C
++--->BN_MP_SQRMOD_C
+| +--->BN_MP_SQR_C
+| | +--->BN_MP_TOOM_SQR_C
+| | | +--->BN_MP_INIT_MULTI_C
+| | | | +--->BN_MP_CLEAR_C
+| | | +--->BN_MP_MOD_2D_C
+| | | | +--->BN_MP_ZERO_C
+| | | | +--->BN_MP_COPY_C
+| | | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_COPY_C
+| | | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_RSHD_C
+| | | | +--->BN_MP_ZERO_C
+| | | +--->BN_MP_MUL_2_C
+| | | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_ADD_C
+| | | | +--->BN_S_MP_ADD_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_CMP_MAG_C
+| | | | +--->BN_S_MP_SUB_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_SUB_C
+| | | | +--->BN_S_MP_ADD_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_CMP_MAG_C
+| | | | +--->BN_S_MP_SUB_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_DIV_2_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_MUL_2D_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_LSHD_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_MUL_D_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_DIV_3_C
+| | | | +--->BN_MP_INIT_SIZE_C
+| | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_EXCH_C
+| | | | +--->BN_MP_CLEAR_C
+| | | +--->BN_MP_LSHD_C
+| | | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLEAR_MULTI_C
+| | | | +--->BN_MP_CLEAR_C
+| | +--->BN_MP_KARATSUBA_SQR_C
+| | | +--->BN_MP_INIT_SIZE_C
+| | | +--->BN_MP_CLAMP_C
+| | | +--->BN_S_MP_ADD_C
+| | | | +--->BN_MP_GROW_C
+| | | +--->BN_S_MP_SUB_C
+| | | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_LSHD_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_RSHD_C
+| | | | | +--->BN_MP_ZERO_C
+| | | +--->BN_MP_ADD_C
+| | | | +--->BN_MP_CMP_MAG_C
+| | | +--->BN_MP_CLEAR_C
+| | +--->BN_FAST_S_MP_SQR_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_S_MP_SQR_C
+| | | +--->BN_MP_INIT_SIZE_C
+| | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_EXCH_C
+| | | +--->BN_MP_CLEAR_C
+| +--->BN_MP_CLEAR_C
+| +--->BN_MP_MOD_C
+| | +--->BN_MP_DIV_C
+| | | +--->BN_MP_CMP_MAG_C
+| | | +--->BN_MP_COPY_C
+| | | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_ZERO_C
+| | | +--->BN_MP_INIT_MULTI_C
+| | | +--->BN_MP_SET_C
+| | | +--->BN_MP_COUNT_BITS_C
+| | | +--->BN_MP_ABS_C
+| | | +--->BN_MP_MUL_2D_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_LSHD_C
+| | | | | +--->BN_MP_RSHD_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_SUB_C
+| | | | +--->BN_S_MP_ADD_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_S_MP_SUB_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_ADD_C
+| | | | +--->BN_S_MP_ADD_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_S_MP_SUB_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_EXCH_C
+| | | +--->BN_MP_CLEAR_MULTI_C
+| | | +--->BN_MP_INIT_SIZE_C
+| | | +--->BN_MP_LSHD_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_RSHD_C
+| | | +--->BN_MP_RSHD_C
+| | | +--->BN_MP_MUL_D_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_EXCH_C
+| | +--->BN_MP_ADD_C
+| | | +--->BN_S_MP_ADD_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_CMP_MAG_C
+| | | +--->BN_S_MP_SUB_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
++--->BN_MP_CLEAR_C
+
+
+BN_MP_READ_UNSIGNED_BIN_C
++--->BN_MP_GROW_C
++--->BN_MP_ZERO_C
++--->BN_MP_MUL_2D_C
+| +--->BN_MP_COPY_C
+| +--->BN_MP_LSHD_C
+| | +--->BN_MP_RSHD_C
+| +--->BN_MP_CLAMP_C
++--->BN_MP_CLAMP_C
+
+
+BN_MP_N_ROOT_C
++--->BN_MP_N_ROOT_EX_C
+| +--->BN_MP_INIT_C
+| +--->BN_MP_SET_C
+| | +--->BN_MP_ZERO_C
+| +--->BN_MP_COPY_C
+| | +--->BN_MP_GROW_C
+| +--->BN_MP_EXPT_D_EX_C
+| | +--->BN_MP_INIT_COPY_C
+| | | +--->BN_MP_INIT_SIZE_C
+| | +--->BN_MP_MUL_C
+| | | +--->BN_MP_TOOM_MUL_C
+| | | | +--->BN_MP_INIT_MULTI_C
+| | | | | +--->BN_MP_CLEAR_C
+| | | | +--->BN_MP_MOD_2D_C
+| | | | | +--->BN_MP_ZERO_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_RSHD_C
+| | | | | +--->BN_MP_ZERO_C
+| | | | +--->BN_MP_MUL_2_C
+| | | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_ADD_C
+| | | | | +--->BN_S_MP_ADD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_CMP_MAG_C
+| | | | | +--->BN_S_MP_SUB_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_SUB_C
+| | | | | +--->BN_S_MP_ADD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_CMP_MAG_C
+| | | | | +--->BN_S_MP_SUB_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_DIV_2_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_MUL_2D_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_LSHD_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_MUL_D_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_DIV_3_C
+| | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_EXCH_C
+| | | | | +--->BN_MP_CLEAR_C
+| | | | +--->BN_MP_LSHD_C
+| | | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLEAR_MULTI_C
+| | | | | +--->BN_MP_CLEAR_C
+| | | +--->BN_MP_KARATSUBA_MUL_C
+| | | | +--->BN_MP_INIT_SIZE_C
+| | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_S_MP_ADD_C
+| | | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_ADD_C
+| | | | | +--->BN_MP_CMP_MAG_C
+| | | | | +--->BN_S_MP_SUB_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | +--->BN_S_MP_SUB_C
+| | | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_LSHD_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_RSHD_C
+| | | | | | +--->BN_MP_ZERO_C
+| | | | +--->BN_MP_CLEAR_C
+| | | +--->BN_FAST_S_MP_MUL_DIGS_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_S_MP_MUL_DIGS_C
+| | | | +--->BN_MP_INIT_SIZE_C
+| | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_EXCH_C
+| | | | +--->BN_MP_CLEAR_C
+| | +--->BN_MP_CLEAR_C
+| | +--->BN_MP_SQR_C
+| | | +--->BN_MP_TOOM_SQR_C
+| | | | +--->BN_MP_INIT_MULTI_C
+| | | | +--->BN_MP_MOD_2D_C
+| | | | | +--->BN_MP_ZERO_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_RSHD_C
+| | | | | +--->BN_MP_ZERO_C
+| | | | +--->BN_MP_MUL_2_C
+| | | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_ADD_C
+| | | | | +--->BN_S_MP_ADD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_CMP_MAG_C
+| | | | | +--->BN_S_MP_SUB_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_SUB_C
+| | | | | +--->BN_S_MP_ADD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_CMP_MAG_C
+| | | | | +--->BN_S_MP_SUB_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_DIV_2_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_MUL_2D_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_LSHD_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_MUL_D_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_DIV_3_C
+| | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_EXCH_C
+| | | | +--->BN_MP_LSHD_C
+| | | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLEAR_MULTI_C
+| | | +--->BN_MP_KARATSUBA_SQR_C
+| | | | +--->BN_MP_INIT_SIZE_C
+| | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_S_MP_ADD_C
+| | | | | +--->BN_MP_GROW_C
+| | | | +--->BN_S_MP_SUB_C
+| | | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_LSHD_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_RSHD_C
+| | | | | | +--->BN_MP_ZERO_C
+| | | | +--->BN_MP_ADD_C
+| | | | | +--->BN_MP_CMP_MAG_C
+| | | +--->BN_FAST_S_MP_SQR_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_S_MP_SQR_C
+| | | | +--->BN_MP_INIT_SIZE_C
+| | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_EXCH_C
+| +--->BN_MP_MUL_C
+| | +--->BN_MP_TOOM_MUL_C
+| | | +--->BN_MP_INIT_MULTI_C
+| | | | +--->BN_MP_CLEAR_C
+| | | +--->BN_MP_MOD_2D_C
+| | | | +--->BN_MP_ZERO_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_RSHD_C
+| | | | +--->BN_MP_ZERO_C
+| | | +--->BN_MP_MUL_2_C
+| | | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_ADD_C
+| | | | +--->BN_S_MP_ADD_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_CMP_MAG_C
+| | | | +--->BN_S_MP_SUB_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_SUB_C
+| | | | +--->BN_S_MP_ADD_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_CMP_MAG_C
+| | | | +--->BN_S_MP_SUB_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_DIV_2_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_MUL_2D_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_LSHD_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_MUL_D_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_DIV_3_C
+| | | | +--->BN_MP_INIT_SIZE_C
+| | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_EXCH_C
+| | | | +--->BN_MP_CLEAR_C
+| | | +--->BN_MP_LSHD_C
+| | | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLEAR_MULTI_C
+| | | | +--->BN_MP_CLEAR_C
+| | +--->BN_MP_KARATSUBA_MUL_C
+| | | +--->BN_MP_INIT_SIZE_C
+| | | +--->BN_MP_CLAMP_C
+| | | +--->BN_S_MP_ADD_C
+| | | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_ADD_C
+| | | | +--->BN_MP_CMP_MAG_C
+| | | | +--->BN_S_MP_SUB_C
+| | | | | +--->BN_MP_GROW_C
+| | | +--->BN_S_MP_SUB_C
+| | | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_LSHD_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_RSHD_C
+| | | | | +--->BN_MP_ZERO_C
+| | | +--->BN_MP_CLEAR_C
+| | +--->BN_FAST_S_MP_MUL_DIGS_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_S_MP_MUL_DIGS_C
+| | | +--->BN_MP_INIT_SIZE_C
+| | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_EXCH_C
+| | | +--->BN_MP_CLEAR_C
+| +--->BN_MP_SUB_C
+| | +--->BN_S_MP_ADD_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_CMP_MAG_C
+| | +--->BN_S_MP_SUB_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLAMP_C
+| +--->BN_MP_MUL_D_C
+| | +--->BN_MP_GROW_C
+| | +--->BN_MP_CLAMP_C
+| +--->BN_MP_DIV_C
+| | +--->BN_MP_CMP_MAG_C
+| | +--->BN_MP_ZERO_C
+| | +--->BN_MP_INIT_MULTI_C
+| | | +--->BN_MP_CLEAR_C
+| | +--->BN_MP_COUNT_BITS_C
+| | +--->BN_MP_ABS_C
+| | +--->BN_MP_MUL_2D_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_LSHD_C
+| | | | +--->BN_MP_RSHD_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_CMP_C
+| | +--->BN_MP_ADD_C
+| | | +--->BN_S_MP_ADD_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_S_MP_SUB_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_DIV_2D_C
+| | | +--->BN_MP_MOD_2D_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_CLEAR_C
+| | | +--->BN_MP_RSHD_C
+| | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_EXCH_C
+| | +--->BN_MP_EXCH_C
+| | +--->BN_MP_CLEAR_MULTI_C
+| | | +--->BN_MP_CLEAR_C
+| | +--->BN_MP_INIT_SIZE_C
+| | +--->BN_MP_INIT_COPY_C
+| | +--->BN_MP_LSHD_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_RSHD_C
+| | +--->BN_MP_RSHD_C
+| | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_CLEAR_C
+| +--->BN_MP_CMP_C
+| | +--->BN_MP_CMP_MAG_C
+| +--->BN_MP_SUB_D_C
+| | +--->BN_MP_GROW_C
+| | +--->BN_MP_ADD_D_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_CLAMP_C
+| +--->BN_MP_EXCH_C
+| +--->BN_MP_CLEAR_C
+
+
+BN_MP_EXPT_D_EX_C
++--->BN_MP_INIT_COPY_C
+| +--->BN_MP_INIT_SIZE_C
+| +--->BN_MP_COPY_C
+| | +--->BN_MP_GROW_C
++--->BN_MP_SET_C
+| +--->BN_MP_ZERO_C
++--->BN_MP_MUL_C
+| +--->BN_MP_TOOM_MUL_C
+| | +--->BN_MP_INIT_MULTI_C
+| | | +--->BN_MP_CLEAR_C
+| | +--->BN_MP_MOD_2D_C
+| | | +--->BN_MP_ZERO_C
+| | | +--->BN_MP_COPY_C
+| | | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_COPY_C
+| | | +--->BN_MP_GROW_C
+| | +--->BN_MP_RSHD_C
+| | | +--->BN_MP_ZERO_C
+| | +--->BN_MP_MUL_2_C
+| | | +--->BN_MP_GROW_C
+| | +--->BN_MP_ADD_C
+| | | +--->BN_S_MP_ADD_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_CMP_MAG_C
+| | | +--->BN_S_MP_SUB_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_SUB_C
+| | | +--->BN_S_MP_ADD_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_CMP_MAG_C
+| | | +--->BN_S_MP_SUB_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_DIV_2_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_MUL_2D_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_LSHD_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_MUL_D_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_DIV_3_C
+| | | +--->BN_MP_INIT_SIZE_C
+| | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_EXCH_C
+| | | +--->BN_MP_CLEAR_C
+| | +--->BN_MP_LSHD_C
+| | | +--->BN_MP_GROW_C
+| | +--->BN_MP_CLEAR_MULTI_C
+| | | +--->BN_MP_CLEAR_C
+| +--->BN_MP_KARATSUBA_MUL_C
+| | +--->BN_MP_INIT_SIZE_C
+| | +--->BN_MP_CLAMP_C
+| | +--->BN_S_MP_ADD_C
+| | | +--->BN_MP_GROW_C
+| | +--->BN_MP_ADD_C
+| | | +--->BN_MP_CMP_MAG_C
+| | | +--->BN_S_MP_SUB_C
+| | | | +--->BN_MP_GROW_C
+| | +--->BN_S_MP_SUB_C
+| | | +--->BN_MP_GROW_C
+| | +--->BN_MP_LSHD_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_RSHD_C
+| | | | +--->BN_MP_ZERO_C
+| | +--->BN_MP_CLEAR_C
+| +--->BN_FAST_S_MP_MUL_DIGS_C
+| | +--->BN_MP_GROW_C
+| | +--->BN_MP_CLAMP_C
+| +--->BN_S_MP_MUL_DIGS_C
+| | +--->BN_MP_INIT_SIZE_C
+| | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_EXCH_C
+| | +--->BN_MP_CLEAR_C
++--->BN_MP_CLEAR_C
++--->BN_MP_SQR_C
+| +--->BN_MP_TOOM_SQR_C
+| | +--->BN_MP_INIT_MULTI_C
+| | +--->BN_MP_MOD_2D_C
+| | | +--->BN_MP_ZERO_C
+| | | +--->BN_MP_COPY_C
+| | | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_COPY_C
+| | | +--->BN_MP_GROW_C
+| | +--->BN_MP_RSHD_C
+| | | +--->BN_MP_ZERO_C
+| | +--->BN_MP_MUL_2_C
+| | | +--->BN_MP_GROW_C
+| | +--->BN_MP_ADD_C
+| | | +--->BN_S_MP_ADD_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_CMP_MAG_C
+| | | +--->BN_S_MP_SUB_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_SUB_C
+| | | +--->BN_S_MP_ADD_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_CMP_MAG_C
+| | | +--->BN_S_MP_SUB_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_DIV_2_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_MUL_2D_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_LSHD_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_MUL_D_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_DIV_3_C
+| | | +--->BN_MP_INIT_SIZE_C
+| | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_EXCH_C
+| | +--->BN_MP_LSHD_C
+| | | +--->BN_MP_GROW_C
+| | +--->BN_MP_CLEAR_MULTI_C
+| +--->BN_MP_KARATSUBA_SQR_C
+| | +--->BN_MP_INIT_SIZE_C
+| | +--->BN_MP_CLAMP_C
+| | +--->BN_S_MP_ADD_C
+| | | +--->BN_MP_GROW_C
+| | +--->BN_S_MP_SUB_C
+| | | +--->BN_MP_GROW_C
+| | +--->BN_MP_LSHD_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_RSHD_C
+| | | | +--->BN_MP_ZERO_C
+| | +--->BN_MP_ADD_C
+| | | +--->BN_MP_CMP_MAG_C
+| +--->BN_FAST_S_MP_SQR_C
+| | +--->BN_MP_GROW_C
+| | +--->BN_MP_CLAMP_C
+| +--->BN_S_MP_SQR_C
+| | +--->BN_MP_INIT_SIZE_C
+| | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_EXCH_C
+
+
+BN_MP_EXPT_D_C
++--->BN_MP_EXPT_D_EX_C
+| +--->BN_MP_INIT_COPY_C
+| | +--->BN_MP_INIT_SIZE_C
+| | +--->BN_MP_COPY_C
+| | | +--->BN_MP_GROW_C
+| +--->BN_MP_SET_C
+| | +--->BN_MP_ZERO_C
+| +--->BN_MP_MUL_C
+| | +--->BN_MP_TOOM_MUL_C
+| | | +--->BN_MP_INIT_MULTI_C
+| | | | +--->BN_MP_CLEAR_C
+| | | +--->BN_MP_MOD_2D_C
+| | | | +--->BN_MP_ZERO_C
+| | | | +--->BN_MP_COPY_C
+| | | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_COPY_C
+| | | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_RSHD_C
+| | | | +--->BN_MP_ZERO_C
+| | | +--->BN_MP_MUL_2_C
+| | | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_ADD_C
+| | | | +--->BN_S_MP_ADD_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_CMP_MAG_C
+| | | | +--->BN_S_MP_SUB_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_SUB_C
+| | | | +--->BN_S_MP_ADD_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_CMP_MAG_C
+| | | | +--->BN_S_MP_SUB_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_DIV_2_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_MUL_2D_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_LSHD_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_MUL_D_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_DIV_3_C
+| | | | +--->BN_MP_INIT_SIZE_C
+| | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_EXCH_C
+| | | | +--->BN_MP_CLEAR_C
+| | | +--->BN_MP_LSHD_C
+| | | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLEAR_MULTI_C
+| | | | +--->BN_MP_CLEAR_C
+| | +--->BN_MP_KARATSUBA_MUL_C
+| | | +--->BN_MP_INIT_SIZE_C
+| | | +--->BN_MP_CLAMP_C
+| | | +--->BN_S_MP_ADD_C
+| | | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_ADD_C
+| | | | +--->BN_MP_CMP_MAG_C
+| | | | +--->BN_S_MP_SUB_C
+| | | | | +--->BN_MP_GROW_C
+| | | +--->BN_S_MP_SUB_C
+| | | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_LSHD_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_RSHD_C
+| | | | | +--->BN_MP_ZERO_C
+| | | +--->BN_MP_CLEAR_C
+| | +--->BN_FAST_S_MP_MUL_DIGS_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_S_MP_MUL_DIGS_C
+| | | +--->BN_MP_INIT_SIZE_C
+| | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_EXCH_C
+| | | +--->BN_MP_CLEAR_C
+| +--->BN_MP_CLEAR_C
+| +--->BN_MP_SQR_C
+| | +--->BN_MP_TOOM_SQR_C
+| | | +--->BN_MP_INIT_MULTI_C
+| | | +--->BN_MP_MOD_2D_C
+| | | | +--->BN_MP_ZERO_C
+| | | | +--->BN_MP_COPY_C
+| | | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_COPY_C
+| | | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_RSHD_C
+| | | | +--->BN_MP_ZERO_C
+| | | +--->BN_MP_MUL_2_C
+| | | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_ADD_C
+| | | | +--->BN_S_MP_ADD_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_CMP_MAG_C
+| | | | +--->BN_S_MP_SUB_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_SUB_C
+| | | | +--->BN_S_MP_ADD_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_CMP_MAG_C
+| | | | +--->BN_S_MP_SUB_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_DIV_2_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_MUL_2D_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_LSHD_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_MUL_D_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_DIV_3_C
+| | | | +--->BN_MP_INIT_SIZE_C
+| | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_EXCH_C
+| | | +--->BN_MP_LSHD_C
+| | | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLEAR_MULTI_C
+| | +--->BN_MP_KARATSUBA_SQR_C
+| | | +--->BN_MP_INIT_SIZE_C
+| | | +--->BN_MP_CLAMP_C
+| | | +--->BN_S_MP_ADD_C
+| | | | +--->BN_MP_GROW_C
+| | | +--->BN_S_MP_SUB_C
+| | | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_LSHD_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_RSHD_C
+| | | | | +--->BN_MP_ZERO_C
+| | | +--->BN_MP_ADD_C
+| | | | +--->BN_MP_CMP_MAG_C
+| | +--->BN_FAST_S_MP_SQR_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_S_MP_SQR_C
+| | | +--->BN_MP_INIT_SIZE_C
+| | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_EXCH_C
+
+
+BN_MP_XOR_C
++--->BN_MP_INIT_COPY_C
+| +--->BN_MP_INIT_SIZE_C
+| +--->BN_MP_COPY_C
+| | +--->BN_MP_GROW_C
++--->BN_MP_CLAMP_C
++--->BN_MP_EXCH_C
++--->BN_MP_CLEAR_C
+
+
+BN_MP_REDUCE_SETUP_C
++--->BN_MP_2EXPT_C
+| +--->BN_MP_ZERO_C
+| +--->BN_MP_GROW_C
++--->BN_MP_DIV_C
+| +--->BN_MP_CMP_MAG_C
+| +--->BN_MP_COPY_C
+| | +--->BN_MP_GROW_C
+| +--->BN_MP_ZERO_C
+| +--->BN_MP_INIT_MULTI_C
+| | +--->BN_MP_INIT_C
+| | +--->BN_MP_CLEAR_C
+| +--->BN_MP_SET_C
+| +--->BN_MP_COUNT_BITS_C
+| +--->BN_MP_ABS_C
+| +--->BN_MP_MUL_2D_C
+| | +--->BN_MP_GROW_C
+| | +--->BN_MP_LSHD_C
+| | | +--->BN_MP_RSHD_C
+| | +--->BN_MP_CLAMP_C
+| +--->BN_MP_CMP_C
+| +--->BN_MP_SUB_C
+| | +--->BN_S_MP_ADD_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_S_MP_SUB_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLAMP_C
+| +--->BN_MP_ADD_C
+| | +--->BN_S_MP_ADD_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_S_MP_SUB_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLAMP_C
+| +--->BN_MP_DIV_2D_C
+| | +--->BN_MP_INIT_C
+| | +--->BN_MP_MOD_2D_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_CLEAR_C
+| | +--->BN_MP_RSHD_C
+| | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_EXCH_C
+| +--->BN_MP_EXCH_C
+| +--->BN_MP_CLEAR_MULTI_C
+| | +--->BN_MP_CLEAR_C
+| +--->BN_MP_INIT_SIZE_C
+| | +--->BN_MP_INIT_C
+| +--->BN_MP_INIT_C
+| +--->BN_MP_INIT_COPY_C
+| +--->BN_MP_LSHD_C
+| | +--->BN_MP_GROW_C
+| | +--->BN_MP_RSHD_C
+| +--->BN_MP_RSHD_C
+| +--->BN_MP_MUL_D_C
+| | +--->BN_MP_GROW_C
+| | +--->BN_MP_CLAMP_C
+| +--->BN_MP_CLAMP_C
+| +--->BN_MP_CLEAR_C
+
+
+BN_MP_RSHD_C
++--->BN_MP_ZERO_C
+
+
+BN_MP_NEG_C
++--->BN_MP_COPY_C
+| +--->BN_MP_GROW_C
+
+
+BN_MP_SHRINK_C
+
+
+BN_MP_PRIME_RANDOM_EX_C
++--->BN_MP_READ_UNSIGNED_BIN_C
+| +--->BN_MP_GROW_C
+| +--->BN_MP_ZERO_C
+| +--->BN_MP_MUL_2D_C
+| | +--->BN_MP_COPY_C
+| | +--->BN_MP_LSHD_C
+| | | +--->BN_MP_RSHD_C
+| | +--->BN_MP_CLAMP_C
+| +--->BN_MP_CLAMP_C
++--->BN_MP_PRIME_IS_PRIME_C
+| +--->BN_MP_CMP_D_C
+| +--->BN_MP_PRIME_IS_DIVISIBLE_C
+| | +--->BN_MP_MOD_D_C
+| | | +--->BN_MP_DIV_D_C
+| | | | +--->BN_MP_COPY_C
+| | | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_DIV_2D_C
+| | | | | +--->BN_MP_ZERO_C
+| | | | | +--->BN_MP_INIT_C
+| | | | | +--->BN_MP_MOD_2D_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_CLEAR_C
+| | | | | +--->BN_MP_RSHD_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_EXCH_C
+| | | | +--->BN_MP_DIV_3_C
+| | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | | +--->BN_MP_INIT_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_EXCH_C
+| | | | | +--->BN_MP_CLEAR_C
+| | | | +--->BN_MP_INIT_SIZE_C
+| | | | | +--->BN_MP_INIT_C
+| | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_EXCH_C
+| | | | +--->BN_MP_CLEAR_C
+| +--->BN_MP_INIT_C
+| +--->BN_MP_SET_C
+| | +--->BN_MP_ZERO_C
+| +--->BN_MP_PRIME_MILLER_RABIN_C
+| | +--->BN_MP_INIT_COPY_C
+| | | +--->BN_MP_INIT_SIZE_C
+| | | +--->BN_MP_COPY_C
+| | | | +--->BN_MP_GROW_C
+| | +--->BN_MP_SUB_D_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_ADD_D_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_CNT_LSB_C
+| | +--->BN_MP_DIV_2D_C
+| | | +--->BN_MP_COPY_C
+| | | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_ZERO_C
+| | | +--->BN_MP_MOD_2D_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_CLEAR_C
+| | | +--->BN_MP_RSHD_C
+| | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_EXCH_C
+| | +--->BN_MP_EXPTMOD_C
+| | | +--->BN_MP_INVMOD_C
+| | | | +--->BN_FAST_MP_INVMOD_C
+| | | | | +--->BN_MP_INIT_MULTI_C
+| | | | | | +--->BN_MP_CLEAR_C
+| | | | | +--->BN_MP_COPY_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_MOD_C
+| | | | | | +--->BN_MP_DIV_C
+| | | | | | | +--->BN_MP_CMP_MAG_C
+| | | | | | | +--->BN_MP_ZERO_C
+| | | | | | | +--->BN_MP_COUNT_BITS_C
+| | | | | | | +--->BN_MP_ABS_C
+| | | | | | | +--->BN_MP_MUL_2D_C
+| | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | | +--->BN_MP_LSHD_C
+| | | | | | | | | +--->BN_MP_RSHD_C
+| | | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | | +--->BN_MP_CMP_C
+| | | | | | | +--->BN_MP_SUB_C
+| | | | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | | +--->BN_MP_ADD_C
+| | | | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | | +--->BN_MP_EXCH_C
+| | | | | | | +--->BN_MP_CLEAR_MULTI_C
+| | | | | | | | +--->BN_MP_CLEAR_C
+| | | | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | | | +--->BN_MP_LSHD_C
+| | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | | +--->BN_MP_RSHD_C
+| | | | | | | +--->BN_MP_RSHD_C
+| | | | | | | +--->BN_MP_MUL_D_C
+| | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | | +--->BN_MP_CLEAR_C
+| | | | | | +--->BN_MP_CLEAR_C
+| | | | | | +--->BN_MP_EXCH_C
+| | | | | | +--->BN_MP_ADD_C
+| | | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | | +--->BN_MP_CMP_MAG_C
+| | | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_DIV_2_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_SUB_C
+| | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_CMP_MAG_C
+| | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_CMP_C
+| | | | | | +--->BN_MP_CMP_MAG_C
+| | | | | +--->BN_MP_ADD_C
+| | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_CMP_MAG_C
+| | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_EXCH_C
+| | | | | +--->BN_MP_CLEAR_MULTI_C
+| | | | | | +--->BN_MP_CLEAR_C
+| | | | +--->BN_MP_INVMOD_SLOW_C
+| | | | | +--->BN_MP_INIT_MULTI_C
+| | | | | | +--->BN_MP_CLEAR_C
+| | | | | +--->BN_MP_MOD_C
+| | | | | | +--->BN_MP_DIV_C
+| | | | | | | +--->BN_MP_CMP_MAG_C
+| | | | | | | +--->BN_MP_COPY_C
+| | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_ZERO_C
+| | | | | | | +--->BN_MP_COUNT_BITS_C
+| | | | | | | +--->BN_MP_ABS_C
+| | | | | | | +--->BN_MP_MUL_2D_C
+| | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | | +--->BN_MP_LSHD_C
+| | | | | | | | | +--->BN_MP_RSHD_C
+| | | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | | +--->BN_MP_CMP_C
+| | | | | | | +--->BN_MP_SUB_C
+| | | | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | | +--->BN_MP_ADD_C
+| | | | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | | +--->BN_MP_EXCH_C
+| | | | | | | +--->BN_MP_CLEAR_MULTI_C
+| | | | | | | | +--->BN_MP_CLEAR_C
+| | | | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | | | +--->BN_MP_LSHD_C
+| | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | | +--->BN_MP_RSHD_C
+| | | | | | | +--->BN_MP_RSHD_C
+| | | | | | | +--->BN_MP_MUL_D_C
+| | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | | +--->BN_MP_CLEAR_C
+| | | | | | +--->BN_MP_CLEAR_C
+| | | | | | +--->BN_MP_EXCH_C
+| | | | | | +--->BN_MP_ADD_C
+| | | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | | +--->BN_MP_CMP_MAG_C
+| | | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_COPY_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_DIV_2_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_ADD_C
+| | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_CMP_MAG_C
+| | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_SUB_C
+| | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_CMP_MAG_C
+| | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_CMP_C
+| | | | | | +--->BN_MP_CMP_MAG_C
+| | | | | +--->BN_MP_CMP_MAG_C
+| | | | | +--->BN_MP_EXCH_C
+| | | | | +--->BN_MP_CLEAR_MULTI_C
+| | | | | | +--->BN_MP_CLEAR_C
+| | | +--->BN_MP_CLEAR_C
+| | | +--->BN_MP_ABS_C
+| | | | +--->BN_MP_COPY_C
+| | | | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLEAR_MULTI_C
+| | | +--->BN_MP_REDUCE_IS_2K_L_C
+| | | +--->BN_S_MP_EXPTMOD_C
+| | | | +--->BN_MP_COUNT_BITS_C
+| | | | +--->BN_MP_REDUCE_SETUP_C
+| | | | | +--->BN_MP_2EXPT_C
+| | | | | | +--->BN_MP_ZERO_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_DIV_C
+| | | | | | +--->BN_MP_CMP_MAG_C
+| | | | | | +--->BN_MP_COPY_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_ZERO_C
+| | | | | | +--->BN_MP_INIT_MULTI_C
+| | | | | | +--->BN_MP_MUL_2D_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_LSHD_C
+| | | | | | | | +--->BN_MP_RSHD_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_CMP_C
+| | | | | | +--->BN_MP_SUB_C
+| | | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_ADD_C
+| | | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_EXCH_C
+| | | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | | +--->BN_MP_LSHD_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_RSHD_C
+| | | | | | +--->BN_MP_RSHD_C
+| | | | | | +--->BN_MP_MUL_D_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_REDUCE_C
+| | | | | +--->BN_MP_RSHD_C
+| | | | | | +--->BN_MP_ZERO_C
+| | | | | +--->BN_MP_MUL_C
+| | | | | | +--->BN_MP_TOOM_MUL_C
+| | | | | | | +--->BN_MP_INIT_MULTI_C
+| | | | | | | +--->BN_MP_MOD_2D_C
+| | | | | | | | +--->BN_MP_ZERO_C
+| | | | | | | | +--->BN_MP_COPY_C
+| | | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | | +--->BN_MP_COPY_C
+| | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_MUL_2_C
+| | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_ADD_C
+| | | | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | | | +--->BN_MP_CMP_MAG_C
+| | | | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | | +--->BN_MP_SUB_C
+| | | | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | | | +--->BN_MP_CMP_MAG_C
+| | | | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | | +--->BN_MP_DIV_2_C
+| | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | | +--->BN_MP_MUL_2D_C
+| | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | | +--->BN_MP_LSHD_C
+| | | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | | +--->BN_MP_MUL_D_C
+| | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | | +--->BN_MP_DIV_3_C
+| | | | | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | | | +--->BN_MP_EXCH_C
+| | | | | | | +--->BN_MP_LSHD_C
+| | | | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_KARATSUBA_MUL_C
+| | | | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_ADD_C
+| | | | | | | | +--->BN_MP_CMP_MAG_C
+| | | | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_LSHD_C
+| | | | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_FAST_S_MP_MUL_DIGS_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_S_MP_MUL_DIGS_C
+| | | | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | | +--->BN_MP_EXCH_C
+| | | | | +--->BN_S_MP_MUL_HIGH_DIGS_C
+| | | | | | +--->BN_FAST_S_MP_MUL_HIGH_DIGS_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_EXCH_C
+| | | | | +--->BN_FAST_S_MP_MUL_HIGH_DIGS_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_MOD_2D_C
+| | | | | | +--->BN_MP_ZERO_C
+| | | | | | +--->BN_MP_COPY_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_S_MP_MUL_DIGS_C
+| | | | | | +--->BN_FAST_S_MP_MUL_DIGS_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_EXCH_C
+| | | | | +--->BN_MP_SUB_C
+| | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_CMP_MAG_C
+| | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_LSHD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_ADD_C
+| | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_CMP_MAG_C
+| | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_CMP_C
+| | | | | | +--->BN_MP_CMP_MAG_C
+| | | | | +--->BN_S_MP_SUB_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_REDUCE_2K_SETUP_L_C
+| | | | | +--->BN_MP_2EXPT_C
+| | | | | | +--->BN_MP_ZERO_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_S_MP_SUB_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_REDUCE_2K_L_C
+| | | | | +--->BN_MP_MUL_C
+| | | | | | +--->BN_MP_TOOM_MUL_C
+| | | | | | | +--->BN_MP_INIT_MULTI_C
+| | | | | | | +--->BN_MP_MOD_2D_C
+| | | | | | | | +--->BN_MP_ZERO_C
+| | | | | | | | +--->BN_MP_COPY_C
+| | | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | | +--->BN_MP_COPY_C
+| | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_RSHD_C
+| | | | | | | | +--->BN_MP_ZERO_C
+| | | | | | | +--->BN_MP_MUL_2_C
+| | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_ADD_C
+| | | | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | | | +--->BN_MP_CMP_MAG_C
+| | | | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | | +--->BN_MP_SUB_C
+| | | | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | | | +--->BN_MP_CMP_MAG_C
+| | | | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | | +--->BN_MP_DIV_2_C
+| | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | | +--->BN_MP_MUL_2D_C
+| | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | | +--->BN_MP_LSHD_C
+| | | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | | +--->BN_MP_MUL_D_C
+| | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | | +--->BN_MP_DIV_3_C
+| | | | | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | | | +--->BN_MP_EXCH_C
+| | | | | | | +--->BN_MP_LSHD_C
+| | | | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_KARATSUBA_MUL_C
+| | | | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_ADD_C
+| | | | | | | | +--->BN_MP_CMP_MAG_C
+| | | | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_LSHD_C
+| | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | | +--->BN_MP_RSHD_C
+| | | | | | | | | +--->BN_MP_ZERO_C
+| | | | | | +--->BN_FAST_S_MP_MUL_DIGS_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_S_MP_MUL_DIGS_C
+| | | | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | | +--->BN_MP_EXCH_C
+| | | | | +--->BN_S_MP_ADD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_CMP_MAG_C
+| | | | | +--->BN_S_MP_SUB_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_MOD_C
+| | | | | +--->BN_MP_DIV_C
+| | | | | | +--->BN_MP_CMP_MAG_C
+| | | | | | +--->BN_MP_COPY_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_ZERO_C
+| | | | | | +--->BN_MP_INIT_MULTI_C
+| | | | | | +--->BN_MP_MUL_2D_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_LSHD_C
+| | | | | | | | +--->BN_MP_RSHD_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_CMP_C
+| | | | | | +--->BN_MP_SUB_C
+| | | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_ADD_C
+| | | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_EXCH_C
+| | | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | | +--->BN_MP_LSHD_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_RSHD_C
+| | | | | | +--->BN_MP_RSHD_C
+| | | | | | +--->BN_MP_MUL_D_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_EXCH_C
+| | | | | +--->BN_MP_ADD_C
+| | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_CMP_MAG_C
+| | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_COPY_C
+| | | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_SQR_C
+| | | | | +--->BN_MP_TOOM_SQR_C
+| | | | | | +--->BN_MP_INIT_MULTI_C
+| | | | | | +--->BN_MP_MOD_2D_C
+| | | | | | | +--->BN_MP_ZERO_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_RSHD_C
+| | | | | | | +--->BN_MP_ZERO_C
+| | | | | | +--->BN_MP_MUL_2_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_ADD_C
+| | | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | | +--->BN_MP_CMP_MAG_C
+| | | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_SUB_C
+| | | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | | +--->BN_MP_CMP_MAG_C
+| | | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_DIV_2_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_MUL_2D_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_LSHD_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_MUL_D_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_DIV_3_C
+| | | | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | | +--->BN_MP_EXCH_C
+| | | | | | +--->BN_MP_LSHD_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_KARATSUBA_SQR_C
+| | | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_LSHD_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_RSHD_C
+| | | | | | | | +--->BN_MP_ZERO_C
+| | | | | | +--->BN_MP_ADD_C
+| | | | | | | +--->BN_MP_CMP_MAG_C
+| | | | | +--->BN_FAST_S_MP_SQR_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_S_MP_SQR_C
+| | | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_EXCH_C
+| | | | +--->BN_MP_MUL_C
+| | | | | +--->BN_MP_TOOM_MUL_C
+| | | | | | +--->BN_MP_INIT_MULTI_C
+| | | | | | +--->BN_MP_MOD_2D_C
+| | | | | | | +--->BN_MP_ZERO_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_RSHD_C
+| | | | | | | +--->BN_MP_ZERO_C
+| | | | | | +--->BN_MP_MUL_2_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_ADD_C
+| | | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | | +--->BN_MP_CMP_MAG_C
+| | | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_SUB_C
+| | | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | | +--->BN_MP_CMP_MAG_C
+| | | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_DIV_2_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_MUL_2D_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_LSHD_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_MUL_D_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_DIV_3_C
+| | | | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | | +--->BN_MP_EXCH_C
+| | | | | | +--->BN_MP_LSHD_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_KARATSUBA_MUL_C
+| | | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_ADD_C
+| | | | | | | +--->BN_MP_CMP_MAG_C
+| | | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_LSHD_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_RSHD_C
+| | | | | | | | +--->BN_MP_ZERO_C
+| | | | | +--->BN_FAST_S_MP_MUL_DIGS_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_S_MP_MUL_DIGS_C
+| | | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_EXCH_C
+| | | | +--->BN_MP_EXCH_C
+| | | +--->BN_MP_DR_IS_MODULUS_C
+| | | +--->BN_MP_REDUCE_IS_2K_C
+| | | | +--->BN_MP_REDUCE_2K_C
+| | | | | +--->BN_MP_COUNT_BITS_C
+| | | | | +--->BN_MP_MUL_D_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_S_MP_ADD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_CMP_MAG_C
+| | | | | +--->BN_S_MP_SUB_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_COUNT_BITS_C
+| | | +--->BN_MP_EXPTMOD_FAST_C
+| | | | +--->BN_MP_COUNT_BITS_C
+| | | | +--->BN_MP_MONTGOMERY_SETUP_C
+| | | | +--->BN_FAST_MP_MONTGOMERY_REDUCE_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_RSHD_C
+| | | | | | +--->BN_MP_ZERO_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_CMP_MAG_C
+| | | | | +--->BN_S_MP_SUB_C
+| | | | +--->BN_MP_MONTGOMERY_REDUCE_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_RSHD_C
+| | | | | | +--->BN_MP_ZERO_C
+| | | | | +--->BN_MP_CMP_MAG_C
+| | | | | +--->BN_S_MP_SUB_C
+| | | | +--->BN_MP_DR_SETUP_C
+| | | | +--->BN_MP_DR_REDUCE_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_CMP_MAG_C
+| | | | | +--->BN_S_MP_SUB_C
+| | | | +--->BN_MP_REDUCE_2K_SETUP_C
+| | | | | +--->BN_MP_2EXPT_C
+| | | | | | +--->BN_MP_ZERO_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_S_MP_SUB_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_REDUCE_2K_C
+| | | | | +--->BN_MP_MUL_D_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_S_MP_ADD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_CMP_MAG_C
+| | | | | +--->BN_S_MP_SUB_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_MONTGOMERY_CALC_NORMALIZATION_C
+| | | | | +--->BN_MP_2EXPT_C
+| | | | | | +--->BN_MP_ZERO_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_MUL_2_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CMP_MAG_C
+| | | | | +--->BN_S_MP_SUB_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_MULMOD_C
+| | | | | +--->BN_MP_MUL_C
+| | | | | | +--->BN_MP_TOOM_MUL_C
+| | | | | | | +--->BN_MP_INIT_MULTI_C
+| | | | | | | +--->BN_MP_MOD_2D_C
+| | | | | | | | +--->BN_MP_ZERO_C
+| | | | | | | | +--->BN_MP_COPY_C
+| | | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | | +--->BN_MP_COPY_C
+| | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_RSHD_C
+| | | | | | | | +--->BN_MP_ZERO_C
+| | | | | | | +--->BN_MP_MUL_2_C
+| | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_ADD_C
+| | | | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | | | +--->BN_MP_CMP_MAG_C
+| | | | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | | +--->BN_MP_SUB_C
+| | | | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | | | +--->BN_MP_CMP_MAG_C
+| | | | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | | +--->BN_MP_DIV_2_C
+| | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | | +--->BN_MP_MUL_2D_C
+| | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | | +--->BN_MP_LSHD_C
+| | | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | | +--->BN_MP_MUL_D_C
+| | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | | +--->BN_MP_DIV_3_C
+| | | | | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | | | +--->BN_MP_EXCH_C
+| | | | | | | +--->BN_MP_LSHD_C
+| | | | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_KARATSUBA_MUL_C
+| | | | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_ADD_C
+| | | | | | | | +--->BN_MP_CMP_MAG_C
+| | | | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_LSHD_C
+| | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | | +--->BN_MP_RSHD_C
+| | | | | | | | | +--->BN_MP_ZERO_C
+| | | | | | +--->BN_FAST_S_MP_MUL_DIGS_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_S_MP_MUL_DIGS_C
+| | | | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | | +--->BN_MP_EXCH_C
+| | | | | +--->BN_MP_MOD_C
+| | | | | | +--->BN_MP_DIV_C
+| | | | | | | +--->BN_MP_CMP_MAG_C
+| | | | | | | +--->BN_MP_COPY_C
+| | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_ZERO_C
+| | | | | | | +--->BN_MP_INIT_MULTI_C
+| | | | | | | +--->BN_MP_MUL_2D_C
+| | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | | +--->BN_MP_LSHD_C
+| | | | | | | | | +--->BN_MP_RSHD_C
+| | | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | | +--->BN_MP_CMP_C
+| | | | | | | +--->BN_MP_SUB_C
+| | | | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | | +--->BN_MP_ADD_C
+| | | | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | | +--->BN_MP_EXCH_C
+| | | | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | | | +--->BN_MP_LSHD_C
+| | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | | +--->BN_MP_RSHD_C
+| | | | | | | +--->BN_MP_RSHD_C
+| | | | | | | +--->BN_MP_MUL_D_C
+| | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_EXCH_C
+| | | | | | +--->BN_MP_ADD_C
+| | | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | | +--->BN_MP_CMP_MAG_C
+| | | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_MOD_C
+| | | | | +--->BN_MP_DIV_C
+| | | | | | +--->BN_MP_CMP_MAG_C
+| | | | | | +--->BN_MP_COPY_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_ZERO_C
+| | | | | | +--->BN_MP_INIT_MULTI_C
+| | | | | | +--->BN_MP_MUL_2D_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_LSHD_C
+| | | | | | | | +--->BN_MP_RSHD_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_CMP_C
+| | | | | | +--->BN_MP_SUB_C
+| | | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_ADD_C
+| | | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_EXCH_C
+| | | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | | +--->BN_MP_LSHD_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_RSHD_C
+| | | | | | +--->BN_MP_RSHD_C
+| | | | | | +--->BN_MP_MUL_D_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_EXCH_C
+| | | | | +--->BN_MP_ADD_C
+| | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_CMP_MAG_C
+| | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_COPY_C
+| | | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_SQR_C
+| | | | | +--->BN_MP_TOOM_SQR_C
+| | | | | | +--->BN_MP_INIT_MULTI_C
+| | | | | | +--->BN_MP_MOD_2D_C
+| | | | | | | +--->BN_MP_ZERO_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_RSHD_C
+| | | | | | | +--->BN_MP_ZERO_C
+| | | | | | +--->BN_MP_MUL_2_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_ADD_C
+| | | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | | +--->BN_MP_CMP_MAG_C
+| | | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_SUB_C
+| | | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | | +--->BN_MP_CMP_MAG_C
+| | | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_DIV_2_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_MUL_2D_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_LSHD_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_MUL_D_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_DIV_3_C
+| | | | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | | +--->BN_MP_EXCH_C
+| | | | | | +--->BN_MP_LSHD_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_KARATSUBA_SQR_C
+| | | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_LSHD_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_RSHD_C
+| | | | | | | | +--->BN_MP_ZERO_C
+| | | | | | +--->BN_MP_ADD_C
+| | | | | | | +--->BN_MP_CMP_MAG_C
+| | | | | +--->BN_FAST_S_MP_SQR_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_S_MP_SQR_C
+| | | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_EXCH_C
+| | | | +--->BN_MP_MUL_C
+| | | | | +--->BN_MP_TOOM_MUL_C
+| | | | | | +--->BN_MP_INIT_MULTI_C
+| | | | | | +--->BN_MP_MOD_2D_C
+| | | | | | | +--->BN_MP_ZERO_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_RSHD_C
+| | | | | | | +--->BN_MP_ZERO_C
+| | | | | | +--->BN_MP_MUL_2_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_ADD_C
+| | | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | | +--->BN_MP_CMP_MAG_C
+| | | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_SUB_C
+| | | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | | +--->BN_MP_CMP_MAG_C
+| | | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_DIV_2_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_MUL_2D_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_LSHD_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_MUL_D_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_DIV_3_C
+| | | | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | | +--->BN_MP_EXCH_C
+| | | | | | +--->BN_MP_LSHD_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_KARATSUBA_MUL_C
+| | | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_ADD_C
+| | | | | | | +--->BN_MP_CMP_MAG_C
+| | | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_LSHD_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_RSHD_C
+| | | | | | | | +--->BN_MP_ZERO_C
+| | | | | +--->BN_FAST_S_MP_MUL_DIGS_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_S_MP_MUL_DIGS_C
+| | | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_EXCH_C
+| | | | +--->BN_MP_EXCH_C
+| | +--->BN_MP_CMP_C
+| | | +--->BN_MP_CMP_MAG_C
+| | +--->BN_MP_SQRMOD_C
+| | | +--->BN_MP_SQR_C
+| | | | +--->BN_MP_TOOM_SQR_C
+| | | | | +--->BN_MP_INIT_MULTI_C
+| | | | | | +--->BN_MP_CLEAR_C
+| | | | | +--->BN_MP_MOD_2D_C
+| | | | | | +--->BN_MP_ZERO_C
+| | | | | | +--->BN_MP_COPY_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_COPY_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_RSHD_C
+| | | | | | +--->BN_MP_ZERO_C
+| | | | | +--->BN_MP_MUL_2_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_ADD_C
+| | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_CMP_MAG_C
+| | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_SUB_C
+| | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_CMP_MAG_C
+| | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_DIV_2_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_MUL_2D_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_LSHD_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_MUL_D_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_DIV_3_C
+| | | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_EXCH_C
+| | | | | | +--->BN_MP_CLEAR_C
+| | | | | +--->BN_MP_LSHD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLEAR_MULTI_C
+| | | | | | +--->BN_MP_CLEAR_C
+| | | | +--->BN_MP_KARATSUBA_SQR_C
+| | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_S_MP_ADD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_S_MP_SUB_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_LSHD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_RSHD_C
+| | | | | | | +--->BN_MP_ZERO_C
+| | | | | +--->BN_MP_ADD_C
+| | | | | | +--->BN_MP_CMP_MAG_C
+| | | | | +--->BN_MP_CLEAR_C
+| | | | +--->BN_FAST_S_MP_SQR_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_S_MP_SQR_C
+| | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_EXCH_C
+| | | | | +--->BN_MP_CLEAR_C
+| | | +--->BN_MP_CLEAR_C
+| | | +--->BN_MP_MOD_C
+| | | | +--->BN_MP_DIV_C
+| | | | | +--->BN_MP_CMP_MAG_C
+| | | | | +--->BN_MP_COPY_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_ZERO_C
+| | | | | +--->BN_MP_INIT_MULTI_C
+| | | | | +--->BN_MP_COUNT_BITS_C
+| | | | | +--->BN_MP_ABS_C
+| | | | | +--->BN_MP_MUL_2D_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_LSHD_C
+| | | | | | | +--->BN_MP_RSHD_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_SUB_C
+| | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_ADD_C
+| | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_EXCH_C
+| | | | | +--->BN_MP_CLEAR_MULTI_C
+| | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | +--->BN_MP_LSHD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_RSHD_C
+| | | | | +--->BN_MP_RSHD_C
+| | | | | +--->BN_MP_MUL_D_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_EXCH_C
+| | | | +--->BN_MP_ADD_C
+| | | | | +--->BN_S_MP_ADD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_CMP_MAG_C
+| | | | | +--->BN_S_MP_SUB_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_CLEAR_C
+| +--->BN_MP_CLEAR_C
++--->BN_MP_SUB_D_C
+| +--->BN_MP_GROW_C
+| +--->BN_MP_ADD_D_C
+| | +--->BN_MP_CLAMP_C
+| +--->BN_MP_CLAMP_C
++--->BN_MP_DIV_2_C
+| +--->BN_MP_GROW_C
+| +--->BN_MP_CLAMP_C
++--->BN_MP_MUL_2_C
+| +--->BN_MP_GROW_C
++--->BN_MP_ADD_D_C
+| +--->BN_MP_GROW_C
+| +--->BN_MP_CLAMP_C
+
+
+BN_MP_CMP_D_C
+
+
+BN_MP_DR_IS_MODULUS_C
+
+
+BN_MP_IMPORT_C
++--->BN_MP_ZERO_C
++--->BN_MP_MUL_2D_C
+| +--->BN_MP_COPY_C
+| | +--->BN_MP_GROW_C
+| +--->BN_MP_GROW_C
+| +--->BN_MP_LSHD_C
+| | +--->BN_MP_RSHD_C
+| +--->BN_MP_CLAMP_C
++--->BN_MP_CLAMP_C
+
+
+BN_MP_COUNT_BITS_C
+
+
+BN_MP_FREAD_C
++--->BN_MP_ZERO_C
++--->BN_MP_MUL_D_C
+| +--->BN_MP_GROW_C
+| +--->BN_MP_CLAMP_C
++--->BN_MP_ADD_D_C
+| +--->BN_MP_GROW_C
+| +--->BN_MP_SUB_D_C
+| | +--->BN_MP_CLAMP_C
+| +--->BN_MP_CLAMP_C
++--->BN_MP_CMP_D_C
+
+
+BN_MP_REDUCE_2K_L_C
++--->BN_MP_INIT_C
++--->BN_MP_COUNT_BITS_C
++--->BN_MP_DIV_2D_C
+| +--->BN_MP_COPY_C
+| | +--->BN_MP_GROW_C
+| +--->BN_MP_ZERO_C
+| +--->BN_MP_MOD_2D_C
+| | +--->BN_MP_CLAMP_C
+| +--->BN_MP_CLEAR_C
+| +--->BN_MP_RSHD_C
+| +--->BN_MP_CLAMP_C
+| +--->BN_MP_EXCH_C
++--->BN_MP_MUL_C
+| +--->BN_MP_TOOM_MUL_C
+| | +--->BN_MP_INIT_MULTI_C
+| | | +--->BN_MP_CLEAR_C
+| | +--->BN_MP_MOD_2D_C
+| | | +--->BN_MP_ZERO_C
+| | | +--->BN_MP_COPY_C
+| | | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_COPY_C
+| | | +--->BN_MP_GROW_C
+| | +--->BN_MP_RSHD_C
+| | | +--->BN_MP_ZERO_C
+| | +--->BN_MP_MUL_2_C
+| | | +--->BN_MP_GROW_C
+| | +--->BN_MP_ADD_C
+| | | +--->BN_S_MP_ADD_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_CMP_MAG_C
+| | | +--->BN_S_MP_SUB_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_SUB_C
+| | | +--->BN_S_MP_ADD_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_CMP_MAG_C
+| | | +--->BN_S_MP_SUB_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_DIV_2_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_MUL_2D_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_LSHD_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_MUL_D_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_DIV_3_C
+| | | +--->BN_MP_INIT_SIZE_C
+| | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_EXCH_C
+| | | +--->BN_MP_CLEAR_C
+| | +--->BN_MP_LSHD_C
+| | | +--->BN_MP_GROW_C
+| | +--->BN_MP_CLEAR_MULTI_C
+| | | +--->BN_MP_CLEAR_C
+| +--->BN_MP_KARATSUBA_MUL_C
+| | +--->BN_MP_INIT_SIZE_C
+| | +--->BN_MP_CLAMP_C
+| | +--->BN_S_MP_ADD_C
+| | | +--->BN_MP_GROW_C
+| | +--->BN_MP_ADD_C
+| | | +--->BN_MP_CMP_MAG_C
+| | | +--->BN_S_MP_SUB_C
+| | | | +--->BN_MP_GROW_C
+| | +--->BN_S_MP_SUB_C
+| | | +--->BN_MP_GROW_C
+| | +--->BN_MP_LSHD_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_RSHD_C
+| | | | +--->BN_MP_ZERO_C
+| | +--->BN_MP_CLEAR_C
+| +--->BN_FAST_S_MP_MUL_DIGS_C
+| | +--->BN_MP_GROW_C
+| | +--->BN_MP_CLAMP_C
+| +--->BN_S_MP_MUL_DIGS_C
+| | +--->BN_MP_INIT_SIZE_C
+| | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_EXCH_C
+| | +--->BN_MP_CLEAR_C
++--->BN_S_MP_ADD_C
+| +--->BN_MP_GROW_C
+| +--->BN_MP_CLAMP_C
++--->BN_MP_CMP_MAG_C
++--->BN_S_MP_SUB_C
+| +--->BN_MP_GROW_C
+| +--->BN_MP_CLAMP_C
++--->BN_MP_CLEAR_C
+
+
+BN_MP_AND_C
++--->BN_MP_INIT_COPY_C
+| +--->BN_MP_INIT_SIZE_C
+| +--->BN_MP_COPY_C
+| | +--->BN_MP_GROW_C
++--->BN_MP_CLAMP_C
++--->BN_MP_EXCH_C
++--->BN_MP_CLEAR_C
+
+
+BN_MP_SQRMOD_C
++--->BN_MP_INIT_C
++--->BN_MP_SQR_C
+| +--->BN_MP_TOOM_SQR_C
+| | +--->BN_MP_INIT_MULTI_C
+| | | +--->BN_MP_CLEAR_C
+| | +--->BN_MP_MOD_2D_C
+| | | +--->BN_MP_ZERO_C
+| | | +--->BN_MP_COPY_C
+| | | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_COPY_C
+| | | +--->BN_MP_GROW_C
+| | +--->BN_MP_RSHD_C
+| | | +--->BN_MP_ZERO_C
+| | +--->BN_MP_MUL_2_C
+| | | +--->BN_MP_GROW_C
+| | +--->BN_MP_ADD_C
+| | | +--->BN_S_MP_ADD_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_CMP_MAG_C
+| | | +--->BN_S_MP_SUB_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_SUB_C
+| | | +--->BN_S_MP_ADD_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_CMP_MAG_C
+| | | +--->BN_S_MP_SUB_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_DIV_2_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_MUL_2D_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_LSHD_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_MUL_D_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_DIV_3_C
+| | | +--->BN_MP_INIT_SIZE_C
+| | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_EXCH_C
+| | | +--->BN_MP_CLEAR_C
+| | +--->BN_MP_LSHD_C
+| | | +--->BN_MP_GROW_C
+| | +--->BN_MP_CLEAR_MULTI_C
+| | | +--->BN_MP_CLEAR_C
+| +--->BN_MP_KARATSUBA_SQR_C
+| | +--->BN_MP_INIT_SIZE_C
+| | +--->BN_MP_CLAMP_C
+| | +--->BN_S_MP_ADD_C
+| | | +--->BN_MP_GROW_C
+| | +--->BN_S_MP_SUB_C
+| | | +--->BN_MP_GROW_C
+| | +--->BN_MP_LSHD_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_RSHD_C
+| | | | +--->BN_MP_ZERO_C
+| | +--->BN_MP_ADD_C
+| | | +--->BN_MP_CMP_MAG_C
+| | +--->BN_MP_CLEAR_C
+| +--->BN_FAST_S_MP_SQR_C
+| | +--->BN_MP_GROW_C
+| | +--->BN_MP_CLAMP_C
+| +--->BN_S_MP_SQR_C
+| | +--->BN_MP_INIT_SIZE_C
+| | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_EXCH_C
+| | +--->BN_MP_CLEAR_C
++--->BN_MP_CLEAR_C
++--->BN_MP_MOD_C
+| +--->BN_MP_DIV_C
+| | +--->BN_MP_CMP_MAG_C
+| | +--->BN_MP_COPY_C
+| | | +--->BN_MP_GROW_C
+| | +--->BN_MP_ZERO_C
+| | +--->BN_MP_INIT_MULTI_C
+| | +--->BN_MP_SET_C
+| | +--->BN_MP_COUNT_BITS_C
+| | +--->BN_MP_ABS_C
+| | +--->BN_MP_MUL_2D_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_LSHD_C
+| | | | +--->BN_MP_RSHD_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_CMP_C
+| | +--->BN_MP_SUB_C
+| | | +--->BN_S_MP_ADD_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_S_MP_SUB_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_ADD_C
+| | | +--->BN_S_MP_ADD_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_S_MP_SUB_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_DIV_2D_C
+| | | +--->BN_MP_MOD_2D_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_RSHD_C
+| | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_EXCH_C
+| | +--->BN_MP_EXCH_C
+| | +--->BN_MP_CLEAR_MULTI_C
+| | +--->BN_MP_INIT_SIZE_C
+| | +--->BN_MP_INIT_COPY_C
+| | +--->BN_MP_LSHD_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_RSHD_C
+| | +--->BN_MP_RSHD_C
+| | +--->BN_MP_MUL_D_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_CLAMP_C
+| +--->BN_MP_EXCH_C
+| +--->BN_MP_ADD_C
+| | +--->BN_S_MP_ADD_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_CMP_MAG_C
+| | +--->BN_S_MP_SUB_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLAMP_C
+
+
+BN_MP_DIV_D_C
++--->BN_MP_COPY_C
+| +--->BN_MP_GROW_C
++--->BN_MP_DIV_2D_C
+| +--->BN_MP_ZERO_C
+| +--->BN_MP_INIT_C
+| +--->BN_MP_MOD_2D_C
+| | +--->BN_MP_CLAMP_C
+| +--->BN_MP_CLEAR_C
+| +--->BN_MP_RSHD_C
+| +--->BN_MP_CLAMP_C
+| +--->BN_MP_EXCH_C
++--->BN_MP_DIV_3_C
+| +--->BN_MP_INIT_SIZE_C
+| | +--->BN_MP_INIT_C
+| +--->BN_MP_CLAMP_C
+| +--->BN_MP_EXCH_C
+| +--->BN_MP_CLEAR_C
++--->BN_MP_INIT_SIZE_C
+| +--->BN_MP_INIT_C
++--->BN_MP_CLAMP_C
++--->BN_MP_EXCH_C
++--->BN_MP_CLEAR_C
+
+
+BN_MP_INIT_MULTI_C
++--->BN_MP_INIT_C
++--->BN_MP_CLEAR_C
+
+
+BN_S_MP_EXPTMOD_C
++--->BN_MP_COUNT_BITS_C
++--->BN_MP_INIT_C
++--->BN_MP_CLEAR_C
++--->BN_MP_REDUCE_SETUP_C
+| +--->BN_MP_2EXPT_C
+| | +--->BN_MP_ZERO_C
+| | +--->BN_MP_GROW_C
+| +--->BN_MP_DIV_C
+| | +--->BN_MP_CMP_MAG_C
+| | +--->BN_MP_COPY_C
+| | | +--->BN_MP_GROW_C
+| | +--->BN_MP_ZERO_C
+| | +--->BN_MP_INIT_MULTI_C
+| | +--->BN_MP_SET_C
+| | +--->BN_MP_ABS_C
+| | +--->BN_MP_MUL_2D_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_LSHD_C
+| | | | +--->BN_MP_RSHD_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_CMP_C
+| | +--->BN_MP_SUB_C
+| | | +--->BN_S_MP_ADD_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_S_MP_SUB_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_ADD_C
+| | | +--->BN_S_MP_ADD_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_S_MP_SUB_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_DIV_2D_C
+| | | +--->BN_MP_MOD_2D_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_RSHD_C
+| | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_EXCH_C
+| | +--->BN_MP_EXCH_C
+| | +--->BN_MP_CLEAR_MULTI_C
+| | +--->BN_MP_INIT_SIZE_C
+| | +--->BN_MP_INIT_COPY_C
+| | +--->BN_MP_LSHD_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_RSHD_C
+| | +--->BN_MP_RSHD_C
+| | +--->BN_MP_MUL_D_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_CLAMP_C
++--->BN_MP_REDUCE_C
+| +--->BN_MP_INIT_COPY_C
+| | +--->BN_MP_INIT_SIZE_C
+| | +--->BN_MP_COPY_C
+| | | +--->BN_MP_GROW_C
+| +--->BN_MP_RSHD_C
+| | +--->BN_MP_ZERO_C
+| +--->BN_MP_MUL_C
+| | +--->BN_MP_TOOM_MUL_C
+| | | +--->BN_MP_INIT_MULTI_C
+| | | +--->BN_MP_MOD_2D_C
+| | | | +--->BN_MP_ZERO_C
+| | | | +--->BN_MP_COPY_C
+| | | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_COPY_C
+| | | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_MUL_2_C
+| | | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_ADD_C
+| | | | +--->BN_S_MP_ADD_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_CMP_MAG_C
+| | | | +--->BN_S_MP_SUB_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_SUB_C
+| | | | +--->BN_S_MP_ADD_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_CMP_MAG_C
+| | | | +--->BN_S_MP_SUB_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_DIV_2_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_MUL_2D_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_LSHD_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_MUL_D_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_DIV_3_C
+| | | | +--->BN_MP_INIT_SIZE_C
+| | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_EXCH_C
+| | | +--->BN_MP_LSHD_C
+| | | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLEAR_MULTI_C
+| | +--->BN_MP_KARATSUBA_MUL_C
+| | | +--->BN_MP_INIT_SIZE_C
+| | | +--->BN_MP_CLAMP_C
+| | | +--->BN_S_MP_ADD_C
+| | | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_ADD_C
+| | | | +--->BN_MP_CMP_MAG_C
+| | | | +--->BN_S_MP_SUB_C
+| | | | | +--->BN_MP_GROW_C
+| | | +--->BN_S_MP_SUB_C
+| | | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_LSHD_C
+| | | | +--->BN_MP_GROW_C
+| | +--->BN_FAST_S_MP_MUL_DIGS_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_S_MP_MUL_DIGS_C
+| | | +--->BN_MP_INIT_SIZE_C
+| | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_EXCH_C
+| +--->BN_S_MP_MUL_HIGH_DIGS_C
+| | +--->BN_FAST_S_MP_MUL_HIGH_DIGS_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_INIT_SIZE_C
+| | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_EXCH_C
+| +--->BN_FAST_S_MP_MUL_HIGH_DIGS_C
+| | +--->BN_MP_GROW_C
+| | +--->BN_MP_CLAMP_C
+| +--->BN_MP_MOD_2D_C
+| | +--->BN_MP_ZERO_C
+| | +--->BN_MP_COPY_C
+| | | +--->BN_MP_GROW_C
+| | +--->BN_MP_CLAMP_C
+| +--->BN_S_MP_MUL_DIGS_C
+| | +--->BN_FAST_S_MP_MUL_DIGS_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_INIT_SIZE_C
+| | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_EXCH_C
+| +--->BN_MP_SUB_C
+| | +--->BN_S_MP_ADD_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_CMP_MAG_C
+| | +--->BN_S_MP_SUB_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLAMP_C
+| +--->BN_MP_CMP_D_C
+| +--->BN_MP_SET_C
+| | +--->BN_MP_ZERO_C
+| +--->BN_MP_LSHD_C
+| | +--->BN_MP_GROW_C
+| +--->BN_MP_ADD_C
+| | +--->BN_S_MP_ADD_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_CMP_MAG_C
+| | +--->BN_S_MP_SUB_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLAMP_C
+| +--->BN_MP_CMP_C
+| | +--->BN_MP_CMP_MAG_C
+| +--->BN_S_MP_SUB_C
+| | +--->BN_MP_GROW_C
+| | +--->BN_MP_CLAMP_C
++--->BN_MP_REDUCE_2K_SETUP_L_C
+| +--->BN_MP_2EXPT_C
+| | +--->BN_MP_ZERO_C
+| | +--->BN_MP_GROW_C
+| +--->BN_S_MP_SUB_C
+| | +--->BN_MP_GROW_C
+| | +--->BN_MP_CLAMP_C
++--->BN_MP_REDUCE_2K_L_C
+| +--->BN_MP_DIV_2D_C
+| | +--->BN_MP_COPY_C
+| | | +--->BN_MP_GROW_C
+| | +--->BN_MP_ZERO_C
+| | +--->BN_MP_MOD_2D_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_RSHD_C
+| | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_EXCH_C
+| +--->BN_MP_MUL_C
+| | +--->BN_MP_TOOM_MUL_C
+| | | +--->BN_MP_INIT_MULTI_C
+| | | +--->BN_MP_MOD_2D_C
+| | | | +--->BN_MP_ZERO_C
+| | | | +--->BN_MP_COPY_C
+| | | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_COPY_C
+| | | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_RSHD_C
+| | | | +--->BN_MP_ZERO_C
+| | | +--->BN_MP_MUL_2_C
+| | | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_ADD_C
+| | | | +--->BN_S_MP_ADD_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_CMP_MAG_C
+| | | | +--->BN_S_MP_SUB_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_SUB_C
+| | | | +--->BN_S_MP_ADD_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_CMP_MAG_C
+| | | | +--->BN_S_MP_SUB_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_DIV_2_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_MUL_2D_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_LSHD_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_MUL_D_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_DIV_3_C
+| | | | +--->BN_MP_INIT_SIZE_C
+| | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_EXCH_C
+| | | +--->BN_MP_LSHD_C
+| | | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLEAR_MULTI_C
+| | +--->BN_MP_KARATSUBA_MUL_C
+| | | +--->BN_MP_INIT_SIZE_C
+| | | +--->BN_MP_CLAMP_C
+| | | +--->BN_S_MP_ADD_C
+| | | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_ADD_C
+| | | | +--->BN_MP_CMP_MAG_C
+| | | | +--->BN_S_MP_SUB_C
+| | | | | +--->BN_MP_GROW_C
+| | | +--->BN_S_MP_SUB_C
+| | | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_LSHD_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_RSHD_C
+| | | | | +--->BN_MP_ZERO_C
+| | +--->BN_FAST_S_MP_MUL_DIGS_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_S_MP_MUL_DIGS_C
+| | | +--->BN_MP_INIT_SIZE_C
+| | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_EXCH_C
+| +--->BN_S_MP_ADD_C
+| | +--->BN_MP_GROW_C
+| | +--->BN_MP_CLAMP_C
+| +--->BN_MP_CMP_MAG_C
+| +--->BN_S_MP_SUB_C
+| | +--->BN_MP_GROW_C
+| | +--->BN_MP_CLAMP_C
++--->BN_MP_MOD_C
+| +--->BN_MP_DIV_C
+| | +--->BN_MP_CMP_MAG_C
+| | +--->BN_MP_COPY_C
+| | | +--->BN_MP_GROW_C
+| | +--->BN_MP_ZERO_C
+| | +--->BN_MP_INIT_MULTI_C
+| | +--->BN_MP_SET_C
+| | +--->BN_MP_ABS_C
+| | +--->BN_MP_MUL_2D_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_LSHD_C
+| | | | +--->BN_MP_RSHD_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_CMP_C
+| | +--->BN_MP_SUB_C
+| | | +--->BN_S_MP_ADD_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_S_MP_SUB_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_ADD_C
+| | | +--->BN_S_MP_ADD_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_S_MP_SUB_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_DIV_2D_C
+| | | +--->BN_MP_MOD_2D_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_RSHD_C
+| | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_EXCH_C
+| | +--->BN_MP_EXCH_C
+| | +--->BN_MP_CLEAR_MULTI_C
+| | +--->BN_MP_INIT_SIZE_C
+| | +--->BN_MP_INIT_COPY_C
+| | +--->BN_MP_LSHD_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_RSHD_C
+| | +--->BN_MP_RSHD_C
+| | +--->BN_MP_MUL_D_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_CLAMP_C
+| +--->BN_MP_EXCH_C
+| +--->BN_MP_ADD_C
+| | +--->BN_S_MP_ADD_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_CMP_MAG_C
+| | +--->BN_S_MP_SUB_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLAMP_C
++--->BN_MP_COPY_C
+| +--->BN_MP_GROW_C
++--->BN_MP_SQR_C
+| +--->BN_MP_TOOM_SQR_C
+| | +--->BN_MP_INIT_MULTI_C
+| | +--->BN_MP_MOD_2D_C
+| | | +--->BN_MP_ZERO_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_RSHD_C
+| | | +--->BN_MP_ZERO_C
+| | +--->BN_MP_MUL_2_C
+| | | +--->BN_MP_GROW_C
+| | +--->BN_MP_ADD_C
+| | | +--->BN_S_MP_ADD_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_CMP_MAG_C
+| | | +--->BN_S_MP_SUB_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_SUB_C
+| | | +--->BN_S_MP_ADD_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_CMP_MAG_C
+| | | +--->BN_S_MP_SUB_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_DIV_2_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_MUL_2D_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_LSHD_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_MUL_D_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_DIV_3_C
+| | | +--->BN_MP_INIT_SIZE_C
+| | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_EXCH_C
+| | +--->BN_MP_LSHD_C
+| | | +--->BN_MP_GROW_C
+| | +--->BN_MP_CLEAR_MULTI_C
+| +--->BN_MP_KARATSUBA_SQR_C
+| | +--->BN_MP_INIT_SIZE_C
+| | +--->BN_MP_CLAMP_C
+| | +--->BN_S_MP_ADD_C
+| | | +--->BN_MP_GROW_C
+| | +--->BN_S_MP_SUB_C
+| | | +--->BN_MP_GROW_C
+| | +--->BN_MP_LSHD_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_RSHD_C
+| | | | +--->BN_MP_ZERO_C
+| | +--->BN_MP_ADD_C
+| | | +--->BN_MP_CMP_MAG_C
+| +--->BN_FAST_S_MP_SQR_C
+| | +--->BN_MP_GROW_C
+| | +--->BN_MP_CLAMP_C
+| +--->BN_S_MP_SQR_C
+| | +--->BN_MP_INIT_SIZE_C
+| | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_EXCH_C
++--->BN_MP_MUL_C
+| +--->BN_MP_TOOM_MUL_C
+| | +--->BN_MP_INIT_MULTI_C
+| | +--->BN_MP_MOD_2D_C
+| | | +--->BN_MP_ZERO_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_RSHD_C
+| | | +--->BN_MP_ZERO_C
+| | +--->BN_MP_MUL_2_C
+| | | +--->BN_MP_GROW_C
+| | +--->BN_MP_ADD_C
+| | | +--->BN_S_MP_ADD_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_CMP_MAG_C
+| | | +--->BN_S_MP_SUB_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_SUB_C
+| | | +--->BN_S_MP_ADD_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_CMP_MAG_C
+| | | +--->BN_S_MP_SUB_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_DIV_2_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_MUL_2D_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_LSHD_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_MUL_D_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_DIV_3_C
+| | | +--->BN_MP_INIT_SIZE_C
+| | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_EXCH_C
+| | +--->BN_MP_LSHD_C
+| | | +--->BN_MP_GROW_C
+| | +--->BN_MP_CLEAR_MULTI_C
+| +--->BN_MP_KARATSUBA_MUL_C
+| | +--->BN_MP_INIT_SIZE_C
+| | +--->BN_MP_CLAMP_C
+| | +--->BN_S_MP_ADD_C
+| | | +--->BN_MP_GROW_C
+| | +--->BN_MP_ADD_C
+| | | +--->BN_MP_CMP_MAG_C
+| | | +--->BN_S_MP_SUB_C
+| | | | +--->BN_MP_GROW_C
+| | +--->BN_S_MP_SUB_C
+| | | +--->BN_MP_GROW_C
+| | +--->BN_MP_LSHD_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_RSHD_C
+| | | | +--->BN_MP_ZERO_C
+| +--->BN_FAST_S_MP_MUL_DIGS_C
+| | +--->BN_MP_GROW_C
+| | +--->BN_MP_CLAMP_C
+| +--->BN_S_MP_MUL_DIGS_C
+| | +--->BN_MP_INIT_SIZE_C
+| | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_EXCH_C
++--->BN_MP_SET_C
+| +--->BN_MP_ZERO_C
++--->BN_MP_EXCH_C
+
+
+BN_MP_MONTGOMERY_CALC_NORMALIZATION_C
++--->BN_MP_COUNT_BITS_C
++--->BN_MP_2EXPT_C
+| +--->BN_MP_ZERO_C
+| +--->BN_MP_GROW_C
++--->BN_MP_SET_C
+| +--->BN_MP_ZERO_C
++--->BN_MP_MUL_2_C
+| +--->BN_MP_GROW_C
++--->BN_MP_CMP_MAG_C
++--->BN_S_MP_SUB_C
+| +--->BN_MP_GROW_C
+| +--->BN_MP_CLAMP_C
+
+
+BN_MP_MONTGOMERY_SETUP_C
+
+
+BN_FAST_MP_INVMOD_C
++--->BN_MP_INIT_MULTI_C
+| +--->BN_MP_INIT_C
+| +--->BN_MP_CLEAR_C
++--->BN_MP_COPY_C
+| +--->BN_MP_GROW_C
++--->BN_MP_MOD_C
+| +--->BN_MP_INIT_C
+| +--->BN_MP_DIV_C
+| | +--->BN_MP_CMP_MAG_C
+| | +--->BN_MP_ZERO_C
+| | +--->BN_MP_SET_C
+| | +--->BN_MP_COUNT_BITS_C
+| | +--->BN_MP_ABS_C
+| | +--->BN_MP_MUL_2D_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_LSHD_C
+| | | | +--->BN_MP_RSHD_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_CMP_C
+| | +--->BN_MP_SUB_C
+| | | +--->BN_S_MP_ADD_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_S_MP_SUB_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_ADD_C
+| | | +--->BN_S_MP_ADD_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_S_MP_SUB_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_DIV_2D_C
+| | | +--->BN_MP_MOD_2D_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_CLEAR_C
+| | | +--->BN_MP_RSHD_C
+| | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_EXCH_C
+| | +--->BN_MP_EXCH_C
+| | +--->BN_MP_CLEAR_MULTI_C
+| | | +--->BN_MP_CLEAR_C
+| | +--->BN_MP_INIT_SIZE_C
+| | +--->BN_MP_INIT_COPY_C
+| | +--->BN_MP_LSHD_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_RSHD_C
+| | +--->BN_MP_RSHD_C
+| | +--->BN_MP_MUL_D_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_CLEAR_C
+| +--->BN_MP_CLEAR_C
+| +--->BN_MP_EXCH_C
+| +--->BN_MP_ADD_C
+| | +--->BN_S_MP_ADD_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_CMP_MAG_C
+| | +--->BN_S_MP_SUB_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLAMP_C
++--->BN_MP_SET_C
+| +--->BN_MP_ZERO_C
++--->BN_MP_DIV_2_C
+| +--->BN_MP_GROW_C
+| +--->BN_MP_CLAMP_C
++--->BN_MP_SUB_C
+| +--->BN_S_MP_ADD_C
+| | +--->BN_MP_GROW_C
+| | +--->BN_MP_CLAMP_C
+| +--->BN_MP_CMP_MAG_C
+| +--->BN_S_MP_SUB_C
+| | +--->BN_MP_GROW_C
+| | +--->BN_MP_CLAMP_C
++--->BN_MP_CMP_C
+| +--->BN_MP_CMP_MAG_C
++--->BN_MP_CMP_D_C
++--->BN_MP_ADD_C
+| +--->BN_S_MP_ADD_C
+| | +--->BN_MP_GROW_C
+| | +--->BN_MP_CLAMP_C
+| +--->BN_MP_CMP_MAG_C
+| +--->BN_S_MP_SUB_C
+| | +--->BN_MP_GROW_C
+| | +--->BN_MP_CLAMP_C
++--->BN_MP_EXCH_C
++--->BN_MP_CLEAR_MULTI_C
+| +--->BN_MP_CLEAR_C
+
+
+BN_MP_TO_UNSIGNED_BIN_C
++--->BN_MP_INIT_COPY_C
+| +--->BN_MP_INIT_SIZE_C
+| +--->BN_MP_COPY_C
+| | +--->BN_MP_GROW_C
++--->BN_MP_DIV_2D_C
+| +--->BN_MP_COPY_C
+| | +--->BN_MP_GROW_C
+| +--->BN_MP_ZERO_C
+| +--->BN_MP_MOD_2D_C
+| | +--->BN_MP_CLAMP_C
+| +--->BN_MP_CLEAR_C
+| +--->BN_MP_RSHD_C
+| +--->BN_MP_CLAMP_C
+| +--->BN_MP_EXCH_C
++--->BN_MP_CLEAR_C
+
+
+BN_MP_CLEAR_MULTI_C
++--->BN_MP_CLEAR_C
+
+
+BNCORE_C
+
+
+BN_MP_TORADIX_C
++--->BN_MP_INIT_COPY_C
+| +--->BN_MP_INIT_SIZE_C
+| +--->BN_MP_COPY_C
+| | +--->BN_MP_GROW_C
++--->BN_MP_DIV_D_C
+| +--->BN_MP_COPY_C
+| | +--->BN_MP_GROW_C
+| +--->BN_MP_DIV_2D_C
+| | +--->BN_MP_ZERO_C
+| | +--->BN_MP_MOD_2D_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_CLEAR_C
+| | +--->BN_MP_RSHD_C
+| | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_EXCH_C
+| +--->BN_MP_DIV_3_C
+| | +--->BN_MP_INIT_SIZE_C
+| | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_EXCH_C
+| | +--->BN_MP_CLEAR_C
+| +--->BN_MP_INIT_SIZE_C
+| +--->BN_MP_CLAMP_C
+| +--->BN_MP_EXCH_C
+| +--->BN_MP_CLEAR_C
++--->BN_MP_CLEAR_C
+
+
+BN_MP_EXPTMOD_FAST_C
++--->BN_MP_COUNT_BITS_C
++--->BN_MP_INIT_C
++--->BN_MP_CLEAR_C
++--->BN_MP_MONTGOMERY_SETUP_C
++--->BN_FAST_MP_MONTGOMERY_REDUCE_C
+| +--->BN_MP_GROW_C
+| +--->BN_MP_RSHD_C
+| | +--->BN_MP_ZERO_C
+| +--->BN_MP_CLAMP_C
+| +--->BN_MP_CMP_MAG_C
+| +--->BN_S_MP_SUB_C
++--->BN_MP_MONTGOMERY_REDUCE_C
+| +--->BN_MP_GROW_C
+| +--->BN_MP_CLAMP_C
+| +--->BN_MP_RSHD_C
+| | +--->BN_MP_ZERO_C
+| +--->BN_MP_CMP_MAG_C
+| +--->BN_S_MP_SUB_C
++--->BN_MP_DR_SETUP_C
++--->BN_MP_DR_REDUCE_C
+| +--->BN_MP_GROW_C
+| +--->BN_MP_CLAMP_C
+| +--->BN_MP_CMP_MAG_C
+| +--->BN_S_MP_SUB_C
++--->BN_MP_REDUCE_2K_SETUP_C
+| +--->BN_MP_2EXPT_C
+| | +--->BN_MP_ZERO_C
+| | +--->BN_MP_GROW_C
+| +--->BN_S_MP_SUB_C
+| | +--->BN_MP_GROW_C
+| | +--->BN_MP_CLAMP_C
++--->BN_MP_REDUCE_2K_C
+| +--->BN_MP_DIV_2D_C
+| | +--->BN_MP_COPY_C
+| | | +--->BN_MP_GROW_C
+| | +--->BN_MP_ZERO_C
+| | +--->BN_MP_MOD_2D_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_RSHD_C
+| | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_EXCH_C
+| +--->BN_MP_MUL_D_C
+| | +--->BN_MP_GROW_C
+| | +--->BN_MP_CLAMP_C
+| +--->BN_S_MP_ADD_C
+| | +--->BN_MP_GROW_C
+| | +--->BN_MP_CLAMP_C
+| +--->BN_MP_CMP_MAG_C
+| +--->BN_S_MP_SUB_C
+| | +--->BN_MP_GROW_C
+| | +--->BN_MP_CLAMP_C
++--->BN_MP_MONTGOMERY_CALC_NORMALIZATION_C
+| +--->BN_MP_2EXPT_C
+| | +--->BN_MP_ZERO_C
+| | +--->BN_MP_GROW_C
+| +--->BN_MP_SET_C
+| | +--->BN_MP_ZERO_C
+| +--->BN_MP_MUL_2_C
+| | +--->BN_MP_GROW_C
+| +--->BN_MP_CMP_MAG_C
+| +--->BN_S_MP_SUB_C
+| | +--->BN_MP_GROW_C
+| | +--->BN_MP_CLAMP_C
++--->BN_MP_MULMOD_C
+| +--->BN_MP_MUL_C
+| | +--->BN_MP_TOOM_MUL_C
+| | | +--->BN_MP_INIT_MULTI_C
+| | | +--->BN_MP_MOD_2D_C
+| | | | +--->BN_MP_ZERO_C
+| | | | +--->BN_MP_COPY_C
+| | | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_COPY_C
+| | | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_RSHD_C
+| | | | +--->BN_MP_ZERO_C
+| | | +--->BN_MP_MUL_2_C
+| | | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_ADD_C
+| | | | +--->BN_S_MP_ADD_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_CMP_MAG_C
+| | | | +--->BN_S_MP_SUB_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_SUB_C
+| | | | +--->BN_S_MP_ADD_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_CMP_MAG_C
+| | | | +--->BN_S_MP_SUB_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_DIV_2_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_MUL_2D_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_LSHD_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_MUL_D_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_DIV_3_C
+| | | | +--->BN_MP_INIT_SIZE_C
+| | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_EXCH_C
+| | | +--->BN_MP_LSHD_C
+| | | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLEAR_MULTI_C
+| | +--->BN_MP_KARATSUBA_MUL_C
+| | | +--->BN_MP_INIT_SIZE_C
+| | | +--->BN_MP_CLAMP_C
+| | | +--->BN_S_MP_ADD_C
+| | | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_ADD_C
+| | | | +--->BN_MP_CMP_MAG_C
+| | | | +--->BN_S_MP_SUB_C
+| | | | | +--->BN_MP_GROW_C
+| | | +--->BN_S_MP_SUB_C
+| | | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_LSHD_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_RSHD_C
+| | | | | +--->BN_MP_ZERO_C
+| | +--->BN_FAST_S_MP_MUL_DIGS_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_S_MP_MUL_DIGS_C
+| | | +--->BN_MP_INIT_SIZE_C
+| | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_EXCH_C
+| +--->BN_MP_MOD_C
+| | +--->BN_MP_DIV_C
+| | | +--->BN_MP_CMP_MAG_C
+| | | +--->BN_MP_COPY_C
+| | | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_ZERO_C
+| | | +--->BN_MP_INIT_MULTI_C
+| | | +--->BN_MP_SET_C
+| | | +--->BN_MP_ABS_C
+| | | +--->BN_MP_MUL_2D_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_LSHD_C
+| | | | | +--->BN_MP_RSHD_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_CMP_C
+| | | +--->BN_MP_SUB_C
+| | | | +--->BN_S_MP_ADD_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_S_MP_SUB_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_ADD_C
+| | | | +--->BN_S_MP_ADD_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_S_MP_SUB_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_DIV_2D_C
+| | | | +--->BN_MP_MOD_2D_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_RSHD_C
+| | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_EXCH_C
+| | | +--->BN_MP_EXCH_C
+| | | +--->BN_MP_CLEAR_MULTI_C
+| | | +--->BN_MP_INIT_SIZE_C
+| | | +--->BN_MP_INIT_COPY_C
+| | | +--->BN_MP_LSHD_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_RSHD_C
+| | | +--->BN_MP_RSHD_C
+| | | +--->BN_MP_MUL_D_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_EXCH_C
+| | +--->BN_MP_ADD_C
+| | | +--->BN_S_MP_ADD_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_CMP_MAG_C
+| | | +--->BN_S_MP_SUB_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
++--->BN_MP_SET_C
+| +--->BN_MP_ZERO_C
++--->BN_MP_MOD_C
+| +--->BN_MP_DIV_C
+| | +--->BN_MP_CMP_MAG_C
+| | +--->BN_MP_COPY_C
+| | | +--->BN_MP_GROW_C
+| | +--->BN_MP_ZERO_C
+| | +--->BN_MP_INIT_MULTI_C
+| | +--->BN_MP_ABS_C
+| | +--->BN_MP_MUL_2D_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_LSHD_C
+| | | | +--->BN_MP_RSHD_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_CMP_C
+| | +--->BN_MP_SUB_C
+| | | +--->BN_S_MP_ADD_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_S_MP_SUB_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_ADD_C
+| | | +--->BN_S_MP_ADD_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_S_MP_SUB_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_DIV_2D_C
+| | | +--->BN_MP_MOD_2D_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_RSHD_C
+| | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_EXCH_C
+| | +--->BN_MP_EXCH_C
+| | +--->BN_MP_CLEAR_MULTI_C
+| | +--->BN_MP_INIT_SIZE_C
+| | +--->BN_MP_INIT_COPY_C
+| | +--->BN_MP_LSHD_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_RSHD_C
+| | +--->BN_MP_RSHD_C
+| | +--->BN_MP_MUL_D_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_CLAMP_C
+| +--->BN_MP_EXCH_C
+| +--->BN_MP_ADD_C
+| | +--->BN_S_MP_ADD_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_CMP_MAG_C
+| | +--->BN_S_MP_SUB_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLAMP_C
++--->BN_MP_COPY_C
+| +--->BN_MP_GROW_C
++--->BN_MP_SQR_C
+| +--->BN_MP_TOOM_SQR_C
+| | +--->BN_MP_INIT_MULTI_C
+| | +--->BN_MP_MOD_2D_C
+| | | +--->BN_MP_ZERO_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_RSHD_C
+| | | +--->BN_MP_ZERO_C
+| | +--->BN_MP_MUL_2_C
+| | | +--->BN_MP_GROW_C
+| | +--->BN_MP_ADD_C
+| | | +--->BN_S_MP_ADD_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_CMP_MAG_C
+| | | +--->BN_S_MP_SUB_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_SUB_C
+| | | +--->BN_S_MP_ADD_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_CMP_MAG_C
+| | | +--->BN_S_MP_SUB_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_DIV_2_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_MUL_2D_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_LSHD_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_MUL_D_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_DIV_3_C
+| | | +--->BN_MP_INIT_SIZE_C
+| | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_EXCH_C
+| | +--->BN_MP_LSHD_C
+| | | +--->BN_MP_GROW_C
+| | +--->BN_MP_CLEAR_MULTI_C
+| +--->BN_MP_KARATSUBA_SQR_C
+| | +--->BN_MP_INIT_SIZE_C
+| | +--->BN_MP_CLAMP_C
+| | +--->BN_S_MP_ADD_C
+| | | +--->BN_MP_GROW_C
+| | +--->BN_S_MP_SUB_C
+| | | +--->BN_MP_GROW_C
+| | +--->BN_MP_LSHD_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_RSHD_C
+| | | | +--->BN_MP_ZERO_C
+| | +--->BN_MP_ADD_C
+| | | +--->BN_MP_CMP_MAG_C
+| +--->BN_FAST_S_MP_SQR_C
+| | +--->BN_MP_GROW_C
+| | +--->BN_MP_CLAMP_C
+| +--->BN_S_MP_SQR_C
+| | +--->BN_MP_INIT_SIZE_C
+| | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_EXCH_C
++--->BN_MP_MUL_C
+| +--->BN_MP_TOOM_MUL_C
+| | +--->BN_MP_INIT_MULTI_C
+| | +--->BN_MP_MOD_2D_C
+| | | +--->BN_MP_ZERO_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_RSHD_C
+| | | +--->BN_MP_ZERO_C
+| | +--->BN_MP_MUL_2_C
+| | | +--->BN_MP_GROW_C
+| | +--->BN_MP_ADD_C
+| | | +--->BN_S_MP_ADD_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_CMP_MAG_C
+| | | +--->BN_S_MP_SUB_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_SUB_C
+| | | +--->BN_S_MP_ADD_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_CMP_MAG_C
+| | | +--->BN_S_MP_SUB_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_DIV_2_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_MUL_2D_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_LSHD_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_MUL_D_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_DIV_3_C
+| | | +--->BN_MP_INIT_SIZE_C
+| | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_EXCH_C
+| | +--->BN_MP_LSHD_C
+| | | +--->BN_MP_GROW_C
+| | +--->BN_MP_CLEAR_MULTI_C
+| +--->BN_MP_KARATSUBA_MUL_C
+| | +--->BN_MP_INIT_SIZE_C
+| | +--->BN_MP_CLAMP_C
+| | +--->BN_S_MP_ADD_C
+| | | +--->BN_MP_GROW_C
+| | +--->BN_MP_ADD_C
+| | | +--->BN_MP_CMP_MAG_C
+| | | +--->BN_S_MP_SUB_C
+| | | | +--->BN_MP_GROW_C
+| | +--->BN_S_MP_SUB_C
+| | | +--->BN_MP_GROW_C
+| | +--->BN_MP_LSHD_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_RSHD_C
+| | | | +--->BN_MP_ZERO_C
+| +--->BN_FAST_S_MP_MUL_DIGS_C
+| | +--->BN_MP_GROW_C
+| | +--->BN_MP_CLAMP_C
+| +--->BN_S_MP_MUL_DIGS_C
+| | +--->BN_MP_INIT_SIZE_C
+| | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_EXCH_C
++--->BN_MP_EXCH_C
+
+
+BN_MP_MUL_D_C
++--->BN_MP_GROW_C
++--->BN_MP_CLAMP_C
+
+
+BN_MP_SET_LONG_LONG_C
+
+
+BN_MP_DIV_2_C
++--->BN_MP_GROW_C
++--->BN_MP_CLAMP_C
+
+
+BN_ERROR_C
+
+
+BN_MP_RAND_C
++--->BN_MP_ZERO_C
++--->BN_MP_ADD_D_C
+| +--->BN_MP_GROW_C
+| +--->BN_MP_SUB_D_C
+| | +--->BN_MP_CLAMP_C
+| +--->BN_MP_CLAMP_C
++--->BN_MP_LSHD_C
+| +--->BN_MP_GROW_C
+| +--->BN_MP_RSHD_C
+
+
+BN_S_MP_SQR_C
++--->BN_MP_INIT_SIZE_C
+| +--->BN_MP_INIT_C
++--->BN_MP_CLAMP_C
++--->BN_MP_EXCH_C
++--->BN_MP_CLEAR_C
+
+
+BN_MP_CMP_C
++--->BN_MP_CMP_MAG_C
+
+
+BN_MP_N_ROOT_EX_C
++--->BN_MP_INIT_C
++--->BN_MP_SET_C
+| +--->BN_MP_ZERO_C
++--->BN_MP_COPY_C
+| +--->BN_MP_GROW_C
++--->BN_MP_EXPT_D_EX_C
+| +--->BN_MP_INIT_COPY_C
+| | +--->BN_MP_INIT_SIZE_C
+| +--->BN_MP_MUL_C
+| | +--->BN_MP_TOOM_MUL_C
+| | | +--->BN_MP_INIT_MULTI_C
+| | | | +--->BN_MP_CLEAR_C
+| | | +--->BN_MP_MOD_2D_C
+| | | | +--->BN_MP_ZERO_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_RSHD_C
+| | | | +--->BN_MP_ZERO_C
+| | | +--->BN_MP_MUL_2_C
+| | | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_ADD_C
+| | | | +--->BN_S_MP_ADD_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_CMP_MAG_C
+| | | | +--->BN_S_MP_SUB_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_SUB_C
+| | | | +--->BN_S_MP_ADD_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_CMP_MAG_C
+| | | | +--->BN_S_MP_SUB_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_DIV_2_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_MUL_2D_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_LSHD_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_MUL_D_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_DIV_3_C
+| | | | +--->BN_MP_INIT_SIZE_C
+| | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_EXCH_C
+| | | | +--->BN_MP_CLEAR_C
+| | | +--->BN_MP_LSHD_C
+| | | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLEAR_MULTI_C
+| | | | +--->BN_MP_CLEAR_C
+| | +--->BN_MP_KARATSUBA_MUL_C
+| | | +--->BN_MP_INIT_SIZE_C
+| | | +--->BN_MP_CLAMP_C
+| | | +--->BN_S_MP_ADD_C
+| | | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_ADD_C
+| | | | +--->BN_MP_CMP_MAG_C
+| | | | +--->BN_S_MP_SUB_C
+| | | | | +--->BN_MP_GROW_C
+| | | +--->BN_S_MP_SUB_C
+| | | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_LSHD_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_RSHD_C
+| | | | | +--->BN_MP_ZERO_C
+| | | +--->BN_MP_CLEAR_C
+| | +--->BN_FAST_S_MP_MUL_DIGS_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_S_MP_MUL_DIGS_C
+| | | +--->BN_MP_INIT_SIZE_C
+| | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_EXCH_C
+| | | +--->BN_MP_CLEAR_C
+| +--->BN_MP_CLEAR_C
+| +--->BN_MP_SQR_C
+| | +--->BN_MP_TOOM_SQR_C
+| | | +--->BN_MP_INIT_MULTI_C
+| | | +--->BN_MP_MOD_2D_C
+| | | | +--->BN_MP_ZERO_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_RSHD_C
+| | | | +--->BN_MP_ZERO_C
+| | | +--->BN_MP_MUL_2_C
+| | | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_ADD_C
+| | | | +--->BN_S_MP_ADD_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_CMP_MAG_C
+| | | | +--->BN_S_MP_SUB_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_SUB_C
+| | | | +--->BN_S_MP_ADD_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_CMP_MAG_C
+| | | | +--->BN_S_MP_SUB_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_DIV_2_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_MUL_2D_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_LSHD_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_MUL_D_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_DIV_3_C
+| | | | +--->BN_MP_INIT_SIZE_C
+| | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_EXCH_C
+| | | +--->BN_MP_LSHD_C
+| | | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLEAR_MULTI_C
+| | +--->BN_MP_KARATSUBA_SQR_C
+| | | +--->BN_MP_INIT_SIZE_C
+| | | +--->BN_MP_CLAMP_C
+| | | +--->BN_S_MP_ADD_C
+| | | | +--->BN_MP_GROW_C
+| | | +--->BN_S_MP_SUB_C
+| | | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_LSHD_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_RSHD_C
+| | | | | +--->BN_MP_ZERO_C
+| | | +--->BN_MP_ADD_C
+| | | | +--->BN_MP_CMP_MAG_C
+| | +--->BN_FAST_S_MP_SQR_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_S_MP_SQR_C
+| | | +--->BN_MP_INIT_SIZE_C
+| | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_EXCH_C
++--->BN_MP_MUL_C
+| +--->BN_MP_TOOM_MUL_C
+| | +--->BN_MP_INIT_MULTI_C
+| | | +--->BN_MP_CLEAR_C
+| | +--->BN_MP_MOD_2D_C
+| | | +--->BN_MP_ZERO_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_RSHD_C
+| | | +--->BN_MP_ZERO_C
+| | +--->BN_MP_MUL_2_C
+| | | +--->BN_MP_GROW_C
+| | +--->BN_MP_ADD_C
+| | | +--->BN_S_MP_ADD_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_CMP_MAG_C
+| | | +--->BN_S_MP_SUB_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_SUB_C
+| | | +--->BN_S_MP_ADD_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_CMP_MAG_C
+| | | +--->BN_S_MP_SUB_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_DIV_2_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_MUL_2D_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_LSHD_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_MUL_D_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_DIV_3_C
+| | | +--->BN_MP_INIT_SIZE_C
+| | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_EXCH_C
+| | | +--->BN_MP_CLEAR_C
+| | +--->BN_MP_LSHD_C
+| | | +--->BN_MP_GROW_C
+| | +--->BN_MP_CLEAR_MULTI_C
+| | | +--->BN_MP_CLEAR_C
+| +--->BN_MP_KARATSUBA_MUL_C
+| | +--->BN_MP_INIT_SIZE_C
+| | +--->BN_MP_CLAMP_C
+| | +--->BN_S_MP_ADD_C
+| | | +--->BN_MP_GROW_C
+| | +--->BN_MP_ADD_C
+| | | +--->BN_MP_CMP_MAG_C
+| | | +--->BN_S_MP_SUB_C
+| | | | +--->BN_MP_GROW_C
+| | +--->BN_S_MP_SUB_C
+| | | +--->BN_MP_GROW_C
+| | +--->BN_MP_LSHD_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_RSHD_C
+| | | | +--->BN_MP_ZERO_C
+| | +--->BN_MP_CLEAR_C
+| +--->BN_FAST_S_MP_MUL_DIGS_C
+| | +--->BN_MP_GROW_C
+| | +--->BN_MP_CLAMP_C
+| +--->BN_S_MP_MUL_DIGS_C
+| | +--->BN_MP_INIT_SIZE_C
+| | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_EXCH_C
+| | +--->BN_MP_CLEAR_C
++--->BN_MP_SUB_C
+| +--->BN_S_MP_ADD_C
+| | +--->BN_MP_GROW_C
+| | +--->BN_MP_CLAMP_C
+| +--->BN_MP_CMP_MAG_C
+| +--->BN_S_MP_SUB_C
+| | +--->BN_MP_GROW_C
+| | +--->BN_MP_CLAMP_C
++--->BN_MP_MUL_D_C
+| +--->BN_MP_GROW_C
+| +--->BN_MP_CLAMP_C
++--->BN_MP_DIV_C
+| +--->BN_MP_CMP_MAG_C
+| +--->BN_MP_ZERO_C
+| +--->BN_MP_INIT_MULTI_C
+| | +--->BN_MP_CLEAR_C
+| +--->BN_MP_COUNT_BITS_C
+| +--->BN_MP_ABS_C
+| +--->BN_MP_MUL_2D_C
+| | +--->BN_MP_GROW_C
+| | +--->BN_MP_LSHD_C
+| | | +--->BN_MP_RSHD_C
+| | +--->BN_MP_CLAMP_C
+| +--->BN_MP_CMP_C
+| +--->BN_MP_ADD_C
+| | +--->BN_S_MP_ADD_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_S_MP_SUB_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLAMP_C
+| +--->BN_MP_DIV_2D_C
+| | +--->BN_MP_MOD_2D_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_CLEAR_C
+| | +--->BN_MP_RSHD_C
+| | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_EXCH_C
+| +--->BN_MP_EXCH_C
+| +--->BN_MP_CLEAR_MULTI_C
+| | +--->BN_MP_CLEAR_C
+| +--->BN_MP_INIT_SIZE_C
+| +--->BN_MP_INIT_COPY_C
+| +--->BN_MP_LSHD_C
+| | +--->BN_MP_GROW_C
+| | +--->BN_MP_RSHD_C
+| +--->BN_MP_RSHD_C
+| +--->BN_MP_CLAMP_C
+| +--->BN_MP_CLEAR_C
++--->BN_MP_CMP_C
+| +--->BN_MP_CMP_MAG_C
++--->BN_MP_SUB_D_C
+| +--->BN_MP_GROW_C
+| +--->BN_MP_ADD_D_C
+| | +--->BN_MP_CLAMP_C
+| +--->BN_MP_CLAMP_C
++--->BN_MP_EXCH_C
++--->BN_MP_CLEAR_C
+
+
+BN_MP_PRIME_IS_DIVISIBLE_C
++--->BN_MP_MOD_D_C
+| +--->BN_MP_DIV_D_C
+| | +--->BN_MP_COPY_C
+| | | +--->BN_MP_GROW_C
+| | +--->BN_MP_DIV_2D_C
+| | | +--->BN_MP_ZERO_C
+| | | +--->BN_MP_INIT_C
+| | | +--->BN_MP_MOD_2D_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_CLEAR_C
+| | | +--->BN_MP_RSHD_C
+| | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_EXCH_C
+| | +--->BN_MP_DIV_3_C
+| | | +--->BN_MP_INIT_SIZE_C
+| | | | +--->BN_MP_INIT_C
+| | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_EXCH_C
+| | | +--->BN_MP_CLEAR_C
+| | +--->BN_MP_INIT_SIZE_C
+| | | +--->BN_MP_INIT_C
+| | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_EXCH_C
+| | +--->BN_MP_CLEAR_C
+
+
+BN_MP_INIT_SET_INT_C
++--->BN_MP_INIT_C
++--->BN_MP_SET_INT_C
+| +--->BN_MP_ZERO_C
+| +--->BN_MP_MUL_2D_C
+| | +--->BN_MP_COPY_C
+| | | +--->BN_MP_GROW_C
+| | +--->BN_MP_GROW_C
+| | +--->BN_MP_LSHD_C
+| | | +--->BN_MP_RSHD_C
+| | +--->BN_MP_CLAMP_C
+| +--->BN_MP_CLAMP_C
+
+
+BN_MP_DIV_3_C
++--->BN_MP_INIT_SIZE_C
+| +--->BN_MP_INIT_C
++--->BN_MP_CLAMP_C
++--->BN_MP_EXCH_C
++--->BN_MP_CLEAR_C
+
+
+BN_MP_MONTGOMERY_REDUCE_C
++--->BN_FAST_MP_MONTGOMERY_REDUCE_C
+| +--->BN_MP_GROW_C
+| +--->BN_MP_RSHD_C
+| | +--->BN_MP_ZERO_C
+| +--->BN_MP_CLAMP_C
+| +--->BN_MP_CMP_MAG_C
+| +--->BN_S_MP_SUB_C
++--->BN_MP_GROW_C
++--->BN_MP_CLAMP_C
++--->BN_MP_RSHD_C
+| +--->BN_MP_ZERO_C
++--->BN_MP_CMP_MAG_C
++--->BN_S_MP_SUB_C
+
+
+BN_MP_INVMOD_SLOW_C
++--->BN_MP_INIT_MULTI_C
+| +--->BN_MP_INIT_C
+| +--->BN_MP_CLEAR_C
++--->BN_MP_MOD_C
+| +--->BN_MP_INIT_C
+| +--->BN_MP_DIV_C
+| | +--->BN_MP_CMP_MAG_C
+| | +--->BN_MP_COPY_C
+| | | +--->BN_MP_GROW_C
+| | +--->BN_MP_ZERO_C
+| | +--->BN_MP_SET_C
+| | +--->BN_MP_COUNT_BITS_C
+| | +--->BN_MP_ABS_C
+| | +--->BN_MP_MUL_2D_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_LSHD_C
+| | | | +--->BN_MP_RSHD_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_CMP_C
+| | +--->BN_MP_SUB_C
+| | | +--->BN_S_MP_ADD_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_S_MP_SUB_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_ADD_C
+| | | +--->BN_S_MP_ADD_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_S_MP_SUB_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_DIV_2D_C
+| | | +--->BN_MP_MOD_2D_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_CLEAR_C
+| | | +--->BN_MP_RSHD_C
+| | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_EXCH_C
+| | +--->BN_MP_EXCH_C
+| | +--->BN_MP_CLEAR_MULTI_C
+| | | +--->BN_MP_CLEAR_C
+| | +--->BN_MP_INIT_SIZE_C
+| | +--->BN_MP_INIT_COPY_C
+| | +--->BN_MP_LSHD_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_RSHD_C
+| | +--->BN_MP_RSHD_C
+| | +--->BN_MP_MUL_D_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_CLEAR_C
+| +--->BN_MP_CLEAR_C
+| +--->BN_MP_EXCH_C
+| +--->BN_MP_ADD_C
+| | +--->BN_S_MP_ADD_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_CMP_MAG_C
+| | +--->BN_S_MP_SUB_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLAMP_C
++--->BN_MP_COPY_C
+| +--->BN_MP_GROW_C
++--->BN_MP_SET_C
+| +--->BN_MP_ZERO_C
++--->BN_MP_DIV_2_C
+| +--->BN_MP_GROW_C
+| +--->BN_MP_CLAMP_C
++--->BN_MP_ADD_C
+| +--->BN_S_MP_ADD_C
+| | +--->BN_MP_GROW_C
+| | +--->BN_MP_CLAMP_C
+| +--->BN_MP_CMP_MAG_C
+| +--->BN_S_MP_SUB_C
+| | +--->BN_MP_GROW_C
+| | +--->BN_MP_CLAMP_C
++--->BN_MP_SUB_C
+| +--->BN_S_MP_ADD_C
+| | +--->BN_MP_GROW_C
+| | +--->BN_MP_CLAMP_C
+| +--->BN_MP_CMP_MAG_C
+| +--->BN_S_MP_SUB_C
+| | +--->BN_MP_GROW_C
+| | +--->BN_MP_CLAMP_C
++--->BN_MP_CMP_C
+| +--->BN_MP_CMP_MAG_C
++--->BN_MP_CMP_D_C
++--->BN_MP_CMP_MAG_C
++--->BN_MP_EXCH_C
++--->BN_MP_CLEAR_MULTI_C
+| +--->BN_MP_CLEAR_C
+
+
+BN_S_MP_ADD_C
++--->BN_MP_GROW_C
++--->BN_MP_CLAMP_C
+
+
+BN_MP_READ_SIGNED_BIN_C
++--->BN_MP_READ_UNSIGNED_BIN_C
+| +--->BN_MP_GROW_C
+| +--->BN_MP_ZERO_C
+| +--->BN_MP_MUL_2D_C
+| | +--->BN_MP_COPY_C
+| | +--->BN_MP_LSHD_C
+| | | +--->BN_MP_RSHD_C
+| | +--->BN_MP_CLAMP_C
+| +--->BN_MP_CLAMP_C
+
+
+BN_MP_MOD_D_C
++--->BN_MP_DIV_D_C
+| +--->BN_MP_COPY_C
+| | +--->BN_MP_GROW_C
+| +--->BN_MP_DIV_2D_C
+| | +--->BN_MP_ZERO_C
+| | +--->BN_MP_INIT_C
+| | +--->BN_MP_MOD_2D_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_CLEAR_C
+| | +--->BN_MP_RSHD_C
+| | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_EXCH_C
+| +--->BN_MP_DIV_3_C
+| | +--->BN_MP_INIT_SIZE_C
+| | | +--->BN_MP_INIT_C
+| | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_EXCH_C
+| | +--->BN_MP_CLEAR_C
+| +--->BN_MP_INIT_SIZE_C
+| | +--->BN_MP_INIT_C
+| +--->BN_MP_CLAMP_C
+| +--->BN_MP_EXCH_C
+| +--->BN_MP_CLEAR_C
+
+
+BN_MP_SQRTMOD_PRIME_C
++--->BN_MP_CMP_D_C
++--->BN_MP_ZERO_C
++--->BN_MP_JACOBI_C
+| +--->BN_MP_INIT_COPY_C
+| | +--->BN_MP_INIT_SIZE_C
+| | +--->BN_MP_COPY_C
+| | | +--->BN_MP_GROW_C
+| +--->BN_MP_CNT_LSB_C
+| +--->BN_MP_DIV_2D_C
+| | +--->BN_MP_COPY_C
+| | | +--->BN_MP_GROW_C
+| | +--->BN_MP_MOD_2D_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_CLEAR_C
+| | +--->BN_MP_RSHD_C
+| | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_EXCH_C
+| +--->BN_MP_MOD_C
+| | +--->BN_MP_DIV_C
+| | | +--->BN_MP_CMP_MAG_C
+| | | +--->BN_MP_COPY_C
+| | | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_INIT_MULTI_C
+| | | | +--->BN_MP_CLEAR_C
+| | | +--->BN_MP_SET_C
+| | | +--->BN_MP_COUNT_BITS_C
+| | | +--->BN_MP_ABS_C
+| | | +--->BN_MP_MUL_2D_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_LSHD_C
+| | | | | +--->BN_MP_RSHD_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_CMP_C
+| | | +--->BN_MP_SUB_C
+| | | | +--->BN_S_MP_ADD_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_S_MP_SUB_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_ADD_C
+| | | | +--->BN_S_MP_ADD_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_S_MP_SUB_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_EXCH_C
+| | | +--->BN_MP_CLEAR_MULTI_C
+| | | | +--->BN_MP_CLEAR_C
+| | | +--->BN_MP_INIT_SIZE_C
+| | | +--->BN_MP_LSHD_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_RSHD_C
+| | | +--->BN_MP_RSHD_C
+| | | +--->BN_MP_MUL_D_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_CLEAR_C
+| | +--->BN_MP_CLEAR_C
+| | +--->BN_MP_EXCH_C
+| | +--->BN_MP_ADD_C
+| | | +--->BN_S_MP_ADD_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_CMP_MAG_C
+| | | +--->BN_S_MP_SUB_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| +--->BN_MP_CLEAR_C
++--->BN_MP_INIT_MULTI_C
+| +--->BN_MP_INIT_C
+| +--->BN_MP_CLEAR_C
++--->BN_MP_MOD_D_C
+| +--->BN_MP_DIV_D_C
+| | +--->BN_MP_COPY_C
+| | | +--->BN_MP_GROW_C
+| | +--->BN_MP_DIV_2D_C
+| | | +--->BN_MP_INIT_C
+| | | +--->BN_MP_MOD_2D_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_CLEAR_C
+| | | +--->BN_MP_RSHD_C
+| | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_EXCH_C
+| | +--->BN_MP_DIV_3_C
+| | | +--->BN_MP_INIT_SIZE_C
+| | | | +--->BN_MP_INIT_C
+| | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_EXCH_C
+| | | +--->BN_MP_CLEAR_C
+| | +--->BN_MP_INIT_SIZE_C
+| | | +--->BN_MP_INIT_C
+| | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_EXCH_C
+| | +--->BN_MP_CLEAR_C
++--->BN_MP_ADD_D_C
+| +--->BN_MP_GROW_C
+| +--->BN_MP_SUB_D_C
+| | +--->BN_MP_CLAMP_C
+| +--->BN_MP_CLAMP_C
++--->BN_MP_DIV_2_C
+| +--->BN_MP_GROW_C
+| +--->BN_MP_CLAMP_C
++--->BN_MP_EXPTMOD_C
+| +--->BN_MP_INIT_C
+| +--->BN_MP_INVMOD_C
+| | +--->BN_FAST_MP_INVMOD_C
+| | | +--->BN_MP_COPY_C
+| | | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_MOD_C
+| | | | +--->BN_MP_DIV_C
+| | | | | +--->BN_MP_CMP_MAG_C
+| | | | | +--->BN_MP_SET_C
+| | | | | +--->BN_MP_COUNT_BITS_C
+| | | | | +--->BN_MP_ABS_C
+| | | | | +--->BN_MP_MUL_2D_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_LSHD_C
+| | | | | | | +--->BN_MP_RSHD_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_CMP_C
+| | | | | +--->BN_MP_SUB_C
+| | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_ADD_C
+| | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_DIV_2D_C
+| | | | | | +--->BN_MP_MOD_2D_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_CLEAR_C
+| | | | | | +--->BN_MP_RSHD_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_EXCH_C
+| | | | | +--->BN_MP_EXCH_C
+| | | | | +--->BN_MP_CLEAR_MULTI_C
+| | | | | | +--->BN_MP_CLEAR_C
+| | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | +--->BN_MP_INIT_COPY_C
+| | | | | +--->BN_MP_LSHD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_RSHD_C
+| | | | | +--->BN_MP_RSHD_C
+| | | | | +--->BN_MP_MUL_D_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_CLEAR_C
+| | | | +--->BN_MP_CLEAR_C
+| | | | +--->BN_MP_EXCH_C
+| | | | +--->BN_MP_ADD_C
+| | | | | +--->BN_S_MP_ADD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_CMP_MAG_C
+| | | | | +--->BN_S_MP_SUB_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_SET_C
+| | | +--->BN_MP_SUB_C
+| | | | +--->BN_S_MP_ADD_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_CMP_MAG_C
+| | | | +--->BN_S_MP_SUB_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_CMP_C
+| | | | +--->BN_MP_CMP_MAG_C
+| | | +--->BN_MP_ADD_C
+| | | | +--->BN_S_MP_ADD_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_CMP_MAG_C
+| | | | +--->BN_S_MP_SUB_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_EXCH_C
+| | | +--->BN_MP_CLEAR_MULTI_C
+| | | | +--->BN_MP_CLEAR_C
+| | +--->BN_MP_INVMOD_SLOW_C
+| | | +--->BN_MP_MOD_C
+| | | | +--->BN_MP_DIV_C
+| | | | | +--->BN_MP_CMP_MAG_C
+| | | | | +--->BN_MP_COPY_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_SET_C
+| | | | | +--->BN_MP_COUNT_BITS_C
+| | | | | +--->BN_MP_ABS_C
+| | | | | +--->BN_MP_MUL_2D_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_LSHD_C
+| | | | | | | +--->BN_MP_RSHD_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_CMP_C
+| | | | | +--->BN_MP_SUB_C
+| | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_ADD_C
+| | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_DIV_2D_C
+| | | | | | +--->BN_MP_MOD_2D_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_CLEAR_C
+| | | | | | +--->BN_MP_RSHD_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_EXCH_C
+| | | | | +--->BN_MP_EXCH_C
+| | | | | +--->BN_MP_CLEAR_MULTI_C
+| | | | | | +--->BN_MP_CLEAR_C
+| | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | +--->BN_MP_INIT_COPY_C
+| | | | | +--->BN_MP_LSHD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_RSHD_C
+| | | | | +--->BN_MP_RSHD_C
+| | | | | +--->BN_MP_MUL_D_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_CLEAR_C
+| | | | +--->BN_MP_CLEAR_C
+| | | | +--->BN_MP_EXCH_C
+| | | | +--->BN_MP_ADD_C
+| | | | | +--->BN_S_MP_ADD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_CMP_MAG_C
+| | | | | +--->BN_S_MP_SUB_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_COPY_C
+| | | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_SET_C
+| | | +--->BN_MP_ADD_C
+| | | | +--->BN_S_MP_ADD_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_CMP_MAG_C
+| | | | +--->BN_S_MP_SUB_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_SUB_C
+| | | | +--->BN_S_MP_ADD_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_CMP_MAG_C
+| | | | +--->BN_S_MP_SUB_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_CMP_C
+| | | | +--->BN_MP_CMP_MAG_C
+| | | +--->BN_MP_CMP_MAG_C
+| | | +--->BN_MP_EXCH_C
+| | | +--->BN_MP_CLEAR_MULTI_C
+| | | | +--->BN_MP_CLEAR_C
+| +--->BN_MP_CLEAR_C
+| +--->BN_MP_ABS_C
+| | +--->BN_MP_COPY_C
+| | | +--->BN_MP_GROW_C
+| +--->BN_MP_CLEAR_MULTI_C
+| +--->BN_MP_REDUCE_IS_2K_L_C
+| +--->BN_S_MP_EXPTMOD_C
+| | +--->BN_MP_COUNT_BITS_C
+| | +--->BN_MP_REDUCE_SETUP_C
+| | | +--->BN_MP_2EXPT_C
+| | | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_DIV_C
+| | | | +--->BN_MP_CMP_MAG_C
+| | | | +--->BN_MP_COPY_C
+| | | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_SET_C
+| | | | +--->BN_MP_MUL_2D_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_LSHD_C
+| | | | | | +--->BN_MP_RSHD_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_CMP_C
+| | | | +--->BN_MP_SUB_C
+| | | | | +--->BN_S_MP_ADD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_S_MP_SUB_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_ADD_C
+| | | | | +--->BN_S_MP_ADD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_S_MP_SUB_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_DIV_2D_C
+| | | | | +--->BN_MP_MOD_2D_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_RSHD_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_EXCH_C
+| | | | +--->BN_MP_EXCH_C
+| | | | +--->BN_MP_INIT_SIZE_C
+| | | | +--->BN_MP_INIT_COPY_C
+| | | | +--->BN_MP_LSHD_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_RSHD_C
+| | | | +--->BN_MP_RSHD_C
+| | | | +--->BN_MP_MUL_D_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_REDUCE_C
+| | | +--->BN_MP_INIT_COPY_C
+| | | | +--->BN_MP_INIT_SIZE_C
+| | | | +--->BN_MP_COPY_C
+| | | | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_RSHD_C
+| | | +--->BN_MP_MUL_C
+| | | | +--->BN_MP_TOOM_MUL_C
+| | | | | +--->BN_MP_MOD_2D_C
+| | | | | | +--->BN_MP_COPY_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_COPY_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_MUL_2_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_ADD_C
+| | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_CMP_MAG_C
+| | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_SUB_C
+| | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_CMP_MAG_C
+| | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_MUL_2D_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_LSHD_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_MUL_D_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_DIV_3_C
+| | | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_EXCH_C
+| | | | | +--->BN_MP_LSHD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_KARATSUBA_MUL_C
+| | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_S_MP_ADD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_ADD_C
+| | | | | | +--->BN_MP_CMP_MAG_C
+| | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_S_MP_SUB_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_LSHD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | +--->BN_FAST_S_MP_MUL_DIGS_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_S_MP_MUL_DIGS_C
+| | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_EXCH_C
+| | | +--->BN_S_MP_MUL_HIGH_DIGS_C
+| | | | +--->BN_FAST_S_MP_MUL_HIGH_DIGS_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_INIT_SIZE_C
+| | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_EXCH_C
+| | | +--->BN_FAST_S_MP_MUL_HIGH_DIGS_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_MOD_2D_C
+| | | | +--->BN_MP_COPY_C
+| | | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_S_MP_MUL_DIGS_C
+| | | | +--->BN_FAST_S_MP_MUL_DIGS_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_INIT_SIZE_C
+| | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_EXCH_C
+| | | +--->BN_MP_SUB_C
+| | | | +--->BN_S_MP_ADD_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_CMP_MAG_C
+| | | | +--->BN_S_MP_SUB_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_SET_C
+| | | +--->BN_MP_LSHD_C
+| | | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_ADD_C
+| | | | +--->BN_S_MP_ADD_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_CMP_MAG_C
+| | | | +--->BN_S_MP_SUB_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_CMP_C
+| | | | +--->BN_MP_CMP_MAG_C
+| | | +--->BN_S_MP_SUB_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_REDUCE_2K_SETUP_L_C
+| | | +--->BN_MP_2EXPT_C
+| | | | +--->BN_MP_GROW_C
+| | | +--->BN_S_MP_SUB_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_REDUCE_2K_L_C
+| | | +--->BN_MP_DIV_2D_C
+| | | | +--->BN_MP_COPY_C
+| | | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_MOD_2D_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_RSHD_C
+| | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_EXCH_C
+| | | +--->BN_MP_MUL_C
+| | | | +--->BN_MP_TOOM_MUL_C
+| | | | | +--->BN_MP_MOD_2D_C
+| | | | | | +--->BN_MP_COPY_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_COPY_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_RSHD_C
+| | | | | +--->BN_MP_MUL_2_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_ADD_C
+| | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_CMP_MAG_C
+| | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_SUB_C
+| | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_CMP_MAG_C
+| | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_MUL_2D_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_LSHD_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_MUL_D_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_DIV_3_C
+| | | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_EXCH_C
+| | | | | +--->BN_MP_LSHD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_KARATSUBA_MUL_C
+| | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_S_MP_ADD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_ADD_C
+| | | | | | +--->BN_MP_CMP_MAG_C
+| | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_S_MP_SUB_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_LSHD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_RSHD_C
+| | | | +--->BN_FAST_S_MP_MUL_DIGS_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_S_MP_MUL_DIGS_C
+| | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_EXCH_C
+| | | +--->BN_S_MP_ADD_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_CMP_MAG_C
+| | | +--->BN_S_MP_SUB_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_MOD_C
+| | | +--->BN_MP_DIV_C
+| | | | +--->BN_MP_CMP_MAG_C
+| | | | +--->BN_MP_COPY_C
+| | | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_SET_C
+| | | | +--->BN_MP_MUL_2D_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_LSHD_C
+| | | | | | +--->BN_MP_RSHD_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_CMP_C
+| | | | +--->BN_MP_SUB_C
+| | | | | +--->BN_S_MP_ADD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_S_MP_SUB_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_ADD_C
+| | | | | +--->BN_S_MP_ADD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_S_MP_SUB_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_DIV_2D_C
+| | | | | +--->BN_MP_MOD_2D_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_RSHD_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_EXCH_C
+| | | | +--->BN_MP_EXCH_C
+| | | | +--->BN_MP_INIT_SIZE_C
+| | | | +--->BN_MP_INIT_COPY_C
+| | | | +--->BN_MP_LSHD_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_RSHD_C
+| | | | +--->BN_MP_RSHD_C
+| | | | +--->BN_MP_MUL_D_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_EXCH_C
+| | | +--->BN_MP_ADD_C
+| | | | +--->BN_S_MP_ADD_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_CMP_MAG_C
+| | | | +--->BN_S_MP_SUB_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_COPY_C
+| | | +--->BN_MP_GROW_C
+| | +--->BN_MP_SQR_C
+| | | +--->BN_MP_TOOM_SQR_C
+| | | | +--->BN_MP_MOD_2D_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_RSHD_C
+| | | | +--->BN_MP_MUL_2_C
+| | | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_ADD_C
+| | | | | +--->BN_S_MP_ADD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_CMP_MAG_C
+| | | | | +--->BN_S_MP_SUB_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_SUB_C
+| | | | | +--->BN_S_MP_ADD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_CMP_MAG_C
+| | | | | +--->BN_S_MP_SUB_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_MUL_2D_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_LSHD_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_MUL_D_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_DIV_3_C
+| | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_EXCH_C
+| | | | +--->BN_MP_LSHD_C
+| | | | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_KARATSUBA_SQR_C
+| | | | +--->BN_MP_INIT_SIZE_C
+| | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_S_MP_ADD_C
+| | | | | +--->BN_MP_GROW_C
+| | | | +--->BN_S_MP_SUB_C
+| | | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_LSHD_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_RSHD_C
+| | | | +--->BN_MP_ADD_C
+| | | | | +--->BN_MP_CMP_MAG_C
+| | | +--->BN_FAST_S_MP_SQR_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_S_MP_SQR_C
+| | | | +--->BN_MP_INIT_SIZE_C
+| | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_EXCH_C
+| | +--->BN_MP_MUL_C
+| | | +--->BN_MP_TOOM_MUL_C
+| | | | +--->BN_MP_MOD_2D_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_RSHD_C
+| | | | +--->BN_MP_MUL_2_C
+| | | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_ADD_C
+| | | | | +--->BN_S_MP_ADD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_CMP_MAG_C
+| | | | | +--->BN_S_MP_SUB_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_SUB_C
+| | | | | +--->BN_S_MP_ADD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_CMP_MAG_C
+| | | | | +--->BN_S_MP_SUB_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_MUL_2D_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_LSHD_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_MUL_D_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_DIV_3_C
+| | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_EXCH_C
+| | | | +--->BN_MP_LSHD_C
+| | | | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_KARATSUBA_MUL_C
+| | | | +--->BN_MP_INIT_SIZE_C
+| | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_S_MP_ADD_C
+| | | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_ADD_C
+| | | | | +--->BN_MP_CMP_MAG_C
+| | | | | +--->BN_S_MP_SUB_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | +--->BN_S_MP_SUB_C
+| | | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_LSHD_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_RSHD_C
+| | | +--->BN_FAST_S_MP_MUL_DIGS_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_S_MP_MUL_DIGS_C
+| | | | +--->BN_MP_INIT_SIZE_C
+| | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_EXCH_C
+| | +--->BN_MP_SET_C
+| | +--->BN_MP_EXCH_C
+| +--->BN_MP_DR_IS_MODULUS_C
+| +--->BN_MP_REDUCE_IS_2K_C
+| | +--->BN_MP_REDUCE_2K_C
+| | | +--->BN_MP_COUNT_BITS_C
+| | | +--->BN_MP_DIV_2D_C
+| | | | +--->BN_MP_COPY_C
+| | | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_MOD_2D_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_RSHD_C
+| | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_EXCH_C
+| | | +--->BN_MP_MUL_D_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_S_MP_ADD_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_CMP_MAG_C
+| | | +--->BN_S_MP_SUB_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_COUNT_BITS_C
+| +--->BN_MP_EXPTMOD_FAST_C
+| | +--->BN_MP_COUNT_BITS_C
+| | +--->BN_MP_MONTGOMERY_SETUP_C
+| | +--->BN_FAST_MP_MONTGOMERY_REDUCE_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_RSHD_C
+| | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_CMP_MAG_C
+| | | +--->BN_S_MP_SUB_C
+| | +--->BN_MP_MONTGOMERY_REDUCE_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_RSHD_C
+| | | +--->BN_MP_CMP_MAG_C
+| | | +--->BN_S_MP_SUB_C
+| | +--->BN_MP_DR_SETUP_C
+| | +--->BN_MP_DR_REDUCE_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_CMP_MAG_C
+| | | +--->BN_S_MP_SUB_C
+| | +--->BN_MP_REDUCE_2K_SETUP_C
+| | | +--->BN_MP_2EXPT_C
+| | | | +--->BN_MP_GROW_C
+| | | +--->BN_S_MP_SUB_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_REDUCE_2K_C
+| | | +--->BN_MP_DIV_2D_C
+| | | | +--->BN_MP_COPY_C
+| | | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_MOD_2D_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_RSHD_C
+| | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_EXCH_C
+| | | +--->BN_MP_MUL_D_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_S_MP_ADD_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_CMP_MAG_C
+| | | +--->BN_S_MP_SUB_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_MONTGOMERY_CALC_NORMALIZATION_C
+| | | +--->BN_MP_2EXPT_C
+| | | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_SET_C
+| | | +--->BN_MP_MUL_2_C
+| | | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CMP_MAG_C
+| | | +--->BN_S_MP_SUB_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_MULMOD_C
+| | | +--->BN_MP_MUL_C
+| | | | +--->BN_MP_TOOM_MUL_C
+| | | | | +--->BN_MP_MOD_2D_C
+| | | | | | +--->BN_MP_COPY_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_COPY_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_RSHD_C
+| | | | | +--->BN_MP_MUL_2_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_ADD_C
+| | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_CMP_MAG_C
+| | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_SUB_C
+| | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_CMP_MAG_C
+| | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_MUL_2D_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_LSHD_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_MUL_D_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_DIV_3_C
+| | | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_EXCH_C
+| | | | | +--->BN_MP_LSHD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_KARATSUBA_MUL_C
+| | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_S_MP_ADD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_ADD_C
+| | | | | | +--->BN_MP_CMP_MAG_C
+| | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_S_MP_SUB_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_LSHD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_RSHD_C
+| | | | +--->BN_FAST_S_MP_MUL_DIGS_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_S_MP_MUL_DIGS_C
+| | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_EXCH_C
+| | | +--->BN_MP_MOD_C
+| | | | +--->BN_MP_DIV_C
+| | | | | +--->BN_MP_CMP_MAG_C
+| | | | | +--->BN_MP_COPY_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_SET_C
+| | | | | +--->BN_MP_MUL_2D_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_LSHD_C
+| | | | | | | +--->BN_MP_RSHD_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_CMP_C
+| | | | | +--->BN_MP_SUB_C
+| | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_ADD_C
+| | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_DIV_2D_C
+| | | | | | +--->BN_MP_MOD_2D_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_RSHD_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_EXCH_C
+| | | | | +--->BN_MP_EXCH_C
+| | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | +--->BN_MP_INIT_COPY_C
+| | | | | +--->BN_MP_LSHD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_RSHD_C
+| | | | | +--->BN_MP_RSHD_C
+| | | | | +--->BN_MP_MUL_D_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_EXCH_C
+| | | | +--->BN_MP_ADD_C
+| | | | | +--->BN_S_MP_ADD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_CMP_MAG_C
+| | | | | +--->BN_S_MP_SUB_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_SET_C
+| | +--->BN_MP_MOD_C
+| | | +--->BN_MP_DIV_C
+| | | | +--->BN_MP_CMP_MAG_C
+| | | | +--->BN_MP_COPY_C
+| | | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_MUL_2D_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_LSHD_C
+| | | | | | +--->BN_MP_RSHD_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_CMP_C
+| | | | +--->BN_MP_SUB_C
+| | | | | +--->BN_S_MP_ADD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_S_MP_SUB_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_ADD_C
+| | | | | +--->BN_S_MP_ADD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_S_MP_SUB_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_DIV_2D_C
+| | | | | +--->BN_MP_MOD_2D_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_RSHD_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_EXCH_C
+| | | | +--->BN_MP_EXCH_C
+| | | | +--->BN_MP_INIT_SIZE_C
+| | | | +--->BN_MP_INIT_COPY_C
+| | | | +--->BN_MP_LSHD_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_RSHD_C
+| | | | +--->BN_MP_RSHD_C
+| | | | +--->BN_MP_MUL_D_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_EXCH_C
+| | | +--->BN_MP_ADD_C
+| | | | +--->BN_S_MP_ADD_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_CMP_MAG_C
+| | | | +--->BN_S_MP_SUB_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_COPY_C
+| | | +--->BN_MP_GROW_C
+| | +--->BN_MP_SQR_C
+| | | +--->BN_MP_TOOM_SQR_C
+| | | | +--->BN_MP_MOD_2D_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_RSHD_C
+| | | | +--->BN_MP_MUL_2_C
+| | | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_ADD_C
+| | | | | +--->BN_S_MP_ADD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_CMP_MAG_C
+| | | | | +--->BN_S_MP_SUB_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_SUB_C
+| | | | | +--->BN_S_MP_ADD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_CMP_MAG_C
+| | | | | +--->BN_S_MP_SUB_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_MUL_2D_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_LSHD_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_MUL_D_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_DIV_3_C
+| | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_EXCH_C
+| | | | +--->BN_MP_LSHD_C
+| | | | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_KARATSUBA_SQR_C
+| | | | +--->BN_MP_INIT_SIZE_C
+| | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_S_MP_ADD_C
+| | | | | +--->BN_MP_GROW_C
+| | | | +--->BN_S_MP_SUB_C
+| | | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_LSHD_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_RSHD_C
+| | | | +--->BN_MP_ADD_C
+| | | | | +--->BN_MP_CMP_MAG_C
+| | | +--->BN_FAST_S_MP_SQR_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_S_MP_SQR_C
+| | | | +--->BN_MP_INIT_SIZE_C
+| | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_EXCH_C
+| | +--->BN_MP_MUL_C
+| | | +--->BN_MP_TOOM_MUL_C
+| | | | +--->BN_MP_MOD_2D_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_RSHD_C
+| | | | +--->BN_MP_MUL_2_C
+| | | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_ADD_C
+| | | | | +--->BN_S_MP_ADD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_CMP_MAG_C
+| | | | | +--->BN_S_MP_SUB_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_SUB_C
+| | | | | +--->BN_S_MP_ADD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_CMP_MAG_C
+| | | | | +--->BN_S_MP_SUB_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_MUL_2D_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_LSHD_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_MUL_D_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_DIV_3_C
+| | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_EXCH_C
+| | | | +--->BN_MP_LSHD_C
+| | | | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_KARATSUBA_MUL_C
+| | | | +--->BN_MP_INIT_SIZE_C
+| | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_S_MP_ADD_C
+| | | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_ADD_C
+| | | | | +--->BN_MP_CMP_MAG_C
+| | | | | +--->BN_S_MP_SUB_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | +--->BN_S_MP_SUB_C
+| | | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_LSHD_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_RSHD_C
+| | | +--->BN_FAST_S_MP_MUL_DIGS_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_S_MP_MUL_DIGS_C
+| | | | +--->BN_MP_INIT_SIZE_C
+| | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_EXCH_C
+| | +--->BN_MP_EXCH_C
++--->BN_MP_COPY_C
+| +--->BN_MP_GROW_C
++--->BN_MP_SUB_D_C
+| +--->BN_MP_GROW_C
+| +--->BN_MP_CLAMP_C
++--->BN_MP_SET_INT_C
+| +--->BN_MP_MUL_2D_C
+| | +--->BN_MP_GROW_C
+| | +--->BN_MP_LSHD_C
+| | | +--->BN_MP_RSHD_C
+| | +--->BN_MP_CLAMP_C
+| +--->BN_MP_CLAMP_C
++--->BN_MP_SQRMOD_C
+| +--->BN_MP_INIT_C
+| +--->BN_MP_SQR_C
+| | +--->BN_MP_TOOM_SQR_C
+| | | +--->BN_MP_MOD_2D_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_RSHD_C
+| | | +--->BN_MP_MUL_2_C
+| | | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_ADD_C
+| | | | +--->BN_S_MP_ADD_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_CMP_MAG_C
+| | | | +--->BN_S_MP_SUB_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_SUB_C
+| | | | +--->BN_S_MP_ADD_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_CMP_MAG_C
+| | | | +--->BN_S_MP_SUB_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_MUL_2D_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_LSHD_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_MUL_D_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_DIV_3_C
+| | | | +--->BN_MP_INIT_SIZE_C
+| | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_EXCH_C
+| | | | +--->BN_MP_CLEAR_C
+| | | +--->BN_MP_LSHD_C
+| | | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLEAR_MULTI_C
+| | | | +--->BN_MP_CLEAR_C
+| | +--->BN_MP_KARATSUBA_SQR_C
+| | | +--->BN_MP_INIT_SIZE_C
+| | | +--->BN_MP_CLAMP_C
+| | | +--->BN_S_MP_ADD_C
+| | | | +--->BN_MP_GROW_C
+| | | +--->BN_S_MP_SUB_C
+| | | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_LSHD_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_RSHD_C
+| | | +--->BN_MP_ADD_C
+| | | | +--->BN_MP_CMP_MAG_C
+| | | +--->BN_MP_CLEAR_C
+| | +--->BN_FAST_S_MP_SQR_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_S_MP_SQR_C
+| | | +--->BN_MP_INIT_SIZE_C
+| | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_EXCH_C
+| | | +--->BN_MP_CLEAR_C
+| +--->BN_MP_CLEAR_C
+| +--->BN_MP_MOD_C
+| | +--->BN_MP_DIV_C
+| | | +--->BN_MP_CMP_MAG_C
+| | | +--->BN_MP_SET_C
+| | | +--->BN_MP_COUNT_BITS_C
+| | | +--->BN_MP_ABS_C
+| | | +--->BN_MP_MUL_2D_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_LSHD_C
+| | | | | +--->BN_MP_RSHD_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_CMP_C
+| | | +--->BN_MP_SUB_C
+| | | | +--->BN_S_MP_ADD_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_S_MP_SUB_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_ADD_C
+| | | | +--->BN_S_MP_ADD_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_S_MP_SUB_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_DIV_2D_C
+| | | | +--->BN_MP_MOD_2D_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_RSHD_C
+| | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_EXCH_C
+| | | +--->BN_MP_EXCH_C
+| | | +--->BN_MP_CLEAR_MULTI_C
+| | | +--->BN_MP_INIT_SIZE_C
+| | | +--->BN_MP_INIT_COPY_C
+| | | +--->BN_MP_LSHD_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_RSHD_C
+| | | +--->BN_MP_RSHD_C
+| | | +--->BN_MP_MUL_D_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_EXCH_C
+| | +--->BN_MP_ADD_C
+| | | +--->BN_S_MP_ADD_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_CMP_MAG_C
+| | | +--->BN_S_MP_SUB_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
++--->BN_MP_MULMOD_C
+| +--->BN_MP_INIT_C
+| +--->BN_MP_MUL_C
+| | +--->BN_MP_TOOM_MUL_C
+| | | +--->BN_MP_MOD_2D_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_RSHD_C
+| | | +--->BN_MP_MUL_2_C
+| | | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_ADD_C
+| | | | +--->BN_S_MP_ADD_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_CMP_MAG_C
+| | | | +--->BN_S_MP_SUB_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_SUB_C
+| | | | +--->BN_S_MP_ADD_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_CMP_MAG_C
+| | | | +--->BN_S_MP_SUB_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_MUL_2D_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_LSHD_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_MUL_D_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_DIV_3_C
+| | | | +--->BN_MP_INIT_SIZE_C
+| | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_EXCH_C
+| | | | +--->BN_MP_CLEAR_C
+| | | +--->BN_MP_LSHD_C
+| | | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLEAR_MULTI_C
+| | | | +--->BN_MP_CLEAR_C
+| | +--->BN_MP_KARATSUBA_MUL_C
+| | | +--->BN_MP_INIT_SIZE_C
+| | | +--->BN_MP_CLAMP_C
+| | | +--->BN_S_MP_ADD_C
+| | | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_ADD_C
+| | | | +--->BN_MP_CMP_MAG_C
+| | | | +--->BN_S_MP_SUB_C
+| | | | | +--->BN_MP_GROW_C
+| | | +--->BN_S_MP_SUB_C
+| | | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_LSHD_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_RSHD_C
+| | | +--->BN_MP_CLEAR_C
+| | +--->BN_FAST_S_MP_MUL_DIGS_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_S_MP_MUL_DIGS_C
+| | | +--->BN_MP_INIT_SIZE_C
+| | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_EXCH_C
+| | | +--->BN_MP_CLEAR_C
+| +--->BN_MP_CLEAR_C
+| +--->BN_MP_MOD_C
+| | +--->BN_MP_DIV_C
+| | | +--->BN_MP_CMP_MAG_C
+| | | +--->BN_MP_SET_C
+| | | +--->BN_MP_COUNT_BITS_C
+| | | +--->BN_MP_ABS_C
+| | | +--->BN_MP_MUL_2D_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_LSHD_C
+| | | | | +--->BN_MP_RSHD_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_CMP_C
+| | | +--->BN_MP_SUB_C
+| | | | +--->BN_S_MP_ADD_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_S_MP_SUB_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_ADD_C
+| | | | +--->BN_S_MP_ADD_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_S_MP_SUB_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_DIV_2D_C
+| | | | +--->BN_MP_MOD_2D_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_RSHD_C
+| | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_EXCH_C
+| | | +--->BN_MP_EXCH_C
+| | | +--->BN_MP_CLEAR_MULTI_C
+| | | +--->BN_MP_INIT_SIZE_C
+| | | +--->BN_MP_INIT_COPY_C
+| | | +--->BN_MP_LSHD_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_RSHD_C
+| | | +--->BN_MP_RSHD_C
+| | | +--->BN_MP_MUL_D_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_EXCH_C
+| | +--->BN_MP_ADD_C
+| | | +--->BN_S_MP_ADD_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_CMP_MAG_C
+| | | +--->BN_S_MP_SUB_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
++--->BN_MP_SET_C
++--->BN_MP_CLEAR_MULTI_C
+| +--->BN_MP_CLEAR_C
+
+
+BN_FAST_S_MP_MUL_HIGH_DIGS_C
++--->BN_MP_GROW_C
++--->BN_MP_CLAMP_C
+
+
+BN_REVERSE_C
+
+
+BN_MP_PRIME_NEXT_PRIME_C
++--->BN_MP_CMP_D_C
++--->BN_MP_SET_C
+| +--->BN_MP_ZERO_C
++--->BN_MP_SUB_D_C
+| +--->BN_MP_GROW_C
+| +--->BN_MP_ADD_D_C
+| | +--->BN_MP_CLAMP_C
+| +--->BN_MP_CLAMP_C
++--->BN_MP_MOD_D_C
+| +--->BN_MP_DIV_D_C
+| | +--->BN_MP_COPY_C
+| | | +--->BN_MP_GROW_C
+| | +--->BN_MP_DIV_2D_C
+| | | +--->BN_MP_ZERO_C
+| | | +--->BN_MP_INIT_C
+| | | +--->BN_MP_MOD_2D_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_CLEAR_C
+| | | +--->BN_MP_RSHD_C
+| | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_EXCH_C
+| | +--->BN_MP_DIV_3_C
+| | | +--->BN_MP_INIT_SIZE_C
+| | | | +--->BN_MP_INIT_C
+| | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_EXCH_C
+| | | +--->BN_MP_CLEAR_C
+| | +--->BN_MP_INIT_SIZE_C
+| | | +--->BN_MP_INIT_C
+| | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_EXCH_C
+| | +--->BN_MP_CLEAR_C
++--->BN_MP_INIT_C
++--->BN_MP_ADD_D_C
+| +--->BN_MP_GROW_C
+| +--->BN_MP_CLAMP_C
++--->BN_MP_PRIME_MILLER_RABIN_C
+| +--->BN_MP_INIT_COPY_C
+| | +--->BN_MP_INIT_SIZE_C
+| | +--->BN_MP_COPY_C
+| | | +--->BN_MP_GROW_C
+| +--->BN_MP_CNT_LSB_C
+| +--->BN_MP_DIV_2D_C
+| | +--->BN_MP_COPY_C
+| | | +--->BN_MP_GROW_C
+| | +--->BN_MP_ZERO_C
+| | +--->BN_MP_MOD_2D_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_CLEAR_C
+| | +--->BN_MP_RSHD_C
+| | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_EXCH_C
+| +--->BN_MP_EXPTMOD_C
+| | +--->BN_MP_INVMOD_C
+| | | +--->BN_FAST_MP_INVMOD_C
+| | | | +--->BN_MP_INIT_MULTI_C
+| | | | | +--->BN_MP_CLEAR_C
+| | | | +--->BN_MP_COPY_C
+| | | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_MOD_C
+| | | | | +--->BN_MP_DIV_C
+| | | | | | +--->BN_MP_CMP_MAG_C
+| | | | | | +--->BN_MP_ZERO_C
+| | | | | | +--->BN_MP_COUNT_BITS_C
+| | | | | | +--->BN_MP_ABS_C
+| | | | | | +--->BN_MP_MUL_2D_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_LSHD_C
+| | | | | | | | +--->BN_MP_RSHD_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_CMP_C
+| | | | | | +--->BN_MP_SUB_C
+| | | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_ADD_C
+| | | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_EXCH_C
+| | | | | | +--->BN_MP_CLEAR_MULTI_C
+| | | | | | | +--->BN_MP_CLEAR_C
+| | | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | | +--->BN_MP_LSHD_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_RSHD_C
+| | | | | | +--->BN_MP_RSHD_C
+| | | | | | +--->BN_MP_MUL_D_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_CLEAR_C
+| | | | | +--->BN_MP_CLEAR_C
+| | | | | +--->BN_MP_EXCH_C
+| | | | | +--->BN_MP_ADD_C
+| | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_CMP_MAG_C
+| | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_DIV_2_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_SUB_C
+| | | | | +--->BN_S_MP_ADD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_CMP_MAG_C
+| | | | | +--->BN_S_MP_SUB_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_CMP_C
+| | | | | +--->BN_MP_CMP_MAG_C
+| | | | +--->BN_MP_ADD_C
+| | | | | +--->BN_S_MP_ADD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_CMP_MAG_C
+| | | | | +--->BN_S_MP_SUB_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_EXCH_C
+| | | | +--->BN_MP_CLEAR_MULTI_C
+| | | | | +--->BN_MP_CLEAR_C
+| | | +--->BN_MP_INVMOD_SLOW_C
+| | | | +--->BN_MP_INIT_MULTI_C
+| | | | | +--->BN_MP_CLEAR_C
+| | | | +--->BN_MP_MOD_C
+| | | | | +--->BN_MP_DIV_C
+| | | | | | +--->BN_MP_CMP_MAG_C
+| | | | | | +--->BN_MP_COPY_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_ZERO_C
+| | | | | | +--->BN_MP_COUNT_BITS_C
+| | | | | | +--->BN_MP_ABS_C
+| | | | | | +--->BN_MP_MUL_2D_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_LSHD_C
+| | | | | | | | +--->BN_MP_RSHD_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_CMP_C
+| | | | | | +--->BN_MP_SUB_C
+| | | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_ADD_C
+| | | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_EXCH_C
+| | | | | | +--->BN_MP_CLEAR_MULTI_C
+| | | | | | | +--->BN_MP_CLEAR_C
+| | | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | | +--->BN_MP_LSHD_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_RSHD_C
+| | | | | | +--->BN_MP_RSHD_C
+| | | | | | +--->BN_MP_MUL_D_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_CLEAR_C
+| | | | | +--->BN_MP_CLEAR_C
+| | | | | +--->BN_MP_EXCH_C
+| | | | | +--->BN_MP_ADD_C
+| | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_CMP_MAG_C
+| | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_COPY_C
+| | | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_DIV_2_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_ADD_C
+| | | | | +--->BN_S_MP_ADD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_CMP_MAG_C
+| | | | | +--->BN_S_MP_SUB_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_SUB_C
+| | | | | +--->BN_S_MP_ADD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_CMP_MAG_C
+| | | | | +--->BN_S_MP_SUB_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_CMP_C
+| | | | | +--->BN_MP_CMP_MAG_C
+| | | | +--->BN_MP_CMP_MAG_C
+| | | | +--->BN_MP_EXCH_C
+| | | | +--->BN_MP_CLEAR_MULTI_C
+| | | | | +--->BN_MP_CLEAR_C
+| | +--->BN_MP_CLEAR_C
+| | +--->BN_MP_ABS_C
+| | | +--->BN_MP_COPY_C
+| | | | +--->BN_MP_GROW_C
+| | +--->BN_MP_CLEAR_MULTI_C
+| | +--->BN_MP_REDUCE_IS_2K_L_C
+| | +--->BN_S_MP_EXPTMOD_C
+| | | +--->BN_MP_COUNT_BITS_C
+| | | +--->BN_MP_REDUCE_SETUP_C
+| | | | +--->BN_MP_2EXPT_C
+| | | | | +--->BN_MP_ZERO_C
+| | | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_DIV_C
+| | | | | +--->BN_MP_CMP_MAG_C
+| | | | | +--->BN_MP_COPY_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_ZERO_C
+| | | | | +--->BN_MP_INIT_MULTI_C
+| | | | | +--->BN_MP_MUL_2D_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_LSHD_C
+| | | | | | | +--->BN_MP_RSHD_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_CMP_C
+| | | | | +--->BN_MP_SUB_C
+| | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_ADD_C
+| | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_EXCH_C
+| | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | +--->BN_MP_LSHD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_RSHD_C
+| | | | | +--->BN_MP_RSHD_C
+| | | | | +--->BN_MP_MUL_D_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_REDUCE_C
+| | | | +--->BN_MP_RSHD_C
+| | | | | +--->BN_MP_ZERO_C
+| | | | +--->BN_MP_MUL_C
+| | | | | +--->BN_MP_TOOM_MUL_C
+| | | | | | +--->BN_MP_INIT_MULTI_C
+| | | | | | +--->BN_MP_MOD_2D_C
+| | | | | | | +--->BN_MP_ZERO_C
+| | | | | | | +--->BN_MP_COPY_C
+| | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_COPY_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_MUL_2_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_ADD_C
+| | | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | | +--->BN_MP_CMP_MAG_C
+| | | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_SUB_C
+| | | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | | +--->BN_MP_CMP_MAG_C
+| | | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_DIV_2_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_MUL_2D_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_LSHD_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_MUL_D_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_DIV_3_C
+| | | | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | | +--->BN_MP_EXCH_C
+| | | | | | +--->BN_MP_LSHD_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_KARATSUBA_MUL_C
+| | | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_ADD_C
+| | | | | | | +--->BN_MP_CMP_MAG_C
+| | | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_LSHD_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_FAST_S_MP_MUL_DIGS_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_S_MP_MUL_DIGS_C
+| | | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_EXCH_C
+| | | | +--->BN_S_MP_MUL_HIGH_DIGS_C
+| | | | | +--->BN_FAST_S_MP_MUL_HIGH_DIGS_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_EXCH_C
+| | | | +--->BN_FAST_S_MP_MUL_HIGH_DIGS_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_MOD_2D_C
+| | | | | +--->BN_MP_ZERO_C
+| | | | | +--->BN_MP_COPY_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_S_MP_MUL_DIGS_C
+| | | | | +--->BN_FAST_S_MP_MUL_DIGS_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_EXCH_C
+| | | | +--->BN_MP_SUB_C
+| | | | | +--->BN_S_MP_ADD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_CMP_MAG_C
+| | | | | +--->BN_S_MP_SUB_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_LSHD_C
+| | | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_ADD_C
+| | | | | +--->BN_S_MP_ADD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_CMP_MAG_C
+| | | | | +--->BN_S_MP_SUB_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_CMP_C
+| | | | | +--->BN_MP_CMP_MAG_C
+| | | | +--->BN_S_MP_SUB_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_REDUCE_2K_SETUP_L_C
+| | | | +--->BN_MP_2EXPT_C
+| | | | | +--->BN_MP_ZERO_C
+| | | | | +--->BN_MP_GROW_C
+| | | | +--->BN_S_MP_SUB_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_REDUCE_2K_L_C
+| | | | +--->BN_MP_MUL_C
+| | | | | +--->BN_MP_TOOM_MUL_C
+| | | | | | +--->BN_MP_INIT_MULTI_C
+| | | | | | +--->BN_MP_MOD_2D_C
+| | | | | | | +--->BN_MP_ZERO_C
+| | | | | | | +--->BN_MP_COPY_C
+| | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_COPY_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_RSHD_C
+| | | | | | | +--->BN_MP_ZERO_C
+| | | | | | +--->BN_MP_MUL_2_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_ADD_C
+| | | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | | +--->BN_MP_CMP_MAG_C
+| | | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_SUB_C
+| | | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | | +--->BN_MP_CMP_MAG_C
+| | | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_DIV_2_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_MUL_2D_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_LSHD_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_MUL_D_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_DIV_3_C
+| | | | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | | +--->BN_MP_EXCH_C
+| | | | | | +--->BN_MP_LSHD_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_KARATSUBA_MUL_C
+| | | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_ADD_C
+| | | | | | | +--->BN_MP_CMP_MAG_C
+| | | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_LSHD_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_RSHD_C
+| | | | | | | | +--->BN_MP_ZERO_C
+| | | | | +--->BN_FAST_S_MP_MUL_DIGS_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_S_MP_MUL_DIGS_C
+| | | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_EXCH_C
+| | | | +--->BN_S_MP_ADD_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_CMP_MAG_C
+| | | | +--->BN_S_MP_SUB_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_MOD_C
+| | | | +--->BN_MP_DIV_C
+| | | | | +--->BN_MP_CMP_MAG_C
+| | | | | +--->BN_MP_COPY_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_ZERO_C
+| | | | | +--->BN_MP_INIT_MULTI_C
+| | | | | +--->BN_MP_MUL_2D_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_LSHD_C
+| | | | | | | +--->BN_MP_RSHD_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_CMP_C
+| | | | | +--->BN_MP_SUB_C
+| | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_ADD_C
+| | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_EXCH_C
+| | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | +--->BN_MP_LSHD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_RSHD_C
+| | | | | +--->BN_MP_RSHD_C
+| | | | | +--->BN_MP_MUL_D_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_EXCH_C
+| | | | +--->BN_MP_ADD_C
+| | | | | +--->BN_S_MP_ADD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_CMP_MAG_C
+| | | | | +--->BN_S_MP_SUB_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_COPY_C
+| | | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_SQR_C
+| | | | +--->BN_MP_TOOM_SQR_C
+| | | | | +--->BN_MP_INIT_MULTI_C
+| | | | | +--->BN_MP_MOD_2D_C
+| | | | | | +--->BN_MP_ZERO_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_RSHD_C
+| | | | | | +--->BN_MP_ZERO_C
+| | | | | +--->BN_MP_MUL_2_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_ADD_C
+| | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_CMP_MAG_C
+| | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_SUB_C
+| | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_CMP_MAG_C
+| | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_DIV_2_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_MUL_2D_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_LSHD_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_MUL_D_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_DIV_3_C
+| | | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_EXCH_C
+| | | | | +--->BN_MP_LSHD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_KARATSUBA_SQR_C
+| | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_S_MP_ADD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_S_MP_SUB_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_LSHD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_RSHD_C
+| | | | | | | +--->BN_MP_ZERO_C
+| | | | | +--->BN_MP_ADD_C
+| | | | | | +--->BN_MP_CMP_MAG_C
+| | | | +--->BN_FAST_S_MP_SQR_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_S_MP_SQR_C
+| | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_EXCH_C
+| | | +--->BN_MP_MUL_C
+| | | | +--->BN_MP_TOOM_MUL_C
+| | | | | +--->BN_MP_INIT_MULTI_C
+| | | | | +--->BN_MP_MOD_2D_C
+| | | | | | +--->BN_MP_ZERO_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_RSHD_C
+| | | | | | +--->BN_MP_ZERO_C
+| | | | | +--->BN_MP_MUL_2_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_ADD_C
+| | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_CMP_MAG_C
+| | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_SUB_C
+| | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_CMP_MAG_C
+| | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_DIV_2_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_MUL_2D_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_LSHD_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_MUL_D_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_DIV_3_C
+| | | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_EXCH_C
+| | | | | +--->BN_MP_LSHD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_KARATSUBA_MUL_C
+| | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_S_MP_ADD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_ADD_C
+| | | | | | +--->BN_MP_CMP_MAG_C
+| | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_S_MP_SUB_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_LSHD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_RSHD_C
+| | | | | | | +--->BN_MP_ZERO_C
+| | | | +--->BN_FAST_S_MP_MUL_DIGS_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_S_MP_MUL_DIGS_C
+| | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_EXCH_C
+| | | +--->BN_MP_EXCH_C
+| | +--->BN_MP_DR_IS_MODULUS_C
+| | +--->BN_MP_REDUCE_IS_2K_C
+| | | +--->BN_MP_REDUCE_2K_C
+| | | | +--->BN_MP_COUNT_BITS_C
+| | | | +--->BN_MP_MUL_D_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_S_MP_ADD_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_CMP_MAG_C
+| | | | +--->BN_S_MP_SUB_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_COUNT_BITS_C
+| | +--->BN_MP_EXPTMOD_FAST_C
+| | | +--->BN_MP_COUNT_BITS_C
+| | | +--->BN_MP_MONTGOMERY_SETUP_C
+| | | +--->BN_FAST_MP_MONTGOMERY_REDUCE_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_RSHD_C
+| | | | | +--->BN_MP_ZERO_C
+| | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_CMP_MAG_C
+| | | | +--->BN_S_MP_SUB_C
+| | | +--->BN_MP_MONTGOMERY_REDUCE_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_RSHD_C
+| | | | | +--->BN_MP_ZERO_C
+| | | | +--->BN_MP_CMP_MAG_C
+| | | | +--->BN_S_MP_SUB_C
+| | | +--->BN_MP_DR_SETUP_C
+| | | +--->BN_MP_DR_REDUCE_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_CMP_MAG_C
+| | | | +--->BN_S_MP_SUB_C
+| | | +--->BN_MP_REDUCE_2K_SETUP_C
+| | | | +--->BN_MP_2EXPT_C
+| | | | | +--->BN_MP_ZERO_C
+| | | | | +--->BN_MP_GROW_C
+| | | | +--->BN_S_MP_SUB_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_REDUCE_2K_C
+| | | | +--->BN_MP_MUL_D_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_S_MP_ADD_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_CMP_MAG_C
+| | | | +--->BN_S_MP_SUB_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_MONTGOMERY_CALC_NORMALIZATION_C
+| | | | +--->BN_MP_2EXPT_C
+| | | | | +--->BN_MP_ZERO_C
+| | | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_MUL_2_C
+| | | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CMP_MAG_C
+| | | | +--->BN_S_MP_SUB_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_MULMOD_C
+| | | | +--->BN_MP_MUL_C
+| | | | | +--->BN_MP_TOOM_MUL_C
+| | | | | | +--->BN_MP_INIT_MULTI_C
+| | | | | | +--->BN_MP_MOD_2D_C
+| | | | | | | +--->BN_MP_ZERO_C
+| | | | | | | +--->BN_MP_COPY_C
+| | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_COPY_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_RSHD_C
+| | | | | | | +--->BN_MP_ZERO_C
+| | | | | | +--->BN_MP_MUL_2_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_ADD_C
+| | | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | | +--->BN_MP_CMP_MAG_C
+| | | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_SUB_C
+| | | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | | +--->BN_MP_CMP_MAG_C
+| | | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_DIV_2_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_MUL_2D_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_LSHD_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_MUL_D_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_DIV_3_C
+| | | | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | | +--->BN_MP_EXCH_C
+| | | | | | +--->BN_MP_LSHD_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_KARATSUBA_MUL_C
+| | | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_ADD_C
+| | | | | | | +--->BN_MP_CMP_MAG_C
+| | | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_LSHD_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_RSHD_C
+| | | | | | | | +--->BN_MP_ZERO_C
+| | | | | +--->BN_FAST_S_MP_MUL_DIGS_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_S_MP_MUL_DIGS_C
+| | | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_EXCH_C
+| | | | +--->BN_MP_MOD_C
+| | | | | +--->BN_MP_DIV_C
+| | | | | | +--->BN_MP_CMP_MAG_C
+| | | | | | +--->BN_MP_COPY_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_ZERO_C
+| | | | | | +--->BN_MP_INIT_MULTI_C
+| | | | | | +--->BN_MP_MUL_2D_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_LSHD_C
+| | | | | | | | +--->BN_MP_RSHD_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_CMP_C
+| | | | | | +--->BN_MP_SUB_C
+| | | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_ADD_C
+| | | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_EXCH_C
+| | | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | | +--->BN_MP_LSHD_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_RSHD_C
+| | | | | | +--->BN_MP_RSHD_C
+| | | | | | +--->BN_MP_MUL_D_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_EXCH_C
+| | | | | +--->BN_MP_ADD_C
+| | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_CMP_MAG_C
+| | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_MOD_C
+| | | | +--->BN_MP_DIV_C
+| | | | | +--->BN_MP_CMP_MAG_C
+| | | | | +--->BN_MP_COPY_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_ZERO_C
+| | | | | +--->BN_MP_INIT_MULTI_C
+| | | | | +--->BN_MP_MUL_2D_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_LSHD_C
+| | | | | | | +--->BN_MP_RSHD_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_CMP_C
+| | | | | +--->BN_MP_SUB_C
+| | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_ADD_C
+| | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_EXCH_C
+| | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | +--->BN_MP_LSHD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_RSHD_C
+| | | | | +--->BN_MP_RSHD_C
+| | | | | +--->BN_MP_MUL_D_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_EXCH_C
+| | | | +--->BN_MP_ADD_C
+| | | | | +--->BN_S_MP_ADD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_CMP_MAG_C
+| | | | | +--->BN_S_MP_SUB_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_COPY_C
+| | | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_SQR_C
+| | | | +--->BN_MP_TOOM_SQR_C
+| | | | | +--->BN_MP_INIT_MULTI_C
+| | | | | +--->BN_MP_MOD_2D_C
+| | | | | | +--->BN_MP_ZERO_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_RSHD_C
+| | | | | | +--->BN_MP_ZERO_C
+| | | | | +--->BN_MP_MUL_2_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_ADD_C
+| | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_CMP_MAG_C
+| | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_SUB_C
+| | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_CMP_MAG_C
+| | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_DIV_2_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_MUL_2D_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_LSHD_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_MUL_D_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_DIV_3_C
+| | | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_EXCH_C
+| | | | | +--->BN_MP_LSHD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_KARATSUBA_SQR_C
+| | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_S_MP_ADD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_S_MP_SUB_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_LSHD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_RSHD_C
+| | | | | | | +--->BN_MP_ZERO_C
+| | | | | +--->BN_MP_ADD_C
+| | | | | | +--->BN_MP_CMP_MAG_C
+| | | | +--->BN_FAST_S_MP_SQR_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_S_MP_SQR_C
+| | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_EXCH_C
+| | | +--->BN_MP_MUL_C
+| | | | +--->BN_MP_TOOM_MUL_C
+| | | | | +--->BN_MP_INIT_MULTI_C
+| | | | | +--->BN_MP_MOD_2D_C
+| | | | | | +--->BN_MP_ZERO_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_RSHD_C
+| | | | | | +--->BN_MP_ZERO_C
+| | | | | +--->BN_MP_MUL_2_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_ADD_C
+| | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_CMP_MAG_C
+| | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_SUB_C
+| | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_CMP_MAG_C
+| | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_DIV_2_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_MUL_2D_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_LSHD_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_MUL_D_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_DIV_3_C
+| | | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_EXCH_C
+| | | | | +--->BN_MP_LSHD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_KARATSUBA_MUL_C
+| | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_S_MP_ADD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_ADD_C
+| | | | | | +--->BN_MP_CMP_MAG_C
+| | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_S_MP_SUB_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_LSHD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_RSHD_C
+| | | | | | | +--->BN_MP_ZERO_C
+| | | | +--->BN_FAST_S_MP_MUL_DIGS_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_S_MP_MUL_DIGS_C
+| | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_EXCH_C
+| | | +--->BN_MP_EXCH_C
+| +--->BN_MP_CMP_C
+| | +--->BN_MP_CMP_MAG_C
+| +--->BN_MP_SQRMOD_C
+| | +--->BN_MP_SQR_C
+| | | +--->BN_MP_TOOM_SQR_C
+| | | | +--->BN_MP_INIT_MULTI_C
+| | | | | +--->BN_MP_CLEAR_C
+| | | | +--->BN_MP_MOD_2D_C
+| | | | | +--->BN_MP_ZERO_C
+| | | | | +--->BN_MP_COPY_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_COPY_C
+| | | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_RSHD_C
+| | | | | +--->BN_MP_ZERO_C
+| | | | +--->BN_MP_MUL_2_C
+| | | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_ADD_C
+| | | | | +--->BN_S_MP_ADD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_CMP_MAG_C
+| | | | | +--->BN_S_MP_SUB_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_SUB_C
+| | | | | +--->BN_S_MP_ADD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_CMP_MAG_C
+| | | | | +--->BN_S_MP_SUB_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_DIV_2_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_MUL_2D_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_LSHD_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_MUL_D_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_DIV_3_C
+| | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_EXCH_C
+| | | | | +--->BN_MP_CLEAR_C
+| | | | +--->BN_MP_LSHD_C
+| | | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLEAR_MULTI_C
+| | | | | +--->BN_MP_CLEAR_C
+| | | +--->BN_MP_KARATSUBA_SQR_C
+| | | | +--->BN_MP_INIT_SIZE_C
+| | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_S_MP_ADD_C
+| | | | | +--->BN_MP_GROW_C
+| | | | +--->BN_S_MP_SUB_C
+| | | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_LSHD_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_RSHD_C
+| | | | | | +--->BN_MP_ZERO_C
+| | | | +--->BN_MP_ADD_C
+| | | | | +--->BN_MP_CMP_MAG_C
+| | | | +--->BN_MP_CLEAR_C
+| | | +--->BN_FAST_S_MP_SQR_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_S_MP_SQR_C
+| | | | +--->BN_MP_INIT_SIZE_C
+| | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_EXCH_C
+| | | | +--->BN_MP_CLEAR_C
+| | +--->BN_MP_CLEAR_C
+| | +--->BN_MP_MOD_C
+| | | +--->BN_MP_DIV_C
+| | | | +--->BN_MP_CMP_MAG_C
+| | | | +--->BN_MP_COPY_C
+| | | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_ZERO_C
+| | | | +--->BN_MP_INIT_MULTI_C
+| | | | +--->BN_MP_COUNT_BITS_C
+| | | | +--->BN_MP_ABS_C
+| | | | +--->BN_MP_MUL_2D_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_LSHD_C
+| | | | | | +--->BN_MP_RSHD_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_SUB_C
+| | | | | +--->BN_S_MP_ADD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_S_MP_SUB_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_ADD_C
+| | | | | +--->BN_S_MP_ADD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_S_MP_SUB_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_EXCH_C
+| | | | +--->BN_MP_CLEAR_MULTI_C
+| | | | +--->BN_MP_INIT_SIZE_C
+| | | | +--->BN_MP_LSHD_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_RSHD_C
+| | | | +--->BN_MP_RSHD_C
+| | | | +--->BN_MP_MUL_D_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_EXCH_C
+| | | +--->BN_MP_ADD_C
+| | | | +--->BN_S_MP_ADD_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_CMP_MAG_C
+| | | | +--->BN_S_MP_SUB_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| +--->BN_MP_CLEAR_C
++--->BN_MP_CLEAR_C
+
+
+BN_MP_TOOM_MUL_C
++--->BN_MP_INIT_MULTI_C
+| +--->BN_MP_INIT_C
+| +--->BN_MP_CLEAR_C
++--->BN_MP_MOD_2D_C
+| +--->BN_MP_ZERO_C
+| +--->BN_MP_COPY_C
+| | +--->BN_MP_GROW_C
+| +--->BN_MP_CLAMP_C
++--->BN_MP_COPY_C
+| +--->BN_MP_GROW_C
++--->BN_MP_RSHD_C
+| +--->BN_MP_ZERO_C
++--->BN_MP_MUL_C
+| +--->BN_MP_KARATSUBA_MUL_C
+| | +--->BN_MP_INIT_SIZE_C
+| | | +--->BN_MP_INIT_C
+| | +--->BN_MP_CLAMP_C
+| | +--->BN_S_MP_ADD_C
+| | | +--->BN_MP_GROW_C
+| | +--->BN_MP_ADD_C
+| | | +--->BN_MP_CMP_MAG_C
+| | | +--->BN_S_MP_SUB_C
+| | | | +--->BN_MP_GROW_C
+| | +--->BN_S_MP_SUB_C
+| | | +--->BN_MP_GROW_C
+| | +--->BN_MP_LSHD_C
+| | | +--->BN_MP_GROW_C
+| | +--->BN_MP_CLEAR_C
+| +--->BN_FAST_S_MP_MUL_DIGS_C
+| | +--->BN_MP_GROW_C
+| | +--->BN_MP_CLAMP_C
+| +--->BN_S_MP_MUL_DIGS_C
+| | +--->BN_MP_INIT_SIZE_C
+| | | +--->BN_MP_INIT_C
+| | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_EXCH_C
+| | +--->BN_MP_CLEAR_C
++--->BN_MP_MUL_2_C
+| +--->BN_MP_GROW_C
++--->BN_MP_ADD_C
+| +--->BN_S_MP_ADD_C
+| | +--->BN_MP_GROW_C
+| | +--->BN_MP_CLAMP_C
+| +--->BN_MP_CMP_MAG_C
+| +--->BN_S_MP_SUB_C
+| | +--->BN_MP_GROW_C
+| | +--->BN_MP_CLAMP_C
++--->BN_MP_SUB_C
+| +--->BN_S_MP_ADD_C
+| | +--->BN_MP_GROW_C
+| | +--->BN_MP_CLAMP_C
+| +--->BN_MP_CMP_MAG_C
+| +--->BN_S_MP_SUB_C
+| | +--->BN_MP_GROW_C
+| | +--->BN_MP_CLAMP_C
++--->BN_MP_DIV_2_C
+| +--->BN_MP_GROW_C
+| +--->BN_MP_CLAMP_C
++--->BN_MP_MUL_2D_C
+| +--->BN_MP_GROW_C
+| +--->BN_MP_LSHD_C
+| +--->BN_MP_CLAMP_C
++--->BN_MP_MUL_D_C
+| +--->BN_MP_GROW_C
+| +--->BN_MP_CLAMP_C
++--->BN_MP_DIV_3_C
+| +--->BN_MP_INIT_SIZE_C
+| | +--->BN_MP_INIT_C
+| +--->BN_MP_CLAMP_C
+| +--->BN_MP_EXCH_C
+| +--->BN_MP_CLEAR_C
++--->BN_MP_LSHD_C
+| +--->BN_MP_GROW_C
++--->BN_MP_CLEAR_MULTI_C
+| +--->BN_MP_CLEAR_C
+
+
+BN_MP_CNT_LSB_C
+
+
+BN_MP_CLAMP_C
+
+
+BN_MP_SUB_D_C
++--->BN_MP_GROW_C
++--->BN_MP_ADD_D_C
+| +--->BN_MP_CLAMP_C
++--->BN_MP_CLAMP_C
+
+
+BN_MP_ADD_C
++--->BN_S_MP_ADD_C
+| +--->BN_MP_GROW_C
+| +--->BN_MP_CLAMP_C
++--->BN_MP_CMP_MAG_C
++--->BN_S_MP_SUB_C
+| +--->BN_MP_GROW_C
+| +--->BN_MP_CLAMP_C
+
+
+BN_MP_REDUCE_2K_C
++--->BN_MP_INIT_C
++--->BN_MP_COUNT_BITS_C
++--->BN_MP_DIV_2D_C
+| +--->BN_MP_COPY_C
+| | +--->BN_MP_GROW_C
+| +--->BN_MP_ZERO_C
+| +--->BN_MP_MOD_2D_C
+| | +--->BN_MP_CLAMP_C
+| +--->BN_MP_CLEAR_C
+| +--->BN_MP_RSHD_C
+| +--->BN_MP_CLAMP_C
+| +--->BN_MP_EXCH_C
++--->BN_MP_MUL_D_C
+| +--->BN_MP_GROW_C
+| +--->BN_MP_CLAMP_C
++--->BN_S_MP_ADD_C
+| +--->BN_MP_GROW_C
+| +--->BN_MP_CLAMP_C
++--->BN_MP_CMP_MAG_C
++--->BN_S_MP_SUB_C
+| +--->BN_MP_GROW_C
+| +--->BN_MP_CLAMP_C
++--->BN_MP_CLEAR_C
+
+
+BN_MP_REDUCE_C
++--->BN_MP_REDUCE_SETUP_C
+| +--->BN_MP_2EXPT_C
+| | +--->BN_MP_ZERO_C
+| | +--->BN_MP_GROW_C
+| +--->BN_MP_DIV_C
+| | +--->BN_MP_CMP_MAG_C
+| | +--->BN_MP_COPY_C
+| | | +--->BN_MP_GROW_C
+| | +--->BN_MP_ZERO_C
+| | +--->BN_MP_INIT_MULTI_C
+| | | +--->BN_MP_INIT_C
+| | | +--->BN_MP_CLEAR_C
+| | +--->BN_MP_SET_C
+| | +--->BN_MP_COUNT_BITS_C
+| | +--->BN_MP_ABS_C
+| | +--->BN_MP_MUL_2D_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_LSHD_C
+| | | | +--->BN_MP_RSHD_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_CMP_C
+| | +--->BN_MP_SUB_C
+| | | +--->BN_S_MP_ADD_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_S_MP_SUB_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_ADD_C
+| | | +--->BN_S_MP_ADD_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_S_MP_SUB_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_DIV_2D_C
+| | | +--->BN_MP_INIT_C
+| | | +--->BN_MP_MOD_2D_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_CLEAR_C
+| | | +--->BN_MP_RSHD_C
+| | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_EXCH_C
+| | +--->BN_MP_EXCH_C
+| | +--->BN_MP_CLEAR_MULTI_C
+| | | +--->BN_MP_CLEAR_C
+| | +--->BN_MP_INIT_SIZE_C
+| | | +--->BN_MP_INIT_C
+| | +--->BN_MP_INIT_C
+| | +--->BN_MP_INIT_COPY_C
+| | +--->BN_MP_LSHD_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_RSHD_C
+| | +--->BN_MP_RSHD_C
+| | +--->BN_MP_MUL_D_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_CLEAR_C
++--->BN_MP_INIT_COPY_C
+| +--->BN_MP_INIT_SIZE_C
+| +--->BN_MP_COPY_C
+| | +--->BN_MP_GROW_C
++--->BN_MP_RSHD_C
+| +--->BN_MP_ZERO_C
++--->BN_MP_MUL_C
+| +--->BN_MP_TOOM_MUL_C
+| | +--->BN_MP_INIT_MULTI_C
+| | | +--->BN_MP_CLEAR_C
+| | +--->BN_MP_MOD_2D_C
+| | | +--->BN_MP_ZERO_C
+| | | +--->BN_MP_COPY_C
+| | | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_COPY_C
+| | | +--->BN_MP_GROW_C
+| | +--->BN_MP_MUL_2_C
+| | | +--->BN_MP_GROW_C
+| | +--->BN_MP_ADD_C
+| | | +--->BN_S_MP_ADD_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_CMP_MAG_C
+| | | +--->BN_S_MP_SUB_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_SUB_C
+| | | +--->BN_S_MP_ADD_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_CMP_MAG_C
+| | | +--->BN_S_MP_SUB_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_DIV_2_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_MUL_2D_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_LSHD_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_MUL_D_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_DIV_3_C
+| | | +--->BN_MP_INIT_SIZE_C
+| | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_EXCH_C
+| | | +--->BN_MP_CLEAR_C
+| | +--->BN_MP_LSHD_C
+| | | +--->BN_MP_GROW_C
+| | +--->BN_MP_CLEAR_MULTI_C
+| | | +--->BN_MP_CLEAR_C
+| +--->BN_MP_KARATSUBA_MUL_C
+| | +--->BN_MP_INIT_SIZE_C
+| | +--->BN_MP_CLAMP_C
+| | +--->BN_S_MP_ADD_C
+| | | +--->BN_MP_GROW_C
+| | +--->BN_MP_ADD_C
+| | | +--->BN_MP_CMP_MAG_C
+| | | +--->BN_S_MP_SUB_C
+| | | | +--->BN_MP_GROW_C
+| | +--->BN_S_MP_SUB_C
+| | | +--->BN_MP_GROW_C
+| | +--->BN_MP_LSHD_C
+| | | +--->BN_MP_GROW_C
+| | +--->BN_MP_CLEAR_C
+| +--->BN_FAST_S_MP_MUL_DIGS_C
+| | +--->BN_MP_GROW_C
+| | +--->BN_MP_CLAMP_C
+| +--->BN_S_MP_MUL_DIGS_C
+| | +--->BN_MP_INIT_SIZE_C
+| | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_EXCH_C
+| | +--->BN_MP_CLEAR_C
++--->BN_S_MP_MUL_HIGH_DIGS_C
+| +--->BN_FAST_S_MP_MUL_HIGH_DIGS_C
+| | +--->BN_MP_GROW_C
+| | +--->BN_MP_CLAMP_C
+| +--->BN_MP_INIT_SIZE_C
+| +--->BN_MP_CLAMP_C
+| +--->BN_MP_EXCH_C
+| +--->BN_MP_CLEAR_C
++--->BN_FAST_S_MP_MUL_HIGH_DIGS_C
+| +--->BN_MP_GROW_C
+| +--->BN_MP_CLAMP_C
++--->BN_MP_MOD_2D_C
+| +--->BN_MP_ZERO_C
+| +--->BN_MP_COPY_C
+| | +--->BN_MP_GROW_C
+| +--->BN_MP_CLAMP_C
++--->BN_S_MP_MUL_DIGS_C
+| +--->BN_FAST_S_MP_MUL_DIGS_C
+| | +--->BN_MP_GROW_C
+| | +--->BN_MP_CLAMP_C
+| +--->BN_MP_INIT_SIZE_C
+| +--->BN_MP_CLAMP_C
+| +--->BN_MP_EXCH_C
+| +--->BN_MP_CLEAR_C
++--->BN_MP_SUB_C
+| +--->BN_S_MP_ADD_C
+| | +--->BN_MP_GROW_C
+| | +--->BN_MP_CLAMP_C
+| +--->BN_MP_CMP_MAG_C
+| +--->BN_S_MP_SUB_C
+| | +--->BN_MP_GROW_C
+| | +--->BN_MP_CLAMP_C
++--->BN_MP_CMP_D_C
++--->BN_MP_SET_C
+| +--->BN_MP_ZERO_C
++--->BN_MP_LSHD_C
+| +--->BN_MP_GROW_C
++--->BN_MP_ADD_C
+| +--->BN_S_MP_ADD_C
+| | +--->BN_MP_GROW_C
+| | +--->BN_MP_CLAMP_C
+| +--->BN_MP_CMP_MAG_C
+| +--->BN_S_MP_SUB_C
+| | +--->BN_MP_GROW_C
+| | +--->BN_MP_CLAMP_C
++--->BN_MP_CMP_C
+| +--->BN_MP_CMP_MAG_C
++--->BN_S_MP_SUB_C
+| +--->BN_MP_GROW_C
+| +--->BN_MP_CLAMP_C
++--->BN_MP_CLEAR_C
+
+
+BN_MP_EXPTMOD_C
++--->BN_MP_INIT_C
++--->BN_MP_INVMOD_C
+| +--->BN_FAST_MP_INVMOD_C
+| | +--->BN_MP_INIT_MULTI_C
+| | | +--->BN_MP_CLEAR_C
+| | +--->BN_MP_COPY_C
+| | | +--->BN_MP_GROW_C
+| | +--->BN_MP_MOD_C
+| | | +--->BN_MP_DIV_C
+| | | | +--->BN_MP_CMP_MAG_C
+| | | | +--->BN_MP_ZERO_C
+| | | | +--->BN_MP_SET_C
+| | | | +--->BN_MP_COUNT_BITS_C
+| | | | +--->BN_MP_ABS_C
+| | | | +--->BN_MP_MUL_2D_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_LSHD_C
+| | | | | | +--->BN_MP_RSHD_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_CMP_C
+| | | | +--->BN_MP_SUB_C
+| | | | | +--->BN_S_MP_ADD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_S_MP_SUB_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_ADD_C
+| | | | | +--->BN_S_MP_ADD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_S_MP_SUB_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_DIV_2D_C
+| | | | | +--->BN_MP_MOD_2D_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_CLEAR_C
+| | | | | +--->BN_MP_RSHD_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_EXCH_C
+| | | | +--->BN_MP_EXCH_C
+| | | | +--->BN_MP_CLEAR_MULTI_C
+| | | | | +--->BN_MP_CLEAR_C
+| | | | +--->BN_MP_INIT_SIZE_C
+| | | | +--->BN_MP_INIT_COPY_C
+| | | | +--->BN_MP_LSHD_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_RSHD_C
+| | | | +--->BN_MP_RSHD_C
+| | | | +--->BN_MP_MUL_D_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_CLEAR_C
+| | | +--->BN_MP_CLEAR_C
+| | | +--->BN_MP_EXCH_C
+| | | +--->BN_MP_ADD_C
+| | | | +--->BN_S_MP_ADD_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_CMP_MAG_C
+| | | | +--->BN_S_MP_SUB_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_SET_C
+| | | +--->BN_MP_ZERO_C
+| | +--->BN_MP_DIV_2_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_SUB_C
+| | | +--->BN_S_MP_ADD_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_CMP_MAG_C
+| | | +--->BN_S_MP_SUB_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_CMP_C
+| | | +--->BN_MP_CMP_MAG_C
+| | +--->BN_MP_CMP_D_C
+| | +--->BN_MP_ADD_C
+| | | +--->BN_S_MP_ADD_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_CMP_MAG_C
+| | | +--->BN_S_MP_SUB_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_EXCH_C
+| | +--->BN_MP_CLEAR_MULTI_C
+| | | +--->BN_MP_CLEAR_C
+| +--->BN_MP_INVMOD_SLOW_C
+| | +--->BN_MP_INIT_MULTI_C
+| | | +--->BN_MP_CLEAR_C
+| | +--->BN_MP_MOD_C
+| | | +--->BN_MP_DIV_C
+| | | | +--->BN_MP_CMP_MAG_C
+| | | | +--->BN_MP_COPY_C
+| | | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_ZERO_C
+| | | | +--->BN_MP_SET_C
+| | | | +--->BN_MP_COUNT_BITS_C
+| | | | +--->BN_MP_ABS_C
+| | | | +--->BN_MP_MUL_2D_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_LSHD_C
+| | | | | | +--->BN_MP_RSHD_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_CMP_C
+| | | | +--->BN_MP_SUB_C
+| | | | | +--->BN_S_MP_ADD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_S_MP_SUB_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_ADD_C
+| | | | | +--->BN_S_MP_ADD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_S_MP_SUB_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_DIV_2D_C
+| | | | | +--->BN_MP_MOD_2D_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_CLEAR_C
+| | | | | +--->BN_MP_RSHD_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_EXCH_C
+| | | | +--->BN_MP_EXCH_C
+| | | | +--->BN_MP_CLEAR_MULTI_C
+| | | | | +--->BN_MP_CLEAR_C
+| | | | +--->BN_MP_INIT_SIZE_C
+| | | | +--->BN_MP_INIT_COPY_C
+| | | | +--->BN_MP_LSHD_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_RSHD_C
+| | | | +--->BN_MP_RSHD_C
+| | | | +--->BN_MP_MUL_D_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_CLEAR_C
+| | | +--->BN_MP_CLEAR_C
+| | | +--->BN_MP_EXCH_C
+| | | +--->BN_MP_ADD_C
+| | | | +--->BN_S_MP_ADD_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_CMP_MAG_C
+| | | | +--->BN_S_MP_SUB_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_COPY_C
+| | | +--->BN_MP_GROW_C
+| | +--->BN_MP_SET_C
+| | | +--->BN_MP_ZERO_C
+| | +--->BN_MP_DIV_2_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_ADD_C
+| | | +--->BN_S_MP_ADD_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_CMP_MAG_C
+| | | +--->BN_S_MP_SUB_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_SUB_C
+| | | +--->BN_S_MP_ADD_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_CMP_MAG_C
+| | | +--->BN_S_MP_SUB_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_CMP_C
+| | | +--->BN_MP_CMP_MAG_C
+| | +--->BN_MP_CMP_D_C
+| | +--->BN_MP_CMP_MAG_C
+| | +--->BN_MP_EXCH_C
+| | +--->BN_MP_CLEAR_MULTI_C
+| | | +--->BN_MP_CLEAR_C
++--->BN_MP_CLEAR_C
++--->BN_MP_ABS_C
+| +--->BN_MP_COPY_C
+| | +--->BN_MP_GROW_C
++--->BN_MP_CLEAR_MULTI_C
++--->BN_MP_REDUCE_IS_2K_L_C
++--->BN_S_MP_EXPTMOD_C
+| +--->BN_MP_COUNT_BITS_C
+| +--->BN_MP_REDUCE_SETUP_C
+| | +--->BN_MP_2EXPT_C
+| | | +--->BN_MP_ZERO_C
+| | | +--->BN_MP_GROW_C
+| | +--->BN_MP_DIV_C
+| | | +--->BN_MP_CMP_MAG_C
+| | | +--->BN_MP_COPY_C
+| | | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_ZERO_C
+| | | +--->BN_MP_INIT_MULTI_C
+| | | +--->BN_MP_SET_C
+| | | +--->BN_MP_MUL_2D_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_LSHD_C
+| | | | | +--->BN_MP_RSHD_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_CMP_C
+| | | +--->BN_MP_SUB_C
+| | | | +--->BN_S_MP_ADD_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_S_MP_SUB_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_ADD_C
+| | | | +--->BN_S_MP_ADD_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_S_MP_SUB_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_DIV_2D_C
+| | | | +--->BN_MP_MOD_2D_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_RSHD_C
+| | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_EXCH_C
+| | | +--->BN_MP_EXCH_C
+| | | +--->BN_MP_INIT_SIZE_C
+| | | +--->BN_MP_INIT_COPY_C
+| | | +--->BN_MP_LSHD_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_RSHD_C
+| | | +--->BN_MP_RSHD_C
+| | | +--->BN_MP_MUL_D_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_CLAMP_C
+| +--->BN_MP_REDUCE_C
+| | +--->BN_MP_INIT_COPY_C
+| | | +--->BN_MP_INIT_SIZE_C
+| | | +--->BN_MP_COPY_C
+| | | | +--->BN_MP_GROW_C
+| | +--->BN_MP_RSHD_C
+| | | +--->BN_MP_ZERO_C
+| | +--->BN_MP_MUL_C
+| | | +--->BN_MP_TOOM_MUL_C
+| | | | +--->BN_MP_INIT_MULTI_C
+| | | | +--->BN_MP_MOD_2D_C
+| | | | | +--->BN_MP_ZERO_C
+| | | | | +--->BN_MP_COPY_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_COPY_C
+| | | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_MUL_2_C
+| | | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_ADD_C
+| | | | | +--->BN_S_MP_ADD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_CMP_MAG_C
+| | | | | +--->BN_S_MP_SUB_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_SUB_C
+| | | | | +--->BN_S_MP_ADD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_CMP_MAG_C
+| | | | | +--->BN_S_MP_SUB_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_DIV_2_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_MUL_2D_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_LSHD_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_MUL_D_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_DIV_3_C
+| | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_EXCH_C
+| | | | +--->BN_MP_LSHD_C
+| | | | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_KARATSUBA_MUL_C
+| | | | +--->BN_MP_INIT_SIZE_C
+| | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_S_MP_ADD_C
+| | | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_ADD_C
+| | | | | +--->BN_MP_CMP_MAG_C
+| | | | | +--->BN_S_MP_SUB_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | +--->BN_S_MP_SUB_C
+| | | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_LSHD_C
+| | | | | +--->BN_MP_GROW_C
+| | | +--->BN_FAST_S_MP_MUL_DIGS_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_S_MP_MUL_DIGS_C
+| | | | +--->BN_MP_INIT_SIZE_C
+| | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_EXCH_C
+| | +--->BN_S_MP_MUL_HIGH_DIGS_C
+| | | +--->BN_FAST_S_MP_MUL_HIGH_DIGS_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_INIT_SIZE_C
+| | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_EXCH_C
+| | +--->BN_FAST_S_MP_MUL_HIGH_DIGS_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_MOD_2D_C
+| | | +--->BN_MP_ZERO_C
+| | | +--->BN_MP_COPY_C
+| | | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_S_MP_MUL_DIGS_C
+| | | +--->BN_FAST_S_MP_MUL_DIGS_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_INIT_SIZE_C
+| | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_EXCH_C
+| | +--->BN_MP_SUB_C
+| | | +--->BN_S_MP_ADD_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_CMP_MAG_C
+| | | +--->BN_S_MP_SUB_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_CMP_D_C
+| | +--->BN_MP_SET_C
+| | | +--->BN_MP_ZERO_C
+| | +--->BN_MP_LSHD_C
+| | | +--->BN_MP_GROW_C
+| | +--->BN_MP_ADD_C
+| | | +--->BN_S_MP_ADD_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_CMP_MAG_C
+| | | +--->BN_S_MP_SUB_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_CMP_C
+| | | +--->BN_MP_CMP_MAG_C
+| | +--->BN_S_MP_SUB_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLAMP_C
+| +--->BN_MP_REDUCE_2K_SETUP_L_C
+| | +--->BN_MP_2EXPT_C
+| | | +--->BN_MP_ZERO_C
+| | | +--->BN_MP_GROW_C
+| | +--->BN_S_MP_SUB_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLAMP_C
+| +--->BN_MP_REDUCE_2K_L_C
+| | +--->BN_MP_DIV_2D_C
+| | | +--->BN_MP_COPY_C
+| | | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_ZERO_C
+| | | +--->BN_MP_MOD_2D_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_RSHD_C
+| | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_EXCH_C
+| | +--->BN_MP_MUL_C
+| | | +--->BN_MP_TOOM_MUL_C
+| | | | +--->BN_MP_INIT_MULTI_C
+| | | | +--->BN_MP_MOD_2D_C
+| | | | | +--->BN_MP_ZERO_C
+| | | | | +--->BN_MP_COPY_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_COPY_C
+| | | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_RSHD_C
+| | | | | +--->BN_MP_ZERO_C
+| | | | +--->BN_MP_MUL_2_C
+| | | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_ADD_C
+| | | | | +--->BN_S_MP_ADD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_CMP_MAG_C
+| | | | | +--->BN_S_MP_SUB_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_SUB_C
+| | | | | +--->BN_S_MP_ADD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_CMP_MAG_C
+| | | | | +--->BN_S_MP_SUB_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_DIV_2_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_MUL_2D_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_LSHD_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_MUL_D_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_DIV_3_C
+| | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_EXCH_C
+| | | | +--->BN_MP_LSHD_C
+| | | | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_KARATSUBA_MUL_C
+| | | | +--->BN_MP_INIT_SIZE_C
+| | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_S_MP_ADD_C
+| | | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_ADD_C
+| | | | | +--->BN_MP_CMP_MAG_C
+| | | | | +--->BN_S_MP_SUB_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | +--->BN_S_MP_SUB_C
+| | | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_LSHD_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_RSHD_C
+| | | | | | +--->BN_MP_ZERO_C
+| | | +--->BN_FAST_S_MP_MUL_DIGS_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_S_MP_MUL_DIGS_C
+| | | | +--->BN_MP_INIT_SIZE_C
+| | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_EXCH_C
+| | +--->BN_S_MP_ADD_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_CMP_MAG_C
+| | +--->BN_S_MP_SUB_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLAMP_C
+| +--->BN_MP_MOD_C
+| | +--->BN_MP_DIV_C
+| | | +--->BN_MP_CMP_MAG_C
+| | | +--->BN_MP_COPY_C
+| | | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_ZERO_C
+| | | +--->BN_MP_INIT_MULTI_C
+| | | +--->BN_MP_SET_C
+| | | +--->BN_MP_MUL_2D_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_LSHD_C
+| | | | | +--->BN_MP_RSHD_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_CMP_C
+| | | +--->BN_MP_SUB_C
+| | | | +--->BN_S_MP_ADD_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_S_MP_SUB_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_ADD_C
+| | | | +--->BN_S_MP_ADD_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_S_MP_SUB_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_DIV_2D_C
+| | | | +--->BN_MP_MOD_2D_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_RSHD_C
+| | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_EXCH_C
+| | | +--->BN_MP_EXCH_C
+| | | +--->BN_MP_INIT_SIZE_C
+| | | +--->BN_MP_INIT_COPY_C
+| | | +--->BN_MP_LSHD_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_RSHD_C
+| | | +--->BN_MP_RSHD_C
+| | | +--->BN_MP_MUL_D_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_EXCH_C
+| | +--->BN_MP_ADD_C
+| | | +--->BN_S_MP_ADD_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_CMP_MAG_C
+| | | +--->BN_S_MP_SUB_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| +--->BN_MP_COPY_C
+| | +--->BN_MP_GROW_C
+| +--->BN_MP_SQR_C
+| | +--->BN_MP_TOOM_SQR_C
+| | | +--->BN_MP_INIT_MULTI_C
+| | | +--->BN_MP_MOD_2D_C
+| | | | +--->BN_MP_ZERO_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_RSHD_C
+| | | | +--->BN_MP_ZERO_C
+| | | +--->BN_MP_MUL_2_C
+| | | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_ADD_C
+| | | | +--->BN_S_MP_ADD_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_CMP_MAG_C
+| | | | +--->BN_S_MP_SUB_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_SUB_C
+| | | | +--->BN_S_MP_ADD_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_CMP_MAG_C
+| | | | +--->BN_S_MP_SUB_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_DIV_2_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_MUL_2D_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_LSHD_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_MUL_D_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_DIV_3_C
+| | | | +--->BN_MP_INIT_SIZE_C
+| | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_EXCH_C
+| | | +--->BN_MP_LSHD_C
+| | | | +--->BN_MP_GROW_C
+| | +--->BN_MP_KARATSUBA_SQR_C
+| | | +--->BN_MP_INIT_SIZE_C
+| | | +--->BN_MP_CLAMP_C
+| | | +--->BN_S_MP_ADD_C
+| | | | +--->BN_MP_GROW_C
+| | | +--->BN_S_MP_SUB_C
+| | | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_LSHD_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_RSHD_C
+| | | | | +--->BN_MP_ZERO_C
+| | | +--->BN_MP_ADD_C
+| | | | +--->BN_MP_CMP_MAG_C
+| | +--->BN_FAST_S_MP_SQR_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_S_MP_SQR_C
+| | | +--->BN_MP_INIT_SIZE_C
+| | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_EXCH_C
+| +--->BN_MP_MUL_C
+| | +--->BN_MP_TOOM_MUL_C
+| | | +--->BN_MP_INIT_MULTI_C
+| | | +--->BN_MP_MOD_2D_C
+| | | | +--->BN_MP_ZERO_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_RSHD_C
+| | | | +--->BN_MP_ZERO_C
+| | | +--->BN_MP_MUL_2_C
+| | | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_ADD_C
+| | | | +--->BN_S_MP_ADD_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_CMP_MAG_C
+| | | | +--->BN_S_MP_SUB_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_SUB_C
+| | | | +--->BN_S_MP_ADD_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_CMP_MAG_C
+| | | | +--->BN_S_MP_SUB_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_DIV_2_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_MUL_2D_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_LSHD_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_MUL_D_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_DIV_3_C
+| | | | +--->BN_MP_INIT_SIZE_C
+| | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_EXCH_C
+| | | +--->BN_MP_LSHD_C
+| | | | +--->BN_MP_GROW_C
+| | +--->BN_MP_KARATSUBA_MUL_C
+| | | +--->BN_MP_INIT_SIZE_C
+| | | +--->BN_MP_CLAMP_C
+| | | +--->BN_S_MP_ADD_C
+| | | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_ADD_C
+| | | | +--->BN_MP_CMP_MAG_C
+| | | | +--->BN_S_MP_SUB_C
+| | | | | +--->BN_MP_GROW_C
+| | | +--->BN_S_MP_SUB_C
+| | | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_LSHD_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_RSHD_C
+| | | | | +--->BN_MP_ZERO_C
+| | +--->BN_FAST_S_MP_MUL_DIGS_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_S_MP_MUL_DIGS_C
+| | | +--->BN_MP_INIT_SIZE_C
+| | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_EXCH_C
+| +--->BN_MP_SET_C
+| | +--->BN_MP_ZERO_C
+| +--->BN_MP_EXCH_C
++--->BN_MP_DR_IS_MODULUS_C
++--->BN_MP_REDUCE_IS_2K_C
+| +--->BN_MP_REDUCE_2K_C
+| | +--->BN_MP_COUNT_BITS_C
+| | +--->BN_MP_DIV_2D_C
+| | | +--->BN_MP_COPY_C
+| | | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_ZERO_C
+| | | +--->BN_MP_MOD_2D_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_RSHD_C
+| | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_EXCH_C
+| | +--->BN_MP_MUL_D_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_S_MP_ADD_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_CMP_MAG_C
+| | +--->BN_S_MP_SUB_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLAMP_C
+| +--->BN_MP_COUNT_BITS_C
++--->BN_MP_EXPTMOD_FAST_C
+| +--->BN_MP_COUNT_BITS_C
+| +--->BN_MP_MONTGOMERY_SETUP_C
+| +--->BN_FAST_MP_MONTGOMERY_REDUCE_C
+| | +--->BN_MP_GROW_C
+| | +--->BN_MP_RSHD_C
+| | | +--->BN_MP_ZERO_C
+| | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_CMP_MAG_C
+| | +--->BN_S_MP_SUB_C
+| +--->BN_MP_MONTGOMERY_REDUCE_C
+| | +--->BN_MP_GROW_C
+| | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_RSHD_C
+| | | +--->BN_MP_ZERO_C
+| | +--->BN_MP_CMP_MAG_C
+| | +--->BN_S_MP_SUB_C
+| +--->BN_MP_DR_SETUP_C
+| +--->BN_MP_DR_REDUCE_C
+| | +--->BN_MP_GROW_C
+| | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_CMP_MAG_C
+| | +--->BN_S_MP_SUB_C
+| +--->BN_MP_REDUCE_2K_SETUP_C
+| | +--->BN_MP_2EXPT_C
+| | | +--->BN_MP_ZERO_C
+| | | +--->BN_MP_GROW_C
+| | +--->BN_S_MP_SUB_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLAMP_C
+| +--->BN_MP_REDUCE_2K_C
+| | +--->BN_MP_DIV_2D_C
+| | | +--->BN_MP_COPY_C
+| | | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_ZERO_C
+| | | +--->BN_MP_MOD_2D_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_RSHD_C
+| | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_EXCH_C
+| | +--->BN_MP_MUL_D_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_S_MP_ADD_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_CMP_MAG_C
+| | +--->BN_S_MP_SUB_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLAMP_C
+| +--->BN_MP_MONTGOMERY_CALC_NORMALIZATION_C
+| | +--->BN_MP_2EXPT_C
+| | | +--->BN_MP_ZERO_C
+| | | +--->BN_MP_GROW_C
+| | +--->BN_MP_SET_C
+| | | +--->BN_MP_ZERO_C
+| | +--->BN_MP_MUL_2_C
+| | | +--->BN_MP_GROW_C
+| | +--->BN_MP_CMP_MAG_C
+| | +--->BN_S_MP_SUB_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLAMP_C
+| +--->BN_MP_MULMOD_C
+| | +--->BN_MP_MUL_C
+| | | +--->BN_MP_TOOM_MUL_C
+| | | | +--->BN_MP_INIT_MULTI_C
+| | | | +--->BN_MP_MOD_2D_C
+| | | | | +--->BN_MP_ZERO_C
+| | | | | +--->BN_MP_COPY_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_COPY_C
+| | | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_RSHD_C
+| | | | | +--->BN_MP_ZERO_C
+| | | | +--->BN_MP_MUL_2_C
+| | | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_ADD_C
+| | | | | +--->BN_S_MP_ADD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_CMP_MAG_C
+| | | | | +--->BN_S_MP_SUB_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_SUB_C
+| | | | | +--->BN_S_MP_ADD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_CMP_MAG_C
+| | | | | +--->BN_S_MP_SUB_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_DIV_2_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_MUL_2D_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_LSHD_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_MUL_D_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_DIV_3_C
+| | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_EXCH_C
+| | | | +--->BN_MP_LSHD_C
+| | | | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_KARATSUBA_MUL_C
+| | | | +--->BN_MP_INIT_SIZE_C
+| | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_S_MP_ADD_C
+| | | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_ADD_C
+| | | | | +--->BN_MP_CMP_MAG_C
+| | | | | +--->BN_S_MP_SUB_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | +--->BN_S_MP_SUB_C
+| | | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_LSHD_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_RSHD_C
+| | | | | | +--->BN_MP_ZERO_C
+| | | +--->BN_FAST_S_MP_MUL_DIGS_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_S_MP_MUL_DIGS_C
+| | | | +--->BN_MP_INIT_SIZE_C
+| | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_EXCH_C
+| | +--->BN_MP_MOD_C
+| | | +--->BN_MP_DIV_C
+| | | | +--->BN_MP_CMP_MAG_C
+| | | | +--->BN_MP_COPY_C
+| | | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_ZERO_C
+| | | | +--->BN_MP_INIT_MULTI_C
+| | | | +--->BN_MP_SET_C
+| | | | +--->BN_MP_MUL_2D_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_LSHD_C
+| | | | | | +--->BN_MP_RSHD_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_CMP_C
+| | | | +--->BN_MP_SUB_C
+| | | | | +--->BN_S_MP_ADD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_S_MP_SUB_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_ADD_C
+| | | | | +--->BN_S_MP_ADD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_S_MP_SUB_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_DIV_2D_C
+| | | | | +--->BN_MP_MOD_2D_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_RSHD_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_EXCH_C
+| | | | +--->BN_MP_EXCH_C
+| | | | +--->BN_MP_INIT_SIZE_C
+| | | | +--->BN_MP_INIT_COPY_C
+| | | | +--->BN_MP_LSHD_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_RSHD_C
+| | | | +--->BN_MP_RSHD_C
+| | | | +--->BN_MP_MUL_D_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_EXCH_C
+| | | +--->BN_MP_ADD_C
+| | | | +--->BN_S_MP_ADD_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_CMP_MAG_C
+| | | | +--->BN_S_MP_SUB_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| +--->BN_MP_SET_C
+| | +--->BN_MP_ZERO_C
+| +--->BN_MP_MOD_C
+| | +--->BN_MP_DIV_C
+| | | +--->BN_MP_CMP_MAG_C
+| | | +--->BN_MP_COPY_C
+| | | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_ZERO_C
+| | | +--->BN_MP_INIT_MULTI_C
+| | | +--->BN_MP_MUL_2D_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_LSHD_C
+| | | | | +--->BN_MP_RSHD_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_CMP_C
+| | | +--->BN_MP_SUB_C
+| | | | +--->BN_S_MP_ADD_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_S_MP_SUB_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_ADD_C
+| | | | +--->BN_S_MP_ADD_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_S_MP_SUB_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_DIV_2D_C
+| | | | +--->BN_MP_MOD_2D_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_RSHD_C
+| | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_EXCH_C
+| | | +--->BN_MP_EXCH_C
+| | | +--->BN_MP_INIT_SIZE_C
+| | | +--->BN_MP_INIT_COPY_C
+| | | +--->BN_MP_LSHD_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_RSHD_C
+| | | +--->BN_MP_RSHD_C
+| | | +--->BN_MP_MUL_D_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_EXCH_C
+| | +--->BN_MP_ADD_C
+| | | +--->BN_S_MP_ADD_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_CMP_MAG_C
+| | | +--->BN_S_MP_SUB_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| +--->BN_MP_COPY_C
+| | +--->BN_MP_GROW_C
+| +--->BN_MP_SQR_C
+| | +--->BN_MP_TOOM_SQR_C
+| | | +--->BN_MP_INIT_MULTI_C
+| | | +--->BN_MP_MOD_2D_C
+| | | | +--->BN_MP_ZERO_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_RSHD_C
+| | | | +--->BN_MP_ZERO_C
+| | | +--->BN_MP_MUL_2_C
+| | | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_ADD_C
+| | | | +--->BN_S_MP_ADD_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_CMP_MAG_C
+| | | | +--->BN_S_MP_SUB_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_SUB_C
+| | | | +--->BN_S_MP_ADD_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_CMP_MAG_C
+| | | | +--->BN_S_MP_SUB_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_DIV_2_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_MUL_2D_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_LSHD_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_MUL_D_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_DIV_3_C
+| | | | +--->BN_MP_INIT_SIZE_C
+| | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_EXCH_C
+| | | +--->BN_MP_LSHD_C
+| | | | +--->BN_MP_GROW_C
+| | +--->BN_MP_KARATSUBA_SQR_C
+| | | +--->BN_MP_INIT_SIZE_C
+| | | +--->BN_MP_CLAMP_C
+| | | +--->BN_S_MP_ADD_C
+| | | | +--->BN_MP_GROW_C
+| | | +--->BN_S_MP_SUB_C
+| | | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_LSHD_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_RSHD_C
+| | | | | +--->BN_MP_ZERO_C
+| | | +--->BN_MP_ADD_C
+| | | | +--->BN_MP_CMP_MAG_C
+| | +--->BN_FAST_S_MP_SQR_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_S_MP_SQR_C
+| | | +--->BN_MP_INIT_SIZE_C
+| | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_EXCH_C
+| +--->BN_MP_MUL_C
+| | +--->BN_MP_TOOM_MUL_C
+| | | +--->BN_MP_INIT_MULTI_C
+| | | +--->BN_MP_MOD_2D_C
+| | | | +--->BN_MP_ZERO_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_RSHD_C
+| | | | +--->BN_MP_ZERO_C
+| | | +--->BN_MP_MUL_2_C
+| | | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_ADD_C
+| | | | +--->BN_S_MP_ADD_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_CMP_MAG_C
+| | | | +--->BN_S_MP_SUB_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_SUB_C
+| | | | +--->BN_S_MP_ADD_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_CMP_MAG_C
+| | | | +--->BN_S_MP_SUB_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_DIV_2_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_MUL_2D_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_LSHD_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_MUL_D_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_DIV_3_C
+| | | | +--->BN_MP_INIT_SIZE_C
+| | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_EXCH_C
+| | | +--->BN_MP_LSHD_C
+| | | | +--->BN_MP_GROW_C
+| | +--->BN_MP_KARATSUBA_MUL_C
+| | | +--->BN_MP_INIT_SIZE_C
+| | | +--->BN_MP_CLAMP_C
+| | | +--->BN_S_MP_ADD_C
+| | | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_ADD_C
+| | | | +--->BN_MP_CMP_MAG_C
+| | | | +--->BN_S_MP_SUB_C
+| | | | | +--->BN_MP_GROW_C
+| | | +--->BN_S_MP_SUB_C
+| | | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_LSHD_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_RSHD_C
+| | | | | +--->BN_MP_ZERO_C
+| | +--->BN_FAST_S_MP_MUL_DIGS_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_S_MP_MUL_DIGS_C
+| | | +--->BN_MP_INIT_SIZE_C
+| | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_EXCH_C
+| +--->BN_MP_EXCH_C
+
+
+BN_MP_LSHD_C
++--->BN_MP_GROW_C
++--->BN_MP_RSHD_C
+| +--->BN_MP_ZERO_C
+
+
+BN_MP_ADD_D_C
++--->BN_MP_GROW_C
++--->BN_MP_SUB_D_C
+| +--->BN_MP_CLAMP_C
++--->BN_MP_CLAMP_C
+
+
+BN_MP_GET_LONG_C
+
+
+BN_MP_GET_LONG_LONG_C
+
+
+BN_MP_CLEAR_C
+
+
+BN_MP_EXTEUCLID_C
++--->BN_MP_INIT_MULTI_C
+| +--->BN_MP_INIT_C
+| +--->BN_MP_CLEAR_C
++--->BN_MP_SET_C
+| +--->BN_MP_ZERO_C
++--->BN_MP_COPY_C
+| +--->BN_MP_GROW_C
++--->BN_MP_DIV_C
+| +--->BN_MP_CMP_MAG_C
+| +--->BN_MP_ZERO_C
+| +--->BN_MP_COUNT_BITS_C
+| +--->BN_MP_ABS_C
+| +--->BN_MP_MUL_2D_C
+| | +--->BN_MP_GROW_C
+| | +--->BN_MP_LSHD_C
+| | | +--->BN_MP_RSHD_C
+| | +--->BN_MP_CLAMP_C
+| +--->BN_MP_CMP_C
+| +--->BN_MP_SUB_C
+| | +--->BN_S_MP_ADD_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_S_MP_SUB_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLAMP_C
+| +--->BN_MP_ADD_C
+| | +--->BN_S_MP_ADD_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_S_MP_SUB_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLAMP_C
+| +--->BN_MP_DIV_2D_C
+| | +--->BN_MP_INIT_C
+| | +--->BN_MP_MOD_2D_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_CLEAR_C
+| | +--->BN_MP_RSHD_C
+| | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_EXCH_C
+| +--->BN_MP_EXCH_C
+| +--->BN_MP_CLEAR_MULTI_C
+| | +--->BN_MP_CLEAR_C
+| +--->BN_MP_INIT_SIZE_C
+| | +--->BN_MP_INIT_C
+| +--->BN_MP_INIT_C
+| +--->BN_MP_INIT_COPY_C
+| +--->BN_MP_LSHD_C
+| | +--->BN_MP_GROW_C
+| | +--->BN_MP_RSHD_C
+| +--->BN_MP_RSHD_C
+| +--->BN_MP_MUL_D_C
+| | +--->BN_MP_GROW_C
+| | +--->BN_MP_CLAMP_C
+| +--->BN_MP_CLAMP_C
+| +--->BN_MP_CLEAR_C
++--->BN_MP_MUL_C
+| +--->BN_MP_TOOM_MUL_C
+| | +--->BN_MP_MOD_2D_C
+| | | +--->BN_MP_ZERO_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_RSHD_C
+| | | +--->BN_MP_ZERO_C
+| | +--->BN_MP_MUL_2_C
+| | | +--->BN_MP_GROW_C
+| | +--->BN_MP_ADD_C
+| | | +--->BN_S_MP_ADD_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_CMP_MAG_C
+| | | +--->BN_S_MP_SUB_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_SUB_C
+| | | +--->BN_S_MP_ADD_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_CMP_MAG_C
+| | | +--->BN_S_MP_SUB_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_DIV_2_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_MUL_2D_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_LSHD_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_MUL_D_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_DIV_3_C
+| | | +--->BN_MP_INIT_SIZE_C
+| | | | +--->BN_MP_INIT_C
+| | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_EXCH_C
+| | | +--->BN_MP_CLEAR_C
+| | +--->BN_MP_LSHD_C
+| | | +--->BN_MP_GROW_C
+| | +--->BN_MP_CLEAR_MULTI_C
+| | | +--->BN_MP_CLEAR_C
+| +--->BN_MP_KARATSUBA_MUL_C
+| | +--->BN_MP_INIT_SIZE_C
+| | | +--->BN_MP_INIT_C
+| | +--->BN_MP_CLAMP_C
+| | +--->BN_S_MP_ADD_C
+| | | +--->BN_MP_GROW_C
+| | +--->BN_MP_ADD_C
+| | | +--->BN_MP_CMP_MAG_C
+| | | +--->BN_S_MP_SUB_C
+| | | | +--->BN_MP_GROW_C
+| | +--->BN_S_MP_SUB_C
+| | | +--->BN_MP_GROW_C
+| | +--->BN_MP_LSHD_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_RSHD_C
+| | | | +--->BN_MP_ZERO_C
+| | +--->BN_MP_CLEAR_C
+| +--->BN_FAST_S_MP_MUL_DIGS_C
+| | +--->BN_MP_GROW_C
+| | +--->BN_MP_CLAMP_C
+| +--->BN_S_MP_MUL_DIGS_C
+| | +--->BN_MP_INIT_SIZE_C
+| | | +--->BN_MP_INIT_C
+| | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_EXCH_C
+| | +--->BN_MP_CLEAR_C
++--->BN_MP_SUB_C
+| +--->BN_S_MP_ADD_C
+| | +--->BN_MP_GROW_C
+| | +--->BN_MP_CLAMP_C
+| +--->BN_MP_CMP_MAG_C
+| +--->BN_S_MP_SUB_C
+| | +--->BN_MP_GROW_C
+| | +--->BN_MP_CLAMP_C
++--->BN_MP_NEG_C
++--->BN_MP_EXCH_C
++--->BN_MP_CLEAR_MULTI_C
+| +--->BN_MP_CLEAR_C
+
+
+BN_MP_TORADIX_N_C
++--->BN_MP_INIT_COPY_C
+| +--->BN_MP_INIT_SIZE_C
+| +--->BN_MP_COPY_C
+| | +--->BN_MP_GROW_C
++--->BN_MP_DIV_D_C
+| +--->BN_MP_COPY_C
+| | +--->BN_MP_GROW_C
+| +--->BN_MP_DIV_2D_C
+| | +--->BN_MP_ZERO_C
+| | +--->BN_MP_MOD_2D_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_CLEAR_C
+| | +--->BN_MP_RSHD_C
+| | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_EXCH_C
+| +--->BN_MP_DIV_3_C
+| | +--->BN_MP_INIT_SIZE_C
+| | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_EXCH_C
+| | +--->BN_MP_CLEAR_C
+| +--->BN_MP_INIT_SIZE_C
+| +--->BN_MP_CLAMP_C
+| +--->BN_MP_EXCH_C
+| +--->BN_MP_CLEAR_C
++--->BN_MP_CLEAR_C
+
+
+BN_MP_RADIX_SIZE_C
++--->BN_MP_COUNT_BITS_C
++--->BN_MP_INIT_COPY_C
+| +--->BN_MP_INIT_SIZE_C
+| +--->BN_MP_COPY_C
+| | +--->BN_MP_GROW_C
++--->BN_MP_DIV_D_C
+| +--->BN_MP_COPY_C
+| | +--->BN_MP_GROW_C
+| +--->BN_MP_DIV_2D_C
+| | +--->BN_MP_ZERO_C
+| | +--->BN_MP_MOD_2D_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_CLEAR_C
+| | +--->BN_MP_RSHD_C
+| | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_EXCH_C
+| +--->BN_MP_DIV_3_C
+| | +--->BN_MP_INIT_SIZE_C
+| | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_EXCH_C
+| | +--->BN_MP_CLEAR_C
+| +--->BN_MP_INIT_SIZE_C
+| +--->BN_MP_CLAMP_C
+| +--->BN_MP_EXCH_C
+| +--->BN_MP_CLEAR_C
++--->BN_MP_CLEAR_C
+
+
+BN_S_MP_MUL_HIGH_DIGS_C
++--->BN_FAST_S_MP_MUL_HIGH_DIGS_C
+| +--->BN_MP_GROW_C
+| +--->BN_MP_CLAMP_C
++--->BN_MP_INIT_SIZE_C
+| +--->BN_MP_INIT_C
++--->BN_MP_CLAMP_C
++--->BN_MP_EXCH_C
++--->BN_MP_CLEAR_C
+
+
+BN_MP_SET_INT_C
++--->BN_MP_ZERO_C
++--->BN_MP_MUL_2D_C
+| +--->BN_MP_COPY_C
+| | +--->BN_MP_GROW_C
+| +--->BN_MP_GROW_C
+| +--->BN_MP_LSHD_C
+| | +--->BN_MP_RSHD_C
+| +--->BN_MP_CLAMP_C
++--->BN_MP_CLAMP_C
+
+
+BN_MP_DR_SETUP_C
+
+
+BN_MP_MUL_2_C
++--->BN_MP_GROW_C
+
+
+BN_MP_FWRITE_C
++--->BN_MP_RADIX_SIZE_C
+| +--->BN_MP_COUNT_BITS_C
+| +--->BN_MP_INIT_COPY_C
+| | +--->BN_MP_INIT_SIZE_C
+| | +--->BN_MP_COPY_C
+| | | +--->BN_MP_GROW_C
+| +--->BN_MP_DIV_D_C
+| | +--->BN_MP_COPY_C
+| | | +--->BN_MP_GROW_C
+| | +--->BN_MP_DIV_2D_C
+| | | +--->BN_MP_ZERO_C
+| | | +--->BN_MP_MOD_2D_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_CLEAR_C
+| | | +--->BN_MP_RSHD_C
+| | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_EXCH_C
+| | +--->BN_MP_DIV_3_C
+| | | +--->BN_MP_INIT_SIZE_C
+| | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_EXCH_C
+| | | +--->BN_MP_CLEAR_C
+| | +--->BN_MP_INIT_SIZE_C
+| | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_EXCH_C
+| | +--->BN_MP_CLEAR_C
+| +--->BN_MP_CLEAR_C
++--->BN_MP_TORADIX_C
+| +--->BN_MP_INIT_COPY_C
+| | +--->BN_MP_INIT_SIZE_C
+| | +--->BN_MP_COPY_C
+| | | +--->BN_MP_GROW_C
+| +--->BN_MP_DIV_D_C
+| | +--->BN_MP_COPY_C
+| | | +--->BN_MP_GROW_C
+| | +--->BN_MP_DIV_2D_C
+| | | +--->BN_MP_ZERO_C
+| | | +--->BN_MP_MOD_2D_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_CLEAR_C
+| | | +--->BN_MP_RSHD_C
+| | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_EXCH_C
+| | +--->BN_MP_DIV_3_C
+| | | +--->BN_MP_INIT_SIZE_C
+| | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_EXCH_C
+| | | +--->BN_MP_CLEAR_C
+| | +--->BN_MP_INIT_SIZE_C
+| | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_EXCH_C
+| | +--->BN_MP_CLEAR_C
+| +--->BN_MP_CLEAR_C
+
+
+BN_MP_GROW_C
+
+
+BN_MP_READ_RADIX_C
++--->BN_MP_ZERO_C
++--->BN_MP_MUL_D_C
+| +--->BN_MP_GROW_C
+| +--->BN_MP_CLAMP_C
++--->BN_MP_ADD_D_C
+| +--->BN_MP_GROW_C
+| +--->BN_MP_SUB_D_C
+| | +--->BN_MP_CLAMP_C
+| +--->BN_MP_CLAMP_C
+
+
+BN_S_MP_MUL_DIGS_C
++--->BN_FAST_S_MP_MUL_DIGS_C
+| +--->BN_MP_GROW_C
+| +--->BN_MP_CLAMP_C
++--->BN_MP_INIT_SIZE_C
+| +--->BN_MP_INIT_C
++--->BN_MP_CLAMP_C
++--->BN_MP_EXCH_C
++--->BN_MP_CLEAR_C
+
+
+BN_PRIME_TAB_C
+
+
+BN_MP_IS_SQUARE_C
++--->BN_MP_MOD_D_C
+| +--->BN_MP_DIV_D_C
+| | +--->BN_MP_COPY_C
+| | | +--->BN_MP_GROW_C
+| | +--->BN_MP_DIV_2D_C
+| | | +--->BN_MP_ZERO_C
+| | | +--->BN_MP_INIT_C
+| | | +--->BN_MP_MOD_2D_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_CLEAR_C
+| | | +--->BN_MP_RSHD_C
+| | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_EXCH_C
+| | +--->BN_MP_DIV_3_C
+| | | +--->BN_MP_INIT_SIZE_C
+| | | | +--->BN_MP_INIT_C
+| | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_EXCH_C
+| | | +--->BN_MP_CLEAR_C
+| | +--->BN_MP_INIT_SIZE_C
+| | | +--->BN_MP_INIT_C
+| | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_EXCH_C
+| | +--->BN_MP_CLEAR_C
++--->BN_MP_INIT_SET_INT_C
+| +--->BN_MP_INIT_C
+| +--->BN_MP_SET_INT_C
+| | +--->BN_MP_ZERO_C
+| | +--->BN_MP_MUL_2D_C
+| | | +--->BN_MP_COPY_C
+| | | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_LSHD_C
+| | | | +--->BN_MP_RSHD_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_CLAMP_C
++--->BN_MP_MOD_C
+| +--->BN_MP_INIT_C
+| +--->BN_MP_DIV_C
+| | +--->BN_MP_CMP_MAG_C
+| | +--->BN_MP_COPY_C
+| | | +--->BN_MP_GROW_C
+| | +--->BN_MP_ZERO_C
+| | +--->BN_MP_INIT_MULTI_C
+| | | +--->BN_MP_CLEAR_C
+| | +--->BN_MP_SET_C
+| | +--->BN_MP_COUNT_BITS_C
+| | +--->BN_MP_ABS_C
+| | +--->BN_MP_MUL_2D_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_LSHD_C
+| | | | +--->BN_MP_RSHD_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_CMP_C
+| | +--->BN_MP_SUB_C
+| | | +--->BN_S_MP_ADD_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_S_MP_SUB_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_ADD_C
+| | | +--->BN_S_MP_ADD_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_S_MP_SUB_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_DIV_2D_C
+| | | +--->BN_MP_MOD_2D_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_CLEAR_C
+| | | +--->BN_MP_RSHD_C
+| | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_EXCH_C
+| | +--->BN_MP_EXCH_C
+| | +--->BN_MP_CLEAR_MULTI_C
+| | | +--->BN_MP_CLEAR_C
+| | +--->BN_MP_INIT_SIZE_C
+| | +--->BN_MP_INIT_COPY_C
+| | +--->BN_MP_LSHD_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_RSHD_C
+| | +--->BN_MP_RSHD_C
+| | +--->BN_MP_MUL_D_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_CLEAR_C
+| +--->BN_MP_CLEAR_C
+| +--->BN_MP_EXCH_C
+| +--->BN_MP_ADD_C
+| | +--->BN_S_MP_ADD_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_CMP_MAG_C
+| | +--->BN_S_MP_SUB_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLAMP_C
++--->BN_MP_GET_INT_C
++--->BN_MP_SQRT_C
+| +--->BN_MP_N_ROOT_C
+| | +--->BN_MP_N_ROOT_EX_C
+| | | +--->BN_MP_INIT_C
+| | | +--->BN_MP_SET_C
+| | | | +--->BN_MP_ZERO_C
+| | | +--->BN_MP_COPY_C
+| | | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_EXPT_D_EX_C
+| | | | +--->BN_MP_INIT_COPY_C
+| | | | | +--->BN_MP_INIT_SIZE_C
+| | | | +--->BN_MP_MUL_C
+| | | | | +--->BN_MP_TOOM_MUL_C
+| | | | | | +--->BN_MP_INIT_MULTI_C
+| | | | | | | +--->BN_MP_CLEAR_C
+| | | | | | +--->BN_MP_MOD_2D_C
+| | | | | | | +--->BN_MP_ZERO_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_RSHD_C
+| | | | | | | +--->BN_MP_ZERO_C
+| | | | | | +--->BN_MP_MUL_2_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_ADD_C
+| | | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | | +--->BN_MP_CMP_MAG_C
+| | | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_SUB_C
+| | | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | | +--->BN_MP_CMP_MAG_C
+| | | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_DIV_2_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_MUL_2D_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_LSHD_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_MUL_D_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_DIV_3_C
+| | | | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | | +--->BN_MP_EXCH_C
+| | | | | | | +--->BN_MP_CLEAR_C
+| | | | | | +--->BN_MP_LSHD_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLEAR_MULTI_C
+| | | | | | | +--->BN_MP_CLEAR_C
+| | | | | +--->BN_MP_KARATSUBA_MUL_C
+| | | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_ADD_C
+| | | | | | | +--->BN_MP_CMP_MAG_C
+| | | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_LSHD_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_RSHD_C
+| | | | | | | | +--->BN_MP_ZERO_C
+| | | | | | +--->BN_MP_CLEAR_C
+| | | | | +--->BN_FAST_S_MP_MUL_DIGS_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_S_MP_MUL_DIGS_C
+| | | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_EXCH_C
+| | | | | | +--->BN_MP_CLEAR_C
+| | | | +--->BN_MP_CLEAR_C
+| | | | +--->BN_MP_SQR_C
+| | | | | +--->BN_MP_TOOM_SQR_C
+| | | | | | +--->BN_MP_INIT_MULTI_C
+| | | | | | +--->BN_MP_MOD_2D_C
+| | | | | | | +--->BN_MP_ZERO_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_RSHD_C
+| | | | | | | +--->BN_MP_ZERO_C
+| | | | | | +--->BN_MP_MUL_2_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_ADD_C
+| | | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | | +--->BN_MP_CMP_MAG_C
+| | | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_SUB_C
+| | | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | | +--->BN_MP_CMP_MAG_C
+| | | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | | +--->BN_MP_GROW_C
+| | | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_DIV_2_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_MUL_2D_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_LSHD_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_MUL_D_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_DIV_3_C
+| | | | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | | +--->BN_MP_EXCH_C
+| | | | | | +--->BN_MP_LSHD_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLEAR_MULTI_C
+| | | | | +--->BN_MP_KARATSUBA_SQR_C
+| | | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_LSHD_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_RSHD_C
+| | | | | | | | +--->BN_MP_ZERO_C
+| | | | | | +--->BN_MP_ADD_C
+| | | | | | | +--->BN_MP_CMP_MAG_C
+| | | | | +--->BN_FAST_S_MP_SQR_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_S_MP_SQR_C
+| | | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_EXCH_C
+| | | +--->BN_MP_MUL_C
+| | | | +--->BN_MP_TOOM_MUL_C
+| | | | | +--->BN_MP_INIT_MULTI_C
+| | | | | | +--->BN_MP_CLEAR_C
+| | | | | +--->BN_MP_MOD_2D_C
+| | | | | | +--->BN_MP_ZERO_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_RSHD_C
+| | | | | | +--->BN_MP_ZERO_C
+| | | | | +--->BN_MP_MUL_2_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_ADD_C
+| | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_CMP_MAG_C
+| | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_SUB_C
+| | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_CMP_MAG_C
+| | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_DIV_2_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_MUL_2D_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_LSHD_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_MUL_D_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_DIV_3_C
+| | | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_EXCH_C
+| | | | | | +--->BN_MP_CLEAR_C
+| | | | | +--->BN_MP_LSHD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLEAR_MULTI_C
+| | | | | | +--->BN_MP_CLEAR_C
+| | | | +--->BN_MP_KARATSUBA_MUL_C
+| | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_S_MP_ADD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_ADD_C
+| | | | | | +--->BN_MP_CMP_MAG_C
+| | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_S_MP_SUB_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_LSHD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_RSHD_C
+| | | | | | | +--->BN_MP_ZERO_C
+| | | | | +--->BN_MP_CLEAR_C
+| | | | +--->BN_FAST_S_MP_MUL_DIGS_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_S_MP_MUL_DIGS_C
+| | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_EXCH_C
+| | | | | +--->BN_MP_CLEAR_C
+| | | +--->BN_MP_SUB_C
+| | | | +--->BN_S_MP_ADD_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_CMP_MAG_C
+| | | | +--->BN_S_MP_SUB_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_MUL_D_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_DIV_C
+| | | | +--->BN_MP_CMP_MAG_C
+| | | | +--->BN_MP_ZERO_C
+| | | | +--->BN_MP_INIT_MULTI_C
+| | | | | +--->BN_MP_CLEAR_C
+| | | | +--->BN_MP_COUNT_BITS_C
+| | | | +--->BN_MP_ABS_C
+| | | | +--->BN_MP_MUL_2D_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_LSHD_C
+| | | | | | +--->BN_MP_RSHD_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_CMP_C
+| | | | +--->BN_MP_ADD_C
+| | | | | +--->BN_S_MP_ADD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_S_MP_SUB_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_DIV_2D_C
+| | | | | +--->BN_MP_MOD_2D_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_CLEAR_C
+| | | | | +--->BN_MP_RSHD_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_EXCH_C
+| | | | +--->BN_MP_EXCH_C
+| | | | +--->BN_MP_CLEAR_MULTI_C
+| | | | | +--->BN_MP_CLEAR_C
+| | | | +--->BN_MP_INIT_SIZE_C
+| | | | +--->BN_MP_INIT_COPY_C
+| | | | +--->BN_MP_LSHD_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_RSHD_C
+| | | | +--->BN_MP_RSHD_C
+| | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_CLEAR_C
+| | | +--->BN_MP_CMP_C
+| | | | +--->BN_MP_CMP_MAG_C
+| | | +--->BN_MP_SUB_D_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_ADD_D_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_EXCH_C
+| | | +--->BN_MP_CLEAR_C
+| +--->BN_MP_ZERO_C
+| +--->BN_MP_INIT_COPY_C
+| | +--->BN_MP_INIT_SIZE_C
+| | +--->BN_MP_COPY_C
+| | | +--->BN_MP_GROW_C
+| +--->BN_MP_RSHD_C
+| +--->BN_MP_DIV_C
+| | +--->BN_MP_CMP_MAG_C
+| | +--->BN_MP_COPY_C
+| | | +--->BN_MP_GROW_C
+| | +--->BN_MP_INIT_MULTI_C
+| | | +--->BN_MP_CLEAR_C
+| | +--->BN_MP_SET_C
+| | +--->BN_MP_COUNT_BITS_C
+| | +--->BN_MP_ABS_C
+| | +--->BN_MP_MUL_2D_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_LSHD_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_CMP_C
+| | +--->BN_MP_SUB_C
+| | | +--->BN_S_MP_ADD_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_S_MP_SUB_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_ADD_C
+| | | +--->BN_S_MP_ADD_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_S_MP_SUB_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_DIV_2D_C
+| | | +--->BN_MP_MOD_2D_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_CLEAR_C
+| | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_EXCH_C
+| | +--->BN_MP_EXCH_C
+| | +--->BN_MP_CLEAR_MULTI_C
+| | | +--->BN_MP_CLEAR_C
+| | +--->BN_MP_INIT_SIZE_C
+| | +--->BN_MP_LSHD_C
+| | | +--->BN_MP_GROW_C
+| | +--->BN_MP_MUL_D_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_CLEAR_C
+| +--->BN_MP_ADD_C
+| | +--->BN_S_MP_ADD_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_CMP_MAG_C
+| | +--->BN_S_MP_SUB_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLAMP_C
+| +--->BN_MP_DIV_2_C
+| | +--->BN_MP_GROW_C
+| | +--->BN_MP_CLAMP_C
+| +--->BN_MP_CMP_MAG_C
+| +--->BN_MP_EXCH_C
+| +--->BN_MP_CLEAR_C
++--->BN_MP_SQR_C
+| +--->BN_MP_TOOM_SQR_C
+| | +--->BN_MP_INIT_MULTI_C
+| | | +--->BN_MP_INIT_C
+| | | +--->BN_MP_CLEAR_C
+| | +--->BN_MP_MOD_2D_C
+| | | +--->BN_MP_ZERO_C
+| | | +--->BN_MP_COPY_C
+| | | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_COPY_C
+| | | +--->BN_MP_GROW_C
+| | +--->BN_MP_RSHD_C
+| | | +--->BN_MP_ZERO_C
+| | +--->BN_MP_MUL_2_C
+| | | +--->BN_MP_GROW_C
+| | +--->BN_MP_ADD_C
+| | | +--->BN_S_MP_ADD_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_CMP_MAG_C
+| | | +--->BN_S_MP_SUB_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_SUB_C
+| | | +--->BN_S_MP_ADD_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_CMP_MAG_C
+| | | +--->BN_S_MP_SUB_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_DIV_2_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_MUL_2D_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_LSHD_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_MUL_D_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_DIV_3_C
+| | | +--->BN_MP_INIT_SIZE_C
+| | | | +--->BN_MP_INIT_C
+| | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_EXCH_C
+| | | +--->BN_MP_CLEAR_C
+| | +--->BN_MP_LSHD_C
+| | | +--->BN_MP_GROW_C
+| | +--->BN_MP_CLEAR_MULTI_C
+| | | +--->BN_MP_CLEAR_C
+| +--->BN_MP_KARATSUBA_SQR_C
+| | +--->BN_MP_INIT_SIZE_C
+| | | +--->BN_MP_INIT_C
+| | +--->BN_MP_CLAMP_C
+| | +--->BN_S_MP_ADD_C
+| | | +--->BN_MP_GROW_C
+| | +--->BN_S_MP_SUB_C
+| | | +--->BN_MP_GROW_C
+| | +--->BN_MP_LSHD_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_RSHD_C
+| | | | +--->BN_MP_ZERO_C
+| | +--->BN_MP_ADD_C
+| | | +--->BN_MP_CMP_MAG_C
+| | +--->BN_MP_CLEAR_C
+| +--->BN_FAST_S_MP_SQR_C
+| | +--->BN_MP_GROW_C
+| | +--->BN_MP_CLAMP_C
+| +--->BN_S_MP_SQR_C
+| | +--->BN_MP_INIT_SIZE_C
+| | | +--->BN_MP_INIT_C
+| | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_EXCH_C
+| | +--->BN_MP_CLEAR_C
++--->BN_MP_CMP_MAG_C
++--->BN_MP_CLEAR_C
+
+
+BN_MP_COPY_C
++--->BN_MP_GROW_C
+
+
+BN_MP_TOOM_SQR_C
++--->BN_MP_INIT_MULTI_C
+| +--->BN_MP_INIT_C
+| +--->BN_MP_CLEAR_C
++--->BN_MP_MOD_2D_C
+| +--->BN_MP_ZERO_C
+| +--->BN_MP_COPY_C
+| | +--->BN_MP_GROW_C
+| +--->BN_MP_CLAMP_C
++--->BN_MP_COPY_C
+| +--->BN_MP_GROW_C
++--->BN_MP_RSHD_C
+| +--->BN_MP_ZERO_C
++--->BN_MP_SQR_C
+| +--->BN_MP_KARATSUBA_SQR_C
+| | +--->BN_MP_INIT_SIZE_C
+| | | +--->BN_MP_INIT_C
+| | +--->BN_MP_CLAMP_C
+| | +--->BN_S_MP_ADD_C
+| | | +--->BN_MP_GROW_C
+| | +--->BN_S_MP_SUB_C
+| | | +--->BN_MP_GROW_C
+| | +--->BN_MP_LSHD_C
+| | | +--->BN_MP_GROW_C
+| | +--->BN_MP_ADD_C
+| | | +--->BN_MP_CMP_MAG_C
+| | +--->BN_MP_CLEAR_C
+| +--->BN_FAST_S_MP_SQR_C
+| | +--->BN_MP_GROW_C
+| | +--->BN_MP_CLAMP_C
+| +--->BN_S_MP_SQR_C
+| | +--->BN_MP_INIT_SIZE_C
+| | | +--->BN_MP_INIT_C
+| | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_EXCH_C
+| | +--->BN_MP_CLEAR_C
++--->BN_MP_MUL_2_C
+| +--->BN_MP_GROW_C
++--->BN_MP_ADD_C
+| +--->BN_S_MP_ADD_C
+| | +--->BN_MP_GROW_C
+| | +--->BN_MP_CLAMP_C
+| +--->BN_MP_CMP_MAG_C
+| +--->BN_S_MP_SUB_C
+| | +--->BN_MP_GROW_C
+| | +--->BN_MP_CLAMP_C
++--->BN_MP_SUB_C
+| +--->BN_S_MP_ADD_C
+| | +--->BN_MP_GROW_C
+| | +--->BN_MP_CLAMP_C
+| +--->BN_MP_CMP_MAG_C
+| +--->BN_S_MP_SUB_C
+| | +--->BN_MP_GROW_C
+| | +--->BN_MP_CLAMP_C
++--->BN_MP_DIV_2_C
+| +--->BN_MP_GROW_C
+| +--->BN_MP_CLAMP_C
++--->BN_MP_MUL_2D_C
+| +--->BN_MP_GROW_C
+| +--->BN_MP_LSHD_C
+| +--->BN_MP_CLAMP_C
++--->BN_MP_MUL_D_C
+| +--->BN_MP_GROW_C
+| +--->BN_MP_CLAMP_C
++--->BN_MP_DIV_3_C
+| +--->BN_MP_INIT_SIZE_C
+| | +--->BN_MP_INIT_C
+| +--->BN_MP_CLAMP_C
+| +--->BN_MP_EXCH_C
+| +--->BN_MP_CLEAR_C
++--->BN_MP_LSHD_C
+| +--->BN_MP_GROW_C
++--->BN_MP_CLEAR_MULTI_C
+| +--->BN_MP_CLEAR_C
+
+
+BN_MP_KARATSUBA_SQR_C
++--->BN_MP_INIT_SIZE_C
+| +--->BN_MP_INIT_C
++--->BN_MP_CLAMP_C
++--->BN_MP_SQR_C
+| +--->BN_MP_TOOM_SQR_C
+| | +--->BN_MP_INIT_MULTI_C
+| | | +--->BN_MP_INIT_C
+| | | +--->BN_MP_CLEAR_C
+| | +--->BN_MP_MOD_2D_C
+| | | +--->BN_MP_ZERO_C
+| | | +--->BN_MP_COPY_C
+| | | | +--->BN_MP_GROW_C
+| | +--->BN_MP_COPY_C
+| | | +--->BN_MP_GROW_C
+| | +--->BN_MP_RSHD_C
+| | | +--->BN_MP_ZERO_C
+| | +--->BN_MP_MUL_2_C
+| | | +--->BN_MP_GROW_C
+| | +--->BN_MP_ADD_C
+| | | +--->BN_S_MP_ADD_C
+| | | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CMP_MAG_C
+| | | +--->BN_S_MP_SUB_C
+| | | | +--->BN_MP_GROW_C
+| | +--->BN_MP_SUB_C
+| | | +--->BN_S_MP_ADD_C
+| | | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CMP_MAG_C
+| | | +--->BN_S_MP_SUB_C
+| | | | +--->BN_MP_GROW_C
+| | +--->BN_MP_DIV_2_C
+| | | +--->BN_MP_GROW_C
+| | +--->BN_MP_MUL_2D_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_LSHD_C
+| | +--->BN_MP_MUL_D_C
+| | | +--->BN_MP_GROW_C
+| | +--->BN_MP_DIV_3_C
+| | | +--->BN_MP_EXCH_C
+| | | +--->BN_MP_CLEAR_C
+| | +--->BN_MP_LSHD_C
+| | | +--->BN_MP_GROW_C
+| | +--->BN_MP_CLEAR_MULTI_C
+| | | +--->BN_MP_CLEAR_C
+| +--->BN_FAST_S_MP_SQR_C
+| | +--->BN_MP_GROW_C
+| +--->BN_S_MP_SQR_C
+| | +--->BN_MP_EXCH_C
+| | +--->BN_MP_CLEAR_C
++--->BN_S_MP_ADD_C
+| +--->BN_MP_GROW_C
++--->BN_S_MP_SUB_C
+| +--->BN_MP_GROW_C
++--->BN_MP_LSHD_C
+| +--->BN_MP_GROW_C
+| +--->BN_MP_RSHD_C
+| | +--->BN_MP_ZERO_C
++--->BN_MP_ADD_C
+| +--->BN_MP_CMP_MAG_C
++--->BN_MP_CLEAR_C
+
+
+BN_MP_GCD_C
++--->BN_MP_ABS_C
+| +--->BN_MP_COPY_C
+| | +--->BN_MP_GROW_C
++--->BN_MP_INIT_COPY_C
+| +--->BN_MP_INIT_SIZE_C
+| +--->BN_MP_COPY_C
+| | +--->BN_MP_GROW_C
++--->BN_MP_CNT_LSB_C
++--->BN_MP_DIV_2D_C
+| +--->BN_MP_COPY_C
+| | +--->BN_MP_GROW_C
+| +--->BN_MP_ZERO_C
+| +--->BN_MP_MOD_2D_C
+| | +--->BN_MP_CLAMP_C
+| +--->BN_MP_CLEAR_C
+| +--->BN_MP_RSHD_C
+| +--->BN_MP_CLAMP_C
+| +--->BN_MP_EXCH_C
++--->BN_MP_CMP_MAG_C
++--->BN_MP_EXCH_C
++--->BN_S_MP_SUB_C
+| +--->BN_MP_GROW_C
+| +--->BN_MP_CLAMP_C
++--->BN_MP_MUL_2D_C
+| +--->BN_MP_COPY_C
+| | +--->BN_MP_GROW_C
+| +--->BN_MP_GROW_C
+| +--->BN_MP_LSHD_C
+| | +--->BN_MP_RSHD_C
+| | | +--->BN_MP_ZERO_C
+| +--->BN_MP_CLAMP_C
++--->BN_MP_CLEAR_C
+
+
+BN_MP_MOD_2D_C
++--->BN_MP_ZERO_C
++--->BN_MP_COPY_C
+| +--->BN_MP_GROW_C
++--->BN_MP_CLAMP_C
+
+
+BN_FAST_MP_MONTGOMERY_REDUCE_C
++--->BN_MP_GROW_C
++--->BN_MP_RSHD_C
+| +--->BN_MP_ZERO_C
++--->BN_MP_CLAMP_C
++--->BN_MP_CMP_MAG_C
++--->BN_S_MP_SUB_C
+
+
+BN_MP_SUBMOD_C
++--->BN_MP_INIT_C
++--->BN_MP_SUB_C
+| +--->BN_S_MP_ADD_C
+| | +--->BN_MP_GROW_C
+| | +--->BN_MP_CLAMP_C
+| +--->BN_MP_CMP_MAG_C
+| +--->BN_S_MP_SUB_C
+| | +--->BN_MP_GROW_C
+| | +--->BN_MP_CLAMP_C
++--->BN_MP_CLEAR_C
++--->BN_MP_MOD_C
+| +--->BN_MP_DIV_C
+| | +--->BN_MP_CMP_MAG_C
+| | +--->BN_MP_COPY_C
+| | | +--->BN_MP_GROW_C
+| | +--->BN_MP_ZERO_C
+| | +--->BN_MP_INIT_MULTI_C
+| | +--->BN_MP_SET_C
+| | +--->BN_MP_COUNT_BITS_C
+| | +--->BN_MP_ABS_C
+| | +--->BN_MP_MUL_2D_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_LSHD_C
+| | | | +--->BN_MP_RSHD_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_CMP_C
+| | +--->BN_MP_ADD_C
+| | | +--->BN_S_MP_ADD_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_S_MP_SUB_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_DIV_2D_C
+| | | +--->BN_MP_MOD_2D_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_RSHD_C
+| | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_EXCH_C
+| | +--->BN_MP_EXCH_C
+| | +--->BN_MP_CLEAR_MULTI_C
+| | +--->BN_MP_INIT_SIZE_C
+| | +--->BN_MP_INIT_COPY_C
+| | +--->BN_MP_LSHD_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_RSHD_C
+| | +--->BN_MP_RSHD_C
+| | +--->BN_MP_MUL_D_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_CLAMP_C
+| +--->BN_MP_EXCH_C
+| +--->BN_MP_ADD_C
+| | +--->BN_S_MP_ADD_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_CMP_MAG_C
+| | +--->BN_S_MP_SUB_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLAMP_C
+
+
+BN_MP_GET_INT_C
+
+
+BN_MP_SET_LONG_C
+
+
+BN_MP_ADDMOD_C
++--->BN_MP_INIT_C
++--->BN_MP_ADD_C
+| +--->BN_S_MP_ADD_C
+| | +--->BN_MP_GROW_C
+| | +--->BN_MP_CLAMP_C
+| +--->BN_MP_CMP_MAG_C
+| +--->BN_S_MP_SUB_C
+| | +--->BN_MP_GROW_C
+| | +--->BN_MP_CLAMP_C
++--->BN_MP_CLEAR_C
++--->BN_MP_MOD_C
+| +--->BN_MP_DIV_C
+| | +--->BN_MP_CMP_MAG_C
+| | +--->BN_MP_COPY_C
+| | | +--->BN_MP_GROW_C
+| | +--->BN_MP_ZERO_C
+| | +--->BN_MP_INIT_MULTI_C
+| | +--->BN_MP_SET_C
+| | +--->BN_MP_COUNT_BITS_C
+| | +--->BN_MP_ABS_C
+| | +--->BN_MP_MUL_2D_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_LSHD_C
+| | | | +--->BN_MP_RSHD_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_CMP_C
+| | +--->BN_MP_SUB_C
+| | | +--->BN_S_MP_ADD_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_S_MP_SUB_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_DIV_2D_C
+| | | +--->BN_MP_MOD_2D_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_RSHD_C
+| | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_EXCH_C
+| | +--->BN_MP_EXCH_C
+| | +--->BN_MP_CLEAR_MULTI_C
+| | +--->BN_MP_INIT_SIZE_C
+| | +--->BN_MP_INIT_COPY_C
+| | +--->BN_MP_LSHD_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_RSHD_C
+| | +--->BN_MP_RSHD_C
+| | +--->BN_MP_MUL_D_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_CLAMP_C
+| +--->BN_MP_EXCH_C
+
+
+BN_MP_PRIME_FERMAT_C
++--->BN_MP_CMP_D_C
++--->BN_MP_INIT_C
++--->BN_MP_EXPTMOD_C
+| +--->BN_MP_INVMOD_C
+| | +--->BN_FAST_MP_INVMOD_C
+| | | +--->BN_MP_INIT_MULTI_C
+| | | | +--->BN_MP_CLEAR_C
+| | | +--->BN_MP_COPY_C
+| | | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_MOD_C
+| | | | +--->BN_MP_DIV_C
+| | | | | +--->BN_MP_CMP_MAG_C
+| | | | | +--->BN_MP_ZERO_C
+| | | | | +--->BN_MP_SET_C
+| | | | | +--->BN_MP_COUNT_BITS_C
+| | | | | +--->BN_MP_ABS_C
+| | | | | +--->BN_MP_MUL_2D_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_LSHD_C
+| | | | | | | +--->BN_MP_RSHD_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_CMP_C
+| | | | | +--->BN_MP_SUB_C
+| | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_ADD_C
+| | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_DIV_2D_C
+| | | | | | +--->BN_MP_MOD_2D_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_CLEAR_C
+| | | | | | +--->BN_MP_RSHD_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_EXCH_C
+| | | | | +--->BN_MP_EXCH_C
+| | | | | +--->BN_MP_CLEAR_MULTI_C
+| | | | | | +--->BN_MP_CLEAR_C
+| | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | +--->BN_MP_INIT_COPY_C
+| | | | | +--->BN_MP_LSHD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_RSHD_C
+| | | | | +--->BN_MP_RSHD_C
+| | | | | +--->BN_MP_MUL_D_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_CLEAR_C
+| | | | +--->BN_MP_CLEAR_C
+| | | | +--->BN_MP_EXCH_C
+| | | | +--->BN_MP_ADD_C
+| | | | | +--->BN_S_MP_ADD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_CMP_MAG_C
+| | | | | +--->BN_S_MP_SUB_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_SET_C
+| | | | +--->BN_MP_ZERO_C
+| | | +--->BN_MP_DIV_2_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_SUB_C
+| | | | +--->BN_S_MP_ADD_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_CMP_MAG_C
+| | | | +--->BN_S_MP_SUB_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_CMP_C
+| | | | +--->BN_MP_CMP_MAG_C
+| | | +--->BN_MP_ADD_C
+| | | | +--->BN_S_MP_ADD_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_CMP_MAG_C
+| | | | +--->BN_S_MP_SUB_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_EXCH_C
+| | | +--->BN_MP_CLEAR_MULTI_C
+| | | | +--->BN_MP_CLEAR_C
+| | +--->BN_MP_INVMOD_SLOW_C
+| | | +--->BN_MP_INIT_MULTI_C
+| | | | +--->BN_MP_CLEAR_C
+| | | +--->BN_MP_MOD_C
+| | | | +--->BN_MP_DIV_C
+| | | | | +--->BN_MP_CMP_MAG_C
+| | | | | +--->BN_MP_COPY_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_ZERO_C
+| | | | | +--->BN_MP_SET_C
+| | | | | +--->BN_MP_COUNT_BITS_C
+| | | | | +--->BN_MP_ABS_C
+| | | | | +--->BN_MP_MUL_2D_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_LSHD_C
+| | | | | | | +--->BN_MP_RSHD_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_CMP_C
+| | | | | +--->BN_MP_SUB_C
+| | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_ADD_C
+| | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_DIV_2D_C
+| | | | | | +--->BN_MP_MOD_2D_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_CLEAR_C
+| | | | | | +--->BN_MP_RSHD_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_EXCH_C
+| | | | | +--->BN_MP_EXCH_C
+| | | | | +--->BN_MP_CLEAR_MULTI_C
+| | | | | | +--->BN_MP_CLEAR_C
+| | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | +--->BN_MP_INIT_COPY_C
+| | | | | +--->BN_MP_LSHD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_RSHD_C
+| | | | | +--->BN_MP_RSHD_C
+| | | | | +--->BN_MP_MUL_D_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_CLEAR_C
+| | | | +--->BN_MP_CLEAR_C
+| | | | +--->BN_MP_EXCH_C
+| | | | +--->BN_MP_ADD_C
+| | | | | +--->BN_S_MP_ADD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_CMP_MAG_C
+| | | | | +--->BN_S_MP_SUB_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_COPY_C
+| | | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_SET_C
+| | | | +--->BN_MP_ZERO_C
+| | | +--->BN_MP_DIV_2_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_ADD_C
+| | | | +--->BN_S_MP_ADD_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_CMP_MAG_C
+| | | | +--->BN_S_MP_SUB_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_SUB_C
+| | | | +--->BN_S_MP_ADD_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_CMP_MAG_C
+| | | | +--->BN_S_MP_SUB_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_CMP_C
+| | | | +--->BN_MP_CMP_MAG_C
+| | | +--->BN_MP_CMP_MAG_C
+| | | +--->BN_MP_EXCH_C
+| | | +--->BN_MP_CLEAR_MULTI_C
+| | | | +--->BN_MP_CLEAR_C
+| +--->BN_MP_CLEAR_C
+| +--->BN_MP_ABS_C
+| | +--->BN_MP_COPY_C
+| | | +--->BN_MP_GROW_C
+| +--->BN_MP_CLEAR_MULTI_C
+| +--->BN_MP_REDUCE_IS_2K_L_C
+| +--->BN_S_MP_EXPTMOD_C
+| | +--->BN_MP_COUNT_BITS_C
+| | +--->BN_MP_REDUCE_SETUP_C
+| | | +--->BN_MP_2EXPT_C
+| | | | +--->BN_MP_ZERO_C
+| | | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_DIV_C
+| | | | +--->BN_MP_CMP_MAG_C
+| | | | +--->BN_MP_COPY_C
+| | | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_ZERO_C
+| | | | +--->BN_MP_INIT_MULTI_C
+| | | | +--->BN_MP_SET_C
+| | | | +--->BN_MP_MUL_2D_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_LSHD_C
+| | | | | | +--->BN_MP_RSHD_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_CMP_C
+| | | | +--->BN_MP_SUB_C
+| | | | | +--->BN_S_MP_ADD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_S_MP_SUB_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_ADD_C
+| | | | | +--->BN_S_MP_ADD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_S_MP_SUB_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_DIV_2D_C
+| | | | | +--->BN_MP_MOD_2D_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_RSHD_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_EXCH_C
+| | | | +--->BN_MP_EXCH_C
+| | | | +--->BN_MP_INIT_SIZE_C
+| | | | +--->BN_MP_INIT_COPY_C
+| | | | +--->BN_MP_LSHD_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_RSHD_C
+| | | | +--->BN_MP_RSHD_C
+| | | | +--->BN_MP_MUL_D_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_REDUCE_C
+| | | +--->BN_MP_INIT_COPY_C
+| | | | +--->BN_MP_INIT_SIZE_C
+| | | | +--->BN_MP_COPY_C
+| | | | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_RSHD_C
+| | | | +--->BN_MP_ZERO_C
+| | | +--->BN_MP_MUL_C
+| | | | +--->BN_MP_TOOM_MUL_C
+| | | | | +--->BN_MP_INIT_MULTI_C
+| | | | | +--->BN_MP_MOD_2D_C
+| | | | | | +--->BN_MP_ZERO_C
+| | | | | | +--->BN_MP_COPY_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_COPY_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_MUL_2_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_ADD_C
+| | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_CMP_MAG_C
+| | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_SUB_C
+| | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_CMP_MAG_C
+| | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_DIV_2_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_MUL_2D_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_LSHD_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_MUL_D_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_DIV_3_C
+| | | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_EXCH_C
+| | | | | +--->BN_MP_LSHD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_KARATSUBA_MUL_C
+| | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_S_MP_ADD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_ADD_C
+| | | | | | +--->BN_MP_CMP_MAG_C
+| | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_S_MP_SUB_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_LSHD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | +--->BN_FAST_S_MP_MUL_DIGS_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_S_MP_MUL_DIGS_C
+| | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_EXCH_C
+| | | +--->BN_S_MP_MUL_HIGH_DIGS_C
+| | | | +--->BN_FAST_S_MP_MUL_HIGH_DIGS_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_INIT_SIZE_C
+| | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_EXCH_C
+| | | +--->BN_FAST_S_MP_MUL_HIGH_DIGS_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_MOD_2D_C
+| | | | +--->BN_MP_ZERO_C
+| | | | +--->BN_MP_COPY_C
+| | | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_S_MP_MUL_DIGS_C
+| | | | +--->BN_FAST_S_MP_MUL_DIGS_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_INIT_SIZE_C
+| | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_EXCH_C
+| | | +--->BN_MP_SUB_C
+| | | | +--->BN_S_MP_ADD_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_CMP_MAG_C
+| | | | +--->BN_S_MP_SUB_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_SET_C
+| | | | +--->BN_MP_ZERO_C
+| | | +--->BN_MP_LSHD_C
+| | | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_ADD_C
+| | | | +--->BN_S_MP_ADD_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_CMP_MAG_C
+| | | | +--->BN_S_MP_SUB_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_CMP_C
+| | | | +--->BN_MP_CMP_MAG_C
+| | | +--->BN_S_MP_SUB_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_REDUCE_2K_SETUP_L_C
+| | | +--->BN_MP_2EXPT_C
+| | | | +--->BN_MP_ZERO_C
+| | | | +--->BN_MP_GROW_C
+| | | +--->BN_S_MP_SUB_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_REDUCE_2K_L_C
+| | | +--->BN_MP_DIV_2D_C
+| | | | +--->BN_MP_COPY_C
+| | | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_ZERO_C
+| | | | +--->BN_MP_MOD_2D_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_RSHD_C
+| | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_EXCH_C
+| | | +--->BN_MP_MUL_C
+| | | | +--->BN_MP_TOOM_MUL_C
+| | | | | +--->BN_MP_INIT_MULTI_C
+| | | | | +--->BN_MP_MOD_2D_C
+| | | | | | +--->BN_MP_ZERO_C
+| | | | | | +--->BN_MP_COPY_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_COPY_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_RSHD_C
+| | | | | | +--->BN_MP_ZERO_C
+| | | | | +--->BN_MP_MUL_2_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_ADD_C
+| | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_CMP_MAG_C
+| | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_SUB_C
+| | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_CMP_MAG_C
+| | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_DIV_2_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_MUL_2D_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_LSHD_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_MUL_D_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_DIV_3_C
+| | | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_EXCH_C
+| | | | | +--->BN_MP_LSHD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_KARATSUBA_MUL_C
+| | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_S_MP_ADD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_ADD_C
+| | | | | | +--->BN_MP_CMP_MAG_C
+| | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_S_MP_SUB_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_LSHD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_RSHD_C
+| | | | | | | +--->BN_MP_ZERO_C
+| | | | +--->BN_FAST_S_MP_MUL_DIGS_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_S_MP_MUL_DIGS_C
+| | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_EXCH_C
+| | | +--->BN_S_MP_ADD_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_CMP_MAG_C
+| | | +--->BN_S_MP_SUB_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_MOD_C
+| | | +--->BN_MP_DIV_C
+| | | | +--->BN_MP_CMP_MAG_C
+| | | | +--->BN_MP_COPY_C
+| | | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_ZERO_C
+| | | | +--->BN_MP_INIT_MULTI_C
+| | | | +--->BN_MP_SET_C
+| | | | +--->BN_MP_MUL_2D_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_LSHD_C
+| | | | | | +--->BN_MP_RSHD_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_CMP_C
+| | | | +--->BN_MP_SUB_C
+| | | | | +--->BN_S_MP_ADD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_S_MP_SUB_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_ADD_C
+| | | | | +--->BN_S_MP_ADD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_S_MP_SUB_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_DIV_2D_C
+| | | | | +--->BN_MP_MOD_2D_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_RSHD_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_EXCH_C
+| | | | +--->BN_MP_EXCH_C
+| | | | +--->BN_MP_INIT_SIZE_C
+| | | | +--->BN_MP_INIT_COPY_C
+| | | | +--->BN_MP_LSHD_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_RSHD_C
+| | | | +--->BN_MP_RSHD_C
+| | | | +--->BN_MP_MUL_D_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_EXCH_C
+| | | +--->BN_MP_ADD_C
+| | | | +--->BN_S_MP_ADD_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_CMP_MAG_C
+| | | | +--->BN_S_MP_SUB_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_COPY_C
+| | | +--->BN_MP_GROW_C
+| | +--->BN_MP_SQR_C
+| | | +--->BN_MP_TOOM_SQR_C
+| | | | +--->BN_MP_INIT_MULTI_C
+| | | | +--->BN_MP_MOD_2D_C
+| | | | | +--->BN_MP_ZERO_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_RSHD_C
+| | | | | +--->BN_MP_ZERO_C
+| | | | +--->BN_MP_MUL_2_C
+| | | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_ADD_C
+| | | | | +--->BN_S_MP_ADD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_CMP_MAG_C
+| | | | | +--->BN_S_MP_SUB_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_SUB_C
+| | | | | +--->BN_S_MP_ADD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_CMP_MAG_C
+| | | | | +--->BN_S_MP_SUB_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_DIV_2_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_MUL_2D_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_LSHD_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_MUL_D_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_DIV_3_C
+| | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_EXCH_C
+| | | | +--->BN_MP_LSHD_C
+| | | | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_KARATSUBA_SQR_C
+| | | | +--->BN_MP_INIT_SIZE_C
+| | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_S_MP_ADD_C
+| | | | | +--->BN_MP_GROW_C
+| | | | +--->BN_S_MP_SUB_C
+| | | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_LSHD_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_RSHD_C
+| | | | | | +--->BN_MP_ZERO_C
+| | | | +--->BN_MP_ADD_C
+| | | | | +--->BN_MP_CMP_MAG_C
+| | | +--->BN_FAST_S_MP_SQR_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_S_MP_SQR_C
+| | | | +--->BN_MP_INIT_SIZE_C
+| | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_EXCH_C
+| | +--->BN_MP_MUL_C
+| | | +--->BN_MP_TOOM_MUL_C
+| | | | +--->BN_MP_INIT_MULTI_C
+| | | | +--->BN_MP_MOD_2D_C
+| | | | | +--->BN_MP_ZERO_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_RSHD_C
+| | | | | +--->BN_MP_ZERO_C
+| | | | +--->BN_MP_MUL_2_C
+| | | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_ADD_C
+| | | | | +--->BN_S_MP_ADD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_CMP_MAG_C
+| | | | | +--->BN_S_MP_SUB_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_SUB_C
+| | | | | +--->BN_S_MP_ADD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_CMP_MAG_C
+| | | | | +--->BN_S_MP_SUB_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_DIV_2_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_MUL_2D_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_LSHD_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_MUL_D_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_DIV_3_C
+| | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_EXCH_C
+| | | | +--->BN_MP_LSHD_C
+| | | | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_KARATSUBA_MUL_C
+| | | | +--->BN_MP_INIT_SIZE_C
+| | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_S_MP_ADD_C
+| | | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_ADD_C
+| | | | | +--->BN_MP_CMP_MAG_C
+| | | | | +--->BN_S_MP_SUB_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | +--->BN_S_MP_SUB_C
+| | | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_LSHD_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_RSHD_C
+| | | | | | +--->BN_MP_ZERO_C
+| | | +--->BN_FAST_S_MP_MUL_DIGS_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_S_MP_MUL_DIGS_C
+| | | | +--->BN_MP_INIT_SIZE_C
+| | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_EXCH_C
+| | +--->BN_MP_SET_C
+| | | +--->BN_MP_ZERO_C
+| | +--->BN_MP_EXCH_C
+| +--->BN_MP_DR_IS_MODULUS_C
+| +--->BN_MP_REDUCE_IS_2K_C
+| | +--->BN_MP_REDUCE_2K_C
+| | | +--->BN_MP_COUNT_BITS_C
+| | | +--->BN_MP_DIV_2D_C
+| | | | +--->BN_MP_COPY_C
+| | | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_ZERO_C
+| | | | +--->BN_MP_MOD_2D_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_RSHD_C
+| | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_EXCH_C
+| | | +--->BN_MP_MUL_D_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_S_MP_ADD_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_CMP_MAG_C
+| | | +--->BN_S_MP_SUB_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_COUNT_BITS_C
+| +--->BN_MP_EXPTMOD_FAST_C
+| | +--->BN_MP_COUNT_BITS_C
+| | +--->BN_MP_MONTGOMERY_SETUP_C
+| | +--->BN_FAST_MP_MONTGOMERY_REDUCE_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_RSHD_C
+| | | | +--->BN_MP_ZERO_C
+| | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_CMP_MAG_C
+| | | +--->BN_S_MP_SUB_C
+| | +--->BN_MP_MONTGOMERY_REDUCE_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_RSHD_C
+| | | | +--->BN_MP_ZERO_C
+| | | +--->BN_MP_CMP_MAG_C
+| | | +--->BN_S_MP_SUB_C
+| | +--->BN_MP_DR_SETUP_C
+| | +--->BN_MP_DR_REDUCE_C
+| | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_CMP_MAG_C
+| | | +--->BN_S_MP_SUB_C
+| | +--->BN_MP_REDUCE_2K_SETUP_C
+| | | +--->BN_MP_2EXPT_C
+| | | | +--->BN_MP_ZERO_C
+| | | | +--->BN_MP_GROW_C
+| | | +--->BN_S_MP_SUB_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_REDUCE_2K_C
+| | | +--->BN_MP_DIV_2D_C
+| | | | +--->BN_MP_COPY_C
+| | | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_ZERO_C
+| | | | +--->BN_MP_MOD_2D_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_RSHD_C
+| | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_EXCH_C
+| | | +--->BN_MP_MUL_D_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_S_MP_ADD_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_CMP_MAG_C
+| | | +--->BN_S_MP_SUB_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_MONTGOMERY_CALC_NORMALIZATION_C
+| | | +--->BN_MP_2EXPT_C
+| | | | +--->BN_MP_ZERO_C
+| | | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_SET_C
+| | | | +--->BN_MP_ZERO_C
+| | | +--->BN_MP_MUL_2_C
+| | | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_CMP_MAG_C
+| | | +--->BN_S_MP_SUB_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_MULMOD_C
+| | | +--->BN_MP_MUL_C
+| | | | +--->BN_MP_TOOM_MUL_C
+| | | | | +--->BN_MP_INIT_MULTI_C
+| | | | | +--->BN_MP_MOD_2D_C
+| | | | | | +--->BN_MP_ZERO_C
+| | | | | | +--->BN_MP_COPY_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_COPY_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_RSHD_C
+| | | | | | +--->BN_MP_ZERO_C
+| | | | | +--->BN_MP_MUL_2_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_ADD_C
+| | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_CMP_MAG_C
+| | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_SUB_C
+| | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_CMP_MAG_C
+| | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_DIV_2_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_MUL_2D_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_LSHD_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_MUL_D_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_DIV_3_C
+| | | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_EXCH_C
+| | | | | +--->BN_MP_LSHD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_KARATSUBA_MUL_C
+| | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_S_MP_ADD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_ADD_C
+| | | | | | +--->BN_MP_CMP_MAG_C
+| | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_S_MP_SUB_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_LSHD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_RSHD_C
+| | | | | | | +--->BN_MP_ZERO_C
+| | | | +--->BN_FAST_S_MP_MUL_DIGS_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_S_MP_MUL_DIGS_C
+| | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_EXCH_C
+| | | +--->BN_MP_MOD_C
+| | | | +--->BN_MP_DIV_C
+| | | | | +--->BN_MP_CMP_MAG_C
+| | | | | +--->BN_MP_COPY_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_ZERO_C
+| | | | | +--->BN_MP_INIT_MULTI_C
+| | | | | +--->BN_MP_SET_C
+| | | | | +--->BN_MP_MUL_2D_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_LSHD_C
+| | | | | | | +--->BN_MP_RSHD_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_CMP_C
+| | | | | +--->BN_MP_SUB_C
+| | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_ADD_C
+| | | | | | +--->BN_S_MP_ADD_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_S_MP_SUB_C
+| | | | | | | +--->BN_MP_GROW_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_DIV_2D_C
+| | | | | | +--->BN_MP_MOD_2D_C
+| | | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_RSHD_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | | +--->BN_MP_EXCH_C
+| | | | | +--->BN_MP_EXCH_C
+| | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | +--->BN_MP_INIT_COPY_C
+| | | | | +--->BN_MP_LSHD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_RSHD_C
+| | | | | +--->BN_MP_RSHD_C
+| | | | | +--->BN_MP_MUL_D_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_EXCH_C
+| | | | +--->BN_MP_ADD_C
+| | | | | +--->BN_S_MP_ADD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_CMP_MAG_C
+| | | | | +--->BN_S_MP_SUB_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_SET_C
+| | | +--->BN_MP_ZERO_C
+| | +--->BN_MP_MOD_C
+| | | +--->BN_MP_DIV_C
+| | | | +--->BN_MP_CMP_MAG_C
+| | | | +--->BN_MP_COPY_C
+| | | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_ZERO_C
+| | | | +--->BN_MP_INIT_MULTI_C
+| | | | +--->BN_MP_MUL_2D_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_LSHD_C
+| | | | | | +--->BN_MP_RSHD_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_CMP_C
+| | | | +--->BN_MP_SUB_C
+| | | | | +--->BN_S_MP_ADD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_S_MP_SUB_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_ADD_C
+| | | | | +--->BN_S_MP_ADD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_S_MP_SUB_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_DIV_2D_C
+| | | | | +--->BN_MP_MOD_2D_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_RSHD_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_EXCH_C
+| | | | +--->BN_MP_EXCH_C
+| | | | +--->BN_MP_INIT_SIZE_C
+| | | | +--->BN_MP_INIT_COPY_C
+| | | | +--->BN_MP_LSHD_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_RSHD_C
+| | | | +--->BN_MP_RSHD_C
+| | | | +--->BN_MP_MUL_D_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_MP_EXCH_C
+| | | +--->BN_MP_ADD_C
+| | | | +--->BN_S_MP_ADD_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_CMP_MAG_C
+| | | | +--->BN_S_MP_SUB_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | +--->BN_MP_COPY_C
+| | | +--->BN_MP_GROW_C
+| | +--->BN_MP_SQR_C
+| | | +--->BN_MP_TOOM_SQR_C
+| | | | +--->BN_MP_INIT_MULTI_C
+| | | | +--->BN_MP_MOD_2D_C
+| | | | | +--->BN_MP_ZERO_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_RSHD_C
+| | | | | +--->BN_MP_ZERO_C
+| | | | +--->BN_MP_MUL_2_C
+| | | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_ADD_C
+| | | | | +--->BN_S_MP_ADD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_CMP_MAG_C
+| | | | | +--->BN_S_MP_SUB_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_SUB_C
+| | | | | +--->BN_S_MP_ADD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_CMP_MAG_C
+| | | | | +--->BN_S_MP_SUB_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_DIV_2_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_MUL_2D_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_LSHD_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_MUL_D_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_DIV_3_C
+| | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_EXCH_C
+| | | | +--->BN_MP_LSHD_C
+| | | | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_KARATSUBA_SQR_C
+| | | | +--->BN_MP_INIT_SIZE_C
+| | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_S_MP_ADD_C
+| | | | | +--->BN_MP_GROW_C
+| | | | +--->BN_S_MP_SUB_C
+| | | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_LSHD_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_RSHD_C
+| | | | | | +--->BN_MP_ZERO_C
+| | | | +--->BN_MP_ADD_C
+| | | | | +--->BN_MP_CMP_MAG_C
+| | | +--->BN_FAST_S_MP_SQR_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_S_MP_SQR_C
+| | | | +--->BN_MP_INIT_SIZE_C
+| | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_EXCH_C
+| | +--->BN_MP_MUL_C
+| | | +--->BN_MP_TOOM_MUL_C
+| | | | +--->BN_MP_INIT_MULTI_C
+| | | | +--->BN_MP_MOD_2D_C
+| | | | | +--->BN_MP_ZERO_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_RSHD_C
+| | | | | +--->BN_MP_ZERO_C
+| | | | +--->BN_MP_MUL_2_C
+| | | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_ADD_C
+| | | | | +--->BN_S_MP_ADD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_CMP_MAG_C
+| | | | | +--->BN_S_MP_SUB_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_SUB_C
+| | | | | +--->BN_S_MP_ADD_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_CMP_MAG_C
+| | | | | +--->BN_S_MP_SUB_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_DIV_2_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_MUL_2D_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_LSHD_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_MUL_D_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_DIV_3_C
+| | | | | +--->BN_MP_INIT_SIZE_C
+| | | | | +--->BN_MP_CLAMP_C
+| | | | | +--->BN_MP_EXCH_C
+| | | | +--->BN_MP_LSHD_C
+| | | | | +--->BN_MP_GROW_C
+| | | +--->BN_MP_KARATSUBA_MUL_C
+| | | | +--->BN_MP_INIT_SIZE_C
+| | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_S_MP_ADD_C
+| | | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_ADD_C
+| | | | | +--->BN_MP_CMP_MAG_C
+| | | | | +--->BN_S_MP_SUB_C
+| | | | | | +--->BN_MP_GROW_C
+| | | | +--->BN_S_MP_SUB_C
+| | | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_LSHD_C
+| | | | | +--->BN_MP_GROW_C
+| | | | | +--->BN_MP_RSHD_C
+| | | | | | +--->BN_MP_ZERO_C
+| | | +--->BN_FAST_S_MP_MUL_DIGS_C
+| | | | +--->BN_MP_GROW_C
+| | | | +--->BN_MP_CLAMP_C
+| | | +--->BN_S_MP_MUL_DIGS_C
+| | | | +--->BN_MP_INIT_SIZE_C
+| | | | +--->BN_MP_CLAMP_C
+| | | | +--->BN_MP_EXCH_C
+| | +--->BN_MP_EXCH_C
++--->BN_MP_CMP_C
+| +--->BN_MP_CMP_MAG_C
++--->BN_MP_CLEAR_C
+
+
+BN_MP_REDUCE_2K_SETUP_L_C
++--->BN_MP_INIT_C
++--->BN_MP_2EXPT_C
+| +--->BN_MP_ZERO_C
+| +--->BN_MP_GROW_C
++--->BN_MP_COUNT_BITS_C
++--->BN_S_MP_SUB_C
+| +--->BN_MP_GROW_C
+| +--->BN_MP_CLAMP_C
++--->BN_MP_CLEAR_C
+
+
diff --git a/libtommath/changes.txt b/libtommath/changes.txt
index aaaf69f..640b497 100644
--- a/libtommath/changes.txt
+++ b/libtommath/changes.txt
@@ -1,3 +1,34 @@
+Feb 5th, 2016
+v1.0
+ -- Bump to 1.0
+ -- Dirkjan Bussink provided a faster version of mp_expt_d()
+ -- Moritz Lenz contributed a fix to mp_mod()
+ and provided mp_get_long() and mp_set_long()
+ -- Fixed bugs in mp_read_radix(), mp_radix_size
+ Thanks to shameister, Gerhard R,
+ -- Christopher Brown provided mp_export() and mp_import()
+ -- Improvements in the code of mp_init_copy()
+ Thanks to ramkumarkoppu,
+ -- lomereiter provided mp_balance_mul()
+ -- Alexander Boström from the heimdal project contributed patches to
+ mp_prime_next_prime() and mp_invmod() and added a mp_isneg() macro
+ -- Fix build issues for Linux x32 ABI
+ -- Added mp_get_long_long() and mp_set_long_long()
+ -- Carlin provided a patch to use arc4random() instead of rand()
+ on platforms where it is supported
+ -- Karel Miko provided mp_sqrtmod_prime()
+
+
+July 23rd, 2010
+v0.42.0
+ -- Fix for mp_prime_next_prime() bug when checking generated prime
+ -- allow mp_shrink to shrink initialized, but empty MPI's
+ -- Added project and solution files for Visual Studio 2005 and Visual Studio 2008.
+
+March 10th, 2007
+v0.41 -- Wolfgang Ehrhardt suggested a quick fix to mp_div_d() which makes the detection of powers of two quicker.
+ -- [CRI] Added libtommath.dsp for Visual C++ users.
+
December 24th, 2006
v0.40 -- Updated makefile to properly support LIBNAME
-- Fixed bug in fast_s_mp_mul_high_digs() which overflowed (line 83), thanks Valgrind!
@@ -12,11 +43,11 @@ v0.39 -- Jim Wigginton pointed out my Montgomery examples in figures 6.4 and 6.
Jan 26th, 2006
v0.38 -- broken makefile.shared fixed
-- removed some carry stores that were not required [updated text]
-
+
November 18th, 2005
v0.37 -- [Don Porter] reported on a TCL list [HEY SEND ME BUGREPORTS ALREADY!!!] that mp_add_d() would compute -0 with some inputs. Fixed.
-- [rinick@gmail.com] reported the makefile.bcc was messed up. Fixed.
- -- [Kevin Kenny] reported some issues with mp_toradix_n(). Now it doesn't require a min of 3 chars of output.
+ -- [Kevin Kenny] reported some issues with mp_toradix_n(). Now it doesn't require a min of 3 chars of output.
-- Made the make command renamable. Wee
August 1st, 2005
@@ -26,8 +57,8 @@ v0.36 -- LTM_PRIME_2MSB_ON was fixed and the "OFF" flag was removed.
-- Ported LTC patch to fix the prime_random_ex() function to get the bitsize correct [and the maskOR flags]
-- Kevin Kenny pointed out a stray //
-- David Hulton pointed out a typo in the textbook [mp_montgomery_setup() pseudo-code]
- -- Neal Hamilton (Elliptic Semiconductor) pointed out that my Karatsuba notation was backwards and that I could use
- unsigned operations in the routine.
+ -- Neal Hamilton (Elliptic Semiconductor) pointed out that my Karatsuba notation was backwards and that I could use
+ unsigned operations in the routine.
-- Paul Schmidt pointed out a linking error in mp_exptmod() when BN_S_MP_EXPTMOD_C is undefined (and another for read_radix)
-- Updated makefiles to be way more flexible
@@ -38,7 +69,7 @@ v0.35 -- Stupid XOR function missing line again... oops.
-- [Wolfgang Ehrhardt] Suggested a fix for mp_reduce() which avoided underruns. ;-)
-- mp_rand() would emit one too many digits and it was possible to get a 0 out of it ... oops
-- Added montgomery to the testing to make sure it handles 1..10 digit moduli correctly
- -- Fixed bug in comba that would lead to possible erroneous outputs when "pa < digs"
+ -- Fixed bug in comba that would lead to possible erroneous outputs when "pa < digs"
-- Fixed bug in mp_toradix_size for "0" [Kevin Kenny]
-- Updated chapters 1-5 of the textbook ;-) It now talks about the new comba code!
@@ -49,7 +80,7 @@ v0.34 -- Fixed two more small errors in mp_prime_random_ex()
-- Added "large" diminished radix support. Speeds up things like DSA where the moduli is of the form 2^k - P for some P < 2^(k/2) or so
Actually is faster than Montgomery on my AMD64 (and probably much faster on a P4)
-- Updated the manual a bit
- -- Ok so I haven't done the textbook work yet... My current freelance gig has landed me in France till the
+ -- Ok so I haven't done the textbook work yet... My current freelance gig has landed me in France till the
end of Feb/05. Once I get back I'll have tons of free time and I plan to go to town on the book.
As of this release the API will freeze. At least until the book catches up with all the changes. I welcome
bug reports but new algorithms will have to wait.
@@ -66,7 +97,7 @@ v0.33 -- Fixed "small" variant for mp_div() which would munge with negative div
October 29th, 2004
v0.32 -- Added "makefile.shared" for shared object support
-- Added more to the build options/configs in the manual
- -- Started the Depends framework, wrote dep.pl to scan deps and
+ -- Started the Depends framework, wrote dep.pl to scan deps and
produce "callgraph.txt" ;-)
-- Wrote SC_RSA_1 which will enable close to the minimum required to perform
RSA on 32-bit [or 64-bit] platforms with LibTomCrypt
@@ -74,7 +105,7 @@ v0.32 -- Added "makefile.shared" for shared object support
you want to use as your mp_div() at build time. Saves roughly 8KB or so.
-- Renamed a few files and changed some comments to make depends system work better.
(No changes to function names)
- -- Merged in new Combas that perform 2 reads per inner loop instead of the older
+ -- Merged in new Combas that perform 2 reads per inner loop instead of the older
3reads/2writes per inner loop of the old code. Really though if you want speed
learn to use TomsFastMath ;-)
@@ -103,8 +134,8 @@ v0.30 -- Added "mp_toradix_n" which stores upto "n-1" least significant digits
call.
-- Removed /etclib directory [um LibTomPoly deprecates this].
-- Fixed mp_mod() so the sign of the result agrees with the sign of the modulus.
- ++ N.B. My semester is almost up so expect updates to the textbook to be posted to the libtomcrypt.org
- website.
+ ++ N.B. My semester is almost up so expect updates to the textbook to be posted to the libtomcrypt.org
+ website.
Jan 25th, 2004
v0.29 ++ Note: "Henrik" from the v0.28 changelog refers to Henrik Goldman ;-)
diff --git a/libtommath/demo/demo.c b/libtommath/demo/demo.c
index bb5eb44..b46b7f8 100644
--- a/libtommath/demo/demo.c
+++ b/libtommath/demo/demo.c
@@ -1,3 +1,4 @@
+#include <string.h>
#include <time.h>
#ifdef IOWNANATHLON
@@ -7,6 +8,28 @@
#define SLEEP
#endif
+/*
+ * Configuration
+ */
+#ifndef LTM_DEMO_TEST_VS_MTEST
+#define LTM_DEMO_TEST_VS_MTEST 1
+#endif
+
+#ifndef LTM_DEMO_TEST_REDUCE_2K_L
+/* This test takes a moment so we disable it by default, but it can be:
+ * 0 to disable testing
+ * 1 to make the test with P = 2^1024 - 0x2A434 B9FDEC95 D8F9D550 FFFFFFFF FFFFFFFF
+ * 2 to make the test with P = 2^2048 - 0x1 00000000 00000000 00000000 00000000 4945DDBF 8EA2A91D 5776399B B83E188F
+ */
+#define LTM_DEMO_TEST_REDUCE_2K_L 0
+#endif
+
+#ifdef LTM_DEMO_REAL_RAND
+#define LTM_DEMO_RAND_SEED time(NULL)
+#else
+#define LTM_DEMO_RAND_SEED 23
+#endif
+
#include "tommath.h"
void ndraw(mp_int * a, char *name)
@@ -16,12 +39,16 @@ void ndraw(mp_int * a, char *name)
printf("%s: ", name);
mp_toradix(a, buf, 10);
printf("%s\n", buf);
+ mp_toradix(a, buf, 16);
+ printf("0x%s\n", buf);
}
+#if LTM_DEMO_TEST_VS_MTEST
static void draw(mp_int * a)
{
ndraw(a, "");
}
+#endif
unsigned long lfsr = 0xAAAAAAAAUL;
@@ -37,183 +64,392 @@ int lbit(void)
}
}
+#if defined(LTM_DEMO_REAL_RAND) && !defined(_WIN32)
+static FILE* fd_urandom;
+#endif
int myrng(unsigned char *dst, int len, void *dat)
{
int x;
-
- for (x = 0; x < len; x++)
- dst[x] = rand() & 0xFF;
+ (void)dat;
+#if defined(LTM_DEMO_REAL_RAND)
+ if (!fd_urandom) {
+#if !defined(_WIN32)
+ fprintf(stderr, "\nno /dev/urandom\n");
+#endif
+ }
+ else {
+ return fread(dst, 1, len, fd_urandom);
+ }
+#endif
+ for (x = 0; x < len; ) {
+ unsigned int r = (unsigned int)rand();
+ do {
+ dst[x++] = r & 0xFF;
+ r >>= 8;
+ } while((r != 0) && (x < len));
+ }
return len;
}
+#if LTM_DEMO_TEST_VS_MTEST != 0
+static void _panic(int l)
+{
+ fprintf(stderr, "\n%d: fgets failed\n", l);
+ exit(EXIT_FAILURE);
+}
+#endif
+
+mp_int a, b, c, d, e, f;
+
+static void _cleanup(void)
+{
+ mp_clear_multi(&a, &b, &c, &d, &e, &f, NULL);
+ printf("\n");
+#ifdef LTM_DEMO_REAL_RAND
+ if(fd_urandom)
+ fclose(fd_urandom);
+#endif
+}
+struct mp_sqrtmod_prime_st {
+ unsigned long p;
+ unsigned long n;
+ mp_digit r;
+};
+struct mp_sqrtmod_prime_st sqrtmod_prime[] = {
+ { 5, 14, 3 },
+ { 7, 9, 4 },
+ { 113, 2, 62 }
+};
+struct mp_jacobi_st {
+ unsigned long n;
+ int c[16];
+};
+struct mp_jacobi_st jacobi[] = {
+ { 3, { 1, -1, 0, 1, -1, 0, 1, -1, 0, 1, -1, 0, 1, -1, 0, 1 } },
+ { 5, { 0, 1, -1, -1, 1, 0, 1, -1, -1, 1, 0, 1, -1, -1, 1, 0 } },
+ { 7, { 1, -1, 1, -1, -1, 0, 1, 1, -1, 1, -1, -1, 0, 1, 1, -1 } },
+ { 9, { -1, 1, 0, 1, 1, 0, 1, 1, 0, 1, 1, 0, 1, 1, 0, 1 } },
+};
char cmd[4096], buf[4096];
int main(void)
{
- mp_int a, b, c, d, e, f;
- unsigned long expt_n, add_n, sub_n, mul_n, div_n, sqr_n, mul2d_n, div2d_n,
- gcd_n, lcm_n, inv_n, div2_n, mul2_n, add_d_n, sub_d_n, t;
unsigned rr;
- int i, n, err, cnt, ix, old_kara_m, old_kara_s;
+ int cnt, ix;
+#if LTM_DEMO_TEST_VS_MTEST
+ unsigned long expt_n, add_n, sub_n, mul_n, div_n, sqr_n, mul2d_n, div2d_n,
+ gcd_n, lcm_n, inv_n, div2_n, mul2_n, add_d_n, sub_d_n;
+ char* ret;
+#else
+ unsigned long s, t;
+ unsigned long long q, r;
mp_digit mp;
+ int i, n, err, should;
+#endif
+ if (mp_init_multi(&a, &b, &c, &d, &e, &f, NULL)!= MP_OKAY)
+ return EXIT_FAILURE;
- mp_init(&a);
- mp_init(&b);
- mp_init(&c);
- mp_init(&d);
- mp_init(&e);
- mp_init(&f);
-
- srand(time(NULL));
-
-#if 0
- // test montgomery
- printf("Testing montgomery...\n");
- for (i = 1; i < 10; i++) {
- printf("Testing digit size: %d\n", i);
- for (n = 0; n < 1000; n++) {
- mp_rand(&a, i);
- a.dp[0] |= 1;
+ atexit(_cleanup);
- // let's see if R is right
- mp_montgomery_calc_normalization(&b, &a);
- mp_montgomery_setup(&a, &mp);
+#if defined(LTM_DEMO_REAL_RAND)
+ if (!fd_urandom) {
+ fd_urandom = fopen("/dev/urandom", "r");
+ if (!fd_urandom) {
+#if !defined(_WIN32)
+ fprintf(stderr, "\ncould not open /dev/urandom\n");
+#endif
+ }
+ }
+#endif
+ srand(LTM_DEMO_RAND_SEED);
- // now test a random reduction
- for (ix = 0; ix < 100; ix++) {
- mp_rand(&c, 1 + abs(rand()) % (2*i));
- mp_copy(&c, &d);
- mp_copy(&c, &e);
+#ifdef MP_8BIT
+ printf("Digit size 8 Bit \n");
+#endif
+#ifdef MP_16BIT
+ printf("Digit size 16 Bit \n");
+#endif
+#ifdef MP_32BIT
+ printf("Digit size 32 Bit \n");
+#endif
+#ifdef MP_64BIT
+ printf("Digit size 64 Bit \n");
+#endif
+ printf("Size of mp_digit: %u\n", (unsigned int)sizeof(mp_digit));
+ printf("Size of mp_word: %u\n", (unsigned int)sizeof(mp_word));
+ printf("DIGIT_BIT: %d\n", DIGIT_BIT);
+ printf("MP_PREC: %d\n", MP_PREC);
+
+#if LTM_DEMO_TEST_VS_MTEST == 0
+ // trivial stuff
+ mp_set_int(&a, 5);
+ mp_neg(&a, &b);
+ if (mp_cmp(&a, &b) != MP_GT) {
+ return EXIT_FAILURE;
+ }
+ if (mp_cmp(&b, &a) != MP_LT) {
+ return EXIT_FAILURE;
+ }
+ mp_neg(&a, &a);
+ if (mp_cmp(&b, &a) != MP_EQ) {
+ return EXIT_FAILURE;
+ }
+ mp_abs(&a, &b);
+ if (mp_isneg(&b) != MP_NO) {
+ return EXIT_FAILURE;
+ }
+ mp_add_d(&a, 1, &b);
+ mp_add_d(&a, 6, &b);
- mp_mod(&d, &a, &d);
- mp_montgomery_reduce(&c, &a, mp);
- mp_mulmod(&c, &b, &a, &c);
- if (mp_cmp(&c, &d) != MP_EQ) {
-printf("d = e mod a, c = e MOD a\n");
-mp_todecimal(&a, buf); printf("a = %s\n", buf);
-mp_todecimal(&e, buf); printf("e = %s\n", buf);
-mp_todecimal(&d, buf); printf("d = %s\n", buf);
-mp_todecimal(&c, buf); printf("c = %s\n", buf);
-printf("compare no compare!\n"); exit(EXIT_FAILURE); }
+ mp_set_int(&a, 0);
+ mp_set_int(&b, 1);
+ if ((err = mp_jacobi(&a, &b, &i)) != MP_OKAY) {
+ printf("Failed executing mp_jacobi(0 | 1) %s.\n", mp_error_to_string(err));
+ return EXIT_FAILURE;
+ }
+ if (i != 1) {
+ printf("Failed trivial mp_jacobi(0 | 1) %d != 1\n", i);
+ return EXIT_FAILURE;
+ }
+ for (cnt = 0; cnt < (int)(sizeof(jacobi)/sizeof(jacobi[0])); ++cnt) {
+ mp_set_int(&b, jacobi[cnt].n);
+ /* only test positive values of a */
+ for (n = -5; n <= 10; ++n) {
+ mp_set_int(&a, abs(n));
+ should = MP_OKAY;
+ if (n < 0) {
+ mp_neg(&a, &a);
+ /* Until #44 is fixed the negative a's must fail */
+ should = MP_VAL;
+ }
+ if ((err = mp_jacobi(&a, &b, &i)) != should) {
+ printf("Failed executing mp_jacobi(%d | %lu) %s.\n", n, jacobi[cnt].n, mp_error_to_string(err));
+ return EXIT_FAILURE;
+ }
+ if (err == MP_OKAY && i != jacobi[cnt].c[n + 5]) {
+ printf("Failed trivial mp_jacobi(%d | %lu) %d != %d\n", n, jacobi[cnt].n, i, jacobi[cnt].c[n + 5]);
+ return EXIT_FAILURE;
}
}
}
- printf("done\n");
// test mp_get_int
- printf("Testing: mp_get_int\n");
+ printf("\n\nTesting: mp_get_int");
for (i = 0; i < 1000; ++i) {
- t = ((unsigned long) rand() * rand() + 1) & 0xFFFFFFFF;
- mp_set_int(&a, t);
- if (t != mp_get_int(&a)) {
- printf("mp_get_int() bad result!\n");
- return 1;
+ t = ((unsigned long) rand () * rand () + 1) & 0xFFFFFFFF;
+ mp_set_int (&a, t);
+ if (t != mp_get_int (&a)) {
+ printf ("\nmp_get_int() bad result!");
+ return EXIT_FAILURE;
}
}
mp_set_int(&a, 0);
if (mp_get_int(&a) != 0) {
- printf("mp_get_int() bad result!\n");
- return 1;
+ printf("\nmp_get_int() bad result!");
+ return EXIT_FAILURE;
}
mp_set_int(&a, 0xffffffff);
if (mp_get_int(&a) != 0xffffffff) {
- printf("mp_get_int() bad result!\n");
- return 1;
+ printf("\nmp_get_int() bad result!");
+ return EXIT_FAILURE;
}
+
+ printf("\n\nTesting: mp_get_long\n");
+ for (i = 0; i < (int)(sizeof(unsigned long)*CHAR_BIT) - 1; ++i) {
+ t = (1ULL << (i+1)) - 1;
+ if (!t)
+ t = -1;
+ printf(" t = 0x%lx i = %d\r", t, i);
+ do {
+ if (mp_set_long(&a, t) != MP_OKAY) {
+ printf("\nmp_set_long() error!");
+ return EXIT_FAILURE;
+ }
+ s = mp_get_long(&a);
+ if (s != t) {
+ printf("\nmp_get_long() bad result! 0x%lx != 0x%lx", s, t);
+ return EXIT_FAILURE;
+ }
+ t <<= 1;
+ } while(t);
+ }
+
+ printf("\n\nTesting: mp_get_long_long\n");
+ for (i = 0; i < (int)(sizeof(unsigned long long)*CHAR_BIT) - 1; ++i) {
+ r = (1ULL << (i+1)) - 1;
+ if (!r)
+ r = -1;
+ printf(" r = 0x%llx i = %d\r", r, i);
+ do {
+ if (mp_set_long_long(&a, r) != MP_OKAY) {
+ printf("\nmp_set_long_long() error!");
+ return EXIT_FAILURE;
+ }
+ q = mp_get_long_long(&a);
+ if (q != r) {
+ printf("\nmp_get_long_long() bad result! 0x%llx != 0x%llx", q, r);
+ return EXIT_FAILURE;
+ }
+ r <<= 1;
+ } while(r);
+ }
+
// test mp_sqrt
- printf("Testing: mp_sqrt\n");
+ printf("\n\nTesting: mp_sqrt\n");
for (i = 0; i < 1000; ++i) {
- printf("%6d\r", i);
- fflush(stdout);
- n = (rand() & 15) + 1;
- mp_rand(&a, n);
- if (mp_sqrt(&a, &b) != MP_OKAY) {
- printf("mp_sqrt() error!\n");
- return 1;
+ printf ("%6d\r", i);
+ fflush (stdout);
+ n = (rand () & 15) + 1;
+ mp_rand (&a, n);
+ if (mp_sqrt (&a, &b) != MP_OKAY) {
+ printf ("\nmp_sqrt() error!");
+ return EXIT_FAILURE;
+ }
+ mp_n_root_ex (&a, 2, &c, 0);
+ mp_n_root_ex (&a, 2, &d, 1);
+ if (mp_cmp_mag (&c, &d) != MP_EQ) {
+ printf ("\nmp_n_root_ex() bad result!");
+ return EXIT_FAILURE;
}
- mp_n_root(&a, 2, &a);
- if (mp_cmp_mag(&b, &a) != MP_EQ) {
- printf("mp_sqrt() bad result!\n");
- return 1;
+ if (mp_cmp_mag (&b, &c) != MP_EQ) {
+ printf ("mp_sqrt() bad result!\n");
+ return EXIT_FAILURE;
}
}
- printf("\nTesting: mp_is_square\n");
+ printf("\n\nTesting: mp_is_square\n");
for (i = 0; i < 1000; ++i) {
- printf("%6d\r", i);
- fflush(stdout);
+ printf ("%6d\r", i);
+ fflush (stdout);
/* test mp_is_square false negatives */
- n = (rand() & 7) + 1;
- mp_rand(&a, n);
- mp_sqr(&a, &a);
- if (mp_is_square(&a, &n) != MP_OKAY) {
- printf("fn:mp_is_square() error!\n");
- return 1;
+ n = (rand () & 7) + 1;
+ mp_rand (&a, n);
+ mp_sqr (&a, &a);
+ if (mp_is_square (&a, &n) != MP_OKAY) {
+ printf ("\nfn:mp_is_square() error!");
+ return EXIT_FAILURE;
}
if (n == 0) {
- printf("fn:mp_is_square() bad result!\n");
- return 1;
+ printf ("\nfn:mp_is_square() bad result!");
+ return EXIT_FAILURE;
}
/* test for false positives */
- mp_add_d(&a, 1, &a);
- if (mp_is_square(&a, &n) != MP_OKAY) {
- printf("fp:mp_is_square() error!\n");
- return 1;
+ mp_add_d (&a, 1, &a);
+ if (mp_is_square (&a, &n) != MP_OKAY) {
+ printf ("\nfp:mp_is_square() error!");
+ return EXIT_FAILURE;
}
if (n == 1) {
- printf("fp:mp_is_square() bad result!\n");
- return 1;
+ printf ("\nfp:mp_is_square() bad result!");
+ return EXIT_FAILURE;
}
}
printf("\n\n");
+ // r^2 = n (mod p)
+ for (i = 0; i < (int)(sizeof(sqrtmod_prime)/sizeof(sqrtmod_prime[0])); ++i) {
+ mp_set_int(&a, sqrtmod_prime[i].p);
+ mp_set_int(&b, sqrtmod_prime[i].n);
+ if (mp_sqrtmod_prime(&b, &a, &c) != MP_OKAY) {
+ printf("Failed executing %d. mp_sqrtmod_prime\n", (i+1));
+ return EXIT_FAILURE;
+ }
+ if (mp_cmp_d(&c, sqrtmod_prime[i].r) != MP_EQ) {
+ printf("Failed %d. trivial mp_sqrtmod_prime\n", (i+1));
+ ndraw(&c, "r");
+ return EXIT_FAILURE;
+ }
+ }
+
/* test for size */
for (ix = 10; ix < 128; ix++) {
- printf("Testing (not safe-prime): %9d bits \r", ix);
- fflush(stdout);
- err =
- mp_prime_random_ex(&a, 8, ix,
- (rand() & 1) ? LTM_PRIME_2MSB_OFF :
- LTM_PRIME_2MSB_ON, myrng, NULL);
+ printf ("Testing (not safe-prime): %9d bits \r", ix);
+ fflush (stdout);
+ err = mp_prime_random_ex (&a, 8, ix,
+ (rand () & 1) ? 0 : LTM_PRIME_2MSB_ON, myrng,
+ NULL);
if (err != MP_OKAY) {
- printf("failed with err code %d\n", err);
- return EXIT_FAILURE;
+ printf ("failed with err code %d\n", err);
+ return EXIT_FAILURE;
}
- if (mp_count_bits(&a) != ix) {
- printf("Prime is %d not %d bits!!!\n", mp_count_bits(&a), ix);
- return EXIT_FAILURE;
+ if (mp_count_bits (&a) != ix) {
+ printf ("Prime is %d not %d bits!!!\n", mp_count_bits (&a), ix);
+ return EXIT_FAILURE;
}
}
+ printf("\n");
for (ix = 16; ix < 128; ix++) {
- printf("Testing ( safe-prime): %9d bits \r", ix);
- fflush(stdout);
- err =
- mp_prime_random_ex(&a, 8, ix,
- ((rand() & 1) ? LTM_PRIME_2MSB_OFF :
- LTM_PRIME_2MSB_ON) | LTM_PRIME_SAFE, myrng,
- NULL);
+ printf ("Testing ( safe-prime): %9d bits \r", ix);
+ fflush (stdout);
+ err = mp_prime_random_ex (
+ &a, 8, ix, ((rand () & 1) ? 0 : LTM_PRIME_2MSB_ON) | LTM_PRIME_SAFE,
+ myrng, NULL);
if (err != MP_OKAY) {
- printf("failed with err code %d\n", err);
- return EXIT_FAILURE;
+ printf ("failed with err code %d\n", err);
+ return EXIT_FAILURE;
}
- if (mp_count_bits(&a) != ix) {
- printf("Prime is %d not %d bits!!!\n", mp_count_bits(&a), ix);
- return EXIT_FAILURE;
+ if (mp_count_bits (&a) != ix) {
+ printf ("Prime is %d not %d bits!!!\n", mp_count_bits (&a), ix);
+ return EXIT_FAILURE;
}
/* let's see if it's really a safe prime */
- mp_sub_d(&a, 1, &a);
- mp_div_2(&a, &a);
- mp_prime_is_prime(&a, 8, &cnt);
+ mp_sub_d (&a, 1, &a);
+ mp_div_2 (&a, &a);
+ mp_prime_is_prime (&a, 8, &cnt);
if (cnt != MP_YES) {
- printf("sub is not prime!\n");
- return EXIT_FAILURE;
+ printf ("sub is not prime!\n");
+ return EXIT_FAILURE;
+ }
+ }
+
+ printf("\n\n");
+
+ // test montgomery
+ printf("Testing: montgomery...\n");
+ for (i = 1; i <= 10; i++) {
+ if (i == 10)
+ i = 1000;
+ printf(" digit size: %2d\r", i);
+ fflush(stdout);
+ for (n = 0; n < 1000; n++) {
+ mp_rand(&a, i);
+ a.dp[0] |= 1;
+
+ // let's see if R is right
+ mp_montgomery_calc_normalization(&b, &a);
+ mp_montgomery_setup(&a, &mp);
+
+ // now test a random reduction
+ for (ix = 0; ix < 100; ix++) {
+ mp_rand(&c, 1 + abs(rand()) % (2*i));
+ mp_copy(&c, &d);
+ mp_copy(&c, &e);
+
+ mp_mod(&d, &a, &d);
+ mp_montgomery_reduce(&c, &a, mp);
+ mp_mulmod(&c, &b, &a, &c);
+
+ if (mp_cmp(&c, &d) != MP_EQ) {
+printf("d = e mod a, c = e MOD a\n");
+mp_todecimal(&a, buf); printf("a = %s\n", buf);
+mp_todecimal(&e, buf); printf("e = %s\n", buf);
+mp_todecimal(&d, buf); printf("d = %s\n", buf);
+mp_todecimal(&c, buf); printf("c = %s\n", buf);
+printf("compare no compare!\n"); return EXIT_FAILURE; }
+ /* only one big montgomery reduction */
+ if (i > 10)
+ {
+ n = 1000;
+ ix = 100;
+ }
+ }
}
}
@@ -239,120 +475,123 @@ printf("compare no compare!\n"); exit(EXIT_FAILURE); }
#endif
/* test mp_cnt_lsb */
- printf("testing mp_cnt_lsb...\n");
+ printf("\n\nTesting: mp_cnt_lsb");
mp_set(&a, 1);
for (ix = 0; ix < 1024; ix++) {
- if (mp_cnt_lsb(&a) != ix) {
- printf("Failed at %d, %d\n", ix, mp_cnt_lsb(&a));
- return 0;
+ if (mp_cnt_lsb (&a) != ix) {
+ printf ("Failed at %d, %d\n", ix, mp_cnt_lsb (&a));
+ return EXIT_FAILURE;
}
- mp_mul_2(&a, &a);
+ mp_mul_2 (&a, &a);
}
/* test mp_reduce_2k */
- printf("Testing mp_reduce_2k...\n");
+ printf("\n\nTesting: mp_reduce_2k\n");
for (cnt = 3; cnt <= 128; ++cnt) {
mp_digit tmp;
- mp_2expt(&a, cnt);
- mp_sub_d(&a, 2, &a); /* a = 2**cnt - 2 */
-
+ mp_2expt (&a, cnt);
+ mp_sub_d (&a, 2, &a); /* a = 2**cnt - 2 */
- printf("\nTesting %4d bits", cnt);
- printf("(%d)", mp_reduce_is_2k(&a));
- mp_reduce_2k_setup(&a, &tmp);
- printf("(%d)", tmp);
+ printf ("\r %4d bits", cnt);
+ printf ("(%d)", mp_reduce_is_2k (&a));
+ mp_reduce_2k_setup (&a, &tmp);
+ printf ("(%lu)", (unsigned long) tmp);
for (ix = 0; ix < 1000; ix++) {
- if (!(ix & 127)) {
- printf(".");
- fflush(stdout);
- }
- mp_rand(&b, (cnt / DIGIT_BIT + 1) * 2);
- mp_copy(&c, &b);
- mp_mod(&c, &a, &c);
- mp_reduce_2k(&b, &a, 2);
- if (mp_cmp(&c, &b)) {
- printf("FAILED\n");
- exit(0);
- }
+ if (!(ix & 127)) {
+ printf (".");
+ fflush (stdout);
+ }
+ mp_rand (&b, (cnt / DIGIT_BIT + 1) * 2);
+ mp_copy (&c, &b);
+ mp_mod (&c, &a, &c);
+ mp_reduce_2k (&b, &a, 2);
+ if (mp_cmp (&c, &b)) {
+ printf ("FAILED\n");
+ return EXIT_FAILURE;
+ }
}
}
/* test mp_div_3 */
- printf("Testing mp_div_3...\n");
+ printf("\n\nTesting: mp_div_3...\n");
mp_set(&d, 3);
for (cnt = 0; cnt < 10000;) {
- mp_digit r1, r2;
+ mp_digit r2;
if (!(++cnt & 127))
- printf("%9d\r", cnt);
+ {
+ printf("%9d\r", cnt);
+ fflush(stdout);
+ }
mp_rand(&a, abs(rand()) % 128 + 1);
mp_div(&a, &d, &b, &e);
mp_div_3(&a, &c, &r2);
if (mp_cmp(&b, &c) || mp_cmp_d(&e, r2)) {
- printf("\n\nmp_div_3 => Failure\n");
+ printf("\nmp_div_3 => Failure\n");
}
}
- printf("\n\nPassed div_3 testing\n");
+ printf("\nPassed div_3 testing");
/* test the DR reduction */
- printf("testing mp_dr_reduce...\n");
+ printf("\n\nTesting: mp_dr_reduce...\n");
for (cnt = 2; cnt < 32; cnt++) {
- printf("%d digit modulus\n", cnt);
- mp_grow(&a, cnt);
- mp_zero(&a);
+ printf ("\r%d digit modulus", cnt);
+ mp_grow (&a, cnt);
+ mp_zero (&a);
for (ix = 1; ix < cnt; ix++) {
- a.dp[ix] = MP_MASK;
+ a.dp[ix] = MP_MASK;
}
a.used = cnt;
a.dp[0] = 3;
- mp_rand(&b, cnt - 1);
- mp_copy(&b, &c);
+ mp_rand (&b, cnt - 1);
+ mp_copy (&b, &c);
rr = 0;
do {
- if (!(rr & 127)) {
- printf("%9lu\r", rr);
- fflush(stdout);
- }
- mp_sqr(&b, &b);
- mp_add_d(&b, 1, &b);
- mp_copy(&b, &c);
-
- mp_mod(&b, &a, &b);
- mp_dr_reduce(&c, &a, (((mp_digit) 1) << DIGIT_BIT) - a.dp[0]);
+ if (!(rr & 127)) {
+ printf (".");
+ fflush (stdout);
+ }
+ mp_sqr (&b, &b);
+ mp_add_d (&b, 1, &b);
+ mp_copy (&b, &c);
- if (mp_cmp(&b, &c) != MP_EQ) {
- printf("Failed on trial %lu\n", rr);
- exit(-1);
+ mp_mod (&b, &a, &b);
+ mp_dr_setup(&a, &mp),
+ mp_dr_reduce (&c, &a, mp);
- }
+ if (mp_cmp (&b, &c) != MP_EQ) {
+ printf ("Failed on trial %u\n", rr);
+ return EXIT_FAILURE;
+ }
} while (++rr < 500);
- printf("Passed DR test for %d digits\n", cnt);
+ printf (" passed");
+ fflush (stdout);
}
-#endif
-
+#if LTM_DEMO_TEST_REDUCE_2K_L
/* test the mp_reduce_2k_l code */
-#if 0
-#if 0
+#if LTM_DEMO_TEST_REDUCE_2K_L == 1
/* first load P with 2^1024 - 0x2A434 B9FDEC95 D8F9D550 FFFFFFFF FFFFFFFF */
mp_2expt(&a, 1024);
mp_read_radix(&b, "2A434B9FDEC95D8F9D550FFFFFFFFFFFFFFFF", 16);
mp_sub(&a, &b, &a);
-#elif 1
+#elif LTM_DEMO_TEST_REDUCE_2K_L == 2
/* p = 2^2048 - 0x1 00000000 00000000 00000000 00000000 4945DDBF 8EA2A91D 5776399B B83E188F */
mp_2expt(&a, 2048);
mp_read_radix(&b,
"1000000000000000000000000000000004945DDBF8EA2A91D5776399BB83E188F",
16);
mp_sub(&a, &b, &a);
+#else
+#error oops
#endif
mp_todecimal(&a, buf);
- printf("p==%s\n", buf);
+ printf("\n\np==%s\n", buf);
/* now mp_reduce_is_2k_l() should return */
if (mp_reduce_is_2k_l(&a) != 1) {
printf("mp_reduce_is_2k_l() return 0, should be 1\n");
@@ -363,9 +602,9 @@ printf("compare no compare!\n"); exit(EXIT_FAILURE); }
mp_rand(&b, 64);
mp_mod(&b, &a, &b);
mp_copy(&b, &c);
- printf("testing mp_reduce_2k_l...");
+ printf("Testing: mp_reduce_2k_l...");
fflush(stdout);
- for (cnt = 0; cnt < (1UL << 20); cnt++) {
+ for (cnt = 0; cnt < (int)(1UL << 20); cnt++) {
mp_sqr(&b, &b);
mp_add_d(&b, 1, &b);
mp_reduce_2k_l(&b, &a, &d);
@@ -373,7 +612,7 @@ printf("compare no compare!\n"); exit(EXIT_FAILURE); }
mp_add_d(&c, 1, &c);
mp_mod(&c, &a, &c);
if (mp_cmp(&b, &c) != MP_EQ) {
- printf("mp_reduce_2k_l() failed at step %lu\n", cnt);
+ printf("mp_reduce_2k_l() failed at step %d\n", cnt);
mp_tohex(&b, buf);
printf("b == %s\n", buf);
mp_tohex(&c, buf);
@@ -382,7 +621,9 @@ printf("compare no compare!\n"); exit(EXIT_FAILURE); }
}
}
printf("...Passed\n");
-#endif
+#endif /* LTM_DEMO_TEST_REDUCE_2K_L */
+
+#else
div2_n = mul2_n = inv_n = expt_n = lcm_n = gcd_n = add_n =
sub_n = mul_n = div_n = sqr_n = mul2d_n = div2d_n = cnt = add_d_n =
@@ -428,17 +669,17 @@ printf("compare no compare!\n"); exit(EXIT_FAILURE); }
("%4lu/%4lu/%4lu/%4lu/%4lu/%4lu/%4lu/%4lu/%4lu/%4lu/%4lu/%4lu/%4lu/%4lu/%4lu ",
add_n, sub_n, mul_n, div_n, sqr_n, mul2d_n, div2d_n, gcd_n, lcm_n,
expt_n, inv_n, div2_n, mul2_n, add_d_n, sub_d_n);
- fgets(cmd, 4095, stdin);
+ ret=fgets(cmd, 4095, stdin); if(!ret){_panic(__LINE__);}
cmd[strlen(cmd) - 1] = 0;
- printf("%s ]\r", cmd);
+ printf("%-6s ]\r", cmd);
fflush(stdout);
if (!strcmp(cmd, "mul2d")) {
++mul2d_n;
- fgets(buf, 4095, stdin);
+ ret=fgets(buf, 4095, stdin); if(!ret){_panic(__LINE__);}
mp_read_radix(&a, buf, 64);
- fgets(buf, 4095, stdin);
+ ret=fgets(buf, 4095, stdin); if(!ret){_panic(__LINE__);}
sscanf(buf, "%d", &rr);
- fgets(buf, 4095, stdin);
+ ret=fgets(buf, 4095, stdin); if(!ret){_panic(__LINE__);}
mp_read_radix(&b, buf, 64);
mp_mul_2d(&a, rr, &a);
@@ -447,15 +688,15 @@ printf("compare no compare!\n"); exit(EXIT_FAILURE); }
printf("mul2d failed, rr == %d\n", rr);
draw(&a);
draw(&b);
- return 0;
+ return EXIT_FAILURE;
}
} else if (!strcmp(cmd, "div2d")) {
++div2d_n;
- fgets(buf, 4095, stdin);
+ ret=fgets(buf, 4095, stdin); if(!ret){_panic(__LINE__);}
mp_read_radix(&a, buf, 64);
- fgets(buf, 4095, stdin);
+ ret=fgets(buf, 4095, stdin); if(!ret){_panic(__LINE__);}
sscanf(buf, "%d", &rr);
- fgets(buf, 4095, stdin);
+ ret=fgets(buf, 4095, stdin); if(!ret){_panic(__LINE__);}
mp_read_radix(&b, buf, 64);
mp_div_2d(&a, rr, &a, &e);
@@ -467,15 +708,15 @@ printf("compare no compare!\n"); exit(EXIT_FAILURE); }
printf("div2d failed, rr == %d\n", rr);
draw(&a);
draw(&b);
- return 0;
+ return EXIT_FAILURE;
}
} else if (!strcmp(cmd, "add")) {
++add_n;
- fgets(buf, 4095, stdin);
+ ret=fgets(buf, 4095, stdin); if(!ret){_panic(__LINE__);}
mp_read_radix(&a, buf, 64);
- fgets(buf, 4095, stdin);
+ ret=fgets(buf, 4095, stdin); if(!ret){_panic(__LINE__);}
mp_read_radix(&b, buf, 64);
- fgets(buf, 4095, stdin);
+ ret=fgets(buf, 4095, stdin); if(!ret){_panic(__LINE__);}
mp_read_radix(&c, buf, 64);
mp_copy(&a, &d);
mp_add(&d, &b, &d);
@@ -485,7 +726,7 @@ printf("compare no compare!\n"); exit(EXIT_FAILURE); }
draw(&b);
draw(&c);
draw(&d);
- return 0;
+ return EXIT_FAILURE;
}
/* test the sign/unsigned storage functions */
@@ -498,7 +739,7 @@ printf("compare no compare!\n"); exit(EXIT_FAILURE); }
printf("mp_signed_bin failure!\n");
draw(&c);
draw(&d);
- return 0;
+ return EXIT_FAILURE;
}
@@ -510,16 +751,16 @@ printf("compare no compare!\n"); exit(EXIT_FAILURE); }
printf("mp_unsigned_bin failure!\n");
draw(&c);
draw(&d);
- return 0;
+ return EXIT_FAILURE;
}
} else if (!strcmp(cmd, "sub")) {
++sub_n;
- fgets(buf, 4095, stdin);
+ ret=fgets(buf, 4095, stdin); if(!ret){_panic(__LINE__);}
mp_read_radix(&a, buf, 64);
- fgets(buf, 4095, stdin);
+ ret=fgets(buf, 4095, stdin); if(!ret){_panic(__LINE__);}
mp_read_radix(&b, buf, 64);
- fgets(buf, 4095, stdin);
+ ret=fgets(buf, 4095, stdin); if(!ret){_panic(__LINE__);}
mp_read_radix(&c, buf, 64);
mp_copy(&a, &d);
mp_sub(&d, &b, &d);
@@ -529,15 +770,15 @@ printf("compare no compare!\n"); exit(EXIT_FAILURE); }
draw(&b);
draw(&c);
draw(&d);
- return 0;
+ return EXIT_FAILURE;
}
} else if (!strcmp(cmd, "mul")) {
++mul_n;
- fgets(buf, 4095, stdin);
+ ret=fgets(buf, 4095, stdin); if(!ret){_panic(__LINE__);}
mp_read_radix(&a, buf, 64);
- fgets(buf, 4095, stdin);
+ ret=fgets(buf, 4095, stdin); if(!ret){_panic(__LINE__);}
mp_read_radix(&b, buf, 64);
- fgets(buf, 4095, stdin);
+ ret=fgets(buf, 4095, stdin); if(!ret){_panic(__LINE__);}
mp_read_radix(&c, buf, 64);
mp_copy(&a, &d);
mp_mul(&d, &b, &d);
@@ -547,17 +788,17 @@ printf("compare no compare!\n"); exit(EXIT_FAILURE); }
draw(&b);
draw(&c);
draw(&d);
- return 0;
+ return EXIT_FAILURE;
}
} else if (!strcmp(cmd, "div")) {
++div_n;
- fgets(buf, 4095, stdin);
+ ret=fgets(buf, 4095, stdin); if(!ret){_panic(__LINE__);}
mp_read_radix(&a, buf, 64);
- fgets(buf, 4095, stdin);
+ ret=fgets(buf, 4095, stdin); if(!ret){_panic(__LINE__);}
mp_read_radix(&b, buf, 64);
- fgets(buf, 4095, stdin);
+ ret=fgets(buf, 4095, stdin); if(!ret){_panic(__LINE__);}
mp_read_radix(&c, buf, 64);
- fgets(buf, 4095, stdin);
+ ret=fgets(buf, 4095, stdin); if(!ret){_panic(__LINE__);}
mp_read_radix(&d, buf, 64);
mp_div(&a, &b, &e, &f);
@@ -570,14 +811,14 @@ printf("compare no compare!\n"); exit(EXIT_FAILURE); }
draw(&d);
draw(&e);
draw(&f);
- return 0;
+ return EXIT_FAILURE;
}
} else if (!strcmp(cmd, "sqr")) {
++sqr_n;
- fgets(buf, 4095, stdin);
+ ret=fgets(buf, 4095, stdin); if(!ret){_panic(__LINE__);}
mp_read_radix(&a, buf, 64);
- fgets(buf, 4095, stdin);
+ ret=fgets(buf, 4095, stdin); if(!ret){_panic(__LINE__);}
mp_read_radix(&b, buf, 64);
mp_copy(&a, &c);
mp_sqr(&c, &c);
@@ -586,15 +827,15 @@ printf("compare no compare!\n"); exit(EXIT_FAILURE); }
draw(&a);
draw(&b);
draw(&c);
- return 0;
+ return EXIT_FAILURE;
}
} else if (!strcmp(cmd, "gcd")) {
++gcd_n;
- fgets(buf, 4095, stdin);
+ ret=fgets(buf, 4095, stdin); if(!ret){_panic(__LINE__);}
mp_read_radix(&a, buf, 64);
- fgets(buf, 4095, stdin);
+ ret=fgets(buf, 4095, stdin); if(!ret){_panic(__LINE__);}
mp_read_radix(&b, buf, 64);
- fgets(buf, 4095, stdin);
+ ret=fgets(buf, 4095, stdin); if(!ret){_panic(__LINE__);}
mp_read_radix(&c, buf, 64);
mp_copy(&a, &d);
mp_gcd(&d, &b, &d);
@@ -605,15 +846,15 @@ printf("compare no compare!\n"); exit(EXIT_FAILURE); }
draw(&b);
draw(&c);
draw(&d);
- return 0;
+ return EXIT_FAILURE;
}
} else if (!strcmp(cmd, "lcm")) {
++lcm_n;
- fgets(buf, 4095, stdin);
+ ret=fgets(buf, 4095, stdin); if(!ret){_panic(__LINE__);}
mp_read_radix(&a, buf, 64);
- fgets(buf, 4095, stdin);
+ ret=fgets(buf, 4095, stdin); if(!ret){_panic(__LINE__);}
mp_read_radix(&b, buf, 64);
- fgets(buf, 4095, stdin);
+ ret=fgets(buf, 4095, stdin); if(!ret){_panic(__LINE__);}
mp_read_radix(&c, buf, 64);
mp_copy(&a, &d);
mp_lcm(&d, &b, &d);
@@ -624,17 +865,17 @@ printf("compare no compare!\n"); exit(EXIT_FAILURE); }
draw(&b);
draw(&c);
draw(&d);
- return 0;
+ return EXIT_FAILURE;
}
} else if (!strcmp(cmd, "expt")) {
++expt_n;
- fgets(buf, 4095, stdin);
+ ret=fgets(buf, 4095, stdin); if(!ret){_panic(__LINE__);}
mp_read_radix(&a, buf, 64);
- fgets(buf, 4095, stdin);
+ ret=fgets(buf, 4095, stdin); if(!ret){_panic(__LINE__);}
mp_read_radix(&b, buf, 64);
- fgets(buf, 4095, stdin);
+ ret=fgets(buf, 4095, stdin); if(!ret){_panic(__LINE__);}
mp_read_radix(&c, buf, 64);
- fgets(buf, 4095, stdin);
+ ret=fgets(buf, 4095, stdin); if(!ret){_panic(__LINE__);}
mp_read_radix(&d, buf, 64);
mp_copy(&a, &e);
mp_exptmod(&e, &b, &c, &e);
@@ -645,15 +886,15 @@ printf("compare no compare!\n"); exit(EXIT_FAILURE); }
draw(&c);
draw(&d);
draw(&e);
- return 0;
+ return EXIT_FAILURE;
}
} else if (!strcmp(cmd, "invmod")) {
++inv_n;
- fgets(buf, 4095, stdin);
+ ret=fgets(buf, 4095, stdin); if(!ret){_panic(__LINE__);}
mp_read_radix(&a, buf, 64);
- fgets(buf, 4095, stdin);
+ ret=fgets(buf, 4095, stdin); if(!ret){_panic(__LINE__);}
mp_read_radix(&b, buf, 64);
- fgets(buf, 4095, stdin);
+ ret=fgets(buf, 4095, stdin); if(!ret){_panic(__LINE__);}
mp_read_radix(&c, buf, 64);
mp_invmod(&a, &b, &d);
mp_mulmod(&d, &a, &b, &e);
@@ -663,16 +904,17 @@ printf("compare no compare!\n"); exit(EXIT_FAILURE); }
draw(&b);
draw(&c);
draw(&d);
+ draw(&e);
mp_gcd(&a, &b, &e);
draw(&e);
- return 0;
+ return EXIT_FAILURE;
}
} else if (!strcmp(cmd, "div2")) {
++div2_n;
- fgets(buf, 4095, stdin);
+ ret=fgets(buf, 4095, stdin); if(!ret){_panic(__LINE__);}
mp_read_radix(&a, buf, 64);
- fgets(buf, 4095, stdin);
+ ret=fgets(buf, 4095, stdin); if(!ret){_panic(__LINE__);}
mp_read_radix(&b, buf, 64);
mp_div_2(&a, &c);
if (mp_cmp(&c, &b) != MP_EQ) {
@@ -680,13 +922,13 @@ printf("compare no compare!\n"); exit(EXIT_FAILURE); }
draw(&a);
draw(&b);
draw(&c);
- return 0;
+ return EXIT_FAILURE;
}
} else if (!strcmp(cmd, "mul2")) {
++mul2_n;
- fgets(buf, 4095, stdin);
+ ret=fgets(buf, 4095, stdin); if(!ret){_panic(__LINE__);}
mp_read_radix(&a, buf, 64);
- fgets(buf, 4095, stdin);
+ ret=fgets(buf, 4095, stdin); if(!ret){_panic(__LINE__);}
mp_read_radix(&b, buf, 64);
mp_mul_2(&a, &c);
if (mp_cmp(&c, &b) != MP_EQ) {
@@ -694,15 +936,15 @@ printf("compare no compare!\n"); exit(EXIT_FAILURE); }
draw(&a);
draw(&b);
draw(&c);
- return 0;
+ return EXIT_FAILURE;
}
} else if (!strcmp(cmd, "add_d")) {
++add_d_n;
- fgets(buf, 4095, stdin);
+ ret=fgets(buf, 4095, stdin); if(!ret){_panic(__LINE__);}
mp_read_radix(&a, buf, 64);
- fgets(buf, 4095, stdin);
+ ret=fgets(buf, 4095, stdin); if(!ret){_panic(__LINE__);}
sscanf(buf, "%d", &ix);
- fgets(buf, 4095, stdin);
+ ret=fgets(buf, 4095, stdin); if(!ret){_panic(__LINE__);}
mp_read_radix(&b, buf, 64);
mp_add_d(&a, ix, &c);
if (mp_cmp(&b, &c) != MP_EQ) {
@@ -711,15 +953,15 @@ printf("compare no compare!\n"); exit(EXIT_FAILURE); }
draw(&b);
draw(&c);
printf("d == %d\n", ix);
- return 0;
+ return EXIT_FAILURE;
}
} else if (!strcmp(cmd, "sub_d")) {
++sub_d_n;
- fgets(buf, 4095, stdin);
+ ret=fgets(buf, 4095, stdin); if(!ret){_panic(__LINE__);}
mp_read_radix(&a, buf, 64);
- fgets(buf, 4095, stdin);
+ ret=fgets(buf, 4095, stdin); if(!ret){_panic(__LINE__);}
sscanf(buf, "%d", &ix);
- fgets(buf, 4095, stdin);
+ ret=fgets(buf, 4095, stdin); if(!ret){_panic(__LINE__);}
mp_read_radix(&b, buf, 64);
mp_sub_d(&a, ix, &c);
if (mp_cmp(&b, &c) != MP_EQ) {
@@ -728,13 +970,17 @@ printf("compare no compare!\n"); exit(EXIT_FAILURE); }
draw(&b);
draw(&c);
printf("d == %d\n", ix);
- return 0;
+ return EXIT_FAILURE;
}
+ } else if (!strcmp(cmd, "exit")) {
+ printf("\nokay, exiting now\n");
+ break;
}
}
+#endif
return 0;
}
-/* $Source: /cvs/libtom/libtommath/demo/demo.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2005/06/24 11:32:07 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtommath/demo/timing.c b/libtommath/demo/timing.c
index d4660a9..87224da 100644
--- a/libtommath/demo/timing.c
+++ b/libtommath/demo/timing.c
@@ -1,7 +1,9 @@
#include <tommath.h>
#include <time.h>
+#include <unistd.h>
+#include <stdint.h>
-ulong64 _tt;
+uint64_t _tt;
#ifdef IOWNANATHLON
#include <unistd.h>
@@ -10,6 +12,12 @@ ulong64 _tt;
#define SLEEP
#endif
+#ifdef LTM_TIMING_REAL_RAND
+#define LTM_TIMING_RAND_SEED time(NULL)
+#else
+#define LTM_TIMING_RAND_SEED 23
+#endif
+
void ndraw(mp_int * a, char *name)
{
@@ -40,14 +48,16 @@ int lbit(void)
}
/* RDTSC from Scott Duplichan */
-static ulong64 TIMFUNC(void)
+static uint64_t TIMFUNC(void)
{
#if defined __GNUC__
#if defined(__i386__) || defined(__x86_64__)
- unsigned long long a;
- __asm__ __volatile__("rdtsc\nmovl %%eax,%0\nmovl %%edx,4+%0\n"::
- "m"(a):"%eax", "%edx");
- return a;
+ /* version from http://www.mcs.anl.gov/~kazutomo/rdtsc.html
+ * the old code always got a warning issued by gcc, clang did not complain...
+ */
+ unsigned hi, lo;
+ __asm__ __volatile__ ("rdtsc" : "=a"(lo), "=d"(hi));
+ return ((uint64_t)lo)|( ((uint64_t)hi)<<32);
#else /* gcc-IA64 version */
unsigned long result;
__asm__ __volatile__("mov %0=ar.itc":"=r"(result)::"memory");
@@ -78,12 +88,24 @@ static ulong64 TIMFUNC(void)
//#define DO8(x) DO4(x); DO4(x);
//#define DO(x) DO8(x); DO8(x);
+#ifdef TIMING_NO_LOGS
+#define FOPEN(a, b) NULL
+#define FPRINTF(a,b,c,d)
+#define FFLUSH(a)
+#define FCLOSE(a) (void)(a)
+#else
+#define FOPEN(a,b) fopen(a,b)
+#define FPRINTF(a,b,c,d) fprintf(a,b,c,d)
+#define FFLUSH(a) fflush(a)
+#define FCLOSE(a) fclose(a)
+#endif
+
int main(void)
{
- ulong64 tt, gg, CLK_PER_SEC;
+ uint64_t tt, gg, CLK_PER_SEC;
FILE *log, *logb, *logc, *logd;
mp_int a, b, c, d, e, f;
- int n, cnt, ix, old_kara_m, old_kara_s;
+ int n, cnt, ix, old_kara_m, old_kara_s, old_toom_m, old_toom_s;
unsigned rr;
mp_init(&a);
@@ -93,19 +115,15 @@ int main(void)
mp_init(&e);
mp_init(&f);
- srand(time(NULL));
-
+ srand(LTM_TIMING_RAND_SEED);
- /* temp. turn off TOOM */
- TOOM_MUL_CUTOFF = TOOM_SQR_CUTOFF = 100000;
CLK_PER_SEC = TIMFUNC();
sleep(1);
CLK_PER_SEC = TIMFUNC() - CLK_PER_SEC;
printf("CLK_PER_SEC == %llu\n", CLK_PER_SEC);
- goto exptmod;
- log = fopen("logs/add.log", "w");
+ log = FOPEN("logs/add.log", "w");
for (cnt = 8; cnt <= 128; cnt += 8) {
SLEEP;
mp_rand(&a, cnt);
@@ -121,12 +139,12 @@ int main(void)
} while (++rr < 100000);
printf("Adding\t\t%4d-bit => %9llu/sec, %9llu cycles\n",
mp_count_bits(&a), CLK_PER_SEC / tt, tt);
- fprintf(log, "%d %9llu\n", cnt * DIGIT_BIT, tt);
- fflush(log);
+ FPRINTF(log, "%d %9llu\n", cnt * DIGIT_BIT, tt);
+ FFLUSH(log);
}
- fclose(log);
+ FCLOSE(log);
- log = fopen("logs/sub.log", "w");
+ log = FOPEN("logs/sub.log", "w");
for (cnt = 8; cnt <= 128; cnt += 8) {
SLEEP;
mp_rand(&a, cnt);
@@ -143,22 +161,26 @@ int main(void)
printf("Subtracting\t\t%4d-bit => %9llu/sec, %9llu cycles\n",
mp_count_bits(&a), CLK_PER_SEC / tt, tt);
- fprintf(log, "%d %9llu\n", cnt * DIGIT_BIT, tt);
- fflush(log);
+ FPRINTF(log, "%d %9llu\n", cnt * DIGIT_BIT, tt);
+ FFLUSH(log);
}
- fclose(log);
+ FCLOSE(log);
/* do mult/square twice, first without karatsuba and second with */
- multtest:
old_kara_m = KARATSUBA_MUL_CUTOFF;
old_kara_s = KARATSUBA_SQR_CUTOFF;
- for (ix = 0; ix < 2; ix++) {
- printf("With%s Karatsuba\n", (ix == 0) ? "out" : "");
-
- KARATSUBA_MUL_CUTOFF = (ix == 0) ? 9999 : old_kara_m;
- KARATSUBA_SQR_CUTOFF = (ix == 0) ? 9999 : old_kara_s;
-
- log = fopen((ix == 0) ? "logs/mult.log" : "logs/mult_kara.log", "w");
+ /* currently toom-cook cut-off is too high to kick in, so we just use the karatsuba values */
+ old_toom_m = old_kara_m;
+ old_toom_s = old_kara_m;
+ for (ix = 0; ix < 3; ix++) {
+ printf("With%s Karatsuba, With%s Toom\n", (ix == 0) ? "out" : "", (ix == 1) ? "out" : "");
+
+ KARATSUBA_MUL_CUTOFF = (ix == 1) ? old_kara_m : 9999;
+ KARATSUBA_SQR_CUTOFF = (ix == 1) ? old_kara_s : 9999;
+ TOOM_MUL_CUTOFF = (ix == 2) ? old_toom_m : 9999;
+ TOOM_SQR_CUTOFF = (ix == 2) ? old_toom_s : 9999;
+
+ log = FOPEN((ix == 0) ? "logs/mult.log" : (ix == 1) ? "logs/mult_kara.log" : "logs/mult_toom.log", "w");
for (cnt = 4; cnt <= 10240 / DIGIT_BIT; cnt += 2) {
SLEEP;
mp_rand(&a, cnt);
@@ -174,12 +196,12 @@ int main(void)
} while (++rr < 100);
printf("Multiplying\t%4d-bit => %9llu/sec, %9llu cycles\n",
mp_count_bits(&a), CLK_PER_SEC / tt, tt);
- fprintf(log, "%d %9llu\n", mp_count_bits(&a), tt);
- fflush(log);
+ FPRINTF(log, "%d %9llu\n", mp_count_bits(&a), tt);
+ FFLUSH(log);
}
- fclose(log);
+ FCLOSE(log);
- log = fopen((ix == 0) ? "logs/sqr.log" : "logs/sqr_kara.log", "w");
+ log = FOPEN((ix == 0) ? "logs/sqr.log" : (ix == 1) ? "logs/sqr_kara.log" : "logs/sqr_toom.log", "w");
for (cnt = 4; cnt <= 10240 / DIGIT_BIT; cnt += 2) {
SLEEP;
mp_rand(&a, cnt);
@@ -194,13 +216,12 @@ int main(void)
} while (++rr < 100);
printf("Squaring\t%4d-bit => %9llu/sec, %9llu cycles\n",
mp_count_bits(&a), CLK_PER_SEC / tt, tt);
- fprintf(log, "%d %9llu\n", mp_count_bits(&a), tt);
- fflush(log);
+ FPRINTF(log, "%d %9llu\n", mp_count_bits(&a), tt);
+ FFLUSH(log);
}
- fclose(log);
+ FCLOSE(log);
}
- exptmod:
{
char *primes[] = {
@@ -235,10 +256,10 @@ int main(void)
"1214855636816562637502584060163403830270705000634713483015101384881871978446801224798536155406895823305035467591632531067547890948695117172076954220727075688048751022421198712032848890056357845974246560748347918630050853933697792254955890439720297560693579400297062396904306270145886830719309296352765295712183040773146419022875165382778007040109957609739589875590885701126197906063620133954893216612678838507540777138437797705602453719559017633986486649523611975865005712371194067612263330335590526176087004421363598470302731349138773205901447704682181517904064735636518462452242791676541725292378925568296858010151852326316777511935037531017413910506921922450666933202278489024521263798482237150056835746454842662048692127173834433089016107854491097456725016327709663199738238442164843147132789153725513257167915555162094970853584447993125488607696008169807374736711297007473812256272245489405898470297178738029484459690836250560495461579533254473316340608217876781986188705928270735695752830825527963838355419762516246028680280988020401914551825487349990306976304093109384451438813251211051597392127491464898797406789175453067960072008590614886532333015881171367104445044718144312416815712216611576221546455968770801413440778423979",
NULL
};
- log = fopen("logs/expt.log", "w");
- logb = fopen("logs/expt_dr.log", "w");
- logc = fopen("logs/expt_2k.log", "w");
- logd = fopen("logs/expt_2kl.log", "w");
+ log = FOPEN("logs/expt.log", "w");
+ logb = FOPEN("logs/expt_dr.log", "w");
+ logc = FOPEN("logs/expt_2k.log", "w");
+ logd = FOPEN("logs/expt_2kl.log", "w");
for (n = 0; primes[n]; n++) {
SLEEP;
mp_read_radix(&a, primes[n], 10);
@@ -271,17 +292,17 @@ int main(void)
}
printf("Exponentiating\t%4d-bit => %9llu/sec, %9llu cycles\n",
mp_count_bits(&a), CLK_PER_SEC / tt, tt);
- fprintf(n < 4 ? logd : (n < 9) ? logc : (n < 16) ? logb : log,
+ FPRINTF(n < 4 ? logd : (n < 9) ? logc : (n < 16) ? logb : log,
"%d %9llu\n", mp_count_bits(&a), tt);
}
}
- fclose(log);
- fclose(logb);
- fclose(logc);
- fclose(logd);
+ FCLOSE(log);
+ FCLOSE(logb);
+ FCLOSE(logc);
+ FCLOSE(logd);
- log = fopen("logs/invmod.log", "w");
- for (cnt = 4; cnt <= 128; cnt += 4) {
+ log = FOPEN("logs/invmod.log", "w");
+ for (cnt = 4; cnt <= 32; cnt += 4) {
SLEEP;
mp_rand(&a, cnt);
mp_rand(&b, cnt);
@@ -307,13 +328,13 @@ int main(void)
}
printf("Inverting mod\t%4d-bit => %9llu/sec, %9llu cycles\n",
mp_count_bits(&a), CLK_PER_SEC / tt, tt);
- fprintf(log, "%d %9llu\n", cnt * DIGIT_BIT, tt);
+ FPRINTF(log, "%d %9llu\n", cnt * DIGIT_BIT, tt);
}
- fclose(log);
+ FCLOSE(log);
return 0;
}
-/* $Source: /cvs/libtom/libtommath/demo/timing.c,v $ */
-/* $Revision: 1.2 $ */
-/* $Date: 2005/05/05 14:38:47 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtommath/dep.pl b/libtommath/dep.pl
index c39e27e..0a5d19a 100644
--- a/libtommath/dep.pl
+++ b/libtommath/dep.pl
@@ -68,7 +68,7 @@ foreach my $filename (glob "bn*.c") {
$line = $';
# now $& is the match, we want to skip over LTM keywords like
# mp_int, mp_word, mp_digit
- if (!($& eq "mp_digit") && !($& eq "mp_word") && !($& eq "mp_int")) {
+ if (!($& eq "mp_digit") && !($& eq "mp_word") && !($& eq "mp_int") && !($& eq "mp_min_u32")) {
my $a = $&;
$a =~ tr/[a-z]/[A-Z]/;
$a = "BN_" . $a . "_C";
diff --git a/libtommath/etc/2kprime.c b/libtommath/etc/2kprime.c
index c09818f..9450283 100644
--- a/libtommath/etc/2kprime.c
+++ b/libtommath/etc/2kprime.c
@@ -79,6 +79,6 @@ int main(void)
-/* $Source: /cvs/libtom/libtommath/etc/2kprime.c,v $ */
-/* $Revision: 1.2 $ */
-/* $Date: 2005/05/05 14:38:47 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtommath/etc/drprime.c b/libtommath/etc/drprime.c
index e413985..c7d253f 100644
--- a/libtommath/etc/drprime.c
+++ b/libtommath/etc/drprime.c
@@ -59,6 +59,6 @@ int main(void)
}
-/* $Source: /cvs/libtom/libtommath/etc/drprime.c,v $ */
-/* $Revision: 1.2 $ */
-/* $Date: 2005/05/05 14:38:47 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtommath/etc/mersenne.c b/libtommath/etc/mersenne.c
index 6a6497a..ae6725a 100644
--- a/libtommath/etc/mersenne.c
+++ b/libtommath/etc/mersenne.c
@@ -139,6 +139,6 @@ main (void)
return 0;
}
-/* $Source: /cvs/libtom/libtommath/etc/mersenne.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:47 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtommath/etc/mont.c b/libtommath/etc/mont.c
index 393be4c..45cf3fd 100644
--- a/libtommath/etc/mont.c
+++ b/libtommath/etc/mont.c
@@ -45,6 +45,6 @@ int main(void)
-/* $Source: /cvs/libtom/libtommath/etc/mont.c,v $ */
-/* $Revision: 1.2 $ */
-/* $Date: 2005/05/05 14:38:47 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtommath/etc/pprime.c b/libtommath/etc/pprime.c
index 317e2a0..9f94423 100644
--- a/libtommath/etc/pprime.c
+++ b/libtommath/etc/pprime.c
@@ -395,6 +395,6 @@ main (void)
return 0;
}
-/* $Source: /cvs/libtom/libtommath/etc/pprime.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:47 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtommath/etc/tune.c b/libtommath/etc/tune.c
index d4a502c..0208b60 100644
--- a/libtommath/etc/tune.c
+++ b/libtommath/etc/tune.c
@@ -1,23 +1,29 @@
/* Tune the Karatsuba parameters
*
- * Tom St Denis, tomstdenis@gmail.com
+ * Tom St Denis, tstdenis82@gmail.com
*/
#include <tommath.h>
#include <time.h>
+#include <stdint.h>
/* how many times todo each size mult. Depends on your computer. For slow computers
- * this can be low like 5 or 10. For fast [re: Athlon] should be 25 - 50 or so
+ * this can be low like 5 or 10. For fast [re: Athlon] should be 25 - 50 or so
*/
#define TIMES (1UL<<14UL)
+#ifndef X86_TIMER
+
/* RDTSC from Scott Duplichan */
-static ulong64 TIMFUNC (void)
+static uint64_t TIMFUNC (void)
{
#if defined __GNUC__
#if defined(__i386__) || defined(__x86_64__)
- unsigned long long a;
- __asm__ __volatile__ ("rdtsc\nmovl %%eax,%0\nmovl %%edx,4+%0\n"::"m"(a):"%eax","%edx");
- return a;
+ /* version from http://www.mcs.anl.gov/~kazutomo/rdtsc.html
+ * the old code always got a warning issued by gcc, clang did not complain...
+ */
+ unsigned hi, lo;
+ __asm__ __volatile__ ("rdtsc" : "=a"(lo), "=d"(hi));
+ return ((uint64_t)lo)|( ((uint64_t)hi)<<32);
#else /* gcc-IA64 version */
unsigned long result;
__asm__ __volatile__("mov %0=ar.itc" : "=r"(result) :: "memory");
@@ -42,23 +48,21 @@ static ulong64 TIMFUNC (void)
}
-#ifndef X86_TIMER
-
/* generic ISO C timer */
-ulong64 LBL_T;
+uint64_t LBL_T;
void t_start(void) { LBL_T = TIMFUNC(); }
-ulong64 t_read(void) { return TIMFUNC() - LBL_T; }
+uint64_t t_read(void) { return TIMFUNC() - LBL_T; }
#else
extern void t_start(void);
-extern ulong64 t_read(void);
+extern uint64_t t_read(void);
#endif
-ulong64 time_mult(int size, int s)
+uint64_t time_mult(int size, int s)
{
unsigned long x;
mp_int a, b, c;
- ulong64 t1;
+ uint64_t t1;
mp_init (&a);
mp_init (&b);
@@ -67,7 +71,7 @@ ulong64 time_mult(int size, int s)
mp_rand (&a, size);
mp_rand (&b, size);
- if (s == 1) {
+ if (s == 1) {
KARATSUBA_MUL_CUTOFF = size;
} else {
KARATSUBA_MUL_CUTOFF = 100000;
@@ -84,18 +88,18 @@ ulong64 time_mult(int size, int s)
return t1;
}
-ulong64 time_sqr(int size, int s)
+uint64_t time_sqr(int size, int s)
{
unsigned long x;
mp_int a, b;
- ulong64 t1;
+ uint64_t t1;
mp_init (&a);
mp_init (&b);
mp_rand (&a, size);
- if (s == 1) {
+ if (s == 1) {
KARATSUBA_SQR_CUTOFF = size;
} else {
KARATSUBA_SQR_CUTOFF = 100000;
@@ -114,10 +118,10 @@ ulong64 time_sqr(int size, int s)
int
main (void)
{
- ulong64 t1, t2;
+ uint64_t t1, t2;
int x, y;
- for (x = 8; ; x += 2) {
+ for (x = 8; ; x += 2) {
t1 = time_mult(x, 0);
t2 = time_mult(x, 1);
printf("%d: %9llu %9llu, %9llu\n", x, t1, t2, t2 - t1);
@@ -125,7 +129,7 @@ main (void)
}
y = x;
- for (x = 8; ; x += 2) {
+ for (x = 8; ; x += 2) {
t1 = time_sqr(x, 0);
t2 = time_sqr(x, 1);
printf("%d: %9llu %9llu, %9llu\n", x, t1, t2, t2 - t1);
@@ -137,6 +141,6 @@ main (void)
return 0;
}
-/* $Source: /cvs/libtom/libtommath/etc/tune.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:47 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtommath/filter.pl b/libtommath/filter.pl
new file mode 100755
index 0000000..a8a50c7
--- /dev/null
+++ b/libtommath/filter.pl
@@ -0,0 +1,34 @@
+#!/usr/bin/perl
+
+# we want to filter every between START_INS and END_INS out and then insert crap from another file (this is fun)
+
+$dst = shift;
+$ins = shift;
+
+open(SRC,"<$dst");
+open(INS,"<$ins");
+open(TMP,">tmp.delme");
+
+$l = 0;
+while (<SRC>) {
+ if ($_ =~ /START_INS/) {
+ print TMP $_;
+ $l = 1;
+ while (<INS>) {
+ print TMP $_;
+ }
+ close INS;
+ } elsif ($_ =~ /END_INS/) {
+ print TMP $_;
+ $l = 0;
+ } elsif ($l == 0) {
+ print TMP $_;
+ }
+}
+
+close TMP;
+close SRC;
+
+# $Source$
+# $Revision$
+# $Date$
diff --git a/libtommath/gen.pl b/libtommath/gen.pl
index 7236591..57f65ac 100644
--- a/libtommath/gen.pl
+++ b/libtommath/gen.pl
@@ -14,4 +14,6 @@ foreach my $filename (glob "bn*.c") {
close SRC or die "Error closing $filename after reading: $!";
}
print OUT "\n/* EOF */\n";
-close OUT or die "Error closing mpi.c after writing: $!"; \ No newline at end of file
+close OUT or die "Error closing mpi.c after writing: $!";
+
+system('perl -pli -e "s/\s*$//" mpi.c');
diff --git a/libtommath/genlist.sh b/libtommath/genlist.sh
new file mode 100755
index 0000000..1f53b66
--- /dev/null
+++ b/libtommath/genlist.sh
@@ -0,0 +1,8 @@
+#!/bin/bash
+
+export a=`find . -maxdepth 1 -type f -name '*.c' | sort | sed -e 'sE\./EE' | sed -e 's/\.c/\.o/' | xargs`
+perl ./parsenames.pl OBJECTS "$a"
+
+# $Source$
+# $Revision$
+# $Date$
diff --git a/libtommath/makefile.bcc b/libtommath/makefile.bcc
index 67743d9..a0cfd74 100644
--- a/libtommath/makefile.bcc
+++ b/libtommath/makefile.bcc
@@ -7,33 +7,35 @@ LIB = tlib
CC = bcc32
CFLAGS = -c -O2 -I.
-OBJECTS=bncore.obj bn_mp_init.obj bn_mp_clear.obj bn_mp_exch.obj bn_mp_grow.obj bn_mp_shrink.obj \
-bn_mp_clamp.obj bn_mp_zero.obj bn_mp_set.obj bn_mp_set_int.obj bn_mp_init_size.obj bn_mp_copy.obj \
-bn_mp_init_copy.obj bn_mp_abs.obj bn_mp_neg.obj bn_mp_cmp_mag.obj bn_mp_cmp.obj bn_mp_cmp_d.obj \
-bn_mp_rshd.obj bn_mp_lshd.obj bn_mp_mod_2d.obj bn_mp_div_2d.obj bn_mp_mul_2d.obj bn_mp_div_2.obj \
-bn_mp_mul_2.obj bn_s_mp_add.obj bn_s_mp_sub.obj bn_fast_s_mp_mul_digs.obj bn_s_mp_mul_digs.obj \
-bn_fast_s_mp_mul_high_digs.obj bn_s_mp_mul_high_digs.obj bn_fast_s_mp_sqr.obj bn_s_mp_sqr.obj \
-bn_mp_add.obj bn_mp_sub.obj bn_mp_karatsuba_mul.obj bn_mp_mul.obj bn_mp_karatsuba_sqr.obj \
-bn_mp_sqr.obj bn_mp_div.obj bn_mp_mod.obj bn_mp_add_d.obj bn_mp_sub_d.obj bn_mp_mul_d.obj \
-bn_mp_div_d.obj bn_mp_mod_d.obj bn_mp_expt_d.obj bn_mp_addmod.obj bn_mp_submod.obj \
-bn_mp_mulmod.obj bn_mp_sqrmod.obj bn_mp_gcd.obj bn_mp_lcm.obj bn_fast_mp_invmod.obj bn_mp_invmod.obj \
-bn_mp_reduce.obj bn_mp_montgomery_setup.obj bn_fast_mp_montgomery_reduce.obj bn_mp_montgomery_reduce.obj \
-bn_mp_exptmod_fast.obj bn_mp_exptmod.obj bn_mp_2expt.obj bn_mp_n_root.obj bn_mp_jacobi.obj bn_reverse.obj \
-bn_mp_count_bits.obj bn_mp_read_unsigned_bin.obj bn_mp_read_signed_bin.obj bn_mp_to_unsigned_bin.obj \
-bn_mp_to_signed_bin.obj bn_mp_unsigned_bin_size.obj bn_mp_signed_bin_size.obj \
-bn_mp_xor.obj bn_mp_and.obj bn_mp_or.obj bn_mp_rand.obj bn_mp_montgomery_calc_normalization.obj \
-bn_mp_prime_is_divisible.obj bn_prime_tab.obj bn_mp_prime_fermat.obj bn_mp_prime_miller_rabin.obj \
-bn_mp_prime_is_prime.obj bn_mp_prime_next_prime.obj bn_mp_dr_reduce.obj \
-bn_mp_dr_is_modulus.obj bn_mp_dr_setup.obj bn_mp_reduce_setup.obj \
-bn_mp_toom_mul.obj bn_mp_toom_sqr.obj bn_mp_div_3.obj bn_s_mp_exptmod.obj \
-bn_mp_reduce_2k.obj bn_mp_reduce_is_2k.obj bn_mp_reduce_2k_setup.obj \
-bn_mp_reduce_2k_l.obj bn_mp_reduce_is_2k_l.obj bn_mp_reduce_2k_setup_l.obj \
-bn_mp_radix_smap.obj bn_mp_read_radix.obj bn_mp_toradix.obj bn_mp_radix_size.obj \
-bn_mp_fread.obj bn_mp_fwrite.obj bn_mp_cnt_lsb.obj bn_error.obj \
-bn_mp_init_multi.obj bn_mp_clear_multi.obj bn_mp_exteuclid.obj bn_mp_toradix_n.obj \
-bn_mp_prime_random_ex.obj bn_mp_get_int.obj bn_mp_sqrt.obj bn_mp_is_square.obj \
-bn_mp_init_set.obj bn_mp_init_set_int.obj bn_mp_invmod_slow.obj bn_mp_prime_rabin_miller_trials.obj \
-bn_mp_to_signed_bin_n.obj bn_mp_to_unsigned_bin_n.obj
+#START_INS
+OBJECTS=bncore.obj bn_error.obj bn_fast_mp_invmod.obj bn_fast_mp_montgomery_reduce.obj bn_fast_s_mp_mul_digs.obj \
+bn_fast_s_mp_mul_high_digs.obj bn_fast_s_mp_sqr.obj bn_mp_2expt.obj bn_mp_abs.obj bn_mp_add.obj bn_mp_add_d.obj \
+bn_mp_addmod.obj bn_mp_and.obj bn_mp_clamp.obj bn_mp_clear.obj bn_mp_clear_multi.obj bn_mp_cmp.obj bn_mp_cmp_d.obj \
+bn_mp_cmp_mag.obj bn_mp_cnt_lsb.obj bn_mp_copy.obj bn_mp_count_bits.obj bn_mp_div_2.obj bn_mp_div_2d.obj bn_mp_div_3.obj \
+bn_mp_div.obj bn_mp_div_d.obj bn_mp_dr_is_modulus.obj bn_mp_dr_reduce.obj bn_mp_dr_setup.obj bn_mp_exch.obj \
+bn_mp_export.obj bn_mp_expt_d.obj bn_mp_expt_d_ex.obj bn_mp_exptmod.obj bn_mp_exptmod_fast.obj bn_mp_exteuclid.obj \
+bn_mp_fread.obj bn_mp_fwrite.obj bn_mp_gcd.obj bn_mp_get_int.obj bn_mp_get_long.obj bn_mp_get_long_long.obj \
+bn_mp_grow.obj bn_mp_import.obj bn_mp_init.obj bn_mp_init_copy.obj bn_mp_init_multi.obj bn_mp_init_set.obj \
+bn_mp_init_set_int.obj bn_mp_init_size.obj bn_mp_invmod.obj bn_mp_invmod_slow.obj bn_mp_is_square.obj \
+bn_mp_jacobi.obj bn_mp_karatsuba_mul.obj bn_mp_karatsuba_sqr.obj bn_mp_lcm.obj bn_mp_lshd.obj bn_mp_mod_2d.obj \
+bn_mp_mod.obj bn_mp_mod_d.obj bn_mp_montgomery_calc_normalization.obj bn_mp_montgomery_reduce.obj \
+bn_mp_montgomery_setup.obj bn_mp_mul_2.obj bn_mp_mul_2d.obj bn_mp_mul.obj bn_mp_mul_d.obj bn_mp_mulmod.obj bn_mp_neg.obj \
+bn_mp_n_root.obj bn_mp_n_root_ex.obj bn_mp_or.obj bn_mp_prime_fermat.obj bn_mp_prime_is_divisible.obj \
+bn_mp_prime_is_prime.obj bn_mp_prime_miller_rabin.obj bn_mp_prime_next_prime.obj \
+bn_mp_prime_rabin_miller_trials.obj bn_mp_prime_random_ex.obj bn_mp_radix_size.obj bn_mp_radix_smap.obj \
+bn_mp_rand.obj bn_mp_read_radix.obj bn_mp_read_signed_bin.obj bn_mp_read_unsigned_bin.obj bn_mp_reduce_2k.obj \
+bn_mp_reduce_2k_l.obj bn_mp_reduce_2k_setup.obj bn_mp_reduce_2k_setup_l.obj bn_mp_reduce.obj \
+bn_mp_reduce_is_2k.obj bn_mp_reduce_is_2k_l.obj bn_mp_reduce_setup.obj bn_mp_rshd.obj bn_mp_set.obj bn_mp_set_int.obj \
+bn_mp_set_long.obj bn_mp_set_long_long.obj bn_mp_shrink.obj bn_mp_signed_bin_size.obj bn_mp_sqr.obj bn_mp_sqrmod.obj \
+bn_mp_sqrt.obj bn_mp_sqrtmod_prime.obj bn_mp_sub.obj bn_mp_sub_d.obj bn_mp_submod.obj bn_mp_toom_mul.obj \
+bn_mp_toom_sqr.obj bn_mp_toradix.obj bn_mp_toradix_n.obj bn_mp_to_signed_bin.obj bn_mp_to_signed_bin_n.obj \
+bn_mp_to_unsigned_bin.obj bn_mp_to_unsigned_bin_n.obj bn_mp_unsigned_bin_size.obj bn_mp_xor.obj bn_mp_zero.obj \
+bn_prime_tab.obj bn_reverse.obj bn_s_mp_add.obj bn_s_mp_exptmod.obj bn_s_mp_mul_digs.obj bn_s_mp_mul_high_digs.obj \
+bn_s_mp_sqr.obj bn_s_mp_sub.obj
+
+#END_INS
+
+HEADERS=tommath.h tommath_class.h tommath_superclass.h
TARGET = libtommath.lib
diff --git a/libtommath/makefile.cygwin_dll b/libtommath/makefile.cygwin_dll
index 85a9b20..6feb5b4 100644
--- a/libtommath/makefile.cygwin_dll
+++ b/libtommath/makefile.cygwin_dll
@@ -8,37 +8,39 @@
CFLAGS += -I./ -Wall -W -Wshadow -O3 -funroll-loops -mno-cygwin
#x86 optimizations [should be valid for any GCC install though]
-CFLAGS += -fomit-frame-pointer
+CFLAGS += -fomit-frame-pointer
default: windll
-OBJECTS=bncore.o bn_mp_init.o bn_mp_clear.o bn_mp_exch.o bn_mp_grow.o bn_mp_shrink.o \
-bn_mp_clamp.o bn_mp_zero.o bn_mp_set.o bn_mp_set_int.o bn_mp_init_size.o bn_mp_copy.o \
-bn_mp_init_copy.o bn_mp_abs.o bn_mp_neg.o bn_mp_cmp_mag.o bn_mp_cmp.o bn_mp_cmp_d.o \
-bn_mp_rshd.o bn_mp_lshd.o bn_mp_mod_2d.o bn_mp_div_2d.o bn_mp_mul_2d.o bn_mp_div_2.o \
-bn_mp_mul_2.o bn_s_mp_add.o bn_s_mp_sub.o bn_fast_s_mp_mul_digs.o bn_s_mp_mul_digs.o \
-bn_fast_s_mp_mul_high_digs.o bn_s_mp_mul_high_digs.o bn_fast_s_mp_sqr.o bn_s_mp_sqr.o \
-bn_mp_add.o bn_mp_sub.o bn_mp_karatsuba_mul.o bn_mp_mul.o bn_mp_karatsuba_sqr.o \
-bn_mp_sqr.o bn_mp_div.o bn_mp_mod.o bn_mp_add_d.o bn_mp_sub_d.o bn_mp_mul_d.o \
-bn_mp_div_d.o bn_mp_mod_d.o bn_mp_expt_d.o bn_mp_addmod.o bn_mp_submod.o \
-bn_mp_mulmod.o bn_mp_sqrmod.o bn_mp_gcd.o bn_mp_lcm.o bn_fast_mp_invmod.o bn_mp_invmod.o \
-bn_mp_reduce.o bn_mp_montgomery_setup.o bn_fast_mp_montgomery_reduce.o bn_mp_montgomery_reduce.o \
-bn_mp_exptmod_fast.o bn_mp_exptmod.o bn_mp_2expt.o bn_mp_n_root.o bn_mp_jacobi.o bn_reverse.o \
-bn_mp_count_bits.o bn_mp_read_unsigned_bin.o bn_mp_read_signed_bin.o bn_mp_to_unsigned_bin.o \
-bn_mp_to_signed_bin.o bn_mp_unsigned_bin_size.o bn_mp_signed_bin_size.o \
-bn_mp_xor.o bn_mp_and.o bn_mp_or.o bn_mp_rand.o bn_mp_montgomery_calc_normalization.o \
-bn_mp_prime_is_divisible.o bn_prime_tab.o bn_mp_prime_fermat.o bn_mp_prime_miller_rabin.o \
-bn_mp_prime_is_prime.o bn_mp_prime_next_prime.o bn_mp_dr_reduce.o \
-bn_mp_dr_is_modulus.o bn_mp_dr_setup.o bn_mp_reduce_setup.o \
-bn_mp_toom_mul.o bn_mp_toom_sqr.o bn_mp_div_3.o bn_s_mp_exptmod.o \
-bn_mp_reduce_2k.o bn_mp_reduce_is_2k.o bn_mp_reduce_2k_setup.o \
-bn_mp_reduce_2k_l.o bn_mp_reduce_is_2k_l.o bn_mp_reduce_2k_setup_l.o \
-bn_mp_radix_smap.o bn_mp_read_radix.o bn_mp_toradix.o bn_mp_radix_size.o \
-bn_mp_fread.o bn_mp_fwrite.o bn_mp_cnt_lsb.o bn_error.o \
-bn_mp_init_multi.o bn_mp_clear_multi.o bn_mp_exteuclid.o bn_mp_toradix_n.o \
-bn_mp_prime_random_ex.o bn_mp_get_int.o bn_mp_sqrt.o bn_mp_is_square.o bn_mp_init_set.o \
-bn_mp_init_set_int.o bn_mp_invmod_slow.o bn_mp_prime_rabin_miller_trials.o \
-bn_mp_to_signed_bin_n.o bn_mp_to_unsigned_bin_n.o
+#START_INS
+OBJECTS=bncore.o bn_error.o bn_fast_mp_invmod.o bn_fast_mp_montgomery_reduce.o bn_fast_s_mp_mul_digs.o \
+bn_fast_s_mp_mul_high_digs.o bn_fast_s_mp_sqr.o bn_mp_2expt.o bn_mp_abs.o bn_mp_add.o bn_mp_add_d.o \
+bn_mp_addmod.o bn_mp_and.o bn_mp_clamp.o bn_mp_clear.o bn_mp_clear_multi.o bn_mp_cmp.o bn_mp_cmp_d.o \
+bn_mp_cmp_mag.o bn_mp_cnt_lsb.o bn_mp_copy.o bn_mp_count_bits.o bn_mp_div_2.o bn_mp_div_2d.o bn_mp_div_3.o \
+bn_mp_div.o bn_mp_div_d.o bn_mp_dr_is_modulus.o bn_mp_dr_reduce.o bn_mp_dr_setup.o bn_mp_exch.o \
+bn_mp_export.o bn_mp_expt_d.o bn_mp_expt_d_ex.o bn_mp_exptmod.o bn_mp_exptmod_fast.o bn_mp_exteuclid.o \
+bn_mp_fread.o bn_mp_fwrite.o bn_mp_gcd.o bn_mp_get_int.o bn_mp_get_long.o bn_mp_get_long_long.o \
+bn_mp_grow.o bn_mp_import.o bn_mp_init.o bn_mp_init_copy.o bn_mp_init_multi.o bn_mp_init_set.o \
+bn_mp_init_set_int.o bn_mp_init_size.o bn_mp_invmod.o bn_mp_invmod_slow.o bn_mp_is_square.o \
+bn_mp_jacobi.o bn_mp_karatsuba_mul.o bn_mp_karatsuba_sqr.o bn_mp_lcm.o bn_mp_lshd.o bn_mp_mod_2d.o \
+bn_mp_mod.o bn_mp_mod_d.o bn_mp_montgomery_calc_normalization.o bn_mp_montgomery_reduce.o \
+bn_mp_montgomery_setup.o bn_mp_mul_2.o bn_mp_mul_2d.o bn_mp_mul.o bn_mp_mul_d.o bn_mp_mulmod.o bn_mp_neg.o \
+bn_mp_n_root.o bn_mp_n_root_ex.o bn_mp_or.o bn_mp_prime_fermat.o bn_mp_prime_is_divisible.o \
+bn_mp_prime_is_prime.o bn_mp_prime_miller_rabin.o bn_mp_prime_next_prime.o \
+bn_mp_prime_rabin_miller_trials.o bn_mp_prime_random_ex.o bn_mp_radix_size.o bn_mp_radix_smap.o \
+bn_mp_rand.o bn_mp_read_radix.o bn_mp_read_signed_bin.o bn_mp_read_unsigned_bin.o bn_mp_reduce_2k.o \
+bn_mp_reduce_2k_l.o bn_mp_reduce_2k_setup.o bn_mp_reduce_2k_setup_l.o bn_mp_reduce.o \
+bn_mp_reduce_is_2k.o bn_mp_reduce_is_2k_l.o bn_mp_reduce_setup.o bn_mp_rshd.o bn_mp_set.o bn_mp_set_int.o \
+bn_mp_set_long.o bn_mp_set_long_long.o bn_mp_shrink.o bn_mp_signed_bin_size.o bn_mp_sqr.o bn_mp_sqrmod.o \
+bn_mp_sqrt.o bn_mp_sqrtmod_prime.o bn_mp_sub.o bn_mp_sub_d.o bn_mp_submod.o bn_mp_toom_mul.o \
+bn_mp_toom_sqr.o bn_mp_toradix.o bn_mp_toradix_n.o bn_mp_to_signed_bin.o bn_mp_to_signed_bin_n.o \
+bn_mp_to_unsigned_bin.o bn_mp_to_unsigned_bin_n.o bn_mp_unsigned_bin_size.o bn_mp_xor.o bn_mp_zero.o \
+bn_prime_tab.o bn_reverse.o bn_s_mp_add.o bn_s_mp_exptmod.o bn_s_mp_mul_digs.o bn_s_mp_mul_high_digs.o \
+bn_s_mp_sqr.o bn_s_mp_sub.o
+
+#END_INS
+
+HEADERS=tommath.h tommath_class.h tommath_superclass.h
# make a Windows DLL via Cygwin
windll: $(OBJECTS)
diff --git a/libtommath/makefile.icc b/libtommath/makefile.icc
index cf70ab0..1563802 100644
--- a/libtommath/makefile.icc
+++ b/libtommath/makefile.icc
@@ -11,7 +11,7 @@ CFLAGS += -I./
# -ax? specifies make code specifically for ? but compatible with IA-32
# -x? specifies compile solely for ? [not specifically IA-32 compatible]
#
-# where ? is
+# where ? is
# K - PIII
# W - first P4 [Williamette]
# N - P4 Northwood
@@ -29,7 +29,6 @@ default: libtommath.a
#default files to install
LIBNAME=libtommath.a
-HEADERS=tommath.h
#LIBPATH-The directory for libtomcrypt to be installed to.
#INCPATH-The directory to install the header files for libtommath.
@@ -39,33 +38,35 @@ LIBPATH=/usr/lib
INCPATH=/usr/include
DATAPATH=/usr/share/doc/libtommath/pdf
-OBJECTS=bncore.o bn_mp_init.o bn_mp_clear.o bn_mp_exch.o bn_mp_grow.o bn_mp_shrink.o \
-bn_mp_clamp.o bn_mp_zero.o bn_mp_set.o bn_mp_set_int.o bn_mp_init_size.o bn_mp_copy.o \
-bn_mp_init_copy.o bn_mp_abs.o bn_mp_neg.o bn_mp_cmp_mag.o bn_mp_cmp.o bn_mp_cmp_d.o \
-bn_mp_rshd.o bn_mp_lshd.o bn_mp_mod_2d.o bn_mp_div_2d.o bn_mp_mul_2d.o bn_mp_div_2.o \
-bn_mp_mul_2.o bn_s_mp_add.o bn_s_mp_sub.o bn_fast_s_mp_mul_digs.o bn_s_mp_mul_digs.o \
-bn_fast_s_mp_mul_high_digs.o bn_s_mp_mul_high_digs.o bn_fast_s_mp_sqr.o bn_s_mp_sqr.o \
-bn_mp_add.o bn_mp_sub.o bn_mp_karatsuba_mul.o bn_mp_mul.o bn_mp_karatsuba_sqr.o \
-bn_mp_sqr.o bn_mp_div.o bn_mp_mod.o bn_mp_add_d.o bn_mp_sub_d.o bn_mp_mul_d.o \
-bn_mp_div_d.o bn_mp_mod_d.o bn_mp_expt_d.o bn_mp_addmod.o bn_mp_submod.o \
-bn_mp_mulmod.o bn_mp_sqrmod.o bn_mp_gcd.o bn_mp_lcm.o bn_fast_mp_invmod.o bn_mp_invmod.o \
-bn_mp_reduce.o bn_mp_montgomery_setup.o bn_fast_mp_montgomery_reduce.o bn_mp_montgomery_reduce.o \
-bn_mp_exptmod_fast.o bn_mp_exptmod.o bn_mp_2expt.o bn_mp_n_root.o bn_mp_jacobi.o bn_reverse.o \
-bn_mp_count_bits.o bn_mp_read_unsigned_bin.o bn_mp_read_signed_bin.o bn_mp_to_unsigned_bin.o \
-bn_mp_to_signed_bin.o bn_mp_unsigned_bin_size.o bn_mp_signed_bin_size.o \
-bn_mp_xor.o bn_mp_and.o bn_mp_or.o bn_mp_rand.o bn_mp_montgomery_calc_normalization.o \
-bn_mp_prime_is_divisible.o bn_prime_tab.o bn_mp_prime_fermat.o bn_mp_prime_miller_rabin.o \
-bn_mp_prime_is_prime.o bn_mp_prime_next_prime.o bn_mp_dr_reduce.o \
-bn_mp_dr_is_modulus.o bn_mp_dr_setup.o bn_mp_reduce_setup.o \
-bn_mp_toom_mul.o bn_mp_toom_sqr.o bn_mp_div_3.o bn_s_mp_exptmod.o \
-bn_mp_reduce_2k.o bn_mp_reduce_is_2k.o bn_mp_reduce_2k_setup.o \
-bn_mp_reduce_2k_l.o bn_mp_reduce_is_2k_l.o bn_mp_reduce_2k_setup_l.o \
-bn_mp_radix_smap.o bn_mp_read_radix.o bn_mp_toradix.o bn_mp_radix_size.o \
-bn_mp_fread.o bn_mp_fwrite.o bn_mp_cnt_lsb.o bn_error.o \
-bn_mp_init_multi.o bn_mp_clear_multi.o bn_mp_exteuclid.o bn_mp_toradix_n.o \
-bn_mp_prime_random_ex.o bn_mp_get_int.o bn_mp_sqrt.o bn_mp_is_square.o bn_mp_init_set.o \
-bn_mp_init_set_int.o bn_mp_invmod_slow.o bn_mp_prime_rabin_miller_trials.o \
-bn_mp_to_signed_bin_n.o bn_mp_to_unsigned_bin_n.o
+#START_INS
+OBJECTS=bncore.o bn_error.o bn_fast_mp_invmod.o bn_fast_mp_montgomery_reduce.o bn_fast_s_mp_mul_digs.o \
+bn_fast_s_mp_mul_high_digs.o bn_fast_s_mp_sqr.o bn_mp_2expt.o bn_mp_abs.o bn_mp_add.o bn_mp_add_d.o \
+bn_mp_addmod.o bn_mp_and.o bn_mp_clamp.o bn_mp_clear.o bn_mp_clear_multi.o bn_mp_cmp.o bn_mp_cmp_d.o \
+bn_mp_cmp_mag.o bn_mp_cnt_lsb.o bn_mp_copy.o bn_mp_count_bits.o bn_mp_div_2.o bn_mp_div_2d.o bn_mp_div_3.o \
+bn_mp_div.o bn_mp_div_d.o bn_mp_dr_is_modulus.o bn_mp_dr_reduce.o bn_mp_dr_setup.o bn_mp_exch.o \
+bn_mp_export.o bn_mp_expt_d.o bn_mp_expt_d_ex.o bn_mp_exptmod.o bn_mp_exptmod_fast.o bn_mp_exteuclid.o \
+bn_mp_fread.o bn_mp_fwrite.o bn_mp_gcd.o bn_mp_get_int.o bn_mp_get_long.o bn_mp_get_long_long.o \
+bn_mp_grow.o bn_mp_import.o bn_mp_init.o bn_mp_init_copy.o bn_mp_init_multi.o bn_mp_init_set.o \
+bn_mp_init_set_int.o bn_mp_init_size.o bn_mp_invmod.o bn_mp_invmod_slow.o bn_mp_is_square.o \
+bn_mp_jacobi.o bn_mp_karatsuba_mul.o bn_mp_karatsuba_sqr.o bn_mp_lcm.o bn_mp_lshd.o bn_mp_mod_2d.o \
+bn_mp_mod.o bn_mp_mod_d.o bn_mp_montgomery_calc_normalization.o bn_mp_montgomery_reduce.o \
+bn_mp_montgomery_setup.o bn_mp_mul_2.o bn_mp_mul_2d.o bn_mp_mul.o bn_mp_mul_d.o bn_mp_mulmod.o bn_mp_neg.o \
+bn_mp_n_root.o bn_mp_n_root_ex.o bn_mp_or.o bn_mp_prime_fermat.o bn_mp_prime_is_divisible.o \
+bn_mp_prime_is_prime.o bn_mp_prime_miller_rabin.o bn_mp_prime_next_prime.o \
+bn_mp_prime_rabin_miller_trials.o bn_mp_prime_random_ex.o bn_mp_radix_size.o bn_mp_radix_smap.o \
+bn_mp_rand.o bn_mp_read_radix.o bn_mp_read_signed_bin.o bn_mp_read_unsigned_bin.o bn_mp_reduce_2k.o \
+bn_mp_reduce_2k_l.o bn_mp_reduce_2k_setup.o bn_mp_reduce_2k_setup_l.o bn_mp_reduce.o \
+bn_mp_reduce_is_2k.o bn_mp_reduce_is_2k_l.o bn_mp_reduce_setup.o bn_mp_rshd.o bn_mp_set.o bn_mp_set_int.o \
+bn_mp_set_long.o bn_mp_set_long_long.o bn_mp_shrink.o bn_mp_signed_bin_size.o bn_mp_sqr.o bn_mp_sqrmod.o \
+bn_mp_sqrt.o bn_mp_sqrtmod_prime.o bn_mp_sub.o bn_mp_sub_d.o bn_mp_submod.o bn_mp_toom_mul.o \
+bn_mp_toom_sqr.o bn_mp_toradix.o bn_mp_toradix_n.o bn_mp_to_signed_bin.o bn_mp_to_signed_bin_n.o \
+bn_mp_to_unsigned_bin.o bn_mp_to_unsigned_bin_n.o bn_mp_unsigned_bin_size.o bn_mp_xor.o bn_mp_zero.o \
+bn_prime_tab.o bn_reverse.o bn_s_mp_add.o bn_s_mp_exptmod.o bn_s_mp_mul_digs.o bn_s_mp_mul_high_digs.o \
+bn_s_mp_sqr.o bn_s_mp_sub.o
+
+#END_INS
+
+HEADERS=tommath.h tommath_class.h tommath_superclass.h
libtommath.a: $(OBJECTS)
$(AR) $(ARFLAGS) libtommath.a $(OBJECTS)
@@ -75,7 +76,7 @@ libtommath.a: $(OBJECTS)
#
# This will build the library with profile generation
# then run the test demo and rebuild the library.
-#
+#
# So far I've seen improvements in the MP math
profiled:
make -f makefile.icc CFLAGS="$(CFLAGS) -prof_gen -DTESTING" timing
@@ -83,7 +84,7 @@ profiled:
rm -f *.a *.o ltmtest
make -f makefile.icc CFLAGS="$(CFLAGS) -prof_use"
-#make a single object profiled library
+#make a single object profiled library
profiled_single:
perl gen.pl
$(CC) $(CFLAGS) -prof_gen -DTESTING -c mpi.c -o mpi.o
@@ -92,7 +93,7 @@ profiled_single:
rm -f *.o ltmtest
$(CC) $(CFLAGS) -prof_use -ip -DTESTING -c mpi.c -o mpi.o
$(AR) $(ARFLAGS) libtommath.a mpi.o
- ranlib libtommath.a
+ ranlib libtommath.a
install: libtommath.a
install -d -g $(GROUP) -o $(USER) $(DESTDIR)$(LIBPATH)
@@ -102,10 +103,10 @@ install: libtommath.a
test: libtommath.a demo/demo.o
$(CC) demo/demo.o libtommath.a -o test
-
-mtest: test
+
+mtest: test
cd mtest ; $(CC) $(CFLAGS) mtest.c -o mtest
-
+
timing: libtommath.a
$(CC) $(CFLAGS) -DTIMER demo/timing.c libtommath.a -o ltmtest
diff --git a/libtommath/makefile.include b/libtommath/makefile.include
new file mode 100644
index 0000000..c862f0f
--- /dev/null
+++ b/libtommath/makefile.include
@@ -0,0 +1,105 @@
+#
+# Include makefile for libtommath
+#
+
+#version of library
+VERSION=1.0
+VERSION_SO=1:0
+
+# default make target
+default: ${LIBNAME}
+
+# Compiler and Linker Names
+ifndef PREFIX
+ PREFIX=
+endif
+
+ifeq ($(CC),cc)
+ CC = $(PREFIX)gcc
+endif
+LD=$(PREFIX)ld
+AR=$(PREFIX)ar
+RANLIB=$(PREFIX)ranlib
+
+ifndef MAKE
+ MAKE=make
+endif
+
+CFLAGS += -I./ -Wall -Wsign-compare -Wextra -Wshadow
+
+ifndef NO_ADDTL_WARNINGS
+# additional warnings
+CFLAGS += -Wsystem-headers -Wdeclaration-after-statement -Wbad-function-cast -Wcast-align
+CFLAGS += -Wstrict-prototypes -Wpointer-arith
+endif
+
+ifdef COMPILE_DEBUG
+#debug
+CFLAGS += -g3
+else
+
+ifdef COMPILE_SIZE
+#for size
+CFLAGS += -Os
+else
+
+ifndef IGNORE_SPEED
+#for speed
+CFLAGS += -O3 -funroll-loops
+
+#x86 optimizations [should be valid for any GCC install though]
+CFLAGS += -fomit-frame-pointer
+endif
+
+endif # COMPILE_SIZE
+endif # COMPILE_DEBUG
+
+# adjust coverage set
+ifneq ($(filter $(shell arch), i386 i686 x86_64 amd64 ia64),)
+ COVERAGE = test_standalone timing
+ COVERAGE_APP = ./test && ./ltmtest
+else
+ COVERAGE = test_standalone
+ COVERAGE_APP = ./test
+endif
+
+HEADERS_PUB=tommath.h tommath_class.h tommath_superclass.h
+HEADERS=tommath_private.h $(HEADERS_PUB)
+
+test_standalone: CFLAGS+=-DLTM_DEMO_TEST_VS_MTEST=0
+
+#LIBPATH-The directory for libtommath to be installed to.
+#INCPATH-The directory to install the header files for libtommath.
+#DATAPATH-The directory to install the pdf docs.
+LIBPATH?=/usr/lib
+INCPATH?=/usr/include
+DATAPATH?=/usr/share/doc/libtommath/pdf
+
+#make the code coverage of the library
+#
+coverage: CFLAGS += -fprofile-arcs -ftest-coverage -DTIMING_NO_LOGS
+coverage: LFLAGS += -lgcov
+coverage: LDFLAGS += -lgcov
+
+coverage: $(COVERAGE)
+ $(COVERAGE_APP)
+
+lcov: coverage
+ rm -f coverage.info
+ lcov --capture --no-external --no-recursion $(LCOV_ARGS) --output-file coverage.info -q
+ genhtml coverage.info --output-directory coverage -q
+
+# target that removes all coverage output
+cleancov-clean:
+ rm -f `find . -type f -name "*.info" | xargs`
+ rm -rf coverage/
+
+# cleans everything - coverage output and standard 'clean'
+cleancov: cleancov-clean clean
+
+clean:
+ rm -f *.gcda *.gcno *.bat *.o *.a *.obj *.lib *.exe *.dll etclib/*.o demo/demo.o test ltmtest mpitest mtest/mtest mtest/mtest.exe \
+ *.idx *.toc *.log *.aux *.dvi *.lof *.ind *.ilg *.ps *.log *.s mpi.c *.da *.dyn *.dpi tommath.tex `find . -type f | grep [~] | xargs` *.lo *.la
+ rm -rf .libs/
+ cd etc ; MAKE=${MAKE} ${MAKE} clean
+ cd pics ; MAKE=${MAKE} ${MAKE} clean
diff --git a/libtommath/makefile.msvc b/libtommath/makefile.msvc
index 5edebec..a47aadd 100644
--- a/libtommath/makefile.msvc
+++ b/libtommath/makefile.msvc
@@ -6,33 +6,33 @@ CFLAGS = /I. /Ox /DWIN32 /W3 /Fo$@
default: library
-OBJECTS=bncore.obj bn_mp_init.obj bn_mp_clear.obj bn_mp_exch.obj bn_mp_grow.obj bn_mp_shrink.obj \
-bn_mp_clamp.obj bn_mp_zero.obj bn_mp_set.obj bn_mp_set_int.obj bn_mp_init_size.obj bn_mp_copy.obj \
-bn_mp_init_copy.obj bn_mp_abs.obj bn_mp_neg.obj bn_mp_cmp_mag.obj bn_mp_cmp.obj bn_mp_cmp_d.obj \
-bn_mp_rshd.obj bn_mp_lshd.obj bn_mp_mod_2d.obj bn_mp_div_2d.obj bn_mp_mul_2d.obj bn_mp_div_2.obj \
-bn_mp_mul_2.obj bn_s_mp_add.obj bn_s_mp_sub.obj bn_fast_s_mp_mul_digs.obj bn_s_mp_mul_digs.obj \
-bn_fast_s_mp_mul_high_digs.obj bn_s_mp_mul_high_digs.obj bn_fast_s_mp_sqr.obj bn_s_mp_sqr.obj \
-bn_mp_add.obj bn_mp_sub.obj bn_mp_karatsuba_mul.obj bn_mp_mul.obj bn_mp_karatsuba_sqr.obj \
-bn_mp_sqr.obj bn_mp_div.obj bn_mp_mod.obj bn_mp_add_d.obj bn_mp_sub_d.obj bn_mp_mul_d.obj \
-bn_mp_div_d.obj bn_mp_mod_d.obj bn_mp_expt_d.obj bn_mp_addmod.obj bn_mp_submod.obj \
-bn_mp_mulmod.obj bn_mp_sqrmod.obj bn_mp_gcd.obj bn_mp_lcm.obj bn_fast_mp_invmod.obj bn_mp_invmod.obj \
-bn_mp_reduce.obj bn_mp_montgomery_setup.obj bn_fast_mp_montgomery_reduce.obj bn_mp_montgomery_reduce.obj \
-bn_mp_exptmod_fast.obj bn_mp_exptmod.obj bn_mp_2expt.obj bn_mp_n_root.obj bn_mp_jacobi.obj bn_reverse.obj \
-bn_mp_count_bits.obj bn_mp_read_unsigned_bin.obj bn_mp_read_signed_bin.obj bn_mp_to_unsigned_bin.obj \
-bn_mp_to_signed_bin.obj bn_mp_unsigned_bin_size.obj bn_mp_signed_bin_size.obj \
-bn_mp_xor.obj bn_mp_and.obj bn_mp_or.obj bn_mp_rand.obj bn_mp_montgomery_calc_normalization.obj \
-bn_mp_prime_is_divisible.obj bn_prime_tab.obj bn_mp_prime_fermat.obj bn_mp_prime_miller_rabin.obj \
-bn_mp_prime_is_prime.obj bn_mp_prime_next_prime.obj bn_mp_dr_reduce.obj \
-bn_mp_dr_is_modulus.obj bn_mp_dr_setup.obj bn_mp_reduce_setup.obj \
-bn_mp_toom_mul.obj bn_mp_toom_sqr.obj bn_mp_div_3.obj bn_s_mp_exptmod.obj \
-bn_mp_reduce_2k.obj bn_mp_reduce_is_2k.obj bn_mp_reduce_2k_setup.obj \
-bn_mp_reduce_2k_l.obj bn_mp_reduce_is_2k_l.obj bn_mp_reduce_2k_setup_l.obj \
-bn_mp_radix_smap.obj bn_mp_read_radix.obj bn_mp_toradix.obj bn_mp_radix_size.obj \
-bn_mp_fread.obj bn_mp_fwrite.obj bn_mp_cnt_lsb.obj bn_error.obj \
-bn_mp_init_multi.obj bn_mp_clear_multi.obj bn_mp_exteuclid.obj bn_mp_toradix_n.obj \
-bn_mp_prime_random_ex.obj bn_mp_get_int.obj bn_mp_sqrt.obj bn_mp_is_square.obj \
-bn_mp_init_set.obj bn_mp_init_set_int.obj bn_mp_invmod_slow.obj bn_mp_prime_rabin_miller_trials.obj \
-bn_mp_to_signed_bin_n.obj bn_mp_to_unsigned_bin_n.obj
+#START_INS
+OBJECTS=bncore.obj bn_error.obj bn_fast_mp_invmod.obj bn_fast_mp_montgomery_reduce.obj bn_fast_s_mp_mul_digs.obj \
+bn_fast_s_mp_mul_high_digs.obj bn_fast_s_mp_sqr.obj bn_mp_2expt.obj bn_mp_abs.obj bn_mp_add.obj bn_mp_add_d.obj \
+bn_mp_addmod.obj bn_mp_and.obj bn_mp_clamp.obj bn_mp_clear.obj bn_mp_clear_multi.obj bn_mp_cmp.obj bn_mp_cmp_d.obj \
+bn_mp_cmp_mag.obj bn_mp_cnt_lsb.obj bn_mp_copy.obj bn_mp_count_bits.obj bn_mp_div_2.obj bn_mp_div_2d.obj bn_mp_div_3.obj \
+bn_mp_div.obj bn_mp_div_d.obj bn_mp_dr_is_modulus.obj bn_mp_dr_reduce.obj bn_mp_dr_setup.obj bn_mp_exch.obj \
+bn_mp_export.obj bn_mp_expt_d.obj bn_mp_expt_d_ex.obj bn_mp_exptmod.obj bn_mp_exptmod_fast.obj bn_mp_exteuclid.obj \
+bn_mp_fread.obj bn_mp_fwrite.obj bn_mp_gcd.obj bn_mp_get_int.obj bn_mp_get_long.obj bn_mp_get_long_long.obj \
+bn_mp_grow.obj bn_mp_import.obj bn_mp_init.obj bn_mp_init_copy.obj bn_mp_init_multi.obj bn_mp_init_set.obj \
+bn_mp_init_set_int.obj bn_mp_init_size.obj bn_mp_invmod.obj bn_mp_invmod_slow.obj bn_mp_is_square.obj \
+bn_mp_jacobi.obj bn_mp_karatsuba_mul.obj bn_mp_karatsuba_sqr.obj bn_mp_lcm.obj bn_mp_lshd.obj bn_mp_mod_2d.obj \
+bn_mp_mod.obj bn_mp_mod_d.obj bn_mp_montgomery_calc_normalization.obj bn_mp_montgomery_reduce.obj \
+bn_mp_montgomery_setup.obj bn_mp_mul_2.obj bn_mp_mul_2d.obj bn_mp_mul.obj bn_mp_mul_d.obj bn_mp_mulmod.obj bn_mp_neg.obj \
+bn_mp_n_root.obj bn_mp_n_root_ex.obj bn_mp_or.obj bn_mp_prime_fermat.obj bn_mp_prime_is_divisible.obj \
+bn_mp_prime_is_prime.obj bn_mp_prime_miller_rabin.obj bn_mp_prime_next_prime.obj \
+bn_mp_prime_rabin_miller_trials.obj bn_mp_prime_random_ex.obj bn_mp_radix_size.obj bn_mp_radix_smap.obj \
+bn_mp_rand.obj bn_mp_read_radix.obj bn_mp_read_signed_bin.obj bn_mp_read_unsigned_bin.obj bn_mp_reduce_2k.obj \
+bn_mp_reduce_2k_l.obj bn_mp_reduce_2k_setup.obj bn_mp_reduce_2k_setup_l.obj bn_mp_reduce.obj \
+bn_mp_reduce_is_2k.obj bn_mp_reduce_is_2k_l.obj bn_mp_reduce_setup.obj bn_mp_rshd.obj bn_mp_set.obj bn_mp_set_int.obj \
+bn_mp_set_long.obj bn_mp_set_long_long.obj bn_mp_shrink.obj bn_mp_signed_bin_size.obj bn_mp_sqr.obj bn_mp_sqrmod.obj \
+bn_mp_sqrt.obj bn_mp_sqrtmod_prime.obj bn_mp_sub.obj bn_mp_sub_d.obj bn_mp_submod.obj bn_mp_toom_mul.obj \
+bn_mp_toom_sqr.obj bn_mp_toradix.obj bn_mp_toradix_n.obj bn_mp_to_signed_bin.obj bn_mp_to_signed_bin_n.obj \
+bn_mp_to_unsigned_bin.obj bn_mp_to_unsigned_bin_n.obj bn_mp_unsigned_bin_size.obj bn_mp_xor.obj bn_mp_zero.obj \
+bn_prime_tab.obj bn_reverse.obj bn_s_mp_add.obj bn_s_mp_exptmod.obj bn_s_mp_mul_digs.obj bn_s_mp_mul_high_digs.obj \
+bn_s_mp_sqr.obj bn_s_mp_sub.obj
+
+#END_INS
HEADERS=tommath.h tommath_class.h tommath_superclass.h
diff --git a/libtommath/makefile.shared b/libtommath/makefile.shared
index e230fb8..559720e 100644
--- a/libtommath/makefile.shared
+++ b/libtommath/makefile.shared
@@ -1,102 +1,71 @@
#Makefile for GCC
#
#Tom St Denis
-VERSION=0:40
-
-CC = libtool --mode=compile --tag=CC gcc
-
-CFLAGS += -I./ -Wall -W -Wshadow -Wsign-compare
-
-ifndef IGNORE_SPEED
-
-#for speed
-CFLAGS += -O3 -funroll-loops
-
-#for size
-#CFLAGS += -Os
-
-#x86 optimizations [should be valid for any GCC install though]
-CFLAGS += -fomit-frame-pointer
-
-endif
-
-#install as this user
-ifndef INSTALL_GROUP
- GROUP=wheel
-else
- GROUP=$(INSTALL_GROUP)
-endif
-
-ifndef INSTALL_USER
- USER=root
-else
- USER=$(INSTALL_USER)
-endif
-
-default: libtommath.la
#default files to install
ifndef LIBNAME
LIBNAME=libtommath.la
endif
-ifndef LIBNAME_S
- LIBNAME_S=libtommath.a
-endif
-HEADERS=tommath.h tommath_class.h tommath_superclass.h
-
-#LIBPATH-The directory for libtommath to be installed to.
-#INCPATH-The directory to install the header files for libtommath.
-#DATAPATH-The directory to install the pdf docs.
-DESTDIR=
-LIBPATH=/usr/lib
-INCPATH=/usr/include
-DATAPATH=/usr/share/doc/libtommath/pdf
-OBJECTS=bncore.o bn_mp_init.o bn_mp_clear.o bn_mp_exch.o bn_mp_grow.o bn_mp_shrink.o \
-bn_mp_clamp.o bn_mp_zero.o bn_mp_set.o bn_mp_set_int.o bn_mp_init_size.o bn_mp_copy.o \
-bn_mp_init_copy.o bn_mp_abs.o bn_mp_neg.o bn_mp_cmp_mag.o bn_mp_cmp.o bn_mp_cmp_d.o \
-bn_mp_rshd.o bn_mp_lshd.o bn_mp_mod_2d.o bn_mp_div_2d.o bn_mp_mul_2d.o bn_mp_div_2.o \
-bn_mp_mul_2.o bn_s_mp_add.o bn_s_mp_sub.o bn_fast_s_mp_mul_digs.o bn_s_mp_mul_digs.o \
-bn_fast_s_mp_mul_high_digs.o bn_s_mp_mul_high_digs.o bn_fast_s_mp_sqr.o bn_s_mp_sqr.o \
-bn_mp_add.o bn_mp_sub.o bn_mp_karatsuba_mul.o bn_mp_mul.o bn_mp_karatsuba_sqr.o \
-bn_mp_sqr.o bn_mp_div.o bn_mp_mod.o bn_mp_add_d.o bn_mp_sub_d.o bn_mp_mul_d.o \
-bn_mp_div_d.o bn_mp_mod_d.o bn_mp_expt_d.o bn_mp_addmod.o bn_mp_submod.o \
-bn_mp_mulmod.o bn_mp_sqrmod.o bn_mp_gcd.o bn_mp_lcm.o bn_fast_mp_invmod.o bn_mp_invmod.o \
-bn_mp_reduce.o bn_mp_montgomery_setup.o bn_fast_mp_montgomery_reduce.o bn_mp_montgomery_reduce.o \
-bn_mp_exptmod_fast.o bn_mp_exptmod.o bn_mp_2expt.o bn_mp_n_root.o bn_mp_jacobi.o bn_reverse.o \
-bn_mp_count_bits.o bn_mp_read_unsigned_bin.o bn_mp_read_signed_bin.o bn_mp_to_unsigned_bin.o \
-bn_mp_to_signed_bin.o bn_mp_unsigned_bin_size.o bn_mp_signed_bin_size.o \
-bn_mp_xor.o bn_mp_and.o bn_mp_or.o bn_mp_rand.o bn_mp_montgomery_calc_normalization.o \
-bn_mp_prime_is_divisible.o bn_prime_tab.o bn_mp_prime_fermat.o bn_mp_prime_miller_rabin.o \
-bn_mp_prime_is_prime.o bn_mp_prime_next_prime.o bn_mp_dr_reduce.o \
-bn_mp_dr_is_modulus.o bn_mp_dr_setup.o bn_mp_reduce_setup.o \
-bn_mp_toom_mul.o bn_mp_toom_sqr.o bn_mp_div_3.o bn_s_mp_exptmod.o \
-bn_mp_reduce_2k.o bn_mp_reduce_is_2k.o bn_mp_reduce_2k_setup.o \
-bn_mp_reduce_2k_l.o bn_mp_reduce_is_2k_l.o bn_mp_reduce_2k_setup_l.o \
-bn_mp_radix_smap.o bn_mp_read_radix.o bn_mp_toradix.o bn_mp_radix_size.o \
-bn_mp_fread.o bn_mp_fwrite.o bn_mp_cnt_lsb.o bn_error.o \
-bn_mp_init_multi.o bn_mp_clear_multi.o bn_mp_exteuclid.o bn_mp_toradix_n.o \
-bn_mp_prime_random_ex.o bn_mp_get_int.o bn_mp_sqrt.o bn_mp_is_square.o bn_mp_init_set.o \
-bn_mp_init_set_int.o bn_mp_invmod_slow.o bn_mp_prime_rabin_miller_trials.o \
-bn_mp_to_signed_bin_n.o bn_mp_to_unsigned_bin_n.o
+include makefile.include
+
+LT ?= libtool
+LTCOMPILE = $(LT) --mode=compile --tag=CC $(CC)
+
+LCOV_ARGS=--directory .libs --directory .
+
+#START_INS
+OBJECTS=bncore.o bn_error.o bn_fast_mp_invmod.o bn_fast_mp_montgomery_reduce.o bn_fast_s_mp_mul_digs.o \
+bn_fast_s_mp_mul_high_digs.o bn_fast_s_mp_sqr.o bn_mp_2expt.o bn_mp_abs.o bn_mp_add.o bn_mp_add_d.o \
+bn_mp_addmod.o bn_mp_and.o bn_mp_clamp.o bn_mp_clear.o bn_mp_clear_multi.o bn_mp_cmp.o bn_mp_cmp_d.o \
+bn_mp_cmp_mag.o bn_mp_cnt_lsb.o bn_mp_copy.o bn_mp_count_bits.o bn_mp_div_2.o bn_mp_div_2d.o bn_mp_div_3.o \
+bn_mp_div.o bn_mp_div_d.o bn_mp_dr_is_modulus.o bn_mp_dr_reduce.o bn_mp_dr_setup.o bn_mp_exch.o \
+bn_mp_export.o bn_mp_expt_d.o bn_mp_expt_d_ex.o bn_mp_exptmod.o bn_mp_exptmod_fast.o bn_mp_exteuclid.o \
+bn_mp_fread.o bn_mp_fwrite.o bn_mp_gcd.o bn_mp_get_int.o bn_mp_get_long.o bn_mp_get_long_long.o \
+bn_mp_grow.o bn_mp_import.o bn_mp_init.o bn_mp_init_copy.o bn_mp_init_multi.o bn_mp_init_set.o \
+bn_mp_init_set_int.o bn_mp_init_size.o bn_mp_invmod.o bn_mp_invmod_slow.o bn_mp_is_square.o \
+bn_mp_jacobi.o bn_mp_karatsuba_mul.o bn_mp_karatsuba_sqr.o bn_mp_lcm.o bn_mp_lshd.o bn_mp_mod_2d.o \
+bn_mp_mod.o bn_mp_mod_d.o bn_mp_montgomery_calc_normalization.o bn_mp_montgomery_reduce.o \
+bn_mp_montgomery_setup.o bn_mp_mul_2.o bn_mp_mul_2d.o bn_mp_mul.o bn_mp_mul_d.o bn_mp_mulmod.o bn_mp_neg.o \
+bn_mp_n_root.o bn_mp_n_root_ex.o bn_mp_or.o bn_mp_prime_fermat.o bn_mp_prime_is_divisible.o \
+bn_mp_prime_is_prime.o bn_mp_prime_miller_rabin.o bn_mp_prime_next_prime.o \
+bn_mp_prime_rabin_miller_trials.o bn_mp_prime_random_ex.o bn_mp_radix_size.o bn_mp_radix_smap.o \
+bn_mp_rand.o bn_mp_read_radix.o bn_mp_read_signed_bin.o bn_mp_read_unsigned_bin.o bn_mp_reduce_2k.o \
+bn_mp_reduce_2k_l.o bn_mp_reduce_2k_setup.o bn_mp_reduce_2k_setup_l.o bn_mp_reduce.o \
+bn_mp_reduce_is_2k.o bn_mp_reduce_is_2k_l.o bn_mp_reduce_setup.o bn_mp_rshd.o bn_mp_set.o bn_mp_set_int.o \
+bn_mp_set_long.o bn_mp_set_long_long.o bn_mp_shrink.o bn_mp_signed_bin_size.o bn_mp_sqr.o bn_mp_sqrmod.o \
+bn_mp_sqrt.o bn_mp_sqrtmod_prime.o bn_mp_sub.o bn_mp_sub_d.o bn_mp_submod.o bn_mp_toom_mul.o \
+bn_mp_toom_sqr.o bn_mp_toradix.o bn_mp_toradix_n.o bn_mp_to_signed_bin.o bn_mp_to_signed_bin_n.o \
+bn_mp_to_unsigned_bin.o bn_mp_to_unsigned_bin_n.o bn_mp_unsigned_bin_size.o bn_mp_xor.o bn_mp_zero.o \
+bn_prime_tab.o bn_reverse.o bn_s_mp_add.o bn_s_mp_exptmod.o bn_s_mp_mul_digs.o bn_s_mp_mul_high_digs.o \
+bn_s_mp_sqr.o bn_s_mp_sub.o
+
+#END_INS
objs: $(OBJECTS)
+.c.o:
+ $(LTCOMPILE) $(CFLAGS) $(LDFLAGS) -o $@ -c $<
+
$(LIBNAME): $(OBJECTS)
- libtool --mode=link gcc *.lo -o $(LIBNAME) -rpath $(LIBPATH) -version-info $(VERSION)
+ $(LT) --mode=link --tag=CC $(CC) $(LDFLAGS) *.lo -o $(LIBNAME) -rpath $(LIBPATH) -version-info $(VERSION_SO)
install: $(LIBNAME)
- install -d -g $(GROUP) -o $(USER) $(DESTDIR)$(LIBPATH)
- libtool --mode=install install -c $(LIBNAME) $(DESTDIR)$(LIBPATH)/$(LIBNAME)
- install -d -g $(GROUP) -o $(USER) $(DESTDIR)$(INCPATH)
- install -g $(GROUP) -o $(USER) $(HEADERS) $(DESTDIR)$(INCPATH)
+ install -d $(DESTDIR)$(LIBPATH)
+ install -d $(DESTDIR)$(INCPATH)
+ $(LT) --mode=install install -c $(LIBNAME) $(DESTDIR)$(LIBPATH)/$(LIBNAME)
+ install -m 644 $(HEADERS_PUB) $(DESTDIR)$(INCPATH)
test: $(LIBNAME) demo/demo.o
- gcc $(CFLAGS) -c demo/demo.c -o demo/demo.o
- libtool --mode=link gcc -o test demo/demo.o $(LIBNAME_S)
-
-mtest: test
- cd mtest ; gcc $(CFLAGS) mtest.c -o mtest
-
+ $(CC) $(CFLAGS) -c demo/demo.c -o demo/demo.o
+ $(LT) --mode=link $(CC) $(LDFLAGS) -o test demo/demo.o $(LIBNAME)
+
+test_standalone: $(LIBNAME) demo/demo.o
+ $(CC) $(CFLAGS) -c demo/demo.c -o demo/demo.o
+ $(LT) --mode=link $(CC) $(LDFLAGS) -o test demo/demo.o $(LIBNAME)
+
+mtest:
+ cd mtest ; $(CC) $(CFLAGS) $(LDFLAGS) mtest.c -o mtest
+
timing: $(LIBNAME)
- gcc $(CFLAGS) -DTIMER demo/timing.c $(LIBNAME_S) -o ltmtest
+ $(LT) --mode=link $(CC) $(CFLAGS) $(LDFLAGS) -DTIMER demo/timing.c $(LIBNAME) -o ltmtest
diff --git a/libtommath/mtest/logtab.h b/libtommath/mtest/logtab.h
index bbefaef..751111e 100644
--- a/libtommath/mtest/logtab.h
+++ b/libtommath/mtest/logtab.h
@@ -19,6 +19,6 @@ const float s_logv_2[] = {
};
-/* $Source: /cvs/libtom/libtommath/mtest/logtab.h,v $ */
-/* $Revision: 1.2 $ */
-/* $Date: 2005/05/05 14:38:47 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtommath/mtest/mpi-config.h b/libtommath/mtest/mpi-config.h
index 6049c25..fc2a885 100644
--- a/libtommath/mtest/mpi-config.h
+++ b/libtommath/mtest/mpi-config.h
@@ -1,5 +1,5 @@
/* Default configuration for MPI library */
-/* $Id: mpi-config.h,v 1.2 2005/05/05 14:38:47 tom Exp $ */
+/* $Id$ */
#ifndef MPI_CONFIG_H_
#define MPI_CONFIG_H_
@@ -85,6 +85,6 @@
/* crc==3287762869, version==2, Sat Feb 02 06:43:53 2002 */
-/* $Source: /cvs/libtom/libtommath/mtest/mpi-config.h,v $ */
-/* $Revision: 1.2 $ */
-/* $Date: 2005/05/05 14:38:47 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtommath/mtest/mpi-types.h b/libtommath/mtest/mpi-types.h
index 026de58..f99d7ee 100644
--- a/libtommath/mtest/mpi-types.h
+++ b/libtommath/mtest/mpi-types.h
@@ -15,6 +15,6 @@ typedef int mp_err;
#define RADIX (MP_DIGIT_MAX+1)
-/* $Source: /cvs/libtom/libtommath/mtest/mpi-types.h,v $ */
-/* $Revision: 1.2 $ */
-/* $Date: 2005/05/05 14:38:47 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtommath/mtest/mpi.c b/libtommath/mtest/mpi.c
index 7c712dd..48dbe27 100644
--- a/libtommath/mtest/mpi.c
+++ b/libtommath/mtest/mpi.c
@@ -6,7 +6,7 @@
Arbitrary precision integer arithmetic library
- $Id: mpi.c,v 1.2 2005/05/05 14:38:47 tom Exp $
+ $Id$
*/
#include "mpi.h"
@@ -22,7 +22,7 @@
#define DIAG(T,V)
#endif
-/*
+/*
If MP_LOGTAB is not defined, use the math library to compute the
logarithms on the fly. Otherwise, use the static table below.
Pick which works best for your system.
@@ -33,7 +33,7 @@
/*
A table of the logs of 2 for various bases (the 0 and 1 entries of
- this table are meaningless and should not be referenced).
+ this table are meaningless and should not be referenced).
This table is used to compute output lengths for the mp_toradix()
function. Since a number n in radix r takes up about log_r(n)
@@ -43,7 +43,7 @@
log_r(n) = log_2(n) * log_r(2)
This table, therefore, is a table of log_r(2) for 2 <= r <= 36,
- which are the output bases supported.
+ which are the output bases supported.
*/
#include "logtab.h"
@@ -104,7 +104,7 @@ static const char *mp_err_string[] = {
/* Value to digit maps for radix conversion */
/* s_dmap_1 - standard digits and letters */
-static const char *s_dmap_1 =
+static const char *s_dmap_1 =
"0123456789ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz+/";
#if 0
@@ -117,7 +117,7 @@ static const char *s_dmap_2 =
/* {{{ Static function declarations */
-/*
+/*
If MP_MACRO is false, these will be defined as actual functions;
otherwise, suitable macro definitions will be used. This works
around the fact that ANSI C89 doesn't support an 'inline' keyword
@@ -258,7 +258,7 @@ mp_err mp_init_array(mp_int mp[], int count)
return MP_OKAY;
CLEANUP:
- while(--pos >= 0)
+ while(--pos >= 0)
mp_clear(&mp[pos]);
return res;
@@ -355,7 +355,7 @@ mp_err mp_copy(mp_int *from, mp_int *to)
if(ALLOC(to) >= USED(from)) {
s_mp_setz(DIGITS(to) + USED(from), ALLOC(to) - USED(from));
s_mp_copy(DIGITS(from), DIGITS(to), USED(from));
-
+
} else {
if((tmp = s_mp_alloc(USED(from), sizeof(mp_digit))) == NULL)
return MP_MEM;
@@ -445,7 +445,7 @@ void mp_clear_array(mp_int mp[], int count)
{
ARGCHK(mp != NULL && count > 0, MP_BADARG);
- while(--count >= 0)
+ while(--count >= 0)
mp_clear(&mp[count]);
} /* end mp_clear_array() */
@@ -455,7 +455,7 @@ void mp_clear_array(mp_int mp[], int count)
/* {{{ mp_zero(mp) */
/*
- mp_zero(mp)
+ mp_zero(mp)
Set mp to zero. Does not change the allocated size of the structure,
and therefore cannot fail (except on a bad argument, which we ignore)
@@ -506,7 +506,7 @@ mp_err mp_set_int(mp_int *mp, long z)
if((res = s_mp_mul_2d(mp, CHAR_BIT)) != MP_OKAY)
return res;
- res = s_mp_add_d(mp,
+ res = s_mp_add_d(mp,
(mp_digit)((v >> (ix * CHAR_BIT)) & UCHAR_MAX));
if(res != MP_OKAY)
return res;
@@ -841,9 +841,9 @@ mp_err mp_neg(mp_int *a, mp_int *b)
if((res = mp_copy(a, b)) != MP_OKAY)
return res;
- if(s_mp_cmp_d(b, 0) == MP_EQ)
+ if(s_mp_cmp_d(b, 0) == MP_EQ)
SIGN(b) = MP_ZPOS;
- else
+ else
SIGN(b) = (SIGN(b) == MP_NEG) ? MP_ZPOS : MP_NEG;
return MP_OKAY;
@@ -870,7 +870,7 @@ mp_err mp_add(mp_int *a, mp_int *b, mp_int *c)
if(SIGN(a) == SIGN(b)) { /* same sign: add values, keep sign */
/* Commutativity of addition lets us do this in either order,
- so we avoid having to use a temporary even if the result
+ so we avoid having to use a temporary even if the result
is supposed to replace the output
*/
if(c == b) {
@@ -880,14 +880,14 @@ mp_err mp_add(mp_int *a, mp_int *b, mp_int *c)
if(c != a && (res = mp_copy(a, c)) != MP_OKAY)
return res;
- if((res = s_mp_add(c, b)) != MP_OKAY)
+ if((res = s_mp_add(c, b)) != MP_OKAY)
return res;
}
} else if((cmp = s_mp_cmp(a, b)) > 0) { /* different sign: a > b */
/* If the output is going to be clobbered, we will use a temporary
- variable; otherwise, we'll do it without touching the memory
+ variable; otherwise, we'll do it without touching the memory
allocator at all, if possible
*/
if(c == b) {
@@ -1019,7 +1019,7 @@ mp_err mp_sub(mp_int *a, mp_int *b, mp_int *c)
mp_clear(&tmp);
} else {
- if(c != b && ((res = mp_copy(b, c)) != MP_OKAY))
+ if(c != b && ((res = mp_copy(b, c)) != MP_OKAY))
return res;
if((res = s_mp_sub(c, a)) != MP_OKAY)
@@ -1066,12 +1066,12 @@ mp_err mp_mul(mp_int *a, mp_int *b, mp_int *c)
if((res = s_mp_mul(c, b)) != MP_OKAY)
return res;
}
-
+
if(sgn == MP_ZPOS || s_mp_cmp_d(c, 0) == MP_EQ)
SIGN(c) = MP_ZPOS;
else
SIGN(c) = sgn;
-
+
return MP_OKAY;
} /* end mp_mul() */
@@ -1160,7 +1160,7 @@ mp_err mp_div(mp_int *a, mp_int *b, mp_int *q, mp_int *r)
return res;
}
- if(q)
+ if(q)
mp_zero(q);
return MP_OKAY;
@@ -1206,10 +1206,10 @@ mp_err mp_div(mp_int *a, mp_int *b, mp_int *q, mp_int *r)
SIGN(&rtmp) = MP_ZPOS;
/* Copy output, if it is needed */
- if(q)
+ if(q)
s_mp_exch(&qtmp, q);
- if(r)
+ if(r)
s_mp_exch(&rtmp, r);
CLEANUP:
@@ -1264,7 +1264,7 @@ mp_err mp_expt(mp_int *a, mp_int *b, mp_int *c)
mp_int s, x;
mp_err res;
mp_digit d;
- int dig, bit;
+ unsigned int bit, dig;
ARGCHK(a != NULL && b != NULL && c != NULL, MP_BADARG);
@@ -1286,12 +1286,12 @@ mp_err mp_expt(mp_int *a, mp_int *b, mp_int *c)
/* Loop over bits of each non-maximal digit */
for(bit = 0; bit < DIGIT_BIT; bit++) {
if(d & 1) {
- if((res = s_mp_mul(&s, &x)) != MP_OKAY)
+ if((res = s_mp_mul(&s, &x)) != MP_OKAY)
goto CLEANUP;
}
d >>= 1;
-
+
if((res = s_mp_sqr(&x)) != MP_OKAY)
goto CLEANUP;
}
@@ -1311,7 +1311,7 @@ mp_err mp_expt(mp_int *a, mp_int *b, mp_int *c)
if((res = s_mp_sqr(&x)) != MP_OKAY)
goto CLEANUP;
}
-
+
if(mp_iseven(b))
SIGN(&s) = SIGN(a);
@@ -1362,7 +1362,7 @@ mp_err mp_mod(mp_int *a, mp_int *m, mp_int *c)
/*
If |a| > m, we need to divide to get the remainder and take the
- absolute value.
+ absolute value.
If |a| < m, we don't need to do any division, just copy and adjust
the sign (if a is negative).
@@ -1376,7 +1376,7 @@ mp_err mp_mod(mp_int *a, mp_int *m, mp_int *c)
if((mag = s_mp_cmp(a, m)) > 0) {
if((res = mp_div(a, m, NULL, c)) != MP_OKAY)
return res;
-
+
if(SIGN(c) == MP_NEG) {
if((res = mp_add(c, m, c)) != MP_OKAY)
return res;
@@ -1391,7 +1391,7 @@ mp_err mp_mod(mp_int *a, mp_int *m, mp_int *c)
return res;
}
-
+
} else {
mp_zero(c);
@@ -1464,9 +1464,9 @@ mp_err mp_sqrt(mp_int *a, mp_int *b)
return MP_RANGE;
/* Special cases for zero and one, trivial */
- if(mp_cmp_d(a, 0) == MP_EQ || mp_cmp_d(a, 1) == MP_EQ)
+ if(mp_cmp_d(a, 0) == MP_EQ || mp_cmp_d(a, 1) == MP_EQ)
return mp_copy(a, b);
-
+
/* Initialize the temporaries we'll use below */
if((res = mp_init_size(&t, USED(a))) != MP_OKAY)
return res;
@@ -1508,7 +1508,7 @@ mp_add_d(&x, 1, &x);
CLEANUP:
mp_clear(&x);
X:
- mp_clear(&t);
+ mp_clear(&t);
return res;
@@ -1626,7 +1626,7 @@ mp_err mp_sqrmod(mp_int *a, mp_int *m, mp_int *c)
Compute c = (a ** b) mod m. Uses a standard square-and-multiply
method with modular reductions at each step. (This is basically the
same code as mp_expt(), except for the addition of the reductions)
-
+
The modular reductions are done using Barrett's algorithm (see
s_mp_reduce() below for details)
*/
@@ -1637,7 +1637,7 @@ mp_err mp_exptmod(mp_int *a, mp_int *b, mp_int *m, mp_int *c)
mp_err res;
mp_digit d, *db = DIGITS(b);
mp_size ub = USED(b);
- int dig, bit;
+ unsigned int bit, dig;
ARGCHK(a != NULL && b != NULL && c != NULL, MP_BADARG);
@@ -1655,7 +1655,7 @@ mp_err mp_exptmod(mp_int *a, mp_int *b, mp_int *m, mp_int *c)
mp_set(&s, 1);
/* mu = b^2k / m */
- s_mp_add_d(&mu, 1);
+ s_mp_add_d(&mu, 1);
s_mp_lshd(&mu, 2 * USED(m));
if((res = mp_div(&mu, m, &mu, NULL)) != MP_OKAY)
goto CLEANUP;
@@ -1866,7 +1866,7 @@ int mp_cmp_int(mp_int *a, long z)
int out;
ARGCHK(a != NULL, MP_EQ);
-
+
mp_init(&tmp); mp_set_int(&tmp, z);
out = mp_cmp(a, &tmp);
mp_clear(&tmp);
@@ -1953,13 +1953,13 @@ mp_err mp_gcd(mp_int *a, mp_int *b, mp_int *c)
if(mp_isodd(&u)) {
if((res = mp_copy(&v, &t)) != MP_OKAY)
goto CLEANUP;
-
+
/* t = -v */
if(SIGN(&v) == MP_ZPOS)
SIGN(&t) = MP_NEG;
else
SIGN(&t) = MP_ZPOS;
-
+
} else {
if((res = mp_copy(&u, &t)) != MP_OKAY)
goto CLEANUP;
@@ -2152,7 +2152,7 @@ mp_err mp_xgcd(mp_int *a, mp_int *b, mp_int *g, mp_int *x, mp_int *y)
if(y)
if((res = mp_copy(&D, y)) != MP_OKAY) goto CLEANUP;
-
+
if(g)
if((res = mp_mul(&gx, &v, g)) != MP_OKAY) goto CLEANUP;
@@ -2255,7 +2255,7 @@ void mp_print(mp_int *mp, FILE *ofp)
/* {{{ mp_read_signed_bin(mp, str, len) */
-/*
+/*
mp_read_signed_bin(mp, str, len)
Read in a raw value (base 256) into the given mp_int
@@ -2332,16 +2332,16 @@ mp_err mp_read_unsigned_bin(mp_int *mp, unsigned char *str, int len)
if((res = mp_add_d(mp, str[ix], mp)) != MP_OKAY)
return res;
}
-
+
return MP_OKAY;
-
+
} /* end mp_read_unsigned_bin() */
/* }}} */
/* {{{ mp_unsigned_bin_size(mp) */
-int mp_unsigned_bin_size(mp_int *mp)
+int mp_unsigned_bin_size(mp_int *mp)
{
mp_digit topdig;
int count;
@@ -2387,7 +2387,7 @@ mp_err mp_to_unsigned_bin(mp_int *mp, unsigned char *str)
/* Generate digits in reverse order */
while(dp < end) {
- int ix;
+ unsigned int ix;
d = *dp;
for(ix = 0; ix < sizeof(mp_digit); ++ix) {
@@ -2440,7 +2440,7 @@ int mp_count_bits(mp_int *mp)
}
return len;
-
+
} /* end mp_count_bits() */
/* }}} */
@@ -2462,14 +2462,14 @@ mp_err mp_read_radix(mp_int *mp, unsigned char *str, int radix)
mp_err res;
mp_sign sig = MP_ZPOS;
- ARGCHK(mp != NULL && str != NULL && radix >= 2 && radix <= MAX_RADIX,
+ ARGCHK(mp != NULL && str != NULL && radix >= 2 && radix <= MAX_RADIX,
MP_BADARG);
mp_zero(mp);
/* Skip leading non-digit characters until a digit or '-' or '+' */
- while(str[ix] &&
- (s_mp_tovalue(str[ix], radix) < 0) &&
+ while(str[ix] &&
+ (s_mp_tovalue(str[ix], radix) < 0) &&
str[ix] != '-' &&
str[ix] != '+') {
++ix;
@@ -2525,7 +2525,7 @@ int mp_radix_size(mp_int *mp, int radix)
/* num = number of digits
qty = number of bits per digit
radix = target base
-
+
Return the number of digits in the specified radix that would be
needed to express 'num' digits of 'qty' bits each.
*/
@@ -2541,7 +2541,7 @@ int mp_value_radix_size(int num, int qty, int radix)
/* {{{ mp_toradix(mp, str, radix) */
-mp_err mp_toradix(mp_int *mp, unsigned char *str, int radix)
+mp_err mp_toradix(mp_int *mp, char *str, int radix)
{
int ix, pos = 0;
@@ -2587,14 +2587,14 @@ mp_err mp_toradix(mp_int *mp, unsigned char *str, int radix)
/* Reverse the digits and sign indicator */
ix = 0;
while(ix < pos) {
- char tmp = str[ix];
+ char _tmp = str[ix];
str[ix] = str[pos];
- str[pos] = tmp;
+ str[pos] = _tmp;
++ix;
--pos;
}
-
+
mp_clear(&tmp);
}
@@ -2806,18 +2806,18 @@ void s_mp_exch(mp_int *a, mp_int *b)
/* {{{ s_mp_lshd(mp, p) */
-/*
+/*
Shift mp leftward by p digits, growing if needed, and zero-filling
the in-shifted digits at the right end. This is a convenient
alternative to multiplication by powers of the radix
- */
+ */
mp_err s_mp_lshd(mp_int *mp, mp_size p)
{
mp_err res;
mp_size pos;
mp_digit *dp;
- int ix;
+ int ix;
if(p == 0)
return MP_OKAY;
@@ -2829,11 +2829,11 @@ mp_err s_mp_lshd(mp_int *mp, mp_size p)
dp = DIGITS(mp);
/* Shift all the significant figures over as needed */
- for(ix = pos - p; ix >= 0; ix--)
+ for(ix = pos - p; ix >= 0; ix--)
dp[ix + p] = dp[ix];
/* Fill the bottom digits with zeroes */
- for(ix = 0; ix < p; ix++)
+ for(ix = 0; (unsigned)ix < p; ix++)
dp[ix] = 0;
return MP_OKAY;
@@ -2844,7 +2844,7 @@ mp_err s_mp_lshd(mp_int *mp, mp_size p)
/* {{{ s_mp_rshd(mp, p) */
-/*
+/*
Shift mp rightward by p digits. Maintains the invariant that
digits above the precision are all zero. Digits shifted off the
end are lost. Cannot fail.
@@ -2898,7 +2898,7 @@ void s_mp_div_2(mp_int *mp)
mp_err s_mp_mul_2(mp_int *mp)
{
- int ix;
+ unsigned int ix;
mp_digit kin = 0, kout, *dp = DIGITS(mp);
mp_err res;
@@ -2970,7 +2970,7 @@ mp_err s_mp_mul_2d(mp_int *mp, mp_digit d)
mp_err res;
mp_digit save, next, mask, *dp;
mp_size used;
- int ix;
+ unsigned int ix;
if((res = s_mp_lshd(mp, d / DIGIT_BIT)) != MP_OKAY)
return res;
@@ -3054,7 +3054,7 @@ void s_mp_div_2d(mp_int *mp, mp_digit d)
end of the division process).
We multiply by the smallest power of 2 that gives us a leading digit
- at least half the radix. By choosing a power of 2, we simplify the
+ at least half the radix. By choosing a power of 2, we simplify the
multiplication and division steps to simple shifts.
*/
mp_digit s_mp_norm(mp_int *a, mp_int *b)
@@ -3066,7 +3066,7 @@ mp_digit s_mp_norm(mp_int *a, mp_int *b)
t <<= 1;
++d;
}
-
+
if(d != 0) {
s_mp_mul_2d(a, d);
s_mp_mul_2d(b, d);
@@ -3188,14 +3188,14 @@ mp_err s_mp_mul_d(mp_int *a, mp_digit d)
test guarantees we have enough storage to do this safely.
*/
if(k) {
- dp[max] = k;
+ dp[max] = k;
USED(a) = max + 1;
}
s_mp_clamp(a);
return MP_OKAY;
-
+
} /* end s_mp_mul_d() */
/* }}} */
@@ -3289,7 +3289,7 @@ mp_err s_mp_add(mp_int *a, mp_int *b) /* magnitude addition */
}
/* If we run out of 'b' digits before we're actually done, make
- sure the carries get propagated upward...
+ sure the carries get propagated upward...
*/
used = USED(a);
while(w && ix < used) {
@@ -3351,7 +3351,7 @@ mp_err s_mp_sub(mp_int *a, mp_int *b) /* magnitude subtract */
/* Clobber any leading zeroes we created */
s_mp_clamp(a);
- /*
+ /*
If there was a borrow out, then |b| > |a| in violation
of our input invariant. We've already done the work,
but we'll at least complain about it...
@@ -3387,7 +3387,7 @@ mp_err s_mp_reduce(mp_int *x, mp_int *m, mp_int *mu)
s_mp_mod_2d(&q, (mp_digit)(DIGIT_BIT * (um + 1)));
#else
s_mp_mul_dig(&q, m, um + 1);
-#endif
+#endif
/* x = x - q */
if((res = mp_sub(x, &q, x)) != MP_OKAY)
@@ -3441,7 +3441,7 @@ mp_err s_mp_mul(mp_int *a, mp_int *b)
pb = DIGITS(b);
for(ix = 0; ix < ub; ++ix, ++pb) {
- if(*pb == 0)
+ if(*pb == 0)
continue;
/* Inner product: Digits of a */
@@ -3480,7 +3480,7 @@ void s_mp_kmul(mp_digit *a, mp_digit *b, mp_digit *out, mp_size len)
for(ix = 0; ix < len; ++ix, ++b) {
if(*b == 0)
continue;
-
+
pa = a;
for(jx = 0; jx < len; ++jx, ++pa) {
pt = out + ix + jx;
@@ -3547,7 +3547,7 @@ mp_err s_mp_sqr(mp_int *a)
*/
for(jx = ix + 1, pa2 = DIGITS(a) + jx; jx < used; ++jx, ++pa2) {
mp_word u = 0, v;
-
+
/* Store this in a temporary to avoid indirections later */
pt = pbt + ix + jx;
@@ -3568,7 +3568,7 @@ mp_err s_mp_sqr(mp_int *a)
v = *pt + k;
/* If we do not already have an overflow carry, check to see
- if the addition will cause one, and set the carry out if so
+ if the addition will cause one, and set the carry out if so
*/
u |= ((MP_WORD_MAX - v) < w);
@@ -3592,7 +3592,7 @@ mp_err s_mp_sqr(mp_int *a)
/* If we are carrying out, propagate the carry to the next digit
in the output. This may cascade, so we have to be somewhat
circumspect -- but we will have enough precision in the output
- that we won't overflow
+ that we won't overflow
*/
kx = 1;
while(k) {
@@ -3664,7 +3664,7 @@ mp_err s_mp_div(mp_int *a, mp_int *b)
while(ix >= 0) {
/* Find a partial substring of a which is at least b */
while(s_mp_cmp(&rem, b) < 0 && ix >= 0) {
- if((res = s_mp_lshd(&rem, 1)) != MP_OKAY)
+ if((res = s_mp_lshd(&rem, 1)) != MP_OKAY)
goto CLEANUP;
if((res = s_mp_lshd(&quot, 1)) != MP_OKAY)
@@ -3676,8 +3676,8 @@ mp_err s_mp_div(mp_int *a, mp_int *b)
}
/* If we didn't find one, we're finished dividing */
- if(s_mp_cmp(&rem, b) < 0)
- break;
+ if(s_mp_cmp(&rem, b) < 0)
+ break;
/* Compute a guess for the next quotient digit */
q = DIGIT(&rem, USED(&rem) - 1);
@@ -3695,7 +3695,7 @@ mp_err s_mp_div(mp_int *a, mp_int *b)
if((res = s_mp_mul_d(&t, q)) != MP_OKAY)
goto CLEANUP;
- /*
+ /*
If it's too big, back it off. We should not have to do this
more than once, or, in rare cases, twice. Knuth describes a
method by which this could be reduced to a maximum of once, but
@@ -3719,7 +3719,7 @@ mp_err s_mp_div(mp_int *a, mp_int *b)
}
/* Denormalize remainder */
- if(d != 0)
+ if(d != 0)
s_mp_div_2d(&rem, d);
s_mp_clamp(&quot);
@@ -3727,7 +3727,7 @@ mp_err s_mp_div(mp_int *a, mp_int *b)
/* Copy quotient back to output */
s_mp_exch(&quot, a);
-
+
/* Copy remainder back to output */
s_mp_exch(&rem, b);
@@ -3757,7 +3757,7 @@ mp_err s_mp_2expt(mp_int *a, mp_digit k)
mp_zero(a);
if((res = s_mp_pad(a, dig + 1)) != MP_OKAY)
return res;
-
+
DIGIT(a, dig) |= (1 << bit);
return MP_OKAY;
@@ -3815,7 +3815,7 @@ int s_mp_cmp_d(mp_int *a, mp_digit d)
if(ua > 1)
return MP_GT;
- if(*ap < d)
+ if(*ap < d)
return MP_LT;
else if(*ap > d)
return MP_GT;
@@ -3857,7 +3857,7 @@ int s_mp_ispow2(mp_int *v)
}
return ((uv - 1) * DIGIT_BIT) + extra;
- }
+ }
return -1;
@@ -3901,7 +3901,7 @@ int s_mp_ispow2d(mp_digit d)
int s_mp_tovalue(char ch, int r)
{
int val, xch;
-
+
if(r > 36)
xch = ch;
else
@@ -3917,7 +3917,7 @@ int s_mp_tovalue(char ch, int r)
val = 62;
else if(xch == '/')
val = 63;
- else
+ else
return -1;
if(val < 0 || val >= r)
@@ -3939,7 +3939,7 @@ int s_mp_tovalue(char ch, int r)
The results may be odd if you use a radix < 2 or > 64, you are
expected to know what you're doing.
*/
-
+
char s_mp_todigit(int val, int r, int low)
{
char ch;
@@ -3960,7 +3960,7 @@ char s_mp_todigit(int val, int r, int low)
/* {{{ s_mp_outlen(bits, radix) */
-/*
+/*
Return an estimate for how long a string is needed to hold a radix
r representation of a number with 'bits' significant bits.
@@ -3980,6 +3980,6 @@ int s_mp_outlen(int bits, int r)
/* HERE THERE BE DRAGONS */
/* crc==4242132123, version==2, Sat Feb 02 06:43:52 2002 */
-/* $Source: /cvs/libtom/libtommath/mtest/mpi.c,v $ */
-/* $Revision: 1.2 $ */
-/* $Date: 2005/05/05 14:38:47 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtommath/mtest/mpi.h b/libtommath/mtest/mpi.h
index 66ae873..5accb52 100644
--- a/libtommath/mtest/mpi.h
+++ b/libtommath/mtest/mpi.h
@@ -6,7 +6,7 @@
Arbitrary precision integer arithmetic library
- $Id: mpi.h,v 1.2 2005/05/05 14:38:47 tom Exp $
+ $Id$
*/
#ifndef _H_MPI_
@@ -210,7 +210,7 @@ int mp_count_bits(mp_int *mp);
mp_err mp_read_radix(mp_int *mp, unsigned char *str, int radix);
int mp_radix_size(mp_int *mp, int radix);
int mp_value_radix_size(int num, int qty, int radix);
-mp_err mp_toradix(mp_int *mp, unsigned char *str, int radix);
+mp_err mp_toradix(mp_int *mp, char *str, int radix);
int mp_char2value(char ch, int r);
@@ -226,6 +226,6 @@ const char *mp_strerror(mp_err ec);
#endif /* end _H_MPI_ */
-/* $Source: /cvs/libtom/libtommath/mtest/mpi.h,v $ */
-/* $Revision: 1.2 $ */
-/* $Date: 2005/05/05 14:38:47 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtommath/mtest/mtest.c b/libtommath/mtest/mtest.c
index bdfe612..56b5a90 100644
--- a/libtommath/mtest/mtest.c
+++ b/libtommath/mtest/mtest.c
@@ -39,39 +39,71 @@ mulmod
#include <time.h>
#include "mpi.c"
+#ifdef LTM_MTEST_REAL_RAND
+#define getRandChar() fgetc(rng)
FILE *rng;
+#else
+#define getRandChar() (rand()&0xFF)
+#endif
void rand_num(mp_int *a)
{
- int n, size;
+ int size;
unsigned char buf[2048];
+ size_t sz;
- size = 1 + ((fgetc(rng)<<8) + fgetc(rng)) % 101;
- buf[0] = (fgetc(rng)&1)?1:0;
- fread(buf+1, 1, size, rng);
- while (buf[1] == 0) buf[1] = fgetc(rng);
+ size = 1 + ((getRandChar()<<8) + getRandChar()) % 101;
+ buf[0] = (getRandChar()&1)?1:0;
+#ifdef LTM_MTEST_REAL_RAND
+ sz = fread(buf+1, 1, size, rng);
+#else
+ sz = 1;
+ while (sz < (unsigned)size) {
+ buf[sz] = getRandChar();
+ ++sz;
+ }
+#endif
+ if (sz != (unsigned)size) {
+ fprintf(stderr, "\nWarning: fread failed\n\n");
+ }
+ while (buf[1] == 0) buf[1] = getRandChar();
mp_read_raw(a, buf, 1+size);
}
void rand_num2(mp_int *a)
{
- int n, size;
+ int size;
unsigned char buf[2048];
+ size_t sz;
- size = 10 + ((fgetc(rng)<<8) + fgetc(rng)) % 101;
- buf[0] = (fgetc(rng)&1)?1:0;
- fread(buf+1, 1, size, rng);
- while (buf[1] == 0) buf[1] = fgetc(rng);
+ size = 10 + ((getRandChar()<<8) + getRandChar()) % 101;
+ buf[0] = (getRandChar()&1)?1:0;
+#ifdef LTM_MTEST_REAL_RAND
+ sz = fread(buf+1, 1, size, rng);
+#else
+ sz = 1;
+ while (sz < (unsigned)size) {
+ buf[sz] = getRandChar();
+ ++sz;
+ }
+#endif
+ if (sz != (unsigned)size) {
+ fprintf(stderr, "\nWarning: fread failed\n\n");
+ }
+ while (buf[1] == 0) buf[1] = getRandChar();
mp_read_raw(a, buf, 1+size);
}
#define mp_to64(a, b) mp_toradix(a, b, 64)
-int main(void)
+int main(int argc, char *argv[])
{
int n, tmp;
+ long long max;
mp_int a, b, c, d, e;
+#ifdef MTEST_NO_FULLSPEED
clock_t t1;
+#endif
char buf[4096];
mp_init(&a);
@@ -80,6 +112,22 @@ int main(void)
mp_init(&d);
mp_init(&e);
+ if (argc > 1) {
+ max = strtol(argv[1], NULL, 0);
+ if (max < 0) {
+ if (max > -64) {
+ max = (1 << -(max)) + 1;
+ } else {
+ max = 1;
+ }
+ } else if (max == 0) {
+ max = 1;
+ }
+ }
+ else {
+ max = 0;
+ }
+
/* initial (2^n - 1)^2 testing, makes sure the comba multiplier works [it has the new carry code] */
/*
@@ -98,6 +146,7 @@ int main(void)
}
*/
+#ifdef LTM_MTEST_REAL_RAND
rng = fopen("/dev/urandom", "rb");
if (rng == NULL) {
rng = fopen("/dev/random", "rb");
@@ -106,16 +155,27 @@ int main(void)
rng = stdin;
}
}
+#else
+ srand(23);
+#endif
+#ifdef MTEST_NO_FULLSPEED
t1 = clock();
+#endif
for (;;) {
-#if 0
+#ifdef MTEST_NO_FULLSPEED
if (clock() - t1 > CLOCKS_PER_SEC) {
sleep(2);
t1 = clock();
}
#endif
- n = fgetc(rng) % 15;
+ n = getRandChar() % 15;
+
+ if (max != 0) {
+ --max;
+ if (max == 0)
+ n = 255;
+ }
if (n == 0) {
/* add tests */
@@ -180,7 +240,7 @@ int main(void)
/* mul_2d test */
rand_num(&a);
mp_copy(&a, &b);
- n = fgetc(rng) & 63;
+ n = getRandChar() & 63;
mp_mul_2d(&b, n, &b);
mp_to64(&a, buf);
printf("mul2d\n");
@@ -192,7 +252,7 @@ int main(void)
/* div_2d test */
rand_num(&a);
mp_copy(&a, &b);
- n = fgetc(rng) & 63;
+ n = getRandChar() & 63;
mp_div_2d(&b, n, &b, NULL);
mp_to64(&a, buf);
printf("div2d\n");
@@ -297,12 +357,18 @@ int main(void)
printf("%s\n%d\n", buf, tmp);
mp_to64(&b, buf);
printf("%s\n", buf);
+ } else if (n == 255) {
+ printf("exit\n");
+ break;
}
+
}
+#ifdef LTM_MTEST_REAL_RAND
fclose(rng);
+#endif
return 0;
}
-/* $Source: /cvs/libtom/libtommath/mtest/mtest.c,v $ */
-/* $Revision: 1.2 $ */
-/* $Date: 2005/05/05 14:38:47 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtommath/parsenames.pl b/libtommath/parsenames.pl
new file mode 100755
index 0000000..cc57673
--- /dev/null
+++ b/libtommath/parsenames.pl
@@ -0,0 +1,25 @@
+#!/usr/bin/perl
+#
+# Splits the list of files and outputs for makefile type files
+# wrapped at 80 chars
+#
+# Tom St Denis
+@a = split(" ", $ARGV[1]);
+$b = "$ARGV[0]=";
+$len = length($b);
+print $b;
+foreach my $obj (@a) {
+ $len = $len + length($obj);
+ $obj =~ s/\*/\$/;
+ if ($len > 100) {
+ printf "\\\n";
+ $len = length($obj);
+ }
+ print "$obj ";
+}
+
+print "\n\n";
+
+# $Source$
+# $Revision$
+# $Date$
diff --git a/libtommath/pre_gen/mpi.c b/libtommath/pre_gen/mpi.c
index f651138..0d55d73 100644
--- a/libtommath/pre_gen/mpi.c
+++ b/libtommath/pre_gen/mpi.c
@@ -13,7 +13,7 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
static const struct {
@@ -43,9 +43,9 @@ char *mp_error_to_string(int code)
#endif
-/* $Source: /cvs/libtom/libtommath/bn_error.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
/* End: bn_error.c */
@@ -64,13 +64,13 @@ char *mp_error_to_string(int code)
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
-/* computes the modular inverse via binary extended euclidean algorithm,
- * that is c = 1/a mod b
+/* computes the modular inverse via binary extended euclidean algorithm,
+ * that is c = 1/a mod b
*
- * Based on slow invmod except this is optimized for the case where b is
+ * Based on slow invmod except this is optimized for the case where b is
* odd as per HAC Note 14.64 on pp. 610
*/
int fast_mp_invmod (mp_int * a, mp_int * b, mp_int * c)
@@ -195,9 +195,9 @@ LBL_ERR:mp_clear_multi (&x, &y, &u, &v, &B, &D, NULL);
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_fast_mp_invmod.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
/* End: bn_fast_mp_invmod.c */
@@ -216,7 +216,7 @@ LBL_ERR:mp_clear_multi (&x, &y, &u, &v, &B, &D, NULL);
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/* computes xR**-1 == x (mod N) via Montgomery Reduction
@@ -371,9 +371,9 @@ int fast_mp_montgomery_reduce (mp_int * x, mp_int * n, mp_digit rho)
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_fast_mp_montgomery_reduce.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
/* End: bn_fast_mp_montgomery_reduce.c */
@@ -392,20 +392,20 @@ int fast_mp_montgomery_reduce (mp_int * x, mp_int * n, mp_digit rho)
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/* Fast (comba) multiplier
*
- * This is the fast column-array [comba] multiplier. It is
- * designed to compute the columns of the product first
- * then handle the carries afterwards. This has the effect
+ * This is the fast column-array [comba] multiplier. It is
+ * designed to compute the columns of the product first
+ * then handle the carries afterwards. This has the effect
* of making the nested loops that compute the columns very
* simple and schedulable on super-scalar processors.
*
- * This has been modified to produce a variable number of
- * digits of output so if say only a half-product is required
- * you don't have to compute the upper half (a feature
+ * This has been modified to produce a variable number of
+ * digits of output so if say only a half-product is required
+ * you don't have to compute the upper half (a feature
* required for fast Barrett reduction).
*
* Based on Algorithm 14.12 on pp.595 of HAC.
@@ -429,7 +429,7 @@ int fast_s_mp_mul_digs (mp_int * a, mp_int * b, mp_int * c, int digs)
/* clear the carry */
_W = 0;
- for (ix = 0; ix < pa; ix++) {
+ for (ix = 0; ix < pa; ix++) {
int tx, ty;
int iy;
mp_digit *tmpx, *tmpy;
@@ -442,7 +442,7 @@ int fast_s_mp_mul_digs (mp_int * a, mp_int * b, mp_int * c, int digs)
tmpx = a->dp + tx;
tmpy = b->dp + ty;
- /* this is the number of times the loop will iterrate, essentially
+ /* this is the number of times the loop will iterrate, essentially
while (tx++ < a->used && ty-- >= 0) { ... }
*/
iy = MIN(a->used-tx, ty+1);
@@ -482,9 +482,9 @@ int fast_s_mp_mul_digs (mp_int * a, mp_int * b, mp_int * c, int digs)
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_fast_s_mp_mul_digs.c,v $ */
-/* $Revision: 1.7 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
/* End: bn_fast_s_mp_mul_digs.c */
@@ -503,7 +503,7 @@ int fast_s_mp_mul_digs (mp_int * a, mp_int * b, mp_int * c, int digs)
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/* this is a modified version of fast_s_mul_digs that only produces
@@ -532,7 +532,7 @@ int fast_s_mp_mul_high_digs (mp_int * a, mp_int * b, mp_int * c, int digs)
/* number of output digits to produce */
pa = a->used + b->used;
_W = 0;
- for (ix = digs; ix < pa; ix++) {
+ for (ix = digs; ix < pa; ix++) {
int tx, ty, iy;
mp_digit *tmpx, *tmpy;
@@ -544,7 +544,7 @@ int fast_s_mp_mul_high_digs (mp_int * a, mp_int * b, mp_int * c, int digs)
tmpx = a->dp + tx;
tmpy = b->dp + ty;
- /* this is the number of times the loop will iterrate, essentially its
+ /* this is the number of times the loop will iterrate, essentially its
while (tx++ < a->used && ty-- >= 0) { ... }
*/
iy = MIN(a->used-tx, ty+1);
@@ -560,7 +560,7 @@ int fast_s_mp_mul_high_digs (mp_int * a, mp_int * b, mp_int * c, int digs)
/* make next carry */
_W = _W >> ((mp_word)DIGIT_BIT);
}
-
+
/* setup dest */
olduse = c->used;
c->used = pa;
@@ -584,9 +584,9 @@ int fast_s_mp_mul_high_digs (mp_int * a, mp_int * b, mp_int * c, int digs)
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_fast_s_mp_mul_high_digs.c,v $ */
-/* $Revision: 1.5 $ */
-/* $Date: 2006/11/14 03:46:25 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
/* End: bn_fast_s_mp_mul_high_digs.c */
@@ -605,14 +605,14 @@ int fast_s_mp_mul_high_digs (mp_int * a, mp_int * b, mp_int * c, int digs)
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/* the jist of squaring...
- * you do like mult except the offset of the tmpx [one that
- * starts closer to zero] can't equal the offset of tmpy.
+ * you do like mult except the offset of the tmpx [one that
+ * starts closer to zero] can't equal the offset of tmpy.
* So basically you set up iy like before then you min it with
- * (ty-tx) so that it never happens. You double all those
+ * (ty-tx) so that it never happens. You double all those
* you add in the inner loop
After that loop you do the squares and add them in.
@@ -634,7 +634,7 @@ int fast_s_mp_sqr (mp_int * a, mp_int * b)
/* number of output digits to produce */
W1 = 0;
- for (ix = 0; ix < pa; ix++) {
+ for (ix = 0; ix < pa; ix++) {
int tx, ty, iy;
mp_word _W;
mp_digit *tmpy;
@@ -655,7 +655,7 @@ int fast_s_mp_sqr (mp_int * a, mp_int * b)
*/
iy = MIN(a->used-tx, ty+1);
- /* now for squaring tx can never equal ty
+ /* now for squaring tx can never equal ty
* we halve the distance since they approach at a rate of 2x
* and we have to round because odd cases need to be executed
*/
@@ -702,9 +702,9 @@ int fast_s_mp_sqr (mp_int * a, mp_int * b)
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_fast_s_mp_sqr.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
/* End: bn_fast_s_mp_sqr.c */
@@ -723,10 +723,10 @@ int fast_s_mp_sqr (mp_int * a, mp_int * b)
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
-/* computes a = 2**b
+/* computes a = 2**b
*
* Simple algorithm which zeroes the int, grows it then just sets one bit
* as required.
@@ -754,9 +754,9 @@ mp_2expt (mp_int * a, int b)
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_2expt.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
/* End: bn_mp_2expt.c */
@@ -775,10 +775,10 @@ mp_2expt (mp_int * a, int b)
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
-/* b = |a|
+/* b = |a|
*
* Simple function copies the input and fixes the sign to positive
*/
@@ -801,9 +801,9 @@ mp_abs (mp_int * a, mp_int * b)
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_abs.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
/* End: bn_mp_abs.c */
@@ -822,7 +822,7 @@ mp_abs (mp_int * a, mp_int * b)
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/* high level addition (handles signs) */
@@ -858,9 +858,9 @@ int mp_add (mp_int * a, mp_int * b, mp_int * c)
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_add.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
/* End: bn_mp_add.c */
@@ -879,7 +879,7 @@ int mp_add (mp_int * a, mp_int * b, mp_int * c)
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/* single digit addition */
@@ -974,9 +974,9 @@ mp_add_d (mp_int * a, mp_digit b, mp_int * c)
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_add_d.c,v $ */
-/* $Revision: 1.4 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
/* End: bn_mp_add_d.c */
@@ -995,7 +995,7 @@ mp_add_d (mp_int * a, mp_digit b, mp_int * c)
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/* d = a + b (mod c) */
@@ -1019,9 +1019,9 @@ mp_addmod (mp_int * a, mp_int * b, mp_int * c, mp_int * d)
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_addmod.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
/* End: bn_mp_addmod.c */
@@ -1040,7 +1040,7 @@ mp_addmod (mp_int * a, mp_int * b, mp_int * c, mp_int * d)
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/* AND two ints together */
@@ -1080,9 +1080,9 @@ mp_and (mp_int * a, mp_int * b, mp_int * c)
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_and.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
/* End: bn_mp_and.c */
@@ -1101,10 +1101,10 @@ mp_and (mp_int * a, mp_int * b, mp_int * c)
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
-/* trim unused digits
+/* trim unused digits
*
* This is used to ensure that leading zero digits are
* trimed and the leading "used" digit will be non-zero
@@ -1128,9 +1128,9 @@ mp_clamp (mp_int * a)
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_clamp.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
/* End: bn_mp_clamp.c */
@@ -1149,7 +1149,7 @@ mp_clamp (mp_int * a)
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/* clear one (frees) */
@@ -1176,9 +1176,9 @@ mp_clear (mp_int * a)
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_clear.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
/* End: bn_mp_clear.c */
@@ -1197,11 +1197,11 @@ mp_clear (mp_int * a)
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include <stdarg.h>
-void mp_clear_multi(mp_int *mp, ...)
+void mp_clear_multi(mp_int *mp, ...)
{
mp_int* next_mp = mp;
va_list args;
@@ -1214,9 +1214,9 @@ void mp_clear_multi(mp_int *mp, ...)
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_clear_multi.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
/* End: bn_mp_clear_multi.c */
@@ -1235,7 +1235,7 @@ void mp_clear_multi(mp_int *mp, ...)
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/* compare two ints (signed)*/
@@ -1250,7 +1250,7 @@ mp_cmp (mp_int * a, mp_int * b)
return MP_GT;
}
}
-
+
/* compare digits */
if (a->sign == MP_NEG) {
/* if negative compare opposite direction */
@@ -1261,9 +1261,9 @@ mp_cmp (mp_int * a, mp_int * b)
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_cmp.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
/* End: bn_mp_cmp.c */
@@ -1282,7 +1282,7 @@ mp_cmp (mp_int * a, mp_int * b)
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/* compare a digit */
@@ -1309,9 +1309,9 @@ int mp_cmp_d(mp_int * a, mp_digit b)
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_cmp_d.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
/* End: bn_mp_cmp_d.c */
@@ -1330,7 +1330,7 @@ int mp_cmp_d(mp_int * a, mp_digit b)
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/* compare maginitude of two ints (unsigned) */
@@ -1343,7 +1343,7 @@ int mp_cmp_mag (mp_int * a, mp_int * b)
if (a->used > b->used) {
return MP_GT;
}
-
+
if (a->used < b->used) {
return MP_LT;
}
@@ -1368,9 +1368,9 @@ int mp_cmp_mag (mp_int * a, mp_int * b)
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_cmp_mag.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
/* End: bn_mp_cmp_mag.c */
@@ -1389,10 +1389,10 @@ int mp_cmp_mag (mp_int * a, mp_int * b)
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
-static const int lnz[16] = {
+static const int lnz[16] = {
4, 0, 1, 0, 2, 0, 1, 0, 3, 0, 1, 0, 2, 0, 1, 0
};
@@ -1425,9 +1425,9 @@ int mp_cnt_lsb(mp_int *a)
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_cnt_lsb.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
/* End: bn_mp_cnt_lsb.c */
@@ -1446,7 +1446,7 @@ int mp_cnt_lsb(mp_int *a)
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/* copy, b = a */
@@ -1497,9 +1497,9 @@ mp_copy (mp_int * a, mp_int * b)
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_copy.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
/* End: bn_mp_copy.c */
@@ -1518,7 +1518,7 @@ mp_copy (mp_int * a, mp_int * b)
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/* returns the number of bits in an int */
@@ -1535,7 +1535,7 @@ mp_count_bits (mp_int * a)
/* get number of digits and add that */
r = (a->used - 1) * DIGIT_BIT;
-
+
/* take the last digit and count the bits in it */
q = a->dp[a->used - 1];
while (q > ((mp_digit) 0)) {
@@ -1546,9 +1546,9 @@ mp_count_bits (mp_int * a)
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_count_bits.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
/* End: bn_mp_count_bits.c */
@@ -1567,7 +1567,7 @@ mp_count_bits (mp_int * a)
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#ifdef BN_MP_DIV_SMALL
@@ -1605,7 +1605,7 @@ int mp_div(mp_int * a, mp_int * b, mp_int * c, mp_int * d)
mp_set(&tq, 1);
n = mp_count_bits(a) - mp_count_bits(b);
if (((res = mp_abs(a, &ta)) != MP_OKAY) ||
- ((res = mp_abs(b, &tb)) != MP_OKAY) ||
+ ((res = mp_abs(b, &tb)) != MP_OKAY) ||
((res = mp_mul_2d(&tb, n, &tb)) != MP_OKAY) ||
((res = mp_mul_2d(&tq, n, &tq)) != MP_OKAY)) {
goto LBL_ERR;
@@ -1642,17 +1642,17 @@ LBL_ERR:
#else
-/* integer signed division.
+/* integer signed division.
* c*b + d == a [e.g. a/b, c=quotient, d=remainder]
* HAC pp.598 Algorithm 14.20
*
- * Note that the description in HAC is horribly
- * incomplete. For example, it doesn't consider
- * the case where digits are removed from 'x' in
- * the inner loop. It also doesn't consider the
+ * Note that the description in HAC is horribly
+ * incomplete. For example, it doesn't consider
+ * the case where digits are removed from 'x' in
+ * the inner loop. It also doesn't consider the
* case that y has fewer than three digits, etc..
*
- * The overall algorithm is as described as
+ * The overall algorithm is as described as
* 14.20 from HAC but fixed to treat these cases.
*/
int mp_div (mp_int * a, mp_int * b, mp_int * c, mp_int * d)
@@ -1742,7 +1742,7 @@ int mp_div (mp_int * a, mp_int * b, mp_int * c, mp_int * d)
continue;
}
- /* step 3.1 if xi == yt then set q{i-t-1} to b-1,
+ /* step 3.1 if xi == yt then set q{i-t-1} to b-1,
* otherwise set q{i-t-1} to (xi*b + x{i-1})/yt */
if (x.dp[i] == y.dp[t]) {
q.dp[i - t - 1] = ((((mp_digit)1) << DIGIT_BIT) - 1);
@@ -1756,10 +1756,10 @@ int mp_div (mp_int * a, mp_int * b, mp_int * c, mp_int * d)
q.dp[i - t - 1] = (mp_digit) (tmp & (mp_word) (MP_MASK));
}
- /* while (q{i-t-1} * (yt * b + y{t-1})) >
- xi * b**2 + xi-1 * b + xi-2
-
- do q{i-t-1} -= 1;
+ /* while (q{i-t-1} * (yt * b + y{t-1})) >
+ xi * b**2 + xi-1 * b + xi-2
+
+ do q{i-t-1} -= 1;
*/
q.dp[i - t - 1] = (q.dp[i - t - 1] + 1) & MP_MASK;
do {
@@ -1810,10 +1810,10 @@ int mp_div (mp_int * a, mp_int * b, mp_int * c, mp_int * d)
}
}
- /* now q is the quotient and x is the remainder
- * [which we have to normalize]
+ /* now q is the quotient and x is the remainder
+ * [which we have to normalize]
*/
-
+
/* get sign before writing to c */
x.sign = x.used == 0 ? MP_ZPOS : a->sign;
@@ -1842,9 +1842,9 @@ LBL_Q:mp_clear (&q);
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_div.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
/* End: bn_mp_div.c */
@@ -1863,7 +1863,7 @@ LBL_Q:mp_clear (&q);
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/* b = a/2 */
@@ -1914,9 +1914,9 @@ int mp_div_2(mp_int * a, mp_int * b)
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_div_2.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
/* End: bn_mp_div_2.c */
@@ -1935,7 +1935,7 @@ int mp_div_2(mp_int * a, mp_int * b)
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/* shift right by a certain bit count (store quotient in c, optional remainder in d) */
@@ -2015,9 +2015,9 @@ int mp_div_2d (mp_int * a, int b, mp_int * c, mp_int * d)
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_div_2d.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
/* End: bn_mp_div_2d.c */
@@ -2036,7 +2036,7 @@ int mp_div_2d (mp_int * a, int b, mp_int * c, mp_int * d)
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/* divide by three (based on routine from MPI and the GMP manual) */
@@ -2047,14 +2047,14 @@ mp_div_3 (mp_int * a, mp_int *c, mp_digit * d)
mp_word w, t;
mp_digit b;
int res, ix;
-
+
/* b = 2**DIGIT_BIT / 3 */
b = (((mp_word)1) << ((mp_word)DIGIT_BIT)) / ((mp_word)3);
if ((res = mp_init_size(&q, a->used)) != MP_OKAY) {
return res;
}
-
+
q.used = a->used;
q.sign = a->sign;
w = 0;
@@ -2092,15 +2092,15 @@ mp_div_3 (mp_int * a, mp_int *c, mp_digit * d)
mp_exch(&q, c);
}
mp_clear(&q);
-
+
return res;
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_div_3.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
/* End: bn_mp_div_3.c */
@@ -2119,14 +2119,19 @@ mp_div_3 (mp_int * a, mp_int *c, mp_digit * d)
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
static int s_is_power_of_two(mp_digit b, int *p)
{
int x;
- for (x = 1; x < DIGIT_BIT; x++) {
+ /* fast return if no power of two */
+ if ((b==0) || (b & (b-1))) {
+ return 0;
+ }
+
+ for (x = 0; x < DIGIT_BIT; x++) {
if (b == (((mp_digit)1)<<x)) {
*p = x;
return 1;
@@ -2181,13 +2186,13 @@ int mp_div_d (mp_int * a, mp_digit b, mp_int * c, mp_digit * d)
if ((res = mp_init_size(&q, a->used)) != MP_OKAY) {
return res;
}
-
+
q.used = a->used;
q.sign = a->sign;
w = 0;
for (ix = a->used - 1; ix >= 0; ix--) {
w = (w << ((mp_word)DIGIT_BIT)) | ((mp_word)a->dp[ix]);
-
+
if (w >= b) {
t = (mp_digit)(w / b);
w -= ((mp_word)t) * ((mp_word)b);
@@ -2196,25 +2201,25 @@ int mp_div_d (mp_int * a, mp_digit b, mp_int * c, mp_digit * d)
}
q.dp[ix] = (mp_digit)t;
}
-
+
if (d != NULL) {
*d = (mp_digit)w;
}
-
+
if (c != NULL) {
mp_clamp(&q);
mp_exch(&q, c);
}
mp_clear(&q);
-
+
return res;
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_div_d.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
/* End: bn_mp_div_d.c */
@@ -2233,7 +2238,7 @@ int mp_div_d (mp_int * a, mp_digit b, mp_int * c, mp_digit * d)
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/* determines if a number is a valid DR modulus */
@@ -2259,9 +2264,9 @@ int mp_dr_is_modulus(mp_int *a)
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_dr_is_modulus.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
/* End: bn_mp_dr_is_modulus.c */
@@ -2280,7 +2285,7 @@ int mp_dr_is_modulus(mp_int *a)
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/* reduce "x" in place modulo "n" using the Diminished Radix algorithm.
@@ -2357,9 +2362,9 @@ top:
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_dr_reduce.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
/* End: bn_mp_dr_reduce.c */
@@ -2378,7 +2383,7 @@ top:
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/* determines the setup value */
@@ -2387,15 +2392,15 @@ void mp_dr_setup(mp_int *a, mp_digit *d)
/* the casts are required if DIGIT_BIT is one less than
* the number of bits in a mp_digit [e.g. DIGIT_BIT==31]
*/
- *d = (mp_digit)((((mp_word)1) << ((mp_word)DIGIT_BIT)) -
+ *d = (mp_digit)((((mp_word)1) << ((mp_word)DIGIT_BIT)) -
((mp_word)a->dp[0]));
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_dr_setup.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
/* End: bn_mp_dr_setup.c */
@@ -2414,10 +2419,10 @@ void mp_dr_setup(mp_int *a, mp_digit *d)
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
-/* swap the elements of two integers, for cases where you can't simply swap the
+/* swap the elements of two integers, for cases where you can't simply swap the
* mp_int pointers around
*/
void
@@ -2431,9 +2436,9 @@ mp_exch (mp_int * a, mp_int * b)
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_exch.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
/* End: bn_mp_exch.c */
@@ -2452,7 +2457,7 @@ mp_exch (mp_int * a, mp_int * b)
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/* calculate c = a**b using a square-multiply algorithm */
@@ -2492,9 +2497,9 @@ int mp_expt_d (mp_int * a, mp_digit b, mp_int * c)
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_expt_d.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
/* End: bn_mp_expt_d.c */
@@ -2513,7 +2518,7 @@ int mp_expt_d (mp_int * a, mp_digit b, mp_int * c)
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
@@ -2560,7 +2565,7 @@ int mp_exptmod (mp_int * G, mp_int * X, mp_int * P, mp_int * Y)
err = mp_exptmod(&tmpG, &tmpX, P, Y);
mp_clear_multi(&tmpG, &tmpX, NULL);
return err;
-#else
+#else
/* no invmod */
return MP_VAL;
#endif
@@ -2587,7 +2592,7 @@ int mp_exptmod (mp_int * G, mp_int * X, mp_int * P, mp_int * Y)
dr = mp_reduce_is_2k(P) << 1;
}
#endif
-
+
/* if the modulus is odd or dr != 0 use the montgomery method */
#ifdef BN_MP_EXPTMOD_FAST_C
if (mp_isodd (P) == 1 || dr != 0) {
@@ -2608,9 +2613,9 @@ int mp_exptmod (mp_int * G, mp_int * X, mp_int * P, mp_int * Y)
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_exptmod.c,v $ */
-/* $Revision: 1.4 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
/* End: bn_mp_exptmod.c */
@@ -2629,7 +2634,7 @@ int mp_exptmod (mp_int * G, mp_int * X, mp_int * P, mp_int * Y)
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/* computes Y == G**X mod P, HAC pp.616, Algorithm 14.85
@@ -2701,7 +2706,7 @@ int mp_exptmod_fast (mp_int * G, mp_int * X, mp_int * P, mp_int * Y, int redmode
/* determine and setup reduction code */
if (redmode == 0) {
-#ifdef BN_MP_MONTGOMERY_SETUP_C
+#ifdef BN_MP_MONTGOMERY_SETUP_C
/* now setup montgomery */
if ((err = mp_montgomery_setup (P, &mp)) != MP_OKAY) {
goto LBL_M;
@@ -2716,7 +2721,7 @@ int mp_exptmod_fast (mp_int * G, mp_int * X, mp_int * P, mp_int * Y, int redmode
if (((P->used * 2 + 1) < MP_WARRAY) &&
P->used < (1 << ((CHAR_BIT * sizeof (mp_word)) - (2 * DIGIT_BIT)))) {
redux = fast_mp_montgomery_reduce;
- } else
+ } else
#endif
{
#ifdef BN_MP_MONTGOMERY_REDUCE_C
@@ -2767,7 +2772,7 @@ int mp_exptmod_fast (mp_int * G, mp_int * X, mp_int * P, mp_int * Y, int redmode
if ((err = mp_montgomery_calc_normalization (&res, P)) != MP_OKAY) {
goto LBL_RES;
}
-#else
+#else
err = MP_VAL;
goto LBL_RES;
#endif
@@ -2933,9 +2938,9 @@ LBL_M:
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_exptmod_fast.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
/* End: bn_mp_exptmod_fast.c */
@@ -2954,10 +2959,10 @@ LBL_M:
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
-/* Extended euclidean algorithm of (a, b) produces
+/* Extended euclidean algorithm of (a, b) produces
a*u1 + b*u2 = u3
*/
int mp_exteuclid(mp_int *a, mp_int *b, mp_int *U1, mp_int *U2, mp_int *U3)
@@ -3019,9 +3024,9 @@ _ERR: mp_clear_multi(&u1, &u2, &u3, &v1, &v2, &v3, &t1, &t2, &t3, &q, &tmp, NULL
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_exteuclid.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
/* End: bn_mp_exteuclid.c */
@@ -3040,17 +3045,17 @@ _ERR: mp_clear_multi(&u1, &u2, &u3, &v1, &v2, &v3, &t1, &t2, &t3, &q, &tmp, NULL
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/* read a bigint from a file stream in ASCII */
int mp_fread(mp_int *a, int radix, FILE *stream)
{
int err, ch, neg, y;
-
+
/* clear a */
mp_zero(a);
-
+
/* if first digit is - then set negative */
ch = fgetc(stream);
if (ch == '-') {
@@ -3059,7 +3064,7 @@ int mp_fread(mp_int *a, int radix, FILE *stream)
} else {
neg = MP_ZPOS;
}
-
+
for (;;) {
/* find y in the radix map */
for (y = 0; y < radix; y++) {
@@ -3070,7 +3075,7 @@ int mp_fread(mp_int *a, int radix, FILE *stream)
if (y == radix) {
break;
}
-
+
/* shift up and add */
if ((err = mp_mul_d(a, radix, a)) != MP_OKAY) {
return err;
@@ -3078,21 +3083,21 @@ int mp_fread(mp_int *a, int radix, FILE *stream)
if ((err = mp_add_d(a, y, a)) != MP_OKAY) {
return err;
}
-
+
ch = fgetc(stream);
}
if (mp_cmp_d(a, 0) != MP_EQ) {
a->sign = neg;
}
-
+
return MP_OKAY;
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_fread.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
/* End: bn_mp_fread.c */
@@ -3111,14 +3116,14 @@ int mp_fread(mp_int *a, int radix, FILE *stream)
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
int mp_fwrite(mp_int *a, int radix, FILE *stream)
{
char *buf;
int err, len, x;
-
+
if ((err = mp_radix_size(a, radix, &len)) != MP_OKAY) {
return err;
}
@@ -3127,28 +3132,28 @@ int mp_fwrite(mp_int *a, int radix, FILE *stream)
if (buf == NULL) {
return MP_MEM;
}
-
+
if ((err = mp_toradix(a, buf, radix)) != MP_OKAY) {
XFREE (buf);
return err;
}
-
+
for (x = 0; x < len; x++) {
if (fputc(buf[x], stream) == EOF) {
XFREE (buf);
return MP_VAL;
}
}
-
+
XFREE (buf);
return MP_OKAY;
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_fwrite.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
/* End: bn_mp_fwrite.c */
@@ -3167,7 +3172,7 @@ int mp_fwrite(mp_int *a, int radix, FILE *stream)
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/* Greatest Common Divisor using the binary method */
@@ -3231,17 +3236,17 @@ int mp_gcd (mp_int * a, mp_int * b, mp_int * c)
/* swap u and v to make sure v is >= u */
mp_exch(&u, &v);
}
-
+
/* subtract smallest from largest */
if ((res = s_mp_sub(&v, &u, &v)) != MP_OKAY) {
goto LBL_V;
}
-
+
/* Divide out all factors of two */
if ((res = mp_div_2d(&v, mp_cnt_lsb(&v), &v, NULL)) != MP_OKAY) {
goto LBL_V;
- }
- }
+ }
+ }
/* multiply by 2**k which we divided out at the beginning */
if ((res = mp_mul_2d (&u, k, c)) != MP_OKAY) {
@@ -3255,9 +3260,9 @@ LBL_U:mp_clear (&v);
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_gcd.c,v $ */
-/* $Revision: 1.4 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
/* End: bn_mp_gcd.c */
@@ -3276,11 +3281,11 @@ LBL_U:mp_clear (&v);
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/* get the lower 32-bits of an mp_int */
-unsigned long mp_get_int(mp_int * a)
+unsigned long mp_get_int(mp_int * a)
{
int i;
unsigned long res;
@@ -3294,7 +3299,7 @@ unsigned long mp_get_int(mp_int * a)
/* get most significant digit of result */
res = DIGIT(a,i);
-
+
while (--i >= 0) {
res = (res << DIGIT_BIT) | DIGIT(a,i);
}
@@ -3304,9 +3309,9 @@ unsigned long mp_get_int(mp_int * a)
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_get_int.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
/* End: bn_mp_get_int.c */
@@ -3325,7 +3330,7 @@ unsigned long mp_get_int(mp_int * a)
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/* grow as required */
@@ -3365,9 +3370,9 @@ int mp_grow (mp_int * a, int size)
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_grow.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
/* End: bn_mp_grow.c */
@@ -3386,7 +3391,7 @@ int mp_grow (mp_int * a, int size)
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/* init a new mp_int */
@@ -3415,9 +3420,9 @@ int mp_init (mp_int * a)
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_init.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
/* End: bn_mp_init.c */
@@ -3436,7 +3441,7 @@ int mp_init (mp_int * a)
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/* creates "a" then copies b into it */
@@ -3451,9 +3456,9 @@ int mp_init_copy (mp_int * a, mp_int * b)
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_init_copy.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
/* End: bn_mp_init_copy.c */
@@ -3472,11 +3477,11 @@ int mp_init_copy (mp_int * a, mp_int * b)
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#include <stdarg.h>
-int mp_init_multi(mp_int *mp, ...)
+int mp_init_multi(mp_int *mp, ...)
{
mp_err res = MP_OKAY; /* Assume ok until proven otherwise */
int n = 0; /* Number of ok inits */
@@ -3490,11 +3495,11 @@ int mp_init_multi(mp_int *mp, ...)
succeeded in init-ing, then return error.
*/
va_list clean_args;
-
+
/* end the current list */
va_end(args);
-
- /* now start cleaning up */
+
+ /* now start cleaning up */
cur_arg = mp;
va_start(clean_args, mp);
while (n--) {
@@ -3514,9 +3519,9 @@ int mp_init_multi(mp_int *mp, ...)
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_init_multi.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
/* End: bn_mp_init_multi.c */
@@ -3535,7 +3540,7 @@ int mp_init_multi(mp_int *mp, ...)
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/* initialize and set a digit */
@@ -3550,9 +3555,9 @@ int mp_init_set (mp_int * a, mp_digit b)
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_init_set.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
/* End: bn_mp_init_set.c */
@@ -3571,7 +3576,7 @@ int mp_init_set (mp_int * a, mp_digit b)
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/* initialize and set a digit */
@@ -3585,9 +3590,9 @@ int mp_init_set_int (mp_int * a, unsigned long b)
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_init_set_int.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
/* End: bn_mp_init_set_int.c */
@@ -3606,7 +3611,7 @@ int mp_init_set_int (mp_int * a, unsigned long b)
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/* init an mp_init for a given size */
@@ -3616,7 +3621,7 @@ int mp_init_size (mp_int * a, int size)
/* pad size so there are always extra digits */
size += (MP_PREC * 2) - (size % MP_PREC);
-
+
/* alloc mem */
a->dp = OPT_CAST(mp_digit) XMALLOC (sizeof (mp_digit) * size);
if (a->dp == NULL) {
@@ -3637,9 +3642,9 @@ int mp_init_size (mp_int * a, int size)
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_init_size.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
/* End: bn_mp_init_size.c */
@@ -3658,7 +3663,7 @@ int mp_init_size (mp_int * a, int size)
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/* hac 14.61, pp608 */
@@ -3684,9 +3689,9 @@ int mp_invmod (mp_int * a, mp_int * b, mp_int * c)
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_invmod.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
/* End: bn_mp_invmod.c */
@@ -3705,7 +3710,7 @@ int mp_invmod (mp_int * a, mp_int * b, mp_int * c)
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/* hac 14.61, pp608 */
@@ -3720,7 +3725,7 @@ int mp_invmod_slow (mp_int * a, mp_int * b, mp_int * c)
}
/* init temps */
- if ((res = mp_init_multi(&x, &y, &u, &v,
+ if ((res = mp_init_multi(&x, &y, &u, &v,
&A, &B, &C, &D, NULL)) != MP_OKAY) {
return res;
}
@@ -3847,14 +3852,14 @@ top:
goto LBL_ERR;
}
}
-
+
/* too big */
while (mp_cmp_mag(&C, b) != MP_LT) {
if ((res = mp_sub(&C, b, &C)) != MP_OKAY) {
goto LBL_ERR;
}
}
-
+
/* C is now the inverse */
mp_exch (&C, c);
res = MP_OKAY;
@@ -3863,9 +3868,9 @@ LBL_ERR:mp_clear_multi (&x, &y, &u, &v, &A, &B, &C, &D, NULL);
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_invmod_slow.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
/* End: bn_mp_invmod_slow.c */
@@ -3884,7 +3889,7 @@ LBL_ERR:mp_clear_multi (&x, &y, &u, &v, &A, &B, &C, &D, NULL);
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/* Check if remainders are possible squares - fast exclude non-squares */
@@ -3910,7 +3915,7 @@ static const char rem_105[105] = {
};
/* Store non-zero to ret if arg is square, and zero if not */
-int mp_is_square(mp_int *arg,int *ret)
+int mp_is_square(mp_int *arg,int *ret)
{
int res;
mp_digit c;
@@ -3918,7 +3923,7 @@ int mp_is_square(mp_int *arg,int *ret)
unsigned long r;
/* Default to Non-square :) */
- *ret = MP_NO;
+ *ret = MP_NO;
if (arg->sign == MP_NEG) {
return MP_VAL;
@@ -3952,8 +3957,8 @@ int mp_is_square(mp_int *arg,int *ret)
r = mp_get_int(&t);
/* Check for other prime modules, note it's not an ERROR but we must
* free "t" so the easiest way is to goto ERR. We know that res
- * is already equal to MP_OKAY from the mp_mod call
- */
+ * is already equal to MP_OKAY from the mp_mod call
+ */
if ( (1L<<(r%11)) & 0x5C4L ) goto ERR;
if ( (1L<<(r%13)) & 0x9E4L ) goto ERR;
if ( (1L<<(r%17)) & 0x5CE8L ) goto ERR;
@@ -3976,9 +3981,9 @@ ERR:mp_clear(&t);
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_is_square.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
/* End: bn_mp_is_square.c */
@@ -3997,7 +4002,7 @@ ERR:mp_clear(&t);
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/* computes the jacobi c = (a | n) (or Legendre if n is prime)
@@ -4085,9 +4090,9 @@ LBL_A1:mp_clear (&a1);
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_jacobi.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
/* End: bn_mp_jacobi.c */
@@ -4106,36 +4111,36 @@ LBL_A1:mp_clear (&a1);
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
-/* c = |a| * |b| using Karatsuba Multiplication using
+/* c = |a| * |b| using Karatsuba Multiplication using
* three half size multiplications
*
- * Let B represent the radix [e.g. 2**DIGIT_BIT] and
- * let n represent half of the number of digits in
+ * Let B represent the radix [e.g. 2**DIGIT_BIT] and
+ * let n represent half of the number of digits in
* the min(a,b)
*
* a = a1 * B**n + a0
* b = b1 * B**n + b0
*
- * Then, a * b =>
+ * Then, a * b =>
a1b1 * B**2n + ((a1 + a0)(b1 + b0) - (a0b0 + a1b1)) * B + a0b0
*
- * Note that a1b1 and a0b0 are used twice and only need to be
- * computed once. So in total three half size (half # of
- * digit) multiplications are performed, a0b0, a1b1 and
+ * Note that a1b1 and a0b0 are used twice and only need to be
+ * computed once. So in total three half size (half # of
+ * digit) multiplications are performed, a0b0, a1b1 and
* (a1+b1)(a0+b0)
*
* Note that a multiplication of half the digits requires
- * 1/4th the number of single precision multiplications so in
- * total after one call 25% of the single precision multiplications
- * are saved. Note also that the call to mp_mul can end up back
- * in this function if the a0, a1, b0, or b1 are above the threshold.
- * This is known as divide-and-conquer and leads to the famous
- * O(N**lg(3)) or O(N**1.584) work which is asymptopically lower than
- * the standard O(N**2) that the baseline/comba methods use.
- * Generally though the overhead of this method doesn't pay off
+ * 1/4th the number of single precision multiplications so in
+ * total after one call 25% of the single precision multiplications
+ * are saved. Note also that the call to mp_mul can end up back
+ * in this function if the a0, a1, b0, or b1 are above the threshold.
+ * This is known as divide-and-conquer and leads to the famous
+ * O(N**lg(3)) or O(N**1.584) work which is asymptopically lower than
+ * the standard O(N**2) that the baseline/comba methods use.
+ * Generally though the overhead of this method doesn't pay off
* until a certain size (N ~ 80) is reached.
*/
int mp_karatsuba_mul (mp_int * a, mp_int * b, mp_int * c)
@@ -4203,7 +4208,7 @@ int mp_karatsuba_mul (mp_int * a, mp_int * b, mp_int * c)
}
}
- /* only need to clamp the lower words since by definition the
+ /* only need to clamp the lower words since by definition the
* upper words x1/y1 must have a known number of digits
*/
mp_clamp (&x0);
@@ -4211,7 +4216,7 @@ int mp_karatsuba_mul (mp_int * a, mp_int * b, mp_int * c)
/* now calc the products x0y0 and x1y1 */
/* after this x0 is no longer required, free temp [x0==t2]! */
- if (mp_mul (&x0, &y0, &x0y0) != MP_OKAY)
+ if (mp_mul (&x0, &y0, &x0y0) != MP_OKAY)
goto X1Y1; /* x0y0 = x0*y0 */
if (mp_mul (&x1, &y1, &x1y1) != MP_OKAY)
goto X1Y1; /* x1y1 = x1*y1 */
@@ -4256,9 +4261,9 @@ ERR:
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_karatsuba_mul.c,v $ */
-/* $Revision: 1.5 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
/* End: bn_mp_karatsuba_mul.c */
@@ -4277,14 +4282,14 @@ ERR:
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
-/* Karatsuba squaring, computes b = a*a using three
+/* Karatsuba squaring, computes b = a*a using three
* half size squarings
*
- * See comments of karatsuba_mul for details. It
- * is essentially the same algorithm but merely
+ * See comments of karatsuba_mul for details. It
+ * is essentially the same algorithm but merely
* tuned to perform recursive squarings.
*/
int mp_karatsuba_sqr (mp_int * a, mp_int * b)
@@ -4381,9 +4386,9 @@ ERR:
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_karatsuba_sqr.c,v $ */
-/* $Revision: 1.5 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
/* End: bn_mp_karatsuba_sqr.c */
@@ -4402,7 +4407,7 @@ ERR:
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/* computes least common multiple as |a*b|/(a, b) */
@@ -4445,9 +4450,9 @@ LBL_T:
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_lcm.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
/* End: bn_mp_lcm.c */
@@ -4466,7 +4471,7 @@ LBL_T:
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/* shift left a certain amount of digits */
@@ -4516,9 +4521,9 @@ int mp_lshd (mp_int * a, int b)
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_lshd.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
/* End: bn_mp_lshd.c */
@@ -4537,7 +4542,7 @@ int mp_lshd (mp_int * a, int b)
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/* c = a mod b, 0 <= c < b */
@@ -4568,9 +4573,9 @@ mp_mod (mp_int * a, mp_int * b, mp_int * c)
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_mod.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
/* End: bn_mp_mod.c */
@@ -4589,7 +4594,7 @@ mp_mod (mp_int * a, mp_int * b, mp_int * c)
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/* calc a value mod 2**b */
@@ -4627,9 +4632,9 @@ mp_mod_2d (mp_int * a, int b, mp_int * c)
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_mod_2d.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
/* End: bn_mp_mod_2d.c */
@@ -4648,7 +4653,7 @@ mp_mod_2d (mp_int * a, int b, mp_int * c)
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
int
@@ -4658,9 +4663,9 @@ mp_mod_d (mp_int * a, mp_digit b, mp_digit * c)
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_mod_d.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
/* End: bn_mp_mod_d.c */
@@ -4679,7 +4684,7 @@ mp_mod_d (mp_int * a, mp_digit b, mp_digit * c)
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/*
@@ -4721,9 +4726,9 @@ int mp_montgomery_calc_normalization (mp_int * a, mp_int * b)
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_montgomery_calc_normalization.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
/* End: bn_mp_montgomery_calc_normalization.c */
@@ -4742,7 +4747,7 @@ int mp_montgomery_calc_normalization (mp_int * a, mp_int * b)
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/* computes xR**-1 == x (mod N) via Montgomery Reduction */
@@ -4843,9 +4848,9 @@ mp_montgomery_reduce (mp_int * x, mp_int * n, mp_digit rho)
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_montgomery_reduce.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
/* End: bn_mp_montgomery_reduce.c */
@@ -4864,7 +4869,7 @@ mp_montgomery_reduce (mp_int * x, mp_int * n, mp_digit rho)
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/* setups the montgomery reduction stuff */
@@ -4906,9 +4911,9 @@ mp_montgomery_setup (mp_int * n, mp_digit * rho)
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_montgomery_setup.c,v $ */
-/* $Revision: 1.4 $ */
-/* $Date: 2006/12/04 21:34:03 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
/* End: bn_mp_montgomery_setup.c */
@@ -4927,7 +4932,7 @@ mp_montgomery_setup (mp_int * n, mp_digit * rho)
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/* high level multiplication (handles sign) */
@@ -4940,29 +4945,29 @@ int mp_mul (mp_int * a, mp_int * b, mp_int * c)
#ifdef BN_MP_TOOM_MUL_C
if (MIN (a->used, b->used) >= TOOM_MUL_CUTOFF) {
res = mp_toom_mul(a, b, c);
- } else
+ } else
#endif
#ifdef BN_MP_KARATSUBA_MUL_C
/* use Karatsuba? */
if (MIN (a->used, b->used) >= KARATSUBA_MUL_CUTOFF) {
res = mp_karatsuba_mul (a, b, c);
- } else
+ } else
#endif
{
/* can we use the fast multiplier?
*
- * The fast multiplier can be used if the output will
- * have less than MP_WARRAY digits and the number of
+ * The fast multiplier can be used if the output will
+ * have less than MP_WARRAY digits and the number of
* digits won't affect carry propagation
*/
int digs = a->used + b->used + 1;
#ifdef BN_FAST_S_MP_MUL_DIGS_C
if ((digs < MP_WARRAY) &&
- MIN(a->used, b->used) <=
+ MIN(a->used, b->used) <=
(1 << ((CHAR_BIT * sizeof (mp_word)) - (2 * DIGIT_BIT)))) {
res = fast_s_mp_mul_digs (a, b, c, digs);
- } else
+ } else
#endif
#ifdef BN_S_MP_MUL_DIGS_C
res = s_mp_mul (a, b, c); /* uses s_mp_mul_digs */
@@ -4976,9 +4981,9 @@ int mp_mul (mp_int * a, mp_int * b, mp_int * c)
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_mul.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
/* End: bn_mp_mul.c */
@@ -4997,7 +5002,7 @@ int mp_mul (mp_int * a, mp_int * b, mp_int * c)
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/* b = a*2 */
@@ -5020,24 +5025,24 @@ int mp_mul_2(mp_int * a, mp_int * b)
/* alias for source */
tmpa = a->dp;
-
+
/* alias for dest */
tmpb = b->dp;
/* carry */
r = 0;
for (x = 0; x < a->used; x++) {
-
- /* get what will be the *next* carry bit from the
- * MSB of the current digit
+
+ /* get what will be the *next* carry bit from the
+ * MSB of the current digit
*/
rr = *tmpa >> ((mp_digit)(DIGIT_BIT - 1));
-
+
/* now shift up this digit, add in the carry [from the previous] */
*tmpb++ = ((*tmpa++ << ((mp_digit)1)) | r) & MP_MASK;
-
- /* copy the carry that would be from the source
- * digit into the next iteration
+
+ /* copy the carry that would be from the source
+ * digit into the next iteration
*/
r = rr;
}
@@ -5049,8 +5054,8 @@ int mp_mul_2(mp_int * a, mp_int * b)
++(b->used);
}
- /* now zero any excess digits on the destination
- * that we didn't write to
+ /* now zero any excess digits on the destination
+ * that we didn't write to
*/
tmpb = b->dp + b->used;
for (x = b->used; x < oldused; x++) {
@@ -5062,9 +5067,9 @@ int mp_mul_2(mp_int * a, mp_int * b)
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_mul_2.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
/* End: bn_mp_mul_2.c */
@@ -5083,7 +5088,7 @@ int mp_mul_2(mp_int * a, mp_int * b)
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/* shift left by a certain bit count */
@@ -5140,7 +5145,7 @@ int mp_mul_2d (mp_int * a, int b, mp_int * c)
/* set the carry to the carry bits of the current word */
r = rr;
}
-
+
/* set final carry */
if (r != 0) {
c->dp[(c->used)++] = r;
@@ -5151,9 +5156,9 @@ int mp_mul_2d (mp_int * a, int b, mp_int * c)
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_mul_2d.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
/* End: bn_mp_mul_2d.c */
@@ -5172,7 +5177,7 @@ int mp_mul_2d (mp_int * a, int b, mp_int * c)
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/* multiply by a digit */
@@ -5234,9 +5239,9 @@ mp_mul_d (mp_int * a, mp_digit b, mp_int * c)
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_mul_d.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
/* End: bn_mp_mul_d.c */
@@ -5255,7 +5260,7 @@ mp_mul_d (mp_int * a, mp_digit b, mp_int * c)
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/* d = a * b (mod c) */
@@ -5278,9 +5283,9 @@ int mp_mulmod (mp_int * a, mp_int * b, mp_int * c, mp_int * d)
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_mulmod.c,v $ */
-/* $Revision: 1.4 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
/* End: bn_mp_mulmod.c */
@@ -5299,17 +5304,17 @@ int mp_mulmod (mp_int * a, mp_int * b, mp_int * c, mp_int * d)
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
-/* find the n'th root of an integer
+/* find the n'th root of an integer
*
- * Result found such that (c)**b <= a and (c+1)**b > a
+ * Result found such that (c)**b <= a and (c+1)**b > a
*
- * This algorithm uses Newton's approximation
- * x[i+1] = x[i] - f(x[i])/f'(x[i])
- * which will find the root in log(N) time where
- * each step involves a fair bit. This is not meant to
+ * This algorithm uses Newton's approximation
+ * x[i+1] = x[i] - f(x[i])/f'(x[i])
+ * which will find the root in log(N) time where
+ * each step involves a fair bit. This is not meant to
* find huge roots [square and cube, etc].
*/
int mp_n_root (mp_int * a, mp_digit b, mp_int * c)
@@ -5348,31 +5353,31 @@ int mp_n_root (mp_int * a, mp_digit b, mp_int * c)
}
/* t2 = t1 - ((t1**b - a) / (b * t1**(b-1))) */
-
+
/* t3 = t1**(b-1) */
- if ((res = mp_expt_d (&t1, b - 1, &t3)) != MP_OKAY) {
+ if ((res = mp_expt_d (&t1, b - 1, &t3)) != MP_OKAY) {
goto LBL_T3;
}
/* numerator */
/* t2 = t1**b */
- if ((res = mp_mul (&t3, &t1, &t2)) != MP_OKAY) {
+ if ((res = mp_mul (&t3, &t1, &t2)) != MP_OKAY) {
goto LBL_T3;
}
/* t2 = t1**b - a */
- if ((res = mp_sub (&t2, a, &t2)) != MP_OKAY) {
+ if ((res = mp_sub (&t2, a, &t2)) != MP_OKAY) {
goto LBL_T3;
}
/* denominator */
/* t3 = t1**(b-1) * b */
- if ((res = mp_mul_d (&t3, b, &t3)) != MP_OKAY) {
+ if ((res = mp_mul_d (&t3, b, &t3)) != MP_OKAY) {
goto LBL_T3;
}
/* t3 = (t1**b - a)/(b * t1**(b-1)) */
- if ((res = mp_div (&t2, &t3, &t3, NULL)) != MP_OKAY) {
+ if ((res = mp_div (&t2, &t3, &t3, NULL)) != MP_OKAY) {
goto LBL_T3;
}
@@ -5414,9 +5419,9 @@ LBL_T1:mp_clear (&t1);
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_n_root.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
/* End: bn_mp_n_root.c */
@@ -5435,7 +5440,7 @@ LBL_T1:mp_clear (&t1);
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/* b = -a */
@@ -5458,9 +5463,9 @@ int mp_neg (mp_int * a, mp_int * b)
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_neg.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
/* End: bn_mp_neg.c */
@@ -5479,7 +5484,7 @@ int mp_neg (mp_int * a, mp_int * b)
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/* OR two ints together */
@@ -5512,9 +5517,9 @@ int mp_or (mp_int * a, mp_int * b, mp_int * c)
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_or.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
/* End: bn_mp_or.c */
@@ -5533,11 +5538,11 @@ int mp_or (mp_int * a, mp_int * b, mp_int * c)
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/* performs one Fermat test.
- *
+ *
* If "a" were prime then b**a == b (mod a) since the order of
* the multiplicative sub-group would be phi(a) = a-1. That means
* it would be the same as b**(a mod (a-1)) == b**1 == b (mod a).
@@ -5578,9 +5583,9 @@ LBL_T:mp_clear (&t);
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_prime_fermat.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
/* End: bn_mp_prime_fermat.c */
@@ -5599,10 +5604,10 @@ LBL_T:mp_clear (&t);
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
-/* determines if an integers is divisible by one
+/* determines if an integers is divisible by one
* of the first PRIME_SIZE primes or not
*
* sets result to 0 if not, 1 if yes
@@ -5632,9 +5637,9 @@ int mp_prime_is_divisible (mp_int * a, int *result)
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_prime_is_divisible.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
/* End: bn_mp_prime_is_divisible.c */
@@ -5653,7 +5658,7 @@ int mp_prime_is_divisible (mp_int * a, int *result)
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/* performs a variable number of rounds of Miller-Rabin
@@ -5719,9 +5724,9 @@ LBL_B:mp_clear (&b);
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_prime_is_prime.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
/* End: bn_mp_prime_is_prime.c */
@@ -5740,14 +5745,14 @@ LBL_B:mp_clear (&b);
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
-/* Miller-Rabin test of "a" to the base of "b" as described in
+/* Miller-Rabin test of "a" to the base of "b" as described in
* HAC pp. 139 Algorithm 4.24
*
* Sets result to 0 if definitely composite or 1 if probably prime.
- * Randomly the chance of error is no more than 1/4 and often
+ * Randomly the chance of error is no more than 1/4 and often
* very much lower.
*/
int mp_prime_miller_rabin (mp_int * a, mp_int * b, int *result)
@@ -5761,7 +5766,7 @@ int mp_prime_miller_rabin (mp_int * a, mp_int * b, int *result)
/* ensure b > 1 */
if (mp_cmp_d(b, 1) != MP_GT) {
return MP_VAL;
- }
+ }
/* get n1 = a - 1 */
if ((err = mp_init_copy (&n1, a)) != MP_OKAY) {
@@ -5826,9 +5831,9 @@ LBL_N1:mp_clear (&n1);
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_prime_miller_rabin.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
/* End: bn_mp_prime_miller_rabin.c */
@@ -5847,7 +5852,7 @@ LBL_N1:mp_clear (&n1);
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/* finds the next prime after the number "a" using "t" trials
@@ -5978,7 +5983,7 @@ int mp_prime_next_prime(mp_int *a, int t, int bbs_style)
/* is this prime? */
for (x = 0; x < t; x++) {
- mp_set(&b, ltm_prime_tab[t]);
+ mp_set(&b, ltm_prime_tab[x]);
if ((err = mp_prime_miller_rabin(a, &b, &res)) != MP_OKAY) {
goto LBL_ERR;
}
@@ -6000,9 +6005,9 @@ LBL_ERR:
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_prime_next_prime.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
/* End: bn_mp_prime_next_prime.c */
@@ -6021,7 +6026,7 @@ LBL_ERR:
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
@@ -6056,9 +6061,9 @@ int mp_prime_rabin_miller_trials(int size)
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_prime_rabin_miller_trials.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
/* End: bn_mp_prime_rabin_miller_trials.c */
@@ -6077,13 +6082,13 @@ int mp_prime_rabin_miller_trials(int size)
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/* makes a truly random prime of a given size (bits),
*
* Flags are as follows:
- *
+ *
* LTM_PRIME_BBS - make prime congruent to 3 mod 4
* LTM_PRIME_SAFE - make sure (p-1)/2 is prime as well (implies LTM_PRIME_BBS)
* LTM_PRIME_2MSB_OFF - make the 2nd highest bit zero
@@ -6128,7 +6133,7 @@ int mp_prime_random_ex(mp_int *a, int t, int size, int flags, ltm_prime_callback
maskOR_msb_offset = ((size & 7) == 1) ? 1 : 0;
if (flags & LTM_PRIME_2MSB_ON) {
maskOR_msb |= 0x80 >> ((9 - size) & 7);
- }
+ }
/* get the maskOR_lsb */
maskOR_lsb = 1;
@@ -6142,7 +6147,7 @@ int mp_prime_random_ex(mp_int *a, int t, int size, int flags, ltm_prime_callback
err = MP_VAL;
goto error;
}
-
+
/* work over the MSbyte */
tmp[0] &= maskAND;
tmp[0] |= 1 << ((size - 1) & 7);
@@ -6156,7 +6161,7 @@ int mp_prime_random_ex(mp_int *a, int t, int size, int flags, ltm_prime_callback
/* is it prime? */
if ((err = mp_prime_is_prime(a, t, &res)) != MP_OKAY) { goto error; }
- if (res == MP_NO) {
+ if (res == MP_NO) {
continue;
}
@@ -6164,7 +6169,7 @@ int mp_prime_random_ex(mp_int *a, int t, int size, int flags, ltm_prime_callback
/* see if (a-1)/2 is prime */
if ((err = mp_sub_d(a, 1, a)) != MP_OKAY) { goto error; }
if ((err = mp_div_2(a, a)) != MP_OKAY) { goto error; }
-
+
/* is it prime? */
if ((err = mp_prime_is_prime(a, t, &res)) != MP_OKAY) { goto error; }
}
@@ -6185,9 +6190,9 @@ error:
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_prime_random_ex.c,v $ */
-/* $Revision: 1.4 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
/* End: bn_mp_prime_random_ex.c */
@@ -6206,7 +6211,7 @@ error:
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/* returns size of ASCII reprensentation */
@@ -6248,7 +6253,7 @@ int mp_radix_size (mp_int * a, int radix, int *size)
}
/* force temp to positive */
- t.sign = MP_ZPOS;
+ t.sign = MP_ZPOS;
/* fetch out all of the digits */
while (mp_iszero (&t) == MP_NO) {
@@ -6267,9 +6272,9 @@ int mp_radix_size (mp_int * a, int radix, int *size)
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_radix_size.c,v $ */
-/* $Revision: 1.4 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
/* End: bn_mp_radix_size.c */
@@ -6288,16 +6293,16 @@ int mp_radix_size (mp_int * a, int radix, int *size)
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/* chars used in radix conversions */
const char *mp_s_rmap = "0123456789ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz+/";
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_radix_smap.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
/* End: bn_mp_radix_smap.c */
@@ -6316,7 +6321,7 @@ const char *mp_s_rmap = "0123456789ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrs
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/* makes a pseudo-random int of a given size */
@@ -6354,9 +6359,9 @@ mp_rand (mp_int * a, int digits)
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_rand.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
/* End: bn_mp_rand.c */
@@ -6375,7 +6380,7 @@ mp_rand (mp_int * a, int digits)
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/* read a string [ASCII] in a given radix */
@@ -6392,8 +6397,8 @@ int mp_read_radix (mp_int * a, const char *str, int radix)
return MP_VAL;
}
- /* if the leading digit is a
- * minus set the sign to negative.
+ /* if the leading digit is a
+ * minus set the sign to negative.
*/
if (*str == '-') {
++str;
@@ -6404,23 +6409,23 @@ int mp_read_radix (mp_int * a, const char *str, int radix)
/* set the integer to the default of zero */
mp_zero (a);
-
+
/* process each digit of the string */
while (*str) {
/* if the radix < 36 the conversion is case insensitive
* this allows numbers like 1AB and 1ab to represent the same value
* [e.g. in hex]
*/
- ch = (char) ((radix < 36) ? toupper (*str) : *str);
+ ch = (char) ((radix < 36) ? toupper ((int)*str) : *str);
for (y = 0; y < 64; y++) {
if (ch == mp_s_rmap[y]) {
break;
}
}
- /* if the char was found in the map
+ /* if the char was found in the map
* and is less than the given radix add it
- * to the number, otherwise exit the loop.
+ * to the number, otherwise exit the loop.
*/
if (y < radix) {
if ((res = mp_mul_d (a, (mp_digit) radix, a)) != MP_OKAY) {
@@ -6434,7 +6439,7 @@ int mp_read_radix (mp_int * a, const char *str, int radix)
}
++str;
}
-
+
/* set the sign only if a != 0 */
if (mp_iszero(a) != 1) {
a->sign = neg;
@@ -6443,9 +6448,9 @@ int mp_read_radix (mp_int * a, const char *str, int radix)
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_read_radix.c,v $ */
-/* $Revision: 1.4 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
/* End: bn_mp_read_radix.c */
@@ -6464,7 +6469,7 @@ int mp_read_radix (mp_int * a, const char *str, int radix)
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/* read signed bin, big endian, first byte is 0==positive or 1==negative */
@@ -6488,9 +6493,9 @@ int mp_read_signed_bin (mp_int * a, const unsigned char *b, int c)
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_read_signed_bin.c,v $ */
-/* $Revision: 1.4 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
/* End: bn_mp_read_signed_bin.c */
@@ -6509,7 +6514,7 @@ int mp_read_signed_bin (mp_int * a, const unsigned char *b, int c)
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/* reads a unsigned char array, assumes the msb is stored first [big endian] */
@@ -6547,9 +6552,9 @@ int mp_read_unsigned_bin (mp_int * a, const unsigned char *b, int c)
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_read_unsigned_bin.c,v $ */
-/* $Revision: 1.4 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
/* End: bn_mp_read_unsigned_bin.c */
@@ -6568,10 +6573,10 @@ int mp_read_unsigned_bin (mp_int * a, const unsigned char *b, int c)
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
-/* reduces x mod m, assumes 0 < x < m**2, mu is
+/* reduces x mod m, assumes 0 < x < m**2, mu is
* precomputed via mp_reduce_setup.
* From HAC pp.604 Algorithm 14.42
*/
@@ -6586,7 +6591,7 @@ int mp_reduce (mp_int * x, mp_int * m, mp_int * mu)
}
/* q1 = x / b**(k-1) */
- mp_rshd (&q, um - 1);
+ mp_rshd (&q, um - 1);
/* according to HAC this optimization is ok */
if (((unsigned long) um) > (((mp_digit)1) << (DIGIT_BIT - 1))) {
@@ -6602,8 +6607,8 @@ int mp_reduce (mp_int * x, mp_int * m, mp_int * mu)
if ((res = fast_s_mp_mul_high_digs (&q, mu, &q, um)) != MP_OKAY) {
goto CLEANUP;
}
-#else
- {
+#else
+ {
res = MP_VAL;
goto CLEANUP;
}
@@ -6611,7 +6616,7 @@ int mp_reduce (mp_int * x, mp_int * m, mp_int * mu)
}
/* q3 = q2 / b**(k+1) */
- mp_rshd (&q, um + 1);
+ mp_rshd (&q, um + 1);
/* x = x mod b**(k+1), quick (no division) */
if ((res = mp_mod_2d (x, DIGIT_BIT * (um + 1), x)) != MP_OKAY) {
@@ -6643,7 +6648,7 @@ int mp_reduce (mp_int * x, mp_int * m, mp_int * mu)
goto CLEANUP;
}
}
-
+
CLEANUP:
mp_clear (&q);
@@ -6651,9 +6656,9 @@ CLEANUP:
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_reduce.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
/* End: bn_mp_reduce.c */
@@ -6672,7 +6677,7 @@ CLEANUP:
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/* reduces a modulo n where n is of the form 2**p - d */
@@ -6680,35 +6685,35 @@ int mp_reduce_2k(mp_int *a, mp_int *n, mp_digit d)
{
mp_int q;
int p, res;
-
+
if ((res = mp_init(&q)) != MP_OKAY) {
return res;
}
-
- p = mp_count_bits(n);
+
+ p = mp_count_bits(n);
top:
/* q = a/2**p, a = a mod 2**p */
if ((res = mp_div_2d(a, p, &q, a)) != MP_OKAY) {
goto ERR;
}
-
+
if (d != 1) {
/* q = q * d */
- if ((res = mp_mul_d(&q, d, &q)) != MP_OKAY) {
+ if ((res = mp_mul_d(&q, d, &q)) != MP_OKAY) {
goto ERR;
}
}
-
+
/* a = a + q */
if ((res = s_mp_add(a, &q, a)) != MP_OKAY) {
goto ERR;
}
-
+
if (mp_cmp_mag(a, n) != MP_LT) {
s_mp_sub(a, n, a);
goto top;
}
-
+
ERR:
mp_clear(&q);
return res;
@@ -6716,9 +6721,9 @@ ERR:
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_reduce_2k.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
/* End: bn_mp_reduce_2k.c */
@@ -6737,10 +6742,10 @@ ERR:
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
-/* reduces a modulo n where n is of the form 2**p - d
+/* reduces a modulo n where n is of the form 2**p - d
This differs from reduce_2k since "d" can be larger
than a single digit.
*/
@@ -6748,33 +6753,33 @@ int mp_reduce_2k_l(mp_int *a, mp_int *n, mp_int *d)
{
mp_int q;
int p, res;
-
+
if ((res = mp_init(&q)) != MP_OKAY) {
return res;
}
-
- p = mp_count_bits(n);
+
+ p = mp_count_bits(n);
top:
/* q = a/2**p, a = a mod 2**p */
if ((res = mp_div_2d(a, p, &q, a)) != MP_OKAY) {
goto ERR;
}
-
+
/* q = q * d */
- if ((res = mp_mul(&q, d, &q)) != MP_OKAY) {
+ if ((res = mp_mul(&q, d, &q)) != MP_OKAY) {
goto ERR;
}
-
+
/* a = a + q */
if ((res = s_mp_add(a, &q, a)) != MP_OKAY) {
goto ERR;
}
-
+
if (mp_cmp_mag(a, n) != MP_LT) {
s_mp_sub(a, n, a);
goto top;
}
-
+
ERR:
mp_clear(&q);
return res;
@@ -6782,9 +6787,9 @@ ERR:
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_reduce_2k_l.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
/* End: bn_mp_reduce_2k_l.c */
@@ -6803,7 +6808,7 @@ ERR:
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/* determines the setup value */
@@ -6811,31 +6816,31 @@ int mp_reduce_2k_setup(mp_int *a, mp_digit *d)
{
int res, p;
mp_int tmp;
-
+
if ((res = mp_init(&tmp)) != MP_OKAY) {
return res;
}
-
+
p = mp_count_bits(a);
if ((res = mp_2expt(&tmp, p)) != MP_OKAY) {
mp_clear(&tmp);
return res;
}
-
+
if ((res = s_mp_sub(&tmp, a, &tmp)) != MP_OKAY) {
mp_clear(&tmp);
return res;
}
-
+
*d = tmp.dp[0];
mp_clear(&tmp);
return MP_OKAY;
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_reduce_2k_setup.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
/* End: bn_mp_reduce_2k_setup.c */
@@ -6854,7 +6859,7 @@ int mp_reduce_2k_setup(mp_int *a, mp_digit *d)
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/* determines the setup value */
@@ -6862,28 +6867,28 @@ int mp_reduce_2k_setup_l(mp_int *a, mp_int *d)
{
int res;
mp_int tmp;
-
+
if ((res = mp_init(&tmp)) != MP_OKAY) {
return res;
}
-
+
if ((res = mp_2expt(&tmp, mp_count_bits(a))) != MP_OKAY) {
goto ERR;
}
-
+
if ((res = s_mp_sub(&tmp, a, d)) != MP_OKAY) {
goto ERR;
}
-
+
ERR:
mp_clear(&tmp);
return res;
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_reduce_2k_setup_l.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
/* End: bn_mp_reduce_2k_setup_l.c */
@@ -6902,7 +6907,7 @@ ERR:
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/* determines if mp_reduce_2k can be used */
@@ -6910,7 +6915,7 @@ int mp_reduce_is_2k(mp_int *a)
{
int ix, iy, iw;
mp_digit iz;
-
+
if (a->used == 0) {
return MP_NO;
} else if (a->used == 1) {
@@ -6919,7 +6924,7 @@ int mp_reduce_is_2k(mp_int *a)
iy = mp_count_bits(a);
iz = 1;
iw = 1;
-
+
/* Test every bit from the second digit up, must be 1 */
for (ix = DIGIT_BIT; ix < iy; ix++) {
if ((a->dp[iw] & iz) == 0) {
@@ -6937,9 +6942,9 @@ int mp_reduce_is_2k(mp_int *a)
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_reduce_is_2k.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
/* End: bn_mp_reduce_is_2k.c */
@@ -6958,14 +6963,14 @@ int mp_reduce_is_2k(mp_int *a)
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/* determines if reduce_2k_l can be used */
int mp_reduce_is_2k_l(mp_int *a)
{
int ix, iy;
-
+
if (a->used == 0) {
return MP_NO;
} else if (a->used == 1) {
@@ -6978,16 +6983,16 @@ int mp_reduce_is_2k_l(mp_int *a)
}
}
return (iy >= (a->used/2)) ? MP_YES : MP_NO;
-
+
}
return MP_NO;
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_reduce_is_2k_l.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
/* End: bn_mp_reduce_is_2k_l.c */
@@ -7006,7 +7011,7 @@ int mp_reduce_is_2k_l(mp_int *a)
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/* pre-calculate the value required for Barrett reduction
@@ -7015,7 +7020,7 @@ int mp_reduce_is_2k_l(mp_int *a)
int mp_reduce_setup (mp_int * a, mp_int * b)
{
int res;
-
+
if ((res = mp_2expt (a, b->used * 2 * DIGIT_BIT)) != MP_OKAY) {
return res;
}
@@ -7023,9 +7028,9 @@ int mp_reduce_setup (mp_int * a, mp_int * b)
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_reduce_setup.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
/* End: bn_mp_reduce_setup.c */
@@ -7044,7 +7049,7 @@ int mp_reduce_setup (mp_int * a, mp_int * b)
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/* shift right a certain amount of digits */
@@ -7074,8 +7079,8 @@ void mp_rshd (mp_int * a, int b)
/* top [offset into digits] */
top = a->dp + b;
- /* this is implemented as a sliding window where
- * the window is b-digits long and digits from
+ /* this is implemented as a sliding window where
+ * the window is b-digits long and digits from
* the top of the window are copied to the bottom
*
* e.g.
@@ -7093,15 +7098,15 @@ void mp_rshd (mp_int * a, int b)
*bottom++ = 0;
}
}
-
+
/* remove excess digits */
a->used -= b;
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_rshd.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
/* End: bn_mp_rshd.c */
@@ -7120,7 +7125,7 @@ void mp_rshd (mp_int * a, int b)
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/* set to a digit */
@@ -7132,9 +7137,9 @@ void mp_set (mp_int * a, mp_digit b)
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_set.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
/* End: bn_mp_set.c */
@@ -7153,7 +7158,7 @@ void mp_set (mp_int * a, mp_digit b)
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/* set a 32-bit const */
@@ -7162,7 +7167,7 @@ int mp_set_int (mp_int * a, unsigned long b)
int x, res;
mp_zero (a);
-
+
/* set four bits at a time */
for (x = 0; x < 8; x++) {
/* shift the number up four bits */
@@ -7184,9 +7189,9 @@ int mp_set_int (mp_int * a, unsigned long b)
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_set_int.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
/* End: bn_mp_set_int.c */
@@ -7205,27 +7210,32 @@ int mp_set_int (mp_int * a, unsigned long b)
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/* shrink a bignum */
int mp_shrink (mp_int * a)
{
mp_digit *tmp;
- if (a->alloc != a->used && a->used > 0) {
- if ((tmp = OPT_CAST(mp_digit) XREALLOC (a->dp, sizeof (mp_digit) * a->used)) == NULL) {
+ int used = 1;
+
+ if(a->used > 0)
+ used = a->used;
+
+ if (a->alloc != used) {
+ if ((tmp = OPT_CAST(mp_digit) XREALLOC (a->dp, sizeof (mp_digit) * used)) == NULL) {
return MP_MEM;
}
a->dp = tmp;
- a->alloc = a->used;
+ a->alloc = used;
}
return MP_OKAY;
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_shrink.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
/* End: bn_mp_shrink.c */
@@ -7244,7 +7254,7 @@ int mp_shrink (mp_int * a)
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/* get the size for an signed equivalent */
@@ -7254,9 +7264,9 @@ int mp_signed_bin_size (mp_int * a)
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_signed_bin_size.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
/* End: bn_mp_signed_bin_size.c */
@@ -7275,7 +7285,7 @@ int mp_signed_bin_size (mp_int * a)
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/* computes b = a*a */
@@ -7289,18 +7299,18 @@ mp_sqr (mp_int * a, mp_int * b)
if (a->used >= TOOM_SQR_CUTOFF) {
res = mp_toom_sqr(a, b);
/* Karatsuba? */
- } else
+ } else
#endif
#ifdef BN_MP_KARATSUBA_SQR_C
if (a->used >= KARATSUBA_SQR_CUTOFF) {
res = mp_karatsuba_sqr (a, b);
- } else
+ } else
#endif
{
#ifdef BN_FAST_S_MP_SQR_C
/* can we use the fast comba multiplier? */
- if ((a->used * 2 + 1) < MP_WARRAY &&
- a->used <
+ if ((a->used * 2 + 1) < MP_WARRAY &&
+ a->used <
(1 << (sizeof(mp_word) * CHAR_BIT - 2*DIGIT_BIT - 1))) {
res = fast_s_mp_sqr (a, b);
} else
@@ -7316,9 +7326,9 @@ if (a->used >= KARATSUBA_SQR_CUTOFF) {
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_sqr.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
/* End: bn_mp_sqr.c */
@@ -7337,7 +7347,7 @@ if (a->used >= KARATSUBA_SQR_CUTOFF) {
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/* c = a * a (mod b) */
@@ -7361,9 +7371,9 @@ mp_sqrmod (mp_int * a, mp_int * b, mp_int * c)
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_sqrmod.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
/* End: bn_mp_sqrmod.c */
@@ -7382,11 +7392,11 @@ mp_sqrmod (mp_int * a, mp_int * b, mp_int * c)
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/* this function is less generic than mp_n_root, simpler and faster */
-int mp_sqrt(mp_int *arg, mp_int *ret)
+int mp_sqrt(mp_int *arg, mp_int *ret)
{
int res;
mp_int t1,t2;
@@ -7413,7 +7423,7 @@ int mp_sqrt(mp_int *arg, mp_int *ret)
/* First approx. (not very bad for large arg) */
mp_rshd (&t1,t1.used/2);
- /* t1 > 0 */
+ /* t1 > 0 */
if ((res = mp_div(arg,&t1,&t2,NULL)) != MP_OKAY) {
goto E1;
}
@@ -7424,7 +7434,7 @@ int mp_sqrt(mp_int *arg, mp_int *ret)
goto E1;
}
/* And now t1 > sqrt(arg) */
- do {
+ do {
if ((res = mp_div(arg,&t1,&t2,NULL)) != MP_OKAY) {
goto E1;
}
@@ -7446,9 +7456,9 @@ E2: mp_clear(&t1);
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_sqrt.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
/* End: bn_mp_sqrt.c */
@@ -7467,7 +7477,7 @@ E2: mp_clear(&t1);
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/* high level subtraction (handles signs) */
@@ -7509,9 +7519,9 @@ mp_sub (mp_int * a, mp_int * b, mp_int * c)
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_sub.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
/* End: bn_mp_sub.c */
@@ -7530,7 +7540,7 @@ mp_sub (mp_int * a, mp_int * b, mp_int * c)
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/* single digit subtraction */
@@ -7606,9 +7616,9 @@ mp_sub_d (mp_int * a, mp_digit b, mp_int * c)
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_sub_d.c,v $ */
-/* $Revision: 1.5 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
/* End: bn_mp_sub_d.c */
@@ -7627,7 +7637,7 @@ mp_sub_d (mp_int * a, mp_digit b, mp_int * c)
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/* d = a - b (mod c) */
@@ -7652,9 +7662,9 @@ mp_submod (mp_int * a, mp_int * b, mp_int * c, mp_int * d)
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_submod.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
/* End: bn_mp_submod.c */
@@ -7673,7 +7683,7 @@ mp_submod (mp_int * a, mp_int * b, mp_int * c, mp_int * d)
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/* store in signed [big endian] format */
@@ -7689,9 +7699,9 @@ int mp_to_signed_bin (mp_int * a, unsigned char *b)
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_to_signed_bin.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
/* End: bn_mp_to_signed_bin.c */
@@ -7710,7 +7720,7 @@ int mp_to_signed_bin (mp_int * a, unsigned char *b)
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/* store in signed [big endian] format */
@@ -7724,9 +7734,9 @@ int mp_to_signed_bin_n (mp_int * a, unsigned char *b, unsigned long *outlen)
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_to_signed_bin_n.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
/* End: bn_mp_to_signed_bin_n.c */
@@ -7745,7 +7755,7 @@ int mp_to_signed_bin_n (mp_int * a, unsigned char *b, unsigned long *outlen)
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/* store in unsigned [big endian] format */
@@ -7776,9 +7786,9 @@ int mp_to_unsigned_bin (mp_int * a, unsigned char *b)
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_to_unsigned_bin.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
/* End: bn_mp_to_unsigned_bin.c */
@@ -7797,7 +7807,7 @@ int mp_to_unsigned_bin (mp_int * a, unsigned char *b)
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/* store in unsigned [big endian] format */
@@ -7811,9 +7821,9 @@ int mp_to_unsigned_bin_n (mp_int * a, unsigned char *b, unsigned long *outlen)
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_to_unsigned_bin_n.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
/* End: bn_mp_to_unsigned_bin_n.c */
@@ -7832,31 +7842,31 @@ int mp_to_unsigned_bin_n (mp_int * a, unsigned char *b, unsigned long *outlen)
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
-/* multiplication using the Toom-Cook 3-way algorithm
+/* multiplication using the Toom-Cook 3-way algorithm
*
- * Much more complicated than Karatsuba but has a lower
- * asymptotic running time of O(N**1.464). This algorithm is
- * only particularly useful on VERY large inputs
+ * Much more complicated than Karatsuba but has a lower
+ * asymptotic running time of O(N**1.464). This algorithm is
+ * only particularly useful on VERY large inputs
* (we're talking 1000s of digits here...).
*/
int mp_toom_mul(mp_int *a, mp_int *b, mp_int *c)
{
mp_int w0, w1, w2, w3, w4, tmp1, tmp2, a0, a1, a2, b0, b1, b2;
int res, B;
-
+
/* init temps */
- if ((res = mp_init_multi(&w0, &w1, &w2, &w3, &w4,
- &a0, &a1, &a2, &b0, &b1,
+ if ((res = mp_init_multi(&w0, &w1, &w2, &w3, &w4,
+ &a0, &a1, &a2, &b0, &b1,
&b2, &tmp1, &tmp2, NULL)) != MP_OKAY) {
return res;
}
-
+
/* B */
B = MIN(a->used, b->used) / 3;
-
+
/* a = a2 * B**2 + a1 * B + a0 */
if ((res = mp_mod_2d(a, DIGIT_BIT * B, &a0)) != MP_OKAY) {
goto ERR;
@@ -7872,7 +7882,7 @@ int mp_toom_mul(mp_int *a, mp_int *b, mp_int *c)
goto ERR;
}
mp_rshd(&a2, B*2);
-
+
/* b = b2 * B**2 + b1 * B + b0 */
if ((res = mp_mod_2d(b, DIGIT_BIT * B, &b0)) != MP_OKAY) {
goto ERR;
@@ -7888,17 +7898,17 @@ int mp_toom_mul(mp_int *a, mp_int *b, mp_int *c)
goto ERR;
}
mp_rshd(&b2, B*2);
-
+
/* w0 = a0*b0 */
if ((res = mp_mul(&a0, &b0, &w0)) != MP_OKAY) {
goto ERR;
}
-
+
/* w4 = a2 * b2 */
if ((res = mp_mul(&a2, &b2, &w4)) != MP_OKAY) {
goto ERR;
}
-
+
/* w1 = (a2 + 2(a1 + 2a0))(b2 + 2(b1 + 2b0)) */
if ((res = mp_mul_2(&a0, &tmp1)) != MP_OKAY) {
goto ERR;
@@ -7912,7 +7922,7 @@ int mp_toom_mul(mp_int *a, mp_int *b, mp_int *c)
if ((res = mp_add(&tmp1, &a2, &tmp1)) != MP_OKAY) {
goto ERR;
}
-
+
if ((res = mp_mul_2(&b0, &tmp2)) != MP_OKAY) {
goto ERR;
}
@@ -7925,11 +7935,11 @@ int mp_toom_mul(mp_int *a, mp_int *b, mp_int *c)
if ((res = mp_add(&tmp2, &b2, &tmp2)) != MP_OKAY) {
goto ERR;
}
-
+
if ((res = mp_mul(&tmp1, &tmp2, &w1)) != MP_OKAY) {
goto ERR;
}
-
+
/* w3 = (a0 + 2(a1 + 2a2))(b0 + 2(b1 + 2b2)) */
if ((res = mp_mul_2(&a2, &tmp1)) != MP_OKAY) {
goto ERR;
@@ -7943,7 +7953,7 @@ int mp_toom_mul(mp_int *a, mp_int *b, mp_int *c)
if ((res = mp_add(&tmp1, &a0, &tmp1)) != MP_OKAY) {
goto ERR;
}
-
+
if ((res = mp_mul_2(&b2, &tmp2)) != MP_OKAY) {
goto ERR;
}
@@ -7956,11 +7966,11 @@ int mp_toom_mul(mp_int *a, mp_int *b, mp_int *c)
if ((res = mp_add(&tmp2, &b0, &tmp2)) != MP_OKAY) {
goto ERR;
}
-
+
if ((res = mp_mul(&tmp1, &tmp2, &w3)) != MP_OKAY) {
goto ERR;
}
-
+
/* w2 = (a2 + a1 + a0)(b2 + b1 + b0) */
if ((res = mp_add(&a2, &a1, &tmp1)) != MP_OKAY) {
@@ -7978,19 +7988,19 @@ int mp_toom_mul(mp_int *a, mp_int *b, mp_int *c)
if ((res = mp_mul(&tmp1, &tmp2, &w2)) != MP_OKAY) {
goto ERR;
}
-
- /* now solve the matrix
-
+
+ /* now solve the matrix
+
0 0 0 0 1
1 2 4 8 16
1 1 1 1 1
16 8 4 2 1
1 0 0 0 0
-
- using 12 subtractions, 4 shifts,
- 2 small divisions and 1 small multiplication
+
+ using 12 subtractions, 4 shifts,
+ 2 small divisions and 1 small multiplication
*/
-
+
/* r1 - r4 */
if ((res = mp_sub(&w1, &w4, &w1)) != MP_OKAY) {
goto ERR;
@@ -8062,7 +8072,7 @@ int mp_toom_mul(mp_int *a, mp_int *b, mp_int *c)
if ((res = mp_div_3(&w3, &w3, NULL)) != MP_OKAY) {
goto ERR;
}
-
+
/* at this point shift W[n] by B*n */
if ((res = mp_lshd(&w1, 1*B)) != MP_OKAY) {
goto ERR;
@@ -8075,8 +8085,8 @@ int mp_toom_mul(mp_int *a, mp_int *b, mp_int *c)
}
if ((res = mp_lshd(&w4, 4*B)) != MP_OKAY) {
goto ERR;
- }
-
+ }
+
if ((res = mp_add(&w0, &w1, c)) != MP_OKAY) {
goto ERR;
}
@@ -8088,20 +8098,20 @@ int mp_toom_mul(mp_int *a, mp_int *b, mp_int *c)
}
if ((res = mp_add(&tmp1, c, c)) != MP_OKAY) {
goto ERR;
- }
-
+ }
+
ERR:
- mp_clear_multi(&w0, &w1, &w2, &w3, &w4,
- &a0, &a1, &a2, &b0, &b1,
+ mp_clear_multi(&w0, &w1, &w2, &w3, &w4,
+ &a0, &a1, &a2, &b0, &b1,
&b2, &tmp1, &tmp2, NULL);
return res;
-}
-
+}
+
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_toom_mul.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
/* End: bn_mp_toom_mul.c */
@@ -8120,7 +8130,7 @@ ERR:
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/* squaring using Toom-Cook 3-way algorithm */
@@ -8329,9 +8339,9 @@ ERR:
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_toom_sqr.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
/* End: bn_mp_toom_sqr.c */
@@ -8350,7 +8360,7 @@ ERR:
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/* stores a bignum as a ASCII string in a given radix (2..64) */
@@ -8408,9 +8418,9 @@ int mp_toradix (mp_int * a, char *str, int radix)
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_toradix.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
/* End: bn_mp_toradix.c */
@@ -8429,12 +8439,12 @@ int mp_toradix (mp_int * a, char *str, int radix)
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
-/* stores a bignum as a ASCII string in a given radix (2..64)
+/* stores a bignum as a ASCII string in a given radix (2..64)
*
- * Stores upto maxlen-1 chars and always a NULL byte
+ * Stores upto maxlen-1 chars and always a NULL byte
*/
int mp_toradix_n(mp_int * a, char *str, int radix, int maxlen)
{
@@ -8467,7 +8477,7 @@ int mp_toradix_n(mp_int * a, char *str, int radix, int maxlen)
/* store the flag and mark the number as positive */
*str++ = '-';
t.sign = MP_ZPOS;
-
+
/* subtract a char */
--maxlen;
}
@@ -8500,9 +8510,9 @@ int mp_toradix_n(mp_int * a, char *str, int radix, int maxlen)
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_toradix_n.c,v $ */
-/* $Revision: 1.4 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
/* End: bn_mp_toradix_n.c */
@@ -8521,7 +8531,7 @@ int mp_toradix_n(mp_int * a, char *str, int radix, int maxlen)
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/* get the size for an unsigned equivalent */
@@ -8532,9 +8542,9 @@ int mp_unsigned_bin_size (mp_int * a)
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_unsigned_bin_size.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
/* End: bn_mp_unsigned_bin_size.c */
@@ -8553,7 +8563,7 @@ int mp_unsigned_bin_size (mp_int * a)
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/* XOR two ints together */
@@ -8587,9 +8597,9 @@ mp_xor (mp_int * a, mp_int * b, mp_int * c)
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_xor.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
/* End: bn_mp_xor.c */
@@ -8608,7 +8618,7 @@ mp_xor (mp_int * a, mp_int * b, mp_int * c)
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/* set to zero */
@@ -8627,9 +8637,9 @@ void mp_zero (mp_int * a)
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_mp_zero.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
/* End: bn_mp_zero.c */
@@ -8648,7 +8658,7 @@ void mp_zero (mp_int * a)
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
const mp_digit ltm_prime_tab[] = {
0x0002, 0x0003, 0x0005, 0x0007, 0x000B, 0x000D, 0x0011, 0x0013,
@@ -8692,9 +8702,9 @@ const mp_digit ltm_prime_tab[] = {
};
#endif
-/* $Source: /cvs/libtom/libtommath/bn_prime_tab.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
/* End: bn_prime_tab.c */
@@ -8713,7 +8723,7 @@ const mp_digit ltm_prime_tab[] = {
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/* reverse an array, used for radix code */
@@ -8735,9 +8745,9 @@ bn_reverse (unsigned char *s, int len)
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_reverse.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
/* End: bn_reverse.c */
@@ -8756,7 +8766,7 @@ bn_reverse (unsigned char *s, int len)
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/* low level addition, based on HAC pp.594, Algorithm 14.7 */
@@ -8818,8 +8828,8 @@ s_mp_add (mp_int * a, mp_int * b, mp_int * c)
*tmpc++ &= MP_MASK;
}
- /* now copy higher words if any, that is in A+B
- * if A or B has more digits add those in
+ /* now copy higher words if any, that is in A+B
+ * if A or B has more digits add those in
*/
if (min != max) {
for (; i < max; i++) {
@@ -8848,9 +8858,9 @@ s_mp_add (mp_int * a, mp_int * b, mp_int * c)
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_s_mp_add.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
/* End: bn_s_mp_add.c */
@@ -8869,7 +8879,7 @@ s_mp_add (mp_int * a, mp_int * b, mp_int * c)
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
#ifdef MP_LOW_MEM
#define TAB_SIZE 32
@@ -8911,7 +8921,7 @@ int s_mp_exptmod (mp_int * G, mp_int * X, mp_int * P, mp_int * Y, int redmode)
/* init M array */
/* init first cell */
if ((err = mp_init(&M[1])) != MP_OKAY) {
- return err;
+ return err;
}
/* now init the second half of the array */
@@ -8929,7 +8939,7 @@ int s_mp_exptmod (mp_int * G, mp_int * X, mp_int * P, mp_int * Y, int redmode)
if ((err = mp_init (&mu)) != MP_OKAY) {
goto LBL_M;
}
-
+
if (redmode == 0) {
if ((err = mp_reduce_setup (&mu, P)) != MP_OKAY) {
goto LBL_MU;
@@ -8940,22 +8950,22 @@ int s_mp_exptmod (mp_int * G, mp_int * X, mp_int * P, mp_int * Y, int redmode)
goto LBL_MU;
}
redux = mp_reduce_2k_l;
- }
+ }
/* create M table
*
- * The M table contains powers of the base,
+ * The M table contains powers of the base,
* e.g. M[x] = G**x mod P
*
- * The first half of the table is not
+ * The first half of the table is not
* computed though accept for M[0] and M[1]
*/
if ((err = mp_mod (G, P, &M[1])) != MP_OKAY) {
goto LBL_MU;
}
- /* compute the value at M[1<<(winsize-1)] by squaring
- * M[1] (winsize-1) times
+ /* compute the value at M[1<<(winsize-1)] by squaring
+ * M[1] (winsize-1) times
*/
if ((err = mp_copy (&M[1], &M[1 << (winsize - 1)])) != MP_OKAY) {
goto LBL_MU;
@@ -8963,7 +8973,7 @@ int s_mp_exptmod (mp_int * G, mp_int * X, mp_int * P, mp_int * Y, int redmode)
for (x = 0; x < (winsize - 1); x++) {
/* square it */
- if ((err = mp_sqr (&M[1 << (winsize - 1)],
+ if ((err = mp_sqr (&M[1 << (winsize - 1)],
&M[1 << (winsize - 1)])) != MP_OKAY) {
goto LBL_MU;
}
@@ -9104,9 +9114,9 @@ LBL_M:
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_s_mp_exptmod.c,v $ */
-/* $Revision: 1.4 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
/* End: bn_s_mp_exptmod.c */
@@ -9125,11 +9135,11 @@ LBL_M:
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/* multiplies |a| * |b| and only computes upto digs digits of result
- * HAC pp. 595, Algorithm 14.12 Modified so you can control how
+ * HAC pp. 595, Algorithm 14.12 Modified so you can control how
* many digits of output are created.
*/
int s_mp_mul_digs (mp_int * a, mp_int * b, mp_int * c, int digs)
@@ -9142,7 +9152,7 @@ int s_mp_mul_digs (mp_int * a, mp_int * b, mp_int * c, int digs)
/* can we use the fast multiplier? */
if (((digs) < MP_WARRAY) &&
- MIN (a->used, b->used) <
+ MIN (a->used, b->used) <
(1 << ((CHAR_BIT * sizeof (mp_word)) - (2 * DIGIT_BIT)))) {
return fast_s_mp_mul_digs (a, b, c, digs);
}
@@ -9164,10 +9174,10 @@ int s_mp_mul_digs (mp_int * a, mp_int * b, mp_int * c, int digs)
/* setup some aliases */
/* copy of the digit from a used within the nested loop */
tmpx = a->dp[ix];
-
+
/* an alias for the destination shifted ix places */
tmpt = t.dp + ix;
-
+
/* an alias for the digits of b */
tmpy = b->dp;
@@ -9198,9 +9208,9 @@ int s_mp_mul_digs (mp_int * a, mp_int * b, mp_int * c, int digs)
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_s_mp_mul_digs.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
/* End: bn_s_mp_mul_digs.c */
@@ -9219,7 +9229,7 @@ int s_mp_mul_digs (mp_int * a, mp_int * b, mp_int * c, int digs)
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/* multiplies |a| * |b| and does not compute the lower digs digits
@@ -9283,9 +9293,9 @@ s_mp_mul_high_digs (mp_int * a, mp_int * b, mp_int * c, int digs)
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_s_mp_mul_high_digs.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
/* End: bn_s_mp_mul_high_digs.c */
@@ -9304,7 +9314,7 @@ s_mp_mul_high_digs (mp_int * a, mp_int * b, mp_int * c, int digs)
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/* low level squaring, b = a*a, HAC pp.596-597, Algorithm 14.16 */
@@ -9340,7 +9350,7 @@ int s_mp_sqr (mp_int * a, mp_int * b)
/* alias for where to store the results */
tmpt = t.dp + (2*ix + 1);
-
+
for (iy = ix + 1; iy < pa; iy++) {
/* first calculate the product */
r = ((mp_word)tmpx) * ((mp_word)a->dp[iy]);
@@ -9371,9 +9381,9 @@ int s_mp_sqr (mp_int * a, mp_int * b)
}
#endif
-/* $Source: /cvs/libtom/libtommath/bn_s_mp_sqr.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
/* End: bn_s_mp_sqr.c */
@@ -9392,7 +9402,7 @@ int s_mp_sqr (mp_int * a, mp_int * b)
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/* low level subtraction (assumes |a| > |b|), HAC pp.595 Algorithm 14.9 */
@@ -9464,9 +9474,9 @@ s_mp_sub (mp_int * a, mp_int * b, mp_int * c)
#endif
-/* $Source: /cvs/libtom/libtommath/bn_s_mp_sub.c,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
/* End: bn_s_mp_sub.c */
@@ -9485,7 +9495,7 @@ s_mp_sub (mp_int * a, mp_int * b, mp_int * c)
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tomstdenis@gmail.com, http://libtom.org
*/
/* Known optimal configurations
@@ -9494,19 +9504,19 @@ s_mp_sub (mp_int * a, mp_int * b, mp_int * c)
-------------------------------------------------------------
Intel P4 Northwood /GCC v3.4.1 / 88/ 128/LTM 0.32 ;-)
AMD Athlon64 /GCC v3.4.4 / 80/ 120/LTM 0.35
-
+
*/
int KARATSUBA_MUL_CUTOFF = 80, /* Min. number of digits before Karatsuba multiplication is used. */
KARATSUBA_SQR_CUTOFF = 120, /* Min. number of digits before Karatsuba squaring is used. */
-
+
TOOM_MUL_CUTOFF = 350, /* no optimal values of these are known yet so set em high */
- TOOM_SQR_CUTOFF = 400;
+ TOOM_SQR_CUTOFF = 400;
#endif
-/* $Source: /cvs/libtom/libtommath/bncore.c,v $ */
-/* $Revision: 1.4 $ */
-/* $Date: 2006/03/31 14:18:44 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
/* End: bncore.c */
diff --git a/libtommath/testme.sh b/libtommath/testme.sh
new file mode 100755
index 0000000..6324525
--- /dev/null
+++ b/libtommath/testme.sh
@@ -0,0 +1,174 @@
+#!/bin/bash
+#
+# return values of this script are:
+# 0 success
+# 128 a test failed
+# >0 the number of timed-out tests
+
+set -e
+
+if [ -f /proc/cpuinfo ]
+then
+ MAKE_JOBS=$(( ($(cat /proc/cpuinfo | grep -E '^processor[[:space:]]*:' | tail -n -1 | cut -d':' -f2) + 1) * 2 + 1 ))
+else
+ MAKE_JOBS=8
+fi
+
+ret=0
+TEST_CFLAGS=""
+
+_help()
+{
+ echo "Usage options for $(basename $0) [--with-cc=arg [other options]]"
+ echo
+ echo "Executing this script without any parameter will only run the default configuration"
+ echo "that has automatically been determined for the architecture you're running."
+ echo
+ echo " --with-cc=* The compiler(s) to use for the tests"
+ echo " This is an option that will be iterated."
+ echo
+ echo "To be able to specify options a compiler has to be given."
+ echo "All options will be tested with all MP_xBIT configurations."
+ echo
+ echo " --with-{m64,m32,mx32} The architecture(s) to build and test for,"
+ echo " e.g. --with-mx32."
+ echo " This is an option that will be iterated, multiple selections are possible."
+ echo " The mx32 architecture is not supported by clang and will not be executed."
+ echo
+ echo " --cflags=* Give an option to the compiler,"
+ echo " e.g. --cflags=-g"
+ echo " This is an option that will always be passed as parameter to CC."
+ echo
+ echo " --make-option=* Give an option to make,"
+ echo " e.g. --make-option=\"-f makefile.shared\""
+ echo " This is an option that will always be passed as parameter to make."
+ echo
+ echo "Godmode:"
+ echo
+ echo " --all Choose all architectures and gcc and clang as compilers"
+ echo
+ echo " --help This message"
+ exit 0
+}
+
+_die()
+{
+ echo "error $2 while $1"
+ if [ "$2" != "124" ]
+ then
+ exit 128
+ else
+ echo "assuming timeout while running test - continue"
+ ret=$(( $ret + 1 ))
+ fi
+}
+
+_runtest()
+{
+ echo -ne " Compile $1 $2"
+ make clean > /dev/null
+ CC="$1" CFLAGS="$2 $TEST_CFLAGS" make -j$MAKE_JOBS test_standalone $MAKE_OPTIONS > /dev/null 2>test_errors.txt
+ echo -e "\rRun test $1 $2"
+ timeout --foreground 90 ./test > test_$(echo ${1}${2} | tr ' ' '_').txt || _die "running tests" $?
+}
+
+_banner()
+{
+ echo "uname="$(uname -a)
+ [[ "$#" != "0" ]] && (echo $1=$($1 -dumpversion)) || true
+}
+
+_exit()
+{
+ if [ "$ret" == "0" ]
+ then
+ echo "Tests successful"
+ else
+ echo "$ret tests timed out"
+ fi
+
+ exit $ret
+}
+
+ARCHFLAGS=""
+COMPILERS=""
+CFLAGS=""
+
+while [ $# -gt 0 ];
+do
+ case $1 in
+ "--with-m64" | "--with-m32" | "--with-mx32")
+ ARCHFLAGS="$ARCHFLAGS ${1:6}"
+ ;;
+ --with-cc=*)
+ COMPILERS="$COMPILERS ${1#*=}"
+ ;;
+ --cflags=*)
+ CFLAGS="$CFLAGS ${1#*=}"
+ ;;
+ --make-option=*)
+ MAKE_OPTIONS="$MAKE_OPTIONS ${1#*=}"
+ ;;
+ --all)
+ COMPILERS="gcc clang"
+ ARCHFLAGS="-m64 -m32 -mx32"
+ ;;
+ --help)
+ _help
+ ;;
+ esac
+ shift
+done
+
+# default to gcc if nothing is given
+if [[ "$COMPILERS" == "" ]]
+then
+ _banner gcc
+ _runtest "gcc" ""
+ _exit
+fi
+
+archflags=( $ARCHFLAGS )
+compilers=( $COMPILERS )
+
+# choosing a compiler without specifying an architecture will use the default architecture
+if [ "${#archflags[@]}" == "0" ]
+then
+ archflags[0]=" "
+fi
+
+_banner
+
+for i in "${compilers[@]}"
+do
+ if [ -z "$(which $i)" ]
+ then
+ echo "Skipped compiler $i, file not found"
+ continue
+ fi
+ compiler_version=$(echo "$i="$($i -dumpversion))
+ if [ "$compiler_version" == "clang=4.2.1" ]
+ then
+ # one of my versions of clang complains about some stuff in stdio.h and stdarg.h ...
+ TEST_CFLAGS="-Wno-typedef-redefinition"
+ else
+ TEST_CFLAGS=""
+ fi
+ echo $compiler_version
+
+ for a in "${archflags[@]}"
+ do
+ if [[ $(expr "$i" : "clang") && "$a" == "-mx32" ]]
+ then
+ echo "clang -mx32 tests skipped"
+ continue
+ fi
+
+ _runtest "$i $a" ""
+ _runtest "$i $a" "-DMP_8BIT"
+ _runtest "$i $a" "-DMP_16BIT"
+ _runtest "$i $a" "-DMP_32BIT"
+ done
+done
+
+_exit
diff --git a/libtommath/tommath.h b/libtommath/tommath.h
index 1ead3d0..925a5f5 100644
--- a/libtommath/tommath.h
+++ b/libtommath/tommath.h
@@ -10,44 +10,25 @@
* The library is free for all purposes without any express
* guarantee it works.
*
- * Tom St Denis, tomstdenis@gmail.com, http://math.libtomcrypt.com
+ * Tom St Denis, tstdenis82@gmail.com, http://math.libtomcrypt.com
*/
#ifndef BN_H_
#define BN_H_
#include <stdio.h>
-#include <string.h>
#include <stdlib.h>
-#include <ctype.h>
+#include <stdint.h>
#include <limits.h>
#include "tommath_class.h"
-#ifndef MIN
- #define MIN(x,y) ((x)<(y)?(x):(y))
-#endif
-
-#ifndef MAX
- #define MAX(x,y) ((x)>(y)?(x):(y))
-#endif
-
#ifdef __cplusplus
extern "C" {
-
-/* C++ compilers don't like assigning void * to mp_digit * */
-#define OPT_CAST(x) (x *)
-
-#else
-
-/* C on the other hand doesn't care */
-#define OPT_CAST(x)
-
#endif
-
/* detect 64-bit mode if possible */
-#if defined(__x86_64__)
- #if !(defined(MP_64BIT) && defined(MP_16BIT) && defined(MP_8BIT))
+#if defined(__x86_64__)
+ #if !(defined(MP_32BIT) || defined(MP_16BIT) || defined(MP_8BIT))
#define MP_64BIT
#endif
#endif
@@ -61,70 +42,68 @@ extern "C" {
* [any size beyond that is ok provided it doesn't overflow the data type]
*/
#ifdef MP_8BIT
- typedef unsigned char mp_digit;
- typedef unsigned short mp_word;
+ typedef uint8_t mp_digit;
+ typedef uint16_t mp_word;
+#define MP_SIZEOF_MP_DIGIT 1
+#ifdef DIGIT_BIT
+#error You must not define DIGIT_BIT when using MP_8BIT
+#endif
#elif defined(MP_16BIT)
- typedef unsigned short mp_digit;
- typedef unsigned long mp_word;
+ typedef uint16_t mp_digit;
+ typedef uint32_t mp_word;
+#define MP_SIZEOF_MP_DIGIT 2
+#ifdef DIGIT_BIT
+#error You must not define DIGIT_BIT when using MP_16BIT
+#endif
#elif defined(MP_64BIT)
/* for GCC only on supported platforms */
-#ifndef CRYPT
- typedef unsigned long long ulong64;
- typedef signed long long long64;
+ typedef uint64_t mp_digit;
+#if defined(_WIN32)
+ typedef unsigned __int128 mp_word;
+#elif defined(__GNUC__)
+ typedef unsigned long mp_word __attribute__ ((mode(TI)));
+#else
+ /* it seems you have a problem
+ * but we assume you can somewhere define your own uint128_t */
+ typedef uint128_t mp_word;
#endif
- typedef unsigned long mp_digit;
- typedef unsigned long mp_word __attribute__ ((mode(TI)));
-
- #define DIGIT_BIT 60
+ #define DIGIT_BIT 60
#else
/* this is the default case, 28-bit digits */
-
- /* this is to make porting into LibTomCrypt easier :-) */
-#ifndef CRYPT
- #if defined(_MSC_VER) || defined(__BORLANDC__)
- typedef unsigned __int64 ulong64;
- typedef signed __int64 long64;
- #else
- typedef unsigned long long ulong64;
- typedef signed long long long64;
- #endif
-#endif
- typedef unsigned long mp_digit;
- typedef ulong64 mp_word;
+ /* this is to make porting into LibTomCrypt easier :-) */
+ typedef uint32_t mp_digit;
+ typedef uint64_t mp_word;
-#ifdef MP_31BIT
+#ifdef MP_31BIT
/* this is an extension that uses 31-bit digits */
- #define DIGIT_BIT 31
+ #define DIGIT_BIT 31
#else
/* default case is 28-bit digits, defines MP_28BIT as a handy macro to test */
- #define DIGIT_BIT 28
+ #define DIGIT_BIT 28
#define MP_28BIT
-#endif
#endif
-
-/* define heap macros */
-#ifndef CRYPT
- /* default to libc stuff */
- #ifndef XMALLOC
- #define XMALLOC malloc
- #define XFREE free
- #define XREALLOC realloc
- #define XCALLOC calloc
- #else
- /* prototypes for our heap functions */
- extern void *XMALLOC(size_t n);
- extern void *XREALLOC(void *p, size_t n);
- extern void *XCALLOC(size_t n, size_t s);
- extern void XFREE(void *p);
- #endif
#endif
-
/* otherwise the bits per digit is calculated automatically from the size of a mp_digit */
#ifndef DIGIT_BIT
- #define DIGIT_BIT ((int)((CHAR_BIT * sizeof(mp_digit) - 1))) /* bits per digit */
+ #define DIGIT_BIT (((CHAR_BIT * MP_SIZEOF_MP_DIGIT) - 1)) /* bits per digit */
+ typedef uint_least32_t mp_min_u32;
+#else
+ typedef mp_digit mp_min_u32;
+#endif
+
+/* platforms that can use a better rand function */
+#if defined(__FreeBSD__) || defined(__OpenBSD__) || defined(__NetBSD__) || defined(__DragonFly__)
+ #define MP_USE_ALT_RAND 1
+#endif
+
+/* use arc4random on platforms that support it */
+#ifdef MP_USE_ALT_RAND
+ #define MP_GEN_RANDOM() arc4random()
+#else
+ #define MP_GEN_RANDOM() rand()
#endif
#define MP_DIGIT_BIT DIGIT_BIT
@@ -169,11 +148,11 @@ extern int KARATSUBA_MUL_CUTOFF,
#define MP_PREC 32 /* default digits of precision */
#else
#define MP_PREC 8 /* default digits of precision */
- #endif
+ #endif
#endif
/* size of comba arrays, should be at least 2 * 2**(BITS_PER_WORD - BITS_PER_DIGIT*2) */
-#define MP_WARRAY (1 << (sizeof(mp_word) * CHAR_BIT - 2 * DIGIT_BIT + 1))
+#define MP_WARRAY (1 << (((sizeof(mp_word) * CHAR_BIT) - (2 * DIGIT_BIT)) + 1))
/* the infamous mp_int structure */
typedef struct {
@@ -190,7 +169,7 @@ typedef int ltm_prime_callback(unsigned char *dst, int len, void *dat);
#define SIGN(m) ((m)->sign)
/* error code to char* string */
-char *mp_error_to_string(int code);
+const char *mp_error_to_string(int code);
/* ---> init and deinit bignum functions <--- */
/* init a bignum */
@@ -219,8 +198,9 @@ int mp_init_size(mp_int *a, int size);
/* ---> Basic Manipulations <--- */
#define mp_iszero(a) (((a)->used == 0) ? MP_YES : MP_NO)
-#define mp_iseven(a) (((a)->used > 0 && (((a)->dp[0] & 1) == 0)) ? MP_YES : MP_NO)
-#define mp_isodd(a) (((a)->used > 0 && (((a)->dp[0] & 1) == 1)) ? MP_YES : MP_NO)
+#define mp_iseven(a) ((((a)->used > 0) && (((a)->dp[0] & 1u) == 0u)) ? MP_YES : MP_NO)
+#define mp_isodd(a) ((((a)->used > 0) && (((a)->dp[0] & 1u) == 1u)) ? MP_YES : MP_NO)
+#define mp_isneg(a) (((a)->sign != MP_ZPOS) ? MP_YES : MP_NO)
/* set to zero */
void mp_zero(mp_int *a);
@@ -231,9 +211,21 @@ void mp_set(mp_int *a, mp_digit b);
/* set a 32-bit const */
int mp_set_int(mp_int *a, unsigned long b);
+/* set a platform dependent unsigned long value */
+int mp_set_long(mp_int *a, unsigned long b);
+
+/* set a platform dependent unsigned long long value */
+int mp_set_long_long(mp_int *a, unsigned long long b);
+
/* get a 32-bit value */
unsigned long mp_get_int(mp_int * a);
+/* get a platform dependent unsigned long value */
+unsigned long mp_get_long(mp_int * a);
+
+/* get a platform dependent unsigned long long value */
+unsigned long long mp_get_long_long(mp_int * a);
+
/* initialize and set a digit */
int mp_init_set (mp_int * a, mp_digit b);
@@ -249,6 +241,12 @@ int mp_init_copy(mp_int *a, mp_int *b);
/* trim unused digits */
void mp_clamp(mp_int *a);
+/* import binary data */
+int mp_import(mp_int* rop, size_t count, int order, size_t size, int endian, size_t nails, const void* op);
+
+/* export binary data */
+int mp_export(void* rop, size_t* countp, int order, size_t size, int endian, size_t nails, mp_int* op);
+
/* ---> digit manipulation <--- */
/* right shift by "b" digits */
@@ -257,19 +255,19 @@ void mp_rshd(mp_int *a, int b);
/* left shift by "b" digits */
int mp_lshd(mp_int *a, int b);
-/* c = a / 2**b */
+/* c = a / 2**b, implemented as c = a >> b */
int mp_div_2d(mp_int *a, int b, mp_int *c, mp_int *d);
/* b = a/2 */
int mp_div_2(mp_int *a, mp_int *b);
-/* c = a * 2**b */
+/* c = a * 2**b, implemented as c = a << b */
int mp_mul_2d(mp_int *a, int b, mp_int *c);
/* b = a*2 */
int mp_mul_2(mp_int *a, mp_int *b);
-/* c = a mod 2**d */
+/* c = a mod 2**b */
int mp_mod_2d(mp_int *a, int b, mp_int *c);
/* computes a = 2**b */
@@ -347,6 +345,7 @@ int mp_div_3(mp_int *a, mp_int *c, mp_digit *d);
/* c = a**b */
int mp_expt_d(mp_int *a, mp_digit b, mp_int *c);
+int mp_expt_d_ex (mp_int * a, mp_digit b, mp_int * c, int fast);
/* c = a mod b, 0 <= c < b */
int mp_mod_d(mp_int *a, mp_digit b, mp_digit *c);
@@ -382,10 +381,14 @@ int mp_lcm(mp_int *a, mp_int *b, mp_int *c);
* returns error if a < 0 and b is even
*/
int mp_n_root(mp_int *a, mp_digit b, mp_int *c);
+int mp_n_root_ex (mp_int * a, mp_digit b, mp_int * c, int fast);
/* special sqrt algo */
int mp_sqrt(mp_int *arg, mp_int *ret);
+/* special sqrt (mod prime) */
+int mp_sqrtmod_prime(mp_int *arg, mp_int *prime, mp_int *ret);
+
/* is number a square? */
int mp_is_square(mp_int *arg, int *ret);
@@ -453,7 +456,7 @@ int mp_exptmod(mp_int *a, mp_int *b, mp_int *c, mp_int *d);
#endif
/* table of first PRIME_SIZE primes */
-extern const mp_digit ltm_prime_tab[];
+extern const mp_digit ltm_prime_tab[PRIME_SIZE];
/* result=1 if a is divisible by one of the first PRIME_SIZE primes */
int mp_prime_is_divisible(mp_int *a, int *result);
@@ -469,7 +472,7 @@ int mp_prime_fermat(mp_int *a, mp_int *b, int *result);
int mp_prime_miller_rabin(mp_int *a, mp_int *b, int *result);
/* This gives [for a given bit size] the number of trials required
- * such that Miller-Rabin gives a prob of failure lower than 2^-96
+ * such that Miller-Rabin gives a prob of failure lower than 2^-96
*/
int mp_prime_rabin_miller_trials(int size);
@@ -490,7 +493,7 @@ int mp_prime_is_prime(mp_int *a, int t, int *result);
int mp_prime_next_prime(mp_int *a, int t, int bbs_style);
/* makes a truly random prime of a given size (bytes),
- * call with bbs = 1 if you want it to be congruent to 3 mod 4
+ * call with bbs = 1 if you want it to be congruent to 3 mod 4
*
* You have to supply a callback which fills in a buffer with random bytes. "dat" is a parameter you can
* have passed to the callback (e.g. a state or something). This function doesn't use "dat" itself
@@ -503,10 +506,9 @@ int mp_prime_next_prime(mp_int *a, int t, int bbs_style);
/* makes a truly random prime of a given size (bits),
*
* Flags are as follows:
- *
+ *
* LTM_PRIME_BBS - make prime congruent to 3 mod 4
* LTM_PRIME_SAFE - make sure (p-1)/2 is prime as well (implies LTM_PRIME_BBS)
- * LTM_PRIME_2MSB_OFF - make the 2nd highest bit zero
* LTM_PRIME_2MSB_ON - make the 2nd highest bit one
*
* You have to supply a callback which fills in a buffer with random bytes. "dat" is a parameter you can
@@ -534,8 +536,10 @@ int mp_toradix(mp_int *a, char *str, int radix);
int mp_toradix_n(mp_int * a, char *str, int radix, int maxlen);
int mp_radix_size(mp_int *a, int radix, int *size);
+#ifndef LTM_NO_FILE
int mp_fread(mp_int *a, int radix, FILE *stream);
int mp_fwrite(mp_int *a, int radix, FILE *stream);
+#endif
#define mp_read_raw(mp, str, len) mp_read_signed_bin((mp), (str), (len))
#define mp_raw_size(mp) mp_signed_bin_size(mp)
@@ -549,29 +553,6 @@ int mp_fwrite(mp_int *a, int radix, FILE *stream);
#define mp_todecimal(M, S) mp_toradix((M), (S), 10)
#define mp_tohex(M, S) mp_toradix((M), (S), 16)
-/* lowlevel functions, do not call! */
-int s_mp_add(mp_int *a, mp_int *b, mp_int *c);
-int s_mp_sub(mp_int *a, mp_int *b, mp_int *c);
-#define s_mp_mul(a, b, c) s_mp_mul_digs(a, b, c, (a)->used + (b)->used + 1)
-int fast_s_mp_mul_digs(mp_int *a, mp_int *b, mp_int *c, int digs);
-int s_mp_mul_digs(mp_int *a, mp_int *b, mp_int *c, int digs);
-int fast_s_mp_mul_high_digs(mp_int *a, mp_int *b, mp_int *c, int digs);
-int s_mp_mul_high_digs(mp_int *a, mp_int *b, mp_int *c, int digs);
-int fast_s_mp_sqr(mp_int *a, mp_int *b);
-int s_mp_sqr(mp_int *a, mp_int *b);
-int mp_karatsuba_mul(mp_int *a, mp_int *b, mp_int *c);
-int mp_toom_mul(mp_int *a, mp_int *b, mp_int *c);
-int mp_karatsuba_sqr(mp_int *a, mp_int *b);
-int mp_toom_sqr(mp_int *a, mp_int *b);
-int fast_mp_invmod(mp_int *a, mp_int *b, mp_int *c);
-int mp_invmod_slow (mp_int * a, mp_int * b, mp_int * c);
-int fast_mp_montgomery_reduce(mp_int *a, mp_int *m, mp_digit mp);
-int mp_exptmod_fast(mp_int *G, mp_int *X, mp_int *P, mp_int *Y, int mode);
-int s_mp_exptmod (mp_int * G, mp_int * X, mp_int * P, mp_int * Y, int mode);
-void bn_reverse(unsigned char *s, int len);
-
-extern const char *mp_s_rmap;
-
#ifdef __cplusplus
}
#endif
diff --git a/libtommath/tommath_class.h b/libtommath/tommath_class.h
index a4e275a..87584ea 100644
--- a/libtommath/tommath_class.h
+++ b/libtommath/tommath_class.h
@@ -38,7 +38,9 @@
#define BN_MP_DR_REDUCE_C
#define BN_MP_DR_SETUP_C
#define BN_MP_EXCH_C
+#define BN_MP_EXPORT_C
#define BN_MP_EXPT_D_C
+#define BN_MP_EXPT_D_EX_C
#define BN_MP_EXPTMOD_C
#define BN_MP_EXPTMOD_FAST_C
#define BN_MP_EXTEUCLID_C
@@ -46,7 +48,10 @@
#define BN_MP_FWRITE_C
#define BN_MP_GCD_C
#define BN_MP_GET_INT_C
+#define BN_MP_GET_LONG_C
+#define BN_MP_GET_LONG_LONG_C
#define BN_MP_GROW_C
+#define BN_MP_IMPORT_C
#define BN_MP_INIT_C
#define BN_MP_INIT_COPY_C
#define BN_MP_INIT_MULTI_C
@@ -73,6 +78,7 @@
#define BN_MP_MUL_D_C
#define BN_MP_MULMOD_C
#define BN_MP_N_ROOT_C
+#define BN_MP_N_ROOT_EX_C
#define BN_MP_NEG_C
#define BN_MP_OR_C
#define BN_MP_PRIME_FERMAT_C
@@ -99,11 +105,14 @@
#define BN_MP_RSHD_C
#define BN_MP_SET_C
#define BN_MP_SET_INT_C
+#define BN_MP_SET_LONG_C
+#define BN_MP_SET_LONG_LONG_C
#define BN_MP_SHRINK_C
#define BN_MP_SIGNED_BIN_SIZE_C
#define BN_MP_SQR_C
#define BN_MP_SQRMOD_C
#define BN_MP_SQRT_C
+#define BN_MP_SQRTMOD_PRIME_C
#define BN_MP_SUB_C
#define BN_MP_SUB_D_C
#define BN_MP_SUBMOD_C
@@ -315,12 +324,23 @@
#if defined(BN_MP_EXCH_C)
#endif
+#if defined(BN_MP_EXPORT_C)
+ #define BN_MP_INIT_COPY_C
+ #define BN_MP_COUNT_BITS_C
+ #define BN_MP_DIV_2D_C
+ #define BN_MP_CLEAR_C
+#endif
+
#if defined(BN_MP_EXPT_D_C)
+ #define BN_MP_EXPT_D_EX_C
+#endif
+
+#if defined(BN_MP_EXPT_D_EX_C)
#define BN_MP_INIT_COPY_C
#define BN_MP_SET_C
- #define BN_MP_SQR_C
- #define BN_MP_CLEAR_C
#define BN_MP_MUL_C
+ #define BN_MP_CLEAR_C
+ #define BN_MP_SQR_C
#endif
#if defined(BN_MP_EXPTMOD_C)
@@ -387,7 +407,6 @@
#if defined(BN_MP_GCD_C)
#define BN_MP_ISZERO_C
#define BN_MP_ABS_C
- #define BN_MP_ZERO_C
#define BN_MP_INIT_COPY_C
#define BN_MP_CNT_LSB_C
#define BN_MP_DIV_2D_C
@@ -401,13 +420,26 @@
#if defined(BN_MP_GET_INT_C)
#endif
+#if defined(BN_MP_GET_LONG_C)
+#endif
+
+#if defined(BN_MP_GET_LONG_LONG_C)
+#endif
+
#if defined(BN_MP_GROW_C)
#endif
+#if defined(BN_MP_IMPORT_C)
+ #define BN_MP_ZERO_C
+ #define BN_MP_MUL_2D_C
+ #define BN_MP_CLAMP_C
+#endif
+
#if defined(BN_MP_INIT_C)
#endif
#if defined(BN_MP_INIT_COPY_C)
+ #define BN_MP_INIT_SIZE_C
#define BN_MP_COPY_C
#endif
@@ -481,8 +513,9 @@
#define BN_MP_MUL_C
#define BN_MP_INIT_SIZE_C
#define BN_MP_CLAMP_C
- #define BN_MP_SUB_C
+ #define BN_S_MP_ADD_C
#define BN_MP_ADD_C
+ #define BN_S_MP_SUB_C
#define BN_MP_LSHD_C
#define BN_MP_CLEAR_C
#endif
@@ -491,8 +524,8 @@
#define BN_MP_INIT_SIZE_C
#define BN_MP_CLAMP_C
#define BN_MP_SQR_C
- #define BN_MP_SUB_C
#define BN_S_MP_ADD_C
+ #define BN_S_MP_SUB_C
#define BN_MP_LSHD_C
#define BN_MP_ADD_C
#define BN_MP_CLEAR_C
@@ -516,8 +549,9 @@
#define BN_MP_INIT_C
#define BN_MP_DIV_C
#define BN_MP_CLEAR_C
- #define BN_MP_ADD_C
+ #define BN_MP_ISZERO_C
#define BN_MP_EXCH_C
+ #define BN_MP_ADD_C
#endif
#if defined(BN_MP_MOD_2D_C)
@@ -583,10 +617,14 @@
#endif
#if defined(BN_MP_N_ROOT_C)
+ #define BN_MP_N_ROOT_EX_C
+#endif
+
+#if defined(BN_MP_N_ROOT_EX_C)
#define BN_MP_INIT_C
#define BN_MP_SET_C
#define BN_MP_COPY_C
- #define BN_MP_EXPT_D_C
+ #define BN_MP_EXPT_D_EX_C
#define BN_MP_MUL_C
#define BN_MP_SUB_C
#define BN_MP_MUL_D_C
@@ -667,9 +705,9 @@
#endif
#if defined(BN_MP_RADIX_SIZE_C)
+ #define BN_MP_ISZERO_C
#define BN_MP_COUNT_BITS_C
#define BN_MP_INIT_COPY_C
- #define BN_MP_ISZERO_C
#define BN_MP_DIV_D_C
#define BN_MP_CLEAR_C
#endif
@@ -687,7 +725,6 @@
#if defined(BN_MP_READ_RADIX_C)
#define BN_MP_ZERO_C
#define BN_MP_S_RMAP_C
- #define BN_MP_RADIX_SMAP_C
#define BN_MP_MUL_D_C
#define BN_MP_ADD_D_C
#define BN_MP_ISZERO_C
@@ -788,6 +825,12 @@
#define BN_MP_CLAMP_C
#endif
+#if defined(BN_MP_SET_LONG_C)
+#endif
+
+#if defined(BN_MP_SET_LONG_LONG_C)
+#endif
+
#if defined(BN_MP_SHRINK_C)
#endif
@@ -823,6 +866,25 @@
#define BN_MP_CLEAR_C
#endif
+#if defined(BN_MP_SQRTMOD_PRIME_C)
+ #define BN_MP_CMP_D_C
+ #define BN_MP_ZERO_C
+ #define BN_MP_JACOBI_C
+ #define BN_MP_INIT_MULTI_C
+ #define BN_MP_MOD_D_C
+ #define BN_MP_ADD_D_C
+ #define BN_MP_DIV_2_C
+ #define BN_MP_EXPTMOD_C
+ #define BN_MP_COPY_C
+ #define BN_MP_SUB_D_C
+ #define BN_MP_ISEVEN_C
+ #define BN_MP_SET_INT_C
+ #define BN_MP_SQRMOD_C
+ #define BN_MP_MULMOD_C
+ #define BN_MP_SET_C
+ #define BN_MP_CLEAR_MULTI_C
+#endif
+
#if defined(BN_MP_SUB_C)
#define BN_S_MP_ADD_C
#define BN_MP_CMP_MAG_C
@@ -1000,6 +1062,6 @@
#undef BN_MP_TOOM_MUL_C
#undef BN_MP_TOOM_SQR_C
-/* $Source: /cvs/libtom/libtommath/tommath_class.h,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2005/07/28 11:59:32 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtommath/tommath_private.h b/libtommath/tommath_private.h
new file mode 100644
index 0000000..bc7cd35
--- /dev/null
+++ b/libtommath/tommath_private.h
@@ -0,0 +1,119 @@
+/* LibTomMath, multiple-precision integer library -- Tom St Denis
+ *
+ * LibTomMath is a library that provides multiple-precision
+ * integer arithmetic as well as number theoretic functionality.
+ *
+ * The library was designed directly after the MPI library by
+ * Michael Fromberger but has been written from scratch with
+ * additional optimizations in place.
+ *
+ * The library is free for all purposes without any express
+ * guarantee it works.
+ *
+ * Tom St Denis, tstdenis82@gmail.com, http://math.libtomcrypt.com
+ */
+#ifndef TOMMATH_PRIV_H_
+#define TOMMATH_PRIV_H_
+
+#include <tommath.h>
+#include <ctype.h>
+
+#define MIN(x,y) (((x) < (y)) ? (x) : (y))
+
+#define MAX(x,y) (((x) > (y)) ? (x) : (y))
+
+#ifdef __cplusplus
+extern "C" {
+
+/* C++ compilers don't like assigning void * to mp_digit * */
+#define OPT_CAST(x) (x *)
+
+#else
+
+/* C on the other hand doesn't care */
+#define OPT_CAST(x)
+
+#endif
+
+/* define heap macros */
+#ifndef XMALLOC
+ /* default to libc stuff */
+ #define XMALLOC malloc
+ #define XFREE free
+ #define XREALLOC realloc
+ #define XCALLOC calloc
+#else
+ /* prototypes for our heap functions */
+ extern void *XMALLOC(size_t n);
+ extern void *XREALLOC(void *p, size_t n);
+ extern void *XCALLOC(size_t n, size_t s);
+ extern void XFREE(void *p);
+#endif
+
+/* lowlevel functions, do not call! */
+int s_mp_add(mp_int *a, mp_int *b, mp_int *c);
+int s_mp_sub(mp_int *a, mp_int *b, mp_int *c);
+#define s_mp_mul(a, b, c) s_mp_mul_digs(a, b, c, (a)->used + (b)->used + 1)
+int fast_s_mp_mul_digs(mp_int *a, mp_int *b, mp_int *c, int digs);
+int s_mp_mul_digs(mp_int *a, mp_int *b, mp_int *c, int digs);
+int fast_s_mp_mul_high_digs(mp_int *a, mp_int *b, mp_int *c, int digs);
+int s_mp_mul_high_digs(mp_int *a, mp_int *b, mp_int *c, int digs);
+int fast_s_mp_sqr(mp_int *a, mp_int *b);
+int s_mp_sqr(mp_int *a, mp_int *b);
+int mp_karatsuba_mul(mp_int *a, mp_int *b, mp_int *c);
+int mp_toom_mul(mp_int *a, mp_int *b, mp_int *c);
+int mp_karatsuba_sqr(mp_int *a, mp_int *b);
+int mp_toom_sqr(mp_int *a, mp_int *b);
+int fast_mp_invmod(mp_int *a, mp_int *b, mp_int *c);
+int mp_invmod_slow (mp_int * a, mp_int * b, mp_int * c);
+int fast_mp_montgomery_reduce(mp_int *x, mp_int *n, mp_digit rho);
+int mp_exptmod_fast(mp_int *G, mp_int *X, mp_int *P, mp_int *Y, int redmode);
+int s_mp_exptmod (mp_int * G, mp_int * X, mp_int * P, mp_int * Y, int redmode);
+void bn_reverse(unsigned char *s, int len);
+
+extern const char *mp_s_rmap;
+
+/* Fancy macro to set an MPI from another type.
+ * There are several things assumed:
+ * x is the counter and unsigned
+ * a is the pointer to the MPI
+ * b is the original value that should be set in the MPI.
+ */
+#define MP_SET_XLONG(func_name, type) \
+int func_name (mp_int * a, type b) \
+{ \
+ unsigned int x; \
+ int res; \
+ \
+ mp_zero (a); \
+ \
+ /* set four bits at a time */ \
+ for (x = 0; x < (sizeof(type) * 2u); x++) { \
+ /* shift the number up four bits */ \
+ if ((res = mp_mul_2d (a, 4, a)) != MP_OKAY) { \
+ return res; \
+ } \
+ \
+ /* OR in the top four bits of the source */ \
+ a->dp[0] |= (b >> ((sizeof(type) * 8u) - 4u)) & 15u; \
+ \
+ /* shift the source up to the next four bits */ \
+ b <<= 4; \
+ \
+ /* ensure that digits are not clamped off */ \
+ a->used += 1; \
+ } \
+ mp_clamp (a); \
+ return MP_OKAY; \
+}
+
+#ifdef __cplusplus
+ }
+#endif
+
+#endif
+
+
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtommath/tommath_superclass.h b/libtommath/tommath_superclass.h
index 2fdebe6..1b26841 100644
--- a/libtommath/tommath_superclass.h
+++ b/libtommath/tommath_superclass.h
@@ -71,6 +71,6 @@
#endif
-/* $Source: /cvs/libtom/libtommath/tommath_superclass.h,v $ */
-/* $Revision: 1.3 $ */
-/* $Date: 2005/05/14 13:29:17 $ */
+/* $Source$ */
+/* $Revision$ */
+/* $Date$ */
diff --git a/libtommath/updatemakes.sh b/libtommath/updatemakes.sh
new file mode 100755
index 0000000..54c3b84
--- /dev/null
+++ b/libtommath/updatemakes.sh
@@ -0,0 +1,33 @@
+#!/bin/bash
+
+bash genlist.sh > tmplist
+
+perl filter.pl makefile tmplist
+sed -e 's/ *$//' < tmp.delme > makefile
+rm -f tmp.delme
+
+perl filter.pl makefile.icc tmplist
+sed -e 's/ *$//' < tmp.delme > makefile.icc
+rm -f tmp.delme
+
+perl filter.pl makefile.shared tmplist
+sed -e 's/ *$//' < tmp.delme > makefile.shared
+rm -f tmp.delme
+
+perl filter.pl makefile.cygwin_dll tmplist
+sed -e 's/ *$//' < tmp.delme > makefile.cygwin_dll
+rm -f tmp.delme
+
+perl filter.pl makefile.bcc tmplist
+sed -e 's/\.o /.obj /g' -e 's/ *$//' < tmp.delme > makefile.bcc
+rm -f tmp.delme
+
+perl filter.pl makefile.msvc tmplist
+sed -e 's/\.o /.obj /g' -e 's/ *$//' < tmp.delme > makefile.msvc
+rm -f tmp.delme
+
+rm -f tmplist
+
+# $Source$
+# $Revision$
+# $Date$
diff --git a/netio.c b/netio.c
index 2e57534..89a0843 100644
--- a/netio.c
+++ b/netio.c
@@ -306,7 +306,7 @@ void set_sock_priority(int sock, enum dropbear_prio prio) {
#ifdef IPTOS_LOWDELAY
int iptos_val = 0;
#endif
-#ifdef SO_PRIORITY
+#ifdef HAVE_LINUX_PKT_SCHED_H
int so_prio_val = 0;
#endif
@@ -333,7 +333,7 @@ void set_sock_priority(int sock, enum dropbear_prio prio) {
}
#endif
-#ifdef SO_PRIORITY
+#ifdef HAVE_LINUX_PKT_SCHED_H
if (prio == DROPBEAR_PRIO_LOWDELAY) {
so_prio_val = TC_PRIO_INTERACTIVE;
} else if (prio == DROPBEAR_PRIO_BULK) {
diff --git a/options.h b/options.h
index 9350020..c1782d2 100644
--- a/options.h
+++ b/options.h
@@ -2,6 +2,8 @@
#define DROPBEAR_OPTIONS_H
/*
+ > > > Don't edit this file any more! < < <
+
Local compile-time configuration should be defined in localoptions.h
See default_options.h.in for a description of the available options.
*/
diff --git a/rsa.c b/rsa.c
index c09447f..1eac8ec 100644
--- a/rsa.c
+++ b/rsa.c
@@ -72,8 +72,7 @@ int buf_get_rsa_pub_key(buffer* buf, dropbear_rsa_key *key) {
ret = DROPBEAR_SUCCESS;
out:
if (ret == DROPBEAR_FAILURE) {
- m_free(key->e);
- m_free(key->n);
+ m_mp_free_multi(&key->e, &key->n, NULL);
}
return ret;
}
@@ -121,9 +120,7 @@ int buf_get_rsa_priv_key(buffer* buf, dropbear_rsa_key *key) {
ret = DROPBEAR_SUCCESS;
out:
if (ret == DROPBEAR_FAILURE) {
- m_free(key->d);
- m_free(key->p);
- m_free(key->q);
+ m_mp_free_multi(&key->d, &key->p, &key->q, NULL);
}
TRACE(("leave buf_get_rsa_priv_key"))
return ret;
@@ -139,26 +136,7 @@ void rsa_key_free(dropbear_rsa_key *key) {
TRACE2(("leave rsa_key_free: key == NULL"))
return;
}
- if (key->d) {
- mp_clear(key->d);
- m_free(key->d);
- }
- if (key->e) {
- mp_clear(key->e);
- m_free(key->e);
- }
- if (key->n) {
- mp_clear(key->n);
- m_free(key->n);
- }
- if (key->p) {
- mp_clear(key->p);
- m_free(key->p);
- }
- if (key->q) {
- mp_clear(key->q);
- m_free(key->q);
- }
+ m_mp_free_multi(&key->d, &key->e, &key->p, &key->q, &key->n, NULL);
m_free(key);
TRACE2(("leave rsa_key_free"))
}
diff --git a/signkey.c b/signkey.c
index 2c29431..58db46b 100644
--- a/signkey.c
+++ b/signkey.c
@@ -102,7 +102,8 @@ enum signkey_type signkey_type_from_name(const char* name, unsigned int namelen)
return DROPBEAR_SIGNKEY_NONE;
}
-/* Returns a pointer to the key part specific to "type" */
+/* Returns a pointer to the key part specific to "type".
+Be sure to check both (ret != NULL) and (*ret != NULL) */
void **
signkey_key_ptr(sign_key *key, enum signkey_type type) {
switch (type) {
@@ -167,7 +168,8 @@ int buf_get_pub_key(buffer *buf, sign_key *key, enum signkey_type *type) {
key->dsskey = m_malloc(sizeof(*key->dsskey));
ret = buf_get_dss_pub_key(buf, key->dsskey);
if (ret == DROPBEAR_FAILURE) {
- m_free(key->dsskey);
+ dss_key_free(key->dsskey);
+ key->dsskey = NULL;
}
}
#endif
@@ -177,7 +179,8 @@ int buf_get_pub_key(buffer *buf, sign_key *key, enum signkey_type *type) {
key->rsakey = m_malloc(sizeof(*key->rsakey));
ret = buf_get_rsa_pub_key(buf, key->rsakey);
if (ret == DROPBEAR_FAILURE) {
- m_free(key->rsakey);
+ rsa_key_free(key->rsakey);
+ key->rsakey = NULL;
}
}
#endif
@@ -201,7 +204,6 @@ int buf_get_pub_key(buffer *buf, sign_key *key, enum signkey_type *type) {
TRACE2(("leave buf_get_pub_key"))
return ret;
-
}
/* returns DROPBEAR_SUCCESS on success, DROPBEAR_FAILURE on fail.
@@ -236,7 +238,8 @@ int buf_get_priv_key(buffer *buf, sign_key *key, enum signkey_type *type) {
key->dsskey = m_malloc(sizeof(*key->dsskey));
ret = buf_get_dss_priv_key(buf, key->dsskey);
if (ret == DROPBEAR_FAILURE) {
- m_free(key->dsskey);
+ dss_key_free(key->dsskey);
+ key->dsskey = NULL;
}
}
#endif
@@ -246,7 +249,8 @@ int buf_get_priv_key(buffer *buf, sign_key *key, enum signkey_type *type) {
key->rsakey = m_malloc(sizeof(*key->rsakey));
ret = buf_get_rsa_priv_key(buf, key->rsakey);
if (ret == DROPBEAR_FAILURE) {
- m_free(key->rsakey);
+ rsa_key_free(key->rsakey);
+ key->rsakey = NULL;
}
}
#endif
@@ -294,7 +298,7 @@ void buf_put_pub_key(buffer* buf, sign_key *key, enum signkey_type type) {
#if DROPBEAR_ECDSA
if (signkey_is_ecdsa(type)) {
ecc_key **eck = (ecc_key**)signkey_key_ptr(key, type);
- if (eck) {
+ if (eck && *eck) {
buf_put_ecdsa_pub_key(pubkeys, *eck);
}
}
@@ -331,7 +335,7 @@ void buf_put_priv_key(buffer* buf, sign_key *key, enum signkey_type type) {
#if DROPBEAR_ECDSA
if (signkey_is_ecdsa(type)) {
ecc_key **eck = (ecc_key**)signkey_key_ptr(key, type);
- if (eck) {
+ if (eck && *eck) {
buf_put_ecdsa_priv_key(buf, *eck);
TRACE(("leave buf_put_priv_key: ecdsa done"))
return;
@@ -495,7 +499,7 @@ void buf_put_sign(buffer* buf, sign_key *key, enum signkey_type type,
#if DROPBEAR_ECDSA
if (signkey_is_ecdsa(type)) {
ecc_key **eck = (ecc_key**)signkey_key_ptr(key, type);
- if (eck) {
+ if (eck && *eck) {
buf_put_ecdsa_sign(sigblob, *eck, data_buf);
}
}
@@ -546,7 +550,7 @@ int buf_verify(buffer * buf, sign_key *key, buffer *data_buf) {
#if DROPBEAR_ECDSA
if (signkey_is_ecdsa(type)) {
ecc_key **eck = (ecc_key**)signkey_key_ptr(key, type);
- if (eck) {
+ if (eck && *eck) {
return buf_ecdsa_verify(buf, *eck, data_buf);
}
}
diff --git a/svr-authpam.c b/svr-authpam.c
index ac8e5ec..05e4f3e 100644
--- a/svr-authpam.c
+++ b/svr-authpam.c
@@ -224,6 +224,12 @@ void svr_auth_pam() {
goto cleanup;
}
+ if ((rc = pam_set_item(pamHandlep, PAM_RHOST, svr_ses.remotehost)) != PAM_SUCCESS) {
+ dropbear_log(LOG_WARNING, "pam_set_item() failed, rc=%d, %s",
+ rc, pam_strerror(pamHandlep, rc));
+ goto cleanup;
+ }
+
#ifdef HAVE_PAM_FAIL_DELAY
/* We have our own random delay code already, disable PAM's */
(void) pam_fail_delay(pamHandlep, 0 /* musec_delay */);
diff --git a/svr-authpubkey.c b/svr-authpubkey.c
index acc660d..fbee63f 100644
--- a/svr-authpubkey.c
+++ b/svr-authpubkey.c
@@ -188,6 +188,107 @@ static void send_msg_userauth_pk_ok(char* algo, unsigned int algolen,
}
+static int checkpubkey_line(buffer* line, int line_num, char* filename,
+ const char* algo, unsigned int algolen,
+ const unsigned char* keyblob, unsigned int keybloblen) {
+ buffer *options_buf = NULL;
+ unsigned int pos, len;
+ int ret = DROPBEAR_FAILURE;
+
+ if (line->len < MIN_AUTHKEYS_LINE || line->len > MAX_AUTHKEYS_LINE) {
+ TRACE(("checkpubkey: bad line length %d", line->len))
+ return DROPBEAR_FAILURE;
+ }
+
+ /* compare the algorithm. +3 so we have enough bytes to read a space and some base64 characters too. */
+ if (line->pos + algolen+3 > line->len) {
+ goto out;
+ }
+ /* check the key type */
+ if (strncmp((const char *) buf_getptr(line, algolen), algo, algolen) != 0) {
+ int is_comment = 0;
+ unsigned char *options_start = NULL;
+ int options_len = 0;
+ int escape, quoted;
+
+ /* skip over any comments or leading whitespace */
+ while (line->pos < line->len) {
+ const char c = buf_getbyte(line);
+ if (c == ' ' || c == '\t') {
+ continue;
+ } else if (c == '#') {
+ is_comment = 1;
+ break;
+ }
+ buf_incrpos(line, -1);
+ break;
+ }
+ if (is_comment) {
+ /* next line */
+ goto out;
+ }
+
+ /* remember start of options */
+ options_start = buf_getptr(line, 1);
+ quoted = 0;
+ escape = 0;
+ options_len = 0;
+
+ /* figure out where the options are */
+ while (line->pos < line->len) {
+ const char c = buf_getbyte(line);
+ if (!quoted && (c == ' ' || c == '\t')) {
+ break;
+ }
+ escape = (!escape && c == '\\');
+ if (!escape && c == '"') {
+ quoted = !quoted;
+ }
+ options_len++;
+ }
+ options_buf = buf_new(options_len);
+ buf_putbytes(options_buf, options_start, options_len);
+
+ /* compare the algorithm. +3 so we have enough bytes to read a space and some base64 characters too. */
+ if (line->pos + algolen+3 > line->len) {
+ goto out;
+ }
+ if (strncmp((const char *) buf_getptr(line, algolen), algo, algolen) != 0) {
+ goto out;
+ }
+ }
+ buf_incrpos(line, algolen);
+
+ /* check for space (' ') character */
+ if (buf_getbyte(line) != ' ') {
+ TRACE(("checkpubkey: space character expected, isn't there"))
+ goto out;
+ }
+
+ /* truncate the line at the space after the base64 data */
+ pos = line->pos;
+ for (len = 0; line->pos < line->len; len++) {
+ if (buf_getbyte(line) == ' ') break;
+ }
+ buf_setpos(line, pos);
+ buf_setlen(line, line->pos + len);
+
+ TRACE(("checkpubkey: line pos = %d len = %d", line->pos, line->len))
+
+ ret = cmp_base64_key(keyblob, keybloblen, (const unsigned char *) algo, algolen, line, NULL);
+
+ if (ret == DROPBEAR_SUCCESS && options_buf) {
+ ret = svr_add_pubkey_options(options_buf, line_num, filename);
+ }
+
+out:
+ if (options_buf) {
+ buf_free(options_buf);
+ }
+ return ret;
+}
+
+
/* Checks whether a specified publickey (and associated algorithm) is an
* acceptable key for authentication */
/* Returns DROPBEAR_SUCCESS if key is ok for auth, DROPBEAR_FAILURE otherwise */
@@ -198,8 +299,7 @@ static int checkpubkey(char* algo, unsigned int algolen,
char * filename = NULL;
int ret = DROPBEAR_FAILURE;
buffer * line = NULL;
- unsigned int len, pos;
- buffer * options_buf = NULL;
+ unsigned int len;
int line_num;
uid_t origuid;
gid_t origgid;
@@ -254,12 +354,6 @@ static int checkpubkey(char* algo, unsigned int algolen,
/* iterate through the lines */
do {
- /* new line : potentially new options */
- if (options_buf) {
- buf_free(options_buf);
- options_buf = NULL;
- }
-
if (buf_getline(line, authfile) == DROPBEAR_FAILURE) {
/* EOF reached */
TRACE(("checkpubkey: authorized_keys EOF reached"))
@@ -267,91 +361,8 @@ static int checkpubkey(char* algo, unsigned int algolen,
}
line_num++;
- if (line->len < MIN_AUTHKEYS_LINE) {
- TRACE(("checkpubkey: line too short"))
- continue; /* line is too short for it to be a valid key */
- }
-
- /* check the key type - will fail if there are options */
- TRACE(("a line!"))
-
- if (strncmp((const char *) buf_getptr(line, algolen), algo, algolen) != 0) {
- int is_comment = 0;
- unsigned char *options_start = NULL;
- int options_len = 0;
- int escape, quoted;
-
- /* skip over any comments or leading whitespace */
- while (line->pos < line->len) {
- const char c = buf_getbyte(line);
- if (c == ' ' || c == '\t') {
- continue;
- } else if (c == '#') {
- is_comment = 1;
- break;
- }
- buf_incrpos(line, -1);
- break;
- }
- if (is_comment) {
- /* next line */
- continue;
- }
-
- /* remember start of options */
- options_start = buf_getptr(line, 1);
- quoted = 0;
- escape = 0;
- options_len = 0;
-
- /* figure out where the options are */
- while (line->pos < line->len) {
- const char c = buf_getbyte(line);
- if (!quoted && (c == ' ' || c == '\t')) {
- break;
- }
- escape = (!escape && c == '\\');
- if (!escape && c == '"') {
- quoted = !quoted;
- }
- options_len++;
- }
- options_buf = buf_new(options_len);
- buf_putbytes(options_buf, options_start, options_len);
-
- /* compare the algorithm. +3 so we have enough bytes to read a space and some base64 characters too. */
- if (line->pos + algolen+3 > line->len) {
- continue;
- }
- if (strncmp((const char *) buf_getptr(line, algolen), algo, algolen) != 0) {
- continue;
- }
- }
- buf_incrpos(line, algolen);
-
- /* check for space (' ') character */
- if (buf_getbyte(line) != ' ') {
- TRACE(("checkpubkey: space character expected, isn't there"))
- continue;
- }
-
- /* truncate the line at the space after the base64 data */
- pos = line->pos;
- for (len = 0; line->pos < line->len; len++) {
- if (buf_getbyte(line) == ' ') break;
- }
- buf_setpos(line, pos);
- buf_setlen(line, line->pos + len);
-
- TRACE(("checkpubkey: line pos = %d len = %d", line->pos, line->len))
-
- ret = cmp_base64_key(keyblob, keybloblen, (const unsigned char *) algo, algolen, line, NULL);
-
- if (ret == DROPBEAR_SUCCESS && options_buf) {
- ret = svr_add_pubkey_options(options_buf, line_num, filename);
- }
-
- if (ret == DROPBEAR_SUCCESS) {
+ if (checkpubkey_line(line, line_num, filename,
+ algo, algolen, keyblob, keybloblen) == DROPBEAR_SUCCESS) {
break;
}
@@ -367,9 +378,6 @@ out:
buf_free(line);
}
m_free(filename);
- if (options_buf) {
- buf_free(options_buf);
- }
TRACE(("leave checkpubkey: ret=%d", ret))
return ret;
}
@@ -465,4 +473,12 @@ static int checkfileperm(char * filename) {
return DROPBEAR_SUCCESS;
}
+#ifdef DROPBEAR_FUZZ
+int fuzz_checkpubkey_line(buffer* line, int line_num, char* filename,
+ const char* algo, unsigned int algolen,
+ const unsigned char* keyblob, unsigned int keybloblen) {
+ return checkpubkey_line(line, line_num, filename, algo, algolen, keyblob, keybloblen);
+}
+#endif
+
#endif
diff --git a/sysoptions.h b/sysoptions.h
index 601bba5..64b149e 100644
--- a/sysoptions.h
+++ b/sysoptions.h
@@ -40,10 +40,10 @@
/* Minimum key sizes for DSS and RSA */
#ifndef MIN_DSS_KEYLEN
-#define MIN_DSS_KEYLEN 512
+#define MIN_DSS_KEYLEN 1024
#endif
#ifndef MIN_RSA_KEYLEN
-#define MIN_RSA_KEYLEN 512
+#define MIN_RSA_KEYLEN 1024
#endif
#define MAX_BANNER_SIZE 2000 /* this is 25*80 chars, any more is foolish */